diff options
Diffstat (limited to 'scene')
279 files changed, 16359 insertions, 8321 deletions
diff --git a/scene/2d/animated_sprite_2d.cpp b/scene/2d/animated_sprite_2d.cpp index 3268544519..0f98fad824 100644 --- a/scene/2d/animated_sprite_2d.cpp +++ b/scene/2d/animated_sprite_2d.cpp @@ -31,11 +31,9 @@ #include "animated_sprite_2d.h" #include "core/os/os.h" +#include "scene/main/viewport.h" #include "scene/scene_string_names.h" -#define NORMAL_SUFFIX "_normal" -#define SPECULAR_SUFFIX "_specular" - #ifdef TOOLS_ENABLED Dictionary AnimatedSprite2D::_edit_get_state() const { Dictionary state = Node2D::_edit_get_state(); @@ -152,8 +150,6 @@ void SpriteFrames::add_animation(const StringName &p_anim) { ERR_FAIL_COND_MSG(animations.has(p_anim), "SpriteFrames already has animation '" + p_anim + "'."); animations[p_anim] = Anim(); - animations[p_anim].normal_name = String(p_anim) + NORMAL_SUFFIX; - animations[p_anim].specular_name = String(p_anim) + SPECULAR_SUFFIX; } bool SpriteFrames::has_animation(const StringName &p_anim) const { @@ -171,8 +167,6 @@ void SpriteFrames::rename_animation(const StringName &p_prev, const StringName & Anim anim = animations[p_prev]; animations.erase(p_prev); animations[p_next] = anim; - animations[p_next].normal_name = String(p_next) + NORMAL_SUFFIX; - animations[p_next].specular_name = String(p_next) + SPECULAR_SUFFIX; } Vector<String> SpriteFrames::_get_animation_list() const { @@ -441,9 +435,6 @@ void AnimatedSprite2D::_notification(int p_what) { return; } - Ref<Texture2D> normal = frames->get_normal_frame(animation, frame); - Ref<Texture2D> specular = frames->get_specular_frame(animation, frame); - RID ci = get_canvas_item(); Size2i s; @@ -453,7 +444,7 @@ void AnimatedSprite2D::_notification(int p_what) { ofs -= s / 2; } - if (Engine::get_singleton()->get_use_pixel_snap()) { + if (get_viewport() && get_viewport()->is_snap_2d_transforms_to_pixel_enabled()) { ofs = ofs.floor(); } Rect2 dst_rect(ofs, s); @@ -465,7 +456,7 @@ void AnimatedSprite2D::_notification(int p_what) { dst_rect.size.y = -dst_rect.size.y; } - texture->draw_rect_region(ci, dst_rect, Rect2(Vector2(), texture->get_size()), Color(1, 1, 1), false, normal, specular, Color(specular_color.r, specular_color.g, specular_color.b, shininess)); + texture->draw_rect_region(ci, dst_rect, Rect2(Vector2(), texture->get_size()), Color(1, 1, 1), false); } break; } @@ -660,29 +651,16 @@ StringName AnimatedSprite2D::get_animation() const { } String AnimatedSprite2D::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + if (frames.is_null()) { - return TTR("A SpriteFrames resource must be created or set in the \"Frames\" property in order for AnimatedSprite to display frames."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A SpriteFrames resource must be created or set in the \"Frames\" property in order for AnimatedSprite to display frames."); } - return String(); -} - -void AnimatedSprite2D::set_specular_color(const Color &p_color) { - specular_color = p_color; - update(); -} - -Color AnimatedSprite2D::get_specular_color() const { - return specular_color; -} - -void AnimatedSprite2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float AnimatedSprite2D::get_shininess() const { - return shininess; + return warning; } void AnimatedSprite2D::_bind_methods() { @@ -717,12 +695,6 @@ void AnimatedSprite2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_speed_scale", "speed_scale"), &AnimatedSprite2D::set_speed_scale); ClassDB::bind_method(D_METHOD("get_speed_scale"), &AnimatedSprite2D::get_speed_scale); - ClassDB::bind_method(D_METHOD("set_specular_color", "color"), &AnimatedSprite2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &AnimatedSprite2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &AnimatedSprite2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &AnimatedSprite2D::get_shininess); - ADD_SIGNAL(MethodInfo("frame_changed")); ADD_SIGNAL(MethodInfo("animation_finished")); @@ -732,9 +704,6 @@ void AnimatedSprite2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "frame"), "set_frame", "get_frame"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "speed_scale"), "set_speed_scale", "get_speed_scale"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "playing"), "_set_playing", "_is_playing"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Offset", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "centered"), "set_centered", "is_centered"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); @@ -754,6 +723,4 @@ AnimatedSprite2D::AnimatedSprite2D() { animation = "default"; timeout = 0; is_over = false; - specular_color = Color(1, 1, 1, 1); - shininess = 1.0; } diff --git a/scene/2d/animated_sprite_2d.h b/scene/2d/animated_sprite_2d.h index cefed56620..fddbf39be2 100644 --- a/scene/2d/animated_sprite_2d.h +++ b/scene/2d/animated_sprite_2d.h @@ -46,14 +46,8 @@ class SpriteFrames : public Resource { loop = true; speed = 5; } - - StringName normal_name; - StringName specular_name; }; - Color specular_color; - float shininess; - Map<StringName, Anim> animations; Array _get_frames() const; @@ -95,34 +89,6 @@ public: return E->get().frames[p_idx]; } - _FORCE_INLINE_ Ref<Texture2D> get_normal_frame(const StringName &p_anim, int p_idx) const { - const Map<StringName, Anim>::Element *E = animations.find(p_anim); - ERR_FAIL_COND_V_MSG(!E, Ref<Texture2D>(), "Animation '" + String(p_anim) + "' doesn't exist."); - ERR_FAIL_COND_V(p_idx < 0, Ref<Texture2D>()); - - const Map<StringName, Anim>::Element *EN = animations.find(E->get().normal_name); - - if (!EN || p_idx >= EN->get().frames.size()) { - return Ref<Texture2D>(); - } - - return EN->get().frames[p_idx]; - } - - _FORCE_INLINE_ Ref<Texture2D> get_specular_frame(const StringName &p_anim, int p_idx) const { - const Map<StringName, Anim>::Element *E = animations.find(p_anim); - ERR_FAIL_COND_V(!E, Ref<Texture2D>()); - ERR_FAIL_COND_V(p_idx < 0, Ref<Texture2D>()); - - const Map<StringName, Anim>::Element *EN = animations.find(E->get().specular_name); - - if (!EN || p_idx >= EN->get().frames.size()) { - return Ref<Texture2D>(); - } - - return EN->get().frames[p_idx]; - } - void set_frame(const StringName &p_anim, int p_idx, const Ref<Texture2D> &p_frame) { Map<StringName, Anim>::Element *E = animations.find(p_anim); ERR_FAIL_COND_MSG(!E, "Animation '" + String(p_anim) + "' doesn't exist."); @@ -166,9 +132,6 @@ class AnimatedSprite2D : public Node2D { bool _is_playing() const; Rect2 _get_rect() const; - Color specular_color; - float shininess; - protected: static void _bind_methods(); void _notification(int p_what); @@ -216,12 +179,6 @@ public: void set_flip_v(bool p_flip); bool is_flipped_v() const; - void set_specular_color(const Color &p_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - virtual String get_configuration_warning() const override; AnimatedSprite2D(); }; diff --git a/scene/2d/area_2d.cpp b/scene/2d/area_2d.cpp index ebfcb9cad6..d51ee3f9a8 100644 --- a/scene/2d/area_2d.cpp +++ b/scene/2d/area_2d.cpp @@ -180,26 +180,20 @@ void Area2D::_body_inout(int p_status, const RID &p_body, ObjectID p_instance, i E->get().shapes.erase(ShapePair(p_body_shape, p_area_shape)); } - bool eraseit = false; - + bool in_tree = E->get().in_tree; if (E->get().rc == 0) { + body_map.erase(E); if (node) { node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area2D::_body_enter_tree)); node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area2D::_body_exit_tree)); - if (E->get().in_tree) { + if (in_tree) { emit_signal(SceneStringNames::get_singleton()->body_exited, obj); } } - - eraseit = true; } - if (!node || E->get().in_tree) { + if (!node || in_tree) { emit_signal(SceneStringNames::get_singleton()->body_shape_exited, objid, obj, p_body_shape, p_area_shape); } - - if (eraseit) { - body_map.erase(E); - } } locked = false; @@ -278,26 +272,20 @@ void Area2D::_area_inout(int p_status, const RID &p_area, ObjectID p_instance, i E->get().shapes.erase(AreaShapePair(p_area_shape, p_self_shape)); } - bool eraseit = false; - + bool in_tree = E->get().in_tree; if (E->get().rc == 0) { + area_map.erase(E); if (node) { node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area2D::_area_enter_tree)); node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area2D::_area_exit_tree)); - if (E->get().in_tree) { + if (in_tree) { emit_signal(SceneStringNames::get_singleton()->area_exited, obj); } } - - eraseit = true; } - if (!node || E->get().in_tree) { + if (!node || in_tree) { emit_signal(SceneStringNames::get_singleton()->area_shape_exited, objid, obj, p_area_shape, p_self_shape); } - - if (eraseit) { - area_map.erase(E); - } } locked = false; diff --git a/scene/2d/area_2d.h b/scene/2d/area_2d.h index 32226ef5a4..01426db999 100644 --- a/scene/2d/area_2d.h +++ b/scene/2d/area_2d.h @@ -31,7 +31,7 @@ #ifndef AREA_2D_H #define AREA_2D_H -#include "core/vset.h" +#include "core/templates/vset.h" #include "scene/2d/collision_object_2d.h" class Area2D : public CollisionObject2D { diff --git a/scene/2d/audio_stream_player_2d.cpp b/scene/2d/audio_stream_player_2d.cpp index 5b89ac15b1..9bd716aeaa 100644 --- a/scene/2d/audio_stream_player_2d.cpp +++ b/scene/2d/audio_stream_player_2d.cpp @@ -30,7 +30,7 @@ #include "audio_stream_player_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/2d/area_2d.h" #include "scene/main/window.h" diff --git a/scene/2d/camera_2d.cpp b/scene/2d/camera_2d.cpp index fd4d5981ff..0d09d21a71 100644 --- a/scene/2d/camera_2d.cpp +++ b/scene/2d/camera_2d.cpp @@ -30,7 +30,7 @@ #include "camera_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/math_funcs.h" #include "scene/scene_string_names.h" #include "servers/rendering_server.h" @@ -77,6 +77,9 @@ void Camera2D::_update_process_mode() { } void Camera2D::set_zoom(const Vector2 &p_zoom) { + // Setting zoom to zero causes 'affine_invert' issues + ERR_FAIL_COND_MSG(Math::is_zero_approx(p_zoom.x) || Math::is_zero_approx(p_zoom.y), "Zoom level must be different from 0 (can be negative)."); + zoom = p_zoom; Point2 old_smoothed_camera_pos = smoothed_camera_pos; _update_scroll(); @@ -198,10 +201,10 @@ Transform2D Camera2D::get_camera_transform() { camera_screen_center = screen_rect.position + screen_rect.size * 0.5; Transform2D xform; + xform.scale_basis(zoom); if (rotating) { xform.set_rotation(angle); } - xform.scale_basis(zoom); xform.set_origin(screen_rect.position /*.floor()*/); /* diff --git a/scene/2d/canvas_group.cpp b/scene/2d/canvas_group.cpp new file mode 100644 index 0000000000..39cae8e0c6 --- /dev/null +++ b/scene/2d/canvas_group.cpp @@ -0,0 +1,87 @@ +/*************************************************************************/ +/* canvas_group.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "canvas_group.h" + +void CanvasGroup::set_fit_margin(float p_fit_margin) { + ERR_FAIL_COND(p_fit_margin < 0.0); + + fit_margin = p_fit_margin; + RS::get_singleton()->canvas_item_set_canvas_group_mode(get_canvas_item(), RS::CANVAS_GROUP_MODE_TRANSPARENT, clear_margin, true, fit_margin, use_mipmaps); + + update(); +} + +float CanvasGroup::get_fit_margin() const { + return fit_margin; +} + +void CanvasGroup::set_clear_margin(float p_clear_margin) { + ERR_FAIL_COND(p_clear_margin < 0.0); + + clear_margin = p_clear_margin; + RS::get_singleton()->canvas_item_set_canvas_group_mode(get_canvas_item(), RS::CANVAS_GROUP_MODE_TRANSPARENT, clear_margin, true, clear_margin, use_mipmaps); + + update(); +} + +float CanvasGroup::get_clear_margin() const { + return clear_margin; +} + +void CanvasGroup::set_use_mipmaps(bool p_use_mipmaps) { + use_mipmaps = p_use_mipmaps; + RS::get_singleton()->canvas_item_set_canvas_group_mode(get_canvas_item(), RS::CANVAS_GROUP_MODE_TRANSPARENT, clear_margin, true, fit_margin, use_mipmaps); +} +bool CanvasGroup::is_using_mipmaps() const { + return use_mipmaps; +} + +void CanvasGroup::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_fit_margin", "fit_margin"), &CanvasGroup::set_fit_margin); + ClassDB::bind_method(D_METHOD("get_fit_margin"), &CanvasGroup::get_fit_margin); + + ClassDB::bind_method(D_METHOD("set_clear_margin", "clear_margin"), &CanvasGroup::set_clear_margin); + ClassDB::bind_method(D_METHOD("get_clear_margin"), &CanvasGroup::get_clear_margin); + + ClassDB::bind_method(D_METHOD("set_use_mipmaps", "use_mipmaps"), &CanvasGroup::set_use_mipmaps); + ClassDB::bind_method(D_METHOD("is_using_mipmaps"), &CanvasGroup::is_using_mipmaps); + + ADD_GROUP("Tweaks", ""); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fit_margin", PROPERTY_HINT_RANGE, "0,1024,1.0,or_greater"), "set_fit_margin", "get_fit_margin"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "clear_margin", PROPERTY_HINT_RANGE, "0,1024,1.0,or_greater"), "set_clear_margin", "get_clear_margin"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_mipmaps"), "set_use_mipmaps", "is_using_mipmaps"); +} + +CanvasGroup::CanvasGroup() { + set_fit_margin(10.0); //sets things +} +CanvasGroup::~CanvasGroup() { +} diff --git a/scene/2d/canvas_group.h b/scene/2d/canvas_group.h new file mode 100644 index 0000000000..19630befc7 --- /dev/null +++ b/scene/2d/canvas_group.h @@ -0,0 +1,59 @@ +/*************************************************************************/ +/* canvas_group.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef CANVASGROUP_H +#define CANVASGROUP_H + +#include "scene/2d/node_2d.h" + +class CanvasGroup : public Node2D { + GDCLASS(CanvasGroup, Node2D) + float fit_margin = 10.0; + float clear_margin = 10.0; + bool use_mipmaps = false; + +protected: + static void _bind_methods(); + +public: + void set_fit_margin(float p_fit_margin); + float get_fit_margin() const; + + void set_clear_margin(float p_clear_margin); + float get_clear_margin() const; + + void set_use_mipmaps(bool p_use_mipmaps); + bool is_using_mipmaps() const; + + CanvasGroup(); + ~CanvasGroup(); +}; + +#endif // CANVASGROUP_H diff --git a/scene/2d/canvas_modulate.cpp b/scene/2d/canvas_modulate.cpp index 56643542a8..8fb16534e8 100644 --- a/scene/2d/canvas_modulate.cpp +++ b/scene/2d/canvas_modulate.cpp @@ -78,14 +78,19 @@ String CanvasModulate::get_configuration_warning() const { return String(); } + String warning = Node2D::get_configuration_warning(); + List<Node *> nodes; get_tree()->get_nodes_in_group("_canvas_modulate_" + itos(get_canvas().get_id()), &nodes); if (nodes.size() > 1) { - return TTR("Only one visible CanvasModulate is allowed per scene (or set of instanced scenes). The first created one will work, while the rest will be ignored."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("Only one visible CanvasModulate is allowed per scene (or set of instanced scenes). The first created one will work, while the rest will be ignored."); } - return String(); + return warning; } CanvasModulate::CanvasModulate() { diff --git a/scene/2d/collision_polygon_2d.cpp b/scene/2d/collision_polygon_2d.cpp index d23398713a..64d82d715c 100644 --- a/scene/2d/collision_polygon_2d.cpp +++ b/scene/2d/collision_polygon_2d.cpp @@ -31,7 +31,7 @@ #include "collision_polygon_2d.h" #include "collision_object_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/geometry_2d.h" #include "scene/resources/concave_polygon_shape_2d.h" #include "scene/resources/convex_polygon_shape_2d.h" @@ -230,15 +230,23 @@ bool CollisionPolygon2D::_edit_is_selected_on_click(const Point2 &p_point, doubl #endif String CollisionPolygon2D::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + if (!Object::cast_to<CollisionObject2D>(get_parent())) { - return TTR("CollisionPolygon2D only serves to provide a collision shape to a CollisionObject2D derived node. Please only use it as a child of Area2D, StaticBody2D, RigidBody2D, KinematicBody2D, etc. to give them a shape."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("CollisionPolygon2D only serves to provide a collision shape to a CollisionObject2D derived node. Please only use it as a child of Area2D, StaticBody2D, RigidBody2D, KinematicBody2D, etc. to give them a shape."); } if (polygon.empty()) { - return TTR("An empty CollisionPolygon2D has no effect on collision."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("An empty CollisionPolygon2D has no effect on collision."); } - return String(); + return warning; } void CollisionPolygon2D::set_disabled(bool p_disabled) { diff --git a/scene/2d/collision_shape_2d.cpp b/scene/2d/collision_shape_2d.cpp index d022c857f3..a5cd624235 100644 --- a/scene/2d/collision_shape_2d.cpp +++ b/scene/2d/collision_shape_2d.cpp @@ -31,7 +31,7 @@ #include "collision_shape_2d.h" #include "collision_object_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/resources/capsule_shape_2d.h" #include "scene/resources/circle_shape_2d.h" #include "scene/resources/concave_polygon_shape_2d.h" diff --git a/scene/2d/cpu_particles_2d.cpp b/scene/2d/cpu_particles_2d.cpp index e3a632c98a..3649746c40 100644 --- a/scene/2d/cpu_particles_2d.cpp +++ b/scene/2d/cpu_particles_2d.cpp @@ -228,15 +228,6 @@ Ref<Texture2D> CPUParticles2D::get_texture() const { return texture; } -void CPUParticles2D::set_normalmap(const Ref<Texture2D> &p_normalmap) { - normalmap = p_normalmap; - update(); -} - -Ref<Texture2D> CPUParticles2D::get_normalmap() const { - return normalmap; -} - void CPUParticles2D::set_fixed_fps(int p_count) { fixed_fps = p_count; } @@ -254,7 +245,7 @@ bool CPUParticles2D::get_fractional_delta() const { } String CPUParticles2D::get_configuration_warning() const { - String warnings; + String warnings = Node2D::get_configuration_warning(); CanvasItemMaterial *mat = Object::cast_to<CanvasItemMaterial>(get_material().ptr()); @@ -406,14 +397,14 @@ Ref<Gradient> CPUParticles2D::get_color_ramp() const { return color_ramp; } -void CPUParticles2D::set_particle_flag(Flags p_flag, bool p_enable) { - ERR_FAIL_INDEX(p_flag, FLAG_MAX); - flags[p_flag] = p_enable; +void CPUParticles2D::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { + ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); + particle_flags[p_particle_flag] = p_enable; } -bool CPUParticles2D::get_particle_flag(Flags p_flag) const { - ERR_FAIL_INDEX_V(p_flag, FLAG_MAX, false); - return flags[p_flag]; +bool CPUParticles2D::get_particle_flag(ParticleFlags p_particle_flag) const { + ERR_FAIL_INDEX_V(p_particle_flag, PARTICLE_FLAG_MAX, false); + return particle_flags[p_particle_flag]; } void CPUParticles2D::set_emission_shape(EmissionShape p_shape) { @@ -914,7 +905,7 @@ void CPUParticles2D::_particles_process(float p_delta) { p.color *= p.base_color; - if (flags[FLAG_ALIGN_Y_TO_VELOCITY]) { + if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { if (p.velocity.length() > 0.0) { p.transform.elements[1] = p.velocity.normalized(); p.transform.elements[0] = p.transform.elements[1].tangent(); @@ -1060,12 +1051,7 @@ void CPUParticles2D::_notification(int p_what) { texrid = texture->get_rid(); } - RID normrid; - if (normalmap.is_valid()) { - normrid = normalmap->get_rid(); - } - - RS::get_singleton()->canvas_item_add_multimesh(get_canvas_item(), multimesh, texrid, normrid); + RS::get_singleton()->canvas_item_add_multimesh(get_canvas_item(), multimesh, texrid); } if (p_what == NOTIFICATION_INTERNAL_PROCESS) { @@ -1144,7 +1130,7 @@ void CPUParticles2D::convert_from_particles(Node *p_particles) { set_color_ramp(gt->get_gradient()); } - set_particle_flag(FLAG_ALIGN_Y_TO_VELOCITY, material->get_flag(ParticlesMaterial::FLAG_ALIGN_Y_TO_VELOCITY)); + set_particle_flag(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY)); set_emission_shape(EmissionShape(material->get_emission_shape())); set_emission_sphere_radius(material->get_emission_sphere_radius()); @@ -1214,9 +1200,6 @@ void CPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &CPUParticles2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &CPUParticles2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normalmap", "normalmap"), &CPUParticles2D::set_normalmap); - ClassDB::bind_method(D_METHOD("get_normalmap"), &CPUParticles2D::get_normalmap); - ClassDB::bind_method(D_METHOD("restart"), &CPUParticles2D::restart); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "emitting"), "set_emitting", "is_emitting"); @@ -1236,7 +1219,6 @@ void CPUParticles2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "local_coords"), "set_use_local_coordinates", "get_use_local_coordinates"); ADD_PROPERTY(PropertyInfo(Variant::INT, "draw_order", PROPERTY_HINT_ENUM, "Index,Lifetime"), "set_draw_order", "get_draw_order"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normalmap", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normalmap", "get_normalmap"); BIND_ENUM_CONSTANT(DRAW_ORDER_INDEX); BIND_ENUM_CONSTANT(DRAW_ORDER_LIFETIME); @@ -1264,8 +1246,8 @@ void CPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &CPUParticles2D::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &CPUParticles2D::get_color_ramp); - ClassDB::bind_method(D_METHOD("set_particle_flag", "flag", "enable"), &CPUParticles2D::set_particle_flag); - ClassDB::bind_method(D_METHOD("get_particle_flag", "flag"), &CPUParticles2D::get_particle_flag); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &CPUParticles2D::set_particle_flag); + ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &CPUParticles2D::get_particle_flag); ClassDB::bind_method(D_METHOD("set_emission_shape", "shape"), &CPUParticles2D::set_emission_shape); ClassDB::bind_method(D_METHOD("get_emission_shape"), &CPUParticles2D::get_emission_shape); @@ -1291,14 +1273,14 @@ void CPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("convert_from_particles", "particles"), &CPUParticles2D::convert_from_particles); ADD_GROUP("Emission Shape", "emission_"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "emission_shape", PROPERTY_HINT_ENUM, "Point,Sphere,Box,Points,Directed Points"), "set_emission_shape", "get_emission_shape"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "emission_shape", PROPERTY_HINT_ENUM, "Point,Sphere,Box,Points,Directed Points", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_emission_shape", "get_emission_shape"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "emission_sphere_radius", PROPERTY_HINT_RANGE, "0.01,128,0.01"), "set_emission_sphere_radius", "get_emission_sphere_radius"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "emission_rect_extents"), "set_emission_rect_extents", "get_emission_rect_extents"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR2_ARRAY, "emission_points"), "set_emission_points", "get_emission_points"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR2_ARRAY, "emission_normals"), "set_emission_normals", "get_emission_normals"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "emission_colors"), "set_emission_colors", "get_emission_colors"); - ADD_GROUP("Flags", "flag_"); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_align_y"), "set_particle_flag", "get_particle_flag", FLAG_ALIGN_Y_TO_VELOCITY); + ADD_GROUP("Particle Flags", "particle_flag_"); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_align_y"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); ADD_GROUP("Direction", ""); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "direction"), "set_direction", "get_direction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "spread", PROPERTY_HINT_RANGE, "0,180,0.01"), "set_spread", "get_spread"); @@ -1369,10 +1351,10 @@ void CPUParticles2D::_bind_methods() { BIND_ENUM_CONSTANT(PARAM_ANIM_OFFSET); BIND_ENUM_CONSTANT(PARAM_MAX); - BIND_ENUM_CONSTANT(FLAG_ALIGN_Y_TO_VELOCITY); - BIND_ENUM_CONSTANT(FLAG_ROTATE_Y); // Unused, but exposed for consistency with 3D. - BIND_ENUM_CONSTANT(FLAG_DISABLE_Z); // Unused, but exposed for consistency with 3D. - BIND_ENUM_CONSTANT(FLAG_MAX); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ROTATE_Y); // Unused, but exposed for consistency with 3D. + BIND_ENUM_CONSTANT(PARTICLE_FLAG_DISABLE_Z); // Unused, but exposed for consistency with 3D. + BIND_ENUM_CONSTANT(PARTICLE_FLAG_MAX); BIND_ENUM_CONSTANT(EMISSION_SHAPE_POINT); BIND_ENUM_CONSTANT(EMISSION_SHAPE_SPHERE); @@ -1433,8 +1415,8 @@ CPUParticles2D::CPUParticles2D() { set_param_randomness(Parameter(i), 0); } - for (int i = 0; i < FLAG_MAX; i++) { - flags[i] = false; + for (int i = 0; i < PARTICLE_FLAG_MAX; i++) { + particle_flags[i] = false; } set_color(Color(1, 1, 1, 1)); diff --git a/scene/2d/cpu_particles_2d.h b/scene/2d/cpu_particles_2d.h index dfc875ceb0..857f19b20f 100644 --- a/scene/2d/cpu_particles_2d.h +++ b/scene/2d/cpu_particles_2d.h @@ -31,7 +31,7 @@ #ifndef CPU_PARTICLES_2D_H #define CPU_PARTICLES_2D_H -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/2d/node_2d.h" #include "scene/resources/texture.h" @@ -46,7 +46,6 @@ public: }; enum Parameter { - PARAM_INITIAL_LINEAR_VELOCITY, PARAM_ANGULAR_VELOCITY, PARAM_ORBIT_VELOCITY, @@ -62,11 +61,11 @@ public: PARAM_MAX }; - enum Flags { - FLAG_ALIGN_Y_TO_VELOCITY, - FLAG_ROTATE_Y, // Unused, but exposed for consistency with 3D. - FLAG_DISABLE_Z, // Unused, but exposed for consistency with 3D. - FLAG_MAX + enum ParticleFlags { + PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, + PARTICLE_FLAG_ROTATE_Y, // Unused, but exposed for consistency with 3D. + PARTICLE_FLAG_DISABLE_Z, // Unused, but exposed for consistency with 3D. + PARTICLE_FLAG_MAX }; enum EmissionShape { @@ -147,7 +146,6 @@ private: DrawOrder draw_order; Ref<Texture2D> texture; - Ref<Texture2D> normalmap; //////// @@ -161,7 +159,7 @@ private: Color color; Ref<Gradient> color_ramp; - bool flags[FLAG_MAX]; + bool particle_flags[PARTICLE_FLAG_MAX]; EmissionShape emission_shape; float emission_sphere_radius; @@ -232,9 +230,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normalmap(const Ref<Texture2D> &p_normalmap); - Ref<Texture2D> get_normalmap() const; - /////////////////// void set_direction(Vector2 p_direction); @@ -258,8 +253,8 @@ public: void set_color_ramp(const Ref<Gradient> &p_ramp); Ref<Gradient> get_color_ramp() const; - void set_particle_flag(Flags p_flag, bool p_enable); - bool get_particle_flag(Flags p_flag) const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); + bool get_particle_flag(ParticleFlags p_particle_flag) const; void set_emission_shape(EmissionShape p_shape); void set_emission_sphere_radius(float p_radius); @@ -292,7 +287,7 @@ public: VARIANT_ENUM_CAST(CPUParticles2D::DrawOrder) VARIANT_ENUM_CAST(CPUParticles2D::Parameter) -VARIANT_ENUM_CAST(CPUParticles2D::Flags) +VARIANT_ENUM_CAST(CPUParticles2D::ParticleFlags) VARIANT_ENUM_CAST(CPUParticles2D::EmissionShape) #endif // CPU_PARTICLES_2D_H diff --git a/scene/2d/gpu_particles_2d.cpp b/scene/2d/gpu_particles_2d.cpp index 0814fbb549..46096d7460 100644 --- a/scene/2d/gpu_particles_2d.cpp +++ b/scene/2d/gpu_particles_2d.cpp @@ -35,7 +35,7 @@ #include "scene/scene_string_names.h" #ifdef TOOLS_ENABLED -#include "core/engine.h" +#include "core/config/engine.h" #endif void GPUParticles2D::set_emitting(bool p_emitting) { @@ -127,9 +127,9 @@ void GPUParticles2D::_update_particle_emission_transform() { void GPUParticles2D::set_process_material(const Ref<Material> &p_material) { process_material = p_material; Ref<ParticlesMaterial> pm = p_material; - if (pm.is_valid() && !pm->get_flag(ParticlesMaterial::FLAG_DISABLE_Z) && pm->get_gravity() == Vector3(0, -9.8, 0)) { + if (pm.is_valid() && !pm->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_DISABLE_Z) && pm->get_gravity() == Vector3(0, -9.8, 0)) { // Likely a new (3D) material, modify it to match 2D space - pm->set_flag(ParticlesMaterial::FLAG_DISABLE_Z, true); + pm->set_particle_flag(ParticlesMaterial::PARTICLE_FLAG_DISABLE_Z, true); pm->set_gravity(Vector3(0, 98, 0)); } RID material_rid; @@ -222,7 +222,7 @@ String GPUParticles2D::get_configuration_warning() const { return TTR("GPU-based particles are not supported by the GLES2 video driver.\nUse the CPUParticles2D node instead. You can use the \"Convert to CPUParticles2D\" option for this purpose."); } - String warnings; + String warnings = Node2D::get_configuration_warning(); if (process_material.is_null()) { if (warnings != String()) { @@ -267,15 +267,6 @@ Ref<Texture2D> GPUParticles2D::get_texture() const { return texture; } -void GPUParticles2D::set_normal_map(const Ref<Texture2D> &p_normal_map) { - normal_map = p_normal_map; - update(); -} - -Ref<Texture2D> GPUParticles2D::get_normal_map() const { - return normal_map; -} - void GPUParticles2D::_validate_property(PropertyInfo &property) const { } @@ -290,12 +281,8 @@ void GPUParticles2D::_notification(int p_what) { if (texture.is_valid()) { texture_rid = texture->get_rid(); } - RID normal_rid; - if (normal_map.is_valid()) { - normal_rid = normal_map->get_rid(); - } - RS::get_singleton()->canvas_item_add_particles(get_canvas_item(), particles, texture_rid, normal_rid); + RS::get_singleton()->canvas_item_add_particles(get_canvas_item(), particles, texture_rid); #ifdef TOOLS_ENABLED if (Engine::get_singleton()->is_editor_hint() && (this == get_tree()->get_edited_scene_root() || get_tree()->get_edited_scene_root()->is_a_parent_of(this))) { @@ -359,9 +346,6 @@ void GPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticles2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticles2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "texture"), &GPUParticles2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &GPUParticles2D::get_normal_map); - ClassDB::bind_method(D_METHOD("capture_rect"), &GPUParticles2D::capture_rect); ClassDB::bind_method(D_METHOD("restart"), &GPUParticles2D::restart); @@ -385,7 +369,6 @@ void GPUParticles2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "process_material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial,ParticlesMaterial"), "set_process_material", "get_process_material"); ADD_GROUP("Textures", ""); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); BIND_ENUM_CONSTANT(DRAW_ORDER_INDEX); BIND_ENUM_CONSTANT(DRAW_ORDER_LIFETIME); diff --git a/scene/2d/gpu_particles_2d.h b/scene/2d/gpu_particles_2d.h index 3258237f92..0d1b82d93e 100644 --- a/scene/2d/gpu_particles_2d.h +++ b/scene/2d/gpu_particles_2d.h @@ -31,7 +31,7 @@ #ifndef PARTICLES_2D_H #define PARTICLES_2D_H -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/2d/node_2d.h" #include "scene/resources/texture.h" @@ -65,7 +65,6 @@ private: DrawOrder draw_order; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; void _update_particle_emission_transform(); @@ -111,9 +110,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> get_normal_map() const; - virtual String get_configuration_warning() const override; void restart(); diff --git a/scene/2d/joints_2d.cpp b/scene/2d/joints_2d.cpp index 8df72d7aac..f5d13fd641 100644 --- a/scene/2d/joints_2d.cpp +++ b/scene/2d/joints_2d.cpp @@ -30,7 +30,7 @@ #include "joints_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "physics_body_2d.h" #include "servers/physics_server_2d.h" @@ -47,29 +47,53 @@ void Joint2D::_update_joint(bool p_only_free) { } if (p_only_free || !is_inside_tree()) { + warning = String(); return; } Node *node_a = has_node(get_node_a()) ? get_node(get_node_a()) : (Node *)nullptr; Node *node_b = has_node(get_node_b()) ? get_node(get_node_b()) : (Node *)nullptr; - if (!node_a || !node_b) { + PhysicsBody2D *body_a = Object::cast_to<PhysicsBody2D>(node_a); + PhysicsBody2D *body_b = Object::cast_to<PhysicsBody2D>(node_b); + + if (node_a && !body_a && node_b && !body_b) { + warning = TTR("Node A and Node B must be PhysicsBody2Ds"); + update_configuration_warning(); return; } - PhysicsBody2D *body_a = Object::cast_to<PhysicsBody2D>(node_a); - PhysicsBody2D *body_b = Object::cast_to<PhysicsBody2D>(node_b); + if (node_a && !body_a) { + warning = TTR("Node A must be a PhysicsBody2D"); + update_configuration_warning(); + return; + } - if (!body_a || !body_b) { + if (node_b && !body_b) { + warning = TTR("Node B must be a PhysicsBody2D"); + update_configuration_warning(); return; } - joint = _configure_joint(body_a, body_b); + if (!body_a || !body_b) { + warning = TTR("Joint is not connected to two PhysicsBody2Ds"); + update_configuration_warning(); + return; + } - if (!joint.is_valid()) { + if (body_a == body_b) { + warning = TTR("Node A and Node B must be different PhysicsBody2Ds"); + update_configuration_warning(); return; } + warning = String(); + update_configuration_warning(); + + joint = _configure_joint(body_a, body_b); + + ERR_FAIL_COND_MSG(!joint.is_valid(), "Failed to configure the joint."); + PhysicsServer2D::get_singleton()->get_singleton()->joint_set_param(joint, PhysicsServer2D::JOINT_PARAM_BIAS, bias); ba = body_a->get_rid(); @@ -141,6 +165,19 @@ bool Joint2D::get_exclude_nodes_from_collision() const { return exclude_from_collision; } +String Joint2D::get_configuration_warning() const { + String node_warning = Node2D::get_configuration_warning(); + + if (!warning.empty()) { + if (!node_warning.empty()) { + node_warning += "\n\n"; + } + node_warning += warning; + } + + return node_warning; +} + void Joint2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_node_a", "node"), &Joint2D::set_node_a); ClassDB::bind_method(D_METHOD("get_node_a"), &Joint2D::get_node_a); @@ -154,8 +191,8 @@ void Joint2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_exclude_nodes_from_collision", "enable"), &Joint2D::set_exclude_nodes_from_collision); ClassDB::bind_method(D_METHOD("get_exclude_nodes_from_collision"), &Joint2D::get_exclude_nodes_from_collision); - ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "node_a", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "CollisionObject2D"), "set_node_a", "get_node_a"); - ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "node_b", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "CollisionObject2D"), "set_node_b", "get_node_b"); + ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "node_a", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "PhysicsBody2D"), "set_node_a", "get_node_a"); + ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "node_b", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "PhysicsBody2D"), "set_node_b", "get_node_b"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bias", PROPERTY_HINT_RANGE, "0,0.9,0.001"), "set_bias", "get_bias"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "disable_collision"), "set_exclude_nodes_from_collision", "get_exclude_nodes_from_collision"); } diff --git a/scene/2d/joints_2d.h b/scene/2d/joints_2d.h index 60534cae65..759e7de8a0 100644 --- a/scene/2d/joints_2d.h +++ b/scene/2d/joints_2d.h @@ -46,6 +46,7 @@ class Joint2D : public Node2D { real_t bias; bool exclude_from_collision; + String warning; protected: void _update_joint(bool p_only_free = false); @@ -56,6 +57,8 @@ protected: static void _bind_methods(); public: + virtual String get_configuration_warning() const override; + void set_node_a(const NodePath &p_node_a); NodePath get_node_a() const; diff --git a/scene/2d/light_2d.cpp b/scene/2d/light_2d.cpp index 1e7e9f6b6a..2b373a669b 100644 --- a/scene/2d/light_2d.cpp +++ b/scene/2d/light_2d.cpp @@ -30,57 +30,9 @@ #include "light_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "servers/rendering_server.h" -#ifdef TOOLS_ENABLED -Dictionary Light2D::_edit_get_state() const { - Dictionary state = Node2D::_edit_get_state(); - state["offset"] = get_texture_offset(); - return state; -} - -void Light2D::_edit_set_state(const Dictionary &p_state) { - Node2D::_edit_set_state(p_state); - set_texture_offset(p_state["offset"]); -} - -void Light2D::_edit_set_pivot(const Point2 &p_pivot) { - set_position(get_transform().xform(p_pivot)); - set_texture_offset(get_texture_offset() - p_pivot); -} - -Point2 Light2D::_edit_get_pivot() const { - return Vector2(); -} - -bool Light2D::_edit_use_pivot() const { - return true; -} - -Rect2 Light2D::_edit_get_rect() const { - if (texture.is_null()) { - return Rect2(); - } - - Size2 s = texture->get_size() * _scale; - return Rect2(texture_offset - s / 2.0, s); -} - -bool Light2D::_edit_use_rect() const { - return !texture.is_null(); -} -#endif - -Rect2 Light2D::get_anchorable_rect() const { - if (texture.is_null()) { - return Rect2(); - } - - Size2 s = texture->get_size() * _scale; - return Rect2(texture_offset - s / 2.0, s); -} - void Light2D::_update_light_visibility() { if (!is_inside_tree()) { return; @@ -123,32 +75,6 @@ bool Light2D::is_editor_only() const { return editor_only; } -void Light2D::set_texture(const Ref<Texture2D> &p_texture) { - texture = p_texture; - if (texture.is_valid()) { - RS::get_singleton()->canvas_light_set_texture(canvas_light, texture->get_rid()); - } else { - RS::get_singleton()->canvas_light_set_texture(canvas_light, RID()); - } - - update_configuration_warning(); -} - -Ref<Texture2D> Light2D::get_texture() const { - return texture; -} - -void Light2D::set_texture_offset(const Vector2 &p_offset) { - texture_offset = p_offset; - RS::get_singleton()->canvas_light_set_texture_offset(canvas_light, texture_offset); - item_rect_changed(); - _change_notify("offset"); -} - -Vector2 Light2D::get_texture_offset() const { - return texture_offset; -} - void Light2D::set_color(const Color &p_color) { color = p_color; RS::get_singleton()->canvas_light_set_color(canvas_light, color); @@ -176,20 +102,6 @@ float Light2D::get_energy() const { return energy; } -void Light2D::set_texture_scale(float p_scale) { - _scale = p_scale; - // Avoid having 0 scale values, can lead to errors in physics and rendering. - if (_scale == 0) { - _scale = CMP_EPSILON; - } - RS::get_singleton()->canvas_light_set_scale(canvas_light, _scale); - item_rect_changed(); -} - -float Light2D::get_texture_scale() const { - return _scale; -} - void Light2D::set_z_range_min(int p_min_z) { z_min = p_min_z; RS::get_singleton()->canvas_light_set_z_range(canvas_light, z_min, z_max); @@ -244,15 +156,6 @@ int Light2D::get_item_shadow_cull_mask() const { return item_shadow_mask; } -void Light2D::set_mode(Mode p_mode) { - mode = p_mode; - RS::get_singleton()->canvas_light_set_mode(canvas_light, RS::CanvasLightMode(p_mode)); -} - -Light2D::Mode Light2D::get_mode() const { - return mode; -} - void Light2D::set_shadow_enabled(bool p_enabled) { shadow = p_enabled; RS::get_singleton()->canvas_light_set_shadow_enabled(canvas_light, shadow); @@ -262,15 +165,6 @@ bool Light2D::is_shadow_enabled() const { return shadow; } -void Light2D::set_shadow_buffer_size(int p_size) { - shadow_buffer_size = p_size; - RS::get_singleton()->canvas_light_set_shadow_buffer_size(canvas_light, shadow_buffer_size); -} - -int Light2D::get_shadow_buffer_size() const { - return shadow_buffer_size; -} - void Light2D::set_shadow_filter(ShadowFilter p_filter) { ERR_FAIL_INDEX(p_filter, SHADOW_FILTER_MAX); shadow_filter = p_filter; @@ -290,6 +184,15 @@ Color Light2D::get_shadow_color() const { return shadow_color; } +void Light2D::set_blend_mode(BlendMode p_mode) { + blend_mode = p_mode; + RS::get_singleton()->canvas_light_set_blend_mode(_get_light(), RS::CanvasLightBlendMode(p_mode)); +} + +Light2D::BlendMode Light2D::get_blend_mode() const { + return blend_mode; +} + void Light2D::_notification(int p_what) { if (p_what == NOTIFICATION_ENTER_TREE) { RS::get_singleton()->canvas_light_attach_to_canvas(canvas_light, get_canvas()); @@ -309,14 +212,6 @@ void Light2D::_notification(int p_what) { } } -String Light2D::get_configuration_warning() const { - if (!texture.is_valid()) { - return TTR("A texture with the shape of the light must be supplied to the \"Texture\" property."); - } - - return String(); -} - void Light2D::set_shadow_smooth(float p_amount) { shadow_smooth = p_amount; RS::get_singleton()->canvas_light_set_shadow_smooth(canvas_light, shadow_smooth); @@ -333,24 +228,12 @@ void Light2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_editor_only", "editor_only"), &Light2D::set_editor_only); ClassDB::bind_method(D_METHOD("is_editor_only"), &Light2D::is_editor_only); - ClassDB::bind_method(D_METHOD("set_texture", "texture"), &Light2D::set_texture); - ClassDB::bind_method(D_METHOD("get_texture"), &Light2D::get_texture); - - ClassDB::bind_method(D_METHOD("set_texture_offset", "texture_offset"), &Light2D::set_texture_offset); - ClassDB::bind_method(D_METHOD("get_texture_offset"), &Light2D::get_texture_offset); - ClassDB::bind_method(D_METHOD("set_color", "color"), &Light2D::set_color); ClassDB::bind_method(D_METHOD("get_color"), &Light2D::get_color); - ClassDB::bind_method(D_METHOD("set_height", "height"), &Light2D::set_height); - ClassDB::bind_method(D_METHOD("get_height"), &Light2D::get_height); - ClassDB::bind_method(D_METHOD("set_energy", "energy"), &Light2D::set_energy); ClassDB::bind_method(D_METHOD("get_energy"), &Light2D::get_energy); - ClassDB::bind_method(D_METHOD("set_texture_scale", "texture_scale"), &Light2D::set_texture_scale); - ClassDB::bind_method(D_METHOD("get_texture_scale"), &Light2D::get_texture_scale); - ClassDB::bind_method(D_METHOD("set_z_range_min", "z"), &Light2D::set_z_range_min); ClassDB::bind_method(D_METHOD("get_z_range_min"), &Light2D::get_z_range_min); @@ -369,15 +252,9 @@ void Light2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_item_shadow_cull_mask", "item_shadow_cull_mask"), &Light2D::set_item_shadow_cull_mask); ClassDB::bind_method(D_METHOD("get_item_shadow_cull_mask"), &Light2D::get_item_shadow_cull_mask); - ClassDB::bind_method(D_METHOD("set_mode", "mode"), &Light2D::set_mode); - ClassDB::bind_method(D_METHOD("get_mode"), &Light2D::get_mode); - ClassDB::bind_method(D_METHOD("set_shadow_enabled", "enabled"), &Light2D::set_shadow_enabled); ClassDB::bind_method(D_METHOD("is_shadow_enabled"), &Light2D::is_shadow_enabled); - ClassDB::bind_method(D_METHOD("set_shadow_buffer_size", "size"), &Light2D::set_shadow_buffer_size); - ClassDB::bind_method(D_METHOD("get_shadow_buffer_size"), &Light2D::get_shadow_buffer_size); - ClassDB::bind_method(D_METHOD("set_shadow_smooth", "smooth"), &Light2D::set_shadow_smooth); ClassDB::bind_method(D_METHOD("get_shadow_smooth"), &Light2D::get_shadow_smooth); @@ -387,16 +264,18 @@ void Light2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_shadow_color", "shadow_color"), &Light2D::set_shadow_color); ClassDB::bind_method(D_METHOD("get_shadow_color"), &Light2D::get_shadow_color); + ClassDB::bind_method(D_METHOD("set_blend_mode", "mode"), &Light2D::set_blend_mode); + ClassDB::bind_method(D_METHOD("get_blend_mode"), &Light2D::get_blend_mode); + + ClassDB::bind_method(D_METHOD("set_height", "height"), &Light2D::set_height); + ClassDB::bind_method(D_METHOD("get_height"), &Light2D::get_height); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "enabled"), "set_enabled", "is_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "editor_only"), "set_editor_only", "is_editor_only"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_texture_offset", "get_texture_offset"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_scale", PROPERTY_HINT_RANGE, "0.01,50,0.01"), "set_texture_scale", "get_texture_scale"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "energy", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_energy", "get_energy"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "mode", PROPERTY_HINT_ENUM, "Add,Sub,Mix,Mask"), "set_mode", "get_mode"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_mode", PROPERTY_HINT_ENUM, "Add,Sub,Mix"), "set_blend_mode", "get_blend_mode"); ADD_GROUP("Range", "range_"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "range_height", PROPERTY_HINT_RANGE, "-2048,2048,0.1,or_lesser,or_greater"), "set_height", "get_height"); ADD_PROPERTY(PropertyInfo(Variant::INT, "range_z_min", PROPERTY_HINT_RANGE, itos(RS::CANVAS_ITEM_Z_MIN) + "," + itos(RS::CANVAS_ITEM_Z_MAX) + ",1"), "set_z_range_min", "get_z_range_min"); ADD_PROPERTY(PropertyInfo(Variant::INT, "range_z_max", PROPERTY_HINT_RANGE, itos(RS::CANVAS_ITEM_Z_MIN) + "," + itos(RS::CANVAS_ITEM_Z_MAX) + ",1"), "set_z_range_max", "get_z_range_max"); ADD_PROPERTY(PropertyInfo(Variant::INT, "range_layer_min", PROPERTY_HINT_RANGE, "-512,512,1"), "set_layer_range_min", "get_layer_range_min"); @@ -406,19 +285,17 @@ void Light2D::_bind_methods() { ADD_GROUP("Shadow", "shadow_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "shadow_enabled"), "set_shadow_enabled", "is_shadow_enabled"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "shadow_color"), "set_shadow_color", "get_shadow_color"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_buffer_size", PROPERTY_HINT_RANGE, "32,16384,1"), "set_shadow_buffer_size", "get_shadow_buffer_size"); ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_filter", PROPERTY_HINT_ENUM, "None,PCF5,PCF13"), "set_shadow_filter", "get_shadow_filter"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shadow_filter_smooth", PROPERTY_HINT_RANGE, "0,64,0.1"), "set_shadow_smooth", "get_shadow_smooth"); ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_item_cull_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_item_shadow_cull_mask", "get_item_shadow_cull_mask"); - BIND_ENUM_CONSTANT(MODE_ADD); - BIND_ENUM_CONSTANT(MODE_SUB); - BIND_ENUM_CONSTANT(MODE_MIX); - BIND_ENUM_CONSTANT(MODE_MASK); - BIND_ENUM_CONSTANT(SHADOW_FILTER_NONE); BIND_ENUM_CONSTANT(SHADOW_FILTER_PCF5); BIND_ENUM_CONSTANT(SHADOW_FILTER_PCF13); + + BIND_ENUM_CONSTANT(BLEND_MODE_ADD); + BIND_ENUM_CONSTANT(BLEND_MODE_SUB); + BIND_ENUM_CONSTANT(BLEND_MODE_MIX); } Light2D::Light2D() { @@ -428,23 +305,168 @@ Light2D::Light2D() { shadow = false; color = Color(1, 1, 1); height = 0; - _scale = 1.0; z_min = -1024; z_max = 1024; layer_min = 0; layer_max = 0; item_mask = 1; item_shadow_mask = 1; - mode = MODE_ADD; - shadow_buffer_size = 2048; energy = 1.0; shadow_color = Color(0, 0, 0, 0); shadow_filter = SHADOW_FILTER_NONE; shadow_smooth = 0; - + blend_mode = BLEND_MODE_ADD; set_notify_transform(true); } Light2D::~Light2D() { RenderingServer::get_singleton()->free(canvas_light); } + +////////////////////////////// + +#ifdef TOOLS_ENABLED + +Dictionary PointLight2D::_edit_get_state() const { + Dictionary state = Node2D::_edit_get_state(); + state["offset"] = get_texture_offset(); + return state; +} + +void PointLight2D::_edit_set_state(const Dictionary &p_state) { + Node2D::_edit_set_state(p_state); + set_texture_offset(p_state["offset"]); +} + +void PointLight2D::_edit_set_pivot(const Point2 &p_pivot) { + set_position(get_transform().xform(p_pivot)); + set_texture_offset(get_texture_offset() - p_pivot); +} + +Point2 PointLight2D::_edit_get_pivot() const { + return Vector2(); +} + +bool PointLight2D::_edit_use_pivot() const { + return true; +} + +Rect2 PointLight2D::_edit_get_rect() const { + if (texture.is_null()) { + return Rect2(); + } + + Size2 s = texture->get_size() * _scale; + return Rect2(texture_offset - s / 2.0, s); +} + +bool PointLight2D::_edit_use_rect() const { + return !texture.is_null(); +} +#endif + +Rect2 PointLight2D::get_anchorable_rect() const { + if (texture.is_null()) { + return Rect2(); + } + + Size2 s = texture->get_size() * _scale; + return Rect2(texture_offset - s / 2.0, s); +} + +void PointLight2D::set_texture(const Ref<Texture2D> &p_texture) { + texture = p_texture; + if (texture.is_valid()) { + RS::get_singleton()->canvas_light_set_texture(_get_light(), texture->get_rid()); + } else { + RS::get_singleton()->canvas_light_set_texture(_get_light(), RID()); + } + + update_configuration_warning(); +} + +Ref<Texture2D> PointLight2D::get_texture() const { + return texture; +} + +void PointLight2D::set_texture_offset(const Vector2 &p_offset) { + texture_offset = p_offset; + RS::get_singleton()->canvas_light_set_texture_offset(_get_light(), texture_offset); + item_rect_changed(); + _change_notify("offset"); +} + +Vector2 PointLight2D::get_texture_offset() const { + return texture_offset; +} + +String PointLight2D::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + + if (!texture.is_valid()) { + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A texture with the shape of the light must be supplied to the \"Texture\" property."); + } + + return warning; +} + +void PointLight2D::set_texture_scale(float p_scale) { + _scale = p_scale; + // Avoid having 0 scale values, can lead to errors in physics and rendering. + if (_scale == 0) { + _scale = CMP_EPSILON; + } + RS::get_singleton()->canvas_light_set_texture_scale(_get_light(), _scale); + item_rect_changed(); +} + +float PointLight2D::get_texture_scale() const { + return _scale; +} + +void PointLight2D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &PointLight2D::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &PointLight2D::get_texture); + + ClassDB::bind_method(D_METHOD("set_texture_offset", "texture_offset"), &PointLight2D::set_texture_offset); + ClassDB::bind_method(D_METHOD("get_texture_offset"), &PointLight2D::get_texture_offset); + + ClassDB::bind_method(D_METHOD("set_texture_scale", "texture_scale"), &PointLight2D::set_texture_scale); + ClassDB::bind_method(D_METHOD("get_texture_scale"), &PointLight2D::get_texture_scale); + + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_texture_offset", "get_texture_offset"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_scale", PROPERTY_HINT_RANGE, "0.01,50,0.01"), "set_texture_scale", "get_texture_scale"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0,1024,1,or_greater"), "set_height", "get_height"); +} + +PointLight2D::PointLight2D() { + RS::get_singleton()->canvas_light_set_mode(_get_light(), RS::CANVAS_LIGHT_MODE_POINT); +} + +////////// + +void DirectionalLight2D::set_max_distance(float p_distance) { + max_distance = p_distance; + RS::get_singleton()->canvas_light_set_directional_distance(_get_light(), max_distance); +} + +float DirectionalLight2D::get_max_distance() const { + return max_distance; +} + +void DirectionalLight2D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_max_distance", "pixels"), &DirectionalLight2D::set_max_distance); + ClassDB::bind_method(D_METHOD("get_max_distance"), &DirectionalLight2D::get_max_distance); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_height", "get_height"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "max_distance", PROPERTY_HINT_RANGE, "0,16384.0,1.0,or_greater"), "set_max_distance", "get_max_distance"); +} + +DirectionalLight2D::DirectionalLight2D() { + RS::get_singleton()->canvas_light_set_mode(_get_light(), RS::CANVAS_LIGHT_MODE_DIRECTIONAL); + set_max_distance(max_distance); // Update RenderingServer. +} diff --git a/scene/2d/light_2d.h b/scene/2d/light_2d.h index 45444800fe..7dfeddc8e5 100644 --- a/scene/2d/light_2d.h +++ b/scene/2d/light_2d.h @@ -37,13 +37,6 @@ class Light2D : public Node2D { GDCLASS(Light2D, Node2D); public: - enum Mode { - MODE_ADD, - MODE_SUB, - MODE_MIX, - MODE_MASK, - }; - enum ShadowFilter { SHADOW_FILTER_NONE, SHADOW_FILTER_PCF5, @@ -51,6 +44,12 @@ public: SHADOW_FILTER_MAX }; + enum BlendMode { + BLEND_MODE_ADD, + BLEND_MODE_SUB, + BLEND_MODE_MIX, + }; + private: RID canvas_light; bool enabled; @@ -59,7 +58,6 @@ private: Color color; Color shadow_color; float height; - float _scale; float energy; int z_min; int z_max; @@ -67,45 +65,26 @@ private: int layer_max; int item_mask; int item_shadow_mask; - int shadow_buffer_size; float shadow_smooth; - Mode mode; Ref<Texture2D> texture; Vector2 texture_offset; ShadowFilter shadow_filter; + BlendMode blend_mode; void _update_light_visibility(); protected: + _FORCE_INLINE_ RID _get_light() const { return canvas_light; } void _notification(int p_what); static void _bind_methods(); public: -#ifdef TOOLS_ENABLED - virtual Dictionary _edit_get_state() const override; - virtual void _edit_set_state(const Dictionary &p_state) override; - - virtual void _edit_set_pivot(const Point2 &p_pivot) override; - virtual Point2 _edit_get_pivot() const override; - virtual bool _edit_use_pivot() const override; - virtual Rect2 _edit_get_rect() const override; - virtual bool _edit_use_rect() const override; -#endif - - virtual Rect2 get_anchorable_rect() const override; - void set_enabled(bool p_enabled); bool is_enabled() const; void set_editor_only(bool p_editor_only); bool is_editor_only() const; - void set_texture(const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_texture() const; - - void set_texture_offset(const Vector2 &p_offset); - Vector2 get_texture_offset() const; - void set_color(const Color &p_color); Color get_color() const; @@ -115,9 +94,6 @@ public: void set_energy(float p_energy); float get_energy() const; - void set_texture_scale(float p_scale); - float get_texture_scale() const; - void set_z_range_min(int p_min_z); int get_z_range_min() const; @@ -136,15 +112,9 @@ public: void set_item_shadow_cull_mask(int p_mask); int get_item_shadow_cull_mask() const; - void set_mode(Mode p_mode); - Mode get_mode() const; - void set_shadow_enabled(bool p_enabled); bool is_shadow_enabled() const; - void set_shadow_buffer_size(int p_size); - int get_shadow_buffer_size() const; - void set_shadow_filter(ShadowFilter p_filter); ShadowFilter get_shadow_filter() const; @@ -154,13 +124,68 @@ public: void set_shadow_smooth(float p_amount); float get_shadow_smooth() const; - String get_configuration_warning() const override; + void set_blend_mode(BlendMode p_mode); + BlendMode get_blend_mode() const; Light2D(); ~Light2D(); }; -VARIANT_ENUM_CAST(Light2D::Mode); VARIANT_ENUM_CAST(Light2D::ShadowFilter); +VARIANT_ENUM_CAST(Light2D::BlendMode); + +class PointLight2D : public Light2D { + GDCLASS(PointLight2D, Light2D); + +private: + float _scale = 1.0; + Ref<Texture2D> texture; + Vector2 texture_offset; + +protected: + static void _bind_methods(); + +public: +#ifdef TOOLS_ENABLED + virtual Dictionary _edit_get_state() const override; + virtual void _edit_set_state(const Dictionary &p_state) override; + + virtual void _edit_set_pivot(const Point2 &p_pivot) override; + virtual Point2 _edit_get_pivot() const override; + virtual bool _edit_use_pivot() const override; + virtual Rect2 _edit_get_rect() const override; + virtual bool _edit_use_rect() const override; +#endif + + virtual Rect2 get_anchorable_rect() const override; + + void set_texture(const Ref<Texture2D> &p_texture); + Ref<Texture2D> get_texture() const; + + void set_texture_offset(const Vector2 &p_offset); + Vector2 get_texture_offset() const; + + void set_texture_scale(float p_scale); + float get_texture_scale() const; + + String get_configuration_warning() const override; + + PointLight2D(); +}; + +class DirectionalLight2D : public Light2D { + GDCLASS(DirectionalLight2D, Light2D); + + float max_distance = 10000.0; + +protected: + static void _bind_methods(); + +public: + void set_max_distance(float p_distance); + float get_max_distance() const; + + DirectionalLight2D(); +}; #endif // LIGHT_2D_H diff --git a/scene/2d/light_occluder_2d.cpp b/scene/2d/light_occluder_2d.cpp index 023cfa6d03..b5b39ccc8f 100644 --- a/scene/2d/light_occluder_2d.cpp +++ b/scene/2d/light_occluder_2d.cpp @@ -31,7 +31,7 @@ #include "light_occluder_2d.h" #include "core/math/geometry_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #define LINE_GRAB_WIDTH 8 @@ -238,7 +238,7 @@ Ref<OccluderPolygon2D> LightOccluder2D::get_occluder_polygon() const { void LightOccluder2D::set_occluder_light_mask(int p_mask) { mask = p_mask; - RS::get_singleton()->canvas_light_occluder_set_light_mask(occluder, mask); + RS::get_singleton()->canvas_light_occluder_set_light_mask(occluder, p_mask); } int LightOccluder2D::get_occluder_light_mask() const { @@ -246,15 +246,31 @@ int LightOccluder2D::get_occluder_light_mask() const { } String LightOccluder2D::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + if (!occluder_polygon.is_valid()) { - return TTR("An occluder polygon must be set (or drawn) for this occluder to take effect."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("An occluder polygon must be set (or drawn) for this occluder to take effect."); } if (occluder_polygon.is_valid() && occluder_polygon->get_polygon().size() == 0) { - return TTR("The occluder polygon for this occluder is empty. Please draw a polygon."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The occluder polygon for this occluder is empty. Please draw a polygon."); } - return String(); + return warning; +} + +void LightOccluder2D::set_as_sdf_collision(bool p_enable) { + sdf_collision = p_enable; + RS::get_singleton()->canvas_light_occluder_set_as_sdf_collision(occluder, sdf_collision); +} +bool LightOccluder2D::is_set_as_sdf_collision() const { + return sdf_collision; } void LightOccluder2D::_bind_methods() { @@ -264,14 +280,20 @@ void LightOccluder2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_occluder_light_mask", "mask"), &LightOccluder2D::set_occluder_light_mask); ClassDB::bind_method(D_METHOD("get_occluder_light_mask"), &LightOccluder2D::get_occluder_light_mask); + ClassDB::bind_method(D_METHOD("set_as_sdf_collision", "enable"), &LightOccluder2D::set_as_sdf_collision); + ClassDB::bind_method(D_METHOD("is_set_as_sdf_collision"), &LightOccluder2D::is_set_as_sdf_collision); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "occluder", PROPERTY_HINT_RESOURCE_TYPE, "OccluderPolygon2D"), "set_occluder_polygon", "get_occluder_polygon"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "light_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_occluder_light_mask", "get_occluder_light_mask"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "sdf_collision"), "set_as_sdf_collision", "is_set_as_sdf_collision"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "occluder_light_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_occluder_light_mask", "get_occluder_light_mask"); } LightOccluder2D::LightOccluder2D() { occluder = RS::get_singleton()->canvas_light_occluder_create(); mask = 1; + set_notify_transform(true); + set_as_sdf_collision(true); } LightOccluder2D::~LightOccluder2D() { diff --git a/scene/2d/light_occluder_2d.h b/scene/2d/light_occluder_2d.h index 694097f985..97574af542 100644 --- a/scene/2d/light_occluder_2d.h +++ b/scene/2d/light_occluder_2d.h @@ -84,7 +84,7 @@ class LightOccluder2D : public Node2D { bool enabled; int mask; Ref<OccluderPolygon2D> occluder_polygon; - + bool sdf_collision; void _poly_changed(); protected: @@ -103,6 +103,9 @@ public: void set_occluder_light_mask(int p_mask); int get_occluder_light_mask() const; + void set_as_sdf_collision(bool p_enable); + bool is_set_as_sdf_collision() const; + String get_configuration_warning() const override; LightOccluder2D(); diff --git a/scene/2d/line_2d.cpp b/scene/2d/line_2d.cpp index b120b115b0..e990e9f53e 100644 --- a/scene/2d/line_2d.cpp +++ b/scene/2d/line_2d.cpp @@ -177,7 +177,7 @@ void Line2D::set_gradient(const Ref<Gradient> &p_gradient) { _gradient = p_gradient; - // Connect to the gradient so the line will update when the ColorRamp is changed + // Connect to the gradient so the line will update when the Gradient is changed if (_gradient.is_valid()) { _gradient->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &Line2D::_gradient_changed)); } diff --git a/scene/2d/line_builder.cpp b/scene/2d/line_builder.cpp index f1522dbaeb..e0116d9bad 100644 --- a/scene/2d/line_builder.cpp +++ b/scene/2d/line_builder.cpp @@ -459,39 +459,6 @@ void LineBuilder::strip_begin(Vector2 up, Vector2 down, Color color, float uvx) _last_index[DOWN] = vi + 1; } -void LineBuilder::strip_new_quad(Vector2 up, Vector2 down, Color color, float uvx) { - int vi = vertices.size(); - - vertices.push_back(vertices[_last_index[UP]]); - vertices.push_back(vertices[_last_index[DOWN]]); - vertices.push_back(up); - vertices.push_back(down); - - if (_interpolate_color) { - colors.push_back(color); - colors.push_back(color); - colors.push_back(color); - colors.push_back(color); - } - - if (texture_mode != Line2D::LINE_TEXTURE_NONE) { - uvs.push_back(uvs[_last_index[UP]]); - uvs.push_back(uvs[_last_index[DOWN]]); - uvs.push_back(Vector2(uvx, UP)); - uvs.push_back(Vector2(uvx, DOWN)); - } - - indices.push_back(vi); - indices.push_back(vi + 3); - indices.push_back(vi + 1); - indices.push_back(vi); - indices.push_back(vi + 2); - indices.push_back(vi + 3); - - _last_index[UP] = vi + 2; - _last_index[DOWN] = vi + 3; -} - void LineBuilder::strip_add_quad(Vector2 up, Vector2 down, Color color, float uvx) { int vi = vertices.size(); diff --git a/scene/2d/line_builder.h b/scene/2d/line_builder.h index 9e3dbbd6c1..0e033d9be1 100644 --- a/scene/2d/line_builder.h +++ b/scene/2d/line_builder.h @@ -31,7 +31,7 @@ #ifndef LINE_BUILDER_H #define LINE_BUILDER_H -#include "core/color.h" +#include "core/math/color.h" #include "core/math/vector2.h" #include "line_2d.h" #include "scene/resources/gradient.h" diff --git a/scene/2d/mesh_instance_2d.cpp b/scene/2d/mesh_instance_2d.cpp index 897595ad1f..037e423ce9 100644 --- a/scene/2d/mesh_instance_2d.cpp +++ b/scene/2d/mesh_instance_2d.cpp @@ -33,7 +33,7 @@ void MeshInstance2D::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { if (mesh.is_valid()) { - draw_mesh(mesh, texture, normal_map); + draw_mesh(mesh, texture); } } } diff --git a/scene/2d/multimesh_instance_2d.cpp b/scene/2d/multimesh_instance_2d.cpp index b99c0a3fa9..c258e30eab 100644 --- a/scene/2d/multimesh_instance_2d.cpp +++ b/scene/2d/multimesh_instance_2d.cpp @@ -33,7 +33,7 @@ void MultiMeshInstance2D::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { if (multimesh.is_valid()) { - draw_multimesh(multimesh, texture, normal_map); + draw_multimesh(multimesh, texture); } } } diff --git a/scene/2d/navigation_agent_2d.cpp b/scene/2d/navigation_agent_2d.cpp index e5cdade4a4..1c7063d0d3 100644 --- a/scene/2d/navigation_agent_2d.cpp +++ b/scene/2d/navigation_agent_2d.cpp @@ -30,7 +30,7 @@ #include "navigation_agent_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/geometry_2d.h" #include "scene/2d/navigation_2d.h" #include "servers/navigation_server_2d.h" @@ -271,11 +271,16 @@ void NavigationAgent2D::_avoidance_done(Vector3 p_new_velocity) { } String NavigationAgent2D::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!Object::cast_to<Node2D>(get_parent())) { - return TTR("The NavigationAgent2D can be used only under a Node2D node"); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The NavigationAgent2D can be used only under a Node2D node"); } - return String(); + return warning; } void NavigationAgent2D::update_navigation() { diff --git a/scene/2d/navigation_agent_2d.h b/scene/2d/navigation_agent_2d.h index 9474392ddf..1f2377837b 100644 --- a/scene/2d/navigation_agent_2d.h +++ b/scene/2d/navigation_agent_2d.h @@ -31,7 +31,7 @@ #ifndef NAVIGATION_AGENT_2D_H #define NAVIGATION_AGENT_2D_H -#include "core/vector.h" +#include "core/templates/vector.h" #include "scene/main/node.h" class Node2D; diff --git a/scene/2d/navigation_obstacle_2d.cpp b/scene/2d/navigation_obstacle_2d.cpp index 568023bbe2..252d7cbb96 100644 --- a/scene/2d/navigation_obstacle_2d.cpp +++ b/scene/2d/navigation_obstacle_2d.cpp @@ -106,11 +106,16 @@ Node *NavigationObstacle2D::get_navigation_node() const { } String NavigationObstacle2D::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!Object::cast_to<Node2D>(get_parent())) { - return TTR("The NavigationObstacle2D only serves to provide collision avoidance to a Node2D object."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The NavigationObstacle2D only serves to provide collision avoidance to a Node2D object."); } - return String(); + return warning; } void NavigationObstacle2D::update_agent_shape() { diff --git a/scene/2d/navigation_region_2d.cpp b/scene/2d/navigation_region_2d.cpp index 671bda558d..98817ec03e 100644 --- a/scene/2d/navigation_region_2d.cpp +++ b/scene/2d/navigation_region_2d.cpp @@ -30,8 +30,8 @@ #include "navigation_region_2d.h" +#include "core/config/engine.h" #include "core/core_string_names.h" -#include "core/engine.h" #include "core/math/geometry_2d.h" #include "core/os/mutex.h" #include "navigation_2d.h" @@ -500,19 +500,26 @@ String NavigationRegion2D::get_configuration_warning() const { return String(); } + String warning = Node2D::get_configuration_warning(); + if (!navpoly.is_valid()) { - return TTR("A NavigationPolygon resource must be set or created for this node to work. Please set a property or draw a polygon."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A NavigationPolygon resource must be set or created for this node to work. Please set a property or draw a polygon."); } const Node2D *c = this; while (c) { if (Object::cast_to<Navigation2D>(c)) { - return String(); + return warning; } c = Object::cast_to<Node2D>(c->get_parent()); } - - return TTR("NavigationRegion2D must be a child or grandchild to a Navigation2D node. It only provides navigation data."); + if (!warning.empty()) { + warning += "\n\n"; + } + return warning + TTR("NavigationRegion2D must be a child or grandchild to a Navigation2D node. It only provides navigation data."); } void NavigationRegion2D::_bind_methods() { diff --git a/scene/2d/node_2d.cpp b/scene/2d/node_2d.cpp index 72250e96b3..42c2585487 100644 --- a/scene/2d/node_2d.cpp +++ b/scene/2d/node_2d.cpp @@ -30,7 +30,7 @@ #include "node_2d.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" #include "scene/gui/control.h" #include "scene/main/window.h" #include "servers/rendering_server.h" diff --git a/scene/2d/parallax_background.cpp b/scene/2d/parallax_background.cpp index 416622e6d5..8c9432f2fa 100644 --- a/scene/2d/parallax_background.cpp +++ b/scene/2d/parallax_background.cpp @@ -101,7 +101,7 @@ void ParallaxBackground::_update_scroll() { } if (ignore_camera_zoom) { - l->set_base_offset_and_scale(ofs, 1.0, screen_offset); + l->set_base_offset_and_scale((ofs + screen_offset * (scale - 1)) / scale, 1.0, screen_offset); } else { l->set_base_offset_and_scale(ofs, scale, screen_offset); } diff --git a/scene/2d/parallax_layer.cpp b/scene/2d/parallax_layer.cpp index 4ed335dec8..01aa5838b4 100644 --- a/scene/2d/parallax_layer.cpp +++ b/scene/2d/parallax_layer.cpp @@ -30,7 +30,7 @@ #include "parallax_layer.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "parallax_background.h" void ParallaxLayer::set_motion_scale(const Size2 &p_scale) { @@ -136,11 +136,16 @@ void ParallaxLayer::set_base_offset_and_scale(const Point2 &p_offset, float p_sc } String ParallaxLayer::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + if (!Object::cast_to<ParallaxBackground>(get_parent())) { - return TTR("ParallaxLayer node only works when set as child of a ParallaxBackground node."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("ParallaxLayer node only works when set as child of a ParallaxBackground node."); } - return String(); + return warning; } void ParallaxLayer::_bind_methods() { diff --git a/scene/2d/path_2d.cpp b/scene/2d/path_2d.cpp index f2f549e851..f40a993423 100644 --- a/scene/2d/path_2d.cpp +++ b/scene/2d/path_2d.cpp @@ -30,7 +30,7 @@ #include "path_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/geometry_2d.h" #include "scene/scene_string_names.h" @@ -170,7 +170,7 @@ void PathFollow2D::_update_transform() { } Vector2 pos = c->interpolate_baked(offset, cubic); - if (rotate) { + if (rotates) { float ahead = offset + lookahead; if (loop && ahead >= path_length) { @@ -254,11 +254,16 @@ String PathFollow2D::get_configuration_warning() const { return String(); } + String warning = Node2D::get_configuration_warning(); + if (!Object::cast_to<Path2D>(get_parent())) { - return TTR("PathFollow2D only works when set as a child of a Path2D node."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("PathFollow2D only works when set as a child of a Path2D node."); } - return String(); + return warning; } void PathFollow2D::_bind_methods() { @@ -274,7 +279,7 @@ void PathFollow2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_unit_offset", "unit_offset"), &PathFollow2D::set_unit_offset); ClassDB::bind_method(D_METHOD("get_unit_offset"), &PathFollow2D::get_unit_offset); - ClassDB::bind_method(D_METHOD("set_rotate", "enable"), &PathFollow2D::set_rotate); + ClassDB::bind_method(D_METHOD("set_rotates", "enable"), &PathFollow2D::set_rotates); ClassDB::bind_method(D_METHOD("is_rotating"), &PathFollow2D::is_rotating); ClassDB::bind_method(D_METHOD("set_cubic_interpolation", "enable"), &PathFollow2D::set_cubic_interpolation); @@ -290,7 +295,7 @@ void PathFollow2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "unit_offset", PROPERTY_HINT_RANGE, "0,1,0.0001,or_lesser,or_greater", PROPERTY_USAGE_EDITOR), "set_unit_offset", "get_unit_offset"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "h_offset"), "set_h_offset", "get_h_offset"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "v_offset"), "set_v_offset", "get_v_offset"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "rotate"), "set_rotate", "is_rotating"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "rotates"), "set_rotates", "is_rotating"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "cubic_interp"), "set_cubic_interpolation", "get_cubic_interpolation"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "loop"), "set_loop", "has_loop"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lookahead", PROPERTY_HINT_RANGE, "0.001,1024.0,0.001"), "set_lookahead", "get_lookahead"); @@ -366,13 +371,13 @@ float PathFollow2D::get_lookahead() const { return lookahead; } -void PathFollow2D::set_rotate(bool p_rotate) { - rotate = p_rotate; +void PathFollow2D::set_rotates(bool p_rotates) { + rotates = p_rotates; _update_transform(); } bool PathFollow2D::is_rotating() const { - return rotate; + return rotates; } void PathFollow2D::set_loop(bool p_loop) { @@ -388,7 +393,7 @@ PathFollow2D::PathFollow2D() { h_offset = 0; v_offset = 0; path = nullptr; - rotate = true; + rotates = true; cubic = true; loop = true; lookahead = 4; diff --git a/scene/2d/path_2d.h b/scene/2d/path_2d.h index 7fea75cd7c..fcb8b40125 100644 --- a/scene/2d/path_2d.h +++ b/scene/2d/path_2d.h @@ -70,7 +70,7 @@ private: real_t lookahead; bool cubic; bool loop; - bool rotate; + bool rotates; void _update_transform(); @@ -99,7 +99,7 @@ public: void set_loop(bool p_loop); bool has_loop() const; - void set_rotate(bool p_rotate); + void set_rotates(bool p_rotates); bool is_rotating() const; void set_cubic_interpolation(bool p_enable); diff --git a/scene/2d/physics_body_2d.cpp b/scene/2d/physics_body_2d.cpp index 0a9de20664..e314669fb0 100644 --- a/scene/2d/physics_body_2d.cpp +++ b/scene/2d/physics_body_2d.cpp @@ -30,27 +30,17 @@ #include "physics_body_2d.h" +#include "core/config/engine.h" #include "core/core_string_names.h" -#include "core/engine.h" -#include "core/list.h" #include "core/math/math_funcs.h" -#include "core/method_bind_ext.gen.inc" -#include "core/object.h" -#include "core/rid.h" +#include "core/object/class_db.h" +#include "core/templates/list.h" +#include "core/templates/rid.h" #include "scene/scene_string_names.h" void PhysicsBody2D::_notification(int p_what) { } -void PhysicsBody2D::_set_layers(uint32_t p_mask) { - set_collision_layer(p_mask); - set_collision_mask(p_mask); -} - -uint32_t PhysicsBody2D::_get_layers() const { - return get_collision_layer(); -} - void PhysicsBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody2D::set_collision_layer); ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody2D::get_collision_layer); @@ -63,13 +53,9 @@ void PhysicsBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody2D::set_collision_layer_bit); ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody2D::get_collision_layer_bit); - ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody2D::_set_layers); - ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody2D::_get_layers); - ClassDB::bind_method(D_METHOD("get_collision_exceptions"), &PhysicsBody2D::get_collision_exceptions); ClassDB::bind_method(D_METHOD("add_collision_exception_with", "body"), &PhysicsBody2D::add_collision_exception_with); ClassDB::bind_method(D_METHOD("remove_collision_exception_with", "body"), &PhysicsBody2D::remove_collision_exception_with); - ADD_PROPERTY(PropertyInfo(Variant::INT, "layers", PROPERTY_HINT_LAYERS_2D_PHYSICS, "", 0), "_set_layers", "_get_layers"); //for backwards compat ADD_GROUP("Collision", "collision_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_2D_PHYSICS), "set_collision_layer", "get_collision_layer"); @@ -474,8 +460,6 @@ RigidBody2D::Mode RigidBody2D::get_mode() const { void RigidBody2D::set_mass(real_t p_mass) { ERR_FAIL_COND(p_mass <= 0); mass = p_mass; - _change_notify("mass"); - _change_notify("weight"); PhysicsServer2D::get_singleton()->body_set_param(get_rid(), PhysicsServer2D::BODY_PARAM_MASS, mass); } @@ -492,14 +476,6 @@ real_t RigidBody2D::get_inertia() const { return PhysicsServer2D::get_singleton()->body_get_param(get_rid(), PhysicsServer2D::BODY_PARAM_INERTIA); } -void RigidBody2D::set_weight(real_t p_weight) { - set_mass(p_weight / (real_t(GLOBAL_DEF("physics/2d/default_gravity", 98)) / 10)); -} - -real_t RigidBody2D::get_weight() const { - return mass * (real_t(GLOBAL_DEF("physics/2d/default_gravity", 98)) / 10); -} - void RigidBody2D::set_physics_material_override(const Ref<PhysicsMaterial> &p_physics_material_override) { if (physics_material_override.is_valid()) { if (physics_material_override->is_connected(CoreStringNames::get_singleton()->changed, callable_mp(this, &RigidBody2D::_reload_physics_characteristics))) { @@ -748,7 +724,7 @@ String RigidBody2D::get_configuration_warning() const { String warning = CollisionObject2D::get_configuration_warning(); if ((get_mode() == MODE_RIGID || get_mode() == MODE_CHARACTER) && (ABS(t.elements[0].length() - 1.0) > 0.05 || ABS(t.elements[1].length() - 1.0) > 0.05)) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("Size changes to RigidBody2D (in character or rigid modes) will be overridden by the physics engine when running.\nChange the size in children collision shapes instead."); @@ -767,9 +743,6 @@ void RigidBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_inertia"), &RigidBody2D::get_inertia); ClassDB::bind_method(D_METHOD("set_inertia", "inertia"), &RigidBody2D::set_inertia); - ClassDB::bind_method(D_METHOD("set_weight", "weight"), &RigidBody2D::set_weight); - ClassDB::bind_method(D_METHOD("get_weight"), &RigidBody2D::get_weight); - ClassDB::bind_method(D_METHOD("set_physics_material_override", "physics_material_override"), &RigidBody2D::set_physics_material_override); ClassDB::bind_method(D_METHOD("get_physics_material_override"), &RigidBody2D::get_physics_material_override); @@ -832,7 +805,6 @@ void RigidBody2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "mode", PROPERTY_HINT_ENUM, "Rigid,Static,Character,Kinematic"), "set_mode", "get_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "mass", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01"), "set_mass", "get_mass"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "inertia", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01", 0), "set_inertia", "get_inertia"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "weight", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01", PROPERTY_USAGE_EDITOR), "set_weight", "get_weight"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "physics_material_override", PROPERTY_HINT_RESOURCE_TYPE, "PhysicsMaterial"), "set_physics_material_override", "get_physics_material_override"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_scale", PROPERTY_HINT_RANGE, "-128,128,0.01"), "set_gravity_scale", "get_gravity_scale"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "custom_integrator"), "set_use_custom_integrator", "is_using_custom_integrator"); diff --git a/scene/2d/physics_body_2d.h b/scene/2d/physics_body_2d.h index e83ab6557d..294b57eb13 100644 --- a/scene/2d/physics_body_2d.h +++ b/scene/2d/physics_body_2d.h @@ -31,7 +31,7 @@ #ifndef PHYSICS_BODY_2D_H #define PHYSICS_BODY_2D_H -#include "core/vset.h" +#include "core/templates/vset.h" #include "scene/2d/collision_object_2d.h" #include "scene/resources/physics_material.h" #include "servers/physics_server_2d.h" @@ -44,9 +44,6 @@ class PhysicsBody2D : public CollisionObject2D { uint32_t collision_layer; uint32_t collision_mask; - void _set_layers(uint32_t p_mask); - uint32_t _get_layers() const; - protected: void _notification(int p_what); PhysicsBody2D(PhysicsServer2D::BodyMode p_mode); @@ -195,9 +192,6 @@ public: void set_inertia(real_t p_inertia); real_t get_inertia() const; - void set_weight(real_t p_weight); - real_t get_weight() const; - void set_physics_material_override(const Ref<PhysicsMaterial> &p_physics_material_override); Ref<PhysicsMaterial> get_physics_material_override() const; diff --git a/scene/2d/polygon_2d.cpp b/scene/2d/polygon_2d.cpp index 13b62816a4..26340bb861 100644 --- a/scene/2d/polygon_2d.cpp +++ b/scene/2d/polygon_2d.cpp @@ -302,7 +302,7 @@ void Polygon2D::_notification(int p_what) { if (invert || polygons.size() == 0) { Vector<int> indices = Geometry2D::triangulate_polygon(points); if (indices.size()) { - RS::get_singleton()->canvas_item_add_triangle_array(get_canvas_item(), indices, points, colors, uvs, bones, weights, texture.is_valid() ? texture->get_rid() : RID(), -1, normal_map.is_valid() ? normal_map->get_rid() : RID(), specular_map.is_valid() ? specular_map->get_rid() : RID(), Color(specular_color.r, specular_color.g, specular_color.b, shininess)); + RS::get_singleton()->canvas_item_add_triangle_array(get_canvas_item(), indices, points, colors, uvs, bones, weights, texture.is_valid() ? texture->get_rid() : RID(), -1); } } else { //draw individual polygons @@ -417,42 +417,6 @@ Ref<Texture2D> Polygon2D::get_texture() const { return texture; } -void Polygon2D::set_normal_map(const Ref<Texture2D> &p_normal_map) { - normal_map = p_normal_map; - update(); -} - -Ref<Texture2D> Polygon2D::get_normal_map() const { - return normal_map; -} - -void Polygon2D::set_specular_map(const Ref<Texture2D> &p_specular_map) { - specular_map = p_specular_map; - update(); -} - -Ref<Texture2D> Polygon2D::get_specular_map() const { - return specular_map; -} - -void Polygon2D::set_specular_color(const Color &p_specular_color) { - specular_color = p_specular_color; - update(); -} - -Color Polygon2D::get_specular_color() const { - return specular_color; -} - -void Polygon2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float Polygon2D::get_shininess() const { - return shininess; -} - void Polygon2D::set_texture_offset(const Vector2 &p_offset) { tex_ofs = p_offset; update(); @@ -616,18 +580,6 @@ void Polygon2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &Polygon2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &Polygon2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &Polygon2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &Polygon2D::get_normal_map); - - ClassDB::bind_method(D_METHOD("set_specular_map", "specular_map"), &Polygon2D::set_specular_map); - ClassDB::bind_method(D_METHOD("get_specular_map"), &Polygon2D::get_specular_map); - - ClassDB::bind_method(D_METHOD("set_specular_color", "specular_color"), &Polygon2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &Polygon2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &Polygon2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &Polygon2D::get_shininess); - ClassDB::bind_method(D_METHOD("set_texture_offset", "texture_offset"), &Polygon2D::set_texture_offset); ClassDB::bind_method(D_METHOD("get_texture_offset"), &Polygon2D::get_texture_offset); @@ -680,11 +632,6 @@ void Polygon2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "texture_scale"), "set_texture_scale", "get_texture_scale"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_rotation_degrees", PROPERTY_HINT_RANGE, "-360,360,0.1,or_lesser,or_greater"), "set_texture_rotation_degrees", "get_texture_rotation_degrees"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_rotation", PROPERTY_HINT_NONE, "", 0), "set_texture_rotation", "get_texture_rotation"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_map", "get_specular_map"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Skeleton", ""); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "skeleton", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Skeleton2D"), "set_skeleton", "get_skeleton"); @@ -711,7 +658,4 @@ Polygon2D::Polygon2D() { color = Color(1, 1, 1); rect_cache_dirty = true; internal_vertices = 0; - - specular_color = Color(1, 1, 1, 1); - shininess = 1.0; } diff --git a/scene/2d/polygon_2d.h b/scene/2d/polygon_2d.h index c5ff05aace..e2a8db414a 100644 --- a/scene/2d/polygon_2d.h +++ b/scene/2d/polygon_2d.h @@ -51,10 +51,6 @@ class Polygon2D : public Node2D { Color color; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; - Ref<Texture2D> specular_map; - Color specular_color; - float shininess; Size2 tex_scale; Vector2 tex_ofs; @@ -115,18 +111,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> get_normal_map() const; - - void set_specular_map(const Ref<Texture2D> &p_specular_map); - Ref<Texture2D> get_specular_map() const; - - void set_specular_color(const Color &p_specular_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - void set_texture_offset(const Vector2 &p_offset); Vector2 get_texture_offset() const; diff --git a/scene/2d/position_2d.cpp b/scene/2d/position_2d.cpp index a94a9f7085..8e4165cf50 100644 --- a/scene/2d/position_2d.cpp +++ b/scene/2d/position_2d.cpp @@ -30,7 +30,7 @@ #include "position_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/resources/texture.h" const float DEFAULT_GIZMO_EXTENTS = 10.0; diff --git a/scene/2d/ray_cast_2d.cpp b/scene/2d/ray_cast_2d.cpp index a00db36077..e53f89c46d 100644 --- a/scene/2d/ray_cast_2d.cpp +++ b/scene/2d/ray_cast_2d.cpp @@ -31,7 +31,7 @@ #include "ray_cast_2d.h" #include "collision_object_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "physics_body_2d.h" #include "servers/physics_server_2d.h" diff --git a/scene/2d/remote_transform_2d.cpp b/scene/2d/remote_transform_2d.cpp index 3104436dbe..7655416ce2 100644 --- a/scene/2d/remote_transform_2d.cpp +++ b/scene/2d/remote_transform_2d.cpp @@ -186,11 +186,16 @@ void RemoteTransform2D::force_update_cache() { } String RemoteTransform2D::get_configuration_warning() const { + String warning = Node2D::get_configuration_warning(); + if (!has_node(remote_node) || !Object::cast_to<Node2D>(get_node(remote_node))) { - return TTR("Path property must point to a valid Node2D node to work."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("Path property must point to a valid Node2D node to work."); } - return String(); + return warning; } void RemoteTransform2D::_bind_methods() { diff --git a/scene/2d/skeleton_2d.cpp b/scene/2d/skeleton_2d.cpp index ea37c8dfe7..ea1d9f5930 100644 --- a/scene/2d/skeleton_2d.cpp +++ b/scene/2d/skeleton_2d.cpp @@ -136,7 +136,7 @@ int Bone2D::get_index_in_skeleton() const { String Bone2D::get_configuration_warning() const { String warning = Node2D::get_configuration_warning(); if (!skeleton) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } if (parent_bone) { @@ -147,7 +147,7 @@ String Bone2D::get_configuration_warning() const { } if (rest == Transform2D(0, 0, 0, 0, 0, 0)) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("This bone lacks a proper REST pose. Go to the Skeleton2D node and set one."); diff --git a/scene/2d/sprite_2d.cpp b/scene/2d/sprite_2d.cpp index d1be93e55d..a065565a0f 100644 --- a/scene/2d/sprite_2d.cpp +++ b/scene/2d/sprite_2d.cpp @@ -99,7 +99,8 @@ void Sprite2D::_get_rects(Rect2 &r_src_rect, Rect2 &r_dst_rect, bool &r_filter_c if (centered) { dest_offset -= frame_size / 2; } - if (Engine::get_singleton()->get_use_pixel_snap()) { + + if (get_viewport() && get_viewport()->is_snap_2d_transforms_to_pixel_enabled()) { dest_offset = dest_offset.floor(); } @@ -130,8 +131,8 @@ void Sprite2D::_notification(int p_what) { Rect2 src_rect, dst_rect; bool filter_clip; _get_rects(src_rect, dst_rect, filter_clip); - texture->draw_rect_region(ci, dst_rect, src_rect, Color(1, 1, 1), false, normal_map, specular, Color(specular_color.r, specular_color.g, specular_color.b, shininess), RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, filter_clip); + texture->draw_rect_region(ci, dst_rect, src_rect, Color(1, 1, 1), false, filter_clip); } break; } } @@ -157,42 +158,6 @@ void Sprite2D::set_texture(const Ref<Texture2D> &p_texture) { _change_notify("texture"); } -void Sprite2D::set_normal_map(const Ref<Texture2D> &p_texture) { - normal_map = p_texture; - update(); -} - -Ref<Texture2D> Sprite2D::get_normal_map() const { - return normal_map; -} - -void Sprite2D::set_specular_map(const Ref<Texture2D> &p_texture) { - specular = p_texture; - update(); -} - -Ref<Texture2D> Sprite2D::get_specular_map() const { - return specular; -} - -void Sprite2D::set_specular_color(const Color &p_color) { - specular_color = p_color; - update(); -} - -Color Sprite2D::get_specular_color() const { - return specular_color; -} - -void Sprite2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float Sprite2D::get_shininess() const { - return shininess; -} - Ref<Texture2D> Sprite2D::get_texture() const { return texture; } @@ -403,6 +368,10 @@ Rect2 Sprite2D::get_rect() const { ofs -= Size2(s) / 2; } + if (get_viewport() && get_viewport()->is_snap_2d_transforms_to_pixel_enabled()) { + ofs = ofs.floor(); + } + if (s == Size2(0, 0)) { s = Size2(1, 1); } @@ -434,18 +403,6 @@ void Sprite2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &Sprite2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &Sprite2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &Sprite2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &Sprite2D::get_normal_map); - - ClassDB::bind_method(D_METHOD("set_specular_map", "specular_map"), &Sprite2D::set_specular_map); - ClassDB::bind_method(D_METHOD("get_specular_map"), &Sprite2D::get_specular_map); - - ClassDB::bind_method(D_METHOD("set_specular_color", "specular_color"), &Sprite2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &Sprite2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &Sprite2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &Sprite2D::get_shininess); - ClassDB::bind_method(D_METHOD("set_centered", "centered"), &Sprite2D::set_centered); ClassDB::bind_method(D_METHOD("is_centered"), &Sprite2D::is_centered); @@ -487,11 +444,6 @@ void Sprite2D::_bind_methods() { ADD_SIGNAL(MethodInfo("texture_changed")); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_map", "get_specular_map"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Offset", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "centered"), "set_centered", "is_centered"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); @@ -515,8 +467,6 @@ Sprite2D::Sprite2D() { vflip = false; region = false; region_filter_clip = false; - shininess = 1.0; - specular_color = Color(1, 1, 1, 1); frame = 0; diff --git a/scene/2d/sprite_2d.h b/scene/2d/sprite_2d.h index f6b752575f..2875d333bb 100644 --- a/scene/2d/sprite_2d.h +++ b/scene/2d/sprite_2d.h @@ -38,8 +38,6 @@ class Sprite2D : public Node2D { GDCLASS(Sprite2D, Node2D); Ref<Texture2D> texture; - Ref<Texture2D> normal_map; - Ref<Texture2D> specular; Color specular_color; float shininess; @@ -87,18 +85,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_normal_map() const; - - void set_specular_map(const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_specular_map() const; - - void set_specular_color(const Color &p_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - void set_centered(bool p_center); bool is_centered() const; diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp index c2951559a4..bff191a2bf 100644 --- a/scene/2d/tile_map.cpp +++ b/scene/2d/tile_map.cpp @@ -32,7 +32,6 @@ #include "collision_object_2d.h" #include "core/io/marshalls.h" -#include "core/method_bind_ext.gen.inc" #include "core/os/os.h" #include "scene/2d/area_2d.h" #include "servers/navigation_server_2d.h" @@ -529,15 +528,14 @@ void TileMap::update_dirty_quadrants() { rect.position += tile_ofs; } - Ref<Texture2D> normal_map = tile_set->tile_get_normal_map(c.id); Color modulate = tile_set->tile_get_modulate(c.id); Color self_modulate = get_self_modulate(); modulate = Color(modulate.r * self_modulate.r, modulate.g * self_modulate.g, modulate.b * self_modulate.b, modulate.a * self_modulate.a); if (r == Rect2()) { - tex->draw_rect(canvas_item, rect, false, modulate, c.transpose, normal_map); + tex->draw_rect(canvas_item, rect, false, modulate, c.transpose); } else { - tex->draw_rect_region(canvas_item, rect, r, modulate, c.transpose, normal_map, Ref<Texture2D>(), Color(1, 1, 1, 1), RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, clip_uv); + tex->draw_rect_region(canvas_item, rect, r, modulate, c.transpose, clip_uv); } Vector<TileSet::ShapeData> shapes = tile_set->tile_get_shapes(c.id); diff --git a/scene/2d/tile_map.h b/scene/2d/tile_map.h index b9dd8f5405..22b615a379 100644 --- a/scene/2d/tile_map.h +++ b/scene/2d/tile_map.h @@ -31,8 +31,8 @@ #ifndef TILE_MAP_H #define TILE_MAP_H -#include "core/self_list.h" -#include "core/vset.h" +#include "core/templates/self_list.h" +#include "core/templates/vset.h" #include "scene/2d/navigation_2d.h" #include "scene/2d/node_2d.h" #include "scene/resources/tile_set.h" diff --git a/scene/2d/visibility_notifier_2d.cpp b/scene/2d/visibility_notifier_2d.cpp index 75154c7acb..e217f2a394 100644 --- a/scene/2d/visibility_notifier_2d.cpp +++ b/scene/2d/visibility_notifier_2d.cpp @@ -30,7 +30,7 @@ #include "visibility_notifier_2d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "gpu_particles_2d.h" #include "scene/2d/animated_sprite_2d.h" #include "scene/2d/physics_body_2d.h" @@ -313,12 +313,17 @@ void VisibilityEnabler2D::_node_removed(Node *p_node) { } String VisibilityEnabler2D::get_configuration_warning() const { + String warning = VisibilityNotifier2D::get_configuration_warning(); + #ifdef TOOLS_ENABLED if (is_inside_tree() && get_parent() && (get_parent()->get_filename() == String() && get_parent() != get_tree()->get_edited_scene_root())) { - return TTR("VisibilityEnabler2D works best when used with the edited scene root directly as parent."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("VisibilityEnabler2D works best when used with the edited scene root directly as parent."); } #endif - return String(); + return warning; } void VisibilityEnabler2D::_bind_methods() { diff --git a/scene/3d/area_3d.cpp b/scene/3d/area_3d.cpp index dc35f069c0..b1adb0e88e 100644 --- a/scene/3d/area_3d.cpp +++ b/scene/3d/area_3d.cpp @@ -180,26 +180,20 @@ void Area3D::_body_inout(int p_status, const RID &p_body, ObjectID p_instance, i E->get().shapes.erase(ShapePair(p_body_shape, p_area_shape)); } - bool eraseit = false; - + bool in_tree = E->get().in_tree; if (E->get().rc == 0) { + body_map.erase(E); if (node) { node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area3D::_body_enter_tree)); node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area3D::_body_exit_tree)); - if (E->get().in_tree) { + if (in_tree) { emit_signal(SceneStringNames::get_singleton()->body_exited, obj); } } - - eraseit = true; } - if (node && E->get().in_tree) { + if (node && in_tree) { emit_signal(SceneStringNames::get_singleton()->body_shape_exited, objid, obj, p_body_shape, p_area_shape); } - - if (eraseit) { - body_map.erase(E); - } } locked = false; @@ -366,26 +360,20 @@ void Area3D::_area_inout(int p_status, const RID &p_area, ObjectID p_instance, i E->get().shapes.erase(AreaShapePair(p_area_shape, p_self_shape)); } - bool eraseit = false; - + bool in_tree = E->get().in_tree; if (E->get().rc == 0) { + area_map.erase(E); if (node) { node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area3D::_area_enter_tree)); node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area3D::_area_exit_tree)); - if (E->get().in_tree) { + if (in_tree) { emit_signal(SceneStringNames::get_singleton()->area_exited, obj); } } - - eraseit = true; } - if (!node || E->get().in_tree) { + if (!node || in_tree) { emit_signal(SceneStringNames::get_singleton()->area_shape_exited, objid, obj, p_area_shape, p_self_shape); } - - if (eraseit) { - area_map.erase(E); - } } locked = false; @@ -517,11 +505,11 @@ bool Area3D::is_overriding_audio_bus() const { return audio_bus_override; } -void Area3D::set_audio_bus(const StringName &p_audio_bus) { +void Area3D::set_audio_bus_name(const StringName &p_audio_bus) { audio_bus = p_audio_bus; } -StringName Area3D::get_audio_bus() const { +StringName Area3D::get_audio_bus_name() const { for (int i = 0; i < AudioServer::get_singleton()->get_bus_count(); i++) { if (AudioServer::get_singleton()->get_bus_name(i) == audio_bus) { return audio_bus; @@ -637,8 +625,8 @@ void Area3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_audio_bus_override", "enable"), &Area3D::set_audio_bus_override); ClassDB::bind_method(D_METHOD("is_overriding_audio_bus"), &Area3D::is_overriding_audio_bus); - ClassDB::bind_method(D_METHOD("set_audio_bus", "name"), &Area3D::set_audio_bus); - ClassDB::bind_method(D_METHOD("get_audio_bus"), &Area3D::get_audio_bus); + ClassDB::bind_method(D_METHOD("set_audio_bus_name", "name"), &Area3D::set_audio_bus_name); + ClassDB::bind_method(D_METHOD("get_audio_bus_name"), &Area3D::get_audio_bus_name); ClassDB::bind_method(D_METHOD("set_use_reverb_bus", "enable"), &Area3D::set_use_reverb_bus); ClassDB::bind_method(D_METHOD("is_using_reverb_bus"), &Area3D::is_using_reverb_bus); @@ -677,7 +665,7 @@ void Area3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_mask", "get_collision_mask"); ADD_GROUP("Audio Bus", "audio_bus_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "audio_bus_override"), "set_audio_bus_override", "is_overriding_audio_bus"); - ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "audio_bus_name", PROPERTY_HINT_ENUM, ""), "set_audio_bus", "get_audio_bus"); + ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "audio_bus_name", PROPERTY_HINT_ENUM, ""), "set_audio_bus_name", "get_audio_bus_name"); ADD_GROUP("Reverb Bus", "reverb_bus_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "reverb_bus_enable"), "set_use_reverb_bus", "is_using_reverb_bus"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "reverb_bus_name", PROPERTY_HINT_ENUM, ""), "set_reverb_bus", "get_reverb_bus"); diff --git a/scene/3d/area_3d.h b/scene/3d/area_3d.h index 07d24f39a7..51f6317517 100644 --- a/scene/3d/area_3d.h +++ b/scene/3d/area_3d.h @@ -31,7 +31,7 @@ #ifndef AREA_3D_H #define AREA_3D_H -#include "core/vset.h" +#include "core/templates/vset.h" #include "scene/3d/collision_object_3d.h" class Area3D : public CollisionObject3D { @@ -190,8 +190,8 @@ public: void set_audio_bus_override(bool p_override); bool is_overriding_audio_bus() const; - void set_audio_bus(const StringName &p_audio_bus); - StringName get_audio_bus() const; + void set_audio_bus_name(const StringName &p_audio_bus); + StringName get_audio_bus_name() const; void set_use_reverb_bus(bool p_enable); bool is_using_reverb_bus() const; diff --git a/scene/3d/audio_stream_player_3d.cpp b/scene/3d/audio_stream_player_3d.cpp index 6e4db8f382..2907eb3c7e 100644 --- a/scene/3d/audio_stream_player_3d.cpp +++ b/scene/3d/audio_stream_player_3d.cpp @@ -30,7 +30,7 @@ #include "audio_stream_player_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/3d/area_3d.h" #include "scene/3d/camera_3d.h" #include "scene/3d/listener_3d.h" @@ -327,9 +327,6 @@ float AudioStreamPlayer3D::_get_attenuation_db(float p_distance) const { return att; } -void _update_sound() { -} - void AudioStreamPlayer3D::_notification(int p_what) { if (p_what == NOTIFICATION_ENTER_TREE) { velocity_tracker->reset(get_global_transform().origin); @@ -487,7 +484,7 @@ void AudioStreamPlayer3D::_notification(int p_what) { if (area) { if (area->is_overriding_audio_bus()) { //override audio bus - StringName bus_name = area->get_audio_bus(); + StringName bus_name = area->get_audio_bus_name(); output.bus_index = AudioServer::get_singleton()->thread_find_bus_index(bus_name); } diff --git a/scene/3d/baked_lightmap.cpp b/scene/3d/baked_lightmap.cpp index e867891ec0..38c9e96fbc 100644 --- a/scene/3d/baked_lightmap.cpp +++ b/scene/3d/baked_lightmap.cpp @@ -37,7 +37,7 @@ #include "core/os/dir_access.h" #include "core/os/file_access.h" #include "core/os/os.h" -#include "core/sort_array.h" +#include "core/templates/sort_array.h" #include "lightmap_probe.h" void BakedLightmapData::add_user(const NodePath &p_path, const Rect2 &p_uv_scale, int p_slice_index, int32_t p_sub_instance) { diff --git a/scene/3d/baked_lightmap.h b/scene/3d/baked_lightmap.h index bebb579252..8808569215 100644 --- a/scene/3d/baked_lightmap.h +++ b/scene/3d/baked_lightmap.h @@ -31,7 +31,7 @@ #ifndef BAKED_LIGHTMAP_H #define BAKED_LIGHTMAP_H -#include "core/local_vector.h" +#include "core/templates/local_vector.h" #include "scene/3d/light_3d.h" #include "scene/3d/lightmapper.h" #include "scene/3d/mesh_instance_3d.h" diff --git a/scene/3d/camera_3d.cpp b/scene/3d/camera_3d.cpp index ecbaca7bd1..178c5c8ff8 100644 --- a/scene/3d/camera_3d.cpp +++ b/scene/3d/camera_3d.cpp @@ -31,7 +31,7 @@ #include "camera_3d.h" #include "collision_object_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/camera_matrix.h" #include "scene/resources/material.h" #include "scene/resources/surface_tool.h" @@ -519,8 +519,8 @@ void Camera3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fov", PROPERTY_HINT_RANGE, "1,179,0.1"), "set_fov", "get_fov"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "size", PROPERTY_HINT_RANGE, "0.1,16384,0.01"), "set_size", "get_size"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "frustum_offset"), "set_frustum_offset", "get_frustum_offset"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "near", PROPERTY_HINT_EXP_RANGE, "0.01,8192,0.01,or_greater"), "set_znear", "get_znear"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "far", PROPERTY_HINT_EXP_RANGE, "0.1,8192,0.1,or_greater"), "set_zfar", "get_zfar"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "near", PROPERTY_HINT_EXP_RANGE, "0.001,10,0.001,or_greater"), "set_znear", "get_znear"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "far", PROPERTY_HINT_EXP_RANGE, "0.01,4000,0.01,or_greater"), "set_zfar", "get_zfar"); BIND_ENUM_CONSTANT(PROJECTION_PERSPECTIVE); BIND_ENUM_CONSTANT(PROJECTION_ORTHOGONAL); @@ -662,7 +662,7 @@ Camera3D::Camera3D() { viewport = nullptr; force_change = false; mode = PROJECTION_PERSPECTIVE; - set_perspective(75.0, 0.05, 100.0); + set_perspective(75.0, 0.05, 4000.0); keep_aspect = KEEP_HEIGHT; layers = 0xfffff; v_offset = 0; diff --git a/scene/3d/camera_3d.h b/scene/3d/camera_3d.h index 6a778d45a2..04cec92b14 100644 --- a/scene/3d/camera_3d.h +++ b/scene/3d/camera_3d.h @@ -42,7 +42,6 @@ class Camera3D : public Node3D { public: enum Projection { - PROJECTION_PERSPECTIVE, PROJECTION_ORTHOGONAL, PROJECTION_FRUSTUM @@ -103,7 +102,6 @@ protected: public: enum { - NOTIFICATION_BECAME_CURRENT = 50, NOTIFICATION_LOST_CURRENT = 51 }; diff --git a/scene/3d/collision_polygon_3d.cpp b/scene/3d/collision_polygon_3d.cpp index e2d11c740a..b8a4ab74ee 100644 --- a/scene/3d/collision_polygon_3d.cpp +++ b/scene/3d/collision_polygon_3d.cpp @@ -156,15 +156,23 @@ bool CollisionPolygon3D::is_disabled() const { } String CollisionPolygon3D::get_configuration_warning() const { + String warning = Node3D::get_configuration_warning(); + if (!Object::cast_to<CollisionObject3D>(get_parent())) { - return TTR("CollisionPolygon3D only serves to provide a collision shape to a CollisionObject3D derived node. Please only use it as a child of Area3D, StaticBody3D, RigidBody3D, KinematicBody3D, etc. to give them a shape."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("CollisionPolygon3D only serves to provide a collision shape to a CollisionObject3D derived node. Please only use it as a child of Area3D, StaticBody3D, RigidBody3D, KinematicBody3D, etc. to give them a shape."); } if (polygon.empty()) { - return TTR("An empty CollisionPolygon3D has no effect on collision."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("An empty CollisionPolygon3D has no effect on collision."); } - return String(); + return warning; } bool CollisionPolygon3D::_is_editable_3d_polygon() const { diff --git a/scene/3d/collision_shape_3d.cpp b/scene/3d/collision_shape_3d.cpp index e7f3f53ca9..e1c691b89a 100644 --- a/scene/3d/collision_shape_3d.cpp +++ b/scene/3d/collision_shape_3d.cpp @@ -124,23 +124,33 @@ void CollisionShape3D::resource_changed(RES res) { } String CollisionShape3D::get_configuration_warning() const { + String warning = Node3D::get_configuration_warning(); + if (!Object::cast_to<CollisionObject3D>(get_parent())) { - return TTR("CollisionShape3D only serves to provide a collision shape to a CollisionObject3D derived node. Please only use it as a child of Area3D, StaticBody3D, RigidBody3D, KinematicBody3D, etc. to give them a shape."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("CollisionShape3D only serves to provide a collision shape to a CollisionObject3D derived node. Please only use it as a child of Area3D, StaticBody3D, RigidBody3D, KinematicBody3D, etc. to give them a shape."); } if (!shape.is_valid()) { - return TTR("A shape must be provided for CollisionShape3D to function. Please create a shape resource for it."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A shape must be provided for CollisionShape3D to function. Please create a shape resource for it."); } - if (Object::cast_to<RigidBody3D>(get_parent())) { - if (Object::cast_to<ConcavePolygonShape3D>(*shape)) { - if (Object::cast_to<RigidBody3D>(get_parent())->get_mode() != RigidBody3D::MODE_STATIC) { - return TTR("ConcavePolygonShape3D doesn't support RigidBody3D in another mode than static."); - } + if (shape.is_valid() && + Object::cast_to<RigidBody3D>(get_parent()) && + Object::cast_to<ConcavePolygonShape3D>(*shape) && + Object::cast_to<RigidBody3D>(get_parent())->get_mode() != RigidBody3D::MODE_STATIC) { + if (!warning.empty()) { + warning += "\n\n"; } + warning += TTR("ConcavePolygonShape3D doesn't support RigidBody3D in another mode than static."); } - return String(); + return warning; } void CollisionShape3D::_bind_methods() { diff --git a/scene/3d/cpu_particles_3d.cpp b/scene/3d/cpu_particles_3d.cpp index ad8760251f..215d9e062c 100644 --- a/scene/3d/cpu_particles_3d.cpp +++ b/scene/3d/cpu_particles_3d.cpp @@ -39,7 +39,7 @@ AABB CPUParticles3D::get_aabb() const { return AABB(); } -Vector<Face3> CPUParticles3D::get_faces(uint32_t p_usage_flags) const { +Vector<Face3> CPUParticles3D::get_faces(uint32_t p_usage_particle_flags) const { return Vector<Face3>(); } @@ -189,7 +189,7 @@ bool CPUParticles3D::get_fractional_delta() const { } String CPUParticles3D::get_configuration_warning() const { - String warnings; + String warnings = GeometryInstance3D::get_configuration_warning(); bool mesh_found = false; bool anim_material_found = false; @@ -368,17 +368,17 @@ Ref<Gradient> CPUParticles3D::get_color_ramp() const { return color_ramp; } -void CPUParticles3D::set_particle_flag(Flags p_flag, bool p_enable) { - ERR_FAIL_INDEX(p_flag, FLAG_MAX); - flags[p_flag] = p_enable; - if (p_flag == FLAG_DISABLE_Z) { +void CPUParticles3D::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { + ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); + particle_flags[p_particle_flag] = p_enable; + if (p_particle_flag == PARTICLE_FLAG_DISABLE_Z) { _change_notify(); } } -bool CPUParticles3D::get_particle_flag(Flags p_flag) const { - ERR_FAIL_INDEX_V(p_flag, FLAG_MAX, false); - return flags[p_flag]; +bool CPUParticles3D::get_particle_flag(ParticleFlags p_particle_flag) const { + ERR_FAIL_INDEX_V(p_particle_flag, PARTICLE_FLAG_MAX, false); + return particle_flags[p_particle_flag]; } void CPUParticles3D::set_emission_shape(EmissionShape p_shape) { @@ -459,7 +459,7 @@ void CPUParticles3D::_validate_property(PropertyInfo &property) const { property.usage = 0; } - if (property.name.begins_with("orbit_") && !flags[FLAG_DISABLE_Z]) { + if (property.name.begins_with("orbit_") && !particle_flags[PARTICLE_FLAG_DISABLE_Z]) { property.usage = 0; } } @@ -675,7 +675,7 @@ void CPUParticles3D::_particles_process(float p_delta) { p.hue_rot_rand = Math::randf(); p.anim_offset_rand = Math::randf(); - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { float angle1_rad = Math::atan2(direction.y, direction.x) + (Math::randf() * 2.0 - 1.0) * Math_PI * spread / 180.0; Vector3 rot = Vector3(Math::cos(angle1_rad), Math::sin(angle1_rad), 0.0); p.velocity = rot * parameters[PARAM_INITIAL_LINEAR_VELOCITY] * Math::lerp(1.0f, float(Math::randf()), randomness[PARAM_INITIAL_LINEAR_VELOCITY]); @@ -725,7 +725,7 @@ void CPUParticles3D::_particles_process(float p_delta) { p.transform.origin = emission_points.get(random_idx); if (emission_shape == EMISSION_SHAPE_DIRECTED_POINTS && emission_normals.size() == pc) { - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { Vector3 normal = emission_normals.get(random_idx); Vector2 normal_2d(normal.x, normal.y); Transform2D m2; @@ -762,7 +762,7 @@ void CPUParticles3D::_particles_process(float p_delta) { p.transform = emission_xform * p.transform; } - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { p.velocity.z = 0.0; p.transform.origin.z = 0.0; } @@ -783,7 +783,7 @@ void CPUParticles3D::_particles_process(float p_delta) { } float tex_orbit_velocity = 0.0; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { if (curve_parameters[PARAM_ORBIT_VELOCITY].is_valid()) { tex_orbit_velocity = curve_parameters[PARAM_ORBIT_VELOCITY]->interpolate(p.custom[1]); } @@ -830,7 +830,7 @@ void CPUParticles3D::_particles_process(float p_delta) { Vector3 force = gravity; Vector3 position = p.transform.origin; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { position.z = 0.0; } //apply linear acceleration @@ -840,7 +840,7 @@ void CPUParticles3D::_particles_process(float p_delta) { Vector3 diff = position - org; force += diff.length() > 0.0 ? diff.normalized() * (parameters[PARAM_RADIAL_ACCEL] + tex_radial_accel) * Math::lerp(1.0f, rand_from_seed(alt_seed), randomness[PARAM_RADIAL_ACCEL]) : Vector3(); //apply tangential acceleration; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { Vector2 yx = Vector2(diff.y, diff.x); Vector2 yx2 = (yx * Vector2(-1.0, 1.0)).normalized(); force += yx.length() > 0.0 ? Vector3(yx2.x, yx2.y, 0.0) * ((parameters[PARAM_TANGENTIAL_ACCEL] + tex_tangential_accel) * Math::lerp(1.0f, rand_from_seed(alt_seed), randomness[PARAM_TANGENTIAL_ACCEL])) : Vector3(); @@ -852,7 +852,7 @@ void CPUParticles3D::_particles_process(float p_delta) { //apply attractor forces p.velocity += force * local_delta; //orbit velocity - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { float orbit_amount = (parameters[PARAM_ORBIT_VELOCITY] + tex_orbit_velocity) * Math::lerp(1.0f, rand_from_seed(alt_seed), randomness[PARAM_ORBIT_VELOCITY]); if (orbit_amount != 0.0) { float ang = orbit_amount * local_delta * Math_PI * 2.0; @@ -923,8 +923,8 @@ void CPUParticles3D::_particles_process(float p_delta) { p.color *= p.base_color; - if (flags[FLAG_DISABLE_Z]) { - if (flags[FLAG_ALIGN_Y_TO_VELOCITY]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { if (p.velocity.length() > 0.0) { p.transform.basis.set_axis(1, p.velocity.normalized()); } else { @@ -941,7 +941,7 @@ void CPUParticles3D::_particles_process(float p_delta) { } else { //orient particle Y towards velocity - if (flags[FLAG_ALIGN_Y_TO_VELOCITY]) { + if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { if (p.velocity.length() > 0.0) { p.transform.basis.set_axis(1, p.velocity.normalized()); } else { @@ -959,7 +959,7 @@ void CPUParticles3D::_particles_process(float p_delta) { } //turn particle by rotation in Y - if (flags[FLAG_ROTATE_Y]) { + if (particle_flags[PARTICLE_FLAG_ROTATE_Y]) { Basis rot_y(Vector3(0, 1, 0), p.custom[0]); p.transform.basis = p.transform.basis * rot_y; } @@ -973,7 +973,7 @@ void CPUParticles3D::_particles_process(float p_delta) { p.transform.basis.scale(Vector3(1, 1, 1) * base_scale); - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { p.velocity.z = 0.0; p.transform.origin.z = 0.0; } @@ -1199,9 +1199,9 @@ void CPUParticles3D::convert_from_particles(Node *p_particles) { set_color_ramp(gt->get_gradient()); } - set_particle_flag(FLAG_ALIGN_Y_TO_VELOCITY, material->get_flag(ParticlesMaterial::FLAG_ALIGN_Y_TO_VELOCITY)); - set_particle_flag(FLAG_ROTATE_Y, material->get_flag(ParticlesMaterial::FLAG_ROTATE_Y)); - set_particle_flag(FLAG_DISABLE_Z, material->get_flag(ParticlesMaterial::FLAG_DISABLE_Z)); + set_particle_flag(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY)); + set_particle_flag(PARTICLE_FLAG_ROTATE_Y, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ROTATE_Y)); + set_particle_flag(PARTICLE_FLAG_DISABLE_Z, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_DISABLE_Z)); set_emission_shape(EmissionShape(material->get_emission_shape())); set_emission_sphere_radius(material->get_emission_sphere_radius()); @@ -1318,8 +1318,8 @@ void CPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &CPUParticles3D::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &CPUParticles3D::get_color_ramp); - ClassDB::bind_method(D_METHOD("set_particle_flag", "flag", "enable"), &CPUParticles3D::set_particle_flag); - ClassDB::bind_method(D_METHOD("get_particle_flag", "flag"), &CPUParticles3D::get_particle_flag); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &CPUParticles3D::set_particle_flag); + ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &CPUParticles3D::get_particle_flag); ClassDB::bind_method(D_METHOD("set_emission_shape", "shape"), &CPUParticles3D::set_emission_shape); ClassDB::bind_method(D_METHOD("get_emission_shape"), &CPUParticles3D::get_emission_shape); @@ -1345,16 +1345,16 @@ void CPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("convert_from_particles", "particles"), &CPUParticles3D::convert_from_particles); ADD_GROUP("Emission Shape", "emission_"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "emission_shape", PROPERTY_HINT_ENUM, "Point,Sphere,Box,Points,Directed Points"), "set_emission_shape", "get_emission_shape"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "emission_shape", PROPERTY_HINT_ENUM, "Point,Sphere,Box,Points,Directed Points", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_emission_shape", "get_emission_shape"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "emission_sphere_radius", PROPERTY_HINT_RANGE, "0.01,128,0.01"), "set_emission_sphere_radius", "get_emission_sphere_radius"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "emission_box_extents"), "set_emission_box_extents", "get_emission_box_extents"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "emission_points"), "set_emission_points", "get_emission_points"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "emission_normals"), "set_emission_normals", "get_emission_normals"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "emission_colors"), "set_emission_colors", "get_emission_colors"); - ADD_GROUP("Flags", "flag_"); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_align_y"), "set_particle_flag", "get_particle_flag", FLAG_ALIGN_Y_TO_VELOCITY); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_rotate_y"), "set_particle_flag", "get_particle_flag", FLAG_ROTATE_Y); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_disable_z"), "set_particle_flag", "get_particle_flag", FLAG_DISABLE_Z); + ADD_GROUP("Particle Flags", "particle_flag_"); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_align_y"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_rotate_y"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_ROTATE_Y); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_disable_z"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_DISABLE_Z); ADD_GROUP("Direction", ""); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "direction"), "set_direction", "get_direction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "spread", PROPERTY_HINT_RANGE, "0,180,0.01"), "set_spread", "get_spread"); @@ -1426,10 +1426,10 @@ void CPUParticles3D::_bind_methods() { BIND_ENUM_CONSTANT(PARAM_ANIM_OFFSET); BIND_ENUM_CONSTANT(PARAM_MAX); - BIND_ENUM_CONSTANT(FLAG_ALIGN_Y_TO_VELOCITY); - BIND_ENUM_CONSTANT(FLAG_ROTATE_Y); - BIND_ENUM_CONSTANT(FLAG_DISABLE_Z); - BIND_ENUM_CONSTANT(FLAG_MAX); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ROTATE_Y); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_DISABLE_Z); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_MAX); BIND_ENUM_CONSTANT(EMISSION_SHAPE_POINT); BIND_ENUM_CONSTANT(EMISSION_SHAPE_SPHERE); @@ -1493,8 +1493,8 @@ CPUParticles3D::CPUParticles3D() { set_param_randomness(Parameter(i), 0); } - for (int i = 0; i < FLAG_MAX; i++) { - flags[i] = false; + for (int i = 0; i < PARTICLE_FLAG_MAX; i++) { + particle_flags[i] = false; } can_update = false; diff --git a/scene/3d/cpu_particles_3d.h b/scene/3d/cpu_particles_3d.h index f44d0dfcfa..8c1b8a684c 100644 --- a/scene/3d/cpu_particles_3d.h +++ b/scene/3d/cpu_particles_3d.h @@ -31,7 +31,7 @@ #ifndef CPU_PARTICLES_H #define CPU_PARTICLES_H -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/3d/visual_instance_3d.h" class CPUParticles3D : public GeometryInstance3D { @@ -46,7 +46,6 @@ public: }; enum Parameter { - PARAM_INITIAL_LINEAR_VELOCITY, PARAM_ANGULAR_VELOCITY, PARAM_ORBIT_VELOCITY, @@ -62,11 +61,11 @@ public: PARAM_MAX }; - enum Flags { - FLAG_ALIGN_Y_TO_VELOCITY, - FLAG_ROTATE_Y, - FLAG_DISABLE_Z, - FLAG_MAX + enum ParticleFlags { + PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, + PARTICLE_FLAG_ROTATE_Y, + PARTICLE_FLAG_DISABLE_Z, + PARTICLE_FLAG_MAX }; enum EmissionShape { @@ -161,7 +160,7 @@ private: Color color; Ref<Gradient> color_ramp; - bool flags[FLAG_MAX]; + bool particle_flags[PARTICLE_FLAG_MAX]; EmissionShape emission_shape; float emission_sphere_radius; @@ -257,8 +256,8 @@ public: void set_color_ramp(const Ref<Gradient> &p_ramp); Ref<Gradient> get_color_ramp() const; - void set_particle_flag(Flags p_flag, bool p_enable); - bool get_particle_flag(Flags p_flag) const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); + bool get_particle_flag(ParticleFlags p_particle_flag) const; void set_emission_shape(EmissionShape p_shape); void set_emission_sphere_radius(float p_radius); @@ -291,7 +290,7 @@ public: VARIANT_ENUM_CAST(CPUParticles3D::DrawOrder) VARIANT_ENUM_CAST(CPUParticles3D::Parameter) -VARIANT_ENUM_CAST(CPUParticles3D::Flags) +VARIANT_ENUM_CAST(CPUParticles3D::ParticleFlags) VARIANT_ENUM_CAST(CPUParticles3D::EmissionShape) #endif // CPU_PARTICLES_H diff --git a/scene/3d/gi_probe.cpp b/scene/3d/gi_probe.cpp index 1b6f9b45b9..fd592012f8 100644 --- a/scene/3d/gi_probe.cpp +++ b/scene/3d/gi_probe.cpp @@ -32,7 +32,6 @@ #include "core/os/os.h" -#include "core/method_bind_ext.gen.inc" #include "mesh_instance_3d.h" #include "voxelizer.h" @@ -514,10 +513,15 @@ Vector<Face3> GIProbe::get_faces(uint32_t p_usage_flags) const { } String GIProbe::get_configuration_warning() const { + String warning = VisualInstance3D::get_configuration_warning(); + if (RenderingServer::get_singleton()->is_low_end()) { - return TTR("GIProbes are not supported by the GLES2 video driver.\nUse a BakedLightmap instead."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("GIProbes are not supported by the GLES2 video driver.\nUse a BakedLightmap instead."); } - return String(); + return warning; } void GIProbe::_bind_methods() { diff --git a/scene/3d/gpu_particles_3d.cpp b/scene/3d/gpu_particles_3d.cpp index 6fa0fc6ecb..ec33d7bcab 100644 --- a/scene/3d/gpu_particles_3d.cpp +++ b/scene/3d/gpu_particles_3d.cpp @@ -124,6 +124,11 @@ void GPUParticles3D::set_speed_scale(float p_scale) { RS::get_singleton()->particles_set_speed_scale(particles, p_scale); } +void GPUParticles3D::set_collision_base_size(float p_size) { + collision_base_size = p_size; + RS::get_singleton()->particles_set_collision_base_size(particles, p_size); +} + bool GPUParticles3D::is_emitting() const { return RS::get_singleton()->particles_get_emitting(particles); } @@ -168,6 +173,10 @@ float GPUParticles3D::get_speed_scale() const { return speed_scale; } +float GPUParticles3D::get_collision_base_size() const { + return collision_base_size; +} + void GPUParticles3D::set_draw_order(DrawOrder p_order) { draw_order = p_order; RS::get_singleton()->particles_set_draw_order(particles, RS::ParticlesDrawOrder(p_order)); @@ -232,7 +241,7 @@ String GPUParticles3D::get_configuration_warning() const { return TTR("GPU-based particles are not supported by the GLES2 video driver.\nUse the CPUParticles3D node instead. You can use the \"Convert to CPUParticles3D\" option for this purpose."); } - String warnings; + String warnings = GeometryInstance3D::get_configuration_warning(); bool meshes_found = false; bool anim_material_found = false; @@ -381,6 +390,7 @@ void GPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_fractional_delta", "enable"), &GPUParticles3D::set_fractional_delta); ClassDB::bind_method(D_METHOD("set_process_material", "material"), &GPUParticles3D::set_process_material); ClassDB::bind_method(D_METHOD("set_speed_scale", "scale"), &GPUParticles3D::set_speed_scale); + ClassDB::bind_method(D_METHOD("set_collision_base_size", "size"), &GPUParticles3D::set_collision_base_size); ClassDB::bind_method(D_METHOD("is_emitting"), &GPUParticles3D::is_emitting); ClassDB::bind_method(D_METHOD("get_amount"), &GPUParticles3D::get_amount); @@ -395,6 +405,7 @@ void GPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_fractional_delta"), &GPUParticles3D::get_fractional_delta); ClassDB::bind_method(D_METHOD("get_process_material"), &GPUParticles3D::get_process_material); ClassDB::bind_method(D_METHOD("get_speed_scale"), &GPUParticles3D::get_speed_scale); + ClassDB::bind_method(D_METHOD("get_collision_base_size"), &GPUParticles3D::get_collision_base_size); ClassDB::bind_method(D_METHOD("set_draw_order", "order"), &GPUParticles3D::set_draw_order); @@ -426,6 +437,8 @@ void GPUParticles3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_randomness_ratio", "get_randomness_ratio"); ADD_PROPERTY(PropertyInfo(Variant::INT, "fixed_fps", PROPERTY_HINT_RANGE, "0,1000,1"), "set_fixed_fps", "get_fixed_fps"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fract_delta"), "set_fractional_delta", "get_fractional_delta"); + ADD_GROUP("Collision", "collision_"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_base_size", PROPERTY_HINT_RANGE, "0,128,0.01,or_greater"), "set_collision_base_size", "get_collision_base_size"); ADD_GROUP("Drawing", ""); ADD_PROPERTY(PropertyInfo(Variant::AABB, "visibility_aabb"), "set_visibility_aabb", "get_visibility_aabb"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "local_coords"), "set_use_local_coordinates", "get_use_local_coordinates"); @@ -469,6 +482,7 @@ GPUParticles3D::GPUParticles3D() { set_draw_passes(1); set_draw_order(DRAW_ORDER_INDEX); set_speed_scale(1); + set_collision_base_size(0.01); } GPUParticles3D::~GPUParticles3D() { diff --git a/scene/3d/gpu_particles_3d.h b/scene/3d/gpu_particles_3d.h index 0d8dadd31d..f0e5f05e5b 100644 --- a/scene/3d/gpu_particles_3d.h +++ b/scene/3d/gpu_particles_3d.h @@ -31,7 +31,7 @@ #ifndef PARTICLES_H #define PARTICLES_H -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/3d/visual_instance_3d.h" #include "scene/resources/material.h" @@ -65,6 +65,7 @@ private: int fixed_fps; bool fractional_delta; NodePath sub_emitter; + float collision_base_size; Ref<Material> process_material; @@ -94,6 +95,7 @@ public: void set_use_local_coordinates(bool p_enable); void set_process_material(const Ref<Material> &p_material); void set_speed_scale(float p_scale); + void set_collision_base_size(float p_ratio); bool is_emitting() const; int get_amount() const; @@ -106,6 +108,7 @@ public: bool get_use_local_coordinates() const; Ref<Material> get_process_material() const; float get_speed_scale() const; + float get_collision_base_size() const; void set_fixed_fps(int p_count); int get_fixed_fps() const; diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp new file mode 100644 index 0000000000..1f0d5d587d --- /dev/null +++ b/scene/3d/gpu_particles_collision_3d.cpp @@ -0,0 +1,901 @@ +/*************************************************************************/ +/* gpu_particles_collision_3d.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "gpu_particles_collision_3d.h" + +#include "core/templates/thread_work_pool.h" +#include "mesh_instance_3d.h" +#include "scene/3d/camera_3d.h" +#include "scene/main/viewport.h" + +void GPUParticlesCollision3D::set_cull_mask(uint32_t p_cull_mask) { + cull_mask = p_cull_mask; + RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask); +} + +uint32_t GPUParticlesCollision3D::get_cull_mask() const { + return cull_mask; +} + +void GPUParticlesCollision3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesCollision3D::set_cull_mask); + ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesCollision3D::get_cull_mask); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask"); +} + +GPUParticlesCollision3D::GPUParticlesCollision3D(RS::ParticlesCollisionType p_type) { + collision = RS::get_singleton()->particles_collision_create(); + RS::get_singleton()->particles_collision_set_collision_type(collision, p_type); + set_base(collision); +} + +GPUParticlesCollision3D::~GPUParticlesCollision3D() { + RS::get_singleton()->free(collision); +} + +///////////////////////////////// + +void GPUParticlesCollisionSphere::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesCollisionSphere::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesCollisionSphere::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); +} + +void GPUParticlesCollisionSphere::set_radius(float p_radius) { + radius = p_radius; + RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); + update_gizmo(); +} + +float GPUParticlesCollisionSphere::get_radius() const { + return radius; +} + +AABB GPUParticlesCollisionSphere::get_aabb() const { + return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); +} + +GPUParticlesCollisionSphere::GPUParticlesCollisionSphere() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE) { +} + +GPUParticlesCollisionSphere::~GPUParticlesCollisionSphere() { +} + +/////////////////////////// + +void GPUParticlesCollisionBox::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionBox::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionBox::get_extents); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); +} + +void GPUParticlesCollisionBox::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesCollisionBox::get_extents() const { + return extents; +} + +AABB GPUParticlesCollisionBox::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionBox::GPUParticlesCollisionBox() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE) { +} + +GPUParticlesCollisionBox::~GPUParticlesCollisionBox() { +} + +/////////////////////////////// +/////////////////////////// + +void GPUParticlesCollisionSDF::_find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes) { + MeshInstance3D *mi = Object::cast_to<MeshInstance3D>(p_at_node); + if (mi && mi->is_visible_in_tree()) { + Ref<Mesh> mesh = mi->get_mesh(); + if (mesh.is_valid()) { + AABB aabb = mesh->get_aabb(); + + Transform xf = get_global_transform().affine_inverse() * mi->get_global_transform(); + + if (p_aabb.intersects(xf.xform(aabb))) { + PlotMesh pm; + pm.local_xform = xf; + pm.mesh = mesh; + plot_meshes.push_back(pm); + } + } + } + + Node3D *s = Object::cast_to<Node3D>(p_at_node); + if (s) { + if (s->is_visible_in_tree()) { + Array meshes = p_at_node->call("get_meshes"); + for (int i = 0; i < meshes.size(); i += 2) { + Transform mxf = meshes[i]; + Ref<Mesh> mesh = meshes[i + 1]; + if (!mesh.is_valid()) { + continue; + } + + AABB aabb = mesh->get_aabb(); + + Transform xf = get_global_transform().affine_inverse() * (s->get_global_transform() * mxf); + + if (p_aabb.intersects(xf.xform(aabb))) { + PlotMesh pm; + pm.local_xform = xf; + pm.mesh = mesh; + plot_meshes.push_back(pm); + } + } + } + } + + for (int i = 0; i < p_at_node->get_child_count(); i++) { + Node *child = p_at_node->get_child(i); + _find_meshes(p_aabb, child, plot_meshes); + } +} + +uint32_t GPUParticlesCollisionSDF::_create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness) { + if (p_face_count == 1) { + return BVH::LEAF_BIT | p_faces[0].index; + } + + uint32_t index = bvh_tree.size(); + { + BVH bvh; + + for (uint32_t i = 0; i < p_face_count; i++) { + const Face3 &f = p_triangles[p_faces[i].index]; + AABB aabb(f.vertex[0], Vector3()); + aabb.expand_to(f.vertex[1]); + aabb.expand_to(f.vertex[2]); + if (p_thickness > 0.0) { + Vector3 normal = p_triangles[p_faces[i].index].get_plane().normal; + aabb.expand_to(f.vertex[0] - normal * p_thickness); + aabb.expand_to(f.vertex[1] - normal * p_thickness); + aabb.expand_to(f.vertex[2] - normal * p_thickness); + } + if (i == 0) { + bvh.bounds = aabb; + } else { + bvh.bounds.merge_with(aabb); + } + } + bvh_tree.push_back(bvh); + } + + uint32_t middle = p_face_count / 2; + + SortArray<FacePos, FaceSort> s; + s.compare.axis = bvh_tree[index].bounds.get_longest_axis_index(); + s.sort(p_faces, p_face_count); + + uint32_t left = _create_bvh(bvh_tree, p_faces, middle, p_triangles, p_thickness); + uint32_t right = _create_bvh(bvh_tree, p_faces + middle, p_face_count - middle, p_triangles, p_thickness); + + bvh_tree[index].children[0] = left; + bvh_tree[index].children[1] = right; + + return index; +} + +static _FORCE_INLINE_ float Vector3_dot2(const Vector3 &p_vec3) { + return p_vec3.dot(p_vec3); +} + +void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance) { + if (p_bvh_cell & BVH::LEAF_BIT) { + p_bvh_cell &= BVH::LEAF_MASK; //remove bit + + Vector3 point = p_pos; + Plane p = triangles[p_bvh_cell].get_plane(); + float d = p.distance_to(point); + float inside_d = 1e20; + if (d < 0 && d > -thickness) { + //inside planes, do this in 2D + + Vector3 x_axis = (triangles[p_bvh_cell].vertex[0] - triangles[p_bvh_cell].vertex[1]).normalized(); + Vector3 y_axis = p.normal.cross(x_axis).normalized(); + + Vector2 points[3]; + for (int i = 0; i < 3; i++) { + points[i] = Vector2(x_axis.dot(triangles[p_bvh_cell].vertex[i]), y_axis.dot(triangles[p_bvh_cell].vertex[i])); + } + + Vector2 p2d = Vector2(x_axis.dot(point), y_axis.dot(point)); + + { + // https://www.shadertoy.com/view/XsXSz4 + + Vector2 e0 = points[1] - points[0]; + Vector2 e1 = points[2] - points[1]; + Vector2 e2 = points[0] - points[2]; + + Vector2 v0 = p2d - points[0]; + Vector2 v1 = p2d - points[1]; + Vector2 v2 = p2d - points[2]; + + Vector2 pq0 = v0 - e0 * CLAMP(v0.dot(e0) / e0.dot(e0), 0.0, 1.0); + Vector2 pq1 = v1 - e1 * CLAMP(v1.dot(e1) / e1.dot(e1), 0.0, 1.0); + Vector2 pq2 = v2 - e2 * CLAMP(v2.dot(e2) / e2.dot(e2), 0.0, 1.0); + + float s = SGN(e0.x * e2.y - e0.y * e2.x); + Vector2 d2 = Vector2(pq0.dot(pq0), s * (v0.x * e0.y - v0.y * e0.x)).min(Vector2(pq1.dot(pq1), s * (v1.x * e1.y - v1.y * e1.x))).min(Vector2(pq2.dot(pq2), s * (v2.x * e2.y - v2.y * e2.x))); + + inside_d = -Math::sqrt(d2.x) * SGN(d2.y); + } + + //make sure distance to planes is not shorter if inside + if (inside_d < 0) { + inside_d = MAX(inside_d, d); + inside_d = MAX(inside_d, -(thickness + d)); + } + + closest_distance = MIN(closest_distance, inside_d); + } else { + if (d < 0) { + point -= p.normal * thickness; //flatten + } + + // https://iquilezles.org/www/articles/distfunctions/distfunctions.htm + Vector3 a = triangles[p_bvh_cell].vertex[0]; + Vector3 b = triangles[p_bvh_cell].vertex[1]; + Vector3 c = triangles[p_bvh_cell].vertex[2]; + + Vector3 ba = b - a; + Vector3 pa = point - a; + Vector3 cb = c - b; + Vector3 pb = point - b; + Vector3 ac = a - c; + Vector3 pc = point - c; + Vector3 nor = ba.cross(ac); + + inside_d = Math::sqrt( + (SGN(ba.cross(nor).dot(pa)) + + SGN(cb.cross(nor).dot(pb)) + + SGN(ac.cross(nor).dot(pc)) < + 2.0) ? + MIN(MIN( + Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa), + Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)), + Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) : + nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor)); + + closest_distance = MIN(closest_distance, inside_d); + } + + } else { + bool pass = true; + if (!bvh[p_bvh_cell].bounds.has_point(p_pos)) { + //outside, find closest point + Vector3 he = bvh[p_bvh_cell].bounds.size * 0.5; + Vector3 center = bvh[p_bvh_cell].bounds.position + he; + + Vector3 rel = (p_pos - center).abs(); + Vector3 closest(MIN(rel.x, he.x), MIN(rel.y, he.y), MIN(rel.z, he.z)); + float d = rel.distance_to(closest); + + if (d >= closest_distance) { + pass = false; //already closer than this aabb, discard + } + } + + if (pass) { + _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[0], triangles, thickness, closest_distance); + _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[1], triangles, thickness, closest_distance); + } + } +} + +void GPUParticlesCollisionSDF::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *params) { + int32_t z_ofs = p_z * params->size.y * params->size.x; + for (int32_t y = 0; y < params->size.y; y++) { + int32_t y_ofs = z_ofs + y * params->size.x; + for (int32_t x = 0; x < params->size.x; x++) { + int32_t x_ofs = y_ofs + x; + float &cell = params->cells[x_ofs]; + + Vector3 pos = params->cell_offset + Vector3(x, y, p_z) * params->cell_size; + + cell = 1e20; + + _find_closest_distance(pos, params->bvh, 0, params->triangles, params->thickness, cell); + } + } +} + +void GPUParticlesCollisionSDF::_compute_sdf(ComputeSDFParams *params) { + ThreadWorkPool work_pool; + work_pool.init(); + work_pool.begin_work(params->size.z, this, &GPUParticlesCollisionSDF::_compute_sdf_z, params); + while (work_pool.get_work_index() < (uint32_t)params->size.z) { + OS::get_singleton()->delay_usec(10000); + bake_step_function(work_pool.get_work_index() * 100 / params->size.z, "Baking SDF"); + } + work_pool.end_work(); + work_pool.finish(); +} + +Vector3i GPUParticlesCollisionSDF::get_estimated_cell_size() const { + static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; + int subdiv = subdivs[get_resolution()]; + + AABB aabb(-extents, extents * 2); + + float cell_size = aabb.get_longest_axis_size() / float(subdiv); + + Vector3i sdf_size = Vector3i(aabb.size / cell_size); + sdf_size.x = MAX(1, sdf_size.x); + sdf_size.y = MAX(1, sdf_size.y); + sdf_size.z = MAX(1, sdf_size.z); + return sdf_size; +} + +Ref<Image> GPUParticlesCollisionSDF::bake() { + static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; + int subdiv = subdivs[get_resolution()]; + + AABB aabb(-extents, extents * 2); + + float cell_size = aabb.get_longest_axis_size() / float(subdiv); + + Vector3i sdf_size = Vector3i(aabb.size / cell_size); + sdf_size.x = MAX(1, sdf_size.x); + sdf_size.y = MAX(1, sdf_size.y); + sdf_size.z = MAX(1, sdf_size.z); + + if (bake_begin_function) { + bake_begin_function(100); + } + + aabb.size = Vector3(sdf_size) * cell_size; + + List<PlotMesh> plot_meshes; + _find_meshes(aabb, get_parent(), plot_meshes); + + LocalVector<Face3> faces; + + if (bake_step_function) { + bake_step_function(0, "Finding Meshes"); + } + + for (List<PlotMesh>::Element *E = plot_meshes.front(); E; E = E->next()) { + const PlotMesh &pm = E->get(); + + for (int i = 0; i < pm.mesh->get_surface_count(); i++) { + if (pm.mesh->surface_get_primitive_type(i) != Mesh::PRIMITIVE_TRIANGLES) { + continue; //only triangles + } + + Array a = pm.mesh->surface_get_arrays(i); + + Vector<Vector3> vertices = a[Mesh::ARRAY_VERTEX]; + const Vector3 *vr = vertices.ptr(); + Vector<int> index = a[Mesh::ARRAY_INDEX]; + + if (index.size()) { + int facecount = index.size() / 3; + const int *ir = index.ptr(); + + for (int j = 0; j < facecount; j++) { + Face3 face; + + for (int k = 0; k < 3; k++) { + face.vertex[k] = pm.local_xform.xform(vr[ir[j * 3 + k]]); + } + + //test against original bounds + if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) { + continue; + } + + faces.push_back(face); + } + + } else { + int facecount = vertices.size() / 3; + + for (int j = 0; j < facecount; j++) { + Face3 face; + + for (int k = 0; k < 3; k++) { + face.vertex[k] = pm.local_xform.xform(vr[j * 3 + k]); + } + + //test against original bounds + if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) { + continue; + } + + faces.push_back(face); + } + } + } + } + + //compute bvh + + ERR_FAIL_COND_V(faces.size() <= 1, Ref<Image>()); + + LocalVector<FacePos> face_pos; + + face_pos.resize(faces.size()); + + float th = cell_size * thickness; + + for (uint32_t i = 0; i < faces.size(); i++) { + face_pos[i].index = i; + face_pos[i].center = (faces[i].vertex[0] + faces[i].vertex[1] + faces[i].vertex[2]) / 2; + if (th > 0.0) { + face_pos[i].center -= faces[i].get_plane().normal * th * 0.5; + } + } + + if (bake_step_function) { + bake_step_function(0, "Creating BVH"); + } + + LocalVector<BVH> bvh; + + _create_bvh(bvh, face_pos.ptr(), face_pos.size(), faces.ptr(), th); + + Vector<uint8_t> data; + data.resize(sdf_size.z * sdf_size.y * sdf_size.x * sizeof(float)); + + if (bake_step_function) { + bake_step_function(0, "Baking SDF"); + } + + ComputeSDFParams params; + params.cells = (float *)data.ptrw(); + params.size = sdf_size; + params.cell_size = cell_size; + params.cell_offset = aabb.position + Vector3(cell_size * 0.5, cell_size * 0.5, cell_size * 0.5); + params.bvh = bvh.ptr(); + params.triangles = faces.ptr(); + params.thickness = th; + _compute_sdf(¶ms); + + Ref<Image> ret; + ret.instance(); + ret->create(sdf_size.x, sdf_size.y * sdf_size.z, false, Image::FORMAT_RF, data); + ret->convert(Image::FORMAT_RH); //convert to half, save space + ret->set_meta("depth", sdf_size.z); //hack, make sure to add to the docs of this function + + if (bake_end_function) { + bake_end_function(); + } + + return ret; +} + +void GPUParticlesCollisionSDF::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionSDF::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionSDF::get_extents); + + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionSDF::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionSDF::get_resolution); + + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesCollisionSDF::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesCollisionSDF::get_texture); + + ClassDB::bind_method(D_METHOD("set_thickness", "thickness"), &GPUParticlesCollisionSDF::set_thickness); + ClassDB::bind_method(D_METHOD("get_thickness"), &GPUParticlesCollisionSDF::get_thickness); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "16,32,64,128,256,512"), "set_resolution", "get_resolution"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "thickness", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_thickness", "get_thickness"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture"); + + BIND_ENUM_CONSTANT(RESOLUTION_16); + BIND_ENUM_CONSTANT(RESOLUTION_32); + BIND_ENUM_CONSTANT(RESOLUTION_64); + BIND_ENUM_CONSTANT(RESOLUTION_128); + BIND_ENUM_CONSTANT(RESOLUTION_256); + BIND_ENUM_CONSTANT(RESOLUTION_512); + BIND_ENUM_CONSTANT(RESOLUTION_MAX); +} + +void GPUParticlesCollisionSDF::set_thickness(float p_thickness) { + thickness = p_thickness; +} + +float GPUParticlesCollisionSDF::get_thickness() const { + return thickness; +} + +void GPUParticlesCollisionSDF::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesCollisionSDF::get_extents() const { + return extents; +} + +void GPUParticlesCollisionSDF::set_resolution(Resolution p_resolution) { + resolution = p_resolution; + update_gizmo(); +} + +GPUParticlesCollisionSDF::Resolution GPUParticlesCollisionSDF::get_resolution() const { + return resolution; +} + +void GPUParticlesCollisionSDF::set_texture(const Ref<Texture3D> &p_texture) { + texture = p_texture; + RID tex = texture.is_valid() ? texture->get_rid() : RID(); + RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); +} + +Ref<Texture3D> GPUParticlesCollisionSDF::get_texture() const { + return texture; +} + +AABB GPUParticlesCollisionSDF::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionSDF::BakeBeginFunc GPUParticlesCollisionSDF::bake_begin_function = nullptr; +GPUParticlesCollisionSDF::BakeStepFunc GPUParticlesCollisionSDF::bake_step_function = nullptr; +GPUParticlesCollisionSDF::BakeEndFunc GPUParticlesCollisionSDF::bake_end_function = nullptr; + +GPUParticlesCollisionSDF::GPUParticlesCollisionSDF() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE) { +} + +GPUParticlesCollisionSDF::~GPUParticlesCollisionSDF() { +} + +//////////////////////////// +//////////////////////////// + +void GPUParticlesCollisionHeightField::_notification(int p_what) { + if (p_what == NOTIFICATION_INTERNAL_PROCESS) { + if (update_mode == UPDATE_MODE_ALWAYS) { + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } + + if (follow_camera_mode && get_viewport()) { + Camera3D *cam = get_viewport()->get_camera(); + if (cam) { + Transform xform = get_global_transform(); + Vector3 x_axis = xform.basis.get_axis(Vector3::AXIS_X).normalized(); + Vector3 z_axis = xform.basis.get_axis(Vector3::AXIS_Z).normalized(); + float x_len = xform.basis.get_scale().x; + float z_len = xform.basis.get_scale().z; + + Vector3 cam_pos = cam->get_global_transform().origin; + Transform new_xform = xform; + + while (x_axis.dot(cam_pos - new_xform.origin) > x_len) { + new_xform.origin += x_axis * x_len; + } + while (x_axis.dot(cam_pos - new_xform.origin) < -x_len) { + new_xform.origin -= x_axis * x_len; + } + + while (z_axis.dot(cam_pos - new_xform.origin) > z_len) { + new_xform.origin += z_axis * z_len; + } + while (z_axis.dot(cam_pos - new_xform.origin) < -z_len) { + new_xform.origin -= z_axis * z_len; + } + + if (new_xform != xform) { + set_global_transform(new_xform); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } + } + } + } + + if (p_what == NOTIFICATION_TRANSFORM_CHANGED) { + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } +} + +void GPUParticlesCollisionHeightField::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionHeightField::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionHeightField::get_extents); + + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionHeightField::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionHeightField::get_resolution); + + ClassDB::bind_method(D_METHOD("set_update_mode", "update_mode"), &GPUParticlesCollisionHeightField::set_update_mode); + ClassDB::bind_method(D_METHOD("get_update_mode"), &GPUParticlesCollisionHeightField::get_update_mode); + + ClassDB::bind_method(D_METHOD("set_follow_camera_mode", "enabled"), &GPUParticlesCollisionHeightField::set_follow_camera_mode); + ClassDB::bind_method(D_METHOD("is_follow_camera_mode_enabled"), &GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled); + + ClassDB::bind_method(D_METHOD("set_follow_camera_push_ratio", "ratio"), &GPUParticlesCollisionHeightField::set_follow_camera_push_ratio); + ClassDB::bind_method(D_METHOD("get_follow_camera_push_ratio"), &GPUParticlesCollisionHeightField::get_follow_camera_push_ratio); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "256,512,1024,2048,4096,8192"), "set_resolution", "get_resolution"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "update_mode", PROPERTY_HINT_ENUM, "WhenMoved,Always"), "set_update_mode", "get_update_mode"); + ADD_GROUP("Folow Camera", "follow_camera_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "follow_camera_enabled"), "set_follow_camera_mode", "is_follow_camera_mode_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "follow_camera_push_ratio", PROPERTY_HINT_RANGE, "0.01,1,0.01"), "set_follow_camera_push_ratio", "get_follow_camera_push_ratio"); + + BIND_ENUM_CONSTANT(RESOLUTION_256); + BIND_ENUM_CONSTANT(RESOLUTION_512); + BIND_ENUM_CONSTANT(RESOLUTION_1024); + BIND_ENUM_CONSTANT(RESOLUTION_2048); + BIND_ENUM_CONSTANT(RESOLUTION_4096); + BIND_ENUM_CONSTANT(RESOLUTION_8192); + BIND_ENUM_CONSTANT(RESOLUTION_MAX); + + BIND_ENUM_CONSTANT(UPDATE_MODE_WHEN_MOVED); + BIND_ENUM_CONSTANT(UPDATE_MODE_ALWAYS); +} + +void GPUParticlesCollisionHeightField::set_follow_camera_push_ratio(float p_follow_camera_push_ratio) { + follow_camera_push_ratio = p_follow_camera_push_ratio; +} + +float GPUParticlesCollisionHeightField::get_follow_camera_push_ratio() const { + return follow_camera_push_ratio; +} + +void GPUParticlesCollisionHeightField::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); +} + +Vector3 GPUParticlesCollisionHeightField::get_extents() const { + return extents; +} + +void GPUParticlesCollisionHeightField::set_resolution(Resolution p_resolution) { + resolution = p_resolution; + RS::get_singleton()->particles_collision_set_height_field_resolution(_get_collision(), RS::ParticlesCollisionHeightfieldResolution(resolution)); + update_gizmo(); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); +} + +GPUParticlesCollisionHeightField::Resolution GPUParticlesCollisionHeightField::get_resolution() const { + return resolution; +} + +void GPUParticlesCollisionHeightField::set_update_mode(UpdateMode p_update_mode) { + update_mode = p_update_mode; + set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); +} + +GPUParticlesCollisionHeightField::UpdateMode GPUParticlesCollisionHeightField::get_update_mode() const { + return update_mode; +} + +void GPUParticlesCollisionHeightField::set_follow_camera_mode(bool p_enabled) { + follow_camera_mode = p_enabled; + set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); +} + +bool GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled() const { + return follow_camera_mode; +} + +AABB GPUParticlesCollisionHeightField::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionHeightField::GPUParticlesCollisionHeightField() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE) { +} + +GPUParticlesCollisionHeightField::~GPUParticlesCollisionHeightField() { +} + +//////////////////////////// +//////////////////////////// + +void GPUParticlesAttractor3D::set_cull_mask(uint32_t p_cull_mask) { + cull_mask = p_cull_mask; + RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask); +} + +uint32_t GPUParticlesAttractor3D::get_cull_mask() const { + return cull_mask; +} + +void GPUParticlesAttractor3D::set_strength(float p_strength) { + strength = p_strength; + RS::get_singleton()->particles_collision_set_attractor_strength(collision, p_strength); +} + +float GPUParticlesAttractor3D::get_strength() const { + return strength; +} + +void GPUParticlesAttractor3D::set_attenuation(float p_attenuation) { + attenuation = p_attenuation; + RS::get_singleton()->particles_collision_set_attractor_attenuation(collision, p_attenuation); +} + +float GPUParticlesAttractor3D::get_attenuation() const { + return attenuation; +} + +void GPUParticlesAttractor3D::set_directionality(float p_directionality) { + directionality = p_directionality; + RS::get_singleton()->particles_collision_set_attractor_directionality(collision, p_directionality); + update_gizmo(); +} + +float GPUParticlesAttractor3D::get_directionality() const { + return directionality; +} + +void GPUParticlesAttractor3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesAttractor3D::set_cull_mask); + ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesAttractor3D::get_cull_mask); + + ClassDB::bind_method(D_METHOD("set_strength", "strength"), &GPUParticlesAttractor3D::set_strength); + ClassDB::bind_method(D_METHOD("get_strength"), &GPUParticlesAttractor3D::get_strength); + + ClassDB::bind_method(D_METHOD("set_attenuation", "attenuation"), &GPUParticlesAttractor3D::set_attenuation); + ClassDB::bind_method(D_METHOD("get_attenuation"), &GPUParticlesAttractor3D::get_attenuation); + + ClassDB::bind_method(D_METHOD("set_directionality", "amount"), &GPUParticlesAttractor3D::set_directionality); + ClassDB::bind_method(D_METHOD("get_directionality"), &GPUParticlesAttractor3D::get_directionality); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "strength", PROPERTY_HINT_RANGE, "-128,128,0.01,or_greater,or_lesser"), "set_strength", "get_strength"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "attenuation", PROPERTY_HINT_EXP_EASING, "0,8,0.01"), "set_attenuation", "get_attenuation"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "directionality", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_directionality", "get_directionality"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask"); +} + +GPUParticlesAttractor3D::GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type) { + collision = RS::get_singleton()->particles_collision_create(); + RS::get_singleton()->particles_collision_set_collision_type(collision, p_type); + set_base(collision); +} +GPUParticlesAttractor3D::~GPUParticlesAttractor3D() { + RS::get_singleton()->free(collision); +} + +///////////////////////////////// + +void GPUParticlesAttractorSphere::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesAttractorSphere::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesAttractorSphere::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); +} + +void GPUParticlesAttractorSphere::set_radius(float p_radius) { + radius = p_radius; + RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); + update_gizmo(); +} + +float GPUParticlesAttractorSphere::get_radius() const { + return radius; +} + +AABB GPUParticlesAttractorSphere::get_aabb() const { + return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); +} + +GPUParticlesAttractorSphere::GPUParticlesAttractorSphere() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT) { +} + +GPUParticlesAttractorSphere::~GPUParticlesAttractorSphere() { +} + +/////////////////////////// + +void GPUParticlesAttractorBox::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorBox::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorBox::get_extents); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); +} + +void GPUParticlesAttractorBox::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesAttractorBox::get_extents() const { + return extents; +} + +AABB GPUParticlesAttractorBox::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesAttractorBox::GPUParticlesAttractorBox() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT) { +} + +GPUParticlesAttractorBox::~GPUParticlesAttractorBox() { +} + +/////////////////////////// + +void GPUParticlesAttractorVectorField::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorVectorField::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorVectorField::get_extents); + + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesAttractorVectorField::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesAttractorVectorField::get_texture); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture"); +} + +void GPUParticlesAttractorVectorField::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesAttractorVectorField::get_extents() const { + return extents; +} + +void GPUParticlesAttractorVectorField::set_texture(const Ref<Texture3D> &p_texture) { + texture = p_texture; + RID tex = texture.is_valid() ? texture->get_rid() : RID(); + RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); +} + +Ref<Texture3D> GPUParticlesAttractorVectorField::get_texture() const { + return texture; +} + +AABB GPUParticlesAttractorVectorField::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesAttractorVectorField::GPUParticlesAttractorVectorField() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) { +} + +GPUParticlesAttractorVectorField::~GPUParticlesAttractorVectorField() { +} diff --git a/scene/3d/gpu_particles_collision_3d.h b/scene/3d/gpu_particles_collision_3d.h new file mode 100644 index 0000000000..9b644ade6b --- /dev/null +++ b/scene/3d/gpu_particles_collision_3d.h @@ -0,0 +1,342 @@ +/*************************************************************************/ +/* gpu_particles_collision_3d.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef GPU_PARTICLES_COLLISION_3D_H +#define GPU_PARTICLES_COLLISION_3D_H + +#include "core/templates/local_vector.h" +#include "core/templates/rid.h" +#include "scene/3d/visual_instance_3d.h" +#include "scene/resources/material.h" + +class GPUParticlesCollision3D : public VisualInstance3D { + GDCLASS(GPUParticlesCollision3D, VisualInstance3D); + + uint32_t cull_mask = 0xFFFFFFFF; + RID collision; + +protected: + _FORCE_INLINE_ RID _get_collision() { return collision; } + static void _bind_methods(); + + GPUParticlesCollision3D(RS::ParticlesCollisionType p_type); + +public: + void set_cull_mask(uint32_t p_cull_mask); + uint32_t get_cull_mask() const; + + virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); } + + ~GPUParticlesCollision3D(); +}; + +class GPUParticlesCollisionSphere : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSphere, GPUParticlesCollision3D); + + float radius = 1.0; + +protected: + static void _bind_methods(); + +public: + void set_radius(float p_radius); + float get_radius() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionSphere(); + ~GPUParticlesCollisionSphere(); +}; + +class GPUParticlesCollisionBox : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionBox, GPUParticlesCollision3D); + + Vector3 extents = Vector3(1, 1, 1); + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionBox(); + ~GPUParticlesCollisionBox(); +}; + +class GPUParticlesCollisionSDF : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSDF, GPUParticlesCollision3D); + +public: + enum Resolution { + RESOLUTION_16, + RESOLUTION_32, + RESOLUTION_64, + RESOLUTION_128, + RESOLUTION_256, + RESOLUTION_512, + RESOLUTION_MAX, + }; + + typedef void (*BakeBeginFunc)(int); + typedef void (*BakeStepFunc)(int, const String &); + typedef void (*BakeEndFunc)(); + +private: + Vector3 extents = Vector3(1, 1, 1); + Resolution resolution = RESOLUTION_64; + Ref<Texture3D> texture; + float thickness = 1.0; + + struct PlotMesh { + Ref<Mesh> mesh; + Transform local_xform; + }; + + void _find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes); + + struct BVH { + enum { + LEAF_BIT = 1 << 30, + LEAF_MASK = LEAF_BIT - 1 + }; + AABB bounds; + uint32_t children[2]; + }; + + struct FacePos { + Vector3 center; + uint32_t index; + }; + + struct FaceSort { + uint32_t axis; + bool operator()(const FacePos &p_left, const FacePos &p_right) const { + return p_left.center[axis] < p_right.center[axis]; + } + }; + + uint32_t _create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness); + + struct ComputeSDFParams { + float *cells; + Vector3i size; + float cell_size; + Vector3 cell_offset; + const BVH *bvh; + const Face3 *triangles; + float thickness; + }; + + void _find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance); + void _compute_sdf_z(uint32_t p_z, ComputeSDFParams *params); + void _compute_sdf(ComputeSDFParams *params); + +protected: + static void _bind_methods(); + +public: + void set_thickness(float p_thickness); + float get_thickness() const; + + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_resolution(Resolution p_resolution); + Resolution get_resolution() const; + + void set_texture(const Ref<Texture3D> &p_texture); + Ref<Texture3D> get_texture() const; + + Vector3i get_estimated_cell_size() const; + Ref<Image> bake(); + + virtual AABB get_aabb() const override; + + static BakeBeginFunc bake_begin_function; + static BakeStepFunc bake_step_function; + static BakeEndFunc bake_end_function; + + GPUParticlesCollisionSDF(); + ~GPUParticlesCollisionSDF(); +}; + +VARIANT_ENUM_CAST(GPUParticlesCollisionSDF::Resolution) + +class GPUParticlesCollisionHeightField : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionHeightField, GPUParticlesCollision3D); + +public: + enum Resolution { + RESOLUTION_256, + RESOLUTION_512, + RESOLUTION_1024, + RESOLUTION_2048, + RESOLUTION_4096, + RESOLUTION_8192, + RESOLUTION_MAX, + }; + + enum UpdateMode { + UPDATE_MODE_WHEN_MOVED, + UPDATE_MODE_ALWAYS, + }; + +private: + Vector3 extents = Vector3(1, 1, 1); + Resolution resolution = RESOLUTION_1024; + bool follow_camera_mode = false; + float follow_camera_push_ratio = 0.1; + + UpdateMode update_mode = UPDATE_MODE_WHEN_MOVED; + +protected: + void _notification(int p_what); + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_resolution(Resolution p_resolution); + Resolution get_resolution() const; + + void set_update_mode(UpdateMode p_update_mode); + UpdateMode get_update_mode() const; + + void set_follow_camera_mode(bool p_enabled); + bool is_follow_camera_mode_enabled() const; + + void set_follow_camera_push_ratio(float p_ratio); + float get_follow_camera_push_ratio() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionHeightField(); + ~GPUParticlesCollisionHeightField(); +}; + +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::Resolution) +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::UpdateMode) + +class GPUParticlesAttractor3D : public VisualInstance3D { + GDCLASS(GPUParticlesAttractor3D, VisualInstance3D); + + uint32_t cull_mask = 0xFFFFFFFF; + RID collision; + float strength = 1.0; + float attenuation = 1.0; + float directionality = 0.0; + +protected: + _FORCE_INLINE_ RID _get_collision() { return collision; } + static void _bind_methods(); + + GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type); + +public: + void set_cull_mask(uint32_t p_cull_mask); + uint32_t get_cull_mask() const; + + void set_strength(float p_strength); + float get_strength() const; + + void set_attenuation(float p_attenuation); + float get_attenuation() const; + + void set_directionality(float p_directionality); + float get_directionality() const; + + virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); } + + ~GPUParticlesAttractor3D(); +}; + +class GPUParticlesAttractorSphere : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorSphere, GPUParticlesAttractor3D); + + float radius = 1.0; + +protected: + static void _bind_methods(); + +public: + void set_radius(float p_radius); + float get_radius() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorSphere(); + ~GPUParticlesAttractorSphere(); +}; + +class GPUParticlesAttractorBox : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorBox, GPUParticlesAttractor3D); + + Vector3 extents = Vector3(1, 1, 1); + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorBox(); + ~GPUParticlesAttractorBox(); +}; + +class GPUParticlesAttractorVectorField : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorVectorField, GPUParticlesAttractor3D); + + Vector3 extents = Vector3(1, 1, 1); + Ref<Texture3D> texture; + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_texture(const Ref<Texture3D> &p_texture); + Ref<Texture3D> get_texture() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorVectorField(); + ~GPUParticlesAttractorVectorField(); +}; + +#endif // GPU_PARTICLES_COLLISION_3D_H diff --git a/scene/3d/light_3d.cpp b/scene/3d/light_3d.cpp index 2eb12d10fa..3f816535f5 100644 --- a/scene/3d/light_3d.cpp +++ b/scene/3d/light_3d.cpp @@ -30,8 +30,8 @@ #include "light_3d.h" -#include "core/engine.h" -#include "core/project_settings.h" +#include "core/config/engine.h" +#include "core/config/project_settings.h" #include "scene/resources/surface_tool.h" bool Light3D::_can_gizmo_scale() const { @@ -394,6 +394,15 @@ bool DirectionalLight3D::is_blend_splits_enabled() const { return blend_splits; } +void DirectionalLight3D::set_sky_only(bool p_sky_only) { + sky_only = p_sky_only; + RS::get_singleton()->light_directional_set_sky_only(light, p_sky_only); +} + +bool DirectionalLight3D::is_sky_only() const { + return sky_only; +} + void DirectionalLight3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_shadow_mode", "mode"), &DirectionalLight3D::set_shadow_mode); ClassDB::bind_method(D_METHOD("get_shadow_mode"), &DirectionalLight3D::get_shadow_mode); @@ -404,6 +413,9 @@ void DirectionalLight3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_blend_splits", "enabled"), &DirectionalLight3D::set_blend_splits); ClassDB::bind_method(D_METHOD("is_blend_splits_enabled"), &DirectionalLight3D::is_blend_splits_enabled); + ClassDB::bind_method(D_METHOD("set_sky_only", "priority"), &DirectionalLight3D::set_sky_only); + ClassDB::bind_method(D_METHOD("is_sky_only"), &DirectionalLight3D::is_sky_only); + ADD_GROUP("Directional Shadow", "directional_shadow_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "directional_shadow_mode", PROPERTY_HINT_ENUM, "Orthogonal (Fast),PSSM 2 Splits (Average),PSSM 4 Splits (Slow)"), "set_shadow_mode", "get_shadow_mode"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_split_1", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_param", "get_param", PARAM_SHADOW_SPLIT_1_OFFSET); @@ -415,6 +427,8 @@ void DirectionalLight3D::_bind_methods() { ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_max_distance", PROPERTY_HINT_EXP_RANGE, "0,8192,0.1,or_greater"), "set_param", "get_param", PARAM_SHADOW_MAX_DISTANCE); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_pancake_size", PROPERTY_HINT_EXP_RANGE, "0,1024,0.1,or_greater"), "set_param", "get_param", PARAM_SHADOW_PANCAKE_SIZE); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_in_sky_only"), "set_sky_only", "is_sky_only"); + BIND_ENUM_CONSTANT(SHADOW_ORTHOGONAL); BIND_ENUM_CONSTANT(SHADOW_PARALLEL_2_SPLITS); BIND_ENUM_CONSTANT(SHADOW_PARALLEL_4_SPLITS); @@ -448,7 +462,7 @@ String OmniLight3D::get_configuration_warning() const { String warning = Light3D::get_configuration_warning(); if (!has_shadow() && get_projector().is_valid()) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("Projector texture only works with shadows active."); @@ -482,15 +496,14 @@ String SpotLight3D::get_configuration_warning() const { String warning = Light3D::get_configuration_warning(); if (has_shadow() && get_param(PARAM_SPOT_ANGLE) >= 90.0) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } - warning += TTR("A SpotLight3D with an angle wider than 90 degrees cannot cast shadows."); } if (!has_shadow() && get_projector().is_valid()) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("Projector texture only works with shadows active."); diff --git a/scene/3d/light_3d.h b/scene/3d/light_3d.h index 69c0478b86..08287a3313 100644 --- a/scene/3d/light_3d.h +++ b/scene/3d/light_3d.h @@ -158,6 +158,7 @@ private: bool blend_splits; ShadowMode shadow_mode; ShadowDepthRange shadow_depth_range; + bool sky_only = false; protected: static void _bind_methods(); @@ -172,6 +173,9 @@ public: void set_blend_splits(bool p_enable); bool is_blend_splits_enabled() const; + void set_sky_only(bool p_sky_only); + bool is_sky_only() const; + DirectionalLight3D(); }; diff --git a/scene/3d/navigation_agent_3d.cpp b/scene/3d/navigation_agent_3d.cpp index e179261002..f9f8f276a3 100644 --- a/scene/3d/navigation_agent_3d.cpp +++ b/scene/3d/navigation_agent_3d.cpp @@ -30,7 +30,7 @@ #include "navigation_agent_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/3d/navigation_3d.h" #include "servers/navigation_server_3d.h" @@ -287,11 +287,16 @@ void NavigationAgent3D::_avoidance_done(Vector3 p_new_velocity) { } String NavigationAgent3D::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!Object::cast_to<Node3D>(get_parent())) { - return TTR("The NavigationAgent3D can be used only under a spatial node."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The NavigationAgent3D can be used only under a spatial node."); } - return String(); + return warning; } void NavigationAgent3D::update_navigation() { diff --git a/scene/3d/navigation_agent_3d.h b/scene/3d/navigation_agent_3d.h index e80367ea50..dcfd302561 100644 --- a/scene/3d/navigation_agent_3d.h +++ b/scene/3d/navigation_agent_3d.h @@ -31,7 +31,7 @@ #ifndef NAVIGATION_AGENT_H #define NAVIGATION_AGENT_H -#include "core/vector.h" +#include "core/templates/vector.h" #include "scene/main/node.h" class Node3D; diff --git a/scene/3d/navigation_obstacle_3d.cpp b/scene/3d/navigation_obstacle_3d.cpp index 69fd5b02fc..adbff06ed6 100644 --- a/scene/3d/navigation_obstacle_3d.cpp +++ b/scene/3d/navigation_obstacle_3d.cpp @@ -113,11 +113,16 @@ Node *NavigationObstacle3D::get_navigation_node() const { } String NavigationObstacle3D::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!Object::cast_to<Node3D>(get_parent())) { - return TTR("The NavigationObstacle3D only serves to provide collision avoidance to a spatial object."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The NavigationObstacle3D only serves to provide collision avoidance to a spatial object."); } - return String(); + return warning; } void NavigationObstacle3D::update_agent_shape() { diff --git a/scene/3d/navigation_region_3d.cpp b/scene/3d/navigation_region_3d.cpp index 15ed448a65..2ae01c7ab8 100644 --- a/scene/3d/navigation_region_3d.cpp +++ b/scene/3d/navigation_region_3d.cpp @@ -182,6 +182,7 @@ void NavigationRegion3D::bake_navigation_mesh() { void NavigationRegion3D::_bake_finished(Ref<NavigationMesh> p_nav_mesh) { set_navigation_mesh(p_nav_mesh); bake_thread = nullptr; + emit_signal("bake_finished"); } String NavigationRegion3D::get_configuration_warning() const { @@ -189,19 +190,28 @@ String NavigationRegion3D::get_configuration_warning() const { return String(); } + String warning = Node3D::get_configuration_warning(); + if (!navmesh.is_valid()) { - return TTR("A NavigationMesh resource must be set or created for this node to work."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A NavigationMesh resource must be set or created for this node to work."); } + const Node3D *c = this; while (c) { if (Object::cast_to<Navigation3D>(c)) { - return String(); + return warning; } c = Object::cast_to<Node3D>(c->get_parent()); } - return TTR("NavigationRegion3D must be a child or grandchild to a Navigation3D node. It only provides navigation data."); + if (!warning.empty()) { + warning += "\n\n"; + } + return warning + TTR("NavigationRegion3D must be a child or grandchild to a Navigation3D node. It only provides navigation data."); } void NavigationRegion3D::_bind_methods() { diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp index bd9e4f5bde..e8005f38ed 100644 --- a/scene/3d/node_3d.cpp +++ b/scene/3d/node_3d.cpp @@ -30,8 +30,8 @@ #include "node_3d.h" -#include "core/engine.h" -#include "core/message_queue.h" +#include "core/config/engine.h" +#include "core/object/message_queue.h" #include "scene/main/scene_tree.h" #include "scene/main/window.h" #include "scene/scene_string_names.h" @@ -103,8 +103,8 @@ void Node3D::_propagate_transform_changed(Node3D *p_origin) { data.children_lock++; for (List<Node3D *>::Element *E = data.children.front(); E; E = E->next()) { - if (E->get()->data.toplevel_active) { - continue; //don't propagate to a toplevel + if (E->get()->data.top_level_active) { + continue; //don't propagate to a top_level } E->get()->_propagate_transform_changed(p_origin); } @@ -136,12 +136,12 @@ void Node3D::_notification(int p_what) { data.C = nullptr; } - if (data.toplevel && !Engine::get_singleton()->is_editor_hint()) { + if (data.top_level && !Engine::get_singleton()->is_editor_hint()) { if (data.parent) { data.local_transform = data.parent->get_global_transform() * get_transform(); data.dirty = DIRTY_VECTORS; //global is always dirty upon entering a scene } - data.toplevel_active = true; + data.top_level_active = true; } data.dirty |= DIRTY_GLOBAL; //global is always dirty upon entering a scene @@ -160,7 +160,7 @@ void Node3D::_notification(int p_what) { } data.parent = nullptr; data.C = nullptr; - data.toplevel_active = false; + data.top_level_active = false; } break; case NOTIFICATION_ENTER_WORLD: { data.inside_world = true; @@ -238,7 +238,7 @@ void Node3D::set_transform(const Transform &p_transform) { void Node3D::set_global_transform(const Transform &p_transform) { Transform xform = - (data.parent && !data.toplevel_active) ? + (data.parent && !data.top_level_active) ? data.parent->get_global_transform().affine_inverse() * p_transform : p_transform; @@ -261,7 +261,7 @@ Transform Node3D::get_global_transform() const { _update_local_transform(); } - if (data.parent && !data.toplevel_active) { + if (data.parent && !data.top_level_active) { data.global_transform = data.parent->get_global_transform() * data.local_transform; } else { data.global_transform = data.local_transform; @@ -462,8 +462,8 @@ bool Node3D::is_scale_disabled() const { return data.disable_scale; } -void Node3D::set_as_toplevel(bool p_enabled) { - if (data.toplevel == p_enabled) { +void Node3D::set_as_top_level(bool p_enabled) { + if (data.top_level == p_enabled) { return; } if (is_inside_tree() && !Engine::get_singleton()->is_editor_hint()) { @@ -473,16 +473,16 @@ void Node3D::set_as_toplevel(bool p_enabled) { set_transform(data.parent->get_global_transform().affine_inverse() * get_global_transform()); } - data.toplevel = p_enabled; - data.toplevel_active = p_enabled; + data.top_level = p_enabled; + data.top_level_active = p_enabled; } else { - data.toplevel = p_enabled; + data.top_level = p_enabled; } } -bool Node3D::is_set_as_toplevel() const { - return data.toplevel; +bool Node3D::is_set_as_top_level() const { + return data.top_level; } Ref<World3D> Node3D::get_world_3d() const { @@ -715,8 +715,8 @@ void Node3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_global_transform"), &Node3D::get_global_transform); ClassDB::bind_method(D_METHOD("get_parent_spatial"), &Node3D::get_parent_spatial); ClassDB::bind_method(D_METHOD("set_ignore_transform_notification", "enabled"), &Node3D::set_ignore_transform_notification); - ClassDB::bind_method(D_METHOD("set_as_toplevel", "enable"), &Node3D::set_as_toplevel); - ClassDB::bind_method(D_METHOD("is_set_as_toplevel"), &Node3D::is_set_as_toplevel); + ClassDB::bind_method(D_METHOD("set_as_top_level", "enable"), &Node3D::set_as_top_level); + ClassDB::bind_method(D_METHOD("is_set_as_top_level"), &Node3D::is_set_as_top_level); ClassDB::bind_method(D_METHOD("set_disable_scale", "disable"), &Node3D::set_disable_scale); ClassDB::bind_method(D_METHOD("is_scale_disabled"), &Node3D::is_scale_disabled); ClassDB::bind_method(D_METHOD("get_world_3d"), &Node3D::get_world_3d); @@ -773,6 +773,7 @@ void Node3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "rotation_degrees", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_rotation_degrees", "get_rotation_degrees"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "rotation", PROPERTY_HINT_NONE, "", 0), "set_rotation", "get_rotation"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "scale", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_scale", "get_scale"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "top_level"), "set_as_top_level", "is_set_as_top_level"); ADD_GROUP("Matrix", ""); ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM, "transform", PROPERTY_HINT_NONE, ""), "set_transform", "get_transform"); ADD_GROUP("Visibility", ""); @@ -788,8 +789,8 @@ Node3D::Node3D() : data.children_lock = 0; data.ignore_notification = false; - data.toplevel = false; - data.toplevel_active = false; + data.top_level = false; + data.top_level_active = false; data.scale = Vector3(1, 1, 1); data.viewport = nullptr; data.inside_world = false; diff --git a/scene/3d/node_3d.h b/scene/3d/node_3d.h index 327d4671e9..5fb421c930 100644 --- a/scene/3d/node_3d.h +++ b/scene/3d/node_3d.h @@ -71,8 +71,8 @@ class Node3D : public Node { Viewport *viewport; - bool toplevel_active; - bool toplevel; + bool top_level_active; + bool top_level; bool inside_world; int children_lock; @@ -111,7 +111,6 @@ protected: public: enum { - NOTIFICATION_TRANSFORM_CHANGED = SceneTree::NOTIFICATION_TRANSFORM_CHANGED, NOTIFICATION_ENTER_WORLD = 41, NOTIFICATION_EXIT_WORLD = 42, @@ -144,8 +143,8 @@ public: virtual Transform get_local_gizmo_transform() const; #endif - void set_as_toplevel(bool p_enabled); - bool is_set_as_toplevel() const; + void set_as_top_level(bool p_enabled); + bool is_set_as_top_level() const; void set_disable_scale(bool p_enabled); bool is_scale_disabled() const; diff --git a/scene/3d/path_3d.cpp b/scene/3d/path_3d.cpp index bf69a8598d..ae6bbad8bf 100644 --- a/scene/3d/path_3d.cpp +++ b/scene/3d/path_3d.cpp @@ -30,7 +30,7 @@ #include "path_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/scene_string_names.h" void Path3D::_notification(int p_what) { @@ -94,10 +94,6 @@ void PathFollow3D::_update_transform(bool p_update_xyz_rot) { return; } - if (delta_offset == 0) { - return; - } - float bl = c->get_baked_length(); if (bl == 0.0) { return; @@ -156,7 +152,7 @@ void PathFollow3D::_update_transform(bool p_update_xyz_rot) { t.origin = pos; - if (p_update_xyz_rot) { // Only update rotation if some parameter has changed - i.e. not on addition to scene tree + if (p_update_xyz_rot && delta_offset != 0) { // Only update rotation if some parameter has changed - i.e. not on addition to scene tree. Vector3 t_prev = (pos - c->interpolate_baked(offset - delta_offset, cubic)).normalized(); Vector3 t_cur = (c->interpolate_baked(offset + delta_offset, cubic) - pos).normalized(); @@ -250,16 +246,24 @@ String PathFollow3D::get_configuration_warning() const { return String(); } + String warning = Node3D::get_configuration_warning(); + if (!Object::cast_to<Path3D>(get_parent())) { - return TTR("PathFollow3D only works when set as a child of a Path3D node."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("PathFollow3D only works when set as a child of a Path3D node."); } else { Path3D *path = Object::cast_to<Path3D>(get_parent()); if (path->get_curve().is_valid() && !path->get_curve()->is_up_vector_enabled() && rotation_mode == ROTATION_ORIENTED) { - return TTR("PathFollow3D's ROTATION_ORIENTED requires \"Up Vector\" to be enabled in its parent Path3D's Curve resource."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("PathFollow3D's ROTATION_ORIENTED requires \"Up Vector\" to be enabled in its parent Path3D's Curve resource."); } } - return String(); + return warning; } void PathFollow3D::_bind_methods() { diff --git a/scene/3d/path_3d.h b/scene/3d/path_3d.h index 1aa9f7ffd2..1b0f5fa4e0 100644 --- a/scene/3d/path_3d.h +++ b/scene/3d/path_3d.h @@ -57,7 +57,6 @@ class PathFollow3D : public Node3D { public: enum RotationMode { - ROTATION_NONE, ROTATION_Y, ROTATION_XY, diff --git a/scene/3d/physics_body_3d.cpp b/scene/3d/physics_body_3d.cpp index fc021e5532..15cd2238e1 100644 --- a/scene/3d/physics_body_3d.cpp +++ b/scene/3d/physics_body_3d.cpp @@ -30,12 +30,11 @@ #include "physics_body_3d.h" +#include "core/config/engine.h" #include "core/core_string_names.h" -#include "core/engine.h" -#include "core/list.h" -#include "core/method_bind_ext.gen.inc" -#include "core/object.h" -#include "core/rid.h" +#include "core/object/class_db.h" +#include "core/templates/list.h" +#include "core/templates/rid.h" #include "scene/3d/collision_shape_3d.h" #include "scene/scene_string_names.h" #include "servers/navigation_server_3d.h" @@ -130,15 +129,6 @@ void PhysicsBody3D::remove_collision_exception_with(Node *p_node) { PhysicsServer3D::get_singleton()->body_remove_collision_exception(get_rid(), collision_object->get_rid()); } -void PhysicsBody3D::_set_layers(uint32_t p_mask) { - set_collision_layer(p_mask); - set_collision_mask(p_mask); -} - -uint32_t PhysicsBody3D::_get_layers() const { - return get_collision_layer(); -} - void PhysicsBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody3D::set_collision_layer); ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody3D::get_collision_layer); @@ -152,9 +142,6 @@ void PhysicsBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody3D::set_collision_layer_bit); ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody3D::get_collision_layer_bit); - ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody3D::_set_layers); - ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody3D::_get_layers); - ADD_GROUP("Collision", "collision_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_layer", "get_collision_layer"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_mask", "get_collision_mask"); @@ -491,8 +478,6 @@ RigidBody3D::Mode RigidBody3D::get_mode() const { void RigidBody3D::set_mass(real_t p_mass) { ERR_FAIL_COND(p_mass <= 0); mass = p_mass; - _change_notify("mass"); - _change_notify("weight"); PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_MASS, mass); } @@ -500,14 +485,6 @@ real_t RigidBody3D::get_mass() const { return mass; } -void RigidBody3D::set_weight(real_t p_weight) { - set_mass(p_weight / real_t(GLOBAL_DEF("physics/3d/default_gravity", 9.8))); -} - -real_t RigidBody3D::get_weight() const { - return mass * real_t(GLOBAL_DEF("physics/3d/default_gravity", 9.8)); -} - void RigidBody3D::set_physics_material_override(const Ref<PhysicsMaterial> &p_physics_material_override) { if (physics_material_override.is_valid()) { if (physics_material_override->is_connected(CoreStringNames::get_singleton()->changed, callable_mp(this, &RigidBody3D::_reload_physics_characteristics))) { @@ -737,7 +714,7 @@ String RigidBody3D::get_configuration_warning() const { String warning = CollisionObject3D::get_configuration_warning(); if ((get_mode() == MODE_RIGID || get_mode() == MODE_CHARACTER) && (ABS(t.basis.get_axis(0).length() - 1.0) > 0.05 || ABS(t.basis.get_axis(1).length() - 1.0) > 0.05 || ABS(t.basis.get_axis(2).length() - 1.0) > 0.05)) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("Size changes to RigidBody3D (in character or rigid modes) will be overridden by the physics engine when running.\nChange the size in children collision shapes instead."); @@ -753,9 +730,6 @@ void RigidBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_mass", "mass"), &RigidBody3D::set_mass); ClassDB::bind_method(D_METHOD("get_mass"), &RigidBody3D::get_mass); - ClassDB::bind_method(D_METHOD("set_weight", "weight"), &RigidBody3D::set_weight); - ClassDB::bind_method(D_METHOD("get_weight"), &RigidBody3D::get_weight); - ClassDB::bind_method(D_METHOD("set_physics_material_override", "physics_material_override"), &RigidBody3D::set_physics_material_override); ClassDB::bind_method(D_METHOD("get_physics_material_override"), &RigidBody3D::get_physics_material_override); @@ -815,7 +789,6 @@ void RigidBody3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "mode", PROPERTY_HINT_ENUM, "Rigid,Static,Character,Kinematic"), "set_mode", "get_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "mass", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01"), "set_mass", "get_mass"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "weight", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01", PROPERTY_USAGE_EDITOR), "set_weight", "get_weight"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "physics_material_override", PROPERTY_HINT_RESOURCE_TYPE, "PhysicsMaterial"), "set_physics_material_override", "get_physics_material_override"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_scale", PROPERTY_HINT_RANGE, "-128,128,0.01"), "set_gravity_scale", "get_gravity_scale"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "custom_integrator"), "set_use_custom_integrator", "is_using_custom_integrator"); @@ -2134,9 +2107,6 @@ void PhysicalBone3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_mass", "mass"), &PhysicalBone3D::set_mass); ClassDB::bind_method(D_METHOD("get_mass"), &PhysicalBone3D::get_mass); - ClassDB::bind_method(D_METHOD("set_weight", "weight"), &PhysicalBone3D::set_weight); - ClassDB::bind_method(D_METHOD("get_weight"), &PhysicalBone3D::get_weight); - ClassDB::bind_method(D_METHOD("set_friction", "friction"), &PhysicalBone3D::set_friction); ClassDB::bind_method(D_METHOD("get_friction"), &PhysicalBone3D::get_friction); @@ -2167,7 +2137,6 @@ void PhysicalBone3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM, "body_offset"), "set_body_offset", "get_body_offset"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "mass", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01"), "set_mass", "get_mass"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "weight", PROPERTY_HINT_EXP_RANGE, "0.01,65535,0.01"), "set_weight", "get_weight"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_friction", "get_friction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_bounce", "get_bounce"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_scale", PROPERTY_HINT_RANGE, "-10,10,0.01"), "set_gravity_scale", "get_gravity_scale"); @@ -2469,14 +2438,6 @@ real_t PhysicalBone3D::get_mass() const { return mass; } -void PhysicalBone3D::set_weight(real_t p_weight) { - set_mass(p_weight / real_t(GLOBAL_DEF("physics/3d/default_gravity", 9.8))); -} - -real_t PhysicalBone3D::get_weight() const { - return mass * real_t(GLOBAL_DEF("physics/3d/default_gravity", 9.8)); -} - void PhysicalBone3D::set_friction(real_t p_friction) { ERR_FAIL_COND(p_friction < 0 || p_friction > 1); @@ -2606,7 +2567,7 @@ void PhysicalBone3D::_start_physics_simulation() { PhysicsServer3D::get_singleton()->body_set_collision_layer(get_rid(), get_collision_layer()); PhysicsServer3D::get_singleton()->body_set_collision_mask(get_rid(), get_collision_mask()); PhysicsServer3D::get_singleton()->body_set_force_integration_callback(get_rid(), this, "_direct_state_changed"); - set_as_toplevel(true); + set_as_top_level(true); _internal_simulate_physics = true; } @@ -2626,7 +2587,7 @@ void PhysicalBone3D::_stop_physics_simulation() { if (_internal_simulate_physics) { PhysicsServer3D::get_singleton()->body_set_force_integration_callback(get_rid(), nullptr, ""); parent_skeleton->set_bone_global_pose_override(bone_id, Transform(), 0.0, false); - set_as_toplevel(false); + set_as_top_level(false); _internal_simulate_physics = false; } } diff --git a/scene/3d/physics_body_3d.h b/scene/3d/physics_body_3d.h index 9830a55183..58eebc90ce 100644 --- a/scene/3d/physics_body_3d.h +++ b/scene/3d/physics_body_3d.h @@ -31,7 +31,7 @@ #ifndef PHYSICS_BODY_3D_H #define PHYSICS_BODY_3D_H -#include "core/vset.h" +#include "core/templates/vset.h" #include "scene/3d/collision_object_3d.h" #include "scene/resources/physics_material.h" #include "servers/physics_server_3d.h" @@ -43,9 +43,6 @@ class PhysicsBody3D : public CollisionObject3D { uint32_t collision_layer; uint32_t collision_mask; - void _set_layers(uint32_t p_mask); - uint32_t _get_layers() const; - protected: static void _bind_methods(); PhysicsBody3D(PhysicsServer3D::BodyMode p_mode); @@ -188,9 +185,6 @@ public: virtual float get_inverse_mass() const override { return 1.0 / mass; } - void set_weight(real_t p_weight); - real_t get_weight() const; - void set_physics_material_override(const Ref<PhysicsMaterial> &p_physics_material_override); Ref<PhysicsMaterial> get_physics_material_override() const; @@ -575,9 +569,6 @@ public: void set_mass(real_t p_mass); real_t get_mass() const; - void set_weight(real_t p_weight); - real_t get_weight() const; - void set_friction(real_t p_friction); real_t get_friction() const; diff --git a/scene/3d/physics_joint_3d.cpp b/scene/3d/physics_joint_3d.cpp index af4d6ae152..06de5ad0ae 100644 --- a/scene/3d/physics_joint_3d.cpp +++ b/scene/3d/physics_joint_3d.cpp @@ -43,6 +43,7 @@ void Joint3D::_update_joint(bool p_only_free) { } if (p_only_free || !is_inside_tree()) { + warning = String(); return; } @@ -52,20 +53,47 @@ void Joint3D::_update_joint(bool p_only_free) { PhysicsBody3D *body_a = Object::cast_to<PhysicsBody3D>(node_a); PhysicsBody3D *body_b = Object::cast_to<PhysicsBody3D>(node_b); - if (!body_a && body_b) { - SWAP(body_a, body_b); + if (node_a && !body_a && node_b && !body_b) { + warning = TTR("Node A and Node B must be PhysicsBody3Ds"); + update_configuration_warning(); + return; } - if (!body_a) { + if (node_a && !body_a) { + warning = TTR("Node A must be a PhysicsBody3D"); + update_configuration_warning(); return; } - joint = _configure_joint(body_a, body_b); + if (node_b && !body_b) { + warning = TTR("Node B must be a PhysicsBody3D"); + update_configuration_warning(); + return; + } + + if (!body_a && !body_b) { + warning = TTR("Joint is not connected to any PhysicsBody3Ds"); + update_configuration_warning(); + return; + } - if (!joint.is_valid()) { + if (body_a == body_b) { + warning = TTR("Node A and Node B must be different PhysicsBody3Ds"); + update_configuration_warning(); return; } + if (!body_a) { + SWAP(body_a, body_b); + } + + warning = String(); + update_configuration_warning(); + + joint = _configure_joint(body_a, body_b); + + ERR_FAIL_COND_MSG(!joint.is_valid(), "Failed to configure the joint."); + PhysicsServer3D::get_singleton()->joint_set_solver_priority(joint, solver_priority); ba = body_a->get_rid(); @@ -137,6 +165,19 @@ bool Joint3D::get_exclude_nodes_from_collision() const { return exclude_from_collision; } +String Joint3D::get_configuration_warning() const { + String node_warning = Node3D::get_configuration_warning(); + + if (!warning.empty()) { + if (!node_warning.empty()) { + node_warning += "\n\n"; + } + node_warning += warning; + } + + return node_warning; +} + void Joint3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_node_a", "node"), &Joint3D::set_node_a); ClassDB::bind_method(D_METHOD("get_node_a"), &Joint3D::get_node_a); @@ -150,8 +191,8 @@ void Joint3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_exclude_nodes_from_collision", "enable"), &Joint3D::set_exclude_nodes_from_collision); ClassDB::bind_method(D_METHOD("get_exclude_nodes_from_collision"), &Joint3D::get_exclude_nodes_from_collision); - ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "nodes/node_a", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "CollisionObject3D"), "set_node_a", "get_node_a"); - ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "nodes/node_b", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "CollisionObject3D"), "set_node_b", "get_node_b"); + ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "nodes/node_a", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "PhysicsBody3D"), "set_node_a", "get_node_a"); + ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "nodes/node_b", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "PhysicsBody3D"), "set_node_b", "get_node_b"); ADD_PROPERTY(PropertyInfo(Variant::INT, "solver/priority", PROPERTY_HINT_RANGE, "1,8,1"), "set_solver_priority", "get_solver_priority"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision/exclude_nodes"), "set_exclude_nodes_from_collision", "get_exclude_nodes_from_collision"); @@ -669,9 +710,6 @@ void Generic6DOFJoint3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_flag_z", "flag", "value"), &Generic6DOFJoint3D::set_flag_z); ClassDB::bind_method(D_METHOD("get_flag_z", "flag"), &Generic6DOFJoint3D::get_flag_z); - ClassDB::bind_method(D_METHOD("set_precision", "precision"), &Generic6DOFJoint3D::set_precision); - ClassDB::bind_method(D_METHOD("get_precision"), &Generic6DOFJoint3D::get_precision); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "linear_limit_x/enabled"), "set_flag_x", "get_flag_x", FLAG_ENABLE_LINEAR_LIMIT); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "linear_limit_x/upper_distance"), "set_param_x", "get_param_x", PARAM_LINEAR_UPPER_LIMIT); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "linear_limit_x/lower_distance"), "set_param_x", "get_param_x", PARAM_LINEAR_LOWER_LIMIT); @@ -760,8 +798,6 @@ void Generic6DOFJoint3D::_bind_methods() { ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "angular_spring_z/damping"), "set_param_z", "get_param_z", PARAM_ANGULAR_SPRING_DAMPING); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "angular_spring_z/equilibrium_point"), "set_param_z", "get_param_z", PARAM_ANGULAR_SPRING_EQUILIBRIUM_POINT); - ADD_PROPERTY(PropertyInfo(Variant::INT, "precision", PROPERTY_HINT_RANGE, "1,99999,1"), "set_precision", "get_precision"); - BIND_ENUM_CONSTANT(PARAM_LINEAR_LOWER_LIMIT); BIND_ENUM_CONSTANT(PARAM_LINEAR_UPPER_LIMIT); BIND_ENUM_CONSTANT(PARAM_LINEAR_LIMIT_SOFTNESS); @@ -880,14 +916,6 @@ bool Generic6DOFJoint3D::get_flag_z(Flag p_flag) const { return flags_z[p_flag]; } -void Generic6DOFJoint3D::set_precision(int p_precision) { - precision = p_precision; - - PhysicsServer3D::get_singleton()->generic_6dof_joint_set_precision( - get_joint(), - precision); -} - RID Generic6DOFJoint3D::_configure_joint(PhysicsBody3D *body_a, PhysicsBody3D *body_b) { Transform gt = get_global_transform(); //Vector3 cone_twistpos = gt.origin; diff --git a/scene/3d/physics_joint_3d.h b/scene/3d/physics_joint_3d.h index 8e2de82527..250ae8bf52 100644 --- a/scene/3d/physics_joint_3d.h +++ b/scene/3d/physics_joint_3d.h @@ -46,6 +46,7 @@ class Joint3D : public Node3D { int solver_priority; bool exclude_from_collision; + String warning; protected: void _update_joint(bool p_only_free = false); @@ -57,6 +58,8 @@ protected: static void _bind_methods(); public: + virtual String get_configuration_warning() const override; + void set_node_a(const NodePath &p_node_a); NodePath get_node_a() const; @@ -203,7 +206,6 @@ class ConeTwistJoint3D : public Joint3D { public: enum Param { - PARAM_SWING_SPAN, PARAM_TWIST_SPAN, PARAM_BIAS, @@ -237,7 +239,6 @@ class Generic6DOFJoint3D : public Joint3D { public: enum Param { - PARAM_LINEAR_LOWER_LIMIT = PhysicsServer3D::G6DOF_JOINT_LINEAR_LOWER_LIMIT, PARAM_LINEAR_UPPER_LIMIT = PhysicsServer3D::G6DOF_JOINT_LINEAR_UPPER_LIMIT, PARAM_LINEAR_LIMIT_SOFTNESS = PhysicsServer3D::G6DOF_JOINT_LINEAR_LIMIT_SOFTNESS, @@ -299,8 +300,6 @@ protected: float params_z[PARAM_MAX]; bool flags_z[FLAG_MAX]; - int precision = 1; - virtual RID _configure_joint(PhysicsBody3D *body_a, PhysicsBody3D *body_b) override; static void _bind_methods(); @@ -323,11 +322,6 @@ public: void set_flag_z(Flag p_flag, bool p_enabled); bool get_flag_z(Flag p_flag) const; - void set_precision(int p_precision); - int get_precision() const { - return precision; - } - Generic6DOFJoint3D(); }; diff --git a/scene/3d/proximity_group_3d.cpp b/scene/3d/proximity_group_3d.cpp index 1a0677c603..7e25255885 100644 --- a/scene/3d/proximity_group_3d.cpp +++ b/scene/3d/proximity_group_3d.cpp @@ -32,7 +32,7 @@ #include "core/math/math_funcs.h" -void ProximityGroup3D::clear_groups() { +void ProximityGroup3D::_clear_groups() { Map<StringName, uint32_t>::Element *E; { @@ -43,21 +43,21 @@ void ProximityGroup3D::clear_groups() { while (E && num < size) { if (E->get() != group_version) { remove_list[num++] = E->key(); - }; + } E = E->next(); - }; + } for (int i = 0; i < num; i++) { groups.erase(remove_list[i]); - }; - }; + } + } if (E) { - clear_groups(); // call until we go through the whole list - }; -}; + _clear_groups(); // call until we go through the whole list + } +} -void ProximityGroup3D::update_groups() { +void ProximityGroup3D::_update_groups() { if (grid_radius == Vector3(0, 0, 0)) { return; } @@ -68,20 +68,20 @@ void ProximityGroup3D::update_groups() { Vector3 vcell = pos / cell_size; int cell[3] = { Math::fast_ftoi(vcell.x), Math::fast_ftoi(vcell.y), Math::fast_ftoi(vcell.z) }; - add_groups(cell, group_name, 0); + _add_groups(cell, group_name, 0); - clear_groups(); -}; + _clear_groups(); +} -void ProximityGroup3D::add_groups(int *p_cell, String p_base, int p_depth) { +void ProximityGroup3D::_add_groups(int *p_cell, String p_base, int p_depth) { p_base = p_base + "|"; if (grid_radius[p_depth] == 0) { if (p_depth == 2) { _new_group(p_base); } else { - add_groups(p_cell, p_base, p_depth + 1); - }; - }; + _add_groups(p_cell, p_base, p_depth + 1); + } + } int start = p_cell[p_depth] - grid_radius[p_depth]; int end = p_cell[p_depth] + grid_radius[p_depth]; @@ -91,72 +91,72 @@ void ProximityGroup3D::add_groups(int *p_cell, String p_base, int p_depth) { if (p_depth == 2) { _new_group(gname); } else { - add_groups(p_cell, gname, p_depth + 1); - }; - }; -}; + _add_groups(p_cell, gname, p_depth + 1); + } + } +} void ProximityGroup3D::_new_group(StringName p_name) { const Map<StringName, uint32_t>::Element *E = groups.find(p_name); if (!E) { add_to_group(p_name); - }; + } groups[p_name] = group_version; -}; +} void ProximityGroup3D::_notification(int p_what) { switch (p_what) { case NOTIFICATION_EXIT_TREE: ++group_version; - clear_groups(); + _clear_groups(); break; case NOTIFICATION_TRANSFORM_CHANGED: - update_groups(); + _update_groups(); break; - }; -}; + } +} -void ProximityGroup3D::broadcast(String p_name, Variant p_params) { +void ProximityGroup3D::broadcast(String p_method, Variant p_parameters) { Map<StringName, uint32_t>::Element *E; E = groups.front(); while (E) { - get_tree()->call_group_flags(SceneTree::GROUP_CALL_DEFAULT, E->key(), "_proximity_group_broadcast", p_name, p_params); + get_tree()->call_group_flags(SceneTree::GROUP_CALL_DEFAULT, E->key(), "_proximity_group_broadcast", p_method, p_parameters); E = E->next(); - }; -}; + } +} -void ProximityGroup3D::_proximity_group_broadcast(String p_name, Variant p_params) { +void ProximityGroup3D::_proximity_group_broadcast(String p_method, Variant p_parameters) { if (dispatch_mode == MODE_PROXY) { - get_parent()->call(p_name, p_params); + get_parent()->call(p_method, p_parameters); } else { - emit_signal("broadcast", p_name, p_params); - }; -}; + emit_signal("broadcast", p_method, p_parameters); + } +} void ProximityGroup3D::set_group_name(const String &p_group_name) { group_name = p_group_name; -}; +} String ProximityGroup3D::get_group_name() const { return group_name; -}; +} void ProximityGroup3D::set_dispatch_mode(DispatchMode p_mode) { dispatch_mode = p_mode; -}; +} ProximityGroup3D::DispatchMode ProximityGroup3D::get_dispatch_mode() const { return dispatch_mode; -}; +} void ProximityGroup3D::set_grid_radius(const Vector3 &p_radius) { grid_radius = p_radius; -}; +} Vector3 ProximityGroup3D::get_grid_radius() const { return grid_radius; -}; +} void ProximityGroup3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_group_name", "name"), &ProximityGroup3D::set_group_name); @@ -165,19 +165,21 @@ void ProximityGroup3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_dispatch_mode"), &ProximityGroup3D::get_dispatch_mode); ClassDB::bind_method(D_METHOD("set_grid_radius", "radius"), &ProximityGroup3D::set_grid_radius); ClassDB::bind_method(D_METHOD("get_grid_radius"), &ProximityGroup3D::get_grid_radius); - ClassDB::bind_method(D_METHOD("broadcast", "name", "parameters"), &ProximityGroup3D::broadcast); - ClassDB::bind_method(D_METHOD("_proximity_group_broadcast", "name", "params"), &ProximityGroup3D::_proximity_group_broadcast); + + ClassDB::bind_method(D_METHOD("broadcast", "method", "parameters"), &ProximityGroup3D::broadcast); + + ClassDB::bind_method(D_METHOD("_proximity_group_broadcast", "method", "parameters"), &ProximityGroup3D::_proximity_group_broadcast); ADD_PROPERTY(PropertyInfo(Variant::STRING, "group_name"), "set_group_name", "get_group_name"); ADD_PROPERTY(PropertyInfo(Variant::INT, "dispatch_mode", PROPERTY_HINT_ENUM, "Proxy,Signal"), "set_dispatch_mode", "get_dispatch_mode"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "grid_radius"), "set_grid_radius", "get_grid_radius"); - ADD_SIGNAL(MethodInfo("broadcast", PropertyInfo(Variant::STRING, "group_name"), PropertyInfo(Variant::ARRAY, "parameters"))); + ADD_SIGNAL(MethodInfo("broadcast", PropertyInfo(Variant::STRING, "method"), PropertyInfo(Variant::ARRAY, "parameters"))); BIND_ENUM_CONSTANT(MODE_PROXY); BIND_ENUM_CONSTANT(MODE_SIGNAL); -}; +} ProximityGroup3D::ProximityGroup3D() { set_notify_transform(true); -}; +} diff --git a/scene/3d/proximity_group_3d.h b/scene/3d/proximity_group_3d.h index dd3a2f0a87..d52843e9a2 100644 --- a/scene/3d/proximity_group_3d.h +++ b/scene/3d/proximity_group_3d.h @@ -35,7 +35,6 @@ class ProximityGroup3D : public Node3D { GDCLASS(ProximityGroup3D, Node3D); - OBJ_CATEGORY("3D"); public: enum DispatchMode { @@ -43,25 +42,25 @@ public: MODE_SIGNAL, }; -public: - void clear_groups(); - void update_groups(); - - void _notification(int p_what); - - DispatchMode dispatch_mode = MODE_PROXY; - +private: Map<StringName, uint32_t> groups; + String group_name; + DispatchMode dispatch_mode = MODE_PROXY; + Vector3 grid_radius = Vector3(1, 1, 1); float cell_size = 1.0; - Vector3 grid_radius = Vector3(1, 1, 1); uint32_t group_version = 0; - void add_groups(int *p_cell, String p_base, int p_depth); + void _clear_groups(); + void _update_groups(); + void _add_groups(int *p_cell, String p_base, int p_depth); void _new_group(StringName p_name); - void _proximity_group_broadcast(String p_name, Variant p_params); + void _proximity_group_broadcast(String p_method, Variant p_parameters); + +protected: + void _notification(int p_what); static void _bind_methods(); @@ -75,7 +74,7 @@ public: void set_grid_radius(const Vector3 &p_radius); Vector3 get_grid_radius() const; - void broadcast(String p_name, Variant p_params); + void broadcast(String p_method, Variant p_parameters); ProximityGroup3D(); ~ProximityGroup3D() {} @@ -83,4 +82,4 @@ public: VARIANT_ENUM_CAST(ProximityGroup3D::DispatchMode); -#endif +#endif // PROXIMITY_GROUP_H diff --git a/scene/3d/ray_cast_3d.cpp b/scene/3d/ray_cast_3d.cpp index 69f09ef569..811e8a331b 100644 --- a/scene/3d/ray_cast_3d.cpp +++ b/scene/3d/ray_cast_3d.cpp @@ -31,7 +31,7 @@ #include "ray_cast_3d.h" #include "collision_object_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "mesh_instance_3d.h" #include "servers/physics_server_3d.h" diff --git a/scene/3d/reflection_probe.cpp b/scene/3d/reflection_probe.cpp index c7948395d3..c82ed423a7 100644 --- a/scene/3d/reflection_probe.cpp +++ b/scene/3d/reflection_probe.cpp @@ -76,6 +76,15 @@ float ReflectionProbe::get_max_distance() const { return max_distance; } +void ReflectionProbe::set_lod_threshold(float p_pixels) { + lod_threshold = p_pixels; + RS::get_singleton()->reflection_probe_set_lod_threshold(probe, p_pixels); +} + +float ReflectionProbe::get_lod_threshold() const { + return lod_threshold; +} + void ReflectionProbe::set_extents(const Vector3 &p_extents) { extents = p_extents; @@ -199,6 +208,9 @@ void ReflectionProbe::_bind_methods() { ClassDB::bind_method(D_METHOD("set_max_distance", "max_distance"), &ReflectionProbe::set_max_distance); ClassDB::bind_method(D_METHOD("get_max_distance"), &ReflectionProbe::get_max_distance); + ClassDB::bind_method(D_METHOD("set_lod_threshold", "ratio"), &ReflectionProbe::set_lod_threshold); + ClassDB::bind_method(D_METHOD("get_lod_threshold"), &ReflectionProbe::get_lod_threshold); + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &ReflectionProbe::set_extents); ClassDB::bind_method(D_METHOD("get_extents"), &ReflectionProbe::get_extents); @@ -229,6 +241,7 @@ void ReflectionProbe::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "interior"), "set_as_interior", "is_set_as_interior"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "enable_shadows"), "set_enable_shadows", "are_shadows_enabled"); ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lod_threshold", PROPERTY_HINT_RANGE, "0,1024,0.1"), "set_lod_threshold", "get_lod_threshold"); ADD_GROUP("Ambient", "ambient_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "ambient_mode", PROPERTY_HINT_ENUM, "Disabled,Environment,ConstantColor"), "set_ambient_mode", "get_ambient_mode"); @@ -256,6 +269,7 @@ ReflectionProbe::ReflectionProbe() { enable_shadows = false; cull_mask = (1 << 20) - 1; update_mode = UPDATE_ONCE; + lod_threshold = 1.0; probe = RenderingServer::get_singleton()->reflection_probe_create(); RS::get_singleton()->instance_set_base(get_instance(), probe); diff --git a/scene/3d/reflection_probe.h b/scene/3d/reflection_probe.h index 56177d0f95..4bff2f8bf9 100644 --- a/scene/3d/reflection_probe.h +++ b/scene/3d/reflection_probe.h @@ -63,6 +63,7 @@ private: AmbientMode ambient_mode; Color ambient_color; float ambient_color_energy; + float lod_threshold; uint32_t cull_mask; UpdateMode update_mode; @@ -90,6 +91,9 @@ public: void set_max_distance(float p_distance); float get_max_distance() const; + void set_lod_threshold(float p_pixels); + float get_lod_threshold() const; + void set_extents(const Vector3 &p_extents); Vector3 get_extents() const; diff --git a/scene/3d/remote_transform_3d.cpp b/scene/3d/remote_transform_3d.cpp index 95fce6b802..358f9346f8 100644 --- a/scene/3d/remote_transform_3d.cpp +++ b/scene/3d/remote_transform_3d.cpp @@ -180,11 +180,16 @@ void RemoteTransform3D::force_update_cache() { } String RemoteTransform3D::get_configuration_warning() const { + String warning = Node3D::get_configuration_warning(); + if (!has_node(remote_node) || !Object::cast_to<Node3D>(get_node(remote_node))) { - return TTR("The \"Remote Path\" property must point to a valid Node3D or Node3D-derived node to work."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The \"Remote Path\" property must point to a valid Node3D or Node3D-derived node to work."); } - return String(); + return warning; } void RemoteTransform3D::_bind_methods() { diff --git a/scene/3d/skeleton_3d.cpp b/scene/3d/skeleton_3d.cpp index 6723ca04b9..4425af26f9 100644 --- a/scene/3d/skeleton_3d.cpp +++ b/scene/3d/skeleton_3d.cpp @@ -30,10 +30,10 @@ #include "skeleton_3d.h" -#include "core/engine.h" -#include "core/message_queue.h" -#include "core/project_settings.h" -#include "core/type_info.h" +#include "core/config/engine.h" +#include "core/config/project_settings.h" +#include "core/object/message_queue.h" +#include "core/variant/type_info.h" #include "scene/3d/physics_body_3d.h" #include "scene/resources/surface_tool.h" #include "scene/scene_string_names.h" @@ -848,7 +848,7 @@ Ref<SkinReference> Skeleton3D::register_skin(const Ref<Skin> &p_skin) { skin_bindings.insert(skin_ref.operator->()); - skin->connect_compat("changed", skin_ref.operator->(), "_skin_changed"); + skin->connect("changed", Callable(skin_ref.operator->(), "_skin_changed")); _make_dirty(); //skin needs to be updated, so update skeleton diff --git a/scene/3d/skeleton_3d.h b/scene/3d/skeleton_3d.h index a21891a32e..c54f89d3ce 100644 --- a/scene/3d/skeleton_3d.h +++ b/scene/3d/skeleton_3d.h @@ -31,7 +31,7 @@ #ifndef SKELETON_3D_H #define SKELETON_3D_H -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/3d/node_3d.h" #include "scene/resources/skin.h" @@ -149,7 +149,6 @@ protected: public: enum { - NOTIFICATION_UPDATE_SKELETON = 50 }; diff --git a/scene/3d/skeleton_ik_3d.h b/scene/3d/skeleton_ik_3d.h index 80acc3e937..6c1db6dd33 100644 --- a/scene/3d/skeleton_ik_3d.h +++ b/scene/3d/skeleton_ik_3d.h @@ -76,10 +76,6 @@ class FabrikInverseKinematic { ChainTip(ChainItem *p_chain_item, const EndEffector *p_end_effector) : chain_item(p_chain_item), end_effector(p_end_effector) {} - - ChainTip(const ChainTip &p_other_ct) : - chain_item(p_other_ct.chain_item), - end_effector(p_other_ct.end_effector) {} }; struct Chain { diff --git a/scene/3d/soft_body_3d.cpp b/scene/3d/soft_body_3d.cpp index d3d7cdc1ce..d811b2e852 100644 --- a/scene/3d/soft_body_3d.cpp +++ b/scene/3d/soft_body_3d.cpp @@ -30,10 +30,10 @@ #include "soft_body_3d.h" -#include "core/list.h" -#include "core/object.h" +#include "core/object/class_db.h" #include "core/os/os.h" -#include "core/rid.h" +#include "core/templates/list.h" +#include "core/templates/rid.h" #include "scene/3d/collision_object_3d.h" #include "scene/3d/physics_body_3d.h" #include "scene/3d/skeleton_3d.h" @@ -282,7 +282,7 @@ void SoftBody3D::_notification(int p_what) { set_notify_transform(false); // Required to be top level with Transform at center of world in order to modify RenderingServer only to support custom Transform - set_as_toplevel(true); + set_as_top_level(true); set_transform(Transform()); set_notify_transform(true); @@ -425,7 +425,7 @@ void SoftBody3D::_draw_soft_mesh() { /// Necessary in order to render the mesh correctly (Soft body nodes are in global space) simulation_started = true; - call_deferred("set_as_toplevel", true); + call_deferred("set_as_top_level", true); call_deferred("set_transform", Transform()); } @@ -480,7 +480,6 @@ void SoftBody3D::become_mesh_owner() { Dictionary surface_lods = mesh->surface_get_lods(0); uint32_t surface_format = mesh->surface_get_format(0); - surface_format &= ~(Mesh::ARRAY_COMPRESS_NORMAL); surface_format |= Mesh::ARRAY_FLAG_USE_DYNAMIC_UPDATE; Ref<ArrayMesh> soft_mesh; @@ -725,7 +724,7 @@ void SoftBody3D::_update_cache_pin_points_datas() { w[i].spatial_attachment = Object::cast_to<Node3D>(get_node(w[i].spatial_attachment_path)); } if (!w[i].spatial_attachment) { - ERR_PRINT("Node3D node not defined in the pinned point, Softbody undefined behaviour!"); + ERR_PRINT("Node3D node not defined in the pinned point, this is undefined behavior for SoftBody3D!"); } } } diff --git a/scene/3d/spring_arm_3d.cpp b/scene/3d/spring_arm_3d.cpp index 9775ecc6c6..287d760db0 100644 --- a/scene/3d/spring_arm_3d.cpp +++ b/scene/3d/spring_arm_3d.cpp @@ -30,7 +30,7 @@ #include "spring_arm_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/3d/collision_object_3d.h" #include "scene/resources/sphere_shape_3d.h" #include "servers/physics_server_3d.h" diff --git a/scene/3d/sprite_3d.cpp b/scene/3d/sprite_3d.cpp index 6e38196ba6..1d20a9cd3b 100644 --- a/scene/3d/sprite_3d.cpp +++ b/scene/3d/sprite_3d.cpp @@ -204,7 +204,6 @@ Ref<TriangleMesh> SpriteBase3D::generate_triangle_mesh() const { float pixel_size = get_pixel_size(); Vector2 vertices[4] = { - (final_rect.position + Vector2(0, final_rect.size.y)) * pixel_size, (final_rect.position + final_rect.size) * pixel_size, (final_rect.position + Vector2(final_rect.size.x, 0)) * pixel_size, @@ -414,7 +413,6 @@ void Sprite3D::_draw() { float pixel_size = get_pixel_size(); Vector2 vertices[4] = { - (final_rect.position + Vector2(0, final_rect.size.y)) * pixel_size, (final_rect.position + final_rect.size) * pixel_size, (final_rect.position + Vector2(final_rect.size.x, 0)) * pixel_size, @@ -488,7 +486,7 @@ void Sprite3D::_draw() { RS::get_singleton()->immediate_normal(immediate, normal); RS::get_singleton()->immediate_tangent(immediate, tangent); RS::get_singleton()->immediate_color(immediate, color); - RS::get_singleton()->immediate_uv(immediate, uvs[i]); + RS::get_singleton()->immediate_uv(immediate, uvs[index[i]]); Vector3 vtx; vtx[x_axis] = vertices[index[i]][0]; @@ -740,7 +738,6 @@ void AnimatedSprite3D::_draw() { float pixel_size = get_pixel_size(); Vector2 vertices[4] = { - (final_rect.position + Vector2(0, final_rect.size.y)) * pixel_size, (final_rect.position + final_rect.size) * pixel_size, (final_rect.position + Vector2(final_rect.size.x, 0)) * pixel_size, @@ -818,7 +815,7 @@ void AnimatedSprite3D::_draw() { RS::get_singleton()->immediate_normal(immediate, normal); RS::get_singleton()->immediate_tangent(immediate, tangent); RS::get_singleton()->immediate_color(immediate, color); - RS::get_singleton()->immediate_uv(immediate, uvs[i]); + RS::get_singleton()->immediate_uv(immediate, uvs[indices[i]]); Vector3 vtx; vtx[x_axis] = vertices[indices[i]][0]; @@ -1074,11 +1071,16 @@ StringName AnimatedSprite3D::get_animation() const { } String AnimatedSprite3D::get_configuration_warning() const { + String warning = SpriteBase3D::get_configuration_warning(); + if (frames.is_null()) { - return TTR("A SpriteFrames resource must be created or set in the \"Frames\" property in order for AnimatedSprite3D to display frames."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("A SpriteFrames resource must be created or set in the \"Frames\" property in order for AnimatedSprite3D to display frames."); } - return String(); + return warning; } void AnimatedSprite3D::_bind_methods() { diff --git a/scene/3d/vehicle_body_3d.cpp b/scene/3d/vehicle_body_3d.cpp index 4c71ab470b..e27307e75f 100644 --- a/scene/3d/vehicle_body_3d.cpp +++ b/scene/3d/vehicle_body_3d.cpp @@ -103,11 +103,16 @@ void VehicleWheel3D::_notification(int p_what) { } String VehicleWheel3D::get_configuration_warning() const { + String warning = Node3D::get_configuration_warning(); + if (!Object::cast_to<VehicleBody3D>(get_parent())) { - return TTR("VehicleWheel3D serves to provide a wheel system to a VehicleBody3D. Please use it as a child of a VehicleBody3D."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("VehicleWheel3D serves to provide a wheel system to a VehicleBody3D. Please use it as a child of a VehicleBody3D."); } - return String(); + return warning; } void VehicleWheel3D::_update(PhysicsDirectBodyState3D *s) { @@ -629,7 +634,6 @@ VehicleBody3D::btVehicleWheelContactPoint::btVehicleWheelContactPoint(PhysicsDir /* TODO: Why is this code unused? if (body1) { - Vector3 r0 = frictionPosWorld - body1->get_global_transform().origin; Vector3 c0 = (r0).cross(frictionDirectionWorld); Vector3 vec = s->get_inverse_inertia_tensor().xform_inv(c0).cross(r0); diff --git a/scene/3d/velocity_tracker_3d.cpp b/scene/3d/velocity_tracker_3d.cpp index db10f3273b..eba7d44c16 100644 --- a/scene/3d/velocity_tracker_3d.cpp +++ b/scene/3d/velocity_tracker_3d.cpp @@ -29,7 +29,7 @@ /*************************************************************************/ #include "velocity_tracker_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" void VelocityTracker3D::set_track_physics_step(bool p_track_physics_step) { physics_step = p_track_physics_step; diff --git a/scene/3d/visibility_notifier_3d.cpp b/scene/3d/visibility_notifier_3d.cpp index a64b0df1cc..9f5c40caf4 100644 --- a/scene/3d/visibility_notifier_3d.cpp +++ b/scene/3d/visibility_notifier_3d.cpp @@ -30,7 +30,7 @@ #include "visibility_notifier_3d.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/3d/camera_3d.h" #include "scene/3d/physics_body_3d.h" #include "scene/animation/animation_player.h" diff --git a/scene/3d/visual_instance_3d.cpp b/scene/3d/visual_instance_3d.cpp index a1c498e8ab..0b70b0f920 100644 --- a/scene/3d/visual_instance_3d.cpp +++ b/scene/3d/visual_instance_3d.cpp @@ -278,6 +278,16 @@ float GeometryInstance3D::get_extra_cull_margin() const { return extra_cull_margin; } +void GeometryInstance3D::set_lod_bias(float p_bias) { + ERR_FAIL_COND(p_bias < 0.0); + lod_bias = p_bias; + RS::get_singleton()->instance_geometry_set_lod_bias(get_instance(), lod_bias); +} + +float GeometryInstance3D::get_lod_bias() const { + return lod_bias; +} + void GeometryInstance3D::set_shader_instance_uniform(const StringName &p_uniform, const Variant &p_value) { if (p_value.get_type() == Variant::NIL) { Variant def_value = RS::get_singleton()->instance_geometry_get_shader_parameter_default_value(get_instance(), p_uniform); @@ -361,6 +371,9 @@ void GeometryInstance3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_gi_mode", "mode"), &GeometryInstance3D::set_gi_mode); ClassDB::bind_method(D_METHOD("get_gi_mode"), &GeometryInstance3D::get_gi_mode); + ClassDB::bind_method(D_METHOD("set_lod_bias", "p_bias"), &GeometryInstance3D::set_lod_bias); + ClassDB::bind_method(D_METHOD("get_lod_bias"), &GeometryInstance3D::get_lod_bias); + ClassDB::bind_method(D_METHOD("set_custom_aabb", "aabb"), &GeometryInstance3D::set_custom_aabb); ClassDB::bind_method(D_METHOD("get_aabb"), &GeometryInstance3D::get_aabb); @@ -369,6 +382,7 @@ void GeometryInstance3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "material_override", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial,StandardMaterial3D", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_DEFERRED_SET_RESOURCE), "set_material_override", "get_material_override"); ADD_PROPERTY(PropertyInfo(Variant::INT, "cast_shadow", PROPERTY_HINT_ENUM, "Off,On,Double-Sided,Shadows Only"), "set_cast_shadows_setting", "get_cast_shadows_setting"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "extra_cull_margin", PROPERTY_HINT_RANGE, "0,16384,0.01"), "set_extra_cull_margin", "get_extra_cull_margin"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lod_bias", PROPERTY_HINT_RANGE, "0.001,128,0.001"), "set_lod_bias", "get_lod_bias"); ADD_GROUP("Global Illumination", "gi_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "gi_mode", PROPERTY_HINT_ENUM, "Disabled,Baked,Dynamic"), "set_gi_mode", "get_gi_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "gi_lightmap_scale", PROPERTY_HINT_ENUM, "1x,2x,4x,8x"), "set_lightmap_scale", "get_lightmap_scale"); @@ -403,6 +417,8 @@ GeometryInstance3D::GeometryInstance3D() { lod_min_hysteresis = 0; lod_max_hysteresis = 0; + lod_bias = 1.0; + gi_mode = GI_MODE_DISABLED; lightmap_scale = LIGHTMAP_SCALE_1X; diff --git a/scene/3d/visual_instance_3d.h b/scene/3d/visual_instance_3d.h index 195674f62d..0810b7b4ce 100644 --- a/scene/3d/visual_instance_3d.h +++ b/scene/3d/visual_instance_3d.h @@ -32,7 +32,7 @@ #define VISUAL_INSTANCE_H #include "core/math/face3.h" -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/3d/node_3d.h" #include "scene/resources/material.h" @@ -112,6 +112,8 @@ private: float lod_min_hysteresis; float lod_max_hysteresis; + float lod_bias; + mutable HashMap<StringName, Variant> instance_uniforms; mutable HashMap<StringName, StringName> instance_uniform_property_remap; @@ -151,6 +153,9 @@ public: void set_extra_cull_margin(float p_margin); float get_extra_cull_margin() const; + void set_lod_bias(float p_bias); + float get_lod_bias() const; + void set_gi_mode(GIMode p_mode); GIMode get_gi_mode() const; diff --git a/scene/3d/voxelizer.cpp b/scene/3d/voxelizer.cpp index de5496ee35..c570fc7b7c 100644 --- a/scene/3d/voxelizer.cpp +++ b/scene/3d/voxelizer.cpp @@ -580,7 +580,6 @@ void Voxelizer::_fixup_plot(int p_idx, int p_level) { /*if (bake_light.size()) { for(int i=0;i<6;i++) { - } }*/ diff --git a/scene/3d/world_environment.cpp b/scene/3d/world_environment.cpp index 5e73e460ed..3c12d4991e 100644 --- a/scene/3d/world_environment.cpp +++ b/scene/3d/world_environment.cpp @@ -110,22 +110,30 @@ Ref<CameraEffects> WorldEnvironment::get_camera_effects() const { } String WorldEnvironment::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!environment.is_valid()) { - return TTR("WorldEnvironment requires its \"Environment\" property to contain an Environment to have a visible effect."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("WorldEnvironment requires its \"Environment\" property to contain an Environment to have a visible effect."); } if (!is_inside_tree()) { - return String(); + return warning; } List<Node *> nodes; get_tree()->get_nodes_in_group("_world_environment_" + itos(get_viewport()->find_world_3d()->get_scenario().get_id()), &nodes); if (nodes.size() > 1) { - return TTR("Only one WorldEnvironment is allowed per scene (or set of instanced scenes)."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("Only one WorldEnvironment is allowed per scene (or set of instanced scenes)."); } - return String(); + return warning; } void WorldEnvironment::_bind_methods() { diff --git a/scene/3d/xr_nodes.cpp b/scene/3d/xr_nodes.cpp index f4a514cdd6..763461880f 100644 --- a/scene/3d/xr_nodes.cpp +++ b/scene/3d/xr_nodes.cpp @@ -60,13 +60,18 @@ String XRCamera3D::get_configuration_warning() const { return String(); } + String warning = Camera3D::get_configuration_warning(); + // must be child node of XROrigin3D! XROrigin3D *origin = Object::cast_to<XROrigin3D>(get_parent()); if (origin == nullptr) { - return TTR("XRCamera3D must have an XROrigin3D node as its parent."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("XRCamera3D must have an XROrigin3D node as its parent."); }; - return String(); + return warning; }; Vector3 XRCamera3D::project_local_ray_normal(const Point2 &p_pos) const { @@ -206,7 +211,7 @@ void XRController3D::_notification(int p_what) { emit_signal("button_pressed", i); button_states += mask; } else if (was_pressed && !is_pressed) { - emit_signal("button_release", i); + emit_signal("button_released", i); button_states -= mask; }; @@ -252,7 +257,7 @@ void XRController3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_mesh"), &XRController3D::get_mesh); ADD_SIGNAL(MethodInfo("button_pressed", PropertyInfo(Variant::INT, "button"))); - ADD_SIGNAL(MethodInfo("button_release", PropertyInfo(Variant::INT, "button"))); + ADD_SIGNAL(MethodInfo("button_released", PropertyInfo(Variant::INT, "button"))); ADD_SIGNAL(MethodInfo("mesh_updated", PropertyInfo(Variant::OBJECT, "mesh", PROPERTY_HINT_RESOURCE_TYPE, "Mesh"))); }; @@ -277,7 +282,7 @@ String XRController3D::get_controller_name() const { return String("Not connected"); }; - return tracker->get_name(); + return tracker->get_tracker_name(); }; int XRController3D::get_joystick_id() const { @@ -362,17 +367,25 @@ String XRController3D::get_configuration_warning() const { return String(); } + String warning = Node3D::get_configuration_warning(); + // must be child node of XROrigin! XROrigin3D *origin = Object::cast_to<XROrigin3D>(get_parent()); if (origin == nullptr) { - return TTR("XRController3D must have an XROrigin3D node as its parent."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("XRController3D must have an XROrigin3D node as its parent."); }; if (controller_id == 0) { - return TTR("The controller ID must not be 0 or this controller won't be bound to an actual controller."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The controller ID must not be 0 or this controller won't be bound to an actual controller."); }; - return String(); + return warning; }; //////////////////////////////////////////////////////////////////////////////////////////////////// @@ -467,7 +480,7 @@ String XRAnchor3D::get_anchor_name() const { return String("Not connected"); }; - return tracker->get_name(); + return tracker->get_tracker_name(); }; bool XRAnchor3D::get_is_active() const { @@ -479,17 +492,25 @@ String XRAnchor3D::get_configuration_warning() const { return String(); } + String warning = Node3D::get_configuration_warning(); + // must be child node of XROrigin3D! XROrigin3D *origin = Object::cast_to<XROrigin3D>(get_parent()); if (origin == nullptr) { - return TTR("XRAnchor3D must have an XROrigin3D node as its parent."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("XRAnchor3D must have an XROrigin3D node as its parent."); }; if (anchor_id == 0) { - return TTR("The anchor ID must not be 0 or this anchor won't be bound to an actual anchor."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The anchor ID must not be 0 or this anchor won't be bound to an actual anchor."); }; - return String(); + return warning; }; Plane XRAnchor3D::get_plane() const { @@ -512,11 +533,16 @@ String XROrigin3D::get_configuration_warning() const { return String(); } + String warning = Node3D::get_configuration_warning(); + if (tracked_camera == nullptr) { - return TTR("XROrigin3D requires an XRCamera3D child node."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("XROrigin3D requires an XRCamera3D child node."); } - return String(); + return warning; }; void XROrigin3D::_bind_methods() { diff --git a/scene/SCsub b/scene/SCsub index f9fc00f3f2..ccd2bab8ff 100644 --- a/scene/SCsub +++ b/scene/SCsub @@ -4,24 +4,9 @@ Import("env") env.scene_sources = [] -# Thirdparty code -thirdparty_dir = "#thirdparty/misc/" -thirdparty_sources = [ - # C++ sources - "easing_equations.cpp", - # C sources - "mikktspace.c", -] -thirdparty_sources = [thirdparty_dir + file for file in thirdparty_sources] - -env_thirdparty = env.Clone() -env_thirdparty.disable_warnings() -env_thirdparty.add_source_files(env.scene_sources, thirdparty_sources) - -# Godot's own sources +# Godot source files env.add_source_files(env.scene_sources, "*.cpp") - # Chain load SCsubs SConscript("main/SCsub") SConscript("gui/SCsub") @@ -32,7 +17,6 @@ SConscript("audio/SCsub") SConscript("resources/SCsub") SConscript("debugger/SCsub") - # Build it all as a library lib = env.add_library("scene", env.scene_sources) env.Prepend(LIBS=[lib]) diff --git a/scene/animation/SCsub b/scene/animation/SCsub index fc61250247..cc33a5af84 100644 --- a/scene/animation/SCsub +++ b/scene/animation/SCsub @@ -2,4 +2,23 @@ Import("env") -env.add_source_files(env.scene_sources, "*.cpp") +# Thirdparty code + +thirdparty_obj = [] + +thirdparty_sources = "#thirdparty/misc/easing_equations.cpp" + +env_thirdparty = env.Clone() +env_thirdparty.disable_warnings() +env_thirdparty.add_source_files(thirdparty_obj, thirdparty_sources) +env.scene_sources += thirdparty_obj + +# Godot source files + +scene_obj = [] + +env.add_source_files(scene_obj, "*.cpp") +env.scene_sources += scene_obj + +# Needed to force rebuilding the scene files when the thirdparty code is updated. +env.Depends(scene_obj, thirdparty_obj) diff --git a/scene/animation/animation_node_state_machine.cpp b/scene/animation/animation_node_state_machine.cpp index 17ce05f130..36552c966d 100644 --- a/scene/animation/animation_node_state_machine.cpp +++ b/scene/animation/animation_node_state_machine.cpp @@ -565,7 +565,7 @@ void AnimationNodeStateMachine::replace_node(const StringName &p_name, Ref<Anima { Ref<AnimationNode> node = states[p_name].node; if (node.is_valid()) { - node->disconnect_compat("tree_changed", this, "_tree_changed"); + node->disconnect("tree_changed", callable_mp(this, &AnimationNodeStateMachine::_tree_changed)); } } @@ -574,7 +574,7 @@ void AnimationNodeStateMachine::replace_node(const StringName &p_name, Ref<Anima emit_changed(); emit_signal("tree_changed"); - p_node->connect_compat("tree_changed", this, "_tree_changed", varray(), CONNECT_REFERENCE_COUNTED); + p_node->connect("tree_changed", callable_mp(this, &AnimationNodeStateMachine::_tree_changed), varray(), CONNECT_REFERENCE_COUNTED); } Ref<AnimationNode> AnimationNodeStateMachine::get_node(const StringName &p_name) const { diff --git a/scene/animation/animation_player.cpp b/scene/animation/animation_player.cpp index 66c587e2d4..159ccae130 100644 --- a/scene/animation/animation_player.cpp +++ b/scene/animation/animation_player.cpp @@ -30,12 +30,13 @@ #include "animation_player.h" -#include "core/engine.h" -#include "core/message_queue.h" +#include "core/config/engine.h" +#include "core/object/message_queue.h" #include "scene/scene_string_names.h" #include "servers/audio/audio_stream.h" #ifdef TOOLS_ENABLED +#include "editor/editor_node.h" #include "editor/editor_settings.h" #include "scene/2d/skeleton_2d.h" @@ -53,6 +54,21 @@ void AnimatedValuesBackup::update_skeletons() { } } } + +void AnimatedValuesBackup::restore() const { + for (int i = 0; i < entries.size(); i++) { + const AnimatedValuesBackup::Entry *entry = &entries[i]; + if (entry->bone_idx == -1) { + entry->object->set_indexed(entry->subpath, entry->value); + } else { + Object::cast_to<Skeleton3D>(entry->object)->set_bone_pose(entry->bone_idx, entry->value); + } + } +} + +void AnimatedValuesBackup::_bind_methods() { + ClassDB::bind_method(D_METHOD("restore"), &AnimatedValuesBackup::restore); +} #endif bool AnimationPlayer::_set(const StringName &p_name, const Variant &p_value) { @@ -762,12 +778,10 @@ void AnimationPlayer::_animation_process_data(PlaybackData &cd, float p_delta, f next_pos = len; } - // fix delta - delta = next_pos - cd.pos; + bool backwards = signbit(delta); // Negative zero means playing backwards too + delta = next_pos - cd.pos; // Fix delta (after determination of backwards because negative zero is lost here) if (&cd == &playback.current) { - bool backwards = delta < 0; - if (!backwards && cd.pos <= len && next_pos == len /*&& playback.blend.empty()*/) { //playback finished end_reached = true; @@ -1294,12 +1308,12 @@ bool AnimationPlayer::is_valid() const { } float AnimationPlayer::get_current_animation_position() const { - ERR_FAIL_COND_V(!playback.current.from, 0); + ERR_FAIL_COND_V_MSG(!playback.current.from, 0, "AnimationPlayer has no current animation"); return playback.current.pos; } float AnimationPlayer::get_current_animation_length() const { - ERR_FAIL_COND_V(!playback.current.from, 0); + ERR_FAIL_COND_V_MSG(!playback.current.from, 0, "AnimationPlayer has no current animation"); return playback.current.from->animation->get_length(); } @@ -1381,6 +1395,14 @@ String AnimationPlayer::get_autoplay() const { return autoplay; } +void AnimationPlayer::set_reset_on_save_enabled(bool p_enabled) { + reset_on_save = p_enabled; +} + +bool AnimationPlayer::is_reset_on_save_enabled() const { + return reset_on_save; +} + void AnimationPlayer::set_animation_process_mode(AnimationProcessMode p_mode) { if (animation_process_mode == p_mode) { return; @@ -1475,15 +1497,15 @@ void AnimationPlayer::get_argument_options(const StringName &p_function, int p_i } #ifdef TOOLS_ENABLED -AnimatedValuesBackup AnimationPlayer::backup_animated_values() { +Ref<AnimatedValuesBackup> AnimationPlayer::backup_animated_values() { + Ref<AnimatedValuesBackup> backup; if (!playback.current.from) { - return AnimatedValuesBackup(); + return backup; } _ensure_node_caches(playback.current.from); - AnimatedValuesBackup backup; - + backup.instance(); for (int i = 0; i < playback.current.from->node_cache.size(); i++) { TrackNodeCache *nc = playback.current.from->node_cache[i]; if (!nc) { @@ -1499,7 +1521,7 @@ AnimatedValuesBackup AnimationPlayer::backup_animated_values() { entry.object = nc->skeleton; entry.bone_idx = nc->bone_idx; entry.value = nc->skeleton->get_bone_pose(nc->bone_idx); - backup.entries.push_back(entry); + backup->entries.push_back(entry); } else { if (nc->spatial) { AnimatedValuesBackup::Entry entry; @@ -1507,7 +1529,7 @@ AnimatedValuesBackup AnimationPlayer::backup_animated_values() { entry.subpath.push_back("transform"); entry.value = nc->spatial->get_transform(); entry.bone_idx = -1; - backup.entries.push_back(entry); + backup->entries.push_back(entry); } else { for (Map<StringName, TrackNodeCache::PropertyAnim>::Element *E = nc->property_anim.front(); E; E = E->next()) { AnimatedValuesBackup::Entry entry; @@ -1517,7 +1539,7 @@ AnimatedValuesBackup AnimationPlayer::backup_animated_values() { entry.value = E->value().object->get_indexed(E->value().subpath, &valid); entry.bone_idx = -1; if (valid) { - backup.entries.push_back(entry); + backup->entries.push_back(entry); } } } @@ -1527,15 +1549,40 @@ AnimatedValuesBackup AnimationPlayer::backup_animated_values() { return backup; } -void AnimationPlayer::restore_animated_values(const AnimatedValuesBackup &p_backup) { - for (int i = 0; i < p_backup.entries.size(); i++) { - const AnimatedValuesBackup::Entry *entry = &p_backup.entries[i]; - if (entry->bone_idx == -1) { - entry->object->set_indexed(entry->subpath, entry->value); - } else { - Object::cast_to<Skeleton3D>(entry->object)->set_bone_pose(entry->bone_idx, entry->value); - } +Ref<AnimatedValuesBackup> AnimationPlayer::apply_reset(bool p_user_initiated) { + ERR_FAIL_COND_V(!can_apply_reset(), Ref<AnimatedValuesBackup>()); + + Ref<Animation> reset_anim = animation_set["RESET"].animation; + ERR_FAIL_COND_V(reset_anim.is_null(), Ref<AnimatedValuesBackup>()); + + Node *root_node = get_node_or_null(root); + ERR_FAIL_COND_V(!root_node, Ref<AnimatedValuesBackup>()); + + AnimationPlayer *aux_player = memnew(AnimationPlayer); + EditorNode::get_singleton()->add_child(aux_player); + aux_player->set_root(aux_player->get_path_to(root_node)); + aux_player->add_animation("RESET", reset_anim); + aux_player->set_assigned_animation("RESET"); + Ref<AnimatedValuesBackup> old_values = aux_player->backup_animated_values(); + aux_player->seek(0.0f, true); + aux_player->queue_delete(); + + if (p_user_initiated) { + Ref<AnimatedValuesBackup> new_values = aux_player->backup_animated_values(); + old_values->restore(); + + UndoRedo *ur = EditorNode::get_singleton()->get_undo_redo(); + ur->create_action(TTR("Anim Apply Reset")); + ur->add_do_method(new_values.ptr(), "restore"); + ur->add_undo_method(old_values.ptr(), "restore"); + ur->commit_action(); } + + return old_values; +} + +bool AnimationPlayer::can_apply_reset() const { + return has_animation("RESET") && playback.assigned != StringName("RESET"); } #endif @@ -1579,6 +1626,9 @@ void AnimationPlayer::_bind_methods() { ClassDB::bind_method(D_METHOD("set_autoplay", "name"), &AnimationPlayer::set_autoplay); ClassDB::bind_method(D_METHOD("get_autoplay"), &AnimationPlayer::get_autoplay); + ClassDB::bind_method(D_METHOD("set_reset_on_save_enabled", "enabled"), &AnimationPlayer::set_reset_on_save_enabled); + ClassDB::bind_method(D_METHOD("is_reset_on_save_enabled"), &AnimationPlayer::is_reset_on_save_enabled); + ClassDB::bind_method(D_METHOD("set_root", "path"), &AnimationPlayer::set_root); ClassDB::bind_method(D_METHOD("get_root"), &AnimationPlayer::get_root); @@ -1602,6 +1652,7 @@ void AnimationPlayer::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "current_animation", PROPERTY_HINT_ENUM, "", PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_ANIMATE_AS_TRIGGER), "set_current_animation", "get_current_animation"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "assigned_animation", PROPERTY_HINT_NONE, "", 0), "set_assigned_animation", "get_assigned_animation"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "autoplay", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_autoplay", "get_autoplay"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "reset_on_save", PROPERTY_HINT_NONE, ""), "set_reset_on_save_enabled", "is_reset_on_save_enabled"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "current_animation_length", PROPERTY_HINT_NONE, "", 0), "", "get_current_animation_length"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "current_animation_position", PROPERTY_HINT_NONE, "", 0), "", "get_current_animation_position"); @@ -1633,6 +1684,7 @@ AnimationPlayer::AnimationPlayer() { speed_scale = 1; end_reached = false; end_notify = false; + reset_on_save = true; animation_process_mode = ANIMATION_PROCESS_IDLE; method_call_mode = ANIMATION_METHOD_CALL_DEFERRED; processing = false; diff --git a/scene/animation/animation_player.h b/scene/animation/animation_player.h index e1b9dffb1f..7f0d5630e1 100644 --- a/scene/animation/animation_player.h +++ b/scene/animation/animation_player.h @@ -37,8 +37,9 @@ #include "scene/resources/animation.h" #ifdef TOOLS_ENABLED -// To save/restore animated values -class AnimatedValuesBackup { +class AnimatedValuesBackup : public Reference { + GDCLASS(AnimatedValuesBackup, Reference); + struct Entry { Object *object; Vector<StringName> subpath; // Unused if bone @@ -49,8 +50,12 @@ class AnimatedValuesBackup { friend class AnimationPlayer; +protected: + static void _bind_methods(); + public: void update_skeletons(); + void restore() const; }; #endif @@ -72,7 +77,6 @@ public: private: enum { - NODE_CACHE_UPDATE_MAX = 1024, BLEND_FROM_MAX = 3 }; @@ -216,6 +220,7 @@ private: bool end_notify; String autoplay; + bool reset_on_save; AnimationProcessMode animation_process_mode; AnimationMethodCallMode method_call_mode; bool processing; @@ -305,6 +310,9 @@ public: void set_autoplay(const String &p_name); String get_autoplay() const; + void set_reset_on_save_enabled(bool p_enabled); + bool is_reset_on_save_enabled() const; + void set_animation_process_mode(AnimationProcessMode p_mode); AnimationProcessMode get_animation_process_mode() const; @@ -326,9 +334,9 @@ public: void get_argument_options(const StringName &p_function, int p_idx, List<String> *r_options) const override; #ifdef TOOLS_ENABLED - // These may be interesting for games, but are too dangerous for general use - AnimatedValuesBackup backup_animated_values(); - void restore_animated_values(const AnimatedValuesBackup &p_backup); + Ref<AnimatedValuesBackup> backup_animated_values(); + Ref<AnimatedValuesBackup> apply_reset(bool p_user_initiated = false); + bool can_apply_reset() const; #endif AnimationPlayer(); diff --git a/scene/animation/animation_tree.cpp b/scene/animation/animation_tree.cpp index 466536db10..2ef3ba87b2 100644 --- a/scene/animation/animation_tree.cpp +++ b/scene/animation/animation_tree.cpp @@ -31,8 +31,7 @@ #include "animation_tree.h" #include "animation_blend_tree.h" -#include "core/engine.h" -#include "core/method_bind_ext.gen.inc" +#include "core/config/engine.h" #include "scene/scene_string_names.h" #include "servers/audio/audio_stream.h" @@ -1288,39 +1287,31 @@ String AnimationTree::get_configuration_warning() const { String warning = Node::get_configuration_warning(); if (!root.is_valid()) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("No root AnimationNode for the graph is set."); } if (!has_node(animation_player)) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } - warning += TTR("Path to an AnimationPlayer node containing animations is not set."); - return warning; - } - - AnimationPlayer *player = Object::cast_to<AnimationPlayer>(get_node(animation_player)); - - if (!player) { - if (warning != String()) { - warning += "\n\n"; - } - - warning += TTR("Path set for AnimationPlayer does not lead to an AnimationPlayer node."); - return warning; - } + } else { + AnimationPlayer *player = Object::cast_to<AnimationPlayer>(get_node(animation_player)); - if (!player->has_node(player->get_root())) { - if (warning != String()) { - warning += "\n\n"; + if (!player) { + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("Path set for AnimationPlayer does not lead to an AnimationPlayer node."); + } else if (!player->has_node(player->get_root())) { + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("The AnimationPlayer root node is not a valid node."); } - - warning += TTR("The AnimationPlayer root node is not a valid node."); - return warning; } return warning; diff --git a/scene/animation/tween.cpp b/scene/animation/tween.cpp index bd4396d680..1a2a97ada8 100644 --- a/scene/animation/tween.cpp +++ b/scene/animation/tween.cpp @@ -30,8 +30,6 @@ #include "tween.h" -#include "core/method_bind_ext.gen.inc" - void Tween::_add_pending_command(StringName p_key, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5, const Variant &p_arg6, const Variant &p_arg7, const Variant &p_arg8, const Variant &p_arg9, const Variant &p_arg10) { // Add a new pending command and reference it pending_commands.push_back(PendingCommand()); diff --git a/scene/animation/tween.h b/scene/animation/tween.h index 668870c526..822fcf0b6f 100644 --- a/scene/animation/tween.h +++ b/scene/animation/tween.h @@ -69,7 +69,6 @@ public: private: enum InterpolateType { - INTER_PROPERTY, INTER_METHOD, FOLLOW_PROPERTY, diff --git a/scene/audio/audio_stream_player.cpp b/scene/audio/audio_stream_player.cpp index 48f70e88cb..14aae9c7bf 100644 --- a/scene/audio/audio_stream_player.cpp +++ b/scene/audio/audio_stream_player.cpp @@ -30,7 +30,7 @@ #include "audio_stream_player.h" -#include "core/engine.h" +#include "core/config/engine.h" void AudioStreamPlayer::_mix_to_bus(const AudioFrame *p_frames, int p_amount) { int bus_index = AudioServer::get_singleton()->thread_find_bus_index(bus); diff --git a/scene/debugger/scene_debugger.cpp b/scene/debugger/scene_debugger.cpp index f57c8e58db..f848fc3e68 100644 --- a/scene/debugger/scene_debugger.cpp +++ b/scene/debugger/scene_debugger.cpp @@ -32,7 +32,7 @@ #include "core/debugger/engine_debugger.h" #include "core/io/marshalls.h" -#include "core/script_language.h" +#include "core/object/script_language.h" #include "scene/main/scene_tree.h" #include "scene/main/window.h" #include "scene/resources/packed_scene.h" diff --git a/scene/debugger/scene_debugger.h b/scene/debugger/scene_debugger.h index a2bafde039..af2d8904b5 100644 --- a/scene/debugger/scene_debugger.h +++ b/scene/debugger/scene_debugger.h @@ -31,10 +31,10 @@ #ifndef SCENE_DEBUGGER_H #define SCENE_DEBUGGER_H -#include "core/array.h" -#include "core/object.h" -#include "core/pair.h" -#include "core/ustring.h" +#include "core/object/class_db.h" +#include "core/string/ustring.h" +#include "core/templates/pair.h" +#include "core/variant/array.h" class Script; diff --git a/scene/gui/aspect_ratio_container.cpp b/scene/gui/aspect_ratio_container.cpp new file mode 100644 index 0000000000..672102bf7a --- /dev/null +++ b/scene/gui/aspect_ratio_container.cpp @@ -0,0 +1,172 @@ +/*************************************************************************/ +/* aspect_ratio_container.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "aspect_ratio_container.h" + +Size2 AspectRatioContainer::get_minimum_size() const { + Size2 ms; + for (int i = 0; i < get_child_count(); i++) { + Control *c = Object::cast_to<Control>(get_child(i)); + if (!c) { + continue; + } + if (c->is_set_as_top_level()) { + continue; + } + if (!c->is_visible()) { + continue; + } + Size2 minsize = c->get_combined_minimum_size(); + ms.width = MAX(ms.width, minsize.width); + ms.height = MAX(ms.height, minsize.height); + } + return ms; +} + +void AspectRatioContainer::set_ratio(float p_ratio) { + ratio = p_ratio; + queue_sort(); +} + +void AspectRatioContainer::set_stretch_mode(StretchMode p_mode) { + stretch_mode = p_mode; + queue_sort(); +} + +void AspectRatioContainer::set_alignment_horizontal(AlignMode p_alignment_horizontal) { + alignment_horizontal = p_alignment_horizontal; + queue_sort(); +} + +void AspectRatioContainer::set_alignment_vertical(AlignMode p_alignment_vertical) { + alignment_vertical = p_alignment_vertical; + queue_sort(); +} + +void AspectRatioContainer::_notification(int p_what) { + switch (p_what) { + case NOTIFICATION_SORT_CHILDREN: { + bool rtl = is_layout_rtl(); + Size2 size = get_size(); + for (int i = 0; i < get_child_count(); i++) { + Control *c = Object::cast_to<Control>(get_child(i)); + if (!c) { + continue; + } + if (c->is_set_as_top_level()) { + continue; + } + Size2 child_minsize = c->get_combined_minimum_size(); + Size2 child_size = Size2(ratio, 1.0); + float scale_factor = 1.0; + + switch (stretch_mode) { + case STRETCH_WIDTH_CONTROLS_HEIGHT: { + scale_factor = size.x / child_size.x; + } break; + case STRETCH_HEIGHT_CONTROLS_WIDTH: { + scale_factor = size.y / child_size.y; + } break; + case STRETCH_FIT: { + scale_factor = MIN(size.x / child_size.x, size.y / child_size.y); + } break; + case STRETCH_COVER: { + scale_factor = MAX(size.x / child_size.x, size.y / child_size.y); + } break; + } + child_size *= scale_factor; + child_size.x = MAX(child_size.x, child_minsize.x); + child_size.y = MAX(child_size.y, child_minsize.y); + + float align_x = 0.5; + switch (alignment_horizontal) { + case ALIGN_BEGIN: { + align_x = 0.0; + } break; + case ALIGN_CENTER: { + align_x = 0.5; + } break; + case ALIGN_END: { + align_x = 1.0; + } break; + } + float align_y = 0.5; + switch (alignment_vertical) { + case ALIGN_BEGIN: { + align_y = 0.0; + } break; + case ALIGN_CENTER: { + align_y = 0.5; + } break; + case ALIGN_END: { + align_y = 1.0; + } break; + } + Vector2 offset = (size - child_size) * Vector2(align_x, align_y); + + if (rtl) { + fit_child_in_rect(c, Rect2(Vector2(size.x - offset.x - child_size.x, offset.y), child_size)); + } else { + fit_child_in_rect(c, Rect2(offset, child_size)); + } + } + } break; + } +} + +void AspectRatioContainer::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_ratio", "ratio"), &AspectRatioContainer::set_ratio); + ClassDB::bind_method(D_METHOD("get_ratio"), &AspectRatioContainer::get_ratio); + + ClassDB::bind_method(D_METHOD("set_stretch_mode", "stretch_mode"), &AspectRatioContainer::set_stretch_mode); + ClassDB::bind_method(D_METHOD("get_stretch_mode"), &AspectRatioContainer::get_stretch_mode); + + ClassDB::bind_method(D_METHOD("set_alignment_horizontal", "alignment_horizontal"), &AspectRatioContainer::set_alignment_horizontal); + ClassDB::bind_method(D_METHOD("get_alignment_horizontal"), &AspectRatioContainer::get_alignment_horizontal); + + ClassDB::bind_method(D_METHOD("set_alignment_vertical", "alignment_vertical"), &AspectRatioContainer::set_alignment_vertical); + ClassDB::bind_method(D_METHOD("get_alignment_vertical"), &AspectRatioContainer::get_alignment_vertical); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "ratio"), "set_ratio", "get_ratio"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "stretch_mode", PROPERTY_HINT_ENUM, "Width controls height,Height controls width,Fit,Cover"), "set_stretch_mode", "get_stretch_mode"); + + ADD_GROUP("Alignment", "alignment_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment_horizontal", PROPERTY_HINT_ENUM, "Begin,Center,End"), "set_alignment_horizontal", "get_alignment_horizontal"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment_vertical", PROPERTY_HINT_ENUM, "Begin,Center,End"), "set_alignment_vertical", "get_alignment_vertical"); + + BIND_ENUM_CONSTANT(STRETCH_WIDTH_CONTROLS_HEIGHT); + BIND_ENUM_CONSTANT(STRETCH_HEIGHT_CONTROLS_WIDTH); + BIND_ENUM_CONSTANT(STRETCH_FIT); + BIND_ENUM_CONSTANT(STRETCH_COVER); + + BIND_ENUM_CONSTANT(ALIGN_BEGIN); + BIND_ENUM_CONSTANT(ALIGN_CENTER); + BIND_ENUM_CONSTANT(ALIGN_END); +} diff --git a/scene/gui/aspect_ratio_container.h b/scene/gui/aspect_ratio_container.h new file mode 100644 index 0000000000..8ffc4363c3 --- /dev/null +++ b/scene/gui/aspect_ratio_container.h @@ -0,0 +1,80 @@ +/*************************************************************************/ +/* aspect_ratio_container.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef ASPECT_RATIO_CONTAINER_H +#define ASPECT_RATIO_CONTAINER_H + +#include "scene/gui/container.h" + +class AspectRatioContainer : public Container { + GDCLASS(AspectRatioContainer, Container); + +protected: + void _notification(int p_what); + static void _bind_methods(); + virtual Size2 get_minimum_size() const override; + +public: + enum StretchMode { + STRETCH_WIDTH_CONTROLS_HEIGHT, + STRETCH_HEIGHT_CONTROLS_WIDTH, + STRETCH_FIT, + STRETCH_COVER, + }; + enum AlignMode { + ALIGN_BEGIN, + ALIGN_CENTER, + ALIGN_END, + }; + +private: + float ratio = 1.0; + StretchMode stretch_mode = STRETCH_FIT; + AlignMode alignment_horizontal = ALIGN_CENTER; + AlignMode alignment_vertical = ALIGN_CENTER; + +public: + void set_ratio(float p_ratio); + float get_ratio() const { return ratio; } + + void set_stretch_mode(StretchMode p_mode); + StretchMode get_stretch_mode() const { return stretch_mode; } + + void set_alignment_horizontal(AlignMode p_alignment_horizontal); + AlignMode get_alignment_horizontal() const { return alignment_horizontal; } + + void set_alignment_vertical(AlignMode p_alignment_vertical); + AlignMode get_alignment_vertical() const { return alignment_vertical; } +}; + +VARIANT_ENUM_CAST(AspectRatioContainer::StretchMode); +VARIANT_ENUM_CAST(AspectRatioContainer::AlignMode); + +#endif // ASPECT_RATIO_CONTAINER_H diff --git a/scene/gui/base_button.cpp b/scene/gui/base_button.cpp index 2e77d20d4e..dadb1bea31 100644 --- a/scene/gui/base_button.cpp +++ b/scene/gui/base_button.cpp @@ -307,17 +307,6 @@ int BaseButton::get_button_mask() const { return button_mask; } -void BaseButton::set_enabled_focus_mode(FocusMode p_mode) { - enabled_focus_mode = p_mode; - if (!status.disabled) { - set_focus_mode(p_mode); - } -} - -Control::FocusMode BaseButton::get_enabled_focus_mode() const { - return enabled_focus_mode; -} - void BaseButton::set_keep_pressed_outside(bool p_on) { keep_pressed_outside = p_on; } @@ -328,16 +317,21 @@ bool BaseButton::is_keep_pressed_outside() const { void BaseButton::set_shortcut(const Ref<Shortcut> &p_shortcut) { shortcut = p_shortcut; - set_process_unhandled_input(shortcut.is_valid()); + set_process_unhandled_key_input(shortcut.is_valid()); } Ref<Shortcut> BaseButton::get_shortcut() const { return shortcut; } -void BaseButton::_unhandled_input(Ref<InputEvent> p_event) { +void BaseButton::_unhandled_key_input(Ref<InputEvent> p_event) { + if (!_is_focus_owner_in_shorcut_context()) { + return; + } + if (!is_disabled() && is_visible_in_tree() && !p_event->is_echo() && shortcut.is_valid() && shortcut->is_shortcut(p_event)) { on_action_event(p_event); + accept_event(); } } @@ -371,9 +365,34 @@ Ref<ButtonGroup> BaseButton::get_button_group() const { return button_group; } +void BaseButton::set_shortcut_context(Node *p_node) { + ERR_FAIL_NULL_MSG(p_node, "Shortcut context node can't be null."); + shortcut_context = p_node->get_instance_id(); +} + +Node *BaseButton::get_shortcut_context() const { + Object *ctx_obj = ObjectDB::get_instance(shortcut_context); + Node *ctx_node = Object::cast_to<Node>(ctx_obj); + + return ctx_node; +} + +bool BaseButton::_is_focus_owner_in_shorcut_context() const { + if (shortcut_context == ObjectID()) { + // No context, therefore global - always "in" context. + return true; + } + + Node *ctx_node = get_shortcut_context(); + Control *vp_focus = get_focus_owner(); + + // If the context is valid and the viewport focus is valid, check if the context is the focus or is a parent of it. + return ctx_node && vp_focus && (ctx_node == vp_focus || ctx_node->is_a_parent_of(vp_focus)); +} + void BaseButton::_bind_methods() { ClassDB::bind_method(D_METHOD("_gui_input"), &BaseButton::_gui_input); - ClassDB::bind_method(D_METHOD("_unhandled_input"), &BaseButton::_unhandled_input); + ClassDB::bind_method(D_METHOD("_unhandled_key_input"), &BaseButton::_unhandled_key_input); ClassDB::bind_method(D_METHOD("set_pressed", "pressed"), &BaseButton::set_pressed); ClassDB::bind_method(D_METHOD("is_pressed"), &BaseButton::is_pressed); ClassDB::bind_method(D_METHOD("is_hovered"), &BaseButton::is_hovered); @@ -388,8 +407,6 @@ void BaseButton::_bind_methods() { ClassDB::bind_method(D_METHOD("set_button_mask", "mask"), &BaseButton::set_button_mask); ClassDB::bind_method(D_METHOD("get_button_mask"), &BaseButton::get_button_mask); ClassDB::bind_method(D_METHOD("get_draw_mode"), &BaseButton::get_draw_mode); - ClassDB::bind_method(D_METHOD("set_enabled_focus_mode", "mode"), &BaseButton::set_enabled_focus_mode); - ClassDB::bind_method(D_METHOD("get_enabled_focus_mode"), &BaseButton::get_enabled_focus_mode); ClassDB::bind_method(D_METHOD("set_keep_pressed_outside", "enabled"), &BaseButton::set_keep_pressed_outside); ClassDB::bind_method(D_METHOD("is_keep_pressed_outside"), &BaseButton::is_keep_pressed_outside); @@ -399,6 +416,9 @@ void BaseButton::_bind_methods() { ClassDB::bind_method(D_METHOD("set_button_group", "button_group"), &BaseButton::set_button_group); ClassDB::bind_method(D_METHOD("get_button_group"), &BaseButton::get_button_group); + ClassDB::bind_method(D_METHOD("set_shortcut_context", "node"), &BaseButton::set_shortcut_context); + ClassDB::bind_method(D_METHOD("get_shortcut_context"), &BaseButton::get_shortcut_context); + BIND_VMETHOD(MethodInfo("_pressed")); BIND_VMETHOD(MethodInfo("_toggled", PropertyInfo(Variant::BOOL, "button_pressed"))); @@ -412,10 +432,10 @@ void BaseButton::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "pressed"), "set_pressed", "is_pressed"); ADD_PROPERTY(PropertyInfo(Variant::INT, "action_mode", PROPERTY_HINT_ENUM, "Button Press,Button Release"), "set_action_mode", "get_action_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "button_mask", PROPERTY_HINT_FLAGS, "Mouse Left, Mouse Right, Mouse Middle"), "set_button_mask", "get_button_mask"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "enabled_focus_mode", PROPERTY_HINT_ENUM, "None,Click,All"), "set_enabled_focus_mode", "get_enabled_focus_mode"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "keep_pressed_outside"), "set_keep_pressed_outside", "is_keep_pressed_outside"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shortcut", PROPERTY_HINT_RESOURCE_TYPE, "Shortcut"), "set_shortcut", "get_shortcut"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "group", PROPERTY_HINT_RESOURCE_TYPE, "ButtonGroup"), "set_button_group", "get_button_group"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "button_group", PROPERTY_HINT_RESOURCE_TYPE, "ButtonGroup"), "set_button_group", "get_button_group"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shortcut_context", PROPERTY_HINT_RESOURCE_TYPE, "Node"), "set_shortcut_context", "get_shortcut_context"); BIND_ENUM_CONSTANT(DRAW_NORMAL); BIND_ENUM_CONSTANT(DRAW_PRESSED); @@ -437,9 +457,9 @@ BaseButton::BaseButton() { status.pressing_inside = false; status.disabled = false; set_focus_mode(FOCUS_ALL); - enabled_focus_mode = FOCUS_ALL; action_mode = ACTION_MODE_BUTTON_RELEASE; button_mask = BUTTON_MASK_LEFT; + shortcut_context = ObjectID(); } BaseButton::~BaseButton() { diff --git a/scene/gui/base_button.h b/scene/gui/base_button.h index 8e71931f8b..661801216d 100644 --- a/scene/gui/base_button.h +++ b/scene/gui/base_button.h @@ -49,8 +49,8 @@ private: bool toggle_mode; bool shortcut_in_tooltip; bool keep_pressed_outside; - FocusMode enabled_focus_mode; Ref<Shortcut> shortcut; + ObjectID shortcut_context; ActionMode action_mode; struct Status { @@ -76,9 +76,11 @@ protected: virtual void toggled(bool p_pressed); static void _bind_methods(); virtual void _gui_input(Ref<InputEvent> p_event); - virtual void _unhandled_input(Ref<InputEvent> p_event); + virtual void _unhandled_key_input(Ref<InputEvent> p_event); void _notification(int p_what); + bool _is_focus_owner_in_shorcut_context() const; + public: enum DrawMode { DRAW_NORMAL, @@ -115,9 +117,6 @@ public: void set_button_mask(int p_mask); int get_button_mask() const; - void set_enabled_focus_mode(FocusMode p_mode); - FocusMode get_enabled_focus_mode() const; - void set_shortcut(const Ref<Shortcut> &p_shortcut); Ref<Shortcut> get_shortcut() const; @@ -126,6 +125,9 @@ public: void set_button_group(const Ref<ButtonGroup> &p_group); Ref<ButtonGroup> get_button_group() const; + void set_shortcut_context(Node *p_node); + Node *get_shortcut_context() const; + BaseButton(); ~BaseButton(); }; diff --git a/scene/gui/box_container.cpp b/scene/gui/box_container.cpp index f130726837..fdd88d155f 100644 --- a/scene/gui/box_container.cpp +++ b/scene/gui/box_container.cpp @@ -44,6 +44,7 @@ void BoxContainer::_resort() { Size2i new_size = get_size(); int sep = get_theme_constant("separation"); //,vertical?"VBoxContainer":"HBoxContainer"); + bool rtl = is_layout_rtl(); bool first = true; int children_count = 0; @@ -57,7 +58,7 @@ void BoxContainer::_resort() { if (!c || !c->is_visible_in_tree()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -111,7 +112,7 @@ void BoxContainer::_resort() { if (!c || !c->is_visible_in_tree()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -152,27 +153,58 @@ void BoxContainer::_resort() { int ofs = 0; if (!has_stretched) { - switch (align) { - case ALIGN_BEGIN: - break; - case ALIGN_CENTER: - ofs = stretch_diff / 2; - break; - case ALIGN_END: - ofs = stretch_diff; - break; + if (!vertical) { + switch (align) { + case ALIGN_BEGIN: + if (rtl) { + ofs = stretch_diff; + } + break; + case ALIGN_CENTER: + ofs = stretch_diff / 2; + break; + case ALIGN_END: + if (!rtl) { + ofs = stretch_diff; + } + break; + } + } else { + switch (align) { + case ALIGN_BEGIN: + break; + case ALIGN_CENTER: + ofs = stretch_diff / 2; + break; + case ALIGN_END: + ofs = stretch_diff; + break; + } } } first = true; int idx = 0; - for (int i = 0; i < get_child_count(); i++) { + int start; + int end; + int delta; + if (!rtl || vertical) { + start = 0; + end = get_child_count(); + delta = +1; + } else { + start = get_child_count() - 1; + end = -1; + delta = -1; + } + + for (int i = start; i != end; i += delta) { Control *c = Object::cast_to<Control>(get_child(i)); if (!c || !c->is_visible_in_tree()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -224,7 +256,7 @@ Size2 BoxContainer::get_minimum_size() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -265,6 +297,10 @@ void BoxContainer::_notification(int p_what) { case NOTIFICATION_THEME_CHANGED: { minimum_size_changed(); } break; + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + queue_sort(); + } break; } } diff --git a/scene/gui/button.cpp b/scene/gui/button.cpp index e400801b66..711e5f9262 100644 --- a/scene/gui/button.cpp +++ b/scene/gui/button.cpp @@ -30,11 +30,11 @@ #include "button.h" -#include "core/translation.h" +#include "core/string/translation.h" #include "servers/rendering_server.h" Size2 Button::get_minimum_size() const { - Size2 minsize = get_theme_font("font")->get_string_size(xl_text); + Size2 minsize = text_buf->get_size(); if (clip_text) { minsize.width = 0; } @@ -65,8 +65,19 @@ void Button::_set_internal_margin(Margin p_margin, float p_value) { void Button::_notification(int p_what) { switch (p_what) { + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + update(); + } break; case NOTIFICATION_TRANSLATION_CHANGED: { xl_text = tr(text); + _shape(); + + minimum_size_changed(); + update(); + } break; + case NOTIFICATION_THEME_CHANGED: { + _shape(); + minimum_size_changed(); update(); } break; @@ -77,10 +88,16 @@ void Button::_notification(int p_what) { Color color_icon(1, 1, 1, 1); Ref<StyleBox> style = get_theme_stylebox("normal"); + bool rtl = is_layout_rtl(); switch (get_draw_mode()) { case DRAW_NORMAL: { - style = get_theme_stylebox("normal"); + if (rtl && has_theme_stylebox("normal_mirrored")) { + style = get_theme_stylebox("normal_mirrored"); + } else { + style = get_theme_stylebox("normal"); + } + if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } @@ -91,7 +108,12 @@ void Button::_notification(int p_what) { } break; case DRAW_HOVER_PRESSED: { if (has_theme_stylebox("hover_pressed") && has_theme_stylebox_override("hover_pressed")) { - style = get_theme_stylebox("hover_pressed"); + if (rtl && has_theme_stylebox("hover_pressed_mirrored")) { + style = get_theme_stylebox("hover_pressed_mirrored"); + } else { + style = get_theme_stylebox("hover_pressed"); + } + if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } @@ -109,7 +131,12 @@ void Button::_notification(int p_what) { [[fallthrough]]; } case DRAW_PRESSED: { - style = get_theme_stylebox("pressed"); + if (rtl && has_theme_stylebox("pressed_mirrored")) { + style = get_theme_stylebox("pressed_mirrored"); + } else { + style = get_theme_stylebox("pressed"); + } + if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } @@ -124,7 +151,12 @@ void Button::_notification(int p_what) { } break; case DRAW_HOVER: { - style = get_theme_stylebox("hover"); + if (rtl && has_theme_stylebox("hover_mirrored")) { + style = get_theme_stylebox("hover_mirrored"); + } else { + style = get_theme_stylebox("hover"); + } + if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } @@ -135,7 +167,12 @@ void Button::_notification(int p_what) { } break; case DRAW_DISABLED: { - style = get_theme_stylebox("disabled"); + if (rtl && has_theme_stylebox("disabled_mirrored")) { + style = get_theme_stylebox("disabled_mirrored"); + } else { + style = get_theme_stylebox("disabled"); + } + if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } @@ -152,7 +189,6 @@ void Button::_notification(int p_what) { style2->draw(ci, Rect2(Point2(), size)); } - Ref<Font> font = get_theme_font("font"); Ref<Texture2D> _icon; if (icon.is_null() && has_theme_icon("icon")) { _icon = Control::get_theme_icon("icon"); @@ -168,15 +204,21 @@ void Button::_notification(int p_what) { } float icon_ofs_region = 0; - if (_internal_margin[MARGIN_LEFT] > 0) { - icon_ofs_region = _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); + if (rtl) { + if (_internal_margin[MARGIN_RIGHT] > 0) { + icon_ofs_region = _internal_margin[MARGIN_RIGHT] + get_theme_constant("hseparation"); + } + } else { + if (_internal_margin[MARGIN_LEFT] > 0) { + icon_ofs_region = _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); + } } if (expand_icon) { Size2 _size = get_size() - style->get_offset() * 2; _size.width -= get_theme_constant("hseparation") + icon_ofs_region; if (!clip_text) { - _size.width -= get_theme_font("font")->get_string_size(xl_text).width; + _size.width -= text_buf->get_size().width; } float icon_width = _icon->get_width() * _size.height / _icon->get_height(); float icon_height = _size.height; @@ -186,14 +228,26 @@ void Button::_notification(int p_what) { icon_height = _icon->get_height() * icon_width / _icon->get_width(); } - icon_region = Rect2(style->get_offset() + Point2(icon_ofs_region, (_size.height - icon_height) / 2), Size2(icon_width, icon_height)); + if (rtl) { + icon_region = Rect2(Point2(size.width - (icon_ofs_region + icon_width + style->get_margin(MARGIN_RIGHT)), style->get_margin(MARGIN_TOP) + (_size.height - icon_height) / 2), Size2(icon_width, icon_height)); + } else { + icon_region = Rect2(style->get_offset() + Point2(icon_ofs_region, (_size.height - icon_height) / 2), Size2(icon_width, icon_height)); + } } else { - icon_region = Rect2(style->get_offset() + Point2(icon_ofs_region, Math::floor((valign - _icon->get_height()) / 2.0)), _icon->get_size()); + if (rtl) { + icon_region = Rect2(Point2(size.width - (icon_ofs_region + _icon->get_size().width + style->get_margin(MARGIN_RIGHT)), style->get_margin(MARGIN_TOP) + Math::floor((valign - _icon->get_height()) / 2.0)), _icon->get_size()); + } else { + icon_region = Rect2(style->get_offset() + Point2(icon_ofs_region, Math::floor((valign - _icon->get_height()) / 2.0)), _icon->get_size()); + } } } Point2 icon_ofs = !_icon.is_null() ? Point2(icon_region.size.width + get_theme_constant("hseparation"), 0) : Point2(); int text_clip = size.width - style->get_minimum_size().width - icon_ofs.width; + text_buf->set_width(clip_text ? text_clip : -1); + + int text_width = clip_text ? MIN(text_clip, text_buf->get_size().x) : text_buf->get_size().x; + if (_internal_margin[MARGIN_LEFT] > 0) { text_clip -= _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); } @@ -201,14 +255,22 @@ void Button::_notification(int p_what) { text_clip -= _internal_margin[MARGIN_RIGHT] + get_theme_constant("hseparation"); } - Point2 text_ofs = (size - style->get_minimum_size() - icon_ofs - font->get_string_size(xl_text) - Point2(_internal_margin[MARGIN_RIGHT] - _internal_margin[MARGIN_LEFT], 0)) / 2.0; + Point2 text_ofs = (size - style->get_minimum_size() - icon_ofs - text_buf->get_size() - Point2(_internal_margin[MARGIN_RIGHT] - _internal_margin[MARGIN_LEFT], 0)) / 2.0; switch (align) { case ALIGN_LEFT: { - if (_internal_margin[MARGIN_LEFT] > 0) { - text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x + _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); + if (rtl) { + if (_internal_margin[MARGIN_RIGHT] > 0) { + text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - text_width - _internal_margin[MARGIN_RIGHT] - get_theme_constant("hseparation"); + } else { + text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - text_width; + } } else { - text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x; + if (_internal_margin[MARGIN_LEFT] > 0) { + text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x + _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); + } else { + text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x; + } } text_ofs.y += style->get_offset().y; } break; @@ -220,17 +282,34 @@ void Button::_notification(int p_what) { text_ofs += style->get_offset(); } break; case ALIGN_RIGHT: { - if (_internal_margin[MARGIN_RIGHT] > 0) { - text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - font->get_string_size(xl_text).x - _internal_margin[MARGIN_RIGHT] - get_theme_constant("hseparation"); + if (rtl) { + if (_internal_margin[MARGIN_LEFT] > 0) { + text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x + _internal_margin[MARGIN_LEFT] + get_theme_constant("hseparation"); + } else { + text_ofs.x = style->get_margin(MARGIN_LEFT) + icon_ofs.x; + } } else { - text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - font->get_string_size(xl_text).x; + if (_internal_margin[MARGIN_RIGHT] > 0) { + text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - text_width - _internal_margin[MARGIN_RIGHT] - get_theme_constant("hseparation"); + } else { + text_ofs.x = size.x - style->get_margin(MARGIN_RIGHT) - text_width; + } } text_ofs.y += style->get_offset().y; } break; } - text_ofs.y += font->get_ascent(); - font->draw(ci, text_ofs.floor(), xl_text, color, clip_text ? text_clip : -1); + if (rtl) { + text_ofs.x -= icon_ofs.x; + } + + Color font_outline_modulate = get_theme_color("font_outline_modulate"); + int outline_size = get_theme_constant("outline_size"); + if (outline_size > 0 && font_outline_modulate.a > 0) { + text_buf->draw_outline(ci, text_ofs.floor(), outline_size, font_outline_modulate); + } + + text_buf->draw(ci, text_ofs.floor(), color); if (!_icon.is_null() && icon_region.size.width > 0) { draw_texture_rect_region(_icon, icon_region, Rect2(Point2(), _icon->get_size()), color_icon); @@ -239,29 +318,90 @@ void Button::_notification(int p_what) { } } +void Button::_shape() { + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + + text_buf->clear(); + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + text_buf->set_direction((TextServer::Direction)text_direction); + } + text_buf->add_string(xl_text, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); +} + void Button::set_text(const String &p_text) { - if (text == p_text) { - return; + if (text != p_text) { + text = p_text; + xl_text = tr(text); + _shape(); + + update(); + _change_notify("text"); + minimum_size_changed(); } - text = p_text; - xl_text = tr(p_text); - update(); - _change_notify("text"); - minimum_size_changed(); } String Button::get_text() const { return text; } -void Button::set_icon(const Ref<Texture2D> &p_icon) { - if (icon == p_icon) { - return; +void Button::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + _shape(); + update(); } - icon = p_icon; +} + +Control::TextDirection Button::get_text_direction() const { + return text_direction; +} + +void Button::clear_opentype_features() { + opentype_features.clear(); + _shape(); update(); - _change_notify("icon"); - minimum_size_changed(); +} + +void Button::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + _shape(); + update(); + } +} + +int Button::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void Button::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + _shape(); + update(); + } +} + +String Button::get_language() const { + return language; +} + +void Button::set_icon(const Ref<Texture2D> &p_icon) { + if (icon != p_icon) { + icon = p_icon; + update(); + _change_notify("icon"); + minimum_size_changed(); + } } Ref<Texture2D> Button::get_icon() const { @@ -269,9 +409,11 @@ Ref<Texture2D> Button::get_icon() const { } void Button::set_expand_icon(bool p_expand_icon) { - expand_icon = p_expand_icon; - update(); - minimum_size_changed(); + if (expand_icon != p_expand_icon) { + expand_icon = p_expand_icon; + update(); + minimum_size_changed(); + } } bool Button::is_expand_icon() const { @@ -279,9 +421,11 @@ bool Button::is_expand_icon() const { } void Button::set_flat(bool p_flat) { - flat = p_flat; - update(); - _change_notify("flat"); + if (flat != p_flat) { + flat = p_flat; + update(); + _change_notify("flat"); + } } bool Button::is_flat() const { @@ -289,9 +433,11 @@ bool Button::is_flat() const { } void Button::set_clip_text(bool p_clip_text) { - clip_text = p_clip_text; - update(); - minimum_size_changed(); + if (clip_text != p_clip_text) { + clip_text = p_clip_text; + update(); + minimum_size_changed(); + } } bool Button::get_clip_text() const { @@ -299,17 +445,76 @@ bool Button::get_clip_text() const { } void Button::set_text_align(TextAlign p_align) { - align = p_align; - update(); + if (align != p_align) { + align = p_align; + update(); + } } Button::TextAlign Button::get_text_align() const { return align; } +bool Button::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + _shape(); + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + _shape(); + update(); + } + } + _change_notify(); + return true; + } + + return false; +} + +bool Button::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + return false; +} + +void Button::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); +} + void Button::_bind_methods() { ClassDB::bind_method(D_METHOD("set_text", "text"), &Button::set_text); ClassDB::bind_method(D_METHOD("get_text"), &Button::get_text); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &Button::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &Button::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &Button::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &Button::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &Button::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &Button::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &Button::get_language); ClassDB::bind_method(D_METHOD("set_button_icon", "texture"), &Button::set_icon); ClassDB::bind_method(D_METHOD("get_button_icon"), &Button::get_icon); ClassDB::bind_method(D_METHOD("set_expand_icon"), &Button::set_expand_icon); @@ -325,7 +530,9 @@ void Button::_bind_methods() { BIND_ENUM_CONSTANT(ALIGN_CENTER); BIND_ENUM_CONSTANT(ALIGN_RIGHT); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_DEFAULT_INTL), "set_text", "get_text"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_MULTILINE_TEXT, "", PROPERTY_USAGE_DEFAULT_INTL), "set_text", "get_text"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "icon", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_button_icon", "get_button_icon"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "flat"), "set_flat", "is_flat"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clip_text"), "set_clip_text", "get_clip_text"); @@ -334,6 +541,9 @@ void Button::_bind_methods() { } Button::Button(const String &p_text) { + text_buf.instance(); + text_buf->set_flags(TextServer::BREAK_MANDATORY); + flat = false; clip_text = false; expand_icon = false; diff --git a/scene/gui/button.h b/scene/gui/button.h index 5b44b1322e..da89e5e6c4 100644 --- a/scene/gui/button.h +++ b/scene/gui/button.h @@ -32,6 +32,7 @@ #define BUTTON_H #include "scene/gui/base_button.h" +#include "scene/resources/text_paragraph.h" class Button : public BaseButton { GDCLASS(Button, BaseButton); @@ -47,23 +48,45 @@ private: bool flat; String text; String xl_text; + Ref<TextParagraph> text_buf; + + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + Ref<Texture2D> icon; bool expand_icon; bool clip_text; TextAlign align; float _internal_margin[4]; + void _shape(); + protected: void _set_internal_margin(Margin p_margin, float p_value); void _notification(int p_what); static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: virtual Size2 get_minimum_size() const override; void set_text(const String &p_text); String get_text() const; + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + void set_icon(const Ref<Texture2D> &p_icon); Ref<Texture2D> get_icon() const; diff --git a/scene/gui/center_container.cpp b/scene/gui/center_container.cpp index f8f9bec3d7..1a72f3ca4d 100644 --- a/scene/gui/center_container.cpp +++ b/scene/gui/center_container.cpp @@ -40,7 +40,7 @@ Size2 CenterContainer::get_minimum_size() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } if (!c->is_visible()) { @@ -77,7 +77,7 @@ void CenterContainer::_notification(int p_what) { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } diff --git a/scene/gui/check_box.cpp b/scene/gui/check_box.cpp index df6f38f65d..0c78369688 100644 --- a/scene/gui/check_box.cpp +++ b/scene/gui/check_box.cpp @@ -68,8 +68,14 @@ Size2 CheckBox::get_minimum_size() const { } void CheckBox::_notification(int p_what) { - if (p_what == NOTIFICATION_THEME_CHANGED) { - _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + if ((p_what == NOTIFICATION_THEME_CHANGED) || (p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED || (p_what == NOTIFICATION_TRANSLATION_CHANGED))) { + if (is_layout_rtl()) { + _set_internal_margin(MARGIN_LEFT, 0.f); + _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + } else { + _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + _set_internal_margin(MARGIN_RIGHT, 0.f); + } } else if (p_what == NOTIFICATION_DRAW) { RID ci = get_canvas_item(); @@ -78,7 +84,11 @@ void CheckBox::_notification(int p_what) { Ref<StyleBox> sb = get_theme_stylebox("normal"); Vector2 ofs; - ofs.x = sb->get_margin(MARGIN_LEFT); + if (is_layout_rtl()) { + ofs.x = get_size().x - sb->get_margin(MARGIN_RIGHT) - get_icon_size().width; + } else { + ofs.x = sb->get_margin(MARGIN_LEFT); + } ofs.y = int((get_size().height - get_icon_size().height) / 2) + get_theme_constant("check_vadjust"); if (is_pressed()) { @@ -96,8 +106,14 @@ bool CheckBox::is_radio() { CheckBox::CheckBox(const String &p_text) : Button(p_text) { set_toggle_mode(true); + set_text_align(ALIGN_LEFT); - _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + + if (is_layout_rtl()) { + _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + } else { + _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + } } CheckBox::~CheckBox() { diff --git a/scene/gui/check_button.cpp b/scene/gui/check_button.cpp index 1ddc730dd1..e58f56a99b 100644 --- a/scene/gui/check_button.cpp +++ b/scene/gui/check_button.cpp @@ -30,7 +30,7 @@ #include "check_button.h" -#include "core/print_string.h" +#include "core/string/print_string.h" #include "servers/rendering_server.h" Size2 CheckButton::get_icon_size() const { @@ -61,19 +61,40 @@ Size2 CheckButton::get_minimum_size() const { } void CheckButton::_notification(int p_what) { - if (p_what == NOTIFICATION_THEME_CHANGED) { - _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + if ((p_what == NOTIFICATION_THEME_CHANGED) || (p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED) || (p_what == NOTIFICATION_TRANSLATION_CHANGED)) { + if (is_layout_rtl()) { + _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + _set_internal_margin(MARGIN_RIGHT, 0.f); + } else { + _set_internal_margin(MARGIN_LEFT, 0.f); + _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + } } else if (p_what == NOTIFICATION_DRAW) { RID ci = get_canvas_item(); + bool rtl = is_layout_rtl(); - Ref<Texture2D> on = Control::get_theme_icon(is_disabled() ? "on_disabled" : "on"); - Ref<Texture2D> off = Control::get_theme_icon(is_disabled() ? "off_disabled" : "off"); + Ref<Texture2D> on; + if (rtl) { + on = Control::get_theme_icon(is_disabled() ? "on_disabled_mirrored" : "on_mirrored"); + } else { + on = Control::get_theme_icon(is_disabled() ? "on_disabled" : "on"); + } + Ref<Texture2D> off; + if (rtl) { + off = Control::get_theme_icon(is_disabled() ? "off_disabled_mirrored" : "off_mirrored"); + } else { + off = Control::get_theme_icon(is_disabled() ? "off_disabled" : "off"); + } Ref<StyleBox> sb = get_theme_stylebox("normal"); Vector2 ofs; Size2 tex_size = get_icon_size(); - ofs.x = get_size().width - (tex_size.width + sb->get_margin(MARGIN_RIGHT)); + if (rtl) { + ofs.x = sb->get_margin(MARGIN_LEFT); + } else { + ofs.x = get_size().width - (tex_size.width + sb->get_margin(MARGIN_RIGHT)); + } ofs.y = (get_size().height - tex_size.height) / 2 + get_theme_constant("check_vadjust"); if (is_pressed()) { @@ -87,8 +108,11 @@ void CheckButton::_notification(int p_what) { CheckButton::CheckButton() { set_toggle_mode(true); set_text_align(ALIGN_LEFT); - - _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + if (is_layout_rtl()) { + _set_internal_margin(MARGIN_LEFT, get_icon_size().width); + } else { + _set_internal_margin(MARGIN_RIGHT, get_icon_size().width); + } } CheckButton::~CheckButton() { diff --git a/scene/gui/code_edit.cpp b/scene/gui/code_edit.cpp index 56cf432b38..59cfbccf99 100644 --- a/scene/gui/code_edit.cpp +++ b/scene/gui/code_edit.cpp @@ -34,9 +34,9 @@ void CodeEdit::_notification(int p_what) { switch (p_what) { case NOTIFICATION_THEME_CHANGED: case NOTIFICATION_ENTER_TREE: { - set_gutter_width(main_gutter, cache.row_height); - set_gutter_width(line_number_gutter, (line_number_digits + 1) * cache.font->get_char_size('0').width); - set_gutter_width(fold_gutter, cache.row_height / 1.2); + set_gutter_width(main_gutter, get_row_height()); + set_gutter_width(line_number_gutter, (line_number_digits + 1) * cache.font->get_char_size('0', 0, cache.font_size).width); + set_gutter_width(fold_gutter, get_row_height() / 1.2); breakpoint_color = get_theme_color("breakpoint_color"); breakpoint_icon = get_theme_icon("breakpoint"); @@ -132,6 +132,7 @@ void CodeEdit::set_line_as_breakpoint(int p_line, bool p_breakpointed) { breakpointed_lines.erase(p_line); } emit_signal("breakpoint_toggled", p_line); + update(); } bool CodeEdit::is_line_breakpointed(int p_line) const { @@ -160,6 +161,7 @@ Array CodeEdit::get_breakpointed_lines() const { void CodeEdit::set_line_as_bookmarked(int p_line, bool p_bookmarked) { int mask = get_line_gutter_metadata(p_line, main_gutter); set_line_gutter_metadata(p_line, main_gutter, p_bookmarked ? mask | MAIN_GUTTER_BOOKMARK : mask & ~MAIN_GUTTER_BOOKMARK); + update(); } bool CodeEdit::is_line_bookmarked(int p_line) const { @@ -188,6 +190,7 @@ Array CodeEdit::get_bookmarked_lines() const { void CodeEdit::set_line_as_executing(int p_line, bool p_executing) { int mask = get_line_gutter_metadata(p_line, main_gutter); set_line_gutter_metadata(p_line, main_gutter, p_executing ? mask | MAIN_GUTTER_EXECUTING : mask & ~MAIN_GUTTER_EXECUTING); + update(); } bool CodeEdit::is_line_executing(int p_line) const { @@ -231,14 +234,16 @@ bool CodeEdit::is_line_numbers_zero_padded() const { } void CodeEdit::_line_number_draw_callback(int p_line, int p_gutter, const Rect2 &p_region) { - String fc = String::num(p_line + 1).lpad(line_number_digits, line_number_padding); - - int yofs = p_region.position.y + (cache.row_height - cache.font->get_height()) / 2; + String fc = TS->format_number(String::num(p_line + 1).lpad(line_number_digits, line_number_padding)); + Ref<TextLine> tl; + tl.instance(); + tl->add_string(fc, cache.font, cache.font_size); + int yofs = p_region.position.y + (get_row_height() - tl->get_size().y) / 2; Color number_color = get_line_gutter_item_color(p_line, line_number_gutter); if (number_color == Color(1, 1, 1)) { number_color = line_number_color; } - cache.font->draw(get_canvas_item(), Point2(p_region.position.x, yofs + cache.font->get_ascent()), fc, number_color); + tl->draw(get_canvas_item(), Point2(p_region.position.x, yofs), number_color); } /* Fold Gutter */ @@ -338,7 +343,10 @@ void CodeEdit::_gutter_clicked(int p_line, int p_gutter) { } if (p_gutter == line_number_gutter) { - cursor_set_line(p_line); + set_selection_mode(TextEdit::SelectionMode::SELECTION_MODE_LINE, p_line, 0); + select(p_line, 0, p_line + 1, 0); + cursor_set_line(p_line + 1); + cursor_set_column(0); return; } @@ -362,7 +370,7 @@ void CodeEdit::_lines_edited_from(int p_from_line, int p_to_line) { while (lc /= 10) { line_number_digits++; } - set_gutter_width(line_number_gutter, (line_number_digits + 1) * cache.font->get_char_size('0').width); + set_gutter_width(line_number_gutter, (line_number_digits + 1) * cache.font->get_char_size('0', 0, cache.font_size).width); int from_line = MIN(p_from_line, p_to_line); int line_count = (p_to_line - p_from_line); @@ -404,6 +412,10 @@ void CodeEdit::_update_gutter_indexes() { } CodeEdit::CodeEdit() { + /* Text Direction */ + set_layout_direction(LAYOUT_DIRECTION_LTR); + set_text_direction(TEXT_DIRECTION_LTR); + /* Gutters */ int gutter_idx = 0; diff --git a/scene/gui/color_picker.cpp b/scene/gui/color_picker.cpp index cbe0367c7b..6ebd1011e9 100644 --- a/scene/gui/color_picker.cpp +++ b/scene/gui/color_picker.cpp @@ -610,12 +610,12 @@ void ColorPicker::_screen_pick_pressed() { if (!screen) { screen = memnew(Control); r->add_child(screen); - screen->set_as_toplevel(true); + screen->set_as_top_level(true); screen->set_anchors_and_margins_preset(Control::PRESET_WIDE); screen->set_default_cursor_shape(CURSOR_POINTING_HAND); screen->connect("gui_input", callable_mp(this, &ColorPicker::_screen_input)); // It immediately toggles off in the first press otherwise. - screen->call_deferred("connect", "hide", Callable(btn_pick, "set_pressed"), varray(false)); + screen->call_deferred("connect", "hidden", Callable(btn_pick, "set_pressed"), varray(false)); } screen->raise(); #ifndef _MSC_VER diff --git a/scene/gui/color_rect.cpp b/scene/gui/color_rect.cpp index 627e589c02..0c38b93c60 100644 --- a/scene/gui/color_rect.cpp +++ b/scene/gui/color_rect.cpp @@ -30,12 +30,12 @@ #include "color_rect.h" -void ColorRect::set_frame_color(const Color &p_color) { +void ColorRect::set_color(const Color &p_color) { color = p_color; update(); } -Color ColorRect::get_frame_color() const { +Color ColorRect::get_color() const { return color; } @@ -46,12 +46,8 @@ void ColorRect::_notification(int p_what) { } void ColorRect::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_frame_color", "color"), &ColorRect::set_frame_color); - ClassDB::bind_method(D_METHOD("get_frame_color"), &ColorRect::get_frame_color); + ClassDB::bind_method(D_METHOD("set_color", "color"), &ColorRect::set_color); + ClassDB::bind_method(D_METHOD("get_color"), &ColorRect::get_color); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_frame_color", "get_frame_color"); -} - -ColorRect::ColorRect() { - color = Color(1, 1, 1); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); } diff --git a/scene/gui/color_rect.h b/scene/gui/color_rect.h index 3df44b9334..61d57f7cca 100644 --- a/scene/gui/color_rect.h +++ b/scene/gui/color_rect.h @@ -36,17 +36,15 @@ class ColorRect : public Control { GDCLASS(ColorRect, Control); - Color color; + Color color = Color(1, 1, 1); protected: void _notification(int p_what); static void _bind_methods(); public: - void set_frame_color(const Color &p_color); - Color get_frame_color() const; - - ColorRect(); + void set_color(const Color &p_color); + Color get_color() const; }; #endif // COLOR_RECT_H diff --git a/scene/gui/container.cpp b/scene/gui/container.cpp index a89eef6209..f01da703c1 100644 --- a/scene/gui/container.cpp +++ b/scene/gui/container.cpp @@ -29,7 +29,7 @@ /*************************************************************************/ #include "container.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" #include "scene/scene_string_names.h" void Container::_child_minsize_changed() { @@ -121,12 +121,7 @@ void Container::fit_child_in_rect(Control *p_child, const Rect2 &p_rect) { } } - for (int i = 0; i < 4; i++) { - p_child->set_anchor(Margin(i), ANCHOR_BEGIN); - } - - p_child->set_position(r.position); - p_child->set_size(r.size); + p_child->set_rect(r); p_child->set_rotation(0); p_child->set_scale(Vector2(1, 1)); } @@ -168,7 +163,7 @@ String Container::get_configuration_warning() const { String warning = Control::get_configuration_warning(); if (get_class() == "Container" && get_script().is_null()) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("Container by itself serves no purpose unless a script configures its children placement behavior.\nIf you don't intend to add a script, use a plain Control node instead."); diff --git a/scene/gui/control.cpp b/scene/gui/control.cpp index 2cdee4641e..bdbb0d4684 100644 --- a/scene/gui/control.cpp +++ b/scene/gui/control.cpp @@ -30,18 +30,21 @@ #include "control.h" +#include "core/config/project_settings.h" #include "core/math/geometry_2d.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" -#include "core/project_settings.h" +#include "core/string/print_string.h" +#include "core/string/translation.h" + #include "scene/gui/label.h" #include "scene/gui/panel.h" #include "scene/main/canvas_layer.h" #include "scene/main/window.h" #include "scene/scene_string_names.h" #include "servers/rendering_server.h" +#include "servers/text_server.h" #ifdef TOOLS_ENABLED #include "editor/editor_settings.h" @@ -220,13 +223,6 @@ bool Control::_set(const StringName &p_name, const Variant &p_value) { } data.icon_override.erase(dname); notification(NOTIFICATION_THEME_CHANGED); - } else if (name.begins_with("custom_shaders/")) { - String dname = name.get_slicec('/', 1); - if (data.shader_override.has(dname)) { - data.shader_override[dname]->disconnect("changed", callable_mp(this, &Control::_override_changed)); - } - data.shader_override.erase(dname); - notification(NOTIFICATION_THEME_CHANGED); } else if (name.begins_with("custom_styles/")) { String dname = name.get_slicec('/', 1); if (data.style_override.has(dname)) { @@ -241,6 +237,10 @@ bool Control::_set(const StringName &p_name, const Variant &p_value) { } data.font_override.erase(dname); notification(NOTIFICATION_THEME_CHANGED); + } else if (name.begins_with("custom_font_sizes/")) { + String dname = name.get_slicec('/', 1); + data.font_size_override.erase(dname); + notification(NOTIFICATION_THEME_CHANGED); } else if (name.begins_with("custom_colors/")) { String dname = name.get_slicec('/', 1); data.color_override.erase(dname); @@ -257,15 +257,15 @@ bool Control::_set(const StringName &p_name, const Variant &p_value) { if (name.begins_with("custom_icons/")) { String dname = name.get_slicec('/', 1); add_theme_icon_override(dname, p_value); - } else if (name.begins_with("custom_shaders/")) { - String dname = name.get_slicec('/', 1); - add_theme_shader_override(dname, p_value); } else if (name.begins_with("custom_styles/")) { String dname = name.get_slicec('/', 1); add_theme_style_override(dname, p_value); } else if (name.begins_with("custom_fonts/")) { String dname = name.get_slicec('/', 1); add_theme_font_override(dname, p_value); + } else if (name.begins_with("custom_font_sizes/")) { + String dname = name.get_slicec('/', 1); + add_theme_font_size_override(dname, p_value); } else if (name.begins_with("custom_colors/")) { String dname = name.get_slicec('/', 1); add_theme_color_override(dname, p_value); @@ -307,20 +307,16 @@ bool Control::_get(const StringName &p_name, Variant &r_ret) const { if (sname.begins_with("custom_icons/")) { String name = sname.get_slicec('/', 1); - r_ret = data.icon_override.has(name) ? Variant(data.icon_override[name]) : Variant(); - } else if (sname.begins_with("custom_shaders/")) { - String name = sname.get_slicec('/', 1); - - r_ret = data.shader_override.has(name) ? Variant(data.shader_override[name]) : Variant(); } else if (sname.begins_with("custom_styles/")) { String name = sname.get_slicec('/', 1); - r_ret = data.style_override.has(name) ? Variant(data.style_override[name]) : Variant(); } else if (sname.begins_with("custom_fonts/")) { String name = sname.get_slicec('/', 1); - r_ret = data.font_override.has(name) ? Variant(data.font_override[name]) : Variant(); + } else if (sname.begins_with("custom_font_sizes/")) { + String name = sname.get_slicec('/', 1); + r_ret = data.font_size_override.has(name) ? Variant(data.font_size_override[name]) : Variant(); } else if (sname.begins_with("custom_colors/")) { String name = sname.get_slicec('/', 1); r_ret = data.color_override.has(name) ? Variant(data.color_override[name]) : Variant(); @@ -339,7 +335,6 @@ void Control::_get_property_list(List<PropertyInfo> *p_list) const { Ref<Theme> theme = Theme::get_default(); /* Using the default theme since the properties below are meant for editor only if (data.theme.is_valid()) { - theme = data.theme; } else { theme = Theme::get_default(); @@ -360,38 +355,38 @@ void Control::_get_property_list(List<PropertyInfo> *p_list) const { } { List<StringName> names; - theme->get_shader_list(get_class_name(), &names); + theme->get_stylebox_list(get_class_name(), &names); for (List<StringName>::Element *E = names.front(); E; E = E->next()) { uint32_t hint = PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_CHECKABLE; - if (data.shader_override.has(E->get())) { + if (data.style_override.has(E->get())) { hint |= PROPERTY_USAGE_STORAGE | PROPERTY_USAGE_CHECKED; } - p_list->push_back(PropertyInfo(Variant::OBJECT, "custom_shaders/" + E->get(), PROPERTY_HINT_RESOURCE_TYPE, "Shader,VisualShader", hint)); + p_list->push_back(PropertyInfo(Variant::OBJECT, "custom_styles/" + E->get(), PROPERTY_HINT_RESOURCE_TYPE, "StyleBox", hint)); } } { List<StringName> names; - theme->get_stylebox_list(get_class_name(), &names); + theme->get_font_list(get_class_name(), &names); for (List<StringName>::Element *E = names.front(); E; E = E->next()) { uint32_t hint = PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_CHECKABLE; - if (data.style_override.has(E->get())) { + if (data.font_override.has(E->get())) { hint |= PROPERTY_USAGE_STORAGE | PROPERTY_USAGE_CHECKED; } - p_list->push_back(PropertyInfo(Variant::OBJECT, "custom_styles/" + E->get(), PROPERTY_HINT_RESOURCE_TYPE, "StyleBox", hint)); + p_list->push_back(PropertyInfo(Variant::OBJECT, "custom_fonts/" + E->get(), PROPERTY_HINT_RESOURCE_TYPE, "Font", hint)); } } { List<StringName> names; - theme->get_font_list(get_class_name(), &names); + theme->get_font_size_list(get_class_name(), &names); for (List<StringName>::Element *E = names.front(); E; E = E->next()) { uint32_t hint = PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_CHECKABLE; - if (data.font_override.has(E->get())) { + if (data.font_size_override.has(E->get())) { hint |= PROPERTY_USAGE_STORAGE | PROPERTY_USAGE_CHECKED; } - p_list->push_back(PropertyInfo(Variant::OBJECT, "custom_fonts/" + E->get(), PROPERTY_HINT_RESOURCE_TYPE, "Font", hint)); + p_list->push_back(PropertyInfo(Variant::INT, "custom_font_sizes/" + E->get(), PROPERTY_HINT_NONE, "", hint)); } } { @@ -424,8 +419,41 @@ Control *Control::get_parent_control() const { return data.parent; } -void Control::_resize(const Size2 &p_size) { - _size_changed(); +void Control::set_layout_direction(Control::LayoutDirection p_direction) { + ERR_FAIL_INDEX((int)p_direction, 4); + + data.layout_dir = p_direction; + propagate_notification(NOTIFICATION_LAYOUT_DIRECTION_CHANGED); +} + +Control::LayoutDirection Control::get_layout_direction() const { + return data.layout_dir; +} + +bool Control::is_layout_rtl() const { + if (data.layout_dir == LAYOUT_DIRECTION_INHERITED) { + Window *parent_window = Object::cast_to<Window>(get_parent()); + Control *parent_control = get_parent_control(); + if (parent_control) { + return parent_control->is_layout_rtl(); + } else if (parent_window) { + return parent_window->is_layout_rtl(); + } else { + if (GLOBAL_GET("display/window/force_right_to_left_layout_direction")) { + return true; + } + String locale = TranslationServer::get_singleton()->get_tool_locale(); + return TS->is_locale_right_to_left(locale); + } + } else if (data.layout_dir == LAYOUT_DIRECTION_LOCALE) { + if (GLOBAL_GET("display/window/force_right_to_left_layout_direction")) { + return true; + } + String locale = TranslationServer::get_singleton()->get_tool_locale(); + return TS->is_locale_right_to_left(locale); + } else { + return (data.layout_dir == LAYOUT_DIRECTION_RTL); + } } //moved theme configuration here, so controls can set up even if still not inside active scene @@ -493,7 +521,7 @@ void Control::_notification(int p_notification) { } CanvasItem *ci = Object::cast_to<CanvasItem>(parent); - if (ci && ci->is_set_as_toplevel()) { + if (ci && ci->is_set_as_top_level()) { subwindow = true; break; } @@ -509,13 +537,13 @@ void Control::_notification(int p_notification) { } if (parent_control && !subwindow) { - //do nothing, has a parent control and not toplevel + //do nothing, has a parent control and not top_level if (data.theme.is_null() && parent_control->data.theme_owner) { data.theme_owner = parent_control->data.theme_owner; notification(NOTIFICATION_THEME_CHANGED); } } else { - //is a regular root control or toplevel + //is a regular root control or top_level data.RI = get_viewport()->_gui_add_root_control(this); } @@ -532,7 +560,7 @@ void Control::_notification(int p_notification) { if (data.parent_canvas_item) { data.parent_canvas_item->disconnect("item_rect_changed", callable_mp(this, &Control::_size_changed)); data.parent_canvas_item = nullptr; - } else if (!is_set_as_toplevel()) { + } else if (!is_set_as_top_level()) { //disconnect viewport get_viewport()->disconnect("size_changed", callable_mp(this, &Control::_size_changed)); } @@ -582,7 +610,6 @@ void Control::_notification(int p_notification) { case NOTIFICATION_FOCUS_EXIT: { emit_signal(SceneStringNames::get_singleton()->focus_exited); update(); - } break; case NOTIFICATION_THEME_CHANGED: { minimum_size_changed(); @@ -591,7 +618,7 @@ void Control::_notification(int p_notification) { case NOTIFICATION_VISIBILITY_CHANGED: { if (!is_visible_in_tree()) { if (get_viewport() != nullptr) { - get_viewport()->_gui_hid_control(this); + get_viewport()->_gui_hide_control(this); } //remove key focus @@ -602,6 +629,10 @@ void Control::_notification(int p_notification) { } } break; + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + _size_changed(); + } break; } } @@ -728,13 +759,13 @@ Size2 Control::get_minimum_size() const { } template <class T> -bool Control::_find_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, T &r_ret, T (Theme::*get_func)(const StringName &, const StringName &) const, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_type) { +bool Control::_find_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, T &r_ret, T (Theme::*get_func)(const StringName &, const StringName &) const, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_node_type) { // try with custom themes Control *theme_owner = p_theme_owner; Window *theme_owner_window = p_theme_owner_window; while (theme_owner || theme_owner_window) { - StringName class_name = p_type; + StringName class_name = p_node_type; while (class_name != StringName()) { if (theme_owner && (theme_owner->data.theme.operator->()->*has_func)(p_name, class_name)) { @@ -771,13 +802,13 @@ bool Control::_find_theme_item(Control *p_theme_owner, Window *p_theme_owner_win return false; } -bool Control::_has_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_type) { +bool Control::_has_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_node_type) { // try with custom themes Control *theme_owner = p_theme_owner; Window *theme_owner_window = p_theme_owner_window; while (theme_owner || theme_owner_window) { - StringName class_name = p_type; + StringName class_name = p_node_type; while (class_name != StringName()) { if (theme_owner && (theme_owner->data.theme.operator->()->*has_func)(p_name, class_name)) { @@ -812,176 +843,176 @@ bool Control::_has_theme_item(Control *p_theme_owner, Window *p_theme_owner_wind return false; } -Ref<Texture2D> Control::get_theme_icon(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +Ref<Texture2D> Control::get_theme_icon(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { const Ref<Texture2D> *tex = data.icon_override.getptr(p_name); if (tex) { return *tex; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return get_icons(data.theme_owner, data.theme_owner_window, p_name, type); } -Ref<Texture2D> Control::get_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { +Ref<Texture2D> Control::get_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { Ref<Texture2D> icon; - if (_find_theme_item(p_theme_owner, p_theme_owner_window, icon, &Theme::get_icon, &Theme::has_icon, p_name, p_type)) { + if (_find_theme_item(p_theme_owner, p_theme_owner_window, icon, &Theme::get_icon, &Theme::has_icon, p_name, p_node_type)) { return icon; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_icon(p_name, p_type)) { - return Theme::get_project_default()->get_icon(p_name, p_type); - } - } - - return Theme::get_default()->get_icon(p_name, p_type); -} - -Ref<Shader> Control::get_theme_shader(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { - const Ref<Shader> *sdr = data.shader_override.getptr(p_name); - if (sdr) { - return *sdr; - } - } - - StringName type = p_type ? p_type : get_class_name(); - - return get_shaders(data.theme_owner, data.theme_owner_window, p_name, type); -} - -Ref<Shader> Control::get_shaders(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - Ref<Shader> shader; - - if (_find_theme_item(p_theme_owner, p_theme_owner_window, shader, &Theme::get_shader, &Theme::has_shader, p_name, p_type)) { - return shader; - } - - if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_shader(p_name, p_type)) { - return Theme::get_project_default()->get_shader(p_name, p_type); + if (Theme::get_project_default()->has_icon(p_name, p_node_type)) { + return Theme::get_project_default()->get_icon(p_name, p_node_type); } } - return Theme::get_default()->get_shader(p_name, p_type); + return Theme::get_default()->get_icon(p_name, p_node_type); } -Ref<StyleBox> Control::get_theme_stylebox(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +Ref<StyleBox> Control::get_theme_stylebox(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { const Ref<StyleBox> *style = data.style_override.getptr(p_name); if (style) { return *style; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return get_styleboxs(data.theme_owner, data.theme_owner_window, p_name, type); } -Ref<StyleBox> Control::get_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { +Ref<StyleBox> Control::get_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { Ref<StyleBox> stylebox; - if (_find_theme_item(p_theme_owner, p_theme_owner_window, stylebox, &Theme::get_stylebox, &Theme::has_stylebox, p_name, p_type)) { + if (_find_theme_item(p_theme_owner, p_theme_owner_window, stylebox, &Theme::get_stylebox, &Theme::has_stylebox, p_name, p_node_type)) { return stylebox; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_stylebox(p_name, p_type)) { - return Theme::get_project_default()->get_stylebox(p_name, p_type); + if (Theme::get_project_default()->has_stylebox(p_name, p_node_type)) { + return Theme::get_project_default()->get_stylebox(p_name, p_node_type); } } - return Theme::get_default()->get_stylebox(p_name, p_type); + return Theme::get_default()->get_stylebox(p_name, p_node_type); } -Ref<Font> Control::get_theme_font(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +Ref<Font> Control::get_theme_font(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { const Ref<Font> *font = data.font_override.getptr(p_name); if (font) { return *font; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return get_fonts(data.theme_owner, data.theme_owner_window, p_name, type); } -Ref<Font> Control::get_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { +int Control::get_theme_font_size(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { + const int *font_size = data.font_size_override.getptr(p_name); + if (font_size) { + return *font_size; + } + } + + StringName type = p_node_type ? p_node_type : get_class_name(); + + return get_font_sizes(data.theme_owner, data.theme_owner_window, p_name, type); +} + +Ref<Font> Control::get_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { Ref<Font> font; - if (_find_theme_item(p_theme_owner, p_theme_owner_window, font, &Theme::get_font, &Theme::has_font, p_name, p_type)) { + if (_find_theme_item(p_theme_owner, p_theme_owner_window, font, &Theme::get_font, &Theme::has_font, p_name, p_node_type)) { return font; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_font(p_name, p_type)) { - return Theme::get_project_default()->get_font(p_name, p_type); + if (Theme::get_project_default()->has_font(p_name, p_node_type)) { + return Theme::get_project_default()->get_font(p_name, p_node_type); + } + } + + return Theme::get_default()->get_font(p_name, p_node_type); +} + +int Control::get_font_sizes(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + int font_size; + + if (_find_theme_item(p_theme_owner, p_theme_owner_window, font_size, &Theme::get_font_size, &Theme::has_font_size, p_name, p_node_type)) { + return font_size; + } + + if (Theme::get_project_default().is_valid()) { + if (Theme::get_project_default()->has_font_size(p_name, p_node_type)) { + return Theme::get_project_default()->get_font_size(p_name, p_node_type); } } - return Theme::get_default()->get_font(p_name, p_type); + return Theme::get_default()->get_font_size(p_name, p_node_type); } -Color Control::get_theme_color(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +Color Control::get_theme_color(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { const Color *color = data.color_override.getptr(p_name); if (color) { return *color; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return get_colors(data.theme_owner, data.theme_owner_window, p_name, type); } -Color Control::get_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { +Color Control::get_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { Color color; - if (_find_theme_item(p_theme_owner, p_theme_owner_window, color, &Theme::get_color, &Theme::has_color, p_name, p_type)) { + if (_find_theme_item(p_theme_owner, p_theme_owner_window, color, &Theme::get_color, &Theme::has_color, p_name, p_node_type)) { return color; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_color(p_name, p_type)) { - return Theme::get_project_default()->get_color(p_name, p_type); + if (Theme::get_project_default()->has_color(p_name, p_node_type)) { + return Theme::get_project_default()->get_color(p_name, p_node_type); } } - return Theme::get_default()->get_color(p_name, p_type); + return Theme::get_default()->get_color(p_name, p_node_type); } -int Control::get_theme_constant(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +int Control::get_theme_constant(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { const int *constant = data.constant_override.getptr(p_name); if (constant) { return *constant; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return get_constants(data.theme_owner, data.theme_owner_window, p_name, type); } -int Control::get_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { +int Control::get_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { int constant; - if (_find_theme_item(p_theme_owner, p_theme_owner_window, constant, &Theme::get_constant, &Theme::has_constant, p_name, p_type)) { + if (_find_theme_item(p_theme_owner, p_theme_owner_window, constant, &Theme::get_constant, &Theme::has_constant, p_name, p_node_type)) { return constant; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_constant(p_name, p_type)) { - return Theme::get_project_default()->get_constant(p_name, p_type); + if (Theme::get_project_default()->has_constant(p_name, p_node_type)) { + return Theme::get_project_default()->get_constant(p_name, p_node_type); } } - return Theme::get_default()->get_constant(p_name, p_type); + return Theme::get_default()->get_constant(p_name, p_node_type); } bool Control::has_theme_icon_override(const StringName &p_name) const { @@ -989,11 +1020,6 @@ bool Control::has_theme_icon_override(const StringName &p_name) const { return tex != nullptr; } -bool Control::has_theme_shader_override(const StringName &p_name) const { - const Ref<Shader> *sdr = data.shader_override.getptr(p_name); - return sdr != nullptr; -} - bool Control::has_theme_stylebox_override(const StringName &p_name) const { const Ref<StyleBox> *style = data.style_override.getptr(p_name); return style != nullptr; @@ -1004,6 +1030,11 @@ bool Control::has_theme_font_override(const StringName &p_name) const { return font != nullptr; } +bool Control::has_theme_font_size_override(const StringName &p_name) const { + const int *font_size = data.font_size_override.getptr(p_name); + return font_size != nullptr; +} + bool Control::has_theme_color_override(const StringName &p_name) const { const Color *color = data.color_override.getptr(p_name); return color != nullptr; @@ -1014,154 +1045,154 @@ bool Control::has_theme_constant_override(const StringName &p_name) const { return constant != nullptr; } -bool Control::has_theme_icon(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +bool Control::has_theme_icon(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { if (has_theme_icon_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return has_icons(data.theme_owner, data.theme_owner_window, p_name, type); } -bool Control::has_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_icon, p_name, p_type)) { +bool Control::has_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_icon, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_color(p_name, p_type)) { + if (Theme::get_project_default()->has_color(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_icon(p_name, p_type); + return Theme::get_default()->has_icon(p_name, p_node_type); } -bool Control::has_theme_shader(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { - if (has_theme_shader_override(p_name)) { +bool Control::has_theme_stylebox(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { + if (has_theme_stylebox_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); - return has_shaders(data.theme_owner, data.theme_owner_window, p_name, type); + return has_styleboxs(data.theme_owner, data.theme_owner_window, p_name, type); } -bool Control::has_shaders(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_shader, p_name, p_type)) { +bool Control::has_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_stylebox, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_shader(p_name, p_type)) { + if (Theme::get_project_default()->has_stylebox(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_shader(p_name, p_type); + return Theme::get_default()->has_stylebox(p_name, p_node_type); } -bool Control::has_theme_stylebox(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { - if (has_theme_stylebox_override(p_name)) { +bool Control::has_theme_font(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { + if (has_theme_font_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); - return has_styleboxs(data.theme_owner, data.theme_owner_window, p_name, type); + return has_fonts(data.theme_owner, data.theme_owner_window, p_name, type); } -bool Control::has_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_stylebox, p_name, p_type)) { +bool Control::has_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_font, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_stylebox(p_name, p_type)) { + if (Theme::get_project_default()->has_font(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_stylebox(p_name, p_type); + return Theme::get_default()->has_font(p_name, p_node_type); } -bool Control::has_theme_font(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { - if (has_theme_font_override(p_name)) { +bool Control::has_theme_font_size(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { + if (has_theme_font_size_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); - return has_fonts(data.theme_owner, data.theme_owner_window, p_name, type); + return has_font_sizes(data.theme_owner, data.theme_owner_window, p_name, type); } -bool Control::has_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_font, p_name, p_type)) { +bool Control::has_font_sizes(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_font_size, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_font(p_name, p_type)) { + if (Theme::get_project_default()->has_font_size(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_font(p_name, p_type); + return Theme::get_default()->has_font_size(p_name, p_node_type); } -bool Control::has_theme_color(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +bool Control::has_theme_color(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { if (has_theme_color_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); return has_colors(data.theme_owner, data.theme_owner_window, p_name, type); } -bool Control::has_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_color, p_name, p_type)) { +bool Control::has_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_color, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_color(p_name, p_type)) { + if (Theme::get_project_default()->has_color(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_color(p_name, p_type); + return Theme::get_default()->has_color(p_name, p_node_type); } -bool Control::has_theme_constant(const StringName &p_name, const StringName &p_type) const { - if (p_type == StringName() || p_type == get_class_name()) { +bool Control::has_theme_constant(const StringName &p_name, const StringName &p_node_type) const { + if (p_node_type == StringName() || p_node_type == get_class_name()) { if (has_theme_constant_override(p_name)) { return true; } } - StringName type = p_type ? p_type : get_class_name(); + StringName type = p_node_type ? p_node_type : get_class_name(); - return has_constants(data.theme_owner, data.theme_owner_window, p_name, p_type); + return has_constants(data.theme_owner, data.theme_owner_window, p_name, p_node_type); } -bool Control::has_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type) { - if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_constant, p_name, p_type)) { +bool Control::has_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type) { + if (_has_theme_item(p_theme_owner, p_theme_owner_window, &Theme::has_constant, p_name, p_node_type)) { return true; } if (Theme::get_project_default().is_valid()) { - if (Theme::get_project_default()->has_constant(p_name, p_type)) { + if (Theme::get_project_default()->has_constant(p_name, p_node_type)) { return true; } } - return Theme::get_default()->has_constant(p_name, p_type); + return Theme::get_default()->has_constant(p_name, p_node_type); } Rect2 Control::get_parent_anchorable_rect() const { @@ -1218,6 +1249,10 @@ void Control::_size_changed() { new_size_cache.width = minimum_size.width; } + if (is_layout_rtl()) { + new_pos_cache.x = parent_rect.size.x - new_pos_cache.x - new_size_cache.x; + } + if (minimum_size.height > new_size_cache.height) { if (data.v_grow == GROW_DIRECTION_BEGIN) { new_pos_cache.y += new_size_cache.height - minimum_size.height; @@ -1427,6 +1462,10 @@ void Control::set_margins_preset(LayoutPreset p_preset, LayoutPresetMode p_resiz Rect2 parent_rect = get_parent_anchorable_rect(); + float x = parent_rect.size.x; + if (is_layout_rtl()) { + x = parent_rect.size.x - x - new_size.x; + } //Left switch (p_preset) { case PRESET_TOP_LEFT: @@ -1437,21 +1476,21 @@ void Control::set_margins_preset(LayoutPreset p_preset, LayoutPresetMode p_resiz case PRESET_LEFT_WIDE: case PRESET_HCENTER_WIDE: case PRESET_WIDE: - data.margin[0] = parent_rect.size.x * (0.0 - data.anchor[0]) + p_margin + parent_rect.position.x; + data.margin[0] = x * (0.0 - data.anchor[0]) + p_margin + parent_rect.position.x; break; case PRESET_CENTER_TOP: case PRESET_CENTER_BOTTOM: case PRESET_CENTER: case PRESET_VCENTER_WIDE: - data.margin[0] = parent_rect.size.x * (0.5 - data.anchor[0]) - new_size.x / 2 + parent_rect.position.x; + data.margin[0] = x * (0.5 - data.anchor[0]) - new_size.x / 2 + parent_rect.position.x; break; case PRESET_TOP_RIGHT: case PRESET_BOTTOM_RIGHT: case PRESET_CENTER_RIGHT: case PRESET_RIGHT_WIDE: - data.margin[0] = parent_rect.size.x * (1.0 - data.anchor[0]) - new_size.x - p_margin + parent_rect.position.x; + data.margin[0] = x * (1.0 - data.anchor[0]) - new_size.x - p_margin + parent_rect.position.x; break; } @@ -1489,14 +1528,14 @@ void Control::set_margins_preset(LayoutPreset p_preset, LayoutPresetMode p_resiz case PRESET_BOTTOM_LEFT: case PRESET_CENTER_LEFT: case PRESET_LEFT_WIDE: - data.margin[2] = parent_rect.size.x * (0.0 - data.anchor[2]) + new_size.x + p_margin + parent_rect.position.x; + data.margin[2] = x * (0.0 - data.anchor[2]) + new_size.x + p_margin + parent_rect.position.x; break; case PRESET_CENTER_TOP: case PRESET_CENTER_BOTTOM: case PRESET_CENTER: case PRESET_VCENTER_WIDE: - data.margin[2] = parent_rect.size.x * (0.5 - data.anchor[2]) + new_size.x / 2 + parent_rect.position.x; + data.margin[2] = x * (0.5 - data.anchor[2]) + new_size.x / 2 + parent_rect.position.x; break; case PRESET_TOP_RIGHT: @@ -1507,7 +1546,7 @@ void Control::set_margins_preset(LayoutPreset p_preset, LayoutPresetMode p_resiz case PRESET_BOTTOM_WIDE: case PRESET_HCENTER_WIDE: case PRESET_WIDE: - data.margin[2] = parent_rect.size.x * (1.0 - data.anchor[2]) - p_margin + parent_rect.position.x; + data.margin[2] = x * (1.0 - data.anchor[2]) - p_margin + parent_rect.position.x; break; } @@ -1630,17 +1669,26 @@ void Control::_compute_anchors(Rect2 p_rect, const float p_margins[4], float (&r ERR_FAIL_COND(parent_rect_size.x == 0.0); ERR_FAIL_COND(parent_rect_size.y == 0.0); - r_anchors[0] = (p_rect.position.x - p_margins[0]) / parent_rect_size.x; + float x = p_rect.position.x; + if (is_layout_rtl()) { + x = parent_rect_size.x - x - p_rect.size.x; + } + r_anchors[0] = (x - p_margins[0]) / parent_rect_size.x; r_anchors[1] = (p_rect.position.y - p_margins[1]) / parent_rect_size.y; - r_anchors[2] = (p_rect.position.x + p_rect.size.x - p_margins[2]) / parent_rect_size.x; + r_anchors[2] = (x + p_rect.size.x - p_margins[2]) / parent_rect_size.x; r_anchors[3] = (p_rect.position.y + p_rect.size.y - p_margins[3]) / parent_rect_size.y; } void Control::_compute_margins(Rect2 p_rect, const float p_anchors[4], float (&r_margins)[4]) { Size2 parent_rect_size = get_parent_anchorable_rect().size; - r_margins[0] = p_rect.position.x - (p_anchors[0] * parent_rect_size.x); + + float x = p_rect.position.x; + if (is_layout_rtl()) { + x = parent_rect_size.x - x - p_rect.size.x; + } + r_margins[0] = x - (p_anchors[0] * parent_rect_size.x); r_margins[1] = p_rect.position.y - (p_anchors[1] * parent_rect_size.y); - r_margins[2] = p_rect.position.x + p_rect.size.x - (p_anchors[2] * parent_rect_size.x); + r_margins[2] = x + p_rect.size.x - (p_anchors[2] * parent_rect_size.x); r_margins[3] = p_rect.position.y + p_rect.size.y - (p_anchors[3] * parent_rect_size.y); } @@ -1661,6 +1709,17 @@ void Control::set_position(const Size2 &p_point, bool p_keep_margins) { _size_changed(); } +void Control::set_rect(const Rect2 &p_rect) { + for (int i = 0; i < 4; i++) { + data.anchor[i] = ANCHOR_BEGIN; + } + + _compute_margins(p_rect, data.anchor, data.margin); + if (is_inside_tree()) { + _size_changed(); + } +} + void Control::_set_size(const Size2 &p_size) { set_size(p_size); } @@ -1744,23 +1803,6 @@ void Control::add_theme_icon_override(const StringName &p_name, const Ref<Textur notification(NOTIFICATION_THEME_CHANGED); } -void Control::add_theme_shader_override(const StringName &p_name, const Ref<Shader> &p_shader) { - if (data.shader_override.has(p_name)) { - data.shader_override[p_name]->disconnect("changed", callable_mp(this, &Control::_override_changed)); - } - - // clear if "null" is passed instead of a shader - if (p_shader.is_null()) { - data.shader_override.erase(p_name); - } else { - data.shader_override[p_name] = p_shader; - if (data.shader_override[p_name].is_valid()) { - data.shader_override[p_name]->connect("changed", callable_mp(this, &Control::_override_changed), Vector<Variant>(), CONNECT_REFERENCE_COUNTED); - } - } - notification(NOTIFICATION_THEME_CHANGED); -} - void Control::add_theme_style_override(const StringName &p_name, const Ref<StyleBox> &p_style) { if (data.style_override.has(p_name)) { data.style_override[p_name]->disconnect("changed", callable_mp(this, &Control::_override_changed)); @@ -1795,6 +1837,11 @@ void Control::add_theme_font_override(const StringName &p_name, const Ref<Font> notification(NOTIFICATION_THEME_CHANGED); } +void Control::add_theme_font_size_override(const StringName &p_name, int p_font_size) { + data.font_size_override[p_name] = p_font_size; + notification(NOTIFICATION_THEME_CHANGED); +} + void Control::add_theme_color_override(const StringName &p_name, const Color &p_color) { data.color_override[p_name] = p_color; notification(NOTIFICATION_THEME_CHANGED); @@ -1816,7 +1863,7 @@ void Control::set_focus_mode(FocusMode p_focus_mode) { } static Control *_next_control(Control *p_from) { - if (p_from->is_set_as_toplevel()) { + if (p_from->is_set_as_top_level()) { return nullptr; // can't go above } @@ -1830,7 +1877,7 @@ static Control *_next_control(Control *p_from) { ERR_FAIL_INDEX_V(next, parent->get_child_count(), nullptr); for (int i = (next + 1); i < parent->get_child_count(); i++) { Control *c = Object::cast_to<Control>(parent->get_child(i)); - if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) { + if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) { continue; } @@ -1867,7 +1914,7 @@ Control *Control::find_next_valid_focus() const { for (int i = 0; i < from->get_child_count(); i++) { Control *c = Object::cast_to<Control>(from->get_child(i)); - if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) { + if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) { continue; } @@ -1879,7 +1926,7 @@ Control *Control::find_next_valid_focus() const { next_child = _next_control(from); if (!next_child) { //nothing else.. go up and find either window or subwindow next_child = const_cast<Control *>(this); - while (next_child && !next_child->is_set_as_toplevel()) { + while (next_child && !next_child->is_set_as_top_level()) { next_child = cast_to<Control>(next_child->get_parent()); } @@ -1915,7 +1962,7 @@ static Control *_prev_control(Control *p_from) { Control *child = nullptr; for (int i = p_from->get_child_count() - 1; i >= 0; i--) { Control *c = Object::cast_to<Control>(p_from->get_child(i)); - if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) { + if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) { continue; } @@ -1955,7 +2002,7 @@ Control *Control::find_prev_valid_focus() const { Control *prev_child = nullptr; - if (from->is_set_as_toplevel() || !Object::cast_to<Control>(from->get_parent())) { + if (from->is_set_as_top_level() || !Object::cast_to<Control>(from->get_parent())) { //find last of the children prev_child = _prev_control(from); @@ -1964,7 +2011,7 @@ Control *Control::find_prev_valid_focus() const { for (int i = (from->get_index() - 1); i >= 0; i--) { Control *c = Object::cast_to<Control>(from->get_parent()->get_child(i)); - if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) { + if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) { continue; } @@ -2023,8 +2070,8 @@ void Control::release_focus() { update(); } -bool Control::is_toplevel_control() const { - return is_inside_tree() && (!data.parent_canvas_item && !data.RI && is_set_as_toplevel()); +bool Control::is_top_level_control() const { + return is_inside_tree() && (!data.parent_canvas_item && !data.RI && is_set_as_top_level()); } void Control::_propagate_theme_changed(Node *p_at, Control *p_owner, Window *p_owner_window, bool p_assign) { @@ -2159,14 +2206,14 @@ String Control::_get_tooltip() const { return data.tooltip; } -void Control::set_focus_neighbour(Margin p_margin, const NodePath &p_neighbour) { +void Control::set_focus_neighbor(Margin p_margin, const NodePath &p_neighbor) { ERR_FAIL_INDEX((int)p_margin, 4); - data.focus_neighbour[p_margin] = p_neighbour; + data.focus_neighbor[p_margin] = p_neighbor; } -NodePath Control::get_focus_neighbour(Margin p_margin) const { +NodePath Control::get_focus_neighbor(Margin p_margin) const { ERR_FAIL_INDEX_V((int)p_margin, 4, NodePath()); - return data.focus_neighbour[p_margin]; + return data.focus_neighbor[p_margin]; } void Control::set_focus_next(const NodePath &p_next) { @@ -2185,17 +2232,17 @@ NodePath Control::get_focus_previous() const { return data.focus_prev; } -#define MAX_NEIGHBOUR_SEARCH_COUNT 512 +#define MAX_NEIGHBOR_SEARCH_COUNT 512 -Control *Control::_get_focus_neighbour(Margin p_margin, int p_count) { +Control *Control::_get_focus_neighbor(Margin p_margin, int p_count) { ERR_FAIL_INDEX_V((int)p_margin, 4, nullptr); - if (p_count >= MAX_NEIGHBOUR_SEARCH_COUNT) { + if (p_count >= MAX_NEIGHBOR_SEARCH_COUNT) { return nullptr; } - if (!data.focus_neighbour[p_margin].is_empty()) { + if (!data.focus_neighbor[p_margin].is_empty()) { Control *c = nullptr; - Node *n = get_node(data.focus_neighbour[p_margin]); + Node *n = get_node(data.focus_neighbor[p_margin]); if (n) { c = Object::cast_to<Control>(n); ERR_FAIL_COND_V_MSG(!c, nullptr, "Neighbor focus node is not a control: " + n->get_name() + "."); @@ -2213,7 +2260,7 @@ Control *Control::_get_focus_neighbour(Margin p_margin, int p_count) { return c; } - c = c->_get_focus_neighbour(p_margin, p_count + 1); + c = c->_get_focus_neighbor(p_margin, p_count + 1); return c; } @@ -2263,12 +2310,12 @@ Control *Control::_get_focus_neighbour(Margin p_margin, int p_count) { return nullptr; } - _window_find_focus_neighbour(vdir, base, points, maxd, dist, &result); + _window_find_focus_neighbor(vdir, base, points, maxd, dist, &result); return result; } -void Control::_window_find_focus_neighbour(const Vector2 &p_dir, Node *p_at, const Point2 *p_points, float p_min, float &r_closest_dist, Control **r_closest) { +void Control::_window_find_focus_neighbor(const Vector2 &p_dir, Node *p_at, const Point2 *p_points, float p_min, float &r_closest_dist, Control **r_closest) { if (Object::cast_to<Viewport>(p_at)) { return; //bye } @@ -2321,7 +2368,7 @@ void Control::_window_find_focus_neighbour(const Vector2 &p_dir, Node *p_at, con if (childc && childc->data.RI) { continue; //subwindow, ignore } - _window_find_focus_neighbour(p_dir, p_at->get_child(i), p_points, p_min, r_closest_dist, r_closest); + _window_find_focus_neighbor(p_dir, p_at->get_child(i), p_points, p_min, r_closest_dist, r_closest); } } @@ -2374,7 +2421,7 @@ void Control::minimum_size_changed() { //invalidate cache upwards while (invalidate && invalidate->data.minimum_size_valid) { invalidate->data.minimum_size_valid = false; - if (invalidate->is_set_as_toplevel()) { + if (invalidate->is_set_as_top_level()) { break; // do not go further up } if (!invalidate->data.parent && get_parent()) { @@ -2437,6 +2484,95 @@ bool Control::is_text_field() const { return false; } +Vector<Vector2i> Control::structured_text_parser(StructuredTextParser p_node_type, const Array &p_args, const String p_text) const { + Vector<Vector2i> ret; + switch (p_node_type) { + case STRUCTURED_TEXT_URI: { + int prev = 0; + for (int i = 0; i < p_text.length(); i++) { + if ((p_text[i] == '\\') || (p_text[i] == '/') || (p_text[i] == '.') || (p_text[i] == ':') || (p_text[i] == '&') || (p_text[i] == '=') || (p_text[i] == '@') || (p_text[i] == '?') || (p_text[i] == '#')) { + if (prev != i) { + ret.push_back(Vector2i(prev, i)); + } + ret.push_back(Vector2i(i, i + 1)); + prev = i + 1; + } + } + if (prev != p_text.length()) { + ret.push_back(Vector2i(prev, p_text.length())); + } + } break; + case STRUCTURED_TEXT_FILE: { + int prev = 0; + for (int i = 0; i < p_text.length(); i++) { + if ((p_text[i] == '\\') || (p_text[i] == '/') || (p_text[i] == ':')) { + if (prev != i) { + ret.push_back(Vector2i(prev, i)); + } + ret.push_back(Vector2i(i, i + 1)); + prev = i + 1; + } + } + if (prev != p_text.length()) { + ret.push_back(Vector2i(prev, p_text.length())); + } + } break; + case STRUCTURED_TEXT_EMAIL: { + bool local = true; + int prev = 0; + for (int i = 0; i < p_text.length(); i++) { + if ((p_text[i] == '@') && local) { // Add full "local" as single context. + local = false; + ret.push_back(Vector2i(prev, i)); + ret.push_back(Vector2i(i, i + 1)); + prev = i + 1; + } else if (!local & (p_text[i] == '.')) { // Add each dot separated "domain" part as context. + if (prev != i) { + ret.push_back(Vector2i(prev, i)); + } + ret.push_back(Vector2i(i, i + 1)); + prev = i + 1; + } + } + if (prev != p_text.length()) { + ret.push_back(Vector2i(prev, p_text.length())); + } + } break; + case STRUCTURED_TEXT_LIST: { + if (p_args.size() == 1 && p_args[0].get_type() == Variant::STRING) { + Vector<String> tags = p_text.split(String(p_args[0])); + int prev = 0; + for (int i = 0; i < tags.size(); i++) { + if (prev != i) { + ret.push_back(Vector2i(prev, prev + tags[i].length())); + } + ret.push_back(Vector2i(prev + tags[i].length(), prev + tags[i].length() + 1)); + prev = prev + tags[i].length() + 1; + } + } + } break; + case STRUCTURED_TEXT_CUSTOM: { + if (get_script_instance()) { + Variant data = get_script_instance()->call(SceneStringNames::get_singleton()->_structured_text_parser, p_args, p_text); + if (data.get_type() == Variant::ARRAY) { + Array _data = data; + for (int i = 0; i < _data.size(); i++) { + if (_data[i].get_type() == Variant::VECTOR2I) { + ret.push_back(Vector2i(_data[i])); + } + } + } + } + } break; + case STRUCTURED_TEXT_NONE: + case STRUCTURED_TEXT_DEFAULT: + default: { + ret.push_back(Vector2i(0, p_text.length())); + } + } + return ret; +} + void Control::set_rotation(float p_radians) { data.rotation = p_radians; update(); @@ -2499,7 +2635,7 @@ Control *Control::get_root_parent_control() const { if (c) { root = c; - if (c->data.RI || c->is_toplevel_control()) { + if (c->data.RI || c->is_top_level_control()) { break; } } @@ -2545,6 +2681,8 @@ void Control::get_argument_options(const StringName &p_function, int p_idx, List Theme::get_default()->get_stylebox_list(get_class(), &sn); } else if (pf == "add_font_override" || pf == "has_font" || pf == "has_font_override" || pf == "get_font") { Theme::get_default()->get_font_list(get_class(), &sn); + } else if (pf == "add_font_size_override" || pf == "has_font_size" || pf == "has_font_size_override" || pf == "get_font_size") { + Theme::get_default()->get_font_size_list(get_class(), &sn); } else if (pf == "add_constant_override" || pf == "has_constant" || pf == "has_constant_override" || pf == "get_constant") { Theme::get_default()->get_constant_list(get_class(), &sn); } @@ -2560,7 +2698,7 @@ String Control::get_configuration_warning() const { String warning = CanvasItem::get_configuration_warning(); if (data.mouse_filter == MOUSE_FILTER_IGNORE && data.tooltip != "") { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("The Hint Tooltip won't be displayed as the control's Mouse Filter is set to \"Ignore\". To solve this, set the Mouse Filter to \"Stop\" or \"Pass\"."); @@ -2662,30 +2800,32 @@ void Control::_bind_methods() { ClassDB::bind_method(D_METHOD("get_theme"), &Control::get_theme); ClassDB::bind_method(D_METHOD("add_theme_icon_override", "name", "texture"), &Control::add_theme_icon_override); - ClassDB::bind_method(D_METHOD("add_theme_shader_override", "name", "shader"), &Control::add_theme_shader_override); ClassDB::bind_method(D_METHOD("add_theme_stylebox_override", "name", "stylebox"), &Control::add_theme_style_override); ClassDB::bind_method(D_METHOD("add_theme_font_override", "name", "font"), &Control::add_theme_font_override); + ClassDB::bind_method(D_METHOD("add_theme_font_size_override", "name", "font_size"), &Control::add_theme_font_size_override); ClassDB::bind_method(D_METHOD("add_theme_color_override", "name", "color"), &Control::add_theme_color_override); ClassDB::bind_method(D_METHOD("add_theme_constant_override", "name", "constant"), &Control::add_theme_constant_override); - ClassDB::bind_method(D_METHOD("get_theme_icon", "name", "type"), &Control::get_theme_icon, DEFVAL("")); - ClassDB::bind_method(D_METHOD("get_theme_stylebox", "name", "type"), &Control::get_theme_stylebox, DEFVAL("")); - ClassDB::bind_method(D_METHOD("get_theme_font", "name", "type"), &Control::get_theme_font, DEFVAL("")); - ClassDB::bind_method(D_METHOD("get_theme_color", "name", "type"), &Control::get_theme_color, DEFVAL("")); - ClassDB::bind_method(D_METHOD("get_theme_constant", "name", "type"), &Control::get_theme_constant, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_icon", "name", "node_type"), &Control::get_theme_icon, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_stylebox", "name", "node_type"), &Control::get_theme_stylebox, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_font", "name", "node_type"), &Control::get_theme_font, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_font_size", "name", "node_type"), &Control::get_theme_font_size, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_color", "name", "node_type"), &Control::get_theme_color, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_constant", "name", "node_type"), &Control::get_theme_constant, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_icon_override", "name"), &Control::has_theme_icon_override); - ClassDB::bind_method(D_METHOD("has_theme_shader_override", "name"), &Control::has_theme_shader_override); ClassDB::bind_method(D_METHOD("has_theme_stylebox_override", "name"), &Control::has_theme_stylebox_override); ClassDB::bind_method(D_METHOD("has_theme_font_override", "name"), &Control::has_theme_font_override); + ClassDB::bind_method(D_METHOD("has_theme_font_size_override", "name"), &Control::has_theme_font_size_override); ClassDB::bind_method(D_METHOD("has_theme_color_override", "name"), &Control::has_theme_color_override); ClassDB::bind_method(D_METHOD("has_theme_constant_override", "name"), &Control::has_theme_constant_override); - ClassDB::bind_method(D_METHOD("has_theme_icon", "name", "type"), &Control::has_theme_icon, DEFVAL("")); - ClassDB::bind_method(D_METHOD("has_theme_stylebox", "name", "type"), &Control::has_theme_stylebox, DEFVAL("")); - ClassDB::bind_method(D_METHOD("has_theme_font", "name", "type"), &Control::has_theme_font, DEFVAL("")); - ClassDB::bind_method(D_METHOD("has_theme_color", "name", "type"), &Control::has_theme_color, DEFVAL("")); - ClassDB::bind_method(D_METHOD("has_theme_constant", "name", "type"), &Control::has_theme_constant, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_icon", "name", "node_type"), &Control::has_theme_icon, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_stylebox", "name", "node_type"), &Control::has_theme_stylebox, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_font", "name", "node_type"), &Control::has_theme_font, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_font_size", "name", "node_type"), &Control::has_theme_font_size, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_color", "name", "node_type"), &Control::has_theme_color, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_constant", "name", "node_type"), &Control::has_theme_constant, DEFVAL("")); ClassDB::bind_method(D_METHOD("get_parent_control"), &Control::get_parent_control); @@ -2703,8 +2843,8 @@ void Control::_bind_methods() { ClassDB::bind_method(D_METHOD("get_default_cursor_shape"), &Control::get_default_cursor_shape); ClassDB::bind_method(D_METHOD("get_cursor_shape", "position"), &Control::get_cursor_shape, DEFVAL(Point2())); - ClassDB::bind_method(D_METHOD("set_focus_neighbour", "margin", "neighbour"), &Control::set_focus_neighbour); - ClassDB::bind_method(D_METHOD("get_focus_neighbour", "margin"), &Control::get_focus_neighbour); + ClassDB::bind_method(D_METHOD("set_focus_neighbor", "margin", "neighbor"), &Control::set_focus_neighbor); + ClassDB::bind_method(D_METHOD("get_focus_neighbor", "margin"), &Control::get_focus_neighbor); ClassDB::bind_method(D_METHOD("set_focus_next", "next"), &Control::set_focus_next); ClassDB::bind_method(D_METHOD("get_focus_next"), &Control::get_focus_next); @@ -2729,6 +2869,12 @@ void Control::_bind_methods() { ClassDB::bind_method(D_METHOD("minimum_size_changed"), &Control::minimum_size_changed); + ClassDB::bind_method(D_METHOD("set_layout_direction", "direction"), &Control::set_layout_direction); + ClassDB::bind_method(D_METHOD("get_layout_direction"), &Control::get_layout_direction); + ClassDB::bind_method(D_METHOD("is_layout_rtl"), &Control::is_layout_rtl); + + BIND_VMETHOD(MethodInfo("_structured_text_parser", PropertyInfo(Variant::ARRAY, "args"), PropertyInfo(Variant::STRING, "text"))); + BIND_VMETHOD(MethodInfo("_gui_input", PropertyInfo(Variant::OBJECT, "event", PROPERTY_HINT_RESOURCE_TYPE, "InputEvent"))); BIND_VMETHOD(MethodInfo(Variant::VECTOR2, "_get_minimum_size")); @@ -2738,7 +2884,9 @@ void Control::_bind_methods() { BIND_VMETHOD(MethodInfo(Variant::BOOL, "can_drop_data", PropertyInfo(Variant::VECTOR2, "position"), PropertyInfo(Variant::NIL, "data"))); BIND_VMETHOD(MethodInfo("drop_data", PropertyInfo(Variant::VECTOR2, "position"), PropertyInfo(Variant::NIL, "data"))); - BIND_VMETHOD(MethodInfo(Variant::OBJECT, "_make_custom_tooltip", PropertyInfo(Variant::STRING, "for_text"))); + BIND_VMETHOD(MethodInfo( + PropertyInfo(Variant::OBJECT, "control", PROPERTY_HINT_RESOURCE_TYPE, "Control"), + "_make_custom_tooltip", PropertyInfo(Variant::STRING, "for_text"))); BIND_VMETHOD(MethodInfo(Variant::BOOL, "_clips_input")); ADD_GROUP("Anchor", "anchor_"); @@ -2757,6 +2905,9 @@ void Control::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "grow_horizontal", PROPERTY_HINT_ENUM, "Begin,End,Both"), "set_h_grow_direction", "get_h_grow_direction"); ADD_PROPERTY(PropertyInfo(Variant::INT, "grow_vertical", PROPERTY_HINT_ENUM, "Begin,End,Both"), "set_v_grow_direction", "get_v_grow_direction"); + ADD_GROUP("Layout Direction", "layout_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "layout_direction", PROPERTY_HINT_ENUM, "Inherited,Locale,Left-to-right,Right-to-left"), "set_layout_direction", "get_layout_direction"); + ADD_GROUP("Rect", "rect_"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "rect_position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "_set_position", "get_position"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "rect_global_position", PROPERTY_HINT_NONE, "", 0), "_set_global_position", "get_global_position"); @@ -2771,10 +2922,10 @@ void Control::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::STRING, "hint_tooltip", PROPERTY_HINT_MULTILINE_TEXT), "set_tooltip", "_get_tooltip"); ADD_GROUP("Focus", "focus_"); - ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbour_left", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbour", "get_focus_neighbour", MARGIN_LEFT); - ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbour_top", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbour", "get_focus_neighbour", MARGIN_TOP); - ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbour_right", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbour", "get_focus_neighbour", MARGIN_RIGHT); - ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbour_bottom", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbour", "get_focus_neighbour", MARGIN_BOTTOM); + ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbor_left", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbor", "get_focus_neighbor", MARGIN_LEFT); + ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbor_top", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbor", "get_focus_neighbor", MARGIN_TOP); + ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbor_right", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbor", "get_focus_neighbor", MARGIN_RIGHT); + ADD_PROPERTYI(PropertyInfo(Variant::NODE_PATH, "focus_neighbor_bottom", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_neighbor", "get_focus_neighbor", MARGIN_BOTTOM); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "focus_next", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_next", "get_focus_next"); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "focus_previous", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Control"), "set_focus_previous", "get_focus_previous"); ADD_PROPERTY(PropertyInfo(Variant::INT, "focus_mode", PROPERTY_HINT_ENUM, "None,Click,All"), "set_focus_mode", "get_focus_mode"); @@ -2803,6 +2954,7 @@ void Control::_bind_methods() { BIND_CONSTANT(NOTIFICATION_THEME_CHANGED); BIND_CONSTANT(NOTIFICATION_SCROLL_BEGIN); BIND_CONSTANT(NOTIFICATION_SCROLL_END); + BIND_CONSTANT(NOTIFICATION_LAYOUT_DIRECTION_CHANGED); BIND_ENUM_CONSTANT(CURSOR_ARROW); BIND_ENUM_CONSTANT(CURSOR_IBEAM); @@ -2861,6 +3013,24 @@ void Control::_bind_methods() { BIND_ENUM_CONSTANT(ANCHOR_BEGIN); BIND_ENUM_CONSTANT(ANCHOR_END); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_INHERITED); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_LOCALE); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_LTR); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_RTL); + + BIND_ENUM_CONSTANT(TEXT_DIRECTION_INHERITED); + BIND_ENUM_CONSTANT(TEXT_DIRECTION_AUTO); + BIND_ENUM_CONSTANT(TEXT_DIRECTION_LTR); + BIND_ENUM_CONSTANT(TEXT_DIRECTION_RTL); + + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_DEFAULT); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_URI); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_FILE); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_EMAIL); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_LIST); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_NONE); + BIND_ENUM_CONSTANT(STRUCTURED_TEXT_CUSTOM); + ADD_SIGNAL(MethodInfo("resized")); ADD_SIGNAL(MethodInfo("gui_input", PropertyInfo(Variant::OBJECT, "event", PROPERTY_HINT_RESOURCE_TYPE, "InputEvent"))); ADD_SIGNAL(MethodInfo("mouse_entered")); @@ -2883,6 +3053,7 @@ Control::Control() { data.theme_owner = nullptr; data.theme_owner_window = nullptr; data.default_cursor = CURSOR_ARROW; + data.layout_dir = LAYOUT_DIRECTION_INHERITED; data.h_size_flags = SIZE_FILL; data.v_size_flags = SIZE_FILL; data.expand = 1; diff --git a/scene/gui/control.h b/scene/gui/control.h index 15e10df0c6..d314c7357b 100644 --- a/scene/gui/control.h +++ b/scene/gui/control.h @@ -32,7 +32,7 @@ #define CONTROL_H #include "core/math/transform_2d.h" -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/gui/shortcut.h" #include "scene/main/canvas_item.h" #include "scene/main/node.h" @@ -49,7 +49,6 @@ class Control : public CanvasItem { public: enum Anchor { - ANCHOR_BEGIN = 0, ANCHOR_END = 1 }; @@ -67,7 +66,6 @@ public: }; enum SizeFlags { - SIZE_FILL = 1, SIZE_EXPAND = 2, SIZE_EXPAND_FILL = SIZE_EXPAND | SIZE_FILL, @@ -129,6 +127,30 @@ public: PRESET_MODE_KEEP_SIZE }; + enum LayoutDirection { + LAYOUT_DIRECTION_INHERITED, + LAYOUT_DIRECTION_LOCALE, + LAYOUT_DIRECTION_LTR, + LAYOUT_DIRECTION_RTL + }; + + enum TextDirection { + TEXT_DIRECTION_AUTO = TextServer::DIRECTION_AUTO, + TEXT_DIRECTION_LTR = TextServer::DIRECTION_LTR, + TEXT_DIRECTION_RTL = TextServer::DIRECTION_RTL, + TEXT_DIRECTION_INHERITED, + }; + + enum StructuredTextParser { + STRUCTURED_TEXT_DEFAULT, + STRUCTURED_TEXT_URI, + STRUCTURED_TEXT_FILE, + STRUCTURED_TEXT_EMAIL, + STRUCTURED_TEXT_LIST, + STRUCTURED_TEXT_NONE, + STRUCTURED_TEXT_CUSTOM + }; + private: struct CComparator { bool operator()(const Control *p_a, const Control *p_b) const { @@ -155,12 +177,12 @@ private: GrowDirection h_grow; GrowDirection v_grow; + LayoutDirection layout_dir; + float rotation; Vector2 scale; Vector2 pivot_offset; - bool pending_resize; - int h_size_flags; int v_size_flags; float expand; @@ -185,14 +207,14 @@ private: CanvasItem *parent_canvas_item; - NodePath focus_neighbour[4]; + NodePath focus_neighbor[4]; NodePath focus_next; NodePath focus_prev; HashMap<StringName, Ref<Texture2D>> icon_override; - HashMap<StringName, Ref<Shader>> shader_override; HashMap<StringName, Ref<StyleBox>> style_override; HashMap<StringName, Ref<Font>> font_override; + HashMap<StringName, int> font_size_override; HashMap<StringName, Color> color_override; HashMap<StringName, int> constant_override; @@ -201,8 +223,8 @@ private: // used internally Control *_find_control_at_pos(CanvasItem *p_node, const Point2 &p_pos, const Transform2D &p_xform, Transform2D &r_inv_xform); - void _window_find_focus_neighbour(const Vector2 &p_dir, Node *p_at, const Point2 *p_points, float p_min, float &r_closest_dist, Control **r_closest); - Control *_get_focus_neighbour(Margin p_margin, int p_count = 0); + void _window_find_focus_neighbor(const Vector2 &p_dir, Node *p_at, const Point2 *p_points, float p_min, float &r_closest_dist, Control **r_closest); + Control *_get_focus_neighbor(Margin p_margin, int p_count = 0); void _set_anchor(Margin p_margin, float p_anchor); void _set_position(const Point2 &p_point); @@ -215,7 +237,6 @@ private: void _update_minimum_size(); void _update_scroll(); - void _resize(const Size2 &p_size); void _compute_margins(Rect2 p_rect, const float p_anchors[4], float (&r_margins)[4]); void _compute_anchors(Rect2 p_rect, const float p_margins[4], float (&r_anchors)[4]); @@ -236,23 +257,23 @@ private: static void _propagate_theme_changed(Node *p_at, Control *p_owner, Window *p_owner_window, bool p_assign = true); template <class T> - _FORCE_INLINE_ static bool _find_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, T &, T (Theme::*get_func)(const StringName &, const StringName &) const, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_type); + _FORCE_INLINE_ static bool _find_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, T &, T (Theme::*get_func)(const StringName &, const StringName &) const, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_node_type); - _FORCE_INLINE_ static bool _has_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_type); + _FORCE_INLINE_ static bool _has_theme_item(Control *p_theme_owner, Window *p_theme_owner_window, bool (Theme::*has_func)(const StringName &, const StringName &) const, const StringName &p_name, const StringName &p_node_type); - static Ref<Texture2D> get_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static Ref<Shader> get_shaders(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static Ref<StyleBox> get_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static Ref<Font> get_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static Color get_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static int get_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); + static Ref<Texture2D> get_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static Ref<StyleBox> get_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static Ref<Font> get_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static int get_font_sizes(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static Color get_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static int get_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); - static bool has_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static bool has_shaders(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static bool has_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static bool has_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static bool has_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); - static bool has_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_type = StringName()); + static bool has_icons(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static bool has_styleboxs(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static bool has_fonts(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static bool has_font_sizes(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static bool has_colors(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); + static bool has_constants(Control *p_theme_owner, Window *p_theme_owner_window, const StringName &p_name, const StringName &p_node_type = StringName()); protected: virtual void add_child_notify(Node *p_child) override; @@ -260,6 +281,8 @@ protected: //virtual void _window_gui_input(InputEvent p_event); + virtual Vector<Vector2i> structured_text_parser(StructuredTextParser p_node_type, const Array &p_args, const String p_text) const; + bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; void _get_property_list(List<PropertyInfo> *p_list) const; @@ -272,7 +295,6 @@ protected: public: enum { - /* NOTIFICATION_DRAW=30, NOTIFICATION_VISIBILITY_CHANGED=38*/ NOTIFICATION_RESIZED = 40, @@ -283,6 +305,7 @@ public: NOTIFICATION_THEME_CHANGED = 45, NOTIFICATION_SCROLL_BEGIN = 47, NOTIFICATION_SCROLL_END = 48, + NOTIFICATION_LAYOUT_DIRECTION_CHANGED = 49, }; @@ -330,6 +353,10 @@ public: Control *get_parent_control() const; + void set_layout_direction(LayoutDirection p_direction); + LayoutDirection get_layout_direction() const; + virtual bool is_layout_rtl() const; + /* POSITIONING */ void set_anchors_preset(LayoutPreset p_preset, bool p_keep_margins = true); @@ -365,6 +392,8 @@ public: Rect2 get_window_rect() const; ///< use with care, as it blocks waiting for the visual server Rect2 get_anchorable_rect() const override; + void set_rect(const Rect2 &p_rect); // Reset anchors to begin and set rect, for faster container children sorting. + void set_rotation(float p_radians); void set_rotation_degrees(float p_degrees); float get_rotation() const; @@ -407,8 +436,8 @@ public: Control *find_next_valid_focus() const; Control *find_prev_valid_focus() const; - void set_focus_neighbour(Margin p_margin, const NodePath &p_neighbour); - NodePath get_focus_neighbour(Margin p_margin) const; + void set_focus_neighbor(Margin p_margin, const NodePath &p_neighbor); + NodePath get_focus_neighbor(Margin p_margin) const; void set_focus_next(const NodePath &p_next); NodePath get_focus_next() const; @@ -423,32 +452,32 @@ public: /* SKINNING */ void add_theme_icon_override(const StringName &p_name, const Ref<Texture2D> &p_icon); - void add_theme_shader_override(const StringName &p_name, const Ref<Shader> &p_shader); void add_theme_style_override(const StringName &p_name, const Ref<StyleBox> &p_style); void add_theme_font_override(const StringName &p_name, const Ref<Font> &p_font); + void add_theme_font_size_override(const StringName &p_name, int p_font_size); void add_theme_color_override(const StringName &p_name, const Color &p_color); void add_theme_constant_override(const StringName &p_name, int p_constant); - Ref<Texture2D> get_theme_icon(const StringName &p_name, const StringName &p_type = StringName()) const; - Ref<Shader> get_theme_shader(const StringName &p_name, const StringName &p_type = StringName()) const; - Ref<StyleBox> get_theme_stylebox(const StringName &p_name, const StringName &p_type = StringName()) const; - Ref<Font> get_theme_font(const StringName &p_name, const StringName &p_type = StringName()) const; - Color get_theme_color(const StringName &p_name, const StringName &p_type = StringName()) const; - int get_theme_constant(const StringName &p_name, const StringName &p_type = StringName()) const; + Ref<Texture2D> get_theme_icon(const StringName &p_name, const StringName &p_node_type = StringName()) const; + Ref<StyleBox> get_theme_stylebox(const StringName &p_name, const StringName &p_node_type = StringName()) const; + Ref<Font> get_theme_font(const StringName &p_name, const StringName &p_node_type = StringName()) const; + int get_theme_font_size(const StringName &p_name, const StringName &p_node_type = StringName()) const; + Color get_theme_color(const StringName &p_name, const StringName &p_node_type = StringName()) const; + int get_theme_constant(const StringName &p_name, const StringName &p_node_type = StringName()) const; bool has_theme_icon_override(const StringName &p_name) const; - bool has_theme_shader_override(const StringName &p_name) const; bool has_theme_stylebox_override(const StringName &p_name) const; bool has_theme_font_override(const StringName &p_name) const; + bool has_theme_font_size_override(const StringName &p_name) const; bool has_theme_color_override(const StringName &p_name) const; bool has_theme_constant_override(const StringName &p_name) const; - bool has_theme_icon(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_shader(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_stylebox(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_font(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_color(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_constant(const StringName &p_name, const StringName &p_type = StringName()) const; + bool has_theme_icon(const StringName &p_name, const StringName &p_node_type = StringName()) const; + bool has_theme_stylebox(const StringName &p_name, const StringName &p_node_type = StringName()) const; + bool has_theme_font(const StringName &p_name, const StringName &p_node_type = StringName()) const; + bool has_theme_font_size(const StringName &p_name, const StringName &p_node_type = StringName()) const; + bool has_theme_color(const StringName &p_name, const StringName &p_node_type = StringName()) const; + bool has_theme_constant(const StringName &p_name, const StringName &p_node_type = StringName()) const; /* TOOLTIP */ @@ -464,7 +493,7 @@ public: virtual Transform2D get_transform() const override; - bool is_toplevel_control() const; + bool is_top_level_control() const; Size2 get_parent_area_size() const; Rect2 get_parent_anchorable_rect() const; @@ -501,5 +530,8 @@ VARIANT_ENUM_CAST(Control::LayoutPresetMode); VARIANT_ENUM_CAST(Control::MouseFilter); VARIANT_ENUM_CAST(Control::GrowDirection); VARIANT_ENUM_CAST(Control::Anchor); +VARIANT_ENUM_CAST(Control::LayoutDirection); +VARIANT_ENUM_CAST(Control::TextDirection); +VARIANT_ENUM_CAST(Control::StructuredTextParser); #endif diff --git a/scene/gui/dialogs.cpp b/scene/gui/dialogs.cpp index 9077bfa4ba..4e80498108 100644 --- a/scene/gui/dialogs.cpp +++ b/scene/gui/dialogs.cpp @@ -31,8 +31,8 @@ #include "dialogs.h" #include "core/os/keyboard.h" -#include "core/print_string.h" -#include "core/translation.h" +#include "core/string/print_string.h" +#include "core/string/translation.h" #include "line_edit.h" #ifdef TOOLS_ENABLED @@ -60,7 +60,7 @@ void AcceptDialog::_notification(int p_what) { switch (p_what) { case NOTIFICATION_VISIBILITY_CHANGED: { if (is_visible()) { - get_ok()->grab_focus(); + get_ok_button()->grab_focus(); _update_child_rects(); parent_visible = get_parent_visible_window(); if (parent_visible) { @@ -181,7 +181,7 @@ void AcceptDialog::_update_child_rects() { continue; } - if (c == hbc || c == label || c == bg || c->is_set_as_toplevel()) { + if (c == hbc || c == label || c == bg || c->is_set_as_top_level()) { continue; } @@ -209,7 +209,7 @@ Size2 AcceptDialog::_get_contents_minimum_size() const { continue; } - if (c == hbc || c == label || c->is_set_as_toplevel()) { + if (c == hbc || c == label || c->is_set_as_top_level()) { continue; } @@ -253,7 +253,7 @@ Button *AcceptDialog::add_button(const String &p_text, bool p_right, const Strin return button; } -Button *AcceptDialog::add_cancel(const String &p_cancel) { +Button *AcceptDialog::add_cancel_button(const String &p_cancel) { String c = p_cancel; if (p_cancel == "") { c = RTR("Cancel"); @@ -264,12 +264,12 @@ Button *AcceptDialog::add_cancel(const String &p_cancel) { } void AcceptDialog::_bind_methods() { - ClassDB::bind_method(D_METHOD("get_ok"), &AcceptDialog::get_ok); + ClassDB::bind_method(D_METHOD("get_ok_button"), &AcceptDialog::get_ok_button); ClassDB::bind_method(D_METHOD("get_label"), &AcceptDialog::get_label); ClassDB::bind_method(D_METHOD("set_hide_on_ok", "enabled"), &AcceptDialog::set_hide_on_ok); ClassDB::bind_method(D_METHOD("get_hide_on_ok"), &AcceptDialog::get_hide_on_ok); ClassDB::bind_method(D_METHOD("add_button", "text", "right", "action"), &AcceptDialog::add_button, DEFVAL(false), DEFVAL("")); - ClassDB::bind_method(D_METHOD("add_cancel", "name"), &AcceptDialog::add_cancel); + ClassDB::bind_method(D_METHOD("add_cancel_button", "name"), &AcceptDialog::add_cancel_button); ClassDB::bind_method(D_METHOD("register_text_enter", "line_edit"), &AcceptDialog::register_text_enter); ClassDB::bind_method(D_METHOD("set_text", "text"), &AcceptDialog::set_text); ClassDB::bind_method(D_METHOD("get_text"), &AcceptDialog::get_text); @@ -337,10 +337,10 @@ AcceptDialog::~AcceptDialog() { // ConfirmationDialog void ConfirmationDialog::_bind_methods() { - ClassDB::bind_method(D_METHOD("get_cancel"), &ConfirmationDialog::get_cancel); + ClassDB::bind_method(D_METHOD("get_cancel_button"), &ConfirmationDialog::get_cancel_button); } -Button *ConfirmationDialog::get_cancel() { +Button *ConfirmationDialog::get_cancel_button() { return cancel; } @@ -349,5 +349,5 @@ ConfirmationDialog::ConfirmationDialog() { #ifdef TOOLS_ENABLED set_min_size(Size2(200, 70) * EDSCALE); #endif - cancel = add_cancel(); + cancel = add_cancel_button(); } diff --git a/scene/gui/dialogs.h b/scene/gui/dialogs.h index de08685ce2..8f6e0e86f9 100644 --- a/scene/gui/dialogs.h +++ b/scene/gui/dialogs.h @@ -79,9 +79,9 @@ public: void register_text_enter(Node *p_line_edit); - Button *get_ok() { return ok; } + Button *get_ok_button() { return ok; } Button *add_button(const String &p_text, bool p_right = false, const String &p_action = ""); - Button *add_cancel(const String &p_cancel = ""); + Button *add_cancel_button(const String &p_cancel = ""); void set_hide_on_ok(bool p_hide); bool get_hide_on_ok() const; @@ -104,7 +104,7 @@ protected: static void _bind_methods(); public: - Button *get_cancel(); + Button *get_cancel_button(); ConfirmationDialog(); }; diff --git a/scene/gui/file_dialog.cpp b/scene/gui/file_dialog.cpp index 4aea2928f4..041b8ef174 100644 --- a/scene/gui/file_dialog.cpp +++ b/scene/gui/file_dialog.cpp @@ -31,7 +31,7 @@ #include "file_dialog.h" #include "core/os/keyboard.h" -#include "core/print_string.h" +#include "core/string/print_string.h" #include "scene/gui/label.h" FileDialog::GetIconFunc FileDialog::get_icon_func = nullptr; @@ -324,15 +324,15 @@ void FileDialog::deselect_items() { // And change get_ok title. if (!tree->is_anything_selected()) { - get_ok()->set_disabled(_is_open_should_be_disabled()); + get_ok_button()->set_disabled(_is_open_should_be_disabled()); switch (mode) { case FILE_MODE_OPEN_FILE: case FILE_MODE_OPEN_FILES: - get_ok()->set_text(RTR("Open")); + get_ok_button()->set_text(RTR("Open")); break; case FILE_MODE_OPEN_DIR: - get_ok()->set_text(RTR("Select Current Folder")); + get_ok_button()->set_text(RTR("Select Current Folder")); break; case FILE_MODE_OPEN_ANY: case FILE_MODE_SAVE_FILE: @@ -356,10 +356,10 @@ void FileDialog::_tree_selected() { if (!d["dir"]) { file->set_text(d["name"]); } else if (mode == FILE_MODE_OPEN_DIR) { - get_ok()->set_text(RTR("Select This Folder")); + get_ok_button()->set_text(RTR("Select This Folder")); } - get_ok()->set_disabled(_is_open_should_be_disabled()); + get_ok_button()->set_disabled(_is_open_should_be_disabled()); } void FileDialog::_tree_item_activated() { @@ -646,35 +646,35 @@ void FileDialog::set_file_mode(FileMode p_mode) { mode = p_mode; switch (mode) { case FILE_MODE_OPEN_FILE: - get_ok()->set_text(RTR("Open")); + get_ok_button()->set_text(RTR("Open")); if (mode_overrides_title) { set_title(RTR("Open a File")); } makedir->hide(); break; case FILE_MODE_OPEN_FILES: - get_ok()->set_text(RTR("Open")); + get_ok_button()->set_text(RTR("Open")); if (mode_overrides_title) { set_title(RTR("Open File(s)")); } makedir->hide(); break; case FILE_MODE_OPEN_DIR: - get_ok()->set_text(RTR("Select Current Folder")); + get_ok_button()->set_text(RTR("Select Current Folder")); if (mode_overrides_title) { set_title(RTR("Open a Directory")); } makedir->show(); break; case FILE_MODE_OPEN_ANY: - get_ok()->set_text(RTR("Open")); + get_ok_button()->set_text(RTR("Open")); if (mode_overrides_title) { set_title(RTR("Open a File or Directory")); } makedir->show(); break; case FILE_MODE_SAVE_FILE: - get_ok()->set_text(RTR("Save")); + get_ok_button()->set_text(RTR("Save")); if (mode_overrides_title) { set_title(RTR("Save a File")); } @@ -879,6 +879,7 @@ FileDialog::FileDialog() { hbc->add_child(drives); dir = memnew(LineEdit); + dir->set_structured_text_bidi_override(Control::STRUCTURED_TEXT_FILE); hbc->add_child(dir); dir->set_h_size_flags(Control::SIZE_EXPAND_FILL); @@ -912,6 +913,7 @@ FileDialog::FileDialog() { file_box = memnew(HBoxContainer); file_box->add_child(memnew(Label(RTR("File:")))); file = memnew(LineEdit); + file->set_structured_text_bidi_override(Control::STRUCTURED_TEXT_FILE); file->set_stretch_ratio(4); file->set_h_size_flags(Control::SIZE_EXPAND_FILL); file_box->add_child(file); @@ -936,7 +938,7 @@ FileDialog::FileDialog() { filter->connect("item_selected", callable_mp(this, &FileDialog::_filter_selected)); confirm_save = memnew(ConfirmationDialog); - // confirm_save->set_as_toplevel(true); + // confirm_save->set_as_top_level(true); add_child(confirm_save); confirm_save->connect("confirmed", callable_mp(this, &FileDialog::_save_confirm_pressed)); @@ -947,6 +949,7 @@ FileDialog::FileDialog() { makedialog->add_child(makevb); makedirname = memnew(LineEdit); + makedirname->set_structured_text_bidi_override(Control::STRUCTURED_TEXT_FILE); makevb->add_margin_child(RTR("Name:"), makedirname); add_child(makedialog); makedialog->register_text_enter(makedirname); diff --git a/scene/gui/gradient_edit.cpp b/scene/gui/gradient_edit.cpp index ecd4ad17ea..53d7ead548 100644 --- a/scene/gui/gradient_edit.cpp +++ b/scene/gui/gradient_edit.cpp @@ -357,7 +357,7 @@ void GradientEdit::_notification(int p_what) { //Draw point markers for (int i = 0; i < points.size(); i++) { - Color col = points[i].color.contrasted(); + Color col = points[i].color.inverted(); col.a = 0.9; draw_line(Vector2(points[i].offset * total_w, 0), Vector2(points[i].offset * total_w, h / 2), col); diff --git a/scene/gui/graph_edit.cpp b/scene/gui/graph_edit.cpp index 467d252c81..2bcc1890fe 100644 --- a/scene/gui/graph_edit.cpp +++ b/scene/gui/graph_edit.cpp @@ -31,6 +31,7 @@ #include "graph_edit.h" #include "core/input/input.h" +#include "core/math/math_funcs.h" #include "core/os/keyboard.h" #include "scene/gui/box_container.h" #include "scene/gui/button.h" @@ -44,6 +45,9 @@ #define MIN_ZOOM (((1 / ZOOM_SCALE) / ZOOM_SCALE) / ZOOM_SCALE) #define MAX_ZOOM (1 * ZOOM_SCALE * ZOOM_SCALE * ZOOM_SCALE) +#define MINIMAP_OFFSET 12 +#define MINIMAP_PADDING 5 + bool GraphEditFilter::has_point(const Point2 &p_point) const { return ge->_filter_input(p_point); } @@ -52,6 +56,141 @@ GraphEditFilter::GraphEditFilter(GraphEdit *p_edit) { ge = p_edit; } +void GraphEditMinimap::_bind_methods() { + ClassDB::bind_method(D_METHOD("_gui_input"), &GraphEditMinimap::_gui_input); +} + +GraphEditMinimap::GraphEditMinimap(GraphEdit *p_edit) { + ge = p_edit; + + graph_proportions = Vector2(1, 1); + graph_padding = Vector2(0, 0); + camera_position = Vector2(100, 50); + camera_size = Vector2(200, 200); + minimap_padding = Vector2(MINIMAP_PADDING, MINIMAP_PADDING); + minimap_offset = minimap_padding + _convert_from_graph_position(graph_padding); + + is_pressing = false; + is_resizing = false; +} + +void GraphEditMinimap::update_minimap() { + Vector2 graph_offset = _get_graph_offset(); + Vector2 graph_size = _get_graph_size(); + + camera_position = ge->get_scroll_ofs() - graph_offset; + camera_size = ge->get_size(); + + Vector2 render_size = _get_render_size(); + float target_ratio = render_size.x / render_size.y; + float graph_ratio = graph_size.x / graph_size.y; + + graph_proportions = graph_size; + graph_padding = Vector2(0, 0); + if (graph_ratio > target_ratio) { + graph_proportions.x = graph_size.x; + graph_proportions.y = graph_size.x / target_ratio; + graph_padding.y = Math::abs(graph_size.y - graph_proportions.y) / 2; + } else { + graph_proportions.x = graph_size.y * target_ratio; + graph_proportions.y = graph_size.y; + graph_padding.x = Math::abs(graph_size.x - graph_proportions.x) / 2; + } + + // This centers minimap inside the minimap rectangle. + minimap_offset = minimap_padding + _convert_from_graph_position(graph_padding); +} + +Rect2 GraphEditMinimap::get_camera_rect() { + Vector2 camera_center = _convert_from_graph_position(camera_position + camera_size / 2) + minimap_offset; + Vector2 camera_viewport = _convert_from_graph_position(camera_size); + Vector2 camera_position = (camera_center - camera_viewport / 2); + return Rect2(camera_position, camera_viewport); +} + +Vector2 GraphEditMinimap::_get_render_size() { + if (!is_inside_tree()) { + return Vector2(0, 0); + } + + return get_size() - 2 * minimap_padding; +} + +Vector2 GraphEditMinimap::_get_graph_offset() { + return Vector2(ge->h_scroll->get_min(), ge->v_scroll->get_min()); +} + +Vector2 GraphEditMinimap::_get_graph_size() { + Vector2 graph_size = Vector2(ge->h_scroll->get_max(), ge->v_scroll->get_max()) - Vector2(ge->h_scroll->get_min(), ge->v_scroll->get_min()); + + if (graph_size.x == 0) { + graph_size.x = 1; + } + if (graph_size.y == 0) { + graph_size.y = 1; + } + + return graph_size; +} + +Vector2 GraphEditMinimap::_convert_from_graph_position(const Vector2 &p_position) { + Vector2 map_position = Vector2(0, 0); + Vector2 render_size = _get_render_size(); + + map_position.x = p_position.x * render_size.x / graph_proportions.x; + map_position.y = p_position.y * render_size.y / graph_proportions.y; + + return map_position; +} + +Vector2 GraphEditMinimap::_convert_to_graph_position(const Vector2 &p_position) { + Vector2 graph_position = Vector2(0, 0); + Vector2 render_size = _get_render_size(); + + graph_position.x = p_position.x * graph_proportions.x / render_size.x; + graph_position.y = p_position.y * graph_proportions.y / render_size.y; + + return graph_position; +} + +void GraphEditMinimap::_gui_input(const Ref<InputEvent> &p_ev) { + Ref<InputEventMouseButton> mb = p_ev; + Ref<InputEventMouseMotion> mm = p_ev; + + if (mb.is_valid() && mb->get_button_index() == BUTTON_LEFT) { + if (mb->is_pressed()) { + is_pressing = true; + + Ref<Texture2D> resizer = get_theme_icon("resizer"); + Rect2 resizer_hitbox = Rect2(Point2(), resizer->get_size()); + if (resizer_hitbox.has_point(mb->get_position())) { + is_resizing = true; + } else { + Vector2 click_position = _convert_to_graph_position(mb->get_position() - minimap_padding) - graph_padding; + _adjust_graph_scroll(click_position); + } + } else { + is_pressing = false; + is_resizing = false; + } + accept_event(); + } else if (mm.is_valid() && is_pressing) { + if (is_resizing) { + ge->set_minimap_size(ge->get_minimap_size() - mm->get_relative()); + update(); + } else { + Vector2 click_position = _convert_to_graph_position(mm->get_position() - minimap_padding) - graph_padding; + _adjust_graph_scroll(click_position); + } + accept_event(); + } +} + +void GraphEditMinimap::_adjust_graph_scroll(const Vector2 &p_offset) { + Vector2 graph_offset = _get_graph_offset(); + ge->set_scroll_ofs(p_offset + graph_offset - camera_size / 2); +} + Error GraphEdit::connect_node(const StringName &p_from, int p_from_port, const StringName &p_to, int p_to_port) { if (is_node_connected(p_from, p_from_port, p_to, p_to_port)) { return OK; @@ -64,6 +203,7 @@ Error GraphEdit::connect_node(const StringName &p_from, int p_from_port, const S c.activity = 0; connections.push_back(c); top_layer->update(); + minimap->update(); update(); connections_layer->update(); @@ -85,6 +225,7 @@ void GraphEdit::disconnect_node(const StringName &p_from, int p_from_port, const if (E->get().from == p_from && E->get().from_port == p_from_port && E->get().to == p_to && E->get().to_port == p_to_port) { connections.erase(E); top_layer->update(); + minimap->update(); update(); connections_layer->update(); return; @@ -118,6 +259,7 @@ void GraphEdit::_scroll_moved(double) { awaiting_scroll_offset_update = true; } top_layer->update(); + minimap->update(); update(); if (!setting_scroll_ofs) { //in godot, signals on change value are avoided as a convention @@ -234,6 +376,7 @@ void GraphEdit::_graph_node_moved(Node *p_gn) { GraphNode *gn = Object::cast_to<GraphNode>(p_gn); ERR_FAIL_COND(!gn); top_layer->update(); + minimap->update(); update(); connections_layer->update(); } @@ -241,13 +384,15 @@ void GraphEdit::_graph_node_moved(Node *p_gn) { void GraphEdit::add_child_notify(Node *p_child) { Control::add_child_notify(p_child); - top_layer->call_deferred("raise"); //top layer always on top! + top_layer->call_deferred("raise"); // Top layer always on top! + GraphNode *gn = Object::cast_to<GraphNode>(p_child); if (gn) { gn->set_scale(Vector2(zoom, zoom)); gn->connect("offset_changed", callable_mp(this, &GraphEdit::_graph_node_moved), varray(gn)); gn->connect("raise_request", callable_mp(this, &GraphEdit::_graph_node_raised), varray(gn)); gn->connect("item_rect_changed", callable_mp((CanvasItem *)connections_layer, &CanvasItem::update)); + gn->connect("item_rect_changed", callable_mp((CanvasItem *)minimap, &GraphEditMinimap::update)); _graph_node_moved(gn); gn->set_mouse_filter(MOUSE_FILTER_PASS); } @@ -255,14 +400,17 @@ void GraphEdit::add_child_notify(Node *p_child) { void GraphEdit::remove_child_notify(Node *p_child) { Control::remove_child_notify(p_child); + if (is_inside_tree()) { - top_layer->call_deferred("raise"); //top layer always on top! + top_layer->call_deferred("raise"); // Top layer always on top! } + GraphNode *gn = Object::cast_to<GraphNode>(p_child); if (gn) { gn->disconnect("offset_changed", callable_mp(this, &GraphEdit::_graph_node_moved)); gn->disconnect("raise_request", callable_mp(this, &GraphEdit::_graph_node_raised)); gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)connections_layer, &CanvasItem::update)); + gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)minimap, &GraphEditMinimap::update)); } } @@ -275,6 +423,7 @@ void GraphEdit::_notification(int p_what) { zoom_reset->set_icon(get_theme_icon("reset")); zoom_plus->set_icon(get_theme_icon("more")); snap_button->set_icon(get_theme_icon("snap")); + minimap_button->set_icon(get_theme_icon("minimap")); } if (p_what == NOTIFICATION_READY) { Size2 hmin = h_scroll->get_combined_minimum_size(); @@ -338,6 +487,7 @@ void GraphEdit::_notification(int p_what) { if (p_what == NOTIFICATION_RESIZED) { _update_scroll(); top_layer->update(); + minimap->update(); } } @@ -472,6 +622,7 @@ void GraphEdit::_top_layer_input(const Ref<InputEvent> &p_ev) { connecting_to = mm->get_position(); connecting_target = false; top_layer->update(); + minimap->update(); connecting_valid = just_disconnected || click_pos.distance_to(connecting_to) > 20.0 * zoom; if (connecting_valid) { @@ -541,13 +692,14 @@ void GraphEdit::_top_layer_input(const Ref<InputEvent> &p_ev) { connecting = false; top_layer->update(); + minimap->update(); update(); connections_layer->update(); } } bool GraphEdit::_check_clickable_control(Control *p_control, const Vector2 &pos) { - if (p_control->is_set_as_toplevel() || !p_control->is_visible()) { + if (p_control->is_set_as_top_level() || !p_control->is_visible()) { return false; } @@ -632,12 +784,12 @@ void GraphEdit::_bake_segment2d(Vector<Vector2> &points, Vector<Color> &colors, } } -void GraphEdit::_draw_cos_line(CanvasItem *p_where, const Vector2 &p_from, const Vector2 &p_to, const Color &p_color, const Color &p_to_color) { +void GraphEdit::_draw_cos_line(CanvasItem *p_where, const Vector2 &p_from, const Vector2 &p_to, const Color &p_color, const Color &p_to_color, float p_width, float p_bezier_ratio = 1.0) { //cubic bezier code float diff = p_to.x - p_from.x; float cp_offset; - int cp_len = get_theme_constant("bezier_len_pos"); - int cp_neg_len = get_theme_constant("bezier_len_neg"); + int cp_len = get_theme_constant("bezier_len_pos") * p_bezier_ratio; + int cp_neg_len = get_theme_constant("bezier_len_neg") * p_bezier_ratio; if (diff > 0) { cp_offset = MIN(cp_len, diff * 0.5); @@ -659,9 +811,9 @@ void GraphEdit::_draw_cos_line(CanvasItem *p_where, const Vector2 &p_from, const colors.push_back(p_to_color); #ifdef TOOLS_ENABLED - p_where->draw_polyline_colors(points, colors, Math::floor(2 * EDSCALE)); + p_where->draw_polyline_colors(points, colors, Math::floor(p_width * EDSCALE), lines_antialiased); #else - p_where->draw_polyline_colors(points, colors, 2); + p_where->draw_polyline_colors(points, colors, p_width, lines_antialiased); #endif } @@ -708,7 +860,7 @@ void GraphEdit::_connections_layer_draw() { color = color.lerp(activity_color, E->get().activity); tocolor = tocolor.lerp(activity_color, E->get().activity); } - _draw_cos_line(connections_layer, frompos, topos, color, tocolor); + _draw_cos_line(connections_layer, frompos, topos, color, tocolor, lines_thickness); } while (to_erase.size()) { @@ -747,7 +899,7 @@ void GraphEdit::_top_layer_draw() { if (!connecting_out) { SWAP(pos, topos); } - _draw_cos_line(top_layer, pos, topos, col, col); + _draw_cos_line(top_layer, pos, topos, col, col, lines_thickness); } if (box_selecting) { @@ -756,6 +908,114 @@ void GraphEdit::_top_layer_draw() { } } +void GraphEdit::_minimap_draw() { + if (!is_minimap_enabled()) { + return; + } + + minimap->update_minimap(); + + // Draw the minimap background. + Rect2 minimap_rect = Rect2(Point2(), minimap->get_size()); + minimap->draw_style_box(minimap->get_theme_stylebox("bg"), minimap_rect); + + Vector2 graph_offset = minimap->_get_graph_offset(); + Vector2 minimap_offset = minimap->minimap_offset; + + // Draw comment graph nodes. + for (int i = get_child_count() - 1; i >= 0; i--) { + GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); + if (!gn || !gn->is_comment()) { + continue; + } + + Vector2 node_position = minimap->_convert_from_graph_position(gn->get_offset() * zoom - graph_offset) + minimap_offset; + Vector2 node_size = minimap->_convert_from_graph_position(gn->get_size() * zoom); + Rect2 node_rect = Rect2(node_position, node_size); + + Ref<StyleBoxFlat> sb_minimap = minimap->get_theme_stylebox("node")->duplicate(); + + // Override default values with colors provided by the GraphNode's stylebox, if possible. + Ref<StyleBoxFlat> sbf = gn->get_theme_stylebox(gn->is_selected() ? "commentfocus" : "comment"); + if (sbf.is_valid()) { + Color node_color = sbf->get_bg_color(); + sb_minimap->set_bg_color(node_color); + } + + minimap->draw_style_box(sb_minimap, node_rect); + } + + // Draw regular graph nodes. + for (int i = get_child_count() - 1; i >= 0; i--) { + GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); + if (!gn || gn->is_comment()) { + continue; + } + + Vector2 node_position = minimap->_convert_from_graph_position(gn->get_offset() * zoom - graph_offset) + minimap_offset; + Vector2 node_size = minimap->_convert_from_graph_position(gn->get_size() * zoom); + Rect2 node_rect = Rect2(node_position, node_size); + + Ref<StyleBoxFlat> sb_minimap = minimap->get_theme_stylebox("node")->duplicate(); + + // Override default values with colors provided by the GraphNode's stylebox, if possible. + Ref<StyleBoxFlat> sbf = gn->get_theme_stylebox(gn->is_selected() ? "selectedframe" : "frame"); + if (sbf.is_valid()) { + Color node_color = sbf->get_border_color(); + sb_minimap->set_bg_color(node_color); + } + + minimap->draw_style_box(sb_minimap, node_rect); + } + + // Draw node connections. + Color activity_color = get_theme_color("activity"); + for (List<Connection>::Element *E = connections.front(); E; E = E->next()) { + NodePath fromnp(E->get().from); + + Node *from = get_node(fromnp); + if (!from) { + continue; + } + GraphNode *gfrom = Object::cast_to<GraphNode>(from); + if (!gfrom) { + continue; + } + + NodePath tonp(E->get().to); + Node *to = get_node(tonp); + if (!to) { + continue; + } + GraphNode *gto = Object::cast_to<GraphNode>(to); + if (!gto) { + continue; + } + + Vector2 from_slot_position = gfrom->get_offset() * zoom + gfrom->get_connection_output_position(E->get().from_port); + Vector2 from_position = minimap->_convert_from_graph_position(from_slot_position - graph_offset) + minimap_offset; + Color from_color = gfrom->get_connection_output_color(E->get().from_port); + Vector2 to_slot_position = gto->get_offset() * zoom + gto->get_connection_input_position(E->get().to_port); + Vector2 to_position = minimap->_convert_from_graph_position(to_slot_position - graph_offset) + minimap_offset; + Color to_color = gto->get_connection_input_color(E->get().to_port); + + if (E->get().activity > 0) { + from_color = from_color.lerp(activity_color, E->get().activity); + to_color = to_color.lerp(activity_color, E->get().activity); + } + _draw_cos_line(minimap, from_position, to_position, from_color, to_color, 1.0, 0.5); + } + + // Draw the "camera" viewport. + Rect2 camera_rect = minimap->get_camera_rect(); + minimap->draw_style_box(minimap->get_theme_stylebox("camera"), camera_rect); + + // Draw the resizer control. + Ref<Texture2D> resizer = minimap->get_theme_icon("resizer"); + Color resizer_color = minimap->get_theme_color("resizer_color"); + minimap->draw_texture(resizer, Point2(), resizer_color); +} + void GraphEdit::set_selected(Node *p_child) { for (int i = get_child_count() - 1; i >= 0; i--) { GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); @@ -775,6 +1035,11 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { } if (mm.is_valid() && dragging) { + if (!moving_selection) { + emit_signal("begin_node_move"); + moving_selection = true; + } + just_selected = true; drag_accum += mm->get_relative(); for (int i = get_child_count() - 1; i >= 0; i--) { @@ -831,6 +1096,7 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { } top_layer->update(); + minimap->update(); } Ref<InputEventMouseButton> b = p_ev; @@ -853,10 +1119,12 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { gn->set_selected(select); } top_layer->update(); + minimap->update(); } else { if (connecting) { connecting = false; top_layer->update(); + minimap->update(); } else { emit_signal("popup_request", b->get_global_position()); } @@ -881,21 +1149,23 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { } if (drag_accum != Vector2()) { - emit_signal("_begin_node_move"); - for (int i = get_child_count() - 1; i >= 0; i--) { GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); if (gn && gn->is_selected()) { gn->set_drag(false); } } + } - emit_signal("_end_node_move"); + if (moving_selection) { + emit_signal("end_node_move"); + moving_selection = false; } dragging = false; top_layer->update(); + minimap->update(); update(); connections_layer->update(); } @@ -1006,6 +1276,7 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { box_selecting = false; previus_selected.clear(); top_layer->update(); + minimap->update(); } if (b->get_button_index() == BUTTON_WHEEL_UP && b->is_pressed()) { @@ -1073,6 +1344,7 @@ void GraphEdit::set_connection_activity(const StringName &p_from, int p_from_por if (Math::is_equal_approx(E->get().activity, p_activity)) { //update only if changed top_layer->update(); + minimap->update(); connections_layer->update(); } E->get().activity = p_activity; @@ -1083,6 +1355,7 @@ void GraphEdit::set_connection_activity(const StringName &p_from, int p_from_por void GraphEdit::clear_connections() { connections.clear(); + minimap->update(); update(); connections_layer->update(); } @@ -1106,6 +1379,7 @@ void GraphEdit::set_zoom_custom(float p_zoom, const Vector2 &p_center) { top_layer->update(); _update_scroll(); + minimap->update(); connections_layer->update(); if (is_visible_in_tree()) { @@ -1223,6 +1497,63 @@ void GraphEdit::_snap_value_changed(double) { update(); } +void GraphEdit::set_minimap_size(Vector2 p_size) { + minimap->set_size(p_size); + Vector2 minimap_size = minimap->get_size(); // The size might've been adjusted by the minimum size. + + minimap->set_anchors_preset(Control::PRESET_BOTTOM_RIGHT); + minimap->set_margin(Margin::MARGIN_LEFT, -minimap_size.x - MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_TOP, -minimap_size.y - MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_RIGHT, -MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_BOTTOM, -MINIMAP_OFFSET); + minimap->update(); +} + +Vector2 GraphEdit::get_minimap_size() const { + return minimap->get_size(); +} + +void GraphEdit::set_minimap_opacity(float p_opacity) { + minimap->set_modulate(Color(1, 1, 1, p_opacity)); + minimap->update(); +} + +float GraphEdit::get_minimap_opacity() const { + Color minimap_modulate = minimap->get_modulate(); + return minimap_modulate.a; +} + +void GraphEdit::set_minimap_enabled(bool p_enable) { + minimap_button->set_pressed(p_enable); + minimap->update(); +} + +bool GraphEdit::is_minimap_enabled() const { + return minimap_button->is_pressed(); +} + +void GraphEdit::_minimap_toggled() { + minimap->update(); +} + +void GraphEdit::set_connection_lines_thickness(float p_thickness) { + lines_thickness = p_thickness; + update(); +} + +float GraphEdit::get_connection_lines_thickness() const { + return lines_thickness; +} + +void GraphEdit::set_connection_lines_antialiased(bool p_antialiased) { + lines_antialiased = p_antialiased; + update(); +} + +bool GraphEdit::is_connection_lines_antialiased() const { + return lines_antialiased; +} + HBoxContainer *GraphEdit::get_zoom_hbox() { return zoom_hb; } @@ -1254,6 +1585,20 @@ void GraphEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("set_use_snap", "enable"), &GraphEdit::set_use_snap); ClassDB::bind_method(D_METHOD("is_using_snap"), &GraphEdit::is_using_snap); + ClassDB::bind_method(D_METHOD("set_connection_lines_thickness", "pixels"), &GraphEdit::set_connection_lines_thickness); + ClassDB::bind_method(D_METHOD("get_connection_lines_thickness"), &GraphEdit::get_connection_lines_thickness); + + ClassDB::bind_method(D_METHOD("set_connection_lines_antialiased", "pixels"), &GraphEdit::set_connection_lines_antialiased); + ClassDB::bind_method(D_METHOD("is_connection_lines_antialiased"), &GraphEdit::is_connection_lines_antialiased); + + ClassDB::bind_method(D_METHOD("set_minimap_size", "p_size"), &GraphEdit::set_minimap_size); + ClassDB::bind_method(D_METHOD("get_minimap_size"), &GraphEdit::get_minimap_size); + ClassDB::bind_method(D_METHOD("set_minimap_opacity", "p_opacity"), &GraphEdit::set_minimap_opacity); + ClassDB::bind_method(D_METHOD("get_minimap_opacity"), &GraphEdit::get_minimap_opacity); + + ClassDB::bind_method(D_METHOD("set_minimap_enabled", "enable"), &GraphEdit::set_minimap_enabled); + ClassDB::bind_method(D_METHOD("is_minimap_enabled"), &GraphEdit::is_minimap_enabled); + ClassDB::bind_method(D_METHOD("set_right_disconnects", "enable"), &GraphEdit::set_right_disconnects); ClassDB::bind_method(D_METHOD("is_right_disconnects_enabled"), &GraphEdit::is_right_disconnects_enabled); @@ -1269,6 +1614,12 @@ void GraphEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "snap_distance"), "set_snap", "get_snap"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_snap"), "set_use_snap", "is_using_snap"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "zoom"), "set_zoom", "get_zoom"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "connection_lines_thickness"), "set_connection_lines_thickness", "get_connection_lines_thickness"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "connection_lines_antialiased"), "set_connection_lines_antialiased", "is_connection_lines_antialiased"); + ADD_GROUP("Minimap", "minimap"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "minimap_enabled"), "set_minimap_enabled", "is_minimap_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "minimap_size"), "set_minimap_size", "get_minimap_size"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "minimap_opacity"), "set_minimap_opacity", "get_minimap_opacity"); ADD_SIGNAL(MethodInfo("connection_request", PropertyInfo(Variant::STRING_NAME, "from"), PropertyInfo(Variant::INT, "from_slot"), PropertyInfo(Variant::STRING_NAME, "to"), PropertyInfo(Variant::INT, "to_slot"))); ADD_SIGNAL(MethodInfo("disconnection_request", PropertyInfo(Variant::STRING_NAME, "from"), PropertyInfo(Variant::INT, "from_slot"), PropertyInfo(Variant::STRING_NAME, "to"), PropertyInfo(Variant::INT, "to_slot"))); @@ -1281,8 +1632,8 @@ void GraphEdit::_bind_methods() { ADD_SIGNAL(MethodInfo("connection_to_empty", PropertyInfo(Variant::STRING_NAME, "from"), PropertyInfo(Variant::INT, "from_slot"), PropertyInfo(Variant::VECTOR2, "release_position"))); ADD_SIGNAL(MethodInfo("connection_from_empty", PropertyInfo(Variant::STRING_NAME, "to"), PropertyInfo(Variant::INT, "to_slot"), PropertyInfo(Variant::VECTOR2, "release_position"))); ADD_SIGNAL(MethodInfo("delete_nodes_request")); - ADD_SIGNAL(MethodInfo("_begin_node_move")); - ADD_SIGNAL(MethodInfo("_end_node_move")); + ADD_SIGNAL(MethodInfo("begin_node_move")); + ADD_SIGNAL(MethodInfo("end_node_move")); ADD_SIGNAL(MethodInfo("scroll_offset_changed", PropertyInfo(Variant::VECTOR2, "ofs"))); } @@ -1374,6 +1725,32 @@ GraphEdit::GraphEdit() { snap_amount->connect("value_changed", callable_mp(this, &GraphEdit::_snap_value_changed)); zoom_hb->add_child(snap_amount); + minimap_button = memnew(Button); + minimap_button->set_flat(true); + minimap_button->set_toggle_mode(true); + minimap_button->set_tooltip(RTR("Enable grid minimap.")); + minimap_button->connect("pressed", callable_mp(this, &GraphEdit::_minimap_toggled)); + minimap_button->set_pressed(true); + minimap_button->set_focus_mode(FOCUS_NONE); + zoom_hb->add_child(minimap_button); + + Vector2 minimap_size = Vector2(240, 160); + float minimap_opacity = 0.65; + + minimap = memnew(GraphEditMinimap(this)); + top_layer->add_child(minimap); + minimap->set_name("_minimap"); + minimap->set_modulate(Color(1, 1, 1, minimap_opacity)); + minimap->set_mouse_filter(MOUSE_FILTER_STOP); + minimap->set_custom_minimum_size(Vector2(50, 50)); + minimap->set_size(minimap_size); + minimap->set_anchors_preset(Control::PRESET_BOTTOM_RIGHT); + minimap->set_margin(Margin::MARGIN_LEFT, -minimap_size.x - MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_TOP, -minimap_size.y - MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_RIGHT, -MINIMAP_OFFSET); + minimap->set_margin(Margin::MARGIN_BOTTOM, -MINIMAP_OFFSET); + minimap->connect("draw", callable_mp(this, &GraphEdit::_minimap_draw)); + setting_scroll_ofs = false; just_disconnected = false; set_clip_contents(true); diff --git a/scene/gui/graph_edit.h b/scene/gui/graph_edit.h index 37cb5989e9..d081789784 100644 --- a/scene/gui/graph_edit.h +++ b/scene/gui/graph_edit.h @@ -45,6 +45,7 @@ class GraphEditFilter : public Control { GDCLASS(GraphEditFilter, Control); friend class GraphEdit; + friend class GraphEditMinimap; GraphEdit *ge; virtual bool has_point(const Point2 &p_point) const override; @@ -52,6 +53,45 @@ public: GraphEditFilter(GraphEdit *p_edit); }; +class GraphEditMinimap : public Control { + GDCLASS(GraphEditMinimap, Control); + + friend class GraphEdit; + friend class GraphEditFilter; + GraphEdit *ge; + +protected: + static void _bind_methods(); + +public: + GraphEditMinimap(GraphEdit *p_edit); + + void update_minimap(); + Rect2 get_camera_rect(); + +private: + Vector2 minimap_padding; + Vector2 minimap_offset; + Vector2 graph_proportions; + Vector2 graph_padding; + Vector2 camera_position; + Vector2 camera_size; + + bool is_pressing; + bool is_resizing; + + Vector2 _get_render_size(); + Vector2 _get_graph_offset(); + Vector2 _get_graph_size(); + + Vector2 _convert_from_graph_position(const Vector2 &p_position); + Vector2 _convert_to_graph_position(const Vector2 &p_position); + + void _gui_input(const Ref<InputEvent> &p_ev); + + void _adjust_graph_scroll(const Vector2 &p_offset); +}; + class GraphEdit : public Control { GDCLASS(GraphEdit, Control); @@ -72,6 +112,8 @@ private: Button *snap_button; SpinBox *snap_amount; + Button *minimap_button; + void _zoom_minus(); void _zoom_reset(); void _zoom_plus(); @@ -98,6 +140,7 @@ private: bool dragging; bool just_selected; + bool moving_selection; Vector2 drag_accum; float zoom; @@ -115,9 +158,12 @@ private: bool awaiting_scroll_offset_update; List<Connection> connections; + float lines_thickness = 2.0f; + bool lines_antialiased = true; + void _bake_segment2d(Vector<Vector2> &points, Vector<Color> &colors, float p_begin, float p_end, const Vector2 &p_a, const Vector2 &p_out, const Vector2 &p_b, const Vector2 &p_in, int p_depth, int p_min_depth, int p_max_depth, float p_tol, const Color &p_color, const Color &p_to_color, int &lines) const; - void _draw_cos_line(CanvasItem *p_where, const Vector2 &p_from, const Vector2 &p_to, const Color &p_color, const Color &p_to_color); + void _draw_cos_line(CanvasItem *p_where, const Vector2 &p_from, const Vector2 &p_to, const Color &p_color, const Color &p_to_color, float p_width, float p_bezier_ratio); void _graph_node_raised(Node *p_gn); void _graph_node_moved(Node *p_gn); @@ -128,12 +174,14 @@ private: Control *connections_layer; GraphEditFilter *top_layer; + GraphEditMinimap *minimap; void _top_layer_input(const Ref<InputEvent> &p_ev); bool is_in_hot_zone(const Vector2 &pos, const Vector2 &p_mouse_pos); void _top_layer_draw(); void _connections_layer_draw(); + void _minimap_draw(); void _update_scroll_offset(); Array _get_connection_list() const; @@ -170,6 +218,9 @@ private: void _snap_toggled(); void _snap_value_changed(double); + friend class GraphEditMinimap; + void _minimap_toggled(); + bool _check_clickable_control(Control *p_control, const Vector2 &pos); protected: @@ -195,7 +246,16 @@ public: void set_zoom_custom(float p_zoom, const Vector2 &p_center); float get_zoom() const; + void set_minimap_size(Vector2 p_size); + Vector2 get_minimap_size() const; + void set_minimap_opacity(float p_opacity); + float get_minimap_opacity() const; + + void set_minimap_enabled(bool p_enable); + bool is_minimap_enabled() const; + GraphEditFilter *get_top_layer() const { return top_layer; } + GraphEditMinimap *get_minimap() const { return minimap; } void get_connection_list(List<Connection> *r_connections) const; void set_right_disconnects(bool p_enable); @@ -218,6 +278,12 @@ public: int get_snap() const; void set_snap(int p_snap); + void set_connection_lines_thickness(float p_thickness); + float get_connection_lines_thickness() const; + + void set_connection_lines_antialiased(bool p_antialiased); + bool is_connection_lines_antialiased() const; + HBoxContainer *get_zoom_hbox(); GraphEdit(); diff --git a/scene/gui/graph_node.cpp b/scene/gui/graph_node.cpp index 01b54ddaa8..4ce33ec8f2 100644 --- a/scene/gui/graph_node.cpp +++ b/scene/gui/graph_node.cpp @@ -30,15 +30,37 @@ #include "graph_node.h" -#include "core/method_bind_ext.gen.inc" +#include "core/string/translation.h" bool GraphNode::_set(const StringName &p_name, const Variant &p_value) { - if (!p_name.operator String().begins_with("slot/")) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + _shape(); + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + _shape(); + update(); + } + } + _change_notify(); + return true; + } + + if (!str.begins_with("slot/")) { return false; } - int idx = p_name.operator String().get_slice("/", 1).to_int(); - String what = p_name.operator String().get_slice("/", 2); + int idx = str.get_slice("/", 1).to_int(); + String what = str.get_slice("/", 2); Slot si; if (slot_info.has(idx)) { @@ -67,12 +89,25 @@ bool GraphNode::_set(const StringName &p_name, const Variant &p_value) { } bool GraphNode::_get(const StringName &p_name, Variant &r_ret) const { - if (!p_name.operator String().begins_with("slot/")) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + + if (!str.begins_with("slot/")) { return false; } - int idx = p_name.operator String().get_slice("/", 1).to_int(); - String what = p_name.operator String().get_slice("/", 2); + int idx = str.get_slice("/", 1).to_int(); + String what = str.get_slice("/", 2); Slot si; if (slot_info.has(idx)) { @@ -99,10 +134,16 @@ bool GraphNode::_get(const StringName &p_name, Variant &r_ret) const { } void GraphNode::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); + int idx = 0; for (int i = 0; i < get_child_count(); i++) { Control *c = Object::cast_to<Control>(get_child(i)); - if (!c || c->is_set_as_toplevel()) { + if (!c || c->is_set_as_top_level()) { continue; } @@ -131,7 +172,7 @@ void GraphNode::_resort() { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -156,7 +197,7 @@ void GraphNode::_resort() { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -215,7 +256,6 @@ void GraphNode::_notification(int p_what) { int close_h_offset = get_theme_constant("close_h_offset"); Color close_color = get_theme_color("close_color"); Color resizer_color = get_theme_color("resizer_color"); - Ref<Font> title_font = get_theme_font("title_font"); int title_offset = get_theme_constant("title_offset"); int title_h_offset = get_theme_constant("title_h_offset"); Color title_color = get_theme_color("title_color"); @@ -243,7 +283,8 @@ void GraphNode::_notification(int p_what) { w -= close->get_width(); } - draw_string(title_font, Point2(sb->get_margin(MARGIN_LEFT) + title_h_offset, -title_font->get_height() + title_font->get_ascent() + title_offset), title, title_color, w); + title_buf->set_width(w); + title_buf->draw(get_canvas_item(), Point2(sb->get_margin(MARGIN_LEFT) + title_h_offset, -title_buf->get_size().y + title_offset), title_color); if (show_close) { Vector2 cpos = Point2(w + sb->get_margin(MARGIN_LEFT) + close_h_offset, -close->get_height() + close_offset); draw_texture(close, cpos, close_color); @@ -287,12 +328,30 @@ void GraphNode::_notification(int p_what) { _resort(); } break; + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: + case NOTIFICATION_TRANSLATION_CHANGED: case NOTIFICATION_THEME_CHANGED: { + _shape(); + minimum_size_changed(); + update(); } break; } } +void GraphNode::_shape() { + Ref<Font> font = get_theme_font("title_font"); + int font_size = get_theme_font_size("title_font_size"); + + title_buf->clear(); + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + title_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + title_buf->set_direction((TextServer::Direction)text_direction); + } + title_buf->add_string(title, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); +} + void GraphNode::set_slot(int p_idx, bool p_enable_left, int p_type_left, const Color &p_color_left, bool p_enable_right, int p_type_right, const Color &p_color_right, const Ref<Texture2D> &p_custom_left, const Ref<Texture2D> &p_custom_right) { ERR_FAIL_COND(p_idx < 0); @@ -370,14 +429,12 @@ Color GraphNode::get_slot_color_right(int p_idx) const { } Size2 GraphNode::get_minimum_size() const { - Ref<Font> title_font = get_theme_font("title_font"); - int sep = get_theme_constant("separation"); Ref<StyleBox> sb = get_theme_stylebox("frame"); bool first = true; Size2 minsize; - minsize.x = title_font->get_string_size(title).x; + minsize.x = title_buf->get_size().x; if (show_close) { Ref<Texture2D> close = get_theme_icon("close"); minsize.x += sep + close->get_width(); @@ -388,7 +445,7 @@ Size2 GraphNode::get_minimum_size() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -412,6 +469,8 @@ void GraphNode::set_title(const String &p_title) { return; } title = p_title; + _shape(); + update(); _change_notify("title"); minimum_size_changed(); @@ -421,6 +480,54 @@ String GraphNode::get_title() const { return title; } +void GraphNode::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + _shape(); + update(); + } +} + +Control::TextDirection GraphNode::get_text_direction() const { + return text_direction; +} + +void GraphNode::clear_opentype_features() { + opentype_features.clear(); + _shape(); + update(); +} + +void GraphNode::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + _shape(); + update(); + } +} + +int GraphNode::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void GraphNode::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + _shape(); + update(); + } +} + +String GraphNode::get_language() const { + return language; +} + void GraphNode::set_offset(const Vector2 &p_offset) { offset = p_offset; emit_signal("offset_changed"); @@ -477,7 +584,7 @@ void GraphNode::_connpos_update() { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -660,6 +767,14 @@ bool GraphNode::is_resizable() const { void GraphNode::_bind_methods() { ClassDB::bind_method(D_METHOD("set_title", "title"), &GraphNode::set_title); ClassDB::bind_method(D_METHOD("get_title"), &GraphNode::get_title); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &GraphNode::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &GraphNode::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &GraphNode::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &GraphNode::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &GraphNode::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &GraphNode::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &GraphNode::get_language); + ClassDB::bind_method(D_METHOD("_gui_input"), &GraphNode::_gui_input); ClassDB::bind_method(D_METHOD("set_slot", "idx", "enable_left", "type_left", "color_left", "enable_right", "type_right", "color_right", "custom_left", "custom_right"), &GraphNode::set_slot, DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>())); @@ -701,6 +816,8 @@ void GraphNode::_bind_methods() { ClassDB::bind_method(D_METHOD("get_overlay"), &GraphNode::get_overlay); ADD_PROPERTY(PropertyInfo(Variant::STRING, "title"), "set_title", "get_title"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "show_close"), "set_show_close_button", "is_close_button_visible"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "resizable"), "set_resizable", "is_resizable"); @@ -720,6 +837,7 @@ void GraphNode::_bind_methods() { } GraphNode::GraphNode() { + title_buf.instance(); overlay = OVERLAY_DISABLED; show_close = false; connpos_dirty = true; diff --git a/scene/gui/graph_node.h b/scene/gui/graph_node.h index 0cf6d9b09a..3cd7ae6e24 100644 --- a/scene/gui/graph_node.h +++ b/scene/gui/graph_node.h @@ -32,6 +32,7 @@ #define GRAPH_NODE_H #include "scene/gui/container.h" +#include "scene/resources/text_line.h" class GraphNode : public Container { GDCLASS(GraphNode, Container); @@ -65,6 +66,12 @@ private: }; String title; + Ref<TextLine> title_buf; + + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + bool show_close; Vector2 offset; bool comment; @@ -93,6 +100,7 @@ private: void _connpos_update(); void _resort(); + void _shape(); Vector2 drag_from; bool selected; @@ -124,6 +132,16 @@ public: void set_title(const String &p_title); String get_title() const; + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + void set_offset(const Vector2 &p_offset); Vector2 get_offset() const; diff --git a/scene/gui/grid_container.cpp b/scene/gui/grid_container.cpp index 2f37461c4d..a08a348a18 100644 --- a/scene/gui/grid_container.cpp +++ b/scene/gui/grid_container.cpp @@ -141,6 +141,7 @@ void GridContainer::_notification(int p_what) { // Finally, fit the nodes. int col_expand = col_expanded.size() > 0 ? remaining_space.width / col_expanded.size() : 0; int row_expand = row_expanded.size() > 0 ? remaining_space.height / row_expanded.size() : 0; + bool rtl = is_layout_rtl(); int col_ofs = 0; int row_ofs = 0; @@ -156,24 +157,37 @@ void GridContainer::_notification(int p_what) { valid_controls_index++; if (col == 0) { - col_ofs = 0; + if (rtl) { + col_ofs = get_size().width; + } else { + col_ofs = 0; + } if (row > 0) { row_ofs += (row_expanded.has(row - 1) ? row_expand : row_minh[row - 1]) + vsep; } } - Point2 p(col_ofs, row_ofs); - Size2 s(col_expanded.has(col) ? col_expand : col_minw[col], row_expanded.has(row) ? row_expand : row_minh[row]); - - fit_child_in_rect(c, Rect2(p, s)); - - col_ofs += s.width + hsep; + if (rtl) { + Size2 s(col_expanded.has(col) ? col_expand : col_minw[col], row_expanded.has(row) ? row_expand : row_minh[row]); + Point2 p(col_ofs - s.width, row_ofs); + fit_child_in_rect(c, Rect2(p, s)); + col_ofs -= s.width + hsep; + } else { + Point2 p(col_ofs, row_ofs); + Size2 s(col_expanded.has(col) ? col_expand : col_minw[col], row_expanded.has(row) ? row_expand : row_minh[row]); + fit_child_in_rect(c, Rect2(p, s)); + col_ofs += s.width + hsep; + } } } break; case NOTIFICATION_THEME_CHANGED: { minimum_size_changed(); } break; + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + queue_sort(); + } break; } } diff --git a/scene/gui/item_list.cpp b/scene/gui/item_list.cpp index 54150d130d..5be7804ac1 100644 --- a/scene/gui/item_list.cpp +++ b/scene/gui/item_list.cpp @@ -29,8 +29,26 @@ /*************************************************************************/ #include "item_list.h" +#include "core/config/project_settings.h" #include "core/os/os.h" -#include "core/project_settings.h" +#include "core/string/translation.h" + +void ItemList::_shape(int p_idx) { + Item &item = items.write[p_idx]; + + item.text_buf->clear(); + if (item.text_direction == Control::TEXT_DIRECTION_INHERITED) { + item.text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + item.text_buf->set_direction((TextServer::Direction)item.text_direction); + } + item.text_buf->add_string(item.text, get_theme_font("font"), get_theme_font_size("font_size"), item.opentype_features, (item.language != "") ? item.language : TranslationServer::get_singleton()->get_tool_locale()); + if (icon_mode == ICON_MODE_TOP && max_text_lines > 0) { + item.text_buf->set_flags(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::BREAK_GRAPHEME_BOUND); + } else { + item.text_buf->set_flags(TextServer::BREAK_NONE); + } +} void ItemList::add_item(const String &p_item, const Ref<Texture2D> &p_texture, bool p_selectable) { Item item; @@ -39,6 +57,7 @@ void ItemList::add_item(const String &p_item, const Ref<Texture2D> &p_texture, b item.icon_region = Rect2i(); item.icon_modulate = Color(1, 1, 1, 1); item.text = p_item; + item.text_buf.instance(); item.selectable = p_selectable; item.selected = false; item.disabled = false; @@ -46,6 +65,8 @@ void ItemList::add_item(const String &p_item, const Ref<Texture2D> &p_texture, b item.custom_bg = Color(0, 0, 0, 0); items.push_back(item); + _shape(items.size() - 1); + update(); shape_changed = true; } @@ -57,6 +78,7 @@ void ItemList::add_icon_item(const Ref<Texture2D> &p_item, bool p_selectable) { item.icon_region = Rect2i(); item.icon_modulate = Color(1, 1, 1, 1); //item.text=p_item; + item.text_buf.instance(); item.selectable = p_selectable; item.selected = false; item.disabled = false; @@ -72,6 +94,7 @@ void ItemList::set_item_text(int p_idx, const String &p_text) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].text = p_text; + _shape(p_idx); update(); shape_changed = true; } @@ -81,6 +104,61 @@ String ItemList::get_item_text(int p_idx) const { return items[p_idx].text; } +void ItemList::set_item_text_direction(int p_idx, Control::TextDirection p_text_direction) { + ERR_FAIL_INDEX(p_idx, items.size()); + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (items[p_idx].text_direction != p_text_direction) { + items.write[p_idx].text_direction = p_text_direction; + _shape(p_idx); + update(); + } +} + +Control::TextDirection ItemList::get_item_text_direction(int p_idx) const { + ERR_FAIL_INDEX_V(p_idx, items.size(), TEXT_DIRECTION_INHERITED); + return items[p_idx].text_direction; +} + +void ItemList::clear_item_opentype_features(int p_idx) { + ERR_FAIL_INDEX(p_idx, items.size()); + items.write[p_idx].opentype_features.clear(); + _shape(p_idx); + update(); +} + +void ItemList::set_item_opentype_feature(int p_idx, const String &p_name, int p_value) { + ERR_FAIL_INDEX(p_idx, items.size()); + int32_t tag = TS->name_to_tag(p_name); + if (!items[p_idx].opentype_features.has(tag) || (int)items[p_idx].opentype_features[tag] != p_value) { + items.write[p_idx].opentype_features[tag] = p_value; + _shape(p_idx); + update(); + } +} + +int ItemList::get_item_opentype_feature(int p_idx, const String &p_name) const { + ERR_FAIL_INDEX_V(p_idx, items.size(), -1); + int32_t tag = TS->name_to_tag(p_name); + if (!items[p_idx].opentype_features.has(tag)) { + return -1; + } + return items[p_idx].opentype_features[tag]; +} + +void ItemList::set_item_language(int p_idx, const String &p_language) { + ERR_FAIL_INDEX(p_idx, items.size()); + if (items[p_idx].language != p_language) { + items.write[p_idx].language = p_language; + _shape(p_idx); + update(); + } +} + +String ItemList::get_item_language(int p_idx) const { + ERR_FAIL_INDEX_V(p_idx, items.size(), ""); + return items[p_idx].language; +} + void ItemList::set_item_tooltip_enabled(int p_idx, const bool p_enabled) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].tooltip_enabled = p_enabled; @@ -361,9 +439,18 @@ bool ItemList::is_same_column_width() const { void ItemList::set_max_text_lines(int p_lines) { ERR_FAIL_COND(p_lines < 1); - max_text_lines = p_lines; - update(); - shape_changed = true; + if (max_text_lines != p_lines) { + max_text_lines = p_lines; + for (int i = 0; i < items.size(); i++) { + if (icon_mode == ICON_MODE_TOP && max_text_lines > 0) { + items.write[i].text_buf->set_flags(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::BREAK_GRAPHEME_BOUND); + } else { + items.write[i].text_buf->set_flags(TextServer::BREAK_NONE); + } + } + shape_changed = true; + update(); + } } int ItemList::get_max_text_lines() const { @@ -392,9 +479,18 @@ ItemList::SelectMode ItemList::get_select_mode() const { void ItemList::set_icon_mode(IconMode p_mode) { ERR_FAIL_INDEX((int)p_mode, 2); - icon_mode = p_mode; - update(); - shape_changed = true; + if (icon_mode != p_mode) { + icon_mode = p_mode; + for (int i = 0; i < items.size(); i++) { + if (icon_mode == ICON_MODE_TOP && max_text_lines > 0) { + items.write[i].text_buf->set_flags(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::BREAK_GRAPHEME_BOUND); + } else { + items.write[i].text_buf->set_flags(TextServer::BREAK_NONE); + } + } + shape_changed = true; + update(); + } } ItemList::IconMode ItemList::get_icon_mode() const { @@ -455,6 +551,10 @@ void ItemList::_gui_input(const Ref<InputEvent> &p_event) { pos -= bg->get_offset(); pos.y += scroll_bar->get_value(); + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } + int closest = -1; for (int i = 0; i < items.size(); i++) { @@ -749,6 +849,14 @@ void ItemList::_notification(int p_what) { update(); } + if ((p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED) || (p_what == NOTIFICATION_TRANSLATION_CHANGED) || (p_what == NOTIFICATION_THEME_CHANGED)) { + for (int i = 0; i < items.size(); i++) { + _shape(i); + } + shape_changed = true; + update(); + } + if (p_what == NOTIFICATION_DRAW) { Ref<StyleBox> bg = get_theme_stylebox("bg"); @@ -774,19 +882,11 @@ void ItemList::_notification(int p_what) { Ref<StyleBox> sbsel = has_focus() ? get_theme_stylebox("selected_focus") : get_theme_stylebox("selected"); Ref<StyleBox> cursor = has_focus() ? get_theme_stylebox("cursor") : get_theme_stylebox("cursor_unfocused"); + bool rtl = is_layout_rtl(); - Ref<Font> font = get_theme_font("font"); Color guide_color = get_theme_color("guide_color"); Color font_color = get_theme_color("font_color"); Color font_color_selected = get_theme_color("font_color_selected"); - int font_height = font->get_height(); - Vector<int> line_size_cache; - Vector<int> line_limit_cache; - - if (max_text_lines) { - line_size_cache.resize(max_text_lines); - line_limit_cache.resize(max_text_lines); - } if (has_focus()) { RenderingServer::get_singleton()->canvas_item_add_clip_ignore(get_canvas_item(), true); @@ -817,13 +917,13 @@ void ItemList::_notification(int p_what) { } if (items[i].text != "") { - Size2 s = font->get_string_size(items[i].text); + Size2 s = items[i].text_buf->get_size(); //s.width=MIN(s.width,fixed_column_width); if (icon_mode == ICON_MODE_TOP) { minsize.x = MAX(minsize.x, s.width); if (max_text_lines > 0) { - minsize.y += (font_height + line_separation) * max_text_lines; + minsize.y += s.height + line_separation * max_text_lines; } else { minsize.y += s.height; } @@ -986,6 +1086,10 @@ void ItemList::_notification(int p_what) { r.position.x -= hseparation / 2; r.size.x += hseparation; + if (rtl) { + r.position.x = size.width - r.position.x - r.size.x; + } + draw_style_box(sbsel, r); } if (items[i].custom_bg.a > 0.001) { @@ -998,6 +1102,10 @@ void ItemList::_notification(int p_what) { r.position.x -= hseparation / 2; r.size.x += hseparation; + if (rtl) { + r.position.x = size.width - r.position.x - r.size.x; + } + draw_rect(r, items[i].custom_bg); } @@ -1049,17 +1157,25 @@ void ItemList::_notification(int p_what) { } Rect2 region = (items[i].icon_region.size.x == 0 || items[i].icon_region.size.y == 0) ? Rect2(Vector2(), items[i].icon->get_size()) : Rect2(items[i].icon_region); + + if (rtl) { + draw_rect.position.x = size.width - draw_rect.position.x - draw_rect.size.x; + } draw_texture_rect_region(items[i].icon, draw_rect, region, modulate, items[i].icon_transposed); } if (items[i].tag_icon.is_valid()) { - draw_texture(items[i].tag_icon, items[i].rect_cache.position + base_ofs); + Point2 draw_pos = items[i].rect_cache.position; + if (rtl) { + draw_pos.x = size.width - draw_pos.x - items[i].tag_icon->get_width(); + } + draw_texture(items[i].tag_icon, draw_pos + base_ofs); } if (items[i].text != "") { int max_len = -1; - Vector2 size2 = font->get_string_size(items[i].text); + Vector2 size2 = items[i].text_buf->get_size(); if (fixed_column_width) { max_len = fixed_column_width; } else if (same_column_width) { @@ -1074,45 +1190,18 @@ void ItemList::_notification(int p_what) { } if (icon_mode == ICON_MODE_TOP && max_text_lines > 0) { - int ss = items[i].text.length(); - float ofs = 0; - int line = 0; - for (int j = 0; j <= ss; j++) { - int cs = j < ss ? font->get_char_size(items[i].text[j], items[i].text[j + 1]).x : 0; - if (ofs + cs > max_len || j == ss) { - line_limit_cache.write[line] = j; - line_size_cache.write[line] = ofs; - line++; - ofs = 0; - if (line >= max_text_lines) { - break; - } - } else { - ofs += cs; - } - } - - line = 0; - ofs = 0; - - text_ofs.y += font->get_ascent(); text_ofs = text_ofs.floor(); text_ofs += base_ofs; text_ofs += items[i].rect_cache.position; - FontDrawer drawer(font, Color(1, 1, 1)); - for (int j = 0; j < ss; j++) { - if (j == line_limit_cache[line]) { - line++; - ofs = 0; - if (line >= max_text_lines) { - break; - } - } - ofs += drawer.draw_char(get_canvas_item(), text_ofs + Vector2(ofs + (max_len - line_size_cache[line]) / 2, line * (font_height + line_separation)).floor(), items[i].text[j], items[i].text[j + 1], modulate); + if (rtl) { + text_ofs.x = size.width - text_ofs.x - max_len; } - //special multiline mode + items.write[i].text_buf->set_width(max_len); + items.write[i].text_buf->set_align(HALIGN_CENTER); + + items[i].text_buf->draw(get_canvas_item(), text_ofs, modulate); } else { if (fixed_column_width > 0) { size2.x = MIN(size2.x, fixed_column_width); @@ -1124,12 +1213,22 @@ void ItemList::_notification(int p_what) { text_ofs.y += (items[i].rect_cache.size.height - size2.y) / 2; } - text_ofs.y += font->get_ascent(); text_ofs = text_ofs.floor(); text_ofs += base_ofs; text_ofs += items[i].rect_cache.position; - draw_string(font, text_ofs, items[i].text, modulate, max_len + 1); + if (rtl) { + text_ofs.x = size.width - text_ofs.x - max_len; + } + + items.write[i].text_buf->set_width(max_len); + + if (rtl) { + items.write[i].text_buf->set_align(HALIGN_RIGHT); + } else { + items.write[i].text_buf->set_align(HALIGN_LEFT); + } + items[i].text_buf->draw(get_canvas_item(), text_ofs, modulate); } } @@ -1140,6 +1239,11 @@ void ItemList::_notification(int p_what) { r.size.y += vseparation; r.position.x -= hseparation / 2; r.size.x += hseparation; + + if (rtl) { + r.position.x = size.width - r.position.x - r.size.x; + } + draw_style_box(cursor, r); } } @@ -1181,6 +1285,10 @@ int ItemList::get_item_at_position(const Point2 &p_pos, bool p_exact) const { pos -= bg->get_offset(); pos.y += scroll_bar->get_value(); + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } + int closest = -1; int closest_dist = 0x7FFFFFFF; @@ -1215,6 +1323,10 @@ bool ItemList::is_pos_at_end_of_items(const Point2 &p_pos) const { pos -= bg->get_offset(); pos.y += scroll_bar->get_value(); + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } + Rect2 endrect = items[items.size() - 1].rect_cache; return (pos.y > endrect.position.y + endrect.size.y); } @@ -1366,6 +1478,16 @@ void ItemList::_bind_methods() { ClassDB::bind_method(D_METHOD("set_item_icon", "idx", "icon"), &ItemList::set_item_icon); ClassDB::bind_method(D_METHOD("get_item_icon", "idx"), &ItemList::get_item_icon); + ClassDB::bind_method(D_METHOD("set_item_text_direction", "idx", "direction"), &ItemList::set_item_text_direction); + ClassDB::bind_method(D_METHOD("get_item_text_direction", "idx"), &ItemList::get_item_text_direction); + + ClassDB::bind_method(D_METHOD("set_item_opentype_feature", "idx", "tag", "value"), &ItemList::set_item_opentype_feature); + ClassDB::bind_method(D_METHOD("get_item_opentype_feature", "idx", "tag"), &ItemList::get_item_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_item_opentype_features", "idx"), &ItemList::clear_item_opentype_features); + + ClassDB::bind_method(D_METHOD("set_item_language", "idx", "language"), &ItemList::set_item_language); + ClassDB::bind_method(D_METHOD("get_item_language", "idx"), &ItemList::get_item_language); + ClassDB::bind_method(D_METHOD("set_item_icon_transposed", "idx", "transposed"), &ItemList::set_item_icon_transposed); ClassDB::bind_method(D_METHOD("is_item_icon_transposed", "idx"), &ItemList::is_item_icon_transposed); diff --git a/scene/gui/item_list.h b/scene/gui/item_list.h index 03f477940c..9684ce0a32 100644 --- a/scene/gui/item_list.h +++ b/scene/gui/item_list.h @@ -33,6 +33,7 @@ #include "scene/gui/control.h" #include "scene/gui/scroll_bar.h" +#include "scene/resources/text_paragraph.h" class ItemList : public Control { GDCLASS(ItemList, Control); @@ -56,6 +57,11 @@ private: Color icon_modulate; Ref<Texture2D> tag_icon; String text; + Ref<TextParagraph> text_buf; + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + bool selectable; bool selected; bool disabled; @@ -117,6 +123,7 @@ private: void _scroll_changed(double); void _gui_input(const Ref<InputEvent> &p_event); + void _shape(int p_idx); protected: void _notification(int p_what); @@ -129,6 +136,16 @@ public: void set_item_text(int p_idx, const String &p_text); String get_item_text(int p_idx) const; + void set_item_text_direction(int p_idx, TextDirection p_text_direction); + TextDirection get_item_text_direction(int p_idx) const; + + void set_item_opentype_feature(int p_idx, const String &p_name, int p_value); + int get_item_opentype_feature(int p_idx, const String &p_name) const; + void clear_item_opentype_features(int p_idx); + + void set_item_language(int p_idx, const String &p_language); + String get_item_language(int p_idx) const; + void set_item_icon(int p_idx, const Ref<Texture2D> &p_icon); Ref<Texture2D> get_item_icon(int p_idx) const; diff --git a/scene/gui/label.cpp b/scene/gui/label.cpp index 9e3418a5c9..566d77e3fd 100644 --- a/scene/gui/label.cpp +++ b/scene/gui/label.cpp @@ -30,17 +30,17 @@ #include "label.h" -#include "core/print_string.h" -#include "core/project_settings.h" -#include "core/translation.h" +#include "core/config/project_settings.h" +#include "core/string/print_string.h" +#include "core/string/translation.h" + +#include "servers/text_server.h" void Label::set_autowrap(bool p_autowrap) { - if (autowrap == p_autowrap) { - return; + if (autowrap != p_autowrap) { + autowrap = p_autowrap; + lines_dirty = true; } - - autowrap = p_autowrap; - word_cache_dirty = true; update(); if (clip) { @@ -54,7 +54,8 @@ bool Label::has_autowrap() const { void Label::set_uppercase(bool p_uppercase) { uppercase = p_uppercase; - word_cache_dirty = true; + dirty = true; + update(); } @@ -62,8 +63,97 @@ bool Label::is_uppercase() const { return uppercase; } -int Label::get_line_height() const { - return get_theme_font("font")->get_height(); +int Label::get_line_height(int p_line) const { + Ref<Font> font = get_theme_font("font"); + if (p_line >= 0 && p_line < lines_rid.size()) { + return TS->shaped_text_get_size(lines_rid[p_line]).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM); + } else if (lines_rid.size() > 0) { + int h = 0; + for (int i = 0; i < lines_rid.size(); i++) { + h = MAX(h, TS->shaped_text_get_size(lines_rid[i]).y) + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM); + } + return h; + } else { + return font->get_height(get_theme_font_size("font_size")); + } +} + +void Label::_shape() { + Ref<StyleBox> style = get_theme_stylebox("normal", "Label"); + int width = (get_size().width - style->get_minimum_size().width); + + if (dirty) { + TS->shaped_text_clear(text_rid); + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + TS->shaped_text_set_direction(text_rid, is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + TS->shaped_text_set_direction(text_rid, (TextServer::Direction)text_direction); + } + TS->shaped_text_add_string(text_rid, (uppercase) ? xl_text.to_upper() : xl_text, get_theme_font("font")->get_rids(), get_theme_font_size("font_size"), opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + TS->shaped_text_set_bidi_override(text_rid, structured_text_parser(st_parser, st_args, xl_text)); + dirty = false; + lines_dirty = true; + } + if (lines_dirty) { + for (int i = 0; i < lines_rid.size(); i++) { + TS->free(lines_rid[i]); + } + lines_rid.clear(); + + Vector<Vector2i> lines = TS->shaped_text_get_line_breaks(text_rid, width, 0, (autowrap) ? (TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND) : TextServer::BREAK_MANDATORY); + for (int i = 0; i < lines.size(); i++) { + RID line = TS->shaped_text_substr(text_rid, lines[i].x, lines[i].y - lines[i].x); + lines_rid.push_back(line); + } + } + + if (xl_text.length() == 0) { + minsize = Size2(1, get_line_height()); + return; + } + if (!autowrap) { + minsize.width = 0.0f; + for (int i = 0; i < lines_rid.size(); i++) { + if (minsize.width < TS->shaped_text_get_size(lines_rid[i]).x) { + minsize.width = TS->shaped_text_get_size(lines_rid[i]).x; + } + } + } + + if (lines_dirty) { // Fill after min_size calculation. + if (align == ALIGN_FILL) { + for (int i = 0; i < lines_rid.size(); i++) { + TS->shaped_text_fit_to_width(lines_rid.write[i], width); + } + } + lines_dirty = false; + } + + _update_visible(); + + if (!autowrap || !clip) { + minimum_size_changed(); + } +} + +void Label::_update_visible() { + int line_spacing = get_theme_constant("line_spacing", "Label"); + Ref<StyleBox> style = get_theme_stylebox("normal", "Label"); + Ref<Font> font = get_theme_font("font"); + int lines_visible = lines_rid.size(); + + if (max_lines_visible >= 0 && lines_visible > max_lines_visible) { + lines_visible = max_lines_visible; + } + + minsize.height = 0; + int last_line = MIN(lines_rid.size(), lines_visible + lines_skipped); + for (int64_t i = lines_skipped; i < last_line; i++) { + minsize.height += TS->shaped_text_get_size(lines_rid[i]).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM) + line_spacing; + if (minsize.height > (get_size().height - style->get_minimum_size().height + line_spacing)) { + break; + } + } } void Label::_notification(int p_what) { @@ -73,8 +163,8 @@ void Label::_notification(int p_what) { return; //nothing new } xl_text = new_text; + dirty = true; - regenerate_word_cache(); update(); } @@ -83,8 +173,8 @@ void Label::_notification(int p_what) { RenderingServer::get_singleton()->canvas_item_set_clip(get_canvas_item(), true); } - if (word_cache_dirty) { - regenerate_word_cache(); + if (dirty || lines_dirty) { + _shape(); } RID ci = get_canvas_item(); @@ -95,51 +185,59 @@ void Label::_notification(int p_what) { Ref<Font> font = get_theme_font("font"); Color font_color = get_theme_color("font_color"); Color font_color_shadow = get_theme_color("font_color_shadow"); - bool use_outline = get_theme_constant("shadow_as_outline"); Point2 shadow_ofs(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); int line_spacing = get_theme_constant("line_spacing"); Color font_outline_modulate = get_theme_color("font_outline_modulate"); + int outline_size = get_theme_constant("outline_size"); + int shadow_outline_size = get_theme_constant("shadow_outline_size"); + bool rtl = is_layout_rtl(); style->draw(ci, Rect2(Point2(0, 0), get_size())); - RenderingServer::get_singleton()->canvas_item_set_distance_field_mode(get_canvas_item(), font.is_valid() && font->is_distance_field_hint()); - - int font_h = font->get_height() + line_spacing; - - int lines_visible = (size.y + line_spacing) / font_h; + float total_h = 0; + int lines_visible = 0; - real_t space_w = font->get_char_size(' ').width; - int chars_total = 0; - - int vbegin = 0, vsep = 0; - - if (lines_visible > line_count) { - lines_visible = line_count; + // Get number of lines to fit to the height. + for (int64_t i = lines_skipped; i < lines_rid.size(); i++) { + total_h += TS->shaped_text_get_size(lines_rid[i]).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM) + line_spacing; + if (total_h > (get_size().height - style->get_minimum_size().height + line_spacing)) { + break; + } + lines_visible++; } if (max_lines_visible >= 0 && lines_visible > max_lines_visible) { lines_visible = max_lines_visible; } + int last_line = MIN(lines_rid.size(), lines_visible + lines_skipped); + + // Get real total height. + total_h = 0; + for (int64_t i = lines_skipped; i < last_line; i++) { + total_h += TS->shaped_text_get_size(lines_rid[i]).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM) + line_spacing; + } + + int vbegin = 0, vsep = 0; if (lines_visible > 0) { switch (valign) { case VALIGN_TOP: { //nothing } break; case VALIGN_CENTER: { - vbegin = (size.y - (lines_visible * font_h - line_spacing)) / 2; + vbegin = (size.y - (total_h - line_spacing)) / 2; vsep = 0; } break; case VALIGN_BOTTOM: { - vbegin = size.y - (lines_visible * font_h - line_spacing); + vbegin = size.y - (total_h - line_spacing); vsep = 0; } break; case VALIGN_FILL: { vbegin = 0; if (lines_visible > 1) { - vsep = (size.y - (lines_visible * font_h - line_spacing)) / (lines_visible - 1); + vsep = (size.y - (total_h - line_spacing)) / (lines_visible - 1); } else { vsep = 0; } @@ -148,138 +246,113 @@ void Label::_notification(int p_what) { } } - WordCache *wc = word_cache; - if (!wc) { - return; - } - - int line = 0; - int line_to = lines_skipped + (lines_visible > 0 ? lines_visible : 1); - FontDrawer drawer(font, font_outline_modulate); - while (wc) { - /* handle lines not meant to be drawn quickly */ - if (line >= line_to) { - break; - } - if (line < lines_skipped) { - while (wc && wc->char_pos >= 0) { - wc = wc->next; - } - if (wc) { - wc = wc->next; - } - line++; - continue; - } - - /* handle lines normally */ - - if (wc->char_pos < 0) { - //empty line - wc = wc->next; - line++; - continue; - } - - WordCache *from = wc; - WordCache *to = wc; - - int taken = 0; - int spaces = 0; - while (to && to->char_pos >= 0) { - taken += to->pixel_width; - if (to->space_count) { - spaces += to->space_count; + int visible_glyphs = -1; + int glyhps_drawn = 0; + if (percent_visible < 1) { + int total_glyphs = 0; + for (int i = lines_skipped; i < last_line; i++) { + const Vector<TextServer::Glyph> visual = TS->shaped_text_get_glyphs(lines_rid[i]); + const TextServer::Glyph *glyphs = visual.ptr(); + int gl_size = visual.size(); + for (int j = 0; j < gl_size; j++) { + if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + total_glyphs++; + } } - to = to->next; } + visible_glyphs = total_glyphs * percent_visible; + } - bool can_fill = to && to->char_pos == WordCache::CHAR_WRAPLINE; - - float x_ofs = 0; - + Vector2 ofs; + ofs.y = style->get_offset().y + vbegin; + for (int i = lines_skipped; i < last_line; i++) { + ofs.x = 0; + ofs.y += TS->shaped_text_get_ascent(lines_rid[i]) + font->get_spacing(Font::SPACING_TOP); switch (align) { case ALIGN_FILL: case ALIGN_LEFT: { - x_ofs = style->get_offset().x; + if (rtl) { + ofs.x = int(size.width - style->get_margin(MARGIN_RIGHT) - TS->shaped_text_get_size(lines_rid[i]).x); + } else { + ofs.x = style->get_offset().x; + } } break; case ALIGN_CENTER: { - x_ofs = int(size.width - (taken + spaces * space_w)) / 2; + ofs.x = int(size.width - TS->shaped_text_get_size(lines_rid[i]).x) / 2; } break; case ALIGN_RIGHT: { - x_ofs = int(size.width - style->get_margin(MARGIN_RIGHT) - (taken + spaces * space_w)); + if (rtl) { + ofs.x = style->get_offset().x; + } else { + ofs.x = int(size.width - style->get_margin(MARGIN_RIGHT) - TS->shaped_text_get_size(lines_rid[i]).x); + } } break; } - float y_ofs = style->get_offset().y; - y_ofs += (line - lines_skipped) * font_h + font->get_ascent(); - y_ofs += vbegin + line * vsep; - - while (from != to) { - // draw a word - int pos = from->char_pos; - if (from->char_pos < 0) { - ERR_PRINT("BUG"); - return; - } - if (from->space_count) { - /* spacing */ - x_ofs += space_w * from->space_count; - if (can_fill && align == ALIGN_FILL && spaces) { - x_ofs += int((size.width - (taken + space_w * spaces)) / spaces); + const Vector<TextServer::Glyph> visual = TS->shaped_text_get_glyphs(lines_rid[i]); + const TextServer::Glyph *glyphs = visual.ptr(); + int gl_size = visual.size(); + + float x = ofs.x; + int outlines_drawn = glyhps_drawn; + for (int j = 0; j < gl_size; j++) { + for (int k = 0; k < glyphs[j].repeat; k++) { + if (glyphs[j].font_rid != RID()) { + if (font_color_shadow.a > 0) { + TS->font_draw_glyph(glyphs[j].font_rid, ci, glyphs[j].font_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off) + shadow_ofs, glyphs[j].index, font_color_shadow); + if (shadow_outline_size > 0) { + //draw shadow + TS->font_draw_glyph_outline(glyphs[j].font_rid, ci, glyphs[j].font_size, shadow_outline_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off) + Vector2(-shadow_ofs.x, shadow_ofs.y), glyphs[j].index, font_color_shadow); + TS->font_draw_glyph_outline(glyphs[j].font_rid, ci, glyphs[j].font_size, shadow_outline_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off) + Vector2(shadow_ofs.x, -shadow_ofs.y), glyphs[j].index, font_color_shadow); + TS->font_draw_glyph_outline(glyphs[j].font_rid, ci, glyphs[j].font_size, shadow_outline_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off) + Vector2(-shadow_ofs.x, -shadow_ofs.y), glyphs[j].index, font_color_shadow); + } + } + if (font_outline_modulate.a != 0.0 && outline_size > 0) { + TS->font_draw_glyph_outline(glyphs[j].font_rid, ci, glyphs[j].font_size, outline_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off), glyphs[j].index, font_outline_modulate); + } } + ofs.x += glyphs[j].advance; } - - if (font_color_shadow.a > 0) { - int chars_total_shadow = chars_total; //save chars drawn - float x_ofs_shadow = x_ofs; - for (int i = 0; i < from->word_len; i++) { - if (visible_chars < 0 || chars_total_shadow < visible_chars) { - char32_t c = xl_text[i + pos]; - char32_t n = xl_text[i + pos + 1]; - if (uppercase) { - c = String::char_uppercase(c); - n = String::char_uppercase(n); - } - - float move = drawer.draw_char(ci, Point2(x_ofs_shadow, y_ofs) + shadow_ofs, c, n, font_color_shadow); - if (use_outline) { - drawer.draw_char(ci, Point2(x_ofs_shadow, y_ofs) + Vector2(-shadow_ofs.x, shadow_ofs.y), c, n, font_color_shadow); - drawer.draw_char(ci, Point2(x_ofs_shadow, y_ofs) + Vector2(shadow_ofs.x, -shadow_ofs.y), c, n, font_color_shadow); - drawer.draw_char(ci, Point2(x_ofs_shadow, y_ofs) + Vector2(-shadow_ofs.x, -shadow_ofs.y), c, n, font_color_shadow); - } - x_ofs_shadow += move; - chars_total_shadow++; + if (visible_glyphs != -1) { + if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + outlines_drawn++; + if (outlines_drawn >= visible_glyphs) { + break; } } } - for (int i = 0; i < from->word_len; i++) { - if (visible_chars < 0 || chars_total < visible_chars) { - char32_t c = xl_text[i + pos]; - char32_t n = xl_text[i + pos + 1]; - if (uppercase) { - c = String::char_uppercase(c); - n = String::char_uppercase(n); + } + ofs.x = x; + + for (int j = 0; j < gl_size; j++) { + for (int k = 0; k < glyphs[j].repeat; k++) { + if (glyphs[j].font_rid != RID()) { + TS->font_draw_glyph(glyphs[j].font_rid, ci, glyphs[j].font_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off), glyphs[j].index, font_color); + } else if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + TS->draw_hex_code_box(ci, glyphs[j].font_size, ofs + Vector2(glyphs[j].x_off, glyphs[j].y_off), glyphs[j].index, font_color); + } + ofs.x += glyphs[j].advance; + } + if (visible_glyphs != -1) { + if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + glyhps_drawn++; + if (glyhps_drawn >= visible_glyphs) { + return; } - - x_ofs += drawer.draw_char(ci, Point2(x_ofs, y_ofs), c, n, font_color); - chars_total++; } } - from = from->next; } - wc = to ? to->next : nullptr; - line++; + ofs.y += TS->shaped_text_get_descent(lines_rid[i]) + vsep + line_spacing + font->get_spacing(Font::SPACING_BOTTOM); } } if (p_what == NOTIFICATION_THEME_CHANGED) { - word_cache_dirty = true; + dirty = true; update(); } if (p_what == NOTIFICATION_RESIZED) { - word_cache_dirty = true; + lines_dirty = true; } } @@ -287,8 +360,8 @@ Size2 Label::get_minimum_size() const { Size2 min_style = get_theme_stylebox("normal")->get_minimum_size(); // don't want to mutable everything - if (word_cache_dirty) { - const_cast<Label *>(this)->regenerate_word_cache(); + if (dirty || lines_dirty) { + const_cast<Label *>(this)->_shape(); } if (autowrap) { @@ -302,230 +375,50 @@ Size2 Label::get_minimum_size() const { } } -int Label::get_longest_line_width() const { - Ref<Font> font = get_theme_font("font"); - real_t max_line_width = 0; - real_t line_width = 0; - - for (int i = 0; i < xl_text.size(); i++) { - char32_t current = xl_text[i]; - if (uppercase) { - current = String::char_uppercase(current); - } - - if (current < 32) { - if (current == '\n') { - if (line_width > max_line_width) { - max_line_width = line_width; - } - line_width = 0; - } - } else { - real_t char_width = font->get_char_size(current, xl_text[i + 1]).width; - line_width += char_width; - } - } - - if (line_width > max_line_width) { - max_line_width = line_width; - } - - // ceiling to ensure autowrapping does not cut text - return Math::ceil(max_line_width); -} - int Label::get_line_count() const { if (!is_inside_tree()) { return 1; } - if (word_cache_dirty) { - const_cast<Label *>(this)->regenerate_word_cache(); + if (dirty || lines_dirty) { + const_cast<Label *>(this)->_shape(); } - return line_count; + return lines_rid.size(); } int Label::get_visible_line_count() const { - int line_spacing = get_theme_constant("line_spacing"); - int font_h = get_theme_font("font")->get_height() + line_spacing; - int lines_visible = (get_size().height - get_theme_stylebox("normal")->get_minimum_size().height + line_spacing) / font_h; - - if (lines_visible > line_count) { - lines_visible = line_count; - } - - if (max_lines_visible >= 0 && lines_visible > max_lines_visible) { - lines_visible = max_lines_visible; - } - - return lines_visible; -} - -void Label::regenerate_word_cache() { - while (word_cache) { - WordCache *current = word_cache; - word_cache = current->next; - memdelete(current); - } - - int width; - if (autowrap) { - Ref<StyleBox> style = get_theme_stylebox("normal"); - width = MAX(get_size().width, get_custom_minimum_size().width) - style->get_minimum_size().width; - } else { - width = get_longest_line_width(); - } - Ref<Font> font = get_theme_font("font"); - - real_t current_word_size = 0; - int word_pos = 0; - real_t line_width = 0; - int space_count = 0; - real_t space_width = font->get_char_size(' ').width; + Ref<StyleBox> style = get_theme_stylebox("normal"); int line_spacing = get_theme_constant("line_spacing"); - line_count = 1; - total_char_cache = 0; - - WordCache *last = nullptr; - - for (int i = 0; i <= xl_text.length(); i++) { - char32_t current = i < xl_text.length() ? xl_text[i] : L' '; //always a space at the end, so the algo works - - if (uppercase) { - current = String::char_uppercase(current); - } - - // ranges taken from http://www.unicodemap.org/ - // if your language is not well supported, consider helping improve - // the unicode support in Godot. - bool separatable = (current >= 0x2E08 && current <= 0xFAFF) || (current >= 0xFE30 && current <= 0xFE4F); - //current>=33 && (current < 65||current >90) && (current<97||current>122) && (current<48||current>57); - bool insert_newline = false; - real_t char_width = 0; - - if (current < 33) { - if (current_word_size > 0) { - WordCache *wc = memnew(WordCache); - if (word_cache) { - last->next = wc; - } else { - word_cache = wc; - } - last = wc; - - wc->pixel_width = current_word_size; - wc->char_pos = word_pos; - wc->word_len = i - word_pos; - wc->space_count = space_count; - current_word_size = 0; - space_count = 0; - } else if ((i == xl_text.length() || current == '\n') && last != nullptr && space_count != 0) { - //in case there are trailing white spaces we add a placeholder word cache with just the spaces - WordCache *wc = memnew(WordCache); - if (word_cache) { - last->next = wc; - } else { - word_cache = wc; - } - last = wc; - - wc->pixel_width = 0; - wc->char_pos = 0; - wc->word_len = 0; - wc->space_count = space_count; - current_word_size = 0; - space_count = 0; - } - - if (current == '\n') { - insert_newline = true; - } else if (current != ' ') { - total_char_cache++; - } - - if (i < xl_text.length() && xl_text[i] == ' ') { - if (line_width > 0 || last == nullptr || last->char_pos != WordCache::CHAR_WRAPLINE) { - space_count++; - line_width += space_width; - } else { - space_count = 0; - } - } - - } else { - // latin characters - if (current_word_size == 0) { - word_pos = i; - } - char_width = font->get_char_size(current, xl_text[i + 1]).width; - current_word_size += char_width; - line_width += char_width; - total_char_cache++; - - // allow autowrap to cut words when they exceed line width - if (autowrap && (current_word_size > width)) { - separatable = true; - } - } - - if ((autowrap && (line_width >= width) && ((last && last->char_pos >= 0) || separatable)) || insert_newline) { - if (separatable) { - if (current_word_size > 0) { - WordCache *wc = memnew(WordCache); - if (word_cache) { - last->next = wc; - } else { - word_cache = wc; - } - last = wc; - - wc->pixel_width = current_word_size - char_width; - wc->char_pos = word_pos; - wc->word_len = i - word_pos; - wc->space_count = space_count; - current_word_size = char_width; - word_pos = i; - } - } - - WordCache *wc = memnew(WordCache); - if (word_cache) { - last->next = wc; - } else { - word_cache = wc; - } - last = wc; - - wc->pixel_width = 0; - wc->char_pos = insert_newline ? WordCache::CHAR_NEWLINE : WordCache::CHAR_WRAPLINE; - - line_width = current_word_size; - line_count++; - space_count = 0; + int lines_visible = 0; + float total_h = 0; + for (int64_t i = lines_skipped; i < lines_rid.size(); i++) { + total_h += TS->shaped_text_get_size(lines_rid[i]).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM) + line_spacing; + if (total_h > (get_size().height - style->get_minimum_size().height + line_spacing)) { + break; } + lines_visible++; } - if (!autowrap) { - minsize.width = width; + if (lines_visible > lines_rid.size()) { + lines_visible = lines_rid.size(); } - if (max_lines_visible > 0 && line_count > max_lines_visible) { - minsize.height = (font->get_height() * max_lines_visible) + (line_spacing * (max_lines_visible - 1)); - } else { - minsize.height = (font->get_height() * line_count) + (line_spacing * (line_count - 1)); + if (max_lines_visible >= 0 && lines_visible > max_lines_visible) { + lines_visible = max_lines_visible; } - if (!autowrap || !clip) { - //helps speed up some labels that may change a lot, as no resizing is requested. Do not change. - minimum_size_changed(); - } - word_cache_dirty = false; + return lines_visible; } void Label::set_align(Align p_align) { ERR_FAIL_INDEX((int)p_align, 4); - align = p_align; + if (align != p_align) { + if (align == ALIGN_FILL || p_align == ALIGN_FILL) { + lines_dirty = true; // Reshape lines. + } + align = p_align; + } update(); } @@ -549,13 +442,83 @@ void Label::set_text(const String &p_string) { } text = p_string; xl_text = tr(p_string); - word_cache_dirty = true; + dirty = true; if (percent_visible < 1) { visible_chars = get_total_character_count() * percent_visible; } update(); } +void Label::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + dirty = true; + update(); + } +} + +void Label::set_structured_text_bidi_override(Control::StructuredTextParser p_parser) { + if (st_parser != p_parser) { + st_parser = p_parser; + dirty = true; + update(); + } +} + +Control::StructuredTextParser Label::get_structured_text_bidi_override() const { + return st_parser; +} + +void Label::set_structured_text_bidi_override_options(Array p_args) { + st_args = p_args; + dirty = true; + update(); +} + +Array Label::get_structured_text_bidi_override_options() const { + return st_args; +} + +Control::TextDirection Label::get_text_direction() const { + return text_direction; +} + +void Label::clear_opentype_features() { + opentype_features.clear(); + dirty = true; + update(); +} + +void Label::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + dirty = true; + update(); + } +} + +int Label::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void Label::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + dirty = true; + update(); + } +} + +String Label::get_language() const { + return language; +} + void Label::set_clip_text(bool p_clip) { clip = p_clip; update(); @@ -573,7 +536,7 @@ String Label::get_text() const { void Label::set_visible_characters(int p_amount) { visible_chars = p_amount; if (get_total_character_count() > 0) { - percent_visible = (float)p_amount / (float)total_char_cache; + percent_visible = (float)p_amount / (float)get_total_character_count(); } _change_notify("percent_visible"); update(); @@ -602,6 +565,7 @@ float Label::get_percent_visible() const { void Label::set_lines_skipped(int p_lines) { lines_skipped = p_lines; + _update_visible(); update(); } @@ -611,6 +575,7 @@ int Label::get_lines_skipped() const { void Label::set_max_lines_visible(int p_lines) { max_lines_visible = p_lines; + _update_visible(); update(); } @@ -619,11 +584,61 @@ int Label::get_max_lines_visible() const { } int Label::get_total_character_count() const { - if (word_cache_dirty) { - const_cast<Label *>(this)->regenerate_word_cache(); + if (dirty || lines_dirty) { + const_cast<Label *>(this)->_shape(); + } + + return xl_text.length(); +} + +bool Label::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + dirty = true; + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + dirty = true; + update(); + } + } + _change_notify(); + return true; } - return total_char_cache; + return false; +} + +bool Label::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + return false; +} + +void Label::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); } void Label::_bind_methods() { @@ -633,13 +648,20 @@ void Label::_bind_methods() { ClassDB::bind_method(D_METHOD("get_valign"), &Label::get_valign); ClassDB::bind_method(D_METHOD("set_text", "text"), &Label::set_text); ClassDB::bind_method(D_METHOD("get_text"), &Label::get_text); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &Label::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &Label::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &Label::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &Label::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &Label::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &Label::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &Label::get_language); ClassDB::bind_method(D_METHOD("set_autowrap", "enable"), &Label::set_autowrap); ClassDB::bind_method(D_METHOD("has_autowrap"), &Label::has_autowrap); ClassDB::bind_method(D_METHOD("set_clip_text", "enable"), &Label::set_clip_text); ClassDB::bind_method(D_METHOD("is_clipping_text"), &Label::is_clipping_text); ClassDB::bind_method(D_METHOD("set_uppercase", "enable"), &Label::set_uppercase); ClassDB::bind_method(D_METHOD("is_uppercase"), &Label::is_uppercase); - ClassDB::bind_method(D_METHOD("get_line_height"), &Label::get_line_height); + ClassDB::bind_method(D_METHOD("get_line_height", "line"), &Label::get_line_height, DEFVAL(-1)); ClassDB::bind_method(D_METHOD("get_line_count"), &Label::get_line_count); ClassDB::bind_method(D_METHOD("get_visible_line_count"), &Label::get_visible_line_count); ClassDB::bind_method(D_METHOD("get_total_character_count"), &Label::get_total_character_count); @@ -651,6 +673,10 @@ void Label::_bind_methods() { ClassDB::bind_method(D_METHOD("get_lines_skipped"), &Label::get_lines_skipped); ClassDB::bind_method(D_METHOD("set_max_lines_visible", "lines_visible"), &Label::set_max_lines_visible); ClassDB::bind_method(D_METHOD("get_max_lines_visible"), &Label::get_max_lines_visible); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "parser"), &Label::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override"), &Label::get_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &Label::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &Label::get_structured_text_bidi_override_options); BIND_ENUM_CONSTANT(ALIGN_LEFT); BIND_ENUM_CONSTANT(ALIGN_CENTER); @@ -663,6 +689,8 @@ void Label::_bind_methods() { BIND_ENUM_CONSTANT(VALIGN_FILL); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_MULTILINE_TEXT, "", PROPERTY_USAGE_DEFAULT_INTL), "set_text", "get_text"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); ADD_PROPERTY(PropertyInfo(Variant::INT, "valign", PROPERTY_HINT_ENUM, "Top,Center,Bottom,Fill"), "set_valign", "get_valign"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "autowrap"), "set_autowrap", "has_autowrap"); @@ -672,18 +700,23 @@ void Label::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "percent_visible", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_percent_visible", "get_percent_visible"); ADD_PROPERTY(PropertyInfo(Variant::INT, "lines_skipped", PROPERTY_HINT_RANGE, "0,999,1"), "set_lines_skipped", "get_lines_skipped"); ADD_PROPERTY(PropertyInfo(Variant::INT, "max_lines_visible", PROPERTY_HINT_RANGE, "-1,999,1"), "set_max_lines_visible", "get_max_lines_visible"); + ADD_GROUP("Structured Text", "structured_text_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "structured_text_bidi_override", PROPERTY_HINT_ENUM, "Default,URI,File,Email,List,None,Custom"), "set_structured_text_bidi_override", "get_structured_text_bidi_override"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "structured_text_bidi_override_options"), "set_structured_text_bidi_override_options", "get_structured_text_bidi_override_options"); } Label::Label(const String &p_text) { + text_rid = TS->create_shaped_text(); + set_mouse_filter(MOUSE_FILTER_IGNORE); set_text(p_text); set_v_size_flags(SIZE_SHRINK_CENTER); } Label::~Label() { - while (word_cache) { - WordCache *current = word_cache; - word_cache = current->next; - memdelete(current); + for (int i = 0; i < lines_rid.size(); i++) { + TS->free(lines_rid[i]); } + lines_rid.clear(); + TS->free(text_rid); } diff --git a/scene/gui/label.h b/scene/gui/label.h index 510a716f5d..386297f582 100644 --- a/scene/gui/label.h +++ b/scene/gui/label.h @@ -38,7 +38,6 @@ class Label : public Control { public: enum Align { - ALIGN_LEFT, ALIGN_CENTER, ALIGN_RIGHT, @@ -46,7 +45,6 @@ public: }; enum VAlign { - VALIGN_TOP, VALIGN_CENTER, VALIGN_BOTTOM, @@ -61,39 +59,37 @@ private: bool autowrap = false; bool clip = false; Size2 minsize; - int line_count = 0; bool uppercase = false; - int get_longest_line_width() const; - - struct WordCache { - enum { - CHAR_NEWLINE = -1, - CHAR_WRAPLINE = -2 - }; - int char_pos = 0; // if -1, then newline - int word_len = 0; - int pixel_width = 0; - int space_count = 0; - WordCache *next = nullptr; - }; + bool lines_dirty = true; + bool dirty = true; + RID text_rid; + Vector<RID> lines_rid; - bool word_cache_dirty = true; - void regenerate_word_cache(); + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + Array st_args; float percent_visible = 1; - WordCache *word_cache = nullptr; - int total_char_cache = 0; int visible_chars = -1; int lines_skipped = 0; int max_lines_visible = -1; + void _update_visible(); + void _shape(); + protected: void _notification(int p_what); static void _bind_methods(); - // bind helpers + + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: virtual Size2 get_minimum_size() const override; @@ -106,6 +102,22 @@ public: void set_text(const String &p_string); String get_text() const; + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + + void set_structured_text_bidi_override(Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override() const; + + void set_structured_text_bidi_override_options(Array p_args); + Array get_structured_text_bidi_override_options() const; + void set_autowrap(bool p_autowrap); bool has_autowrap() const; @@ -128,7 +140,7 @@ public: void set_max_lines_visible(int p_lines); int get_max_lines_visible() const; - int get_line_height() const; + int get_line_height(int p_line = -1) const; int get_line_count() const; int get_visible_line_count() const; diff --git a/scene/gui/line_edit.cpp b/scene/gui/line_edit.cpp index 1b8f04297d..9f8b944f4c 100644 --- a/scene/gui/line_edit.cpp +++ b/scene/gui/line_edit.cpp @@ -30,26 +30,28 @@ #include "line_edit.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" -#include "core/translation.h" +#include "core/string/print_string.h" +#include "core/string/translation.h" #include "label.h" #include "servers/display_server.h" +#include "servers/text_server.h" #ifdef TOOLS_ENABLED #include "editor/editor_scale.h" #include "editor/editor_settings.h" #endif #include "scene/main/window.h" -static bool _is_text_char(char32_t c) { - return !is_symbol(c); -} void LineEdit::_gui_input(Ref<InputEvent> p_event) { Ref<InputEventMouseButton> b = p_event; if (b.is_valid()) { + if (ime_text.length() != 0) { + // Ignore mouse clicks in IME input mode. + return; + } if (b->is_pressed() && b->get_button_index() == BUTTON_RIGHT && context_menu_enabled) { menu->set_position(get_screen_transform().xform(get_local_mouse_position())); menu->set_size(Vector2(1, 1)); @@ -70,6 +72,7 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { if (!text.empty() && is_editable() && _is_over_clear_button(b->get_position())) { clear_button_status.press_attempt = true; clear_button_status.pressing_inside = true; + update(); return; } @@ -199,6 +202,18 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { bool handled = true; switch (code) { + case (KEY_QUOTELEFT): { // Swap current input direction (primary cursor) + + if (input_direction == TEXT_DIRECTION_LTR) { + input_direction = TEXT_DIRECTION_RTL; + } else { + input_direction = TEXT_DIRECTION_LTR; + } + set_cursor_position(get_cursor_position()); + update(); + + } break; + case (KEY_X): { // CUT. if (editable) { @@ -213,6 +228,7 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { } break; + case (KEY_Y): // PASTE (Yank for unix users). case (KEY_V): { // PASTE. if (editable) { @@ -236,20 +252,13 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { if (editable) { deselect(); text = text.substr(cursor_pos, text.length() - cursor_pos); - update_cached_width(); + _shape(); set_cursor_position(0); _text_changed(); } } break; - case (KEY_Y): { // PASTE (Yank for unix users). - - if (editable) { - paste_text(); - } - - } break; case (KEY_K): { // Delete from cursor_pos to end. if (editable) { @@ -334,17 +343,13 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { } else if (k->get_command()) { #endif int cc = cursor_pos; - bool prev_char = false; - - while (cc > 0) { - bool ischar = _is_text_char(text[cc - 1]); - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text_rid); + for (int i = words.size() - 1; i >= 0; i--) { + if (words[i].x < cc) { + cc = words[i].x; break; } - - prev_char = ischar; - cc--; } delete_text(cc, cursor_pos); @@ -389,24 +394,24 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { break; } else if (k->get_command()) { #endif - bool prev_char = false; int cc = cursor_pos; - while (cc > 0) { - bool ischar = _is_text_char(text[cc - 1]); - - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text_rid); + for (int i = words.size() - 1; i >= 0; i--) { + if (words[i].x < cc) { + cc = words[i].x; break; } - - prev_char = ischar; - cc--; } set_cursor_position(cc); } else { - set_cursor_position(get_cursor_position() - 1); + if (mid_grapheme_caret_enabled) { + set_cursor_position(get_cursor_position() - 1); + } else { + set_cursor_position(TS->shaped_text_prev_grapheme_pos(text_rid, get_cursor_position())); + } } shift_selection_check_post(k->get_shift()); @@ -445,24 +450,24 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { break; } else if (k->get_command()) { #endif - bool prev_char = false; int cc = cursor_pos; - while (cc < text.length()) { - bool ischar = _is_text_char(text[cc]); - - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text_rid); + for (int i = 0; i < words.size(); i++) { + if (words[i].y > cc) { + cc = words[i].y; break; } - - prev_char = ischar; - cc++; } set_cursor_position(cc); } else { - set_cursor_position(get_cursor_position() + 1); + if (mid_grapheme_caret_enabled) { + set_cursor_position(get_cursor_position() + 1); + } else { + set_cursor_position(TS->shaped_text_next_grapheme_pos(text_rid, get_cursor_position())); + } } shift_selection_check_post(k->get_shift()); @@ -515,23 +520,25 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { #endif int cc = cursor_pos; - bool prev_char = false; - - while (cc < text.length()) { - bool ischar = _is_text_char(text[cc]); - - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text_rid); + for (int i = 0; i < words.size(); i++) { + if (words[i].y > cc) { + cc = words[i].y; break; } - prev_char = ischar; - cc++; } delete_text(cursor_pos, cc); } else { - set_cursor_position(cursor_pos + 1); - delete_char(); + if (mid_grapheme_caret_enabled) { + set_cursor_position(cursor_pos + 1); + delete_char(); + } else { + int cc = cursor_pos; + set_cursor_position(TS->shaped_text_next_grapheme_pos(text_rid, cursor_pos)); + delete_text(cc, cursor_pos); + } } } break; @@ -561,10 +568,10 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { } break; case KEY_MENU: { if (context_menu_enabled) { - Point2 pos = Point2(get_cursor_pixel_pos(), (get_size().y + get_theme_font("font")->get_height()) / 2); + Point2 pos = Point2(get_cursor_pixel_pos().x, (get_size().y + get_theme_font("font")->get_height(get_theme_font_size("font_size"))) / 2); menu->set_position(get_global_transform().xform(pos)); menu->set_size(Vector2(1, 1)); - // menu->set_scale(get_global_transform().get_scale()); + //menu->set_scale(get_global_transform().get_scale()); menu->popup(); menu->grab_focus(); } @@ -604,7 +611,10 @@ void LineEdit::_gui_input(Ref<InputEvent> p_event) { void LineEdit::set_align(Align p_align) { ERR_FAIL_INDEX((int)p_align, 4); - align = p_align; + if (align != p_align) { + align = p_align; + _shape(); + } update(); } @@ -633,14 +643,8 @@ void LineEdit::drop_data(const Point2 &p_point, const Variant &p_data) { set_cursor_at_pixel_pos(p_point.x); int selected = selection.end - selection.begin; - Ref<Font> font = get_theme_font("font"); - if (font != nullptr) { - for (int i = selection.begin; i < selection.end; i++) { - cached_width -= font->get_char_size(pass ? secret_character[0] : text[i]).width; - } - } - text.erase(selection.begin, selected); + _shape(); append_at_cursor(p_data); selection.begin = cursor_pos - selected; @@ -679,13 +683,18 @@ void LineEdit::_notification(int p_what) { } break; #endif case NOTIFICATION_RESIZED: { - window_pos = 0; + _fit_to_width(); + scroll_offset = 0; set_cursor_position(get_cursor_position()); - + } break; + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: + case NOTIFICATION_THEME_CHANGED: { + _shape(); + update(); } break; case NOTIFICATION_TRANSLATION_CHANGED: { placeholder_translated = tr(placeholder); - update_placeholder_width(); + _shape(); update(); } break; case NOTIFICATION_WM_WINDOW_FOCUS_IN: { @@ -704,6 +713,7 @@ void LineEdit::_notification(int p_what) { } int width, height; + bool rtl = is_layout_rtl(); Size2 size = get_size(); width = size.width; @@ -716,7 +726,6 @@ void LineEdit::_notification(int p_what) { style = get_theme_stylebox("read_only"); draw_caret = false; } - Ref<Font> font = get_theme_font("font"); style->draw(ci, Rect2(Point2(), size)); @@ -727,39 +736,44 @@ void LineEdit::_notification(int p_what) { int x_ofs = 0; bool using_placeholder = text.empty() && ime_text.empty(); - int cached_text_width = using_placeholder ? cached_placeholder_width : cached_width; + float text_width = TS->shaped_text_get_size(text_rid).x; + float text_height = TS->shaped_text_get_size(text_rid).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM); switch (align) { case ALIGN_FILL: case ALIGN_LEFT: { - x_ofs = style->get_offset().x; + if (rtl) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } else { + x_ofs = style->get_offset().x; + } } break; case ALIGN_CENTER: { - if (window_pos != 0) { + if (scroll_offset != 0) { x_ofs = style->get_offset().x; } else { - x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - (cached_text_width)) / 2); + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - (text_width)) / 2); } } break; case ALIGN_RIGHT: { - x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - style->get_margin(MARGIN_RIGHT) - (cached_text_width))); + if (rtl) { + x_ofs = style->get_offset().x; + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } } break; } int ofs_max = width - style->get_margin(MARGIN_RIGHT); - int char_ofs = window_pos; int y_area = height - style->get_minimum_size().height; - int y_ofs = style->get_offset().y + (y_area - font->get_height()) / 2; - - int font_ascent = font->get_ascent(); + int y_ofs = style->get_offset().y + (y_area - text_height) / 2; Color selection_color = get_theme_color("selection_color"); Color font_color = is_editable() ? get_theme_color("font_color") : get_theme_color("font_color_uneditable"); Color font_color_selected = get_theme_color("font_color_selected"); Color cursor_color = get_theme_color("cursor_color"); - const String &t = using_placeholder ? placeholder_translated : text; // Draw placeholder color. if (using_placeholder) { font_color.a *= placeholder_alpha; @@ -780,8 +794,8 @@ void LineEdit::_notification(int p_what) { r_icon->draw(ci, Point2(width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT), height / 2 - r_icon->get_height() / 2), color_icon); if (align == ALIGN_CENTER) { - if (window_pos == 0) { - x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - cached_text_width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT) * 2) / 2); + if (scroll_offset == 0) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(size.width - text_width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT) * 2) / 2); } } else { x_ofs = MAX(style->get_margin(MARGIN_LEFT), x_ofs - r_icon->get_width() - style->get_margin(MARGIN_RIGHT)); @@ -790,137 +804,135 @@ void LineEdit::_notification(int p_what) { ofs_max -= r_icon->get_width(); } - int caret_height = font->get_height() > y_area ? y_area : font->get_height(); - FontDrawer drawer(font, Color(1, 1, 1)); - while (true) { - // End of string, break. - if (char_ofs >= t.length()) { - break; - } - - if (char_ofs == cursor_pos) { - if (ime_text.length() > 0) { - int ofs = 0; - while (true) { - if (ofs >= ime_text.length()) { - break; - } - - char32_t cchar = (pass && !text.empty()) ? secret_character[0] : ime_text[ofs]; - char32_t next = (pass && !text.empty()) ? secret_character[0] : ime_text[ofs + 1]; - int im_char_width = font->get_char_size(cchar, next).width; - - if ((x_ofs + im_char_width) > ofs_max) { - break; - } - - bool selected = ofs >= ime_selection.x && ofs < ime_selection.x + ime_selection.y; - if (selected) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs + caret_height), Size2(im_char_width, 3)), font_color); - } else { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs + caret_height), Size2(im_char_width, 1)), font_color); - } - - drawer.draw_char(ci, Point2(x_ofs, y_ofs + font_ascent), cchar, next, font_color); +#ifdef TOOLS_ENABLED + int caret_width = Math::round(EDSCALE); +#else + int caret_width = 1; +#endif - x_ofs += im_char_width; - ofs++; + // Draw selections rects. + Vector2 ofs = Point2(x_ofs + scroll_offset, y_ofs); + if (selection.enabled) { + Vector<Vector2> sel = TS->shaped_text_get_selection(text_rid, selection.begin, selection.end); + for (int i = 0; i < sel.size(); i++) { + Rect2 rect = Rect2(sel[i].x + ofs.x, ofs.y, sel[i].y - sel[i].x, text_height); + if (rect.position.x + rect.size.x <= x_ofs || rect.position.x > ofs_max) { + continue; + } + if (rect.position.x < x_ofs) { + rect.size.x -= (x_ofs - rect.position.x); + rect.position.x = x_ofs; + } else if (rect.position.x + rect.size.x > ofs_max) { + rect.size.x = ofs_max - rect.position.x; + } + RenderingServer::get_singleton()->canvas_item_add_rect(ci, rect, selection_color); + } + } + const Vector<TextServer::Glyph> visual = TS->shaped_text_get_glyphs(text_rid); + const TextServer::Glyph *glyphs = visual.ptr(); + int gl_size = visual.size(); + + // Draw text. + ofs.y += TS->shaped_text_get_ascent(text_rid); + for (int i = 0; i < gl_size; i++) { + bool selected = selection.enabled && glyphs[i].start >= selection.begin && glyphs[i].end <= selection.end; + for (int j = 0; j < glyphs[i].repeat; j++) { + if (ceil(ofs.x) >= x_ofs && (ofs.x + glyphs[i].advance) <= ofs_max) { + if (glyphs[i].font_rid != RID()) { + TS->font_draw_glyph(glyphs[i].font_rid, ci, glyphs[i].font_size, ofs + Vector2(glyphs[i].x_off, glyphs[i].y_off), glyphs[i].index, selected ? font_color_selected : font_color); + } else if ((glyphs[i].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + TS->draw_hex_code_box(ci, glyphs[i].font_size, ofs + Vector2(glyphs[i].x_off, glyphs[i].y_off), glyphs[i].index, selected ? font_color_selected : font_color); } } + ofs.x += glyphs[i].advance; } - - char32_t cchar = (pass && !text.empty()) ? secret_character[0] : t[char_ofs]; - char32_t next = (pass && !text.empty()) ? secret_character[0] : t[char_ofs + 1]; - int char_width = font->get_char_size(cchar, next).width; - - // End of widget, break. - if ((x_ofs + char_width) > ofs_max) { + if (ofs.x >= ofs_max) { break; } - - bool selected = selection.enabled && char_ofs >= selection.begin && char_ofs < selection.end; - - if (selected) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs), Size2(char_width, caret_height)), selection_color); - } - - int yofs = y_ofs + (caret_height - font->get_height()) / 2; - drawer.draw_char(ci, Point2(x_ofs, yofs + font_ascent), cchar, next, selected ? font_color_selected : font_color); - - if (char_ofs == cursor_pos && draw_caret && !using_placeholder) { - if (ime_text.length() == 0) { -#ifdef TOOLS_ENABLED - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs), Size2(Math::round(EDSCALE), caret_height)), cursor_color); -#else - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs), Size2(1, caret_height)), cursor_color); -#endif - } - } - - x_ofs += char_width; - char_ofs++; } - if (char_ofs == cursor_pos) { - if (ime_text.length() > 0) { - int ofs = 0; - while (true) { - if (ofs >= ime_text.length()) { - break; + // Draw carets. + ofs.x = x_ofs + scroll_offset; + if (draw_caret) { + if (ime_text.length() == 0) { + // Normal caret. + Rect2 l_caret, t_caret; + TextServer::Direction l_dir, t_dir; + TS->shaped_text_get_carets(text_rid, cursor_pos, l_caret, l_dir, t_caret, t_dir); + + if (l_caret == Rect2() && t_caret == Rect2()) { + // No carets, add one at the start. + int h = get_theme_font("font")->get_height(get_theme_font_size("font_size")); + int y = style->get_offset().y + (y_area - h) / 2; + if (rtl) { + l_dir = TextServer::DIRECTION_RTL; + l_caret = Rect2(Vector2(ofs_max, y), Size2(caret_width, h)); + } else { + l_dir = TextServer::DIRECTION_LTR; + l_caret = Rect2(Vector2(x_ofs, y), Size2(caret_width, h)); } - - char32_t cchar = (pass && !text.empty()) ? secret_character[0] : ime_text[ofs]; - char32_t next = (pass && !text.empty()) ? secret_character[0] : ime_text[ofs + 1]; - int im_char_width = font->get_char_size(cchar, next).width; - - if ((x_ofs + im_char_width) > ofs_max) { - break; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, l_caret, cursor_color); + } else { + if (l_caret != Rect2() && l_dir == TextServer::DIRECTION_AUTO) { + // Draw extra marker on top of mid caret. + Rect2 trect = Rect2(l_caret.position.x - 3 * caret_width, l_caret.position.y, 6 * caret_width, caret_width); + trect.position += ofs; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, trect, cursor_color); } - bool selected = ofs >= ime_selection.x && ofs < ime_selection.x + ime_selection.y; - if (selected) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs + caret_height), Size2(im_char_width, 3)), font_color); - } else { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(x_ofs, y_ofs + caret_height), Size2(im_char_width, 1)), font_color); - } + l_caret.position += ofs; + l_caret.size.x = caret_width; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, l_caret, cursor_color); - drawer.draw_char(ci, Point2(x_ofs, y_ofs + font_ascent), cchar, next, font_color); + t_caret.position += ofs; + t_caret.size.x = caret_width; - x_ofs += im_char_width; - ofs++; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, t_caret, cursor_color); } - } - } - - if ((char_ofs == cursor_pos || using_placeholder) && draw_caret) { // May be at the end, or placeholder. - if (ime_text.length() == 0) { - int caret_x_ofs = x_ofs; - if (using_placeholder) { - switch (align) { - case ALIGN_LEFT: - case ALIGN_FILL: { - caret_x_ofs = style->get_offset().x; - } break; - case ALIGN_CENTER: { - caret_x_ofs = ofs_max / 2; - } break; - case ALIGN_RIGHT: { - caret_x_ofs = ofs_max; - } break; + } else { + { + // IME intermidiet text range. + Vector<Vector2> sel = TS->shaped_text_get_selection(text_rid, cursor_pos, cursor_pos + ime_text.length()); + for (int i = 0; i < sel.size(); i++) { + Rect2 rect = Rect2(sel[i].x + ofs.x, ofs.y, sel[i].y - sel[i].x, text_height); + if (rect.position.x + rect.size.x <= x_ofs || rect.position.x > ofs_max) { + continue; + } + if (rect.position.x < x_ofs) { + rect.size.x -= (x_ofs - rect.position.x); + rect.position.x = x_ofs; + } else if (rect.position.x + rect.size.x > ofs_max) { + rect.size.x = ofs_max - rect.position.x; + } + rect.size.y = caret_width; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, rect, cursor_color); + } + } + { + // IME caret. + Vector<Vector2> sel = TS->shaped_text_get_selection(text_rid, cursor_pos + ime_selection.x, cursor_pos + ime_selection.x + ime_selection.y); + for (int i = 0; i < sel.size(); i++) { + Rect2 rect = Rect2(sel[i].x + ofs.x, ofs.y, sel[i].y - sel[i].x, text_height); + if (rect.position.x + rect.size.x <= x_ofs || rect.position.x > ofs_max) { + continue; + } + if (rect.position.x < x_ofs) { + rect.size.x -= (x_ofs - rect.position.x); + rect.position.x = x_ofs; + } else if (rect.position.x + rect.size.x > ofs_max) { + rect.size.x = ofs_max - rect.position.x; + } + rect.size.y = caret_width * 3; + RenderingServer::get_singleton()->canvas_item_add_rect(ci, rect, cursor_color); } } -#ifdef TOOLS_ENABLED - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(caret_x_ofs, y_ofs), Size2(Math::round(EDSCALE), caret_height)), cursor_color); -#else - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(caret_x_ofs, y_ofs), Size2(1, caret_height)), cursor_color); -#endif } } if (has_focus()) { if (get_viewport()->get_window_id() != DisplayServer::INVALID_WINDOW_ID) { DisplayServer::get_singleton()->window_set_ime_active(true, get_viewport()->get_window_id()); - DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + Point2(using_placeholder ? 0 : x_ofs, y_ofs + caret_height), get_viewport()->get_window_id()); + DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + Point2(using_placeholder ? 0 : x_ofs, y_ofs + TS->shaped_text_get_size(text_rid).y), get_viewport()->get_window_id()); } } } break; @@ -961,6 +973,8 @@ void LineEdit::_notification(int p_what) { } ime_text = ""; ime_selection = Point2(); + _shape(); + set_cursor_position(cursor_pos); // Update scroll_offset if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_VIRTUAL_KEYBOARD) && virtual_keyboard_enabled) { DisplayServer::get_singleton()->virtual_keyboard_hide(); @@ -971,6 +985,9 @@ void LineEdit::_notification(int p_what) { if (has_focus()) { ime_text = DisplayServer::get_singleton()->ime_get_text(); ime_selection = DisplayServer::get_singleton()->ime_get_selection(); + _shape(); + set_cursor_position(cursor_pos); // Update scroll_offset + update(); } } break; @@ -1022,14 +1039,10 @@ void LineEdit::undo() { undo_stack_pos = undo_stack_pos->prev(); TextOperation op = undo_stack_pos->get(); text = op.text; - cached_width = op.cached_width; - window_pos = op.window_pos; + scroll_offset = op.scroll_offset; set_cursor_position(op.cursor_pos); - if (expand_to_text_length) { - minimum_size_changed(); - } - + _shape(); _emit_text_change(); } @@ -1043,14 +1056,10 @@ void LineEdit::redo() { undo_stack_pos = undo_stack_pos->next(); TextOperation op = undo_stack_pos->get(); text = op.text; - cached_width = op.cached_width; - window_pos = op.window_pos; + scroll_offset = op.scroll_offset; set_cursor_position(op.cursor_pos); - if (expand_to_text_length) { - minimum_size_changed(); - } - + _shape(); _emit_text_change(); } @@ -1070,98 +1079,138 @@ void LineEdit::shift_selection_check_post(bool p_shift) { } void LineEdit::set_cursor_at_pixel_pos(int p_x) { - Ref<Font> font = get_theme_font("font"); - int ofs = window_pos; Ref<StyleBox> style = get_theme_stylebox("normal"); - int pixel_ofs = 0; - Size2 size = get_size(); - bool display_clear_icon = !text.empty() && is_editable() && clear_button_enabled; - int r_icon_width = Control::get_theme_icon("clear")->get_width(); + bool rtl = is_layout_rtl(); + int x_ofs = 0; + float text_width = TS->shaped_text_get_size(text_rid).x; switch (align) { case ALIGN_FILL: case ALIGN_LEFT: { - pixel_ofs = int(style->get_offset().x); + if (rtl) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } else { + x_ofs = style->get_offset().x; + } } break; case ALIGN_CENTER: { - if (window_pos != 0) { - pixel_ofs = int(style->get_offset().x); + if (scroll_offset != 0) { + x_ofs = style->get_offset().x; } else { - pixel_ofs = int(size.width - (cached_width)) / 2; - } - - if (display_clear_icon) { - pixel_ofs -= int(r_icon_width / 2 + style->get_margin(MARGIN_RIGHT)); + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - (text_width)) / 2); } } break; case ALIGN_RIGHT: { - pixel_ofs = int(size.width - style->get_margin(MARGIN_RIGHT) - (cached_width)); - - if (display_clear_icon) { - pixel_ofs -= int(r_icon_width + style->get_margin(MARGIN_RIGHT)); + if (rtl) { + x_ofs = style->get_offset().x; + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); } } break; } - while (ofs < text.length()) { - int char_w = 0; - if (font != nullptr) { - char_w = font->get_char_size(pass ? secret_character[0] : text[ofs]).width; - } - pixel_ofs += char_w; - - if (pixel_ofs > p_x) { // Found what we look for. - break; + bool using_placeholder = text.empty() && ime_text.empty(); + bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; + if (right_icon.is_valid() || display_clear_icon) { + Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; + if (align == ALIGN_CENTER) { + if (scroll_offset == 0) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT) * 2) / 2); + } + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), x_ofs - r_icon->get_width() - style->get_margin(MARGIN_RIGHT)); } - - ofs++; } + int ofs = TS->shaped_text_hit_test_position(text_rid, p_x - x_ofs - scroll_offset); set_cursor_position(ofs); } -int LineEdit::get_cursor_pixel_pos() { - Ref<Font> font = get_theme_font("font"); - int ofs = window_pos; +Vector2i LineEdit::get_cursor_pixel_pos() { Ref<StyleBox> style = get_theme_stylebox("normal"); - int pixel_ofs = 0; - Size2 size = get_size(); - bool display_clear_icon = !text.empty() && is_editable() && clear_button_enabled; - int r_icon_width = Control::get_theme_icon("clear")->get_width(); + bool rtl = is_layout_rtl(); + int x_ofs = 0; + float text_width = TS->shaped_text_get_size(text_rid).x; switch (align) { case ALIGN_FILL: case ALIGN_LEFT: { - pixel_ofs = int(style->get_offset().x); + if (rtl) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } else { + x_ofs = style->get_offset().x; + } } break; case ALIGN_CENTER: { - if (window_pos != 0) { - pixel_ofs = int(style->get_offset().x); + if (scroll_offset != 0) { + x_ofs = style->get_offset().x; } else { - pixel_ofs = int(size.width - (cached_width)) / 2; - } - - if (display_clear_icon) { - pixel_ofs -= int(r_icon_width / 2 + style->get_margin(MARGIN_RIGHT)); + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - (text_width)) / 2); } } break; case ALIGN_RIGHT: { - pixel_ofs = int(size.width - style->get_margin(MARGIN_RIGHT) - (cached_width)); - - if (display_clear_icon) { - pixel_ofs -= int(r_icon_width + style->get_margin(MARGIN_RIGHT)); + if (rtl) { + x_ofs = style->get_offset().x; + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); } } break; } - while (ofs < cursor_pos) { - if (font != nullptr) { - pixel_ofs += font->get_char_size(pass ? secret_character[0] : text[ofs]).width; + bool using_placeholder = text.empty() && ime_text.empty(); + bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; + if (right_icon.is_valid() || display_clear_icon) { + Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; + if (align == ALIGN_CENTER) { + if (scroll_offset == 0) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT) * 2) / 2); + } + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), x_ofs - r_icon->get_width() - style->get_margin(MARGIN_RIGHT)); } - ofs++; } - return pixel_ofs; + Vector2i ret; + Rect2 l_caret, t_caret; + TextServer::Direction l_dir, t_dir; + // Get position of the start of caret. + if (ime_text.length() != 0 && ime_selection.x != 0) { + TS->shaped_text_get_carets(text_rid, cursor_pos + ime_selection.x, l_caret, l_dir, t_caret, t_dir); + } else { + TS->shaped_text_get_carets(text_rid, cursor_pos, l_caret, l_dir, t_caret, t_dir); + } + + if ((l_caret != Rect2() && (l_dir == TextServer::DIRECTION_AUTO || l_dir == (TextServer::Direction)input_direction)) || (t_caret == Rect2())) { + ret.x = x_ofs + l_caret.position.x + scroll_offset; + } else { + ret.x = x_ofs + t_caret.position.x + scroll_offset; + } + + // Get position of the end of caret. + if (ime_text.length() != 0) { + if (ime_selection.y != 0) { + TS->shaped_text_get_carets(text_rid, cursor_pos + ime_selection.x + ime_selection.y, l_caret, l_dir, t_caret, t_dir); + } else { + TS->shaped_text_get_carets(text_rid, cursor_pos + ime_text.size(), l_caret, l_dir, t_caret, t_dir); + } + if ((l_caret != Rect2() && (l_dir == TextServer::DIRECTION_AUTO || l_dir == (TextServer::Direction)input_direction)) || (t_caret == Rect2())) { + ret.y = x_ofs + l_caret.position.x + scroll_offset; + } else { + ret.y = x_ofs + t_caret.position.x + scroll_offset; + } + } else { + ret.y = ret.x; + } + + return ret; +} + +void LineEdit::set_mid_grapheme_caret_enabled(const bool p_enabled) { + mid_grapheme_caret_enabled = p_enabled; +} + +bool LineEdit::get_mid_grapheme_caret_enabled() const { + return mid_grapheme_caret_enabled; } bool LineEdit::cursor_get_blink_enabled() const { @@ -1226,49 +1275,26 @@ void LineEdit::delete_char() { return; } - Ref<Font> font = get_theme_font("font"); - if (font != nullptr) { - cached_width -= font->get_char_size(pass ? secret_character[0] : text[cursor_pos - 1]).width; - } - text.erase(cursor_pos - 1, 1); + _shape(); set_cursor_position(get_cursor_position() - 1); - if (align == ALIGN_CENTER || align == ALIGN_RIGHT) { - window_pos = CLAMP(window_pos - 1, 0, MAX(text.length() - 1, 0)); - } - _text_changed(); } void LineEdit::delete_text(int p_from_column, int p_to_column) { ERR_FAIL_COND_MSG(p_from_column < 0 || p_from_column > p_to_column || p_to_column > text.length(), vformat("Positional parameters (from: %d, to: %d) are inverted or outside the text length (%d).", p_from_column, p_to_column, text.length())); - if (text.size() > 0) { - Ref<Font> font = get_theme_font("font"); - if (font != nullptr) { - for (int i = p_from_column; i < p_to_column; i++) { - cached_width -= font->get_char_size(pass ? secret_character[0] : text[i]).width; - } - } - } else { - cached_width = 0; - } text.erase(p_from_column, p_to_column - p_from_column); + _shape(); + cursor_pos -= CLAMP(cursor_pos - p_from_column, 0, p_to_column - p_from_column); if (cursor_pos >= text.length()) { cursor_pos = text.length(); } - if (window_pos > cursor_pos) { - window_pos = cursor_pos; - } - - if (align == ALIGN_CENTER || align == ALIGN_RIGHT) { - window_pos = CLAMP(window_pos - (p_to_column - p_from_column), 0, MAX(text.length() - 1, 0)); - } if (!text_changed_dirty) { if (is_inside_tree()) { @@ -1282,13 +1308,100 @@ void LineEdit::set_text(String p_text) { clear_internal(); append_at_cursor(p_text); - if (expand_to_text_length) { - minimum_size_changed(); + update(); + cursor_pos = 0; + scroll_offset = 0; +} + +void LineEdit::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + if (text_direction != TEXT_DIRECTION_AUTO && text_direction != TEXT_DIRECTION_INHERITED) { + input_direction = text_direction; + } + _shape(); + + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), text_direction == TEXT_DIRECTION_INHERITED); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_AUTO), text_direction == TEXT_DIRECTION_AUTO); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_LTR), text_direction == TEXT_DIRECTION_LTR); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_RTL), text_direction == TEXT_DIRECTION_RTL); + update(); } +} +Control::TextDirection LineEdit::get_text_direction() const { + return text_direction; +} + +void LineEdit::clear_opentype_features() { + opentype_features.clear(); + _shape(); update(); - cursor_pos = 0; - window_pos = 0; +} + +void LineEdit::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + _shape(); + update(); + } +} + +int LineEdit::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void LineEdit::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + _shape(); + update(); + } +} + +String LineEdit::get_language() const { + return language; +} + +void LineEdit::set_draw_control_chars(bool p_draw_control_chars) { + if (draw_control_chars != p_draw_control_chars) { + draw_control_chars = p_draw_control_chars; + menu->set_item_checked(menu->get_item_index(MENU_DISPLAY_UCC), draw_control_chars); + _shape(); + update(); + } +} + +bool LineEdit::get_draw_control_chars() const { + return draw_control_chars; +} + +void LineEdit::set_structured_text_bidi_override(Control::StructuredTextParser p_parser) { + if (st_parser != p_parser) { + st_parser = p_parser; + _shape(); + update(); + } +} + +Control::StructuredTextParser LineEdit::get_structured_text_bidi_override() const { + return st_parser; +} + +void LineEdit::set_structured_text_bidi_override_options(Array p_args) { + st_args = p_args; + _shape(); + update(); +} + +Array LineEdit::get_structured_text_bidi_override_options() const { + return st_args; } void LineEdit::clear() { @@ -1303,7 +1416,7 @@ String LineEdit::get_text() const { void LineEdit::set_placeholder(String p_text) { placeholder = p_text; placeholder_translated = tr(placeholder); - update_placeholder_width(); + _shape(); update(); } @@ -1331,57 +1444,68 @@ void LineEdit::set_cursor_position(int p_pos) { cursor_pos = p_pos; + // Fit to window. + if (!is_inside_tree()) { - window_pos = cursor_pos; + scroll_offset = 0; return; } Ref<StyleBox> style = get_theme_stylebox("normal"); - Ref<Font> font = get_theme_font("font"); - - if (cursor_pos <= window_pos) { - // Adjust window if cursor goes too much to the left. - set_window_pos(MAX(0, cursor_pos - 1)); - } else { - // Adjust window if cursor goes too much to the right. - int window_width = get_size().width - style->get_minimum_size().width; - bool display_clear_icon = !text.empty() && is_editable() && clear_button_enabled; - if (right_icon.is_valid() || display_clear_icon) { - Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; - window_width -= r_icon->get_width(); - } + bool rtl = is_layout_rtl(); - if (window_width < 0) { - return; - } - int wp = window_pos; - - if (font.is_valid()) { - int accum_width = 0; - - for (int i = cursor_pos; i >= window_pos; i--) { - if (i >= text.length()) { - // Do not do this, because if the cursor is at the end, its just fine that it takes no space. - // accum_width = font->get_char_size(' ').width; - } else { - if (pass) { - accum_width += font->get_char_size(secret_character[0], i + 1 < text.length() ? secret_character[0] : 0).width; - } else { - accum_width += font->get_char_size(text[i], i + 1 < text.length() ? text[i + 1] : 0).width; // Anything should do. - } - } - if (accum_width > window_width) { - break; - } + int x_ofs = 0; + float text_width = TS->shaped_text_get_size(text_rid).x; + switch (align) { + case ALIGN_FILL: + case ALIGN_LEFT: { + if (rtl) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } else { + x_ofs = style->get_offset().x; + } + } break; + case ALIGN_CENTER: { + if (scroll_offset != 0) { + x_ofs = style->get_offset().x; + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - (text_width)) / 2); + } + } break; + case ALIGN_RIGHT: { + if (rtl) { + x_ofs = style->get_offset().x; + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - style->get_margin(MARGIN_RIGHT) - (text_width))); + } + } break; + } - wp = i; + int ofs_max = get_size().width - style->get_margin(MARGIN_RIGHT); + bool using_placeholder = text.empty() && ime_text.empty(); + bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; + if (right_icon.is_valid() || display_clear_icon) { + Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; + if (align == ALIGN_CENTER) { + if (scroll_offset == 0) { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(MARGIN_RIGHT) * 2) / 2); } + } else { + x_ofs = MAX(style->get_margin(MARGIN_LEFT), x_ofs - r_icon->get_width() - style->get_margin(MARGIN_RIGHT)); } + ofs_max -= r_icon->get_width(); + } - if (wp != window_pos) { - set_window_pos(wp); - } + // Note: Use too coordinates to fit IME input range. + Vector2i primary_catret_offset = get_cursor_pixel_pos(); + + if (MIN(primary_catret_offset.x, primary_catret_offset.y) <= x_ofs) { + scroll_offset += (x_ofs - MIN(primary_catret_offset.x, primary_catret_offset.y)); + } else if (MAX(primary_catret_offset.x, primary_catret_offset.y) >= ofs_max) { + scroll_offset += (ofs_max - MAX(primary_catret_offset.x, primary_catret_offset.y)); } + scroll_offset = MIN(0, scroll_offset); + update(); } @@ -1389,19 +1513,27 @@ int LineEdit::get_cursor_position() const { return cursor_pos; } -void LineEdit::set_window_pos(int p_pos) { - window_pos = p_pos; - if (window_pos < 0) { - window_pos = 0; +void LineEdit::set_scroll_offset(int p_pos) { + scroll_offset = p_pos; + if (scroll_offset < 0) { + scroll_offset = 0; } } +int LineEdit::get_scroll_offset() const { + return scroll_offset; +} + void LineEdit::append_at_cursor(String p_text) { if ((max_length <= 0) || (text.length() + p_text.length() <= max_length)) { String pre = text.substr(0, cursor_pos); String post = text.substr(cursor_pos, text.length() - cursor_pos); text = pre + p_text + post; - update_cached_width(); + _shape(); + TextServer::Direction dir = TS->shaped_text_get_dominant_direciton_in_range(text_rid, cursor_pos, cursor_pos + p_text.length()); + if (dir != TextServer::DIRECTION_AUTO) { + input_direction = (TextDirection)dir; + } set_cursor_position(cursor_pos + p_text.length()); } else { emit_signal("text_change_rejected"); @@ -1411,39 +1543,39 @@ void LineEdit::append_at_cursor(String p_text) { void LineEdit::clear_internal() { deselect(); _clear_undo_stack(); - cached_width = 0; cursor_pos = 0; - window_pos = 0; + scroll_offset = 0; undo_text = ""; text = ""; + _shape(); update(); } Size2 LineEdit::get_minimum_size() const { Ref<StyleBox> style = get_theme_stylebox("normal"); Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); Size2 min_size; // Minimum size of text. - int space_size = font->get_char_size(' ').x; + int space_size = font->get_char_size('m', 0, font_size).x; min_size.width = get_theme_constant("minimum_spaces") * space_size; if (expand_to_text_length) { // Add a space because some fonts are too exact, and because cursor needs a bit more when at the end. - min_size.width = MAX(min_size.width, font->get_string_size(text).x + space_size); + min_size.width = MAX(min_size.width, full_width + space_size); } - min_size.height = font->get_height(); + min_size.height = MAX(TS->shaped_text_get_size(text_rid).y + font->get_spacing(Font::SPACING_TOP) + font->get_spacing(Font::SPACING_BOTTOM), font->get_height(font_size)); // Take icons into account. - if (!text.empty() && is_editable() && clear_button_enabled) { - min_size.width = MAX(min_size.width, Control::get_theme_icon("clear")->get_width()); - min_size.height = MAX(min_size.height, Control::get_theme_icon("clear")->get_height()); - } - if (right_icon.is_valid()) { - min_size.width = MAX(min_size.width, right_icon->get_width()); - min_size.height = MAX(min_size.height, right_icon->get_height()); + bool using_placeholder = text.empty() && ime_text.empty(); + bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; + if (right_icon.is_valid() || display_clear_icon) { + Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; + min_size.width += r_icon->get_width(); + min_size.height = MAX(min_size.height, r_icon->get_height()); } return style->get_minimum_size() + min_size; @@ -1526,8 +1658,10 @@ bool LineEdit::is_editable() const { } void LineEdit::set_secret(bool p_secret) { - pass = p_secret; - update_cached_width(); + if (pass != p_secret) { + pass = p_secret; + _shape(); + } update(); } @@ -1540,8 +1674,10 @@ void LineEdit::set_secret_character(const String &p_string) { // It also wouldn't make sense to use multiple characters as the secret character. ERR_FAIL_COND_MSG(p_string.length() != 1, "Secret character must be exactly one character long (" + itos(p_string.length()) + " characters given)."); - secret_character = p_string; - update_cached_width(); + if (secret_character != p_string) { + secret_character = p_string; + _shape(); + } update(); } @@ -1618,6 +1754,101 @@ void LineEdit::menu_option(int p_option) { if (editable) { redo(); } + } break; + case MENU_DIR_INHERITED: { + set_text_direction(TEXT_DIRECTION_INHERITED); + } break; + case MENU_DIR_AUTO: { + set_text_direction(TEXT_DIRECTION_AUTO); + } break; + case MENU_DIR_LTR: { + set_text_direction(TEXT_DIRECTION_LTR); + } break; + case MENU_DIR_RTL: { + set_text_direction(TEXT_DIRECTION_RTL); + } break; + case MENU_DISPLAY_UCC: { + set_draw_control_chars(!get_draw_control_chars()); + } break; + case MENU_INSERT_LRM: { + if (editable) { + append_at_cursor(String::chr(0x200E)); + } + } break; + case MENU_INSERT_RLM: { + if (editable) { + append_at_cursor(String::chr(0x200F)); + } + } break; + case MENU_INSERT_LRE: { + if (editable) { + append_at_cursor(String::chr(0x202A)); + } + } break; + case MENU_INSERT_RLE: { + if (editable) { + append_at_cursor(String::chr(0x202B)); + } + } break; + case MENU_INSERT_LRO: { + if (editable) { + append_at_cursor(String::chr(0x202D)); + } + } break; + case MENU_INSERT_RLO: { + if (editable) { + append_at_cursor(String::chr(0x202E)); + } + } break; + case MENU_INSERT_PDF: { + if (editable) { + append_at_cursor(String::chr(0x202C)); + } + } break; + case MENU_INSERT_ALM: { + if (editable) { + append_at_cursor(String::chr(0x061C)); + } + } break; + case MENU_INSERT_LRI: { + if (editable) { + append_at_cursor(String::chr(0x2066)); + } + } break; + case MENU_INSERT_RLI: { + if (editable) { + append_at_cursor(String::chr(0x2067)); + } + } break; + case MENU_INSERT_FSI: { + if (editable) { + append_at_cursor(String::chr(0x2068)); + } + } break; + case MENU_INSERT_PDI: { + if (editable) { + append_at_cursor(String::chr(0x2069)); + } + } break; + case MENU_INSERT_ZWJ: { + if (editable) { + append_at_cursor(String::chr(0x200D)); + } + } break; + case MENU_INSERT_ZWNJ: { + if (editable) { + append_at_cursor(String::chr(0x200C)); + } + } break; + case MENU_INSERT_WJ: { + if (editable) { + append_at_cursor(String::chr(0x2060)); + } + } break; + case MENU_INSERT_SHY: { + if (editable) { + append_at_cursor(String::chr(0x00AD)); + } } } } @@ -1644,7 +1875,7 @@ void LineEdit::_editor_settings_changed() { void LineEdit::set_expand_to_text_length(bool p_enabled) { expand_to_text_length = p_enabled; minimum_size_changed(); - set_window_pos(0); + set_cursor_position(cursor_pos); } bool LineEdit::get_expand_to_text_length() const { @@ -1656,6 +1887,7 @@ void LineEdit::set_clear_button_enabled(bool p_enabled) { return; } clear_button_enabled = p_enabled; + _fit_to_width(); minimum_size_changed(); update(); } @@ -1701,6 +1933,7 @@ void LineEdit::set_right_icon(const Ref<Texture2D> &p_icon) { return; } right_icon = p_icon; + _fit_to_width(); minimum_size_changed(); update(); } @@ -1710,10 +1943,6 @@ Ref<Texture2D> LineEdit::get_right_icon() { } void LineEdit::_text_changed() { - if (expand_to_text_length) { - minimum_size_changed(); - } - _emit_text_change(); _clear_redo(); } @@ -1724,24 +1953,55 @@ void LineEdit::_emit_text_change() { text_changed_dirty = false; } -void LineEdit::update_cached_width() { - Ref<Font> font = get_theme_font("font"); - cached_width = 0; - if (font != nullptr) { - String text = get_text(); - for (int i = 0; i < text.length(); i++) { - cached_width += font->get_char_size(pass ? secret_character[0] : text[i]).width; +void LineEdit::_shape() { + Size2 old_size = TS->shaped_text_get_size(text_rid); + TS->shaped_text_clear(text_rid); + + String t; + if (text.length() == 0) { + t = placeholder_translated; + } else if (pass) { + t = secret_character.repeat(text.length() + ime_text.length()); + } else { + if (ime_text.length() > 0) { + t = text.substr(0, cursor_pos) + ime_text + text.substr(cursor_pos, text.length()); + } else { + t = text; } } + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + TS->shaped_text_set_direction(text_rid, is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + TS->shaped_text_set_direction(text_rid, (TextServer::Direction)text_direction); + } + TS->shaped_text_set_preserve_control(text_rid, draw_control_chars); + + const Ref<Font> &font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + TS->shaped_text_add_string(text_rid, t, font->get_rids(), font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + TS->shaped_text_set_bidi_override(text_rid, structured_text_parser(st_parser, st_args, t)); + + full_width = TS->shaped_text_get_size(text_rid).x; + _fit_to_width(); + + Size2 size = TS->shaped_text_get_size(text_rid); + + if ((expand_to_text_length && old_size.x != size.x) || (old_size.y != size.y)) { + minimum_size_changed(); + } } -void LineEdit::update_placeholder_width() { - Ref<Font> font = get_theme_font("font"); - cached_placeholder_width = 0; - if (font != nullptr) { - for (int i = 0; i < placeholder_translated.length(); i++) { - cached_placeholder_width += font->get_char_size(placeholder_translated[i]).width; +void LineEdit::_fit_to_width() { + if (align == ALIGN_FILL) { + Ref<StyleBox> style = get_theme_stylebox("normal"); + int t_width = get_size().width - style->get_margin(MARGIN_RIGHT) - style->get_margin(MARGIN_LEFT); + bool using_placeholder = text.empty() && ime_text.empty(); + bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; + if (right_icon.is_valid() || display_clear_icon) { + Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon("clear") : right_icon; + t_width -= r_icon->get_width(); } + TS->shaped_text_fit_to_width(text_rid, MAX(t_width, full_width)); } } @@ -1769,9 +2029,8 @@ void LineEdit::_clear_undo_stack() { void LineEdit::_create_undo_state() { TextOperation op; op.text = text; - op.cached_width = cached_width; op.cursor_pos = cursor_pos; - op.window_pos = window_pos; + op.scroll_offset = scroll_offset; undo_stack.push_back(op); } @@ -1795,6 +2054,63 @@ void LineEdit::_generate_context_menu() { menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? KEY_MASK_CMD | KEY_Z : 0); menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? KEY_MASK_CMD | KEY_MASK_SHIFT | KEY_Z : 0); } + menu->add_separator(); + menu->add_submenu_item(RTR("Text writing direction"), "DirMenu"); + menu->add_separator(); + menu->add_check_item(RTR("Display control characters"), MENU_DISPLAY_UCC); + if (editable) { + menu->add_submenu_item(RTR("Insert control character"), "CTLMenu"); + } +} + +bool LineEdit::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + _shape(); + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + _shape(); + update(); + } + } + _change_notify(); + return true; + } + + return false; +} + +bool LineEdit::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + return false; +} + +void LineEdit::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); } void LineEdit::_bind_methods() { @@ -1810,16 +2126,32 @@ void LineEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("deselect"), &LineEdit::deselect); ClassDB::bind_method(D_METHOD("set_text", "text"), &LineEdit::set_text); ClassDB::bind_method(D_METHOD("get_text"), &LineEdit::get_text); + ClassDB::bind_method(D_METHOD("get_draw_control_chars"), &LineEdit::get_draw_control_chars); + ClassDB::bind_method(D_METHOD("set_draw_control_chars", "enable"), &LineEdit::set_draw_control_chars); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &LineEdit::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &LineEdit::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &LineEdit::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &LineEdit::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &LineEdit::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &LineEdit::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &LineEdit::get_language); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "parser"), &LineEdit::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override"), &LineEdit::get_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &LineEdit::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &LineEdit::get_structured_text_bidi_override_options); ClassDB::bind_method(D_METHOD("set_placeholder", "text"), &LineEdit::set_placeholder); ClassDB::bind_method(D_METHOD("get_placeholder"), &LineEdit::get_placeholder); ClassDB::bind_method(D_METHOD("set_placeholder_alpha", "alpha"), &LineEdit::set_placeholder_alpha); ClassDB::bind_method(D_METHOD("get_placeholder_alpha"), &LineEdit::get_placeholder_alpha); ClassDB::bind_method(D_METHOD("set_cursor_position", "position"), &LineEdit::set_cursor_position); ClassDB::bind_method(D_METHOD("get_cursor_position"), &LineEdit::get_cursor_position); + ClassDB::bind_method(D_METHOD("get_scroll_offset"), &LineEdit::get_scroll_offset); ClassDB::bind_method(D_METHOD("set_expand_to_text_length", "enabled"), &LineEdit::set_expand_to_text_length); ClassDB::bind_method(D_METHOD("get_expand_to_text_length"), &LineEdit::get_expand_to_text_length); ClassDB::bind_method(D_METHOD("cursor_set_blink_enabled", "enabled"), &LineEdit::cursor_set_blink_enabled); ClassDB::bind_method(D_METHOD("cursor_get_blink_enabled"), &LineEdit::cursor_get_blink_enabled); + ClassDB::bind_method(D_METHOD("set_mid_grapheme_caret_enabled", "enabled"), &LineEdit::set_mid_grapheme_caret_enabled); + ClassDB::bind_method(D_METHOD("get_mid_grapheme_caret_enabled"), &LineEdit::get_mid_grapheme_caret_enabled); ClassDB::bind_method(D_METHOD("cursor_set_force_displayed", "enabled"), &LineEdit::cursor_set_force_displayed); ClassDB::bind_method(D_METHOD("cursor_get_force_displayed"), &LineEdit::cursor_get_force_displayed); ClassDB::bind_method(D_METHOD("cursor_set_blink_speed", "blink_speed"), &LineEdit::cursor_set_blink_speed); @@ -1866,6 +2198,27 @@ void LineEdit::_bind_methods() { BIND_ENUM_CONSTANT(MENU_SELECT_ALL); BIND_ENUM_CONSTANT(MENU_UNDO); BIND_ENUM_CONSTANT(MENU_REDO); + BIND_ENUM_CONSTANT(MENU_DIR_INHERITED); + BIND_ENUM_CONSTANT(MENU_DIR_AUTO); + BIND_ENUM_CONSTANT(MENU_DIR_LTR); + BIND_ENUM_CONSTANT(MENU_DIR_RTL); + BIND_ENUM_CONSTANT(MENU_DISPLAY_UCC); + BIND_ENUM_CONSTANT(MENU_INSERT_LRM); + BIND_ENUM_CONSTANT(MENU_INSERT_RLM); + BIND_ENUM_CONSTANT(MENU_INSERT_LRE); + BIND_ENUM_CONSTANT(MENU_INSERT_RLE); + BIND_ENUM_CONSTANT(MENU_INSERT_LRO); + BIND_ENUM_CONSTANT(MENU_INSERT_RLO); + BIND_ENUM_CONSTANT(MENU_INSERT_PDF); + BIND_ENUM_CONSTANT(MENU_INSERT_ALM); + BIND_ENUM_CONSTANT(MENU_INSERT_LRI); + BIND_ENUM_CONSTANT(MENU_INSERT_RLI); + BIND_ENUM_CONSTANT(MENU_INSERT_FSI); + BIND_ENUM_CONSTANT(MENU_INSERT_PDI); + BIND_ENUM_CONSTANT(MENU_INSERT_ZWJ); + BIND_ENUM_CONSTANT(MENU_INSERT_ZWNJ); + BIND_ENUM_CONSTANT(MENU_INSERT_WJ); + BIND_ENUM_CONSTANT(MENU_INSERT_SHY); BIND_ENUM_CONSTANT(MENU_MAX); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text"), "set_text", "get_text"); @@ -1881,6 +2234,12 @@ void LineEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "shortcut_keys_enabled"), "set_shortcut_keys_enabled", "is_shortcut_keys_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "selecting_enabled"), "set_selecting_enabled", "is_selecting_enabled"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "right_icon", PROPERTY_HINT_RESOURCE_TYPE, "Texture"), "set_right_icon", "get_right_icon"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "draw_control_chars"), "set_draw_control_chars", "get_draw_control_chars"); + ADD_GROUP("Structured Text", "structured_text_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "structured_text_bidi_override", PROPERTY_HINT_ENUM, "Default,URI,File,Email,List,None,Custom"), "set_structured_text_bidi_override", "get_structured_text_bidi_override"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "structured_text_bidi_override_options"), "set_structured_text_bidi_override_options", "get_structured_text_bidi_override_options"); ADD_GROUP("Placeholder", "placeholder_"); ADD_PROPERTY(PropertyInfo(Variant::STRING, "placeholder_text"), "set_placeholder", "get_placeholder"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "placeholder_alpha", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_placeholder_alpha", "get_placeholder_alpha"); @@ -1889,50 +2248,67 @@ void LineEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "caret_blink_speed", PROPERTY_HINT_RANGE, "0.1,10,0.01"), "cursor_set_blink_speed", "cursor_get_blink_speed"); ADD_PROPERTY(PropertyInfo(Variant::INT, "caret_position"), "set_cursor_position", "get_cursor_position"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "caret_force_displayed"), "cursor_set_force_displayed", "cursor_get_force_displayed"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "caret_mid_grapheme"), "set_mid_grapheme_caret_enabled", "get_mid_grapheme_caret_enabled"); } LineEdit::LineEdit() { - undo_stack_pos = nullptr; + text_rid = TS->create_shaped_text(); _create_undo_state(); - align = ALIGN_LEFT; - cached_width = 0; - cached_placeholder_width = 0; - cursor_pos = 0; - window_pos = 0; - window_has_focus = true; - max_length = 0; - pass = false; - secret_character = "*"; - text_changed_dirty = false; - placeholder_alpha = 0.6; - clear_button_enabled = false; + clear_button_status.press_attempt = false; clear_button_status.pressing_inside = false; - shortcut_keys_enabled = true; - selecting_enabled = true; deselect(); set_focus_mode(FOCUS_ALL); set_default_cursor_shape(CURSOR_IBEAM); set_mouse_filter(MOUSE_FILTER_STOP); - draw_caret = true; - caret_blink_enabled = false; - caret_force_displayed = false; caret_blink_timer = memnew(Timer); add_child(caret_blink_timer); caret_blink_timer->set_wait_time(0.65); caret_blink_timer->connect("timeout", callable_mp(this, &LineEdit::_toggle_draw_caret)); cursor_set_blink_enabled(false); - context_menu_enabled = true; menu = memnew(PopupMenu); add_child(menu); - editable = false; // Initialise to opposite first, so we get past the early-out in set_editable. - set_editable(true); + + menu_dir = memnew(PopupMenu); + menu_dir->set_name("DirMenu"); + menu_dir->add_radio_check_item(RTR("Same as layout direction"), MENU_DIR_INHERITED); + menu_dir->add_radio_check_item(RTR("Auto-detect direction"), MENU_DIR_AUTO); + menu_dir->add_radio_check_item(RTR("Left-to-right"), MENU_DIR_LTR); + menu_dir->add_radio_check_item(RTR("Right-to-left"), MENU_DIR_RTL); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), true); + menu->add_child(menu_dir); + + menu_ctl = memnew(PopupMenu); + menu_ctl->set_name("CTLMenu"); + menu_ctl->add_item(RTR("Left-to-right mark (LRM)"), MENU_INSERT_LRM); + menu_ctl->add_item(RTR("Right-to-left mark (RLM)"), MENU_INSERT_RLM); + menu_ctl->add_item(RTR("Start of left-to-right embedding (LRE)"), MENU_INSERT_LRE); + menu_ctl->add_item(RTR("Start of right-to-left embedding (RLE)"), MENU_INSERT_RLE); + menu_ctl->add_item(RTR("Start of left-to-right override (LRO)"), MENU_INSERT_LRO); + menu_ctl->add_item(RTR("Start of right-to-left override (RLO)"), MENU_INSERT_RLO); + menu_ctl->add_item(RTR("Pop direction formatting (PDF)"), MENU_INSERT_PDF); + menu_ctl->add_separator(); + menu_ctl->add_item(RTR("Arabic letter mark (ALM)"), MENU_INSERT_ALM); + menu_ctl->add_item(RTR("Left-to-right isolate (LRI)"), MENU_INSERT_LRI); + menu_ctl->add_item(RTR("Right-to-left isolate (RLI)"), MENU_INSERT_RLI); + menu_ctl->add_item(RTR("First strong isolate (FSI)"), MENU_INSERT_FSI); + menu_ctl->add_item(RTR("Pop direction isolate (PDI)"), MENU_INSERT_PDI); + menu_ctl->add_separator(); + menu_ctl->add_item(RTR("Zero width joiner (ZWJ)"), MENU_INSERT_ZWJ); + menu_ctl->add_item(RTR("Zero width non-joiner (ZWNJ)"), MENU_INSERT_ZWNJ); + menu_ctl->add_item(RTR("Word joiner (WJ)"), MENU_INSERT_WJ); + menu_ctl->add_item(RTR("Soft hyphen (SHY)"), MENU_INSERT_SHY); + menu->add_child(menu_ctl); + + set_editable(true); // Initialise to opposite first, so we get past the early-out in set_editable. menu->connect("id_pressed", callable_mp(this, &LineEdit::menu_option)); - expand_to_text_length = false; + menu_dir->connect("id_pressed", callable_mp(this, &LineEdit::menu_option)); + menu_ctl->connect("id_pressed", callable_mp(this, &LineEdit::menu_option)); } LineEdit::~LineEdit() { + TS->free(text_rid); } diff --git a/scene/gui/line_edit.h b/scene/gui/line_edit.h index d6cc1f1f11..e7b2a34eed 100644 --- a/scene/gui/line_edit.h +++ b/scene/gui/line_edit.h @@ -39,7 +39,6 @@ class LineEdit : public Control { public: enum Align { - ALIGN_LEFT, ALIGN_CENTER, ALIGN_RIGHT, @@ -54,41 +53,76 @@ public: MENU_SELECT_ALL, MENU_UNDO, MENU_REDO, + MENU_DIR_INHERITED, + MENU_DIR_AUTO, + MENU_DIR_LTR, + MENU_DIR_RTL, + MENU_DISPLAY_UCC, + MENU_INSERT_LRM, + MENU_INSERT_RLM, + MENU_INSERT_LRE, + MENU_INSERT_RLE, + MENU_INSERT_LRO, + MENU_INSERT_RLO, + MENU_INSERT_PDF, + MENU_INSERT_ALM, + MENU_INSERT_LRI, + MENU_INSERT_RLI, + MENU_INSERT_FSI, + MENU_INSERT_PDI, + MENU_INSERT_ZWJ, + MENU_INSERT_ZWNJ, + MENU_INSERT_WJ, + MENU_INSERT_SHY, MENU_MAX - }; private: - Align align; + Align align = ALIGN_LEFT; - bool editable; - bool pass; - bool text_changed_dirty; + bool editable = false; + bool pass = false; + bool text_changed_dirty = false; String undo_text; String text; String placeholder; String placeholder_translated; - String secret_character; - float placeholder_alpha; + String secret_character = "*"; + float placeholder_alpha = 0.6; String ime_text; Point2 ime_selection; - bool selecting_enabled; + RID text_rid; + float full_width = 0; + + bool selecting_enabled = true; - bool context_menu_enabled; - PopupMenu *menu; + bool context_menu_enabled = true; + PopupMenu *menu = nullptr; + PopupMenu *menu_dir = nullptr; + PopupMenu *menu_ctl = nullptr; - int cursor_pos; - int window_pos; - int max_length; // 0 for no maximum. + bool mid_grapheme_caret_enabled = false; - int cached_width; - int cached_placeholder_width; + int cursor_pos = 0; + int scroll_offset = 0; + int max_length = 0; // 0 for no maximum. - bool clear_button_enabled; + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + TextDirection input_direction = TEXT_DIRECTION_LTR; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + Array st_args; + bool draw_control_chars = false; - bool shortcut_keys_enabled; + bool expand_to_text_length = false; + bool window_has_focus = true; + + bool clear_button_enabled = false; + + bool shortcut_keys_enabled = true; bool virtual_keyboard_enabled = true; @@ -106,18 +140,23 @@ private: struct TextOperation { int cursor_pos; - int window_pos; + int scroll_offset; int cached_width; String text; }; List<TextOperation> undo_stack; - List<TextOperation>::Element *undo_stack_pos; + List<TextOperation>::Element *undo_stack_pos = nullptr; struct ClearButtonStatus { - bool press_attempt; - bool pressing_inside; + bool press_attempt = false; + bool pressing_inside = false; } clear_button_status; + bool caret_blink_enabled = false; + bool caret_force_displayed = false; + bool draw_caret = true; + Timer *caret_blink_timer = nullptr; + bool _is_over_clear_button(const Point2 &p_pos) const; void _clear_undo_stack(); @@ -126,28 +165,20 @@ private: void _generate_context_menu(); - Timer *caret_blink_timer; - + void _shape(); + void _fit_to_width(); void _text_changed(); void _emit_text_change(); - bool expand_to_text_length; - - void update_cached_width(); - void update_placeholder_width(); - - bool caret_blink_enabled; - bool caret_force_displayed; - bool draw_caret; - bool window_has_focus; void shift_selection_check_pre(bool); void shift_selection_check_post(bool); void selection_fill_at_cursor(); - void set_window_pos(int p_pos); + void set_scroll_offset(int p_pos); + int get_scroll_offset() const; void set_cursor_at_pixel_pos(int p_x); - int get_cursor_pixel_pos(); + Vector2i get_cursor_pixel_pos(); void _reset_caret_blink_timer(); void _toggle_draw_caret(); @@ -163,6 +194,10 @@ private: protected: static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: void set_align(Align p_align); Align get_align() const; @@ -185,19 +220,47 @@ public: void delete_char(); void delete_text(int p_from_column, int p_to_column); + void set_text(String p_text); String get_text() const; + + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + + void set_draw_control_chars(bool p_draw_control_chars); + bool get_draw_control_chars() const; + + void set_structured_text_bidi_override(Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override() const; + + void set_structured_text_bidi_override_options(Array p_args); + Array get_structured_text_bidi_override_options() const; + void set_placeholder(String p_text); String get_placeholder() const; + void set_placeholder_alpha(float p_alpha); float get_placeholder_alpha() const; + void set_cursor_position(int p_pos); int get_cursor_position() const; + void set_max_length(int p_max_length); int get_max_length() const; + void append_at_cursor(String p_text); void clear(); + void set_mid_grapheme_caret_enabled(const bool p_enabled); + bool get_mid_grapheme_caret_enabled() const; + bool cursor_get_blink_enabled() const; void cursor_set_blink_enabled(const bool p_enabled); diff --git a/scene/gui/link_button.cpp b/scene/gui/link_button.cpp index f8c8bd4caf..b66ee514dc 100644 --- a/scene/gui/link_button.cpp +++ b/scene/gui/link_button.cpp @@ -29,17 +29,103 @@ /*************************************************************************/ #include "link_button.h" +#include "core/string/translation.h" + +void LinkButton::_shape() { + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + + text_buf->clear(); + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + text_buf->set_direction((TextServer::Direction)text_direction); + } + TS->shaped_text_set_bidi_override(text_buf->get_rid(), structured_text_parser(st_parser, st_args, text)); + text_buf->add_string(text, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); +} void LinkButton::set_text(const String &p_text) { text = p_text; - update(); + _shape(); minimum_size_changed(); + update(); } String LinkButton::get_text() const { return text; } +void LinkButton::set_structured_text_bidi_override(Control::StructuredTextParser p_parser) { + if (st_parser != p_parser) { + st_parser = p_parser; + _shape(); + update(); + } +} + +Control::StructuredTextParser LinkButton::get_structured_text_bidi_override() const { + return st_parser; +} + +void LinkButton::set_structured_text_bidi_override_options(Array p_args) { + st_args = p_args; + _shape(); + update(); +} + +Array LinkButton::get_structured_text_bidi_override_options() const { + return st_args; +} + +void LinkButton::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + _shape(); + update(); + } +} + +Control::TextDirection LinkButton::get_text_direction() const { + return text_direction; +} + +void LinkButton::clear_opentype_features() { + opentype_features.clear(); + _shape(); + update(); +} + +void LinkButton::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + _shape(); + update(); + } +} + +int LinkButton::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void LinkButton::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + _shape(); + update(); + } +} + +String LinkButton::get_language() const { + return language; +} + void LinkButton::set_underline_mode(UnderlineMode p_underline_mode) { underline_mode = p_underline_mode; update(); @@ -50,11 +136,20 @@ LinkButton::UnderlineMode LinkButton::get_underline_mode() const { } Size2 LinkButton::get_minimum_size() const { - return get_theme_font("font")->get_string_size(text); + return text_buf->get_size(); } void LinkButton::_notification(int p_what) { switch (p_what) { + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + update(); + } break; + case NOTIFICATION_THEME_CHANGED: { + _shape(); + minimum_size_changed(); + update(); + } break; case NOTIFICATION_DRAW: { RID ci = get_canvas_item(); Size2 size = get_size(); @@ -94,39 +189,112 @@ void LinkButton::_notification(int p_what) { style->draw(ci, Rect2(Point2(), size)); } - Ref<Font> font = get_theme_font("font"); + int width = text_buf->get_line_width(); - draw_string(font, Vector2(0, font->get_ascent()), text, color); + if (is_layout_rtl()) { + text_buf->draw(get_canvas_item(), Vector2(size.width - width, 0), color); + } else { + text_buf->draw(get_canvas_item(), Vector2(0, 0), color); + } if (do_underline) { - int underline_spacing = get_theme_constant("underline_spacing") + font->get_underline_position(); - int width = font->get_string_size(text).width; - int y = font->get_ascent() + underline_spacing; + int underline_spacing = get_theme_constant("underline_spacing") + text_buf->get_line_underline_position(); + int y = text_buf->get_line_ascent() + underline_spacing; - draw_line(Vector2(0, y), Vector2(width, y), color, font->get_underline_thickness()); + if (is_layout_rtl()) { + draw_line(Vector2(size.width - width, y), Vector2(size.width, y), color, text_buf->get_line_underline_thickness()); + } else { + draw_line(Vector2(0, y), Vector2(width, y), color, text_buf->get_line_underline_thickness()); + } } } break; } } +bool LinkButton::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + _shape(); + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + _shape(); + update(); + } + } + _change_notify(); + return true; + } + + return false; +} + +bool LinkButton::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + return false; +} + +void LinkButton::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); +} + void LinkButton::_bind_methods() { ClassDB::bind_method(D_METHOD("set_text", "text"), &LinkButton::set_text); ClassDB::bind_method(D_METHOD("get_text"), &LinkButton::get_text); - + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &LinkButton::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &LinkButton::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &LinkButton::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &LinkButton::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &LinkButton::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &LinkButton::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &LinkButton::get_language); ClassDB::bind_method(D_METHOD("set_underline_mode", "underline_mode"), &LinkButton::set_underline_mode); ClassDB::bind_method(D_METHOD("get_underline_mode"), &LinkButton::get_underline_mode); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "parser"), &LinkButton::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override"), &LinkButton::get_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &LinkButton::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &LinkButton::get_structured_text_bidi_override_options); BIND_ENUM_CONSTANT(UNDERLINE_MODE_ALWAYS); BIND_ENUM_CONSTANT(UNDERLINE_MODE_ON_HOVER); BIND_ENUM_CONSTANT(UNDERLINE_MODE_NEVER); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text"), "set_text", "get_text"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::INT, "underline", PROPERTY_HINT_ENUM, "Always,On Hover,Never"), "set_underline_mode", "get_underline_mode"); + ADD_GROUP("Structured Text", "structured_text_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "structured_text_bidi_override", PROPERTY_HINT_ENUM, "Default,URI,File,Email,List,None,Custom"), "set_structured_text_bidi_override", "get_structured_text_bidi_override"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "structured_text_bidi_override_options"), "set_structured_text_bidi_override_options", "get_structured_text_bidi_override_options"); } LinkButton::LinkButton() { + text_buf.instance(); underline_mode = UNDERLINE_MODE_ALWAYS; - set_enabled_focus_mode(FOCUS_NONE); + set_focus_mode(FOCUS_NONE); set_default_cursor_shape(CURSOR_POINTING_HAND); } diff --git a/scene/gui/link_button.h b/scene/gui/link_button.h index b8469b529a..8c1daef166 100644 --- a/scene/gui/link_button.h +++ b/scene/gui/link_button.h @@ -33,6 +33,7 @@ #include "scene/gui/base_button.h" #include "scene/resources/bit_map.h" +#include "scene/resources/text_line.h" class LinkButton : public BaseButton { GDCLASS(LinkButton, BaseButton); @@ -46,17 +47,46 @@ public: private: String text; + Ref<TextLine> text_buf; UnderlineMode underline_mode; + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + Array st_args; + + void _shape(); + protected: virtual Size2 get_minimum_size() const override; void _notification(int p_what); static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: void set_text(const String &p_text); String get_text() const; + void set_structured_text_bidi_override(Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override() const; + + void set_structured_text_bidi_override_options(Array p_args); + Array get_structured_text_bidi_override_options() const; + + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + void set_underline_mode(UnderlineMode p_underline_mode); UnderlineMode get_underline_mode() const; diff --git a/scene/gui/margin_container.cpp b/scene/gui/margin_container.cpp index 0299065f77..b674b492d8 100644 --- a/scene/gui/margin_container.cpp +++ b/scene/gui/margin_container.cpp @@ -43,7 +43,7 @@ Size2 MarginContainer::get_minimum_size() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } if (!c->is_visible()) { @@ -80,7 +80,7 @@ void MarginContainer::_notification(int p_what) { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } diff --git a/scene/gui/menu_button.cpp b/scene/gui/menu_button.cpp index aa69fb39e7..b98b3f7094 100644 --- a/scene/gui/menu_button.cpp +++ b/scene/gui/menu_button.cpp @@ -34,6 +34,10 @@ #include "scene/main/window.h" void MenuButton::_unhandled_key_input(Ref<InputEvent> p_event) { + if (!_is_focus_owner_in_shorcut_context()) { + return; + } + if (disable_shortcuts) { return; } @@ -43,9 +47,6 @@ void MenuButton::_unhandled_key_input(Ref<InputEvent> p_event) { return; } - //bool global_only = (get_viewport()->get_modal_stack_top() && !get_viewport()->get_modal_stack_top()->is_a_parent_of(this)); - //if (popup->activate_item_by_event(p_event, global_only)) - // accept_event(); if (popup->activate_item_by_event(p_event, false)) { accept_event(); } @@ -53,17 +54,9 @@ void MenuButton::_unhandled_key_input(Ref<InputEvent> p_event) { } void MenuButton::pressed() { - { - Window *w = Object::cast_to<Window>(get_viewport()); - if (w && !w->is_embedding_subwindows()) { - print_line("windowpos: " + w->get_position()); - } - } Size2 size = get_size(); Point2 gp = get_screen_position(); - - print_line("screenpos: " + gp); gp.y += get_size().y; popup->set_position(gp); @@ -108,7 +101,6 @@ void MenuButton::_notification(int p_what) { void MenuButton::_bind_methods() { ClassDB::bind_method(D_METHOD("get_popup"), &MenuButton::get_popup); - ClassDB::bind_method(D_METHOD("_unhandled_key_input"), &MenuButton::_unhandled_key_input); ClassDB::bind_method(D_METHOD("_set_items"), &MenuButton::_set_items); ClassDB::bind_method(D_METHOD("_get_items"), &MenuButton::_get_items); ClassDB::bind_method(D_METHOD("set_switch_on_hover", "enable"), &MenuButton::set_switch_on_hover); @@ -130,8 +122,8 @@ MenuButton::MenuButton() { set_flat(true); set_toggle_mode(true); set_disable_shortcuts(false); - set_enabled_focus_mode(FOCUS_NONE); set_process_unhandled_key_input(true); + set_focus_mode(FOCUS_NONE); set_action_mode(ACTION_MODE_BUTTON_PRESS); popup = memnew(PopupMenu); diff --git a/scene/gui/menu_button.h b/scene/gui/menu_button.h index 6330899ad3..65b46d5b69 100644 --- a/scene/gui/menu_button.h +++ b/scene/gui/menu_button.h @@ -42,7 +42,6 @@ class MenuButton : public Button { bool disable_shortcuts; PopupMenu *popup; - void _unhandled_key_input(Ref<InputEvent> p_event); Array _get_items() const; void _set_items(const Array &p_items); @@ -51,6 +50,7 @@ class MenuButton : public Button { protected: void _notification(int p_what); static void _bind_methods(); + virtual void _unhandled_key_input(Ref<InputEvent> p_event) override; public: virtual void pressed() override; diff --git a/scene/gui/nine_patch_rect.h b/scene/gui/nine_patch_rect.h index 487fe4c860..a539ad43c0 100644 --- a/scene/gui/nine_patch_rect.h +++ b/scene/gui/nine_patch_rect.h @@ -79,4 +79,5 @@ public: }; VARIANT_ENUM_CAST(NinePatchRect::AxisStretchMode) + #endif // NINE_PATCH_RECT_H diff --git a/scene/gui/option_button.cpp b/scene/gui/option_button.cpp index 5780cc5e71..902d2715d4 100644 --- a/scene/gui/option_button.cpp +++ b/scene/gui/option_button.cpp @@ -30,7 +30,7 @@ #include "option_button.h" -#include "core/print_string.h" +#include "core/string/print_string.h" Size2 OptionButton::get_minimum_size() const { Size2 minsize = Button::get_minimum_size(); @@ -77,12 +77,25 @@ void OptionButton::_notification(int p_what) { Size2 size = get_size(); - Point2 ofs(size.width - arrow->get_width() - get_theme_constant("arrow_margin"), int(Math::abs((size.height - arrow->get_height()) / 2))); + Point2 ofs; + if (is_layout_rtl()) { + ofs = Point2(get_theme_constant("arrow_margin"), int(Math::abs((size.height - arrow->get_height()) / 2))); + } else { + ofs = Point2(size.width - arrow->get_width() - get_theme_constant("arrow_margin"), int(Math::abs((size.height - arrow->get_height()) / 2))); + } arrow->draw(ci, ofs, clr); } break; + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: case NOTIFICATION_THEME_CHANGED: { if (has_theme_icon("arrow")) { - _set_internal_margin(MARGIN_RIGHT, Control::get_theme_icon("arrow")->get_width()); + if (is_layout_rtl()) { + _set_internal_margin(MARGIN_LEFT, Control::get_theme_icon("arrow")->get_width()); + _set_internal_margin(MARGIN_RIGHT, 0.f); + } else { + _set_internal_margin(MARGIN_LEFT, 0.f); + _set_internal_margin(MARGIN_RIGHT, Control::get_theme_icon("arrow")->get_width()); + } } } break; case NOTIFICATION_VISIBILITY_CHANGED: { @@ -326,10 +339,16 @@ OptionButton::OptionButton() { current = -1; set_toggle_mode(true); set_text_align(ALIGN_LEFT); - set_action_mode(ACTION_MODE_BUTTON_PRESS); - if (has_theme_icon("arrow")) { - _set_internal_margin(MARGIN_RIGHT, Control::get_theme_icon("arrow")->get_width()); + if (is_layout_rtl()) { + if (has_theme_icon("arrow")) { + _set_internal_margin(MARGIN_LEFT, Control::get_theme_icon("arrow")->get_width()); + } + } else { + if (has_theme_icon("arrow")) { + _set_internal_margin(MARGIN_RIGHT, Control::get_theme_icon("arrow")->get_width()); + } } + set_action_mode(ACTION_MODE_BUTTON_PRESS); popup = memnew(PopupMenu); popup->hide(); diff --git a/scene/gui/panel.cpp b/scene/gui/panel.cpp index d8d9beca2b..acbb6d7ab5 100644 --- a/scene/gui/panel.cpp +++ b/scene/gui/panel.cpp @@ -30,7 +30,7 @@ #include "panel.h" -#include "core/print_string.h" +#include "core/string/print_string.h" void Panel::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { diff --git a/scene/gui/panel_container.cpp b/scene/gui/panel_container.cpp index 9abdfac009..051b4de825 100644 --- a/scene/gui/panel_container.cpp +++ b/scene/gui/panel_container.cpp @@ -45,7 +45,7 @@ Size2 PanelContainer::get_minimum_size() const { if (!c || !c->is_visible()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -95,7 +95,7 @@ void PanelContainer::_notification(int p_what) { if (!c || !c->is_visible_in_tree()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } diff --git a/scene/gui/popup.cpp b/scene/gui/popup.cpp index 8a65aa5032..791c78e2b4 100644 --- a/scene/gui/popup.cpp +++ b/scene/gui/popup.cpp @@ -30,7 +30,7 @@ #include "popup.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/os/keyboard.h" #include "scene/gui/panel.h" @@ -93,7 +93,7 @@ void Popup::_notification(int p_what) { } void Popup::_parent_focused() { - if (popped_up) { + if (popped_up && close_on_parent_focus) { _close_pressed(); } } @@ -112,7 +112,19 @@ void Popup::set_as_minsize() { set_size(get_contents_minimum_size()); } +void Popup::set_close_on_parent_focus(bool p_close) { + close_on_parent_focus = p_close; +} + +bool Popup::get_close_on_parent_focus() { + return close_on_parent_focus; +} + void Popup::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_close_on_parent_focus", "close"), &Popup::set_close_on_parent_focus); + ClassDB::bind_method(D_METHOD("get_close_on_parent_focus"), &Popup::get_close_on_parent_focus); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "close_on_parent_focus"), "set_close_on_parent_focus", "get_close_on_parent_focus"); + ADD_SIGNAL(MethodInfo("popup_hide")); } @@ -191,7 +203,7 @@ Size2 PopupPanel::_get_contents_minimum_size() const { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -215,7 +227,7 @@ void PopupPanel::_update_child_rects() { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } diff --git a/scene/gui/popup.h b/scene/gui/popup.h index 3e5b89ccf3..48e7ea9452 100644 --- a/scene/gui/popup.h +++ b/scene/gui/popup.h @@ -33,13 +33,14 @@ #include "scene/main/window.h" -#include "core/local_vector.h" +#include "core/templates/local_vector.h" class Popup : public Window { GDCLASS(Popup, Window); LocalVector<Window *> visible_parents; bool popped_up = false; + bool close_on_parent_focus = true; void _input_from_window(const Ref<InputEvent> &p_event); @@ -57,6 +58,10 @@ protected: public: void set_as_minsize(); + + void set_close_on_parent_focus(bool p_close); + bool get_close_on_parent_focus(); + Popup(); ~Popup(); }; diff --git a/scene/gui/popup_menu.cpp b/scene/gui/popup_menu.cpp index bc70809ad5..07f03ad40e 100644 --- a/scene/gui/popup_menu.cpp +++ b/scene/gui/popup_menu.cpp @@ -33,16 +33,14 @@ #include "core/input/input.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" -#include "core/translation.h" - -String PopupMenu::_get_accel_text(int p_item) const { - ERR_FAIL_INDEX_V(p_item, items.size(), String()); - - if (items[p_item].shortcut.is_valid()) { - return items[p_item].shortcut->get_as_text(); - } else if (items[p_item].accel) { - return keycode_get_string(items[p_item].accel); +#include "core/string/print_string.h" +#include "core/string/translation.h" + +String PopupMenu::_get_accel_text(const Item &p_item) const { + if (p_item.shortcut.is_valid()) { + return p_item.shortcut->get_as_text(); + } else if (p_item.accel) { + return keycode_get_string(p_item.accel); } return String(); } @@ -53,11 +51,9 @@ Size2 PopupMenu::_get_contents_minimum_size() const { Size2 minsize = get_theme_stylebox("panel")->get_minimum_size(); // Accounts for margin in the margin container minsize.x += scroll_container->get_v_scrollbar()->get_size().width * 2; // Adds a buffer so that the scrollbar does not render over the top of content - Ref<Font> font = get_theme_font("font"); float max_w = 0; float icon_w = 0; - int font_h = font->get_height(); int check_w = MAX(get_theme_icon("checked")->get_width(), get_theme_icon("radio_checked")->get_width()) + hseparation; int accel_max_w = 0; bool has_check = false; @@ -66,7 +62,7 @@ Size2 PopupMenu::_get_contents_minimum_size() const { Size2 size; Size2 icon_size = items[i].get_icon_size(); - size.height = MAX(icon_size.height, font_h); + size.height = MAX(icon_size.height, items[i].text_buf->get_size().y); icon_w = MAX(icon_size.width, icon_w); size.width += items[i].h_ofs; @@ -75,15 +71,14 @@ Size2 PopupMenu::_get_contents_minimum_size() const { has_check = true; } - String text = items[i].xl_text; - size.width += font->get_string_size(text).width; + size.width += items[i].text_buf->get_size().x; if (i > 0) { size.height += vseparation; } if (items[i].accel || (items[i].shortcut.is_valid() && items[i].shortcut->is_valid())) { int accel_w = hseparation * 2; - accel_w += font->get_string_size(_get_accel_text(i)).width; + accel_w += items[i].accel_text_buf->get_size().x; accel_max_w = MAX(accel_w, accel_max_w); } @@ -112,13 +107,12 @@ Size2 PopupMenu::_get_contents_minimum_size() const { } int PopupMenu::_get_items_total_height() const { - int font_height = get_theme_font("font")->get_height(); int vsep = get_theme_constant("vseparation"); // Get total height of all items by taking max of icon height and font height int items_total_height = 0; for (int i = 0; i < items.size(); i++) { - items_total_height += MAX(items[i].get_icon_size().height, font_height) + vsep; + items_total_height += MAX(items[i].get_icon_size().height, items[i].text_buf->get_size().y) + vsep; } // Subtract a separator which is not needed for the last item. @@ -150,7 +144,6 @@ int PopupMenu::_get_mouse_over(const Point2 &p_over) const { Ref<StyleBox> style = get_theme_stylebox("panel"); // Accounts for margin in the margin container int vseparation = get_theme_constant("vseparation"); - float font_h = get_theme_font("font")->get_height(); Point2 ofs = style->get_offset() + Point2(0, vseparation / 2); @@ -163,7 +156,7 @@ int PopupMenu::_get_mouse_over(const Point2 &p_over) const { ofs.y += vseparation; } - ofs.y += MAX(items[i].get_icon_size().height, font_h); + ofs.y += MAX(items[i].get_icon_size().height, items[i].text_buf->get_size().y); if (p_over.y - control->get_position().y < ofs.y) { return i; @@ -173,11 +166,11 @@ int PopupMenu::_get_mouse_over(const Point2 &p_over) const { return -1; } -void PopupMenu::_activate_submenu(int over) { - Node *n = get_node(items[over].submenu); - ERR_FAIL_COND_MSG(!n, "Item subnode does not exist: " + items[over].submenu + "."); +void PopupMenu::_activate_submenu(int p_over) { + Node *n = get_node(items[p_over].submenu); + ERR_FAIL_COND_MSG(!n, "Item subnode does not exist: " + items[p_over].submenu + "."); Popup *submenu_popup = Object::cast_to<Popup>(n); - ERR_FAIL_COND_MSG(!submenu_popup, "Item subnode is not a Popup: " + items[over].submenu + "."); + ERR_FAIL_COND_MSG(!submenu_popup, "Item subnode is not a Popup: " + items[p_over].submenu + "."); if (submenu_popup->is_visible()) { return; //already visible! } @@ -190,14 +183,24 @@ void PopupMenu::_activate_submenu(int over) { float scroll_offset = control->get_position().y; - Point2 submenu_pos = this_pos + Point2(this_rect.size.width, items[over]._ofs_cache + scroll_offset); + Point2 submenu_pos; Size2 submenu_size = submenu_popup->get_size(); + if (control->is_layout_rtl()) { + submenu_pos = this_pos + Point2(-submenu_size.width, items[p_over]._ofs_cache + scroll_offset); + } else { + submenu_pos = this_pos + Point2(this_rect.size.width, items[p_over]._ofs_cache + scroll_offset); + } // Fix pos if going outside parent rect + if (submenu_pos.x < get_parent_rect().position.x) { + submenu_pos.x = this_pos.x + submenu_size.width; + } + if (submenu_pos.x + submenu_size.width > get_parent_rect().size.width) { submenu_pos.x = this_pos.x - submenu_size.width; } + submenu_popup->set_close_on_parent_focus(false); submenu_popup->set_position(submenu_pos); submenu_popup->set_as_minsize(); // Shrink the popup size to it's contents. submenu_popup->popup(); @@ -210,11 +213,11 @@ void PopupMenu::_activate_submenu(int over) { // Autohide area above the submenu item submenu_pum->clear_autohide_areas(); - submenu_pum->add_autohide_area(Rect2(this_rect.position.x, this_rect.position.y, this_rect.size.x, items[over]._ofs_cache + scroll_offset + style->get_offset().height - vsep / 2)); + submenu_pum->add_autohide_area(Rect2(this_rect.position.x, this_rect.position.y, this_rect.size.x, items[p_over]._ofs_cache + scroll_offset + style->get_offset().height - vsep / 2)); // If there is an area below the submenu item, add an autohide area there. - if (items[over]._ofs_cache + items[over]._height_cache + scroll_offset <= control->get_size().height) { - int from = items[over]._ofs_cache + items[over]._height_cache + scroll_offset + vsep / 2 + style->get_offset().height; + if (items[p_over]._ofs_cache + items[p_over]._height_cache + scroll_offset <= control->get_size().height) { + int from = items[p_over]._ofs_cache + items[p_over]._height_cache + scroll_offset + vsep / 2 + style->get_offset().height; submenu_pum->add_autohide_area(Rect2(this_rect.position.x, this_rect.position.y + from, this_rect.size.x, this_rect.size.y - from)); } } @@ -229,12 +232,13 @@ void PopupMenu::_submenu_timeout() { } void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { - if (p_event->is_action("ui_down") && p_event->is_pressed() && mouse_over != items.size() - 1) { + if (p_event->is_action("ui_down") && p_event->is_pressed()) { int search_from = mouse_over + 1; if (search_from >= items.size()) { search_from = 0; } + bool match_found = false; for (int i = search_from; i < items.size(); i++) { if (!items[i].separator && !items[i].disabled) { mouse_over = i; @@ -242,15 +246,31 @@ void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { _scroll_to_item(i); control->update(); set_input_as_handled(); + match_found = true; break; } } - } else if (p_event->is_action("ui_up") && p_event->is_pressed() && mouse_over != 0) { + + if (!match_found) { + // If the last item is not selectable, try re-searching from the start. + for (int i = 0; i < search_from; i++) { + if (!items[i].separator && !items[i].disabled) { + mouse_over = i; + emit_signal("id_focused", i); + _scroll_to_item(i); + control->update(); + set_input_as_handled(); + break; + } + } + } + } else if (p_event->is_action("ui_up") && p_event->is_pressed()) { int search_from = mouse_over - 1; if (search_from < 0) { search_from = items.size() - 1; } + bool match_found = false; for (int i = search_from; i >= 0; i--) { if (!items[i].separator && !items[i].disabled) { mouse_over = i; @@ -258,9 +278,24 @@ void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { _scroll_to_item(i); control->update(); set_input_as_handled(); + match_found = true; break; } } + + if (!match_found) { + // If the first item is not selectable, try re-searching from the end. + for (int i = items.size() - 1; i >= search_from; i--) { + if (!items[i].separator && !items[i].disabled) { + mouse_over = i; + emit_signal("id_focused", i); + _scroll_to_item(i); + control->update(); + set_input_as_handled(); + break; + } + } + } } else if (p_event->is_action("ui_left") && p_event->is_pressed()) { Node *n = get_parent(); if (n && Object::cast_to<PopupMenu>(n)) { @@ -286,7 +321,11 @@ void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { // Make an area which does not include v scrollbar, so that items are not activated when dragging scrollbar. Rect2 item_clickable_area = scroll_container->get_rect(); if (scroll_container->get_v_scrollbar()->is_visible_in_tree()) { - item_clickable_area.size.width -= scroll_container->get_v_scrollbar()->get_size().width; + if (is_layout_rtl()) { + item_clickable_area.position.x += scroll_container->get_v_scrollbar()->get_size().width; + } else { + item_clickable_area.size.width -= scroll_container->get_v_scrollbar()->get_size().width; + } } Ref<InputEventMouseButton> b = p_event; @@ -305,12 +344,14 @@ void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { during_grabbed_click = false; initial_button_mask = 0; - int over = _get_mouse_over(b->get_position()); - - if (invalidated_click) { - invalidated_click = false; + // Disable clicks under a time threshold to avoid selection right when opening the popup. + uint64_t now = OS::get_singleton()->get_ticks_msec(); + uint64_t diff = now - popup_time_msec; + if (diff < 100) { return; } + + int over = _get_mouse_over(b->get_position()); if (over < 0) { if (!was_during_grabbed_click) { hide(); @@ -338,13 +379,6 @@ void PopupMenu::_gui_input(const Ref<InputEvent> &p_event) { return; } - if (invalidated_click) { - moved += m->get_relative(); - if (moved.length() > 4) { - invalidated_click = false; - } - } - for (List<Rect2>::Element *E = autohide_areas.front(); E; E = E->next()) { if (!Rect2(Point2(), get_size()).has_point(m->get_position()) && E->get().has_point(m->get_position())) { _close_pressed(); @@ -421,13 +455,19 @@ void PopupMenu::_draw_items() { margin_size.width = margin_container->get_theme_constant("margin_right") + margin_container->get_theme_constant("margin_left"); margin_size.height = margin_container->get_theme_constant("margin_top") + margin_container->get_theme_constant("margin_bottom"); + bool rtl = control->is_layout_rtl(); Ref<StyleBox> style = get_theme_stylebox("panel"); Ref<StyleBox> hover = get_theme_stylebox("hover"); - Ref<Font> font = get_theme_font("font"); // In Item::checkable_type enum order (less the non-checkable member) Ref<Texture2D> check[] = { get_theme_icon("checked"), get_theme_icon("radio_checked") }; Ref<Texture2D> uncheck[] = { get_theme_icon("unchecked"), get_theme_icon("radio_unchecked") }; - Ref<Texture2D> submenu = get_theme_icon("submenu"); + Ref<Texture2D> submenu; + if (rtl) { + submenu = get_theme_icon("submenu_mirrored"); + } else { + submenu = get_theme_icon("submenu"); + } + Ref<StyleBox> separator = get_theme_stylebox("separator"); Ref<StyleBox> labeled_separator_left = get_theme_stylebox("labeled_separator_left"); Ref<StyleBox> labeled_separator_right = get_theme_stylebox("labeled_separator_right"); @@ -438,7 +478,7 @@ void PopupMenu::_draw_items() { Color font_color_disabled = get_theme_color("font_color_disabled"); Color font_color_accel = get_theme_color("font_color_accel"); Color font_color_hover = get_theme_color("font_color_hover"); - float font_h = font->get_height(); + Color font_color_separator = get_theme_color("font_color_separator"); float scroll_width = scroll_container->get_v_scrollbar()->is_visible_in_tree() ? scroll_container->get_v_scrollbar()->get_size().width : 0; float display_width = control->get_size().width - scroll_width; @@ -471,12 +511,18 @@ void PopupMenu::_draw_items() { ofs.y += vseparation; } + _shape_item(i); + Point2 item_ofs = ofs; Size2 icon_size = items[i].get_icon_size(); - float h = MAX(icon_size.height, font_h); + float h = MAX(icon_size.height, items[i].text_buf->get_size().y); if (i == mouse_over) { - hover->draw(ci, Rect2(item_ofs + Point2(-hseparation, -vseparation / 2), Size2(display_width + hseparation * 2, h + vseparation))); + if (rtl) { + hover->draw(ci, Rect2(item_ofs + Point2(-hseparation + scroll_width, -vseparation / 2), Size2(display_width + hseparation * 2, h + vseparation))); + } else { + hover->draw(ci, Rect2(item_ofs + Point2(-hseparation, -vseparation / 2), Size2(display_width + hseparation * 2, h + vseparation))); + } } String text = items[i].xl_text; @@ -486,7 +532,7 @@ void PopupMenu::_draw_items() { if (items[i].separator) { int sep_h = separator->get_center_size().height + separator->get_minimum_size().height; if (text != String()) { - int text_size = font->get_string_size(text).width; + int text_size = items[i].text_buf->get_size().width; int text_center = display_width / 2; int text_left = text_center - text_size / 2; int text_right = text_center + text_size / 2; @@ -506,36 +552,54 @@ void PopupMenu::_draw_items() { // Checkboxes if (items[i].checkable_type) { Texture2D *icon = (items[i].checked ? check[items[i].checkable_type - 1] : uncheck[items[i].checkable_type - 1]).ptr(); - icon->draw(ci, item_ofs + Point2(0, Math::floor((h - icon->get_height()) / 2.0)), icon_color); + if (rtl) { + icon->draw(ci, Size2(control->get_size().width - item_ofs.x - icon->get_width(), item_ofs.y) + Point2(0, Math::floor((h - icon->get_height()) / 2.0)), icon_color); + } else { + icon->draw(ci, item_ofs + Point2(0, Math::floor((h - icon->get_height()) / 2.0)), icon_color); + } } // Icon if (!items[i].icon.is_null()) { - items[i].icon->draw(ci, item_ofs + Size2(check_ofs, 0) + Point2(0, Math::floor((h - icon_size.height) / 2.0)), icon_color); + if (rtl) { + items[i].icon->draw(ci, Size2(control->get_size().width - item_ofs.x - check_ofs - icon_size.width, item_ofs.y) + Point2(0, Math::floor((h - icon_size.height) / 2.0)), icon_color); + } else { + items[i].icon->draw(ci, item_ofs + Size2(check_ofs, 0) + Point2(0, Math::floor((h - icon_size.height) / 2.0)), icon_color); + } } // Submenu arrow on right hand side if (items[i].submenu != "") { - submenu->draw(ci, Point2(display_width - submenu->get_width(), item_ofs.y + Math::floor(h - submenu->get_height()) / 2), icon_color); + if (rtl) { + submenu->draw(ci, Point2(scroll_width + style->get_margin(MARGIN_LEFT), item_ofs.y + Math::floor(h - submenu->get_height()) / 2), icon_color); + } else { + submenu->draw(ci, Point2(display_width - style->get_margin(MARGIN_RIGHT) - submenu->get_width(), item_ofs.y + Math::floor(h - submenu->get_height()) / 2), icon_color); + } } // Text - item_ofs.y += font->get_ascent(); if (items[i].separator) { if (text != String()) { - int center = (display_width - font->get_string_size(text).width) / 2; - font->draw(ci, Point2(center, item_ofs.y + Math::floor((h - font_h) / 2.0)), text, font_color_disabled); + int center = (display_width - items[i].text_buf->get_size().width) / 2; + items[i].text_buf->draw(ci, Point2(center, item_ofs.y + Math::floor((h - items[i].text_buf->get_size().y) / 2.0)), font_color_separator); } } else { item_ofs.x += icon_ofs + check_ofs; - font->draw(ci, item_ofs + Point2(0, Math::floor((h - font_h) / 2.0)), text, items[i].disabled ? font_color_disabled : (i == mouse_over ? font_color_hover : font_color)); + if (rtl) { + items[i].text_buf->draw(ci, Size2(control->get_size().width - items[i].text_buf->get_size().width - item_ofs.x, item_ofs.y) + Point2(0, Math::floor((h - items[i].text_buf->get_size().y) / 2.0)), items[i].disabled ? font_color_disabled : (i == mouse_over ? font_color_hover : font_color)); + } else { + items[i].text_buf->draw(ci, item_ofs + Point2(0, Math::floor((h - items[i].text_buf->get_size().y) / 2.0)), items[i].disabled ? font_color_disabled : (i == mouse_over ? font_color_hover : font_color)); + } } // Accelerator / Shortcut if (items[i].accel || (items[i].shortcut.is_valid() && items[i].shortcut->is_valid())) { - String sc_text = _get_accel_text(i); - item_ofs.x = display_width - font->get_string_size(sc_text).width; - font->draw(ci, item_ofs + Point2(0, Math::floor((h - font_h) / 2.0)), sc_text, i == mouse_over ? font_color_hover : font_color_accel); + if (rtl) { + item_ofs.x = scroll_width + style->get_margin(MARGIN_LEFT); + } else { + item_ofs.x = display_width - style->get_margin(MARGIN_RIGHT) - items[i].accel_text_buf->get_size().x; + } + items[i].accel_text_buf->draw(ci, item_ofs + Point2(0, Math::floor((h - items[i].text_buf->get_size().y) / 2.0)), i == mouse_over ? font_color_hover : font_color_accel); } // Cache the item vertical offset from the first item and the height @@ -552,6 +616,52 @@ void PopupMenu::_draw_background() { style->draw(ci2, Rect2(Point2(), margin_container->get_size())); } +void PopupMenu::_minimum_lifetime_timeout() { + close_allowed = true; + // If the mouse still isn't in this popup after timer expires, close. + if (!get_visible_rect().has_point(get_mouse_position())) { + _close_pressed(); + } +} + +void PopupMenu::_close_pressed() { + // Only apply minimum lifetime to submenus. + PopupMenu *parent_pum = Object::cast_to<PopupMenu>(get_parent()); + if (!parent_pum) { + Popup::_close_pressed(); + return; + } + + // If the timer has expired, close. If timer is still running, do nothing. + if (close_allowed) { + close_allowed = false; + Popup::_close_pressed(); + } else if (minimum_lifetime_timer->is_stopped()) { + minimum_lifetime_timer->start(); + } +} + +void PopupMenu::_shape_item(int p_item) { + if (items.write[p_item].dirty) { + items.write[p_item].text_buf->clear(); + + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + + if (items[p_item].text_direction == Control::TEXT_DIRECTION_INHERITED) { + items.write[p_item].text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + items.write[p_item].text_buf->set_direction((TextServer::Direction)items[p_item].text_direction); + } + items.write[p_item].text_buf->add_string(items.write[p_item].xl_text, font, font_size, items[p_item].opentype_features, (items[p_item].language != "") ? items[p_item].language : TranslationServer::get_singleton()->get_tool_locale()); + + items.write[p_item].accel_text_buf->clear(); + items.write[p_item].accel_text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + items.write[p_item].accel_text_buf->add_string(_get_accel_text(items.write[p_item]), font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + items.write[p_item].dirty = false; + } +} + void PopupMenu::_notification(int p_what) { switch (p_what) { case NOTIFICATION_ENTER_TREE: { @@ -562,16 +672,19 @@ void PopupMenu::_notification(int p_what) { set_submenu_popup_delay(pm_delay); } } break; + case NOTIFICATION_THEME_CHANGED: + case Control::NOTIFICATION_LAYOUT_DIRECTION_CHANGED: case NOTIFICATION_TRANSLATION_CHANGED: { for (int i = 0; i < items.size(); i++) { items.write[i].xl_text = tr(items[i].text); + items.write[i].dirty = true; } child_controls_changed(); control->update(); } break; case NOTIFICATION_WM_MOUSE_ENTER: { - //grab_focus(); + grab_focus(); } break; case NOTIFICATION_WM_MOUSE_EXIT: { if (mouse_over >= 0 && (items[mouse_over].submenu == "" || submenu_over != -1)) { @@ -655,6 +768,7 @@ void PopupMenu::add_item(const String &p_label, int p_id, uint32_t p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -664,6 +778,7 @@ void PopupMenu::add_icon_item(const Ref<Texture2D> &p_icon, const String &p_labe ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.icon = p_icon; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -673,6 +788,7 @@ void PopupMenu::add_check_item(const String &p_label, int p_id, uint32_t p_accel ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.checkable_type = Item::CHECKABLE_TYPE_CHECK_BOX; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -683,6 +799,7 @@ void PopupMenu::add_icon_check_item(const Ref<Texture2D> &p_icon, const String & item.icon = p_icon; item.checkable_type = Item::CHECKABLE_TYPE_CHECK_BOX; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -692,6 +809,7 @@ void PopupMenu::add_radio_check_item(const String &p_label, int p_id, uint32_t p ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.checkable_type = Item::CHECKABLE_TYPE_RADIO_BUTTON; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -702,6 +820,7 @@ void PopupMenu::add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const St item.icon = p_icon; item.checkable_type = Item::CHECKABLE_TYPE_RADIO_BUTTON; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -712,6 +831,7 @@ void PopupMenu::add_multistate_item(const String &p_label, int p_max_states, int item.max_states = p_max_states; item.state = p_default_state; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -729,6 +849,7 @@ void PopupMenu::add_shortcut(const Ref<Shortcut> &p_shortcut, int p_id, bool p_g Item item; ITEM_SETUP_WITH_SHORTCUT(p_shortcut, p_id, p_global); items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -738,6 +859,7 @@ void PopupMenu::add_icon_shortcut(const Ref<Texture2D> &p_icon, const Ref<Shortc ITEM_SETUP_WITH_SHORTCUT(p_shortcut, p_id, p_global); item.icon = p_icon; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -747,6 +869,7 @@ void PopupMenu::add_check_shortcut(const Ref<Shortcut> &p_shortcut, int p_id, bo ITEM_SETUP_WITH_SHORTCUT(p_shortcut, p_id, p_global); item.checkable_type = Item::CHECKABLE_TYPE_CHECK_BOX; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -757,6 +880,7 @@ void PopupMenu::add_icon_check_shortcut(const Ref<Texture2D> &p_icon, const Ref< item.icon = p_icon; item.checkable_type = Item::CHECKABLE_TYPE_CHECK_BOX; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -766,6 +890,7 @@ void PopupMenu::add_radio_check_shortcut(const Ref<Shortcut> &p_shortcut, int p_ ITEM_SETUP_WITH_SHORTCUT(p_shortcut, p_id, p_global); item.checkable_type = Item::CHECKABLE_TYPE_RADIO_BUTTON; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -776,6 +901,7 @@ void PopupMenu::add_icon_radio_check_shortcut(const Ref<Texture2D> &p_icon, cons item.icon = p_icon; item.checkable_type = Item::CHECKABLE_TYPE_RADIO_BUTTON; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -787,6 +913,7 @@ void PopupMenu::add_submenu_item(const String &p_label, const String &p_submenu, item.id = p_id == -1 ? items.size() : p_id; item.submenu = p_submenu; items.push_back(item); + _shape_item(items.size() - 1); control->update(); child_controls_changed(); } @@ -800,11 +927,48 @@ void PopupMenu::set_item_text(int p_idx, const String &p_text) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].text = p_text; items.write[p_idx].xl_text = tr(p_text); + _shape_item(p_idx); control->update(); child_controls_changed(); } +void PopupMenu::set_item_text_direction(int p_item, Control::TextDirection p_text_direction) { + ERR_FAIL_INDEX(p_item, items.size()); + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (items[p_item].text_direction != p_text_direction) { + items.write[p_item].text_direction = p_text_direction; + items.write[p_item].dirty = true; + control->update(); + } +} + +void PopupMenu::clear_item_opentype_features(int p_item) { + ERR_FAIL_INDEX(p_item, items.size()); + items.write[p_item].opentype_features.clear(); + items.write[p_item].dirty = true; + control->update(); +} + +void PopupMenu::set_item_opentype_feature(int p_item, const String &p_name, int p_value) { + ERR_FAIL_INDEX(p_item, items.size()); + int32_t tag = TS->name_to_tag(p_name); + if (!items[p_item].opentype_features.has(tag) || (int)items[p_item].opentype_features[tag] != p_value) { + items.write[p_item].opentype_features[tag] = p_value; + items.write[p_item].dirty = true; + control->update(); + } +} + +void PopupMenu::set_item_language(int p_item, const String &p_language) { + ERR_FAIL_INDEX(p_item, items.size()); + if (items[p_item].language != p_language) { + items.write[p_item].language = p_language; + items.write[p_item].dirty = true; + control->update(); + } +} + void PopupMenu::set_item_icon(int p_idx, const Ref<Texture2D> &p_icon) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].icon = p_icon; @@ -833,6 +997,7 @@ void PopupMenu::set_item_id(int p_idx, int p_id) { void PopupMenu::set_item_accelerator(int p_idx, uint32_t p_accel) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].accel = p_accel; + items.write[p_idx].dirty = true; control->update(); child_controls_changed(); @@ -871,6 +1036,25 @@ String PopupMenu::get_item_text(int p_idx) const { return items[p_idx].text; } +Control::TextDirection PopupMenu::get_item_text_direction(int p_item) const { + ERR_FAIL_INDEX_V(p_item, items.size(), Control::TEXT_DIRECTION_INHERITED); + return items[p_item].text_direction; +} + +int PopupMenu::get_item_opentype_feature(int p_item, const String &p_name) const { + ERR_FAIL_INDEX_V(p_item, items.size(), -1); + int32_t tag = TS->name_to_tag(p_name); + if (!items[p_item].opentype_features.has(tag)) { + return -1; + } + return items[p_item].opentype_features[tag]; +} + +String PopupMenu::get_item_language(int p_item) const { + ERR_FAIL_INDEX_V(p_item, items.size(), ""); + return items[p_item].language; +} + int PopupMenu::get_item_idx_from_text(const String &text) const { for (int idx = 0; idx < items.size(); idx++) { if (items[idx].text == text) { @@ -977,6 +1161,7 @@ void PopupMenu::set_item_shortcut(int p_idx, const Ref<Shortcut> &p_shortcut, bo } items.write[p_idx].shortcut = p_shortcut; items.write[p_idx].shortcut_is_global = p_global; + items.write[p_idx].dirty = true; if (items[p_idx].shortcut.is_valid()) { _ref_shortcut(items[p_idx].shortcut); @@ -1369,6 +1554,9 @@ void PopupMenu::_bind_methods() { ClassDB::bind_method(D_METHOD("add_submenu_item", "label", "submenu", "id"), &PopupMenu::add_submenu_item, DEFVAL(-1)); ClassDB::bind_method(D_METHOD("set_item_text", "idx", "text"), &PopupMenu::set_item_text); + ClassDB::bind_method(D_METHOD("set_item_text_direction", "idx", "direction"), &PopupMenu::set_item_text_direction); + ClassDB::bind_method(D_METHOD("set_item_opentype_feature", "idx", "tag", "value"), &PopupMenu::set_item_opentype_feature); + ClassDB::bind_method(D_METHOD("set_item_language", "idx", "language"), &PopupMenu::set_item_language); ClassDB::bind_method(D_METHOD("set_item_icon", "idx", "icon"), &PopupMenu::set_item_icon); ClassDB::bind_method(D_METHOD("set_item_checked", "idx", "checked"), &PopupMenu::set_item_checked); ClassDB::bind_method(D_METHOD("set_item_id", "idx", "id"), &PopupMenu::set_item_id); @@ -1388,6 +1576,10 @@ void PopupMenu::_bind_methods() { ClassDB::bind_method(D_METHOD("toggle_item_multistate", "idx"), &PopupMenu::toggle_item_multistate); ClassDB::bind_method(D_METHOD("get_item_text", "idx"), &PopupMenu::get_item_text); + ClassDB::bind_method(D_METHOD("get_item_text_direction", "idx"), &PopupMenu::get_item_text_direction); + ClassDB::bind_method(D_METHOD("get_item_opentype_feature", "idx", "tag"), &PopupMenu::get_item_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_item_opentype_features", "idx"), &PopupMenu::clear_item_opentype_features); + ClassDB::bind_method(D_METHOD("get_item_language", "idx"), &PopupMenu::get_item_language); ClassDB::bind_method(D_METHOD("get_item_icon", "idx"), &PopupMenu::get_item_icon); ClassDB::bind_method(D_METHOD("is_item_checked", "idx"), &PopupMenu::is_item_checked); ClassDB::bind_method(D_METHOD("get_item_id", "idx"), &PopupMenu::get_item_id); @@ -1443,7 +1635,7 @@ void PopupMenu::_bind_methods() { void PopupMenu::popup(const Rect2 &p_bounds) { moved = Vector2(); - invalidated_click = true; + popup_time_msec = OS::get_singleton()->get_ticks_msec(); set_as_minsize(); Popup::popup(p_bounds); } @@ -1475,7 +1667,6 @@ PopupMenu::PopupMenu() { submenu_over = -1; initial_button_mask = 0; during_grabbed_click = false; - invalidated_click = false; allow_search = true; search_time_msec = 0; @@ -1490,6 +1681,12 @@ PopupMenu::PopupMenu() { submenu_timer->set_one_shot(true); submenu_timer->connect("timeout", callable_mp(this, &PopupMenu::_submenu_timeout)); add_child(submenu_timer); + + minimum_lifetime_timer = memnew(Timer); + minimum_lifetime_timer->set_wait_time(0.3); + minimum_lifetime_timer->set_one_shot(true); + minimum_lifetime_timer->connect("timeout", callable_mp(this, &PopupMenu::_minimum_lifetime_timeout)); + add_child(minimum_lifetime_timer); } PopupMenu::~PopupMenu() { diff --git a/scene/gui/popup_menu.h b/scene/gui/popup_menu.h index 9535fd07d7..a082fcf0e7 100644 --- a/scene/gui/popup_menu.h +++ b/scene/gui/popup_menu.h @@ -35,6 +35,7 @@ #include "scene/gui/popup.h" #include "scene/gui/scroll_container.h" #include "scene/gui/shortcut.h" +#include "scene/resources/text_line.h" class PopupMenu : public Popup { GDCLASS(PopupMenu, Popup); @@ -43,6 +44,13 @@ class PopupMenu : public Popup { Ref<Texture2D> icon; String text; String xl_text; + Ref<TextLine> text_buf; + Ref<TextLine> accel_text_buf; + + Dictionary opentype_features; + String language; + Control::TextDirection text_direction = Control::TEXT_DIRECTION_AUTO; + bool checked; enum { CHECKABLE_TYPE_NONE, @@ -53,6 +61,7 @@ class PopupMenu : public Popup { int state; bool separator; bool disabled; + bool dirty; int id; Variant metadata; String submenu; @@ -71,6 +80,9 @@ class PopupMenu : public Popup { } Item() { + text_buf.instance(); + accel_text_buf.instance(); + dirty = true; checked = false; checkable_type = CHECKABLE_TYPE_NONE; separator = false; @@ -86,6 +98,9 @@ class PopupMenu : public Popup { } }; + bool close_allowed = false; + + Timer *minimum_lifetime_timer = nullptr; Timer *submenu_timer; List<Rect2> autohide_areas; Vector<Item> items; @@ -94,18 +109,20 @@ class PopupMenu : public Popup { int mouse_over; int submenu_over; Rect2 parent_rect; - String _get_accel_text(int p_item) const; + String _get_accel_text(const Item &p_item) const; int _get_mouse_over(const Point2 &p_over) const; virtual Size2 _get_contents_minimum_size() const override; int _get_items_total_height() const; void _scroll_to_item(int p_item); + void _shape_item(int p_item); + void _gui_input(const Ref<InputEvent> &p_event); - void _activate_submenu(int over); + void _activate_submenu(int p_over); void _submenu_timeout(); - bool invalidated_click; + uint64_t popup_time_msec = 0; bool hide_on_item_selection; bool hide_on_checkable_item_selection; bool hide_on_multistate_item_selection; @@ -130,6 +147,9 @@ class PopupMenu : public Popup { void _draw_items(); void _draw_background(); + void _minimum_lifetime_timeout(); + void _close_pressed(); + protected: friend class MenuButton; void _notification(int p_what); @@ -155,6 +175,11 @@ public: void add_submenu_item(const String &p_label, const String &p_submenu, int p_id = -1); void set_item_text(int p_idx, const String &p_text); + + void set_item_text_direction(int p_idx, Control::TextDirection p_text_direction); + void set_item_opentype_feature(int p_idx, const String &p_name, int p_value); + void clear_item_opentype_features(int p_idx); + void set_item_language(int p_idx, const String &p_language); void set_item_icon(int p_idx, const Ref<Texture2D> &p_icon); void set_item_checked(int p_idx, bool p_checked); void set_item_id(int p_idx, int p_id); @@ -175,6 +200,9 @@ public: void toggle_item_checked(int p_idx); String get_item_text(int p_idx) const; + Control::TextDirection get_item_text_direction(int p_idx) const; + int get_item_opentype_feature(int p_idx, const String &p_name) const; + String get_item_language(int p_idx) const; int get_item_idx_from_text(const String &text) const; Ref<Texture2D> get_item_icon(int p_idx) const; bool is_item_checked(int p_idx) const; diff --git a/scene/gui/progress_bar.cpp b/scene/gui/progress_bar.cpp index 9246f1723d..1344d010ae 100644 --- a/scene/gui/progress_bar.cpp +++ b/scene/gui/progress_bar.cpp @@ -29,17 +29,21 @@ /*************************************************************************/ #include "progress_bar.h" +#include "scene/resources/text_line.h" Size2 ProgressBar::get_minimum_size() const { Ref<StyleBox> bg = get_theme_stylebox("bg"); Ref<StyleBox> fg = get_theme_stylebox("fg"); Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); Size2 minimum_size = bg->get_minimum_size(); minimum_size.height = MAX(minimum_size.height, fg->get_minimum_size().height); minimum_size.width = MAX(minimum_size.width, fg->get_minimum_size().width); if (percent_visible) { - minimum_size.height = MAX(minimum_size.height, bg->get_minimum_size().height + font->get_height()); + String txt = "100%"; + TextLine tl = TextLine(txt, font, font_size); + minimum_size.height = MAX(minimum_size.height, bg->get_minimum_size().height + tl.get_size().y); } else { // this is needed, else the progressbar will collapse minimum_size.width = MAX(minimum_size.width, 1); minimum_size.height = MAX(minimum_size.height, 1); @@ -52,6 +56,7 @@ void ProgressBar::_notification(int p_what) { Ref<StyleBox> bg = get_theme_stylebox("bg"); Ref<StyleBox> fg = get_theme_stylebox("fg"); Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); Color font_color = get_theme_color("font_color"); draw_style_box(bg, Rect2(Point2(), get_size())); @@ -59,12 +64,17 @@ void ProgressBar::_notification(int p_what) { int mp = fg->get_minimum_size().width; int p = r * (get_size().width - mp); if (p > 0) { - draw_style_box(fg, Rect2(Point2(), Size2(p + fg->get_minimum_size().width, get_size().height))); + if (is_layout_rtl()) { + draw_style_box(fg, Rect2(Point2(p, 0), Size2(fg->get_minimum_size().width, get_size().height))); + } else { + draw_style_box(fg, Rect2(Point2(0, 0), Size2(p + fg->get_minimum_size().width, get_size().height))); + } } if (percent_visible) { - String txt = itos(int(get_as_ratio() * 100)) + "%"; - font->draw_halign(get_canvas_item(), Point2(0, font->get_ascent() + (get_size().height - font->get_height()) / 2), HALIGN_CENTER, get_size().width, txt, font_color); + String txt = TS->format_number(itos(int(get_as_ratio() * 100))) + TS->percent_sign(); + TextLine tl = TextLine(txt, font, font_size); + tl.draw(get_canvas_item(), Point2(get_size().width - tl.get_size().x, get_size().height - tl.get_size().y) / 2, font_color); } } } diff --git a/scene/gui/range.cpp b/scene/gui/range.cpp index 59e26d9e38..bdb9f408f0 100644 --- a/scene/gui/range.cpp +++ b/scene/gui/range.cpp @@ -34,7 +34,7 @@ String Range::get_configuration_warning() const { String warning = Control::get_configuration_warning(); if (shared->exp_ratio && shared->min <= 0) { - if (warning != String()) { + if (!warning.empty()) { warning += "\n\n"; } warning += TTR("If \"Exp Edit\" is enabled, \"Min Value\" must be greater than 0."); diff --git a/scene/gui/reference_rect.cpp b/scene/gui/reference_rect.cpp index 27c57c684a..773acb2713 100644 --- a/scene/gui/reference_rect.cpp +++ b/scene/gui/reference_rect.cpp @@ -30,7 +30,7 @@ #include "reference_rect.h" -#include "core/engine.h" +#include "core/config/engine.h" void ReferenceRect::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { @@ -38,7 +38,7 @@ void ReferenceRect::_notification(int p_what) { return; } if (Engine::get_singleton()->is_editor_hint() || !editor_only) { - draw_rect(Rect2(Point2(), get_size()), border_color, false); + draw_rect(Rect2(Point2(), get_size()), border_color, false, border_width); } } } @@ -52,6 +52,15 @@ Color ReferenceRect::get_border_color() const { return border_color; } +void ReferenceRect::set_border_width(float p_width) { + border_width = MAX(0.0, p_width); + update(); +} + +float ReferenceRect::get_border_width() const { + return border_width; +} + void ReferenceRect::set_editor_only(const bool &p_enabled) { editor_only = p_enabled; update(); @@ -65,14 +74,13 @@ void ReferenceRect::_bind_methods() { ClassDB::bind_method(D_METHOD("get_border_color"), &ReferenceRect::get_border_color); ClassDB::bind_method(D_METHOD("set_border_color", "color"), &ReferenceRect::set_border_color); + ClassDB::bind_method(D_METHOD("get_border_width"), &ReferenceRect::get_border_width); + ClassDB::bind_method(D_METHOD("set_border_width", "width"), &ReferenceRect::set_border_width); + ClassDB::bind_method(D_METHOD("get_editor_only"), &ReferenceRect::get_editor_only); ClassDB::bind_method(D_METHOD("set_editor_only", "enabled"), &ReferenceRect::set_editor_only); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "border_color"), "set_border_color", "get_border_color"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "border_width", PROPERTY_HINT_RANGE, "0.0,5.0,0.1,or_greater"), "set_border_width", "get_border_width"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "editor_only"), "set_editor_only", "get_editor_only"); } - -ReferenceRect::ReferenceRect() { - border_color = Color(1, 0, 0); - editor_only = true; -} diff --git a/scene/gui/reference_rect.h b/scene/gui/reference_rect.h index db2f4269f3..becbbf47c5 100644 --- a/scene/gui/reference_rect.h +++ b/scene/gui/reference_rect.h @@ -35,19 +35,22 @@ class ReferenceRect : public Control { GDCLASS(ReferenceRect, Control); - Color border_color; - bool editor_only; + + Color border_color = Color(1, 0, 0); + float border_width = 1.0; + bool editor_only = true; protected: void _notification(int p_what); static void _bind_methods(); public: - ReferenceRect(); - void set_border_color(const Color &p_color); Color get_border_color() const; + void set_border_width(float p_width); + float get_border_width() const; + void set_editor_only(const bool &p_enabled); bool get_editor_only() const; }; diff --git a/scene/gui/rich_text_effect.cpp b/scene/gui/rich_text_effect.cpp index 2628e5ab0f..5b201f45d3 100644 --- a/scene/gui/rich_text_effect.cpp +++ b/scene/gui/rich_text_effect.cpp @@ -30,7 +30,7 @@ #include "rich_text_effect.h" -#include "core/script_language.h" +#include "core/object/script_language.h" void RichTextEffect::_bind_methods() { BIND_VMETHOD(MethodInfo(Variant::BOOL, "_process_custom_fx", PropertyInfo(Variant::OBJECT, "char_fx", PROPERTY_HINT_RESOURCE_TYPE, "CharFXTransform"))); @@ -64,11 +64,8 @@ RichTextEffect::RichTextEffect() { } void CharFXTransform::_bind_methods() { - ClassDB::bind_method(D_METHOD("get_relative_index"), &CharFXTransform::get_relative_index); - ClassDB::bind_method(D_METHOD("set_relative_index", "index"), &CharFXTransform::set_relative_index); - - ClassDB::bind_method(D_METHOD("get_absolute_index"), &CharFXTransform::get_absolute_index); - ClassDB::bind_method(D_METHOD("set_absolute_index", "index"), &CharFXTransform::set_absolute_index); + ClassDB::bind_method(D_METHOD("get_range"), &CharFXTransform::get_range); + ClassDB::bind_method(D_METHOD("set_range", "range"), &CharFXTransform::set_range); ClassDB::bind_method(D_METHOD("get_elapsed_time"), &CharFXTransform::get_elapsed_time); ClassDB::bind_method(D_METHOD("set_elapsed_time", "time"), &CharFXTransform::set_elapsed_time); @@ -76,6 +73,9 @@ void CharFXTransform::_bind_methods() { ClassDB::bind_method(D_METHOD("is_visible"), &CharFXTransform::is_visible); ClassDB::bind_method(D_METHOD("set_visibility", "visibility"), &CharFXTransform::set_visibility); + ClassDB::bind_method(D_METHOD("is_outline"), &CharFXTransform::is_outline); + ClassDB::bind_method(D_METHOD("set_outline", "outline"), &CharFXTransform::set_outline); + ClassDB::bind_method(D_METHOD("get_offset"), &CharFXTransform::get_offset); ClassDB::bind_method(D_METHOD("set_offset", "offset"), &CharFXTransform::set_offset); @@ -85,27 +85,24 @@ void CharFXTransform::_bind_methods() { ClassDB::bind_method(D_METHOD("get_environment"), &CharFXTransform::get_environment); ClassDB::bind_method(D_METHOD("set_environment", "environment"), &CharFXTransform::set_environment); - ClassDB::bind_method(D_METHOD("get_character"), &CharFXTransform::get_character); - ClassDB::bind_method(D_METHOD("set_character", "character"), &CharFXTransform::set_character); + ClassDB::bind_method(D_METHOD("get_glyph_index"), &CharFXTransform::get_glyph_index); + ClassDB::bind_method(D_METHOD("set_glyph_index", "glyph_index"), &CharFXTransform::set_glyph_index); + + ClassDB::bind_method(D_METHOD("get_font"), &CharFXTransform::get_font); + ClassDB::bind_method(D_METHOD("set_font", "font"), &CharFXTransform::set_font); - ADD_PROPERTY(PropertyInfo(Variant::INT, "relative_index"), "set_relative_index", "get_relative_index"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "absolute_index"), "set_absolute_index", "get_absolute_index"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "range"), "set_range", "get_range"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "elapsed_time"), "set_elapsed_time", "get_elapsed_time"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "visible"), "set_visibility", "is_visible"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "outline"), "set_outline", "is_outline"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "env"), "set_environment", "get_environment"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "character"), "set_character", "get_character"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "glyph_index"), "set_glyph_index", "get_glyph_index"); + ADD_PROPERTY(PropertyInfo(Variant::RID, "font"), "set_font", "get_font"); } CharFXTransform::CharFXTransform() { - relative_index = 0; - absolute_index = 0; - visibility = true; - offset = Point2(); - color = Color(); - character = 0; - elapsed_time = 0.0f; } CharFXTransform::~CharFXTransform() { diff --git a/scene/gui/rich_text_effect.h b/scene/gui/rich_text_effect.h index a5401f7eaa..1aa62c1c83 100644 --- a/scene/gui/rich_text_effect.h +++ b/scene/gui/rich_text_effect.h @@ -31,7 +31,7 @@ #ifndef RICH_TEXT_EFFECT_H #define RICH_TEXT_EFFECT_H -#include "core/resource.h" +#include "core/io/resource.h" class RichTextEffect : public Resource { GDCLASS(RichTextEffect, Resource); @@ -54,32 +54,37 @@ protected: static void _bind_methods(); public: - uint64_t relative_index; - uint64_t absolute_index; - bool visibility; + Vector2i range; + bool visibility = true; + bool outline = false; Point2 offset; Color color; - char32_t character; - float elapsed_time; + float elapsed_time = 0.0f; Dictionary environment; + uint32_t glpyh_index = 0; + RID font; CharFXTransform(); ~CharFXTransform(); - uint64_t get_relative_index() { return relative_index; } - void set_relative_index(uint64_t p_index) { relative_index = p_index; } - uint64_t get_absolute_index() { return absolute_index; } - void set_absolute_index(uint64_t p_index) { absolute_index = p_index; } + Vector2i get_range() { return range; } + void set_range(const Vector2i &p_range) { range = p_range; } float get_elapsed_time() { return elapsed_time; } void set_elapsed_time(float p_elapsed_time) { elapsed_time = p_elapsed_time; } bool is_visible() { return visibility; } - void set_visibility(bool p_vis) { visibility = p_vis; } + void set_visibility(bool p_visibility) { visibility = p_visibility; } + bool is_outline() { return outline; } + void set_outline(bool p_outline) { outline = p_outline; } Point2 get_offset() { return offset; } void set_offset(Point2 p_offset) { offset = p_offset; } Color get_color() { return color; } void set_color(Color p_color) { color = p_color; } - int get_character() { return (int)character; } - void set_character(int p_char) { character = (char32_t)p_char; } + + uint32_t get_glyph_index() const { return glpyh_index; }; + void set_glyph_index(uint32_t p_glpyh_index) { glpyh_index = p_glpyh_index; }; + RID get_font() const { return font; }; + void set_font(RID p_font) { font = p_font; }; + Dictionary get_environment() { return environment; } void set_environment(Dictionary p_environment) { environment = p_environment; } }; diff --git a/scene/gui/rich_text_label.cpp b/scene/gui/rich_text_label.cpp index fb4931ea91..244d90ca6b 100644 --- a/scene/gui/rich_text_label.cpp +++ b/scene/gui/rich_text_label.cpp @@ -140,741 +140,1088 @@ Rect2 RichTextLabel::_get_text_rect() { return Rect2(style->get_offset(), get_size() - style->get_minimum_size()); } -int RichTextLabel::_process_line(ItemFrame *p_frame, const Vector2 &p_ofs, int &y, int p_width, int p_line, ProcessMode p_mode, const Ref<Font> &p_base_font, const Color &p_base_color, const Color &p_font_color_shadow, bool p_shadow_as_outline, const Point2 &shadow_ofs, const Point2i &p_click_pos, Item **r_click_item, int *r_click_char, bool *r_outside, int p_char_count) { - ERR_FAIL_INDEX_V((int)p_mode, 3, 0); - - RID ci; - if (r_outside) { - *r_outside = false; +RichTextLabel::Item *RichTextLabel::_get_item_at_pos(RichTextLabel::Item *p_item_from, RichTextLabel::Item *p_item_to, int p_position) { + int offset = 0; + for (Item *it = p_item_from; it && it != p_item_to; it = _get_next_item(it)) { + switch (it->type) { + case ITEM_TEXT: { + ItemText *t = (ItemText *)it; + offset += t->text.length(); + if (offset > p_position) { + return it; + } + } break; + case ITEM_NEWLINE: + case ITEM_IMAGE: + case ITEM_TABLE: { + offset += 1; + } break; + default: + break; + } } - if (p_mode == PROCESS_DRAW) { - ci = get_canvas_item(); + return p_item_from; +} - if (r_click_item) { - *r_click_item = nullptr; - } +String RichTextLabel::_roman(int p_num, bool p_capitalize) const { + if (p_num > 3999) { + return "ERR"; + }; + String s; + if (p_capitalize) { + String M[] = { "", "M", "MM", "MMM" }; + String C[] = { "", "C", "CC", "CCC", "CD", "D", "DC", "DCC", "DCCC", "CM" }; + String X[] = { "", "X", "XX", "XXX", "XL", "L", "LX", "LXX", "LXXX", "XC" }; + String I[] = { "", "I", "II", "III", "IV", "V", "VI", "VII", "VIII", "IX" }; + s = M[p_num / 1000] + C[(p_num % 1000) / 100] + X[(p_num % 100) / 10] + I[p_num % 10]; + } else { + String M[] = { "", "m", "mm", "mmm" }; + String C[] = { "", "c", "cc", "ccc", "cd", "d", "dc", "dcc", "dccc", "cm" }; + String X[] = { "", "x", "xx", "xxx", "xl", "l", "lx", "lxx", "lxxx", "xc" }; + String I[] = { "", "i", "ii", "iii", "iv", "v", "vi", "vii", "viii", "ix" }; + s = M[p_num / 1000] + C[(p_num % 1000) / 100] + X[(p_num % 100) / 10] + I[p_num % 10]; } - Line &l = p_frame->lines.write[p_line]; - Item *it = l.from; + return s; +} - int line_ofs = 0; - int margin = _find_margin(it, p_base_font); - Align align = _find_align(it); - int line = 0; - int spaces = 0; +String RichTextLabel::_letters(int p_num, bool p_capitalize) const { + int64_t n = p_num; - int height = get_size().y; + int chars = 0; + do { + n /= 24; + chars++; + } while (n); - if (p_mode != PROCESS_CACHE) { - ERR_FAIL_INDEX_V(line, l.offset_caches.size(), 0); - line_ofs = l.offset_caches[line]; - } + String s; + s.resize(chars + 1); + char32_t *c = s.ptrw(); + c[chars] = 0; + n = p_num; + do { + int mod = ABS(n % 24); + char a = (p_capitalize ? 'A' : 'a'); + c[--chars] = a + mod - 1; - if (p_mode == PROCESS_CACHE) { - l.offset_caches.clear(); - l.height_caches.clear(); - l.ascent_caches.clear(); - l.descent_caches.clear(); - l.char_count = 0; - l.minimum_width = 0; - l.maximum_width = 0; - } + n /= 24; + } while (n); - int wofs = margin; - int spaces_size = 0; - int align_ofs = 0; + return s; +} - if (p_mode != PROCESS_CACHE && align != ALIGN_FILL) { - wofs += line_ofs; - } +void RichTextLabel::_resize_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width) { + ERR_FAIL_COND(p_frame == nullptr); + ERR_FAIL_COND(p_line < 0 || p_line >= p_frame->lines.size()); + + Line &l = p_frame->lines.write[p_line]; - int begin = margin; + l.offset.x = _find_margin(l.from, p_base_font, p_base_font_size); + l.text_buf->set_width(p_width - l.offset.x); - Ref<Font> cfont = _find_font(it); - if (cfont.is_null()) { - cfont = p_base_font; + if (tab_size > 0) { // Align inline tabs. + Vector<float> tabs; + tabs.push_back(tab_size * p_base_font->get_char_size('m', 0, p_base_font_size).width); + l.text_buf->tab_align(tabs); } - //line height should be the font height for the first time, this ensures that an empty line will never have zero height and successive newlines are displayed - int line_height = cfont->get_height(); - int line_ascent = cfont->get_ascent(); - int line_descent = cfont->get_descent(); + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + switch (it->type) { + case ITEM_TABLE: { + ItemTable *table = static_cast<ItemTable *>(it); + int hseparation = get_theme_constant("table_hseparation"); + int vseparation = get_theme_constant("table_vseparation"); + int col_count = table->columns.size(); - int backtrack = 0; // for dynamic hidden content. + for (int i = 0; i < col_count; i++) { + table->columns.write[i].width = 0; + } - int nonblank_line_count = 0; //number of nonblank lines as counted during PROCESS_DRAW + int idx = 0; + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + for (int i = 0; i < frame->lines.size(); i++) { + _resize_line(frame, i, p_base_font, p_base_font_size, 1); + } + idx++; + } - Variant meta; + // Compute minimum width for each cell. + const int available_width = p_width - hseparation * (col_count - 1); -#define RETURN return nonblank_line_count - -#define NEW_LINE \ - { \ - if (p_mode != PROCESS_CACHE) { \ - line++; \ - backtrack = 0; \ - if (!line_is_blank) { \ - nonblank_line_count++; \ - } \ - line_is_blank = true; \ - if (line < l.offset_caches.size()) \ - line_ofs = l.offset_caches[line]; \ - wofs = margin; \ - if (align != ALIGN_FILL) \ - wofs += line_ofs; \ - } else { \ - int used = wofs - margin; \ - switch (align) { \ - case ALIGN_LEFT: \ - l.offset_caches.push_back(0); \ - break; \ - case ALIGN_CENTER: \ - l.offset_caches.push_back(((p_width - margin) - used) / 2); \ - break; \ - case ALIGN_RIGHT: \ - l.offset_caches.push_back(((p_width - margin) - used)); \ - break; \ - case ALIGN_FILL: \ - l.offset_caches.push_back(line_wrapped ? ((p_width - margin) - used) : 0); \ - break; \ - } \ - l.height_caches.push_back(line_height); \ - l.ascent_caches.push_back(line_ascent); \ - l.descent_caches.push_back(line_descent); \ - l.space_caches.push_back(spaces); \ - } \ - line_wrapped = false; \ - y += line_height + get_theme_constant(SceneStringNames::get_singleton()->line_separation); \ - line_height = 0; \ - line_ascent = 0; \ - line_descent = 0; \ - spaces = 0; \ - spaces_size = 0; \ - wofs = begin; \ - align_ofs = 0; \ - if (p_mode != PROCESS_CACHE) { \ - lh = line < l.height_caches.size() ? l.height_caches[line] : 1; \ - line_ascent = line < l.ascent_caches.size() ? l.ascent_caches[line] : 1; \ - line_descent = line < l.descent_caches.size() ? l.descent_caches[line] : 1; \ - if (align != ALIGN_FILL) { \ - if (line < l.offset_caches.size()) { \ - wofs = l.offset_caches[line]; \ - } \ - } \ - } \ - if (p_mode == PROCESS_POINTER && r_click_item && p_click_pos.y >= p_ofs.y + y && p_click_pos.y <= p_ofs.y + y + lh && p_click_pos.x < p_ofs.x + wofs) { \ - if (r_outside) \ - *r_outside = true; \ - *r_click_item = it; \ - *r_click_char = rchar; \ - RETURN; \ - } \ - } - -#define ENSURE_WIDTH(m_width) \ - if (p_mode == PROCESS_CACHE) { \ - l.maximum_width = MAX(l.maximum_width, MIN(p_width, wofs + m_width)); \ - l.minimum_width = MAX(l.minimum_width, m_width); \ - } \ - if (wofs - backtrack + m_width > p_width) { \ - line_wrapped = true; \ - if (p_mode == PROCESS_CACHE) { \ - if (spaces > 0) \ - spaces -= 1; \ - } \ - const bool x_in_range = (p_click_pos.x > p_ofs.x + wofs) && (!p_frame->cell || p_click_pos.x < p_ofs.x + p_width); \ - if (p_mode == PROCESS_POINTER && r_click_item && p_click_pos.y >= p_ofs.y + y && p_click_pos.y <= p_ofs.y + y + lh && x_in_range) { \ - if (r_outside) \ - *r_outside = true; \ - *r_click_item = it; \ - *r_click_char = rchar; \ - RETURN; \ - } \ - NEW_LINE \ - } - -#define ADVANCE(m_width) \ - { \ - if (p_mode == PROCESS_POINTER && r_click_item && p_click_pos.y >= p_ofs.y + y && p_click_pos.y <= p_ofs.y + y + lh && p_click_pos.x >= p_ofs.x + wofs && p_click_pos.x < p_ofs.x + wofs + m_width) { \ - if (r_outside) \ - *r_outside = false; \ - *r_click_item = it; \ - *r_click_char = rchar; \ - RETURN; \ - } \ - wofs += m_width; \ - } - -#define CHECK_HEIGHT(m_height) \ - if (m_height > line_height) { \ - line_height = m_height; \ - } - -#define YRANGE_VISIBLE(m_top, m_height) \ - (m_height > 0 && ((m_top >= 0 && m_top < height) || ((m_top + m_height - 1) >= 0 && (m_top + m_height - 1) < height))) - - Color selection_fg; - Color selection_bg; - - if (p_mode == PROCESS_DRAW) { - selection_fg = get_theme_color("font_color_selected"); - selection_bg = get_theme_color("selection_color"); - } - - int rchar = 0; - int lh = 0; - bool line_is_blank = true; - bool line_wrapped = false; - int fh = 0; + // Compute available width and total ratio (for expanders). + int total_ratio = 0; + int remaining_width = available_width; + table->total_width = hseparation; - while (it) { - switch (it->type) { - case ITEM_ALIGN: { - ItemAlign *align_it = static_cast<ItemAlign *>(it); + for (int i = 0; i < col_count; i++) { + remaining_width -= table->columns[i].min_width; + if (table->columns[i].max_width > table->columns[i].min_width) { + table->columns.write[i].expand = true; + } + if (table->columns[i].expand) { + total_ratio += table->columns[i].expand_ratio; + } + } - align = align_it->align; + // Assign actual widths. + for (int i = 0; i < col_count; i++) { + table->columns.write[i].width = table->columns[i].min_width; + if (table->columns[i].expand && total_ratio > 0) { + table->columns.write[i].width += table->columns[i].expand_ratio * remaining_width / total_ratio; + } + table->total_width += table->columns[i].width + hseparation; + } - } break; - case ITEM_INDENT: { - if (it != l.from) { - ItemIndent *indent_it = static_cast<ItemIndent *>(it); - - int indent = indent_it->level * tab_size * cfont->get_char_size(' ').width; - margin += indent; - begin += indent; - wofs += indent; + // Resize to max_width if needed and distribute the remaining space. + bool table_need_fit = true; + while (table_need_fit) { + table_need_fit = false; + // Fit slim. + for (int i = 0; i < col_count; i++) { + if (!table->columns[i].expand) { + continue; + } + int dif = table->columns[i].width - table->columns[i].max_width; + if (dif > 0) { + table_need_fit = true; + table->columns.write[i].width = table->columns[i].max_width; + table->total_width -= dif; + total_ratio -= table->columns[i].expand_ratio; + } + } + // Grow. + remaining_width = available_width - table->total_width; + if (remaining_width > 0 && total_ratio > 0) { + for (int i = 0; i < col_count; i++) { + if (table->columns[i].expand) { + int dif = table->columns[i].max_width - table->columns[i].width; + if (dif > 0) { + int slice = table->columns[i].expand_ratio * remaining_width / total_ratio; + int incr = MIN(dif, slice); + table->columns.write[i].width += incr; + table->total_width += incr; + } + } + } + } } + // Update line width and get total height. + idx = 0; + table->total_height = 0; + table->rows.clear(); + + Vector2 offset; + float row_height = 0; + + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + + int column = idx % col_count; + + offset.x += frame->padding.position.x; + float yofs = frame->padding.position.y; + for (int i = 0; i < frame->lines.size(); i++) { + frame->lines.write[i].text_buf->set_width(table->columns[column].width); + table->columns.write[column].width = MAX(table->columns.write[column].width, ceil(frame->lines[i].text_buf->get_size().x)); + + if (i > 0) { + frame->lines.write[i].offset.y = frame->lines[i - 1].offset.y + frame->lines[i - 1].text_buf->get_size().y; + } else { + frame->lines.write[i].offset.y = 0; + } + frame->lines.write[i].offset += Vector2(offset.x, offset.y); + + float h = frame->lines[i].text_buf->get_size().y; + if (frame->min_size_over.y > 0) { + h = MAX(h, frame->min_size_over.y); + } + if (frame->max_size_over.y > 0) { + h = MIN(h, frame->max_size_over.y); + } + yofs += h; + } + yofs += frame->padding.size.y; + offset.x += table->columns[column].width + hseparation + frame->padding.size.x; + + row_height = MAX(yofs, row_height); + if (column == col_count - 1) { + offset.x = 0; + row_height += vseparation; + table->total_height += row_height; + offset.y += row_height; + table->rows.push_back(row_height); + row_height = 0; + } + idx++; + } + l.text_buf->resize_object((uint64_t)it, Size2(table->total_width, table->total_height), table->inline_align); } break; - case ITEM_TEXT: { - ItemText *text = static_cast<ItemText *>(it); + default: + break; + } + } + if (p_line > 0) { + l.offset.y = p_frame->lines[p_line - 1].offset.y + p_frame->lines[p_line - 1].text_buf->get_size().y; + } else { + l.offset.y = 0; + } +} + +void RichTextLabel::_shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width, int *r_char_offset) { + ERR_FAIL_COND(p_frame == nullptr); + ERR_FAIL_COND(p_line < 0 || p_line >= p_frame->lines.size()); + + Line &l = p_frame->lines.write[p_line]; + + // Clear cache. + l.text_buf->clear(); + l.text_buf->set_flags(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND | TextServer::JUSTIFICATION_TRIM_EDGE_SPACES); + l.char_offset = *r_char_offset; + l.char_count = 0; + + // Add indent. + l.offset.x = _find_margin(l.from, p_base_font, p_base_font_size); + l.text_buf->set_width(p_width - l.offset.x); + l.text_buf->set_align((HAlign)_find_align(l.from)); + l.text_buf->set_direction(_find_direction(l.from)); + + if (tab_size > 0) { // Align inline tabs. + Vector<float> tabs; + tabs.push_back(tab_size * p_base_font->get_char_size('m', 0, p_base_font_size).width); + l.text_buf->tab_align(tabs); + } + + // Shape current paragraph. + String text; + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + if (visible_characters >= 0 && l.char_offset + l.char_count > visible_characters) { + break; + } + switch (it->type) { + case ITEM_NEWLINE: { Ref<Font> font = _find_font(it); if (font.is_null()) { font = p_base_font; } + int font_size = _find_font_size(it); + if (font_size == -1) { + font_size = p_base_font_size; + } + l.text_buf->add_string("\n", font, font_size, Dictionary(), ""); + text += "\n"; + l.char_count += 1; + } break; + case ITEM_TEXT: { + ItemText *t = (ItemText *)it; + Ref<Font> font = _find_font(it); + if (font.is_null()) { + font = p_base_font; + } + int font_size = _find_font_size(it); + if (font_size == -1) { + font_size = p_base_font_size; + } + Dictionary font_ftr = _find_font_features(it); + String lang = _find_language(it); + String tx = t->text; + if (visible_characters >= 0 && l.char_offset + l.char_count + tx.length() > visible_characters) { + tx = tx.substr(0, l.char_offset + l.char_count + tx.length() - visible_characters); + } - const char32_t *c = text->text.get_data(); - const char32_t *cf = c; - int ascent = font->get_ascent(); - int descent = font->get_descent(); - - Color color; - Color font_color_shadow; - bool underline = false; - bool strikethrough = false; - ItemFade *fade = nullptr; - int it_char_start = p_char_count; - - Vector<ItemFX *> fx_stack = Vector<ItemFX *>(); - _fetch_item_fx_stack(text, fx_stack); - bool custom_fx_ok = true; - - if (p_mode == PROCESS_DRAW) { - color = _find_color(text, p_base_color); - font_color_shadow = _find_color(text, p_font_color_shadow); - if (_find_underline(text) || (_find_meta(text, &meta) && underline_meta)) { - underline = true; - } else if (_find_strikethrough(text)) { - strikethrough = true; - } + l.text_buf->add_string(tx, font, font_size, font_ftr, lang); + text += tx; + l.char_count += tx.length(); + } break; + case ITEM_IMAGE: { + ItemImage *img = (ItemImage *)it; + l.text_buf->add_object((uint64_t)it, img->image->get_size(), img->inline_align, 1); + text += String::chr(0xfffc); + } break; + case ITEM_TABLE: { + ItemTable *table = static_cast<ItemTable *>(it); + int hseparation = get_theme_constant("table_hseparation"); + int vseparation = get_theme_constant("table_vseparation"); + int col_count = table->columns.size(); + int t_char_count = 0; + // Set minimums to zero. + for (int i = 0; i < col_count; i++) { + table->columns.write[i].min_width = 0; + table->columns.write[i].max_width = 0; + table->columns.write[i].width = 0; + } + // Compute minimum width for each cell. + const int available_width = p_width - hseparation * (col_count - 1); - Item *fade_item = it; - while (fade_item) { - if (fade_item->type == ITEM_FADE) { - fade = static_cast<ItemFade *>(fade_item); - break; - } - fade_item = fade_item->parent; - } + int idx = 0; + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); - } else if (p_mode == PROCESS_CACHE) { - l.char_count += text->text.length(); + int column = idx % col_count; + for (int i = 0; i < frame->lines.size(); i++) { + int char_offset = l.char_offset + l.char_count; + _shape_line(frame, i, p_base_font, p_base_font_size, 1, &char_offset); + int cell_ch = (char_offset - (l.char_offset + l.char_count)); + l.char_count += cell_ch; + t_char_count += cell_ch; + + table->columns.write[column].min_width = MAX(table->columns[column].min_width, ceil(frame->lines[i].text_buf->get_size().x)); + table->columns.write[column].max_width = MAX(table->columns[column].max_width, ceil(frame->lines[i].text_buf->get_non_wraped_size().x)); + } + idx++; } - rchar = 0; - FontDrawer drawer(font, Color(1, 1, 1)); - while (*c) { - int end = 0; - int w = 0; - int fw = 0; + // Compute available width and total ratio (for expanders). + int total_ratio = 0; + int remaining_width = available_width; + table->total_width = hseparation; - lh = 0; + for (int i = 0; i < col_count; i++) { + remaining_width -= table->columns[i].min_width; + if (table->columns[i].max_width > table->columns[i].min_width) { + table->columns.write[i].expand = true; + } + if (table->columns[i].expand) { + total_ratio += table->columns[i].expand_ratio; + } + } - if (p_mode != PROCESS_CACHE) { - lh = line < l.height_caches.size() ? l.height_caches[line] : 1; - line_ascent = line < l.ascent_caches.size() ? l.ascent_caches[line] : 1; - line_descent = line < l.descent_caches.size() ? l.descent_caches[line] : 1; + // Assign actual widths. + for (int i = 0; i < col_count; i++) { + table->columns.write[i].width = table->columns[i].min_width; + if (table->columns[i].expand && total_ratio > 0) { + table->columns.write[i].width += table->columns[i].expand_ratio * remaining_width / total_ratio; } - while (c[end] != 0 && !(end && c[end - 1] == ' ' && c[end] != ' ')) { - int cw = font->get_char_size(c[end], c[end + 1]).width; - if (c[end] == '\t') { - cw = tab_size * font->get_char_size(' ').width; - } + table->total_width += table->columns[i].width + hseparation; + } - if (end > 0 && fw + cw + begin > p_width) { - break; //don't allow lines longer than assigned width + // Resize to max_width if needed and distribute the remaining space. + bool table_need_fit = true; + while (table_need_fit) { + table_need_fit = false; + // Fit slim. + for (int i = 0; i < col_count; i++) { + if (!table->columns[i].expand) { + continue; + } + int dif = table->columns[i].width - table->columns[i].max_width; + if (dif > 0) { + table_need_fit = true; + table->columns.write[i].width = table->columns[i].max_width; + table->total_width -= dif; + total_ratio -= table->columns[i].expand_ratio; } - - fw += cw; - - end++; } - CHECK_HEIGHT(fh); - ENSURE_WIDTH(fw); - - line_ascent = MAX(line_ascent, ascent); - line_descent = MAX(line_descent, descent); - fh = line_ascent + line_descent; - - if (end && c[end - 1] == ' ') { - if (p_mode == PROCESS_CACHE) { - spaces_size += font->get_char_size(' ').width; - } else if (align == ALIGN_FILL) { - int ln = MIN(l.offset_caches.size() - 1, line); - if (l.space_caches[ln]) { - align_ofs = spaces * l.offset_caches[ln] / l.space_caches[ln]; + // Grow. + remaining_width = available_width - table->total_width; + if (remaining_width > 0 && total_ratio > 0) { + for (int i = 0; i < col_count; i++) { + if (table->columns[i].expand) { + int dif = table->columns[i].max_width - table->columns[i].width; + if (dif > 0) { + int slice = table->columns[i].expand_ratio * remaining_width / total_ratio; + int incr = MIN(dif, slice); + table->columns.write[i].width += incr; + table->total_width += incr; + } } } - spaces++; } + } - { - int ofs = 0 - backtrack; + // Update line width and get total height. + idx = 0; + table->total_height = 0; + table->rows.clear(); - for (int i = 0; i < end; i++) { - int pofs = wofs + ofs; + Vector2 offset; + float row_height = 0; - if (p_mode == PROCESS_POINTER && r_click_char && p_click_pos.y >= p_ofs.y + y && p_click_pos.y <= p_ofs.y + y + lh) { - int cw = font->get_char_size(c[i], c[i + 1]).x; + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); - if (c[i] == '\t') { - cw = tab_size * font->get_char_size(' ').width; - } + int column = idx % col_count; - if (p_click_pos.x - cw / 2 > p_ofs.x + align_ofs + pofs) { - rchar = int((&c[i]) - cf); - } + offset.x += frame->padding.position.x; + float yofs = frame->padding.position.y; + for (int i = 0; i < frame->lines.size(); i++) { + frame->lines.write[i].text_buf->set_width(table->columns[column].width); + table->columns.write[column].width = MAX(table->columns.write[column].width, ceil(frame->lines[i].text_buf->get_size().x)); - ofs += cw; - } else if (p_mode == PROCESS_DRAW) { - bool selected = false; - Color fx_color = Color(color); - Point2 fx_offset; - char32_t fx_char = c[i]; - - if (selection.active) { - int cofs = (&c[i]) - cf; - if ((text->index > selection.from->index || (text->index == selection.from->index && cofs >= selection.from_char)) && (text->index < selection.to->index || (text->index == selection.to->index && cofs <= selection.to_char))) { - selected = true; - } - } + if (i > 0) { + frame->lines.write[i].offset.y = frame->lines[i - 1].offset.y + frame->lines[i - 1].text_buf->get_size().y; + } else { + frame->lines.write[i].offset.y = 0; + } + frame->lines.write[i].offset += Vector2(offset.x, offset.y); - int cw = 0; - int c_item_offset = p_char_count - it_char_start; + float h = frame->lines[i].text_buf->get_size().y; + if (frame->min_size_over.y > 0) { + h = MAX(h, frame->min_size_over.y); + } + if (frame->max_size_over.y > 0) { + h = MIN(h, frame->max_size_over.y); + } + yofs += h; + } + yofs += frame->padding.size.y; + offset.x += table->columns[column].width + hseparation + frame->padding.size.x; - float faded_visibility = 1.0f; - if (fade) { - if (c_item_offset >= fade->starting_index) { - faded_visibility -= (float)(c_item_offset - fade->starting_index) / (float)fade->length; - faded_visibility = faded_visibility < 0.0f ? 0.0f : faded_visibility; - } - fx_color.a = faded_visibility; - } + row_height = MAX(yofs, row_height); + if (column == col_count - 1) { + offset.x = 0; + row_height += vseparation; + table->total_height += row_height; + offset.y += row_height; + table->rows.push_back(row_height); + row_height = 0; + } + idx++; + } - bool visible = visible_characters < 0 || ((p_char_count < visible_characters && YRANGE_VISIBLE(y + lh - line_descent - line_ascent, line_ascent + line_descent)) && - faded_visibility > 0.0f); + l.text_buf->add_object((uint64_t)it, Size2(table->total_width, table->total_height), table->inline_align, t_char_count); + text += String::chr(0xfffc).repeat(t_char_count); + } break; + default: + break; + } + } - const bool previously_visible = visible; + //Apply BiDi override. + l.text_buf->set_bidi_override(structured_text_parser(_find_stt(l.from), st_args, text)); - for (int j = 0; j < fx_stack.size(); j++) { - ItemFX *item_fx = fx_stack[j]; + *r_char_offset = l.char_offset + l.char_count; - if (item_fx->type == ITEM_CUSTOMFX && custom_fx_ok) { - ItemCustomFX *item_custom = static_cast<ItemCustomFX *>(item_fx); + if (p_line > 0) { + l.offset.y = p_frame->lines[p_line - 1].offset.y + p_frame->lines[p_line - 1].text_buf->get_size().y; + } else { + l.offset.y = 0; + } +} - Ref<CharFXTransform> charfx = item_custom->char_fx_transform; - Ref<RichTextEffect> custom_effect = item_custom->custom_effect; +float RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_color_shadow, bool p_shadow_as_outline, const Point2 &p_shadow_ofs) { + Vector2 off; - if (!custom_effect.is_null()) { - charfx->elapsed_time = item_custom->elapsed_time; - charfx->relative_index = c_item_offset; - charfx->absolute_index = p_char_count; - charfx->visibility = visible; - charfx->offset = fx_offset; - charfx->color = fx_color; - charfx->character = fx_char; + ERR_FAIL_COND_V(p_frame == nullptr, off.y); + ERR_FAIL_COND_V(p_line < 0 || p_line >= p_frame->lines.size(), off.y); - bool effect_status = custom_effect->_process_effect_impl(charfx); - custom_fx_ok = effect_status; + Line &l = p_frame->lines.write[p_line]; - fx_offset += charfx->offset; - fx_color = charfx->color; - visible &= charfx->visibility; - fx_char = charfx->character; - } - } else if (item_fx->type == ITEM_SHAKE) { - ItemShake *item_shake = static_cast<ItemShake *>(item_fx); - - uint64_t char_current_rand = item_shake->offset_random(c_item_offset); - uint64_t char_previous_rand = item_shake->offset_previous_random(c_item_offset); - uint64_t max_rand = 2147483647; - double current_offset = Math::range_lerp(char_current_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); - double previous_offset = Math::range_lerp(char_previous_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); - double n_time = (double)(item_shake->elapsed_time / (0.5f / item_shake->rate)); - n_time = (n_time > 1.0) ? 1.0 : n_time; - fx_offset += Point2(Math::lerp(Math::sin(previous_offset), - Math::sin(current_offset), - n_time), - Math::lerp(Math::cos(previous_offset), - Math::cos(current_offset), - n_time)) * - (float)item_shake->strength / 10.0f; - } else if (item_fx->type == ITEM_WAVE) { - ItemWave *item_wave = static_cast<ItemWave *>(item_fx); - - double value = Math::sin(item_wave->frequency * item_wave->elapsed_time + ((p_ofs.x + pofs) / 50)) * (item_wave->amplitude / 10.0f); - fx_offset += Point2(0, 1) * value; - } else if (item_fx->type == ITEM_TORNADO) { - ItemTornado *item_tornado = static_cast<ItemTornado *>(item_fx); - - double torn_x = Math::sin(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + pofs) / 50)) * (item_tornado->radius); - double torn_y = Math::cos(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + pofs) / 50)) * (item_tornado->radius); - fx_offset += Point2(torn_x, torn_y); - } else if (item_fx->type == ITEM_RAINBOW) { - ItemRainbow *item_rainbow = static_cast<ItemRainbow *>(item_fx); - - fx_color = fx_color.from_hsv(item_rainbow->frequency * (item_rainbow->elapsed_time + ((p_ofs.x + pofs) / 50)), - item_rainbow->saturation, - item_rainbow->value, - fx_color.a); - } - } + Item *it_from = l.from; + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + Variant meta; - if (visible) { - line_is_blank = false; - w += font->get_char_size(c[i], c[i + 1]).x; - } + if (it_from == nullptr) { + return off.y; + } - if (c[i] == '\t') { - visible = false; - } + RID ci = get_canvas_item(); + bool rtl = (l.text_buf->get_direction() == TextServer::DIRECTION_RTL); + bool lrtl = is_layout_rtl(); - if (visible) { - if (selected) { - cw = font->get_char_size(fx_char, c[i + 1]).x; - draw_rect(Rect2(p_ofs.x + pofs, p_ofs.y + y, cw, lh), selection_bg); - } + Vector<int> list_index; + Vector<ItemList *> list_items; + _find_list(l.from, list_index, list_items); - if (p_font_color_shadow.a > 0) { - float x_ofs_shadow = align_ofs + pofs; - float y_ofs_shadow = y + lh - line_descent; - font->draw_char(ci, Point2(x_ofs_shadow, y_ofs_shadow) + shadow_ofs + fx_offset, fx_char, c[i + 1], p_font_color_shadow); + String prefix; + for (int i = 0; i < list_index.size(); i++) { + if (rtl) { + prefix = prefix + "."; + } else { + prefix = "." + prefix; + } + String segment; + if (list_items[i]->list_type == LIST_DOTS) { + static const char32_t _prefix[2] = { 0x25CF, 0 }; + prefix = _prefix; + break; + } else if (list_items[i]->list_type == LIST_NUMBERS) { + segment = TS->format_number(itos(list_index[i]), _find_language(l.from)); + } else if (list_items[i]->list_type == LIST_LETTERS) { + segment = _letters(list_index[i], list_items[i]->capitalize); + } else if (list_items[i]->list_type == LIST_ROMAN) { + segment = _roman(list_index[i], list_items[i]->capitalize); + } + if (rtl) { + prefix = prefix + segment; + } else { + prefix = segment + prefix; + } + } + if (prefix != "") { + Ref<Font> font = _find_font(l.from); + if (font.is_null()) { + font = get_theme_font("normal_font"); + } + int font_size = _find_font_size(l.from); + if (font_size == -1) { + font_size = get_theme_font_size("normal_font_size"); + } + if (rtl) { + float offx = 0.0f; + if (!lrtl && p_frame == main) { // Skip Scrollbar. + offx -= scroll_w; + } + font->draw_string(ci, p_ofs + Vector2(p_width - l.offset.x + offx, l.text_buf->get_line_ascent(0)), " " + prefix, HALIGN_LEFT, l.offset.x, font_size, _find_color(l.from, p_base_color)); + } else { + float offx = 0.0f; + if (lrtl && p_frame == main) { // Skip Scrollbar. + offx += scroll_w; + } + font->draw_string(ci, p_ofs + Vector2(offx, l.text_buf->get_line_ascent(0)), prefix + " ", HALIGN_RIGHT, l.offset.x, font_size, _find_color(l.from, p_base_color)); + } + } - if (p_shadow_as_outline) { - font->draw_char(ci, Point2(x_ofs_shadow, y_ofs_shadow) + Vector2(-shadow_ofs.x, shadow_ofs.y) + fx_offset, fx_char, c[i + 1], p_font_color_shadow); - font->draw_char(ci, Point2(x_ofs_shadow, y_ofs_shadow) + Vector2(shadow_ofs.x, -shadow_ofs.y) + fx_offset, fx_char, c[i + 1], p_font_color_shadow); - font->draw_char(ci, Point2(x_ofs_shadow, y_ofs_shadow) + Vector2(-shadow_ofs.x, -shadow_ofs.y) + fx_offset, fx_char, c[i + 1], p_font_color_shadow); - } - } + // Draw text. + for (int line = 0; line < l.text_buf->get_line_count(); line++) { + RID rid = l.text_buf->get_line_rid(line); - if (selected) { - drawer.draw_char(ci, p_ofs + Point2(align_ofs + pofs, y + lh - line_descent), fx_char, c[i + 1], override_selected_font_color ? selection_fg : fx_color); - } else { - cw = drawer.draw_char(ci, p_ofs + Point2(align_ofs + pofs, y + lh - line_descent) + fx_offset, fx_char, c[i + 1], fx_color); - } - } else if (previously_visible && c[i] != '\t') { - backtrack += font->get_char_size(fx_char, c[i + 1]).x; - } + float width = l.text_buf->get_width(); + float length = TS->shaped_text_get_width(rid); + + // Draw line. + + if (rtl) { + off.x = p_width - l.offset.x - width; + if (!lrtl && p_frame == main) { // Skip Scrollbar. + off.x -= scroll_w; + } + } else { + off.x = l.offset.x; + if (lrtl && p_frame == main) { // Skip Scrollbar. + off.x += scroll_w; + } + } - p_char_count++; - if (c[i] == '\t') { - cw = tab_size * font->get_char_size(' ').width; - backtrack = MAX(0, backtrack - cw); + // Draw text. + switch (l.text_buf->get_align()) { + case HALIGN_FILL: + case HALIGN_LEFT: { + if (rtl) { + off.x += width - length; + } + } break; + case HALIGN_CENTER: { + off.x += Math::floor((width - length) / 2.0); + } break; + case HALIGN_RIGHT: { + if (!rtl) { + off.x += width - length; + } + } break; + } + + //draw_rect(Rect2(p_ofs + off, TS->shaped_text_get_size(rid)), Color(1,0,0), false, 2); //DEBUG_RECTS + + off.y += TS->shaped_text_get_ascent(rid); + // Draw inlined objects. + Array objects = TS->shaped_text_get_objects(rid); + for (int i = 0; i < objects.size(); i++) { + Item *it = (Item *)(uint64_t)objects[i]; + if (it != nullptr) { + Rect2 rect = TS->shaped_text_get_object_rect(rid, objects[i]); + //draw_rect(rect, Color(1,0,0), false, 2); //DEBUG_RECTS + switch (it->type) { + case ITEM_IMAGE: { + ItemImage *img = static_cast<ItemImage *>(it); + img->image->draw_rect(ci, Rect2(p_ofs + rect.position + off, rect.size), false, img->color); + } break; + case ITEM_TABLE: { + ItemTable *table = static_cast<ItemTable *>(it); + Color odd_row_bg = get_theme_color("table_odd_row_bg"); + Color even_row_bg = get_theme_color("table_even_row_bg"); + Color border = get_theme_color("table_border"); + int col_count = table->columns.size(); + int row_count = table->rows.size(); + + int idx = 0; + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + + int col = idx % col_count; + int row = idx / col_count; + + if (frame->lines.size() != 0 && row < row_count) { + Vector2 coff = frame->lines[0].offset; + if (rtl) { + coff.x = rect.size.width - table->columns[col].width - coff.x; + } + if (row % 2 == 0) { + draw_rect(Rect2(p_ofs + rect.position + off + coff - frame->padding.position, Size2(table->columns[col].width, table->rows[row])), (frame->odd_row_bg != Color(0, 0, 0, 0) ? frame->odd_row_bg : odd_row_bg), true); + } else { + draw_rect(Rect2(p_ofs + rect.position + off + coff - frame->padding.position, Size2(table->columns[col].width, table->rows[row])), (frame->even_row_bg != Color(0, 0, 0, 0) ? frame->even_row_bg : even_row_bg), true); } + draw_rect(Rect2(p_ofs + rect.position + off + coff - frame->padding.position, Size2(table->columns[col].width, table->rows[row])), (frame->border != Color(0, 0, 0, 0) ? frame->border : border), false); + } - ofs += cw; + for (int j = 0; j < frame->lines.size(); j++) { + _draw_line(frame, j, p_ofs + rect.position + off + Vector2(0, frame->lines[j].offset.y), rect.size.x, p_base_color, p_outline_size, p_outline_color, p_font_color_shadow, p_shadow_as_outline, p_shadow_ofs); } + idx++; } + } break; + default: + break; + } + } + } - if (underline) { - Color uc = color; - uc.a *= 0.5; - int uy = y + lh - line_descent + font->get_underline_position(); - float underline_width = font->get_underline_thickness(); -#ifdef TOOLS_ENABLED - underline_width *= EDSCALE; -#endif - RS::get_singleton()->canvas_item_add_line(ci, p_ofs + Point2(align_ofs + wofs, uy), p_ofs + Point2(align_ofs + wofs + w, uy), uc, underline_width); - } else if (strikethrough) { - Color uc = color; - uc.a *= 0.5; - int uy = y + lh - (line_ascent + line_descent) / 2; - float strikethrough_width = font->get_underline_thickness(); -#ifdef TOOLS_ENABLED - strikethrough_width *= EDSCALE; -#endif - RS::get_singleton()->canvas_item_add_line(ci, p_ofs + Point2(align_ofs + wofs, uy), p_ofs + Point2(align_ofs + wofs + w, uy), uc, strikethrough_width); - } - } + const Vector<TextServer::Glyph> visual = TS->shaped_text_get_glyphs(rid); + const TextServer::Glyph *glyphs = visual.ptr(); + int gl_size = visual.size(); - ADVANCE(fw); - CHECK_HEIGHT(fh); //must be done somewhere - c = &c[end]; - } + Vector2 gloff = off; + // Draw oulines and shadow. + for (int i = 0; i < gl_size; i++) { + Item *it = _get_item_at_pos(it_from, it_to, glyphs[i].start); + int size = _find_outline_size(it); + Color font_color = _find_outline_color(it, Color(0, 0, 0, 0)); + if (size <= 0) { + gloff.x += glyphs[i].advance; + continue; + } - } break; - case ITEM_IMAGE: { - lh = 0; - if (p_mode != PROCESS_CACHE) { - lh = line < l.height_caches.size() ? l.height_caches[line] : 1; - } else { - l.char_count += 1; //images count as chars too + // Get FX. + ItemFade *fade = nullptr; + Item *fade_item = it; + while (fade_item) { + if (fade_item->type == ITEM_FADE) { + fade = static_cast<ItemFade *>(fade_item); + break; } + fade_item = fade_item->parent; + } - ItemImage *img = static_cast<ItemImage *>(it); + Vector<ItemFX *> fx_stack; + _fetch_item_fx_stack(it, fx_stack); + bool custom_fx_ok = true; - Ref<Font> font = _find_font(it); - if (font.is_null()) { - font = p_base_font; + Point2 fx_offset = Vector2(glyphs[i].x_off, glyphs[i].y_off); + RID frid = glyphs[i].font_rid; + uint32_t gl = glyphs[i].index; + + //Apply fx. + float faded_visibility = 1.0f; + if (fade) { + if (glyphs[i].start >= fade->starting_index) { + faded_visibility -= (float)(glyphs[i].start - fade->starting_index) / (float)fade->length; + faded_visibility = faded_visibility < 0.0f ? 0.0f : faded_visibility; } + font_color.a = faded_visibility; + } - if (p_mode == PROCESS_POINTER && r_click_char) { - *r_click_char = 0; + bool visible = (font_color.a != 0); + + for (int j = 0; j < fx_stack.size(); j++) { + ItemFX *item_fx = fx_stack[j]; + if (item_fx->type == ITEM_CUSTOMFX && custom_fx_ok) { + ItemCustomFX *item_custom = static_cast<ItemCustomFX *>(item_fx); + + Ref<CharFXTransform> charfx = item_custom->char_fx_transform; + Ref<RichTextEffect> custom_effect = item_custom->custom_effect; + + if (!custom_effect.is_null()) { + charfx->elapsed_time = item_custom->elapsed_time; + charfx->range = Vector2i(l.char_offset + glyphs[i].start, l.char_offset + glyphs[i].end); + charfx->visibility = visible; + charfx->outline = true; + charfx->font = frid; + charfx->glpyh_index = gl; + charfx->offset = fx_offset; + charfx->color = font_color; + + bool effect_status = custom_effect->_process_effect_impl(charfx); + custom_fx_ok = effect_status; + + fx_offset += charfx->offset; + font_color = charfx->color; + frid = charfx->font; + gl = charfx->glpyh_index; + visible &= charfx->visibility; + } + } else if (item_fx->type == ITEM_SHAKE) { + ItemShake *item_shake = static_cast<ItemShake *>(item_fx); + + uint64_t char_current_rand = item_shake->offset_random(glyphs[i].start); + uint64_t char_previous_rand = item_shake->offset_previous_random(glyphs[i].start); + uint64_t max_rand = 2147483647; + double current_offset = Math::range_lerp(char_current_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); + double previous_offset = Math::range_lerp(char_previous_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); + double n_time = (double)(item_shake->elapsed_time / (0.5f / item_shake->rate)); + n_time = (n_time > 1.0) ? 1.0 : n_time; + fx_offset += Point2(Math::lerp(Math::sin(previous_offset), Math::sin(current_offset), n_time), Math::lerp(Math::cos(previous_offset), Math::cos(current_offset), n_time)) * (float)item_shake->strength / 10.0f; + } else if (item_fx->type == ITEM_WAVE) { + ItemWave *item_wave = static_cast<ItemWave *>(item_fx); + + double value = Math::sin(item_wave->frequency * item_wave->elapsed_time + ((p_ofs.x + off.x) / 50)) * (item_wave->amplitude / 10.0f); + fx_offset += Point2(0, 1) * value; + } else if (item_fx->type == ITEM_TORNADO) { + ItemTornado *item_tornado = static_cast<ItemTornado *>(item_fx); + + double torn_x = Math::sin(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + gloff.x) / 50)) * (item_tornado->radius); + double torn_y = Math::cos(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + gloff.x) / 50)) * (item_tornado->radius); + fx_offset += Point2(torn_x, torn_y); + } else if (item_fx->type == ITEM_RAINBOW) { + ItemRainbow *item_rainbow = static_cast<ItemRainbow *>(item_fx); + + font_color = font_color.from_hsv(item_rainbow->frequency * (item_rainbow->elapsed_time + ((p_ofs.x + gloff.x) / 50)), item_rainbow->saturation, item_rainbow->value, font_color.a); } + } - ENSURE_WIDTH(img->size.width); + Point2 shadow_ofs(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); - bool visible = visible_characters < 0 || (p_char_count < visible_characters && YRANGE_VISIBLE(y + lh - font->get_descent() - img->size.height, img->size.height)); + // Draw glyph outlines. + for (int j = 0; j < glyphs[i].repeat; j++) { if (visible) { - line_is_blank = false; - } - - if (p_mode == PROCESS_DRAW && visible) { - img->image->draw_rect(ci, Rect2(p_ofs + Point2(align_ofs + wofs, y + lh - font->get_descent() - img->size.height), img->size), false, img->color); + if (frid != RID()) { + if (p_shadow_as_outline) { + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(-shadow_ofs.x, shadow_ofs.y), gl, p_font_color_shadow); + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(shadow_ofs.x, -shadow_ofs.y), gl, p_font_color_shadow); + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(-shadow_ofs.x, -shadow_ofs.y), gl, p_font_color_shadow); + } + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff, gl, font_color); + } } - p_char_count++; - - ADVANCE(img->size.width); - CHECK_HEIGHT((img->size.height + font->get_descent())); + gloff.x += glyphs[i].advance; + } + } - } break; - case ITEM_NEWLINE: { - lh = 0; + // Draw main text. + Color selection_fg = get_theme_color("font_color_selected"); + Color selection_bg = get_theme_color("selection_color"); - if (p_mode != PROCESS_CACHE) { - lh = line < l.height_caches.size() ? l.height_caches[line] : 1; - line_is_blank = true; - } + int sel_start = -1; + int sel_end = -1; - } break; - case ITEM_TABLE: { - lh = 0; - ItemTable *table = static_cast<ItemTable *>(it); - int hseparation = get_theme_constant("table_hseparation"); - int vseparation = get_theme_constant("table_vseparation"); - Color ccolor = _find_color(table, p_base_color); - Vector2 draw_ofs = Point2(wofs, y); - Color font_color_shadow = get_theme_color("font_color_shadow"); - bool use_outline = get_theme_constant("shadow_as_outline"); - Point2 shadow_ofs2(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); - - if (p_mode == PROCESS_CACHE) { - int idx = 0; - //set minimums to zero - for (int i = 0; i < table->columns.size(); i++) { - table->columns.write[i].min_width = 0; - table->columns.write[i].max_width = 0; - table->columns.write[i].width = 0; - } - //compute minimum width for each cell - const int available_width = p_width - hseparation * (table->columns.size() - 1) - wofs; + if (selection.active && (selection.from_frame->lines[selection.from_line].char_offset + selection.from_char) <= (l.char_offset + TS->shaped_text_get_range(rid).y) && (selection.to_frame->lines[selection.to_line].char_offset + selection.to_char) >= (l.char_offset + TS->shaped_text_get_range(rid).x)) { + sel_start = MAX(TS->shaped_text_get_range(rid).x, (selection.from_frame->lines[selection.from_line].char_offset + selection.from_char) - l.char_offset); + sel_end = MIN(TS->shaped_text_get_range(rid).y, (selection.to_frame->lines[selection.to_line].char_offset + selection.to_char) - l.char_offset); - for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { - ERR_CONTINUE(E->get()->type != ITEM_FRAME); //children should all be frames - ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, sel_start, sel_end); + for (int i = 0; i < sel.size(); i++) { + Rect2 rect = Rect2(sel[i].x + p_ofs.x + off.x, p_ofs.y + off.y - TS->shaped_text_get_ascent(rid), sel[i].y - sel[i].x, TS->shaped_text_get_size(rid).y); + RenderingServer::get_singleton()->canvas_item_add_rect(ci, rect, selection_bg); + } + } - int column = idx % table->columns.size(); + for (int i = 0; i < gl_size; i++) { + bool selected = selection.active && (sel_start != -1) && (glyphs[i].start >= sel_start) && (glyphs[i].end <= sel_end); + Item *it = _get_item_at_pos(it_from, it_to, glyphs[i].start); + Color font_color = _find_color(it, p_base_color); + if (_find_underline(it) || (_find_meta(it, &meta) && underline_meta)) { + Color uc = font_color; + uc.a *= 0.5; + float y_off = TS->shaped_text_get_underline_position(rid); + float underline_width = TS->shaped_text_get_underline_thickness(rid); +#ifdef TOOLS_ENABLED + underline_width *= EDSCALE; +#endif + draw_line(p_ofs + Vector2(off.x, off.y + y_off), p_ofs + Vector2(off.x + glyphs[i].advance * glyphs[i].repeat, off.y + y_off), uc, underline_width); + } else if (_find_strikethrough(it)) { + Color uc = font_color; + uc.a *= 0.5; + float y_off = -TS->shaped_text_get_ascent(rid) + TS->shaped_text_get_size(rid).y / 2; + float underline_width = TS->shaped_text_get_underline_thickness(rid); +#ifdef TOOLS_ENABLED + underline_width *= EDSCALE; +#endif + draw_line(p_ofs + Vector2(off.x, off.y + y_off), p_ofs + Vector2(off.x + glyphs[i].advance * glyphs[i].repeat, off.y + y_off), uc, underline_width); + } - int ly = 0; + // Get FX. + ItemFade *fade = nullptr; + Item *fade_item = it; + while (fade_item) { + if (fade_item->type == ITEM_FADE) { + fade = static_cast<ItemFade *>(fade_item); + break; + } + fade_item = fade_item->parent; + } - for (int i = 0; i < frame->lines.size(); i++) { - _process_line(frame, Point2(), ly, available_width, i, PROCESS_CACHE, cfont, Color(), font_color_shadow, use_outline, shadow_ofs2); - table->columns.write[column].min_width = MAX(table->columns[column].min_width, frame->lines[i].minimum_width); - table->columns.write[column].max_width = MAX(table->columns[column].max_width, frame->lines[i].maximum_width); - } - idx++; - } + Vector<ItemFX *> fx_stack; + _fetch_item_fx_stack(it, fx_stack); + bool custom_fx_ok = true; - //compute available width and total ratio (for expanders) + Point2 fx_offset = Vector2(glyphs[i].x_off, glyphs[i].y_off); + RID frid = glyphs[i].font_rid; + uint32_t gl = glyphs[i].index; - int total_ratio = 0; - int remaining_width = available_width; - table->total_width = hseparation; + //Apply fx. + float faded_visibility = 1.0f; + if (fade) { + if (glyphs[i].start >= fade->starting_index) { + faded_visibility -= (float)(glyphs[i].start - fade->starting_index) / (float)fade->length; + faded_visibility = faded_visibility < 0.0f ? 0.0f : faded_visibility; + } + font_color.a = faded_visibility; + } - for (int i = 0; i < table->columns.size(); i++) { - remaining_width -= table->columns[i].min_width; - if (table->columns[i].max_width > table->columns[i].min_width) { - table->columns.write[i].expand = true; - } - if (table->columns[i].expand) { - total_ratio += table->columns[i].expand_ratio; - } + bool visible = (font_color.a != 0); + + for (int j = 0; j < fx_stack.size(); j++) { + ItemFX *item_fx = fx_stack[j]; + if (item_fx->type == ITEM_CUSTOMFX && custom_fx_ok) { + ItemCustomFX *item_custom = static_cast<ItemCustomFX *>(item_fx); + + Ref<CharFXTransform> charfx = item_custom->char_fx_transform; + Ref<RichTextEffect> custom_effect = item_custom->custom_effect; + + if (!custom_effect.is_null()) { + charfx->elapsed_time = item_custom->elapsed_time; + charfx->range = Vector2i(l.char_offset + glyphs[i].start, l.char_offset + glyphs[i].end); + charfx->visibility = visible; + charfx->outline = false; + charfx->font = frid; + charfx->glpyh_index = gl; + charfx->offset = fx_offset; + charfx->color = font_color; + + bool effect_status = custom_effect->_process_effect_impl(charfx); + custom_fx_ok = effect_status; + + fx_offset += charfx->offset; + font_color = charfx->color; + frid = charfx->font; + gl = charfx->glpyh_index; + visible &= charfx->visibility; } + } else if (item_fx->type == ITEM_SHAKE) { + ItemShake *item_shake = static_cast<ItemShake *>(item_fx); + + uint64_t char_current_rand = item_shake->offset_random(glyphs[i].start); + uint64_t char_previous_rand = item_shake->offset_previous_random(glyphs[i].start); + uint64_t max_rand = 2147483647; + double current_offset = Math::range_lerp(char_current_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); + double previous_offset = Math::range_lerp(char_previous_rand % max_rand, 0, max_rand, 0.0f, 2.f * (float)Math_PI); + double n_time = (double)(item_shake->elapsed_time / (0.5f / item_shake->rate)); + n_time = (n_time > 1.0) ? 1.0 : n_time; + fx_offset += Point2(Math::lerp(Math::sin(previous_offset), Math::sin(current_offset), n_time), Math::lerp(Math::cos(previous_offset), Math::cos(current_offset), n_time)) * (float)item_shake->strength / 10.0f; + } else if (item_fx->type == ITEM_WAVE) { + ItemWave *item_wave = static_cast<ItemWave *>(item_fx); + + double value = Math::sin(item_wave->frequency * item_wave->elapsed_time + ((p_ofs.x + off.x) / 50)) * (item_wave->amplitude / 10.0f); + fx_offset += Point2(0, 1) * value; + } else if (item_fx->type == ITEM_TORNADO) { + ItemTornado *item_tornado = static_cast<ItemTornado *>(item_fx); + + double torn_x = Math::sin(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + off.x) / 50)) * (item_tornado->radius); + double torn_y = Math::cos(item_tornado->frequency * item_tornado->elapsed_time + ((p_ofs.x + off.x) / 50)) * (item_tornado->radius); + fx_offset += Point2(torn_x, torn_y); + } else if (item_fx->type == ITEM_RAINBOW) { + ItemRainbow *item_rainbow = static_cast<ItemRainbow *>(item_fx); + + font_color = font_color.from_hsv(item_rainbow->frequency * (item_rainbow->elapsed_time + ((p_ofs.x + off.x) / 50)), item_rainbow->saturation, item_rainbow->value, font_color.a); + } + } - //assign actual widths - for (int i = 0; i < table->columns.size(); i++) { - table->columns.write[i].width = table->columns[i].min_width; - if (table->columns[i].expand && total_ratio > 0) { - table->columns.write[i].width += table->columns[i].expand_ratio * remaining_width / total_ratio; - } - table->total_width += table->columns[i].width + hseparation; - } + if (selected) { + font_color = override_selected_font_color ? selection_fg : font_color; + } - //resize to max_width if needed and distribute the remaining space - bool table_need_fit = true; - while (table_need_fit) { - table_need_fit = false; - //fit slim - for (int i = 0; i < table->columns.size(); i++) { - if (!table->columns[i].expand) { - continue; - } - int dif = table->columns[i].width - table->columns[i].max_width; - if (dif > 0) { - table_need_fit = true; - table->columns.write[i].width = table->columns[i].max_width; - table->total_width -= dif; - total_ratio -= table->columns[i].expand_ratio; - } - } - //grow - remaining_width = available_width - table->total_width; - if (remaining_width > 0 && total_ratio > 0) { - for (int i = 0; i < table->columns.size(); i++) { - if (table->columns[i].expand) { - int dif = table->columns[i].max_width - table->columns[i].width; - if (dif > 0) { - int slice = table->columns[i].expand_ratio * remaining_width / total_ratio; - int incr = MIN(dif, slice); - table->columns.write[i].width += incr; - table->total_width += incr; - } - } - } - } + // Draw glyphs. + for (int j = 0; j < glyphs[i].repeat; j++) { + if (visible) { + if (frid != RID()) { + TS->font_draw_glyph(frid, ci, glyphs[i].font_size, p_ofs + fx_offset + off, gl, selected ? selection_fg : font_color); + } else if ((glyphs[i].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + TS->draw_hex_code_box(ci, glyphs[i].font_size, p_ofs + fx_offset + off, gl, selected ? selection_fg : font_color); } + } + off.x += glyphs[i].advance; + } + } + off.y += TS->shaped_text_get_descent(rid); + } - //compute caches properly again with the right width - idx = 0; - for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { - ERR_CONTINUE(E->get()->type != ITEM_FRAME); //children should all be frames - ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + return off.y; +} - int column = idx % table->columns.size(); +void RichTextLabel::_find_click(ItemFrame *p_frame, const Point2i &p_click, ItemFrame **r_click_frame, int *r_click_line, Item **r_click_item, int *r_click_char, bool *r_outside) { + if (r_click_item) { + *r_click_item = nullptr; + } + if (r_click_char != nullptr) { + *r_click_char = 0; + } + if (r_outside != nullptr) { + *r_outside = true; + } - for (int i = 0; i < frame->lines.size(); i++) { - int ly = 0; - _process_line(frame, Point2(), ly, table->columns[column].width, i, PROCESS_CACHE, cfont, Color(), font_color_shadow, use_outline, shadow_ofs2); - frame->lines.write[i].height_cache = ly; //actual height - frame->lines.write[i].height_accum_cache = ly; //actual height - } - idx++; - } - } + Size2 size = get_size(); + Rect2 text_rect = _get_text_rect(); - Point2 offset(align_ofs + hseparation, vseparation); + int vofs = vscroll->get_value(); - int row_height = 0; - //draw using computed caches - int idx = 0; - for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { - ERR_CONTINUE(E->get()->type != ITEM_FRAME); //children should all be frames - ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + // Search for the first line. + int from_line = 0; - int column = idx % table->columns.size(); + //TODO, change to binary search ? + while (from_line < main->lines.size()) { + if (main->lines[from_line].offset.y + main->lines[from_line].text_buf->get_size().y + _get_text_rect().get_position().y >= vofs) { + break; + } + from_line++; + } - int ly = 0; - int yofs = 0; + if (from_line >= main->lines.size()) { + return; + } + + Point2 ofs = text_rect.get_position() + Vector2(0, main->lines[from_line].offset.y - vofs); + while (ofs.y < size.height && from_line < main->lines.size()) { + ofs.y += _find_click_in_line(p_frame, from_line, ofs, text_rect.size.x, p_click, r_click_frame, r_click_line, r_click_item, r_click_char); + if (((r_click_item != nullptr) && ((*r_click_item) != nullptr)) || ((r_click_frame != nullptr) && ((*r_click_frame) != nullptr))) { + if (r_outside != nullptr) { + *r_outside = false; + } + return; + } + from_line++; + } +} - int lines_h = frame->lines[frame->lines.size() - 1].height_accum_cache - (frame->lines[0].height_accum_cache - frame->lines[0].height_cache); - int lines_ofs = p_ofs.y + offset.y + draw_ofs.y; +float RichTextLabel::_find_click_in_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Point2i &p_click, ItemFrame **r_click_frame, int *r_click_line, Item **r_click_item, int *r_click_char) { + Vector2 off; - bool visible = lines_ofs < get_size().height && lines_ofs + lines_h >= 0; - if (visible) { - line_is_blank = false; - } + int char_pos = -1; + Line &l = p_frame->lines.write[p_line]; + bool rtl = (l.text_buf->get_direction() == TextServer::DIRECTION_RTL); + bool lrtl = is_layout_rtl(); + bool table_hit = false; - for (int i = 0; i < frame->lines.size(); i++) { - if (visible) { - if (p_mode == PROCESS_DRAW) { - nonblank_line_count += _process_line(frame, p_ofs + offset + draw_ofs + Vector2(0, yofs), ly, table->columns[column].width, i, PROCESS_DRAW, cfont, ccolor, font_color_shadow, use_outline, shadow_ofs2); - } else if (p_mode == PROCESS_POINTER) { - _process_line(frame, p_ofs + offset + draw_ofs + Vector2(0, yofs), ly, table->columns[column].width, i, PROCESS_POINTER, cfont, ccolor, font_color_shadow, use_outline, shadow_ofs2, p_click_pos, r_click_item, r_click_char, r_outside); - if (r_click_item && *r_click_item) { - RETURN; // exit early - } - } - } + for (int line = 0; line < l.text_buf->get_line_count(); line++) { + RID rid = l.text_buf->get_line_rid(line); - yofs += frame->lines[i].height_cache; - if (p_mode == PROCESS_CACHE) { - frame->lines.write[i].height_accum_cache = offset.y + draw_ofs.y + frame->lines[i].height_cache; - } - } + float width = l.text_buf->get_width(); + float length = TS->shaped_text_get_width(rid); - row_height = MAX(yofs, row_height); - offset.x += table->columns[column].width + hseparation; + if (rtl) { + off.x = p_width - l.offset.x - width; + if (!lrtl && p_frame == main) { // Skip Scrollbar. + off.x -= scroll_w; + } + } else { + off.x = l.offset.x; + if (lrtl && p_frame == main) { // Skip Scrollbar. + off.x += scroll_w; + } + } - if (column == table->columns.size() - 1) { - offset.y += row_height + vseparation; - offset.x = hseparation; - row_height = 0; - } - idx++; + switch (l.text_buf->get_align()) { + case HALIGN_FILL: + case HALIGN_LEFT: { + if (rtl) { + off.x += width - length; } - - int total_height = offset.y; - if (row_height) { - total_height = row_height + vseparation; + } break; + case HALIGN_CENTER: { + off.x += Math::floor((width - length) / 2.0); + } break; + case HALIGN_RIGHT: { + if (!rtl) { + off.x += width - length; } + } break; + } - ADVANCE(table->total_width); - CHECK_HEIGHT(total_height); + off.y += TS->shaped_text_get_ascent(rid); - } break; + Array objects = TS->shaped_text_get_objects(rid); + for (int i = 0; i < objects.size(); i++) { + Item *it = (Item *)(uint64_t)objects[i]; + if (it != nullptr) { + Rect2 rect = TS->shaped_text_get_object_rect(rid, objects[i]); + if (rect.has_point(p_click - p_ofs - off)) { + switch (it->type) { + case ITEM_TABLE: { + int hseparation = get_theme_constant("table_hseparation"); + int vseparation = get_theme_constant("table_vseparation"); - default: { - } - } + ItemTable *table = static_cast<ItemTable *>(it); + + table_hit = true; - Item *itp = it; + int idx = 0; + int col_count = table->columns.size(); + int row_count = table->rows.size(); - it = _get_next_item(it); + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); - if (it && (p_line + 1 < p_frame->lines.size()) && p_frame->lines[p_line + 1].from == it) { - if (p_mode == PROCESS_POINTER && r_click_item && p_click_pos.y >= p_ofs.y + y && p_click_pos.y <= p_ofs.y + y + lh) { - //went to next line, but pointer was on the previous one - if (r_outside) { - *r_outside = true; + int col = idx % col_count; + int row = idx / col_count; + + if (frame->lines.size() != 0 && row < row_count) { + Vector2 coff = frame->lines[0].offset; + if (rtl) { + coff.x = rect.size.width - table->columns[col].width - coff.x; + } + Rect2 crect = Rect2(p_ofs + off + rect.position + coff - frame->padding.position, Size2(table->columns[col].width + hseparation, table->rows[row] + vseparation) + frame->padding.position + frame->padding.size); + if (col == col_count - 1) { + if (rtl) { + crect.size.x = crect.position.x + crect.size.x; + crect.position.x = 0; + } else { + crect.size.x = get_size().x; + } + } + if (crect.has_point(p_click)) { + for (int j = 0; j < frame->lines.size(); j++) { + _find_click_in_line(frame, j, p_ofs + off + rect.position + Vector2(0, frame->lines[j].offset.y), rect.size.x, p_click, r_click_frame, r_click_line, r_click_item, r_click_char); + if (((r_click_item != nullptr) && ((*r_click_item) != nullptr)) || ((r_click_frame != nullptr) && ((*r_click_frame) != nullptr))) { + return off.y; + } + } + } + } + idx++; + } + } break; + default: + break; + } } - *r_click_item = itp; - *r_click_char = rchar; - RETURN; } + } + Rect2 rect = Rect2(p_ofs + off - Vector2(0, TS->shaped_text_get_ascent(rid)), Size2(get_size().x, TS->shaped_text_get_size(rid).y)); - break; + if (rect.has_point(p_click) && !table_hit) { + char_pos = TS->shaped_text_hit_test_position(rid, p_click.x - rect.position.x); } + off.y += TS->shaped_text_get_descent(rid); } - NEW_LINE; - RETURN; + if (char_pos >= 0) { + // Find item. + if (r_click_item != nullptr) { + Item *it = p_frame->lines[p_line].from; + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + it = _get_item_at_pos(it, it_to, char_pos); + *r_click_item = it; + } + + if (r_click_frame != nullptr) { + *r_click_frame = p_frame; + } -#undef RETURN -#undef NEW_LINE -#undef ENSURE_WIDTH -#undef ADVANCE -#undef CHECK_HEIGHT + if (r_click_line != nullptr) { + *r_click_line = p_line; + } + + if (r_click_char != nullptr) { + *r_click_char = char_pos; + } + } + + return off.y; } void RichTextLabel::_scroll_changed(double) { @@ -910,7 +1257,7 @@ void RichTextLabel::_update_scroll() { vscroll->hide(); } - main->first_invalid_line = 0; //invalidate ALL + main->first_resized_line = 0; //invalidate ALL _validate_line_caches(main); } } @@ -960,10 +1307,11 @@ void RichTextLabel::_notification(int p_what) { } } break; case NOTIFICATION_RESIZED: { - main->first_invalid_line = 0; //invalidate ALL + main->first_resized_line = 0; //invalidate ALL update(); } break; + case NOTIFICATION_THEME_CHANGED: case NOTIFICATION_ENTER_TREE: { if (bbcode != "") { set_bbcode(bbcode); @@ -971,11 +1319,11 @@ void RichTextLabel::_notification(int p_what) { main->first_invalid_line = 0; //invalidate ALL update(); - } break; - case NOTIFICATION_THEME_CHANGED: { + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: + case NOTIFICATION_TRANSLATION_CHANGED: { + main->first_invalid_line = 0; //invalidate ALL update(); - } break; case NOTIFICATION_DRAW: { _validate_line_caches(main); @@ -994,36 +1342,37 @@ void RichTextLabel::_notification(int p_what) { RenderingServer::get_singleton()->canvas_item_add_clip_ignore(ci, false); } - int ofs = vscroll->get_value(); - - //todo, change to binary search + float vofs = vscroll->get_value(); + // Search for the first line. int from_line = 0; - int total_chars = 0; + + //TODO, change to binary search ? while (from_line < main->lines.size()) { - if (main->lines[from_line].height_accum_cache + _get_text_rect().get_position().y >= ofs) { + if (main->lines[from_line].offset.y + main->lines[from_line].text_buf->get_size().y + _get_text_rect().get_position().y >= vofs) { break; } - total_chars += main->lines[from_line].char_count; from_line++; } if (from_line >= main->lines.size()) { break; //nothing to draw } - int y = (main->lines[from_line].height_accum_cache - main->lines[from_line].height_cache) - ofs; Ref<Font> base_font = get_theme_font("normal_font"); Color base_color = get_theme_color("default_color"); + Color outline_color = get_theme_color("outline_color"); + int outline_size = get_theme_constant("outline_size"); Color font_color_shadow = get_theme_color("font_color_shadow"); bool use_outline = get_theme_constant("shadow_as_outline"); Point2 shadow_ofs(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); visible_line_count = 0; - while (y < size.height && from_line < main->lines.size()) { - visible_line_count++; - _process_line(main, text_rect.get_position(), y, text_rect.get_size().width - scroll_w, from_line, PROCESS_DRAW, base_font, base_color, font_color_shadow, use_outline, shadow_ofs, Point2i(), nullptr, nullptr, nullptr, total_chars); - total_chars += main->lines[from_line].char_count; + // New cache draw. + Point2 ofs = text_rect.get_position() + Vector2(0, main->lines[from_line].offset.y - vofs); + while (ofs.y < size.height && from_line < main->lines.size()) { + visible_line_count++; + ofs.y += _draw_line(main, from_line, ofs, text_rect.size.x, base_color, outline_size, outline_color, font_color_shadow, use_outline, shadow_ofs); from_line++; } } break; @@ -1036,50 +1385,12 @@ void RichTextLabel::_notification(int p_what) { } } -void RichTextLabel::_find_click(ItemFrame *p_frame, const Point2i &p_click, Item **r_click_item, int *r_click_char, bool *r_outside) { - if (r_click_item) { - *r_click_item = nullptr; - } - - Rect2 text_rect = _get_text_rect(); - int ofs = vscroll->get_value(); - Color font_color_shadow = get_theme_color("font_color_shadow"); - bool use_outline = get_theme_constant("shadow_as_outline"); - Point2 shadow_ofs(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); - - //todo, change to binary search - int from_line = 0; - - while (from_line < p_frame->lines.size()) { - if (p_frame->lines[from_line].height_accum_cache >= ofs) { - break; - } - from_line++; - } - - if (from_line >= p_frame->lines.size()) { - return; - } - - int y = (p_frame->lines[from_line].height_accum_cache - p_frame->lines[from_line].height_cache) - ofs; - Ref<Font> base_font = get_theme_font("normal_font"); - Color base_color = get_theme_color("default_color"); - - while (y < text_rect.get_size().height && from_line < p_frame->lines.size()) { - _process_line(p_frame, text_rect.get_position(), y, text_rect.get_size().width - scroll_w, from_line, PROCESS_POINTER, base_font, base_color, font_color_shadow, use_outline, shadow_ofs, p_click, r_click_item, r_click_char, r_outside); - if (r_click_item && *r_click_item) { - return; - } - from_line++; - } -} - Control::CursorShape RichTextLabel::get_cursor_shape(const Point2 &p_pos) const { if (!underline_meta) { return CURSOR_ARROW; } - if (selection.click) { + if (selection.click_item) { return CURSOR_IBEAM; } @@ -1087,10 +1398,13 @@ Control::CursorShape RichTextLabel::get_cursor_shape(const Point2 &p_pos) const return CURSOR_ARROW; //invalid } - int line = 0; + if (main->first_resized_line < main->lines.size()) { + return CURSOR_ARROW; //invalid + } + Item *item = nullptr; - bool outside; - ((RichTextLabel *)(this))->_find_click(main, p_pos, &item, &line, &outside); + bool outside = true; + ((RichTextLabel *)(this))->_find_click(main, p_pos, nullptr, nullptr, &item, nullptr, &outside); if (item && !outside && ((RichTextLabel *)(this))->_find_meta(item, nullptr)) { return CURSOR_POINTING_HAND; @@ -1106,27 +1420,37 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { if (main->first_invalid_line < main->lines.size()) { return; } + if (main->first_resized_line < main->lines.size()) { + return; + } if (b->get_button_index() == BUTTON_LEFT) { if (b->is_pressed() && !b->is_doubleclick()) { scroll_updated = false; - int line = 0; - Item *item = nullptr; - + ItemFrame *c_frame = nullptr; + int c_line = 0; + Item *c_item = nullptr; + int c_index = 0; bool outside; - _find_click(main, b->get_position(), &item, &line, &outside); - if (item) { + _find_click(main, b->get_position(), &c_frame, &c_line, &c_item, &c_index, &outside); + if (c_item != nullptr) { if (selection.enabled) { - selection.click = item; - selection.click_char = line; + selection.click_frame = c_frame; + selection.click_item = c_item; + selection.click_line = c_line; + selection.click_char = c_index; // Erase previous selection. if (selection.active) { - selection.from = nullptr; - selection.from_char = '\0'; - selection.to = nullptr; - selection.to_char = '\0'; + selection.from_frame = nullptr; + selection.from_line = 0; + selection.from_item = nullptr; + selection.from_char = 0; + selection.to_frame = nullptr; + selection.to_line = 0; + selection.to_item = nullptr; + selection.to_char = 0; selection.active = false; update(); @@ -1135,44 +1459,49 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { } } else if (b->is_pressed() && b->is_doubleclick() && selection.enabled) { //doubleclick: select word - int line = 0; - Item *item = nullptr; + + ItemFrame *c_frame = nullptr; + int c_line = 0; + Item *c_item = nullptr; + int c_index = 0; bool outside; - _find_click(main, b->get_position(), &item, &line, &outside); + _find_click(main, b->get_position(), &c_frame, &c_line, &c_item, &c_index, &outside); - while (item && item->type != ITEM_TEXT) { - item = _get_next_item(item, true); - } + if (c_frame) { + const Line &l = c_frame->lines[c_line]; + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(l.text_buf->get_rid()); + for (int i = 0; i < words.size(); i++) { + if (c_index >= words[i].x && c_index < words[i].y) { + selection.from_frame = c_frame; + selection.from_line = c_line; + selection.from_item = c_item; + selection.from_char = words[i].x; + + selection.to_frame = c_frame; + selection.to_line = c_line; + selection.to_item = c_item; + selection.to_char = words[i].y; - if (item && item->type == ITEM_TEXT) { - String itext = static_cast<ItemText *>(item)->text; - - int beg, end; - if (select_word(itext, line, beg, end)) { - selection.from = item; - selection.to = item; - selection.from_char = beg; - selection.to_char = end - 1; - selection.active = true; - update(); + selection.active = true; + update(); + break; + } } } } else if (!b->is_pressed()) { - selection.click = nullptr; + selection.click_item = nullptr; if (!b->is_doubleclick() && !scroll_updated) { - int line = 0; - Item *item = nullptr; + Item *c_item = nullptr; - bool outside; - _find_click(main, b->get_position(), &item, &line, &outside); + bool outside = true; + _find_click(main, b->get_position(), nullptr, nullptr, &c_item, nullptr, &outside); - if (item) { + if (c_item) { Variant meta; - if (!outside && _find_meta(item, &meta)) { + if (!outside && _find_meta(c_item, &meta)) { //meta clicked - emit_signal("meta_clicked", meta); } } @@ -1221,13 +1550,13 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { } break; case KEY_UP: { if (vscroll->is_visible_in_tree()) { - vscroll->set_value(vscroll->get_value() - get_theme_font("normal_font")->get_height()); + vscroll->set_value(vscroll->get_value() - get_theme_font("normal_font")->get_height(get_theme_font_size("normal_font_size"))); handled = true; } } break; case KEY_DOWN: { if (vscroll->is_visible_in_tree()) { - vscroll->set_value(vscroll->get_value() + get_theme_font("normal_font")->get_height()); + vscroll->set_value(vscroll->get_value() + get_theme_font("normal_font")->get_height(get_theme_font_size("normal_font_size"))); handled = true; } } break; @@ -1265,27 +1594,32 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { if (main->first_invalid_line < main->lines.size()) { return; } + if (main->first_resized_line < main->lines.size()) { + return; + } - int line = 0; - Item *item = nullptr; + ItemFrame *c_frame = nullptr; + int c_line = 0; + Item *c_item = nullptr; + int c_index = 0; bool outside; - _find_click(main, m->get_position(), &item, &line, &outside); - - if (selection.click) { - if (!item) { - return; // do not update - } - selection.from = selection.click; + _find_click(main, m->get_position(), &c_frame, &c_line, &c_item, &c_index, &outside); + if (selection.click_item && c_item) { + selection.from_frame = selection.click_frame; + selection.from_line = selection.click_line; + selection.from_item = selection.click_item; selection.from_char = selection.click_char; - selection.to = item; - selection.to_char = line; + selection.to_frame = c_frame; + selection.to_line = c_line; + selection.to_item = c_item; + selection.to_char = c_index; bool swap = false; - if (selection.from->index > selection.to->index) { + if (selection.from_item->index > selection.to_item->index) { swap = true; - } else if (selection.from->index == selection.to->index) { + } else if (selection.from_item->index == selection.to_item->index) { if (selection.from_char > selection.to_char) { swap = true; } else if (selection.from_char == selection.to_char) { @@ -1295,7 +1629,9 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { } if (swap) { - SWAP(selection.from, selection.to); + SWAP(selection.from_frame, selection.to_frame); + SWAP(selection.from_line, selection.to_line); + SWAP(selection.from_item, selection.to_item); SWAP(selection.from_char, selection.to_char); } @@ -1305,7 +1641,7 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { Variant meta; ItemMeta *item_meta; - if (item && !outside && _find_meta(item, &meta, &item_meta)) { + if (c_item && !outside && _find_meta(c_item, &meta, &item_meta)) { if (meta_hovering != item_meta) { if (meta_hovering) { emit_signal("meta_hover_ended", current_meta); @@ -1322,6 +1658,31 @@ void RichTextLabel::_gui_input(Ref<InputEvent> p_event) { } } +void RichTextLabel::_find_frame(Item *p_item, ItemFrame **r_frame, int *r_line) { + if (r_frame != nullptr) { + *r_frame = nullptr; + } + if (r_line != nullptr) { + *r_line = 0; + } + + Item *item = p_item; + + while (item) { + if (item->parent != nullptr && item->parent->type == ITEM_FRAME) { + if (r_frame != nullptr) { + *r_frame = (ItemFrame *)item->parent; + } + if (r_line != nullptr) { + *r_line = item->line; + } + return; + } + + item = item->parent; + } +} + Ref<Font> RichTextLabel::_find_font(Item *p_item) { Item *fontitem = p_item; @@ -1337,10 +1698,103 @@ Ref<Font> RichTextLabel::_find_font(Item *p_item) { return Ref<Font>(); } -int RichTextLabel::_find_margin(Item *p_item, const Ref<Font> &p_base_font) { +int RichTextLabel::_find_font_size(Item *p_item) { + Item *sizeitem = p_item; + + while (sizeitem) { + if (sizeitem->type == ITEM_FONT_SIZE) { + ItemFontSize *fi = static_cast<ItemFontSize *>(sizeitem); + return fi->font_size; + } + + sizeitem = sizeitem->parent; + } + + return -1; +} + +int RichTextLabel::_find_outline_size(Item *p_item) { + Item *sizeitem = p_item; + + while (sizeitem) { + if (sizeitem->type == ITEM_OUTLINE_SIZE) { + ItemOutlineSize *fi = static_cast<ItemOutlineSize *>(sizeitem); + return fi->outline_size; + } + + sizeitem = sizeitem->parent; + } + + return 0; +} + +Dictionary RichTextLabel::_find_font_features(Item *p_item) { + Item *ffitem = p_item; + + while (ffitem) { + if (ffitem->type == ITEM_FONT_FEATURES) { + ItemFontFeatures *fi = static_cast<ItemFontFeatures *>(ffitem); + return fi->opentype_features; + } + + ffitem = ffitem->parent; + } + + return Dictionary(); +} + +RichTextLabel::ItemList *RichTextLabel::_find_list_item(Item *p_item) { Item *item = p_item; - int margin = 0; + while (item) { + if (item->type == ITEM_LIST) { + return static_cast<ItemList *>(item); + } + item = item->parent; + } + + return nullptr; +} + +int RichTextLabel::_find_list(Item *p_item, Vector<int> &r_index, Vector<ItemList *> &r_list) { + Item *item = p_item; + Item *prev_item = p_item; + + int level = 0; + + while (item) { + if (item->type == ITEM_LIST) { + ItemList *list = static_cast<ItemList *>(item); + + ItemFrame *frame = nullptr; + int line = -1; + _find_frame(list, &frame, &line); + + int index = 1; + if (frame != nullptr) { + for (int i = list->line + 1; i <= prev_item->line; i++) { + if (_find_list_item(frame->lines[i].from) == list) { + index++; + } + } + } + + r_index.push_back(index); + r_list.push_back(list); + + prev_item = item; + } + level++; + item = item->parent; + } + + return level; +} + +int RichTextLabel::_find_margin(Item *p_item, const Ref<Font> &p_base_font, int p_base_font_size) { + Item *item = p_item; + + float margin = 0; while (item) { if (item->type == ITEM_INDENT) { @@ -1348,16 +1802,22 @@ int RichTextLabel::_find_margin(Item *p_item, const Ref<Font> &p_base_font) { if (font.is_null()) { font = p_base_font; } - - ItemIndent *indent = static_cast<ItemIndent *>(item); - - margin += indent->level * tab_size * font->get_char_size(' ').width; + int font_size = _find_font_size(item); + if (font_size == -1) { + font_size = p_base_font_size; + } + margin += tab_size * font->get_char_size('m', 0, font_size).width; } else if (item->type == ITEM_LIST) { Ref<Font> font = _find_font(item); if (font.is_null()) { font = p_base_font; } + int font_size = _find_font_size(item); + if (font_size == -1) { + font_size = p_base_font_size; + } + margin += tab_size * font->get_char_size('m', 0, font_size).width; } item = item->parent; @@ -1370,9 +1830,9 @@ RichTextLabel::Align RichTextLabel::_find_align(Item *p_item) { Item *item = p_item; while (item) { - if (item->type == ITEM_ALIGN) { - ItemAlign *align = static_cast<ItemAlign *>(item); - return align->align; + if (item->type == ITEM_PARAGRAPH) { + ItemParagraph *p = static_cast<ItemParagraph *>(item); + return p->align; } item = item->parent; @@ -1381,6 +1841,57 @@ RichTextLabel::Align RichTextLabel::_find_align(Item *p_item) { return default_align; } +TextServer::Direction RichTextLabel::_find_direction(Item *p_item) { + Item *item = p_item; + + while (item) { + if (item->type == ITEM_PARAGRAPH) { + ItemParagraph *p = static_cast<ItemParagraph *>(item); + if (p->direction != Control::TEXT_DIRECTION_INHERITED) { + return (TextServer::Direction)p->direction; + } + } + + item = item->parent; + } + + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + return is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR; + } else { + return (TextServer::Direction)text_direction; + } +} + +Control::StructuredTextParser RichTextLabel::_find_stt(Item *p_item) { + Item *item = p_item; + + while (item) { + if (item->type == ITEM_PARAGRAPH) { + ItemParagraph *p = static_cast<ItemParagraph *>(item); + return p->st_parser; + } + + item = item->parent; + } + + return st_parser; +} + +String RichTextLabel::_find_language(Item *p_item) { + Item *item = p_item; + + while (item) { + if (item->type == ITEM_PARAGRAPH) { + ItemParagraph *p = static_cast<ItemParagraph *>(item); + return p->language; + } + + item = item->parent; + } + + return language; +} + Color RichTextLabel::_find_color(Item *p_item, const Color &p_default_color) { Item *item = p_item; @@ -1396,25 +1907,26 @@ Color RichTextLabel::_find_color(Item *p_item, const Color &p_default_color) { return p_default_color; } -bool RichTextLabel::_find_underline(Item *p_item) { +Color RichTextLabel::_find_outline_color(Item *p_item, const Color &p_default_color) { Item *item = p_item; while (item) { - if (item->type == ITEM_UNDERLINE) { - return true; + if (item->type == ITEM_OUTLINE_COLOR) { + ItemOutlineColor *color = static_cast<ItemOutlineColor *>(item); + return color->color; } item = item->parent; } - return false; + return p_default_color; } -bool RichTextLabel::_find_strikethrough(Item *p_item) { +bool RichTextLabel::_find_underline(Item *p_item) { Item *item = p_item; while (item) { - if (item->type == ITEM_STRIKETHROUGH) { + if (item->type == ITEM_UNDERLINE) { return true; } @@ -1424,17 +1936,17 @@ bool RichTextLabel::_find_strikethrough(Item *p_item) { return false; } -bool RichTextLabel::_find_by_type(Item *p_item, ItemType p_type) { - ERR_FAIL_INDEX_V((int)p_type, 19, false); - +bool RichTextLabel::_find_strikethrough(Item *p_item) { Item *item = p_item; while (item) { - if (item->type == p_type) { + if (item->type == ITEM_STRIKETHROUGH) { return true; } + item = item->parent; } + return false; } @@ -1530,38 +2042,67 @@ bool RichTextLabel::_find_layout_subitem(Item *from, Item *to) { void RichTextLabel::_validate_line_caches(ItemFrame *p_frame) { if (p_frame->first_invalid_line == p_frame->lines.size()) { + if (p_frame->first_resized_line == p_frame->lines.size()) { + return; + } + + // Resize lines without reshaping. + Size2 size = get_size(); + if (fixed_width != -1) { + size.width = fixed_width; + } + Rect2 text_rect = _get_text_rect(); + + Ref<Font> base_font = get_theme_font("normal_font"); + int base_font_size = get_theme_font_size("normal_font_size"); + + for (int i = p_frame->first_resized_line; i < p_frame->lines.size(); i++) { + _resize_line(p_frame, i, base_font, base_font_size, text_rect.get_size().width - scroll_w); + } + + int total_height = 0; + if (p_frame->lines.size()) { + total_height = p_frame->lines[p_frame->lines.size() - 1].offset.y + p_frame->lines[p_frame->lines.size() - 1].text_buf->get_size().y + get_theme_stylebox("normal")->get_minimum_size().height; + } + + p_frame->first_resized_line = p_frame->lines.size(); + + updating_scroll = true; + vscroll->set_max(total_height); + vscroll->set_page(size.height); + if (scroll_follow && scroll_following) { + vscroll->set_value(total_height - size.height); + } + updating_scroll = false; + + if (fit_content_height) { + minimum_size_changed(); + } return; } - //validate invalid lines + // Shape invalid lines. Size2 size = get_size(); if (fixed_width != -1) { size.width = fixed_width; } Rect2 text_rect = _get_text_rect(); - Color font_color_shadow = get_theme_color("font_color_shadow"); - bool use_outline = get_theme_constant("shadow_as_outline"); - Point2 shadow_ofs(get_theme_constant("shadow_offset_x"), get_theme_constant("shadow_offset_y")); Ref<Font> base_font = get_theme_font("normal_font"); + int base_font_size = get_theme_font_size("normal_font_size"); + int total_chars = (p_frame->first_invalid_line == 0) ? 0 : (p_frame->lines[p_frame->first_invalid_line].char_offset + p_frame->lines[p_frame->first_invalid_line].char_count); for (int i = p_frame->first_invalid_line; i < p_frame->lines.size(); i++) { - int y = 0; - _process_line(p_frame, text_rect.get_position(), y, text_rect.get_size().width - scroll_w, i, PROCESS_CACHE, base_font, Color(), font_color_shadow, use_outline, shadow_ofs); - p_frame->lines.write[i].height_cache = y; - p_frame->lines.write[i].height_accum_cache = y; - - if (i > 0) { - p_frame->lines.write[i].height_accum_cache += p_frame->lines[i - 1].height_accum_cache; - } + _shape_line(p_frame, i, base_font, base_font_size, text_rect.get_size().width - scroll_w, &total_chars); } int total_height = 0; if (p_frame->lines.size()) { - total_height = p_frame->lines[p_frame->lines.size() - 1].height_accum_cache + get_theme_stylebox("normal")->get_minimum_size().height; + total_height = p_frame->lines[p_frame->lines.size() - 1].offset.y + p_frame->lines[p_frame->lines.size() - 1].text_buf->get_size().y + get_theme_stylebox("normal")->get_minimum_size().height; } - main->first_invalid_line = p_frame->lines.size(); + p_frame->first_invalid_line = p_frame->lines.size(); + p_frame->first_resized_line = p_frame->lines.size(); updating_scroll = true; vscroll->set_max(total_height); @@ -1569,7 +2110,6 @@ void RichTextLabel::_validate_line_caches(ItemFrame *p_frame) { if (scroll_follow && scroll_following) { vscroll->set_value(total_height - size.height); } - updating_scroll = false; if (fit_content_height) { @@ -1641,6 +2181,13 @@ void RichTextLabel::_add_item(Item *p_item, bool p_enter, bool p_ensure_newline) p_item->parent = current; p_item->E = current->subitems.push_back(p_item); p_item->index = current_idx++; + p_item->char_ofs = current_char_ofs; + if (p_item->type == ITEM_TEXT) { + ItemText *t = (ItemText *)p_item; + current_char_ofs += t->text.length(); + } else if (p_item->type == ITEM_IMAGE) { + current_char_ofs++; + } if (p_enter) { current = p_item; @@ -1686,7 +2233,7 @@ void RichTextLabel::_remove_item(Item *p_item, const int p_line, const int p_sub } } -void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, const int p_height, const Color &p_color) { +void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, const int p_height, const Color &p_color, VAlign p_align) { if (current->type == ITEM_TABLE) { return; } @@ -1696,6 +2243,7 @@ void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, item->image = p_image; item->color = p_color; + item->inline_align = p_align; if (p_width > 0) { // custom width @@ -1764,7 +2312,7 @@ bool RichTextLabel::remove_line(const int p_line) { main->lines.write[0].from = main; } - main->first_invalid_line = 0; + main->first_invalid_line = 0; // p_line ??? return true; } @@ -1813,6 +2361,30 @@ void RichTextLabel::push_mono() { push_font(mono_font); } +void RichTextLabel::push_font_size(int p_font_size) { + ERR_FAIL_COND(current->type == ITEM_TABLE); + ItemFontSize *item = memnew(ItemFontSize); + + item->font_size = p_font_size; + _add_item(item, true); +} + +void RichTextLabel::push_font_features(const Dictionary &p_features) { + ERR_FAIL_COND(current->type == ITEM_TABLE); + ItemFontFeatures *item = memnew(ItemFontFeatures); + + item->opentype_features = p_features; + _add_item(item, true); +} + +void RichTextLabel::push_outline_size(int p_font_size) { + ERR_FAIL_COND(current->type == ITEM_TABLE); + ItemOutlineSize *item = memnew(ItemOutlineSize); + + item->outline_size = p_font_size; + _add_item(item, true); +} + void RichTextLabel::push_color(const Color &p_color) { ERR_FAIL_COND(current->type == ITEM_TABLE); ItemColor *item = memnew(ItemColor); @@ -1821,6 +2393,14 @@ void RichTextLabel::push_color(const Color &p_color) { _add_item(item, true); } +void RichTextLabel::push_outline_color(const Color &p_color) { + ERR_FAIL_COND(current->type == ITEM_TABLE); + ItemOutlineColor *item = memnew(ItemOutlineColor); + + item->color = p_color; + _add_item(item, true); +} + void RichTextLabel::push_underline() { ERR_FAIL_COND(current->type == ITEM_TABLE); ItemUnderline *item = memnew(ItemUnderline); @@ -1835,11 +2415,14 @@ void RichTextLabel::push_strikethrough() { _add_item(item, true); } -void RichTextLabel::push_align(Align p_align) { +void RichTextLabel::push_paragraph(Align p_align, Control::TextDirection p_direction, const String &p_language, Control::StructuredTextParser p_st_parser) { ERR_FAIL_COND(current->type == ITEM_TABLE); - ItemAlign *item = memnew(ItemAlign); + ItemParagraph *item = memnew(ItemParagraph); item->align = p_align; + item->direction = p_direction; + item->language = p_language; + item->st_parser = p_st_parser; _add_item(item, true, true); } @@ -1852,13 +2435,15 @@ void RichTextLabel::push_indent(int p_level) { _add_item(item, true, true); } -void RichTextLabel::push_list(ListType p_list) { +void RichTextLabel::push_list(int p_level, ListType p_list, bool p_capitalize) { ERR_FAIL_COND(current->type == ITEM_TABLE); - ERR_FAIL_INDEX(p_list, 3); + ERR_FAIL_COND(p_level < 0); ItemList *item = memnew(ItemList); item->list_type = p_list; + item->level = p_level; + item->capitalize = p_capitalize; _add_item(item, true, true); } @@ -1870,17 +2455,18 @@ void RichTextLabel::push_meta(const Variant &p_meta) { _add_item(item, true); } -void RichTextLabel::push_table(int p_columns) { +void RichTextLabel::push_table(int p_columns, VAlign p_align) { ERR_FAIL_COND(p_columns < 1); ItemTable *item = memnew(ItemTable); item->columns.resize(p_columns); item->total_width = 0; + item->inline_align = p_align; for (int i = 0; i < item->columns.size(); i++) { item->columns.write[i].expand = false; item->columns.write[i].expand_ratio = 1; } - _add_item(item, true, true); + _add_item(item, true, false); } void RichTextLabel::push_fade(int p_start_index, int p_length) { @@ -1934,6 +2520,36 @@ void RichTextLabel::set_table_column_expand(int p_column, bool p_expand, int p_r table->columns.write[p_column].expand_ratio = p_ratio; } +void RichTextLabel::set_cell_row_background_color(const Color &p_odd_row_bg, const Color &p_even_row_bg) { + ERR_FAIL_COND(current->type != ITEM_FRAME); + ItemFrame *cell = static_cast<ItemFrame *>(current); + ERR_FAIL_COND(!cell->cell); + cell->odd_row_bg = p_odd_row_bg; + cell->even_row_bg = p_even_row_bg; +} + +void RichTextLabel::set_cell_border_color(const Color &p_color) { + ERR_FAIL_COND(current->type != ITEM_FRAME); + ItemFrame *cell = static_cast<ItemFrame *>(current); + ERR_FAIL_COND(!cell->cell); + cell->border = p_color; +} + +void RichTextLabel::set_cell_size_override(const Size2 &p_min_size, const Size2 &p_max_size) { + ERR_FAIL_COND(current->type != ITEM_FRAME); + ItemFrame *cell = static_cast<ItemFrame *>(current); + ERR_FAIL_COND(!cell->cell); + cell->min_size_over = p_min_size; + cell->max_size_over = p_max_size; +} + +void RichTextLabel::set_cell_padding(const Rect2 &p_padding) { + ERR_FAIL_COND(current->type != ITEM_FRAME); + ItemFrame *cell = static_cast<ItemFrame *>(current); + ERR_FAIL_COND(!cell->cell); + cell->padding = p_padding; +} + void RichTextLabel::push_cell() { ERR_FAIL_COND(current->type != ITEM_TABLE); @@ -1942,10 +2558,9 @@ void RichTextLabel::push_cell() { _add_item(item, true); current_frame = item; item->cell = true; - item->parent_line = item->parent_frame->lines.size() - 1; item->lines.resize(1); item->lines.write[0].from = nullptr; - item->first_invalid_line = 0; + item->first_invalid_line = 0; // parent frame last line ??? } int RichTextLabel::get_current_table_column() const { @@ -1972,9 +2587,13 @@ void RichTextLabel::clear() { main->lines.resize(1); main->first_invalid_line = 0; update(); - selection.click = nullptr; + + selection.click_frame = nullptr; + selection.click_item = nullptr; selection.active = false; + current_idx = 1; + current_char_ofs = 0; if (scroll_follow) { scroll_following = true; } @@ -1986,7 +2605,7 @@ void RichTextLabel::clear() { void RichTextLabel::set_tab_size(int p_spaces) { tab_size = p_spaces; - main->first_invalid_line = 0; + main->first_resized_line = 0; update(); } @@ -2135,7 +2754,7 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { if (tag_stack.front()->get() == "i") { in_italics = false; } - if (tag_stack.front()->get() == "indent") { + if ((tag_stack.front()->get() == "indent") || (tag_stack.front()->get() == "ol") || (tag_stack.front()->get() == "ul")) { indent_level--; } @@ -2177,12 +2796,24 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag.begins_with("table=")) { - int columns = tag.substr(6, tag.length()).to_int(); + Vector<String> subtag = tag.substr(6, tag.length()).split(","); + int columns = subtag[0].to_int(); if (columns < 1) { columns = 1; } - push_table(columns); + VAlign align = VALIGN_TOP; + if (subtag.size() > 1) { + if (subtag[1] == "top" || subtag[1] == "t") { + align = VALIGN_TOP; + } else if (subtag[1] == "center" || subtag[1] == "c") { + align = VALIGN_CENTER; + } else if (subtag[1] == "bottom" || subtag[1] == "b") { + align = VALIGN_BOTTOM; + } + } + + push_table(columns, align); pos = brk_end + 1; tag_stack.push_front("table"); } else if (tag == "cell") { @@ -2197,6 +2828,42 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { set_table_column_expand(get_current_table_column(), true, ratio); push_cell(); + + pos = brk_end + 1; + tag_stack.push_front("cell"); + } else if (tag.begins_with("cell ")) { + Vector<String> subtag = tag.substr(5, tag.length()).split(" "); + + for (int i = 0; i < subtag.size(); i++) { + Vector<String> subtag_a = subtag[i].split("="); + if (subtag_a.size() == 2) { + if (subtag_a[0] == "expand") { + int ratio = subtag_a[1].to_int(); + if (ratio < 1) { + ratio = 1; + } + set_table_column_expand(get_current_table_column(), true, ratio); + } + } + } + push_cell(); + for (int i = 0; i < subtag.size(); i++) { + Vector<String> subtag_a = subtag[i].split("="); + if (subtag_a.size() == 2) { + if (subtag_a[0] == "border") { + Color color = _get_color_from_string(subtag_a[1], Color(0, 0, 0, 0)); + set_cell_border_color(color); + } else if (subtag_a[0] == "bg") { + Vector<String> subtag_b = subtag_a[1].split(","); + if (subtag_b.size() == 2) { + Color color1 = _get_color_from_string(subtag_b[0], Color(0, 0, 0, 0)); + Color color2 = _get_color_from_string(subtag_b[1], Color(0, 0, 0, 0)); + set_cell_row_background_color(color1, color2); + } + } + } + } + pos = brk_end + 1; tag_stack.push_front("cell"); } else if (tag == "u") { @@ -2209,32 +2876,156 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { push_strikethrough(); pos = brk_end + 1; tag_stack.push_front(tag); + } else if (tag == "lrm") { + add_text(String::chr(0x200E)); + pos = brk_end + 1; + } else if (tag == "rlm") { + add_text(String::chr(0x200F)); + pos = brk_end + 1; + } else if (tag == "lre") { + add_text(String::chr(0x202A)); + pos = brk_end + 1; + } else if (tag == "rle") { + add_text(String::chr(0x202B)); + pos = brk_end + 1; + } else if (tag == "lro") { + add_text(String::chr(0x202D)); + pos = brk_end + 1; + } else if (tag == "rlo") { + add_text(String::chr(0x202E)); + pos = brk_end + 1; + } else if (tag == "pdf") { + add_text(String::chr(0x202C)); + pos = brk_end + 1; + } else if (tag == "alm") { + add_text(String::chr(0x061c)); + pos = brk_end + 1; + } else if (tag == "lri") { + add_text(String::chr(0x2066)); + pos = brk_end + 1; + } else if (tag == "rli") { + add_text(String::chr(0x2027)); + pos = brk_end + 1; + } else if (tag == "fsi") { + add_text(String::chr(0x2068)); + pos = brk_end + 1; + } else if (tag == "pdi") { + add_text(String::chr(0x2069)); + pos = brk_end + 1; + } else if (tag == "zwj") { + add_text(String::chr(0x200D)); + pos = brk_end + 1; + } else if (tag == "zwnj") { + add_text(String::chr(0x200C)); + pos = brk_end + 1; + } else if (tag == "wj") { + add_text(String::chr(0x2060)); + pos = brk_end + 1; + } else if (tag == "shy") { + add_text(String::chr(0x00AD)); + pos = brk_end + 1; } else if (tag == "center") { - push_align(ALIGN_CENTER); + push_paragraph(ALIGN_CENTER); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "fill") { - push_align(ALIGN_FILL); + push_paragraph(ALIGN_FILL); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "right") { - push_align(ALIGN_RIGHT); + push_paragraph(ALIGN_RIGHT); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "ul") { - push_list(LIST_DOTS); + indent_level++; + push_list(indent_level, LIST_DOTS, false); pos = brk_end + 1; tag_stack.push_front(tag); - } else if (tag == "ol") { - push_list(LIST_NUMBERS); + } else if ((tag == "ol") || (tag == "ol type=1")) { + indent_level++; + push_list(indent_level, LIST_NUMBERS, false); pos = brk_end + 1; tag_stack.push_front(tag); + } else if (tag == "ol type=a") { + indent_level++; + push_list(indent_level, LIST_LETTERS, false); + pos = brk_end + 1; + tag_stack.push_front("ol"); + } else if (tag == "ol type=A") { + indent_level++; + push_list(indent_level, LIST_LETTERS, true); + pos = brk_end + 1; + tag_stack.push_front("ol"); + } else if (tag == "ol type=i") { + indent_level++; + push_list(indent_level, LIST_ROMAN, false); + pos = brk_end + 1; + tag_stack.push_front("ol"); + } else if (tag == "ol type=I") { + indent_level++; + push_list(indent_level, LIST_ROMAN, true); + pos = brk_end + 1; + tag_stack.push_front("ol"); } else if (tag == "indent") { indent_level++; push_indent(indent_level); pos = brk_end + 1; tag_stack.push_front(tag); - + } else if (tag == "p") { + push_paragraph(ALIGN_LEFT); + pos = brk_end + 1; + tag_stack.push_front("p"); + } else if (tag.begins_with("p ")) { + Vector<String> subtag = tag.substr(2, tag.length()).split(" "); + Align align = ALIGN_LEFT; + Control::TextDirection dir = Control::TEXT_DIRECTION_INHERITED; + String lang; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + for (int i = 0; i < subtag.size(); i++) { + Vector<String> subtag_a = subtag[i].split("="); + if (subtag_a.size() == 2) { + if (subtag_a[0] == "align") { + if (subtag_a[1] == "l" || subtag_a[1] == "left") { + align = ALIGN_LEFT; + } else if (subtag_a[1] == "c" || subtag_a[1] == "center") { + align = ALIGN_CENTER; + } else if (subtag_a[1] == "r" || subtag_a[1] == "right") { + align = ALIGN_RIGHT; + } else if (subtag_a[1] == "f" || subtag_a[1] == "fill") { + align = ALIGN_FILL; + } + } else if (subtag_a[0] == "dir" || subtag_a[0] == "direction") { + if (subtag_a[1] == "a" || subtag_a[1] == "auto") { + dir = Control::TEXT_DIRECTION_AUTO; + } else if (subtag_a[1] == "l" || subtag_a[1] == "ltr") { + dir = Control::TEXT_DIRECTION_LTR; + } else if (subtag_a[1] == "r" || subtag_a[1] == "rtl") { + dir = Control::TEXT_DIRECTION_RTL; + } + } else if (subtag_a[0] == "lang" || subtag_a[0] == "language") { + lang = subtag_a[1]; + } else if (subtag_a[0] == "st" || subtag_a[0] == "bidi_override") { + if (subtag_a[1] == "d" || subtag_a[1] == "default") { + st_parser = STRUCTURED_TEXT_DEFAULT; + } else if (subtag_a[1] == "u" || subtag_a[1] == "uri") { + st_parser = STRUCTURED_TEXT_URI; + } else if (subtag_a[1] == "f" || subtag_a[1] == "file") { + st_parser = STRUCTURED_TEXT_FILE; + } else if (subtag_a[1] == "e" || subtag_a[1] == "email") { + st_parser = STRUCTURED_TEXT_EMAIL; + } else if (subtag_a[1] == "l" || subtag_a[1] == "list") { + st_parser = STRUCTURED_TEXT_LIST; + } else if (subtag_a[1] == "n" || subtag_a[1] == "none") { + st_parser = STRUCTURED_TEXT_NONE; + } else if (subtag_a[1] == "c" || subtag_a[1] == "custom") { + st_parser = STRUCTURED_TEXT_CUSTOM; + } + } + } + } + push_paragraph(align, dir, lang, st_parser); + pos = brk_end + 1; + tag_stack.push_front("p"); } else if (tag == "url") { int end = p_bbcode.find("[", brk_end); if (end == -1) { @@ -2251,7 +3042,19 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { push_meta(url); pos = brk_end + 1; tag_stack.push_front("url"); - } else if (bbcode_name == "img") { + } else if (tag.begins_with("img")) { + VAlign align = VALIGN_TOP; + if (tag.begins_with("img=")) { + String al = tag.substr(4, tag.length()); + if (al == "top" || al == "t") { + align = VALIGN_TOP; + } else if (al == "center" || al == "c") { + align = VALIGN_CENTER; + } else if (al == "bottom" || al == "b") { + align = VALIGN_BOTTOM; + } + } + int end = p_bbcode.find("[", brk_end); if (end == -1) { end = p_bbcode.length(); @@ -2289,7 +3092,7 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { } } - add_image(texture, width, height, color); + add_image(texture, width, height, color, align); } pos = end; @@ -2301,6 +3104,13 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { pos = brk_end + 1; tag_stack.push_front("color"); + } else if (tag.begins_with("outline_color=")) { + String color_str = tag.substr(14, tag.length()); + Color color = _get_color_from_string(color_str, base_color); + push_outline_color(color); + pos = brk_end + 1; + tag_stack.push_front("outline_color"); + } else if (tag.begins_with("font=")) { String fnt = tag.substr(5, tag.length()); @@ -2313,6 +3123,54 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { pos = brk_end + 1; tag_stack.push_front("font"); + } else if (tag.begins_with("font_size=")) { + int fnt_size = tag.substr(10, tag.length()).to_int(); + push_font_size(fnt_size); + pos = brk_end + 1; + tag_stack.push_front("font_size"); + } else if (tag.begins_with("opentype_features=")) { + String fnt_ftr = tag.substr(18, tag.length()); + Vector<String> subtag = fnt_ftr.split(","); + Dictionary ftrs; + for (int i = 0; i < subtag.size(); i++) { + Vector<String> subtag_a = subtag[i].split("="); + if (subtag_a.size() == 2) { + ftrs[TS->name_to_tag(subtag_a[0])] = subtag_a[1].to_int(); + } else if (subtag_a.size() == 1) { + ftrs[TS->name_to_tag(subtag_a[0])] = 1; + } + } + push_font_features(ftrs); + pos = brk_end + 1; + tag_stack.push_front("opentype_features"); + } else if (tag.begins_with("font ")) { + Vector<String> subtag = tag.substr(2, tag.length()).split(" "); + + for (int i = 1; i < subtag.size(); i++) { + Vector<String> subtag_a = subtag[i].split("=", true, 2); + if (subtag_a.size() == 2) { + if (subtag_a[0] == "name" || subtag_a[0] == "n") { + String fnt = subtag_a[1]; + Ref<Font> font = ResourceLoader::load(fnt, "Font"); + if (font.is_valid()) { + push_font(font); + } else { + push_font(normal_font); + } + } else if (subtag_a[0] == "size" || subtag_a[0] == "s") { + int fnt_size = subtag_a[1].to_int(); + push_font_size(fnt_size); + } + } + } + + pos = brk_end + 1; + tag_stack.push_front("font"); + } else if (tag.begins_with("outline_size=")) { + int fnt_size = tag.substr(13, tag.length()).to_int(); + push_outline_size(fnt_size); + pos = brk_end + 1; + tag_stack.push_front("outline_size"); } else if (bbcode_name == "fade") { int start_index = 0; @@ -2445,7 +3303,7 @@ Error RichTextLabel::append_bbcode(const String &p_bbcode) { void RichTextLabel::scroll_to_line(int p_line) { ERR_FAIL_INDEX(p_line, main->lines.size()); _validate_line_caches(main); - vscroll->set_value(main->lines[p_line].height_accum_cache - main->lines[p_line].height_cache); + vscroll->set_value(main->lines[p_line].offset.y); } int RichTextLabel::get_line_count() const { @@ -2472,94 +3330,165 @@ void RichTextLabel::set_selection_enabled(bool p_enabled) { } } -bool RichTextLabel::search(const String &p_string, bool p_from_selection, bool p_search_previous) { - ERR_FAIL_COND_V(!selection.enabled, false); - Item *it = main; - int charidx = 0; - - if (p_from_selection && selection.active) { - it = selection.to; - charidx = selection.to_char + 1; - } - - while (it) { - if (it->type == ITEM_TEXT) { - ItemText *t = static_cast<ItemText *>(it); - int sp = t->text.findn(p_string, charidx); - if (sp != -1) { - selection.from = it; - selection.from_char = sp; - selection.to = it; - selection.to_char = sp + p_string.length() - 1; - selection.active = true; - update(); - - _validate_line_caches(main); +bool RichTextLabel::_search_line(ItemFrame *p_frame, int p_line, const String &p_string, Item *p_from, Item *p_to) { + ERR_FAIL_COND_V(p_frame == nullptr, false); + ERR_FAIL_COND_V(p_line < 0 || p_line >= p_frame->lines.size(), false); - int fh = _find_font(t).is_valid() ? _find_font(t)->get_height() : get_theme_font("normal_font")->get_height(); + Line &l = p_frame->lines.write[p_line]; - float offset = 0; + String text; + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + switch (it->type) { + case ITEM_NEWLINE: { + text += "\n"; + } break; + case ITEM_TEXT: { + ItemText *t = (ItemText *)it; + text += t->text; + } break; + case ITEM_IMAGE: { + text += " "; + } break; + case ITEM_TABLE: { + ItemTable *table = static_cast<ItemTable *>(it); + int idx = 0; + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); - int line = t->line; - Item *item = t; - while (item) { - if (item->type == ITEM_FRAME) { - ItemFrame *frame = static_cast<ItemFrame *>(item); - if (line >= 0 && line < frame->lines.size()) { - offset += frame->lines[line].height_accum_cache - frame->lines[line].height_cache; - line = frame->line; + for (int i = 0; i < frame->lines.size(); i++) { + if (_search_line(frame, i, p_string, p_from, p_to)) { + return true; } } - item = item->parent; + idx++; } - vscroll->set_value(offset - fh); + } break; + default: + break; + } + } + int sp = text.findn(p_string, 0); + if (sp != -1) { + selection.from_frame = p_frame; + selection.from_line = p_line; + selection.from_item = _get_item_at_pos(l.from, it_to, sp); + selection.from_char = sp; + selection.to_frame = p_frame; + selection.to_line = p_line; + selection.to_item = _get_item_at_pos(l.from, it_to, sp + p_string.length() - 1); + selection.to_char = sp + p_string.length() - 1; + selection.active = true; + return true; + } + return false; +} + +bool RichTextLabel::search(const String &p_string, bool p_from_selection, bool p_search_previous) { + ERR_FAIL_COND_V(!selection.enabled, false); + + if (p_from_selection && selection.active) { + for (int i = 0; i < main->lines.size(); i++) { + if (_search_line(main, i, p_string, selection.from_item, selection.to_item)) { + update(); return true; } } - - if (p_search_previous) { - it = _get_prev_item(it, true); - } else { - it = _get_next_item(it, true); + } else { + for (int i = 0; i < main->lines.size(); i++) { + if (_search_line(main, i, p_string, nullptr, nullptr)) { + update(); + return true; + } } - charidx = 0; } return false; } -void RichTextLabel::selection_copy() { - if (!selection.active || !selection.enabled) { - return; - } - +String RichTextLabel::_get_line_text(ItemFrame *p_frame, int p_line, Selection p_selection) { String text; + ERR_FAIL_COND_V(p_frame == nullptr, text); + ERR_FAIL_COND_V(p_line < 0 || p_line >= p_frame->lines.size(), text); - RichTextLabel::Item *item = selection.from; - - while (item) { - if (item->type == ITEM_TEXT) { - String itext = static_cast<ItemText *>(item)->text; - if (item == selection.from && item == selection.to) { - text += itext.substr(selection.from_char, selection.to_char - selection.from_char + 1); - } else if (item == selection.from) { - text += itext.substr(selection.from_char, itext.size()); - } else if (item == selection.to) { - text += itext.substr(0, selection.to_char + 1); - } else { - text += itext; - } + Line &l = p_frame->lines.write[p_line]; - } else if (item->type == ITEM_NEWLINE) { - text += "\n"; + Item *it_to = (p_line + 1 < p_frame->lines.size()) ? p_frame->lines[p_line + 1].from : nullptr; + int end_idx = 0; + if (it_to != nullptr) { + end_idx = it_to->index; + } else { + for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + end_idx = it->index + 1; + } + } + for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + if ((p_selection.to_item != nullptr) && (p_selection.to_item->index < l.from->index)) { + break; } - if (item == selection.to) { + if ((p_selection.from_item != nullptr) && (p_selection.from_item->index >= end_idx)) { break; } + switch (it->type) { + case ITEM_NEWLINE: { + text += "\n"; + } break; + case ITEM_TEXT: { + ItemText *t = (ItemText *)it; + text += t->text; + } break; + case ITEM_IMAGE: { + text += " "; + } break; + case ITEM_TABLE: { + ItemTable *table = static_cast<ItemTable *>(it); + int idx = 0; + int col_count = table->columns.size(); + for (List<Item *>::Element *E = table->subitems.front(); E; E = E->next()) { + ERR_CONTINUE(E->get()->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E->get()); + int column = idx % col_count; + + for (int i = 0; i < frame->lines.size(); i++) { + text += _get_line_text(frame, i, p_selection); + } + if (column == col_count - 1) { + text += "\n"; + } else { + text += " "; + } + idx++; + } + } break; + default: + break; + } + } + if ((l.from != nullptr) && (p_frame == p_selection.to_frame) && (p_selection.to_item != nullptr) && (p_selection.to_item->index >= l.from->index) && (p_selection.to_item->index < end_idx)) { + text = text.substr(0, p_selection.to_char); + } + if ((l.from != nullptr) && (p_frame == p_selection.from_frame) && (p_selection.from_item != nullptr) && (p_selection.from_item->index >= l.from->index) && (p_selection.from_item->index < end_idx)) { + text = text.substr(p_selection.from_char, -1); + } + return text; +} + +String RichTextLabel::get_selected_text() { + if (!selection.active || !selection.enabled) { + return ""; + } - item = _get_next_item(item, true); + String text; + for (int i = 0; i < main->lines.size(); i++) { + text += _get_line_text(main, i, selection); } + return text; +} + +void RichTextLabel::selection_copy() { + String text = get_selected_text(); if (text != "") { DisplayServer::get_singleton()->clipboard_set(text); @@ -2605,7 +3534,7 @@ String RichTextLabel::get_text() { text += t->text; } else if (it->type == ITEM_NEWLINE) { text += "\n"; - } else if (it->type == ITEM_INDENT) { + } else if (it->type == ITEM_INDENT || it->type == ITEM_LIST) { text += "\t"; } it = _get_next_item(it, true); @@ -2618,18 +3547,73 @@ void RichTextLabel::set_text(const String &p_string) { add_text(p_string); } -void RichTextLabel::set_percent_visible(float p_percent) { - if (p_percent < 0 || p_percent >= 1) { - visible_characters = -1; - percent_visible = 1; +void RichTextLabel::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + main->first_invalid_line = 0; //invalidate ALL + _validate_line_caches(main); + update(); + } +} - } else { - visible_characters = get_total_character_count() * p_percent; - percent_visible = p_percent; +void RichTextLabel::set_structured_text_bidi_override(Control::StructuredTextParser p_parser) { + if (st_parser != p_parser) { + st_parser = p_parser; + main->first_invalid_line = 0; //invalidate ALL + _validate_line_caches(main); + update(); } +} + +Control::StructuredTextParser RichTextLabel::get_structured_text_bidi_override() const { + return st_parser; +} + +void RichTextLabel::set_structured_text_bidi_override_options(Array p_args) { + st_args = p_args; + main->first_invalid_line = 0; //invalidate ALL + _validate_line_caches(main); update(); } +Array RichTextLabel::get_structured_text_bidi_override_options() const { + return st_args; +} + +Control::TextDirection RichTextLabel::get_text_direction() const { + return text_direction; +} + +void RichTextLabel::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + main->first_invalid_line = 0; //invalidate ALL + _validate_line_caches(main); + update(); + } +} + +String RichTextLabel::get_language() const { + return language; +} + +void RichTextLabel::set_percent_visible(float p_percent) { + if (percent_visible != p_percent) { + if (p_percent < 0 || p_percent >= 1) { + visible_characters = -1; + percent_visible = 1; + + } else { + visible_characters = get_total_character_count() * p_percent; + percent_visible = p_percent; + } + main->first_invalid_line = 0; //invalidate ALL + _validate_line_caches(main); + update(); + } +} + float RichTextLabel::get_percent_visible() const { return percent_visible; } @@ -2665,7 +3649,7 @@ void RichTextLabel::install_effect(const Variant effect) { int RichTextLabel::get_content_height() const { int total_height = 0; if (main->lines.size()) { - total_height = main->lines[main->lines.size() - 1].height_accum_cache + get_theme_stylebox("normal")->get_minimum_size().height; + total_height = main->lines[main->lines.size() - 1].offset.y + main->lines[main->lines.size() - 1].text_buf->get_size().y + get_theme_stylebox("normal")->get_minimum_size().height; } return total_height; } @@ -2675,29 +3659,46 @@ void RichTextLabel::_bind_methods() { ClassDB::bind_method(D_METHOD("get_text"), &RichTextLabel::get_text); ClassDB::bind_method(D_METHOD("add_text", "text"), &RichTextLabel::add_text); ClassDB::bind_method(D_METHOD("set_text", "text"), &RichTextLabel::set_text); - ClassDB::bind_method(D_METHOD("add_image", "image", "width", "height", "color"), &RichTextLabel::add_image, DEFVAL(0), DEFVAL(0), DEFVAL(Color(1.0, 1.0, 1.0))); + ClassDB::bind_method(D_METHOD("add_image", "image", "width", "height", "color", "inline_align"), &RichTextLabel::add_image, DEFVAL(0), DEFVAL(0), DEFVAL(Color(1.0, 1.0, 1.0)), DEFVAL(VALIGN_TOP)); ClassDB::bind_method(D_METHOD("newline"), &RichTextLabel::add_newline); ClassDB::bind_method(D_METHOD("remove_line", "line"), &RichTextLabel::remove_line); ClassDB::bind_method(D_METHOD("push_font", "font"), &RichTextLabel::push_font); + ClassDB::bind_method(D_METHOD("push_font_size", "font_size"), &RichTextLabel::push_font_size); + ClassDB::bind_method(D_METHOD("push_font_features", "opentype_features"), &RichTextLabel::push_font_features); ClassDB::bind_method(D_METHOD("push_normal"), &RichTextLabel::push_normal); ClassDB::bind_method(D_METHOD("push_bold"), &RichTextLabel::push_bold); ClassDB::bind_method(D_METHOD("push_bold_italics"), &RichTextLabel::push_bold_italics); ClassDB::bind_method(D_METHOD("push_italics"), &RichTextLabel::push_italics); ClassDB::bind_method(D_METHOD("push_mono"), &RichTextLabel::push_mono); ClassDB::bind_method(D_METHOD("push_color", "color"), &RichTextLabel::push_color); - ClassDB::bind_method(D_METHOD("push_align", "align"), &RichTextLabel::push_align); + ClassDB::bind_method(D_METHOD("push_outline_size", "outline_size"), &RichTextLabel::push_outline_size); + ClassDB::bind_method(D_METHOD("push_outline_color", "color"), &RichTextLabel::push_outline_color); + ClassDB::bind_method(D_METHOD("push_paragraph", "align", "base_direction", "language", "st_parser"), &RichTextLabel::push_paragraph, DEFVAL(TextServer::DIRECTION_AUTO), DEFVAL(""), DEFVAL(STRUCTURED_TEXT_DEFAULT)); ClassDB::bind_method(D_METHOD("push_indent", "level"), &RichTextLabel::push_indent); - ClassDB::bind_method(D_METHOD("push_list", "type"), &RichTextLabel::push_list); + ClassDB::bind_method(D_METHOD("push_list", "level", "type", "capitalize"), &RichTextLabel::push_list); ClassDB::bind_method(D_METHOD("push_meta", "data"), &RichTextLabel::push_meta); ClassDB::bind_method(D_METHOD("push_underline"), &RichTextLabel::push_underline); ClassDB::bind_method(D_METHOD("push_strikethrough"), &RichTextLabel::push_strikethrough); - ClassDB::bind_method(D_METHOD("push_table", "columns"), &RichTextLabel::push_table); + ClassDB::bind_method(D_METHOD("push_table", "columns", "inline_align"), &RichTextLabel::push_table, DEFVAL(VALIGN_TOP)); ClassDB::bind_method(D_METHOD("set_table_column_expand", "column", "expand", "ratio"), &RichTextLabel::set_table_column_expand); + ClassDB::bind_method(D_METHOD("set_cell_row_background_color", "odd_row_bg", "even_row_bg"), &RichTextLabel::set_cell_row_background_color); + ClassDB::bind_method(D_METHOD("set_cell_border_color", "color"), &RichTextLabel::set_cell_border_color); + ClassDB::bind_method(D_METHOD("set_cell_size_override", "min_size", "max_size"), &RichTextLabel::set_cell_size_override); + ClassDB::bind_method(D_METHOD("set_cell_padding", "padding"), &RichTextLabel::set_cell_padding); ClassDB::bind_method(D_METHOD("push_cell"), &RichTextLabel::push_cell); ClassDB::bind_method(D_METHOD("pop"), &RichTextLabel::pop); ClassDB::bind_method(D_METHOD("clear"), &RichTextLabel::clear); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "parser"), &RichTextLabel::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override"), &RichTextLabel::get_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &RichTextLabel::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &RichTextLabel::get_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &RichTextLabel::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &RichTextLabel::get_text_direction); + ClassDB::bind_method(D_METHOD("set_language", "language"), &RichTextLabel::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &RichTextLabel::get_language); + ClassDB::bind_method(D_METHOD("set_meta_underline", "enable"), &RichTextLabel::set_meta_underline); ClassDB::bind_method(D_METHOD("is_meta_underlined"), &RichTextLabel::is_meta_underlined); @@ -2772,6 +3773,13 @@ void RichTextLabel::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "custom_effects", PROPERTY_HINT_ARRAY_TYPE, "RichTextEffect", (PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_SCRIPT_VARIABLE)), "set_effects", "get_effects"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); + + ADD_GROUP("Structured Text", "structured_text_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "structured_text_bidi_override", PROPERTY_HINT_ENUM, "Default,URI,File,Email,List,None,Custom"), "set_structured_text_bidi_override", "get_structured_text_bidi_override"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "structured_text_bidi_override_options"), "set_structured_text_bidi_override_options", "get_structured_text_bidi_override_options"); + ADD_SIGNAL(MethodInfo("meta_clicked", PropertyInfo(Variant::NIL, "meta", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NIL_IS_VARIANT))); ADD_SIGNAL(MethodInfo("meta_hover_started", PropertyInfo(Variant::NIL, "meta", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NIL_IS_VARIANT))); ADD_SIGNAL(MethodInfo("meta_hover_ended", PropertyInfo(Variant::NIL, "meta", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NIL_IS_VARIANT))); @@ -2783,6 +3791,7 @@ void RichTextLabel::_bind_methods() { BIND_ENUM_CONSTANT(LIST_NUMBERS); BIND_ENUM_CONSTANT(LIST_LETTERS); + BIND_ENUM_CONSTANT(LIST_ROMAN); BIND_ENUM_CONSTANT(LIST_DOTS); BIND_ENUM_CONSTANT(ITEM_FRAME); @@ -2790,10 +3799,14 @@ void RichTextLabel::_bind_methods() { BIND_ENUM_CONSTANT(ITEM_IMAGE); BIND_ENUM_CONSTANT(ITEM_NEWLINE); BIND_ENUM_CONSTANT(ITEM_FONT); + BIND_ENUM_CONSTANT(ITEM_FONT_SIZE); + BIND_ENUM_CONSTANT(ITEM_FONT_FEATURES); BIND_ENUM_CONSTANT(ITEM_COLOR); + BIND_ENUM_CONSTANT(ITEM_OUTLINE_SIZE); + BIND_ENUM_CONSTANT(ITEM_OUTLINE_COLOR); BIND_ENUM_CONSTANT(ITEM_UNDERLINE); BIND_ENUM_CONSTANT(ITEM_STRIKETHROUGH); - BIND_ENUM_CONSTANT(ITEM_ALIGN); + BIND_ENUM_CONSTANT(ITEM_PARAGRAPH); BIND_ENUM_CONSTANT(ITEM_INDENT); BIND_ENUM_CONSTANT(ITEM_LIST); BIND_ENUM_CONSTANT(ITEM_TABLE); @@ -2923,6 +3936,7 @@ RichTextLabel::RichTextLabel() { main->lines.resize(1); main->lines.write[0].from = main; main->first_invalid_line = 0; + main->first_resized_line = 0; current_frame = main; tab_size = 4; default_align = ALIGN_LEFT; @@ -2948,10 +3962,10 @@ RichTextLabel::RichTextLabel() { vscroll->connect("value_changed", callable_mp(this, &RichTextLabel::_scroll_changed)); vscroll->set_step(1); vscroll->hide(); - current_idx = 1; use_bbcode = false; - selection.click = nullptr; + selection.click_frame = nullptr; + selection.click_item = nullptr; selection.active = false; selection.enabled = false; diff --git a/scene/gui/rich_text_label.h b/scene/gui/rich_text_label.h index 2bda7c7fce..93e48dd449 100644 --- a/scene/gui/rich_text_label.h +++ b/scene/gui/rich_text_label.h @@ -33,13 +33,13 @@ #include "rich_text_effect.h" #include "scene/gui/scroll_bar.h" +#include "scene/resources/text_paragraph.h" class RichTextLabel : public Control { GDCLASS(RichTextLabel, Control); public: enum Align { - ALIGN_LEFT, ALIGN_CENTER, ALIGN_RIGHT, @@ -47,23 +47,26 @@ public: }; enum ListType { - LIST_NUMBERS, LIST_LETTERS, + LIST_ROMAN, LIST_DOTS }; enum ItemType { - ITEM_FRAME, ITEM_TEXT, ITEM_IMAGE, ITEM_NEWLINE, ITEM_FONT, + ITEM_FONT_SIZE, + ITEM_FONT_FEATURES, ITEM_COLOR, + ITEM_OUTLINE_SIZE, + ITEM_OUTLINE_COLOR, ITEM_UNDERLINE, ITEM_STRIKETHROUGH, - ITEM_ALIGN, + ITEM_PARAGRAPH, ITEM_INDENT, ITEM_LIST, ITEM_TABLE, @@ -83,31 +86,25 @@ private: struct Item; struct Line { - Item *from; - Vector<int> offset_caches; - Vector<int> height_caches; - Vector<int> ascent_caches; - Vector<int> descent_caches; - Vector<int> space_caches; - int height_cache; - int height_accum_cache; - int char_count; - int minimum_width; - int maximum_width; - - Line() { - from = nullptr; - char_count = 0; - } + Item *from = nullptr; + + Ref<TextParagraph> text_buf; + + Vector2 offset; + int char_offset = 0; + int char_count = 0; + + Line() { text_buf.instance(); } }; struct Item { - int index; - Item *parent; - ItemType type; + int index = 0; + int char_ofs = 0; + Item *parent = nullptr; + ItemType type = ITEM_FRAME; List<Item *> subitems; - List<Item *>::Element *E; - int line; + List<Item *>::Element *E = nullptr; + int line = 0; void _clear_children() { while (subitems.size()) { @@ -116,29 +113,26 @@ private: } } - Item() { - parent = nullptr; - E = nullptr; - line = 0; - index = 0; - type = ITEM_FRAME; - } virtual ~Item() { _clear_children(); } }; struct ItemFrame : public Item { - int parent_line; - bool cell; + bool cell = false; + Vector<Line> lines; - int first_invalid_line; - ItemFrame *parent_frame; - - ItemFrame() { - type = ITEM_FRAME; - parent_frame = nullptr; - cell = false; - parent_line = 0; - } + int first_invalid_line = 0; + int first_resized_line = 0; + + ItemFrame *parent_frame = nullptr; + + Color odd_row_bg = Color(0, 0, 0, 0); + Color even_row_bg = Color(0, 0, 0, 0); + Color border = Color(0, 0, 0, 0); + Size2 min_size_over = Size2(-1, -1); + Size2 max_size_over = Size2(-1, -1); + Rect2 padding; + + ItemFrame() { type = ITEM_FRAME; } }; struct ItemText : public Item { @@ -148,6 +142,7 @@ private: struct ItemImage : public Item { Ref<Texture2D> image; + VAlign inline_align = VALIGN_TOP; Size2 size; Color color; ItemImage() { type = ITEM_IMAGE; } @@ -158,11 +153,31 @@ private: ItemFont() { type = ITEM_FONT; } }; + struct ItemFontSize : public Item { + int font_size = 16; + ItemFontSize() { type = ITEM_FONT_SIZE; } + }; + + struct ItemFontFeatures : public Item { + Dictionary opentype_features; + ItemFontFeatures() { type = ITEM_FONT_FEATURES; } + }; + struct ItemColor : public Item { Color color; ItemColor() { type = ITEM_COLOR; } }; + struct ItemOutlineSize : public Item { + int outline_size = 0; + ItemOutlineSize() { type = ITEM_OUTLINE_SIZE; } + }; + + struct ItemOutlineColor : public Item { + Color color; + ItemOutlineColor() { type = ITEM_OUTLINE_COLOR; } + }; + struct ItemUnderline : public Item { ItemUnderline() { type = ITEM_UNDERLINE; } }; @@ -176,18 +191,23 @@ private: ItemMeta() { type = ITEM_META; } }; - struct ItemAlign : public Item { - Align align; - ItemAlign() { type = ITEM_ALIGN; } + struct ItemParagraph : public Item { + Align align = ALIGN_LEFT; + String language; + Control::TextDirection direction = Control::TEXT_DIRECTION_AUTO; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + ItemParagraph() { type = ITEM_PARAGRAPH; } }; struct ItemIndent : public Item { - int level; + int level = 0; ItemIndent() { type = ITEM_INDENT; } }; struct ItemList : public Item { - ListType list_type; + ListType list_type = LIST_DOTS; + bool capitalize = false; + int level = 0; ItemList() { type = ITEM_LIST; } }; @@ -205,37 +225,32 @@ private: }; Vector<Column> columns; - int total_width; + Vector<float> rows; + + int total_width = 0; + int total_height = 0; + VAlign inline_align = VALIGN_TOP; ItemTable() { type = ITEM_TABLE; } }; struct ItemFade : public Item { - int starting_index; - int length; + int starting_index = 0; + int length = 0; ItemFade() { type = ITEM_FADE; } }; struct ItemFX : public Item { - float elapsed_time; - - ItemFX() { - elapsed_time = 0.0f; - } + float elapsed_time = 0.f; }; struct ItemShake : public ItemFX { - int strength; - float rate; - uint64_t _current_rng; - uint64_t _previous_rng; - - ItemShake() { - strength = 0; - rate = 0.0f; - _current_rng = 0; - type = ITEM_SHAKE; - } + int strength = 0; + float rate = 0.0f; + uint64_t _current_rng = 0; + uint64_t _previous_rng = 0; + + ItemShake() { type = ITEM_SHAKE; } void reroll_random() { _previous_rng = _current_rng; @@ -254,38 +269,25 @@ private: }; struct ItemWave : public ItemFX { - float frequency; - float amplitude; + float frequency = 1.0f; + float amplitude = 1.0f; - ItemWave() { - frequency = 1.0f; - amplitude = 1.0f; - type = ITEM_WAVE; - } + ItemWave() { type = ITEM_WAVE; } }; struct ItemTornado : public ItemFX { - float radius; - float frequency; + float radius = 1.0f; + float frequency = 1.0f; - ItemTornado() { - radius = 1.0f; - frequency = 1.0f; - type = ITEM_TORNADO; - } + ItemTornado() { type = ITEM_TORNADO; } }; struct ItemRainbow : public ItemFX { - float saturation; - float value; - float frequency; - - ItemRainbow() { - saturation = 0.8f; - value = 0.8f; - frequency = 1.0f; - type = ITEM_RAINBOW; - } + float saturation = 0.8f; + float value = 0.8f; + float frequency = 1.0f; + + ItemRainbow() { type = ITEM_RAINBOW; } }; struct ItemCustomFX : public ItemFX { @@ -294,7 +296,6 @@ private: ItemCustomFX() { type = ITEM_CUSTOMFX; - char_fx_transform.instance(); } @@ -319,7 +320,8 @@ private: int scroll_w; bool scroll_updated; bool updating_scroll; - int current_idx; + int current_idx = 1; + int current_char_ofs = 0; int visible_line_count; int tab_size; @@ -339,24 +341,25 @@ private: void _add_item(Item *p_item, bool p_enter = false, bool p_ensure_newline = false); void _remove_item(Item *p_item, const int p_line, const int p_subitem_line); - struct ProcessState { - int line_width; - }; - - enum ProcessMode { - - PROCESS_CACHE, - PROCESS_DRAW, - PROCESS_POINTER - }; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + Array st_args; struct Selection { - Item *click; + ItemFrame *click_frame; + int click_line; + Item *click_item; int click_char; - Item *from; + ItemFrame *from_frame; + int from_line; + Item *from_item; int from_char; - Item *to; + + ItemFrame *to_frame; + int to_line; + Item *to_item; int to_char; bool active; // anything selected? i.e. from, to, etc. valid? @@ -368,18 +371,38 @@ private: int visible_characters; float percent_visible; - int _process_line(ItemFrame *p_frame, const Vector2 &p_ofs, int &y, int p_width, int p_line, ProcessMode p_mode, const Ref<Font> &p_base_font, const Color &p_base_color, const Color &p_font_color_shadow, bool p_shadow_as_outline, const Point2 &shadow_ofs, const Point2i &p_click_pos = Point2i(), Item **r_click_item = nullptr, int *r_click_char = nullptr, bool *r_outside = nullptr, int p_char_count = 0); - void _find_click(ItemFrame *p_frame, const Point2i &p_click, Item **r_click_item = nullptr, int *r_click_char = nullptr, bool *r_outside = nullptr); + void _find_click(ItemFrame *p_frame, const Point2i &p_click, ItemFrame **r_click_frame = nullptr, int *r_click_line = nullptr, Item **r_click_item = nullptr, int *r_click_char = nullptr, bool *r_outside = nullptr); + + String _get_line_text(ItemFrame *p_frame, int p_line, Selection p_sel); + bool _search_line(ItemFrame *p_frame, int p_line, const String &p_string, Item *p_from, Item *p_to); + + void _shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width, int *r_char_offset); + void _resize_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width); + float _draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_color_shadow, bool p_shadow_as_outline, const Point2 &shadow_ofs); + float _find_click_in_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Point2i &p_click, ItemFrame **r_click_frame = nullptr, int *r_click_line = nullptr, Item **r_click_item = nullptr, int *r_click_char = nullptr); + + String _roman(int p_num, bool p_capitalize) const; + String _letters(int p_num, bool p_capitalize) const; + Item *_get_item_at_pos(Item *p_item_from, Item *p_item_to, int p_position); + void _find_frame(Item *p_item, ItemFrame **r_frame, int *r_line); Ref<Font> _find_font(Item *p_item); - int _find_margin(Item *p_item, const Ref<Font> &p_base_font); + int _find_font_size(Item *p_item); + Dictionary _find_font_features(Item *p_item); + int _find_outline_size(Item *p_item); + ItemList *_find_list_item(Item *p_item); + int _find_list(Item *p_item, Vector<int> &r_index, Vector<ItemList *> &r_list); + int _find_margin(Item *p_item, const Ref<Font> &p_base_font, int p_base_font_size); Align _find_align(Item *p_item); + TextServer::Direction _find_direction(Item *p_item); + Control::StructuredTextParser _find_stt(Item *p_item); + String _find_language(Item *p_item); Color _find_color(Item *p_item, const Color &p_default_color); + Color _find_outline_color(Item *p_item, const Color &p_default_color); bool _find_underline(Item *p_item); bool _find_strikethrough(Item *p_item); bool _find_meta(Item *p_item, Variant *r_meta, ItemMeta **r_item = nullptr); bool _find_layout_subitem(Item *from, Item *to); - bool _find_by_type(Item *p_item, ItemType p_type); void _fetch_item_fx_stack(Item *p_item, Vector<ItemFX *> &r_stack); static Color _get_color_from_string(const String &p_color_str, const Color &p_default_color); @@ -399,8 +422,6 @@ private: bool use_bbcode; String bbcode; - void _update_all_lines(); - int fixed_width; bool fit_content_height; @@ -411,23 +432,27 @@ protected: public: String get_text(); void add_text(const String &p_text); - void add_image(const Ref<Texture2D> &p_image, const int p_width = 0, const int p_height = 0, const Color &p_color = Color(1.0, 1.0, 1.0)); + void add_image(const Ref<Texture2D> &p_image, const int p_width = 0, const int p_height = 0, const Color &p_color = Color(1.0, 1.0, 1.0), VAlign p_align = VALIGN_TOP); void add_newline(); bool remove_line(const int p_line); void push_font(const Ref<Font> &p_font); + void push_font_size(int p_font_size); + void push_font_features(const Dictionary &p_features); + void push_outline_size(int p_font_size); void push_normal(); void push_bold(); void push_bold_italics(); void push_italics(); void push_mono(); void push_color(const Color &p_color); + void push_outline_color(const Color &p_color); void push_underline(); void push_strikethrough(); - void push_align(Align p_align); + void push_paragraph(Align p_align, Control::TextDirection p_direction = Control::TEXT_DIRECTION_INHERITED, const String &p_language = "", Control::StructuredTextParser p_st_parser = STRUCTURED_TEXT_DEFAULT); void push_indent(int p_level); - void push_list(ListType p_list); + void push_list(int p_level, ListType p_list, bool p_capitalize); void push_meta(const Variant &p_meta); - void push_table(int p_columns); + void push_table(int p_columns, VAlign p_align = VALIGN_TOP); void push_fade(int p_start_index, int p_length); void push_shake(int p_strength, float p_rate); void push_wave(float p_frequency, float p_amplitude); @@ -435,6 +460,10 @@ public: void push_rainbow(float p_saturation, float p_value, float p_frequency); void push_customfx(Ref<RichTextEffect> p_custom_effect, Dictionary p_environment); void set_table_column_expand(int p_column, bool p_expand, int p_ratio = 1); + void set_cell_row_background_color(const Color &p_odd_row_bg, const Color &p_even_row_bg); + void set_cell_border_color(const Color &p_color); + void set_cell_size_override(const Size2 &p_min_size, const Size2 &p_max_size); + void set_cell_padding(const Rect2 &p_padding); int get_current_table_column() const; void push_cell(); void pop(); @@ -475,6 +504,7 @@ public: void set_selection_enabled(bool p_enabled); bool is_selection_enabled() const; + String get_selected_text(); void selection_copy(); Error parse_bbcode(const String &p_bbcode); @@ -488,6 +518,18 @@ public: void set_text(const String &p_string); + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_language(const String &p_language); + String get_language() const; + + void set_structured_text_bidi_override(Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override() const; + + void set_structured_text_bidi_override_options(Array p_args); + Array get_structured_text_bidi_override_options() const; + void set_visible_characters(int p_visible); int get_visible_characters() const; int get_total_character_count() const; diff --git a/scene/gui/scroll_bar.cpp b/scene/gui/scroll_bar.cpp index 0e9ef71892..70de63fd40 100644 --- a/scene/gui/scroll_bar.cpp +++ b/scene/gui/scroll_bar.cpp @@ -32,7 +32,7 @@ #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" +#include "core/string/print_string.h" #include "scene/main/window.h" bool ScrollBar::focus_by_default = false; @@ -449,18 +449,6 @@ double ScrollBar::get_area_offset() const { return ofs; } -double ScrollBar::get_click_pos(const Point2 &p_pos) const { - float pos = (orientation == VERTICAL) ? p_pos.y : p_pos.x; - pos -= get_area_offset(); - - float area = get_area_size(); - if (area == 0) { - return 0; - } else { - return pos / area; - } -} - double ScrollBar::get_grabber_offset() const { return (get_area_size()) * get_as_ratio(); } diff --git a/scene/gui/scroll_bar.h b/scene/gui/scroll_bar.h index 6ae76e453a..358ed74965 100644 --- a/scene/gui/scroll_bar.h +++ b/scene/gui/scroll_bar.h @@ -53,15 +53,14 @@ class ScrollBar : public Range { struct Drag { bool active = false; - float pos_at_click; - float value_at_click; + float pos_at_click = 0; + float value_at_click = 0; } drag; double get_grabber_size() const; double get_grabber_min_size() const; double get_area_size() const; double get_area_offset() const; - double get_click_pos(const Point2 &p_pos) const; double get_grabber_offset() const; static void set_can_focus_by_default(bool p_can_focus); diff --git a/scene/gui/scroll_container.cpp b/scene/gui/scroll_container.cpp index b72b913af0..3a54ac7443 100644 --- a/scene/gui/scroll_container.cpp +++ b/scene/gui/scroll_container.cpp @@ -45,7 +45,7 @@ Size2 ScrollContainer::get_minimum_size() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } if (c == h_scroll || c == v_scroll) { @@ -213,6 +213,10 @@ void ScrollContainer::_gui_input(const Ref<InputEvent> &p_gui_input) { } void ScrollContainer::_update_scrollbar_position() { + if (!_updating_scrollbars) { + return; + } + Size2 hmin = h_scroll->get_combined_minimum_size(); Size2 vmin = v_scroll->get_combined_minimum_size(); @@ -228,6 +232,8 @@ void ScrollContainer::_update_scrollbar_position() { h_scroll->raise(); v_scroll->raise(); + + _updating_scrollbars = false; } void ScrollContainer::_ensure_focused_visible(Control *p_control) { @@ -249,13 +255,18 @@ void ScrollContainer::_ensure_focused_visible(Control *p_control) { float diff = MAX(MIN(other_rect.position.y, global_rect.position.y), other_rect.position.y + other_rect.size.y - global_rect.size.y + bottom_margin); set_v_scroll(get_v_scroll() + (diff - global_rect.position.y)); - diff = MAX(MIN(other_rect.position.x, global_rect.position.x), other_rect.position.x + other_rect.size.x - global_rect.size.x + right_margin); + if (is_layout_rtl()) { + diff = MAX(MIN(other_rect.position.x, global_rect.position.x), other_rect.position.x + other_rect.size.x - global_rect.size.x); + } else { + diff = MAX(MIN(other_rect.position.x, global_rect.position.x), other_rect.position.x + other_rect.size.x - global_rect.size.x + right_margin); + } set_h_scroll(get_h_scroll() + (diff - global_rect.position.x)); } } void ScrollContainer::_notification(int p_what) { - if (p_what == NOTIFICATION_ENTER_TREE || p_what == NOTIFICATION_THEME_CHANGED) { + if (p_what == NOTIFICATION_ENTER_TREE || p_what == NOTIFICATION_THEME_CHANGED || p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED || p_what == NOTIFICATION_TRANSLATION_CHANGED) { + _updating_scrollbars = true; call_deferred("_update_scrollbar_position"); }; @@ -271,6 +282,7 @@ void ScrollContainer::_notification(int p_what) { Ref<StyleBox> sb = get_theme_stylebox("bg"); size -= sb->get_minimum_size(); ofs += sb->get_offset(); + bool rtl = is_layout_rtl(); if (h_scroll->is_visible_in_tree() && h_scroll->get_parent() == this) { //scrolls may have been moved out for reasons size.y -= h_scroll->get_minimum_size().y; @@ -285,7 +297,7 @@ void ScrollContainer::_notification(int p_what) { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } if (c == h_scroll || c == v_scroll) { @@ -313,6 +325,9 @@ void ScrollContainer::_notification(int p_what) { } } r.position += ofs; + if (rtl && v_scroll->is_visible_in_tree() && v_scroll->get_parent() == this) { + r.position.x += v_scroll->get_minimum_size().x; + } fit_child_in_rect(c, r); } @@ -414,12 +429,13 @@ void ScrollContainer::update_scrollbars() { bool hide_scroll_v = !scroll_v || min.height <= size.height; bool hide_scroll_h = !scroll_h || min.width <= size.width; + v_scroll->set_max(min.height); if (hide_scroll_v) { + v_scroll->set_page(size.height); v_scroll->hide(); scroll.y = 0; } else { v_scroll->show(); - v_scroll->set_max(min.height); if (hide_scroll_h) { v_scroll->set_page(size.height); } else { @@ -429,12 +445,13 @@ void ScrollContainer::update_scrollbars() { scroll.y = v_scroll->get_value(); } + h_scroll->set_max(min.width); if (hide_scroll_h) { + h_scroll->set_page(size.width); h_scroll->hide(); scroll.x = 0; } else { h_scroll->show(); - h_scroll->set_max(min.width); if (hide_scroll_v) { h_scroll->set_page(size.width); } else { @@ -520,6 +537,8 @@ void ScrollContainer::set_follow_focus(bool p_follow) { } String ScrollContainer::get_configuration_warning() const { + String warning = Container::get_configuration_warning(); + int found = 0; for (int i = 0; i < get_child_count(); i++) { @@ -527,7 +546,7 @@ String ScrollContainer::get_configuration_warning() const { if (!c) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } if (c == h_scroll || c == v_scroll) { @@ -538,10 +557,12 @@ String ScrollContainer::get_configuration_warning() const { } if (found != 1) { - return TTR("ScrollContainer is intended to work with a single child control.\nUse a container as child (VBox, HBox, etc.), or a Control and set the custom minimum size manually."); - } else { - return ""; + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("ScrollContainer is intended to work with a single child control.\nUse a container as child (VBox, HBox, etc.), or a Control and set the custom minimum size manually."); } + return warning; } HScrollBar *ScrollContainer::get_h_scrollbar() { diff --git a/scene/gui/scroll_container.h b/scene/gui/scroll_container.h index b28d66ed53..4bf200009e 100644 --- a/scene/gui/scroll_container.h +++ b/scene/gui/scroll_container.h @@ -74,6 +74,7 @@ protected: void _scroll_moved(float); static void _bind_methods(); + bool _updating_scrollbars = false; void _update_scrollbar_position(); void _ensure_focused_visible(Control *p_node); diff --git a/scene/gui/shortcut.h b/scene/gui/shortcut.h index 0d7809e5cf..176958b397 100644 --- a/scene/gui/shortcut.h +++ b/scene/gui/shortcut.h @@ -32,7 +32,7 @@ #define SHORTCUT_H #include "core/input/input_event.h" -#include "core/resource.h" +#include "core/io/resource.h" class Shortcut : public Resource { GDCLASS(Shortcut, Resource); diff --git a/scene/gui/spin_box.cpp b/scene/gui/spin_box.cpp index ae2f99e91d..46b24efed5 100644 --- a/scene/gui/spin_box.cpp +++ b/scene/gui/spin_box.cpp @@ -40,7 +40,7 @@ Size2 SpinBox::get_minimum_size() const { } void SpinBox::_value_changed(double) { - String value = String::num(get_value(), Math::range_step_decimals(get_step())); + String value = TS->format_number(String::num(get_value(), Math::range_step_decimals(get_step()))); if (prefix != "") { value = prefix + " " + value; } @@ -53,8 +53,10 @@ void SpinBox::_value_changed(double) { void SpinBox::_text_entered(const String &p_string) { Ref<Expression> expr; expr.instance(); + + String num = TS->parse_number(p_string); // Ignore the prefix and suffix in the expression - Error err = expr->parse(p_string.trim_prefix(prefix + " ").trim_suffix(" " + suffix)); + Error err = expr->parse(num.trim_prefix(prefix + " ").trim_suffix(" " + suffix)); if (err != OK) { return; } @@ -170,7 +172,8 @@ void SpinBox::_line_edit_focus_exit() { inline void SpinBox::_adjust_width_for_icon(const Ref<Texture2D> &icon) { int w = icon->get_width(); - if (w != last_w) { + if ((w != last_w)) { + line_edit->set_margin(MARGIN_LEFT, 0); line_edit->set_margin(MARGIN_RIGHT, -w); last_w = w; } @@ -185,16 +188,24 @@ void SpinBox::_notification(int p_what) { RID ci = get_canvas_item(); Size2i size = get_size(); - updown->draw(ci, Point2i(size.width - updown->get_width(), (size.height - updown->get_height()) / 2)); + if (is_layout_rtl()) { + updown->draw(ci, Point2i(0, (size.height - updown->get_height()) / 2)); + } else { + updown->draw(ci, Point2i(size.width - updown->get_width(), (size.height - updown->get_height()) / 2)); + } } else if (p_what == NOTIFICATION_FOCUS_EXIT) { //_value_changed(0); } else if (p_what == NOTIFICATION_ENTER_TREE) { _adjust_width_for_icon(get_theme_icon("updown")); _value_changed(0); + } else if (p_what == NOTIFICATION_TRANSLATION_CHANGED) { + _value_changed(0); } else if (p_what == NOTIFICATION_THEME_CHANGED) { call_deferred("minimum_size_changed"); get_line_edit()->call_deferred("minimum_size_changed"); + } else if (p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED || p_what == NOTIFICATION_TRANSLATION_CHANGED) { + update(); } } @@ -263,6 +274,8 @@ SpinBox::SpinBox() { line_edit->set_anchors_and_margins_preset(Control::PRESET_WIDE); line_edit->set_mouse_filter(MOUSE_FILTER_PASS); + line_edit->set_align(LineEdit::ALIGN_LEFT); + //connect("value_changed",this,"_value_changed"); line_edit->connect("text_entered", callable_mp(this, &SpinBox::_text_entered), Vector<Variant>(), CONNECT_DEFERRED); line_edit->connect("focus_exited", callable_mp(this, &SpinBox::_line_edit_focus_exit), Vector<Variant>(), CONNECT_DEFERRED); diff --git a/scene/gui/split_container.cpp b/scene/gui/split_container.cpp index 5c60153d91..1e85bba0e3 100644 --- a/scene/gui/split_container.cpp +++ b/scene/gui/split_container.cpp @@ -41,7 +41,7 @@ Control *SplitContainer::_getch(int p_idx) const { if (!c || !c->is_visible_in_tree()) { continue; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { continue; } @@ -112,9 +112,16 @@ void SplitContainer::_resort() { int sofs = middle_sep + sep; fit_child_in_rect(second, Rect2(Point2(0, sofs), Size2(get_size().width, get_size().height - sofs))); } else { - fit_child_in_rect(first, Rect2(Point2(0, 0), Size2(middle_sep, get_size().height))); - int sofs = middle_sep + sep; - fit_child_in_rect(second, Rect2(Point2(sofs, 0), Size2(get_size().width - sofs, get_size().height))); + if (is_layout_rtl()) { + middle_sep = get_size().width - middle_sep - sep; + fit_child_in_rect(second, Rect2(Point2(0, 0), Size2(middle_sep, get_size().height))); + int sofs = middle_sep + sep; + fit_child_in_rect(first, Rect2(Point2(sofs, 0), Size2(get_size().width - sofs, get_size().height))); + } else { + fit_child_in_rect(first, Rect2(Point2(0, 0), Size2(middle_sep, get_size().height))); + int sofs = middle_sep + sep; + fit_child_in_rect(second, Rect2(Point2(sofs, 0), Size2(get_size().width - sofs, get_size().height))); + } } update(); @@ -157,6 +164,10 @@ Size2 SplitContainer::get_minimum_size() const { void SplitContainer::_notification(int p_what) { switch (p_what) { + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + queue_sort(); + } break; case NOTIFICATION_SORT_CHILDREN: { _resort(); } break; @@ -247,7 +258,11 @@ void SplitContainer::_gui_input(const Ref<InputEvent> &p_event) { return; } - split_offset = drag_ofs + ((vertical ? mm->get_position().y : mm->get_position().x) - drag_from); + if (!vertical && is_layout_rtl()) { + split_offset = drag_ofs + (drag_from - (vertical ? mm->get_position().y : mm->get_position().x)); + } else { + split_offset = drag_ofs + ((vertical ? mm->get_position().y : mm->get_position().x) - drag_from); + } should_clamp_split_offset = true; queue_sort(); emit_signal("dragged", get_split_offset()); diff --git a/scene/gui/subviewport_container.cpp b/scene/gui/subviewport_container.cpp index 4e1ad2ae05..c5f56fe8e2 100644 --- a/scene/gui/subviewport_container.cpp +++ b/scene/gui/subviewport_container.cpp @@ -30,7 +30,7 @@ #include "subviewport_container.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "scene/main/viewport.h" Size2 SubViewportContainer::get_minimum_size() const { diff --git a/scene/gui/tab_container.cpp b/scene/gui/tab_container.cpp index 41b8fad49d..01c1a15b79 100644 --- a/scene/gui/tab_container.cpp +++ b/scene/gui/tab_container.cpp @@ -30,7 +30,9 @@ #include "tab_container.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" +#include "core/string/translation.h" + #include "scene/gui/box_container.h" #include "scene/gui/label.h" #include "scene/gui/texture_rect.h" @@ -48,11 +50,12 @@ int TabContainer::_get_top_margin() const { int tab_height = MAX(MAX(tab_bg->get_minimum_size().height, tab_fg->get_minimum_size().height), tab_disabled->get_minimum_size().height); // Font height or higher icon wins. - Ref<Font> font = get_theme_font("font"); - int content_height = font->get_height(); + int content_height = 0; Vector<Control *> tabs = _get_tabs(); for (int i = 0; i < tabs.size(); i++) { + content_height = MAX(content_height, text_buf[i]->get_size().y); + Control *c = tabs[i]; if (!c->has_meta("_tab_icon")) { continue; @@ -78,23 +81,36 @@ void TabContainer::_gui_input(const Ref<InputEvent> &p_event) { Size2 size = get_size(); // Click must be on tabs in the tab header area. - if (pos.x < tabs_ofs_cache || pos.y > _get_top_margin()) { + if (pos.y > _get_top_margin()) { return; } // Handle menu button. Ref<Texture2D> menu = get_theme_icon("menu"); - if (popup && pos.x > size.width - menu->get_width()) { - emit_signal("pre_popup_pressed"); + if (is_layout_rtl()) { + if (popup && pos.x < menu->get_width()) { + emit_signal("pre_popup_pressed"); - Vector2 popup_pos = get_screen_position(); - popup_pos.x += size.width - popup->get_size().width; - popup_pos.y += menu->get_height(); + Vector2 popup_pos = get_screen_position(); + popup_pos.y += menu->get_height(); - popup->set_position(popup_pos); - popup->popup(); - return; + popup->set_position(popup_pos); + popup->popup(); + return; + } + } else { + if (popup && pos.x > size.width - menu->get_width()) { + emit_signal("pre_popup_pressed"); + + Vector2 popup_pos = get_screen_position(); + popup_pos.x += size.width - popup->get_size().width; + popup_pos.y += menu->get_height(); + + popup->set_position(popup_pos); + popup->popup(); + return; + } } // Do not activate tabs when tabs is empty. @@ -113,22 +129,46 @@ void TabContainer::_gui_input(const Ref<InputEvent> &p_event) { Ref<Texture2D> increment = get_theme_icon("increment"); Ref<Texture2D> decrement = get_theme_icon("decrement"); - if (pos.x > size.width - increment->get_width() - popup_ofs) { - if (last_tab_cache < tabs.size() - 1) { - first_tab_cache += 1; - update(); + if (is_layout_rtl()) { + if (pos.x < popup_ofs + decrement->get_width()) { + if (last_tab_cache < tabs.size() - 1) { + first_tab_cache += 1; + update(); + } + return; + } else if (pos.x < popup_ofs + increment->get_width() + decrement->get_width()) { + if (first_tab_cache > 0) { + first_tab_cache -= 1; + update(); + } + return; } - return; - } else if (pos.x > size.width - increment->get_width() - decrement->get_width() - popup_ofs) { - if (first_tab_cache > 0) { - first_tab_cache -= 1; - update(); + } else { + if (pos.x > size.width - increment->get_width() - popup_ofs && pos.x) { + if (last_tab_cache < tabs.size() - 1) { + first_tab_cache += 1; + update(); + } + return; + } else if (pos.x > size.width - increment->get_width() - decrement->get_width() - popup_ofs) { + if (first_tab_cache > 0) { + first_tab_cache -= 1; + update(); + } + return; } - return; } } // Activate the clicked tab. + if (is_layout_rtl()) { + pos.x = size.width - pos.x; + } + + if (pos.x < tabs_ofs_cache) { + return; + } + pos.x -= tabs_ofs_cache; for (int i = first_tab_cache; i <= last_tab_cache; i++) { if (get_tab_hidden(i)) { @@ -152,7 +192,7 @@ void TabContainer::_gui_input(const Ref<InputEvent> &p_event) { Size2 size = get_size(); // Mouse must be on tabs in the tab header area. - if (pos.x < tabs_ofs_cache || pos.y > _get_top_margin()) { + if (pos.y > _get_top_margin()) { if (menu_hovered || highlight_arrow > -1) { menu_hovered = false; highlight_arrow = -1; @@ -163,16 +203,30 @@ void TabContainer::_gui_input(const Ref<InputEvent> &p_event) { Ref<Texture2D> menu = get_theme_icon("menu"); if (popup) { - if (pos.x >= size.width - menu->get_width()) { - if (!menu_hovered) { - menu_hovered = true; - highlight_arrow = -1; + if (is_layout_rtl()) { + if (pos.x <= menu->get_width()) { + if (!menu_hovered) { + menu_hovered = true; + highlight_arrow = -1; + update(); + return; + } + } else if (menu_hovered) { + menu_hovered = false; + update(); + } + } else { + if (pos.x >= size.width - menu->get_width()) { + if (!menu_hovered) { + menu_hovered = true; + highlight_arrow = -1; + update(); + return; + } + } else if (menu_hovered) { + menu_hovered = false; update(); - return; } - } else if (menu_hovered) { - menu_hovered = false; - update(); } if (menu_hovered) { @@ -194,29 +248,43 @@ void TabContainer::_gui_input(const Ref<InputEvent> &p_event) { Ref<Texture2D> increment = get_theme_icon("increment"); Ref<Texture2D> decrement = get_theme_icon("decrement"); - if (pos.x >= size.width - increment->get_width() - popup_ofs) { - if (highlight_arrow != 1) { - highlight_arrow = 1; + + if (is_layout_rtl()) { + if (pos.x <= popup_ofs + decrement->get_width()) { + if (highlight_arrow != 1) { + highlight_arrow = 1; + update(); + } + } else if (pos.x <= popup_ofs + increment->get_width() + decrement->get_width()) { + if (highlight_arrow != 0) { + highlight_arrow = 0; + update(); + } + } else if (highlight_arrow > -1) { + highlight_arrow = -1; update(); } - } else if (pos.x >= size.width - increment->get_width() - decrement->get_width() - popup_ofs) { - if (highlight_arrow != 0) { - highlight_arrow = 0; + } else { + if (pos.x >= size.width - increment->get_width() - popup_ofs) { + if (highlight_arrow != 1) { + highlight_arrow = 1; + update(); + } + } else if (pos.x >= size.width - increment->get_width() - decrement->get_width() - popup_ofs) { + if (highlight_arrow != 0) { + highlight_arrow = 0; + update(); + } + } else if (highlight_arrow > -1) { + highlight_arrow = -1; update(); } - } else if (highlight_arrow > -1) { - highlight_arrow = -1; - update(); } } } void TabContainer::_notification(int p_what) { switch (p_what) { - case NOTIFICATION_TRANSLATION_CHANGED: { - minimum_size_changed(); - update(); - } break; case NOTIFICATION_RESIZED: { Vector<Control *> tabs = _get_tabs(); int side_margin = get_theme_constant("side_margin"); @@ -259,6 +327,7 @@ void TabContainer::_notification(int p_what) { case NOTIFICATION_DRAW: { RID canvas = get_canvas_item(); Size2 size = get_size(); + bool rtl = is_layout_rtl(); // Draw only the tab area if the header is hidden. Ref<StyleBox> panel = get_theme_stylebox("panel"); @@ -277,12 +346,10 @@ void TabContainer::_notification(int p_what) { Ref<Texture2D> decrement_hl = get_theme_icon("decrement_highlight"); Ref<Texture2D> menu = get_theme_icon("menu"); Ref<Texture2D> menu_hl = get_theme_icon("menu_highlight"); - Ref<Font> font = get_theme_font("font"); Color font_color_fg = get_theme_color("font_color_fg"); Color font_color_bg = get_theme_color("font_color_bg"); Color font_color_disabled = get_theme_color("font_color_disabled"); int side_margin = get_theme_constant("side_margin"); - int icon_text_distance = get_theme_constant("icon_separation"); // Find out start and width of the header area. int header_x = side_margin; @@ -348,101 +415,185 @@ void TabContainer::_notification(int p_what) { break; } - // Draw the tab area. - panel->draw(canvas, Rect2(0, header_height, size.width, size.height - header_height)); + if (all_tabs_in_front) { + // Draw the tab area. + panel->draw(canvas, Rect2(0, header_height, size.width, size.height - header_height)); + } - // Draw all visible tabs. + // Draw unselected tabs in back int x = 0; + int x_current = 0; + int index = 0; for (int i = 0; i < tab_widths.size(); i++) { - if (get_tab_hidden(i)) { + index = i + first_tab_cache; + if (get_tab_hidden(index)) { continue; } - Ref<StyleBox> tab_style; - Color font_color; - if (get_tab_disabled(i + first_tab_cache)) { - tab_style = tab_disabled; - font_color = font_color_disabled; - } else if (i + first_tab_cache == current) { - tab_style = tab_fg; - font_color = font_color_fg; - } else { - tab_style = tab_bg; - font_color = font_color_bg; - } - // Draw the tab background. int tab_width = tab_widths[i]; - Rect2 tab_rect(tabs_ofs_cache + x, 0, tab_width, header_height); - tab_style->draw(canvas, tab_rect); - - // Draw the tab contents. - Control *control = Object::cast_to<Control>(tabs[i + first_tab_cache]); - String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); - - int x_content = tab_rect.position.x + tab_style->get_margin(MARGIN_LEFT); - int top_margin = tab_style->get_margin(MARGIN_TOP); - int y_center = top_margin + (tab_rect.size.y - tab_style->get_minimum_size().y) / 2; - - // Draw the tab icon. - if (control->has_meta("_tab_icon")) { - Ref<Texture2D> icon = control->get_meta("_tab_icon"); - if (icon.is_valid()) { - int y = y_center - (icon->get_height() / 2); - icon->draw(canvas, Point2i(x_content, y)); - if (text != "") { - x_content += icon->get_width() + icon_text_distance; - } + if (get_tab_disabled(index)) { + if (rtl) { + _draw_tab(tab_disabled, font_color_disabled, index, size.width - (tabs_ofs_cache + x) - tab_width); + } else { + _draw_tab(tab_disabled, font_color_disabled, index, tabs_ofs_cache + x); + } + } else if (index == current) { + x_current = x; + } else { + if (rtl) { + _draw_tab(tab_bg, font_color_bg, index, size.width - (tabs_ofs_cache + x) - tab_width); + } else { + _draw_tab(tab_bg, font_color_bg, index, tabs_ofs_cache + x); } } - // Draw the tab text. - Point2i text_pos(x_content, y_center - (font->get_height() / 2) + font->get_ascent()); - font->draw(canvas, text_pos, text, font_color); - x += tab_width; - last_tab_cache = i + first_tab_cache; + last_tab_cache = index; + } + + if (!all_tabs_in_front) { + // Draw the tab area. + panel->draw(canvas, Rect2(0, header_height, size.width, size.height - header_height)); + } + + // Draw selected tab in front. only draw selected tab when it's in visible range. + if (tabs.size() > 0 && current - first_tab_cache < tab_widths.size() && current >= first_tab_cache) { + if (rtl) { + _draw_tab(tab_fg, font_color_fg, current, size.width - (tabs_ofs_cache + x_current) - tab_widths[current]); + } else { + _draw_tab(tab_fg, font_color_fg, current, tabs_ofs_cache + x_current); + } } // Draw the popup menu. - x = get_size().width; + if (rtl) { + x = 0; + } else { + x = get_size().width; + } if (popup) { - x -= menu->get_width(); + if (!rtl) { + x -= menu->get_width(); + } if (menu_hovered) { menu_hl->draw(get_canvas_item(), Size2(x, (header_height - menu_hl->get_height()) / 2)); } else { menu->draw(get_canvas_item(), Size2(x, (header_height - menu->get_height()) / 2)); } + if (rtl) { + x += menu->get_width(); + } } // Draw the navigation buttons. if (buttons_visible_cache) { - x -= increment->get_width(); - if (last_tab_cache < tabs.size() - 1) { - draw_texture(highlight_arrow == 1 ? increment_hl : increment, Point2(x, (header_height - increment->get_height()) / 2)); - } else { - draw_texture(increment, Point2(x, (header_height - increment->get_height()) / 2), Color(1, 1, 1, 0.5)); - } + if (rtl) { + if (last_tab_cache < tabs.size() - 1) { + draw_texture(highlight_arrow == 1 ? decrement_hl : decrement, Point2(x, (header_height - increment->get_height()) / 2)); + } else { + draw_texture(decrement, Point2(x, (header_height - increment->get_height()) / 2), Color(1, 1, 1, 0.5)); + } + x += increment->get_width(); - x -= decrement->get_width(); - if (first_tab_cache > 0) { - draw_texture(highlight_arrow == 0 ? decrement_hl : decrement, Point2(x, (header_height - decrement->get_height()) / 2)); + if (first_tab_cache > 0) { + draw_texture(highlight_arrow == 0 ? increment_hl : increment, Point2(x, (header_height - decrement->get_height()) / 2)); + } else { + draw_texture(increment, Point2(x, (header_height - decrement->get_height()) / 2), Color(1, 1, 1, 0.5)); + } + x += decrement->get_width(); } else { - draw_texture(decrement, Point2(x, (header_height - decrement->get_height()) / 2), Color(1, 1, 1, 0.5)); + x -= increment->get_width(); + if (last_tab_cache < tabs.size() - 1) { + draw_texture(highlight_arrow == 1 ? increment_hl : increment, Point2(x, (header_height - increment->get_height()) / 2)); + } else { + draw_texture(increment, Point2(x, (header_height - increment->get_height()) / 2), Color(1, 1, 1, 0.5)); + } + + x -= decrement->get_width(); + if (first_tab_cache > 0) { + draw_texture(highlight_arrow == 0 ? decrement_hl : decrement, Point2(x, (header_height - decrement->get_height()) / 2)); + } else { + draw_texture(decrement, Point2(x, (header_height - decrement->get_height()) / 2), Color(1, 1, 1, 0.5)); + } } } } break; + case NOTIFICATION_TRANSLATION_CHANGED: + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + Vector<Control *> tabs = _get_tabs(); + for (int i = 0; i < tabs.size(); i++) { + text_buf.write[i]->clear(); + } + _theme_changing = true; call_deferred("_on_theme_changed"); // Wait until all changed theme. } break; } } +void TabContainer::_draw_tab(Ref<StyleBox> &p_tab_style, Color &p_font_color, int p_index, float p_x) { + Vector<Control *> tabs = _get_tabs(); + RID canvas = get_canvas_item(); + Ref<Font> font = get_theme_font("font"); + int icon_text_distance = get_theme_constant("icon_separation"); + int tab_width = _get_tab_width(p_index); + int header_height = _get_top_margin(); + + // Draw the tab background. + Rect2 tab_rect(p_x, 0, tab_width, header_height); + p_tab_style->draw(canvas, tab_rect); + + // Draw the tab contents. + Control *control = Object::cast_to<Control>(tabs[p_index]); + String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); + + int x_content = tab_rect.position.x + p_tab_style->get_margin(MARGIN_LEFT); + int top_margin = p_tab_style->get_margin(MARGIN_TOP); + int y_center = top_margin + (tab_rect.size.y - p_tab_style->get_minimum_size().y) / 2; + + // Draw the tab icon. + if (control->has_meta("_tab_icon")) { + Ref<Texture2D> icon = control->get_meta("_tab_icon"); + if (icon.is_valid()) { + int y = y_center - (icon->get_height() / 2); + icon->draw(canvas, Point2i(x_content, y)); + if (text != "") { + x_content += icon->get_width() + icon_text_distance; + } + } + } + + // Draw the tab text. + Point2i text_pos(x_content, y_center - text_buf[p_index]->get_size().y / 2); + text_buf[p_index]->draw(canvas, text_pos, p_font_color); +} + void TabContainer::_on_theme_changed() { + if (!_theme_changing) { + return; + } + + text_buf.clear(); + bool rtl = is_layout_rtl(); + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + Vector<Control *> tabs = _get_tabs(); + for (int i = 0; i < tabs.size(); i++) { + Control *control = Object::cast_to<Control>(tabs[i]); + String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); + Ref<TextLine> name; + name.instance(); + name->set_direction(rtl ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + name->add_string(text, font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + text_buf.push_back(name); + } + + minimum_size_changed(); if (get_tab_count() > 0) { _repaint(); update(); } + _theme_changing = false; } void TabContainer::_repaint() { @@ -478,14 +629,15 @@ void TabContainer::_on_mouse_exited() { int TabContainer::_get_tab_width(int p_index) const { ERR_FAIL_INDEX_V(p_index, get_tab_count(), 0); Control *control = Object::cast_to<Control>(_get_tabs()[p_index]); - if (!control || control->is_set_as_toplevel() || get_tab_hidden(p_index)) { + if (!control || control->is_set_as_top_level() || get_tab_hidden(p_index)) { return 0; } // Get the width of the text displayed on the tab. Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(control->get_name()); - int width = font->get_string_size(text).width; + int width = font->get_string_size(text, font_size).width; // Add space for a tab icon. if (control->has_meta("_tab_icon")) { @@ -517,7 +669,7 @@ Vector<Control *> TabContainer::_get_tabs() const { Vector<Control *> controls; for (int i = 0; i < get_child_count(); i++) { Control *control = Object::cast_to<Control>(get_child(i)); - if (!control || control->is_toplevel_control()) { + if (!control || control->is_top_level_control()) { continue; } @@ -527,6 +679,21 @@ Vector<Control *> TabContainer::_get_tabs() const { } void TabContainer::_child_renamed_callback() { + text_buf.clear(); + Vector<Control *> tabs = _get_tabs(); + bool rtl = is_layout_rtl(); + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + for (int i = 0; i < tabs.size(); i++) { + Control *control = Object::cast_to<Control>(tabs[i]); + String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); + Ref<TextLine> name; + name.instance(); + name->set_direction(rtl ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + name->add_string(text, font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + text_buf.push_back(name); + } + update(); } @@ -537,13 +704,28 @@ void TabContainer::add_child_notify(Node *p_child) { if (!c) { return; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { return; } + text_buf.clear(); + Vector<Control *> tabs = _get_tabs(); + bool rtl = is_layout_rtl(); + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + for (int i = 0; i < tabs.size(); i++) { + Control *control = Object::cast_to<Control>(tabs[i]); + String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); + Ref<TextLine> name; + name.instance(); + name->set_direction(rtl ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + name->add_string(text, font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + text_buf.push_back(name); + } + bool first = false; - if (get_tab_count() != 1) { + if (tabs.size() != 1) { c->hide(); } else { c->show(); @@ -631,7 +813,22 @@ void TabContainer::remove_child_notify(Node *p_child) { } void TabContainer::_update_current_tab() { - int tc = get_tab_count(); + text_buf.clear(); + Vector<Control *> tabs = _get_tabs(); + bool rtl = is_layout_rtl(); + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + for (int i = 0; i < tabs.size(); i++) { + Control *control = Object::cast_to<Control>(tabs[i]); + String text = control->has_meta("_tab_name") ? String(tr(String(control->get_meta("_tab_name")))) : String(tr(control->get_name())); + Ref<TextLine> name; + name.instance(); + name->set_direction(rtl ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + name->add_string(text, font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + text_buf.push_back(name); + } + + int tc = tabs.size(); if (current >= tc) { current = tc - 1; } @@ -747,30 +944,38 @@ int TabContainer::get_tab_idx_at_point(const Point2 &p_point) const { } // must be on tabs in the tab header area. - if (p_point.x < tabs_ofs_cache || p_point.y > _get_top_margin()) { + if (p_point.y > _get_top_margin()) { return -1; } Size2 size = get_size(); - int right_ofs = 0; + int button_ofs = 0; + int px = p_point.x; + + if (is_layout_rtl()) { + px = size.width - px; + } + + if (px < tabs_ofs_cache) { + return -1; + } Popup *popup = get_popup(); if (popup) { Ref<Texture2D> menu = get_theme_icon("menu"); - right_ofs += menu->get_width(); + button_ofs += menu->get_width(); } if (buttons_visible_cache) { Ref<Texture2D> increment = get_theme_icon("increment"); Ref<Texture2D> decrement = get_theme_icon("decrement"); - right_ofs += increment->get_width() + decrement->get_width(); + button_ofs += increment->get_width() + decrement->get_width(); } - if (p_point.x > size.width - right_ofs) { + if (px > size.width - button_ofs) { return -1; } // get the tab at the point Vector<Control *> tabs = _get_tabs(); - int px = p_point.x; px -= tabs_ofs_cache; for (int i = first_tab_cache; i <= last_tab_cache; i++) { int tab_width = _get_tab_width(i); @@ -819,6 +1024,20 @@ bool TabContainer::are_tabs_visible() const { return tabs_visible; } +void TabContainer::set_all_tabs_in_front(bool p_in_front) { + if (p_in_front == all_tabs_in_front) { + return; + } + + all_tabs_in_front = p_in_front; + + update(); +} + +bool TabContainer::is_all_tabs_in_front() const { + return all_tabs_in_front; +} + Control *TabContainer::_get_tab(int p_idx) const { return get_tab_control(p_idx); } @@ -943,7 +1162,7 @@ Size2 TabContainer::get_minimum_size() const { if (tabs_visible) { ms.y += MAX(MAX(tab_bg->get_minimum_size().y, tab_fg->get_minimum_size().y), tab_disabled->get_minimum_size().y); - ms.y += font->get_height(); + ms.y += _get_top_margin(); } Ref<StyleBox> sb = get_theme_stylebox("panel"); @@ -1010,6 +1229,8 @@ void TabContainer::_bind_methods() { ClassDB::bind_method(D_METHOD("get_tab_align"), &TabContainer::get_tab_align); ClassDB::bind_method(D_METHOD("set_tabs_visible", "visible"), &TabContainer::set_tabs_visible); ClassDB::bind_method(D_METHOD("are_tabs_visible"), &TabContainer::are_tabs_visible); + ClassDB::bind_method(D_METHOD("set_all_tabs_in_front", "is_front"), &TabContainer::set_all_tabs_in_front); + ClassDB::bind_method(D_METHOD("is_all_tabs_in_front"), &TabContainer::is_all_tabs_in_front); ClassDB::bind_method(D_METHOD("set_tab_title", "tab_idx", "title"), &TabContainer::set_tab_title); ClassDB::bind_method(D_METHOD("get_tab_title", "tab_idx"), &TabContainer::get_tab_title); ClassDB::bind_method(D_METHOD("set_tab_icon", "tab_idx", "icon"), &TabContainer::set_tab_icon); @@ -1036,6 +1257,7 @@ void TabContainer::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_align", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_tab_align", "get_tab_align"); ADD_PROPERTY(PropertyInfo(Variant::INT, "current_tab", PROPERTY_HINT_RANGE, "-1,4096,1", PROPERTY_USAGE_EDITOR), "set_current_tab", "get_current_tab"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "tabs_visible"), "set_tabs_visible", "are_tabs_visible"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "all_tabs_in_front"), "set_all_tabs_in_front", "is_all_tabs_in_front"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "drag_to_rearrange_enabled"), "set_drag_to_rearrange_enabled", "get_drag_to_rearrange_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_hidden_tabs_for_min_size"), "set_use_hidden_tabs_for_min_size", "get_use_hidden_tabs_for_min_size"); @@ -1055,6 +1277,7 @@ TabContainer::TabContainer() { previous = 0; align = ALIGN_CENTER; tabs_visible = true; + all_tabs_in_front = false; drag_to_rearrange_enabled = false; tabs_rearrange_group = -1; use_hidden_tabs_for_min_size = false; diff --git a/scene/gui/tab_container.h b/scene/gui/tab_container.h index 7ea667d60f..91153e5fc3 100644 --- a/scene/gui/tab_container.h +++ b/scene/gui/tab_container.h @@ -33,12 +33,13 @@ #include "scene/gui/container.h" #include "scene/gui/popup.h" +#include "scene/resources/text_line.h" + class TabContainer : public Container { GDCLASS(TabContainer, Container); public: enum TabAlign { - ALIGN_LEFT, ALIGN_CENTER, ALIGN_RIGHT @@ -51,6 +52,7 @@ private: int current; int previous; bool tabs_visible; + bool all_tabs_in_front; bool buttons_visible_cache; bool menu_hovered; int highlight_arrow; @@ -62,12 +64,15 @@ private: bool use_hidden_tabs_for_min_size; int tabs_rearrange_group; + Vector<Ref<TextLine>> text_buf; Vector<Control *> _get_tabs() const; int _get_tab_width(int p_index) const; + bool _theme_changing = false; void _on_theme_changed(); void _repaint(); void _on_mouse_exited(); void _update_current_tab(); + void _draw_tab(Ref<StyleBox> &p_tab_style, Color &p_font_color, int p_index, float p_x); protected: void _child_renamed_callback(); @@ -90,6 +95,9 @@ public: void set_tabs_visible(bool p_visible); bool are_tabs_visible() const; + void set_all_tabs_in_front(bool p_is_front); + bool is_all_tabs_in_front() const; + void set_tab_title(int p_tab, const String &p_title); String get_tab_title(int p_tab) const; diff --git a/scene/gui/tabs.cpp b/scene/gui/tabs.cpp index d47f771d1d..5b26428e45 100644 --- a/scene/gui/tabs.cpp +++ b/scene/gui/tabs.cpp @@ -30,7 +30,9 @@ #include "tabs.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" +#include "core/string/translation.h" + #include "scene/gui/box_container.h" #include "scene/gui/label.h" #include "scene/gui/texture_rect.h" @@ -39,9 +41,10 @@ Size2 Tabs::get_minimum_size() const { Ref<StyleBox> tab_bg = get_theme_stylebox("tab_bg"); Ref<StyleBox> tab_fg = get_theme_stylebox("tab_fg"); Ref<StyleBox> tab_disabled = get_theme_stylebox("tab_disabled"); - Ref<Font> font = get_theme_font("font"); - Size2 ms(0, MAX(MAX(tab_bg->get_minimum_size().height, tab_fg->get_minimum_size().height), tab_disabled->get_minimum_size().height) + font->get_height()); + int y_margin = MAX(MAX(tab_bg->get_minimum_size().height, tab_fg->get_minimum_size().height), tab_disabled->get_minimum_size().height); + + Size2 ms(0, 0); for (int i = 0; i < tabs.size(); i++) { Ref<Texture2D> tex = tabs[i].icon; @@ -52,7 +55,8 @@ Size2 Tabs::get_minimum_size() const { } } - ms.width += Math::ceil(font->get_string_size(tabs[i].xl_text).width); + ms.width += Math::ceil(tabs[i].text_buf->get_size().x); + ms.height = MAX(ms.height, tabs[i].text_buf->get_size().y + y_margin); if (tabs[i].disabled) { ms.width += tab_disabled->get_minimum_size().width; @@ -94,12 +98,19 @@ void Tabs::_gui_input(const Ref<InputEvent> &p_event) { Ref<Texture2D> incr = get_theme_icon("increment"); Ref<Texture2D> decr = get_theme_icon("decrement"); - int limit = get_size().width - incr->get_width() - decr->get_width(); - - if (pos.x > limit + decr->get_width()) { - highlight_arrow = 1; - } else if (pos.x > limit) { - highlight_arrow = 0; + if (is_layout_rtl()) { + if (pos.x < decr->get_width()) { + highlight_arrow = 1; + } else if (pos.x < incr->get_width() + decr->get_width()) { + highlight_arrow = 0; + } + } else { + int limit = get_size().width - incr->get_width() - decr->get_width(); + if (pos.x > limit + decr->get_width()) { + highlight_arrow = 1; + } else if (pos.x > limit) { + highlight_arrow = 0; + } } } @@ -142,7 +153,7 @@ void Tabs::_gui_input(const Ref<InputEvent> &p_event) { if (cb_pressing && !mb->is_pressed() && mb->get_button_index() == BUTTON_LEFT) { if (cb_hover != -1) { //pressed - emit_signal("tab_close", cb_hover); + emit_signal("tab_closed", cb_hover); } cb_pressing = false; @@ -157,20 +168,35 @@ void Tabs::_gui_input(const Ref<InputEvent> &p_event) { Ref<Texture2D> incr = get_theme_icon("increment"); Ref<Texture2D> decr = get_theme_icon("decrement"); - int limit = get_size().width - incr->get_width() - decr->get_width(); - - if (pos.x > limit + decr->get_width()) { - if (missing_right) { - offset++; - update(); + if (is_layout_rtl()) { + if (pos.x < decr->get_width()) { + if (missing_right) { + offset++; + update(); + } + return; + } else if (pos.x < incr->get_width() + decr->get_width()) { + if (offset > 0) { + offset--; + update(); + } + return; } - return; - } else if (pos.x > limit) { - if (offset > 0) { - offset--; - update(); + } else { + int limit = get_size().width - incr->get_width() - decr->get_width(); + if (pos.x > limit + decr->get_width()) { + if (missing_right) { + offset++; + update(); + } + return; + } else if (pos.x > limit) { + if (offset > 0) { + offset--; + update(); + } + return; } - return; } } @@ -188,7 +214,7 @@ void Tabs::_gui_input(const Ref<InputEvent> &p_event) { return; } - if (pos.x >= tabs[i].ofs_cache && pos.x < tabs[i].ofs_cache + tabs[i].size_cache) { + if (pos.x >= get_tab_rect(i).position.x && pos.x < get_tab_rect(i).position.x + tabs[i].size_cache) { if (!tabs[i].disabled) { found = i; } @@ -204,12 +230,32 @@ void Tabs::_gui_input(const Ref<InputEvent> &p_event) { } } +void Tabs::_shape(int p_tab) { + Ref<Font> font = get_theme_font("font"); + int font_size = get_theme_font_size("font_size"); + + tabs.write[p_tab].xl_text = tr(tabs[p_tab].text); + tabs.write[p_tab].text_buf->clear(); + if (tabs[p_tab].text_direction == Control::TEXT_DIRECTION_INHERITED) { + tabs.write[p_tab].text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + tabs.write[p_tab].text_buf->set_direction((TextServer::Direction)tabs[p_tab].text_direction); + } + + tabs.write[p_tab].text_buf->add_string(tabs.write[p_tab].xl_text, font, font_size, tabs[p_tab].opentype_features, (tabs[p_tab].language != "") ? tabs[p_tab].language : TranslationServer::get_singleton()->get_tool_locale()); +} + void Tabs::_notification(int p_what) { switch (p_what) { + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { + _update_cache(); + update(); + } break; case NOTIFICATION_TRANSLATION_CHANGED: { for (int i = 0; i < tabs.size(); ++i) { - tabs.write[i].xl_text = tr(tabs[i].text); + _shape(i); } + _update_cache(); minimum_size_changed(); update(); } break; @@ -225,11 +271,12 @@ void Tabs::_notification(int p_what) { Ref<StyleBox> tab_bg = get_theme_stylebox("tab_bg"); Ref<StyleBox> tab_fg = get_theme_stylebox("tab_fg"); Ref<StyleBox> tab_disabled = get_theme_stylebox("tab_disabled"); - Ref<Font> font = get_theme_font("font"); Color color_fg = get_theme_color("font_color_fg"); Color color_bg = get_theme_color("font_color_bg"); Color color_disabled = get_theme_color("font_color_disabled"); Ref<Texture2D> close = get_theme_icon("close"); + Vector2 size = get_size(); + bool rtl = is_layout_rtl(); int h = get_size().height; int w = 0; @@ -286,7 +333,12 @@ void Tabs::_notification(int p_what) { max_drawn_tab = i; } - Rect2 sb_rect = Rect2(w, 0, tabs[i].size_cache, h); + Rect2 sb_rect; + if (rtl) { + sb_rect = Rect2(size.width - w - tabs[i].size_cache, 0, tabs[i].size_cache, h); + } else { + sb_rect = Rect2(w, 0, tabs[i].size_cache, h); + } sb->draw(ci, sb_rect); w += sb->get_margin(MARGIN_LEFT); @@ -294,13 +346,21 @@ void Tabs::_notification(int p_what) { Size2i sb_ms = sb->get_minimum_size(); Ref<Texture2D> icon = tabs[i].icon; if (icon.is_valid()) { - icon->draw(ci, Point2i(w, sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - icon->get_height()) / 2)); + if (rtl) { + icon->draw(ci, Point2i(size.width - w - icon->get_width(), sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - icon->get_height()) / 2)); + } else { + icon->draw(ci, Point2i(w, sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - icon->get_height()) / 2)); + } if (tabs[i].text != "") { w += icon->get_width() + get_theme_constant("hseparation"); } } - font->draw(ci, Point2i(w, sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - font->get_height()) / 2 + font->get_ascent()), tabs[i].xl_text, col, tabs[i].size_text); + if (rtl) { + tabs[i].text_buf->draw(ci, Point2i(size.width - w - tabs[i].text_buf->get_size().x, sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - tabs[i].text_buf->get_size().y) / 2), col); + } else { + tabs[i].text_buf->draw(ci, Point2i(w, sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - tabs[i].text_buf->get_size().y) / 2), col); + } w += tabs[i].size_text; @@ -312,7 +372,11 @@ void Tabs::_notification(int p_what) { Rect2 rb_rect; rb_rect.size = style->get_minimum_size() + rb->get_size(); - rb_rect.position.x = w; + if (rtl) { + rb_rect.position.x = size.width - w - rb_rect.size.x; + } else { + rb_rect.position.x = w; + } rb_rect.position.y = sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - (rb_rect.size.y)) / 2; if (rb_hover == i) { @@ -323,7 +387,11 @@ void Tabs::_notification(int p_what) { } } - rb->draw(ci, Point2i(w + style->get_margin(MARGIN_LEFT), rb_rect.position.y + style->get_margin(MARGIN_TOP))); + if (rtl) { + rb->draw(ci, Point2i(size.width - w - rb_rect.size.x + style->get_margin(MARGIN_LEFT), rb_rect.position.y + style->get_margin(MARGIN_TOP))); + } else { + rb->draw(ci, Point2i(w + style->get_margin(MARGIN_LEFT), rb_rect.position.y + style->get_margin(MARGIN_TOP))); + } w += rb->get_width(); tabs.write[i].rb_rect = rb_rect; } @@ -336,7 +404,11 @@ void Tabs::_notification(int p_what) { Rect2 cb_rect; cb_rect.size = style->get_minimum_size() + cb->get_size(); - cb_rect.position.x = w; + if (rtl) { + cb_rect.position.x = size.width - w - cb_rect.size.x; + } else { + cb_rect.position.x = w; + } cb_rect.position.y = sb->get_margin(MARGIN_TOP) + ((sb_rect.size.y - sb_ms.y) - (cb_rect.size.y)) / 2; if (!tabs[i].disabled && cb_hover == i) { @@ -347,7 +419,11 @@ void Tabs::_notification(int p_what) { } } - cb->draw(ci, Point2i(w + style->get_margin(MARGIN_LEFT), cb_rect.position.y + style->get_margin(MARGIN_TOP))); + if (rtl) { + cb->draw(ci, Point2i(size.width - w - cb_rect.size.x + style->get_margin(MARGIN_LEFT), cb_rect.position.y + style->get_margin(MARGIN_TOP))); + } else { + cb->draw(ci, Point2i(w + style->get_margin(MARGIN_LEFT), cb_rect.position.y + style->get_margin(MARGIN_TOP))); + } w += cb->get_width(); tabs.write[i].cb_rect = cb_rect; } @@ -358,16 +434,30 @@ void Tabs::_notification(int p_what) { if (offset > 0 || missing_right) { int vofs = (get_size().height - incr->get_size().height) / 2; - if (offset > 0) { - draw_texture(highlight_arrow == 0 ? decr_hl : decr, Point2(limit, vofs)); - } else { - draw_texture(decr, Point2(limit, vofs), Color(1, 1, 1, 0.5)); - } + if (rtl) { + if (missing_right) { + draw_texture(highlight_arrow == 1 ? decr_hl : decr, Point2(0, vofs)); + } else { + draw_texture(decr, Point2(0, vofs), Color(1, 1, 1, 0.5)); + } - if (missing_right) { - draw_texture(highlight_arrow == 1 ? incr_hl : incr, Point2(limit + decr->get_size().width, vofs)); + if (offset > 0) { + draw_texture(highlight_arrow == 0 ? incr_hl : incr, Point2(incr->get_size().width, vofs)); + } else { + draw_texture(incr, Point2(incr->get_size().width, vofs), Color(1, 1, 1, 0.5)); + } } else { - draw_texture(incr, Point2(limit + decr->get_size().width, vofs), Color(1, 1, 1, 0.5)); + if (offset > 0) { + draw_texture(highlight_arrow == 0 ? decr_hl : decr, Point2(limit, vofs)); + } else { + draw_texture(decr, Point2(limit, vofs), Color(1, 1, 1, 0.5)); + } + + if (missing_right) { + draw_texture(highlight_arrow == 1 ? incr_hl : incr, Point2(limit + decr->get_size().width, vofs)); + } else { + draw_texture(incr, Point2(limit + decr->get_size().width, vofs), Color(1, 1, 1, 0.5)); + } } buttons_visible = true; @@ -422,6 +512,7 @@ void Tabs::set_tab_title(int p_tab, const String &p_title) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].text = p_title; tabs.write[p_tab].xl_text = tr(p_title); + _shape(p_tab); update(); minimum_size_changed(); } @@ -431,6 +522,61 @@ String Tabs::get_tab_title(int p_tab) const { return tabs[p_tab].text; } +void Tabs::set_tab_text_direction(int p_tab, Control::TextDirection p_text_direction) { + ERR_FAIL_INDEX(p_tab, tabs.size()); + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (tabs[p_tab].text_direction != p_text_direction) { + tabs.write[p_tab].text_direction = p_text_direction; + _shape(p_tab); + update(); + } +} + +Control::TextDirection Tabs::get_tab_text_direction(int p_tab) const { + ERR_FAIL_INDEX_V(p_tab, tabs.size(), Control::TEXT_DIRECTION_INHERITED); + return tabs[p_tab].text_direction; +} + +void Tabs::clear_tab_opentype_features(int p_tab) { + ERR_FAIL_INDEX(p_tab, tabs.size()); + tabs.write[p_tab].opentype_features.clear(); + _shape(p_tab); + update(); +} + +void Tabs::set_tab_opentype_feature(int p_tab, const String &p_name, int p_value) { + ERR_FAIL_INDEX(p_tab, tabs.size()); + int32_t tag = TS->name_to_tag(p_name); + if (!tabs[p_tab].opentype_features.has(tag) || (int)tabs[p_tab].opentype_features[tag] != p_value) { + tabs.write[p_tab].opentype_features[tag] = p_value; + _shape(p_tab); + update(); + } +} + +int Tabs::get_tab_opentype_feature(int p_tab, const String &p_name) const { + ERR_FAIL_INDEX_V(p_tab, tabs.size(), -1); + int32_t tag = TS->name_to_tag(p_name); + if (!tabs[p_tab].opentype_features.has(tag)) { + return -1; + } + return tabs[p_tab].opentype_features[tag]; +} + +void Tabs::set_tab_language(int p_tab, const String &p_language) { + ERR_FAIL_INDEX(p_tab, tabs.size()); + if (tabs[p_tab].language != p_language) { + tabs.write[p_tab].language = p_language; + _shape(p_tab); + update(); + } +} + +String Tabs::get_tab_language(int p_tab) const { + ERR_FAIL_INDEX_V(p_tab, tabs.size(), ""); + return tabs[p_tab].language; +} + void Tabs::set_tab_icon(int p_tab, const Ref<Texture2D> &p_icon) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].icon = p_icon; @@ -495,7 +641,7 @@ void Tabs::_update_hover() { } if (hover != hover_now) { hover = hover_now; - emit_signal("tab_hover", hover); + emit_signal("tab_hovered", hover); } if (hover_buttons == -1) { // no hover @@ -508,7 +654,6 @@ void Tabs::_update_cache() { Ref<StyleBox> tab_disabled = get_theme_stylebox("tab_disabled"); Ref<StyleBox> tab_bg = get_theme_stylebox("tab_bg"); Ref<StyleBox> tab_fg = get_theme_stylebox("tab_fg"); - Ref<Font> font = get_theme_font("font"); Ref<Texture2D> incr = get_theme_icon("increment"); Ref<Texture2D> decr = get_theme_icon("decrement"); int limit = get_size().width - incr->get_width() - decr->get_width(); @@ -520,7 +665,8 @@ void Tabs::_update_cache() { for (int i = 0; i < tabs.size(); i++) { tabs.write[i].ofs_cache = mw; tabs.write[i].size_cache = get_tab_width(i); - tabs.write[i].size_text = Math::ceil(font->get_string_size(tabs[i].xl_text).width); + tabs.write[i].size_text = Math::ceil(tabs[i].text_buf->get_size().x); + tabs.write[i].text_buf->set_width(-1); mw += tabs[i].size_cache; if (tabs[i].size_cache <= min_width || i == current) { size_fixed += tabs[i].size_cache; @@ -562,6 +708,7 @@ void Tabs::_update_cache() { tabs.write[i].ofs_cache = w; tabs.write[i].size_cache = lsize; tabs.write[i].size_text = slen; + tabs.write[i].text_buf->set_width(slen); w += lsize; } } @@ -578,6 +725,9 @@ void Tabs::add_tab(const String &p_str, const Ref<Texture2D> &p_icon) { Tab t; t.text = p_str; t.xl_text = tr(p_str); + t.text_buf.instance(); + t.text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + t.text_buf->add_string(t.xl_text, get_theme_font("font"), get_theme_font_size("font_size"), Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); t.icon = p_icon; t.disabled = false; t.ofs_cache = 0; @@ -771,7 +921,6 @@ int Tabs::get_tab_width(int p_idx) const { Ref<StyleBox> tab_bg = get_theme_stylebox("tab_bg"); Ref<StyleBox> tab_fg = get_theme_stylebox("tab_fg"); Ref<StyleBox> tab_disabled = get_theme_stylebox("tab_disabled"); - Ref<Font> font = get_theme_font("font"); int x = 0; @@ -783,7 +932,7 @@ int Tabs::get_tab_width(int p_idx) const { } } - x += Math::ceil(font->get_string_size(tabs[p_idx].xl_text).width); + x += Math::ceil(tabs[p_idx].text_buf->get_size().x); if (tabs[p_idx].disabled) { x += tab_disabled->get_minimum_size().width; @@ -869,7 +1018,11 @@ void Tabs::ensure_tab_visible(int p_idx) { Rect2 Tabs::get_tab_rect(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), Rect2()); - return Rect2(tabs[p_tab].ofs_cache, 0, tabs[p_tab].size_cache, get_size().height); + if (is_layout_rtl()) { + return Rect2(get_size().width - tabs[p_tab].ofs_cache - tabs[p_tab].size_cache, 0, tabs[p_tab].size_cache, get_size().height); + } else { + return Rect2(tabs[p_tab].ofs_cache, 0, tabs[p_tab].size_cache, get_size().height); + } } void Tabs::set_tab_close_display_policy(CloseButtonDisplayPolicy p_policy) { @@ -927,6 +1080,13 @@ void Tabs::_bind_methods() { ClassDB::bind_method(D_METHOD("get_previous_tab"), &Tabs::get_previous_tab); ClassDB::bind_method(D_METHOD("set_tab_title", "tab_idx", "title"), &Tabs::set_tab_title); ClassDB::bind_method(D_METHOD("get_tab_title", "tab_idx"), &Tabs::get_tab_title); + ClassDB::bind_method(D_METHOD("set_tab_text_direction", "tab_idx", "direction"), &Tabs::set_tab_text_direction); + ClassDB::bind_method(D_METHOD("get_tab_text_direction", "tab_idx"), &Tabs::get_tab_text_direction); + ClassDB::bind_method(D_METHOD("set_tab_opentype_feature", "tab_idx", "tag", "values"), &Tabs::set_tab_opentype_feature); + ClassDB::bind_method(D_METHOD("get_tab_opentype_feature", "tab_idx", "tag"), &Tabs::get_tab_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_tab_opentype_features", "tab_idx"), &Tabs::clear_tab_opentype_features); + ClassDB::bind_method(D_METHOD("set_tab_language", "tab_idx", "language"), &Tabs::set_tab_language); + ClassDB::bind_method(D_METHOD("get_tab_language", "tab_idx"), &Tabs::get_tab_language); ClassDB::bind_method(D_METHOD("set_tab_icon", "tab_idx", "icon"), &Tabs::set_tab_icon); ClassDB::bind_method(D_METHOD("get_tab_icon", "tab_idx"), &Tabs::get_tab_icon); ClassDB::bind_method(D_METHOD("set_tab_disabled", "tab_idx", "disabled"), &Tabs::set_tab_disabled); @@ -954,8 +1114,8 @@ void Tabs::_bind_methods() { ADD_SIGNAL(MethodInfo("tab_changed", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("right_button_pressed", PropertyInfo(Variant::INT, "tab"))); - ADD_SIGNAL(MethodInfo("tab_close", PropertyInfo(Variant::INT, "tab"))); - ADD_SIGNAL(MethodInfo("tab_hover", PropertyInfo(Variant::INT, "tab"))); + ADD_SIGNAL(MethodInfo("tab_closed", PropertyInfo(Variant::INT, "tab"))); + ADD_SIGNAL(MethodInfo("tab_hovered", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("reposition_active_tab_request", PropertyInfo(Variant::INT, "idx_to"))); ADD_SIGNAL(MethodInfo("tab_clicked", PropertyInfo(Variant::INT, "tab"))); diff --git a/scene/gui/tabs.h b/scene/gui/tabs.h index b94c4a37a1..bf62ba7210 100644 --- a/scene/gui/tabs.h +++ b/scene/gui/tabs.h @@ -32,13 +32,13 @@ #define TABS_H #include "scene/gui/control.h" +#include "scene/resources/text_line.h" class Tabs : public Control { GDCLASS(Tabs, Control); public: enum TabAlign { - ALIGN_LEFT, ALIGN_CENTER, ALIGN_RIGHT, @@ -46,7 +46,6 @@ public: }; enum CloseButtonDisplayPolicy { - CLOSE_BUTTON_SHOW_NEVER, CLOSE_BUTTON_SHOW_ACTIVE_ONLY, CLOSE_BUTTON_SHOW_ALWAYS, @@ -57,6 +56,12 @@ private: struct Tab { String text; String xl_text; + + Dictionary opentype_features; + String language; + Control::TextDirection text_direction = Control::TEXT_DIRECTION_INHERITED; + + Ref<TextLine> text_buf; Ref<Texture2D> icon; int ofs_cache; bool disabled; @@ -103,6 +108,8 @@ private: void _on_mouse_exited(); + void _shape(int p_tab); + protected: void _gui_input(const Ref<InputEvent> &p_event); void _notification(int p_what); @@ -119,6 +126,16 @@ public: void set_tab_title(int p_tab, const String &p_title); String get_tab_title(int p_tab) const; + void set_tab_text_direction(int p_tab, TextDirection p_text_direction); + TextDirection get_tab_text_direction(int p_tab) const; + + void set_tab_opentype_feature(int p_tab, const String &p_name, int p_value); + int get_tab_opentype_feature(int p_tab, const String &p_name) const; + void clear_tab_opentype_features(int p_tab); + + void set_tab_language(int p_tab, const String &p_language); + String get_tab_language(int p_tab) const; + void set_tab_icon(int p_tab, const Ref<Texture2D> &p_icon); Ref<Texture2D> get_tab_icon(int p_tab) const; diff --git a/scene/gui/text_edit.cpp b/scene/gui/text_edit.cpp index 957e1c11c7..f3569f9ce3 100644 --- a/scene/gui/text_edit.cpp +++ b/scene/gui/text_edit.cpp @@ -30,12 +30,14 @@ #include "text_edit.h" +#include "core/config/project_settings.h" #include "core/input/input.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" +#include "core/object/script_language.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/project_settings.h" -#include "core/script_language.h" +#include "core/string/translation.h" + #include "scene/main/window.h" #ifdef TOOLS_ENABLED @@ -113,63 +115,118 @@ void TextEdit::Text::set_font(const Ref<Font> &p_font) { font = p_font; } +void TextEdit::Text::set_font_size(int p_font_size) { + font_size = p_font_size; +} + void TextEdit::Text::set_indent_size(int p_indent_size) { indent_size = p_indent_size; } -void TextEdit::Text::_update_line_cache(int p_line) const { - int w = 0; +void TextEdit::Text::set_font_features(const Dictionary &p_features) { + opentype_features = p_features; +} - int len = text[p_line].data.length(); - const char32_t *str = text[p_line].data.get_data(); +void TextEdit::Text::set_direction_and_language(TextServer::Direction p_direction, String p_language) { + direction = p_direction; + language = p_language; +} - // Update width. +void TextEdit::Text::set_draw_control_chars(bool p_draw_control_chars) { + draw_control_chars = p_draw_control_chars; +} - for (int i = 0; i < len; i++) { - w += get_char_width(str[i], str[i + 1], w); - } +int TextEdit::Text::get_line_width(int p_line) const { + ERR_FAIL_INDEX_V(p_line, text.size(), 0); + return text[p_line].data_buf->get_size().x; +} - text.write[p_line].width_cache = w; - text.write[p_line].wrap_amount_cache = -1; +int TextEdit::Text::get_line_height(int p_line, int p_wrap_index) const { + ERR_FAIL_INDEX_V(p_line, text.size(), 0); + + return text[p_line].data_buf->get_line_size(p_wrap_index).y; } -int TextEdit::Text::get_line_width(int p_line) const { - ERR_FAIL_INDEX_V(p_line, text.size(), -1); +void TextEdit::Text::set_width(float p_width) { + width = p_width; +} + +int TextEdit::Text::get_line_wrap_amount(int p_line) const { + ERR_FAIL_INDEX_V(p_line, text.size(), 0); - if (text[p_line].width_cache == -1) { - _update_line_cache(p_line); + return text[p_line].data_buf->get_line_count() - 1; +} + +Vector<Vector2i> TextEdit::Text::get_line_wrap_ranges(int p_line) const { + Vector<Vector2i> ret; + ERR_FAIL_INDEX_V(p_line, text.size(), ret); + + for (int i = 0; i < text[p_line].data_buf->get_line_count(); i++) { + ret.push_back(text[p_line].data_buf->get_line_range(i)); } + return ret; +} - return text[p_line].width_cache; +const Ref<TextParagraph> TextEdit::Text::get_line_data(int p_line) const { + ERR_FAIL_INDEX_V(p_line, text.size(), Ref<TextParagraph>()); + return text[p_line].data_buf; } -void TextEdit::Text::set_line_wrap_amount(int p_line, int p_wrap_amount) const { +_FORCE_INLINE_ const String &TextEdit::Text::operator[](int p_line) const { + return text[p_line].data; +} + +void TextEdit::Text::invalidate_cache(int p_line, int p_column, const String &p_ime_text, const Vector<Vector2i> &p_bidi_override) { ERR_FAIL_INDEX(p_line, text.size()); - text.write[p_line].wrap_amount_cache = p_wrap_amount; -} + if (font.is_null() || font_size <= 0) { + return; // Not in tree? + } -int TextEdit::Text::get_line_wrap_amount(int p_line) const { - ERR_FAIL_INDEX_V(p_line, text.size(), -1); + text.write[p_line].data_buf->clear(); + text.write[p_line].data_buf->set_width(width); + text.write[p_line].data_buf->set_direction((TextServer::Direction)direction); + text.write[p_line].data_buf->set_preserve_control(draw_control_chars); + if (p_ime_text.length() > 0) { + text.write[p_line].data_buf->add_string(p_ime_text, font, font_size, opentype_features, language); + if (!p_bidi_override.empty()) { + TS->shaped_text_set_bidi_override(text.write[p_line].data_buf->get_rid(), p_bidi_override); + } + } else { + text.write[p_line].data_buf->add_string(text[p_line].data, font, font_size, opentype_features, language); + if (!text[p_line].bidi_override.empty()) { + TS->shaped_text_set_bidi_override(text.write[p_line].data_buf->get_rid(), text[p_line].bidi_override); + } + } - return text[p_line].wrap_amount_cache; + // Apply tab align. + if (indent_size > 0) { + Vector<float> tabs; + tabs.push_back(font->get_char_size('m', 0, font_size).width * indent_size); + text.write[p_line].data_buf->tab_align(tabs); + } } -void TextEdit::Text::clear_width_cache() { +void TextEdit::Text::invalidate_all_lines() { for (int i = 0; i < text.size(); i++) { - text.write[i].width_cache = -1; + text.write[i].data_buf->set_width(width); + if (indent_size > 0) { + Vector<float> tabs; + tabs.push_back(font->get_char_size('m', 0, font_size).width * indent_size); + text.write[i].data_buf->tab_align(tabs); + } } } -void TextEdit::Text::clear_wrap_cache() { +void TextEdit::Text::invalidate_all() { for (int i = 0; i < text.size(); i++) { - text.write[i].wrap_amount_cache = -1; + invalidate_cache(i); } } void TextEdit::Text::clear() { text.clear(); - insert(0, ""); + insert(0, "", Vector<Vector2i>()); } int TextEdit::Text::get_max_width(bool p_exclude_hidden) const { @@ -184,46 +241,30 @@ int TextEdit::Text::get_max_width(bool p_exclude_hidden) const { return max; } -void TextEdit::Text::set(int p_line, const String &p_text) { +void TextEdit::Text::set(int p_line, const String &p_text, const Vector<Vector2i> &p_bidi_override) { ERR_FAIL_INDEX(p_line, text.size()); - text.write[p_line].width_cache = -1; - text.write[p_line].wrap_amount_cache = -1; text.write[p_line].data = p_text; + text.write[p_line].bidi_override = p_bidi_override; + invalidate_cache(p_line); } -void TextEdit::Text::insert(int p_at, const String &p_text) { +void TextEdit::Text::insert(int p_at, const String &p_text, const Vector<Vector2i> &p_bidi_override) { Line line; line.gutters.resize(gutter_count); line.marked = false; line.hidden = false; - line.width_cache = -1; - line.wrap_amount_cache = -1; line.data = p_text; + line.bidi_override = p_bidi_override; text.insert(p_at, line); + + invalidate_cache(p_at); } void TextEdit::Text::remove(int p_at) { text.remove(p_at); } -int TextEdit::Text::get_char_width(char32_t c, char32_t next_c, int px) const { - int tab_w = font->get_char_size(' ').width * indent_size; - int w = 0; - - if (c == '\t') { - int left = px % tab_w; - if (left == 0) { - w = tab_w; - } else { - w = tab_w - px % tab_w; // Is right. - } - } else { - w = font->get_char_size(c, next_c).width; - } - return w; -} - void TextEdit::Text::add_gutter(int p_at) { for (int i = 0; i < text.size(); i++) { if (p_at < 0 || p_at > gutter_count) { @@ -318,15 +359,15 @@ void TextEdit::_click_selection_held() { // Warning: is_mouse_button_pressed(BUTTON_LEFT) returns false for double+ clicks, so this doesn't work for MODE_WORD // and MODE_LINE. However, moving the mouse triggers _gui_input, which calls these functions too, so that's not a huge problem. // I'm unsure if there's an actual fix that doesn't have a ton of side effects. - if (Input::get_singleton()->is_mouse_button_pressed(BUTTON_LEFT) && selection.selecting_mode != Selection::MODE_NONE) { + if (Input::get_singleton()->is_mouse_button_pressed(BUTTON_LEFT) && selection.selecting_mode != SelectionMode::SELECTION_MODE_NONE) { switch (selection.selecting_mode) { - case Selection::MODE_POINTER: { + case SelectionMode::SELECTION_MODE_POINTER: { _update_selection_mode_pointer(); } break; - case Selection::MODE_WORD: { + case SelectionMode::SELECTION_MODE_WORD: { _update_selection_mode_word(); } break; - case Selection::MODE_LINE: { + case SelectionMode::SELECTION_MODE_LINE: { _update_selection_mode_line(); } break; default: { @@ -338,9 +379,17 @@ void TextEdit::_click_selection_held() { } } +Point2 TextEdit::_get_local_mouse_pos() const { + Point2 mp = get_local_mouse_position(); + if (is_layout_rtl()) { + mp.x = get_size().width - mp.x; + } + return mp; +} + void TextEdit::_update_selection_mode_pointer() { dragging_selection = true; - Point2 mp = get_local_mouse_position(); + Point2 mp = _get_local_mouse_pos(); int row, col; _get_mouse_pos(Point2i(mp.x, mp.y), row, col); @@ -356,7 +405,7 @@ void TextEdit::_update_selection_mode_pointer() { void TextEdit::_update_selection_mode_word() { dragging_selection = true; - Point2 mp = get_local_mouse_position(); + Point2 mp = _get_local_mouse_pos(); int row, col; _get_mouse_pos(Point2i(mp.x, mp.y), row, col); @@ -413,7 +462,7 @@ void TextEdit::_update_selection_mode_word() { void TextEdit::_update_selection_mode_line() { dragging_selection = true; - Point2 mp = get_local_mouse_position(); + Point2 mp = _get_local_mouse_pos(); int row, col; _get_mouse_pos(Point2i(mp.x, mp.y), row, col); @@ -438,7 +487,7 @@ void TextEdit::_update_selection_mode_line() { } void TextEdit::_update_minimap_click() { - Point2 mp = get_local_mouse_position(); + Point2 mp = _get_local_mouse_pos(); int xmargin_end = get_size().width - cache.style_normal->get_margin(MARGIN_RIGHT); if (!dragging_minimap && (mp.x < xmargin_end - minimap_width || mp.y > xmargin_end)) { @@ -479,7 +528,8 @@ void TextEdit::_update_minimap_drag() { control_height = scroll_height; } - Point2 mp = get_local_mouse_position(); + Point2 mp = _get_local_mouse_pos(); + double diff = (mp.y - minimap_scroll_click_pos) / control_height; v_scroll->set_as_ratio(minimap_scroll_ratio + diff); } @@ -494,7 +544,7 @@ void TextEdit::_notification(int p_what) { if (text_changed_dirty) { MessageQueue::get_singleton()->push_call(this, "_text_changed_emit"); } - _update_wrap_at(); + _update_wrap_at(true); } break; case NOTIFICATION_RESIZED: { _update_scrollbars(); @@ -506,9 +556,11 @@ void TextEdit::_notification(int p_what) { call_deferred("_update_wrap_at"); } } break; + case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: + case NOTIFICATION_TRANSLATION_CHANGED: case NOTIFICATION_THEME_CHANGED: { _update_caches(); - _update_wrap_at(); + _update_wrap_at(true); } break; case NOTIFICATION_WM_WINDOW_FOCUS_IN: { window_has_focus = true; @@ -556,6 +608,7 @@ void TextEdit::_notification(int p_what) { } Size2 size = get_size(); + bool rtl = is_layout_rtl(); if ((!has_focus() && !menu->has_focus()) || !window_has_focus) { draw_caret = false; } @@ -582,8 +635,6 @@ void TextEdit::_notification(int p_what) { cache.style_focus->draw(ci, Rect2(Point2(), size)); } - int ascent = cache.font->get_ascent(); - int visible_rows = get_visible_rows() + 1; Color color = readonly ? cache.font_color_readonly : cache.font_color; @@ -593,17 +644,25 @@ void TextEdit::_notification(int p_what) { } if (line_length_guidelines) { - const int hard_x = xmargin_beg + (int)cache.font->get_char_size('0').width * line_length_guideline_hard_col - cursor.x_ofs; + const int hard_x = xmargin_beg + (int)cache.font->get_char_size('0', 0, cache.font_size).width * line_length_guideline_hard_col - cursor.x_ofs; if (hard_x > xmargin_beg && hard_x < xmargin_end) { - RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(hard_x, 0), Point2(hard_x, size.height), cache.line_length_guideline_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(size.width - hard_x, 0), Point2(size.width - hard_x, size.height), cache.line_length_guideline_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(hard_x, 0), Point2(hard_x, size.height), cache.line_length_guideline_color); + } } // Draw a "Soft" line length guideline, less visible than the hard line length guideline. // It's usually set to a lower column compared to the hard line length guideline. // Only drawn if its column differs from the hard line length guideline. - const int soft_x = xmargin_beg + (int)cache.font->get_char_size('0').width * line_length_guideline_soft_col - cursor.x_ofs; + const int soft_x = xmargin_beg + (int)cache.font->get_char_size('0', 0, cache.font_size).width * line_length_guideline_soft_col - cursor.x_ofs; if (hard_x != soft_x && soft_x > xmargin_beg && soft_x < xmargin_end) { - RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(soft_x, 0), Point2(soft_x, size.height), cache.line_length_guideline_color * Color(1, 1, 1, 0.5)); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(size.width - soft_x, 0), Point2(size.width - soft_x, size.height), cache.line_length_guideline_color * Color(1, 1, 1, 0.5)); + } else { + RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2(soft_x, 0), Point2(soft_x, size.height), cache.line_length_guideline_color * Color(1, 1, 1, 0.5)); + } } } @@ -762,7 +821,7 @@ void TextEdit::_notification(int p_what) { int cursor_wrap_index = get_cursor_wrap_index(); - FontDrawer drawer(cache.font, Color(1, 1, 1)); + //FontDrawer drawer(cache.font, Color(1, 1, 1)); int first_visible_line = get_first_visible_line() - 1; int draw_amount = visible_rows + (smooth_scroll_enabled ? 1 : 0); @@ -791,7 +850,11 @@ void TextEdit::_notification(int p_what) { // draw the minimap Color viewport_color = (cache.background_color.get_v() < 0.5) ? Color(1, 1, 1, 0.1) : Color(0, 0, 0, 0.1); - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2((xmargin_end + 2), viewport_offset_y, cache.minimap_width, viewport_height), viewport_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - (xmargin_end + 2) - cache.minimap_width, viewport_offset_y, cache.minimap_width, viewport_height), viewport_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2((xmargin_end + 2), viewport_offset_y, cache.minimap_width, viewport_height), viewport_color); + } for (int i = 0; i < minimap_draw_amount; i++) { minimap_line++; @@ -841,7 +904,11 @@ void TextEdit::_notification(int p_what) { } if (minimap_line == cursor.line && cursor_wrap_index == line_wrap_index && highlight_current_line) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2((xmargin_end + 2), i * 3, cache.minimap_width, 2), cache.current_line_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - (xmargin_end + 2) - cache.minimap_width, i * 3, cache.minimap_width, 2), cache.current_line_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2((xmargin_end + 2), i * 3, cache.minimap_width, 2), cache.current_line_color); + } } Color previous_color; @@ -888,7 +955,11 @@ void TextEdit::_notification(int p_what) { // take one for zero indexing, and if we hit whitespace / the end of a word. int chars = MAX(0, (j - (characters - 1)) - (is_whitespace ? 1 : 0)) + 1; int char_x_ofs = indent_px + ((xmargin_end + minimap_char_size.x) + (minimap_char_size.x * chars)) + tabs; - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_x_ofs, minimap_line_height * i), Point2(minimap_char_size.x * characters, minimap_char_size.y)), previous_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(size.width - char_x_ofs - minimap_char_size.x * characters, minimap_line_height * i), Point2(minimap_char_size.x * characters, minimap_char_size.y)), previous_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_x_ofs, minimap_line_height * i), Point2(minimap_char_size.x * characters, minimap_char_size.y)), previous_color); + } } if (out_of_bounds) { @@ -907,6 +978,7 @@ void TextEdit::_notification(int p_what) { } // draw main text + int row_height = get_row_height(); int line = first_visible_line; for (int i = 0; i < draw_amount; i++) { line++; @@ -926,20 +998,17 @@ void TextEdit::_notification(int p_what) { continue; } - const String &fullstr = text[line]; - Dictionary color_map = _get_line_syntax_highlighting(line); // Ensure we at least use the font color. Color current_color = readonly ? cache.font_color_readonly : cache.font_color; - bool underlined = false; + const Ref<TextParagraph> ldata = text.get_line_data(line); Vector<String> wrap_rows = get_wrap_rows_text(line); int line_wrap_amount = times_line_wraps(line); - int last_wrap_column = 0; - for (int line_wrap_index = 0; line_wrap_index < line_wrap_amount + 1; line_wrap_index++) { + for (int line_wrap_index = 0; line_wrap_index <= line_wrap_amount; line_wrap_index++) { if (line_wrap_index != 0) { i++; if (i >= draw_amount) { @@ -948,18 +1017,7 @@ void TextEdit::_notification(int p_what) { } const String &str = wrap_rows[line_wrap_index]; - int indent_px = line_wrap_index != 0 ? get_indent_level(line) * cache.font->get_char_size(' ').width : 0; - if (indent_px >= wrap_at) { - indent_px = 0; - } - - if (line_wrap_index > 0) { - last_wrap_column += wrap_rows[line_wrap_index - 1].length(); - } - int char_margin = xmargin_beg - cursor.x_ofs; - char_margin += indent_px; - int char_ofs = 0; int ofs_readonly = 0; int ofs_x = 0; @@ -968,48 +1026,45 @@ void TextEdit::_notification(int p_what) { ofs_x = cache.style_readonly->get_offset().x / 2; } - int ofs_y = (i * get_row_height() + cache.line_spacing / 2) + ofs_readonly; - ofs_y -= cursor.wrap_ofs * get_row_height(); - ofs_y -= get_v_scroll_offset() * get_row_height(); - - // Check if line contains highlighted word. - int highlighted_text_col = -1; - int search_text_col = -1; - int highlighted_word_col = -1; - - if (!search_text.empty()) { - search_text_col = _get_column_pos_of_word(search_text, str, search_flags, 0); - } - - if (highlighted_text.length() != 0 && highlighted_text != search_text) { - highlighted_text_col = _get_column_pos_of_word(highlighted_text, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, 0); - } - - if (select_identifiers_enabled && highlighted_word.length() != 0) { - if (_is_char(highlighted_word[0]) || highlighted_word[0] == '.') { - highlighted_word_col = _get_column_pos_of_word(highlighted_word, fullstr, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, 0); - } - } + int ofs_y = (i * row_height + cache.line_spacing / 2) + ofs_readonly; + ofs_y -= cursor.wrap_ofs * row_height; + ofs_y -= get_v_scroll_offset() * row_height; if (text.is_marked(line)) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, xmargin_end - xmargin_beg, get_row_height()), cache.mark_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - ofs_x - xmargin_end, ofs_y, xmargin_end - xmargin_beg, row_height), cache.mark_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, xmargin_end - xmargin_beg, row_height), cache.mark_color); + } } if (str.length() == 0) { // Draw line background if empty as we won't loop at at all. if (line == cursor.line && cursor_wrap_index == line_wrap_index && highlight_current_line) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(ofs_x, ofs_y, xmargin_end, get_row_height()), cache.current_line_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - ofs_x - xmargin_end, ofs_y, xmargin_end, row_height), cache.current_line_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(ofs_x, ofs_y, xmargin_end, row_height), cache.current_line_color); + } } // Give visual indication of empty selected line. if (selection.active && line >= selection.from_line && line <= selection.to_line && char_margin >= xmargin_beg) { - int char_w = cache.font->get_char_size(' ').width; - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, char_w, get_row_height()), cache.selection_color); + int char_w = cache.font->get_char_size('m', 0, cache.font_size).width; + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - xmargin_beg - ofs_x - char_w, ofs_y, char_w, row_height), cache.selection_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, char_w, row_height), cache.selection_color); + } } } else { // If it has text, then draw current line marker in the margin, as line number etc will draw over it, draw the rest of line marker later. if (line == cursor.line && cursor_wrap_index == line_wrap_index && highlight_current_line) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(0, ofs_y, xmargin_beg + ofs_x, get_row_height()), cache.current_line_color); + if (rtl) { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(size.width - ofs_x - xmargin_end, ofs_y, xmargin_end, row_height), cache.current_line_color); + } else { + RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(ofs_x, ofs_y, xmargin_end, row_height), cache.current_line_color); + } } } @@ -1031,8 +1086,12 @@ void TextEdit::_notification(int p_what) { break; } - int yofs = ofs_y + (get_row_height() - cache.font->get_height()) / 2; - cache.font->draw(ci, Point2(gutter_offset + ofs_x, yofs + cache.font->get_ascent()), text, get_line_gutter_item_color(line, g)); + Ref<TextLine> tl; + tl.instance(); + tl->add_string(text, cache.font, cache.font_size); + + int yofs = ofs_y + (row_height - tl->get_size().y) / 2; + tl->draw(ci, Point2(gutter_offset + ofs_x, yofs), get_line_gutter_item_color(line, g)); } break; case GUTTER_TPYE_ICON: { const Ref<Texture2D> icon = get_line_gutter_icon(line, g); @@ -1040,7 +1099,7 @@ void TextEdit::_notification(int p_what) { break; } - Rect2i gutter_rect = Rect2i(Point2i(gutter_offset, ofs_y), Size2i(gutter.width, get_row_height())); + Rect2 gutter_rect = Rect2(Point2i(gutter_offset, ofs_y), Size2i(gutter.width, row_height)); int horizontal_padding = gutter_rect.size.x / 6; int vertical_padding = gutter_rect.size.y / 6; @@ -1048,13 +1107,28 @@ void TextEdit::_notification(int p_what) { gutter_rect.position += Point2(horizontal_padding, vertical_padding); gutter_rect.size -= Point2(horizontal_padding, vertical_padding) * 2; + // Correct icon aspect ratio. + float icon_ratio = icon->get_width() / icon->get_height(); + float gutter_ratio = gutter_rect.size.x / gutter_rect.size.y; + if (gutter_ratio > icon_ratio) { + gutter_rect.size.x = floor(icon->get_width() * (gutter_rect.size.y / icon->get_height())); + } else { + gutter_rect.size.y = floor(icon->get_height() * (gutter_rect.size.x / icon->get_width())); + } + if (rtl) { + gutter_rect.position.x = size.width - gutter_rect.position.x - gutter_rect.size.x; + } + icon->draw_rect(ci, gutter_rect, false, get_line_gutter_item_color(line, g)); } break; case GUTTER_TPYE_CUSTOM: { if (gutter.custom_draw_obj.is_valid()) { Object *cdo = ObjectDB::get_instance(gutter.custom_draw_obj); if (cdo) { - Rect2i gutter_rect = Rect2i(Point2i(gutter_offset, ofs_y), Size2i(gutter.width, get_row_height())); + Rect2i gutter_rect = Rect2i(Point2i(gutter_offset, ofs_y), Size2i(gutter.width, row_height)); + if (rtl) { + gutter_rect.position.x = size.width - gutter_rect.position.x - gutter_rect.size.x; + } cdo->call(gutter.custom_draw_callback, line, g, Rect2(gutter_rect)); } } @@ -1065,296 +1139,303 @@ void TextEdit::_notification(int p_what) { } } - // Loop through characters in one line. - int j = 0; - for (; j < str.length(); j++) { - if (color_map.has(last_wrap_column + j)) { - current_color = color_map[last_wrap_column + j].get("color"); - if (readonly && current_color.a > cache.font_color_readonly.a) { - current_color.a = cache.font_color_readonly.a; - } - } - color = current_color; - - int char_w; + // Draw line. + RID rid = ldata->get_line_rid(line_wrap_index); + float text_height = TS->shaped_text_get_size(rid).y + cache.font->get_spacing(Font::SPACING_TOP) + cache.font->get_spacing(Font::SPACING_BOTTOM); - // Handle tabulator. - char_w = text.get_char_width(str[j], str[j + 1], char_ofs); - - if ((char_ofs + char_margin) < xmargin_beg) { - char_ofs += char_w; + if (rtl) { + char_margin = size.width - char_margin - TS->shaped_text_get_size(rid).x; + } - // Line highlighting handle horizontal clipping. - if (line == cursor.line && cursor_wrap_index == line_wrap_index && highlight_current_line) { - if (j == str.length() - 1) { - // End of line when last char is skipped. - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, xmargin_end - (char_ofs + char_margin + char_w), get_row_height()), cache.current_line_color); - } else if ((char_ofs + char_margin) > xmargin_beg) { - // Char next to margin is skipped. - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(xmargin_beg + ofs_x, ofs_y, (char_ofs + char_margin) - (xmargin_beg + ofs_x), get_row_height()), cache.current_line_color); - } + if (selection.active && line >= selection.from_line && line <= selection.to_line) { // Selection + int sel_from = (line > selection.from_line) ? TS->shaped_text_get_range(rid).x : selection.from_column; + int sel_to = (line < selection.to_line) ? TS->shaped_text_get_range(rid).y : selection.to_column; + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, sel_from, sel_to); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, row_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; } - continue; - } - - if ((char_ofs + char_margin + char_w) >= xmargin_end) { - break; + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + draw_rect(rect, cache.selection_color, true); } + } - bool in_search_result = false; - - if (search_text_col != -1) { - // If we are at the end check for new search result on same line. - if (j >= search_text_col + search_text.length()) { - search_text_col = _get_column_pos_of_word(search_text, str, search_flags, j); + int start = TS->shaped_text_get_range(rid).x; + if (!search_text.empty()) { // Search highhlight + int search_text_col = _get_column_pos_of_word(search_text, str, search_flags, 0); + while (search_text_col != -1) { + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, search_text_col + start, search_text_col + search_text.length() + start); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, row_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; + } + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + draw_rect(rect, cache.search_result_color, true); + draw_rect(rect, cache.search_result_border_color, false); } - in_search_result = j >= search_text_col && j < search_text_col + search_text.length(); - - if (in_search_result) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin, ofs_y), Size2i(char_w, get_row_height())), cache.search_result_color); - } + search_text_col = _get_column_pos_of_word(search_text, str, search_flags, search_text_col + 1); } + } - // Current line highlighting. - bool in_selection = (selection.active && line >= selection.from_line && line <= selection.to_line && (line > selection.from_line || last_wrap_column + j >= selection.from_column) && (line < selection.to_line || last_wrap_column + j < selection.to_column)); - - if (line == cursor.line && cursor_wrap_index == line_wrap_index && highlight_current_line) { - // Draw the wrap indent offset highlight. - if (line_wrap_index != 0 && j == 0) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(char_ofs + char_margin + ofs_x - indent_px, ofs_y, indent_px, get_row_height()), cache.current_line_color); - } - // If its the last char draw to end of the line. - if (j == str.length() - 1) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(char_ofs + char_margin + char_w + ofs_x, ofs_y, xmargin_end - (char_ofs + char_margin + char_w), get_row_height()), cache.current_line_color); - } - // Actual text. - if (!in_selection) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y), Size2i(char_w, get_row_height())), cache.current_line_color); + if (highlight_all_occurrences && !only_whitespaces_highlighted && !highlighted_text.empty()) { // Highlight + int highlighted_text_col = _get_column_pos_of_word(highlighted_text, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, 0); + while (highlighted_text_col != -1) { + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, highlighted_text_col + start, highlighted_text_col + highlighted_text.length() + start); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, row_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; + } + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + draw_rect(rect, cache.word_highlighted_color); } - } - if (in_selection) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y), Size2i(char_w, get_row_height())), cache.selection_color); + highlighted_text_col = _get_column_pos_of_word(highlighted_text, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, highlighted_text_col + 1); } + } - if (in_search_result) { - Color border_color = (line == search_result_line && j >= search_result_col && j < search_result_col + search_text.length()) ? cache.font_color : cache.search_result_border_color; - - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y), Size2i(char_w, 1)), border_color); - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y + get_row_height() - 1), Size2i(char_w, 1)), border_color); + if (select_identifiers_enabled && highlighted_word.length() != 0) { // Highlight word + if (_is_char(highlighted_word[0]) || highlighted_word[0] == '.') { + int highlighted_word_col = _get_column_pos_of_word(highlighted_word, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, 0); + while (highlighted_word_col != -1) { + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, highlighted_word_col + start, highlighted_word_col + highlighted_word.length() + start); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, row_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; + } + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + rect.position.y = TS->shaped_text_get_ascent(rid) + cache.font->get_underline_position(cache.font_size); + rect.size.y = cache.font->get_underline_thickness(cache.font_size); + draw_rect(rect, cache.font_color_selected); + } - if (j == search_text_col) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y), Size2i(1, get_row_height())), border_color); - } - if (j == search_text_col + search_text.length() - 1) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + char_w + ofs_x - 1, ofs_y), Size2i(1, get_row_height())), border_color); + highlighted_word_col = _get_column_pos_of_word(highlighted_word, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, highlighted_word_col + 1); } } + } - if (highlight_all_occurrences && !only_whitespaces_highlighted) { - if (highlighted_text_col != -1) { - // If we are at the end check for new word on same line. - if (j > highlighted_text_col + highlighted_text.length()) { - highlighted_text_col = _get_column_pos_of_word(highlighted_text, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, j); - } - - bool in_highlighted_word = (j >= highlighted_text_col && j < highlighted_text_col + highlighted_text.length()); + ofs_y += (row_height - text_height) / 2; - // If this is the original highlighted text we don't want to highlight it again. - if (cursor.line == line && cursor_wrap_index == line_wrap_index && (cursor.column >= highlighted_text_col && cursor.column <= highlighted_text_col + highlighted_text.length())) { - in_highlighted_word = false; - } + const Vector<TextServer::Glyph> visual = TS->shaped_text_get_glyphs(rid); + const TextServer::Glyph *glyphs = visual.ptr(); + int gl_size = visual.size(); - if (in_highlighted_word) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2i(char_ofs + char_margin + ofs_x, ofs_y), Size2i(char_w, get_row_height())), cache.word_highlighted_color); - } + ofs_y += ldata->get_line_ascent(line_wrap_index); + float char_ofs = 0.f; + for (int j = 0; j < gl_size; j++) { + if (color_map.has(glyphs[j].start)) { + current_color = color_map[glyphs[j].start].get("color"); + if (readonly && current_color.a > cache.font_color_readonly.a) { + current_color.a = cache.font_color_readonly.a; } } - if (highlighted_word_col != -1) { - if (j + last_wrap_column > highlighted_word_col + highlighted_word.length()) { - highlighted_word_col = _get_column_pos_of_word(highlighted_word, fullstr, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, j + last_wrap_column); + if (selection.active && line >= selection.from_line && line <= selection.to_line) { // Selection + int sel_from = (line > selection.from_line) ? TS->shaped_text_get_range(rid).x : selection.from_column; + int sel_to = (line < selection.to_line) ? TS->shaped_text_get_range(rid).y : selection.to_column; + + if (glyphs[j].start >= sel_from && glyphs[j].end <= sel_to && override_selected_font_color) { + current_color = cache.font_color_selected; } - underlined = (j + last_wrap_column >= highlighted_word_col && j + last_wrap_column < highlighted_word_col + highlighted_word.length()); } if (brace_matching_enabled) { - int yofs = ofs_y + (get_row_height() - cache.font->get_height()) / 2; - if ((brace_open_match_line == line && brace_open_match_column == last_wrap_column + j) || - (cursor.column == last_wrap_column + j && cursor.line == line && cursor_wrap_index == line_wrap_index && (brace_open_matching || brace_open_mismatch))) { + if ((brace_open_match_line == line && brace_open_match_column == glyphs[j].start) || + (cursor.column == glyphs[j].start && cursor.line == line && cursor_wrap_index == line_wrap_index && (brace_open_matching || brace_open_mismatch))) { if (brace_open_mismatch) { - color = cache.brace_mismatch_color; + current_color = cache.brace_mismatch_color; } - drawer.draw_char(ci, Point2i(char_ofs + char_margin + ofs_x, yofs + ascent), '_', str[j + 1], in_selection && override_selected_font_color ? cache.font_color_selected : color); + Rect2 rect = Rect2(char_ofs + char_margin + ofs_x, ofs_y + cache.font->get_underline_position(cache.font_size), glyphs[j].advance * glyphs[j].repeat, cache.font->get_underline_thickness(cache.font_size)); + draw_rect(rect, current_color); } - if ((brace_close_match_line == line && brace_close_match_column == last_wrap_column + j) || - (cursor.column == last_wrap_column + j + 1 && cursor.line == line && cursor_wrap_index == line_wrap_index && (brace_close_matching || brace_close_mismatch))) { + if ((brace_close_match_line == line && brace_close_match_column == glyphs[j].start) || + (cursor.column == glyphs[j].start + 1 && cursor.line == line && cursor_wrap_index == line_wrap_index && (brace_close_matching || brace_close_mismatch))) { if (brace_close_mismatch) { - color = cache.brace_mismatch_color; + current_color = cache.brace_mismatch_color; } - drawer.draw_char(ci, Point2i(char_ofs + char_margin + ofs_x, yofs + ascent), '_', str[j + 1], in_selection && override_selected_font_color ? cache.font_color_selected : color); + Rect2 rect = Rect2(char_ofs + char_margin + ofs_x, ofs_y + cache.font->get_underline_position(cache.font_size), glyphs[j].advance * glyphs[j].repeat, cache.font->get_underline_thickness(cache.font_size)); + draw_rect(rect, current_color); } } - - if (cursor.column == last_wrap_column + j && cursor.line == line && cursor_wrap_index == line_wrap_index) { - cursor_pos = Point2i(char_ofs + char_margin + ofs_x, ofs_y); - cursor_pos.y += (get_row_height() - cache.font->get_height()) / 2; - - if (insert_mode) { - cursor_insert_offset_y = (cache.font->get_height() - 3); - cursor_pos.y += cursor_insert_offset_y; + if (draw_tabs && ((glyphs[j].flags & TextServer::GRAPHEME_IS_TAB) == TextServer::GRAPHEME_IS_TAB)) { + int yofs = (text_height - cache.tab_icon->get_height()) / 2 - ldata->get_line_ascent(line_wrap_index); + cache.tab_icon->draw(ci, Point2(char_ofs + char_margin + ofs_x, ofs_y + yofs), current_color); + } + if (draw_spaces && ((glyphs[j].flags & TextServer::GRAPHEME_IS_SPACE) == TextServer::GRAPHEME_IS_SPACE)) { + int yofs = (text_height - cache.space_icon->get_height()) / 2 - ldata->get_line_ascent(line_wrap_index); + int xofs = (glyphs[j].advance * glyphs[j].repeat - cache.space_icon->get_width()) / 2; + cache.space_icon->draw(ci, Point2(char_ofs + char_margin + ofs_x + xofs, ofs_y + yofs), current_color); + } + for (int k = 0; k < glyphs[j].repeat; k++) { + if ((char_ofs + char_margin) >= xmargin_beg && (char_ofs + glyphs[j].advance + char_margin) <= xmargin_end) { + if (glyphs[j].font_rid != RID()) { + TS->font_draw_glyph(glyphs[j].font_rid, ci, glyphs[j].font_size, Vector2(char_margin + char_ofs + ofs_x + glyphs[j].x_off, ofs_y + glyphs[j].y_off), glyphs[j].index, current_color); + } else if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { + TS->draw_hex_code_box(ci, glyphs[j].font_size, Vector2(char_margin + char_ofs + ofs_x + glyphs[j].x_off, ofs_y + glyphs[j].y_off), glyphs[j].index, current_color); + } } + char_ofs += glyphs[j].advance; + } + if ((char_ofs + char_margin) >= xmargin_end) { + break; + } + } - int caret_w = (str[j] == '\t') ? cache.font->get_char_size(' ').width : char_w; - if (ime_text.length() > 0) { - int ofs = 0; - while (true) { - if (ofs >= ime_text.length()) { - break; - } - - char32_t cchar = ime_text[ofs]; - char32_t next = ime_text[ofs + 1]; - int im_char_width = cache.font->get_char_size(cchar, next).width; - - if ((char_ofs + char_margin + im_char_width) >= xmargin_end) { - break; - } - - bool selected = ofs >= ime_selection.x && ofs < ime_selection.x + ime_selection.y; - if (selected) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_ofs + char_margin, ofs_y + get_row_height()), Size2(im_char_width, 3)), color); - } else { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_ofs + char_margin, ofs_y + get_row_height()), Size2(im_char_width, 1)), color); - } - - drawer.draw_char(ci, Point2(char_ofs + char_margin + ofs_x, ofs_y + ascent), cchar, next, color); + if (line_wrap_index == line_wrap_amount && is_folded(line)) { + int yofs = (text_height - cache.folded_eol_icon->get_height()) / 2 - ldata->get_line_ascent(line_wrap_index); + int xofs = cache.folded_eol_icon->get_width() / 2; + Color eol_color = cache.code_folding_color; + eol_color.a = 1; + cache.folded_eol_icon->draw(ci, Point2(char_ofs + char_margin + xofs + ofs_x, ofs_y + yofs), eol_color); + } - char_ofs += im_char_width; - ofs++; - } - } - if (ime_text.length() == 0) { - if (draw_caret) { - if (insert_mode) { -#ifdef TOOLS_ENABLED - int caret_h = (block_caret) ? 4 : 2 * EDSCALE; -#else - int caret_h = (block_caret) ? 4 : 2; -#endif - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(cursor_pos, Size2i(caret_w, caret_h)), cache.caret_color); - } else { + // Carets #ifdef TOOLS_ENABLED - caret_w = (block_caret) ? caret_w : 2 * EDSCALE; + int caret_width = Math::round(EDSCALE); #else - caret_w = (block_caret) ? caret_w : 2; + int caret_width = 1; #endif - - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(cursor_pos, Size2i(caret_w, cache.font->get_height())), cache.caret_color); - } + if (cursor.line == line && ((line_wrap_index == line_wrap_amount) || (cursor.column != TS->shaped_text_get_range(rid).y))) { + cursor_pos.y = ofs_y + ldata->get_line_descent(line_wrap_index); + if (ime_text.length() == 0) { + Rect2 l_caret, t_caret; + TextServer::Direction l_dir, t_dir; + if (str.length() != 0) { + // Get carets. + TS->shaped_text_get_carets(rid, cursor.column, l_caret, l_dir, t_caret, t_dir); + } else { + // No carets, add one at the start. + int h = cache.font->get_height(cache.font_size); + if (rtl) { + l_dir = TextServer::DIRECTION_RTL; + l_caret = Rect2(Vector2(xmargin_end - char_margin + ofs_x, -h / 2), Size2(caret_width * 4, h)); + } else { + l_dir = TextServer::DIRECTION_LTR; + l_caret = Rect2(Vector2(char_ofs, -h / 2), Size2(caret_width * 4, h)); } } - } - if (cursor.column == last_wrap_column + j && cursor.line == line && cursor_wrap_index == line_wrap_index && block_caret && draw_caret && !insert_mode) { - color = cache.caret_background_color; - } else if (block_caret) { - color = readonly ? cache.font_color_readonly : cache.font_color; - } - - if (str[j] >= 32) { - int yofs = ofs_y + (get_row_height() - cache.font->get_height()) / 2; - int w = drawer.draw_char(ci, Point2i(char_ofs + char_margin + ofs_x, yofs + ascent), str[j], str[j + 1], in_selection && override_selected_font_color ? cache.font_color_selected : color); - if (underlined) { - float line_width = cache.font->get_underline_thickness(); -#ifdef TOOLS_ENABLED - line_width *= EDSCALE; -#endif - - draw_rect(Rect2(char_ofs + char_margin + ofs_x, yofs + ascent + cache.font->get_underline_position(), w, line_width), in_selection && override_selected_font_color ? cache.font_color_selected : color); + if ((l_caret != Rect2() && (l_dir == TextServer::DIRECTION_AUTO || l_dir == (TextServer::Direction)input_direction)) || (t_caret == Rect2())) { + cursor_pos.x = char_margin + ofs_x + l_caret.position.x; + } else { + cursor_pos.x = char_margin + ofs_x + t_caret.position.x; } - } else if (draw_tabs && str[j] == '\t') { - int yofs = (get_row_height() - cache.tab_icon->get_height()) / 2; - cache.tab_icon->draw(ci, Point2(char_ofs + char_margin + ofs_x, ofs_y + yofs), in_selection && override_selected_font_color ? cache.font_color_selected : color); - } - - if (draw_spaces && str[j] == ' ') { - int yofs = (get_row_height() - cache.space_icon->get_height()) / 2; - cache.space_icon->draw(ci, Point2(char_ofs + char_margin + ofs_x, ofs_y + yofs), in_selection && override_selected_font_color ? cache.font_color_selected : color); - } - char_ofs += char_w; - - if (line_wrap_index == line_wrap_amount && j == str.length() - 1 && is_folded(line)) { - int yofs = (get_row_height() - cache.folded_eol_icon->get_height()) / 2; - int xofs = cache.folded_eol_icon->get_width() / 2; - Color eol_color = cache.code_folding_color; - eol_color.a = 1; - cache.folded_eol_icon->draw(ci, Point2(char_ofs + char_margin + xofs + ofs_x, ofs_y + yofs), eol_color); - } - } + if (draw_caret) { + if (block_caret || insert_mode) { + //Block or underline caret, draw trailing carets at full height. + int h = cache.font->get_height(cache.font_size); + + if (t_caret != Rect2()) { + if (insert_mode) { + t_caret.position.y = TS->shaped_text_get_descent(rid); + t_caret.size.y = caret_width; + } else { + t_caret.position.y = -TS->shaped_text_get_ascent(rid); + t_caret.size.y = h; + } + t_caret.position += Vector2(char_margin + ofs_x, ofs_y); + + draw_rect(t_caret, cache.caret_color, false); + } else { // End of the line. + if (insert_mode) { + l_caret.position.y = TS->shaped_text_get_descent(rid); + l_caret.size.y = caret_width; + } else { + l_caret.position.y = -TS->shaped_text_get_ascent(rid); + l_caret.size.y = h; + } + l_caret.position += Vector2(char_margin + ofs_x, ofs_y); + l_caret.size.x = cache.font->get_char_size('m', 0, cache.font_size).x; - if (cursor.column == (last_wrap_column + j) && cursor.line == line && cursor_wrap_index == line_wrap_index && (char_ofs + char_margin) >= xmargin_beg) { - cursor_pos = Point2i(char_ofs + char_margin + ofs_x, ofs_y); - cursor_pos.y += (get_row_height() - cache.font->get_height()) / 2; + draw_rect(l_caret, cache.caret_color, false); + } + } else { + // Normal caret. + if (l_caret != Rect2() && l_dir == TextServer::DIRECTION_AUTO) { + // Draw extra marker on top of mid caret. + Rect2 trect = Rect2(l_caret.position.x - 3 * caret_width, l_caret.position.y, 6 * caret_width, caret_width); + trect.position += Vector2(char_margin + ofs_x, ofs_y); + RenderingServer::get_singleton()->canvas_item_add_rect(ci, trect, cache.caret_color); + } + l_caret.position += Vector2(char_margin + ofs_x, ofs_y); + l_caret.size.x = caret_width; - if (insert_mode) { - cursor_insert_offset_y = cache.font->get_height() - 3; - cursor_pos.y += cursor_insert_offset_y; - } - if (ime_text.length() > 0) { - int ofs = 0; - while (true) { - if (ofs >= ime_text.length()) { - break; - } + draw_rect(l_caret, cache.caret_color); - char32_t cchar = ime_text[ofs]; - char32_t next = ime_text[ofs + 1]; - int im_char_width = cache.font->get_char_size(cchar, next).width; + t_caret.position += Vector2(char_margin + ofs_x, ofs_y); + t_caret.size.x = caret_width; - if ((char_ofs + char_margin + im_char_width) >= xmargin_end) { - break; + draw_rect(t_caret, cache.caret_color); } - - bool selected = ofs >= ime_selection.x && ofs < ime_selection.x + ime_selection.y; - if (selected) { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_ofs + char_margin, ofs_y + get_row_height()), Size2(im_char_width, 3)), color); - } else { - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(char_ofs + char_margin, ofs_y + get_row_height()), Size2(im_char_width, 1)), color); + } + } else { + { + // IME intermidiet text range. + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, cursor.column, cursor.column + ime_text.length()); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, text_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; + } + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + rect.size.y = caret_width; + draw_rect(rect, cache.caret_color); + cursor_pos.x = rect.position.x; } - - drawer.draw_char(ci, Point2(char_ofs + char_margin + ofs_x, ofs_y + ascent), cchar, next, color); - - char_ofs += im_char_width; - ofs++; } - } - if (ime_text.length() == 0) { - if (draw_caret) { - if (insert_mode) { - int char_w = cache.font->get_char_size(' ').width; -#ifdef TOOLS_ENABLED - int caret_h = (block_caret) ? 4 : 2 * EDSCALE; -#else - int caret_h = (block_caret) ? 4 : 2; -#endif - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(cursor_pos, Size2i(char_w, caret_h)), cache.caret_color); - } else { - int char_w = cache.font->get_char_size(' ').width; -#ifdef TOOLS_ENABLED - int caret_w = (block_caret) ? char_w : 2 * EDSCALE; -#else - int caret_w = (block_caret) ? char_w : 2; -#endif - - RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(cursor_pos, Size2i(caret_w, cache.font->get_height())), cache.caret_color); + { + // IME caret. + Vector<Vector2> sel = TS->shaped_text_get_selection(rid, cursor.column + ime_selection.x, cursor.column + ime_selection.x + ime_selection.y); + for (int j = 0; j < sel.size(); j++) { + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, text_height); + if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { + continue; + } + if (rect.position.x < xmargin_beg) { + rect.size.x -= (xmargin_beg - rect.position.x); + rect.position.x = xmargin_beg; + } else if (rect.position.x + rect.size.x > xmargin_end) { + rect.size.x = xmargin_end - rect.position.x; + } + rect.size.y = caret_width * 3; + draw_rect(rect, cache.caret_color); + cursor_pos.x = rect.position.x; } } } } + ofs_y += ldata->get_line_descent(line_wrap_index); } } @@ -1363,19 +1444,19 @@ void TextEdit::_notification(int p_what) { // Code completion box. Ref<StyleBox> csb = get_theme_stylebox("completion"); int maxlines = get_theme_constant("completion_lines"); - int cmax_width = get_theme_constant("completion_max_width") * cache.font->get_char_size('x').x; + int cmax_width = get_theme_constant("completion_max_width") * cache.font->get_char_size('x', 0, cache.font_size).x; int scrollw = get_theme_constant("completion_scroll_width"); Color scrollc = get_theme_color("completion_scroll_color"); const int completion_options_size = completion_options.size(); int lines = MIN(completion_options_size, maxlines); int w = 0; - int h = lines * get_row_height(); - int nofs = cache.font->get_string_size(completion_base).width; + int h = lines * row_height; + int nofs = cache.font->get_string_size(completion_base, cache.font_size).width; if (completion_options_size < 50) { for (int i = 0; i < completion_options_size; i++) { - int w2 = MIN(cache.font->get_string_size(completion_options[i].display).x, cmax_width); + int w2 = MIN(cache.font->get_string_size(completion_options[i].display, cache.font_size).x, cmax_width); if (w2 > w) { w = w2; } @@ -1386,15 +1467,26 @@ void TextEdit::_notification(int p_what) { // Add space for completion icons. const int icon_hsep = get_theme_constant("hseparation", "ItemList"); - Size2 icon_area_size(get_row_height(), get_row_height()); + Size2 icon_area_size(row_height, row_height); w += icon_area_size.width + icon_hsep; + int line_from = CLAMP(completion_index - lines / 2, 0, completion_options_size - lines); + + for (int i = 0; i < lines; i++) { + int l = line_from + i; + ERR_CONTINUE(l < 0 || l >= completion_options_size); + if (completion_options[l].default_value.get_type() == Variant::COLOR) { + w += icon_area_size.width; + break; + } + } + int th = h + csb->get_minimum_size().y; - if (cursor_pos.y + get_row_height() + th > get_size().height) { + if (cursor_pos.y + row_height + th > get_size().height) { completion_rect.position.y = cursor_pos.y - th - (cache.line_spacing / 2.0f) - cursor_insert_offset_y; } else { - completion_rect.position.y = cursor_pos.y + cache.font->get_height() + (cache.line_spacing / 2.0f) + csb->get_offset().y - cursor_insert_offset_y; + completion_rect.position.y = cursor_pos.y + cache.font->get_height(cache.font_size) + (cache.line_spacing / 2.0f) + csb->get_offset().y - cursor_insert_offset_y; completion_below = true; } @@ -1415,19 +1507,24 @@ void TextEdit::_notification(int p_what) { if (cache.completion_background_color.a > 0.01) { RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(completion_rect.position, completion_rect.size + Size2(scrollw, 0)), cache.completion_background_color); } - int line_from = CLAMP(completion_index - lines / 2, 0, completion_options_size - lines); RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(completion_rect.position.x, completion_rect.position.y + (completion_index - line_from) * get_row_height()), Size2(completion_rect.size.width, get_row_height())), cache.completion_selected_color); + draw_rect(Rect2(completion_rect.position + Vector2(icon_area_size.x + icon_hsep, 0), Size2(MIN(nofs, completion_rect.size.width - (icon_area_size.x + icon_hsep)), completion_rect.size.height)), cache.completion_existing_color); for (int i = 0; i < lines; i++) { int l = line_from + i; ERR_CONTINUE(l < 0 || l >= completion_options_size); - int yofs = (get_row_height() - cache.font->get_height()) / 2; - Point2 title_pos(completion_rect.position.x, completion_rect.position.y + i * get_row_height() + cache.font->get_ascent() + yofs); + + Ref<TextLine> tl; + tl.instance(); + tl->add_string(completion_options[l].display, cache.font, cache.font_size); + + int yofs = (row_height - tl->get_size().y) / 2; + Point2 title_pos(completion_rect.position.x, completion_rect.position.y + i * row_height + yofs); // Draw completion icon if it is valid. Ref<Texture2D> icon = completion_options[l].icon; - Rect2 icon_area(completion_rect.position.x, completion_rect.position.y + i * get_row_height(), icon_area_size.width, icon_area_size.height); + Rect2 icon_area(completion_rect.position.x, completion_rect.position.y + i * row_height, icon_area_size.width, icon_area_size.height); if (icon.is_valid()) { const real_t max_scale = 0.7f; const real_t side = max_scale * icon_area.size.width; @@ -1437,7 +1534,21 @@ void TextEdit::_notification(int p_what) { } title_pos.x = icon_area.position.x + icon_area.size.width + icon_hsep; - draw_string(cache.font, title_pos, completion_options[l].display, completion_options[l].font_color, completion_rect.size.width - (icon_area_size.x + icon_hsep)); + + tl->set_width(completion_rect.size.width - (icon_area_size.x + icon_hsep)); + + if (rtl) { + if (completion_options[l].default_value.get_type() == Variant::COLOR) { + draw_rect(Rect2(Point2(completion_rect.position.x, icon_area.position.y), icon_area_size), (Color)completion_options[l].default_value); + } + tl->set_align(HALIGN_RIGHT); + } else { + if (completion_options[l].default_value.get_type() == Variant::COLOR) { + draw_rect(Rect2(Point2(completion_rect.position.x + completion_rect.size.width - icon_area_size.x, icon_area.position.y), icon_area_size), (Color)completion_options[l].default_value); + } + tl->set_align(HALIGN_LEFT); + } + tl->draw(ci, title_pos, completion_options[l].font_color); } if (scrollw) { @@ -1475,16 +1586,16 @@ void TextEdit::_notification(int p_what) { int spacing = 0; for (int i = 0; i < sc; i++) { String l = completion_hint.get_slice("\n", i); - int len = font->get_string_size(l).x; + int len = font->get_string_size(l, cache.font_size).x; max_w = MAX(len, max_w); if (i == 0) { - offset = font->get_string_size(l.substr(0, l.find(String::chr(0xFFFF)))).x; + offset = font->get_string_size(l.substr(0, l.find(String::chr(0xFFFF))), cache.font_size).x; } else { spacing += cache.line_spacing; } } - Size2 size2 = Size2(max_w, sc * font->get_height() + spacing); + Size2 size2 = Size2(max_w, sc * font->get_height(cache.font_size) + spacing); Size2 minsize = size2 + sb->get_minimum_size(); if (completion_hint_offset == -0xFFFF) { @@ -1494,7 +1605,7 @@ void TextEdit::_notification(int p_what) { Point2 hint_ofs = Vector2(completion_hint_offset, cursor_pos.y) + callhint_offset; if (callhint_below) { - hint_ofs.y += get_row_height() + sb->get_offset().y; + hint_ofs.y += row_height + sb->get_offset().y; } else { hint_ofs.y -= minsize.y + sb->get_offset().y; } @@ -1508,15 +1619,15 @@ void TextEdit::_notification(int p_what) { String l = completion_hint.get_slice("\n", i); if (l.find(String::chr(0xFFFF)) != -1) { - begin = font->get_string_size(l.substr(0, l.find(String::chr(0xFFFF)))).x; - end = font->get_string_size(l.substr(0, l.rfind(String::chr(0xFFFF)))).x; + begin = font->get_string_size(l.substr(0, l.find(String::chr(0xFFFF))), cache.font_size).x; + end = font->get_string_size(l.substr(0, l.rfind(String::chr(0xFFFF))), cache.font_size).x; } - Point2 round_ofs = hint_ofs + sb->get_offset() + Vector2(0, font->get_ascent() + font->get_height() * i + spacing); + Point2 round_ofs = hint_ofs + sb->get_offset() + Vector2(0, font->get_ascent(cache.font_size) + font->get_height(cache.font_size) * i + spacing); round_ofs = round_ofs.round(); - draw_string(font, round_ofs, l.replace(String::chr(0xFFFF), ""), font_color); + draw_string(font, round_ofs, l.replace(String::chr(0xFFFF), ""), HALIGN_LEFT, -1, cache.font_size, font_color); if (end > 0) { - Vector2 b = hint_ofs + sb->get_offset() + Vector2(begin, font->get_height() + font->get_height() * i + spacing - 1); + Vector2 b = hint_ofs + sb->get_offset() + Vector2(begin, font->get_height(cache.font_size) + font->get_height(cache.font_size) * i + spacing - 1); draw_line(b, b + Vector2(end - begin, 0), font_color); } spacing += cache.line_spacing; @@ -1526,7 +1637,7 @@ void TextEdit::_notification(int p_what) { if (has_focus()) { if (get_viewport()->get_window_id() != DisplayServer::INVALID_WINDOW_ID) { DisplayServer::get_singleton()->window_set_ime_active(true, get_viewport()->get_window_id()); - DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + cursor_pos + Point2(0, get_row_height()), get_viewport()->get_window_id()); + DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + cursor_pos, get_viewport()->get_window_id()); } } } break; @@ -1539,12 +1650,26 @@ void TextEdit::_notification(int p_what) { if (get_viewport()->get_window_id() != DisplayServer::INVALID_WINDOW_ID) { DisplayServer::get_singleton()->window_set_ime_active(true, get_viewport()->get_window_id()); - Point2 cursor_pos = Point2(cursor_get_column(), cursor_get_line()) * get_row_height(); - DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + cursor_pos, get_viewport()->get_window_id()); + DisplayServer::get_singleton()->window_set_ime_position(get_global_position() + _get_cursor_pixel_pos(false), get_viewport()->get_window_id()); } if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_VIRTUAL_KEYBOARD) && virtual_keyboard_enabled) { - DisplayServer::get_singleton()->virtual_keyboard_show(get_text(), get_global_rect(), true); + int cursor_start = -1; + int cursor_end = -1; + + if (!selection.active) { + String full_text = _base_get_text(0, 0, cursor.line, cursor.column); + + cursor_start = full_text.length(); + } else { + String pre_text = _base_get_text(0, 0, selection.from_line, selection.from_column); + String post_text = _base_get_text(selection.from_line, selection.from_column, selection.to_line, selection.to_column); + + cursor_start = pre_text.length(); + cursor_end = cursor_start + post_text.length(); + } + + DisplayServer::get_singleton()->virtual_keyboard_show(get_text(), get_global_rect(), true, -1, cursor_start, cursor_end); } } break; case NOTIFICATION_FOCUS_EXIT: { @@ -1558,6 +1683,7 @@ void TextEdit::_notification(int p_what) { } ime_text = ""; ime_selection = Point2(); + text.invalidate_cache(cursor.line, cursor.column, ime_text); if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_VIRTUAL_KEYBOARD) && virtual_keyboard_enabled) { DisplayServer::get_singleton()->virtual_keyboard_hide(); @@ -1567,6 +1693,15 @@ void TextEdit::_notification(int p_what) { if (has_focus()) { ime_text = DisplayServer::get_singleton()->ime_get_text(); ime_selection = DisplayServer::get_singleton()->ime_get_selection(); + + String t; + if (cursor.column >= 0) { + t = text[cursor.line].substr(0, cursor.column) + ime_text + text[cursor.line].substr(cursor.column, text[cursor.line].length()); + } else { + t = ime_text; + } + + text.invalidate_cache(cursor.line, cursor.column, t, structured_text_parser(st_parser, st_args, t)); update(); } } break; @@ -1917,7 +2052,7 @@ void TextEdit::_get_mouse_pos(const Point2i &p_mouse, int &r_row, int &r_col) co } if (row < 0) { - row = 0; // TODO. + row = 0; } int col = 0; @@ -1928,58 +2063,43 @@ void TextEdit::_get_mouse_pos(const Point2i &p_mouse, int &r_row, int &r_col) co } else { int colx = p_mouse.x - (cache.style_normal->get_margin(MARGIN_LEFT) + gutters_width + gutter_padding); colx += cursor.x_ofs; - col = get_char_pos_for_line(colx, row, wrap_index); - if (is_wrap_enabled() && wrap_index < times_line_wraps(row)) { - // Move back one if we are at the end of the row. - Vector<String> rows2 = get_wrap_rows_text(row); - int row_end_col = 0; - for (int i = 0; i < wrap_index + 1; i++) { - row_end_col += rows2[i].length(); - } - if (col >= row_end_col) { - col -= 1; - } + + RID text_rid = text.get_line_data(row)->get_line_rid(wrap_index); + if (is_layout_rtl()) { + colx = TS->shaped_text_get_size(text_rid).x - colx; } + col = TS->shaped_text_hit_test_position(text_rid, colx); } r_row = row; r_col = col; } -Vector2i TextEdit::_get_cursor_pixel_pos() { - adjust_viewport_to_cursor(); - int row = (cursor.line - get_first_visible_line() - cursor.wrap_ofs); - // Correct for hidden and wrapped lines - for (int i = get_first_visible_line(); i < cursor.line; i++) { - if (is_line_hidden(i)) { - row -= 1; - continue; - } - row += times_line_wraps(i); +Vector2i TextEdit::_get_cursor_pixel_pos(bool p_adjust_viewport) { + if (p_adjust_viewport) { + adjust_viewport_to_cursor(); } - // Row might be wrapped. Adjust row and r_column - Vector<String> rows2 = get_wrap_rows_text(cursor.line); - while (rows2.size() > 1) { - if (cursor.column >= rows2[0].length()) { - cursor.column -= rows2[0].length(); - rows2.remove(0); - row++; - } else { - break; + int row = 1; + for (int i = get_first_visible_line(); i < cursor.line; i++) { + if (!is_line_hidden(i)) { + row += times_line_wraps(i) + 1; } } + row += cursor.wrap_ofs; // Calculate final pixel position - int y = (row - get_v_scroll_offset() + 1 /*Bottom of line*/) * get_row_height(); + int y = (row - get_v_scroll_offset()) * get_row_height(); int x = cache.style_normal->get_margin(MARGIN_LEFT) + gutters_width + gutter_padding - cursor.x_ofs; - int ix = 0; - while (ix < rows2[0].size() && ix < cursor.column) { - if (cache.font != nullptr) { - x += cache.font->get_char_size(rows2[0].get(ix)).width; - } - ix++; + + Rect2 l_caret, t_caret; + TextServer::Direction l_dir, t_dir; + RID text_rid = text.get_line_data(cursor.line)->get_line_rid(cursor.wrap_ofs); + TS->shaped_text_get_carets(text_rid, cursor.column, l_caret, l_dir, t_caret, t_dir); + if ((l_caret != Rect2() && (l_dir == TextServer::DIRECTION_AUTO || l_dir == (TextServer::Direction)input_direction)) || (t_caret == Rect2())) { + x += l_caret.position.x; + } else { + x += t_caret.position.x; } - x += get_indent_level(cursor.line) * cache.font->get_char_size(' ').width; return Vector2i(x, y); } @@ -2044,7 +2164,15 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { Ref<InputEventMouseButton> mb = p_gui_input; if (mb.is_valid()) { - if (completion_active && completion_rect.has_point(mb->get_position())) { + Vector2i mpos = mb->get_position(); + if (is_layout_rtl()) { + mpos.x = get_size().x - mpos.x; + } + if (ime_text.length() != 0) { + // Ignore mouse clicks in IME input mode. + return; + } + if (completion_active && completion_rect.has_point(mpos)) { if (!mb->is_pressed()) { return; } @@ -2065,7 +2193,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { } if (mb->get_button_index() == BUTTON_LEFT) { - completion_index = CLAMP(completion_line_ofs + (mb->get_position().y - completion_rect.position.y) / get_row_height(), 0, completion_options.size() - 1); + completion_index = CLAMP(completion_line_ofs + (mpos.y - completion_rect.position.y) / get_row_height(), 0, completion_options.size() - 1); completion_current = completion_options[completion_index]; update(); @@ -2104,7 +2232,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { _reset_caret_blink_timer(); int row, col; - _get_mouse_pos(Point2i(mb->get_position().x, mb->get_position().y), row, col); + _get_mouse_pos(Point2i(mpos.x, mpos.y), row, col); int left_margin = cache.style_normal->get_margin(MARGIN_LEFT); for (int i = 0; i < gutters.size(); i++) { @@ -2112,7 +2240,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { continue; } - if (mb->get_position().x > left_margin && mb->get_position().x <= (left_margin + gutters[i].width) - 3) { + if (mpos.x > left_margin && mpos.x <= (left_margin + gutters[i].width) - 3) { emit_signal("gutter_clicked", row, i); return; } @@ -2123,7 +2251,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { // Unfold on folded icon click. if (is_folded(row)) { left_margin += gutter_padding + text.get_line_width(row) - cursor.x_ofs; - if (mb->get_position().x > left_margin && mb->get_position().x <= left_margin + cache.folded_eol_icon->get_width() + 3) { + if (mpos.x > left_margin && mpos.x <= left_margin + cache.folded_eol_icon->get_width() + 3) { unfold_line(row); return; } @@ -2146,7 +2274,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { if (mb->get_shift() && (cursor.column != prev_col || cursor.line != prev_line)) { if (!selection.active) { selection.active = true; - selection.selecting_mode = Selection::MODE_POINTER; + selection.selecting_mode = SelectionMode::SELECTION_MODE_POINTER; selection.from_column = prev_col; selection.from_line = prev_line; selection.to_column = cursor.column; @@ -2190,19 +2318,19 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { } else { selection.active = false; - selection.selecting_mode = Selection::MODE_POINTER; + selection.selecting_mode = SelectionMode::SELECTION_MODE_POINTER; selection.selecting_line = row; selection.selecting_column = col; } if (!mb->is_doubleclick() && (OS::get_singleton()->get_ticks_msec() - last_dblclk) < 600 && cursor.line == prev_line) { // Triple-click select line. - selection.selecting_mode = Selection::MODE_LINE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_LINE; _update_selection_mode_line(); last_dblclk = 0; } else if (mb->is_doubleclick() && text[cursor.line].length()) { // Double-click select word. - selection.selecting_mode = Selection::MODE_WORD; + selection.selecting_mode = SelectionMode::SELECTION_MODE_WORD; _update_selection_mode_word(); last_dblclk = OS::get_singleton()->get_ticks_msec(); } @@ -2214,7 +2342,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { _reset_caret_blink_timer(); int row, col; - _get_mouse_pos(Point2i(mb->get_position().x, mb->get_position().y), row, col); + _get_mouse_pos(Point2i(mpos.x, mpos.y), row, col); if (is_right_click_moving_caret()) { if (is_selection_active()) { @@ -2234,7 +2362,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { } } - menu->set_position(get_screen_transform().xform(get_local_mouse_position())); + menu->set_position(get_screen_transform().xform(mpos)); menu->set_size(Vector2(1, 1)); // menu->set_scale(get_global_transform().get_scale()); menu->popup(); @@ -2244,7 +2372,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { if (mb->get_button_index() == BUTTON_LEFT) { if (mb->get_command() && highlighted_word != String()) { int row, col; - _get_mouse_pos(Point2i(mb->get_position().x, mb->get_position().y), row, col); + _get_mouse_pos(Point2i(mpos.x, mpos.y), row, col); emit_signal("symbol_lookup", highlighted_word, row, col); return; @@ -2280,9 +2408,13 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { Ref<InputEventMouseMotion> mm = p_gui_input; if (mm.is_valid()) { + Vector2i mpos = mm->get_position(); + if (is_layout_rtl()) { + mpos.x = get_size().x - mpos.x; + } if (select_identifiers_enabled) { if (!dragging_minimap && !dragging_selection && mm->get_command() && mm->get_button_mask() == 0) { - String new_word = get_word_at_pos(mm->get_position()); + String new_word = get_word_at_pos(mpos); if (new_word != highlighted_word) { emit_signal("symbol_validate", new_word); } @@ -2302,13 +2434,13 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { if (!dragging_minimap) { switch (selection.selecting_mode) { - case Selection::MODE_POINTER: { + case SelectionMode::SELECTION_MODE_POINTER: { _update_selection_mode_pointer(); } break; - case Selection::MODE_WORD: { + case SelectionMode::SELECTION_MODE_WORD: { _update_selection_mode_word(); } break; - case Selection::MODE_LINE: { + case SelectionMode::SELECTION_MODE_LINE: { _update_selection_mode_line(); } break; default: { @@ -2336,7 +2468,8 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { #endif if (select_identifiers_enabled) { if (k->is_pressed() && !dragging_minimap && !dragging_selection) { - emit_signal("symbol_validate", get_word_at_pos(get_local_mouse_position())); + Point2 mp = _get_local_mouse_pos(); + emit_signal("symbol_validate", get_word_at_pos(mp)); } else { set_highlighted_word(String()); } @@ -2585,7 +2718,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { if (unselect) { selection.active = false; - selection.selecting_mode = Selection::MODE_NONE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; update(); } if (clear) { @@ -2674,7 +2807,7 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { continue; } - if (indent_char_found && is_line_comment(i)) { + if (indent_char_found && is_line_comment(cursor.line)) { should_indent = true; break; } else if (indent_char_found && !_is_whitespace(c)) { @@ -2817,34 +2950,12 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { int line = cursor.line; int column = cursor.column; - // Check if we are removing a single whitespace, if so remove it and the next char type, - // else we just remove the whitespace. - bool only_whitespace = false; - if (_is_whitespace(text[line][column - 1]) && _is_whitespace(text[line][column - 2])) { - only_whitespace = true; - } else if (_is_whitespace(text[line][column - 1])) { - // Remove the single whitespace. - column--; - } - - // Check if its a text char. - bool only_char = (_is_text_char(text[line][column - 1]) && !only_whitespace); - - // If its not whitespace or char then symbol. - bool only_symbols = !(only_whitespace || only_char); - - while (column > 0) { - bool is_whitespace = _is_whitespace(text[line][column - 1]); - bool is_text_char = _is_text_char(text[line][column - 1]); - - if (only_whitespace && !is_whitespace) { - break; - } else if (only_char && !is_text_char) { - break; - } else if (only_symbols && (is_whitespace || is_text_char)) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text.get_line_data(line)->get_rid()); + for (int i = words.size() - 1; i >= 0; i--) { + if (words[i].x < column) { + column = words[i].x; break; } - column--; } _remove_text(line, column, cursor.line, cursor.column); @@ -2914,17 +3025,12 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { cursor_set_line(cursor.line - 1); cursor_set_column(text[cursor.line].length()); } else { - bool prev_char = false; - - while (cc > 0) { - bool ischar = _is_text_char(text[cursor.line][cc - 1]); - - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text.get_line_data(cursor.line)->get_rid()); + for (int i = words.size() - 1; i >= 0; i--) { + if (words[i].x < cc) { + cc = words[i].x; break; } - - prev_char = ischar; - cc--; } cursor_set_column(cc); } @@ -2935,7 +3041,11 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { cursor_set_column(text[cursor.line].length()); } } else { - cursor_set_column(cursor_get_column() - 1); + if (mid_grapheme_caret_enabled) { + cursor_set_column(cursor_get_column() - 1); + } else { + cursor_set_column(TS->shaped_text_prev_grapheme_pos(text.get_line_data(cursor.line)->get_rid(), cursor_get_column())); + } } if (k->get_shift()) { @@ -2977,16 +3087,12 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { cursor_set_line(cursor.line + 1); cursor_set_column(0); } else { - bool prev_char = false; - - while (cc < text[cursor.line].length()) { - bool ischar = _is_text_char(text[cursor.line][cc]); - - if (prev_char && !ischar) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text.get_line_data(cursor.line)->get_rid()); + for (int i = 0; i < words.size(); i++) { + if (words[i].y > cc) { + cc = words[i].y; break; } - prev_char = ischar; - cc++; } cursor_set_column(cc); } @@ -2997,7 +3103,11 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { cursor_set_column(0); } } else { - cursor_set_column(cursor_get_column() + 1); + if (mid_grapheme_caret_enabled) { + cursor_set_column(cursor_get_column() + 1); + } else { + cursor_set_column(TS->shaped_text_next_grapheme_pos(text.get_line_data(cursor.line)->get_rid(), cursor_get_column())); + } } if (k->get_shift()) { @@ -3136,34 +3246,12 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { int line = cursor.line; int column = cursor.column; - // Check if we are removing a single whitespace, if so remove it and the next char type, - // else we just remove the whitespace. - bool only_whitespace = false; - if (_is_whitespace(text[line][column]) && _is_whitespace(text[line][column + 1])) { - only_whitespace = true; - } else if (_is_whitespace(text[line][column])) { - // Remove the single whitespace. - column++; - } - - // Check if its a text char. - bool only_char = (_is_text_char(text[line][column]) && !only_whitespace); - - // If its not whitespace or char then symbol. - bool only_symbols = !(only_whitespace || only_char); - - while (column < curline_len) { - bool is_whitespace = _is_whitespace(text[line][column]); - bool is_text_char = _is_text_char(text[line][column]); - - if (only_whitespace && !is_whitespace) { - break; - } else if (only_char && !is_text_char) { - break; - } else if (only_symbols && (is_whitespace || is_text_char)) { + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text.get_line_data(line)->get_rid()); + for (int i = 0; i < words.size(); i++) { + if (words[i].y > column) { + column = words[i].y; break; } - column++; } next_line = line; @@ -3174,7 +3262,11 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { next_line = cursor.line; #endif } else { - next_column = cursor.column < curline_len ? (cursor.column + 1) : 0; + if (mid_grapheme_caret_enabled) { + next_column = cursor.column < curline_len ? (cursor.column + 1) : 0; + } else { + next_column = cursor.column < curline_len ? TS->shaped_text_next_grapheme_pos(text.get_line_data(cursor.line)->get_rid(), (cursor.column)) : 0; + } } _remove_text(cursor.line, cursor.column, next_line, next_column); @@ -3404,6 +3496,20 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { completion_hint = ""; #endif } break; + case (KEY_QUOTELEFT): { // Swap current input direction (primary cursor) + if (!k->get_command()) { + keycode_handled = false; + break; + } + + if (input_direction == TEXT_DIRECTION_LTR) { + input_direction = TEXT_DIRECTION_RTL; + } else { + input_direction = TEXT_DIRECTION_LTR; + } + cursor_set_column(cursor.column); + update(); + } break; case KEY_X: { if (readonly) { break; @@ -3491,9 +3597,8 @@ void TextEdit::_gui_input(const Ref<InputEvent> &p_gui_input) { case KEY_MENU: { if (context_menu_enabled) { - menu->set_position(get_global_transform().xform(_get_cursor_pixel_pos())); + menu->set_position(get_screen_transform().xform(_get_cursor_pixel_pos())); menu->set_size(Vector2(1, 1)); - // menu->set_scale(get_global_transform().get_scale()); menu->popup(); menu->grab_focus(); } @@ -3613,17 +3718,17 @@ void TextEdit::_scroll_down(real_t p_delta) { } void TextEdit::_pre_shift_selection() { - if (!selection.active || selection.selecting_mode == Selection::MODE_NONE) { + if (!selection.active || selection.selecting_mode == SelectionMode::SELECTION_MODE_NONE) { selection.selecting_line = cursor.line; selection.selecting_column = cursor.column; selection.active = true; } - selection.selecting_mode = Selection::MODE_SHIFT; + selection.selecting_mode = SelectionMode::SELECTION_MODE_SHIFT; } void TextEdit::_post_shift_selection() { - if (selection.active && selection.selecting_mode == Selection::MODE_SHIFT) { + if (selection.active && selection.selecting_mode == SelectionMode::SELECTION_MODE_SHIFT) { select(selection.selecting_line, selection.selecting_column, cursor.line, cursor.column); update(); } @@ -3687,7 +3792,7 @@ void TextEdit::_base_insert_text(int p_line, int p_char, const String &p_text, i /* STEP 2: Add spaces if the char is greater than the end of the line. */ while (p_char > text[p_line].length()) { - text.set(p_line, text[p_line] + String::chr(' ')); + text.set(p_line, text[p_line] + String::chr(' '), structured_text_parser(st_parser, st_args, text[p_line] + String::chr(' '))); } /* STEP 3: Separate dest string in pre and post text. */ @@ -3699,13 +3804,13 @@ void TextEdit::_base_insert_text(int p_line, int p_char, const String &p_text, i // Insert the substrings. if (j == 0) { - text.set(p_line, preinsert_text + substrings[j]); + text.set(p_line, preinsert_text + substrings[j], structured_text_parser(st_parser, st_args, preinsert_text + substrings[j])); } else { - text.insert(p_line + j, substrings[j]); + text.insert(p_line + j, substrings[j], structured_text_parser(st_parser, st_args, substrings[j])); } if (j == substrings.size() - 1) { - text.set(p_line + j, text[p_line + j] + postinsert_text); + text.set(p_line + j, text[p_line + j] + postinsert_text, structured_text_parser(st_parser, st_args, text[p_line + j] + postinsert_text)); } } @@ -3716,11 +3821,16 @@ void TextEdit::_base_insert_text(int p_line, int p_char, const String &p_text, i text.set_hidden(p_line, false); } - text.set_line_wrap_amount(p_line, -1); + text.invalidate_cache(p_line); r_end_line = p_line + substrings.size() - 1; r_end_column = text[r_end_line].length() - postinsert_text.length(); + TextServer::Direction dir = TS->shaped_text_get_dominant_direciton_in_range(text.get_line_data(r_end_line)->get_rid(), (r_end_line == p_line) ? cursor.column : 0, r_end_column); + if (dir != TextServer::DIRECTION_AUTO) { + input_direction = (TextDirection)dir; + } + if (!text_changed_dirty && !setting_text) { if (is_inside_tree()) { MessageQueue::get_singleton()->push_call(this, "_text_changed_emit"); @@ -3767,9 +3877,10 @@ void TextEdit::_base_remove_text(int p_from_line, int p_from_column, int p_to_li for (int i = p_from_line; i < p_to_line; i++) { text.remove(p_from_line + 1); } - text.set(p_from_line, pre_text + post_text); + text.set(p_from_line, pre_text + post_text, structured_text_parser(st_parser, st_args, pre_text + post_text)); - text.set_line_wrap_amount(p_from_line, -1); + //text.set_line_wrap_amount(p_from_line, -1); + text.invalidate_cache(p_from_line); if (!text_changed_dirty && !setting_text) { if (is_inside_tree()) { @@ -3943,6 +4054,13 @@ void TextEdit::_generate_context_menu() { menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? KEY_MASK_CMD | KEY_Z : 0); menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? KEY_MASK_CMD | KEY_MASK_SHIFT | KEY_Z : 0); } + menu->add_separator(); + menu->add_submenu_item(RTR("Text writing direction"), "DirMenu"); + menu->add_separator(); + menu->add_check_item(RTR("Display control characters"), MENU_DISPLAY_UCC); + if (!readonly) { + menu->add_submenu_item(RTR("Insert control character"), "CTLMenu"); + } } int TextEdit::get_visible_rows() const { @@ -3970,19 +4088,27 @@ int TextEdit::get_total_visible_rows() const { return total_rows; } -void TextEdit::_update_wrap_at() { - wrap_at = get_size().width - cache.style_normal->get_minimum_size().width - gutters_width - gutter_padding - cache.minimap_width - wrap_right_offset; - update_cursor_wrap_offset(); - text.clear_wrap_cache(); +void TextEdit::_update_wrap_at(bool p_force) { + int new_wrap_at = get_size().width - cache.style_normal->get_minimum_size().width - gutters_width - gutter_padding; + if (draw_minimap) { + new_wrap_at -= minimap_width; + } + if (v_scroll->is_visible_in_tree()) { + new_wrap_at -= v_scroll->get_combined_minimum_size().width; + } + new_wrap_at -= wrap_right_offset; // Give it a little more space. - for (int i = 0; i < text.size(); i++) { - // Update all values that wrap. - if (!line_wraps(i)) { - continue; + if ((wrap_at != new_wrap_at) || p_force) { + wrap_at = new_wrap_at; + if (wrap_enabled) { + text.set_width(wrap_at); + } else { + text.set_width(-1); } - Vector<String> rows = get_wrap_rows_text(i); - text.set_line_wrap_amount(i, rows.size() - 1); + text.invalidate_all_lines(); } + + update_cursor_wrap_offset(); } void TextEdit::adjust_viewport_to_cursor() { @@ -4014,14 +4140,32 @@ void TextEdit::adjust_viewport_to_cursor() { if (!is_wrap_enabled()) { // Adjust x offset. - int cursor_x = get_column_x_offset(cursor.column, text[cursor.line]); + Vector2i cursor_pos; - if (cursor_x > (cursor.x_ofs + visible_width)) { - cursor.x_ofs = cursor_x - visible_width + 1; + // Get position of the start of caret. + if (ime_text.length() != 0 && ime_selection.x != 0) { + cursor_pos.x = get_column_x_offset_for_line(cursor.column + ime_selection.x, cursor.line); + } else { + cursor_pos.x = get_column_x_offset_for_line(cursor.column, cursor.line); + } + + // Get position of the end of caret. + if (ime_text.length() != 0) { + if (ime_selection.y != 0) { + cursor_pos.y = get_column_x_offset_for_line(cursor.column + ime_selection.x + ime_selection.y, cursor.line); + } else { + cursor_pos.y = get_column_x_offset_for_line(cursor.column + ime_text.size(), cursor.line); + } + } else { + cursor_pos.y = cursor_pos.x; } - if (cursor_x < cursor.x_ofs) { - cursor.x_ofs = cursor_x; + if (MAX(cursor_pos.x, cursor_pos.y) > (cursor.x_ofs + visible_width)) { + cursor.x_ofs = MAX(cursor_pos.x, cursor_pos.y) - visible_width + 1; + } + + if (MIN(cursor_pos.x, cursor_pos.y) < cursor.x_ofs) { + cursor.x_ofs = MIN(cursor_pos.x, cursor_pos.y); } } else { cursor.x_ofs = 0; @@ -4049,14 +4193,33 @@ void TextEdit::center_viewport_to_cursor() { if (is_wrap_enabled()) { // Center x offset. - int cursor_x = get_column_x_offset_for_line(cursor.column, cursor.line); - if (cursor_x > (cursor.x_ofs + visible_width)) { - cursor.x_ofs = cursor_x - visible_width + 1; + Vector2i cursor_pos; + + // Get position of the start of caret. + if (ime_text.length() != 0 && ime_selection.x != 0) { + cursor_pos.x = get_column_x_offset_for_line(cursor.column + ime_selection.x, cursor.line); + } else { + cursor_pos.x = get_column_x_offset_for_line(cursor.column, cursor.line); + } + + // Get position of the end of caret. + if (ime_text.length() != 0) { + if (ime_selection.y != 0) { + cursor_pos.y = get_column_x_offset_for_line(cursor.column + ime_selection.x + ime_selection.y, cursor.line); + } else { + cursor_pos.y = get_column_x_offset_for_line(cursor.column + ime_text.size(), cursor.line); + } + } else { + cursor_pos.y = cursor_pos.x; + } + + if (MAX(cursor_pos.x, cursor_pos.y) > (cursor.x_ofs + visible_width)) { + cursor.x_ofs = MAX(cursor_pos.x, cursor_pos.y) - visible_width + 1; } - if (cursor_x < cursor.x_ofs) { - cursor.x_ofs = cursor_x; + if (MIN(cursor_pos.x, cursor_pos.y) < cursor.x_ofs) { + cursor.x_ofs = MIN(cursor_pos.x, cursor_pos.y); } } else { cursor.x_ofs = 0; @@ -4081,24 +4244,17 @@ bool TextEdit::line_wraps(int line) const { if (!is_wrap_enabled()) { return false; } - return text.get_line_width(line) > wrap_at; + return text.get_line_wrap_amount(line) > 0; } int TextEdit::times_line_wraps(int line) const { ERR_FAIL_INDEX_V(line, text.size(), 0); + if (!line_wraps(line)) { return 0; } - int wrap_amount = text.get_line_wrap_amount(line); - if (wrap_amount == -1) { - // Update the value. - Vector<String> rows = get_wrap_rows_text(line); - wrap_amount = rows.size() - 1; - text.set_line_wrap_amount(line, wrap_amount); - } - - return wrap_amount; + return text.get_line_wrap_amount(line); } Vector<String> TextEdit::get_wrap_rows_text(int p_line) const { @@ -4110,66 +4266,12 @@ Vector<String> TextEdit::get_wrap_rows_text(int p_line) const { return lines; } - int px = 0; - int col = 0; - String line_text = text[p_line]; - String wrap_substring = ""; - - int word_px = 0; - String word_str = ""; - int cur_wrap_index = 0; - - int tab_offset_px = get_indent_level(p_line) * cache.font->get_char_size(' ').width; - if (tab_offset_px >= wrap_at) { - tab_offset_px = 0; + const String &line_text = text[p_line]; + Vector<Vector2i> line_ranges = text.get_line_wrap_ranges(p_line); + for (int i = 0; i < line_ranges.size(); i++) { + lines.push_back(line_text.substr(line_ranges[i].x, line_ranges[i].y - line_ranges[i].x)); } - while (col < line_text.length()) { - char32_t c = line_text[col]; - int w = text.get_char_width(c, line_text[col + 1], px + word_px); - - int indent_ofs = (cur_wrap_index != 0 ? tab_offset_px : 0); - - if (indent_ofs + word_px + w > wrap_at) { - // Not enough space to add this char; start next line. - wrap_substring += word_str; - lines.push_back(wrap_substring); - cur_wrap_index++; - wrap_substring = ""; - px = 0; - - word_str = ""; - word_str += c; - word_px = w; - } else { - word_str += c; - word_px += w; - if (c == ' ') { - // End of a word; add this word to the substring. - wrap_substring += word_str; - px += word_px; - word_str = ""; - word_px = 0; - } - - if (indent_ofs + px + word_px > wrap_at) { - // This word will be moved to the next line. - lines.push_back(wrap_substring); - // Reset for next wrap. - cur_wrap_index++; - wrap_substring = ""; - px = 0; - } - } - col++; - } - // Line ends before hit wrap_at; add this word to the substring. - wrap_substring += word_str; - lines.push_back(wrap_substring); - - // Update cache. - text.set_line_wrap_amount(p_line, lines.size() - 1); - return lines; } @@ -4199,6 +4301,14 @@ int TextEdit::get_line_wrap_index_at_col(int p_line, int p_column) const { return wrap_index; } +void TextEdit::set_mid_grapheme_caret_enabled(const bool p_enabled) { + mid_grapheme_caret_enabled = p_enabled; +} + +bool TextEdit::get_mid_grapheme_caret_enabled() const { + return mid_grapheme_caret_enabled; +} + void TextEdit::cursor_set_column(int p_col, bool p_adjust_viewport) { if (p_col < 0) { p_col = 0; @@ -4333,6 +4443,30 @@ bool TextEdit::is_right_click_moving_caret() const { return right_click_moves_caret; } +TextEdit::SelectionMode TextEdit::get_selection_mode() const { + return selection.selecting_mode; +} + +void TextEdit::set_selection_mode(SelectionMode p_mode, int p_line, int p_column) { + selection.selecting_mode = p_mode; + if (p_line >= 0) { + ERR_FAIL_INDEX(p_line, text.size()); + selection.selecting_line = p_line; + } + if (p_column >= 0) { + ERR_FAIL_INDEX(p_column, text[selection.selecting_line].length()); + selection.selecting_column = p_column; + } +} + +int TextEdit::get_selection_line() const { + return selection.selecting_line; +}; + +int TextEdit::get_selection_column() const { + return selection.selecting_column; +}; + void TextEdit::_v_scroll_input() { scrolling = false; minimap_clicked = false; @@ -4372,101 +4506,47 @@ void TextEdit::_scroll_moved(double p_to_val) { } int TextEdit::get_row_height() const { - return cache.font->get_height() + cache.line_spacing; + int height = cache.font->get_height(cache.font_size); + for (int i = 0; i < text.size(); i++) { + for (int j = 0; j <= text.get_line_wrap_amount(i); j++) { + height = MAX(height, text.get_line_height(i, j)); + } + } + return height + cache.line_spacing; } int TextEdit::get_char_pos_for_line(int p_px, int p_line, int p_wrap_index) const { ERR_FAIL_INDEX_V(p_line, text.size(), 0); + p_wrap_index = MIN(p_wrap_index, text.get_line_data(p_line)->get_line_count() - 1); - if (line_wraps(p_line)) { - int line_wrap_amount = times_line_wraps(p_line); - int wrap_offset_px = get_indent_level(p_line) * cache.font->get_char_size(' ').width; - if (wrap_offset_px >= wrap_at) { - wrap_offset_px = 0; - } - if (p_wrap_index > line_wrap_amount) { - p_wrap_index = line_wrap_amount; - } - if (p_wrap_index > 0) { - p_px -= wrap_offset_px; - } else { - p_wrap_index = 0; - } - Vector<String> rows = get_wrap_rows_text(p_line); - int c_pos = get_char_pos_for(p_px, rows[p_wrap_index]); - for (int i = 0; i < p_wrap_index; i++) { - String s = rows[i]; - c_pos += s.length(); - } - - return c_pos; - } else { - return get_char_pos_for(p_px, text[p_line]); + RID text_rid = text.get_line_data(p_line)->get_line_rid(p_wrap_index); + if (is_layout_rtl()) { + p_px = TS->shaped_text_get_size(text_rid).x - p_px; } + return TS->shaped_text_hit_test_position(text_rid, p_px); } int TextEdit::get_column_x_offset_for_line(int p_char, int p_line) const { ERR_FAIL_INDEX_V(p_line, text.size(), 0); - if (line_wraps(p_line)) { - int n_char = p_char; - int col = 0; - Vector<String> rows = get_wrap_rows_text(p_line); - int wrap_index = 0; - for (int i = 0; i < rows.size(); i++) { - wrap_index = i; - String s = rows[wrap_index]; - col += s.length(); - if (col > p_char) { - break; - } - n_char -= s.length(); - } - int px = get_column_x_offset(n_char, rows[wrap_index]); - - int wrap_offset_px = get_indent_level(p_line) * cache.font->get_char_size(' ').width; - if (wrap_offset_px >= wrap_at) { - wrap_offset_px = 0; - } - if (wrap_index != 0) { - px += wrap_offset_px; - } - - return px; - } else { - return get_column_x_offset(p_char, text[p_line]); - } -} - -int TextEdit::get_char_pos_for(int p_px, String p_str) const { - int px = 0; - int c = 0; - - while (c < p_str.length()) { - int w = text.get_char_width(p_str[c], p_str[c + 1], px); - - if (p_px < (px + w / 2)) { + int row = 0; + Vector<Vector2i> rows2 = text.get_line_wrap_ranges(p_line); + for (int i = 0; i < rows2.size(); i++) { + if ((p_char >= rows2[i].x) && (p_char < rows2[i].y)) { + row = i; break; } - px += w; - c++; } - return c; -} - -int TextEdit::get_column_x_offset(int p_char, String p_str) const { - int px = 0; - - for (int i = 0; i < p_char; i++) { - if (i >= p_str.length()) { - break; - } - - px += text.get_char_width(p_str[i], p_str[i + 1], px); + Rect2 l_caret, t_caret; + TextServer::Direction l_dir, t_dir; + RID text_rid = text.get_line_data(p_line)->get_line_rid(row); + TS->shaped_text_get_carets(text_rid, cursor.column, l_caret, l_dir, t_caret, t_dir); + if ((l_caret != Rect2() && (l_dir == TextServer::DIRECTION_AUTO || l_dir == (TextServer::Direction)input_direction)) || (t_caret == Rect2())) { + return l_caret.position.x; + } else { + return t_caret.position.x; } - - return px; } void TextEdit::insert_text_at_cursor(const String &p_text) { @@ -4476,7 +4556,7 @@ void TextEdit::insert_text_at_cursor(const String &p_text) { _remove_text(selection.from_line, selection.from_column, selection.to_line, selection.to_column); selection.active = false; - selection.selecting_mode = Selection::MODE_NONE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; } _insert_text_at_cursor(p_text); @@ -4552,7 +4632,7 @@ void TextEdit::set_text(String p_text) { update(); setting_text = false; -}; +} String TextEdit::get_text() { String longthing; @@ -4565,11 +4645,124 @@ String TextEdit::get_text() { } return longthing; -}; +} + +void TextEdit::set_structured_text_bidi_override(Control::StructuredTextParser p_parser) { + if (st_parser != p_parser) { + st_parser = p_parser; + for (int i = 0; i < text.size(); i++) { + text.set(i, text[i], structured_text_parser(st_parser, st_args, text[i])); + } + update(); + } +} + +Control::StructuredTextParser TextEdit::get_structured_text_bidi_override() const { + return st_parser; +} + +void TextEdit::set_structured_text_bidi_override_options(Array p_args) { + st_args = p_args; + for (int i = 0; i < text.size(); i++) { + text.set(i, text[i], structured_text_parser(st_parser, st_args, text[i])); + } + update(); +} + +Array TextEdit::get_structured_text_bidi_override_options() const { + return st_args; +} + +void TextEdit::set_text_direction(Control::TextDirection p_text_direction) { + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (text_direction != p_text_direction) { + text_direction = p_text_direction; + if (text_direction != TEXT_DIRECTION_AUTO && text_direction != TEXT_DIRECTION_INHERITED) { + input_direction = text_direction; + } + TextServer::Direction dir; + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + dir = is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR; + } else { + dir = (TextServer::Direction)text_direction; + } + text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.invalidate_all(); + + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), text_direction == TEXT_DIRECTION_INHERITED); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_AUTO), text_direction == TEXT_DIRECTION_AUTO); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_LTR), text_direction == TEXT_DIRECTION_LTR); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_RTL), text_direction == TEXT_DIRECTION_RTL); + update(); + } +} + +Control::TextDirection TextEdit::get_text_direction() const { + return text_direction; +} + +void TextEdit::clear_opentype_features() { + opentype_features.clear(); + text.set_font_features(opentype_features); + text.invalidate_all(); + update(); +} + +void TextEdit::set_opentype_feature(const String &p_name, int p_value) { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag) || (int)opentype_features[tag] != p_value) { + opentype_features[tag] = p_value; + text.set_font_features(opentype_features); + text.invalidate_all(); + update(); + } +} + +int TextEdit::get_opentype_feature(const String &p_name) const { + int32_t tag = TS->name_to_tag(p_name); + if (!opentype_features.has(tag)) { + return -1; + } + return opentype_features[tag]; +} + +void TextEdit::set_language(const String &p_language) { + if (language != p_language) { + language = p_language; + TextServer::Direction dir; + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + dir = is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR; + } else { + dir = (TextServer::Direction)text_direction; + } + text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.invalidate_all(); + update(); + } +} + +String TextEdit::get_language() const { + return language; +} + +void TextEdit::set_draw_control_chars(bool p_draw_control_chars) { + if (draw_control_chars != p_draw_control_chars) { + draw_control_chars = p_draw_control_chars; + menu->set_item_checked(menu->get_item_index(MENU_DISPLAY_UCC), draw_control_chars); + text.set_draw_control_chars(draw_control_chars); + text.invalidate_all(); + update(); + } +} + +bool TextEdit::get_draw_control_chars() const { + return draw_control_chars; +} String TextEdit::get_text_for_lookup_completion() { int row, col; - _get_mouse_pos(get_local_mouse_position(), row, col); + Point2i mp = _get_local_mouse_pos(); + _get_mouse_pos(mp, row, col); String longthing; int len = text.size(); @@ -4644,32 +4837,6 @@ void TextEdit::set_readonly(bool p_readonly) { readonly = p_readonly; _generate_context_menu(); - // Reorganize context menu. - menu->clear(); - - if (!readonly) { - menu->add_item(RTR("Undo"), MENU_UNDO, KEY_MASK_CMD | KEY_Z); - menu->add_item(RTR("Redo"), MENU_REDO, KEY_MASK_CMD | KEY_MASK_SHIFT | KEY_Z); - } - - if (!readonly) { - menu->add_separator(); - menu->add_item(RTR("Cut"), MENU_CUT, KEY_MASK_CMD | KEY_X); - } - - menu->add_item(RTR("Copy"), MENU_COPY, KEY_MASK_CMD | KEY_C); - - if (!readonly) { - menu->add_item(RTR("Paste"), MENU_PASTE, KEY_MASK_CMD | KEY_V); - } - - menu->add_separator(); - menu->add_item(RTR("Select All"), MENU_SELECT_ALL, KEY_MASK_CMD | KEY_A); - - if (!readonly) { - menu->add_item(RTR("Clear"), MENU_CLEAR); - } - update(); } @@ -4678,7 +4845,10 @@ bool TextEdit::is_readonly() const { } void TextEdit::set_wrap_enabled(bool p_wrap_enabled) { - wrap_enabled = p_wrap_enabled; + if (wrap_enabled != p_wrap_enabled) { + wrap_enabled = p_wrap_enabled; + _update_wrap_at(true); + } } bool TextEdit::is_wrap_enabled() const { @@ -4720,6 +4890,7 @@ void TextEdit::_update_caches() { cache.completion_existing_color = get_theme_color("completion_existing_color"); cache.completion_font_color = get_theme_color("completion_font_color"); cache.font = get_theme_font("font"); + cache.font_size = get_theme_font_size("font_size"); cache.caret_color = get_theme_color("caret_color"); cache.caret_background_color = get_theme_color("caret_background_color"); cache.font_color = get_theme_color("font_color"); @@ -4740,12 +4911,22 @@ void TextEdit::_update_caches() { #else cache.line_spacing = get_theme_constant("line_spacing"); #endif - cache.row_height = cache.font->get_height() + cache.line_spacing; cache.tab_icon = get_theme_icon("tab"); cache.space_icon = get_theme_icon("space"); cache.folded_eol_icon = get_theme_icon("GuiEllipsis", "EditorIcons"); + + TextServer::Direction dir; + if (text_direction == Control::TEXT_DIRECTION_INHERITED) { + dir = is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR; + } else { + dir = (TextServer::Direction)text_direction; + } + text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.set_font_features(opentype_features); + text.set_draw_control_chars(draw_control_chars); text.set_font(cache.font); - text.clear_width_cache(); + text.set_font_size(cache.font_size); + text.invalidate_all(); if (syntax_highlighter.is_valid()) { syntax_highlighter->set_text_edit(this); @@ -4985,7 +5166,7 @@ void TextEdit::cut() { cursor_set_column(selection.from_column); selection.active = false; - selection.selecting_mode = Selection::MODE_NONE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; update(); cut_copy_line = ""; } @@ -5011,7 +5192,7 @@ void TextEdit::paste() { begin_complex_operation(); if (selection.active) { selection.active = false; - selection.selecting_mode = Selection::MODE_NONE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; _remove_text(selection.from_line, selection.from_column, selection.to_line, selection.to_column); cursor_set_line(selection.from_line); cursor_set_column(selection.from_column); @@ -5043,7 +5224,7 @@ void TextEdit::select_all() { selection.selecting_column = 0; selection.to_line = text.size() - 1; selection.to_column = text[selection.to_line].length(); - selection.selecting_mode = Selection::MODE_SHIFT; + selection.selecting_mode = SelectionMode::SELECTION_MODE_SHIFT; selection.shiftclick_left = true; cursor_set_line(selection.to_line, false); cursor_set_column(selection.to_column, false); @@ -5152,27 +5333,13 @@ String TextEdit::get_selection_text() const { } String TextEdit::get_word_under_cursor() const { - int prev_cc = cursor.column; - while (prev_cc > 0) { - bool is_char = _is_text_char(text[cursor.line][prev_cc - 1]); - if (!is_char) { - break; + Vector<Vector2i> words = TS->shaped_text_get_word_breaks(text.get_line_data(cursor.line)->get_rid()); + for (int i = 0; i < words.size(); i++) { + if (words[i].x <= cursor.column && words[i].y > cursor.column) { + return text[cursor.line].substr(words[i].x, words[i].y - words[i].x); } - --prev_cc; } - - int next_cc = cursor.column; - while (next_cc < text[cursor.line].length()) { - bool is_char = _is_text_char(text[cursor.line][next_cc]); - if (!is_char) { - break; - } - ++next_cc; - } - if (prev_cc == cursor.column || next_cc == cursor.column) { - return ""; - } - return text[cursor.line].substr(prev_cc, next_cc - prev_cc); + return ""; } void TextEdit::set_search_text(const String &p_search_text) { @@ -5468,7 +5635,7 @@ int TextEdit::num_lines_from_rows(int p_line_from, int p_wrap_index_from, int vi break; } } - wrap_index = times_line_wraps(MIN(i, text.size() - 1)) - (num_visible - visible_amount); + wrap_index = times_line_wraps(MIN(i, text.size() - 1)) - MAX(0, num_visible - visible_amount); } else { visible_amount = ABS(visible_amount); int i; @@ -5483,7 +5650,7 @@ int TextEdit::num_lines_from_rows(int p_line_from, int p_wrap_index_from, int vi break; } } - wrap_index = (num_visible - visible_amount); + wrap_index = MAX(0, num_visible - visible_amount); } wrap_index = MAX(wrap_index, 0); return num_total; @@ -5858,8 +6025,11 @@ bool TextEdit::is_indent_using_spaces() const { void TextEdit::set_indent_size(const int p_size) { ERR_FAIL_COND_MSG(p_size <= 0, "Indend size must be greater than 0."); - indent_size = p_size; - text.set_indent_size(p_size); + if (indent_size != p_size) { + indent_size = p_size; + text.set_indent_size(p_size); + text.invalidate_all_lines(); + } space_indent = ""; for (int i = 0; i < p_size; i++) { @@ -5884,6 +6054,7 @@ bool TextEdit::is_drawing_tabs() const { void TextEdit::set_draw_spaces(bool p_draw) { draw_spaces = p_draw; + update(); } bool TextEdit::is_drawing_spaces() const { @@ -6406,7 +6577,7 @@ void TextEdit::set_tooltip_request_func(Object *p_obj, const StringName &p_funct } void TextEdit::set_line(int line, String new_text) { - if (line < 0 || line > text.size()) { + if (line < 0 || line >= text.size()) { return; } _remove_text(line, 0, line, text[line].length()); @@ -6453,7 +6624,10 @@ void TextEdit::set_line_length_guideline_hard_column(int p_column) { } void TextEdit::set_draw_minimap(bool p_draw) { - draw_minimap = p_draw; + if (draw_minimap != p_draw) { + draw_minimap = p_draw; + _update_wrap_at(); + } update(); } @@ -6462,7 +6636,10 @@ bool TextEdit::is_drawing_minimap() const { } void TextEdit::set_minimap_width(int p_minimap_width) { - minimap_width = p_minimap_width; + if (minimap_width != p_minimap_width) { + minimap_width = p_minimap_width; + _update_wrap_at(); + } update(); } @@ -6523,6 +6700,101 @@ void TextEdit::menu_option(int p_option) { } break; case MENU_REDO: { redo(); + } break; + case MENU_DIR_INHERITED: { + set_text_direction(TEXT_DIRECTION_INHERITED); + } break; + case MENU_DIR_AUTO: { + set_text_direction(TEXT_DIRECTION_AUTO); + } break; + case MENU_DIR_LTR: { + set_text_direction(TEXT_DIRECTION_LTR); + } break; + case MENU_DIR_RTL: { + set_text_direction(TEXT_DIRECTION_RTL); + } break; + case MENU_DISPLAY_UCC: { + set_draw_control_chars(!get_draw_control_chars()); + } break; + case MENU_INSERT_LRM: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x200E)); + } + } break; + case MENU_INSERT_RLM: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x200F)); + } + } break; + case MENU_INSERT_LRE: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x202A)); + } + } break; + case MENU_INSERT_RLE: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x202B)); + } + } break; + case MENU_INSERT_LRO: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x202D)); + } + } break; + case MENU_INSERT_RLO: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x202E)); + } + } break; + case MENU_INSERT_PDF: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x202C)); + } + } break; + case MENU_INSERT_ALM: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x061C)); + } + } break; + case MENU_INSERT_LRI: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x2066)); + } + } break; + case MENU_INSERT_RLI: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x2067)); + } + } break; + case MENU_INSERT_FSI: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x2068)); + } + } break; + case MENU_INSERT_PDI: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x2069)); + } + } break; + case MENU_INSERT_ZWJ: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x200D)); + } + } break; + case MENU_INSERT_ZWNJ: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x200C)); + } + } break; + case MENU_INSERT_WJ: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x2060)); + } + } break; + case MENU_INSERT_SHY: { + if (!readonly) { + insert_text_at_cursor(String::chr(0x00AD)); + } } } } @@ -6584,21 +6856,90 @@ PopupMenu *TextEdit::get_menu() const { return menu; } +bool TextEdit::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + double value = p_value; + if (value == -1) { + if (opentype_features.has(tag)) { + opentype_features.erase(tag); + text.set_font_features(opentype_features); + text.invalidate_all(); + update(); + } + } else { + if ((double)opentype_features[tag] != value) { + opentype_features[tag] = value; + text.set_font_features(opentype_features); + text.invalidate_all(); + ; + update(); + } + } + _change_notify(); + return true; + } + + return false; +} + +bool TextEdit::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("opentype_features/")) { + String name = str.get_slicec('/', 1); + int32_t tag = TS->name_to_tag(name); + if (opentype_features.has(tag)) { + r_ret = opentype_features[tag]; + return true; + } else { + r_ret = -1; + return true; + } + } + return false; +} + +void TextEdit::_get_property_list(List<PropertyInfo> *p_list) const { + for (const Variant *ftr = opentype_features.next(nullptr); ftr != nullptr; ftr = opentype_features.next(ftr)) { + String name = TS->tag_to_name(*ftr); + p_list->push_back(PropertyInfo(Variant::FLOAT, "opentype_features/" + name)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "opentype_features/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); +} + void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("_gui_input"), &TextEdit::_gui_input); ClassDB::bind_method(D_METHOD("_cursor_changed_emit"), &TextEdit::_cursor_changed_emit); ClassDB::bind_method(D_METHOD("_text_changed_emit"), &TextEdit::_text_changed_emit); - ClassDB::bind_method(D_METHOD("_update_wrap_at"), &TextEdit::_update_wrap_at); + ClassDB::bind_method(D_METHOD("_update_wrap_at", "force"), &TextEdit::_update_wrap_at, DEFVAL(false)); BIND_ENUM_CONSTANT(SEARCH_MATCH_CASE); BIND_ENUM_CONSTANT(SEARCH_WHOLE_WORDS); BIND_ENUM_CONSTANT(SEARCH_BACKWARDS); + BIND_ENUM_CONSTANT(SELECTION_MODE_NONE); + BIND_ENUM_CONSTANT(SELECTION_MODE_SHIFT); + BIND_ENUM_CONSTANT(SELECTION_MODE_POINTER); + BIND_ENUM_CONSTANT(SELECTION_MODE_WORD); + BIND_ENUM_CONSTANT(SELECTION_MODE_LINE); + /* ClassDB::bind_method(D_METHOD("delete_char"),&TextEdit::delete_char); ClassDB::bind_method(D_METHOD("delete_line"),&TextEdit::delete_line); */ + ClassDB::bind_method(D_METHOD("get_draw_control_chars"), &TextEdit::get_draw_control_chars); + ClassDB::bind_method(D_METHOD("set_draw_control_chars", "enable"), &TextEdit::set_draw_control_chars); + ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &TextEdit::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction"), &TextEdit::get_text_direction); + ClassDB::bind_method(D_METHOD("set_opentype_feature", "tag", "value"), &TextEdit::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "tag"), &TextEdit::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features"), &TextEdit::clear_opentype_features); + ClassDB::bind_method(D_METHOD("set_language", "language"), &TextEdit::set_language); + ClassDB::bind_method(D_METHOD("get_language"), &TextEdit::get_language); + ClassDB::bind_method(D_METHOD("set_text", "text"), &TextEdit::set_text); ClassDB::bind_method(D_METHOD("insert_text_at_cursor", "text"), &TextEdit::insert_text_at_cursor); @@ -6607,6 +6948,11 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("get_line", "line"), &TextEdit::get_line); ClassDB::bind_method(D_METHOD("set_line", "line", "new_text"), &TextEdit::set_line); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "parser"), &TextEdit::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override"), &TextEdit::get_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &TextEdit::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &TextEdit::get_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("center_viewport_to_cursor"), &TextEdit::center_viewport_to_cursor); ClassDB::bind_method(D_METHOD("cursor_set_column", "column", "adjust_viewport"), &TextEdit::cursor_set_column, DEFVAL(true)); ClassDB::bind_method(D_METHOD("cursor_set_line", "line", "adjust_viewport", "can_be_hidden", "wrap_index"), &TextEdit::cursor_set_line, DEFVAL(true), DEFVAL(true), DEFVAL(0)); @@ -6620,9 +6966,17 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("cursor_set_block_mode", "enable"), &TextEdit::cursor_set_block_mode); ClassDB::bind_method(D_METHOD("cursor_is_block_mode"), &TextEdit::cursor_is_block_mode); + ClassDB::bind_method(D_METHOD("set_mid_grapheme_caret_enabled", "enabled"), &TextEdit::set_mid_grapheme_caret_enabled); + ClassDB::bind_method(D_METHOD("get_mid_grapheme_caret_enabled"), &TextEdit::get_mid_grapheme_caret_enabled); + ClassDB::bind_method(D_METHOD("set_right_click_moves_caret", "enable"), &TextEdit::set_right_click_moves_caret); ClassDB::bind_method(D_METHOD("is_right_click_moving_caret"), &TextEdit::is_right_click_moving_caret); + ClassDB::bind_method(D_METHOD("get_selection_mode"), &TextEdit::get_selection_mode); + ClassDB::bind_method(D_METHOD("set_selection_mode", "mode", "line", "column"), &TextEdit::set_selection_mode, DEFVAL(-1), DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_selection_line"), &TextEdit::get_selection_line); + ClassDB::bind_method(D_METHOD("get_selection_column"), &TextEdit::get_selection_column); + ClassDB::bind_method(D_METHOD("set_readonly", "enable"), &TextEdit::set_readonly); ClassDB::bind_method(D_METHOD("is_readonly"), &TextEdit::is_readonly); @@ -6739,6 +7093,9 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("get_minimap_width"), &TextEdit::get_minimap_width); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_MULTILINE_TEXT), "set_text", "get_text"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,LTR,RTL,Inherited"), "set_text_direction", "get_text_direction"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "draw_control_chars"), "set_draw_control_chars", "get_draw_control_chars"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "readonly"), "set_readonly", "is_readonly"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "highlight_current_line"), "set_highlight_current_line", "is_highlight_current_line_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "draw_tabs"), "set_draw_tabs", "is_drawing_tabs"); @@ -6767,6 +7124,11 @@ void TextEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "caret_blink"), "cursor_set_blink_enabled", "cursor_get_blink_enabled"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "caret_blink_speed", PROPERTY_HINT_RANGE, "0.1,10,0.01"), "cursor_set_blink_speed", "cursor_get_blink_speed"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "caret_moving_by_right_click"), "set_right_click_moves_caret", "is_right_click_moving_caret"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "caret_mid_grapheme"), "set_mid_grapheme_caret_enabled", "get_mid_grapheme_caret_enabled"); + + ADD_GROUP("Structured Text", "structured_text_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "structured_text_bidi_override", PROPERTY_HINT_ENUM, "Default,URI,File,Email,List,None,Custom"), "set_structured_text_bidi_override", "get_structured_text_bidi_override"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "structured_text_bidi_override_options"), "set_structured_text_bidi_override_options", "get_structured_text_bidi_override_options"); ADD_SIGNAL(MethodInfo("cursor_changed")); ADD_SIGNAL(MethodInfo("text_changed")); @@ -6785,6 +7147,27 @@ void TextEdit::_bind_methods() { BIND_ENUM_CONSTANT(MENU_SELECT_ALL); BIND_ENUM_CONSTANT(MENU_UNDO); BIND_ENUM_CONSTANT(MENU_REDO); + BIND_ENUM_CONSTANT(MENU_DIR_INHERITED); + BIND_ENUM_CONSTANT(MENU_DIR_AUTO); + BIND_ENUM_CONSTANT(MENU_DIR_LTR); + BIND_ENUM_CONSTANT(MENU_DIR_RTL); + BIND_ENUM_CONSTANT(MENU_DISPLAY_UCC); + BIND_ENUM_CONSTANT(MENU_INSERT_LRM); + BIND_ENUM_CONSTANT(MENU_INSERT_RLM); + BIND_ENUM_CONSTANT(MENU_INSERT_LRE); + BIND_ENUM_CONSTANT(MENU_INSERT_RLE); + BIND_ENUM_CONSTANT(MENU_INSERT_LRO); + BIND_ENUM_CONSTANT(MENU_INSERT_RLO); + BIND_ENUM_CONSTANT(MENU_INSERT_PDF); + BIND_ENUM_CONSTANT(MENU_INSERT_ALM); + BIND_ENUM_CONSTANT(MENU_INSERT_LRI); + BIND_ENUM_CONSTANT(MENU_INSERT_RLI); + BIND_ENUM_CONSTANT(MENU_INSERT_FSI); + BIND_ENUM_CONSTANT(MENU_INSERT_PDI); + BIND_ENUM_CONSTANT(MENU_INSERT_ZWJ); + BIND_ENUM_CONSTANT(MENU_INSERT_ZWNJ); + BIND_ENUM_CONSTANT(MENU_INSERT_WJ); + BIND_ENUM_CONSTANT(MENU_INSERT_SHY); BIND_ENUM_CONSTANT(MENU_MAX); GLOBAL_DEF("gui/timers/text_edit_idle_detect_sec", 3); @@ -6806,8 +7189,8 @@ TextEdit::TextEdit() { wrap_right_offset = 10; set_focus_mode(FOCUS_ALL); _update_caches(); - cache.row_height = 1; cache.line_spacing = 1; + cache.font_size = 16; set_default_cursor_shape(CURSOR_IBEAM); indent_size = 4; @@ -6831,7 +7214,7 @@ TextEdit::TextEdit() { cursor_changed_dirty = false; text_changed_dirty = false; - selection.selecting_mode = Selection::MODE_NONE; + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; selection.selecting_line = 0; selection.selecting_column = 0; selection.selecting_text = false; @@ -6907,9 +7290,43 @@ TextEdit::TextEdit() { shortcut_keys_enabled = true; menu = memnew(PopupMenu); add_child(menu); + + menu_dir = memnew(PopupMenu); + menu_dir->set_name("DirMenu"); + menu_dir->add_radio_check_item(RTR("Same as layout direction"), MENU_DIR_INHERITED); + menu_dir->add_radio_check_item(RTR("Auto-detect direction"), MENU_DIR_AUTO); + menu_dir->add_radio_check_item(RTR("Left-to-right"), MENU_DIR_LTR); + menu_dir->add_radio_check_item(RTR("Right-to-left"), MENU_DIR_RTL); + menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), true); + menu->add_child(menu_dir); + + menu_ctl = memnew(PopupMenu); + menu_ctl->set_name("CTLMenu"); + menu_ctl->add_item(RTR("Left-to-right mark (LRM)"), MENU_INSERT_LRM); + menu_ctl->add_item(RTR("Right-to-left mark (RLM)"), MENU_INSERT_RLM); + menu_ctl->add_item(RTR("Start of left-to-right embedding (LRE)"), MENU_INSERT_LRE); + menu_ctl->add_item(RTR("Start of right-to-left embedding (RLE)"), MENU_INSERT_RLE); + menu_ctl->add_item(RTR("Start of left-to-right override (LRO)"), MENU_INSERT_LRO); + menu_ctl->add_item(RTR("Start of right-to-left override (RLO)"), MENU_INSERT_RLO); + menu_ctl->add_item(RTR("Pop direction formatting (PDF)"), MENU_INSERT_PDF); + menu_ctl->add_separator(); + menu_ctl->add_item(RTR("Arabic letter mark (ALM)"), MENU_INSERT_ALM); + menu_ctl->add_item(RTR("Left-to-right isolate (LRI)"), MENU_INSERT_LRI); + menu_ctl->add_item(RTR("Right-to-left isolate (RLI)"), MENU_INSERT_RLI); + menu_ctl->add_item(RTR("First strong isolate (FSI)"), MENU_INSERT_FSI); + menu_ctl->add_item(RTR("Pop direction isolate (PDI)"), MENU_INSERT_PDI); + menu_ctl->add_separator(); + menu_ctl->add_item(RTR("Zero width joiner (ZWJ)"), MENU_INSERT_ZWJ); + menu_ctl->add_item(RTR("Zero width non-joiner (ZWNJ)"), MENU_INSERT_ZWNJ); + menu_ctl->add_item(RTR("Word joiner (WJ)"), MENU_INSERT_WJ); + menu_ctl->add_item(RTR("Soft hyphen (SHY)"), MENU_INSERT_SHY); + menu->add_child(menu_ctl); + readonly = true; // Initialise to opposite first, so we get past the early-out in set_readonly. set_readonly(false); menu->connect("id_pressed", callable_mp(this, &TextEdit::menu_option)); + menu_dir->connect("id_pressed", callable_mp(this, &TextEdit::menu_option)); + menu_ctl->connect("id_pressed", callable_mp(this, &TextEdit::menu_option)); first_draw = true; } diff --git a/scene/gui/text_edit.h b/scene/gui/text_edit.h index 562f4768ae..3f16ed1366 100644 --- a/scene/gui/text_edit.h +++ b/scene/gui/text_edit.h @@ -36,6 +36,7 @@ #include "scene/gui/scroll_bar.h" #include "scene/main/timer.h" #include "scene/resources/syntax_highlighter.h" +#include "scene/resources/text_paragraph.h" class TextEdit : public Control { GDCLASS(TextEdit, Control); @@ -47,6 +48,14 @@ public: GUTTER_TPYE_CUSTOM }; + enum SelectionMode { + SELECTION_MODE_NONE, + SELECTION_MODE_SHIFT, + SELECTION_MODE_POINTER, + SELECTION_MODE_WORD, + SELECTION_MODE_LINE + }; + private: struct GutterInfo { GutterType type = GutterType::GUTTER_TYPE_STRING; @@ -79,47 +88,68 @@ private: struct Line { Vector<Gutter> gutters; - int32_t width_cache; + String data; + Vector<Vector2i> bidi_override; + Ref<TextParagraph> data_buf; + bool marked; bool hidden; - int32_t wrap_amount_cache; - String data; + Line() { - width_cache = 0; + data_buf.instance(); + marked = false; hidden = false; - wrap_amount_cache = 0; } }; private: mutable Vector<Line> text; Ref<Font> font; + int font_size = -1; + + Dictionary opentype_features; + String language; + TextServer::Direction direction = TextServer::DIRECTION_AUTO; + bool draw_control_chars = false; + + int width = -1; + int indent_size = 4; int gutter_count = 0; - void _update_line_cache(int p_line) const; - public: void set_indent_size(int p_indent_size); void set_font(const Ref<Font> &p_font); + void set_font_size(int p_font_size); + void set_font_features(const Dictionary &p_features); + void set_direction_and_language(TextServer::Direction p_direction, String p_language); + void set_draw_control_chars(bool p_draw_control_chars); + + int get_line_height(int p_line, int p_wrap_index) const; int get_line_width(int p_line) const; int get_max_width(bool p_exclude_hidden = false) const; - int get_char_width(char32_t c, char32_t next_c, int px) const; - void set_line_wrap_amount(int p_line, int p_wrap_amount) const; + + void set_width(float p_width); int get_line_wrap_amount(int p_line) const; - void set(int p_line, const String &p_text); + Vector<Vector2i> get_line_wrap_ranges(int p_line) const; + const Ref<TextParagraph> get_line_data(int p_line) const; + + void set(int p_line, const String &p_text, const Vector<Vector2i> &p_bidi_override); void set_marked(int p_line, bool p_marked) { text.write[p_line].marked = p_marked; } bool is_marked(int p_line) const { return text[p_line].marked; } void set_hidden(int p_line, bool p_hidden) { text.write[p_line].hidden = p_hidden; } bool is_hidden(int p_line) const { return text[p_line].hidden; } - void insert(int p_at, const String &p_text); + void insert(int p_at, const String &p_text, const Vector<Vector2i> &p_bidi_override); void remove(int p_at); int size() const { return text.size(); } void clear(); - void clear_width_cache(); - void clear_wrap_cache(); - _FORCE_INLINE_ const String &operator[](int p_line) const { return text[p_line].data; } + + void invalidate_cache(int p_line, int p_column = -1, const String &p_ime_text = String(), const Vector<Vector2i> &p_bidi_override = Vector<Vector2i>()); + void invalidate_all(); + void invalidate_all_lines(); + + _FORCE_INLINE_ const String &operator[](int p_line) const; /* Gutters. */ void add_gutter(int p_at); @@ -157,16 +187,7 @@ private: } cursor; struct Selection { - enum Mode { - - MODE_NONE, - MODE_SHIFT, - MODE_POINTER, - MODE_WORD, - MODE_LINE - }; - - Mode selecting_mode; + SelectionMode selecting_mode; int selecting_line, selecting_column; int selected_word_beg, selected_word_end, selected_word_origin; bool selecting_text; @@ -178,7 +199,7 @@ private: bool shiftclick_left; Selection() { - selecting_mode = MODE_NONE; + selecting_mode = SelectionMode::SELECTION_MODE_NONE; selecting_line = 0; selecting_column = 0; selected_word_beg = 0; @@ -261,6 +282,14 @@ private: // data Text text; + Dictionary opentype_features; + String language; + TextDirection text_direction = TEXT_DIRECTION_AUTO; + TextDirection input_direction = TEXT_DIRECTION_LTR; + Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; + Array st_args; + bool draw_control_chars = false; + uint32_t version; uint32_t saved_version; @@ -276,6 +305,7 @@ private: bool window_has_focus; bool block_caret; bool right_click_moves_caret; + bool mid_grapheme_caret_enabled = false; bool wrap_enabled; int wrap_at; @@ -357,7 +387,7 @@ private: int _get_minimap_visible_rows() const; void update_cursor_wrap_offset(); - void _update_wrap_at(); + void _update_wrap_at(bool p_force = false); bool line_wraps(int line) const; int times_line_wraps(int line) const; Vector<String> get_wrap_rows_text(int p_line) const; @@ -377,8 +407,6 @@ private: int get_char_pos_for_line(int p_px, int p_line, int p_wrap_index = 0) const; int get_column_x_offset_for_line(int p_char, int p_line) const; - int get_char_pos_for(int p_px, String p_str) const; - int get_column_x_offset(int p_char, String p_str) const; void adjust_viewport_to_cursor(); double get_scroll_line_diff() const; @@ -406,6 +434,8 @@ private: Size2 get_minimum_size() const override; int _get_control_height() const; + Point2 _get_local_mouse_pos() const; + void _reset_caret_blink_timer(); void _toggle_draw_caret(); @@ -426,6 +456,8 @@ private: Dictionary _search_bind(const String &p_key, uint32_t p_search_flags, int p_from_line, int p_from_column) const; PopupMenu *menu; + PopupMenu *menu_dir; + PopupMenu *menu_ctl; void _clear(); void _cancel_completion(); @@ -445,6 +477,7 @@ protected: Ref<StyleBox> style_focus; Ref<StyleBox> style_readonly; Ref<Font> font; + int font_size; Color completion_background_color; Color completion_selected_color; Color completion_existing_color; @@ -465,11 +498,9 @@ protected: Color search_result_border_color; Color background_color; - int row_height; int line_spacing; int minimap_width; Cache() { - row_height = 0; line_spacing = 0; minimap_width = 0; } @@ -488,6 +519,10 @@ protected: static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: /* Syntax Highlighting. */ Ref<SyntaxHighlighter> get_syntax_highlighter(); @@ -542,6 +577,27 @@ public: MENU_SELECT_ALL, MENU_UNDO, MENU_REDO, + MENU_DIR_INHERITED, + MENU_DIR_AUTO, + MENU_DIR_LTR, + MENU_DIR_RTL, + MENU_DISPLAY_UCC, + MENU_INSERT_LRM, + MENU_INSERT_RLM, + MENU_INSERT_LRE, + MENU_INSERT_RLE, + MENU_INSERT_LRO, + MENU_INSERT_RLO, + MENU_INSERT_PDF, + MENU_INSERT_ALM, + MENU_INSERT_LRI, + MENU_INSERT_RLI, + MENU_INSERT_FSI, + MENU_INSERT_PDI, + MENU_INSERT_ZWJ, + MENU_INSERT_ZWNJ, + MENU_INSERT_WJ, + MENU_INSERT_SHY, MENU_MAX }; @@ -565,6 +621,25 @@ public: bool is_insert_text_operation(); + void set_text_direction(TextDirection p_text_direction); + TextDirection get_text_direction() const; + + void set_opentype_feature(const String &p_name, int p_value); + int get_opentype_feature(const String &p_name) const; + void clear_opentype_features(); + + void set_language(const String &p_language); + String get_language() const; + + void set_draw_control_chars(bool p_draw_control_chars); + bool get_draw_control_chars() const; + + void set_structured_text_bidi_override(Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override() const; + + void set_structured_text_bidi_override_options(Array p_args); + Array get_structured_text_bidi_override_options() const; + void set_highlighted_word(const String &new_word); void set_text(String p_text); void insert_text_at_cursor(const String &p_text); @@ -617,12 +692,15 @@ public: void center_viewport_to_cursor(); + void set_mid_grapheme_caret_enabled(const bool p_enabled); + bool get_mid_grapheme_caret_enabled() const; + void cursor_set_column(int p_col, bool p_adjust_viewport = true); void cursor_set_line(int p_row, bool p_adjust_viewport = true, bool p_can_be_hidden = true, int p_wrap_index = 0); int cursor_get_column() const; int cursor_get_line() const; - Vector2i _get_cursor_pixel_pos(); + Vector2i _get_cursor_pixel_pos(bool p_adjust_viewport = true); bool cursor_get_blink_enabled() const; void cursor_set_blink_enabled(const bool p_enabled); @@ -636,6 +714,11 @@ public: void set_right_click_moves_caret(bool p_enable); bool is_right_click_moving_caret() const; + SelectionMode get_selection_mode() const; + void set_selection_mode(SelectionMode p_mode, int p_line = -1, int p_column = -1); + int get_selection_line() const; + int get_selection_column() const; + void set_readonly(bool p_readonly); bool is_readonly() const; @@ -761,6 +844,7 @@ public: }; VARIANT_ENUM_CAST(TextEdit::GutterType); +VARIANT_ENUM_CAST(TextEdit::SelectionMode); VARIANT_ENUM_CAST(TextEdit::MenuItems); VARIANT_ENUM_CAST(TextEdit::SearchFlags); diff --git a/scene/gui/texture_progress.cpp b/scene/gui/texture_progress_bar.cpp index 484b14d11c..b5115690ac 100644 --- a/scene/gui/texture_progress.cpp +++ b/scene/gui/texture_progress_bar.cpp @@ -1,5 +1,5 @@ /*************************************************************************/ -/* texture_progress.cpp */ +/* texture_progress_bar.cpp */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,21 +28,21 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#include "texture_progress.h" +#include "texture_progress_bar.h" -#include "core/engine.h" +#include "core/config/engine.h" -void TextureProgress::set_under_texture(const Ref<Texture2D> &p_texture) { +void TextureProgressBar::set_under_texture(const Ref<Texture2D> &p_texture) { under = p_texture; update(); minimum_size_changed(); } -Ref<Texture2D> TextureProgress::get_under_texture() const { +Ref<Texture2D> TextureProgressBar::get_under_texture() const { return under; } -void TextureProgress::set_over_texture(const Ref<Texture2D> &p_texture) { +void TextureProgressBar::set_over_texture(const Ref<Texture2D> &p_texture) { over = p_texture; update(); if (under.is_null()) { @@ -50,33 +50,33 @@ void TextureProgress::set_over_texture(const Ref<Texture2D> &p_texture) { } } -Ref<Texture2D> TextureProgress::get_over_texture() const { +Ref<Texture2D> TextureProgressBar::get_over_texture() const { return over; } -void TextureProgress::set_stretch_margin(Margin p_margin, int p_size) { +void TextureProgressBar::set_stretch_margin(Margin p_margin, int p_size) { ERR_FAIL_INDEX((int)p_margin, 4); stretch_margin[p_margin] = p_size; update(); minimum_size_changed(); } -int TextureProgress::get_stretch_margin(Margin p_margin) const { +int TextureProgressBar::get_stretch_margin(Margin p_margin) const { ERR_FAIL_INDEX_V((int)p_margin, 4, 0); return stretch_margin[p_margin]; } -void TextureProgress::set_nine_patch_stretch(bool p_stretch) { +void TextureProgressBar::set_nine_patch_stretch(bool p_stretch) { nine_patch_stretch = p_stretch; update(); minimum_size_changed(); } -bool TextureProgress::get_nine_patch_stretch() const { +bool TextureProgressBar::get_nine_patch_stretch() const { return nine_patch_stretch; } -Size2 TextureProgress::get_minimum_size() const { +Size2 TextureProgressBar::get_minimum_size() const { if (nine_patch_stretch) { return Size2(stretch_margin[MARGIN_LEFT] + stretch_margin[MARGIN_RIGHT], stretch_margin[MARGIN_TOP] + stretch_margin[MARGIN_BOTTOM]); } else if (under.is_valid()) { @@ -90,44 +90,44 @@ Size2 TextureProgress::get_minimum_size() const { return Size2(1, 1); } -void TextureProgress::set_progress_texture(const Ref<Texture2D> &p_texture) { +void TextureProgressBar::set_progress_texture(const Ref<Texture2D> &p_texture) { progress = p_texture; update(); minimum_size_changed(); } -Ref<Texture2D> TextureProgress::get_progress_texture() const { +Ref<Texture2D> TextureProgressBar::get_progress_texture() const { return progress; } -void TextureProgress::set_tint_under(const Color &p_tint) { +void TextureProgressBar::set_tint_under(const Color &p_tint) { tint_under = p_tint; update(); } -Color TextureProgress::get_tint_under() const { +Color TextureProgressBar::get_tint_under() const { return tint_under; } -void TextureProgress::set_tint_progress(const Color &p_tint) { +void TextureProgressBar::set_tint_progress(const Color &p_tint) { tint_progress = p_tint; update(); } -Color TextureProgress::get_tint_progress() const { +Color TextureProgressBar::get_tint_progress() const { return tint_progress; } -void TextureProgress::set_tint_over(const Color &p_tint) { +void TextureProgressBar::set_tint_over(const Color &p_tint) { tint_over = p_tint; update(); } -Color TextureProgress::get_tint_over() const { +Color TextureProgressBar::get_tint_over() const { return tint_over; } -Point2 TextureProgress::unit_val_to_uv(float val) { +Point2 TextureProgressBar::unit_val_to_uv(float val) { if (progress.is_null()) { return Point2(); } @@ -191,7 +191,7 @@ Point2 TextureProgress::unit_val_to_uv(float val) { return (p + t1 * dir); } -Point2 TextureProgress::get_relative_center() { +Point2 TextureProgressBar::get_relative_center() { if (progress.is_null()) { return Point2(); } @@ -204,7 +204,7 @@ Point2 TextureProgress::get_relative_center() { return p; } -void TextureProgress::draw_nine_patch_stretched(const Ref<Texture2D> &p_texture, FillMode p_mode, double p_ratio, const Color &p_modulate) { +void TextureProgressBar::draw_nine_patch_stretched(const Ref<Texture2D> &p_texture, FillMode p_mode, double p_ratio, const Color &p_modulate) { Vector2 texture_size = p_texture->get_size(); Vector2 topleft = Vector2(stretch_margin[MARGIN_LEFT], stretch_margin[MARGIN_TOP]); Vector2 bottomright = Vector2(stretch_margin[MARGIN_RIGHT], stretch_margin[MARGIN_BOTTOM]); @@ -306,7 +306,7 @@ void TextureProgress::draw_nine_patch_stretched(const Ref<Texture2D> &p_texture, RS::get_singleton()->canvas_item_add_nine_patch(ci, dst_rect, src_rect, p_texture->get_rid(), topleft, bottomright, RS::NINE_PATCH_STRETCH, RS::NINE_PATCH_STRETCH, true, p_modulate); } -void TextureProgress::_notification(int p_what) { +void TextureProgressBar::_notification(int p_what) { const float corners[12] = { -0.125, -0.375, -0.625, -0.875, 0.125, 0.375, 0.625, 0.875, 1.125, 1.375, 1.625, 1.875 }; switch (p_what) { case NOTIFICATION_DRAW: { @@ -428,17 +428,17 @@ void TextureProgress::_notification(int p_what) { } } -void TextureProgress::set_fill_mode(int p_fill) { +void TextureProgressBar::set_fill_mode(int p_fill) { ERR_FAIL_INDEX(p_fill, 9); mode = (FillMode)p_fill; update(); } -int TextureProgress::get_fill_mode() { +int TextureProgressBar::get_fill_mode() { return mode; } -void TextureProgress::set_radial_initial_angle(float p_angle) { +void TextureProgressBar::set_radial_initial_angle(float p_angle) { while (p_angle > 360) { p_angle -= 360; } @@ -449,64 +449,64 @@ void TextureProgress::set_radial_initial_angle(float p_angle) { update(); } -float TextureProgress::get_radial_initial_angle() { +float TextureProgressBar::get_radial_initial_angle() { return rad_init_angle; } -void TextureProgress::set_fill_degrees(float p_angle) { +void TextureProgressBar::set_fill_degrees(float p_angle) { rad_max_degrees = CLAMP(p_angle, 0, 360); update(); } -float TextureProgress::get_fill_degrees() { +float TextureProgressBar::get_fill_degrees() { return rad_max_degrees; } -void TextureProgress::set_radial_center_offset(const Point2 &p_off) { +void TextureProgressBar::set_radial_center_offset(const Point2 &p_off) { rad_center_off = p_off; update(); } -Point2 TextureProgress::get_radial_center_offset() { +Point2 TextureProgressBar::get_radial_center_offset() { return rad_center_off; } -void TextureProgress::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_under_texture", "tex"), &TextureProgress::set_under_texture); - ClassDB::bind_method(D_METHOD("get_under_texture"), &TextureProgress::get_under_texture); +void TextureProgressBar::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_under_texture", "tex"), &TextureProgressBar::set_under_texture); + ClassDB::bind_method(D_METHOD("get_under_texture"), &TextureProgressBar::get_under_texture); - ClassDB::bind_method(D_METHOD("set_progress_texture", "tex"), &TextureProgress::set_progress_texture); - ClassDB::bind_method(D_METHOD("get_progress_texture"), &TextureProgress::get_progress_texture); + ClassDB::bind_method(D_METHOD("set_progress_texture", "tex"), &TextureProgressBar::set_progress_texture); + ClassDB::bind_method(D_METHOD("get_progress_texture"), &TextureProgressBar::get_progress_texture); - ClassDB::bind_method(D_METHOD("set_over_texture", "tex"), &TextureProgress::set_over_texture); - ClassDB::bind_method(D_METHOD("get_over_texture"), &TextureProgress::get_over_texture); + ClassDB::bind_method(D_METHOD("set_over_texture", "tex"), &TextureProgressBar::set_over_texture); + ClassDB::bind_method(D_METHOD("get_over_texture"), &TextureProgressBar::get_over_texture); - ClassDB::bind_method(D_METHOD("set_fill_mode", "mode"), &TextureProgress::set_fill_mode); - ClassDB::bind_method(D_METHOD("get_fill_mode"), &TextureProgress::get_fill_mode); + ClassDB::bind_method(D_METHOD("set_fill_mode", "mode"), &TextureProgressBar::set_fill_mode); + ClassDB::bind_method(D_METHOD("get_fill_mode"), &TextureProgressBar::get_fill_mode); - ClassDB::bind_method(D_METHOD("set_tint_under", "tint"), &TextureProgress::set_tint_under); - ClassDB::bind_method(D_METHOD("get_tint_under"), &TextureProgress::get_tint_under); + ClassDB::bind_method(D_METHOD("set_tint_under", "tint"), &TextureProgressBar::set_tint_under); + ClassDB::bind_method(D_METHOD("get_tint_under"), &TextureProgressBar::get_tint_under); - ClassDB::bind_method(D_METHOD("set_tint_progress", "tint"), &TextureProgress::set_tint_progress); - ClassDB::bind_method(D_METHOD("get_tint_progress"), &TextureProgress::get_tint_progress); + ClassDB::bind_method(D_METHOD("set_tint_progress", "tint"), &TextureProgressBar::set_tint_progress); + ClassDB::bind_method(D_METHOD("get_tint_progress"), &TextureProgressBar::get_tint_progress); - ClassDB::bind_method(D_METHOD("set_tint_over", "tint"), &TextureProgress::set_tint_over); - ClassDB::bind_method(D_METHOD("get_tint_over"), &TextureProgress::get_tint_over); + ClassDB::bind_method(D_METHOD("set_tint_over", "tint"), &TextureProgressBar::set_tint_over); + ClassDB::bind_method(D_METHOD("get_tint_over"), &TextureProgressBar::get_tint_over); - ClassDB::bind_method(D_METHOD("set_radial_initial_angle", "mode"), &TextureProgress::set_radial_initial_angle); - ClassDB::bind_method(D_METHOD("get_radial_initial_angle"), &TextureProgress::get_radial_initial_angle); + ClassDB::bind_method(D_METHOD("set_radial_initial_angle", "mode"), &TextureProgressBar::set_radial_initial_angle); + ClassDB::bind_method(D_METHOD("get_radial_initial_angle"), &TextureProgressBar::get_radial_initial_angle); - ClassDB::bind_method(D_METHOD("set_radial_center_offset", "mode"), &TextureProgress::set_radial_center_offset); - ClassDB::bind_method(D_METHOD("get_radial_center_offset"), &TextureProgress::get_radial_center_offset); + ClassDB::bind_method(D_METHOD("set_radial_center_offset", "mode"), &TextureProgressBar::set_radial_center_offset); + ClassDB::bind_method(D_METHOD("get_radial_center_offset"), &TextureProgressBar::get_radial_center_offset); - ClassDB::bind_method(D_METHOD("set_fill_degrees", "mode"), &TextureProgress::set_fill_degrees); - ClassDB::bind_method(D_METHOD("get_fill_degrees"), &TextureProgress::get_fill_degrees); + ClassDB::bind_method(D_METHOD("set_fill_degrees", "mode"), &TextureProgressBar::set_fill_degrees); + ClassDB::bind_method(D_METHOD("get_fill_degrees"), &TextureProgressBar::get_fill_degrees); - ClassDB::bind_method(D_METHOD("set_stretch_margin", "margin", "value"), &TextureProgress::set_stretch_margin); - ClassDB::bind_method(D_METHOD("get_stretch_margin", "margin"), &TextureProgress::get_stretch_margin); + ClassDB::bind_method(D_METHOD("set_stretch_margin", "margin", "value"), &TextureProgressBar::set_stretch_margin); + ClassDB::bind_method(D_METHOD("get_stretch_margin", "margin"), &TextureProgressBar::get_stretch_margin); - ClassDB::bind_method(D_METHOD("set_nine_patch_stretch", "stretch"), &TextureProgress::set_nine_patch_stretch); - ClassDB::bind_method(D_METHOD("get_nine_patch_stretch"), &TextureProgress::get_nine_patch_stretch); + ClassDB::bind_method(D_METHOD("set_nine_patch_stretch", "stretch"), &TextureProgressBar::set_nine_patch_stretch); + ClassDB::bind_method(D_METHOD("get_nine_patch_stretch"), &TextureProgressBar::get_nine_patch_stretch); ADD_GROUP("Textures", "texture_"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture_under", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_under_texture", "get_under_texture"); @@ -539,7 +539,7 @@ void TextureProgress::_bind_methods() { BIND_ENUM_CONSTANT(FILL_CLOCKWISE_AND_COUNTER_CLOCKWISE); } -TextureProgress::TextureProgress() { +TextureProgressBar::TextureProgressBar() { mode = FILL_LEFT_TO_RIGHT; rad_init_angle = 0; rad_center_off = Point2(); diff --git a/scene/gui/texture_progress.h b/scene/gui/texture_progress_bar.h index 5e29fca21f..342e719a59 100644 --- a/scene/gui/texture_progress.h +++ b/scene/gui/texture_progress_bar.h @@ -1,5 +1,5 @@ /*************************************************************************/ -/* texture_progress.h */ +/* texture_progress_bar.h */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,13 +28,13 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef TEXTURE_PROGRESS_H -#define TEXTURE_PROGRESS_H +#ifndef TEXTURE_PROGRESS_BAR_H +#define TEXTURE_PROGRESS_BAR_H #include "scene/gui/range.h" -class TextureProgress : public Range { - GDCLASS(TextureProgress, Range); +class TextureProgressBar : public Range { + GDCLASS(TextureProgressBar, Range); Ref<Texture2D> under; Ref<Texture2D> progress; @@ -95,7 +95,7 @@ public: Size2 get_minimum_size() const override; - TextureProgress(); + TextureProgressBar(); private: FillMode mode; @@ -111,6 +111,6 @@ private: void draw_nine_patch_stretched(const Ref<Texture2D> &p_texture, FillMode p_mode, double p_ratio, const Color &p_modulate); }; -VARIANT_ENUM_CAST(TextureProgress::FillMode); +VARIANT_ENUM_CAST(TextureProgressBar::FillMode); -#endif // TEXTURE_PROGRESS_H +#endif // TEXTURE_PROGRESS_BAR_H diff --git a/scene/gui/texture_rect.h b/scene/gui/texture_rect.h index efd3f0698a..e39545f679 100644 --- a/scene/gui/texture_rect.h +++ b/scene/gui/texture_rect.h @@ -28,8 +28,8 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef TEXTURE_FRAME_H -#define TEXTURE_FRAME_H +#ifndef TEXTURE_RECT_H +#define TEXTURE_RECT_H #include "scene/gui/control.h" @@ -83,4 +83,5 @@ public: }; VARIANT_ENUM_CAST(TextureRect::StretchMode); -#endif // TEXTURE_FRAME_H + +#endif // TEXTURE_RECT_H diff --git a/scene/gui/tree.cpp b/scene/gui/tree.cpp index f6636cf392..063a5e7ac1 100644 --- a/scene/gui/tree.cpp +++ b/scene/gui/tree.cpp @@ -30,12 +30,13 @@ #include "tree.h" +#include "core/config/project_settings.h" #include "core/input/input.h" #include "core/math/math_funcs.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" -#include "core/project_settings.h" +#include "core/string/print_string.h" +#include "core/string/translation.h" #include "scene/main/window.h" #include "box_container.h" @@ -129,6 +130,7 @@ void TreeItem::set_cell_mode(int p_column, TreeCellMode p_mode) { c.checked = false; c.icon = Ref<Texture2D>(); c.text = ""; + c.dirty = true; c.icon_max_w = 0; _changed_notify(p_column); } @@ -153,6 +155,7 @@ bool TreeItem::is_checked(int p_column) const { void TreeItem::set_text(int p_column, String p_text) { ERR_FAIL_INDEX(p_column, cells.size()); cells.write[p_column].text = p_text; + cells.write[p_column].dirty = true; if (cells[p_column].mode == TreeItem::CELL_MODE_RANGE) { Vector<String> strings = p_text.split(","); @@ -176,6 +179,87 @@ String TreeItem::get_text(int p_column) const { return cells[p_column].text; } +void TreeItem::set_text_direction(int p_column, Control::TextDirection p_text_direction) { + ERR_FAIL_INDEX(p_column, cells.size()); + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (cells[p_column].text_direction != p_text_direction) { + cells.write[p_column].text_direction = p_text_direction; + cells.write[p_column].dirty = true; + _changed_notify(p_column); + } +} + +Control::TextDirection TreeItem::get_text_direction(int p_column) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), Control::TEXT_DIRECTION_INHERITED); + return cells[p_column].text_direction; +} + +void TreeItem::clear_opentype_features(int p_column) { + ERR_FAIL_INDEX(p_column, cells.size()); + cells.write[p_column].opentype_features.clear(); + cells.write[p_column].dirty = true; + _changed_notify(p_column); +} + +void TreeItem::set_opentype_feature(int p_column, const String &p_name, int p_value) { + ERR_FAIL_INDEX(p_column, cells.size()); + int32_t tag = TS->name_to_tag(p_name); + if (!cells[p_column].opentype_features.has(tag) || (int)cells[p_column].opentype_features[tag] != p_value) { + cells.write[p_column].opentype_features[tag] = p_value; + cells.write[p_column].dirty = true; + _changed_notify(p_column); + } +} + +int TreeItem::get_opentype_feature(int p_column, const String &p_name) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), -1); + int32_t tag = TS->name_to_tag(p_name); + if (!cells[p_column].opentype_features.has(tag)) { + return -1; + } + return cells[p_column].opentype_features[tag]; +} + +void TreeItem::set_structured_text_bidi_override(int p_column, Control::StructuredTextParser p_parser) { + ERR_FAIL_INDEX(p_column, cells.size()); + if (cells[p_column].st_parser != p_parser) { + cells.write[p_column].st_parser = p_parser; + cells.write[p_column].dirty = true; + _changed_notify(p_column); + } +} + +Control::StructuredTextParser TreeItem::get_structured_text_bidi_override(int p_column) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), Control::STRUCTURED_TEXT_NONE); + return cells[p_column].st_parser; +} + +void TreeItem::set_structured_text_bidi_override_options(int p_column, Array p_args) { + ERR_FAIL_INDEX(p_column, cells.size()); + cells.write[p_column].st_args = p_args; + cells.write[p_column].dirty = true; + _changed_notify(p_column); +} + +Array TreeItem::get_structured_text_bidi_override_options(int p_column) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), Array()); + return cells[p_column].st_args; +} + +void TreeItem::set_language(int p_column, const String &p_language) { + ERR_FAIL_INDEX(p_column, cells.size()); + if (cells[p_column].language != p_language) { + cells.write[p_column].language = p_language; + cells.write[p_column].dirty = true; + _changed_notify(p_column); + } +} + +String TreeItem::get_language(int p_column) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), ""); + return cells[p_column].language; +} + void TreeItem::set_suffix(int p_column, String p_suffix) { ERR_FAIL_INDEX(p_column, cells.size()); cells.write[p_column].suffix = p_suffix; @@ -246,6 +330,7 @@ void TreeItem::set_range(int p_column, double p_value) { } cells.write[p_column].val = p_value; + cells.write[p_column].dirty = true; _changed_notify(p_column); } @@ -512,12 +597,6 @@ String TreeItem::get_button_tooltip(int p_column, int p_idx) const { return cells[p_column].buttons[p_idx].tooltip; } -int TreeItem::get_button_id(int p_column, int p_idx) const { - ERR_FAIL_INDEX_V(p_column, cells.size(), -1); - ERR_FAIL_INDEX_V(p_idx, cells[p_column].buttons.size(), -1); - return cells[p_column].buttons[p_idx].id; -} - void TreeItem::erase_button(int p_column, int p_idx) { ERR_FAIL_INDEX(p_column, cells.size()); ERR_FAIL_INDEX(p_idx, cells[p_column].buttons.size()); @@ -719,6 +798,22 @@ void TreeItem::_bind_methods() { ClassDB::bind_method(D_METHOD("set_text", "column", "text"), &TreeItem::set_text); ClassDB::bind_method(D_METHOD("get_text", "column"), &TreeItem::get_text); + ClassDB::bind_method(D_METHOD("set_text_direction", "column", "direction"), &TreeItem::set_text_direction); + ClassDB::bind_method(D_METHOD("get_text_direction", "column"), &TreeItem::get_text_direction); + + ClassDB::bind_method(D_METHOD("set_opentype_feature", "column", "tag", "value"), &TreeItem::set_opentype_feature); + ClassDB::bind_method(D_METHOD("get_opentype_feature", "column", "tag"), &TreeItem::get_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_opentype_features", "column"), &TreeItem::clear_opentype_features); + + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override", "column", "parser"), &TreeItem::set_structured_text_bidi_override); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override", "column"), &TreeItem::get_structured_text_bidi_override); + + ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "column", "args"), &TreeItem::set_structured_text_bidi_override_options); + ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options", "column"), &TreeItem::get_structured_text_bidi_override_options); + + ClassDB::bind_method(D_METHOD("set_language", "column", "language"), &TreeItem::set_language); + ClassDB::bind_method(D_METHOD("get_language", "column"), &TreeItem::get_language); + ClassDB::bind_method(D_METHOD("set_suffix", "column", "text"), &TreeItem::set_suffix); ClassDB::bind_method(D_METHOD("get_suffix", "column"), &TreeItem::get_suffix); @@ -896,7 +991,9 @@ TreeItem::~TreeItem() { void Tree::update_cache() { cache.font = get_theme_font("font"); + cache.font_size = get_theme_font_size("font_size"); cache.tb_font = get_theme_font("title_button_font"); + cache.tb_font_size = get_theme_font_size("title_button_font_size"); cache.bg = get_theme_stylebox("bg"); cache.selected = get_theme_stylebox("selected"); cache.selected_focus = get_theme_stylebox("selected_focus"); @@ -906,7 +1003,11 @@ void Tree::update_cache() { cache.checked = get_theme_icon("checked"); cache.unchecked = get_theme_icon("unchecked"); - cache.arrow_collapsed = get_theme_icon("arrow_collapsed"); + if (is_layout_rtl()) { + cache.arrow_collapsed = get_theme_icon("arrow_collapsed_mirrored"); + } else { + cache.arrow_collapsed = get_theme_icon("arrow_collapsed"); + } cache.arrow = get_theme_icon("arrow"); cache.select_arrow = get_theme_icon("select_arrow"); cache.updown = get_theme_icon("updown"); @@ -935,7 +1036,7 @@ void Tree::update_cache() { cache.title_button_hover = get_theme_stylebox("title_button_hover"); cache.title_button_color = get_theme_color("title_button_color"); - v_scroll->set_custom_step(cache.font->get_height()); + v_scroll->set_custom_step(cache.font->get_height(cache.font_size)); } int Tree::compute_item_height(TreeItem *p_item) const { @@ -944,9 +1045,13 @@ int Tree::compute_item_height(TreeItem *p_item) const { } ERR_FAIL_COND_V(cache.font.is_null(), 0); - int height = cache.font->get_height(); + int height = 0; for (int i = 0; i < columns.size(); i++) { + if (p_item->cells[i].dirty) { + const_cast<Tree *>(this)->update_item_cell(p_item, i); + } + height = MAX(height, p_item->cells[i].text_buf->get_size().y); for (int j = 0; j < p_item->cells[i].buttons.size(); j++) { Size2i s; // = cache.button_pressed->get_minimum_size(); s += p_item->cells[i].buttons[j].texture->get_size(); @@ -1013,39 +1118,53 @@ int Tree::get_item_height(TreeItem *p_item) const { return height; } -void Tree::draw_item_rect(const TreeItem::Cell &p_cell, const Rect2i &p_rect, const Color &p_color, const Color &p_icon_color) { +void Tree::draw_item_rect(TreeItem::Cell &p_cell, const Rect2i &p_rect, const Color &p_color, const Color &p_icon_color) { ERR_FAIL_COND(cache.font.is_null()); Rect2i rect = p_rect; - Ref<Font> font = cache.font; - String text = p_cell.text; - if (p_cell.suffix != String()) { - text += " " + p_cell.suffix; - } + Size2 ts = p_cell.text_buf->get_size(); + bool rtl = is_layout_rtl(); int w = 0; if (!p_cell.icon.is_null()) { Size2i bmsize = p_cell.get_icon_size(); - if (p_cell.icon_max_w > 0 && bmsize.width > p_cell.icon_max_w) { bmsize.width = p_cell.icon_max_w; } w += bmsize.width + cache.hseparation; + if (rect.size.width > 0 && (w + ts.width) > rect.size.width) { + ts.width = rect.size.width - w; + } } - w += font->get_string_size(text).width; + w += ts.width; switch (p_cell.text_align) { case TreeItem::ALIGN_LEFT: - break; //do none + if (rtl) { + rect.position.x += MAX(0, (rect.size.width - w)); + } + break; case TreeItem::ALIGN_CENTER: rect.position.x += MAX(0, (rect.size.width - w) / 2); - break; //do none + break; case TreeItem::ALIGN_RIGHT: - rect.position.x += MAX(0, (rect.size.width - w)); - break; //do none + if (!rtl) { + rect.position.x += MAX(0, (rect.size.width - w)); + } + break; } RID ci = get_canvas_item(); + + if (rtl) { + Point2 draw_pos = rect.position; + draw_pos.y += Math::floor((rect.size.y - p_cell.text_buf->get_size().y) / 2.0); + p_cell.text_buf->set_width(MAX(0, rect.size.width)); + p_cell.text_buf->draw(ci, draw_pos, p_color); + rect.position.x += ts.width + cache.hseparation; + rect.size.x -= ts.width + cache.hseparation; + } + if (!p_cell.icon.is_null()) { Size2i bmsize = p_cell.get_icon_size(); @@ -1059,8 +1178,80 @@ void Tree::draw_item_rect(const TreeItem::Cell &p_cell, const Rect2i &p_rect, co rect.size.x -= bmsize.x + cache.hseparation; } - rect.position.y += Math::floor((rect.size.y - font->get_height()) / 2.0) + font->get_ascent(); - font->draw(ci, rect.position, text, p_color, MAX(0, rect.size.width)); + if (!rtl) { + Point2 draw_pos = rect.position; + draw_pos.y += Math::floor((rect.size.y - p_cell.text_buf->get_size().y) / 2.0); + p_cell.text_buf->set_width(MAX(0, rect.size.width)); + p_cell.text_buf->draw(ci, draw_pos, p_color); + } +} + +void Tree::update_column(int p_col) { + columns.write[p_col].text_buf->clear(); + if (columns[p_col].text_direction == Control::TEXT_DIRECTION_INHERITED) { + columns.write[p_col].text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + columns.write[p_col].text_buf->set_direction((TextServer::Direction)columns[p_col].text_direction); + } + columns.write[p_col].text_buf->add_string(columns[p_col].title, cache.font, cache.font_size, columns[p_col].opentype_features, (columns[p_col].language != "") ? columns[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); +} + +void Tree::update_item_cell(TreeItem *p_item, int p_col) { + String valtext; + + p_item->cells.write[p_col].text_buf->clear(); + if (p_item->cells[p_col].mode == TreeItem::CELL_MODE_RANGE) { + if (p_item->cells[p_col].text != "") { + if (!p_item->cells[p_col].editable) { + return; + } + + int option = (int)p_item->cells[p_col].val; + + valtext = RTR("(Other)"); + Vector<String> strings = p_item->cells[p_col].text.split(","); + for (int j = 0; j < strings.size(); j++) { + int value = j; + if (!strings[j].get_slicec(':', 1).empty()) { + value = strings[j].get_slicec(':', 1).to_int(); + } + if (option == value) { + valtext = strings[j].get_slicec(':', 0); + break; + } + } + + } else { + valtext = String::num(p_item->cells[p_col].val, Math::range_step_decimals(p_item->cells[p_col].step)); + } + } else { + valtext = p_item->cells[p_col].text; + } + + if (p_item->cells[p_col].suffix != String()) { + valtext += " " + p_item->cells[p_col].suffix; + } + + if (p_item->cells[p_col].text_direction == Control::TEXT_DIRECTION_INHERITED) { + p_item->cells.write[p_col].text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + } else { + p_item->cells.write[p_col].text_buf->set_direction((TextServer::Direction)p_item->cells[p_col].text_direction); + } + p_item->cells.write[p_col].text_buf->add_string(valtext, cache.font, cache.font_size, p_item->cells[p_col].opentype_features, (p_item->cells[p_col].language != "") ? p_item->cells[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); + TS->shaped_text_set_bidi_override(p_item->cells[p_col].text_buf->get_rid(), structured_text_parser(p_item->cells[p_col].st_parser, p_item->cells[p_col].st_args, valtext)); + p_item->cells.write[p_col].dirty = false; +} + +void Tree::update_item_cache(TreeItem *p_item) { + for (int i = 0; i < p_item->cells.size(); i++) { + update_item_cell(p_item, i); + } + + TreeItem *c = p_item->children; + while (c) { + update_item_cache(c); + c = c->next; + } } int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 &p_draw_size, TreeItem *p_item) { @@ -1073,6 +1264,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 int htotal = 0; int label_h = compute_item_height(p_item); + bool rtl = is_layout_rtl(); /* Calculate height of the label part */ label_h += cache.vseparation; @@ -1086,9 +1278,6 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 //if (p_item->get_parent()!=root || !hide_root) ERR_FAIL_COND_V(cache.font.is_null(), -1); - Ref<Font> font = cache.font; - - int font_ascent = font->get_ascent(); int ofs = p_pos.x + ((p_item->disable_folding || hide_folding) ? cache.hseparation : cache.item_margin); int skip2 = 0; @@ -1133,12 +1322,20 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if (cache.click_type == Cache::CLICK_BUTTON && cache.click_item == p_item && cache.click_column == i && cache.click_index == j && !p_item->cells[i].buttons[j].disabled) { //being pressed - cache.button_pressed->draw(get_canvas_item(), Rect2(o, s)); + Point2 od = o; + if (rtl) { + od.x = get_size().width - od.x - s.x; + } + cache.button_pressed->draw(get_canvas_item(), Rect2(od, s)); } o.y += (label_h - s.height) / 2; o += cache.button_pressed->get_offset(); + if (rtl) { + o.x = get_size().width - o.x - b->get_width(); + } + b->draw(ci, o, p_item->cells[i].buttons[j].disabled ? Color(1, 1, 1, 0.5) : p_item->cells[i].buttons[j].color); w -= s.width + cache.button_margin; bw += s.width + cache.button_margin; @@ -1152,7 +1349,11 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 } if (cache.draw_guides) { - RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2i(cell_rect.position.x, cell_rect.position.y + cell_rect.size.height), cell_rect.position + cell_rect.size, cache.guide_color, 1); + Rect2 r = cell_rect; + if (rtl) { + r.position.x = get_size().width - r.position.x - r.size.x; + } + RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2i(r.position.x, r.position.y + r.size.height), r.position + r.size, cache.guide_color, 1); } if (i == 0) { @@ -1160,6 +1361,9 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 Rect2i row_rect = Rect2i(Point2i(cache.bg->get_margin(MARGIN_LEFT), item_rect.position.y), Size2i(get_size().width - cache.bg->get_minimum_size().width, item_rect.size.y)); //Rect2 r = Rect2i(row_rect.pos,row_rect.size); //r.grow(cache.selected->get_margin(MARGIN_LEFT)); + if (rtl) { + row_rect.position.x = get_size().width - row_rect.position.x - row_rect.size.x; + } if (has_focus()) { cache.selected_focus->draw(ci, row_rect); } else { @@ -1171,13 +1375,12 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if ((select_mode == SELECT_ROW && selected_item == p_item) || p_item->cells[i].selected) { Rect2i r(cell_rect.position, cell_rect.size); - if (p_item->cells[i].text.size() > 0) { - float icon_width = p_item->cells[i].get_icon_size().width; - r.position.x += icon_width; - r.size.x -= icon_width; - } p_item->set_meta("__focus_rect", Rect2(r.position, r.size)); + if (rtl) { + r.position.x = get_size().width - r.position.x - r.size.x; + } + if (p_item->cells[i].selected) { if (has_focus()) { cache.selected_focus->draw(ci, r); @@ -1196,6 +1399,9 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 r.position.x -= cache.hseparation; r.size.x += cache.hseparation; } + if (rtl) { + r.position.x = get_size().width - r.position.x - r.size.x; + } if (p_item->cells[i].custom_bg_outline) { RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(r.position.x, r.position.y, r.size.x, 1), p_item->cells[i].bg_color); RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(r.position.x, r.position.y + r.size.y - 1, r.size.x, 1), p_item->cells[i].bg_color); @@ -1208,8 +1414,12 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if (drop_mode_flags && drop_mode_over == p_item) { Rect2 r = cell_rect; + bool has_parent = p_item->get_children() != nullptr; + if (rtl) { + r.position.x = get_size().width - r.position.x - r.size.x; + } - if (drop_mode_section == -1 || drop_mode_section == 0) { + if (drop_mode_section == -1 || has_parent || drop_mode_section == 0) { RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(r.position.x, r.position.y, r.size.x, 1), cache.drop_position_color); } @@ -1218,7 +1428,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(r.position.x + r.size.x - 1, r.position.y, 1, r.size.y), cache.drop_position_color); } - if (drop_mode_section == 1 || drop_mode_section == 0) { + if ((drop_mode_section == 1 && !has_parent) || drop_mode_section == 0) { RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(r.position.x, r.position.y + r.size.y, r.size.x, 1), cache.drop_position_color); } } @@ -1226,12 +1436,21 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 Color col = p_item->cells[i].custom_color ? p_item->cells[i].color : get_theme_color(p_item->cells[i].selected ? "font_color_selected" : "font_color"); Color icon_col = p_item->cells[i].icon_color; + if (p_item->cells[i].dirty) { + const_cast<Tree *>(this)->update_item_cell(p_item, i); + } + + if (rtl) { + item_rect.position.x = get_size().width - item_rect.position.x - item_rect.size.x; + } + Point2i text_pos = item_rect.position; - text_pos.y += Math::floor((item_rect.size.y - font->get_height()) / 2) + font_ascent; + text_pos.y += Math::floor((item_rect.size.y - p_item->cells[i].text_buf->get_size().y) / 2); + int text_width = p_item->cells[i].text_buf->get_size().x; switch (p_item->cells[i].mode) { case TreeItem::CELL_MODE_STRING: { - draw_item_rect(p_item->cells[i], item_rect, col, icon_col); + draw_item_rect(p_item->cells.write[i], item_rect, col, icon_col); } break; case TreeItem::CELL_MODE_CHECK: { Ref<Texture2D> checked = cache.checked; @@ -1252,7 +1471,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 item_rect.size.x -= check_w; item_rect.position.x += check_w; - draw_item_rect(p_item->cells[i], item_rect, col, icon_col); + draw_item_rect(p_item->cells.write[i], item_rect, col, icon_col); } break; case TreeItem::CELL_MODE_RANGE: { @@ -1261,28 +1480,15 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 break; } - int option = (int)p_item->cells[i].val; - - String s = RTR("(Other)"); - Vector<String> strings = p_item->cells[i].text.split(","); - for (int j = 0; j < strings.size(); j++) { - int value = j; - if (!strings[j].get_slicec(':', 1).empty()) { - value = strings[j].get_slicec(':', 1).to_int(); - } - if (option == value) { - s = strings[j].get_slicec(':', 0); - break; - } - } - - if (p_item->cells[i].suffix != String()) { - s += " " + p_item->cells[i].suffix; - } - Ref<Texture2D> downarrow = cache.select_arrow; + int cell_width = item_rect.size.x - downarrow->get_width(); - font->draw(ci, text_pos, s, col, item_rect.size.x - downarrow->get_width()); + p_item->cells.write[i].text_buf->set_width(cell_width); + if (rtl) { + p_item->cells[i].text_buf->draw(ci, text_pos + Vector2(cell_width - text_width, 0), col); + } else { + p_item->cells[i].text_buf->draw(ci, text_pos, col); + } Point2i arrow_pos = item_rect.position; arrow_pos.x += item_rect.size.x - downarrow->get_width(); @@ -1292,14 +1498,14 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 } else { Ref<Texture2D> updown = cache.updown; - String valtext = String::num(p_item->cells[i].val, Math::range_step_decimals(p_item->cells[i].step)); + int cell_width = item_rect.size.x - updown->get_width(); - if (p_item->cells[i].suffix != String()) { - valtext += " " + p_item->cells[i].suffix; + if (rtl) { + p_item->cells[i].text_buf->draw(ci, text_pos + Vector2(cell_width - text_width, 0), col); + } else { + p_item->cells[i].text_buf->draw(ci, text_pos, col); } - font->draw(ci, text_pos, valtext, col, item_rect.size.x - updown->get_width()); - if (!p_item->cells[i].editable) { break; } @@ -1337,7 +1543,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 } if (!p_item->cells[i].editable) { - draw_item_rect(p_item->cells[i], item_rect, col, icon_col); + draw_item_rect(p_item->cells.write[i], item_rect, col, icon_col); break; } @@ -1365,7 +1571,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 ir.position += cache.custom_button->get_offset(); } - draw_item_rect(p_item->cells[i], ir, col, icon_col); + draw_item_rect(p_item->cells.write[i], ir, col, icon_col); downarrow->draw(ci, arrow_pos); @@ -1379,6 +1585,9 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 } if (select_mode == SELECT_MULTI && selected_item == p_item && selected_col == i) { + if (is_layout_rtl()) { + cell_rect.position.x = get_size().width - cell_rect.position.x - cell_rect.size.x; + } if (has_focus()) { cache.cursor->draw(ci, cell_rect); } else { @@ -1397,7 +1606,13 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 arrow = cache.arrow; } - arrow->draw(ci, p_pos + p_draw_ofs + Point2i(0, (label_h - arrow->get_height()) / 2) - cache.offset); + Point2 apos = p_pos + p_draw_ofs + Point2i(0, (label_h - arrow->get_height()) / 2) - cache.offset; + + if (rtl) { + apos.x = get_size().width - apos.x - arrow->get_width(); + } + + arrow->draw(ci, apos); } } @@ -1433,6 +1648,10 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 Point2i parent_pos = Point2i(parent_ofs - cache.arrow->get_width() / 2, p_pos.y + label_h / 2 + cache.arrow->get_height() / 2) - cache.offset + p_draw_ofs; if (root_pos.y + line_width >= 0) { + if (rtl) { + root_pos.x = get_size().width - root_pos.x; + parent_pos.x = get_size().width - parent_pos.x; + } RenderingServer::get_singleton()->canvas_item_add_line(ci, root_pos, Point2i(parent_pos.x - Math::floor(line_width / 2), root_pos.y), cache.relationship_line_color, line_width); RenderingServer::get_singleton()->canvas_item_add_line(ci, Point2i(parent_pos.x, root_pos.y), Point2i(parent_pos.x, prev_ofs), cache.relationship_line_color, line_width); } @@ -1809,7 +2028,6 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, bool case TreeItem::CELL_MODE_RANGE: { if (c.text != "") { //if (x >= (get_column_width(col)-item_h/2)) { - popup_menu->clear(); for (int i = 0; i < c.text.get_slice_count(","); i++) { String s = c.text.get_slicec(',', i); @@ -1980,7 +2198,6 @@ void Tree::_text_editor_enter(String p_text) { } else if (c.val > c.max) { c.val = c.max; } - //popup_edited_item->edited_signal.call( popup_edited_item_col ); } break; default: { @@ -2346,8 +2563,13 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { } Ref<StyleBox> bg = cache.bg; + bool rtl = is_layout_rtl(); - Point2 pos = mm->get_position() - bg->get_offset(); + Point2 pos = mm->get_position(); + if (rtl) { + pos.x = get_size().width - pos.x; + } + pos -= cache.bg->get_offset(); Cache::ClickType old_hover = cache.hover_type; int old_index = cache.hover_index; @@ -2372,6 +2594,9 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { if (root) { Point2 mpos = mm->get_position(); + if (rtl) { + mpos.x = get_size().width - mpos.x; + } mpos -= cache.bg->get_offset(); mpos.y -= _get_title_button_height(); if (mpos.y >= 0) { @@ -2428,6 +2653,9 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { if (!range_drag_enabled) { Vector2 cpos = mm->get_position(); + if (rtl) { + cpos.x = get_size().width - cpos.x; + } if (cpos.distance_to(pressing_pos) > 2) { range_drag_enabled = true; range_drag_capture_pos = cpos; @@ -2459,9 +2687,15 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { update_cache(); } + bool rtl = is_layout_rtl(); + if (!b->is_pressed()) { if (b->get_button_index() == BUTTON_LEFT) { - Point2 pos = b->get_position() - cache.bg->get_offset(); + Point2 pos = b->get_position(); + if (rtl) { + pos.x = get_size().width - pos.x; + } + pos -= cache.bg->get_offset(); if (show_column_titles) { pos.y -= _get_title_button_height(); @@ -2492,7 +2726,11 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { warp_mouse(range_drag_capture_pos); } else { Rect2 rect = get_selected()->get_meta("__focus_rect"); - if (rect.has_point(Point2(b->get_position().x, b->get_position().y))) { + Point2 mpos = b->get_position(); + if (rtl) { + mpos.x = get_size().width - mpos.x; + } + if (rect.has_point(mpos)) { if (!edit_selected()) { emit_signal("item_double_clicked"); } @@ -2537,7 +2775,11 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { case BUTTON_LEFT: { Ref<StyleBox> bg = cache.bg; - Point2 pos = b->get_position() - bg->get_offset(); + Point2 pos = b->get_position(); + if (rtl) { + pos.x = get_size().width - pos.x; + } + pos -= bg->get_offset(); cache.click_type = Cache::CLICK_NONE; if (show_column_titles) { pos.y -= _get_title_button_height(); @@ -2577,6 +2819,9 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { if (pressing_for_editor) { pressing_pos = b->get_position(); + if (rtl) { + pressing_pos.x = get_size().width - pressing_pos.x; + } } if (b->get_button_index() == BUTTON_RIGHT) { @@ -2640,7 +2885,11 @@ void Tree::_gui_input(Ref<InputEvent> p_event) { v_scroll->set_value(v_scroll->get_value() + v_scroll->get_page() * pan_gesture->get_delta().y / 8); double prev_h = h_scroll->get_value(); - h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * pan_gesture->get_delta().x / 8); + if (is_layout_rtl()) { + h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * -pan_gesture->get_delta().x / 8); + } else { + h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * pan_gesture->get_delta().x / 8); + } if (v_scroll->get_value() != prev_v || h_scroll->get_value() != prev_h) { accept_event(); @@ -2787,7 +3036,13 @@ void Tree::update_scrollbars() { int Tree::_get_title_button_height() const { ERR_FAIL_COND_V(cache.font.is_null() || cache.title_button.is_null(), 0); - return show_column_titles ? cache.font->get_height() + cache.title_button->get_minimum_size().height : 0; + int h = 0; + if (show_column_titles) { + for (int i = 0; i < columns.size(); i++) { + h = MAX(h, columns[i].text_buf->get_size().y + cache.title_button->get_minimum_size().height); + } + } + return h; } void Tree::_notification(int p_what) { @@ -2916,17 +3171,22 @@ void Tree::_notification(int p_what) { Ref<StyleBox> sb = (cache.click_type == Cache::CLICK_TITLE && cache.click_index == i) ? cache.title_button_pressed : ((cache.hover_type == Cache::CLICK_TITLE && cache.hover_index == i) ? cache.title_button_hover : cache.title_button); Ref<Font> f = cache.tb_font; Rect2 tbrect = Rect2(ofs2 - cache.offset.x, bg->get_margin(MARGIN_TOP), get_column_width(i), tbh); + if (is_layout_rtl()) { + tbrect.position.x = get_size().width - tbrect.size.x - tbrect.position.x; + } sb->draw(ci, tbrect); ofs2 += tbrect.size.width; //text int clip_w = tbrect.size.width - sb->get_minimum_size().width; - f->draw_halign(ci, tbrect.position + Point2i(sb->get_offset().x, (tbrect.size.height - f->get_height()) / 2 + f->get_ascent()), HALIGN_CENTER, clip_w, columns[i].title, cache.title_button_color); + columns.write[i].text_buf->set_width(clip_w); + columns[i].text_buf->draw(ci, tbrect.position + Point2i(sb->get_offset().x + (tbrect.size.width - columns[i].text_buf->get_size().x) / 2, (tbrect.size.height - columns[i].text_buf->get_size().y) / 2), cache.title_button_color); } } } - if (p_what == NOTIFICATION_THEME_CHANGED) { + if (p_what == NOTIFICATION_THEME_CHANGED || p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED || p_what == NOTIFICATION_TRANSLATION_CHANGED) { update_cache(); + _update_all(); } if (p_what == NOTIFICATION_RESIZED || p_what == NOTIFICATION_TRANSFORM_CHANGED) { @@ -2944,6 +3204,15 @@ void Tree::_notification(int p_what) { } } +void Tree::_update_all() { + for (int i = 0; i < columns.size(); i++) { + update_column(i); + } + if (root) { + update_item_cache(root); + } +} + Size2 Tree::get_minimum_size() const { return Size2(1, 1); } @@ -3019,6 +3288,9 @@ TreeItem *Tree::get_last_item() { void Tree::item_edited(int p_column, TreeItem *p_item, bool p_lmb) { edited_item = p_item; edited_col = p_column; + if (p_item != nullptr && p_column >= 0 && p_column < p_item->cells.size()) { + edited_item->cells.write[p_column].dirty = true; + } if (p_lmb) { emit_signal("item_edited"); } else { @@ -3027,6 +3299,9 @@ void Tree::item_edited(int p_column, TreeItem *p_item, bool p_lmb) { } void Tree::item_changed(int p_column, TreeItem *p_item) { + if (p_item != nullptr && p_column >= 0 && p_column < p_item->cells.size()) { + p_item->cells.write[p_column].dirty = true; + } update(); } @@ -3228,7 +3503,7 @@ void Tree::propagate_set_columns(TreeItem *p_item) { TreeItem *c = p_item->get_children(); while (c) { propagate_set_columns(c); - c = c->get_next(); + c = c->next; } } @@ -3384,7 +3659,11 @@ bool Tree::are_column_titles_visible() const { void Tree::set_column_title(int p_column, const String &p_title) { ERR_FAIL_INDEX(p_column, columns.size()); + if (cache.font.is_null()) { // avoid a strange case that may corrupt stuff + update_cache(); + } columns.write[p_column].title = p_title; + update_column(p_column); update(); } @@ -3393,6 +3672,61 @@ String Tree::get_column_title(int p_column) const { return columns[p_column].title; } +void Tree::set_column_title_direction(int p_column, Control::TextDirection p_text_direction) { + ERR_FAIL_INDEX(p_column, columns.size()); + ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); + if (columns[p_column].text_direction != p_text_direction) { + columns.write[p_column].text_direction = p_text_direction; + update_column(p_column); + update(); + } +} + +Control::TextDirection Tree::get_column_title_direction(int p_column) const { + ERR_FAIL_INDEX_V(p_column, columns.size(), TEXT_DIRECTION_INHERITED); + return columns[p_column].text_direction; +} + +void Tree::clear_column_title_opentype_features(int p_column) { + ERR_FAIL_INDEX(p_column, columns.size()); + columns.write[p_column].opentype_features.clear(); + update_column(p_column); + update(); +} + +void Tree::set_column_title_opentype_feature(int p_column, const String &p_name, int p_value) { + ERR_FAIL_INDEX(p_column, columns.size()); + int32_t tag = TS->name_to_tag(p_name); + if (!columns[p_column].opentype_features.has(tag) || (int)columns[p_column].opentype_features[tag] != p_value) { + columns.write[p_column].opentype_features[tag] = p_value; + update_column(p_column); + update(); + } +} + +int Tree::get_column_title_opentype_feature(int p_column, const String &p_name) const { + ERR_FAIL_INDEX_V(p_column, columns.size(), -1); + int32_t tag = TS->name_to_tag(p_name); + if (!columns[p_column].opentype_features.has(tag)) { + return -1; + } + return columns[p_column].opentype_features[tag]; +} + +void Tree::set_column_title_language(int p_column, const String &p_language) { + ERR_FAIL_INDEX(p_column, columns.size()); + if (columns[p_column].language != p_language) { + columns.write[p_column].language = p_language; + update_column(p_column); + update(); + } +} + +String Tree::get_column_title_language(int p_column) const { + ERR_FAIL_INDEX_V(p_column, columns.size(), ""); + return columns[p_column].language; +} + Point2 Tree::get_scroll() const { Point2 ofs; if (h_scroll->is_visible_in_tree()) { @@ -3558,6 +3892,9 @@ TreeItem *Tree::_find_item_at_pos(TreeItem *p_item, const Point2 &p_pos, int &r_ int Tree::get_column_at_position(const Point2 &p_pos) const { if (root) { Point2 pos = p_pos; + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } pos -= cache.bg->get_offset(); pos.y -= _get_title_button_height(); if (pos.y < 0) { @@ -3585,6 +3922,9 @@ int Tree::get_column_at_position(const Point2 &p_pos) const { int Tree::get_drop_section_at_position(const Point2 &p_pos) const { if (root) { Point2 pos = p_pos; + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } pos -= cache.bg->get_offset(); pos.y -= _get_title_button_height(); if (pos.y < 0) { @@ -3612,6 +3952,9 @@ int Tree::get_drop_section_at_position(const Point2 &p_pos) const { TreeItem *Tree::get_item_at_position(const Point2 &p_pos) const { if (root) { Point2 pos = p_pos; + if (is_layout_rtl()) { + pos.x = get_size().width - pos.x; + } pos -= cache.bg->get_offset(); pos.y -= _get_title_button_height(); if (pos.y < 0) { @@ -3732,10 +4075,6 @@ void Tree::set_cursor_can_exit_tree(bool p_enable) { cursor_can_exit_tree = p_enable; } -bool Tree::can_cursor_exit_tree() const { - return cursor_can_exit_tree; -} - void Tree::set_hide_folding(bool p_hide) { hide_folding = p_hide; update(); @@ -3823,6 +4162,17 @@ void Tree::_bind_methods() { ClassDB::bind_method(D_METHOD("set_column_title", "column", "title"), &Tree::set_column_title); ClassDB::bind_method(D_METHOD("get_column_title", "column"), &Tree::get_column_title); + + ClassDB::bind_method(D_METHOD("set_column_title_direction", "column", "direction"), &Tree::set_column_title_direction); + ClassDB::bind_method(D_METHOD("get_column_title_direction", "column"), &Tree::get_column_title_direction); + + ClassDB::bind_method(D_METHOD("set_column_title_opentype_feature", "column", "tag", "value"), &Tree::set_column_title_opentype_feature); + ClassDB::bind_method(D_METHOD("get_column_title_opentype_feature", "column", "tag"), &Tree::get_column_title_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_column_title_opentype_features", "column"), &Tree::clear_column_title_opentype_features); + + ClassDB::bind_method(D_METHOD("set_column_title_language", "column", "language"), &Tree::set_column_title_language); + ClassDB::bind_method(D_METHOD("get_column_title_language", "column"), &Tree::get_column_title_language); + ClassDB::bind_method(D_METHOD("get_scroll"), &Tree::get_scroll); ClassDB::bind_method(D_METHOD("set_hide_folding", "hide"), &Tree::set_hide_folding); @@ -3891,7 +4241,7 @@ Tree::Tree() { popup_menu = memnew(PopupMenu); popup_menu->hide(); add_child(popup_menu); - // popup_menu->set_as_toplevel(true); + // popup_menu->set_as_top_level(true); popup_editor = memnew(Popup); popup_editor->set_wrap_controls(true); diff --git a/scene/gui/tree.h b/scene/gui/tree.h index c0910a8fe0..82422b8be3 100644 --- a/scene/gui/tree.h +++ b/scene/gui/tree.h @@ -36,6 +36,7 @@ #include "scene/gui/popup_menu.h" #include "scene/gui/scroll_bar.h" #include "scene/gui/slider.h" +#include "scene/resources/text_line.h" class Tree; @@ -44,7 +45,6 @@ class TreeItem : public Object { public: enum TreeCellMode { - CELL_MODE_STRING, ///< just a string CELL_MODE_CHECK, ///< string + check CELL_MODE_RANGE, ///< Contains a range @@ -68,6 +68,13 @@ private: Rect2i icon_region; String text; String suffix; + Ref<TextLine> text_buf; + Dictionary opentype_features; + String language; + Control::StructuredTextParser st_parser = Control::STRUCTURED_TEXT_DEFAULT; + Array st_args; + Control::TextDirection text_direction = Control::TEXT_DIRECTION_INHERITED; + bool dirty; double min, max, step, val; int icon_max_w; bool expr; @@ -109,6 +116,8 @@ private: Vector<Button> buttons; Cell() { + text_buf.instance(); + dirty = true; custom_draw_obj = ObjectID(); custom_button = false; mode = TreeItem::CELL_MODE_STRING; @@ -183,6 +192,22 @@ public: void set_text(int p_column, String p_text); String get_text(int p_column) const; + void set_text_direction(int p_column, Control::TextDirection p_text_direction); + Control::TextDirection get_text_direction(int p_column) const; + + void set_opentype_feature(int p_column, const String &p_name, int p_value); + int get_opentype_feature(int p_column, const String &p_name) const; + void clear_opentype_features(int p_column); + + void set_structured_text_bidi_override(int p_column, Control::StructuredTextParser p_parser); + Control::StructuredTextParser get_structured_text_bidi_override(int p_column) const; + + void set_structured_text_bidi_override_options(int p_column, Array p_args); + Array get_structured_text_bidi_override_options(int p_column) const; + + void set_language(int p_column, const String &p_language); + String get_language(int p_column) const; + void set_suffix(int p_column, String p_suffix); String get_suffix(int p_column) const; @@ -202,7 +227,6 @@ public: int get_button_count(int p_column) const; String get_button_tooltip(int p_column, int p_idx) const; Ref<Texture2D> get_button(int p_column, int p_idx) const; - int get_button_id(int p_column, int p_idx) const; void erase_button(int p_column, int p_idx); int get_button_by_id(int p_column, int p_id) const; void set_button(int p_column, int p_idx, const Ref<Texture2D> &p_button); @@ -349,7 +373,12 @@ private: int min_width; bool expand; String title; + Ref<TextLine> text_buf; + Dictionary opentype_features; + String language; + Control::TextDirection text_direction = Control::TEXT_DIRECTION_INHERITED; ColumnInfo() { + text_buf.instance(); min_width = 1; expand = true; } @@ -375,8 +404,12 @@ private: int compute_item_height(TreeItem *p_item) const; int get_item_height(TreeItem *p_item) const; + void _update_all(); + void update_column(int p_col); + void update_item_cell(TreeItem *p_item, int p_col); + void update_item_cache(TreeItem *p_item); //void draw_item_text(String p_text,const Ref<Texture2D>& p_icon,int p_icon_max_w,bool p_tool,Rect2i p_rect,const Color& p_color); - void draw_item_rect(const TreeItem::Cell &p_cell, const Rect2i &p_rect, const Color &p_color, const Color &p_icon_color); + void draw_item_rect(TreeItem::Cell &p_cell, const Rect2i &p_rect, const Color &p_color, const Color &p_icon_color); int draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 &p_draw_size, TreeItem *p_item); void select_single_item(TreeItem *p_selected, TreeItem *p_current, int p_col, TreeItem *p_prev = nullptr, bool *r_in_range = nullptr, bool p_force_deselect = false); int propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, bool p_doubleclick, TreeItem *p_item, int p_button, const Ref<InputEventWithModifiers> &p_mod); @@ -401,6 +434,8 @@ private: struct Cache { Ref<Font> font; Ref<Font> tb_font; + int font_size; + int tb_font_size; Ref<StyleBox> bg; Ref<StyleBox> selected; Ref<StyleBox> selected_focus; @@ -564,6 +599,16 @@ public: void set_column_title(int p_column, const String &p_title); String get_column_title(int p_column) const; + void set_column_title_direction(int p_column, Control::TextDirection p_text_direction); + Control::TextDirection get_column_title_direction(int p_column) const; + + void set_column_title_opentype_feature(int p_column, const String &p_name, int p_value); + int get_column_title_opentype_feature(int p_column, const String &p_name) const; + void clear_column_title_opentype_features(int p_column); + + void set_column_title_language(int p_column, const String &p_language); + String get_column_title_language(int p_column) const; + void set_column_titles_visible(bool p_show); bool are_column_titles_visible() const; @@ -587,7 +632,6 @@ public: void scroll_to_item(TreeItem *p_item); void set_cursor_can_exit_tree(bool p_enable); - bool can_cursor_exit_tree() const; VScrollBar *get_vscroll_bar() { return v_scroll; } diff --git a/scene/main/canvas_item.cpp b/scene/main/canvas_item.cpp index 796408a38d..43350fae37 100644 --- a/scene/main/canvas_item.cpp +++ b/scene/main/canvas_item.cpp @@ -31,8 +31,8 @@ #include "canvas_item.h" #include "core/input/input.h" -#include "core/message_queue.h" -#include "core/method_bind_ext.gen.inc" +#include "core/object/message_queue.h" +#include "scene/2d/canvas_group.h" #include "scene/main/canvas_layer.h" #include "scene/main/viewport.h" #include "scene/main/window.h" @@ -364,14 +364,14 @@ void CanvasItem::_propagate_visibility_changed(bool p_visible) { if (p_visible) { update(); //todo optimize } else { - emit_signal(SceneStringNames::get_singleton()->hide); + emit_signal(SceneStringNames::get_singleton()->hidden); } _block(); for (int i = 0; i < get_child_count(); i++) { CanvasItem *c = Object::cast_to<CanvasItem>(get_child(i)); - if (c && c->visible) { //should the toplevels stop propagation? i think so but.. + if (c && c->visible) { //should the top_levels stop propagation? i think so but.. c->_propagate_visibility_changed(p_visible); } } @@ -486,7 +486,7 @@ Transform2D CanvasItem::get_global_transform() const { return global_transform; } -void CanvasItem::_toplevel_raise_self() { +void CanvasItem::_top_level_raise_self() { if (!is_inside_tree()) { return; } @@ -499,7 +499,7 @@ void CanvasItem::_toplevel_raise_self() { } void CanvasItem::_enter_canvas() { - if ((!Object::cast_to<CanvasItem>(get_parent())) || toplevel) { + if ((!Object::cast_to<CanvasItem>(get_parent())) || top_level) { Node *n = this; canvas_layer = nullptr; @@ -533,7 +533,7 @@ void CanvasItem::_enter_canvas() { get_viewport()->gui_reset_canvas_sort_index(); } - get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_toplevel_raise_self"); + get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_top_level_raise_self"); } else { CanvasItem *parent = get_parent_item(); @@ -599,7 +599,7 @@ void CanvasItem::_notification(int p_what) { } if (group != "") { - get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_toplevel_raise_self"); + get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_top_level_raise_self"); } else { CanvasItem *p = get_parent_item(); ERR_FAIL_COND(!p); @@ -674,27 +674,29 @@ Color CanvasItem::get_modulate() const { return modulate; } -void CanvasItem::set_as_toplevel(bool p_toplevel) { - if (toplevel == p_toplevel) { +void CanvasItem::set_as_top_level(bool p_top_level) { + if (top_level == p_top_level) { return; } if (!is_inside_tree()) { - toplevel = p_toplevel; + top_level = p_top_level; return; } _exit_canvas(); - toplevel = p_toplevel; + top_level = p_top_level; _enter_canvas(); + + _notify_transform(); } -bool CanvasItem::is_set_as_toplevel() const { - return toplevel; +bool CanvasItem::is_set_as_top_level() const { + return top_level; } CanvasItem *CanvasItem::get_parent_item() const { - if (toplevel) { + if (top_level) { return nullptr; } @@ -740,21 +742,21 @@ void CanvasItem::draw_line(const Point2 &p_from, const Point2 &p_to, const Color RenderingServer::get_singleton()->canvas_item_add_line(canvas_item, p_from, p_to, p_color, p_width); } -void CanvasItem::draw_polyline(const Vector<Point2> &p_points, const Color &p_color, float p_width) { +void CanvasItem::draw_polyline(const Vector<Point2> &p_points, const Color &p_color, float p_width, bool p_antialiased) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); Vector<Color> colors; colors.push_back(p_color); - RenderingServer::get_singleton()->canvas_item_add_polyline(canvas_item, p_points, colors, p_width); + RenderingServer::get_singleton()->canvas_item_add_polyline(canvas_item, p_points, colors, p_width, p_antialiased); } -void CanvasItem::draw_polyline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width) { +void CanvasItem::draw_polyline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width, bool p_antialiased) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); - RenderingServer::get_singleton()->canvas_item_add_polyline(canvas_item, p_points, p_colors, p_width); + RenderingServer::get_singleton()->canvas_item_add_polyline(canvas_item, p_points, p_colors, p_width, p_antialiased); } -void CanvasItem::draw_arc(const Vector2 &p_center, float p_radius, float p_start_angle, float p_end_angle, int p_point_count, const Color &p_color, float p_width) { +void CanvasItem::draw_arc(const Vector2 &p_center, float p_radius, float p_start_angle, float p_end_angle, int p_point_count, const Color &p_color, float p_width, bool p_antialiased) { Vector<Point2> points; points.resize(p_point_count); const float delta_angle = p_end_angle - p_start_angle; @@ -763,7 +765,7 @@ void CanvasItem::draw_arc(const Vector2 &p_center, float p_radius, float p_start points.set(i, p_center + Vector2(Math::cos(theta), Math::sin(theta)) * p_radius); } - draw_polyline(points, p_color, p_width); + draw_polyline(points, p_color, p_width, p_antialiased); } void CanvasItem::draw_multiline(const Vector<Point2> &p_points, const Color &p_color, float p_width) { @@ -832,25 +834,25 @@ void CanvasItem::draw_circle(const Point2 &p_pos, float p_radius, const Color &p RenderingServer::get_singleton()->canvas_item_add_circle(canvas_item, p_pos, p_radius, p_color); } -void CanvasItem::draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw(canvas_item, p_pos, p_modulate, false, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + p_texture->draw(canvas_item, p_pos, p_modulate, false); } -void CanvasItem::draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw_rect(canvas_item, p_rect, p_tile, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + p_texture->draw_rect(canvas_item, p_rect, p_tile, p_modulate, p_transpose); } -void CanvasItem::draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, bool p_clip_uv, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw_rect_region(canvas_item, p_rect, p_src_rect, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat), p_clip_uv); + p_texture->draw_rect_region(canvas_item, p_rect, p_src_rect, p_modulate, p_transpose, p_clip_uv); } void CanvasItem::draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p_rect) { @@ -861,14 +863,11 @@ void CanvasItem::draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p p_style_box->draw(canvas_item, p_rect); } -void CanvasItem::draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, float p_width, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, float p_width) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_primitive(canvas_item, p_points, p_colors, p_uvs, rid, p_width, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_primitive(canvas_item, p_points, p_colors, p_uvs, rid, p_width); } void CanvasItem::draw_set_transform(const Point2 &p_offset, float p_rot, const Size2 &p_scale) { @@ -885,63 +884,54 @@ void CanvasItem::draw_set_transform_matrix(const Transform2D &p_matrix) { RenderingServer::get_singleton()->canvas_item_add_set_transform(canvas_item, p_matrix); } -void CanvasItem::draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, p_colors, p_uvs, rid, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, p_colors, p_uvs, rid); } -void CanvasItem::draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); Vector<Color> colors; colors.push_back(p_color); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, colors, p_uvs, rid, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, colors, p_uvs, rid); } -void CanvasItem::draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, const Transform2D &p_transform, const Color &p_modulate, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Transform2D &p_transform, const Color &p_modulate) { ERR_FAIL_COND(p_mesh.is_null()); RID texture_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID normal_map_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_map_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(canvas_item, p_mesh->get_rid(), p_transform, p_modulate, texture_rid, normal_map_rid, specular_map_rid, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_mesh(canvas_item, p_mesh->get_rid(), p_transform, p_modulate, texture_rid); } -void CanvasItem::draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture) { ERR_FAIL_COND(p_multimesh.is_null()); RID texture_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID normal_map_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_map_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_multimesh(canvas_item, p_multimesh->get_rid(), texture_rid, normal_map_rid, specular_map_rid, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_multimesh(canvas_item, p_multimesh->get_rid(), texture_rid); } -void CanvasItem::draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, const Color &p_modulate, int p_clip_w) { +void CanvasItem::draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align, float p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint8_t p_flags) const { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); - ERR_FAIL_COND(p_font.is_null()); - p_font->draw(canvas_item, p_pos, p_text, p_modulate, p_clip_w); + p_font->draw_string(canvas_item, p_pos, p_text, p_align, p_width, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); } -float CanvasItem::draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next, const Color &p_modulate) { - ERR_FAIL_COND_V_MSG(!drawing, 0, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); +void CanvasItem::draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align, float p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint8_t p_flags) const { + ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); + ERR_FAIL_COND(p_font.is_null()); + p_font->draw_multiline_string(canvas_item, p_pos, p_text, p_align, p_width, p_max_lines, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); +} - ERR_FAIL_COND_V(p_char.length() != 1, 0); - ERR_FAIL_COND_V(p_font.is_null(), 0); +float CanvasItem::draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate) const { + ERR_FAIL_COND_V_MSG(!drawing, 0.f, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); + ERR_FAIL_COND_V(p_font.is_null(), 0.f); + ERR_FAIL_COND_V(p_char.length() != 1, 0.f); - if (p_font->has_outline()) { - p_font->draw_char(canvas_item, p_pos, p_char[0], p_next.get_data()[0], Color(1, 1, 1), true); - } - return p_font->draw_char(canvas_item, p_pos, p_char[0], p_next.get_data()[0], p_modulate); + return p_font->draw_char(canvas_item, p_pos, p_char[0], p_next.get_data()[0], p_size, p_modulate, p_outline_size, p_outline_modulate); } void CanvasItem::_notify_transform(CanvasItem *p_node) { @@ -967,7 +957,7 @@ void CanvasItem::_notify_transform(CanvasItem *p_node) { for (List<CanvasItem *>::Element *E = p_node->children_items.front(); E; E = E->next()) { CanvasItem *ci = E->get(); - if (ci->toplevel) { + if (ci->top_level) { continue; } _notify_transform(ci); @@ -997,9 +987,9 @@ ObjectID CanvasItem::get_canvas_layer_instance_id() const { } } -CanvasItem *CanvasItem::get_toplevel() const { +CanvasItem *CanvasItem::get_top_level() const { CanvasItem *ci = const_cast<CanvasItem *>(this); - while (!ci->toplevel && Object::cast_to<CanvasItem>(ci->get_parent())) { + while (!ci->top_level && Object::cast_to<CanvasItem>(ci->get_parent())) { ci = Object::cast_to<CanvasItem>(ci->get_parent()); } @@ -1009,7 +999,7 @@ CanvasItem *CanvasItem::get_toplevel() const { Ref<World2D> CanvasItem::get_world_2d() const { ERR_FAIL_COND_V(!is_inside_tree(), Ref<World2D>()); - CanvasItem *tl = get_toplevel(); + CanvasItem *tl = get_top_level(); if (tl->get_viewport()) { return tl->get_viewport()->find_world_2d(); @@ -1104,7 +1094,7 @@ void CanvasItem::force_update_transform() { } void CanvasItem::_bind_methods() { - ClassDB::bind_method(D_METHOD("_toplevel_raise_self"), &CanvasItem::_toplevel_raise_self); + ClassDB::bind_method(D_METHOD("_top_level_raise_self"), &CanvasItem::_top_level_raise_self); ClassDB::bind_method(D_METHOD("_update_callback"), &CanvasItem::_update_callback); #ifdef TOOLS_ENABLED @@ -1136,8 +1126,8 @@ void CanvasItem::_bind_methods() { ClassDB::bind_method(D_METHOD("update"), &CanvasItem::update); - ClassDB::bind_method(D_METHOD("set_as_toplevel", "enable"), &CanvasItem::set_as_toplevel); - ClassDB::bind_method(D_METHOD("is_set_as_toplevel"), &CanvasItem::is_set_as_toplevel); + ClassDB::bind_method(D_METHOD("set_as_top_level", "enable"), &CanvasItem::set_as_top_level); + ClassDB::bind_method(D_METHOD("is_set_as_top_level"), &CanvasItem::is_set_as_top_level); ClassDB::bind_method(D_METHOD("set_light_mask", "light_mask"), &CanvasItem::set_light_mask); ClassDB::bind_method(D_METHOD("get_light_mask"), &CanvasItem::get_light_mask); @@ -1155,25 +1145,25 @@ void CanvasItem::_bind_methods() { //ClassDB::bind_method(D_METHOD("get_transform"),&CanvasItem::get_transform); ClassDB::bind_method(D_METHOD("draw_line", "from", "to", "color", "width"), &CanvasItem::draw_line, DEFVAL(1.0)); - ClassDB::bind_method(D_METHOD("draw_polyline", "points", "color", "width"), &CanvasItem::draw_polyline, DEFVAL(1.0)); - ClassDB::bind_method(D_METHOD("draw_polyline_colors", "points", "colors", "width"), &CanvasItem::draw_polyline_colors, DEFVAL(1.0)); - ClassDB::bind_method(D_METHOD("draw_arc", "center", "radius", "start_angle", "end_angle", "point_count", "color", "width"), &CanvasItem::draw_arc, DEFVAL(1.0)); + ClassDB::bind_method(D_METHOD("draw_polyline", "points", "color", "width", "antialiased"), &CanvasItem::draw_polyline, DEFVAL(1.0), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_polyline_colors", "points", "colors", "width", "antialiased"), &CanvasItem::draw_polyline_colors, DEFVAL(1.0), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_arc", "center", "radius", "start_angle", "end_angle", "point_count", "color", "width", "antialiased"), &CanvasItem::draw_arc, DEFVAL(1.0), DEFVAL(false)); ClassDB::bind_method(D_METHOD("draw_multiline", "points", "color", "width"), &CanvasItem::draw_multiline, DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_multiline_colors", "points", "colors", "width"), &CanvasItem::draw_multiline_colors, DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_rect", "rect", "color", "filled", "width"), &CanvasItem::draw_rect, DEFVAL(true), DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_circle", "position", "radius", "color"), &CanvasItem::draw_circle); - ClassDB::bind_method(D_METHOD("draw_texture", "texture", "position", "modulate", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_texture_rect", "texture", "rect", "tile", "modulate", "transpose", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture_rect, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_texture_rect_region", "texture", "rect", "src_rect", "modulate", "transpose", "normal_map", "specular_map", "specular_shininess", "clip_uv", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture_rect_region, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(true), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); + ClassDB::bind_method(D_METHOD("draw_texture", "texture", "position", "modulate"), &CanvasItem::draw_texture, DEFVAL(Color(1, 1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_texture_rect", "texture", "rect", "tile", "modulate", "transpose"), &CanvasItem::draw_texture_rect, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_texture_rect_region", "texture", "rect", "src_rect", "modulate", "transpose", "clip_uv"), &CanvasItem::draw_texture_rect_region, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(true)); ClassDB::bind_method(D_METHOD("draw_style_box", "style_box", "rect"), &CanvasItem::draw_style_box); - ClassDB::bind_method(D_METHOD("draw_primitive", "points", "colors", "uvs", "texture", "width", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_primitive, DEFVAL(Ref<Texture2D>()), DEFVAL(1.0), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_polygon", "points", "colors", "uvs", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_colored_polygon", "points", "color", "uvs", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_colored_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_string", "font", "position", "text", "modulate", "clip_w"), &CanvasItem::draw_string, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("draw_char", "font", "position", "char", "next", "modulate"), &CanvasItem::draw_char, DEFVAL(Color(1, 1, 1, 1))); - ClassDB::bind_method(D_METHOD("draw_mesh", "mesh", "texture", "normal_map", "specular_map", "specular_shininess", "transform", "modulate", "texture_filter", "texture_repeat"), &CanvasItem::draw_mesh, DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(Transform2D()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_multimesh", "multimesh", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_multimesh, DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - + ClassDB::bind_method(D_METHOD("draw_primitive", "points", "colors", "uvs", "texture", "width"), &CanvasItem::draw_primitive, DEFVAL(Ref<Texture2D>()), DEFVAL(1.0)); + ClassDB::bind_method(D_METHOD("draw_polygon", "points", "colors", "uvs", "texture"), &CanvasItem::draw_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); + ClassDB::bind_method(D_METHOD("draw_colored_polygon", "points", "color", "uvs", "texture"), &CanvasItem::draw_colored_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); + ClassDB::bind_method(D_METHOD("draw_string", "font", "pos", "text", "align", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_multiline_string", "font", "pos", "text", "align", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_multiline_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_char", "font", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &CanvasItem::draw_char, DEFVAL(""), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); + ClassDB::bind_method(D_METHOD("draw_mesh", "mesh", "texture", "transform", "modulate"), &CanvasItem::draw_mesh, DEFVAL(Transform2D()), DEFVAL(Color(1, 1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_multimesh", "multimesh", "texture"), &CanvasItem::draw_multimesh); ClassDB::bind_method(D_METHOD("draw_set_transform", "position", "rotation", "scale"), &CanvasItem::draw_set_transform, DEFVAL(0.0), DEFVAL(Size2(1.0, 1.0))); ClassDB::bind_method(D_METHOD("draw_set_transform_matrix", "xform"), &CanvasItem::draw_set_transform_matrix); ClassDB::bind_method(D_METHOD("get_transform"), &CanvasItem::get_transform); @@ -1211,6 +1201,9 @@ void CanvasItem::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture_repeat", "mode"), &CanvasItem::set_texture_repeat); ClassDB::bind_method(D_METHOD("get_texture_repeat"), &CanvasItem::get_texture_repeat); + ClassDB::bind_method(D_METHOD("set_clip_children", "enable"), &CanvasItem::set_clip_children); + ClassDB::bind_method(D_METHOD("is_clipping_children"), &CanvasItem::is_clipping_children); + BIND_VMETHOD(MethodInfo("_draw")); ADD_GROUP("Visibility", ""); @@ -1218,7 +1211,9 @@ void CanvasItem::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::COLOR, "modulate"), "set_modulate", "get_modulate"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "self_modulate"), "set_self_modulate", "get_self_modulate"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "show_behind_parent"), "set_draw_behind_parent", "is_draw_behind_parent_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "top_level"), "set_as_top_level", "is_set_as_top_level"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "show_on_top", PROPERTY_HINT_NONE, "", 0), "_set_on_top", "_is_on_top"); //compatibility + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clip_children"), "set_clip_children", "is_clipping_children"); ADD_PROPERTY(PropertyInfo(Variant::INT, "light_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_light_mask", "get_light_mask"); ADD_GROUP("Texture", "texture_"); @@ -1228,13 +1223,11 @@ void CanvasItem::_bind_methods() { ADD_GROUP("Material", ""); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial,CanvasItemMaterial"), "set_material", "get_material"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_parent_material"), "set_use_parent_material", "get_use_parent_material"); - //exporting these things doesn't really make much sense i think - // ADD_PROPERTY(PropertyInfo(Variant::BOOL, "toplevel", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_as_toplevel", "is_set_as_toplevel"); // ADD_PROPERTY(PropertyInfo(Variant::BOOL,"transform/notify"),"set_transform_notify","is_transform_notify_enabled"); ADD_SIGNAL(MethodInfo("draw")); ADD_SIGNAL(MethodInfo("visibility_changed")); - ADD_SIGNAL(MethodInfo("hide")); + ADD_SIGNAL(MethodInfo("hidden")); ADD_SIGNAL(MethodInfo("item_rect_changed")); BIND_CONSTANT(NOTIFICATION_TRANSFORM_CHANGED); @@ -1329,23 +1322,7 @@ void CanvasItem::_update_texture_filter_changed(bool p_propagate) { if (parent_item) { texture_filter_cache = parent_item->texture_filter_cache; } else { - //from viewport - switch (get_viewport()->get_default_canvas_item_texture_filter()) { - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS; - break; - default: { - } - } + texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT; } } else { texture_filter_cache = RS::CanvasItemTextureFilter(texture_filter); @@ -1355,7 +1332,7 @@ void CanvasItem::_update_texture_filter_changed(bool p_propagate) { if (p_propagate) { for (List<CanvasItem *>::Element *E = children_items.front(); E; E = E->next()) { - if (!E->get()->toplevel && E->get()->texture_filter == TEXTURE_FILTER_PARENT_NODE) { + if (!E->get()->top_level && E->get()->texture_filter == TEXTURE_FILTER_PARENT_NODE) { E->get()->_update_texture_filter_changed(true); } } @@ -1386,20 +1363,7 @@ void CanvasItem::_update_texture_repeat_changed(bool p_propagate) { if (parent_item) { texture_repeat_cache = parent_item->texture_repeat_cache; } else { - //from viewport - switch (get_viewport()->get_default_canvas_item_texture_repeat()) { - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_DISABLED: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_ENABLED: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MIRROR: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_MIRROR; - break; - default: { - } - } + texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT; } } else { texture_repeat_cache = RS::CanvasItemTextureRepeat(texture_repeat); @@ -1408,7 +1372,7 @@ void CanvasItem::_update_texture_repeat_changed(bool p_propagate) { update(); if (p_propagate) { for (List<CanvasItem *>::Element *E = children_items.front(); E; E = E->next()) { - if (!E->get()->toplevel && E->get()->texture_repeat == TEXTURE_REPEAT_PARENT_NODE) { + if (!E->get()->top_level && E->get()->texture_repeat == TEXTURE_REPEAT_PARENT_NODE) { E->get()->_update_texture_repeat_changed(true); } } @@ -1425,6 +1389,22 @@ void CanvasItem::set_texture_repeat(TextureRepeat p_texture_repeat) { _change_notify(); } +void CanvasItem::set_clip_children(bool p_enabled) { + if (clip_children == p_enabled) { + return; + } + clip_children = p_enabled; + + if (Object::cast_to<CanvasGroup>(this) != nullptr) { + //avoid accidental bugs, make this not work on CanvasGroup + return; + } + RS::get_singleton()->canvas_item_set_canvas_group_mode(get_canvas_item(), clip_children ? RS::CANVAS_GROUP_MODE_OPAQUE : RS::CANVAS_GROUP_MODE_DISABLED); +} +bool CanvasItem::is_clipping_children() const { + return clip_children; +} + CanvasItem::TextureRepeat CanvasItem::get_texture_repeat() const { return texture_repeat; } @@ -1437,10 +1417,11 @@ CanvasItem::CanvasItem() : pending_update = false; modulate = Color(1, 1, 1, 1); self_modulate = Color(1, 1, 1, 1); - toplevel = false; + top_level = false; first_draw = false; drawing = false; behind = false; + clip_children = false; block_transform_notify = false; canvas_layer = nullptr; use_parent_material = false; @@ -1459,3 +1440,154 @@ CanvasItem::CanvasItem() : CanvasItem::~CanvasItem() { RenderingServer::get_singleton()->free(canvas_item); } + +/////////////////////////////////////////////////////////////////// + +void CanvasTexture::set_diffuse_texture(const Ref<Texture2D> &p_diffuse) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_diffuse.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + diffuse_texture = p_diffuse; + + RID tex_rid = diffuse_texture.is_valid() ? diffuse_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_DIFFUSE, tex_rid); + emit_changed(); +} +Ref<Texture2D> CanvasTexture::get_diffuse_texture() const { + return diffuse_texture; +} + +void CanvasTexture::set_normal_texture(const Ref<Texture2D> &p_normal) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_normal.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + normal_texture = p_normal; + RID tex_rid = normal_texture.is_valid() ? normal_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_NORMAL, tex_rid); +} +Ref<Texture2D> CanvasTexture::get_normal_texture() const { + return normal_texture; +} + +void CanvasTexture::set_specular_texture(const Ref<Texture2D> &p_specular) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_specular.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + specular_texture = p_specular; + RID tex_rid = specular_texture.is_valid() ? specular_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_SPECULAR, tex_rid); +} +Ref<Texture2D> CanvasTexture::get_specular_texture() const { + return specular_texture; +} + +void CanvasTexture::set_specular_color(const Color &p_color) { + specular = p_color; + RS::get_singleton()->canvas_texture_set_shading_parameters(canvas_texture, specular, shininess); +} +Color CanvasTexture::get_specular_color() const { + return specular; +} + +void CanvasTexture::set_specular_shininess(float p_shininess) { + shininess = p_shininess; + RS::get_singleton()->canvas_texture_set_shading_parameters(canvas_texture, specular, shininess); +} +float CanvasTexture::get_specular_shininess() const { + return shininess; +} + +void CanvasTexture::set_texture_filter(CanvasItem::TextureFilter p_filter) { + texture_filter = p_filter; + RS::get_singleton()->canvas_texture_set_texture_filter(canvas_texture, RS::CanvasItemTextureFilter(p_filter)); +} +CanvasItem::TextureFilter CanvasTexture::get_texture_filter() const { + return texture_filter; +} + +void CanvasTexture::set_texture_repeat(CanvasItem::TextureRepeat p_repeat) { + texture_repeat = p_repeat; + RS::get_singleton()->canvas_texture_set_texture_repeat(canvas_texture, RS::CanvasItemTextureRepeat(p_repeat)); +} +CanvasItem::TextureRepeat CanvasTexture::get_texture_repeat() const { + return texture_repeat; +} + +int CanvasTexture::get_width() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_width(); + } else { + return 1; + } +} +int CanvasTexture::get_height() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_height(); + } else { + return 1; + } +} + +bool CanvasTexture::is_pixel_opaque(int p_x, int p_y) const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->is_pixel_opaque(p_x, p_y); + } else { + return false; + } +} + +bool CanvasTexture::has_alpha() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->has_alpha(); + } else { + return false; + } +} + +Ref<Image> CanvasTexture::get_data() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_data(); + } else { + return Ref<Image>(); + } +} + +RID CanvasTexture::get_rid() const { + return canvas_texture; +} + +void CanvasTexture::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_diffuse_texture", "texture"), &CanvasTexture::set_diffuse_texture); + ClassDB::bind_method(D_METHOD("get_diffuse_texture"), &CanvasTexture::get_diffuse_texture); + + ClassDB::bind_method(D_METHOD("set_normal_texture", "texture"), &CanvasTexture::set_normal_texture); + ClassDB::bind_method(D_METHOD("get_normal_texture"), &CanvasTexture::get_normal_texture); + + ClassDB::bind_method(D_METHOD("set_specular_texture", "texture"), &CanvasTexture::set_specular_texture); + ClassDB::bind_method(D_METHOD("get_specular_texture"), &CanvasTexture::get_specular_texture); + + ClassDB::bind_method(D_METHOD("set_specular_color", "color"), &CanvasTexture::set_specular_color); + ClassDB::bind_method(D_METHOD("get_specular_color"), &CanvasTexture::get_specular_color); + + ClassDB::bind_method(D_METHOD("set_specular_shininess", "shininess"), &CanvasTexture::set_specular_shininess); + ClassDB::bind_method(D_METHOD("get_specular_shininess"), &CanvasTexture::get_specular_shininess); + + ClassDB::bind_method(D_METHOD("set_texture_filter", "filter"), &CanvasTexture::set_texture_filter); + ClassDB::bind_method(D_METHOD("get_texture_filter"), &CanvasTexture::get_texture_filter); + + ClassDB::bind_method(D_METHOD("set_texture_repeat", "repeat"), &CanvasTexture::set_texture_repeat); + ClassDB::bind_method(D_METHOD("get_texture_repeat"), &CanvasTexture::get_texture_repeat); + + ADD_GROUP("Diffuse", "diffuse_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "diffuse_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_diffuse_texture", "get_diffuse_texture"); + ADD_GROUP("Normalmap", "normal_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_texture", "get_normal_texture"); + ADD_GROUP("Specular", "specular_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_texture", "get_specular_texture"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "specular_shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_specular_shininess", "get_specular_shininess"); + ADD_GROUP("Texture", "texture_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "texture_filter", PROPERTY_HINT_ENUM, "Inherit,Nearest,Linear,MipmapNearest,MipmapLinear,MipmapNearestAniso,MipmapLinearAniso"), "set_texture_filter", "get_texture_filter"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "texture_repeat", PROPERTY_HINT_ENUM, "Inherit,Disabled,Enabled,Mirror"), "set_texture_repeat", "get_texture_repeat"); +} + +CanvasTexture::CanvasTexture() { + canvas_texture = RS::get_singleton()->canvas_texture_create(); +} +CanvasTexture::~CanvasTexture() { + RS::get_singleton()->free(canvas_texture); +} diff --git a/scene/main/canvas_item.h b/scene/main/canvas_item.h index 3f32df87a7..3cde6b69c1 100644 --- a/scene/main/canvas_item.h +++ b/scene/main/canvas_item.h @@ -37,6 +37,7 @@ #include "scene/resources/multimesh.h" #include "scene/resources/shader.h" #include "scene/resources/texture.h" +#include "servers/text_server.h" class CanvasLayer; class Viewport; @@ -200,8 +201,9 @@ private: Window *window; bool first_draw; bool visible; + bool clip_children; bool pending_update; - bool toplevel; + bool top_level; bool drawing; bool block_transform_notify; bool behind; @@ -220,7 +222,7 @@ private: mutable Transform2D global_transform; mutable bool global_invalid; - void _toplevel_raise_self(); + void _top_level_raise_self(); void _propagate_visibility_changed(bool p_visible); @@ -315,6 +317,9 @@ public: void update(); + void set_clip_children(bool p_enabled); + bool is_clipping_children() const; + virtual void set_light_mask(int p_light_mask); int get_light_mask() const; @@ -327,26 +332,27 @@ public: /* DRAWING API */ void draw_line(const Point2 &p_from, const Point2 &p_to, const Color &p_color, float p_width = 1.0); - void draw_polyline(const Vector<Point2> &p_points, const Color &p_color, float p_width = 1.0); - void draw_polyline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0); - void draw_arc(const Vector2 &p_center, float p_radius, float p_start_angle, float p_end_angle, int p_point_count, const Color &p_color, float p_width = 1.0); + void draw_polyline(const Vector<Point2> &p_points, const Color &p_color, float p_width = 1.0, bool p_antialiased = false); + void draw_polyline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0, bool p_antialiased = false); + void draw_arc(const Vector2 &p_center, float p_radius, float p_start_angle, float p_end_angle, int p_point_count, const Color &p_color, float p_width = 1.0, bool p_antialiased = false); void draw_multiline(const Vector<Point2> &p_points, const Color &p_color, float p_width = 1.0); void draw_multiline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0); void draw_rect(const Rect2 &p_rect, const Color &p_color, bool p_filled = true, float p_width = 1.0); void draw_circle(const Point2 &p_pos, float p_radius, const Color &p_color); - void draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1, 1), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), bool p_clip_uv = false, TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1, 1)); + void draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false); + void draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = false); void draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p_rect); - void draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture = Ref<Texture2D>(), float p_width = 1, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>(), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>(), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture = Ref<Texture2D>(), float p_width = 1); + void draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>()); + void draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>()); - void draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1)); + void draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture); - void draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, const Color &p_modulate = Color(1, 1, 1), int p_clip_w = -1); - float draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next = "", const Color &p_modulate = Color(1, 1, 1)); + void draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, float p_width = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint8_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + void draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, float p_width = -1, int p_max_lines = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint8_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + float draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next = "", int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; void draw_set_transform(const Point2 &p_offset, float p_rot = 0.0, const Size2 &p_scale = Size2(1.0, 1.0)); void draw_set_transform_matrix(const Transform2D &p_matrix); @@ -355,8 +361,8 @@ public: /* RECT / TRANSFORM */ - void set_as_toplevel(bool p_toplevel); - bool is_set_as_toplevel() const; + void set_as_top_level(bool p_top_level); + bool is_set_as_top_level() const; void set_draw_behind_parent(bool p_enable); bool is_draw_behind_parent_enabled() const; @@ -369,7 +375,7 @@ public: virtual Transform2D get_global_transform_with_canvas() const; virtual Transform2D get_screen_transform() const; - CanvasItem *get_toplevel() const; + CanvasItem *get_top_level() const; _FORCE_INLINE_ RID get_canvas_item() const { return canvas_item; } @@ -423,4 +429,58 @@ public: VARIANT_ENUM_CAST(CanvasItem::TextureFilter) VARIANT_ENUM_CAST(CanvasItem::TextureRepeat) +class CanvasTexture : public Texture2D { + GDCLASS(CanvasTexture, Texture2D); + OBJ_SAVE_TYPE(Texture2D); // Saves derived classes with common type so they can be interchanged. + + Ref<Texture2D> diffuse_texture; + Ref<Texture2D> normal_texture; + Ref<Texture2D> specular_texture; + Color specular = Color(1, 1, 1, 1); + float shininess = 1.0; + + RID canvas_texture; + + CanvasItem::TextureFilter texture_filter = CanvasItem::TEXTURE_FILTER_PARENT_NODE; + CanvasItem::TextureRepeat texture_repeat = CanvasItem::TEXTURE_REPEAT_PARENT_NODE; + +protected: + static void _bind_methods(); + +public: + void set_diffuse_texture(const Ref<Texture2D> &p_diffuse); + Ref<Texture2D> get_diffuse_texture() const; + + void set_normal_texture(const Ref<Texture2D> &p_normal); + Ref<Texture2D> get_normal_texture() const; + + void set_specular_texture(const Ref<Texture2D> &p_specular); + Ref<Texture2D> get_specular_texture() const; + + void set_specular_color(const Color &p_color); + Color get_specular_color() const; + + void set_specular_shininess(float p_shininess); + float get_specular_shininess() const; + + void set_texture_filter(CanvasItem::TextureFilter p_filter); + CanvasItem::TextureFilter get_texture_filter() const; + + void set_texture_repeat(CanvasItem::TextureRepeat p_repeat); + CanvasItem::TextureRepeat get_texture_repeat() const; + + virtual int get_width() const override; + virtual int get_height() const override; + + virtual bool is_pixel_opaque(int p_x, int p_y) const override; + virtual bool has_alpha() const override; + + virtual Ref<Image> get_data() const override; + + virtual RID get_rid() const override; + + CanvasTexture(); + ~CanvasTexture(); +}; + #endif // CANVAS_ITEM_H diff --git a/scene/main/http_request.cpp b/scene/main/http_request.cpp index da0169b60b..f484d25dc1 100644 --- a/scene/main/http_request.cpp +++ b/scene/main/http_request.cpp @@ -30,7 +30,7 @@ #include "http_request.h" #include "core/io/compression.h" -#include "core/ustring.h" +#include "core/string/ustring.h" void HTTPRequest::_redirect_request(const String &p_new_url) { } diff --git a/scene/main/node.cpp b/scene/main/node.cpp index e7753089c7..47440f8c60 100644 --- a/scene/main/node.cpp +++ b/scene/main/node.cpp @@ -32,8 +32,8 @@ #include "core/core_string_names.h" #include "core/io/resource_loader.h" -#include "core/message_queue.h" -#include "core/print_string.h" +#include "core/object/message_queue.h" +#include "core/string/print_string.h" #include "instance_placeholder.h" #include "scene/debugger/scene_debugger.h" #include "scene/resources/packed_scene.h" @@ -2873,6 +2873,7 @@ void Node::_bind_methods() { BIND_CONSTANT(NOTIFICATION_APPLICATION_PAUSED); BIND_CONSTANT(NOTIFICATION_APPLICATION_FOCUS_IN); BIND_CONSTANT(NOTIFICATION_APPLICATION_FOCUS_OUT); + BIND_CONSTANT(NOTIFICATION_TEXT_SERVER_CHANGED); BIND_ENUM_CONSTANT(PAUSE_MODE_INHERIT); BIND_ENUM_CONSTANT(PAUSE_MODE_STOP); @@ -2889,7 +2890,6 @@ void Node::_bind_methods() { ADD_SIGNAL(MethodInfo("tree_exiting")); ADD_SIGNAL(MethodInfo("tree_exited")); - ADD_GROUP("Pause", "pause_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "pause_mode", PROPERTY_HINT_ENUM, "Inherit,Stop,Process"), "set_pause_mode", "get_pause_mode"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "name", PROPERTY_HINT_NONE, "", 0), "set_name", "get_name"); diff --git a/scene/main/node.h b/scene/main/node.h index 2928466cd0..024d036fd3 100644 --- a/scene/main/node.h +++ b/scene/main/node.h @@ -31,13 +31,12 @@ #ifndef NODE_H #define NODE_H -#include "core/class_db.h" -#include "core/map.h" -#include "core/node_path.h" -#include "core/object.h" -#include "core/project_settings.h" -#include "core/script_language.h" -#include "core/typed_array.h" +#include "core/config/project_settings.h" +#include "core/object/class_db.h" +#include "core/object/script_language.h" +#include "core/string/node_path.h" +#include "core/templates/map.h" +#include "core/variant/typed_array.h" #include "scene/main/scene_tree.h" class Viewport; @@ -48,14 +47,12 @@ class Node : public Object { public: enum PauseMode { - PAUSE_MODE_INHERIT, PAUSE_MODE_STOP, PAUSE_MODE_PROCESS }; enum DuplicateFlags { - DUPLICATE_SIGNALS = 1, DUPLICATE_GROUPS = 2, DUPLICATE_SCRIPTS = 4, @@ -77,9 +74,8 @@ public: private: struct GroupData { - bool persistent; - SceneTree::Group *group; - GroupData() { persistent = false; } + bool persistent = false; + SceneTree::Group *group = nullptr; }; struct NetData { @@ -219,7 +215,6 @@ protected: public: enum { - // you can make your own, but don't use the same numbers as other notifications in other nodes NOTIFICATION_ENTER_TREE = 10, NOTIFICATION_EXIT_TREE = 11, @@ -258,8 +253,8 @@ public: NOTIFICATION_APPLICATION_RESUMED = MainLoop::NOTIFICATION_APPLICATION_RESUMED, NOTIFICATION_APPLICATION_PAUSED = MainLoop::NOTIFICATION_APPLICATION_PAUSED, NOTIFICATION_APPLICATION_FOCUS_IN = MainLoop::NOTIFICATION_APPLICATION_FOCUS_IN, - NOTIFICATION_APPLICATION_FOCUS_OUT = MainLoop::NOTIFICATION_APPLICATION_FOCUS_OUT - + NOTIFICATION_APPLICATION_FOCUS_OUT = MainLoop::NOTIFICATION_APPLICATION_FOCUS_OUT, + NOTIFICATION_TEXT_SERVER_CHANGED = MainLoop::NOTIFICATION_TEXT_SERVER_CHANGED, }; /* NODE/TREE */ diff --git a/scene/main/scene_tree.cpp b/scene/main/scene_tree.cpp index adefb53862..1df61daa2c 100644 --- a/scene/main/scene_tree.cpp +++ b/scene/main/scene_tree.cpp @@ -30,19 +30,19 @@ #include "scene_tree.h" +#include "core/config/project_settings.h" #include "core/debugger/engine_debugger.h" #include "core/input/input.h" #include "core/io/marshalls.h" #include "core/io/resource_loader.h" -#include "core/message_queue.h" +#include "core/object/message_queue.h" #include "core/os/dir_access.h" #include "core/os/keyboard.h" #include "core/os/os.h" -#include "core/print_string.h" -#include "core/project_settings.h" +#include "core/string/print_string.h" #include "node.h" #include "scene/debugger/scene_debugger.h" -#include "scene/resources/dynamic_font.h" +#include "scene/resources/font.h" #include "scene/resources/material.h" #include "scene/resources/mesh.h" #include "scene/resources/packed_scene.h" @@ -827,12 +827,9 @@ void SceneTree::_notify_group_pause(const StringName &p_group, int p_notificatio /* void SceneMainLoop::_update_listener_2d() { - if (listener_2d.is_valid()) { - SpatialSound2DServer::get_singleton()->listener_set_space( listener_2d, world_2d->get_sound_space() ); } - } */ @@ -1383,14 +1380,35 @@ SceneTree::SceneTree() { root->set_as_audio_listener_2d(true); current_scene = nullptr; - int msaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/msaa", 0); + const int msaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/msaa", 0); ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/screen_filters/msaa", PropertyInfo(Variant::INT, "rendering/quality/screen_filters/msaa", PROPERTY_HINT_ENUM, "Disabled (Fastest),2x (Fast),4x (Average),8x (Slow),16x (Slower)")); root->set_msaa(Viewport::MSAA(msaa_mode)); - int ssaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/screen_space_aa", 0); + const int ssaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/screen_space_aa", 0); ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/screen_filters/screen_space_aa", PropertyInfo(Variant::INT, "rendering/quality/screen_filters/screen_space_aa", PROPERTY_HINT_ENUM, "Disabled (Fastest),FXAA (Fast)")); root->set_screen_space_aa(Viewport::ScreenSpaceAA(ssaa_mode)); + const bool use_debanding = GLOBAL_DEF("rendering/quality/screen_filters/use_debanding", false); + root->set_use_debanding(use_debanding); + + float lod_threshold = GLOBAL_DEF("rendering/quality/mesh_lod/threshold_pixels", 1.0); + ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/mesh_lod/threshold_pixels", PropertyInfo(Variant::FLOAT, "rendering/quality/mesh_lod/threshold_pixels", PROPERTY_HINT_RANGE, "0,1024,0.1")); + root->set_lod_threshold(lod_threshold); + + bool snap_2d_transforms = GLOBAL_DEF("rendering/quality/2d/snap_2d_transforms_to_pixel", false); + root->set_snap_2d_transforms_to_pixel(snap_2d_transforms); + + bool snap_2d_vertices = GLOBAL_DEF("rendering/quality/2d/snap_2d_vertices_to_pixel", false); + root->set_snap_2d_vertices_to_pixel(snap_2d_vertices); + + Viewport::SDFOversize sdf_oversize = Viewport::SDFOversize(int(GLOBAL_DEF("rendering/quality/2d_sdf/oversize", 1))); + root->set_sdf_oversize(sdf_oversize); + Viewport::SDFScale sdf_scale = Viewport::SDFScale(int(GLOBAL_DEF("rendering/quality/2d_sdf/scale", 1))); + root->set_sdf_scale(sdf_scale); + + ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/2d_sdf/oversize", PropertyInfo(Variant::INT, "rendering/quality/2d_sdf/oversize", PROPERTY_HINT_ENUM, "100%,120%,150%,200%")); + ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/2d_sdf/scale", PropertyInfo(Variant::INT, "rendering/quality/2d_sdf/scale", PROPERTY_HINT_ENUM, "100%,50%,25%")); + { //load default fallback environment //get possible extensions List<String> exts; diff --git a/scene/main/scene_tree.h b/scene/main/scene_tree.h index e5ab4f9958..3e5802ce2e 100644 --- a/scene/main/scene_tree.h +++ b/scene/main/scene_tree.h @@ -34,7 +34,7 @@ #include "core/io/multiplayer_api.h" #include "core/os/main_loop.h" #include "core/os/thread_safe.h" -#include "core/self_list.h" +#include "core/templates/self_list.h" #include "scene/resources/mesh.h" #include "scene/resources/world_2d.h" #include "scene/resources/world_3d.h" diff --git a/scene/main/shader_globals_override.cpp b/scene/main/shader_globals_override.cpp index 726dcb58de..432fb5b4fb 100644 --- a/scene/main/shader_globals_override.cpp +++ b/scene/main/shader_globals_override.cpp @@ -202,7 +202,7 @@ void ShaderGlobalsOverride::_get_property_list(List<PropertyInfo> *p_list) const Override o; o.in_use = false; Callable::CallError ce; - o.override = Variant::construct(pinfo.type, nullptr, 0, ce); + Variant::construct(pinfo.type, o.override, nullptr, 0, ce); overrides[variables[i]] = o; } @@ -261,11 +261,16 @@ void ShaderGlobalsOverride::_notification(int p_what) { } String ShaderGlobalsOverride::get_configuration_warning() const { + String warning = Node::get_configuration_warning(); + if (!active) { - return TTR("ShaderGlobalsOverride is not active because another node of the same type is in the scene."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("ShaderGlobalsOverride is not active because another node of the same type is in the scene."); } - return String(); + return warning; } void ShaderGlobalsOverride::_bind_methods() { diff --git a/scene/main/timer.cpp b/scene/main/timer.cpp index fb55892b54..1c6037d26e 100644 --- a/scene/main/timer.cpp +++ b/scene/main/timer.cpp @@ -30,7 +30,7 @@ #include "timer.h" -#include "core/engine.h" +#include "core/config/engine.h" void Timer::_notification(int p_what) { switch (p_what) { @@ -46,7 +46,7 @@ void Timer::_notification(int p_what) { } } break; case NOTIFICATION_INTERNAL_PROCESS: { - if (timer_process_mode == TIMER_PROCESS_PHYSICS || !is_processing_internal()) { + if (!processing || timer_process_mode == TIMER_PROCESS_PHYSICS || !is_processing_internal()) { return; } time_left -= get_process_delta_time(); @@ -63,7 +63,7 @@ void Timer::_notification(int p_what) { } break; case NOTIFICATION_INTERNAL_PHYSICS_PROCESS: { - if (timer_process_mode == TIMER_PROCESS_IDLE || !is_physics_processing_internal()) { + if (!processing || timer_process_mode == TIMER_PROCESS_IDLE || !is_physics_processing_internal()) { return; } time_left -= get_physics_process_delta_time(); diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp index b29b40ea5f..c96dd4ad35 100644 --- a/scene/main/viewport.cpp +++ b/scene/main/viewport.cpp @@ -30,11 +30,13 @@ #include "viewport.h" +#include "core/config/project_settings.h" #include "core/core_string_names.h" #include "core/debugger/engine_debugger.h" #include "core/input/input.h" #include "core/os/os.h" -#include "core/project_settings.h" +#include "core/string/translation.h" + #include "scene/2d/collision_object_2d.h" #include "scene/3d/camera_3d.h" #include "scene/3d/collision_object_3d.h" @@ -161,6 +163,11 @@ ViewportTexture::~ViewportTexture() { ///////////////////////////////////// +// Aliases used to provide custom styles to tooltips in the default +// theme and editor theme. +// TooltipPanel is also used for custom tooltips, while TooltipLabel +// is only relevant for default tooltips. + class TooltipPanel : public PopupPanel { GDCLASS(TooltipPanel, PopupPanel); @@ -175,6 +182,8 @@ public: TooltipLabel() {} }; +///////////////////////////////////// + Viewport::GUI::GUI() { embed_subwindows_hint = false; embedding_subwindows = false; @@ -188,7 +197,7 @@ Viewport::GUI::GUI() { mouse_over = nullptr; drag_mouse_over = nullptr; - tooltip = nullptr; + tooltip_control = nullptr; tooltip_popup = nullptr; tooltip_label = nullptr; } @@ -278,16 +287,19 @@ void Viewport::_sub_window_update(Window *p_window) { // Draw the title bar text. Ref<Font> title_font = p_window->get_theme_font("title_font"); + int font_size = p_window->get_theme_font_size("title_font_size"); Color title_color = p_window->get_theme_color("title_color"); int title_height = p_window->get_theme_constant("title_height"); - int font_height = title_font->get_height() - title_font->get_descent() * 2; - int x = (r.size.width - title_font->get_string_size(p_window->get_title()).x) / 2; - int y = (-title_height + font_height) / 2; - int close_h_ofs = p_window->get_theme_constant("close_h_ofs"); int close_v_ofs = p_window->get_theme_constant("close_v_ofs"); - title_font->draw(sw.canvas_item, r.position + Point2(x, y), p_window->get_title(), title_color, r.size.width - panel->get_minimum_size().x - close_h_ofs); + TextLine title_text = TextLine(p_window->get_title(), title_font, font_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + title_text.set_width(r.size.width - panel->get_minimum_size().x - close_h_ofs); + title_text.set_direction(p_window->is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); + int x = (r.size.width - title_text.get_size().x) / 2; + int y = (-title_height - title_text.get_size().y) / 2; + + title_text.draw(sw.canvas_item, r.position + Point2(x, y), title_color); bool hl = gui.subwindow_focused == sw.window && gui.subwindow_drag == SUB_WINDOW_DRAG_CLOSE && gui.subwindow_drag_close_inside; @@ -814,7 +826,14 @@ void Viewport::_notification(int p_what) { } } break; - case NOTIFICATION_WM_MOUSE_EXIT: + case NOTIFICATION_WM_MOUSE_EXIT: { + _drop_physics_mouseover(); + + // Unlike on loss of focus (NOTIFICATION_WM_WINDOW_FOCUS_OUT), do not + // drop the gui mouseover here, as a scrollbar may be dragged while the + // mouse is outside the window (without the window having lost focus). + // See bug #39634 + } break; case NOTIFICATION_WM_WINDOW_FOCUS_OUT: { _drop_physics_mouseover(); @@ -1465,7 +1484,7 @@ void Viewport::_gui_sort_roots() { } void Viewport::_gui_cancel_tooltip() { - gui.tooltip = nullptr; + gui.tooltip_control = nullptr; gui.tooltip_timer = -1; if (gui.tooltip_popup) { gui.tooltip_popup->queue_delete(); @@ -1474,29 +1493,34 @@ void Viewport::_gui_cancel_tooltip() { } } -String Viewport::_gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Control **r_which) { +String Viewport::_gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Control **r_tooltip_owner) { Vector2 pos = p_pos; String tooltip; while (p_control) { tooltip = p_control->get_tooltip(pos); - if (r_which) { - *r_which = p_control; + if (r_tooltip_owner) { + *r_tooltip_owner = p_control; } - if (tooltip != String()) { + // If we found a tooltip, we stop here. + if (!tooltip.empty()) { break; } - pos = p_control->get_transform().xform(pos); + + // Otherwise, we check parent controls unless some conditions prevent it. if (p_control->data.mouse_filter == Control::MOUSE_FILTER_STOP) { break; } - if (p_control->is_set_as_toplevel()) { + if (p_control->is_set_as_top_level()) { break; } + // Transform cursor pos for parent control. + pos = p_control->get_transform().xform(pos); + p_control = p_control->get_parent_control(); } @@ -1504,34 +1528,40 @@ String Viewport::_gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Cont } void Viewport::_gui_show_tooltip() { - if (!gui.tooltip) { + if (!gui.tooltip_control) { return; } - Control *which = nullptr; - String tooltip = _gui_get_tooltip(gui.tooltip, gui.tooltip->get_global_transform().xform_inv(gui.last_mouse_pos), &which); - tooltip = tooltip.strip_edges(); - if (tooltip.length() == 0) { - return; // bye + // Get the Control under cursor and the relevant tooltip text, if any. + Control *tooltip_owner = nullptr; + String tooltip_text = _gui_get_tooltip( + gui.tooltip_control, + gui.tooltip_control->get_global_transform().xform_inv(gui.last_mouse_pos), + &tooltip_owner); + tooltip_text.strip_edges(); + if (tooltip_text.empty()) { + return; // Nothing to show. } + // Remove previous popup if we change something. if (gui.tooltip_popup) { memdelete(gui.tooltip_popup); gui.tooltip_popup = nullptr; gui.tooltip_label = nullptr; } - if (!which) { + if (!tooltip_owner) { return; } - Control *rp = which; - - Control *base_tooltip = which->make_custom_tooltip(tooltip); + // Controls can implement `make_custom_tooltip` to provide their own tooltip. + // This should be a Control node which will be added as child to a TooltipPanel. + Control *base_tooltip = tooltip_owner->make_custom_tooltip(tooltip_text); + // If no custom tooltip is given, use a default implementation. if (!base_tooltip) { gui.tooltip_label = memnew(TooltipLabel); - gui.tooltip_label->set_text(tooltip); + gui.tooltip_label->set_text(tooltip_text); base_tooltip = gui.tooltip_label; } @@ -1545,10 +1575,7 @@ void Viewport::_gui_show_tooltip() { gui.tooltip_popup = panel; - rp->add_child(gui.tooltip_popup); - - //if (gui.tooltip) // Avoids crash when rapidly switching controls. - // gui.tooltip_popup->set_scale(gui.tooltip->get_global_transform().get_scale()); + tooltip_owner->add_child(gui.tooltip_popup); Point2 tooltip_offset = ProjectSettings::get_singleton()->get("display/mouse_cursor/tooltip_position_offset"); Rect2 r(gui.tooltip_pos + tooltip_offset, gui.tooltip_popup->get_contents_minimum_size()); @@ -1620,7 +1647,7 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu } } - if (!control->is_inside_tree() || control->is_set_as_toplevel()) { + if (!control->is_inside_tree() || control->is_set_as_top_level()) { break; } if (gui.key_event_accepted) { @@ -1631,7 +1658,7 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu } } - if (ci->is_set_as_toplevel()) { + if (ci->is_set_as_top_level()) { break; } @@ -1655,7 +1682,7 @@ void Viewport::_gui_call_notification(Control *p_control, int p_what) { break; } - if (!control->is_inside_tree() || control->is_set_as_toplevel()) { + if (!control->is_inside_tree() || control->is_set_as_top_level()) { break; } if (control->data.mouse_filter == Control::MOUSE_FILTER_STOP) { @@ -1663,7 +1690,7 @@ void Viewport::_gui_call_notification(Control *p_control, int p_what) { } } - if (ci->is_set_as_toplevel()) { + if (ci->is_set_as_top_level()) { break; } @@ -1721,7 +1748,7 @@ Control *Viewport::_gui_find_control_at_pos(CanvasItem *p_node, const Point2 &p_ if (!c || !c->clips_input() || c->has_point(matrix.affine_inverse().xform(p_global))) { for (int i = p_node->get_child_count() - 1; i >= 0; i--) { CanvasItem *ci = Object::cast_to<CanvasItem>(p_node->get_child(i)); - if (!ci || ci->is_set_as_toplevel()) { + if (!ci || ci->is_set_as_top_level()) { continue; } @@ -1768,7 +1795,7 @@ bool Viewport::_gui_drop(Control *p_at_control, Point2 p_at_pos, bool p_just_che p_at_pos = ci->get_transform().xform(p_at_pos); - if (ci->is_set_as_toplevel()) { + if (ci->is_set_as_top_level()) { break; } @@ -1782,18 +1809,12 @@ bool Viewport::_gui_drop(Control *p_at_control, Point2 p_at_pos, bool p_just_che void Viewport::_gui_input_event(Ref<InputEvent> p_event) { ERR_FAIL_COND(p_event.is_null()); - //? - /* - if (!is_visible()) { - return; //simple and plain - } - */ - Ref<InputEventMouseButton> mb = p_event; - if (mb.is_valid()) { gui.key_event_accepted = false; + Control *over = nullptr; + Point2 mpos = mb->get_position(); if (mb->is_pressed()) { Size2 pos = mpos; @@ -1865,7 +1886,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } } - if (ci->is_set_as_toplevel()) { + if (ci->is_set_as_top_level()) { break; } @@ -1897,8 +1918,6 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } _gui_cancel_tooltip(); - //gui.tooltip_popup->hide(); - } else { if (gui.drag_data.get_type() != Variant::NIL && mb->get_button_index() == BUTTON_LEFT) { if (gui.drag_mouse_over) { @@ -1948,12 +1967,36 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { gui.drag_data=Variant(); //always clear }*/ + // In case the mouse was released after for example dragging a scrollbar, + // check whether the current control is different from the stored one. If + // it is different, rather than wait for it to be updated the next time the + // mouse is moved, notify the control so that it can e.g. drop the highlight. + // This code is duplicated from the mm.is_valid()-case further below. + if (gui.mouse_focus) { + over = gui.mouse_focus; + } else { + over = _gui_find_control(mpos); + } + + if (gui.mouse_focus_mask == 0 && over != gui.mouse_over) { + if (gui.mouse_over) { + _gui_call_notification(gui.mouse_over, Control::NOTIFICATION_MOUSE_EXIT); + } + + _gui_cancel_tooltip(); + + if (over) { + _gui_call_notification(over, Control::NOTIFICATION_MOUSE_ENTER); + } + } + + gui.mouse_over = over; + set_input_as_handled(); } } Ref<InputEventMouseMotion> mm = p_event; - if (mm.is_valid()) { gui.key_event_accepted = false; Point2 mpos = mm->get_position(); @@ -1993,7 +2036,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } } - if (ci->is_set_as_toplevel()) { + if (ci->is_set_as_top_level()) { break; } @@ -2008,10 +2051,11 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } } + // These sections of code are reused in the mb.is_valid() case further up + // for the purpose of notifying controls about potential changes in focus + // when the mousebutton is released. if (gui.mouse_focus) { over = gui.mouse_focus; - //recompute focus_inv_xform again here - } else { over = _gui_find_control(mpos); } @@ -2052,8 +2096,8 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { bool is_tooltip_shown = false; if (gui.tooltip_popup) { - if (can_tooltip && gui.tooltip) { - String tooltip = _gui_get_tooltip(over, gui.tooltip->get_global_transform().xform_inv(mpos)); + if (can_tooltip && gui.tooltip_control) { + String tooltip = _gui_get_tooltip(over, gui.tooltip_control->get_global_transform().xform_inv(mpos)); if (tooltip.length() == 0) { _gui_cancel_tooltip(); @@ -2078,14 +2122,12 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } if (can_tooltip && !is_tooltip_shown) { - gui.tooltip = over; - gui.tooltip_pos = over->get_screen_transform().xform(pos); //(parent_xform * get_transform()).affine_inverse().xform(pos); + gui.tooltip_control = over; + gui.tooltip_pos = over->get_screen_transform().xform(pos); gui.tooltip_timer = gui.tooltip_delay; } } - //pos = gui.focus_inv_xform.xform(pos); - mm->set_position(pos); Control::CursorShape cursor_shape = Control::CURSOR_ARROW; @@ -2105,7 +2147,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { if (c->data.mouse_filter == Control::MOUSE_FILTER_STOP) { break; } - if (c->is_set_as_toplevel()) { + if (c->is_set_as_top_level()) { break; } c = c->get_parent_control(); @@ -2332,7 +2374,6 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { //keyboard focus //if (from && p_event->is_pressed() && !p_event->get_alt() && !p_event->get_metakey() && !p_event->key->get_command()) { - Ref<InputEventKey> k = p_event; //need to check for mods, otherwise any combination of alt/ctrl/shift+<up/down/left/righ/etc> is handled here when it shouldn't be. bool mods = k.is_valid() && (k->get_control() || k->get_alt() || k->get_shift() || k->get_metakey()); @@ -2351,19 +2392,19 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } if (!mods && p_event->is_action_pressed("ui_up") && input->is_action_just_pressed("ui_up")) { - next = from->_get_focus_neighbour(MARGIN_TOP); + next = from->_get_focus_neighbor(MARGIN_TOP); } if (!mods && p_event->is_action_pressed("ui_left") && input->is_action_just_pressed("ui_left")) { - next = from->_get_focus_neighbour(MARGIN_LEFT); + next = from->_get_focus_neighbor(MARGIN_LEFT); } if (!mods && p_event->is_action_pressed("ui_right") && input->is_action_just_pressed("ui_right")) { - next = from->_get_focus_neighbour(MARGIN_RIGHT); + next = from->_get_focus_neighbor(MARGIN_RIGHT); } if (!mods && p_event->is_action_pressed("ui_down") && input->is_action_just_pressed("ui_down")) { - next = from->_get_focus_neighbour(MARGIN_BOTTOM); + next = from->_get_focus_neighbor(MARGIN_BOTTOM); } if (next) { @@ -2404,7 +2445,7 @@ void Viewport::_gui_set_drag_preview(Control *p_base, Control *p_control) { if (gui.drag_preview) { memdelete(gui.drag_preview); } - p_control->set_as_toplevel(true); + p_control->set_as_top_level(true); p_control->set_position(gui.last_mouse_pos); p_base->get_root_parent_control()->add_child(p_control); //add as child of viewport p_control->raise(); @@ -2422,7 +2463,7 @@ void Viewport::_gui_unfocus_control(Control *p_control) { } } -void Viewport::_gui_hid_control(Control *p_control) { +void Viewport::_gui_hide_control(Control *p_control) { if (gui.mouse_focus == p_control) { _drop_mouse_focus(); } @@ -2436,7 +2477,7 @@ void Viewport::_gui_hid_control(Control *p_control) { if (gui.drag_mouse_over == p_control) { gui.drag_mouse_over = nullptr; } - if (gui.tooltip == p_control) { + if (gui.tooltip_control == p_control) { _gui_cancel_tooltip(); } } @@ -2459,8 +2500,8 @@ void Viewport::_gui_remove_control(Control *p_control) { if (gui.drag_mouse_over == p_control) { gui.drag_mouse_over = nullptr; } - if (gui.tooltip == p_control) { - gui.tooltip = nullptr; + if (gui.tooltip_control == p_control) { + gui.tooltip_control = nullptr; } } @@ -2998,7 +3039,10 @@ void Viewport::unhandled_input(const Ref<InputEvent> &p_event, bool p_local_coor ev = p_event; } + // Unhandled Input get_tree()->_call_input_pause(unhandled_input_group, "_unhandled_input", ev, this); + + // Unhandled key Input - used for performance reasons - This is called a lot less then _unhandled_input since it ignores MouseMotion, etc if (!is_input_handled() && Object::cast_to<InputEventKey>(*ev) != nullptr) { get_tree()->_call_input_pause(unhandled_key_input_group, "_unhandled_key_input", ev, this); } @@ -3089,14 +3133,18 @@ Variant Viewport::gui_get_drag_data() const { String Viewport::get_configuration_warning() const { /*if (get_parent() && !Object::cast_to<Control>(get_parent()) && !render_target) { - return TTR("This viewport is not set as render target. If you intend for it to display its contents directly to the screen, make it a child of a Control so it can obtain a size. Otherwise, make it a RenderTarget and assign its internal texture to some node for display."); }*/ + String warning = Node::get_configuration_warning(); + if (size.x == 0 || size.y == 0) { - return TTR("Viewport size must be greater than 0 to render anything."); + if (!warning.empty()) { + warning += "\n\n"; + } + warning += TTR("Viewport size must be greater than 0 to render anything."); } - return String(); + return warning; } void Viewport::gui_reset_canvas_sort_index() { @@ -3133,6 +3181,25 @@ Viewport::ScreenSpaceAA Viewport::get_screen_space_aa() const { return screen_space_aa; } +void Viewport::set_use_debanding(bool p_use_debanding) { + if (use_debanding == p_use_debanding) + return; + use_debanding = p_use_debanding; + RS::get_singleton()->viewport_set_use_debanding(viewport, p_use_debanding); +} + +bool Viewport::is_using_debanding() const { + return use_debanding; +} + +void Viewport::set_lod_threshold(float p_pixels) { + lod_threshold = p_pixels; + RS::get_singleton()->viewport_set_lod_threshold(viewport, lod_threshold); +} +float Viewport::get_lod_threshold() const { + return lod_threshold; +} + void Viewport::set_debug_draw(DebugDraw p_debug_draw) { debug_draw = p_debug_draw; RS::get_singleton()->viewport_set_debug_draw(viewport, RS::ViewportDebugDraw(p_debug_draw)); @@ -3154,6 +3221,24 @@ bool Viewport::is_snap_controls_to_pixels_enabled() const { return snap_controls_to_pixels; } +void Viewport::set_snap_2d_transforms_to_pixel(bool p_enable) { + snap_2d_transforms_to_pixel = p_enable; + RS::get_singleton()->viewport_set_snap_2d_transforms_to_pixel(viewport, snap_2d_transforms_to_pixel); +} + +bool Viewport::is_snap_2d_transforms_to_pixel_enabled() const { + return snap_2d_transforms_to_pixel; +} + +void Viewport::set_snap_2d_vertices_to_pixel(bool p_enable) { + snap_2d_vertices_to_pixel = p_enable; + RS::get_singleton()->viewport_set_snap_2d_vertices_to_pixel(viewport, snap_2d_vertices_to_pixel); +} + +bool Viewport::is_snap_2d_vertices_to_pixel_enabled() const { + return snap_2d_vertices_to_pixel; +} + bool Viewport::gui_is_dragging() const { return gui.dragging; } @@ -3208,11 +3293,28 @@ void Viewport::_validate_property(PropertyInfo &property) const { } void Viewport::set_default_canvas_item_texture_filter(DefaultCanvasItemTextureFilter p_filter) { + ERR_FAIL_INDEX(p_filter, DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_MAX); + if (default_canvas_item_texture_filter == p_filter) { return; } default_canvas_item_texture_filter = p_filter; - _propagate_update_default_filter(this); + switch (default_canvas_item_texture_filter) { + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS); + break; + default: { + } + } } Viewport::DefaultCanvasItemTextureFilter Viewport::get_default_canvas_item_texture_filter() const { @@ -3220,37 +3322,31 @@ Viewport::DefaultCanvasItemTextureFilter Viewport::get_default_canvas_item_textu } void Viewport::set_default_canvas_item_texture_repeat(DefaultCanvasItemTextureRepeat p_repeat) { + ERR_FAIL_INDEX(p_repeat, DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MAX); + if (default_canvas_item_texture_repeat == p_repeat) { return; } - default_canvas_item_texture_repeat = p_repeat; - _propagate_update_default_repeat(this); -} - -Viewport::DefaultCanvasItemTextureRepeat Viewport::get_default_canvas_item_texture_repeat() const { - return default_canvas_item_texture_repeat; -} -void Viewport::_propagate_update_default_filter(Node *p_node) { - CanvasItem *ci = Object::cast_to<CanvasItem>(p_node); - if (ci) { - ci->_update_texture_filter_changed(false); - } + default_canvas_item_texture_repeat = p_repeat; - for (int i = 0; i < p_node->get_child_count(); i++) { - _propagate_update_default_filter(p_node->get_child(i)); + switch (default_canvas_item_texture_repeat) { + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_DISABLED: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_ENABLED: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MIRROR: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_MIRROR); + break; + default: { + } } } -void Viewport::_propagate_update_default_repeat(Node *p_node) { - CanvasItem *ci = Object::cast_to<CanvasItem>(p_node); - if (ci) { - ci->_update_texture_repeat_changed(false); - } - - for (int i = 0; i < p_node->get_child_count(); i++) { - _propagate_update_default_repeat(p_node->get_child(i)); - } +Viewport::DefaultCanvasItemTextureRepeat Viewport::get_default_canvas_item_texture_repeat() const { + return default_canvas_item_texture_repeat; } DisplayServer::WindowID Viewport::get_window_id() const { @@ -3294,6 +3390,24 @@ void Viewport::pass_mouse_focus_to(Viewport *p_viewport, Control *p_control) { } } +void Viewport::set_sdf_oversize(SDFOversize p_sdf_oversize) { + ERR_FAIL_INDEX(p_sdf_oversize, SDF_OVERSIZE_MAX); + sdf_oversize = p_sdf_oversize; + RS::get_singleton()->viewport_set_sdf_oversize_and_scale(viewport, RS::ViewportSDFOversize(sdf_oversize), RS::ViewportSDFScale(sdf_scale)); +} +Viewport::SDFOversize Viewport::get_sdf_oversize() const { + return sdf_oversize; +} + +void Viewport::set_sdf_scale(SDFScale p_sdf_scale) { + ERR_FAIL_INDEX(p_sdf_scale, SDF_SCALE_MAX); + sdf_scale = p_sdf_scale; + RS::get_singleton()->viewport_set_sdf_oversize_and_scale(viewport, RS::ViewportSDFOversize(sdf_oversize), RS::ViewportSDFScale(sdf_scale)); +} +Viewport::SDFScale Viewport::get_sdf_scale() const { + return sdf_scale; +} + void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_world_2d", "world_2d"), &Viewport::set_world_2d); ClassDB::bind_method(D_METHOD("get_world_2d"), &Viewport::get_world_2d); @@ -3319,6 +3433,9 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_screen_space_aa", "screen_space_aa"), &Viewport::set_screen_space_aa); ClassDB::bind_method(D_METHOD("get_screen_space_aa"), &Viewport::get_screen_space_aa); + ClassDB::bind_method(D_METHOD("set_use_debanding", "enable"), &Viewport::set_use_debanding); + ClassDB::bind_method(D_METHOD("is_using_debanding"), &Viewport::is_using_debanding); + ClassDB::bind_method(D_METHOD("set_debug_draw", "debug_draw"), &Viewport::set_debug_draw); ClassDB::bind_method(D_METHOD("get_debug_draw"), &Viewport::get_debug_draw); @@ -3365,6 +3482,12 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_snap_controls_to_pixels", "enabled"), &Viewport::set_snap_controls_to_pixels); ClassDB::bind_method(D_METHOD("is_snap_controls_to_pixels_enabled"), &Viewport::is_snap_controls_to_pixels_enabled); + ClassDB::bind_method(D_METHOD("set_snap_2d_transforms_to_pixel", "enabled"), &Viewport::set_snap_2d_transforms_to_pixel); + ClassDB::bind_method(D_METHOD("is_snap_2d_transforms_to_pixel_enabled"), &Viewport::is_snap_2d_transforms_to_pixel_enabled); + + ClassDB::bind_method(D_METHOD("set_snap_2d_vertices_to_pixel", "enabled"), &Viewport::set_snap_2d_vertices_to_pixel); + ClassDB::bind_method(D_METHOD("is_snap_2d_vertices_to_pixel_enabled"), &Viewport::is_snap_2d_vertices_to_pixel_enabled); + ClassDB::bind_method(D_METHOD("set_shadow_atlas_quadrant_subdiv", "quadrant", "subdiv"), &Viewport::set_shadow_atlas_quadrant_subdiv); ClassDB::bind_method(D_METHOD("get_shadow_atlas_quadrant_subdiv", "quadrant"), &Viewport::get_shadow_atlas_quadrant_subdiv); @@ -3384,14 +3507,27 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_default_canvas_item_texture_repeat", "mode"), &Viewport::set_default_canvas_item_texture_repeat); ClassDB::bind_method(D_METHOD("get_default_canvas_item_texture_repeat"), &Viewport::get_default_canvas_item_texture_repeat); + ClassDB::bind_method(D_METHOD("set_sdf_oversize", "oversize"), &Viewport::set_sdf_oversize); + ClassDB::bind_method(D_METHOD("get_sdf_oversize"), &Viewport::get_sdf_oversize); + + ClassDB::bind_method(D_METHOD("set_sdf_scale", "scale"), &Viewport::set_sdf_scale); + ClassDB::bind_method(D_METHOD("get_sdf_scale"), &Viewport::get_sdf_scale); + + ClassDB::bind_method(D_METHOD("set_lod_threshold", "pixels"), &Viewport::set_lod_threshold); + ClassDB::bind_method(D_METHOD("get_lod_threshold"), &Viewport::get_lod_threshold); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "own_world_3d"), "set_use_own_world_3d", "is_using_own_world_3d"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "world_3d", PROPERTY_HINT_RESOURCE_TYPE, "World3D"), "set_world_3d", "get_world_3d"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "world_2d", PROPERTY_HINT_RESOURCE_TYPE, "World2D", 0), "set_world_2d", "get_world_2d"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "transparent_bg"), "set_transparent_background", "has_transparent_background"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "handle_input_locally"), "set_handle_input_locally", "is_handling_input_locally"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "snap_2d_transforms_to_pixel"), "set_snap_2d_transforms_to_pixel", "is_snap_2d_transforms_to_pixel_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "snap_2d_vertices_to_pixel"), "set_snap_2d_vertices_to_pixel", "is_snap_2d_vertices_to_pixel_enabled"); ADD_GROUP("Rendering", ""); ADD_PROPERTY(PropertyInfo(Variant::INT, "msaa", PROPERTY_HINT_ENUM, "Disabled,2x,4x,8x,16x,AndroidVR 2x,AndroidVR 4x"), "set_msaa", "get_msaa"); ADD_PROPERTY(PropertyInfo(Variant::INT, "screen_space_aa", PROPERTY_HINT_ENUM, "Disabled,FXAA"), "set_screen_space_aa", "get_screen_space_aa"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_debanding"), "set_use_debanding", "is_using_debanding"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lod_threshold", PROPERTY_HINT_RANGE, "0,1024,0.1"), "set_lod_threshold", "get_lod_threshold"); ADD_PROPERTY(PropertyInfo(Variant::INT, "debug_draw", PROPERTY_HINT_ENUM, "Disabled,Unshaded,Overdraw,Wireframe"), "set_debug_draw", "get_debug_draw"); ADD_GROUP("Canvas Items", "canvas_item_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "canvas_item_default_texture_filter", PROPERTY_HINT_ENUM, "Nearest,Linear,MipmapLinear,MipmapNearest"), "set_default_canvas_item_texture_filter", "get_default_canvas_item_texture_filter"); @@ -3405,6 +3541,9 @@ void Viewport::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gui_disable_input"), "set_disable_input", "is_input_disabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gui_snap_controls_to_pixels"), "set_snap_controls_to_pixels", "is_snap_controls_to_pixels_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gui_embed_subwindows"), "set_embed_subwindows_hint", "get_embed_subwindows_hint"); + ADD_GROUP("SDF", "sdf_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "sdf_oversize", PROPERTY_HINT_ENUM, "100%,120%,150%,200%"), "set_sdf_oversize", "get_sdf_oversize"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "sdf_scale", PROPERTY_HINT_ENUM, "100%,50%,25%"), "set_sdf_scale", "get_sdf_scale"); ADD_GROUP("Shadow Atlas", "shadow_atlas_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_atlas_size"), "set_shadow_atlas_size", "get_shadow_atlas_size"); ADD_PROPERTYI(PropertyInfo(Variant::INT, "shadow_atlas_quad_0", PROPERTY_HINT_ENUM, "Disabled,1 Shadow,4 Shadows,16 Shadows,64 Shadows,256 Shadows,1024 Shadows"), "set_shadow_atlas_quadrant_subdiv", "get_shadow_atlas_quadrant_subdiv", 0); @@ -3463,6 +3602,7 @@ void Viewport::_bind_methods() { BIND_ENUM_CONSTANT(DEBUG_DRAW_SDFGI); BIND_ENUM_CONSTANT(DEBUG_DRAW_SDFGI_PROBES); BIND_ENUM_CONSTANT(DEBUG_DRAW_GI_BUFFER); + BIND_ENUM_CONSTANT(DEBUG_DRAW_DISABLE_LOD); BIND_ENUM_CONSTANT(DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST); BIND_ENUM_CONSTANT(DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR); @@ -3474,6 +3614,17 @@ void Viewport::_bind_methods() { BIND_ENUM_CONSTANT(DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); BIND_ENUM_CONSTANT(DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MIRROR); BIND_ENUM_CONSTANT(DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MAX); + + BIND_ENUM_CONSTANT(SDF_OVERSIZE_100_PERCENT); + BIND_ENUM_CONSTANT(SDF_OVERSIZE_120_PERCENT); + BIND_ENUM_CONSTANT(SDF_OVERSIZE_150_PERCENT); + BIND_ENUM_CONSTANT(SDF_OVERSIZE_200_PERCENT); + BIND_ENUM_CONSTANT(SDF_OVERSIZE_MAX); + + BIND_ENUM_CONSTANT(SDF_SCALE_100_PERCENT); + BIND_ENUM_CONSTANT(SDF_SCALE_50_PERCENT); + BIND_ENUM_CONSTANT(SDF_SCALE_25_PERCENT); + BIND_ENUM_CONSTANT(SDF_SCALE_MAX); } Viewport::Viewport() { @@ -3514,6 +3665,8 @@ Viewport::Viewport() { set_shadow_atlas_quadrant_subdiv(2, SHADOW_ATLAS_QUADRANT_SUBDIV_16); set_shadow_atlas_quadrant_subdiv(3, SHADOW_ATLAS_QUADRANT_SUBDIV_64); + set_lod_threshold(lod_threshold); + String id = itos(get_instance_id()); input_group = "_vp_input" + id; gui_input_group = "_vp_gui_input" + id; @@ -3522,14 +3675,13 @@ Viewport::Viewport() { disable_input = false; - //window tooltip + // Window tooltip. gui.tooltip_timer = -1; - //gui.tooltip_timer->force_parent_owned(); gui.tooltip_delay = GLOBAL_DEF("gui/timers/tooltip_delay_sec", 0.5); ProjectSettings::get_singleton()->set_custom_property_info("gui/timers/tooltip_delay_sec", PropertyInfo(Variant::FLOAT, "gui/timers/tooltip_delay_sec", PROPERTY_HINT_RANGE, "0,5,0.01,or_greater")); // No negative numbers - gui.tooltip = nullptr; + gui.tooltip_control = nullptr; gui.tooltip_label = nullptr; gui.drag_preview = nullptr; gui.drag_attempted = false; @@ -3546,6 +3698,9 @@ Viewport::Viewport() { debug_draw = DEBUG_DRAW_DISABLED; snap_controls_to_pixels = true; + snap_2d_transforms_to_pixel = false; + snap_2d_vertices_to_pixel = false; + physics_last_mouse_state.alt = false; physics_last_mouse_state.control = false; physics_last_mouse_state.shift = false; @@ -3558,6 +3713,10 @@ Viewport::Viewport() { default_canvas_item_texture_filter = DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR; default_canvas_item_texture_repeat = DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_DISABLED; + + sdf_oversize = SDF_OVERSIZE_120_PERCENT; + sdf_scale = SDF_SCALE_50_PERCENT; + set_sdf_oversize(SDF_OVERSIZE_120_PERCENT); //set to server } Viewport::~Viewport() { @@ -3680,7 +3839,7 @@ void SubViewport::_bind_methods() { BIND_ENUM_CONSTANT(CLEAR_MODE_ALWAYS); BIND_ENUM_CONSTANT(CLEAR_MODE_NEVER); - BIND_ENUM_CONSTANT(CLEAR_MODE_ONLY_NEXT_FRAME); + BIND_ENUM_CONSTANT(CLEAR_MODE_ONCE); BIND_ENUM_CONSTANT(UPDATE_DISABLED); BIND_ENUM_CONSTANT(UPDATE_ONCE); diff --git a/scene/main/viewport.h b/scene/main/viewport.h index 52145a7761..ffbc3c782a 100644 --- a/scene/main/viewport.h +++ b/scene/main/viewport.h @@ -142,6 +142,7 @@ public: DEBUG_DRAW_SDFGI, DEBUG_DRAW_SDFGI_PROBES, DEBUG_DRAW_GI_BUFFER, + DEBUG_DRAW_DISABLE_LOD, }; enum DefaultCanvasItemTextureFilter { @@ -159,6 +160,21 @@ public: DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MAX, }; + enum SDFOversize { + SDF_OVERSIZE_100_PERCENT, + SDF_OVERSIZE_120_PERCENT, + SDF_OVERSIZE_150_PERCENT, + SDF_OVERSIZE_200_PERCENT, + SDF_OVERSIZE_MAX + }; + + enum SDFScale { + SDF_SCALE_100_PERCENT, + SDF_SCALE_50_PERCENT, + SDF_SCALE_25_PERCENT, + SDF_SCALE_MAX + }; + enum { SUBWINDOW_CANVAS_LAYER = 1024 }; @@ -225,6 +241,8 @@ private: bool gen_mipmaps; bool snap_controls_to_pixels; + bool snap_2d_transforms_to_pixel; + bool snap_2d_vertices_to_pixel; bool physics_object_picking; List<Ref<InputEvent>> physics_picking_events; @@ -279,9 +297,15 @@ private: MSAA msaa; ScreenSpaceAA screen_space_aa; + bool use_debanding = false; + float lod_threshold = 1.0; + Ref<ViewportTexture> default_texture; Set<ViewportTexture *> viewport_textures; + SDFOversize sdf_oversize; + SDFScale sdf_scale; + enum SubWindowDrag { SUB_WINDOW_DRAG_DISABLED, SUB_WINDOW_DRAG_MOVE, @@ -320,7 +344,7 @@ private: Control *mouse_over; Control *drag_mouse_over; Vector2 drag_mouse_over_pos; - Control *tooltip; + Control *tooltip_control; Window *tooltip_popup; Label *tooltip_label; Point2 tooltip_pos; @@ -356,9 +380,6 @@ private: DefaultCanvasItemTextureFilter default_canvas_item_texture_filter; DefaultCanvasItemTextureRepeat default_canvas_item_texture_repeat; - void _propagate_update_default_filter(Node *p_node); - void _propagate_update_default_repeat(Node *p_node); - bool disable_input; void _gui_call_input(Control *p_control, const Ref<InputEvent> &p_input); @@ -382,12 +403,12 @@ private: void _gui_remove_root_control(List<Control *>::Element *RI); - String _gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Control **r_which = nullptr); + String _gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Control **r_tooltip_owner = nullptr); void _gui_cancel_tooltip(); void _gui_show_tooltip(); void _gui_remove_control(Control *p_control); - void _gui_hid_control(Control *p_control); + void _gui_hide_control(Control *p_control); void _gui_force_drag(Control *p_base, const Variant &p_data, Control *p_control); void _gui_set_drag_preview(Control *p_base, Control *p_control); @@ -521,6 +542,12 @@ public: void set_screen_space_aa(ScreenSpaceAA p_screen_space_aa); ScreenSpaceAA get_screen_space_aa() const; + void set_use_debanding(bool p_use_debanding); + bool is_using_debanding() const; + + void set_lod_threshold(float p_pixels); + float get_lod_threshold() const; + Vector2 get_camera_coords(const Vector2 &p_viewport_coords) const; Vector2 get_camera_rect_size() const; @@ -555,6 +582,12 @@ public: void set_snap_controls_to_pixels(bool p_enable); bool is_snap_controls_to_pixels_enabled() const; + void set_snap_2d_transforms_to_pixel(bool p_enable); + bool is_snap_2d_transforms_to_pixel_enabled() const; + + void set_snap_2d_vertices_to_pixel(bool p_enable); + bool is_snap_2d_vertices_to_pixel_enabled() const; + void set_input_as_handled(); bool is_input_handled() const; @@ -563,6 +596,12 @@ public: bool gui_is_dragging() const; + void set_sdf_oversize(SDFOversize p_sdf_oversize); + SDFOversize get_sdf_oversize() const; + + void set_sdf_scale(SDFScale p_sdf_scale); + SDFScale get_sdf_scale() const; + void set_default_canvas_item_texture_filter(DefaultCanvasItemTextureFilter p_filter); DefaultCanvasItemTextureFilter get_default_canvas_item_texture_filter() const; @@ -589,10 +628,9 @@ class SubViewport : public Viewport { public: enum ClearMode { - CLEAR_MODE_ALWAYS, CLEAR_MODE_NEVER, - CLEAR_MODE_ONLY_NEXT_FRAME + CLEAR_MODE_ONCE }; enum UpdateMode { @@ -642,6 +680,8 @@ VARIANT_ENUM_CAST(Viewport::ShadowAtlasQuadrantSubdiv); VARIANT_ENUM_CAST(Viewport::MSAA); VARIANT_ENUM_CAST(Viewport::ScreenSpaceAA); VARIANT_ENUM_CAST(Viewport::DebugDraw); +VARIANT_ENUM_CAST(Viewport::SDFScale); +VARIANT_ENUM_CAST(Viewport::SDFOversize); VARIANT_ENUM_CAST(SubViewport::ClearMode); VARIANT_ENUM_CAST(Viewport::RenderInfo); VARIANT_ENUM_CAST(Viewport::DefaultCanvasItemTextureFilter); diff --git a/scene/main/window.cpp b/scene/main/window.cpp index 7c2350d1c0..ad87139332 100644 --- a/scene/main/window.cpp +++ b/scene/main/window.cpp @@ -32,8 +32,9 @@ #include "core/debugger/engine_debugger.h" #include "core/os/keyboard.h" +#include "core/string/translation.h" #include "scene/gui/control.h" -#include "scene/resources/dynamic_font.h" +#include "scene/resources/font.h" #include "scene/scene_string_names.h" void Window::set_title(const String &p_title) { @@ -659,9 +660,8 @@ void Window::_update_viewport_size() { if (!use_font_oversampling) { font_oversampling = 1.0; } - if (DynamicFontAtSize::font_oversampling != font_oversampling) { - DynamicFontAtSize::font_oversampling = font_oversampling; - DynamicFont::update_oversampling(); + if (TS->font_get_oversampling() != font_oversampling) { + TS->font_set_oversampling(font_oversampling); } } @@ -895,11 +895,11 @@ void Window::_window_input(const Ref<InputEvent> &p_ev) { if (exclusive_child != nullptr) { Window *focus_target = exclusive_child; + focus_target->grab_focus(); while (focus_target->exclusive_child != nullptr) { - focus_target->grab_focus(); focus_target = focus_target->exclusive_child; + focus_target->grab_focus(); } - focus_target->grab_focus(); if (!is_embedding_subwindows()) { //not embedding, no need for event return; @@ -983,7 +983,7 @@ void Window::popup_centered_clamped(const Size2i &p_size, float p_fallback_ratio Rect2i popup_rect; popup_rect.size = Vector2i(MIN(size_ratio.x, p_size.x), MIN(size_ratio.y, p_size.y)); - popup_rect.position = (parent_rect.size - popup_rect.size) / 2; + popup_rect.position = parent_rect.position + (parent_rect.size - popup_rect.size) / 2; popup(popup_rect); } @@ -1009,7 +1009,7 @@ void Window::popup_centered(const Size2i &p_minsize) { } else { popup_rect.size = p_minsize; } - popup_rect.position = (parent_rect.size - popup_rect.size) / 2; + popup_rect.position = parent_rect.position + (parent_rect.size - popup_rect.size) / 2; popup(popup_rect); } @@ -1031,7 +1031,7 @@ void Window::popup_centered_ratio(float p_ratio) { Rect2i popup_rect; popup_rect.size = parent_rect.size * p_ratio; - popup_rect.position = (parent_rect.size - popup_rect.size) / 2; + popup_rect.position = parent_rect.position + (parent_rect.size - popup_rect.size) / 2; popup(popup_rect); } @@ -1167,11 +1167,6 @@ Ref<Texture2D> Window::get_theme_icon(const StringName &p_name, const StringName return Control::get_icons(theme_owner, theme_owner_window, p_name, type); } -Ref<Shader> Window::get_theme_shader(const StringName &p_name, const StringName &p_type) const { - StringName type = p_type ? p_type : get_class_name(); - return Control::get_shaders(theme_owner, theme_owner_window, p_name, type); -} - Ref<StyleBox> Window::get_theme_stylebox(const StringName &p_name, const StringName &p_type) const { StringName type = p_type ? p_type : get_class_name(); return Control::get_styleboxs(theme_owner, theme_owner_window, p_name, type); @@ -1182,6 +1177,11 @@ Ref<Font> Window::get_theme_font(const StringName &p_name, const StringName &p_t return Control::get_fonts(theme_owner, theme_owner_window, p_name, type); } +int Window::get_theme_font_size(const StringName &p_name, const StringName &p_type) const { + StringName type = p_type ? p_type : get_class_name(); + return Control::get_font_sizes(theme_owner, theme_owner_window, p_name, type); +} + Color Window::get_theme_color(const StringName &p_name, const StringName &p_type) const { StringName type = p_type ? p_type : get_class_name(); return Control::get_colors(theme_owner, theme_owner_window, p_name, type); @@ -1197,11 +1197,6 @@ bool Window::has_theme_icon(const StringName &p_name, const StringName &p_type) return Control::has_icons(theme_owner, theme_owner_window, p_name, type); } -bool Window::has_theme_shader(const StringName &p_name, const StringName &p_type) const { - StringName type = p_type ? p_type : get_class_name(); - return Control::has_shaders(theme_owner, theme_owner_window, p_name, type); -} - bool Window::has_theme_stylebox(const StringName &p_name, const StringName &p_type) const { StringName type = p_type ? p_type : get_class_name(); return Control::has_styleboxs(theme_owner, theme_owner_window, p_name, type); @@ -1212,6 +1207,11 @@ bool Window::has_theme_font(const StringName &p_name, const StringName &p_type) return Control::has_fonts(theme_owner, theme_owner_window, p_name, type); } +bool Window::has_theme_font_size(const StringName &p_name, const StringName &p_type) const { + StringName type = p_type ? p_type : get_class_name(); + return Control::has_font_sizes(theme_owner, theme_owner_window, p_name, type); +} + bool Window::has_theme_color(const StringName &p_name, const StringName &p_type) const { StringName type = p_type ? p_type : get_class_name(); return Control::has_colors(theme_owner, theme_owner_window, p_name, type); @@ -1266,6 +1266,40 @@ bool Window::is_clamped_to_embedder() const { return clamp_to_embedder; } +void Window::set_layout_direction(Window::LayoutDirection p_direction) { + ERR_FAIL_INDEX((int)p_direction, 4); + + layout_dir = p_direction; + propagate_notification(Control::NOTIFICATION_LAYOUT_DIRECTION_CHANGED); +} + +Window::LayoutDirection Window::get_layout_direction() const { + return layout_dir; +} + +bool Window::is_layout_rtl() const { + if (layout_dir == LAYOUT_DIRECTION_INHERITED) { + Window *parent = Object::cast_to<Window>(get_parent()); + if (parent) { + return parent->is_layout_rtl(); + } else { + if (GLOBAL_GET("display/window/force_right_to_left_layout_direction")) { + return true; + } + String locale = TranslationServer::get_singleton()->get_tool_locale(); + return TS->is_locale_right_to_left(locale); + } + } else if (layout_dir == LAYOUT_DIRECTION_LOCALE) { + if (GLOBAL_GET("display/window/force_right_to_left_layout_direction")) { + return true; + } + String locale = TranslationServer::get_singleton()->get_tool_locale(); + return TS->is_locale_right_to_left(locale); + } else { + return (layout_dir == LAYOUT_DIRECTION_RTL); + } +} + void Window::_bind_methods() { ClassDB::bind_method(D_METHOD("set_title", "title"), &Window::set_title); ClassDB::bind_method(D_METHOD("get_title"), &Window::get_title); @@ -1344,15 +1378,21 @@ void Window::_bind_methods() { ClassDB::bind_method(D_METHOD("get_theme_icon", "name", "type"), &Window::get_theme_icon, DEFVAL("")); ClassDB::bind_method(D_METHOD("get_theme_stylebox", "name", "type"), &Window::get_theme_stylebox, DEFVAL("")); ClassDB::bind_method(D_METHOD("get_theme_font", "name", "type"), &Window::get_theme_font, DEFVAL("")); + ClassDB::bind_method(D_METHOD("get_theme_font_size", "name", "type"), &Window::get_theme_font_size, DEFVAL("")); ClassDB::bind_method(D_METHOD("get_theme_color", "name", "type"), &Window::get_theme_color, DEFVAL("")); ClassDB::bind_method(D_METHOD("get_theme_constant", "name", "type"), &Window::get_theme_constant, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_icon", "name", "type"), &Window::has_theme_icon, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_stylebox", "name", "type"), &Window::has_theme_stylebox, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_font", "name", "type"), &Window::has_theme_font, DEFVAL("")); + ClassDB::bind_method(D_METHOD("has_theme_font_size", "name", "type"), &Window::has_theme_font_size, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_color", "name", "type"), &Window::has_theme_color, DEFVAL("")); ClassDB::bind_method(D_METHOD("has_theme_constant", "name", "type"), &Window::has_theme_constant, DEFVAL("")); + ClassDB::bind_method(D_METHOD("set_layout_direction", "direction"), &Window::set_layout_direction); + ClassDB::bind_method(D_METHOD("get_layout_direction"), &Window::get_layout_direction); + ClassDB::bind_method(D_METHOD("is_layout_rtl"), &Window::is_layout_rtl); + ClassDB::bind_method(D_METHOD("popup", "rect"), &Window::popup, DEFVAL(Rect2i())); ClassDB::bind_method(D_METHOD("popup_on_parent", "parent_rect"), &Window::popup_on_parent); ClassDB::bind_method(D_METHOD("popup_centered_ratio", "ratio"), &Window::popup_centered_ratio, DEFVAL(0.8)); @@ -1418,6 +1458,11 @@ void Window::_bind_methods() { BIND_ENUM_CONSTANT(CONTENT_SCALE_ASPECT_KEEP_WIDTH); BIND_ENUM_CONSTANT(CONTENT_SCALE_ASPECT_KEEP_HEIGHT); BIND_ENUM_CONSTANT(CONTENT_SCALE_ASPECT_EXPAND); + + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_INHERITED); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_LOCALE); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_LTR); + BIND_ENUM_CONSTANT(LAYOUT_DIRECTION_RTL); } Window::Window() { diff --git a/scene/main/window.h b/scene/main/window.h index 09c52b30a3..20f8309952 100644 --- a/scene/main/window.h +++ b/scene/main/window.h @@ -69,6 +69,13 @@ public: CONTENT_SCALE_ASPECT_EXPAND, }; + enum LayoutDirection { + LAYOUT_DIRECTION_INHERITED, + LAYOUT_DIRECTION_LOCALE, + LAYOUT_DIRECTION_LTR, + LAYOUT_DIRECTION_RTL + }; + enum { DEFAULT_WINDOW_SIZE = 100, }; @@ -94,6 +101,8 @@ private: bool updating_child_controls = false; bool clamp_to_embedder = false; + LayoutDirection layout_dir = LAYOUT_DIRECTION_INHERITED; + void _update_child_controls(); Size2i content_scale_size; @@ -147,10 +156,9 @@ protected: public: enum { - NOTIFICATION_VISIBILITY_CHANGED = 30, NOTIFICATION_POST_POPUP = 31, - NOTIFICATION_THEME_CHANGED = 32, + NOTIFICATION_THEME_CHANGED = 32 }; void set_title(const String &p_title); @@ -238,19 +246,23 @@ public: void grab_focus(); bool has_focus() const; + void set_layout_direction(LayoutDirection p_direction); + LayoutDirection get_layout_direction() const; + bool is_layout_rtl() const; + Rect2i get_usable_parent_rect() const; Ref<Texture2D> get_theme_icon(const StringName &p_name, const StringName &p_type = StringName()) const; - Ref<Shader> get_theme_shader(const StringName &p_name, const StringName &p_type = StringName()) const; Ref<StyleBox> get_theme_stylebox(const StringName &p_name, const StringName &p_type = StringName()) const; Ref<Font> get_theme_font(const StringName &p_name, const StringName &p_type = StringName()) const; + int get_theme_font_size(const StringName &p_name, const StringName &p_type = StringName()) const; Color get_theme_color(const StringName &p_name, const StringName &p_type = StringName()) const; int get_theme_constant(const StringName &p_name, const StringName &p_type = StringName()) const; bool has_theme_icon(const StringName &p_name, const StringName &p_type = StringName()) const; - bool has_theme_shader(const StringName &p_name, const StringName &p_type = StringName()) const; bool has_theme_stylebox(const StringName &p_name, const StringName &p_type = StringName()) const; bool has_theme_font(const StringName &p_name, const StringName &p_type = StringName()) const; + bool has_theme_font_size(const StringName &p_name, const StringName &p_type = StringName()) const; bool has_theme_color(const StringName &p_name, const StringName &p_type = StringName()) const; bool has_theme_constant(const StringName &p_name, const StringName &p_type = StringName()) const; @@ -265,5 +277,6 @@ VARIANT_ENUM_CAST(Window::Mode); VARIANT_ENUM_CAST(Window::Flags); VARIANT_ENUM_CAST(Window::ContentScaleMode); VARIANT_ENUM_CAST(Window::ContentScaleAspect); +VARIANT_ENUM_CAST(Window::LayoutDirection); #endif // WINDOW_H diff --git a/scene/register_scene_types.cpp b/scene/register_scene_types.cpp index 820513c53d..30077aa642 100644 --- a/scene/register_scene_types.cpp +++ b/scene/register_scene_types.cpp @@ -30,14 +30,15 @@ #include "register_scene_types.h" -#include "core/class_db.h" +#include "core/config/project_settings.h" +#include "core/object/class_db.h" #include "core/os/os.h" -#include "core/project_settings.h" #include "scene/2d/animated_sprite_2d.h" #include "scene/2d/area_2d.h" #include "scene/2d/audio_stream_player_2d.h" #include "scene/2d/back_buffer_copy.h" #include "scene/2d/camera_2d.h" +#include "scene/2d/canvas_group.h" #include "scene/2d/canvas_modulate.h" #include "scene/2d/collision_polygon_2d.h" #include "scene/2d/collision_shape_2d.h" @@ -76,6 +77,7 @@ #include "scene/animation/tween.h" #include "scene/audio/audio_stream_player.h" #include "scene/debugger/scene_debugger.h" +#include "scene/gui/aspect_ratio_container.h" #include "scene/gui/box_container.h" #include "scene/gui/button.h" #include "scene/gui/center_container.h" @@ -116,7 +118,7 @@ #include "scene/gui/tabs.h" #include "scene/gui/text_edit.h" #include "scene/gui/texture_button.h" -#include "scene/gui/texture_progress.h" +#include "scene/gui/texture_progress_bar.h" #include "scene/gui/texture_rect.h" #include "scene/gui/tree.h" #include "scene/gui/video_player.h" @@ -142,7 +144,7 @@ #include "scene/resources/convex_polygon_shape_3d.h" #include "scene/resources/cylinder_shape_3d.h" #include "scene/resources/default_theme/default_theme.h" -#include "scene/resources/dynamic_font.h" +#include "scene/resources/font.h" #include "scene/resources/gradient.h" #include "scene/resources/height_map_shape_3d.h" #include "scene/resources/line_shape_2d.h" @@ -166,6 +168,8 @@ #include "scene/resources/surface_tool.h" #include "scene/resources/syntax_highlighter.h" #include "scene/resources/text_file.h" +#include "scene/resources/text_line.h" +#include "scene/resources/text_paragraph.h" #include "scene/resources/texture.h" #include "scene/resources/tile_set.h" #include "scene/resources/video_stream.h" @@ -194,6 +198,7 @@ #include "scene/3d/decal.h" #include "scene/3d/gi_probe.h" #include "scene/3d/gpu_particles_3d.h" +#include "scene/3d/gpu_particles_collision_3d.h" #include "scene/3d/immediate_geometry_3d.h" #include "scene/3d/light_3d.h" #include "scene/3d/lightmap_probe.h" @@ -227,14 +232,16 @@ static Ref<ResourceFormatSaverText> resource_saver_text; static Ref<ResourceFormatLoaderText> resource_loader_text; -static Ref<ResourceFormatLoaderDynamicFont> resource_loader_dynamic_font; +static Ref<ResourceFormatLoaderFont> resource_loader_font; + +#ifndef DISABLE_DEPRECATED +static Ref<ResourceFormatLoaderCompatFont> resource_loader_compat_font; +#endif /* DISABLE_DEPRECATED */ static Ref<ResourceFormatLoaderStreamTexture2D> resource_loader_stream_texture; static Ref<ResourceFormatLoaderStreamTextureLayered> resource_loader_texture_layered; static Ref<ResourceFormatLoaderStreamTexture3D> resource_loader_texture_3d; -static Ref<ResourceFormatLoaderBMFont> resource_loader_bmfont; - static Ref<ResourceFormatSaverShader> resource_saver_shader; static Ref<ResourceFormatLoaderShader> resource_loader_shader; @@ -245,8 +252,13 @@ void register_scene_types() { Node::init_node_hrcr(); - resource_loader_dynamic_font.instance(); - ResourceLoader::add_resource_format_loader(resource_loader_dynamic_font); + resource_loader_font.instance(); + ResourceLoader::add_resource_format_loader(resource_loader_font); + +#ifndef DISABLE_DEPRECATED + resource_loader_compat_font.instance(); + ResourceLoader::add_resource_format_loader(resource_loader_compat_font); +#endif /* DISABLE_DEPRECATED */ resource_loader_stream_texture.instance(); ResourceLoader::add_resource_format_loader(resource_loader_stream_texture); @@ -269,9 +281,6 @@ void register_scene_types() { resource_loader_shader.instance(); ResourceLoader::add_resource_format_loader(resource_loader_shader, true); - resource_loader_bmfont.instance(); - ResourceLoader::add_resource_format_loader(resource_loader_bmfont, true); - OS::get_singleton()->yield(); //may take time to init ClassDB::register_class<Object>(); @@ -322,6 +331,7 @@ void register_scene_types() { ClassDB::register_class<ColorRect>(); ClassDB::register_class<NinePatchRect>(); ClassDB::register_class<ReferenceRect>(); + ClassDB::register_class<AspectRatioContainer>(); ClassDB::register_class<TabContainer>(); ClassDB::register_class<Tabs>(); ClassDB::register_virtual_class<Separator>(); @@ -339,7 +349,7 @@ void register_scene_types() { OS::get_singleton()->yield(); //may take time to init - ClassDB::register_class<TextureProgress>(); + ClassDB::register_class<TextureProgressBar>(); ClassDB::register_class<ItemList>(); ClassDB::register_class<LineEdit>(); @@ -450,6 +460,15 @@ void register_scene_types() { ClassDB::register_class<LightmapProbe>(); ClassDB::register_virtual_class<Lightmapper>(); ClassDB::register_class<GPUParticles3D>(); + ClassDB::register_virtual_class<GPUParticlesCollision3D>(); + ClassDB::register_class<GPUParticlesCollisionBox>(); + ClassDB::register_class<GPUParticlesCollisionSphere>(); + ClassDB::register_class<GPUParticlesCollisionSDF>(); + ClassDB::register_class<GPUParticlesCollisionHeightField>(); + ClassDB::register_virtual_class<GPUParticlesAttractor3D>(); + ClassDB::register_class<GPUParticlesAttractorBox>(); + ClassDB::register_class<GPUParticlesAttractorSphere>(); + ClassDB::register_class<GPUParticlesAttractorVectorField>(); ClassDB::register_class<CPUParticles3D>(); ClassDB::register_class<Position3D>(); @@ -512,7 +531,8 @@ void register_scene_types() { ClassDB::register_class<VisualShaderNodeCustom>(); ClassDB::register_class<VisualShaderNodeInput>(); ClassDB::register_virtual_class<VisualShaderNodeOutput>(); - ClassDB::register_class<VisualShaderNodeGroupBase>(); + ClassDB::register_virtual_class<VisualShaderNodeResizableBase>(); + ClassDB::register_virtual_class<VisualShaderNodeGroupBase>(); ClassDB::register_class<VisualShaderNodeFloatConstant>(); ClassDB::register_class<VisualShaderNodeIntConstant>(); ClassDB::register_class<VisualShaderNodeBooleanConstant>(); @@ -553,6 +573,7 @@ void register_scene_types() { ClassDB::register_class<VisualShaderNodeVectorDecompose>(); ClassDB::register_class<VisualShaderNodeTransformDecompose>(); ClassDB::register_class<VisualShaderNodeTexture>(); + ClassDB::register_class<VisualShaderNodeCurveTexture>(); ClassDB::register_virtual_class<VisualShaderNodeSample3D>(); ClassDB::register_class<VisualShaderNodeTexture2DArray>(); ClassDB::register_class<VisualShaderNodeTexture3D>(); @@ -582,6 +603,7 @@ void register_scene_types() { ClassDB::register_class<ShaderMaterial>(); ClassDB::register_virtual_class<CanvasItem>(); + ClassDB::register_class<CanvasTexture>(); ClassDB::register_class<CanvasItemMaterial>(); SceneTree::add_idle_callback(CanvasItemMaterial::flush_changes); CanvasItemMaterial::init_shaders(); @@ -589,6 +611,7 @@ void register_scene_types() { /* REGISTER 2D */ ClassDB::register_class<Node2D>(); + ClassDB::register_class<CanvasGroup>(); ClassDB::register_class<CPUParticles2D>(); ClassDB::register_class<GPUParticles2D>(); ClassDB::register_class<Sprite2D>(); @@ -613,7 +636,9 @@ void register_scene_types() { ClassDB::register_class<Polygon2D>(); ClassDB::register_class<Skeleton2D>(); ClassDB::register_class<Bone2D>(); - ClassDB::register_class<Light2D>(); + ClassDB::register_virtual_class<Light2D>(); + ClassDB::register_class<PointLight2D>(); + ClassDB::register_class<DirectionalLight2D>(); ClassDB::register_class<LightOccluder2D>(); ClassDB::register_class<OccluderPolygon2D>(); ClassDB::register_class<YSort>(); @@ -654,8 +679,8 @@ void register_scene_types() { #ifndef _3D_DISABLED ClassDB::register_virtual_class<PrimitiveMesh>(); + ClassDB::register_class<BoxMesh>(); ClassDB::register_class<CapsuleMesh>(); - ClassDB::register_class<CubeMesh>(); ClassDB::register_class<CylinderMesh>(); ClassDB::register_class<PlaneMesh>(); ClassDB::register_class<PrismMesh>(); @@ -721,16 +746,13 @@ void register_scene_types() { ClassDB::register_class<StreamTexture2DArray>(); ClassDB::register_class<Animation>(); - ClassDB::register_virtual_class<Font>(); - ClassDB::register_class<BitmapFont>(); + ClassDB::register_class<FontData>(); + ClassDB::register_class<Font>(); ClassDB::register_class<Curve>(); ClassDB::register_class<TextFile>(); - - ClassDB::register_class<DynamicFontData>(); - ClassDB::register_class<DynamicFont>(); - - DynamicFont::initialize_dynamic_fonts(); + ClassDB::register_class<TextLine>(); + ClassDB::register_class<TextParagraph>(); ClassDB::register_virtual_class<StyleBox>(); ClassDB::register_class<StyleBoxEmpty>(); @@ -786,6 +808,9 @@ void register_scene_types() { #ifndef DISABLE_DEPRECATED // Dropped in 4.0, near approximation. ClassDB::add_compatibility_class("AnimationTreePlayer", "AnimationTree"); + ClassDB::add_compatibility_class("BitmapFont", "Font"); + ClassDB::add_compatibility_class("DynamicFont", "Font"); + ClassDB::add_compatibility_class("DynamicFontData", "FontData"); ClassDB::add_compatibility_class("ToolButton", "Button"); // Renamed in 4.0. @@ -822,6 +847,7 @@ void register_scene_types() { ClassDB::add_compatibility_class("CSGShape", "CSGShape3D"); ClassDB::add_compatibility_class("CSGSphere", "CSGSphere3D"); ClassDB::add_compatibility_class("CSGTorus", "CSGTorus3D"); + ClassDB::add_compatibility_class("CubeMesh", "BoxMesh"); ClassDB::add_compatibility_class("CylinderShape", "CylinderShape3D"); ClassDB::add_compatibility_class("DirectionalLight", "DirectionalLight3D"); ClassDB::add_compatibility_class("EditorSpatialGizmo", "EditorNode3DGizmo"); @@ -889,6 +915,7 @@ void register_scene_types() { ClassDB::add_compatibility_class("SpringArm", "SpringArm3D"); ClassDB::add_compatibility_class("Sprite", "Sprite2D"); ClassDB::add_compatibility_class("StaticBody", "StaticBody3D"); + ClassDB::add_compatibility_class("TextureProgress", "TextureProgressBar"); ClassDB::add_compatibility_class("VehicleBody", "VehicleBody3D"); ClassDB::add_compatibility_class("VehicleWheel", "VehicleWheel3D"); ClassDB::add_compatibility_class("ViewportContainer", "SubViewportContainer"); @@ -902,8 +929,9 @@ void register_scene_types() { ClassDB::add_compatibility_class("VisualShaderNodeScalarUniform", "VisualShaderNodeFloatUniform"); ClassDB::add_compatibility_class("World", "World3D"); ClassDB::add_compatibility_class("StreamTexture", "StreamTexture2D"); + ClassDB::add_compatibility_class("Light2D", "PointLight2D"); -#endif +#endif /* DISABLE_DEPRECATED */ OS::get_singleton()->yield(); //may take time to init @@ -952,8 +980,13 @@ void unregister_scene_types() { SceneDebugger::deinitialize(); clear_default_theme(); - ResourceLoader::remove_resource_format_loader(resource_loader_dynamic_font); - resource_loader_dynamic_font.unref(); + ResourceLoader::remove_resource_format_loader(resource_loader_font); + resource_loader_font.unref(); + +#ifndef DISABLE_DEPRECATED + ResourceLoader::remove_resource_format_loader(resource_loader_compat_font); + resource_loader_compat_font.unref(); +#endif /* DISABLE_DEPRECATED */ ResourceLoader::remove_resource_format_loader(resource_loader_texture_layered); resource_loader_texture_layered.unref(); @@ -964,8 +997,6 @@ void unregister_scene_types() { ResourceLoader::remove_resource_format_loader(resource_loader_stream_texture); resource_loader_stream_texture.unref(); - DynamicFont::finish_dynamic_fonts(); - ResourceSaver::remove_resource_format_saver(resource_saver_text); resource_saver_text.unref(); @@ -978,9 +1009,6 @@ void unregister_scene_types() { ResourceLoader::remove_resource_format_loader(resource_loader_shader); resource_loader_shader.unref(); - ResourceLoader::remove_resource_format_loader(resource_loader_bmfont); - resource_loader_bmfont.unref(); - //StandardMaterial3D is not initialised when 3D is disabled, so it shouldn't be cleaned up either #ifndef _3D_DISABLED BaseMaterial3D::finish_shaders(); diff --git a/scene/resources/SCsub b/scene/resources/SCsub index 3a86b22835..f4dc7a46fb 100644 --- a/scene/resources/SCsub +++ b/scene/resources/SCsub @@ -2,6 +2,25 @@ Import("env") -env.add_source_files(env.scene_sources, "*.cpp") +# Thirdparty code + +thirdparty_obj = [] + +thirdparty_sources = "#thirdparty/misc/mikktspace.c" + +env_thirdparty = env.Clone() +env_thirdparty.disable_warnings() +env_thirdparty.add_source_files(thirdparty_obj, thirdparty_sources) +env.scene_sources += thirdparty_obj + +# Godot source files + +scene_obj = [] + +env.add_source_files(scene_obj, "*.cpp") +env.scene_sources += scene_obj + +# Needed to force rebuilding the scene files when the thirdparty code is updated. +env.Depends(scene_obj, thirdparty_obj) SConscript("default_theme/SCsub") diff --git a/scene/resources/animation.cpp b/scene/resources/animation.cpp index b8edd70712..f4670ca850 100644 --- a/scene/resources/animation.cpp +++ b/scene/resources/animation.cpp @@ -33,8 +33,6 @@ #include "core/math/geometry_3d.h" -#define ANIM_MIN_LENGTH 0.001 - bool Animation::_set(const StringName &p_name, const Variant &p_value) { String name = p_name; @@ -721,7 +719,6 @@ bool Animation::track_get_interpolation_loop_wrap(int p_track) const { /* template<class T> int Animation::_insert_pos(float p_time, T& p_keys) { - // simple, linear time inset that should be fast enough in reality. int idx=p_keys.size(); @@ -734,14 +731,12 @@ int Animation::_insert_pos(float p_time, T& p_keys) { p_keys.insert(idx,T()); return idx; } else if (p_keys[idx-1].time == p_time) { - // condition for replacing. return idx-1; } idx--; } - } */ @@ -813,8 +808,8 @@ int Animation::transform_track_insert_key(int p_track, float p_time, const Vecto return ret; } -void Animation::track_remove_key_at_position(int p_track, float p_pos) { - int idx = track_find_key(p_track, p_pos, true); +void Animation::track_remove_key_at_time(int p_track, float p_time) { + int idx = track_find_key(p_track, p_time, true); ERR_FAIL_COND(idx < 0); track_remove_key(p_track, idx); } @@ -2611,7 +2606,7 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("transform_track_insert_key", "track_idx", "time", "location", "rotation", "scale"), &Animation::transform_track_insert_key); ClassDB::bind_method(D_METHOD("track_insert_key", "track_idx", "time", "key", "transition"), &Animation::track_insert_key, DEFVAL(1)); ClassDB::bind_method(D_METHOD("track_remove_key", "track_idx", "key_idx"), &Animation::track_remove_key); - ClassDB::bind_method(D_METHOD("track_remove_key_at_position", "track_idx", "position"), &Animation::track_remove_key_at_position); + ClassDB::bind_method(D_METHOD("track_remove_key_at_time", "track_idx", "time"), &Animation::track_remove_key_at_time); ClassDB::bind_method(D_METHOD("track_set_key_value", "track_idx", "key", "value"), &Animation::track_set_key_value); ClassDB::bind_method(D_METHOD("track_set_key_transition", "track_idx", "key_idx", "transition"), &Animation::track_set_key_transition); ClassDB::bind_method(D_METHOD("track_set_key_time", "track_idx", "key_idx", "time"), &Animation::track_set_key_time); @@ -2633,6 +2628,7 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("value_track_get_update_mode", "track_idx"), &Animation::value_track_get_update_mode); ClassDB::bind_method(D_METHOD("value_track_get_key_indices", "track_idx", "time_sec", "delta"), &Animation::_value_track_get_key_indices); + ClassDB::bind_method(D_METHOD("value_track_interpolate", "track_idx", "time_sec"), &Animation::value_track_interpolate); ClassDB::bind_method(D_METHOD("method_track_get_key_indices", "track_idx", "time_sec", "delta"), &Animation::_method_track_get_key_indices); ClassDB::bind_method(D_METHOD("method_track_get_name", "track_idx", "key_idx"), &Animation::method_track_get_name); diff --git a/scene/resources/animation.h b/scene/resources/animation.h index 722a400fd6..650a54ebfc 100644 --- a/scene/resources/animation.h +++ b/scene/resources/animation.h @@ -31,7 +31,9 @@ #ifndef ANIMATION_H #define ANIMATION_H -#include "core/resource.h" +#include "core/io/resource.h" + +#define ANIM_MIN_LENGTH 0.001 class Animation : public Resource { GDCLASS(Animation, Resource); @@ -293,7 +295,7 @@ public: void track_set_key_time(int p_track, int p_key_idx, float p_time); int track_find_key(int p_track, float p_time, bool p_exact = false) const; void track_remove_key(int p_track, int p_idx); - void track_remove_key_at_position(int p_track, float p_pos); + void track_remove_key_at_time(int p_track, float p_time); int track_get_key_count(int p_track) const; Variant track_get_key_value(int p_track, int p_key_idx) const; float track_get_key_time(int p_track, int p_key_idx) const; diff --git a/scene/resources/audio_stream_sample.cpp b/scene/resources/audio_stream_sample.cpp index f02e7987a9..600a859894 100644 --- a/scene/resources/audio_stream_sample.cpp +++ b/scene/resources/audio_stream_sample.cpp @@ -261,7 +261,8 @@ void AudioStreamPlaybackSample::mix(AudioFrame *p_buffer, float p_rate_scale, in sign = -1; } - float base_rate = AudioServer::get_singleton()->get_mix_rate(); + float global_rate_scale = AudioServer::get_singleton()->get_global_rate_scale(); + float base_rate = AudioServer::get_singleton()->get_mix_rate() * global_rate_scale; float srate = base->mix_rate; srate *= p_rate_scale; float fincrement = srate / base_rate; diff --git a/scene/resources/bit_map.cpp b/scene/resources/bit_map.cpp index 10f0de8ff8..d07447179d 100644 --- a/scene/resources/bit_map.cpp +++ b/scene/resources/bit_map.cpp @@ -63,7 +63,7 @@ void BitMap::create_from_image_alpha(const Ref<Image> &p_image, float p_threshol } void BitMap::set_bit_rect(const Rect2 &p_rect, bool p_value) { - Rect2i current = Rect2i(0, 0, width, height).clip(p_rect); + Rect2i current = Rect2i(0, 0, width, height).intersection(p_rect); uint8_t *data = bitmask.ptrw(); for (int i = current.position.x; i < current.position.x + current.size.x; i++) { @@ -482,7 +482,7 @@ static void fill_bits(const BitMap *p_src, Ref<BitMap> &p_map, const Point2i &p_ } Vector<Vector<Vector2>> BitMap::clip_opaque_to_polygons(const Rect2 &p_rect, float p_epsilon) const { - Rect2i r = Rect2i(0, 0, width, height).clip(p_rect); + Rect2i r = Rect2i(0, 0, width, height).intersection(p_rect); print_verbose("BitMap: Rect: " + r); Point2i from; @@ -522,7 +522,7 @@ void BitMap::grow_mask(int p_pixels, const Rect2 &p_rect) { bool bit_value = p_pixels > 0; p_pixels = Math::abs(p_pixels); - Rect2i r = Rect2i(0, 0, width, height).clip(p_rect); + Rect2i r = Rect2i(0, 0, width, height).intersection(p_rect); Ref<BitMap> copy; copy.instance(); diff --git a/scene/resources/bit_map.h b/scene/resources/bit_map.h index 59f3b4dc3c..56ff72c094 100644 --- a/scene/resources/bit_map.h +++ b/scene/resources/bit_map.h @@ -31,9 +31,9 @@ #ifndef BIT_MAP_H #define BIT_MAP_H -#include "core/image.h" +#include "core/io/image.h" +#include "core/io/resource.h" #include "core/io/resource_loader.h" -#include "core/resource.h" class BitMap : public Resource { GDCLASS(BitMap, Resource); diff --git a/scene/resources/camera_effects.h b/scene/resources/camera_effects.h index 99fd4eb37c..9a26f3d0b2 100644 --- a/scene/resources/camera_effects.h +++ b/scene/resources/camera_effects.h @@ -31,8 +31,8 @@ #ifndef CAMERA_EFFECTS_H #define CAMERA_EFFECTS_H -#include "core/resource.h" -#include "core/rid.h" +#include "core/io/resource.h" +#include "core/templates/rid.h" class CameraEffects : public Resource { GDCLASS(CameraEffects, Resource); diff --git a/scene/resources/capsule_shape_3d.cpp b/scene/resources/capsule_shape_3d.cpp index 9d1355eec6..5da7f682e5 100644 --- a/scene/resources/capsule_shape_3d.cpp +++ b/scene/resources/capsule_shape_3d.cpp @@ -106,8 +106,8 @@ void CapsuleShape3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_height", "height"), &CapsuleShape3D::set_height); ClassDB::bind_method(D_METHOD("get_height"), &CapsuleShape3D::get_height); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,4096,0.01"), "set_radius", "get_radius"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0.01,4096,0.01"), "set_height", "get_height"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.001,4096,0.001"), "set_radius", "get_radius"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0.001,4096,0.001"), "set_height", "get_height"); } CapsuleShape3D::CapsuleShape3D() : diff --git a/scene/resources/curve.h b/scene/resources/curve.h index 57ddaf897d..6c5f4b7057 100644 --- a/scene/resources/curve.h +++ b/scene/resources/curve.h @@ -31,7 +31,7 @@ #ifndef CURVE_H #define CURVE_H -#include "core/resource.h" +#include "core/io/resource.h" // y(x) curve class Curve : public Resource { diff --git a/scene/resources/cylinder_shape_3d.cpp b/scene/resources/cylinder_shape_3d.cpp index ad64541247..bb8c27a60d 100644 --- a/scene/resources/cylinder_shape_3d.cpp +++ b/scene/resources/cylinder_shape_3d.cpp @@ -99,8 +99,8 @@ void CylinderShape3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_height", "height"), &CylinderShape3D::set_height); ClassDB::bind_method(D_METHOD("get_height"), &CylinderShape3D::get_height); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,4096,0.01"), "set_radius", "get_radius"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0.01,4096,0.01"), "set_height", "get_height"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.001,4096,0.001"), "set_radius", "get_radius"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "0.001,4096,0.001"), "set_height", "get_height"); } CylinderShape3D::CylinderShape3D() : diff --git a/scene/resources/default_theme/arrow_left.png b/scene/resources/default_theme/arrow_left.png Binary files differnew file mode 100644 index 0000000000..4163059dd3 --- /dev/null +++ b/scene/resources/default_theme/arrow_left.png diff --git a/scene/resources/default_theme/default_theme.cpp b/scene/resources/default_theme/default_theme.cpp index f65f78b332..2de28b5e5c 100644 --- a/scene/resources/default_theme/default_theme.cpp +++ b/scene/resources/default_theme/default_theme.cpp @@ -38,6 +38,8 @@ #include "font_hidpi.inc" #include "font_lodpi.inc" +#include "servers/text_server.h" + typedef Map<const void *, Ref<ImageTexture>> TexCacheMap; static TexCacheMap *tex_cache; @@ -75,6 +77,17 @@ static Ref<StyleBoxTexture> make_stylebox(T p_src, float p_left, float p_top, fl return style; } +static Ref<StyleBoxFlat> make_flat_stylebox(Color p_color, float p_margin_left = -1, float p_margin_top = -1, float p_margin_right = -1, float p_margin_bottom = -1) { + Ref<StyleBoxFlat> style(memnew(StyleBoxFlat)); + style->set_bg_color(p_color); + style->set_default_margin(MARGIN_LEFT, p_margin_left * scale); + style->set_default_margin(MARGIN_RIGHT, p_margin_right * scale); + style->set_default_margin(MARGIN_BOTTOM, p_margin_bottom * scale); + style->set_default_margin(MARGIN_TOP, p_margin_top * scale); + + return style; +} + static Ref<StyleBoxTexture> sb_expand(Ref<StyleBoxTexture> p_sbox, float p_left, float p_top, float p_right, float p_botton) { p_sbox->set_expand_margin_size(MARGIN_LEFT, p_left * scale); p_sbox->set_expand_margin_size(MARGIN_TOP, p_top * scale); @@ -95,38 +108,23 @@ static Ref<Texture2D> make_icon(T p_src) { return texture; } -static Ref<BitmapFont> make_font(int p_height, int p_ascent, int p_charcount, const int *p_char_rects, int p_kerning_count, const int *p_kernings, int p_w, int p_h, const unsigned char *p_img) { - Ref<BitmapFont> font(memnew(BitmapFont)); - - Ref<Image> image = memnew(Image(p_img)); - Ref<ImageTexture> tex = memnew(ImageTexture); - tex->create_from_image(image); - - font->add_texture(tex); - - for (int i = 0; i < p_charcount; i++) { - const int *c = &p_char_rects[i * 8]; +static Ref<Texture2D> flip_icon(Ref<Texture2D> p_texture, bool p_flip_y = false, bool p_flip_x = false) { + if (!p_flip_y && !p_flip_x) { + return p_texture; + } - int chr = c[0]; - Rect2 frect; - frect.position.x = c[1]; - frect.position.y = c[2]; - frect.size.x = c[3]; - frect.size.y = c[4]; - Point2 align(c[6], c[5]); - int advance = c[7]; + Ref<ImageTexture> texture(memnew(ImageTexture)); + Ref<Image> img = p_texture->get_data(); - font->add_char(chr, 0, frect, align, advance); + if (p_flip_y) { + img->flip_y(); } - - for (int i = 0; i < p_kerning_count; i++) { - font->add_kerning_pair(p_kernings[i * 3 + 0], p_kernings[i * 3 + 1], p_kernings[i * 3 + 2]); + if (p_flip_x) { + img->flip_x(); } - font->set_height(p_height); - font->set_ascent(p_ascent); - - return font; + texture->create_from_image(img); + return texture; } static Ref<StyleBox> make_empty_stylebox(float p_margin_left = -1, float p_margin_top = -1, float p_margin_right = -1, float p_margin_botton = -1) { @@ -182,11 +180,14 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("focus", "Button", sb_button_focus); theme->set_font("font", "Button", Ref<Font>()); + theme->set_font_size("font_size", "Button", -1); + theme->set_constant("outline_size", "Button", 0 * scale); theme->set_color("font_color", "Button", control_font_color); theme->set_color("font_color_pressed", "Button", control_font_color_pressed); theme->set_color("font_color_hover", "Button", control_font_color_hover); theme->set_color("font_color_disabled", "Button", control_font_color_disabled); + theme->set_color("font_outline_modulate", "Button", Color(1, 1, 1)); theme->set_constant("hseparation", "Button", 2 * scale); @@ -195,6 +196,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("focus", "LinkButton", focus); theme->set_font("font", "LinkButton", Ref<Font>()); + theme->set_font_size("font_size", "LinkButton", -1); theme->set_color("font_color", "LinkButton", control_font_color); theme->set_color("font_color_pressed", "LinkButton", control_font_color_pressed); @@ -211,6 +213,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("focus", "ColorPickerButton", sb_button_focus); theme->set_font("font", "ColorPickerButton", Ref<Font>()); + theme->set_font_size("font_size", "ColorPickerButton", -1); theme->set_color("font_color", "ColorPickerButton", Color(1, 1, 1, 1)); theme->set_color("font_color_pressed", "ColorPickerButton", Color(0.8, 0.8, 0.8, 1)); @@ -221,21 +224,33 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const // OptionButton + Ref<StyleBox> sb_optbutton_focus = sb_expand(make_stylebox(button_focus_png, 4, 4, 4, 4, 6, 2, 6, 2), 2, 2, 2, 2); + theme->set_stylebox("focus", "OptionButton", sb_optbutton_focus); + Ref<StyleBox> sb_optbutton_normal = sb_expand(make_stylebox(option_button_normal_png, 4, 4, 21, 4, 6, 3, 9, 3), 2, 2, 2, 2); Ref<StyleBox> sb_optbutton_pressed = sb_expand(make_stylebox(option_button_pressed_png, 4, 4, 21, 4, 6, 3, 9, 3), 2, 2, 2, 2); Ref<StyleBox> sb_optbutton_hover = sb_expand(make_stylebox(option_button_hover_png, 4, 4, 21, 4, 6, 2, 9, 2), 2, 2, 2, 2); Ref<StyleBox> sb_optbutton_disabled = sb_expand(make_stylebox(option_button_disabled_png, 4, 4, 21, 4, 6, 2, 9, 2), 2, 2, 2, 2); - Ref<StyleBox> sb_optbutton_focus = sb_expand(make_stylebox(button_focus_png, 4, 4, 4, 4, 6, 2, 6, 2), 2, 2, 2, 2); theme->set_stylebox("normal", "OptionButton", sb_optbutton_normal); theme->set_stylebox("pressed", "OptionButton", sb_optbutton_pressed); theme->set_stylebox("hover", "OptionButton", sb_optbutton_hover); theme->set_stylebox("disabled", "OptionButton", sb_optbutton_disabled); - theme->set_stylebox("focus", "OptionButton", sb_optbutton_focus); + + Ref<StyleBox> sb_optbutton_normal_mirrored = sb_expand(make_stylebox(option_button_normal_mirrored_png, 21, 4, 4, 4, 9, 3, 6, 3), 2, 2, 2, 2); + Ref<StyleBox> sb_optbutton_pressed_mirrored = sb_expand(make_stylebox(option_button_pressed_mirrored_png, 21, 4, 4, 4, 9, 3, 6, 3), 2, 2, 2, 2); + Ref<StyleBox> sb_optbutton_hover_mirrored = sb_expand(make_stylebox(option_button_hover_mirrored_png, 21, 4, 4, 4, 9, 2, 6, 2), 2, 2, 2, 2); + Ref<StyleBox> sb_optbutton_disabled_mirrored = sb_expand(make_stylebox(option_button_disabled_mirrored_png, 21, 4, 4, 4, 9, 2, 6, 2), 2, 2, 2, 2); + + theme->set_stylebox("normal_mirrored", "OptionButton", sb_optbutton_normal_mirrored); + theme->set_stylebox("pressed_mirrored", "OptionButton", sb_optbutton_pressed_mirrored); + theme->set_stylebox("hover_mirrored", "OptionButton", sb_optbutton_hover_mirrored); + theme->set_stylebox("disabled_mirrored", "OptionButton", sb_optbutton_disabled_mirrored); theme->set_icon("arrow", "OptionButton", make_icon(option_arrow_png)); theme->set_font("font", "OptionButton", Ref<Font>()); + theme->set_font_size("font_size", "OptionButton", -1); theme->set_color("font_color", "OptionButton", control_font_color); theme->set_color("font_color_pressed", "OptionButton", control_font_color_pressed); @@ -254,6 +269,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("focus", "MenuButton", sb_button_focus); theme->set_font("font", "MenuButton", Ref<Font>()); + theme->set_font_size("font_size", "MenuButton", -1); theme->set_color("font_color", "MenuButton", control_font_color); theme->set_color("font_color_pressed", "MenuButton", control_font_color_pressed); @@ -288,6 +304,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("radio_unchecked", "CheckBox", make_icon(radio_unchecked_png)); theme->set_font("font", "CheckBox", Ref<Font>()); + theme->set_font_size("font_size", "CheckBox", -1); theme->set_color("font_color", "CheckBox", control_font_color); theme->set_color("font_color_pressed", "CheckBox", control_font_color_pressed); @@ -318,7 +335,13 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("off", "CheckButton", make_icon(toggle_off_png)); theme->set_icon("off_disabled", "CheckButton", make_icon(toggle_off_disabled_png)); + theme->set_icon("on_mirrored", "CheckButton", make_icon(toggle_on_mirrored_png)); + theme->set_icon("on_disabled_mirrored", "CheckButton", make_icon(toggle_on_disabled_mirrored_png)); + theme->set_icon("off_mirrored", "CheckButton", make_icon(toggle_off_mirrored_png)); + theme->set_icon("off_disabled_mirrored", "CheckButton", make_icon(toggle_off_disabled_mirrored_png)); + theme->set_font("font", "CheckButton", Ref<Font>()); + theme->set_font_size("font_size", "CheckButton", -1); theme->set_color("font_color", "CheckButton", control_font_color); theme->set_color("font_color_pressed", "CheckButton", control_font_color_pressed); @@ -333,6 +356,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("normal", "Label", memnew(StyleBoxEmpty)); theme->set_font("font", "Label", Ref<Font>()); + theme->set_font_size("font_size", "Label", -1); theme->set_color("font_color", "Label", Color(1, 1, 1)); theme->set_color("font_color_shadow", "Label", Color(0, 0, 0, 0)); @@ -340,7 +364,8 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("shadow_offset_x", "Label", 1 * scale); theme->set_constant("shadow_offset_y", "Label", 1 * scale); - theme->set_constant("shadow_as_outline", "Label", 0 * scale); + theme->set_constant("outline_size", "Label", 0 * scale); + theme->set_constant("shadow_outline_size", "Label", 1 * scale); theme->set_constant("line_spacing", "Label", 3 * scale); // LineEdit @@ -350,6 +375,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("read_only", "LineEdit", make_stylebox(line_edit_disabled_png, 6, 6, 6, 6)); theme->set_font("font", "LineEdit", Ref<Font>()); + theme->set_font_size("font_size", "LineEdit", -1); theme->set_color("font_color", "LineEdit", control_font_color); theme->set_color("font_color_selected", "LineEdit", Color(0, 0, 0)); @@ -369,6 +395,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("fg", "ProgressBar", make_stylebox(progress_fill_png, 6, 6, 6, 6, 2, 1, 2, 1)); theme->set_font("font", "ProgressBar", Ref<Font>()); + theme->set_font_size("font_size", "ProgressBar", -1); theme->set_color("font_color", "ProgressBar", control_font_color_hover); theme->set_color("font_color_shadow", "ProgressBar", Color(0, 0, 0)); @@ -384,6 +411,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("space", "TextEdit", make_icon(space_png)); theme->set_font("font", "TextEdit", Ref<Font>()); + theme->set_font_size("font_size", "TextEdit", -1); theme->set_color("background_color", "TextEdit", Color(0, 0, 0, 0)); theme->set_color("completion_background_color", "TextEdit", Color(0.17, 0.16, 0.2)); @@ -423,6 +451,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("folded", "CodeEdit", make_icon(arrow_right_png)); theme->set_font("font", "CodeEdit", Ref<Font>()); + theme->set_font_size("font_size", "CodeEdit", -1); theme->set_color("background_color", "CodeEdit", Color(0, 0, 0, 0)); theme->set_color("completion_background_color", "CodeEdit", Color(0.17, 0.16, 0.2)); @@ -563,13 +592,16 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("radio_checked", "PopupMenu", make_icon(radio_checked_png)); theme->set_icon("radio_unchecked", "PopupMenu", make_icon(radio_unchecked_png)); theme->set_icon("submenu", "PopupMenu", make_icon(submenu_png)); + theme->set_icon("submenu_mirrored", "PopupMenu", make_icon(submenu_mirrored_png)); theme->set_font("font", "PopupMenu", Ref<Font>()); + theme->set_font_size("font_size", "PopupMenu", -1); theme->set_color("font_color", "PopupMenu", control_font_color); theme->set_color("font_color_accel", "PopupMenu", Color(0.7, 0.7, 0.7, 0.8)); theme->set_color("font_color_disabled", "PopupMenu", Color(0.4, 0.4, 0.4, 0.8)); theme->set_color("font_color_hover", "PopupMenu", control_font_color); + theme->set_color("font_color_separator", "PopupMenu", control_font_color); theme->set_constant("hseparation", "PopupMenu", 4 * scale); theme->set_constant("vseparation", "PopupMenu", 4 * scale); @@ -632,9 +664,11 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("select_arrow", "Tree", make_icon(dropdown_png)); theme->set_icon("arrow", "Tree", make_icon(arrow_down_png)); theme->set_icon("arrow_collapsed", "Tree", make_icon(arrow_right_png)); + theme->set_icon("arrow_collapsed_mirrored", "Tree", make_icon(arrow_left_png)); theme->set_font("title_button_font", "Tree", Ref<Font>()); theme->set_font("font", "Tree", Ref<Font>()); + theme->set_font_size("font_size", "Tree", -1); theme->set_color("title_button_color", "Tree", control_font_color); theme->set_color("font_color", "Tree", control_font_color_low); @@ -663,7 +697,10 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("vseparation", "ItemList", 2); theme->set_constant("icon_margin", "ItemList", 4); theme->set_constant("line_separation", "ItemList", 2 * scale); + theme->set_font("font", "ItemList", Ref<Font>()); + theme->set_font_size("font_size", "ItemList", -1); + theme->set_color("font_color", "ItemList", control_font_color_lower); theme->set_color("font_color_selected", "ItemList", control_font_color_pressed); theme->set_color("guide_color", "ItemList", Color(0, 0, 0, 0.1)); @@ -692,6 +729,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("menu_highlight", "TabContainer", make_icon(tab_menu_hl_png)); theme->set_font("font", "TabContainer", Ref<Font>()); + theme->set_font_size("font_size", "TabContainer", -1); theme->set_color("font_color_fg", "TabContainer", control_font_color_hover); theme->set_color("font_color_bg", "TabContainer", control_font_color_low); @@ -716,6 +754,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("close", "Tabs", make_icon(tab_close_png)); theme->set_font("font", "Tabs", Ref<Font>()); + theme->set_font_size("font_size", "Tabs", -1); theme->set_color("font_color_fg", "Tabs", control_font_color_hover); theme->set_color("font_color_bg", "Tabs", control_font_color_low); @@ -775,6 +814,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_stylebox("panel", "TooltipPanel", style_tt); theme->set_font("font", "TooltipLabel", Ref<Font>()); + theme->set_font_size("font_size", "TooltipLabel", -1); theme->set_color("font_color", "TooltipLabel", Color(0, 0, 0)); theme->set_color("font_color_shadow", "TooltipLabel", Color(0, 0, 0, 0.1)); @@ -793,6 +833,12 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_font("bold_italics_font", "RichTextLabel", Ref<Font>()); theme->set_font("mono_font", "RichTextLabel", Ref<Font>()); + theme->set_font_size("normal_font_size", "RichTextLabel", -1); + theme->set_font_size("bold_font_size", "RichTextLabel", -1); + theme->set_font_size("italics_font_size", "RichTextLabel", -1); + theme->set_font_size("bold_italics_font_size", "RichTextLabel", -1); + theme->set_font_size("mono_font_size", "RichTextLabel", -1); + theme->set_color("default_color", "RichTextLabel", Color(1, 1, 1)); theme->set_color("font_color_selected", "RichTextLabel", font_color_selection); theme->set_color("selection_color", "RichTextLabel", Color(0.1, 0.1, 1, 0.8)); @@ -807,6 +853,9 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("table_hseparation", "RichTextLabel", 3 * scale); theme->set_constant("table_vseparation", "RichTextLabel", 3 * scale); + theme->set_color("table_odd_row_bg", "RichTextLabel", Color(0, 0, 0, 0)); + theme->set_color("table_even_row_bg", "RichTextLabel", Color(0, 0, 0, 0)); + theme->set_color("table_border", "RichTextLabel", Color(0, 0, 0, 0)); // Containers theme->set_stylebox("bg", "VSplitContainer", make_stylebox(vsplit_bg_png, 1, 1, 1, 1)); @@ -835,6 +884,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_icon("reset", "GraphEdit", make_icon(icon_zoom_reset_png)); theme->set_icon("more", "GraphEdit", make_icon(icon_zoom_more_png)); theme->set_icon("snap", "GraphEdit", make_icon(icon_snap_grid_png)); + theme->set_icon("minimap", "GraphEdit", make_icon(icon_grid_minimap_png)); theme->set_stylebox("bg", "GraphEdit", make_stylebox(tree_bg_png, 4, 4, 4, 5)); theme->set_color("grid_minor", "GraphEdit", Color(1, 1, 1, 0.05)); theme->set_color("grid_major", "GraphEdit", Color(1, 1, 1, 0.2)); @@ -848,6 +898,19 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("port_grab_distance_horizontal", "GraphEdit", 48 * scale); theme->set_constant("port_grab_distance_vertical", "GraphEdit", 6 * scale); + theme->set_stylebox("bg", "GraphEditMinimap", make_flat_stylebox(Color(0.24, 0.24, 0.24), 0, 0, 0, 0)); + Ref<StyleBoxFlat> style_minimap_camera = make_flat_stylebox(Color(0.65, 0.65, 0.65, 0.2), 0, 0, 0, 0); + style_minimap_camera->set_border_color(Color(0.65, 0.65, 0.65, 0.45)); + style_minimap_camera->set_border_width_all(1); + theme->set_stylebox("camera", "GraphEditMinimap", style_minimap_camera); + Ref<StyleBoxFlat> style_minimap_node = make_flat_stylebox(Color(1, 1, 1), 0, 0, 0, 0); + style_minimap_node->set_corner_radius_all(2); + theme->set_stylebox("node", "GraphEditMinimap", style_minimap_node); + + Ref<Texture2D> resizer_icon = make_icon(window_resizer_png); + theme->set_icon("resizer", "GraphEditMinimap", flip_icon(resizer_icon, true, true)); + theme->set_color("resizer_color", "GraphEditMinimap", Color(1, 1, 1, 0.85)); + // Theme default_icon = make_icon(error_icon_png); @@ -863,12 +926,47 @@ void make_default_theme(bool p_hidpi, Ref<Font> p_font) { Ref<StyleBox> default_style; Ref<Texture2D> default_icon; Ref<Font> default_font; + int default_font_size = 16; if (p_font.is_valid()) { default_font = p_font; } else if (p_hidpi) { - default_font = make_font(_hidpi_font_height, _hidpi_font_ascent, _hidpi_font_charcount, &_hidpi_font_charrects[0][0], _hidpi_font_kerning_pair_count, &_hidpi_font_kerning_pairs[0][0], _hidpi_font_img_width, _hidpi_font_img_height, _hidpi_font_img_data); + TextServer::BitmapFontData data; + data.height = _hidpi_font_height; + data.ascent = _hidpi_font_ascent; + data.charcount = _hidpi_font_charcount; + data.char_rects = &_hidpi_font_charrects[0][0]; + data.kerning_count = _hidpi_font_kerning_pair_count; + data.kernings = &_hidpi_font_kerning_pairs[0][0]; + data.w = _hidpi_font_img_width; + data.h = _hidpi_font_img_height; + data.img = _hidpi_font_img_data; + + Ref<FontData> font_data; + font_data.instance(); + font_data->load_memory((const uint8_t *)&data, sizeof(data), "fnt"); + default_font_size = font_data->get_base_size(); + + default_font.instance(); + default_font->add_data(font_data); } else { - default_font = make_font(_lodpi_font_height, _lodpi_font_ascent, _lodpi_font_charcount, &_lodpi_font_charrects[0][0], _lodpi_font_kerning_pair_count, &_lodpi_font_kerning_pairs[0][0], _lodpi_font_img_width, _lodpi_font_img_height, _lodpi_font_img_data); + TextServer::BitmapFontData data; + data.height = _lodpi_font_height; + data.ascent = _lodpi_font_ascent; + data.charcount = _lodpi_font_charcount; + data.char_rects = &_lodpi_font_charrects[0][0]; + data.kerning_count = _lodpi_font_kerning_pair_count; + data.kernings = &_lodpi_font_kerning_pairs[0][0]; + data.w = _lodpi_font_img_width; + data.h = _lodpi_font_img_height; + data.img = _lodpi_font_img_data; + + Ref<FontData> font_data; + font_data.instance(); + font_data->load_memory((const uint8_t *)&data, sizeof(data), "fnt"); + default_font_size = font_data->get_base_size(); + + default_font.instance(); + default_font->add_data(font_data); } Ref<Font> large_font = default_font; fill_default_theme(t, default_font, large_font, default_icon, default_style, p_hidpi ? 2.0 : 1.0); @@ -877,6 +975,7 @@ void make_default_theme(bool p_hidpi, Ref<Font> p_font) { Theme::set_default_icon(default_icon); Theme::set_default_style(default_style); Theme::set_default_font(default_font); + Theme::set_default_font_size(default_font_size); } void clear_default_theme() { diff --git a/scene/resources/default_theme/font_lodpi.inc b/scene/resources/default_theme/font_lodpi.inc index 959e2c1d7b..d2f5851224 100644 --- a/scene/resources/default_theme/font_lodpi.inc +++ b/scene/resources/default_theme/font_lodpi.inc @@ -8,7 +8,7 @@ static const int _lodpi_font_charrects[191][8]={ {224,85,180,5,11,0,1,7}, {192,32,16,11,13,-2,-1,9}, {96,2,216,3,2,0,3,8}, -{160,1734439808,0,0,0,11,0,4}, +{160,0,0,0,0,11,0,4}, {32,0,0,0,0,11,0,4}, {33,65,234,2,10,1,1,4}, {225,112,169,5,11,0,1,7}, diff --git a/scene/resources/default_theme/icon_grid_minimap.png b/scene/resources/default_theme/icon_grid_minimap.png Binary files differnew file mode 100644 index 0000000000..00a6179d5e --- /dev/null +++ b/scene/resources/default_theme/icon_grid_minimap.png diff --git a/scene/resources/default_theme/option_button_disabled_mirrored.png b/scene/resources/default_theme/option_button_disabled_mirrored.png Binary files differnew file mode 100644 index 0000000000..9d149a35ca --- /dev/null +++ b/scene/resources/default_theme/option_button_disabled_mirrored.png diff --git a/scene/resources/default_theme/option_button_hover_mirrored.png b/scene/resources/default_theme/option_button_hover_mirrored.png Binary files differnew file mode 100644 index 0000000000..d49c165645 --- /dev/null +++ b/scene/resources/default_theme/option_button_hover_mirrored.png diff --git a/scene/resources/default_theme/option_button_normal_mirrored.png b/scene/resources/default_theme/option_button_normal_mirrored.png Binary files differnew file mode 100644 index 0000000000..feec848f33 --- /dev/null +++ b/scene/resources/default_theme/option_button_normal_mirrored.png diff --git a/scene/resources/default_theme/option_button_pressed_mirrored.png b/scene/resources/default_theme/option_button_pressed_mirrored.png Binary files differnew file mode 100644 index 0000000000..94cabb18d6 --- /dev/null +++ b/scene/resources/default_theme/option_button_pressed_mirrored.png diff --git a/scene/resources/default_theme/submenu_mirrored.png b/scene/resources/default_theme/submenu_mirrored.png Binary files differnew file mode 100644 index 0000000000..1142b9ba9f --- /dev/null +++ b/scene/resources/default_theme/submenu_mirrored.png diff --git a/scene/resources/default_theme/theme_data.h b/scene/resources/default_theme/theme_data.h index a15efb593a..b905c9db69 100644 --- a/scene/resources/default_theme/theme_data.h +++ b/scene/resources/default_theme/theme_data.h @@ -6,6 +6,10 @@ static const unsigned char arrow_down_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0xc, 0x0, 0x0, 0x0, 0xc, 0x8, 0x4, 0x0, 0x0, 0x0, 0xfc, 0x7c, 0x94, 0x6c, 0x0, 0x0, 0x0, 0x34, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xa0, 0x32, 0x78, 0xf0, 0x1f, 0x15, 0x52, 0x20, 0xf1, 0x30, 0xee, 0xc1, 0x17, 0xb8, 0xf0, 0xb7, 0x87, 0x69, 0x48, 0xb6, 0xdc, 0xd7, 0xb8, 0x7f, 0x9, 0x2c, 0x7c, 0xfd, 0xb1, 0x2e, 0x9a, 0x3, 0x5e, 0x70, 0x3f, 0x9c, 0xff, 0x70, 0xfe, 0xb, 0x6e, 0x6, 0xea, 0x3, 0x0, 0xfb, 0x81, 0x48, 0xb8, 0x4d, 0xe4, 0x75, 0xd9, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char arrow_left_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0xc, 0x0, 0x0, 0x0, 0xc, 0x8, 0x4, 0x0, 0x0, 0x0, 0xfc, 0x7c, 0x94, 0x6c, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x0, 0x59, 0x49, 0x44, 0x41, 0x54, 0x18, 0xd3, 0x63, 0x60, 0xa0, 0x0, 0xdc, 0x4f, 0x78, 0xf0, 0xff, 0xc1, 0xff, 0x7, 0xff, 0x21, 0x3c, 0x46, 0x98, 0xf0, 0x43, 0xed, 0xff, 0x27, 0x19, 0xb8, 0x19, 0x18, 0x18, 0x18, 0x14, 0x18, 0x19, 0x18, 0x18, 0x18, 0x98, 0x20, 0xc2, 0x2f, 0xb8, 0xff, 0xaf, 0x82, 0x8, 0xc3, 0x0, 0x54, 0xe2, 0xe7, 0x14, 0x6, 0x2d, 0x54, 0x83, 0x99, 0x70, 0xd9, 0x8, 0x95, 0x60, 0xcf, 0x61, 0xb8, 0x86, 0x55, 0x42, 0xe2, 0x2b, 0x63, 0x18, 0xc3, 0x57, 0xac, 0x46, 0xc9, 0x5f, 0xfd, 0x9f, 0x43, 0x89, 0x67, 0x19, 0x18, 0x0, 0xf4, 0x30, 0x14, 0x49, 0xef, 0xe6, 0x74, 0x60, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char arrow_right_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0xc, 0x0, 0x0, 0x0, 0xc, 0x8, 0x4, 0x0, 0x0, 0x0, 0xfc, 0x7c, 0x94, 0x6c, 0x0, 0x0, 0x0, 0x2e, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0x20, 0x17, 0x3c, 0xf8, 0xf, 0x82, 0xf7, 0x13, 0x70, 0x48, 0x3c, 0xf8, 0xf2, 0x50, 0x1b, 0x43, 0x2, 0xa, 0xaf, 0xbe, 0xe0, 0xc6, 0x2e, 0xf1, 0xff, 0xe1, 0x7c, 0x12, 0x24, 0x10, 0x46, 0x11, 0xb6, 0x1c, 0xe1, 0x5c, 0xa, 0x0, 0x0, 0xe0, 0x14, 0x48, 0xb1, 0x3d, 0x1b, 0x7a, 0xf0, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -162,6 +166,10 @@ static const unsigned char icon_folder_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x4, 0x0, 0x0, 0x0, 0xb5, 0xfa, 0x37, 0xea, 0x0, 0x0, 0x0, 0x2e, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xa0, 0x6, 0x78, 0x70, 0xf4, 0xc1, 0x7f, 0x24, 0x78, 0x18, 0x53, 0xc1, 0x7f, 0x54, 0x48, 0x50, 0xc1, 0x43, 0x1b, 0xbc, 0xa, 0x50, 0xad, 0x23, 0xa4, 0xe0, 0xff, 0x70, 0x52, 0x70, 0x18, 0x97, 0xf4, 0xfd, 0x43, 0xd4, 0x88, 0x4a, 0x0, 0x5a, 0xcb, 0x18, 0xab, 0x5e, 0xd9, 0x1a, 0x53, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char icon_grid_minimap_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x6, 0x0, 0x0, 0x0, 0x1f, 0xf3, 0xff, 0x61, 0x0, 0x0, 0x0, 0x9, 0x70, 0x48, 0x59, 0x73, 0x0, 0x0, 0xe, 0xc3, 0x0, 0x0, 0xe, 0xc3, 0x1, 0xc7, 0x6f, 0xa8, 0x64, 0x0, 0x0, 0x0, 0x19, 0x74, 0x45, 0x58, 0x74, 0x53, 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x0, 0x77, 0x77, 0x77, 0x2e, 0x69, 0x6e, 0x6b, 0x73, 0x63, 0x61, 0x70, 0x65, 0x2e, 0x6f, 0x72, 0x67, 0x9b, 0xee, 0x3c, 0x1a, 0x0, 0x0, 0x2, 0xd, 0x49, 0x44, 0x41, 0x54, 0x38, 0x8d, 0x75, 0x93, 0x31, 0x68, 0x14, 0x51, 0x10, 0x86, 0xbf, 0xd9, 0xd, 0xbb, 0xde, 0x76, 0x82, 0x21, 0xf8, 0xe0, 0xbc, 0x5d, 0x8b, 0x80, 0x69, 0x6c, 0xd2, 0x5a, 0x6a, 0x91, 0xc3, 0xd2, 0x46, 0x22, 0x8, 0x9, 0x89, 0x70, 0x85, 0x10, 0x41, 0xd, 0x24, 0x45, 0xb0, 0xb, 0x68, 0x11, 0x14, 0x24, 0x10, 0x22, 0x62, 0x21, 0x41, 0xe, 0x4b, 0x21, 0xa4, 0xb7, 0x49, 0x17, 0xb1, 0x8, 0xb9, 0xdd, 0xc7, 0x86, 0x33, 0x21, 0xe1, 0x3a, 0x8f, 0x64, 0x61, 0x6f, 0x2c, 0xbc, 0x3b, 0x36, 0xb9, 0xdc, 0xc0, 0x2b, 0xde, 0xcc, 0xfc, 0xf3, 0xff, 0xfc, 0xcc, 0x48, 0xa3, 0xd1, 0x78, 0x20, 0x22, 0x13, 0xbe, 0xef, 0xaf, 0xdf, 0xac, 0xd7, 0x1f, 0xe1, 0x38, 0xd3, 0xa8, 0x2a, 0xf0, 0x45, 0x6a, 0xb5, 0xcf, 0x5c, 0x11, 0xcd, 0x66, 0x33, 0x38, 0x3f, 0x3f, 0x9f, 0x13, 0x91, 0x7d, 0xb1, 0xd6, 0x6e, 0xaa, 0xea, 0xd3, 0xe0, 0xe8, 0xe8, 0xde, 0xe8, 0xee, 0xee, 0x37, 0xc0, 0xe9, 0xf6, 0x75, 0xf0, 0xfd, 0x9, 0x99, 0x9d, 0x6d, 0x15, 0x81, 0x59, 0x96, 0x3d, 0x3, 0x5e, 0x2, 0x63, 0x22, 0xf2, 0x69, 0xa4, 0x57, 0x1c, 0xdd, 0xdb, 0xfb, 0x5b, 0x0, 0x3, 0x38, 0x67, 0x41, 0x30, 0x11, 0xc7, 0xf1, 0x13, 0x0, 0x11, 0x71, 0xb2, 0x2c, 0x7b, 0xd8, 0xad, 0xad, 0x2, 0x6f, 0xb9, 0x0, 0x38, 0x3c, 0xfc, 0x5, 0x9c, 0xf6, 0xff, 0x22, 0x27, 0x27, 0xe3, 0xe3, 0x7f, 0xa, 0x3, 0x67, 0x45, 0xe4, 0xbb, 0xe7, 0x79, 0xb7, 0xc3, 0x30, 0x7c, 0xd7, 0x67, 0xe9, 0xe3, 0x67, 0x66, 0x5c, 0x60, 0x1, 0x50, 0x40, 0x51, 0x7d, 0x71, 0x6b, 0x72, 0xf2, 0x20, 0x8a, 0xa2, 0xf9, 0x28, 0x8a, 0xe6, 0x1, 0x3a, 0x9d, 0xce, 0x4f, 0x63, 0x4c, 0x3b, 0x4d, 0xd3, 0xd2, 0xc0, 0x80, 0x3c, 0xcf, 0xf, 0x92, 0xa9, 0xa9, 0x31, 0x60, 0x5, 0x58, 0x91, 0x5a, 0xed, 0xc7, 0x15, 0xfe, 0x95, 0xac, 0xb5, 0xcf, 0xf3, 0x3c, 0x3f, 0xe8, 0x25, 0x46, 0xa, 0xc5, 0xd, 0x11, 0x59, 0xb3, 0xd5, 0xea, 0x1b, 0xa0, 0x95, 0x54, 0xab, 0x5b, 0x97, 0xd1, 0x22, 0xb2, 0xa6, 0xaa, 0x6d, 0x60, 0xd, 0x58, 0xba, 0xa0, 0x20, 0xc, 0xc3, 0x65, 0xd7, 0x75, 0x23, 0xe0, 0x2e, 0xb0, 0x1, 0x5c, 0xbf, 0xf4, 0x0, 0xbe, 0xba, 0xae, 0x1b, 0x85, 0x61, 0xb8, 0x3c, 0xa0, 0x20, 0x4d, 0xd3, 0x52, 0xb9, 0x5c, 0x6e, 0xc5, 0x71, 0xbc, 0x23, 0x22, 0xd3, 0x61, 0x18, 0xde, 0x2f, 0xb2, 0x27, 0x49, 0xa2, 0xaa, 0xba, 0x53, 0x2e, 0x97, 0x5b, 0x69, 0x9a, 0x96, 0xf2, 0x3c, 0x1f, 0xf0, 0xc0, 0x5a, 0x6b, 0x5f, 0x1, 0x25, 0x86, 0x84, 0xe3, 0x38, 0x9e, 0xb5, 0x76, 0x2e, 0xcf, 0xf3, 0xfd, 0x1, 0x5, 0x22, 0xb2, 0xa1, 0xaa, 0x4b, 0x22, 0x72, 0xad, 0xcb, 0x38, 0xe0, 0x81, 0xaa, 0x7e, 0x0, 0xce, 0x44, 0xe4, 0xbd, 0xaa, 0xbe, 0xbe, 0xa0, 0xa0, 0x52, 0xa9, 0x2c, 0x7a, 0x9e, 0x17, 0x1, 0x3d, 0xe0, 0x55, 0x1e, 0x6c, 0x79, 0x9e, 0x17, 0x55, 0x2a, 0x95, 0xc5, 0x1, 0x5, 0xcd, 0x66, 0x33, 0x30, 0xc6, 0x9c, 0xc6, 0x71, 0xbc, 0x2d, 0x22, 0x8f, 0x87, 0x78, 0xb0, 0x6d, 0x8c, 0x39, 0xed, 0xae, 0x74, 0xdf, 0x83, 0x3a, 0x70, 0x9c, 0x65, 0x59, 0x23, 0x49, 0x92, 0x5, 0x11, 0x9, 0x86, 0x79, 0x20, 0x22, 0x41, 0x92, 0x24, 0xb, 0x59, 0x96, 0x35, 0x80, 0x63, 0xa0, 0x2e, 0x3d, 0xf6, 0xc2, 0x91, 0xdc, 0x0, 0x5c, 0x55, 0x5d, 0xbf, 0x4, 0x9e, 0x3, 0x72, 0xfe, 0xaf, 0xfb, 0xaa, 0xe7, 0x79, 0x1f, 0x8d, 0x31, 0x6d, 0x29, 0x36, 0xf5, 0xce, 0x14, 0xb8, 0x33, 0x44, 0xc4, 0x6f, 0xdf, 0xf7, 0xd7, 0x8d, 0x31, 0xed, 0x5e, 0xe2, 0x1f, 0xb, 0x5c, 0xe2, 0xcb, 0xd, 0x9b, 0x69, 0xcb, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char icon_parent_folder_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x4, 0x0, 0x0, 0x0, 0xb5, 0xfa, 0x37, 0xea, 0x0, 0x0, 0x0, 0x68, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xa0, 0x33, 0xb8, 0x27, 0xfe, 0xe0, 0xfc, 0x83, 0x73, 0xf7, 0xc4, 0x71, 0x48, 0xdf, 0x11, 0x7b, 0x78, 0xe9, 0xc1, 0x3f, 0x20, 0xbc, 0xfe, 0x40, 0x12, 0x8f, 0x34, 0x4c, 0x9, 0xa6, 0xe1, 0x57, 0x80, 0x12, 0x17, 0x81, 0xf8, 0x2f, 0x58, 0xe1, 0x15, 0x34, 0x8b, 0x1e, 0x9c, 0x5, 0xa, 0x5e, 0xb8, 0x23, 0x6, 0x52, 0x70, 0x5b, 0x14, 0xac, 0xf0, 0xc, 0xaa, 0x82, 0x7d, 0xf, 0x8e, 0xde, 0x14, 0xf9, 0xcf, 0x8, 0x52, 0xc0, 0xc0, 0x70, 0x5b, 0xf4, 0xe1, 0xc9, 0x7, 0x47, 0xb1, 0xb8, 0x3, 0xaa, 0x0, 0xa, 0x48, 0x52, 0x80, 0xb0, 0xea, 0xc8, 0xc3, 0x83, 0xc, 0x83, 0xe, 0x0, 0x0, 0xb8, 0x27, 0x55, 0x4c, 0xbe, 0xc0, 0xd2, 0xac, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -214,18 +222,34 @@ static const unsigned char option_button_disabled_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x2f, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x3f, 0x3f, 0x3f, 0x5a, 0x5a, 0x5a, 0x2b, 0x2b, 0x31, 0x2e, 0x2e, 0x34, 0x59, 0x59, 0x59, 0x2a, 0x2a, 0x30, 0x4b, 0x4b, 0x4b, 0x22, 0x22, 0x27, 0x35, 0x35, 0x35, 0x4a, 0x4a, 0x4a, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x56, 0x56, 0x56, 0x62, 0x62, 0x62, 0x2a, 0x2a, 0x31, 0x2a, 0x2a, 0x30, 0x2d, 0x2d, 0x34, 0x2f, 0x2f, 0x36, 0x2e, 0x2e, 0x35, 0x2c, 0x2c, 0x32, 0x48, 0x48, 0x48, 0x44, 0x44, 0x44, 0x43, 0x43, 0x43, 0x54, 0x54, 0x54, 0x26, 0x26, 0x2b, 0x24, 0x24, 0x28, 0x27, 0x27, 0x2d, 0x29, 0x29, 0x2f, 0x28, 0x28, 0x2e, 0x25, 0x25, 0x2b, 0x23, 0x23, 0x28, 0x26, 0x26, 0x2c, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x22, 0x22, 0x26, 0x52, 0x52, 0x52, 0x42, 0x42, 0x42, 0x2d, 0x2d, 0x33, 0x22, 0x22, 0x27, 0x51, 0x51, 0x51, 0x40, 0x40, 0x40, 0x27, 0x27, 0x2b, 0x2e, 0x2e, 0x34, 0x2c, 0x2c, 0x31, 0x29, 0x29, 0x2e, 0x4f, 0x4f, 0x4f, 0x3f, 0x3f, 0x3f, 0x4d, 0x4d, 0x4d, 0x3e, 0x3e, 0x3e, 0x24, 0x24, 0x2a, 0x24, 0x24, 0x29, 0x20, 0x20, 0x25, 0x4c, 0x4c, 0x4c, 0x3d, 0x3d, 0x3d, 0x28, 0x28, 0x2d, 0x2b, 0x2b, 0x30, 0x29, 0x29, 0x2d, 0x20, 0x20, 0x23, 0x4a, 0x4a, 0x4a, 0x3b, 0x3b, 0x3b, 0x22, 0x22, 0x28, 0x27, 0x27, 0x2c, 0x1e, 0x1e, 0x22, 0x49, 0x49, 0x49, 0x3a, 0x3a, 0x3a, 0x21, 0x21, 0x26, 0x21, 0x21, 0x25, 0x23, 0x23, 0x27, 0x20, 0x20, 0x24, 0x1d, 0x1d, 0x21, 0x39, 0x39, 0x39, 0x47, 0x47, 0x47, 0x1f, 0x1f, 0x24, 0x1f, 0x1f, 0x23, 0x1e, 0x1e, 0x21, 0x46, 0x46, 0x46, 0xd3, 0xa7, 0xd4, 0x88, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x4, 0xa, 0x11, 0x19, 0x1f, 0x22, 0x24, 0x1d, 0x16, 0xd, 0x7, 0x2, 0x15, 0x25, 0x34, 0x3f, 0x46, 0x47, 0x48, 0x43, 0x3a, 0x2d, 0x1b, 0x77, 0xef, 0xe6, 0x49, 0xef, 0xe6, 0xef, 0xe7, 0x77, 0xef, 0xe4, 0x4a, 0xba, 0xea, 0xc1, 0xeb, 0x0, 0x0, 0x0, 0xec, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x6c, 0x8e, 0x5, 0x4e, 0x0, 0x31, 0x10, 0x45, 0xff, 0xef, 0x56, 0xc2, 0xe2, 0xee, 0x4e, 0x3c, 0xc8, 0xd, 0xb8, 0x38, 0xa7, 0xc0, 0xdd, 0xdd, 0x5d, 0xbb, 0x94, 0x4c, 0xd2, 0xc1, 0xdf, 0x4a, 0x47, 0x5e, 0x27, 0xc3, 0xc, 0x80, 0x64, 0x24, 0xb8, 0xc7, 0x4f, 0x2c, 0x6b, 0xd5, 0x90, 0xff, 0xdd, 0x23, 0x7e, 0xc1, 0xa2, 0xb6, 0x64, 0xad, 0x26, 0x82, 0xc6, 0xef, 0x45, 0xbc, 0xe3, 0x1, 0x2c, 0x69, 0x9b, 0xc8, 0x7f, 0x5, 0x36, 0x1e, 0x41, 0x84, 0xd6, 0x4, 0x25, 0x90, 0xb7, 0x39, 0x6c, 0x4c, 0x2f, 0xbe, 0x68, 0xdf, 0x13, 0xa1, 0x9e, 0xc8, 0xa4, 0xb7, 0xe7, 0x47, 0x93, 0x63, 0x1b, 0xf9, 0xdc, 0x8, 0x88, 0x60, 0xbf, 0x4, 0xff, 0xd2, 0x56, 0x93, 0xe3, 0xb7, 0xb2, 0xf6, 0x2c, 0x36, 0x1, 0x16, 0xf4, 0x5f, 0x42, 0xc4, 0x17, 0x8f, 0xb5, 0xc0, 0xa5, 0x8, 0x30, 0x5f, 0xc2, 0x5d, 0xcf, 0xc9, 0xd, 0x74, 0x87, 0x8b, 0x5e, 0x56, 0x22, 0x24, 0xf7, 0x6d, 0xc2, 0xd1, 0x80, 0x26, 0x27, 0x5d, 0x5b, 0x67, 0x7d, 0x2f, 0x80, 0x4d, 0xc9, 0x7f, 0x9, 0x63, 0xa7, 0x61, 0x23, 0xc7, 0x74, 0x3d, 0xf, 0xae, 0x41, 0x84, 0x6f, 0x13, 0xe6, 0x26, 0xfa, 0x36, 0x46, 0x73, 0xbc, 0xba, 0x3b, 0xd6, 0xca, 0x8, 0xd0, 0xd6, 0x36, 0x4e, 0x35, 0xeb, 0xad, 0xd7, 0xb0, 0x60, 0x72, 0xdc, 0xda, 0x9c, 0x2, 0x67, 0x76, 0x64, 0x82, 0x99, 0x9b, 0xb6, 0x80, 0xb0, 0x7e, 0x8d, 0xf6, 0x5a, 0xdd, 0xe1, 0xb5, 0xba, 0xba, 0xb1, 0x0, 0xcd, 0xc7, 0x50, 0x23, 0xeb, 0xfb, 0x7f, 0xb4, 0xc8, 0x22, 0x18, 0xdd, 0x0, 0xd5, 0xec, 0x4e, 0x53, 0xc6, 0x18, 0x44, 0x3f, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char option_button_disabled_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x2f, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x2d, 0x2d, 0x34, 0x2b, 0x2b, 0x31, 0x5a, 0x5a, 0x5a, 0x3e, 0x3e, 0x3e, 0x2a, 0x2a, 0x30, 0x59, 0x59, 0x59, 0x22, 0x22, 0x27, 0x4b, 0x4b, 0x4b, 0x22, 0x22, 0x29, 0x24, 0x24, 0x28, 0x4a, 0x4a, 0x4a, 0x36, 0x36, 0x36, 0x2a, 0x2a, 0x30, 0x2c, 0x2c, 0x32, 0x2d, 0x2d, 0x34, 0x2e, 0x2e, 0x35, 0x2f, 0x2f, 0x36, 0x2a, 0x2a, 0x31, 0x62, 0x62, 0x62, 0x56, 0x56, 0x56, 0x23, 0x23, 0x28, 0x25, 0x25, 0x2b, 0x27, 0x27, 0x2d, 0x28, 0x28, 0x2e, 0x29, 0x29, 0x2f, 0x24, 0x24, 0x28, 0x26, 0x26, 0x2b, 0x54, 0x54, 0x54, 0x43, 0x43, 0x43, 0x44, 0x44, 0x44, 0x48, 0x48, 0x48, 0x22, 0x22, 0x26, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x26, 0x26, 0x2c, 0x22, 0x22, 0x27, 0x2d, 0x2d, 0x33, 0x52, 0x52, 0x52, 0x42, 0x42, 0x42, 0x27, 0x27, 0x2b, 0x29, 0x29, 0x2e, 0x2c, 0x2c, 0x31, 0x2e, 0x2e, 0x34, 0x51, 0x51, 0x51, 0x40, 0x40, 0x40, 0x4f, 0x4f, 0x4f, 0x3f, 0x3f, 0x3f, 0x20, 0x20, 0x25, 0x24, 0x24, 0x29, 0x24, 0x24, 0x2a, 0x4d, 0x4d, 0x4d, 0x3e, 0x3e, 0x3e, 0x20, 0x20, 0x23, 0x29, 0x29, 0x2d, 0x2b, 0x2b, 0x30, 0x28, 0x28, 0x2d, 0x4c, 0x4c, 0x4c, 0x3d, 0x3d, 0x3d, 0x1e, 0x1e, 0x22, 0x27, 0x27, 0x2c, 0x22, 0x22, 0x28, 0x4a, 0x4a, 0x4a, 0x3b, 0x3b, 0x3b, 0x1d, 0x1d, 0x21, 0x20, 0x20, 0x24, 0x23, 0x23, 0x27, 0x21, 0x21, 0x25, 0x21, 0x21, 0x26, 0x3a, 0x3a, 0x3a, 0x49, 0x49, 0x49, 0x1e, 0x1e, 0x21, 0x1f, 0x1f, 0x23, 0x1f, 0x1f, 0x24, 0x47, 0x47, 0x47, 0x39, 0x39, 0x39, 0x46, 0x46, 0x46, 0xda, 0x9d, 0x96, 0x5c, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x2, 0x7, 0xd, 0x16, 0x1d, 0x22, 0x24, 0x1f, 0x19, 0x11, 0xa, 0x4, 0x1b, 0x2d, 0x3a, 0x43, 0x48, 0x47, 0x46, 0x3f, 0x34, 0x25, 0x15, 0x49, 0xe6, 0xef, 0x77, 0xe6, 0xef, 0xe7, 0xef, 0x4a, 0xe4, 0xef, 0x77, 0x7e, 0xb9, 0x59, 0x66, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x1, 0xf, 0x49, 0x44, 0x41, 0x54, 0x28, 0xcf, 0x85, 0xd1, 0xd9, 0x52, 0xc2, 0x30, 0x14, 0x80, 0xe1, 0x2a, 0x5a, 0x56, 0x97, 0xb2, 0xb9, 0xef, 0x50, 0x45, 0x4b, 0x6d, 0xe, 0x95, 0xa6, 0xa5, 0x40, 0xab, 0x15, 0x5, 0xdc, 0xc0, 0x8a, 0xa, 0xb8, 0xa1, 0xef, 0xff, 0xc, 0x86, 0x90, 0x30, 0xc, 0x17, 0xfa, 0x5d, 0x26, 0xff, 0x4c, 0x4e, 0x12, 0x41, 0x98, 0x32, 0x33, 0x1b, 0x98, 0x9b, 0x17, 0x83, 0x84, 0x18, 0xa, 0x47, 0xa2, 0xb1, 0xe9, 0x7d, 0x21, 0x16, 0x58, 0x58, 0x5c, 0x5a, 0x96, 0x24, 0x29, 0x9e, 0x48, 0xa6, 0xd2, 0x2b, 0x51, 0xb2, 0xb4, 0xba, 0x96, 0xc9, 0xca, 0x87, 0x47, 0x8c, 0x9c, 0xc9, 0x1d, 0x9f, 0x30, 0xeb, 0x1b, 0xe9, 0x8, 0x9, 0x36, 0x15, 0x25, 0xaf, 0x9e, 0x6a, 0x8c, 0x8a, 0xa0, 0xa0, 0x8f, 0x9c, 0x15, 0xb7, 0x52, 0x61, 0x12, 0xa8, 0x6, 0x56, 0x4d, 0x2b, 0xcb, 0x98, 0xb8, 0xc4, 0x3, 0x5d, 0x2f, 0x24, 0x43, 0xc3, 0xc0, 0x6, 0xcd, 0x2a, 0xcb, 0x4c, 0xe, 0x4a, 0x95, 0x2a, 0x57, 0x49, 0x88, 0x24, 0x70, 0xc, 0x70, 0xcf, 0xcb, 0x17, 0x8c, 0x5, 0x8e, 0x77, 0xc9, 0x79, 0xf1, 0x20, 0x9, 0x80, 0x4, 0xd6, 0x64, 0x50, 0xbb, 0xe2, 0x6a, 0xd2, 0x30, 0xc0, 0xd7, 0xf5, 0x89, 0x19, 0xb4, 0x46, 0xbe, 0x79, 0xc3, 0x35, 0x69, 0x80, 0x6e, 0x15, 0xb8, 0x33, 0xef, 0x99, 0x7, 0x84, 0x5a, 0x6d, 0xae, 0x45, 0x8f, 0xb0, 0x1f, 0xed, 0x86, 0x3f, 0xbe, 0xa6, 0x6f, 0x3f, 0x75, 0x9e, 0xb9, 0xe, 0x1d, 0xd2, 0x78, 0x79, 0xed, 0x62, 0xf0, 0x19, 0xdc, 0xeb, 0x17, 0xdf, 0xb8, 0x77, 0x7a, 0xcd, 0xed, 0x8f, 0xcf, 0x5e, 0xb7, 0x8e, 0x19, 0xe5, 0xab, 0x3f, 0xf8, 0x66, 0xda, 0x3b, 0xf4, 0xa1, 0x76, 0xf7, 0x90, 0xe3, 0x8e, 0x67, 0x70, 0x1, 0xbc, 0x9f, 0x91, 0xc1, 0xfe, 0x1, 0x7d, 0xea, 0x7f, 0x3f, 0xeb, 0xef, 0xef, 0xfe, 0x5, 0xd6, 0xe3, 0x56, 0x89, 0xd8, 0x62, 0xb6, 0x83, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char option_button_hover_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x41, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x42, 0x40, 0x4b, 0x5f, 0x5a, 0x6c, 0x2b, 0x2b, 0x31, 0x2e, 0x2e, 0x34, 0x5f, 0x5a, 0x6b, 0x2a, 0x2a, 0x30, 0x56, 0x53, 0x64, 0x22, 0x22, 0x27, 0x3e, 0x3b, 0x46, 0x57, 0x53, 0x63, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x5b, 0x57, 0x68, 0x5a, 0x56, 0x67, 0x67, 0x63, 0x76, 0x2a, 0x2a, 0x31, 0x2a, 0x2a, 0x30, 0x2d, 0x2d, 0x34, 0x2f, 0x2f, 0x36, 0x2e, 0x2e, 0x35, 0x2c, 0x2c, 0x32, 0x4d, 0x4a, 0x57, 0x49, 0x46, 0x52, 0x48, 0x45, 0x51, 0x5a, 0x56, 0x65, 0x26, 0x26, 0x2b, 0x24, 0x24, 0x28, 0x27, 0x27, 0x2d, 0x29, 0x29, 0x2f, 0x28, 0x28, 0x2e, 0x25, 0x25, 0x2b, 0x23, 0x23, 0x28, 0x5b, 0x57, 0x66, 0x26, 0x26, 0x2c, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x22, 0x22, 0x26, 0x59, 0x55, 0x64, 0x47, 0x44, 0x50, 0x2d, 0x2d, 0x33, 0x22, 0x22, 0x27, 0x58, 0x54, 0x64, 0x46, 0x43, 0x50, 0x27, 0x27, 0x2b, 0x2e, 0x2e, 0x34, 0x2c, 0x2c, 0x31, 0x29, 0x29, 0x2e, 0x56, 0x53, 0x63, 0x45, 0x42, 0x4f, 0x56, 0x53, 0x62, 0x45, 0x42, 0x4e, 0x24, 0x24, 0x2a, 0x24, 0x24, 0x29, 0x20, 0x20, 0x25, 0x55, 0x51, 0x62, 0x44, 0x41, 0x4e, 0x28, 0x28, 0x2d, 0x2b, 0x2b, 0x30, 0x29, 0x29, 0x2d, 0x20, 0x20, 0x23, 0x55, 0x51, 0x60, 0x44, 0x41, 0x4d, 0x22, 0x22, 0x28, 0x27, 0x27, 0x2c, 0x1e, 0x1e, 0x22, 0x43, 0x40, 0x4c, 0x54, 0x50, 0x5f, 0x21, 0x21, 0x26, 0x21, 0x21, 0x25, 0x23, 0x23, 0x27, 0x20, 0x20, 0x24, 0x1d, 0x1d, 0x21, 0x47, 0x43, 0x51, 0x43, 0x3f, 0x4d, 0x42, 0x3f, 0x4c, 0x53, 0x4f, 0x5f, 0x1f, 0x1f, 0x24, 0x1f, 0x1f, 0x23, 0x1e, 0x1e, 0x21, 0x53, 0x50, 0x5f, 0x53, 0x4f, 0x5e, 0x5f, 0x5a, 0x6c, 0xd3, 0x26, 0x54, 0x35, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x4, 0xa, 0x11, 0x19, 0x1f, 0x22, 0x24, 0x1d, 0x16, 0xd, 0x7, 0x2, 0x15, 0x25, 0x34, 0x3f, 0x46, 0x47, 0x48, 0x43, 0x3a, 0x2d, 0x1b, 0x77, 0xef, 0xe6, 0x49, 0xef, 0xe6, 0xef, 0xe7, 0x77, 0xef, 0xe4, 0x4a, 0xba, 0xea, 0xc1, 0xeb, 0x0, 0x0, 0x0, 0xe5, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x85, 0x91, 0x43, 0x62, 0xc5, 0x60, 0x18, 0x45, 0xef, 0x8d, 0x51, 0xdb, 0xee, 0x46, 0xca, 0x6d, 0x77, 0x58, 0xce, 0x6b, 0xdb, 0x7c, 0x8a, 0xad, 0xea, 0x44, 0x1f, 0x4e, 0x92, 0x1f, 0x4c, 0x0, 0xe0, 0x9, 0x61, 0xf0, 0x89, 0x32, 0x12, 0xcd, 0xd4, 0x8, 0xef, 0x1f, 0x35, 0x54, 0xa0, 0x68, 0x1a, 0x34, 0x89, 0x8, 0x86, 0xa4, 0xd, 0x57, 0xb4, 0xdf, 0x79, 0x5, 0x89, 0x94, 0xba, 0xf9, 0xb3, 0xc0, 0xce, 0xeb, 0xf0, 0x17, 0x1c, 0xab, 0x11, 0x9, 0x1a, 0xf9, 0x96, 0x84, 0x5d, 0x5e, 0x43, 0x15, 0x7, 0x2e, 0x42, 0x41, 0x51, 0xd3, 0xbe, 0x67, 0xd5, 0x6b, 0x42, 0x3a, 0x38, 0x9b, 0xf5, 0x2e, 0x20, 0xfa, 0x5, 0x33, 0x41, 0x69, 0xf4, 0xeb, 0x49, 0x6c, 0x19, 0xe6, 0xbd, 0xdd, 0xd, 0x48, 0xa0, 0x92, 0xb, 0x36, 0x72, 0x6a, 0x26, 0xf0, 0x14, 0xa, 0x10, 0x72, 0xe1, 0x7d, 0xf4, 0xf6, 0x35, 0x1b, 0xc3, 0xe3, 0x18, 0x9d, 0x50, 0xf0, 0xe4, 0xc2, 0x17, 0xae, 0x27, 0xd3, 0xe4, 0x6e, 0xe8, 0xf8, 0x7e, 0xbc, 0x1, 0x48, 0x9e, 0x57, 0xf8, 0xc5, 0xfc, 0xbd, 0x7a, 0x98, 0xc4, 0x94, 0x47, 0xbf, 0xe4, 0xce, 0x48, 0x8, 0x6e, 0x69, 0x91, 0x63, 0x47, 0x73, 0x49, 0xbc, 0x77, 0x3e, 0xd7, 0x4b, 0x3b, 0x12, 0x36, 0x16, 0xb3, 0x85, 0x6a, 0x68, 0xce, 0x39, 0x62, 0xc6, 0xba, 0x3d, 0x8d, 0xe7, 0x91, 0x20, 0xac, 0xad, 0xa6, 0xc2, 0xe, 0x6, 0xcc, 0x74, 0xc, 0x2d, 0xe7, 0xf9, 0x55, 0x2, 0x28, 0x94, 0x37, 0xab, 0xee, 0xa1, 0xcc, 0xbf, 0xdb, 0xed, 0x3, 0x70, 0xe6, 0x4f, 0x4a, 0xc3, 0xed, 0xed, 0xf3, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char option_button_hover_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x41, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x2d, 0x2d, 0x34, 0x2b, 0x2b, 0x31, 0x5f, 0x5a, 0x6c, 0x42, 0x40, 0x4b, 0x2a, 0x2a, 0x30, 0x5f, 0x5a, 0x6b, 0x22, 0x22, 0x27, 0x56, 0x53, 0x64, 0x22, 0x22, 0x29, 0x24, 0x24, 0x28, 0x57, 0x53, 0x63, 0x3e, 0x3c, 0x47, 0x2a, 0x2a, 0x30, 0x2c, 0x2c, 0x32, 0x2d, 0x2d, 0x34, 0x2e, 0x2e, 0x35, 0x2f, 0x2f, 0x36, 0x2a, 0x2a, 0x31, 0x67, 0x63, 0x76, 0x5a, 0x56, 0x67, 0x5b, 0x57, 0x68, 0x23, 0x23, 0x28, 0x25, 0x25, 0x2b, 0x27, 0x27, 0x2d, 0x28, 0x28, 0x2e, 0x29, 0x29, 0x2f, 0x24, 0x24, 0x28, 0x26, 0x26, 0x2b, 0x5a, 0x56, 0x65, 0x48, 0x45, 0x51, 0x49, 0x46, 0x52, 0x4d, 0x4a, 0x57, 0x22, 0x22, 0x26, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x26, 0x26, 0x2c, 0x5b, 0x57, 0x66, 0x22, 0x22, 0x27, 0x2d, 0x2d, 0x33, 0x59, 0x55, 0x64, 0x47, 0x44, 0x50, 0x27, 0x27, 0x2b, 0x29, 0x29, 0x2e, 0x2c, 0x2c, 0x31, 0x2e, 0x2e, 0x34, 0x58, 0x54, 0x64, 0x46, 0x43, 0x50, 0x56, 0x53, 0x63, 0x45, 0x42, 0x4f, 0x20, 0x20, 0x25, 0x24, 0x24, 0x29, 0x24, 0x24, 0x2a, 0x56, 0x53, 0x62, 0x45, 0x42, 0x4e, 0x20, 0x20, 0x23, 0x29, 0x29, 0x2d, 0x2b, 0x2b, 0x30, 0x28, 0x28, 0x2d, 0x55, 0x51, 0x62, 0x44, 0x41, 0x4e, 0x1e, 0x1e, 0x22, 0x27, 0x27, 0x2c, 0x22, 0x22, 0x28, 0x55, 0x51, 0x60, 0x44, 0x41, 0x4d, 0x1d, 0x1d, 0x21, 0x20, 0x20, 0x24, 0x23, 0x23, 0x27, 0x21, 0x21, 0x25, 0x21, 0x21, 0x26, 0x54, 0x50, 0x5f, 0x43, 0x40, 0x4c, 0x1e, 0x1e, 0x21, 0x1f, 0x1f, 0x23, 0x1f, 0x1f, 0x24, 0x53, 0x4f, 0x5f, 0x42, 0x3f, 0x4c, 0x43, 0x3f, 0x4d, 0x47, 0x43, 0x51, 0x5f, 0x5a, 0x6c, 0x53, 0x4f, 0x5e, 0x53, 0x50, 0x5f, 0x68, 0x6, 0xa3, 0x65, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x2, 0x7, 0xd, 0x16, 0x1d, 0x22, 0x24, 0x1f, 0x19, 0x11, 0xa, 0x4, 0x1b, 0x2d, 0x3a, 0x43, 0x48, 0x47, 0x46, 0x3f, 0x34, 0x25, 0x15, 0x49, 0xe6, 0xef, 0x77, 0xe6, 0xef, 0xe7, 0xef, 0x4a, 0xe4, 0xef, 0x77, 0x7e, 0xb9, 0x59, 0x66, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x1, 0x15, 0x49, 0x44, 0x41, 0x54, 0x28, 0xcf, 0x85, 0xd1, 0xd9, 0x52, 0xc2, 0x30, 0x14, 0x80, 0xe1, 0x2a, 0x5a, 0x56, 0x97, 0xb2, 0xb9, 0x8b, 0xb, 0x54, 0x51, 0x4b, 0x6d, 0x8f, 0x60, 0xd3, 0x62, 0xc1, 0x56, 0x11, 0x5, 0xdc, 0xd0, 0x5a, 0x14, 0x70, 0x5f, 0xdf, 0xff, 0x1, 0xc, 0x69, 0xc2, 0x30, 0x5c, 0xe8, 0x77, 0x99, 0xfc, 0x33, 0x39, 0x49, 0x38, 0x6e, 0xc8, 0xc8, 0xa8, 0x6f, 0x6c, 0x9c, 0xf7, 0x63, 0x7c, 0x20, 0x18, 0xa, 0x47, 0x86, 0xf7, 0xb9, 0x88, 0x6f, 0x62, 0x72, 0x6a, 0x5a, 0x10, 0x84, 0x68, 0x2c, 0x9e, 0x48, 0xce, 0x84, 0xf1, 0xd2, 0xec, 0x5c, 0x3a, 0x23, 0x6e, 0x6c, 0x52, 0x62, 0x3a, 0xbb, 0xb5, 0xed, 0xd9, 0x99, 0x5f, 0x48, 0x86, 0x70, 0xb0, 0x28, 0x49, 0x39, 0x79, 0x57, 0xa1, 0x64, 0x15, 0xf6, 0xf2, 0x9e, 0xc2, 0xfe, 0x52, 0x22, 0x88, 0x3, 0x59, 0x43, 0xb2, 0x6e, 0x64, 0x28, 0x1d, 0x15, 0x59, 0x90, 0x2f, 0x1c, 0xc4, 0x3, 0xbd, 0xc0, 0x4, 0xc5, 0x28, 0x89, 0x54, 0x16, 0x8a, 0xe5, 0x43, 0xa6, 0x1c, 0xe3, 0x71, 0x60, 0x69, 0x60, 0x1f, 0x95, 0x8e, 0x29, 0x3, 0xac, 0xca, 0x9, 0x53, 0x89, 0xfa, 0x71, 0x0, 0x38, 0x30, 0x6, 0x83, 0xea, 0x29, 0x53, 0x15, 0x7a, 0x1, 0x3a, 0xab, 0xd, 0xcc, 0xa0, 0xd4, 0x73, 0x8d, 0x73, 0xa6, 0x41, 0x2, 0xf5, 0x42, 0x82, 0x4b, 0xfd, 0x8a, 0xba, 0x56, 0xd5, 0xe6, 0xd, 0xd3, 0x24, 0x47, 0x98, 0xb7, 0x66, 0xdd, 0xe9, 0x5f, 0xd3, 0x31, 0xef, 0xdc, 0x16, 0xe3, 0x92, 0x21, 0xb5, 0xfb, 0x87, 0x36, 0x2, 0x87, 0x42, 0x9d, 0xee, 0xe3, 0x13, 0xd5, 0x72, 0xc9, 0x35, 0x97, 0x9f, 0x5f, 0x3a, 0xed, 0x1a, 0xa2, 0xa4, 0xd7, 0xee, 0xdb, 0xbb, 0xe7, 0xe3, 0x33, 0x45, 0x1e, 0x6a, 0x65, 0x55, 0xb5, 0xec, 0xfe, 0xc, 0x36, 0xc0, 0xd7, 0xb7, 0xe7, 0x67, 0x6d, 0x9d, 0x3c, 0xf5, 0xbf, 0x9f, 0xf5, 0xf7, 0x77, 0xff, 0x2, 0xa7, 0xc5, 0x58, 0xc8, 0x6e, 0x59, 0x8, 0x3, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char option_button_normal_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x41, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x3c, 0x3a, 0x44, 0x56, 0x53, 0x61, 0x2b, 0x2b, 0x31, 0x2e, 0x2e, 0x34, 0x56, 0x52, 0x60, 0x2a, 0x2a, 0x30, 0x47, 0x44, 0x52, 0x22, 0x22, 0x27, 0x33, 0x31, 0x39, 0x47, 0x44, 0x50, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x52, 0x50, 0x5d, 0x51, 0x4f, 0x5d, 0x5d, 0x5a, 0x6a, 0x2a, 0x2a, 0x31, 0x2a, 0x2a, 0x30, 0x2d, 0x2d, 0x34, 0x2f, 0x2f, 0x36, 0x2e, 0x2e, 0x35, 0x2c, 0x2c, 0x32, 0x46, 0x42, 0x4e, 0x42, 0x3e, 0x4a, 0x41, 0x3e, 0x49, 0x51, 0x4e, 0x5b, 0x26, 0x26, 0x2b, 0x24, 0x24, 0x28, 0x27, 0x27, 0x2d, 0x29, 0x29, 0x2f, 0x28, 0x28, 0x2e, 0x25, 0x25, 0x2b, 0x23, 0x23, 0x28, 0x40, 0x3e, 0x48, 0x50, 0x4e, 0x5a, 0x26, 0x26, 0x2c, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x22, 0x22, 0x26, 0x4f, 0x4c, 0x59, 0x3f, 0x3d, 0x47, 0x2d, 0x2d, 0x33, 0x22, 0x22, 0x27, 0x4e, 0x4a, 0x58, 0x3e, 0x3b, 0x46, 0x27, 0x27, 0x2b, 0x2e, 0x2e, 0x34, 0x2c, 0x2c, 0x31, 0x29, 0x29, 0x2e, 0x4b, 0x49, 0x55, 0x3c, 0x3a, 0x44, 0x4a, 0x47, 0x54, 0x3b, 0x39, 0x43, 0x24, 0x24, 0x2a, 0x24, 0x24, 0x29, 0x20, 0x20, 0x25, 0x49, 0x46, 0x53, 0x3a, 0x38, 0x42, 0x28, 0x28, 0x2d, 0x2b, 0x2b, 0x30, 0x29, 0x29, 0x2d, 0x20, 0x20, 0x23, 0x47, 0x45, 0x50, 0x39, 0x37, 0x40, 0x22, 0x22, 0x28, 0x27, 0x27, 0x2c, 0x1e, 0x1e, 0x22, 0x47, 0x43, 0x50, 0x38, 0x35, 0x3f, 0x46, 0x42, 0x4f, 0x21, 0x21, 0x26, 0x21, 0x21, 0x25, 0x23, 0x23, 0x27, 0x20, 0x20, 0x24, 0x1d, 0x1d, 0x21, 0x36, 0x34, 0x3e, 0x44, 0x41, 0x4e, 0x1f, 0x1f, 0x24, 0x1f, 0x1f, 0x23, 0x1e, 0x1e, 0x21, 0x44, 0x42, 0x4d, 0x44, 0x41, 0x4c, 0x4e, 0x4b, 0x58, 0x8, 0xd9, 0x10, 0xcb, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x4, 0xa, 0x11, 0x19, 0x1f, 0x22, 0x24, 0x1d, 0x16, 0xd, 0x7, 0x2, 0x15, 0x25, 0x34, 0x3f, 0x46, 0x47, 0x48, 0x43, 0x3a, 0x2d, 0x1b, 0x77, 0xef, 0xe6, 0x49, 0xef, 0xe6, 0xef, 0xe7, 0x77, 0xef, 0xe4, 0x4a, 0xba, 0xea, 0xc1, 0xeb, 0x0, 0x0, 0x0, 0xe6, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x6c, 0xd1, 0x55, 0x5a, 0xc4, 0x30, 0x14, 0x5, 0xe0, 0x73, 0xea, 0x82, 0xbb, 0x3b, 0x6c, 0x80, 0x45, 0xb0, 0x70, 0x5e, 0xb1, 0x37, 0xdc, 0x75, 0xdc, 0x3d, 0x43, 0x2a, 0x5f, 0x3a, 0x7e, 0x6a, 0xc9, 0xbd, 0x7f, 0x9d, 0x2a, 0x0, 0xa4, 0x16, 0xd, 0xaa, 0x18, 0x8e, 0x41, 0x3f, 0x11, 0xd1, 0xbe, 0x52, 0xc7, 0x48, 0xa8, 0xfb, 0x5e, 0x68, 0xd4, 0x24, 0x96, 0x6a, 0xfc, 0xaf, 0x8b, 0x32, 0xbf, 0x61, 0x90, 0xc6, 0x3c, 0x27, 0x3, 0xce, 0xfe, 0x20, 0x2, 0x4b, 0xd2, 0x45, 0x1f, 0x14, 0xd5, 0x78, 0x5e, 0x36, 0x1c, 0x7d, 0xe5, 0x33, 0x2, 0xb3, 0x84, 0x8a, 0xec, 0xd4, 0xeb, 0x9a, 0x1a, 0x1b, 0x82, 0xf5, 0x79, 0x20, 0x2, 0x46, 0x1f, 0x58, 0x8d, 0x95, 0xe4, 0x6a, 0x1d, 0xcf, 0x4f, 0x89, 0x85, 0x10, 0x80, 0x56, 0x1f, 0x8, 0xf4, 0x53, 0xf7, 0x81, 0x6c, 0x4, 0xa0, 0xf5, 0x41, 0x69, 0xeb, 0xb7, 0xd0, 0x7b, 0x86, 0xcc, 0x36, 0xbb, 0x11, 0x90, 0x66, 0x1f, 0x88, 0xef, 0xbd, 0x64, 0x92, 0x5a, 0x7b, 0x4e, 0xed, 0x34, 0x42, 0x20, 0xa5, 0xd5, 0x7, 0x27, 0x69, 0xfb, 0x51, 0x8d, 0x69, 0x6e, 0xd5, 0xcc, 0xb9, 0x18, 0xf4, 0xaf, 0x40, 0x6e, 0x3f, 0x1d, 0xab, 0xf1, 0xdd, 0xc7, 0xf1, 0x12, 0x45, 0xc, 0xce, 0x4f, 0x17, 0x12, 0xd0, 0xb6, 0xc4, 0x87, 0x1a, 0x6f, 0x2f, 0x48, 0x8b, 0xef, 0x31, 0xd0, 0x6e, 0xce, 0xa8, 0xc0, 0x25, 0x56, 0x7d, 0x5, 0x52, 0xed, 0x6e, 0xae, 0x68, 0x0, 0xd4, 0x86, 0x7f, 0x56, 0x43, 0x62, 0x38, 0xc, 0x46, 0x28, 0xba, 0x1, 0x7a, 0xad, 0x4f, 0x59, 0x90, 0xab, 0xbf, 0xa4, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char option_button_normal_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x41, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x2d, 0x2d, 0x34, 0x2b, 0x2b, 0x31, 0x56, 0x53, 0x61, 0x3c, 0x3a, 0x45, 0x2a, 0x2a, 0x30, 0x56, 0x52, 0x60, 0x22, 0x22, 0x27, 0x47, 0x44, 0x52, 0x22, 0x22, 0x29, 0x24, 0x24, 0x28, 0x47, 0x44, 0x50, 0x33, 0x31, 0x3a, 0x2a, 0x2a, 0x30, 0x2c, 0x2c, 0x32, 0x2d, 0x2d, 0x34, 0x2e, 0x2e, 0x35, 0x2f, 0x2f, 0x36, 0x2a, 0x2a, 0x31, 0x5d, 0x5a, 0x6a, 0x51, 0x4f, 0x5d, 0x52, 0x50, 0x5d, 0x23, 0x23, 0x28, 0x25, 0x25, 0x2b, 0x27, 0x27, 0x2d, 0x28, 0x28, 0x2e, 0x29, 0x29, 0x2f, 0x24, 0x24, 0x28, 0x26, 0x26, 0x2b, 0x51, 0x4e, 0x5b, 0x41, 0x3e, 0x49, 0x42, 0x3e, 0x4a, 0x46, 0x42, 0x4e, 0x22, 0x22, 0x26, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x26, 0x26, 0x2c, 0x50, 0x4e, 0x5a, 0x40, 0x3e, 0x48, 0x22, 0x22, 0x27, 0x2d, 0x2d, 0x33, 0x4f, 0x4c, 0x59, 0x3f, 0x3d, 0x47, 0x27, 0x27, 0x2b, 0x29, 0x29, 0x2e, 0x2c, 0x2c, 0x31, 0x2e, 0x2e, 0x34, 0x4e, 0x4a, 0x58, 0x3e, 0x3b, 0x46, 0x4b, 0x49, 0x55, 0x3c, 0x3a, 0x44, 0x20, 0x20, 0x25, 0x24, 0x24, 0x29, 0x24, 0x24, 0x2a, 0x4a, 0x47, 0x54, 0x3b, 0x39, 0x43, 0x20, 0x20, 0x23, 0x29, 0x29, 0x2d, 0x2b, 0x2b, 0x30, 0x28, 0x28, 0x2d, 0x49, 0x46, 0x53, 0x3a, 0x38, 0x42, 0x1e, 0x1e, 0x22, 0x27, 0x27, 0x2c, 0x22, 0x22, 0x28, 0x47, 0x45, 0x50, 0x39, 0x37, 0x40, 0x1d, 0x1d, 0x21, 0x20, 0x20, 0x24, 0x23, 0x23, 0x27, 0x21, 0x21, 0x25, 0x21, 0x21, 0x26, 0x46, 0x42, 0x4f, 0x38, 0x35, 0x3f, 0x47, 0x43, 0x50, 0x1e, 0x1e, 0x21, 0x1f, 0x1f, 0x23, 0x1f, 0x1f, 0x24, 0x44, 0x41, 0x4e, 0x36, 0x34, 0x3e, 0x4e, 0x4b, 0x58, 0x44, 0x41, 0x4c, 0x44, 0x42, 0x4d, 0x7d, 0x2e, 0xcf, 0xc5, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x2, 0x7, 0xd, 0x16, 0x1d, 0x22, 0x24, 0x1f, 0x19, 0x11, 0xa, 0x4, 0x1b, 0x2d, 0x3a, 0x43, 0x48, 0x47, 0x46, 0x3f, 0x34, 0x25, 0x15, 0x49, 0xe6, 0xef, 0x77, 0xe6, 0xef, 0xe7, 0xef, 0x4a, 0xe4, 0xef, 0x77, 0x7e, 0xb9, 0x59, 0x66, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x1, 0x13, 0x49, 0x44, 0x41, 0x54, 0x28, 0xcf, 0x85, 0xd1, 0xd9, 0x52, 0xc2, 0x30, 0x14, 0x80, 0xe1, 0x2a, 0x5a, 0x56, 0x97, 0xb2, 0xb9, 0x8b, 0xb, 0x54, 0x51, 0x4b, 0x6d, 0xf, 0x68, 0xd3, 0xa2, 0x5, 0x5b, 0x40, 0x14, 0x70, 0x3, 0x2b, 0x2a, 0xe0, 0xbe, 0xbd, 0xff, 0x3, 0x18, 0xd2, 0x84, 0x61, 0xb8, 0xd0, 0xef, 0x32, 0xf9, 0x67, 0x72, 0x92, 0x70, 0xdc, 0x88, 0xb1, 0x71, 0xcf, 0xc4, 0x24, 0xef, 0xc5, 0x78, 0x9f, 0x3f, 0x10, 0xc, 0x8d, 0xee, 0x73, 0x21, 0xcf, 0xd4, 0xf4, 0xcc, 0xac, 0x20, 0x8, 0xe1, 0x48, 0x34, 0x16, 0x9f, 0xb, 0xe2, 0xa5, 0xf9, 0x85, 0x64, 0x4a, 0xdc, 0xda, 0xa6, 0xc4, 0x64, 0x7a, 0x67, 0xd7, 0xb5, 0xb7, 0xb8, 0x14, 0xf, 0xe0, 0x60, 0x59, 0x92, 0x32, 0xf2, 0xbe, 0x42, 0xc9, 0x2a, 0x64, 0x73, 0xae, 0x83, 0xc3, 0x95, 0x98, 0x1f, 0x7, 0xb2, 0x86, 0x64, 0xdd, 0x48, 0x51, 0x3a, 0xca, 0x1f, 0x1d, 0x53, 0xb9, 0x6c, 0xd4, 0xd7, 0xf, 0x4c, 0x50, 0x8c, 0x82, 0x48, 0xa5, 0x21, 0x5f, 0x3c, 0x61, 0x8a, 0x11, 0x1e, 0x7, 0x96, 0x6, 0x76, 0xa9, 0x50, 0xa6, 0xc, 0xb0, 0x2a, 0xa7, 0x4c, 0x25, 0xec, 0xc5, 0x1, 0xe0, 0xc0, 0x18, 0xe, 0xaa, 0x67, 0x4c, 0x55, 0xe8, 0x7, 0xe8, 0xbc, 0x36, 0x34, 0x83, 0x52, 0xcf, 0x34, 0x2e, 0x98, 0x6, 0x9, 0xd4, 0x4b, 0x9, 0xae, 0xf4, 0x6b, 0xea, 0x46, 0x55, 0x9b, 0x2d, 0xa6, 0x49, 0x8e, 0x30, 0x6f, 0xcd, 0xba, 0x33, 0xb8, 0xa6, 0x63, 0xde, 0xb5, 0xef, 0x99, 0x36, 0x19, 0x52, 0x7b, 0x78, 0xec, 0x20, 0x70, 0x28, 0xd4, 0xed, 0x3d, 0x3d, 0x33, 0x2f, 0xe4, 0x9a, 0xab, 0xaf, 0x6f, 0xdd, 0x4e, 0xd, 0x51, 0xd2, 0x7b, 0xef, 0xe3, 0x93, 0x6a, 0x25, 0xc8, 0x43, 0xad, 0xad, 0xab, 0x96, 0x3d, 0x98, 0xc1, 0x6, 0xf8, 0xfa, 0x76, 0xfd, 0x6c, 0x6c, 0x92, 0xa7, 0xfe, 0xf7, 0xb3, 0xfe, 0xfe, 0xee, 0x5f, 0xa1, 0x5f, 0x59, 0xbd, 0x75, 0x41, 0x2b, 0xf8, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char option_button_pressed_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x4a, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x31, 0x2f, 0x37, 0x46, 0x43, 0x4f, 0x2b, 0x2b, 0x31, 0x2e, 0x2e, 0x34, 0x47, 0x44, 0x50, 0x2a, 0x2a, 0x30, 0x55, 0x52, 0x5f, 0x22, 0x22, 0x27, 0x3d, 0x3a, 0x45, 0x56, 0x52, 0x60, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x43, 0x40, 0x4c, 0x42, 0x40, 0x4b, 0x4c, 0x49, 0x56, 0x2a, 0x2a, 0x31, 0x2a, 0x2a, 0x30, 0x2d, 0x2d, 0x34, 0x2f, 0x2f, 0x36, 0x2e, 0x2e, 0x35, 0x2c, 0x2c, 0x32, 0x3a, 0x38, 0x41, 0x36, 0x34, 0x3d, 0x44, 0x41, 0x4c, 0x26, 0x26, 0x2b, 0x24, 0x24, 0x28, 0x27, 0x27, 0x2d, 0x29, 0x29, 0x2f, 0x28, 0x28, 0x2e, 0x25, 0x25, 0x2b, 0x23, 0x23, 0x28, 0x44, 0x42, 0x4e, 0x36, 0x34, 0x3e, 0x44, 0x41, 0x4e, 0x26, 0x26, 0x2c, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x22, 0x22, 0x26, 0x46, 0x42, 0x4f, 0x38, 0x35, 0x3f, 0x2d, 0x2d, 0x33, 0x22, 0x22, 0x27, 0x47, 0x45, 0x50, 0x39, 0x37, 0x40, 0x27, 0x27, 0x2b, 0x2e, 0x2e, 0x34, 0x2c, 0x2c, 0x31, 0x29, 0x29, 0x2e, 0x49, 0x46, 0x53, 0x3a, 0x38, 0x42, 0x4a, 0x47, 0x54, 0x3b, 0x39, 0x43, 0x24, 0x24, 0x2a, 0x24, 0x24, 0x29, 0x20, 0x20, 0x25, 0x4b, 0x49, 0x55, 0x3c, 0x3a, 0x44, 0x28, 0x28, 0x2d, 0x2b, 0x2b, 0x30, 0x29, 0x29, 0x2d, 0x20, 0x20, 0x23, 0x4e, 0x4a, 0x58, 0x3e, 0x3b, 0x46, 0x22, 0x22, 0x28, 0x27, 0x27, 0x2c, 0x1e, 0x1e, 0x22, 0x50, 0x4d, 0x5a, 0x3f, 0x3d, 0x48, 0x3f, 0x3d, 0x47, 0x4f, 0x4c, 0x59, 0x21, 0x21, 0x26, 0x21, 0x21, 0x25, 0x23, 0x23, 0x27, 0x20, 0x20, 0x24, 0x1d, 0x1d, 0x21, 0x45, 0x42, 0x4d, 0x41, 0x3e, 0x49, 0x40, 0x3e, 0x48, 0x50, 0x4e, 0x5a, 0x1f, 0x1f, 0x24, 0x1f, 0x1f, 0x23, 0x1e, 0x1e, 0x21, 0x52, 0x4e, 0x5c, 0x51, 0x4e, 0x5b, 0x5d, 0x59, 0x69, 0x10, 0x9d, 0xe0, 0x3c, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x4, 0xa, 0x11, 0x19, 0x1f, 0x22, 0x24, 0x1d, 0x16, 0xd, 0x7, 0x2, 0x15, 0x25, 0x34, 0x3f, 0x46, 0x47, 0x48, 0x43, 0x3a, 0x2d, 0x1b, 0x77, 0xef, 0xe6, 0x49, 0xef, 0xe6, 0xef, 0xe7, 0x77, 0xef, 0xe4, 0x4a, 0xba, 0xea, 0xc1, 0xeb, 0x0, 0x0, 0x0, 0xe6, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x6c, 0xcf, 0x3, 0x62, 0x4, 0x51, 0x10, 0x4, 0xd0, 0xaa, 0x31, 0x62, 0xdb, 0xb8, 0x49, 0x2e, 0x9e, 0x3b, 0xc4, 0xb6, 0x9d, 0xc5, 0x58, 0x1f, 0xc1, 0xd6, 0xe8, 0x77, 0xf7, 0x1b, 0x59, 0x6c, 0x2, 0x20, 0x37, 0xaa, 0xc5, 0x17, 0x7e, 0xc7, 0x62, 0x28, 0x45, 0x75, 0xfe, 0x6c, 0xe1, 0x4f, 0x68, 0x86, 0x41, 0x69, 0x44, 0x51, 0x4b, 0xb1, 0xce, 0xcc, 0xe4, 0x83, 0xd7, 0xb0, 0x48, 0x6b, 0x98, 0xe8, 0x9, 0x38, 0x70, 0x8b, 0xa, 0xcc, 0x12, 0x1a, 0xf0, 0x4d, 0xac, 0x87, 0xf3, 0x96, 0x6f, 0x8e, 0x5f, 0x56, 0xc0, 0x53, 0x20, 0x8f, 0xbf, 0xdb, 0x86, 0x58, 0x5b, 0x9, 0xbf, 0x47, 0x80, 0xa, 0x58, 0x1a, 0x38, 0xad, 0x9, 0x5f, 0xac, 0xe3, 0x20, 0xbc, 0x4b, 0x46, 0x4b, 0x0, 0x3a, 0x1a, 0x24, 0xd0, 0x69, 0x85, 0xc0, 0x63, 0x5, 0x60, 0x68, 0xf0, 0x36, 0x7f, 0xf3, 0xaa, 0xbe, 0xe1, 0x61, 0x81, 0x69, 0x5, 0x72, 0x5b, 0x83, 0xe4, 0x6a, 0x59, 0x16, 0xf7, 0x53, 0x47, 0x77, 0x8b, 0xad, 0x12, 0xe4, 0xb9, 0xa3, 0xc1, 0xe6, 0x83, 0x7b, 0x20, 0xd6, 0xb4, 0xe7, 0xbf, 0xed, 0xe1, 0x1a, 0xd8, 0xfa, 0xdf, 0xb9, 0x70, 0xb8, 0x21, 0xd6, 0xbb, 0x17, 0x1b, 0xe3, 0x4c, 0x6a, 0xb0, 0xbd, 0x25, 0x5, 0x3b, 0x5e, 0x7c, 0x21, 0xc0, 0xc2, 0x68, 0xee, 0xf1, 0xbc, 0x6, 0x46, 0xb1, 0xbd, 0x5e, 0x30, 0x5, 0x27, 0x19, 0x24, 0xb8, 0x61, 0x6e, 0xf8, 0xf5, 0xf7, 0xcd, 0x47, 0x16, 0xa0, 0x18, 0x13, 0x6a, 0x64, 0x7d, 0xff, 0x8f, 0x1e, 0x59, 0x84, 0xa2, 0x1b, 0x0, 0xe5, 0xe0, 0x4e, 0x46, 0x1d, 0x98, 0x92, 0x5c, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char option_button_pressed_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x20, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x40, 0xde, 0x8d, 0x6b, 0x0, 0x0, 0x1, 0x4a, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x2d, 0x2d, 0x34, 0x2b, 0x2b, 0x31, 0x46, 0x43, 0x4f, 0x31, 0x2f, 0x38, 0x2a, 0x2a, 0x30, 0x47, 0x44, 0x50, 0x22, 0x22, 0x27, 0x55, 0x52, 0x5f, 0x22, 0x22, 0x29, 0x24, 0x24, 0x28, 0x56, 0x52, 0x60, 0x3c, 0x3a, 0x45, 0x2a, 0x2a, 0x30, 0x2c, 0x2c, 0x32, 0x2d, 0x2d, 0x34, 0x2e, 0x2e, 0x35, 0x2f, 0x2f, 0x36, 0x2a, 0x2a, 0x31, 0x4c, 0x49, 0x56, 0x42, 0x40, 0x4b, 0x43, 0x40, 0x4c, 0x23, 0x23, 0x28, 0x25, 0x25, 0x2b, 0x27, 0x27, 0x2d, 0x28, 0x28, 0x2e, 0x29, 0x29, 0x2f, 0x24, 0x24, 0x28, 0x26, 0x26, 0x2b, 0x44, 0x41, 0x4c, 0x36, 0x34, 0x3d, 0x3a, 0x38, 0x41, 0x22, 0x22, 0x26, 0x25, 0x25, 0x2a, 0x2a, 0x2a, 0x2f, 0x2b, 0x2b, 0x31, 0x26, 0x26, 0x2c, 0x44, 0x41, 0x4e, 0x36, 0x34, 0x3e, 0x44, 0x42, 0x4e, 0x22, 0x22, 0x27, 0x2d, 0x2d, 0x33, 0x46, 0x42, 0x4f, 0x38, 0x35, 0x3f, 0x27, 0x27, 0x2b, 0x29, 0x29, 0x2e, 0x2c, 0x2c, 0x31, 0x2e, 0x2e, 0x34, 0x47, 0x45, 0x50, 0x39, 0x37, 0x40, 0x49, 0x46, 0x53, 0x3a, 0x38, 0x42, 0x20, 0x20, 0x25, 0x24, 0x24, 0x29, 0x24, 0x24, 0x2a, 0x4a, 0x47, 0x54, 0x3b, 0x39, 0x43, 0x20, 0x20, 0x23, 0x29, 0x29, 0x2d, 0x2b, 0x2b, 0x30, 0x28, 0x28, 0x2d, 0x4b, 0x49, 0x55, 0x3c, 0x3a, 0x44, 0x1e, 0x1e, 0x22, 0x27, 0x27, 0x2c, 0x22, 0x22, 0x28, 0x4e, 0x4a, 0x58, 0x3e, 0x3b, 0x46, 0x1d, 0x1d, 0x21, 0x20, 0x20, 0x24, 0x23, 0x23, 0x27, 0x21, 0x21, 0x25, 0x21, 0x21, 0x26, 0x4f, 0x4c, 0x59, 0x3f, 0x3d, 0x47, 0x3f, 0x3d, 0x48, 0x50, 0x4d, 0x5a, 0x1e, 0x1e, 0x21, 0x1f, 0x1f, 0x23, 0x1f, 0x1f, 0x24, 0x50, 0x4e, 0x5a, 0x40, 0x3e, 0x48, 0x41, 0x3e, 0x49, 0x45, 0x42, 0x4d, 0x5d, 0x59, 0x69, 0x51, 0x4e, 0x5b, 0x52, 0x4e, 0x5c, 0x49, 0x7e, 0x80, 0x9, 0x0, 0x0, 0x0, 0x24, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x2, 0x7, 0xd, 0x16, 0x1d, 0x22, 0x24, 0x1f, 0x19, 0x11, 0xa, 0x4, 0x1b, 0x2d, 0x3a, 0x43, 0x48, 0x47, 0x46, 0x3f, 0x34, 0x25, 0x15, 0x49, 0xe6, 0xef, 0x77, 0xe6, 0xef, 0xe7, 0xef, 0x4a, 0xe4, 0xef, 0x77, 0x7e, 0xb9, 0x59, 0x66, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x1, 0x14, 0x49, 0x44, 0x41, 0x54, 0x28, 0xcf, 0x63, 0x60, 0x40, 0x3, 0x8c, 0x4c, 0xcc, 0x2c, 0xac, 0x6c, 0xec, 0x40, 0xc0, 0xc6, 0xc1, 0xc9, 0xc5, 0xcd, 0x83, 0x2e, 0xcf, 0xc0, 0xc3, 0xcc, 0xcb, 0xc7, 0x2f, 0x20, 0x28, 0x28, 0x28, 0x24, 0x2c, 0x22, 0x2a, 0x26, 0xce, 0xd, 0x14, 0x92, 0x90, 0x54, 0x51, 0x55, 0x53, 0xd7, 0x80, 0x2, 0x35, 0x15, 0x4d, 0x2d, 0x6d, 0x8, 0xd0, 0x91, 0x92, 0x16, 0xe3, 0x2, 0x2a, 0x90, 0xd1, 0xd5, 0xd5, 0xd3, 0x37, 0x30, 0x84, 0x2, 0x7d, 0x23, 0x63, 0x13, 0x53, 0x28, 0x30, 0x93, 0x15, 0xe5, 0x4, 0x2a, 0xd0, 0x37, 0xb7, 0xd0, 0xb7, 0xb4, 0x52, 0x85, 0x2, 0x4b, 0xb, 0x6b, 0x1b, 0x5b, 0x18, 0xb0, 0x13, 0xe1, 0x0, 0x29, 0xb0, 0x37, 0x36, 0xb4, 0x72, 0x50, 0x83, 0x2, 0x4d, 0x63, 0x6b, 0x47, 0x27, 0x18, 0x70, 0x14, 0x66, 0x3, 0x2a, 0x70, 0x36, 0x37, 0x76, 0x71, 0x75, 0x70, 0x83, 0x2, 0x2b, 0x63, 0x67, 0x77, 0xf, 0x18, 0x70, 0x17, 0x62, 0x7, 0x2a, 0x30, 0x6, 0x2a, 0xb0, 0x42, 0x56, 0xe0, 0xe9, 0x5, 0x3, 0x9e, 0x82, 0x20, 0x5, 0x16, 0xde, 0x3e, 0x48, 0x6e, 0x30, 0xf4, 0xd5, 0xf3, 0xf3, 0x87, 0x1, 0x3f, 0xb0, 0x2, 0xa3, 0x0, 0x5d, 0xe3, 0x40, 0xcb, 0x20, 0x28, 0x8, 0x36, 0x32, 0xa, 0x9, 0x85, 0x81, 0x10, 0xb0, 0x15, 0xf6, 0x61, 0xf6, 0xbe, 0xe1, 0x70, 0x6f, 0x86, 0xdb, 0x47, 0x44, 0x46, 0xc1, 0x40, 0x24, 0xd8, 0x91, 0xe6, 0xd1, 0x31, 0xb1, 0x16, 0xc6, 0xe1, 0x50, 0x60, 0x11, 0x17, 0x9f, 0x90, 0x8, 0x5, 0x49, 0xc9, 0x60, 0x6f, 0xca, 0xa5, 0xa4, 0xc6, 0xc5, 0xfa, 0x58, 0x40, 0x81, 0x6e, 0x5a, 0x7c, 0x7a, 0x6, 0x4, 0x64, 0x66, 0xc9, 0x83, 0x3, 0x4a, 0x41, 0xd1, 0xc8, 0xd9, 0x5, 0xee, 0x6, 0x17, 0x63, 0xe3, 0xec, 0x1c, 0x8, 0xc8, 0x55, 0x52, 0x6, 0x7, 0x35, 0xc1, 0xc8, 0xc2, 0x1f, 0xdd, 0x0, 0xa5, 0xe, 0x59, 0xe5, 0x7f, 0xe9, 0xa4, 0x40, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char overbright_indicator_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x4, 0x3, 0x0, 0x0, 0x0, 0xed, 0xdd, 0xe2, 0x52, 0x0, 0x0, 0x1, 0x85, 0x69, 0x43, 0x43, 0x50, 0x49, 0x43, 0x43, 0x20, 0x70, 0x72, 0x6f, 0x66, 0x69, 0x6c, 0x65, 0x0, 0x0, 0x78, 0x9c, 0x7d, 0x91, 0x3d, 0x48, 0xc3, 0x40, 0x1c, 0xc5, 0x5f, 0x53, 0xa5, 0x2a, 0x2d, 0xe, 0x16, 0x11, 0x75, 0xc8, 0x50, 0x9d, 0x2c, 0x8a, 0x8a, 0x38, 0x6a, 0x15, 0x8a, 0x50, 0x21, 0xd4, 0xa, 0xad, 0x3a, 0x98, 0x5c, 0xfa, 0x21, 0x34, 0x69, 0x48, 0x52, 0x5c, 0x1c, 0x5, 0xd7, 0x82, 0x83, 0x1f, 0x8b, 0x55, 0x7, 0x17, 0x67, 0x5d, 0x1d, 0x5c, 0x5, 0x41, 0xf0, 0x3, 0xc4, 0xc5, 0xd5, 0x49, 0xd1, 0x45, 0x4a, 0xfc, 0x5f, 0x5a, 0x68, 0x11, 0xe3, 0xc1, 0x71, 0x3f, 0xde, 0xdd, 0x7b, 0xdc, 0xbd, 0x3, 0x84, 0x6a, 0x91, 0x69, 0x56, 0xdb, 0x18, 0xa0, 0xe9, 0xb6, 0x99, 0x8c, 0xc7, 0xc4, 0x74, 0x66, 0x45, 0xc, 0xbc, 0xa2, 0x13, 0x3, 0x8, 0xa1, 0x17, 0xa3, 0x32, 0xb3, 0x8c, 0x59, 0x49, 0x4a, 0xc0, 0x73, 0x7c, 0xdd, 0xc3, 0xc7, 0xd7, 0xbb, 0x28, 0xcf, 0xf2, 0x3e, 0xf7, 0xe7, 0x8, 0xa9, 0x59, 0x8b, 0x1, 0x3e, 0x91, 0x78, 0x86, 0x19, 0xa6, 0x4d, 0xbc, 0x4e, 0x3c, 0xb5, 0x69, 0x1b, 0x9c, 0xf7, 0x89, 0xc3, 0xac, 0x20, 0xab, 0xc4, 0xe7, 0xc4, 0x23, 0x26, 0x5d, 0x90, 0xf8, 0x91, 0xeb, 0x4a, 0x9d, 0xdf, 0x38, 0xe7, 0x5d, 0x16, 0x78, 0x66, 0xd8, 0x4c, 0x25, 0xe7, 0x88, 0xc3, 0xc4, 0x62, 0xbe, 0x85, 0x95, 0x16, 0x66, 0x5, 0x53, 0x23, 0x9e, 0x24, 0x8e, 0xa8, 0x9a, 0x4e, 0xf9, 0x42, 0xba, 0xce, 0x2a, 0xe7, 0x2d, 0xce, 0x5a, 0xb1, 0xcc, 0x1a, 0xf7, 0xe4, 0x2f, 0xc, 0x66, 0xf5, 0xe5, 0x25, 0xae, 0xd3, 0x1c, 0x44, 0x1c, 0xb, 0x58, 0x84, 0x4, 0x11, 0xa, 0xca, 0xd8, 0x40, 0x11, 0x36, 0xa2, 0xb4, 0xea, 0xa4, 0x58, 0x48, 0xd2, 0x7e, 0xcc, 0xc3, 0xdf, 0xef, 0xfa, 0x25, 0x72, 0x29, 0xe4, 0xda, 0x0, 0x23, 0xc7, 0x3c, 0x4a, 0xd0, 0x20, 0xbb, 0x7e, 0xf0, 0x3f, 0xf8, 0xdd, 0xad, 0x95, 0x9b, 0x18, 0xaf, 0x27, 0x5, 0x63, 0x40, 0xfb, 0x8b, 0xe3, 0x7c, 0xc, 0x1, 0x81, 0x5d, 0xa0, 0x56, 0x71, 0x9c, 0xef, 0x63, 0xc7, 0xa9, 0x9d, 0x0, 0xfe, 0x67, 0xe0, 0x4a, 0x6f, 0xfa, 0x4b, 0x55, 0x60, 0xfa, 0x93, 0xf4, 0x4a, 0x53, 0x8b, 0x1c, 0x1, 0xdd, 0xdb, 0xc0, 0xc5, 0x75, 0x53, 0x53, 0xf6, 0x80, 0xcb, 0x1d, 0xa0, 0xef, 0xc9, 0x90, 0x4d, 0xd9, 0x95, 0xfc, 0x34, 0x85, 0x5c, 0xe, 0x78, 0x3f, 0xa3, 0x6f, 0xca, 0x0, 0x3d, 0xb7, 0x40, 0xd7, 0x6a, 0xbd, 0xb7, 0xc6, 0x3e, 0x4e, 0x1f, 0x80, 0x14, 0x75, 0x95, 0xb8, 0x1, 0xe, 0xe, 0x81, 0xe1, 0x3c, 0x65, 0xaf, 0x79, 0xbc, 0xbb, 0xa3, 0xb5, 0xb7, 0x7f, 0xcf, 0x34, 0xfa, 0xfb, 0x1, 0x8e, 0x80, 0x72, 0xb2, 0xed, 0x78, 0xfa, 0x7b, 0x0, 0x0, 0x0, 0x9, 0x70, 0x48, 0x59, 0x73, 0x0, 0x0, 0xe, 0xc4, 0x0, 0x0, 0xe, 0xc4, 0x1, 0x95, 0x2b, 0xe, 0x1b, 0x0, 0x0, 0x0, 0x15, 0x50, 0x4c, 0x54, 0x45, 0xff, 0xff, 0xff, 0x63, 0x63, 0x66, 0x0, 0x0, 0x3, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x0, 0x0, 0x4, 0x0, 0x0, 0x0, 0x4c, 0x39, 0x3a, 0xe, 0x0, 0x0, 0x0, 0x6, 0x74, 0x52, 0x4e, 0x53, 0xff, 0xff, 0xff, 0x7f, 0x0, 0x80, 0x2c, 0x16, 0xc1, 0x6d, 0x0, 0x0, 0x0, 0x1, 0x62, 0x4b, 0x47, 0x44, 0x6, 0x61, 0x66, 0xb8, 0x7d, 0x0, 0x0, 0x0, 0x32, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x62, 0x0, 0x1, 0x46, 0x65, 0x17, 0x17, 0x30, 0x43, 0xc8, 0x4, 0x50, 0x88, 0x1c, 0x52, 0x1, 0x0, 0x2, 0x40, 0x14, 0xbb, 0x70, 0x8b, 0x40, 0xff, 0x2c, 0x18, 0xbe, 0xc6, 0xed, 0x8d, 0x42, 0xa1, 0x50, 0x28, 0x14, 0xa, 0x85, 0xbd, 0xb0, 0x13, 0xfc, 0x71, 0x1, 0xca, 0xf, 0x19, 0x62, 0x24, 0xd6, 0x8, 0xaa, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -314,6 +338,10 @@ static const unsigned char submenu_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x8, 0x0, 0x0, 0x0, 0x8, 0x8, 0x4, 0x0, 0x0, 0x0, 0x6e, 0x6, 0x76, 0x0, 0x0, 0x0, 0x0, 0x2e, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0x78, 0xc0, 0xf0, 0xe0, 0x3f, 0x8, 0xde, 0x4f, 0x60, 0x0, 0x3, 0xb8, 0xc0, 0x83, 0x2f, 0xf, 0xb5, 0xe1, 0x2, 0x50, 0x78, 0xf5, 0x5, 0x37, 0xaa, 0xc0, 0xff, 0x87, 0xf3, 0x31, 0x4, 0x30, 0xb5, 0x60, 0x1a, 0x8a, 0x61, 0x2d, 0x0, 0xa6, 0x55, 0x4f, 0xb1, 0x91, 0xd6, 0xa7, 0xae, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char submenu_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x8, 0x0, 0x0, 0x0, 0x8, 0x8, 0x4, 0x0, 0x0, 0x0, 0x6e, 0x6, 0x76, 0x0, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x0, 0x57, 0x49, 0x44, 0x41, 0x54, 0x8, 0xd7, 0x55, 0xcb, 0xa1, 0x11, 0x83, 0x40, 0x14, 0x45, 0xd1, 0xb3, 0x6b, 0x10, 0x34, 0x10, 0x47, 0x34, 0xf4, 0x13, 0x9d, 0x2, 0x28, 0x87, 0x2a, 0xe8, 0x84, 0x2, 0x82, 0x65, 0x71, 0x69, 0x0, 0x11, 0xf5, 0x11, 0x4c, 0x66, 0xd8, 0xe7, 0xee, 0x99, 0x79, 0x80, 0xed, 0x5d, 0xa2, 0x44, 0x9, 0x12, 0xec, 0x43, 0x2c, 0x5a, 0x78, 0xa6, 0xcc, 0xb7, 0x8d, 0xf9, 0x4a, 0xc8, 0xfc, 0x26, 0x3d, 0x37, 0xa8, 0x97, 0x69, 0x46, 0x6b, 0x5, 0x8f, 0x23, 0xbd, 0x1c, 0xd5, 0xa5, 0xfb, 0xc4, 0xf8, 0x87, 0x13, 0xd2, 0x2f, 0x14, 0x49, 0x6f, 0xb1, 0x11, 0xe1, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char tab_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x8, 0x0, 0x0, 0x0, 0x8, 0x8, 0x4, 0x0, 0x0, 0x0, 0x6e, 0x6, 0x76, 0x0, 0x0, 0x0, 0x0, 0x19, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xc0, 0x2, 0xfe, 0x47, 0xfe, 0x17, 0x1, 0xc2, 0x48, 0xd2, 0x84, 0x10, 0x2, 0x84, 0xb9, 0x98, 0x0, 0x0, 0xbf, 0x67, 0x1d, 0x5, 0x89, 0x9b, 0x48, 0x90, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -354,6 +382,14 @@ static const unsigned char toggle_off_disabled_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x0, 0xfc, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x14, 0x14, 0x17, 0x20, 0x20, 0x25, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x24, 0x24, 0x29, 0x25, 0x25, 0x2a, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x10, 0x10, 0x13, 0x22, 0x22, 0x27, 0x24, 0x24, 0x28, 0x25, 0x25, 0x28, 0x25, 0x25, 0x29, 0x25, 0x25, 0x27, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x19, 0x19, 0x1c, 0x2b, 0x26, 0x2c, 0x40, 0x40, 0x44, 0x4e, 0x4e, 0x52, 0x1a, 0x1a, 0x1d, 0x32, 0x32, 0x37, 0x2c, 0x26, 0x2c, 0x26, 0x25, 0x2a, 0x27, 0x25, 0x2a, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x11, 0x11, 0x14, 0x2f, 0x26, 0x2d, 0x12, 0x12, 0x14, 0x23, 0x23, 0x27, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x15, 0x15, 0x18, 0x20, 0x20, 0x25, 0x20, 0x20, 0x24, 0x5b, 0x5b, 0x5f, 0x84, 0x84, 0x87, 0x77, 0x77, 0x7a, 0x20, 0x20, 0x24, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x69, 0x69, 0x6c, 0x24, 0x24, 0x28, 0x0, 0x0, 0x0, 0x24, 0x24, 0x28, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x24, 0x24, 0x27, 0x15, 0x15, 0x18, 0x23, 0x23, 0x28, 0x12, 0x12, 0x14, 0x0, 0x0, 0x0, 0x1a, 0x1a, 0x1e, 0x0, 0x0, 0x0, 0x11, 0x11, 0x13, 0x22, 0x22, 0x26, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x71, 0xb, 0x1b, 0xbb, 0x0, 0x0, 0x0, 0x54, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x1, 0x2, 0x3, 0x4, 0x9, 0xe, 0x13, 0x16, 0x18, 0x19, 0xa, 0x26, 0x36, 0x44, 0x4d, 0x52, 0x54, 0x55, 0x6, 0x12, 0x27, 0x43, 0x98, 0xe5, 0xfa, 0xfe, 0xff, 0xff, 0x8, 0x17, 0x35, 0x86, 0xf3, 0xff, 0xff, 0xff, 0xff, 0x7, 0x3a, 0xb4, 0xff, 0xff, 0xff, 0xb9, 0xff, 0xff, 0xff, 0xff, 0xb, 0x28, 0x8a, 0xff, 0x8b, 0xf6, 0x45, 0x5, 0x9b, 0xe6, 0xff, 0xff, 0xff, 0xff, 0xe6, 0x37, 0xf, 0xff, 0xfb, 0x4c, 0xfe, 0x4e, 0x4f, 0x50, 0xfb, 0x9c, 0xf6, 0x8c, 0x3b, 0xbb, 0x3c, 0x87, 0xf3, 0x53, 0x14, 0xd4, 0x6d, 0x6c, 0xf9, 0x0, 0x0, 0x2, 0x3, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0xdd, 0x55, 0x85, 0x9a, 0xe2, 0x30, 0x18, 0xbc, 0x7a, 0x8b, 0xbb, 0x7b, 0x2, 0xbb, 0x4d, 0x36, 0xb8, 0x3b, 0xeb, 0xae, 0xef, 0xff, 0x2e, 0x47, 0x48, 0x3f, 0xa0, 0x7a, 0xae, 0x83, 0x56, 0xfe, 0xe9, 0xfc, 0xfe, 0xe9, 0x6f, 0x2, 0xc7, 0xb, 0x82, 0xf8, 0x45, 0x8, 0x2, 0xcf, 0x39, 0x9a, 0xf3, 0xa2, 0x24, 0x2b, 0xaa, 0xe6, 0xfb, 0x2, 0x34, 0x55, 0x91, 0x25, 0x91, 0xb7, 0x3f, 0x5d, 0xf4, 0xab, 0x81, 0x60, 0x28, 0x1c, 0x89, 0xc6, 0x3c, 0x11, 0x8d, 0x84, 0x43, 0xc1, 0x80, 0xea, 0x17, 0x2d, 0x2a, 0xf8, 0x78, 0x22, 0x99, 0x4a, 0x67, 0xb2, 0xb9, 0x7c, 0xe1, 0xb, 0xc8, 0xe7, 0xb2, 0x99, 0x74, 0x2a, 0x99, 0x88, 0xf3, 0x26, 0xfb, 0x62, 0xa9, 0x5c, 0xa9, 0xd6, 0x0, 0x80, 0x10, 0xb2, 0xfb, 0x20, 0x5, 0x80, 0x75, 0xe8, 0x48, 0x52, 0xad, 0x94, 0x4b, 0xc5, 0x23, 0x6, 0xae, 0xa1, 0x9d, 0x9c, 0xd6, 0x80, 0x8e, 0xf0, 0x1e, 0x48, 0xdf, 0xb1, 0xd4, 0x81, 0x8b, 0x8e, 0xd3, 0x13, 0xad, 0xc1, 0x1d, 0xfc, 0x57, 0x82, 0x67, 0x35, 0x48, 0x30, 0x6a, 0xb6, 0x76, 0x97, 0x5b, 0x3a, 0x41, 0x98, 0xb4, 0x77, 0x4a, 0xdc, 0x3c, 0x39, 0xb, 0x2a, 0xfb, 0x38, 0xf0, 0x9d, 0x6e, 0xaf, 0x6, 0x11, 0xea, 0x1f, 0xdf, 0x41, 0x10, 0x6a, 0x7b, 0xc6, 0x62, 0xd0, 0xed, 0xf0, 0x6, 0x81, 0x58, 0xa, 0xd, 0x1, 0xa1, 0xa2, 0x8f, 0xa1, 0x23, 0xd2, 0xf2, 0x62, 0x18, 0x8e, 0x4a, 0x63, 0x26, 0x81, 0x93, 0x2, 0x13, 0xa0, 0xe3, 0xbe, 0xf5, 0xe, 0x82, 0x3d, 0x25, 0x14, 0x26, 0x1, 0x89, 0x11, 0xf0, 0x72, 0x70, 0xba, 0x15, 0x60, 0xbf, 0x3, 0x11, 0xe3, 0xcf, 0x6c, 0xbe, 0x58, 0xa2, 0x42, 0x7f, 0xb1, 0xc5, 0xee, 0x8b, 0x9d, 0x5f, 0xad, 0x37, 0xcc, 0x7, 0x41, 0x9, 0x65, 0x21, 0xbd, 0xd9, 0x8a, 0x3d, 0xe9, 0xf9, 0x7c, 0x46, 0x16, 0xb3, 0x3e, 0x35, 0xa4, 0x5f, 0x6, 0x2e, 0x46, 0x8a, 0xc0, 0x8, 0xd4, 0xcb, 0x2b, 0x88, 0x75, 0x3b, 0x81, 0x8e, 0xd, 0x1, 0xd4, 0x68, 0x8e, 0xfa, 0xe7, 0x94, 0xe0, 0x7c, 0x4f, 0x90, 0xbf, 0x56, 0x45, 0x46, 0x50, 0xba, 0xa9, 0x41, 0xec, 0x10, 0xb0, 0x96, 0x41, 0xd0, 0x3f, 0xdf, 0x7e, 0xe1, 0x79, 0xff, 0xfc, 0xfc, 0x9c, 0x6c, 0xbf, 0xf6, 0x14, 0xb7, 0x25, 0x83, 0x40, 0xd, 0xd7, 0x3c, 0x15, 0x90, 0x9d, 0x2, 0xec, 0xae, 0x40, 0x9, 0xdd, 0x1, 0xef, 0x18, 0xa0, 0x2, 0x59, 0xda, 0x5c, 0xd8, 0xc7, 0x80, 0x97, 0xd7, 0x5f, 0xc8, 0x42, 0x7f, 0x79, 0xbe, 0x9c, 0x17, 0x2c, 0x4, 0xfb, 0x2c, 0xd0, 0x3a, 0xb8, 0xff, 0x42, 0x1d, 0x10, 0x5a, 0x95, 0x33, 0x44, 0xd8, 0x97, 0x81, 0xfb, 0xa4, 0xc4, 0xed, 0x2b, 0xf1, 0x1, 0xfe, 0x40, 0x25, 0xd2, 0x5e, 0x18, 0x7c, 0x7b, 0x2f, 0x3c, 0xd2, 0x5e, 0xf8, 0x72, 0x37, 0x16, 0xbe, 0xdc, 0x8d, 0x6c, 0x1e, 0x3c, 0x3d, 0xd7, 0x40, 0xdb, 0x32, 0xf, 0xbc, 0xec, 0x9f, 0x5f, 0xf6, 0xf3, 0x80, 0x4d, 0x24, 0x2d, 0xf8, 0xfa, 0x6, 0xea, 0x80, 0xd, 0x24, 0x68, 0x0, 0x6c, 0x5f, 0x8e, 0xf6, 0xd5, 0xd7, 0xa0, 0x56, 0x34, 0xcf, 0xb4, 0x86, 0x92, 0xc, 0xa5, 0x33, 0x17, 0xf9, 0xc2, 0x17, 0x91, 0xbf, 0xc8, 0xa4, 0x43, 0x49, 0xa5, 0xc1, 0x5b, 0xa7, 0x72, 0x47, 0xd, 0xac, 0x47, 0xd7, 0xef, 0xb1, 0x2f, 0xe0, 0xfd, 0x7a, 0xb4, 0xe, 0xa8, 0x1d, 0x91, 0xb3, 0x6f, 0x95, 0xb1, 0xb4, 0xf9, 0x28, 0x7d, 0x79, 0x2f, 0x94, 0x3e, 0x36, 0xd2, 0x98, 0xe7, 0x5c, 0x36, 0x93, 0xf8, 0x15, 0xa0, 0x9b, 0xe9, 0xff, 0xc2, 0x67, 0x14, 0xf4, 0xa5, 0xb3, 0x35, 0x5e, 0x63, 0x97, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char toggle_off_disabled_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x0, 0x9c, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0xd, 0xd, 0xf, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x24, 0x24, 0x29, 0x25, 0x25, 0x2a, 0x1d, 0x1d, 0x21, 0x11, 0x11, 0x14, 0x23, 0x23, 0x28, 0x2e, 0x2e, 0x2e, 0x46, 0x46, 0x46, 0x57, 0x57, 0x57, 0x60, 0x60, 0x60, 0x62, 0x62, 0x62, 0x5e, 0x5e, 0x5e, 0x4a, 0x4a, 0x4a, 0x12, 0x12, 0x15, 0x25, 0x27, 0x2d, 0x42, 0x42, 0x42, 0x59, 0x59, 0x59, 0x32, 0x32, 0x32, 0x25, 0x26, 0x2d, 0x25, 0x25, 0x2b, 0x25, 0x26, 0x2c, 0x39, 0x39, 0x39, 0x49, 0x49, 0x49, 0x5a, 0x5a, 0x5a, 0x48, 0x48, 0x48, 0x54, 0x54, 0x54, 0x34, 0x34, 0x34, 0x35, 0x35, 0x35, 0x1e, 0x1e, 0x22, 0x25, 0x26, 0x2b, 0x3f, 0x3f, 0x3f, 0xe, 0xe, 0x10, 0x2c, 0x2c, 0x2c, 0x58, 0x58, 0x58, 0x5d, 0x5d, 0x5f, 0x80, 0x80, 0x80, 0x79, 0x79, 0x79, 0x40, 0x40, 0x44, 0x32, 0x32, 0x37, 0x41, 0x41, 0x41, 0x1a, 0x1a, 0x1d, 0x6a, 0x6a, 0x6d, 0x52, 0x52, 0x52, 0x3a, 0x3a, 0x3a, 0x5b, 0x5b, 0x5b, 0x2f, 0x2f, 0x2f, 0x50, 0x50, 0x51, 0x13, 0x13, 0x15, 0x2b, 0xcd, 0x4, 0x96, 0x0, 0x0, 0x0, 0x1, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x40, 0xe6, 0xd8, 0x66, 0x0, 0x0, 0x1, 0x29, 0x49, 0x44, 0x41, 0x54, 0x48, 0xc7, 0xed, 0x94, 0xdb, 0x76, 0x83, 0x20, 0x10, 0x45, 0x8d, 0xe8, 0x24, 0x98, 0xda, 0x1a, 0x93, 0xda, 0x5b, 0xac, 0xb9, 0x50, 0x14, 0x52, 0x72, 0xfd, 0xff, 0x7f, 0xab, 0x68, 0x49, 0x28, 0x5a, 0x35, 0xf5, 0xa5, 0xf, 0x39, 0xf, 0xb3, 0x96, 0xe3, 0xda, 0x7, 0x98, 0x81, 0xb1, 0xac, 0x9b, 0xfe, 0x97, 0x6, 0x36, 0x72, 0x5c, 0x68, 0x91, 0xeb, 0x20, 0x7b, 0x50, 0xcf, 0xf, 0x5b, 0xe1, 0xb3, 0xc9, 0xb0, 0x6, 0x1f, 0xe1, 0x46, 0xc6, 0x1b, 0xdf, 0xf9, 0xf7, 0xa5, 0x1e, 0x2, 0xf, 0xf0, 0xc8, 0xe4, 0x27, 0x8d, 0xcb, 0x87, 0xd3, 0xd9, 0xf8, 0x31, 0x7a, 0x92, 0x7a, 0xf6, 0x5e, 0x5e, 0xdf, 0xa6, 0xa1, 0x3b, 0x31, 0xc, 0x1a, 0xd7, 0xf, 0xe7, 0xf1, 0xbb, 0xfe, 0x9d, 0xc4, 0xf3, 0x10, 0xff, 0xe4, 0x17, 0x4d, 0xfc, 0x72, 0x15, 0x7b, 0xc6, 0x81, 0xe2, 0xd5, 0x72, 0xa1, 0xf3, 0xeb, 0xc6, 0xf3, 0x93, 0x8f, 0xc4, 0x4c, 0x25, 0x33, 0x2, 0x6b, 0xcd, 0xc0, 0x56, 0x3f, 0x10, 0x4d, 0x33, 0x6, 0x24, 0xcd, 0x55, 0x4, 0x2e, 0x93, 0x9b, 0xa0, 0x6a, 0x1a, 0x6c, 0xe0, 0x53, 0x33, 0x40, 0x2a, 0x2f, 0x28, 0xe2, 0x29, 0x22, 0x12, 0x24, 0x25, 0x9d, 0x6b, 0xbb, 0xab, 0x1a, 0xec, 0xb6, 0x80, 0x34, 0x3, 0x47, 0x6d, 0x40, 0x42, 0x94, 0x11, 0x21, 0xd, 0x84, 0x32, 0xd8, 0x1f, 0xaa, 0x6, 0x87, 0x3d, 0xe8, 0x65, 0x54, 0x3d, 0x24, 0x22, 0xf, 0x47, 0x4a, 0x84, 0x10, 0xbc, 0x8, 0x45, 0xd6, 0x8f, 0xaa, 0x6, 0x91, 0xf, 0x50, 0xd3, 0x44, 0x5e, 0xec, 0xe0, 0x78, 0xfd, 0xe, 0x2e, 0x35, 0x60, 0xc0, 0x33, 0xf3, 0x8, 0x1d, 0x6a, 0x70, 0xee, 0x2, 0xc9, 0x44, 0x46, 0xc1, 0x30, 0xe8, 0xd0, 0x85, 0xcb, 0x3d, 0xe0, 0x4c, 0xd6, 0x92, 0xf1, 0xef, 0xd0, 0xf5, 0x1e, 0xf4, 0xbe, 0x89, 0xfd, 0xdf, 0x42, 0xff, 0xd7, 0x68, 0x9d, 0xae, 0x9b, 0x7, 0xa7, 0xba, 0x89, 0x4, 0x9d, 0x55, 0x37, 0x91, 0xca, 0x99, 0x88, 0xdb, 0x61, 0xfc, 0xeb, 0x4c, 0xbc, 0xe9, 0xaf, 0xfa, 0x2, 0xdc, 0x1a, 0x30, 0x60, 0x4e, 0xef, 0xb8, 0xbb, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + +static const unsigned char toggle_off_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x1, 0xaa, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xd, 0xd, 0xf, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x24, 0x24, 0x29, 0x24, 0x24, 0x28, 0x20, 0x20, 0x25, 0x14, 0x14, 0x17, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xa, 0xa, 0xc, 0x1d, 0x1d, 0x21, 0x22, 0x22, 0x27, 0x10, 0x10, 0x13, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x11, 0x11, 0x14, 0x23, 0x23, 0x28, 0x19, 0x19, 0x1c, 0x12, 0x12, 0x15, 0x1a, 0x1a, 0x1d, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xb, 0xb, 0xd, 0x23, 0x23, 0x28, 0x11, 0x11, 0x14, 0x1e, 0x1e, 0x22, 0x23, 0x23, 0x27, 0xe, 0xe, 0x10, 0x15, 0x15, 0x18, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x25, 0x0, 0x0, 0x0, 0x24, 0x24, 0x28, 0x0, 0x0, 0x0, 0x20, 0x20, 0x24, 0x24, 0x24, 0x27, 0x0, 0x0, 0x0, 0xe, 0xe, 0x10, 0x15, 0x15, 0x18, 0x23, 0x23, 0x28, 0xb, 0xb, 0xd, 0x12, 0x12, 0x14, 0x0, 0x0, 0x0, 0x13, 0x13, 0x15, 0x1a, 0x1a, 0x1e, 0xb, 0xb, 0xc, 0x1d, 0x1d, 0x21, 0x22, 0x22, 0x26, 0x11, 0x11, 0x13, 0x24, 0x24, 0x28, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x25, 0x25, 0x2a, 0x24, 0x24, 0x29, 0x25, 0x25, 0x28, 0x25, 0x25, 0x29, 0x24, 0x24, 0x28, 0x2d, 0x26, 0x2c, 0x51, 0x2c, 0x39, 0x6c, 0x31, 0x42, 0x71, 0x32, 0x44, 0x6e, 0x31, 0x43, 0x63, 0x2f, 0x3f, 0x4d, 0x2b, 0x37, 0x27, 0x25, 0x2a, 0x47, 0x2a, 0x35, 0x68, 0x30, 0x40, 0x52, 0x2c, 0x39, 0x3c, 0x28, 0x31, 0x2e, 0x25, 0x2c, 0x26, 0x25, 0x2a, 0x32, 0x26, 0x2e, 0x4d, 0x2b, 0x38, 0x66, 0x30, 0x40, 0x50, 0x2c, 0x38, 0x5e, 0x2e, 0x3d, 0x38, 0x27, 0x30, 0x35, 0x27, 0x2f, 0x5f, 0x2e, 0x3d, 0x44, 0x2a, 0x34, 0x5f, 0x2f, 0x3e, 0x2f, 0x25, 0x2c, 0x43, 0x2a, 0x34, 0x2c, 0x26, 0x2c, 0x66, 0x2f, 0x40, 0x37, 0x27, 0x30, 0x36, 0x27, 0x30, 0x64, 0x2f, 0x3f, 0x2b, 0x26, 0x2c, 0x40, 0x40, 0x44, 0xad, 0xad, 0xaf, 0xff, 0xff, 0xff, 0xf2, 0xf2, 0xf2, 0x77, 0x77, 0x7a, 0x5b, 0x5b, 0x5f, 0x32, 0x32, 0x37, 0x46, 0x2a, 0x35, 0x53, 0x2c, 0x39, 0xc9, 0xc9, 0xca, 0xbb, 0xbb, 0xbd, 0x69, 0x69, 0x6c, 0x5d, 0x2e, 0x3d, 0x3e, 0x29, 0x32, 0x84, 0x84, 0x87, 0xd6, 0xd6, 0xd7, 0x69, 0x30, 0x41, 0x2f, 0x26, 0x2d, 0x92, 0x92, 0x94, 0xa0, 0xa0, 0xa2, 0x4e, 0x4e, 0x52, 0x48, 0x2b, 0x36, 0x2c, 0x26, 0x2b, 0x25, 0x25, 0x27, 0xea, 0xac, 0x78, 0x5d, 0x0, 0x0, 0x0, 0x51, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x1, 0x2, 0x3, 0x4, 0x9, 0xe, 0x13, 0x16, 0x18, 0x19, 0xa, 0x26, 0x36, 0x44, 0x4d, 0x52, 0x54, 0x55, 0x6, 0x12, 0x27, 0x43, 0x80, 0xc5, 0xe7, 0xf5, 0xfe, 0xfa, 0xe5, 0x98, 0x8, 0x17, 0x35, 0x73, 0xd9, 0xf3, 0x86, 0x7, 0x3a, 0x96, 0xf9, 0xb4, 0x9a, 0xb9, 0xb, 0x28, 0x76, 0xfb, 0x8a, 0xde, 0xf6, 0x82, 0x9b, 0xc6, 0xe6, 0x4c, 0xfe, 0x4f, 0xe9, 0xfb, 0x37, 0x83, 0x9c, 0xf6, 0x77, 0x8b, 0x3b, 0x9c, 0xbb, 0x74, 0xda, 0xf3, 0x87, 0xfb, 0x45, 0x4e, 0x53, 0x5, 0xf, 0x14, 0xc7, 0x22, 0x44, 0x61, 0x0, 0x0, 0x2, 0x45, 0x49, 0x44, 0x41, 0x54, 0x48, 0xc7, 0xd5, 0x55, 0xe7, 0x5f, 0xd3, 0x40, 0x18, 0x26, 0x3b, 0x91, 0x24, 0x65, 0x95, 0xd, 0xd, 0x8e, 0x22, 0x6a, 0x71, 0x2b, 0x82, 0x75, 0xe1, 0x66, 0xa6, 0x97, 0xa0, 0x56, 0x45, 0xa4, 0x2a, 0x2e, 0xdc, 0x76, 0x25, 0x18, 0x84, 0x6, 0x9c, 0xff, 0xb3, 0xb9, 0x26, 0x17, 0xda, 0xa4, 0x49, 0xd4, 0x4f, 0xfa, 0x7c, 0xb8, 0xdf, 0xe5, 0xcd, 0xef, 0x79, 0xee, 0xbd, 0xf7, 0xde, 0xd1, 0xd4, 0xf4, 0xf, 0x1, 0xc3, 0x9, 0x82, 0x8c, 0x4, 0x41, 0xe0, 0x58, 0x43, 0x3a, 0x4e, 0x52, 0x34, 0xc3, 0x72, 0xbb, 0x22, 0xc0, 0xb1, 0xc, 0x4d, 0x91, 0xb8, 0xff, 0x74, 0xb2, 0x99, 0xe5, 0x5, 0x31, 0xd6, 0xd2, 0xda, 0x16, 0x8a, 0xd6, 0x96, 0x98, 0x28, 0xf0, 0x6c, 0x33, 0xe9, 0xf1, 0x2, 0x6f, 0xef, 0x88, 0x77, 0x76, 0x75, 0xf7, 0xf4, 0xf6, 0xc9, 0x11, 0xc8, 0xf4, 0xf5, 0xf, 0xc, 0x76, 0xc6, 0x3b, 0xda, 0xeb, 0x9c, 0xc0, 0x13, 0xd2, 0xd0, 0xee, 0x3d, 0x99, 0x0, 0xe, 0x50, 0x20, 0xec, 0xbd, 0xb5, 0x1, 0x40, 0xdd, 0xbb, 0x6f, 0x48, 0x4a, 0xd4, 0x28, 0x60, 0x49, 0x6e, 0x78, 0xff, 0x48, 0xe0, 0xa1, 0x90, 0xbb, 0x70, 0xeb, 0xf6, 0x1d, 0x1b, 0xd9, 0xbb, 0xf7, 0x16, 0x80, 0x7a, 0x60, 0x98, 0x4b, 0x62, 0x3b, 0xf7, 0x67, 0x84, 0x83, 0xa1, 0xbe, 0xdf, 0x5f, 0x7c, 0xb0, 0xf4, 0x70, 0x39, 0x57, 0xdd, 0xe7, 0x1e, 0x3d, 0x7e, 0xb2, 0xa8, 0xa8, 0x87, 0x4, 0xc6, 0x8d, 0x3, 0x9e, 0x1a, 0x3d, 0x7c, 0x24, 0x94, 0xbf, 0xf2, 0xf4, 0x59, 0xed, 0xf7, 0xf3, 0x17, 0x2b, 0x8a, 0x7a, 0x74, 0x34, 0x85, 0x2e, 0x41, 0x4a, 0xe2, 0xb1, 0x30, 0x7e, 0xee, 0xe5, 0xea, 0xab, 0x7a, 0xcb, 0xf2, 0xea, 0x6b, 0x70, 0x5c, 0x94, 0x48, 0xe7, 0x6, 0x14, 0x7f, 0x22, 0x34, 0xf0, 0x6f, 0xde, 0xbe, 0xf3, 0x9a, 0xde, 0x7f, 0xf8, 0x8, 0x4e, 0xf2, 0x94, 0x73, 0x3, 0x5a, 0x38, 0x85, 0x7e, 0xe4, 0xb, 0xc5, 0x52, 0x59, 0xd6, 0x8a, 0x16, 0xaa, 0x8b, 0xe, 0x8d, 0x6b, 0x9f, 0xfc, 0xa2, 0x4b, 0x6b, 0xe0, 0xb4, 0x40, 0xdb, 0x2, 0x4, 0x23, 0xf6, 0x20, 0xbb, 0xb1, 0x9e, 0xff, 0x5c, 0xcc, 0x6b, 0x90, 0xa8, 0xd9, 0x6c, 0xb, 0x1b, 0x9b, 0x7e, 0x81, 0xcd, 0xd, 0xa5, 0x5f, 0x64, 0x1c, 0x1, 0x76, 0xac, 0x17, 0x39, 0x0, 0x49, 0xeb, 0x15, 0xcd, 0x84, 0x2, 0x26, 0x12, 0xd8, 0xda, 0xf6, 0xb, 0x6c, 0x6f, 0x29, 0x67, 0xc6, 0x58, 0x47, 0x40, 0x1a, 0x47, 0x6f, 0xa8, 0x99, 0xd6, 0xf2, 0xa5, 0xa0, 0x19, 0x86, 0xa1, 0x57, 0x97, 0xaa, 0x35, 0x9b, 0x6b, 0x10, 0xd8, 0xac, 0xa2, 0x8e, 0x4b, 0xc8, 0x83, 0x18, 0x4a, 0x22, 0x1d, 0x7a, 0x50, 0xf8, 0xaa, 0x41, 0xa6, 0x66, 0x44, 0x78, 0xa0, 0xc6, 0x58, 0x37, 0x6, 0x13, 0xc8, 0x6e, 0x56, 0x64, 0xbd, 0x54, 0xf6, 0x8, 0x34, 0x8e, 0x1, 0x38, 0x8b, 0x62, 0x80, 0xd3, 0x69, 0xf7, 0x15, 0xb4, 0x92, 0x59, 0x2a, 0xc8, 0x1e, 0x81, 0xa0, 0x57, 0x48, 0xd3, 0x6e, 0x1e, 0x9c, 0x73, 0x7f, 0xe8, 0x95, 0x6f, 0x56, 0x2c, 0xcb, 0xba, 0xb3, 0x84, 0xe5, 0xc1, 0x79, 0x94, 0x7, 0x7f, 0x97, 0x89, 0xca, 0x5, 0x37, 0x13, 0x61, 0x2d, 0x5c, 0xfc, 0xf3, 0x5a, 0xb8, 0xb4, 0x53, 0xb, 0xbf, 0x51, 0x8d, 0xdf, 0x43, 0xab, 0x11, 0xf6, 0x83, 0xc9, 0xcb, 0xa1, 0x3e, 0xd4, 0xf7, 0x83, 0x1f, 0x40, 0xbd, 0x32, 0x59, 0xd3, 0xf, 0x60, 0x47, 0xe2, 0x84, 0xab, 0xd7, 0x82, 0xc8, 0x76, 0x47, 0x72, 0x9a, 0x92, 0xd5, 0x91, 0x7e, 0x82, 0xeb, 0x37, 0x4, 0x2e, 0x51, 0xdf, 0xd3, 0x92, 0x4c, 0x5c, 0xec, 0xea, 0x9e, 0x18, 0x91, 0x23, 0x91, 0xb9, 0x39, 0x30, 0x28, 0xc6, 0x99, 0xa4, 0xa7, 0x31, 0x63, 0x64, 0x8a, 0xe5, 0xd3, 0x53, 0xd3, 0x33, 0x6d, 0x11, 0x98, 0x99, 0x9e, 0x4a, 0xf3, 0x6c, 0x8a, 0xf4, 0xcd, 0x6, 0xc, 0x9f, 0xa5, 0xe6, 0xe6, 0xa5, 0xe8, 0xb9, 0x20, 0xcd, 0xcf, 0x51, 0xb3, 0x8d, 0x67, 0x8b, 0x35, 0x99, 0xa2, 0x7, 0x93, 0x35, 0x9a, 0x2, 0x26, 0xd3, 0xff, 0x8b, 0x5f, 0x3d, 0xdc, 0x7c, 0xb4, 0x8c, 0xb2, 0xd8, 0x5f, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char toggle_on_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x1, 0x74, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xd, 0xd, 0xf, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x24, 0x24, 0x29, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xa, 0xa, 0xc, 0x1d, 0x1d, 0x21, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x11, 0x11, 0x14, 0x23, 0x23, 0x28, 0x12, 0x12, 0x15, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xb, 0xb, 0xd, 0x23, 0x23, 0x28, 0xb, 0xb, 0xd, 0x1e, 0x1e, 0x22, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xe, 0xe, 0x10, 0x1a, 0x1a, 0x1e, 0x1a, 0x1a, 0x1d, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x20, 0x20, 0x24, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xe, 0xe, 0x10, 0xb, 0xb, 0xd, 0x0, 0x0, 0x0, 0x13, 0x13, 0x15, 0x0, 0x0, 0x0, 0xb, 0xb, 0xc, 0x1d, 0x1d, 0x21, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x25, 0x25, 0x2a, 0x24, 0x24, 0x29, 0x25, 0x2c, 0x36, 0x27, 0x49, 0x65, 0x29, 0x5d, 0x85, 0x2a, 0x66, 0x95, 0x2a, 0x68, 0x99, 0x29, 0x64, 0x92, 0x28, 0x4c, 0x6b, 0x25, 0x27, 0x2d, 0x27, 0x43, 0x5c, 0x29, 0x5f, 0x89, 0x27, 0x49, 0x66, 0x25, 0x30, 0x3e, 0x25, 0x26, 0x2d, 0x25, 0x25, 0x2b, 0x25, 0x26, 0x2c, 0x25, 0x2d, 0x38, 0x25, 0x3a, 0x4c, 0x27, 0x4d, 0x6b, 0x29, 0x60, 0x8c, 0x27, 0x44, 0x5c, 0x27, 0x4b, 0x69, 0x28, 0x59, 0x7f, 0x25, 0x34, 0x43, 0x25, 0x35, 0x45, 0x28, 0x58, 0x7f, 0x25, 0x26, 0x2b, 0x27, 0x40, 0x57, 0x27, 0x41, 0x57, 0x25, 0x2a, 0x33, 0x29, 0x5d, 0x87, 0x25, 0x34, 0x44, 0x25, 0x2b, 0x34, 0x40, 0x40, 0x44, 0xad, 0xad, 0xaf, 0xff, 0xff, 0xff, 0xf2, 0xf2, 0xf2, 0x77, 0x77, 0x7a, 0x5b, 0x5b, 0x5f, 0x4e, 0x4e, 0x52, 0xc9, 0xc9, 0xca, 0x27, 0x43, 0x5b, 0x27, 0x4d, 0x6c, 0x27, 0x4e, 0x6d, 0xbb, 0xbb, 0xbd, 0x69, 0x69, 0x6c, 0x28, 0x56, 0x7b, 0x26, 0x3b, 0x4e, 0x26, 0x3a, 0x4e, 0x32, 0x32, 0x37, 0x84, 0x84, 0x87, 0xd6, 0xd6, 0xd7, 0x29, 0x61, 0x8d, 0x25, 0x2e, 0x39, 0x92, 0x92, 0x94, 0xa0, 0xa0, 0xa2, 0xe4, 0xe4, 0xe5, 0x27, 0x44, 0x5d, 0xdd, 0xc9, 0xf2, 0x7e, 0x0, 0x0, 0x0, 0x41, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x1, 0x2, 0x3, 0x4, 0x9, 0xe, 0x13, 0x16, 0x18, 0x19, 0xa, 0x26, 0x36, 0x44, 0x4d, 0x52, 0x54, 0x55, 0x6, 0x12, 0x27, 0x43, 0x80, 0xc5, 0xe7, 0xf5, 0xfe, 0x8, 0x17, 0x35, 0x73, 0xd9, 0x7, 0x3a, 0x96, 0xf9, 0x9a, 0xb, 0x28, 0x76, 0xfb, 0x77, 0xde, 0x45, 0x5, 0x82, 0xc6, 0xc6, 0x37, 0xf, 0xe9, 0x4c, 0x4e, 0x4f, 0x50, 0x83, 0x78, 0x3b, 0x9c, 0x3c, 0x74, 0xda, 0x53, 0x14, 0x37, 0x21, 0x5a, 0x6c, 0x0, 0x0, 0x2, 0x4, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0xdd, 0x95, 0x63, 0x83, 0xdc, 0x60, 0x10, 0xc7, 0x1b, 0x3c, 0xc1, 0xda, 0x3e, 0xdb, 0x36, 0xe7, 0x6c, 0xdb, 0xa, 0xcf, 0xc6, 0x7e, 0xf8, 0x2a, 0x6d, 0xb8, 0xac, 0x7b, 0xbf, 0xf7, 0xf3, 0x1f, 0xcf, 0x7c, 0xf8, 0x97, 0xc0, 0x70, 0x82, 0x20, 0xb3, 0x42, 0x10, 0x38, 0x96, 0xd2, 0x1c, 0x27, 0x11, 0x45, 0x33, 0xac, 0x2d, 0xb, 0x2c, 0x43, 0x53, 0x88, 0xc4, 0xad, 0xde, 0x49, 0x3b, 0xe3, 0x70, 0xba, 0xdc, 0x1e, 0xaf, 0x2f, 0x23, 0x5e, 0x8f, 0xdb, 0xe5, 0x74, 0x30, 0x76, 0xd2, 0x14, 0x5, 0xee, 0xf, 0x4, 0x43, 0xe1, 0x48, 0x34, 0x16, 0x87, 0x2c, 0xc4, 0x63, 0xd1, 0x48, 0x38, 0x14, 0xc, 0xf8, 0x71, 0x83, 0x7d, 0xa2, 0xa0, 0xb0, 0xa8, 0x78, 0x4, 0x72, 0x64, 0xa4, 0xb8, 0xa8, 0xb0, 0x20, 0xa1, 0x53, 0xc0, 0x4a, 0xd8, 0xd2, 0xb2, 0x72, 0xc8, 0xc4, 0xe8, 0xd8, 0xf8, 0xc4, 0xa4, 0xc2, 0xd4, 0xf4, 0x28, 0x94, 0x97, 0x95, 0xb2, 0x25, 0x98, 0x96, 0x3f, 0xed, 0xac, 0xc8, 0x18, 0xfb, 0xcc, 0xec, 0xdc, 0xfc, 0xc2, 0xe2, 0xd2, 0x17, 0x96, 0x57, 0x56, 0xd7, 0xd6, 0x37, 0x66, 0xe2, 0x15, 0x4e, 0x5a, 0xad, 0x3, 0x5e, 0x59, 0x55, 0x5d, 0x93, 0xd1, 0x7e, 0x73, 0x6b, 0x1b, 0x74, 0xec, 0xec, 0x6e, 0xce, 0xd4, 0xd4, 0x56, 0x55, 0x7e, 0x4f, 0x82, 0x2c, 0x70, 0xd5, 0x41, 0x6, 0xf6, 0xf6, 0xb7, 0x56, 0xc0, 0xc0, 0xca, 0xd6, 0xc1, 0x5e, 0x5d, 0x7d, 0x41, 0x83, 0x12, 0x2, 0x86, 0x1c, 0x8d, 0x90, 0x89, 0xc3, 0xa3, 0x63, 0x30, 0xb1, 0x33, 0x77, 0x2, 0x8d, 0xe, 0xa4, 0x8, 0xe0, 0x94, 0xb3, 0x9, 0x54, 0x4e, 0xcf, 0x38, 0x5e, 0x0, 0x91, 0x93, 0x40, 0x94, 0x41, 0xe1, 0xfc, 0x2, 0x2c, 0x5c, 0x9e, 0x43, 0x73, 0x4b, 0xab, 0x92, 0x3, 0x41, 0xbb, 0xa2, 0xa0, 0x22, 0x5f, 0x9d, 0x5e, 0x73, 0xa7, 0x22, 0x27, 0x6b, 0x2, 0x37, 0xb7, 0x60, 0xe1, 0xee, 0x6, 0xda, 0xea, 0x69, 0x42, 0x11, 0x60, 0xda, 0x63, 0x5a, 0x0, 0xdc, 0x3d, 0xc0, 0xd5, 0x83, 0xf8, 0xc8, 0x8b, 0xaa, 0xc0, 0xd3, 0x33, 0x58, 0x78, 0x7e, 0x82, 0xf2, 0xe, 0x86, 0x54, 0x4, 0xa, 0x3a, 0xb5, 0x1e, 0x8a, 0x8f, 0x0, 0xf0, 0x72, 0x26, 0xca, 0x2f, 0x8f, 0xaa, 0xc0, 0xc4, 0x22, 0x58, 0x58, 0x9c, 0x0, 0xe8, 0x2a, 0xf8, 0x26, 0xc0, 0xb8, 0xb5, 0x21, 0xba, 0xff, 0x12, 0xc1, 0xd9, 0xeb, 0x67, 0xe3, 0xb7, 0xb3, 0x9c, 0x23, 0xa0, 0x5d, 0x6d, 0xa0, 0xf2, 0xf8, 0x0, 0xf7, 0xbc, 0xf0, 0x59, 0x40, 0xe0, 0x72, 0xad, 0x1, 0x4e, 0xb5, 0xe8, 0xba, 0x20, 0xf2, 0x8f, 0xfc, 0xd9, 0xd7, 0x2, 0x3e, 0xe6, 0xda, 0x5, 0xc, 0x39, 0xba, 0x41, 0xe3, 0xfe, 0x41, 0x2, 0x38, 0x15, 0x0, 0x24, 0x21, 0xf3, 0x1c, 0x74, 0x7, 0x11, 0xf6, 0xd3, 0x93, 0xa8, 0xee, 0x42, 0x6d, 0xfe, 0xbb, 0xd0, 0xa3, 0xed, 0x42, 0xe, 0xdb, 0xb8, 0x61, 0xdc, 0xc6, 0xa4, 0xba, 0x8d, 0xea, 0x3d, 0xe8, 0xed, 0xab, 0xc9, 0xe7, 0x1e, 0xd4, 0xf4, 0xf5, 0xab, 0xf7, 0x40, 0xb9, 0x48, 0xac, 0x73, 0x60, 0x10, 0x72, 0x66, 0x70, 0xc0, 0xc9, 0x26, 0x8c, 0x37, 0xad, 0x84, 0xe, 0xba, 0xc2, 0x91, 0xb6, 0x72, 0xc8, 0x4a, 0x79, 0x5b, 0x24, 0xec, 0xa, 0xd2, 0x25, 0xb8, 0xf9, 0x2a, 0x57, 0x32, 0x8e, 0x96, 0xfa, 0x8e, 0x21, 0x5f, 0x16, 0x86, 0x3a, 0xea, 0x5b, 0x1c, 0x4c, 0x25, 0x89, 0x59, 0xbf, 0x4a, 0x3, 0x6a, 0x1d, 0x2e, 0xc8, 0xfe, 0x17, 0xa, 0x86, 0x5b, 0x51, 0x3, 0x8e, 0xa5, 0xf9, 0x4c, 0x64, 0xe, 0x68, 0x9f, 0xe9, 0xbd, 0xf0, 0x9, 0xb7, 0x71, 0x36, 0xc6, 0x9b, 0x3d, 0x7f, 0x21, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -362,6 +398,14 @@ static const unsigned char toggle_on_disabled_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x1, 0x53, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xd, 0xd, 0xf, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x24, 0x24, 0x29, 0x25, 0x25, 0x2a, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xa, 0xa, 0xc, 0x1d, 0x1d, 0x21, 0x24, 0x24, 0x29, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x11, 0x11, 0x14, 0x23, 0x23, 0x28, 0x2e, 0x2e, 0x2e, 0x46, 0x46, 0x46, 0x57, 0x57, 0x57, 0x60, 0x60, 0x60, 0x62, 0x62, 0x62, 0x5e, 0x5e, 0x5e, 0x4a, 0x4a, 0x4a, 0x12, 0x12, 0x15, 0x25, 0x27, 0x2d, 0x42, 0x42, 0x42, 0x59, 0x59, 0x59, 0x32, 0x32, 0x32, 0x25, 0x26, 0x2d, 0x25, 0x25, 0x2b, 0x25, 0x26, 0x2c, 0x39, 0x39, 0x39, 0x49, 0x49, 0x49, 0x5a, 0x5a, 0x5a, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xb, 0xb, 0xd, 0x23, 0x23, 0x28, 0x48, 0x48, 0x48, 0x54, 0x54, 0x54, 0x34, 0x34, 0x34, 0x35, 0x35, 0x35, 0xb, 0xb, 0xd, 0x1e, 0x1e, 0x22, 0x25, 0x26, 0x2b, 0x3f, 0x3f, 0x3f, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xe, 0xe, 0x10, 0x2c, 0x2c, 0x2c, 0x58, 0x58, 0x58, 0x1a, 0x1a, 0x1e, 0x40, 0x40, 0x44, 0x56, 0x56, 0x58, 0x80, 0x80, 0x80, 0x79, 0x79, 0x79, 0x3c, 0x3c, 0x3d, 0x2e, 0x2e, 0x30, 0x27, 0x27, 0x29, 0x64, 0x64, 0x66, 0x41, 0x41, 0x41, 0x1a, 0x1a, 0x1d, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x5d, 0x5d, 0x5f, 0x34, 0x34, 0x36, 0x52, 0x52, 0x52, 0x3a, 0x3a, 0x3a, 0x20, 0x20, 0x24, 0x0, 0x0, 0x0, 0x32, 0x32, 0x37, 0x42, 0x42, 0x44, 0x6a, 0x6a, 0x6d, 0x5b, 0x5b, 0x5b, 0x2f, 0x2f, 0x2f, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x49, 0x49, 0x4a, 0x0, 0x0, 0x0, 0x50, 0x50, 0x51, 0x70, 0x70, 0x74, 0xe, 0xe, 0x10, 0xb, 0xb, 0xd, 0x0, 0x0, 0x0, 0x13, 0x13, 0x15, 0x0, 0x0, 0x0, 0xb, 0xb, 0xc, 0x1d, 0x1d, 0x21, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xbd, 0xb, 0x85, 0x35, 0x0, 0x0, 0x0, 0x71, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x1, 0x2, 0x3, 0x4, 0x9, 0xe, 0x13, 0x16, 0x18, 0x19, 0xa, 0x26, 0x36, 0x44, 0x4d, 0x52, 0x54, 0x55, 0x6, 0x12, 0x27, 0x43, 0x80, 0xc5, 0xe7, 0xf5, 0xfe, 0xff, 0x8, 0x17, 0x35, 0x73, 0xd9, 0xff, 0x7, 0x3a, 0x96, 0xf9, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x9a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xb, 0x28, 0x76, 0xfb, 0xff, 0xff, 0xff, 0xff, 0x77, 0xde, 0xff, 0xff, 0x45, 0x5, 0x82, 0xff, 0xff, 0xc6, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xc6, 0x37, 0xf, 0xff, 0xff, 0xff, 0xff, 0xe9, 0x4c, 0xff, 0xff, 0xff, 0xff, 0xff, 0x4e, 0x4f, 0xff, 0x50, 0xff, 0xff, 0x83, 0x78, 0x3b, 0x9c, 0x3c, 0x74, 0xda, 0x53, 0x14, 0x49, 0x96, 0x6e, 0xf, 0x0, 0x0, 0x1, 0xfa, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x62, 0x18, 0x5e, 0x0, 0xd0, 0x5c, 0x39, 0x28, 0x49, 0x12, 0xc0, 0x60, 0xb8, 0xda, 0xdd, 0xcb, 0x31, 0x33, 0xb6, 0x6d, 0xdb, 0x5e, 0xdb, 0xd6, 0xfb, 0x17, 0x4e, 0x7d, 0x37, 0xe6, 0xf9, 0x2b, 0x23, 0x7f, 0x9c, 0x20, 0x28, 0x86, 0xe1, 0xb, 0xc1, 0x30, 0x14, 0x99, 0x6a, 0x8e, 0xe2, 0x4, 0x49, 0xd1, 0xcc, 0xda, 0x2, 0x18, 0x9a, 0x22, 0x9, 0x1c, 0x9d, 0xf4, 0x8e, 0xaf, 0xd3, 0x1b, 0x9b, 0x5b, 0xdb, 0x1c, 0x2e, 0x6f, 0x2e, 0x5c, 0xce, 0xf6, 0xd6, 0xe6, 0x6, 0xbd, 0x8e, 0x8f, 0x45, 0x81, 0xf2, 0x5, 0x42, 0x91, 0x58, 0x22, 0x95, 0xc9, 0x61, 0x1, 0x72, 0x99, 0x54, 0x22, 0x16, 0x9, 0x5, 0x7c, 0x74, 0xc4, 0x5e, 0xa1, 0x54, 0xa9, 0x35, 0x5a, 0x58, 0x12, 0xad, 0x46, 0xad, 0x52, 0x2a, 0x86, 0x14, 0x10, 0x1d, 0xa3, 0x37, 0x18, 0x61, 0x1e, 0x26, 0xb3, 0xc5, 0x6a, 0x63, 0xb1, 0x3b, 0x4c, 0x60, 0x34, 0xe8, 0x19, 0x1d, 0x32, 0xc8, 0x9f, 0xda, 0x74, 0xce, 0x8d, 0xdd, 0xe5, 0xf6, 0x98, 0xbd, 0x3e, 0xff, 0x57, 0x2, 0xa6, 0x60, 0x28, 0xec, 0x76, 0xc9, 0x9d, 0x9b, 0x54, 0xbf, 0xe, 0x68, 0x24, 0x1a, 0x8b, 0xcf, 0xb5, 0x4f, 0x24, 0x53, 0x30, 0x44, 0x3a, 0x99, 0x70, 0xc5, 0x33, 0xd1, 0xc8, 0x8f, 0x24, 0x70, 0xe5, 0x56, 0x16, 0xe6, 0x90, 0xcb, 0x27, 0x4d, 0x63, 0x9, 0x25, 0xf3, 0xb9, 0x6c, 0x41, 0x59, 0x64, 0x43, 0x40, 0x88, 0x8d, 0x12, 0xcc, 0xa3, 0x5c, 0x49, 0xc3, 0x18, 0x69, 0x4f, 0x19, 0x4a, 0x1b, 0x4, 0x2b, 0x80, 0x92, 0x9b, 0x55, 0xe8, 0x53, 0xab, 0x37, 0x9a, 0x2d, 0x68, 0x37, 0x3a, 0xd0, 0xee, 0x2, 0x4b, 0xcf, 0x1, 0x13, 0x38, 0x7a, 0xb0, 0xb3, 0xbb, 0xc7, 0xe6, 0x80, 0x51, 0x5b, 0x52, 0xe8, 0xd3, 0xdd, 0xaf, 0x1d, 0x34, 0x6a, 0xed, 0x46, 0x77, 0x20, 0x70, 0x78, 0x4, 0x13, 0x1c, 0x1d, 0xc2, 0x71, 0x81, 0xc2, 0x58, 0x1, 0xfa, 0x44, 0x36, 0x8, 0xa0, 0x71, 0xa, 0xb0, 0x7f, 0xd6, 0x3e, 0x6f, 0xb6, 0xfb, 0x2, 0x17, 0x97, 0x30, 0xc1, 0xe5, 0x5, 0x18, 0xaf, 0x68, 0x9c, 0x15, 0x50, 0x5e, 0xf, 0x7a, 0xd8, 0x3e, 0x7, 0x80, 0x9b, 0x7a, 0xbb, 0x7b, 0x73, 0xde, 0x17, 0xb0, 0xfa, 0x60, 0x2, 0x9f, 0x15, 0xe0, 0x56, 0xf9, 0x5d, 0x80, 0xde, 0x1e, 0xc, 0xd1, 0xe9, 0xd7, 0x8, 0xea, 0x77, 0xed, 0x2e, 0xdc, 0xd7, 0x97, 0x8e, 0x80, 0xda, 0x3a, 0x86, 0x3e, 0xe7, 0x67, 0x70, 0xda, 0x6c, 0xb5, 0xbb, 0xd0, 0x6a, 0x2c, 0x5b, 0x3, 0x94, 0xdc, 0xad, 0x42, 0x9f, 0x76, 0xf3, 0xbc, 0x59, 0x87, 0xaf, 0xe1, 0x9f, 0x2f, 0xd5, 0x5, 0x76, 0xe, 0x1e, 0x60, 0xc0, 0xe9, 0x59, 0x7, 0xa0, 0xd6, 0x2, 0xe8, 0xb4, 0xe6, 0xcf, 0xc1, 0x83, 0x90, 0x40, 0x7e, 0x79, 0x12, 0xfb, 0xbb, 0x90, 0x59, 0x7d, 0x17, 0x1e, 0xd9, 0x5d, 0xf8, 0xd5, 0x6d, 0xec, 0xdf, 0x83, 0xa7, 0xe7, 0xf8, 0x2a, 0xf7, 0x20, 0xfe, 0xfc, 0xc2, 0xde, 0x83, 0xfe, 0x45, 0x62, 0x36, 0x5f, 0xdf, 0x60, 0x69, 0xde, 0x5e, 0x37, 0x19, 0xc5, 0xe8, 0x4d, 0xd3, 0x51, 0xc2, 0x2d, 0xb1, 0xe4, 0xd8, 0x8, 0xb, 0x31, 0x1e, 0x4b, 0xc4, 0x5b, 0x42, 0x4a, 0x87, 0x8e, 0x5f, 0xe5, 0x8, 0xbd, 0xb1, 0x5b, 0xb8, 0x7a, 0xe7, 0x2d, 0xe0, 0xfd, 0xaa, 0xb0, 0xbb, 0x41, 0x47, 0x70, 0x64, 0xf2, 0xab, 0x14, 0x89, 0xbd, 0xf, 0xe5, 0xe2, 0xbf, 0xa0, 0xfc, 0xd8, 0x23, 0x8a, 0x28, 0x32, 0xe3, 0x33, 0xe1, 0x4b, 0xc0, 0x7e, 0xa6, 0xff, 0x87, 0xcf, 0xb, 0x94, 0xb9, 0x37, 0x3c, 0xc6, 0xd8, 0xcd, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char toggle_on_disabled_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x0, 0x69, 0x50, 0x4c, 0x54, 0x45, 0x93, 0x7f, 0x2b, 0x14, 0x14, 0x17, 0x20, 0x20, 0x25, 0x24, 0x24, 0x28, 0x24, 0x24, 0x29, 0x25, 0x25, 0x2a, 0x10, 0x10, 0x13, 0x22, 0x22, 0x27, 0x25, 0x25, 0x28, 0x25, 0x25, 0x29, 0x25, 0x25, 0x27, 0x19, 0x19, 0x1c, 0x2b, 0x26, 0x2c, 0x40, 0x40, 0x44, 0x4e, 0x4e, 0x52, 0x1a, 0x1a, 0x1d, 0x32, 0x32, 0x37, 0x2c, 0x26, 0x2c, 0x26, 0x25, 0x2a, 0x27, 0x25, 0x2a, 0x11, 0x11, 0x14, 0x2f, 0x26, 0x2d, 0x12, 0x12, 0x14, 0x23, 0x23, 0x27, 0x15, 0x15, 0x18, 0x5b, 0x5b, 0x5f, 0x84, 0x84, 0x87, 0x77, 0x77, 0x7a, 0x69, 0x69, 0x6c, 0x20, 0x20, 0x24, 0x24, 0x24, 0x27, 0x23, 0x23, 0x28, 0x1a, 0x1a, 0x1e, 0x11, 0x11, 0x13, 0x22, 0x22, 0x26, 0xd7, 0x77, 0xc6, 0x92, 0x0, 0x0, 0x0, 0x1, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x40, 0xe6, 0xd8, 0x66, 0x0, 0x0, 0x1, 0x35, 0x49, 0x44, 0x41, 0x54, 0x48, 0xc7, 0xed, 0x94, 0xd1, 0x72, 0x83, 0x20, 0x10, 0x45, 0x4d, 0x90, 0xb8, 0x18, 0x96, 0x6c, 0xb5, 0x24, 0x41, 0x68, 0x9b, 0xf4, 0xff, 0x3f, 0xb2, 0x84, 0xb4, 0x8a, 0xa, 0x3a, 0x9d, 0x74, 0xa6, 0x2f, 0xb9, 0xbe, 0x38, 0xca, 0x3d, 0x5c, 0x16, 0xd8, 0xa2, 0x78, 0xea, 0x2f, 0xb5, 0xd9, 0xb2, 0xb2, 0xe4, 0x2b, 0x2a, 0x4b, 0xb6, 0xdd, 0x24, 0xed, 0xbb, 0x8a, 0x1, 0x8, 0x21, 0xee, 0xe3, 0xc4, 0x4d, 0x20, 0x6a, 0x91, 0x84, 0x54, 0xbb, 0xb9, 0x7f, 0xcf, 0x40, 0xa2, 0xea, 0x85, 0x32, 0x50, 0x6a, 0xc8, 0xe4, 0xd8, 0x4f, 0xfd, 0x7, 0x26, 0x48, 0xe1, 0x4b, 0x13, 0x7e, 0x37, 0x92, 0x50, 0x51, 0x1b, 0x92, 0xe4, 0x56, 0x72, 0x18, 0xfb, 0x5f, 0x99, 0x40, 0xd4, 0xf1, 0x8, 0x42, 0x6c, 0x17, 0x6b, 0x71, 0x1c, 0x1, 0x4e, 0x40, 0x21, 0x74, 0x24, 0x89, 0xd4, 0x2c, 0x11, 0x4e, 0xb1, 0xff, 0xc, 0x52, 0xe9, 0xe9, 0x8, 0x52, 0x8b, 0x11, 0xf8, 0x39, 0x2, 0x6c, 0x7d, 0x80, 0xf9, 0x8, 0xa4, 0xe1, 0xd5, 0x74, 0x16, 0xb9, 0xee, 0x5a, 0xae, 0xdd, 0xcf, 0xb7, 0xb7, 0x8, 0xe0, 0x2b, 0x40, 0x73, 0x40, 0x4, 0x75, 0x6, 0xa9, 0x43, 0xdd, 0xb9, 0x8, 0xc0, 0x46, 0x0, 0x25, 0xe7, 0x0, 0xa9, 0xfa, 0x0, 0x9d, 0xe7, 0x1b, 0xd4, 0xce, 0xea, 0x1, 0x50, 0x8e, 0x1, 0x89, 0x82, 0x35, 0x3d, 0x20, 0xb8, 0x94, 0xd1, 0x4e, 0xb9, 0x1, 0xc0, 0x7f, 0x91, 0x80, 0x42, 0x2, 0xe5, 0xcd, 0xd6, 0x24, 0x13, 0xbc, 0xc3, 0x5a, 0xd, 0x90, 0x93, 0xf5, 0x4b, 0xf0, 0x8b, 0x49, 0xd6, 0x60, 0x75, 0x17, 0xb4, 0x75, 0xd6, 0x84, 0x95, 0xb8, 0xe4, 0x2e, 0xac, 0x9f, 0x3, 0xba, 0x9d, 0x4b, 0xf4, 0xb3, 0xb4, 0xfd, 0x4c, 0xf1, 0x39, 0x28, 0x3e, 0xc4, 0x63, 0x27, 0xb1, 0x38, 0x3e, 0x7a, 0x17, 0xb2, 0xb7, 0x31, 0xeb, 0x9f, 0xdc, 0xc6, 0xa2, 0xb8, 0x30, 0x68, 0xa7, 0xfd, 0x60, 0xc1, 0x7f, 0x99, 0x77, 0x94, 0xeb, 0x27, 0xd4, 0x70, 0x6f, 0x48, 0xe2, 0x5b, 0xe0, 0x9f, 0xa4, 0xbf, 0xba, 0x66, 0x7b, 0x22, 0x5f, 0x55, 0xb6, 0x27, 0x3e, 0xf5, 0x8f, 0xfa, 0x2, 0xa0, 0x14, 0x20, 0xeb, 0xde, 0xb1, 0x8c, 0x34, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + +static const unsigned char toggle_on_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x40, 0x0, 0x0, 0x0, 0x20, 0x8, 0x3, 0x0, 0x0, 0x0, 0x95, 0x43, 0x8e, 0xb6, 0x0, 0x0, 0x1, 0x9b, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xd, 0xd, 0xf, 0x1a, 0x1a, 0x1e, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x24, 0x24, 0x29, 0x24, 0x24, 0x28, 0x20, 0x20, 0x25, 0x14, 0x14, 0x17, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xa, 0xa, 0xc, 0x1d, 0x1d, 0x21, 0x22, 0x22, 0x27, 0x10, 0x10, 0x13, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x11, 0x11, 0x14, 0x23, 0x23, 0x28, 0x19, 0x19, 0x1c, 0x12, 0x12, 0x15, 0x1a, 0x1a, 0x1d, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xb, 0xb, 0xd, 0x23, 0x23, 0x28, 0x12, 0x12, 0x14, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x1e, 0x1e, 0x22, 0x23, 0x23, 0x27, 0xe, 0xe, 0x10, 0x15, 0x15, 0x18, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x1a, 0x1a, 0x1d, 0x20, 0x20, 0x24, 0x20, 0x20, 0x24, 0x24, 0x24, 0x28, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0xe, 0xe, 0x10, 0x15, 0x15, 0x18, 0xb, 0xb, 0xd, 0x12, 0x12, 0x14, 0x0, 0x0, 0x0, 0x13, 0x13, 0x15, 0x1a, 0x1a, 0x1e, 0xb, 0xb, 0xc, 0x1d, 0x1d, 0x21, 0x11, 0x11, 0x13, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x25, 0x25, 0x2a, 0x24, 0x24, 0x29, 0x25, 0x25, 0x29, 0x25, 0x25, 0x27, 0x25, 0x2c, 0x36, 0x28, 0x4c, 0x6b, 0x29, 0x64, 0x92, 0x2a, 0x68, 0x99, 0x2a, 0x66, 0x95, 0x29, 0x5d, 0x85, 0x27, 0x49, 0x65, 0x25, 0x25, 0x28, 0x25, 0x27, 0x2d, 0x27, 0x44, 0x5c, 0x29, 0x60, 0x8c, 0x27, 0x4d, 0x6b, 0x25, 0x3a, 0x4c, 0x25, 0x2d, 0x38, 0x25, 0x26, 0x2c, 0x25, 0x25, 0x2b, 0x25, 0x26, 0x2d, 0x25, 0x30, 0x3e, 0x27, 0x49, 0x66, 0x29, 0x5f, 0x89, 0x27, 0x43, 0x5c, 0x27, 0x4b, 0x69, 0x28, 0x58, 0x7f, 0x25, 0x35, 0x45, 0x25, 0x34, 0x43, 0x28, 0x59, 0x7f, 0x25, 0x26, 0x2b, 0x27, 0x41, 0x57, 0x27, 0x40, 0x57, 0x25, 0x2b, 0x34, 0x25, 0x34, 0x44, 0x29, 0x5d, 0x87, 0x25, 0x2a, 0x33, 0x27, 0x43, 0x5b, 0x27, 0x4e, 0x6d, 0x27, 0x4d, 0x6c, 0x40, 0x40, 0x44, 0xad, 0xad, 0xaf, 0xff, 0xff, 0xff, 0xf2, 0xf2, 0xf2, 0x77, 0x77, 0x7a, 0x5b, 0x5b, 0x5f, 0x4e, 0x4e, 0x52, 0xc9, 0xc9, 0xca, 0x28, 0x56, 0x7b, 0x26, 0x3a, 0x4e, 0x26, 0x3b, 0x4e, 0xbb, 0xbb, 0xbd, 0x69, 0x69, 0x6c, 0x29, 0x61, 0x8d, 0x25, 0x2e, 0x39, 0x32, 0x32, 0x37, 0x84, 0x84, 0x87, 0xd6, 0xd6, 0xd7, 0x92, 0x92, 0x94, 0xa0, 0xa0, 0xa2, 0x27, 0x44, 0x5d, 0xa6, 0xa2, 0x25, 0x5b, 0x0, 0x0, 0x0, 0x4c, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x1, 0x2, 0x3, 0x4, 0x9, 0xe, 0x13, 0x16, 0x18, 0x19, 0xa, 0x26, 0x36, 0x44, 0x4d, 0x52, 0x54, 0x55, 0x6, 0x12, 0x27, 0x43, 0x80, 0xc5, 0xe7, 0xf5, 0xfe, 0xfa, 0xe5, 0x98, 0x8, 0x17, 0x35, 0x73, 0xd9, 0xf3, 0x86, 0x7, 0x3a, 0x96, 0xf9, 0xb4, 0x9a, 0xb9, 0xb, 0x28, 0x77, 0xfb, 0x8b, 0x5, 0x45, 0xde, 0xf6, 0x82, 0x9b, 0xf, 0x37, 0xc6, 0xe6, 0xe9, 0xfb, 0x4e, 0x50, 0x83, 0x9c, 0x78, 0x8c, 0x3c, 0x9c, 0xbb, 0x74, 0xda, 0x87, 0x53, 0x14, 0xd0, 0x92, 0x4e, 0x2c, 0x0, 0x0, 0x2, 0x35, 0x49, 0x44, 0x41, 0x54, 0x48, 0xc7, 0x63, 0x60, 0x18, 0x44, 0x80, 0x91, 0x89, 0x99, 0x99, 0x85, 0x20, 0x60, 0x66, 0x66, 0x62, 0xc4, 0xaa, 0x9d, 0x89, 0x85, 0x95, 0x8d, 0x9d, 0x83, 0x93, 0x8b, 0x0, 0xe0, 0xe4, 0x60, 0x67, 0x63, 0x65, 0x61, 0xc2, 0xb4, 0x9d, 0x85, 0x9b, 0x83, 0x87, 0x97, 0x8f, 0x5f, 0x40, 0x50, 0x8, 0x2f, 0x10, 0x14, 0xe0, 0xe7, 0xe3, 0xe5, 0xe1, 0xe0, 0x66, 0x41, 0x73, 0x5, 0x93, 0xb0, 0x88, 0xa8, 0x98, 0xb8, 0x84, 0xa4, 0x94, 0xb4, 0xf, 0x1, 0xe0, 0x2b, 0x2d, 0x23, 0x2b, 0x27, 0x26, 0x2a, 0x22, 0x8c, 0xe2, 0x8, 0x26, 0x79, 0x5, 0x45, 0x25, 0x65, 0x5f, 0xc, 0xd5, 0x7e, 0xfe, 0x7e, 0x58, 0xd, 0x51, 0x51, 0x55, 0x54, 0x90, 0x47, 0x32, 0x81, 0x51, 0x8d, 0x53, 0x5d, 0x43, 0xd3, 0x27, 0x20, 0x30, 0x28, 0x18, 0x2, 0x42, 0x42, 0xc3, 0x2, 0x20, 0x6, 0x84, 0xe3, 0x70, 0x87, 0x96, 0x3a, 0xa7, 0x1a, 0x23, 0xc2, 0xff, 0xec, 0xbc, 0xda, 0xd2, 0x11, 0x91, 0x51, 0xd1, 0x31, 0xb1, 0x71, 0xf1, 0x20, 0x90, 0x90, 0x98, 0x94, 0x9c, 0x12, 0x1, 0x36, 0x2, 0x97, 0x4f, 0x74, 0x78, 0xd9, 0xe1, 0xe1, 0xc0, 0xa4, 0xab, 0xa7, 0x6f, 0x10, 0x91, 0x9a, 0x96, 0x8e, 0xac, 0x22, 0x23, 0x33, 0x35, 0x2, 0x6f, 0x58, 0x18, 0xea, 0xe9, 0x42, 0x3d, 0xc1, 0x68, 0xa4, 0x60, 0x6c, 0x92, 0x95, 0x9d, 0x19, 0x8b, 0xaa, 0x22, 0x36, 0x33, 0x27, 0xb, 0x9f, 0x9, 0xa6, 0xc6, 0xa, 0x46, 0x10, 0x27, 0x30, 0xb1, 0xf2, 0x98, 0xf9, 0xe4, 0x26, 0xa7, 0xa3, 0xab, 0xc8, 0xcb, 0x2f, 0xc0, 0x1b, 0x1f, 0xe6, 0x3c, 0xac, 0x10, 0x3, 0x58, 0x2c, 0x2c, 0xad, 0x7c, 0xa, 0x8b, 0x30, 0x55, 0x14, 0x17, 0xc2, 0x99, 0x25, 0xa5, 0x65, 0xe5, 0x15, 0x3e, 0x95, 0x65, 0x55, 0x3e, 0x95, 0xd5, 0x30, 0x31, 0x6b, 0x4b, 0xb, 0x88, 0x1f, 0x84, 0xd9, 0x8d, 0x6d, 0x7c, 0x6a, 0x6a, 0x31, 0xd, 0xa8, 0xab, 0x81, 0x33, 0xab, 0xeb, 0x4b, 0x1a, 0xca, 0x4a, 0x2a, 0xcb, 0xaa, 0x91, 0xc, 0xb0, 0x35, 0x66, 0x67, 0x6, 0x1b, 0xa0, 0xc6, 0x61, 0xa7, 0xe9, 0xd3, 0xd8, 0x84, 0x69, 0x40, 0x53, 0x23, 0xdc, 0x1, 0x65, 0xcd, 0x3e, 0x3e, 0xf5, 0x2d, 0x95, 0xad, 0xe5, 0x95, 0x8, 0x3, 0x7c, 0xed, 0x38, 0x58, 0x20, 0x6, 0x28, 0xd8, 0xfb, 0xf8, 0x84, 0x24, 0x60, 0x1a, 0x90, 0x10, 0x2, 0x63, 0x55, 0xb6, 0x2, 0x89, 0xb6, 0xd2, 0xca, 0xea, 0xb6, 0x56, 0x84, 0x1, 0x3e, 0xf6, 0xa, 0x2c, 0xc4, 0xba, 0xa0, 0x19, 0xe4, 0x82, 0xd2, 0x76, 0xa0, 0xe6, 0xf2, 0x52, 0x4c, 0x17, 0x10, 0x13, 0x6, 0xad, 0x2d, 0x3e, 0xcd, 0xe5, 0x15, 0x40, 0x3, 0x2a, 0xca, 0x30, 0xc3, 0x80, 0x98, 0x58, 0xa8, 0x2c, 0x6f, 0x2d, 0x2f, 0x5, 0x7, 0x60, 0x2b, 0x66, 0x2c, 0x30, 0xb1, 0x8a, 0x3a, 0x10, 0x4c, 0x7, 0xcd, 0x2d, 0x55, 0xc0, 0xb0, 0xac, 0xf0, 0xf1, 0xa9, 0xaa, 0x80, 0x9, 0x39, 0x8a, 0x42, 0xd3, 0x1, 0xc5, 0x29, 0x11, 0x94, 0x17, 0x9c, 0x48, 0xcf, 0xb, 0xce, 0xf0, 0xbc, 0x0, 0xcb, 0x8d, 0x1d, 0xa8, 0xb9, 0x31, 0x12, 0xbf, 0x7e, 0xe4, 0xdc, 0x8, 0x2a, 0xf, 0x5c, 0x5c, 0xd, 0xb0, 0x94, 0x7, 0xb8, 0xf5, 0xbb, 0xb9, 0x20, 0x95, 0x7, 0xa0, 0x12, 0x89, 0x93, 0xd7, 0xdd, 0x3, 0x53, 0x9d, 0x5f, 0x38, 0xf6, 0xf2, 0x40, 0xc5, 0x93, 0x97, 0x53, 0x1e, 0xb5, 0x4c, 0x53, 0x63, 0x17, 0xe5, 0x13, 0x97, 0xb0, 0xd1, 0xf4, 0x21, 0x8, 0x7c, 0x6d, 0x65, 0xe5, 0xf8, 0x44, 0xd9, 0xd5, 0xd0, 0xa, 0x66, 0x46, 0x16, 0x5d, 0xe, 0x1e, 0x4b, 0x63, 0x3b, 0x2f, 0x21, 0x2, 0xc0, 0xcb, 0xce, 0xd8, 0x92, 0x87, 0x43, 0x97, 0x5, 0xa3, 0x6e, 0x60, 0x64, 0x32, 0x62, 0xb5, 0xf0, 0x56, 0x20, 0x5c, 0x2f, 0x28, 0x78, 0x5b, 0xb0, 0x1a, 0x61, 0xaf, 0x5b, 0x80, 0x35, 0x13, 0xe1, 0x8a, 0x9, 0x58, 0x35, 0xe1, 0xa8, 0x99, 0x86, 0x2e, 0x0, 0x0, 0x69, 0x2c, 0x6b, 0xc2, 0xf1, 0x2f, 0x53, 0x53, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char tooltip_bg_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x4, 0x3, 0x0, 0x0, 0x0, 0xed, 0xdd, 0xe2, 0x52, 0x0, 0x0, 0x0, 0x30, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x2d, 0x2c, 0x2f, 0x48, 0x46, 0x4a, 0xdd, 0xdd, 0xdd, 0x4c, 0x4a, 0x4e, 0x48, 0x46, 0x4a, 0x40, 0x3e, 0x42, 0xbc, 0x3, 0x4f, 0xe9, 0x0, 0x0, 0x0, 0xd, 0x74, 0x52, 0x4e, 0x53, 0xa, 0x1a, 0x26, 0x29, 0x2a, 0x48, 0x65, 0x6d, 0x6e, 0x66, 0xf5, 0xfe, 0xcc, 0xff, 0xb7, 0x4a, 0xbe, 0x0, 0x0, 0x0, 0x38, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0x60, 0x54, 0x76, 0x1, 0x2, 0x23, 0x1, 0x6, 0xd1, 0xf4, 0xe, 0x20, 0x28, 0xb, 0x64, 0xd0, 0x5c, 0x7d, 0x17, 0x8, 0x76, 0x4d, 0x62, 0x70, 0x7f, 0x7f, 0x6, 0x8, 0xfe, 0x95, 0x30, 0x78, 0xdc, 0x1, 0x31, 0xce, 0xb6, 0x50, 0xc8, 0x80, 0x1b, 0x8, 0xb7, 0x2, 0x6e, 0x29, 0xdc, 0x19, 0x0, 0xcf, 0x24, 0x4d, 0xb3, 0xd0, 0x4d, 0xb9, 0x40, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -426,4 +470,8 @@ static const unsigned char window_resizer_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x4, 0x0, 0x0, 0x0, 0xb5, 0xfa, 0x37, 0xea, 0x0, 0x0, 0x0, 0x1e, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0x18, 0xbc, 0xe0, 0x45, 0x3f, 0x1, 0xe9, 0xec, 0xfe, 0x81, 0x94, 0x86, 0xb1, 0x70, 0x48, 0x23, 0x58, 0x84, 0xa4, 0x7, 0x15, 0x0, 0x0, 0xed, 0x9f, 0x18, 0xe8, 0xcd, 0x91, 0xd8, 0xe, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char window_resizer_mirrored_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x4, 0x0, 0x0, 0x0, 0xb5, 0xfa, 0x37, 0xea, 0x0, 0x0, 0x0, 0x1, 0x6f, 0x72, 0x4e, 0x54, 0x1, 0xcf, 0xa2, 0x77, 0x9a, 0x0, 0x0, 0x0, 0x27, 0x49, 0x44, 0x41, 0x54, 0x28, 0xcf, 0x63, 0x60, 0x18, 0x44, 0xe0, 0x45, 0x3f, 0x76, 0x71, 0x26, 0x18, 0xa3, 0x19, 0xa7, 0x12, 0x38, 0xc8, 0xee, 0xa7, 0xb1, 0x12, 0x98, 0x4, 0x4e, 0x25, 0x8, 0x9, 0x4a, 0x94, 0xc, 0x10, 0x0, 0x0, 0x9d, 0x84, 0x18, 0x73, 0x33, 0x1c, 0x96, 0xd6, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + // shaders block diff --git a/scene/resources/default_theme/toggle_off_disabled_mirrored.png b/scene/resources/default_theme/toggle_off_disabled_mirrored.png Binary files differnew file mode 100644 index 0000000000..799b63c098 --- /dev/null +++ b/scene/resources/default_theme/toggle_off_disabled_mirrored.png diff --git a/scene/resources/default_theme/toggle_off_mirrored.png b/scene/resources/default_theme/toggle_off_mirrored.png Binary files differnew file mode 100644 index 0000000000..3487605d58 --- /dev/null +++ b/scene/resources/default_theme/toggle_off_mirrored.png diff --git a/scene/resources/default_theme/toggle_on_disabled_mirrored.png b/scene/resources/default_theme/toggle_on_disabled_mirrored.png Binary files differnew file mode 100644 index 0000000000..0758babd4f --- /dev/null +++ b/scene/resources/default_theme/toggle_on_disabled_mirrored.png diff --git a/scene/resources/default_theme/toggle_on_mirrored.png b/scene/resources/default_theme/toggle_on_mirrored.png Binary files differnew file mode 100644 index 0000000000..3fd953c8e2 --- /dev/null +++ b/scene/resources/default_theme/toggle_on_mirrored.png diff --git a/scene/resources/default_theme/window_resizer_mirrored.png b/scene/resources/default_theme/window_resizer_mirrored.png Binary files differnew file mode 100644 index 0000000000..bbce5f1406 --- /dev/null +++ b/scene/resources/default_theme/window_resizer_mirrored.png diff --git a/scene/resources/dynamic_font.cpp b/scene/resources/dynamic_font.cpp deleted file mode 100644 index bc983c1d7e..0000000000 --- a/scene/resources/dynamic_font.cpp +++ /dev/null @@ -1,1143 +0,0 @@ -/*************************************************************************/ -/* dynamic_font.cpp */ -/*************************************************************************/ -/* This file is part of: */ -/* GODOT ENGINE */ -/* https://godotengine.org */ -/*************************************************************************/ -/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ -/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ -/* */ -/* Permission is hereby granted, free of charge, to any person obtaining */ -/* a copy of this software and associated documentation files (the */ -/* "Software"), to deal in the Software without restriction, including */ -/* without limitation the rights to use, copy, modify, merge, publish, */ -/* distribute, sublicense, and/or sell copies of the Software, and to */ -/* permit persons to whom the Software is furnished to do so, subject to */ -/* the following conditions: */ -/* */ -/* The above copyright notice and this permission notice shall be */ -/* included in all copies or substantial portions of the Software. */ -/* */ -/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ -/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ -/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ -/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ -/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ -/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ -/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ -/*************************************************************************/ - -#include "modules/modules_enabled.gen.h" -#ifdef MODULE_FREETYPE_ENABLED - -#include "dynamic_font.h" - -#include "core/os/file_access.h" -#include "core/os/os.h" - -#include FT_STROKER_H - -#define __STDC_LIMIT_MACROS -#include <stdint.h> - -bool DynamicFontData::CacheID::operator<(CacheID right) const { - return key < right.key; -} - -Ref<DynamicFontAtSize> DynamicFontData::_get_dynamic_font_at_size(CacheID p_cache_id) { - if (size_cache.has(p_cache_id)) { - return Ref<DynamicFontAtSize>(size_cache[p_cache_id]); - } - - Ref<DynamicFontAtSize> dfas; - - dfas.instance(); - - dfas->font = Ref<DynamicFontData>(this); - - size_cache[p_cache_id] = dfas.ptr(); - dfas->id = p_cache_id; - dfas->_load(); - - return dfas; -} - -void DynamicFontData::set_font_ptr(const uint8_t *p_font_mem, int p_font_mem_size) { - font_mem = p_font_mem; - font_mem_size = p_font_mem_size; -} - -void DynamicFontData::set_font_path(const String &p_path) { - font_path = p_path; -} - -String DynamicFontData::get_font_path() const { - return font_path; -} - -void DynamicFontData::set_force_autohinter(bool p_force) { - force_autohinter = p_force; -} - -void DynamicFontData::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_antialiased", "antialiased"), &DynamicFontData::set_antialiased); - ClassDB::bind_method(D_METHOD("is_antialiased"), &DynamicFontData::is_antialiased); - ClassDB::bind_method(D_METHOD("set_font_path", "path"), &DynamicFontData::set_font_path); - ClassDB::bind_method(D_METHOD("get_font_path"), &DynamicFontData::get_font_path); - ClassDB::bind_method(D_METHOD("set_hinting", "mode"), &DynamicFontData::set_hinting); - ClassDB::bind_method(D_METHOD("get_hinting"), &DynamicFontData::get_hinting); - - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "antialiased"), "set_antialiased", "is_antialiased"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "hinting", PROPERTY_HINT_ENUM, "None,Light,Normal"), "set_hinting", "get_hinting"); - - BIND_ENUM_CONSTANT(HINTING_NONE); - BIND_ENUM_CONSTANT(HINTING_LIGHT); - BIND_ENUM_CONSTANT(HINTING_NORMAL); - - ADD_PROPERTY(PropertyInfo(Variant::STRING, "font_path", PROPERTY_HINT_FILE, "*.ttf,*.otf"), "set_font_path", "get_font_path"); -} - -DynamicFontData::DynamicFontData() { - antialiased = true; - force_autohinter = false; - hinting = DynamicFontData::HINTING_NORMAL; - font_mem = nullptr; - font_mem_size = 0; -} - -DynamicFontData::~DynamicFontData() { -} - -//////////////////// -HashMap<String, Vector<uint8_t>> DynamicFontAtSize::_fontdata; - -Error DynamicFontAtSize::_load() { - int error = FT_Init_FreeType(&library); - - ERR_FAIL_COND_V_MSG(error != 0, ERR_CANT_CREATE, "Error initializing FreeType."); - - // FT_OPEN_STREAM is extremely slow only on Android. - if (OS::get_singleton()->get_name() == "Android" && font->font_mem == nullptr && font->font_path != String()) { - // cache font only once for each font->font_path - if (_fontdata.has(font->font_path)) { - font->set_font_ptr(_fontdata[font->font_path].ptr(), _fontdata[font->font_path].size()); - - } else { - FileAccess *f = FileAccess::open(font->font_path, FileAccess::READ); - if (!f) { - FT_Done_FreeType(library); - ERR_FAIL_V_MSG(ERR_CANT_OPEN, "Cannot open font file '" + font->font_path + "'."); - } - - size_t len = f->get_len(); - _fontdata[font->font_path] = Vector<uint8_t>(); - Vector<uint8_t> &fontdata = _fontdata[font->font_path]; - fontdata.resize(len); - f->get_buffer(fontdata.ptrw(), len); - font->set_font_ptr(fontdata.ptr(), len); - f->close(); - } - } - - if (font->font_mem == nullptr && font->font_path != String()) { - FileAccess *f = FileAccess::open(font->font_path, FileAccess::READ); - if (!f) { - FT_Done_FreeType(library); - ERR_FAIL_V_MSG(ERR_CANT_OPEN, "Cannot open font file '" + font->font_path + "'."); - } - - memset(&stream, 0, sizeof(FT_StreamRec)); - stream.base = nullptr; - stream.size = f->get_len(); - stream.pos = 0; - stream.descriptor.pointer = f; - stream.read = _ft_stream_io; - stream.close = _ft_stream_close; - - FT_Open_Args fargs; - memset(&fargs, 0, sizeof(FT_Open_Args)); - fargs.flags = FT_OPEN_STREAM; - fargs.stream = &stream; - error = FT_Open_Face(library, &fargs, 0, &face); - } else if (font->font_mem) { - memset(&stream, 0, sizeof(FT_StreamRec)); - stream.base = (unsigned char *)font->font_mem; - stream.size = font->font_mem_size; - stream.pos = 0; - - FT_Open_Args fargs; - memset(&fargs, 0, sizeof(FT_Open_Args)); - fargs.memory_base = (unsigned char *)font->font_mem; - fargs.memory_size = font->font_mem_size; - fargs.flags = FT_OPEN_MEMORY; - fargs.stream = &stream; - error = FT_Open_Face(library, &fargs, 0, &face); - - } else { - FT_Done_FreeType(library); - ERR_FAIL_V_MSG(ERR_UNCONFIGURED, "DynamicFont uninitialized."); - } - - //error = FT_New_Face( library, src_path.utf8().get_data(),0,&face ); - - if (error == FT_Err_Unknown_File_Format) { - FT_Done_FreeType(library); - ERR_FAIL_V_MSG(ERR_FILE_CANT_OPEN, "Unknown font format."); - - } else if (error) { - FT_Done_FreeType(library); - ERR_FAIL_V_MSG(ERR_FILE_CANT_OPEN, "Error loading font."); - } - - if (FT_HAS_COLOR(face) && face->num_fixed_sizes > 0) { - int best_match = 0; - int diff = ABS(id.size - ((int64_t)face->available_sizes[0].width)); - scale_color_font = float(id.size * oversampling) / face->available_sizes[0].width; - for (int i = 1; i < face->num_fixed_sizes; i++) { - int ndiff = ABS(id.size - ((int64_t)face->available_sizes[i].width)); - if (ndiff < diff) { - best_match = i; - diff = ndiff; - scale_color_font = float(id.size * oversampling) / face->available_sizes[i].width; - } - } - FT_Select_Size(face, best_match); - } else { - FT_Set_Pixel_Sizes(face, 0, id.size * oversampling); - } - - ascent = (face->size->metrics.ascender / 64.0) / oversampling * scale_color_font; - descent = (-face->size->metrics.descender / 64.0) / oversampling * scale_color_font; - underline_position = -face->underline_position / 64.0 / oversampling * scale_color_font; - underline_thickness = face->underline_thickness / 64.0 / oversampling * scale_color_font; - linegap = 0; - - valid = true; - return OK; -} - -float DynamicFontAtSize::font_oversampling = 1.0; - -float DynamicFontAtSize::get_height() const { - return ascent + descent; -} - -float DynamicFontAtSize::get_ascent() const { - return ascent; -} - -float DynamicFontAtSize::get_descent() const { - return descent; -} - -float DynamicFontAtSize::get_underline_position() const { - return underline_position; -} - -float DynamicFontAtSize::get_underline_thickness() const { - return underline_thickness; -} - -const Pair<const DynamicFontAtSize::Character *, DynamicFontAtSize *> DynamicFontAtSize::_find_char_with_font(char32_t p_char, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks) const { - const Character *chr = char_map.getptr(p_char); - ERR_FAIL_COND_V(!chr, (Pair<const Character *, DynamicFontAtSize *>(nullptr, nullptr))); - - if (!chr->found) { - //not found, try in fallbacks - for (int i = 0; i < p_fallbacks.size(); i++) { - DynamicFontAtSize *fb = const_cast<DynamicFontAtSize *>(p_fallbacks[i].ptr()); - if (!fb->valid) { - continue; - } - - fb->_update_char(p_char); - const Character *fallback_chr = fb->char_map.getptr(p_char); - ERR_CONTINUE(!fallback_chr); - - if (!fallback_chr->found) { - continue; - } - - return Pair<const Character *, DynamicFontAtSize *>(fallback_chr, fb); - } - - //not found, try 0xFFFD to display 'not found'. - const_cast<DynamicFontAtSize *>(this)->_update_char(0xFFFD); - chr = char_map.getptr(0xFFFD); - ERR_FAIL_COND_V(!chr, (Pair<const Character *, DynamicFontAtSize *>(nullptr, nullptr))); - } - - return Pair<const Character *, DynamicFontAtSize *>(chr, const_cast<DynamicFontAtSize *>(this)); -} - -Size2 DynamicFontAtSize::get_char_size(char32_t p_char, char32_t p_next, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks) const { - if (!valid) { - return Size2(1, 1); - } - const_cast<DynamicFontAtSize *>(this)->_update_char(p_char); - - Pair<const Character *, DynamicFontAtSize *> char_pair_with_font = _find_char_with_font(p_char, p_fallbacks); - const Character *ch = char_pair_with_font.first; - ERR_FAIL_COND_V(!ch, Size2()); - - Size2 ret(0, get_height()); - - if (ch->found) { - ret.x = ch->advance; - } - - return ret; -} - -String DynamicFontAtSize::get_available_chars() const { - String chars; - - FT_UInt gindex; - FT_ULong charcode = FT_Get_First_Char(face, &gindex); - while (gindex != 0) { - if (charcode != 0) { - chars += char32_t(charcode); - } - charcode = FT_Get_Next_Char(face, charcode, &gindex); - } - - return chars; -} - -float DynamicFontAtSize::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, const Color &p_modulate, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks, bool p_advance_only, bool p_outline) const { - if (!valid) { - return 0; - } - - const_cast<DynamicFontAtSize *>(this)->_update_char(p_char); - - Pair<const Character *, DynamicFontAtSize *> char_pair_with_font = _find_char_with_font(p_char, p_fallbacks); - const Character *ch = char_pair_with_font.first; - DynamicFontAtSize *font = char_pair_with_font.second; - - ERR_FAIL_COND_V(!ch, 0.0); - - float advance = 0.0; - - // use normal character size if there's no outline character - if (p_outline && !ch->found) { - FT_GlyphSlot slot = face->glyph; - int error = FT_Load_Char(face, p_char, FT_HAS_COLOR(face) ? FT_LOAD_COLOR : FT_LOAD_DEFAULT); - if (!error) { - error = FT_Render_Glyph(face->glyph, FT_RENDER_MODE_NORMAL); - if (!error) { - Character character = Character::not_found(); - character = const_cast<DynamicFontAtSize *>(this)->_bitmap_to_character(slot->bitmap, slot->bitmap_top, slot->bitmap_left, slot->advance.x / 64.0); - advance = character.advance; - } - } - } - - if (ch->found) { - ERR_FAIL_COND_V(ch->texture_idx < -1 || ch->texture_idx >= font->textures.size(), 0); - - if (!p_advance_only && ch->texture_idx != -1) { - Point2 cpos = p_pos; - cpos.x += ch->h_align; - cpos.y -= font->get_ascent(); - cpos.y += ch->v_align; - Color modulate = p_modulate; - if (FT_HAS_COLOR(face)) { - modulate.r = modulate.g = modulate.b = 1.0; - } - RID texture = font->textures[ch->texture_idx].texture->get_rid(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, ch->rect.size), texture, ch->rect_uv, modulate, false, RID(), RID(), Color(1, 1, 1, 1), false); - } - - advance = ch->advance; - } - - return advance; -} - -unsigned long DynamicFontAtSize::_ft_stream_io(FT_Stream stream, unsigned long offset, unsigned char *buffer, unsigned long count) { - FileAccess *f = (FileAccess *)stream->descriptor.pointer; - - if (f->get_position() != offset) { - f->seek(offset); - } - - if (count == 0) { - return 0; - } - - return f->get_buffer(buffer, count); -} - -void DynamicFontAtSize::_ft_stream_close(FT_Stream stream) { - FileAccess *f = (FileAccess *)stream->descriptor.pointer; - f->close(); - memdelete(f); -} - -DynamicFontAtSize::Character DynamicFontAtSize::Character::not_found() { - Character ch; - ch.texture_idx = -1; - ch.advance = 0; - ch.h_align = 0; - ch.v_align = 0; - ch.found = false; - return ch; -} - -DynamicFontAtSize::TexturePosition DynamicFontAtSize::_find_texture_pos_for_glyph(int p_color_size, Image::Format p_image_format, int p_width, int p_height) { - TexturePosition ret; - ret.index = -1; - ret.x = 0; - ret.y = 0; - - int mw = p_width; - int mh = p_height; - - for (int i = 0; i < textures.size(); i++) { - const CharTexture &ct = textures[i]; - - if (ct.texture->get_format() != p_image_format) { - continue; - } - - if (mw > ct.texture_size || mh > ct.texture_size) { //too big for this texture - continue; - } - - ret.y = 0x7FFFFFFF; - ret.x = 0; - - for (int j = 0; j < ct.texture_size - mw; j++) { - int max_y = 0; - - for (int k = j; k < j + mw; k++) { - int y = ct.offsets[k]; - if (y > max_y) { - max_y = y; - } - } - - if (max_y < ret.y) { - ret.y = max_y; - ret.x = j; - } - } - - if (ret.y == 0x7FFFFFFF || ret.y + mh > ct.texture_size) { - continue; //fail, could not fit it here - } - - ret.index = i; - break; - } - - if (ret.index == -1) { - //could not find texture to fit, create one - ret.x = 0; - ret.y = 0; - - int texsize = MAX(id.size * oversampling * 8, 256); - if (mw > texsize) { - texsize = mw; //special case, adapt to it? - } - if (mh > texsize) { - texsize = mh; //special case, adapt to it? - } - - texsize = next_power_of_2(texsize); - - texsize = MIN(texsize, 4096); - - CharTexture tex; - tex.texture_size = texsize; - tex.imgdata.resize(texsize * texsize * p_color_size); //grayscale alpha - - { - //zero texture - uint8_t *w = tex.imgdata.ptrw(); - ERR_FAIL_COND_V(texsize * texsize * p_color_size > tex.imgdata.size(), ret); - for (int i = 0; i < texsize * texsize * p_color_size; i++) { - w[i] = 0; - } - } - tex.offsets.resize(texsize); - for (int i = 0; i < texsize; i++) { //zero offsets - tex.offsets.write[i] = 0; - } - - textures.push_back(tex); - ret.index = textures.size() - 1; - } - - return ret; -} - -DynamicFontAtSize::Character DynamicFontAtSize::_bitmap_to_character(FT_Bitmap bitmap, int yofs, int xofs, float advance) { - int w = bitmap.width; - int h = bitmap.rows; - - int mw = w + rect_margin * 2; - int mh = h + rect_margin * 2; - - ERR_FAIL_COND_V(mw > 4096, Character::not_found()); - ERR_FAIL_COND_V(mh > 4096, Character::not_found()); - - int color_size = bitmap.pixel_mode == FT_PIXEL_MODE_BGRA ? 4 : 2; - Image::Format require_format = color_size == 4 ? Image::FORMAT_RGBA8 : Image::FORMAT_LA8; - - TexturePosition tex_pos = _find_texture_pos_for_glyph(color_size, require_format, mw, mh); - ERR_FAIL_COND_V(tex_pos.index < 0, Character::not_found()); - - //fit character in char texture - - CharTexture &tex = textures.write[tex_pos.index]; - - { - uint8_t *wr = tex.imgdata.ptrw(); - - for (int i = 0; i < h; i++) { - for (int j = 0; j < w; j++) { - int ofs = ((i + tex_pos.y + rect_margin) * tex.texture_size + j + tex_pos.x + rect_margin) * color_size; - ERR_FAIL_COND_V(ofs >= tex.imgdata.size(), Character::not_found()); - switch (bitmap.pixel_mode) { - case FT_PIXEL_MODE_MONO: { - int byte = i * bitmap.pitch + (j >> 3); - int bit = 1 << (7 - (j % 8)); - wr[ofs + 0] = 255; //grayscale as 1 - wr[ofs + 1] = (bitmap.buffer[byte] & bit) ? 255 : 0; - } break; - case FT_PIXEL_MODE_GRAY: - wr[ofs + 0] = 255; //grayscale as 1 - wr[ofs + 1] = bitmap.buffer[i * bitmap.pitch + j]; - break; - case FT_PIXEL_MODE_BGRA: { - int ofs_color = i * bitmap.pitch + (j << 2); - wr[ofs + 2] = bitmap.buffer[ofs_color + 0]; - wr[ofs + 1] = bitmap.buffer[ofs_color + 1]; - wr[ofs + 0] = bitmap.buffer[ofs_color + 2]; - wr[ofs + 3] = bitmap.buffer[ofs_color + 3]; - } break; - // TODO: FT_PIXEL_MODE_LCD - default: - ERR_FAIL_V_MSG(Character::not_found(), "Font uses unsupported pixel format: " + itos(bitmap.pixel_mode) + "."); - break; - } - } - } - } - - //blit to image and texture - { - Ref<Image> img = memnew(Image(tex.texture_size, tex.texture_size, 0, require_format, tex.imgdata)); - - if (tex.texture.is_null()) { - tex.texture.instance(); - tex.texture->create_from_image(img); - } else { - tex.texture->update(img); //update - } - } - - // update height array - - for (int k = tex_pos.x; k < tex_pos.x + mw; k++) { - tex.offsets.write[k] = tex_pos.y + mh; - } - - Character chr; - chr.h_align = xofs * scale_color_font / oversampling; - chr.v_align = ascent - (yofs * scale_color_font / oversampling); // + ascent - descent; - chr.advance = advance * scale_color_font / oversampling; - chr.texture_idx = tex_pos.index; - chr.found = true; - - chr.rect_uv = Rect2(tex_pos.x + rect_margin, tex_pos.y + rect_margin, w, h); - chr.rect = chr.rect_uv; - chr.rect.position /= oversampling; - chr.rect.size = chr.rect.size * scale_color_font / oversampling; - return chr; -} - -DynamicFontAtSize::Character DynamicFontAtSize::_make_outline_char(char32_t p_char) { - Character ret = Character::not_found(); - - if (FT_Load_Char(face, p_char, FT_LOAD_NO_BITMAP | (font->force_autohinter ? FT_LOAD_FORCE_AUTOHINT : 0)) != 0) { - return ret; - } - - FT_Stroker stroker; - if (FT_Stroker_New(library, &stroker) != 0) { - return ret; - } - - FT_Stroker_Set(stroker, (int)(id.outline_size * oversampling * 64.0), FT_STROKER_LINECAP_BUTT, FT_STROKER_LINEJOIN_ROUND, 0); - FT_Glyph glyph; - FT_BitmapGlyph glyph_bitmap; - - if (FT_Get_Glyph(face->glyph, &glyph) != 0) { - goto cleanup_stroker; - } - if (FT_Glyph_Stroke(&glyph, stroker, 1) != 0) { - goto cleanup_glyph; - } - if (FT_Glyph_To_Bitmap(&glyph, font->antialiased ? FT_RENDER_MODE_NORMAL : FT_RENDER_MODE_MONO, nullptr, 1) != 0) { - goto cleanup_glyph; - } - - glyph_bitmap = (FT_BitmapGlyph)glyph; - ret = _bitmap_to_character(glyph_bitmap->bitmap, glyph_bitmap->top, glyph_bitmap->left, glyph->advance.x / 65536.0); - -cleanup_glyph: - FT_Done_Glyph(glyph); -cleanup_stroker: - FT_Stroker_Done(stroker); - return ret; -} - -void DynamicFontAtSize::_update_char(char32_t p_char) { - if (char_map.has(p_char)) { - return; - } - - _THREAD_SAFE_METHOD_ - - Character character = Character::not_found(); - - FT_GlyphSlot slot = face->glyph; - - if (FT_Get_Char_Index(face, p_char) == 0) { - char_map[p_char] = character; - return; - } - - int ft_hinting; - - switch (font->hinting) { - case DynamicFontData::HINTING_NONE: - ft_hinting = FT_LOAD_NO_HINTING; - break; - case DynamicFontData::HINTING_LIGHT: - ft_hinting = FT_LOAD_TARGET_LIGHT; - break; - default: - ft_hinting = FT_LOAD_TARGET_NORMAL; - break; - } - - int error = FT_Load_Char(face, p_char, FT_HAS_COLOR(face) ? FT_LOAD_COLOR : FT_LOAD_DEFAULT | (font->force_autohinter ? FT_LOAD_FORCE_AUTOHINT : 0) | ft_hinting); - if (error) { - char_map[p_char] = character; - return; - } - - if (id.outline_size > 0) { - character = _make_outline_char(p_char); - } else { - error = FT_Render_Glyph(face->glyph, font->antialiased ? FT_RENDER_MODE_NORMAL : FT_RENDER_MODE_MONO); - if (!error) { - character = _bitmap_to_character(slot->bitmap, slot->bitmap_top, slot->bitmap_left, slot->advance.x / 64.0); - } - } - - char_map[p_char] = character; -} - -void DynamicFontAtSize::update_oversampling() { - if (oversampling == font_oversampling || !valid) { - return; - } - - FT_Done_FreeType(library); - textures.clear(); - char_map.clear(); - oversampling = font_oversampling; - valid = false; - _load(); -} - -DynamicFontAtSize::DynamicFontAtSize() { - valid = false; - rect_margin = 1; - ascent = 1; - descent = 1; - linegap = 1; - oversampling = font_oversampling; - scale_color_font = 1; -} - -DynamicFontAtSize::~DynamicFontAtSize() { - if (valid) { - FT_Done_FreeType(library); - } - font->size_cache.erase(id); - font.unref(); -} - -///////////////////////// - -void DynamicFont::_reload_cache() { - ERR_FAIL_COND(cache_id.size < 1); - if (!data.is_valid()) { - data_at_size.unref(); - outline_data_at_size.unref(); - fallbacks.resize(0); - fallback_data_at_size.resize(0); - fallback_outline_data_at_size.resize(0); - return; - } - - data_at_size = data->_get_dynamic_font_at_size(cache_id); - if (outline_cache_id.outline_size > 0) { - outline_data_at_size = data->_get_dynamic_font_at_size(outline_cache_id); - fallback_outline_data_at_size.resize(fallback_data_at_size.size()); - } else { - outline_data_at_size.unref(); - fallback_outline_data_at_size.resize(0); - } - - for (int i = 0; i < fallbacks.size(); i++) { - fallback_data_at_size.write[i] = fallbacks.write[i]->_get_dynamic_font_at_size(cache_id); - if (outline_cache_id.outline_size > 0) { - fallback_outline_data_at_size.write[i] = fallbacks.write[i]->_get_dynamic_font_at_size(outline_cache_id); - } - } - - emit_changed(); - _change_notify(); -} - -void DynamicFont::set_font_data(const Ref<DynamicFontData> &p_data) { - data = p_data; - _reload_cache(); - - emit_changed(); - _change_notify(); -} - -Ref<DynamicFontData> DynamicFont::get_font_data() const { - return data; -} - -void DynamicFont::set_size(int p_size) { - if (cache_id.size == p_size) { - return; - } - cache_id.size = p_size; - outline_cache_id.size = p_size; - _reload_cache(); -} - -int DynamicFont::get_size() const { - return cache_id.size; -} - -void DynamicFont::set_outline_size(int p_size) { - if (outline_cache_id.outline_size == p_size) { - return; - } - ERR_FAIL_COND(p_size < 0 || p_size > UINT8_MAX); - outline_cache_id.outline_size = p_size; - _reload_cache(); -} - -int DynamicFont::get_outline_size() const { - return outline_cache_id.outline_size; -} - -void DynamicFont::set_outline_color(Color p_color) { - if (p_color != outline_color) { - outline_color = p_color; - emit_changed(); - _change_notify(); - } -} - -Color DynamicFont::get_outline_color() const { - return outline_color; -} - -bool DynamicFontData::is_antialiased() const { - return antialiased; -} - -void DynamicFontData::set_antialiased(bool p_antialiased) { - if (antialiased == p_antialiased) { - return; - } - antialiased = p_antialiased; -} - -DynamicFontData::Hinting DynamicFontData::get_hinting() const { - return hinting; -} - -void DynamicFontData::set_hinting(Hinting p_hinting) { - if (hinting == p_hinting) { - return; - } - hinting = p_hinting; -} - -int DynamicFont::get_spacing(int p_type) const { - if (p_type == SPACING_TOP) { - return spacing_top; - } else if (p_type == SPACING_BOTTOM) { - return spacing_bottom; - } else if (p_type == SPACING_CHAR) { - return spacing_char; - } else if (p_type == SPACING_SPACE) { - return spacing_space; - } - - return 0; -} - -void DynamicFont::set_spacing(int p_type, int p_value) { - if (p_type == SPACING_TOP) { - spacing_top = p_value; - } else if (p_type == SPACING_BOTTOM) { - spacing_bottom = p_value; - } else if (p_type == SPACING_CHAR) { - spacing_char = p_value; - } else if (p_type == SPACING_SPACE) { - spacing_space = p_value; - } - - emit_changed(); - _change_notify(); -} - -float DynamicFont::get_height() const { - if (!data_at_size.is_valid()) { - return 1; - } - - return data_at_size->get_height() + spacing_top + spacing_bottom; -} - -float DynamicFont::get_ascent() const { - if (!data_at_size.is_valid()) { - return 1; - } - - return data_at_size->get_ascent() + spacing_top; -} - -float DynamicFont::get_descent() const { - if (!data_at_size.is_valid()) { - return 1; - } - - return data_at_size->get_descent() + spacing_bottom; -} - -float DynamicFont::get_underline_position() const { - if (!data_at_size.is_valid()) { - return 2; - } - - return data_at_size->get_underline_position(); -} - -float DynamicFont::get_underline_thickness() const { - if (!data_at_size.is_valid()) { - return 1; - } - - return data_at_size->get_underline_thickness(); -} - -Size2 DynamicFont::get_char_size(char32_t p_char, char32_t p_next) const { - if (!data_at_size.is_valid()) { - return Size2(1, 1); - } - - Size2 ret = data_at_size->get_char_size(p_char, p_next, fallback_data_at_size); - if (p_char == ' ') { - ret.width += spacing_space + spacing_char; - } else if (p_next) { - ret.width += spacing_char; - } - - return ret; -} - -String DynamicFont::get_available_chars() const { - if (!data_at_size.is_valid()) { - return ""; - } - - String chars = data_at_size->get_available_chars(); - - for (int i = 0; i < fallback_data_at_size.size(); i++) { - String fallback_chars = fallback_data_at_size[i]->get_available_chars(); - for (int j = 0; j < fallback_chars.length(); j++) { - if (chars.find_char(fallback_chars[j]) == -1) { - chars += fallback_chars[j]; - } - } - } - - return chars; -} - -bool DynamicFont::is_distance_field_hint() const { - return false; -} - -bool DynamicFont::has_outline() const { - return outline_cache_id.outline_size > 0; -} - -float DynamicFont::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, const Color &p_modulate, bool p_outline) const { - const Ref<DynamicFontAtSize> &font_at_size = p_outline && outline_cache_id.outline_size > 0 ? outline_data_at_size : data_at_size; - - if (!font_at_size.is_valid()) { - return 0; - } - - const Vector<Ref<DynamicFontAtSize>> &fallbacks = p_outline && outline_cache_id.outline_size > 0 ? fallback_outline_data_at_size : fallback_data_at_size; - Color color = p_outline && outline_cache_id.outline_size > 0 ? p_modulate * outline_color : p_modulate; - - // If requested outline draw, but no outline is present, simply return advance without drawing anything - bool advance_only = p_outline && outline_cache_id.outline_size == 0; - return font_at_size->draw_char(p_canvas_item, p_pos, p_char, p_next, color, fallbacks, advance_only, p_outline) + spacing_char; -} - -void DynamicFont::set_fallback(int p_idx, const Ref<DynamicFontData> &p_data) { - ERR_FAIL_COND(p_data.is_null()); - ERR_FAIL_INDEX(p_idx, fallbacks.size()); - fallbacks.write[p_idx] = p_data; - fallback_data_at_size.write[p_idx] = fallbacks.write[p_idx]->_get_dynamic_font_at_size(cache_id); -} - -void DynamicFont::add_fallback(const Ref<DynamicFontData> &p_data) { - ERR_FAIL_COND(p_data.is_null()); - fallbacks.push_back(p_data); - fallback_data_at_size.push_back(fallbacks.write[fallbacks.size() - 1]->_get_dynamic_font_at_size(cache_id)); //const.. - if (outline_cache_id.outline_size > 0) { - fallback_outline_data_at_size.push_back(fallbacks.write[fallbacks.size() - 1]->_get_dynamic_font_at_size(outline_cache_id)); - } - - _change_notify(); - emit_changed(); - _change_notify(); -} - -int DynamicFont::get_fallback_count() const { - return fallbacks.size(); -} - -Ref<DynamicFontData> DynamicFont::get_fallback(int p_idx) const { - ERR_FAIL_INDEX_V(p_idx, fallbacks.size(), Ref<DynamicFontData>()); - - return fallbacks[p_idx]; -} - -void DynamicFont::remove_fallback(int p_idx) { - ERR_FAIL_INDEX(p_idx, fallbacks.size()); - fallbacks.remove(p_idx); - fallback_data_at_size.remove(p_idx); - emit_changed(); - _change_notify(); -} - -bool DynamicFont::_set(const StringName &p_name, const Variant &p_value) { - String str = p_name; - if (str.begins_with("fallback/")) { - int idx = str.get_slicec('/', 1).to_int(); - Ref<DynamicFontData> fd = p_value; - - if (fd.is_valid()) { - if (idx == fallbacks.size()) { - add_fallback(fd); - return true; - } else if (idx >= 0 && idx < fallbacks.size()) { - set_fallback(idx, fd); - return true; - } else { - return false; - } - } else if (idx >= 0 && idx < fallbacks.size()) { - remove_fallback(idx); - return true; - } - } - - return false; -} - -bool DynamicFont::_get(const StringName &p_name, Variant &r_ret) const { - String str = p_name; - if (str.begins_with("fallback/")) { - int idx = str.get_slicec('/', 1).to_int(); - - if (idx == fallbacks.size()) { - r_ret = Ref<DynamicFontData>(); - return true; - } else if (idx >= 0 && idx < fallbacks.size()) { - r_ret = get_fallback(idx); - return true; - } - } - - return false; -} - -void DynamicFont::_get_property_list(List<PropertyInfo> *p_list) const { - for (int i = 0; i < fallbacks.size(); i++) { - p_list->push_back(PropertyInfo(Variant::OBJECT, "fallback/" + itos(i), PROPERTY_HINT_RESOURCE_TYPE, "DynamicFontData")); - } - - p_list->push_back(PropertyInfo(Variant::OBJECT, "fallback/" + itos(fallbacks.size()), PROPERTY_HINT_RESOURCE_TYPE, "DynamicFontData")); -} - -void DynamicFont::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_font_data", "data"), &DynamicFont::set_font_data); - ClassDB::bind_method(D_METHOD("get_font_data"), &DynamicFont::get_font_data); - - ClassDB::bind_method(D_METHOD("get_available_chars"), &DynamicFont::get_available_chars); - - ClassDB::bind_method(D_METHOD("set_size", "data"), &DynamicFont::set_size); - ClassDB::bind_method(D_METHOD("get_size"), &DynamicFont::get_size); - - ClassDB::bind_method(D_METHOD("set_outline_size", "size"), &DynamicFont::set_outline_size); - ClassDB::bind_method(D_METHOD("get_outline_size"), &DynamicFont::get_outline_size); - - ClassDB::bind_method(D_METHOD("set_outline_color", "color"), &DynamicFont::set_outline_color); - ClassDB::bind_method(D_METHOD("get_outline_color"), &DynamicFont::get_outline_color); - - ClassDB::bind_method(D_METHOD("set_spacing", "type", "value"), &DynamicFont::set_spacing); - ClassDB::bind_method(D_METHOD("get_spacing", "type"), &DynamicFont::get_spacing); - - ClassDB::bind_method(D_METHOD("add_fallback", "data"), &DynamicFont::add_fallback); - ClassDB::bind_method(D_METHOD("set_fallback", "idx", "data"), &DynamicFont::set_fallback); - ClassDB::bind_method(D_METHOD("get_fallback", "idx"), &DynamicFont::get_fallback); - ClassDB::bind_method(D_METHOD("remove_fallback", "idx"), &DynamicFont::remove_fallback); - ClassDB::bind_method(D_METHOD("get_fallback_count"), &DynamicFont::get_fallback_count); - - ADD_GROUP("Settings", ""); - ADD_PROPERTY(PropertyInfo(Variant::INT, "size", PROPERTY_HINT_RANGE, "1,1024,1"), "set_size", "get_size"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "outline_size", PROPERTY_HINT_RANGE, "0,1024,1"), "set_outline_size", "get_outline_size"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "outline_color"), "set_outline_color", "get_outline_color"); - ADD_GROUP("Extra Spacing", "extra_spacing"); - ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_top"), "set_spacing", "get_spacing", SPACING_TOP); - ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_bottom"), "set_spacing", "get_spacing", SPACING_BOTTOM); - ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_char"), "set_spacing", "get_spacing", SPACING_CHAR); - ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_space"), "set_spacing", "get_spacing", SPACING_SPACE); - ADD_GROUP("Font", ""); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "font_data", PROPERTY_HINT_RESOURCE_TYPE, "DynamicFontData"), "set_font_data", "get_font_data"); - - BIND_ENUM_CONSTANT(SPACING_TOP); - BIND_ENUM_CONSTANT(SPACING_BOTTOM); - BIND_ENUM_CONSTANT(SPACING_CHAR); - BIND_ENUM_CONSTANT(SPACING_SPACE); -} - -Mutex DynamicFont::dynamic_font_mutex; - -SelfList<DynamicFont>::List *DynamicFont::dynamic_fonts = nullptr; - -DynamicFont::DynamicFont() : - font_list(this) { - valid = false; - cache_id.size = 16; - outline_cache_id.size = 16; - spacing_top = 0; - spacing_bottom = 0; - spacing_char = 0; - spacing_space = 0; - outline_color = Color(1, 1, 1); - - MutexLock lock(dynamic_font_mutex); - dynamic_fonts->add(&font_list); -} - -DynamicFont::~DynamicFont() { - MutexLock lock(dynamic_font_mutex); - dynamic_fonts->remove(&font_list); -} - -void DynamicFont::initialize_dynamic_fonts() { - dynamic_fonts = memnew(SelfList<DynamicFont>::List()); -} - -void DynamicFont::finish_dynamic_fonts() { - memdelete(dynamic_fonts); - dynamic_fonts = nullptr; -} - -void DynamicFont::update_oversampling() { - Vector<Ref<DynamicFont>> changed; - { - MutexLock lock(dynamic_font_mutex); - - SelfList<DynamicFont> *E = dynamic_fonts->first(); - while (E) { - if (E->self()->data_at_size.is_valid()) { - E->self()->data_at_size->update_oversampling(); - - if (E->self()->outline_data_at_size.is_valid()) { - E->self()->outline_data_at_size->update_oversampling(); - } - - for (int i = 0; i < E->self()->fallback_data_at_size.size(); i++) { - if (E->self()->fallback_data_at_size[i].is_valid()) { - E->self()->fallback_data_at_size.write[i]->update_oversampling(); - - if (E->self()->has_outline() && E->self()->fallback_outline_data_at_size[i].is_valid()) { - E->self()->fallback_outline_data_at_size.write[i]->update_oversampling(); - } - } - } - - changed.push_back(Ref<DynamicFont>(E->self())); - } - - E = E->next(); - } - } - - for (int i = 0; i < changed.size(); i++) { - changed.write[i]->emit_changed(); - } -} - -///////////////////////// - -RES ResourceFormatLoaderDynamicFont::load(const String &p_path, const String &p_original_path, Error *r_error, bool p_use_sub_threads, float *r_progress, bool p_no_cache) { - if (r_error) { - *r_error = ERR_FILE_CANT_OPEN; - } - - Ref<DynamicFontData> dfont; - dfont.instance(); - dfont->set_font_path(p_path); - - if (r_error) { - *r_error = OK; - } - - return dfont; -} - -void ResourceFormatLoaderDynamicFont::get_recognized_extensions(List<String> *p_extensions) const { - p_extensions->push_back("ttf"); - p_extensions->push_back("otf"); -} - -bool ResourceFormatLoaderDynamicFont::handles_type(const String &p_type) const { - return (p_type == "DynamicFontData"); -} - -String ResourceFormatLoaderDynamicFont::get_resource_type(const String &p_path) const { - String el = p_path.get_extension().to_lower(); - if (el == "ttf" || el == "otf") { - return "DynamicFontData"; - } - return ""; -} - -#endif diff --git a/scene/resources/dynamic_font.h b/scene/resources/dynamic_font.h deleted file mode 100644 index a881e21da8..0000000000 --- a/scene/resources/dynamic_font.h +++ /dev/null @@ -1,316 +0,0 @@ -/*************************************************************************/ -/* dynamic_font.h */ -/*************************************************************************/ -/* This file is part of: */ -/* GODOT ENGINE */ -/* https://godotengine.org */ -/*************************************************************************/ -/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ -/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ -/* */ -/* Permission is hereby granted, free of charge, to any person obtaining */ -/* a copy of this software and associated documentation files (the */ -/* "Software"), to deal in the Software without restriction, including */ -/* without limitation the rights to use, copy, modify, merge, publish, */ -/* distribute, sublicense, and/or sell copies of the Software, and to */ -/* permit persons to whom the Software is furnished to do so, subject to */ -/* the following conditions: */ -/* */ -/* The above copyright notice and this permission notice shall be */ -/* included in all copies or substantial portions of the Software. */ -/* */ -/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ -/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ -/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ -/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ -/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ -/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ -/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ -/*************************************************************************/ - -#ifndef DYNAMIC_FONT_H -#define DYNAMIC_FONT_H - -#include "modules/modules_enabled.gen.h" -#ifdef MODULE_FREETYPE_ENABLED - -#include "core/io/resource_loader.h" -#include "core/os/mutex.h" -#include "core/os/thread_safe.h" -#include "core/pair.h" -#include "scene/resources/font.h" - -#include <ft2build.h> -#include FT_FREETYPE_H - -class DynamicFontAtSize; -class DynamicFont; - -class DynamicFontData : public Resource { - GDCLASS(DynamicFontData, Resource); - -public: - struct CacheID { - union { - struct { - uint32_t size : 16; - uint32_t outline_size : 8; - uint32_t unused : 8; - }; - uint32_t key; - }; - bool operator<(CacheID right) const; - CacheID() { - key = 0; - } - }; - - enum Hinting { - HINTING_NONE, - HINTING_LIGHT, - HINTING_NORMAL - }; - - bool is_antialiased() const; - void set_antialiased(bool p_antialiased); - Hinting get_hinting() const; - void set_hinting(Hinting p_hinting); - -private: - const uint8_t *font_mem; - int font_mem_size; - bool antialiased; - bool force_autohinter; - Hinting hinting; - - String font_path; - Map<CacheID, DynamicFontAtSize *> size_cache; - - friend class DynamicFontAtSize; - - friend class DynamicFont; - - Ref<DynamicFontAtSize> _get_dynamic_font_at_size(CacheID p_cache_id); - -protected: - static void _bind_methods(); - -public: - void set_font_ptr(const uint8_t *p_font_mem, int p_font_mem_size); - void set_font_path(const String &p_path); - String get_font_path() const; - void set_force_autohinter(bool p_force); - - DynamicFontData(); - ~DynamicFontData(); -}; - -VARIANT_ENUM_CAST(DynamicFontData::Hinting); - -class DynamicFontAtSize : public Reference { - GDCLASS(DynamicFontAtSize, Reference); - - _THREAD_SAFE_CLASS_ - - FT_Library library; /* handle to library */ - FT_Face face; /* handle to face object */ - FT_StreamRec stream; - - float ascent; - float descent; - float linegap; - float rect_margin; - float oversampling; - float scale_color_font; - float underline_position; - float underline_thickness; - - bool valid; - - struct CharTexture { - Vector<uint8_t> imgdata; - int texture_size; - Vector<int> offsets; - Ref<ImageTexture> texture; - }; - - Vector<CharTexture> textures; - - struct Character { - bool found; - int texture_idx; - Rect2 rect; - Rect2 rect_uv; - float v_align; - float h_align; - float advance; - - Character() { - texture_idx = 0; - v_align = 0; - } - - static Character not_found(); - }; - - struct TexturePosition { - int index; - int x; - int y; - }; - - const Pair<const Character *, DynamicFontAtSize *> _find_char_with_font(char32_t p_char, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks) const; - Character _make_outline_char(char32_t p_char); - TexturePosition _find_texture_pos_for_glyph(int p_color_size, Image::Format p_image_format, int p_width, int p_height); - Character _bitmap_to_character(FT_Bitmap bitmap, int yofs, int xofs, float advance); - - static unsigned long _ft_stream_io(FT_Stream stream, unsigned long offset, unsigned char *buffer, unsigned long count); - static void _ft_stream_close(FT_Stream stream); - - HashMap<char32_t, Character> char_map; - - _FORCE_INLINE_ void _update_char(char32_t p_char); - - friend class DynamicFontData; - Ref<DynamicFontData> font; - DynamicFontData::CacheID id; - - static HashMap<String, Vector<uint8_t>> _fontdata; - Error _load(); - -public: - static float font_oversampling; - - float get_height() const; - - float get_ascent() const; - float get_descent() const; - float get_underline_position() const; - float get_underline_thickness() const; - - Size2 get_char_size(char32_t p_char, char32_t p_next, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks) const; - String get_available_chars() const; - - float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, const Color &p_modulate, const Vector<Ref<DynamicFontAtSize>> &p_fallbacks, bool p_advance_only = false, bool p_outline = false) const; - - void set_texture_flags(uint32_t p_flags); - void update_oversampling(); - - DynamicFontAtSize(); - ~DynamicFontAtSize(); -}; - -/////////////// - -class DynamicFont : public Font { - GDCLASS(DynamicFont, Font); - -public: - enum SpacingType { - SPACING_TOP, - SPACING_BOTTOM, - SPACING_CHAR, - SPACING_SPACE - }; - -private: - Ref<DynamicFontData> data; - Ref<DynamicFontAtSize> data_at_size; - Ref<DynamicFontAtSize> outline_data_at_size; - - Vector<Ref<DynamicFontData>> fallbacks; - Vector<Ref<DynamicFontAtSize>> fallback_data_at_size; - Vector<Ref<DynamicFontAtSize>> fallback_outline_data_at_size; - - DynamicFontData::CacheID cache_id; - DynamicFontData::CacheID outline_cache_id; - - bool valid; - int spacing_top; - int spacing_bottom; - int spacing_char; - int spacing_space; - - Color outline_color; - -protected: - void _reload_cache(); - - bool _set(const StringName &p_name, const Variant &p_value); - bool _get(const StringName &p_name, Variant &r_ret) const; - void _get_property_list(List<PropertyInfo> *p_list) const; - - static void _bind_methods(); - -public: - void set_font_data(const Ref<DynamicFontData> &p_data); - Ref<DynamicFontData> get_font_data() const; - - void set_size(int p_size); - int get_size() const; - - void set_outline_size(int p_size); - int get_outline_size() const; - - void set_outline_color(Color p_color); - Color get_outline_color() const; - - bool get_use_mipmaps() const; - void set_use_mipmaps(bool p_enable); - - bool get_use_filter() const; - void set_use_filter(bool p_enable); - - int get_spacing(int p_type) const; - void set_spacing(int p_type, int p_value); - - void add_fallback(const Ref<DynamicFontData> &p_data); - void set_fallback(int p_idx, const Ref<DynamicFontData> &p_data); - int get_fallback_count() const; - Ref<DynamicFontData> get_fallback(int p_idx) const; - void remove_fallback(int p_idx); - - virtual float get_height() const override; - - virtual float get_ascent() const override; - virtual float get_descent() const override; - virtual float get_underline_position() const override; - virtual float get_underline_thickness() const override; - - virtual Size2 get_char_size(char32_t p_char, char32_t p_next = 0) const override; - String get_available_chars() const; - - virtual bool is_distance_field_hint() const override; - - virtual bool has_outline() const override; - - virtual float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, const Color &p_modulate = Color(1, 1, 1), bool p_outline = false) const override; - - SelfList<DynamicFont> font_list; - - static Mutex dynamic_font_mutex; - static SelfList<DynamicFont>::List *dynamic_fonts; - - static void initialize_dynamic_fonts(); - static void finish_dynamic_fonts(); - static void update_oversampling(); - - DynamicFont(); - ~DynamicFont(); -}; - -VARIANT_ENUM_CAST(DynamicFont::SpacingType); - -///////////// - -class ResourceFormatLoaderDynamicFont : public ResourceFormatLoader { -public: - virtual RES load(const String &p_path, const String &p_original_path = "", Error *r_error = nullptr, bool p_use_sub_threads = false, float *r_progress = nullptr, bool p_no_cache = false); - virtual void get_recognized_extensions(List<String> *p_extensions) const; - virtual bool handles_type(const String &p_type) const; - virtual String get_resource_type(const String &p_path) const; -}; - -#endif - -#endif diff --git a/scene/resources/environment.cpp b/scene/resources/environment.cpp index ee8e63266d..1eb78a3679 100644 --- a/scene/resources/environment.cpp +++ b/scene/resources/environment.cpp @@ -30,7 +30,8 @@ #include "environment.h" -#include "core/project_settings.h" +#include "core/config/project_settings.h" +#include "core/core_string_names.h" #include "servers/rendering_server.h" #include "texture.h" @@ -44,6 +45,9 @@ void Environment::set_background(BGMode p_bg) { bg_mode = p_bg; RS::get_singleton()->environment_set_background(environment, RS::EnvironmentBG(p_bg)); _change_notify(); + if (bg_mode != BG_SKY) { + set_fog_aerial_perspective(0.0); + } } Environment::BGMode Environment::get_background() const { @@ -578,22 +582,28 @@ bool Environment::is_glow_enabled() const { return glow_enabled; } -void Environment::set_glow_level_enabled(int p_level, bool p_enabled) { +void Environment::set_glow_level(int p_level, float p_intensity) { ERR_FAIL_INDEX(p_level, RS::MAX_GLOW_LEVELS); - if (p_enabled) { - glow_levels |= (1 << p_level); - } else { - glow_levels &= ~(1 << p_level); - } + glow_levels.write[p_level] = p_intensity; _update_glow(); } -bool Environment::is_glow_level_enabled(int p_level) const { - ERR_FAIL_INDEX_V(p_level, RS::MAX_GLOW_LEVELS, false); +float Environment::get_glow_level(int p_level) const { + ERR_FAIL_INDEX_V(p_level, RS::MAX_GLOW_LEVELS, 0.0); + + return glow_levels[p_level]; +} + +void Environment::set_glow_normalized(bool p_normalized) { + glow_normalize_levels = p_normalized; - return glow_levels & (1 << p_level); + _update_glow(); +} + +bool Environment::is_glow_normalized() const { + return glow_normalize_levels; } void Environment::set_glow_intensity(float p_intensity) { @@ -670,10 +680,24 @@ float Environment::get_glow_hdr_luminance_cap() const { } void Environment::_update_glow() { + Vector<float> normalized_levels; + if (glow_normalize_levels) { + normalized_levels.resize(7); + float size = 0.0; + for (int i = 0; i < glow_levels.size(); i++) { + size += glow_levels[i]; + } + for (int i = 0; i < glow_levels.size(); i++) { + normalized_levels.write[i] = glow_levels[i] / size; + } + } else { + normalized_levels = glow_levels; + } + RS::get_singleton()->environment_set_glow( environment, glow_enabled, - glow_levels, + normalized_levels, glow_intensity, glow_strength, glow_mix, @@ -739,6 +763,14 @@ float Environment::get_fog_height_density() const { return fog_height_density; } +void Environment::set_fog_aerial_perspective(float p_aerial_perspective) { + fog_aerial_perspective = p_aerial_perspective; + _update_fog(); +} +float Environment::get_fog_aerial_perspective() const { + return fog_aerial_perspective; +} + void Environment::_update_fog() { RS::get_singleton()->environment_set_fog( environment, @@ -748,7 +780,8 @@ void Environment::_update_fog() { fog_sun_scatter, fog_density, fog_height, - fog_height_density); + fog_height_density, + fog_aerial_perspective); } // Volumetric Fog @@ -859,23 +892,38 @@ float Environment::get_adjustment_saturation() const { return adjustment_saturation; } -void Environment::set_adjustment_color_correction(const Ref<Texture2D> &p_ramp) { - adjustment_color_correction = p_ramp; +void Environment::set_adjustment_color_correction(Ref<Texture> p_color_correction) { + adjustment_color_correction = p_color_correction; + Ref<GradientTexture> grad_tex = p_color_correction; + if (grad_tex.is_valid()) { + if (!grad_tex->is_connected(CoreStringNames::get_singleton()->changed, callable_mp(this, &Environment::_update_adjustment))) { + grad_tex->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &Environment::_update_adjustment)); + } + } + Ref<Texture2D> adjustment_texture_2d = adjustment_color_correction; + if (adjustment_texture_2d.is_valid()) { + use_1d_color_correction = true; + } else { + use_1d_color_correction = false; + } _update_adjustment(); } -Ref<Texture2D> Environment::get_adjustment_color_correction() const { +Ref<Texture> Environment::get_adjustment_color_correction() const { return adjustment_color_correction; } void Environment::_update_adjustment() { + RID color_correction = adjustment_color_correction.is_valid() ? adjustment_color_correction->get_rid() : RID(); + RS::get_singleton()->environment_set_adjustment( environment, adjustment_enabled, adjustment_brightness, adjustment_contrast, adjustment_saturation, - adjustment_color_correction.is_valid() ? adjustment_color_correction->get_rid() : RID()); + use_1d_color_correction, + color_correction); } // Private methods, constructor and destructor @@ -887,6 +935,12 @@ void Environment::_validate_property(PropertyInfo &property) const { } } + if (property.name == "fog_aerial_perspective") { + if (bg_mode != BG_SKY) { + property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + } + } + if (property.name == "glow_intensity" && glow_blend_mode == GLOW_BLEND_MODE_MIX) { property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; } @@ -1162,8 +1216,10 @@ void Environment::_bind_methods() { ClassDB::bind_method(D_METHOD("set_glow_enabled", "enabled"), &Environment::set_glow_enabled); ClassDB::bind_method(D_METHOD("is_glow_enabled"), &Environment::is_glow_enabled); - ClassDB::bind_method(D_METHOD("set_glow_level_enabled", "idx", "enabled"), &Environment::set_glow_level_enabled); - ClassDB::bind_method(D_METHOD("is_glow_level_enabled", "idx"), &Environment::is_glow_level_enabled); + ClassDB::bind_method(D_METHOD("set_glow_level", "idx", "intensity"), &Environment::set_glow_level); + ClassDB::bind_method(D_METHOD("get_glow_level", "idx"), &Environment::get_glow_level); + ClassDB::bind_method(D_METHOD("set_glow_normalized", "normalize"), &Environment::set_glow_normalized); + ClassDB::bind_method(D_METHOD("is_glow_normalized"), &Environment::is_glow_normalized); ClassDB::bind_method(D_METHOD("set_glow_intensity", "intensity"), &Environment::set_glow_intensity); ClassDB::bind_method(D_METHOD("get_glow_intensity"), &Environment::get_glow_intensity); ClassDB::bind_method(D_METHOD("set_glow_strength", "strength"), &Environment::set_glow_strength); @@ -1183,13 +1239,14 @@ void Environment::_bind_methods() { ADD_GROUP("Glow", "glow_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_enabled"), "set_glow_enabled", "is_glow_enabled"); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/1"), "set_glow_level_enabled", "is_glow_level_enabled", 0); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/2"), "set_glow_level_enabled", "is_glow_level_enabled", 1); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/3"), "set_glow_level_enabled", "is_glow_level_enabled", 2); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/4"), "set_glow_level_enabled", "is_glow_level_enabled", 3); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/5"), "set_glow_level_enabled", "is_glow_level_enabled", 4); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/6"), "set_glow_level_enabled", "is_glow_level_enabled", 5); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/7"), "set_glow_level_enabled", "is_glow_level_enabled", 6); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/1", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 0); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/2", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 1); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/3", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 2); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/4", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 3); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/5", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 4); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/6", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 5); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/7", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 6); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_normalized"), "set_glow_normalized", "is_glow_normalized"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_intensity", PROPERTY_HINT_RANGE, "0.0,8.0,0.01"), "set_glow_intensity", "get_glow_intensity"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_strength", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_glow_strength", "get_glow_strength"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_mix", PROPERTY_HINT_RANGE, "0.0,1.0,0.001"), "set_glow_mix", "get_glow_mix"); @@ -1219,6 +1276,9 @@ void Environment::_bind_methods() { ClassDB::bind_method(D_METHOD("set_fog_height_density", "height_density"), &Environment::set_fog_height_density); ClassDB::bind_method(D_METHOD("get_fog_height_density"), &Environment::get_fog_height_density); + ClassDB::bind_method(D_METHOD("set_fog_aerial_perspective", "aerial_perspective"), &Environment::set_fog_aerial_perspective); + ClassDB::bind_method(D_METHOD("get_fog_aerial_perspective"), &Environment::get_fog_aerial_perspective); + ADD_GROUP("Fog", "fog_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fog_enabled"), "set_fog_enabled", "is_fog_enabled"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "fog_light_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_fog_light_color", "get_fog_light_color"); @@ -1226,6 +1286,7 @@ void Environment::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_sun_scatter", PROPERTY_HINT_RANGE, "0,1,0.01,or_greater"), "set_fog_sun_scatter", "get_fog_sun_scatter"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_density", PROPERTY_HINT_RANGE, "0,16,0.0001"), "set_fog_density", "get_fog_density"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_aerial_perspective", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_fog_aerial_perspective", "get_fog_aerial_perspective"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height", PROPERTY_HINT_RANGE, "-1024,1024,0.01,or_lesser,or_greater"), "set_fog_height", "get_fog_height"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height_density", PROPERTY_HINT_RANGE, "0,128,0.001,or_greater"), "set_fog_height_density", "get_fog_height_density"); @@ -1274,7 +1335,7 @@ void Environment::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "adjustment_brightness", PROPERTY_HINT_RANGE, "0.01,8,0.01"), "set_adjustment_brightness", "get_adjustment_brightness"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "adjustment_contrast", PROPERTY_HINT_RANGE, "0.01,8,0.01"), "set_adjustment_contrast", "get_adjustment_contrast"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "adjustment_saturation", PROPERTY_HINT_RANGE, "0.01,8,0.01"), "set_adjustment_saturation", "get_adjustment_saturation"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "adjustment_color_correction", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_adjustment_color_correction", "get_adjustment_color_correction"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "adjustment_color_correction", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D,Texture3D"), "set_adjustment_color_correction", "get_adjustment_color_correction"); // Constants @@ -1329,6 +1390,16 @@ Environment::Environment() { environment = RS::get_singleton()->environment_create(); set_camera_feed_id(bg_camera_feed_id); + + glow_levels.resize(7); + glow_levels.write[0] = 0.0; + glow_levels.write[1] = 0.0; + glow_levels.write[2] = 1.0; + glow_levels.write[3] = 0.0; + glow_levels.write[4] = 1.0; + glow_levels.write[5] = 0.0; + glow_levels.write[6] = 0.0; + _update_ambient_light(); _update_tonemap(); _update_ssr(); diff --git a/scene/resources/environment.h b/scene/resources/environment.h index d4d84f31aa..106ba92bfe 100644 --- a/scene/resources/environment.h +++ b/scene/resources/environment.h @@ -31,7 +31,7 @@ #ifndef ENVIRONMENT_H #define ENVIRONMENT_H -#include "core/resource.h" +#include "core/io/resource.h" #include "scene/resources/sky.h" #include "scene/resources/texture.h" #include "servers/rendering_server.h" @@ -171,7 +171,8 @@ private: // Glow bool glow_enabled = false; - int glow_levels = (1 << 2) | (1 << 4); + Vector<float> glow_levels; + bool glow_normalize_levels = false; float glow_intensity = 0.8; float glow_strength = 1.0; float glow_mix = 0.05; @@ -190,6 +191,7 @@ private: float fog_density = 0.001; float fog_height = 0.0; float fog_height_density = 0.0; //can be negative to invert effect + float fog_aerial_perspective = 0.0; void _update_fog(); @@ -209,7 +211,8 @@ private: float adjustment_brightness = 1.0; float adjustment_contrast = 1.0; float adjustment_saturation = 1.0; - Ref<Texture2D> adjustment_color_correction; + bool use_1d_color_correction = true; + Ref<Texture> adjustment_color_correction; void _update_adjustment(); protected: @@ -332,8 +335,10 @@ public: // Glow void set_glow_enabled(bool p_enabled); bool is_glow_enabled() const; - void set_glow_level_enabled(int p_level, bool p_enabled); - bool is_glow_level_enabled(int p_level) const; + void set_glow_level(int p_level, float p_intensity); + float get_glow_level(int p_level) const; + void set_glow_normalized(bool p_normalized); + bool is_glow_normalized() const; void set_glow_intensity(float p_intensity); float get_glow_intensity() const; void set_glow_strength(float p_strength); @@ -368,6 +373,8 @@ public: float get_fog_height() const; void set_fog_height_density(float p_amount); float get_fog_height_density() const; + void set_fog_aerial_perspective(float p_aerial_perspective); + float get_fog_aerial_perspective() const; // Volumetric Fog void set_volumetric_fog_enabled(bool p_enable); @@ -396,8 +403,8 @@ public: float get_adjustment_contrast() const; void set_adjustment_saturation(float p_saturation); float get_adjustment_saturation() const; - void set_adjustment_color_correction(const Ref<Texture2D> &p_ramp); - Ref<Texture2D> get_adjustment_color_correction() const; + void set_adjustment_color_correction(Ref<Texture> p_color_correction); + Ref<Texture> get_adjustment_color_correction() const; Environment(); ~Environment(); diff --git a/scene/resources/font.cpp b/scene/resources/font.cpp index 7cc39f661d..791f260c0e 100644 --- a/scene/resources/font.cpp +++ b/scene/resources/font.cpp @@ -31,640 +31,1017 @@ #include "font.h" #include "core/io/resource_loader.h" -#include "core/method_bind_ext.gen.inc" -#include "core/os/file_access.h" +#include "core/string/translation.h" +#include "core/templates/hashfuncs.h" +#include "scene/resources/text_line.h" +#include "scene/resources/text_paragraph.h" -void Font::draw_halign(RID p_canvas_item, const Point2 &p_pos, HAlign p_align, float p_width, const String &p_text, const Color &p_modulate, const Color &p_outline_modulate) const { - float length = get_string_size(p_text).width; - if (length >= p_width) { - draw(p_canvas_item, p_pos, p_text, p_modulate, p_width, p_outline_modulate); - return; - } +void FontData::_bind_methods() { + ClassDB::bind_method(D_METHOD("load_resource", "filename", "base_size"), &FontData::load_resource, DEFVAL(16)); + ClassDB::bind_method(D_METHOD("load_memory", "data", "type", "base_size"), &FontData::_load_memory, DEFVAL(16)); - float ofs = 0.f; - switch (p_align) { - case HALIGN_LEFT: { - ofs = 0; - } break; - case HALIGN_CENTER: { - ofs = Math::floor((p_width - length) / 2.0); - } break; - case HALIGN_RIGHT: { - ofs = p_width - length; - } break; - default: { - ERR_PRINT("Unknown halignment type"); - } break; - } - draw(p_canvas_item, p_pos + Point2(ofs, 0), p_text, p_modulate, p_width, p_outline_modulate); -} + ClassDB::bind_method(D_METHOD("set_data_path", "path"), &FontData::set_data_path); + ClassDB::bind_method(D_METHOD("get_data_path"), &FontData::get_data_path); -void Font::draw(RID p_canvas_item, const Point2 &p_pos, const String &p_text, const Color &p_modulate, int p_clip_w, const Color &p_outline_modulate) const { - Vector2 ofs; + ClassDB::bind_method(D_METHOD("get_height", "size"), &FontData::get_height); + ClassDB::bind_method(D_METHOD("get_ascent", "size"), &FontData::get_ascent); + ClassDB::bind_method(D_METHOD("get_descent", "size"), &FontData::get_descent); - int chars_drawn = 0; - bool with_outline = has_outline(); - for (int i = 0; i < p_text.length(); i++) { - int width = get_char_size(p_text[i]).width; + ClassDB::bind_method(D_METHOD("get_underline_position", "size"), &FontData::get_underline_position); + ClassDB::bind_method(D_METHOD("get_underline_thickness", "size"), &FontData::get_underline_thickness); - if (p_clip_w >= 0 && (ofs.x + width) > p_clip_w) { - break; //clip - } + ClassDB::bind_method(D_METHOD("set_antialiased", "antialiased"), &FontData::set_antialiased); + ClassDB::bind_method(D_METHOD("get_antialiased"), &FontData::get_antialiased); - ofs.x += draw_char(p_canvas_item, p_pos + ofs, p_text[i], p_text[i + 1], with_outline ? p_outline_modulate : p_modulate, with_outline); - ++chars_drawn; - } + ClassDB::bind_method(D_METHOD("get_variation_list"), &FontData::get_variation_list); + + ClassDB::bind_method(D_METHOD("set_variation", "tag", "value"), &FontData::set_variation); + ClassDB::bind_method(D_METHOD("get_variation", "tag"), &FontData::get_variation); + + ClassDB::bind_method(D_METHOD("set_hinting", "hinting"), &FontData::set_hinting); + ClassDB::bind_method(D_METHOD("get_hinting"), &FontData::get_hinting); + + ClassDB::bind_method(D_METHOD("set_force_autohinter", "enabled"), &FontData::set_force_autohinter); + ClassDB::bind_method(D_METHOD("get_force_autohinter"), &FontData::get_force_autohinter); + + ClassDB::bind_method(D_METHOD("set_distance_field_hint", "distance_field"), &FontData::set_distance_field_hint); + ClassDB::bind_method(D_METHOD("get_distance_field_hint"), &FontData::get_distance_field_hint); + + ClassDB::bind_method(D_METHOD("has_char", "char"), &FontData::has_char); + ClassDB::bind_method(D_METHOD("get_supported_chars"), &FontData::get_supported_chars); + + ClassDB::bind_method(D_METHOD("get_glyph_advance", "index", "size"), &FontData::get_glyph_advance); + ClassDB::bind_method(D_METHOD("get_glyph_kerning", "index_a", "index_b", "size"), &FontData::get_glyph_kerning); + + ClassDB::bind_method(D_METHOD("get_base_size"), &FontData::get_base_size); + + ClassDB::bind_method(D_METHOD("has_outline"), &FontData::has_outline); + + ClassDB::bind_method(D_METHOD("is_language_supported", "language"), &FontData::is_language_supported); + ClassDB::bind_method(D_METHOD("set_language_support_override", "language", "supported"), &FontData::set_language_support_override); + ClassDB::bind_method(D_METHOD("get_language_support_override", "language"), &FontData::get_language_support_override); + ClassDB::bind_method(D_METHOD("remove_language_support_override", "language"), &FontData::remove_language_support_override); + ClassDB::bind_method(D_METHOD("get_language_support_overrides"), &FontData::get_language_support_overrides); + + ClassDB::bind_method(D_METHOD("is_script_supported", "script"), &FontData::is_script_supported); + ClassDB::bind_method(D_METHOD("set_script_support_override", "script", "supported"), &FontData::set_script_support_override); + ClassDB::bind_method(D_METHOD("get_script_support_override", "script"), &FontData::get_script_support_override); + ClassDB::bind_method(D_METHOD("remove_script_support_override", "script"), &FontData::remove_script_support_override); + ClassDB::bind_method(D_METHOD("get_script_support_overrides"), &FontData::get_script_support_overrides); + + ClassDB::bind_method(D_METHOD("get_glyph_index", "char", "variation_selector"), &FontData::get_glyph_index, DEFVAL(0x0000)); + ClassDB::bind_method(D_METHOD("draw_glyph", "canvas", "size", "pos", "index", "color"), &FontData::draw_glyph, DEFVAL(Color(1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_glyph_outline", "canvas", "size", "outline_size", "pos", "index", "color"), &FontData::draw_glyph_outline, DEFVAL(Color(1, 1, 1))); + + ADD_PROPERTY(PropertyInfo(Variant::STRING, "data_path", PROPERTY_HINT_FILE, "*.ttf,*.otf,*.woff,*.fnt,*.font"), "set_data_path", "get_data_path"); - if (has_outline()) { - ofs = Vector2(0, 0); - for (int i = 0; i < chars_drawn; i++) { - ofs.x += draw_char(p_canvas_item, p_pos + ofs, p_text[i], p_text[i + 1], p_modulate, false); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "antialiased"), "set_antialiased", "get_antialiased"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "force_autohinter"), "set_force_autohinter", "get_force_autohinter"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "distance_field_hint"), "set_distance_field_hint", "get_distance_field_hint"); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "hinting", PROPERTY_HINT_ENUM, "None,Light,Normal"), "set_hinting", "get_hinting"); +} + +bool FontData::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; + if (str.begins_with("language_support_override/")) { + String lang = str.get_slicec('/', 1); + if (lang == "_new") { + return false; } + set_language_support_override(lang, p_value); + return true; + } + if (str.begins_with("script_support_override/")) { + String scr = str.get_slicec('/', 1); + if (scr == "_new") { + return false; + } + set_script_support_override(scr, p_value); + return true; + } + if (str.begins_with("variation/")) { + String name = str.get_slicec('/', 1); + set_variation(name, p_value); + return true; } -} -void Font::update_changes() { - emit_changed(); + return false; } -void Font::_bind_methods() { - ClassDB::bind_method(D_METHOD("draw", "canvas_item", "position", "string", "modulate", "clip_w", "outline_modulate"), &Font::draw, DEFVAL(Color(1, 1, 1)), DEFVAL(-1), DEFVAL(Color(1, 1, 1))); - ClassDB::bind_method(D_METHOD("get_ascent"), &Font::get_ascent); - ClassDB::bind_method(D_METHOD("get_descent"), &Font::get_descent); - ClassDB::bind_method(D_METHOD("get_height"), &Font::get_height); - ClassDB::bind_method(D_METHOD("is_distance_field_hint"), &Font::is_distance_field_hint); - ClassDB::bind_method(D_METHOD("get_char_size", "char", "next"), &Font::get_char_size, DEFVAL(0)); - ClassDB::bind_method(D_METHOD("get_string_size", "string"), &Font::get_string_size); - ClassDB::bind_method(D_METHOD("get_wordwrap_string_size", "string", "width"), &Font::get_wordwrap_string_size); - ClassDB::bind_method(D_METHOD("has_outline"), &Font::has_outline); - ClassDB::bind_method(D_METHOD("draw_char", "canvas_item", "position", "char", "next", "modulate", "outline"), &Font::draw_char, DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(false)); - ClassDB::bind_method(D_METHOD("update_changes"), &Font::update_changes); -} +bool FontData::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("language_support_override/")) { + String lang = str.get_slicec('/', 1); + if (lang == "_new") { + return true; + } + r_ret = get_language_support_override(lang); + return true; + } + if (str.begins_with("script_support_override/")) { + String scr = str.get_slicec('/', 1); + if (scr == "_new") { + return true; + } + r_ret = get_script_support_override(scr); + return true; + } + if (str.begins_with("variation/")) { + String name = str.get_slicec('/', 1); -Font::Font() { + r_ret = get_variation(name); + return true; + } + + return false; } -///////////////////////////////////////////////////////////////// +void FontData::_get_property_list(List<PropertyInfo> *p_list) const { + Vector<String> lang_over = get_language_support_overrides(); + for (int i = 0; i < lang_over.size(); i++) { + p_list->push_back(PropertyInfo(Variant::BOOL, "language_support_override/" + lang_over[i], PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_STORAGE)); + } + p_list->push_back(PropertyInfo(Variant::NIL, "language_support_override/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); -void BitmapFont::_set_chars(const Vector<int> &p_chars) { - int len = p_chars.size(); - //char 1 charsize 1 texture, 4 rect, 2 align, advance 1 - ERR_FAIL_COND(len % 9); - if (!len) { - return; //none to do + Vector<String> scr_over = get_script_support_overrides(); + for (int i = 0; i < scr_over.size(); i++) { + p_list->push_back(PropertyInfo(Variant::BOOL, "script_support_override/" + scr_over[i], PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_STORAGE)); } - int chars = len / 9; + p_list->push_back(PropertyInfo(Variant::NIL, "script_support_override/_new", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); - const int *r = p_chars.ptr(); - for (int i = 0; i < chars; i++) { - const int *data = &r[i * 9]; - add_char(data[0], data[1], Rect2(data[2], data[3], data[4], data[5]), Size2(data[6], data[7]), data[8]); + Dictionary variations = get_variation_list(); + for (const Variant *ftr = variations.next(nullptr); ftr != nullptr; ftr = variations.next(ftr)) { + Vector3i v = variations[*ftr]; + p_list->push_back(PropertyInfo(Variant::FLOAT, "variation/" + TS->tag_to_name(*ftr), PROPERTY_HINT_RANGE, itos(v.x) + "," + itos(v.y), PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_STORAGE)); } } -Vector<int> BitmapFont::_get_chars() const { - Vector<int> chars; +RID FontData::get_rid() const { + return rid; +} - const char32_t *key = nullptr; +void FontData::load_resource(const String &p_filename, int p_base_size) { + if (rid != RID()) { + TS->free(rid); + } + rid = TS->create_font_resource(p_filename, p_base_size); + path = p_filename; + base_size = TS->font_get_base_size(rid); + emit_changed(); +} - while ((key = char_map.next(key))) { - const Character *c = char_map.getptr(*key); - ERR_FAIL_COND_V(!c, Vector<int>()); - chars.push_back(*key); - chars.push_back(c->texture_idx); - chars.push_back(c->rect.position.x); - chars.push_back(c->rect.position.y); +void FontData::_load_memory(const PackedByteArray &p_data, const String &p_type, int p_base_size) { + if (rid != RID()) { + TS->free(rid); + } + rid = TS->create_font_memory(p_data.ptr(), p_data.size(), p_type, p_base_size); + path = TTR("(Memory: " + p_type.to_upper() + " @ 0x" + String::num_int64((uint64_t)p_data.ptr(), 16, true) + ")"); + base_size = TS->font_get_base_size(rid); + emit_changed(); +} - chars.push_back(c->rect.size.x); - chars.push_back(c->rect.size.y); - chars.push_back(c->h_align); - chars.push_back(c->v_align); - chars.push_back(c->advance); +void FontData::load_memory(const uint8_t *p_data, size_t p_size, const String &p_type, int p_base_size) { + if (rid != RID()) { + TS->free(rid); } + rid = TS->create_font_memory(p_data, p_size, p_type, p_base_size); + path = TTR("(Memory: " + p_type.to_upper() + " @ 0x" + String::num_int64((uint64_t)p_data, 16, true) + ")"); + base_size = TS->font_get_base_size(rid); + emit_changed(); +} - return chars; +void FontData::set_data_path(const String &p_path) { + load_resource(p_path, base_size); } -void BitmapFont::_set_kernings(const Vector<int> &p_kernings) { - int len = p_kernings.size(); - ERR_FAIL_COND(len % 3); - if (!len) { - return; - } - const int *r = p_kernings.ptr(); +String FontData::get_data_path() const { + return path; +} - for (int i = 0; i < len / 3; i++) { - const int *data = &r[i * 3]; - add_kerning_pair(data[0], data[1], data[2]); +float FontData::get_height(int p_size) const { + if (rid == RID()) { + return 0.f; // Do not raise errors in getters, to prevent editor from spamming errors on incomplete (without data_path set) fonts. } + return TS->font_get_height(rid, (p_size < 0) ? base_size : p_size); } -Vector<int> BitmapFont::_get_kernings() const { - Vector<int> kernings; - - for (Map<KerningPairKey, int>::Element *E = kerning_map.front(); E; E = E->next()) { - kernings.push_back(E->key().A); - kernings.push_back(E->key().B); - kernings.push_back(E->get()); +float FontData::get_ascent(int p_size) const { + if (rid == RID()) { + return 0.f; } + return TS->font_get_ascent(rid, (p_size < 0) ? base_size : p_size); +} - return kernings; +float FontData::get_descent(int p_size) const { + if (rid == RID()) { + return 0.f; + } + return TS->font_get_descent(rid, (p_size < 0) ? base_size : p_size); } -void BitmapFont::_set_textures(const Vector<Variant> &p_textures) { - textures.clear(); - for (int i = 0; i < p_textures.size(); i++) { - Ref<Texture2D> tex = p_textures[i]; - ERR_CONTINUE(!tex.is_valid()); - add_texture(tex); +float FontData::get_underline_position(int p_size) const { + if (rid == RID()) { + return 0.f; } + return TS->font_get_underline_position(rid, (p_size < 0) ? base_size : p_size); } -Vector<Variant> BitmapFont::_get_textures() const { - Vector<Variant> rtextures; - for (int i = 0; i < textures.size(); i++) { - rtextures.push_back(textures[i]); +Dictionary FontData::get_feature_list() const { + if (rid == RID()) { + return Dictionary(); } - return rtextures; + return TS->font_get_feature_list(rid); } -Error BitmapFont::create_from_fnt(const String &p_file) { - //fnt format used by angelcode bmfont - //http://www.angelcode.com/products/bmfont/ +float FontData::get_underline_thickness(int p_size) const { + if (rid == RID()) { + return 0.f; + } + return TS->font_get_underline_thickness(rid, (p_size < 0) ? base_size : p_size); +} - FileAccess *f = FileAccess::open(p_file, FileAccess::READ); +Dictionary FontData::get_variation_list() const { + if (rid == RID()) { + return Dictionary(); + } + return TS->font_get_variation_list(rid); +} - ERR_FAIL_COND_V_MSG(!f, ERR_FILE_NOT_FOUND, "Can't open font: " + p_file + "."); +void FontData::set_variation(const String &p_name, double p_value) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_variation(rid, p_name, p_value); + emit_changed(); +} - clear(); +double FontData::get_variation(const String &p_name) const { + if (rid == RID()) { + return 0; + } + return TS->font_get_variation(rid, p_name); +} - while (true) { - String line = f->get_line(); +void FontData::set_antialiased(bool p_antialiased) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_antialiased(rid, p_antialiased); + emit_changed(); +} - int delimiter = line.find(" "); - String type = line.substr(0, delimiter); - int pos = delimiter + 1; - Map<String, String> keys; +bool FontData::get_antialiased() const { + if (rid == RID()) { + return false; + } + return TS->font_get_antialiased(rid); +} - while (pos < line.size() && line[pos] == ' ') { - pos++; - } +void FontData::set_distance_field_hint(bool p_distance_field) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_distance_field_hint(rid, p_distance_field); + emit_changed(); +} - while (pos < line.size()) { - int eq = line.find("=", pos); - if (eq == -1) { - break; - } - String key = line.substr(pos, eq - pos); - int end = -1; - String value; - if (line[eq + 1] == '"') { - end = line.find("\"", eq + 2); - if (end == -1) { - break; - } - value = line.substr(eq + 2, end - 1 - eq - 1); - pos = end + 1; - } else { - end = line.find(" ", eq + 1); - if (end == -1) { - end = line.size(); - } +bool FontData::get_distance_field_hint() const { + if (rid == RID()) { + return false; + } + return TS->font_get_distance_field_hint(rid); +} - value = line.substr(eq + 1, end - eq); +void FontData::set_hinting(TextServer::Hinting p_hinting) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_hinting(rid, p_hinting); + emit_changed(); +} - pos = end; - } +TextServer::Hinting FontData::get_hinting() const { + if (rid == RID()) { + return TextServer::HINTING_NONE; + } + return TS->font_get_hinting(rid); +} - while (pos < line.size() && line[pos] == ' ') { - pos++; - } +void FontData::set_force_autohinter(bool p_enabeld) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_force_autohinter(rid, p_enabeld); + emit_changed(); +} - keys[key] = value; - } +bool FontData::get_force_autohinter() const { + if (rid == RID()) { + return false; + } + return TS->font_get_force_autohinter(rid); +} - if (type == "info") { - if (keys.has("face")) { - set_name(keys["face"]); - } - /* - if (keys.has("size")) - font->set_height(keys["size"].to_int()); - */ - - } else if (type == "common") { - if (keys.has("lineHeight")) { - set_height(keys["lineHeight"].to_int()); - } - if (keys.has("base")) { - set_ascent(keys["base"].to_int()); - } +bool FontData::has_char(char32_t p_char) const { + if (rid == RID()) { + return false; + } + return TS->font_has_char(rid, p_char); +} - } else if (type == "page") { - if (keys.has("file")) { - String base_dir = p_file.get_base_dir(); - String file = base_dir.plus_file(keys["file"]); - Ref<Texture2D> tex = ResourceLoader::load(file); - if (tex.is_null()) { - ERR_PRINT("Can't load font texture!"); - } else { - add_texture(tex); - } - } - } else if (type == "char") { - char32_t idx = 0; - if (keys.has("id")) { - idx = keys["id"].to_int(); - } +String FontData::get_supported_chars() const { + ERR_FAIL_COND_V(rid == RID(), String()); + return TS->font_get_supported_chars(rid); +} - Rect2 rect; +Vector2 FontData::get_glyph_advance(uint32_t p_index, int p_size) const { + ERR_FAIL_COND_V(rid == RID(), Vector2()); + return TS->font_get_glyph_advance(rid, p_index, (p_size < 0) ? base_size : p_size); +} - if (keys.has("x")) { - rect.position.x = keys["x"].to_int(); - } - if (keys.has("y")) { - rect.position.y = keys["y"].to_int(); - } - if (keys.has("width")) { - rect.size.width = keys["width"].to_int(); - } - if (keys.has("height")) { - rect.size.height = keys["height"].to_int(); - } +Vector2 FontData::get_glyph_kerning(uint32_t p_index_a, uint32_t p_index_b, int p_size) const { + ERR_FAIL_COND_V(rid == RID(), Vector2()); + return TS->font_get_glyph_kerning(rid, p_index_a, p_index_b, (p_size < 0) ? base_size : p_size); +} - Point2 ofs; +bool FontData::has_outline() const { + if (rid == RID()) { + return false; + } + return TS->font_has_outline(rid); +} - if (keys.has("xoffset")) { - ofs.x = keys["xoffset"].to_int(); - } - if (keys.has("yoffset")) { - ofs.y = keys["yoffset"].to_int(); - } +float FontData::get_base_size() const { + return base_size; +} - int texture = 0; - if (keys.has("page")) { - texture = keys["page"].to_int(); - } - int advance = -1; - if (keys.has("xadvance")) { - advance = keys["xadvance"].to_int(); - } +bool FontData::is_language_supported(const String &p_language) const { + if (rid == RID()) { + return false; + } + return TS->font_is_language_supported(rid, p_language); +} - add_char(idx, texture, rect, ofs, advance); +void FontData::set_language_support_override(const String &p_language, bool p_supported) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_language_support_override(rid, p_language, p_supported); + emit_changed(); +} - } else if (type == "kerning") { - char32_t first = 0, second = 0; - int k = 0; +bool FontData::get_language_support_override(const String &p_language) const { + if (rid == RID()) { + return false; + } + return TS->font_get_language_support_override(rid, p_language); +} - if (keys.has("first")) { - first = keys["first"].to_int(); - } - if (keys.has("second")) { - second = keys["second"].to_int(); - } - if (keys.has("amount")) { - k = keys["amount"].to_int(); - } +void FontData::remove_language_support_override(const String &p_language) { + ERR_FAIL_COND(rid == RID()); + TS->font_remove_language_support_override(rid, p_language); + emit_changed(); +} - add_kerning_pair(first, second, -k); - } +Vector<String> FontData::get_language_support_overrides() const { + if (rid == RID()) { + return Vector<String>(); + } + return TS->font_get_language_support_overrides(rid); +} - if (f->eof_reached()) { - break; - } +bool FontData::is_script_supported(const String &p_script) const { + if (rid == RID()) { + return false; } + return TS->font_is_script_supported(rid, p_script); +} - memdelete(f); +void FontData::set_script_support_override(const String &p_script, bool p_supported) { + ERR_FAIL_COND(rid == RID()); + TS->font_set_script_support_override(rid, p_script, p_supported); + emit_changed(); +} - return OK; +bool FontData::get_script_support_override(const String &p_script) const { + if (rid == RID()) { + return false; + } + return TS->font_get_script_support_override(rid, p_script); } -void BitmapFont::set_height(float p_height) { - height = p_height; +void FontData::remove_script_support_override(const String &p_script) { + ERR_FAIL_COND(rid == RID()); + TS->font_remove_script_support_override(rid, p_script); + emit_changed(); } -float BitmapFont::get_height() const { - return height; +Vector<String> FontData::get_script_support_overrides() const { + if (rid == RID()) { + return Vector<String>(); + } + return TS->font_get_script_support_overrides(rid); } -void BitmapFont::set_ascent(float p_ascent) { - ascent = p_ascent; +uint32_t FontData::get_glyph_index(char32_t p_char, char32_t p_variation_selector) const { + ERR_FAIL_COND_V(rid == RID(), 0); + return TS->font_get_glyph_index(rid, p_char, p_variation_selector); } -float BitmapFont::get_ascent() const { - return ascent; +Vector2 FontData::draw_glyph(RID p_canvas, int p_size, const Vector2 &p_pos, uint32_t p_index, const Color &p_color) const { + ERR_FAIL_COND_V(rid == RID(), Vector2()); + return TS->font_draw_glyph(rid, p_canvas, (p_size <= 0) ? base_size : p_size, p_pos, p_index, p_color); } -float BitmapFont::get_descent() const { - return height - ascent; +Vector2 FontData::draw_glyph_outline(RID p_canvas, int p_size, int p_outline_size, const Vector2 &p_pos, uint32_t p_index, const Color &p_color) const { + ERR_FAIL_COND_V(rid == RID(), Vector2()); + return TS->font_draw_glyph_outline(rid, p_canvas, (p_size <= 0) ? base_size : p_size, p_outline_size, p_pos, p_index, p_color); } -float BitmapFont::get_underline_position() const { - return 2; +FontData::FontData() {} + +FontData::FontData(const String &p_filename, int p_base_size) { + load_resource(p_filename, p_base_size); } -float BitmapFont::get_underline_thickness() const { - return 1; +FontData::FontData(const PackedByteArray &p_data, const String &p_type, int p_base_size) { + _load_memory(p_data, p_type, p_base_size); } -void BitmapFont::add_texture(const Ref<Texture2D> &p_texture) { - ERR_FAIL_COND_MSG(p_texture.is_null(), "It's not a reference to a valid Texture object."); - textures.push_back(p_texture); +FontData::~FontData() { + if (rid != RID()) { + TS->free(rid); + } } -int BitmapFont::get_texture_count() const { - return textures.size(); -}; +/*************************************************************************/ -Ref<Texture2D> BitmapFont::get_texture(int p_idx) const { - ERR_FAIL_INDEX_V(p_idx, textures.size(), Ref<Texture2D>()); - return textures[p_idx]; -}; +void Font::_bind_methods() { + ClassDB::bind_method(D_METHOD("add_data", "data"), &Font::add_data); + ClassDB::bind_method(D_METHOD("set_data", "idx", "data"), &Font::set_data); + ClassDB::bind_method(D_METHOD("get_data_count"), &Font::get_data_count); + ClassDB::bind_method(D_METHOD("get_data", "idx"), &Font::get_data); + ClassDB::bind_method(D_METHOD("remove_data", "idx"), &Font::remove_data); -int BitmapFont::get_character_count() const { - return char_map.size(); -}; + ClassDB::bind_method(D_METHOD("get_height", "size"), &Font::get_height, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_ascent", "size"), &Font::get_ascent, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_descent", "size"), &Font::get_descent, DEFVAL(-1)); -Vector<char32_t> BitmapFont::get_char_keys() const { - Vector<char32_t> chars; - chars.resize(char_map.size()); - const char32_t *ct = nullptr; - int count = 0; - while ((ct = char_map.next(ct))) { - chars.write[count++] = *ct; - }; + ClassDB::bind_method(D_METHOD("get_underline_position", "size"), &Font::get_underline_position, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_underline_thickness", "size"), &Font::get_underline_thickness, DEFVAL(-1)); - return chars; -}; + ClassDB::bind_method(D_METHOD("get_spacing", "type"), &Font::get_spacing); + ClassDB::bind_method(D_METHOD("set_spacing", "type", "value"), &Font::set_spacing); -BitmapFont::Character BitmapFont::get_character(char32_t p_char) const { - if (!char_map.has(p_char)) { - ERR_FAIL_V(Character()); - }; + ClassDB::bind_method(D_METHOD("get_string_size", "text", "size"), &Font::get_string_size, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_multiline_string_size", "text", "width", "size", "flags"), &Font::get_multiline_string_size, DEFVAL(-1), DEFVAL(-1), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND)); - return char_map[p_char]; -}; + ClassDB::bind_method(D_METHOD("draw_string", "canvas_item", "pos", "text", "align", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_multiline_string", "canvas_item", "pos", "text", "align", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_multiline_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); -void BitmapFont::add_char(char32_t p_char, int p_texture_idx, const Rect2 &p_rect, const Size2 &p_align, float p_advance) { - if (p_advance < 0) { - p_advance = p_rect.size.width; - } + ClassDB::bind_method(D_METHOD("has_char", "char"), &Font::has_char); + ClassDB::bind_method(D_METHOD("get_supported_chars"), &Font::get_supported_chars); + + ClassDB::bind_method(D_METHOD("get_char_size", "char", "next", "size"), &Font::get_char_size, DEFVAL(0), DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("draw_char", "canvas_item", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &Font::draw_char, DEFVAL(0), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); + + ClassDB::bind_method(D_METHOD("update_changes"), &Font::update_changes); - Character c; - c.rect = p_rect; - c.texture_idx = p_texture_idx; - c.v_align = p_align.y; - c.advance = p_advance; - c.h_align = p_align.x; + ADD_GROUP("Extra Spacing", "extra_spacing"); + ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_top"), "set_spacing", "get_spacing", SPACING_TOP); + ADD_PROPERTYI(PropertyInfo(Variant::INT, "extra_spacing_bottom"), "set_spacing", "get_spacing", SPACING_BOTTOM); - char_map[p_char] = c; + BIND_ENUM_CONSTANT(SPACING_TOP); + BIND_ENUM_CONSTANT(SPACING_BOTTOM); } -void BitmapFont::add_kerning_pair(char32_t p_A, char32_t p_B, int p_kerning) { - KerningPairKey kpk; - kpk.A = p_A; - kpk.B = p_B; +void Font::_data_changed() { + cache.clear(); + cache_wrap.clear(); - if (p_kerning == 0 && kerning_map.has(kpk)) { - kerning_map.erase(kpk); - } else { - kerning_map[kpk] = p_kerning; + emit_changed(); + _change_notify(); +} + +bool Font::_set(const StringName &p_name, const Variant &p_value) { + String str = p_name; +#ifndef DISABLE_DEPRECATED + if (str == "font_data") { // Compatibility, DynamicFont main data + Ref<FontData> fd = p_value; + if (fd.is_valid()) { + add_data(fd); + return true; + } + return false; + } else if (str.begins_with("fallback/")) { // Compatibility, DynamicFont fallback data + Ref<FontData> fd = p_value; + if (fd.is_valid()) { + add_data(fd); + return true; + } + return false; + } else if (str == "fallback") { // Compatibility, BitmapFont fallback + Ref<Font> f = p_value; + if (f.is_valid()) { + for (int i = 0; i < f->get_data_count(); i++) { + add_data(f->get_data(i)); + } + return true; + } + return false; } +#endif /* DISABLE_DEPRECATED */ + if (str.begins_with("data/")) { + int idx = str.get_slicec('/', 1).to_int(); + Ref<FontData> fd = p_value; + + if (fd.is_valid()) { + if (idx == data.size()) { + add_data(fd); + return true; + } else if (idx >= 0 && idx < data.size()) { + set_data(idx, fd); + return true; + } else { + return false; + } + } else if (idx >= 0 && idx < data.size()) { + remove_data(idx); + return true; + } + } + + return false; } -Vector<BitmapFont::KerningPairKey> BitmapFont::get_kerning_pair_keys() const { - Vector<BitmapFont::KerningPairKey> ret; - ret.resize(kerning_map.size()); - int i = 0; +bool Font::_get(const StringName &p_name, Variant &r_ret) const { + String str = p_name; + if (str.begins_with("data/")) { + int idx = str.get_slicec('/', 1).to_int(); + + if (idx == data.size()) { + r_ret = Ref<FontData>(); + return true; + } else if (idx >= 0 && idx < data.size()) { + r_ret = get_data(idx); + return true; + } + } - for (Map<KerningPairKey, int>::Element *E = kerning_map.front(); E; E = E->next()) { - ret.write[i++] = E->key(); + return false; +} + +void Font::_get_property_list(List<PropertyInfo> *p_list) const { + for (int i = 0; i < data.size(); i++) { + p_list->push_back(PropertyInfo(Variant::OBJECT, "data/" + itos(i), PROPERTY_HINT_RESOURCE_TYPE, "FontData")); } - return ret; + p_list->push_back(PropertyInfo(Variant::OBJECT, "data/" + itos(data.size()), PROPERTY_HINT_RESOURCE_TYPE, "FontData")); } -int BitmapFont::get_kerning_pair(char32_t p_A, char32_t p_B) const { - KerningPairKey kpk; - kpk.A = p_A; - kpk.B = p_B; +void Font::add_data(const Ref<FontData> &p_data) { + ERR_FAIL_COND(p_data.is_null()); + data.push_back(p_data); - const Map<KerningPairKey, int>::Element *E = kerning_map.find(kpk); - if (E) { - return E->get(); + if (data[data.size() - 1].is_valid()) { + data.write[data.size() - 1]->connect("changed", callable_mp(this, &Font::_data_changed), varray(), CONNECT_REFERENCE_COUNTED); } - return 0; + cache.clear(); + cache_wrap.clear(); + + emit_changed(); + _change_notify(); } -void BitmapFont::set_distance_field_hint(bool p_distance_field) { - distance_field_hint = p_distance_field; +void Font::set_data(int p_idx, const Ref<FontData> &p_data) { + ERR_FAIL_COND(p_data.is_null()); + ERR_FAIL_INDEX(p_idx, data.size()); + + if (data[p_idx].is_valid()) { + data.write[p_idx]->disconnect("changed", callable_mp(this, &Font::_data_changed)); + } + + data.write[p_idx] = p_data; + + if (data[p_idx].is_valid()) { + data.write[p_idx]->connect("changed", callable_mp(this, &Font::_data_changed), varray(), CONNECT_REFERENCE_COUNTED); + } + + cache.clear(); + cache_wrap.clear(); + emit_changed(); + _change_notify(); } -bool BitmapFont::is_distance_field_hint() const { - return distance_field_hint; +int Font::get_data_count() const { + return data.size(); } -void BitmapFont::clear() { - height = 1; - ascent = 0; - char_map.clear(); - textures.clear(); - kerning_map.clear(); - distance_field_hint = false; +Ref<FontData> Font::get_data(int p_idx) const { + ERR_FAIL_INDEX_V(p_idx, data.size(), Ref<FontData>()); + return data[p_idx]; } -Size2 Font::get_string_size(const String &p_string) const { - float w = 0; +void Font::remove_data(int p_idx) { + ERR_FAIL_INDEX(p_idx, data.size()); + + if (data[p_idx].is_valid()) { + data.write[p_idx]->disconnect("changed", callable_mp(this, &Font::_data_changed)); + } + + data.remove(p_idx); + + cache.clear(); + cache_wrap.clear(); + + emit_changed(); + _change_notify(); +} + +Dictionary Font::get_feature_list() const { + Dictionary out; + for (int i = 0; i < data.size(); i++) { + Dictionary data_ftrs = data[i]->get_feature_list(); + for (const Variant *ftr = data_ftrs.next(nullptr); ftr != nullptr; ftr = data_ftrs.next(ftr)) { + out[*ftr] = data_ftrs[*ftr]; + } + } + return out; +} - int l = p_string.length(); - if (l == 0) { - return Size2(0, get_height()); +float Font::get_height(int p_size) const { + float ret = 0.f; + for (int i = 0; i < data.size(); i++) { + ret = MAX(ret, data[i]->get_height(p_size)); } - const char32_t *sptr = &p_string[0]; + return ret + spacing_top + spacing_bottom; +} - for (int i = 0; i < l; i++) { - w += get_char_size(sptr[i], sptr[i + 1]).width; +float Font::get_ascent(int p_size) const { + float ret = 0.f; + for (int i = 0; i < data.size(); i++) { + ret = MAX(ret, data[i]->get_ascent(p_size)); } + return ret + spacing_top; +} - return Size2(w, get_height()); +float Font::get_descent(int p_size) const { + float ret = 0.f; + for (int i = 0; i < data.size(); i++) { + ret = MAX(ret, data[i]->get_descent(p_size)); + } + return ret + spacing_bottom; } -Size2 Font::get_wordwrap_string_size(const String &p_string, float p_width) const { - ERR_FAIL_COND_V(p_width <= 0, Vector2(0, get_height())); +float Font::get_underline_position(int p_size) const { + float ret = 0.f; + for (int i = 0; i < data.size(); i++) { + ret = MAX(ret, data[i]->get_underline_position(p_size)); + } + return ret; +} - int l = p_string.length(); - if (l == 0) { - return Size2(p_width, get_height()); +float Font::get_underline_thickness(int p_size) const { + float ret = 0.f; + for (int i = 0; i < data.size(); i++) { + ret = MAX(ret, data[i]->get_underline_thickness(p_size)); } + return ret; +} - float line_w = 0; - float h = 0; - float space_w = get_char_size(' ').width; - Vector<String> lines = p_string.split("\n"); - for (int i = 0; i < lines.size(); i++) { - h += get_height(); - String t = lines[i]; - line_w = 0; - Vector<String> words = t.split(" "); - for (int j = 0; j < words.size(); j++) { - line_w += get_string_size(words[j]).x; - if (line_w > p_width) { - h += get_height(); - line_w = get_string_size(words[j]).x; - } else { - line_w += space_w; - } - } +int Font::get_spacing(int p_type) const { + if (p_type == SPACING_TOP) { + return spacing_top; + } else if (p_type == SPACING_BOTTOM) { + return spacing_bottom; } - return Size2(p_width, h); + return 0; } -void BitmapFont::set_fallback(const Ref<BitmapFont> &p_fallback) { - for (Ref<BitmapFont> fallback_child = p_fallback; fallback_child != nullptr; fallback_child = fallback_child->get_fallback()) { - ERR_FAIL_COND_MSG(fallback_child == this, "Can't set as fallback one of its parents to prevent crashes due to recursive loop."); +void Font::set_spacing(int p_type, int p_value) { + if (p_type == SPACING_TOP) { + spacing_top = p_value; + } else if (p_type == SPACING_BOTTOM) { + spacing_bottom = p_value; } - fallback = p_fallback; + emit_changed(); + _change_notify(); } -Ref<BitmapFont> BitmapFont::get_fallback() const { - return fallback; +// Drawing string and string sizes, cached. + +Size2 Font::get_string_size(const String &p_text, int p_size) const { + ERR_FAIL_COND_V(data.empty(), Size2()); + + uint64_t hash = p_text.hash64(); + hash = hash_djb2_one_64(p_size, hash); + + Ref<TextLine> buffer; + if (cache.has(hash)) { + buffer = cache.get(hash); + } else { + buffer.instance(); + int size = p_size <= 0 ? data[0]->get_base_size() : p_size; + buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + cache.insert(hash, buffer); + } + if (buffer->get_orientation() == TextServer::ORIENTATION_HORIZONTAL) { + return buffer->get_size() + Vector2(0, spacing_top + spacing_bottom); + } else { + return buffer->get_size() + Vector2(spacing_top + spacing_bottom, 0); + } } -float BitmapFont::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, const Color &p_modulate, bool p_outline) const { - const Character *c = char_map.getptr(p_char); +Size2 Font::get_multiline_string_size(const String &p_text, float p_width, int p_size, uint8_t p_flags) const { + ERR_FAIL_COND_V(data.empty(), Size2()); + + uint64_t hash = p_text.hash64(); + hash = hash_djb2_one_64(p_size, hash); - if (!c) { - if (fallback.is_valid()) { - return fallback->draw_char(p_canvas_item, p_pos, p_char, p_next, p_modulate, p_outline); + uint64_t wrp_hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); + wrp_hash = hash_djb2_one_64(p_flags, wrp_hash); + + Ref<TextParagraph> lines_buffer; + if (cache_wrap.has(wrp_hash)) { + lines_buffer = cache_wrap.get(wrp_hash); + } else { + lines_buffer.instance(); + int size = p_size <= 0 ? data[0]->get_base_size() : p_size; + lines_buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + lines_buffer->set_width(p_width); + lines_buffer->set_flags(p_flags); + cache_wrap.insert(wrp_hash, lines_buffer); + } + + Size2 ret; + for (int i = 0; i < lines_buffer->get_line_count(); i++) { + Size2 line_size = lines_buffer->get_line_size(i); + if (lines_buffer->get_orientation() == TextServer::ORIENTATION_HORIZONTAL) { + ret.x = MAX(ret.x, line_size.x); + ret.y += line_size.y + spacing_top + spacing_bottom; + } else { + ret.y = MAX(ret.y, line_size.y); + ret.x += line_size.x + spacing_top + spacing_bottom; } - return 0; + } + return ret; +} + +void Font::draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align, float p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint8_t p_flags) const { + uint64_t hash = p_text.hash64(); + hash = hash_djb2_one_64(p_size, hash); + + Ref<TextLine> buffer; + if (cache.has(hash)) { + buffer = cache.get(hash); + } else { + buffer.instance(); + int size = p_size <= 0 ? data[0]->get_base_size() : p_size; + buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + cache.insert(hash, buffer); } - ERR_FAIL_COND_V(c->texture_idx < -1 || c->texture_idx >= textures.size(), 0); - if (!p_outline && c->texture_idx != -1) { - Point2 cpos = p_pos; - cpos.x += c->h_align; - cpos.y -= ascent; - cpos.y += c->v_align; - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, c->rect.size), textures[c->texture_idx]->get_rid(), c->rect, p_modulate, false, RID(), RID(), Color(1, 1, 1, 1), false); + Vector2 ofs = p_pos; + if (buffer->get_orientation() == TextServer::ORIENTATION_HORIZONTAL) { + ofs.y += spacing_top - buffer->get_line_ascent(); + } else { + ofs.x += spacing_top - buffer->get_line_ascent(); } - return get_char_size(p_char, p_next).width; + buffer->set_width(p_width); + buffer->set_align(p_align); + + if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { + buffer->draw_outline(p_canvas_item, ofs, p_outline_size, p_outline_modulate); + } + buffer->draw(p_canvas_item, ofs, p_modulate); } -Size2 BitmapFont::get_char_size(char32_t p_char, char32_t p_next) const { - const Character *c = char_map.getptr(p_char); +void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align, float p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint8_t p_flags) const { + uint64_t hash = p_text.hash64(); + hash = hash_djb2_one_64(p_size, hash); - if (!c) { - if (fallback.is_valid()) { - return fallback->get_char_size(p_char, p_next); - } - return Size2(); + uint64_t wrp_hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); + wrp_hash = hash_djb2_one_64(p_flags, wrp_hash); + + Ref<TextParagraph> lines_buffer; + if (cache_wrap.has(wrp_hash)) { + lines_buffer = cache_wrap.get(wrp_hash); + } else { + lines_buffer.instance(); + int size = p_size <= 0 ? data[0]->get_base_size() : p_size; + lines_buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + lines_buffer->set_width(p_width); + lines_buffer->set_flags(p_flags); + cache_wrap.insert(wrp_hash, lines_buffer); } - Size2 ret(c->advance, c->rect.size.y); + lines_buffer->set_align(p_align); + + Vector2 lofs = p_pos; + for (int i = 0; i < lines_buffer->get_line_count(); i++) { + if (lines_buffer->get_orientation() == TextServer::ORIENTATION_HORIZONTAL) { + lofs.y += spacing_top; + if (i == 0) { + lofs.y -= lines_buffer->get_line_ascent(0); + } + } else { + lofs.x += spacing_top; + if (i == 0) { + lofs.x -= lines_buffer->get_line_ascent(0); + } + } + if (p_width > 0) { + lines_buffer->set_align(p_align); + } + + if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { + lines_buffer->draw_line_outline(p_canvas_item, lofs, i, p_outline_size, p_outline_modulate); + } + lines_buffer->draw_line(p_canvas_item, lofs, i, p_modulate); - if (p_next) { - KerningPairKey kpk; - kpk.A = p_char; - kpk.B = p_next; + Size2 line_size = lines_buffer->get_line_size(i); + if (lines_buffer->get_orientation() == TextServer::ORIENTATION_HORIZONTAL) { + lofs.y += line_size.y + spacing_bottom; + } else { + lofs.x += line_size.x + spacing_bottom; + } - const Map<KerningPairKey, int>::Element *E = kerning_map.find(kpk); - if (E) { - ret.width -= E->get(); + if ((p_max_lines > 0) && (i >= p_max_lines)) { + return; } } +} - return ret; +bool Font::has_char(char32_t p_char) const { + for (int i = 0; i < data.size(); i++) { + if (data[i]->has_char(p_char)) { + return true; + } + } + return false; } -void BitmapFont::_bind_methods() { - ClassDB::bind_method(D_METHOD("create_from_fnt", "path"), &BitmapFont::create_from_fnt); - ClassDB::bind_method(D_METHOD("set_height", "px"), &BitmapFont::set_height); +String Font::get_supported_chars() const { + String chars; + for (int i = 0; i < data.size(); i++) { + String data_chars = data[i]->get_supported_chars(); + for (int j = 0; j < data_chars.length(); j++) { + if (chars.find_char(data_chars[j]) == -1) { + chars += data_chars[j]; + } + } + } + return chars; +} - ClassDB::bind_method(D_METHOD("set_ascent", "px"), &BitmapFont::set_ascent); +Size2 Font::get_char_size(char32_t p_char, char32_t p_next, int p_size) const { + for (int i = 0; i < data.size(); i++) { + if (data[i]->has_char(p_char)) { + int size = p_size <= 0 ? data[i]->get_base_size() : p_size; + uint32_t glyph_a = data[i]->get_glyph_index(p_char); + Size2 ret = Size2(data[i]->get_glyph_advance(glyph_a, size).x, data[i]->get_height(size)); + if ((p_next != 0) && data[i]->has_char(p_next)) { + uint32_t glyph_b = data[i]->get_glyph_index(p_next); + ret.x -= data[i]->get_glyph_kerning(glyph_a, glyph_b, size).x; + } + return ret; + } + } + return Size2(); +} - ClassDB::bind_method(D_METHOD("add_kerning_pair", "char_a", "char_b", "kerning"), &BitmapFont::add_kerning_pair); - ClassDB::bind_method(D_METHOD("get_kerning_pair", "char_a", "char_b"), &BitmapFont::get_kerning_pair); +float Font::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate) const { + for (int i = 0; i < data.size(); i++) { + if (data[i]->has_char(p_char)) { + int size = p_size <= 0 ? data[i]->get_base_size() : p_size; + uint32_t glyph_a = data[i]->get_glyph_index(p_char); + float ret = data[i]->get_glyph_advance(glyph_a, size).x; + if ((p_next != 0) && data[i]->has_char(p_next)) { + uint32_t glyph_b = data[i]->get_glyph_index(p_next); + ret -= data[i]->get_glyph_kerning(glyph_a, glyph_b, size).x; + } + if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { + data[i]->draw_glyph_outline(p_canvas_item, size, p_outline_size, p_pos, glyph_a, p_outline_modulate); + } + data[i]->draw_glyph(p_canvas_item, size, p_pos, glyph_a, p_modulate); + return ret; + } + } + return 0; +} - ClassDB::bind_method(D_METHOD("add_texture", "texture"), &BitmapFont::add_texture); - ClassDB::bind_method(D_METHOD("add_char", "character", "texture", "rect", "align", "advance"), &BitmapFont::add_char, DEFVAL(Point2()), DEFVAL(-1)); +Vector<RID> Font::get_rids() const { + Vector<RID> ret; + for (int i = 0; i < data.size(); i++) { + RID rid = data[i]->get_rid(); + if (rid != RID()) { + ret.push_back(rid); + } + } + return ret; +} - ClassDB::bind_method(D_METHOD("get_texture_count"), &BitmapFont::get_texture_count); - ClassDB::bind_method(D_METHOD("get_texture", "idx"), &BitmapFont::get_texture); +void Font::update_changes() { + emit_changed(); +} - ClassDB::bind_method(D_METHOD("set_distance_field_hint", "enable"), &BitmapFont::set_distance_field_hint); +Font::Font() { + cache.set_capacity(128); + cache_wrap.set_capacity(32); +} - ClassDB::bind_method(D_METHOD("clear"), &BitmapFont::clear); +Font::~Font() { + cache.clear(); + cache_wrap.clear(); +} - ClassDB::bind_method(D_METHOD("_set_chars"), &BitmapFont::_set_chars); - ClassDB::bind_method(D_METHOD("_get_chars"), &BitmapFont::_get_chars); +/*************************************************************************/ - ClassDB::bind_method(D_METHOD("_set_kernings"), &BitmapFont::_set_kernings); - ClassDB::bind_method(D_METHOD("_get_kernings"), &BitmapFont::_get_kernings); +RES ResourceFormatLoaderFont::load(const String &p_path, const String &p_original_path, Error *r_error, bool p_use_sub_threads, float *r_progress, bool p_no_cache) { + if (r_error) { + *r_error = ERR_FILE_CANT_OPEN; + } - ClassDB::bind_method(D_METHOD("_set_textures"), &BitmapFont::_set_textures); - ClassDB::bind_method(D_METHOD("_get_textures"), &BitmapFont::_get_textures); + Ref<FontData> dfont; + dfont.instance(); + dfont->load_resource(p_path); - ClassDB::bind_method(D_METHOD("set_fallback", "fallback"), &BitmapFont::set_fallback); - ClassDB::bind_method(D_METHOD("get_fallback"), &BitmapFont::get_fallback); + if (r_error) { + *r_error = OK; + } + + return dfont; +} - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "textures", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_textures", "_get_textures"); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "chars", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_chars", "_get_chars"); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "kernings", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_kernings", "_get_kernings"); +void ResourceFormatLoaderFont::get_recognized_extensions_for_type(const String &p_type, List<String> *p_extensions) const { +#ifndef DISABLE_DEPRECATED + if (p_type == "DynamicFontData") { + p_extensions->push_back("ttf"); + p_extensions->push_back("otf"); + p_extensions->push_back("woff"); + return; + } + if (p_type == "BitmapFont") { // BitmapFont (*.font, *fnt) is handled by ResourceFormatLoaderCompatFont + return; + } +#endif /* DISABLE_DEPRECATED */ + if (p_type == "" || handles_type(p_type)) { + get_recognized_extensions(p_extensions); + } +} - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height", PROPERTY_HINT_RANGE, "1,1024,1"), "set_height", "get_height"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "ascent", PROPERTY_HINT_RANGE, "0,1024,1"), "set_ascent", "get_ascent"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "distance_field"), "set_distance_field_hint", "is_distance_field_hint"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "fallback", PROPERTY_HINT_RESOURCE_TYPE, "BitmapFont"), "set_fallback", "get_fallback"); +void ResourceFormatLoaderFont::get_recognized_extensions(List<String> *p_extensions) const { + p_extensions->push_back("ttf"); + p_extensions->push_back("otf"); + p_extensions->push_back("woff"); + p_extensions->push_back("font"); + p_extensions->push_back("fnt"); } -BitmapFont::BitmapFont() { - clear(); +bool ResourceFormatLoaderFont::handles_type(const String &p_type) const { + return (p_type == "FontData"); } -BitmapFont::~BitmapFont() { - clear(); +String ResourceFormatLoaderFont::get_resource_type(const String &p_path) const { + String el = p_path.get_extension().to_lower(); + if (el == "ttf" || el == "otf" || el == "woff" || el == "font" || el == "fnt") { + return "FontData"; + } + return ""; } -//////////// +#ifndef DISABLE_DEPRECATED -RES ResourceFormatLoaderBMFont::load(const String &p_path, const String &p_original_path, Error *r_error, bool p_use_sub_threads, float *r_progress, bool p_no_cache) { +RES ResourceFormatLoaderCompatFont::load(const String &p_path, const String &p_original_path, Error *r_error, bool p_use_sub_threads, float *r_progress, bool p_no_cache) { if (r_error) { *r_error = ERR_FILE_CANT_OPEN; } - Ref<BitmapFont> font; - font.instance(); + Ref<FontData> dfont; + dfont.instance(); + dfont->load_resource(p_path); - Error err = font->create_from_fnt(p_path); + Ref<Font> font; + font.instance(); + font->add_data(dfont); - if (err) { - if (r_error) { - *r_error = err; - } - return RES(); + if (r_error) { + *r_error = OK; } return font; } -void ResourceFormatLoaderBMFont::get_recognized_extensions(List<String> *p_extensions) const { - p_extensions->push_back("fnt"); +void ResourceFormatLoaderCompatFont::get_recognized_extensions_for_type(const String &p_type, List<String> *p_extensions) const { + if (p_type == "BitmapFont") { + p_extensions->push_back("font"); + p_extensions->push_back("fnt"); + } } -bool ResourceFormatLoaderBMFont::handles_type(const String &p_type) const { - return (p_type == "BitmapFont"); +void ResourceFormatLoaderCompatFont::get_recognized_extensions(List<String> *p_extensions) const { } -String ResourceFormatLoaderBMFont::get_resource_type(const String &p_path) const { - String el = p_path.get_extension().to_lower(); - if (el == "fnt") { - return "BitmapFont"; - } +bool ResourceFormatLoaderCompatFont::handles_type(const String &p_type) const { + return (p_type == "Font"); +} + +String ResourceFormatLoaderCompatFont::get_resource_type(const String &p_path) const { return ""; } + +#endif /* DISABLE_DEPRECATED */ diff --git a/scene/resources/font.h b/scene/resources/font.h index c739520da3..fe28e1aea5 100644 --- a/scene/resources/font.h +++ b/scene/resources/font.h @@ -31,179 +31,194 @@ #ifndef FONT_H #define FONT_H -#include "core/map.h" -#include "core/resource.h" +#include "core/io/resource.h" +#include "core/templates/lru.h" +#include "core/templates/map.h" #include "scene/resources/texture.h" +#include "servers/text_server.h" -class Font : public Resource { - GDCLASS(Font, Resource); +/*************************************************************************/ + +class FontData : public Resource { + GDCLASS(FontData, Resource); + + RID rid; + int base_size = 16; + String path; protected: static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + public: - virtual float get_height() const = 0; + virtual RID get_rid() const override; - virtual float get_ascent() const = 0; - virtual float get_descent() const = 0; - virtual float get_underline_position() const = 0; - virtual float get_underline_thickness() const = 0; + void load_resource(const String &p_filename, int p_base_size = 16); + void load_memory(const uint8_t *p_data, size_t p_size, const String &p_type, int p_base_size = 16); + void _load_memory(const PackedByteArray &p_data, const String &p_type, int p_base_size = 16); - virtual Size2 get_char_size(char32_t p_char, char32_t p_next = 0) const = 0; - Size2 get_string_size(const String &p_string) const; - Size2 get_wordwrap_string_size(const String &p_string, float p_width) const; + void set_data_path(const String &p_path); + String get_data_path() const; - virtual bool is_distance_field_hint() const = 0; + float get_height(int p_size) const; + float get_ascent(int p_size) const; + float get_descent(int p_size) const; - void draw(RID p_canvas_item, const Point2 &p_pos, const String &p_text, const Color &p_modulate = Color(1, 1, 1), int p_clip_w = -1, const Color &p_outline_modulate = Color(1, 1, 1)) const; - void draw_halign(RID p_canvas_item, const Point2 &p_pos, HAlign p_align, float p_width, const String &p_text, const Color &p_modulate = Color(1, 1, 1), const Color &p_outline_modulate = Color(1, 1, 1)) const; + Dictionary get_feature_list() const; + Dictionary get_variation_list() const; - virtual bool has_outline() const { return false; } - virtual float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, const Color &p_modulate = Color(1, 1, 1), bool p_outline = false) const = 0; + void set_variation(const String &p_name, double p_value); + double get_variation(const String &p_name) const; - void update_changes(); - Font(); -}; + float get_underline_position(int p_size) const; + float get_underline_thickness(int p_size) const; -// Helper class to that draws outlines immediately and draws characters in its destructor. -class FontDrawer { - const Ref<Font> &font; - Color outline_color; - bool has_outline; - - struct PendingDraw { - RID canvas_item; - Point2 pos; - char32_t chr; - char32_t next; - Color modulate; - }; + void set_antialiased(bool p_antialiased); + bool get_antialiased() const; - Vector<PendingDraw> pending_draws; + void set_distance_field_hint(bool p_distance_field); + bool get_distance_field_hint() const; -public: - FontDrawer(const Ref<Font> &p_font, const Color &p_outline_color) : - font(p_font), - outline_color(p_outline_color) { - has_outline = p_font->has_outline(); - } - - float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, const Color &p_modulate = Color(1, 1, 1)) { - if (has_outline) { - PendingDraw draw = { p_canvas_item, p_pos, p_char, p_next, p_modulate }; - pending_draws.push_back(draw); - } - return font->draw_char(p_canvas_item, p_pos, p_char, p_next, has_outline ? outline_color : p_modulate, has_outline); - } - - ~FontDrawer() { - for (int i = 0; i < pending_draws.size(); ++i) { - const PendingDraw &draw = pending_draws[i]; - font->draw_char(draw.canvas_item, draw.pos, draw.chr, draw.next, draw.modulate, false); - } - } -}; + void set_force_autohinter(bool p_enabeld); + bool get_force_autohinter() const; -class BitmapFont : public Font { - GDCLASS(BitmapFont, Font); - RES_BASE_EXTENSION("font"); + void set_hinting(TextServer::Hinting p_hinting); + TextServer::Hinting get_hinting() const; - Vector<Ref<Texture2D>> textures; + bool has_char(char32_t p_char) const; + String get_supported_chars() const; -public: - struct Character { - int texture_idx; - Rect2 rect; - float v_align; - float h_align; - float advance; - - Character() { - texture_idx = 0; - v_align = 0; - } - }; + Vector2 get_glyph_advance(uint32_t p_index, int p_size) const; + Vector2 get_glyph_kerning(uint32_t p_index_a, uint32_t p_index_b, int p_size) const; + + bool has_outline() const; + float get_base_size() const; + + bool is_language_supported(const String &p_language) const; + void set_language_support_override(const String &p_language, bool p_supported); + bool get_language_support_override(const String &p_language) const; + void remove_language_support_override(const String &p_language); + Vector<String> get_language_support_overrides() const; + + bool is_script_supported(const String &p_script) const; + void set_script_support_override(const String &p_script, bool p_supported); + bool get_script_support_override(const String &p_script) const; + void remove_script_support_override(const String &p_script); + Vector<String> get_script_support_overrides() const; - struct KerningPairKey { - union { - struct { - uint32_t A, B; - }; + uint32_t get_glyph_index(char32_t p_char, char32_t p_variation_selector = 0x0000) const; - uint64_t pair; - }; + Vector2 draw_glyph(RID p_canvas, int p_size, const Vector2 &p_pos, uint32_t p_index, const Color &p_color = Color(1, 1, 1)) const; + Vector2 draw_glyph_outline(RID p_canvas, int p_size, int p_outline_size, const Vector2 &p_pos, uint32_t p_index, const Color &p_color = Color(1, 1, 1)) const; + + FontData(); + FontData(const String &p_filename, int p_base_size); + FontData(const PackedByteArray &p_data, const String &p_type, int p_base_size); + + ~FontData(); +}; + +/*************************************************************************/ - _FORCE_INLINE_ bool operator<(const KerningPairKey &p_r) const { return pair < p_r.pair; } +class TextLine; +class TextParagraph; + +class Font : public Resource { + GDCLASS(Font, Resource); + +public: + enum SpacingType { + SPACING_TOP, + SPACING_BOTTOM }; private: - HashMap<char32_t, Character> char_map; - Map<KerningPairKey, int> kerning_map; - - float height; - float ascent; - bool distance_field_hint; + int spacing_top = 0; + int spacing_bottom = 0; - void _set_chars(const Vector<int> &p_chars); - Vector<int> _get_chars() const; - void _set_kernings(const Vector<int> &p_kernings); - Vector<int> _get_kernings() const; - void _set_textures(const Vector<Variant> &p_textures); - Vector<Variant> _get_textures() const; + mutable LRUCache<uint64_t, Ref<TextLine>> cache; + mutable LRUCache<uint64_t, Ref<TextParagraph>> cache_wrap; - Ref<BitmapFont> fallback; + Vector<Ref<FontData>> data; protected: static void _bind_methods(); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + + void _data_changed(); + public: - Error create_from_fnt(const String &p_file); + Dictionary get_feature_list() const; - void set_height(float p_height); - float get_height() const override; + // Font data control. + void add_data(const Ref<FontData> &p_data); + void set_data(int p_idx, const Ref<FontData> &p_data); + int get_data_count() const; + Ref<FontData> get_data(int p_idx) const; + void remove_data(int p_idx); - void set_ascent(float p_ascent); - float get_ascent() const override; - float get_descent() const override; - float get_underline_position() const override; - float get_underline_thickness() const override; + float get_height(int p_size = -1) const; + float get_ascent(int p_size = -1) const; + float get_descent(int p_size = -1) const; - void add_texture(const Ref<Texture2D> &p_texture); - void add_char(char32_t p_char, int p_texture_idx, const Rect2 &p_rect, const Size2 &p_align, float p_advance = -1); + float get_underline_position(int p_size = -1) const; + float get_underline_thickness(int p_size = -1) const; - int get_character_count() const; - Vector<char32_t> get_char_keys() const; - Character get_character(char32_t p_char) const; + int get_spacing(int p_type) const; + void set_spacing(int p_type, int p_value); - int get_texture_count() const; - Ref<Texture2D> get_texture(int p_idx) const; + // Drawing string. + Size2 get_string_size(const String &p_text, int p_size = -1) const; + Size2 get_multiline_string_size(const String &p_text, float p_width = -1, int p_size = -1, uint8_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND) const; - void add_kerning_pair(char32_t p_A, char32_t p_B, int p_kerning); - int get_kerning_pair(char32_t p_A, char32_t p_B) const; - Vector<KerningPairKey> get_kerning_pair_keys() const; + void draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, float p_width = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint8_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + void draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, float p_width = -1, int p_max_lines = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint8_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; - Size2 get_char_size(char32_t p_char, char32_t p_next = 0) const override; + // Helper functions. + bool has_char(char32_t p_char) const; + String get_supported_chars() const; - void set_fallback(const Ref<BitmapFont> &p_fallback); - Ref<BitmapFont> get_fallback() const; + Size2 get_char_size(char32_t p_char, char32_t p_next = 0, int p_size = -1) const; + float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; - void clear(); + Vector<RID> get_rids() const; - void set_distance_field_hint(bool p_distance_field); - bool is_distance_field_hint() const override; + void update_changes(); + + Font(); + ~Font(); +}; + +VARIANT_ENUM_CAST(Font::SpacingType); - float draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, const Color &p_modulate = Color(1, 1, 1), bool p_outline = false) const override; +/*************************************************************************/ - BitmapFont(); - ~BitmapFont(); +class ResourceFormatLoaderFont : public ResourceFormatLoader { +public: + virtual RES load(const String &p_path, const String &p_original_path = "", Error *r_error = nullptr, bool p_use_sub_threads = false, float *r_progress = nullptr, bool p_no_cache = false); + virtual void get_recognized_extensions_for_type(const String &p_type, List<String> *p_extensions) const; + virtual void get_recognized_extensions(List<String> *p_extensions) const; + virtual bool handles_type(const String &p_type) const; + virtual String get_resource_type(const String &p_path) const; }; -class ResourceFormatLoaderBMFont : public ResourceFormatLoader { +#ifndef DISABLE_DEPRECATED + +class ResourceFormatLoaderCompatFont : public ResourceFormatLoader { public: virtual RES load(const String &p_path, const String &p_original_path = "", Error *r_error = nullptr, bool p_use_sub_threads = false, float *r_progress = nullptr, bool p_no_cache = false); + virtual void get_recognized_extensions_for_type(const String &p_type, List<String> *p_extensions) const; virtual void get_recognized_extensions(List<String> *p_extensions) const; virtual bool handles_type(const String &p_type) const; virtual String get_resource_type(const String &p_path) const; }; -#endif +#endif /* DISABLE_DEPRECATED */ + +#endif /* FONT_H */ diff --git a/scene/resources/gradient.cpp b/scene/resources/gradient.cpp index 4bcc52776b..6b41b97e45 100644 --- a/scene/resources/gradient.cpp +++ b/scene/resources/gradient.cpp @@ -32,14 +32,8 @@ #include "core/core_string_names.h" -//setter and getter names for property serialization -#define COLOR_RAMP_GET_OFFSETS "get_offsets" -#define COLOR_RAMP_GET_COLORS "get_colors" -#define COLOR_RAMP_SET_OFFSETS "set_offsets" -#define COLOR_RAMP_SET_COLORS "set_colors" - Gradient::Gradient() { - //Set initial color ramp transition from black to white + //Set initial gradient transition from black to white points.resize(2); points.write[0].color = Color(0, 0, 0, 1); points.write[0].offset = 0; @@ -65,14 +59,14 @@ void Gradient::_bind_methods() { ClassDB::bind_method(D_METHOD("get_point_count"), &Gradient::get_points_count); - ClassDB::bind_method(D_METHOD(COLOR_RAMP_SET_OFFSETS, "offsets"), &Gradient::set_offsets); - ClassDB::bind_method(D_METHOD(COLOR_RAMP_GET_OFFSETS), &Gradient::get_offsets); + ClassDB::bind_method(D_METHOD("set_offsets", "offsets"), &Gradient::set_offsets); + ClassDB::bind_method(D_METHOD("get_offsets"), &Gradient::get_offsets); - ClassDB::bind_method(D_METHOD(COLOR_RAMP_SET_COLORS, "colors"), &Gradient::set_colors); - ClassDB::bind_method(D_METHOD(COLOR_RAMP_GET_COLORS), &Gradient::get_colors); + ClassDB::bind_method(D_METHOD("set_colors", "colors"), &Gradient::set_colors); + ClassDB::bind_method(D_METHOD("get_colors"), &Gradient::get_colors); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_FLOAT32_ARRAY, "offsets"), COLOR_RAMP_SET_OFFSETS, COLOR_RAMP_GET_OFFSETS); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "colors"), COLOR_RAMP_SET_COLORS, COLOR_RAMP_GET_COLORS); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_FLOAT32_ARRAY, "offsets"), "set_offsets", "get_offsets"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "colors"), "set_colors", "get_colors"); } Vector<float> Gradient::get_offsets() const { @@ -129,7 +123,7 @@ void Gradient::add_point(float p_offset, const Color &p_color) { void Gradient::remove_point(int p_index) { ERR_FAIL_INDEX(p_index, points.size()); - ERR_FAIL_COND(points.size() <= 2); + ERR_FAIL_COND(points.size() <= 1); points.remove(p_index); emit_signal(CoreStringNames::get_singleton()->changed); } diff --git a/scene/resources/gradient.h b/scene/resources/gradient.h index 6518b13ee8..e839909770 100644 --- a/scene/resources/gradient.h +++ b/scene/resources/gradient.h @@ -31,7 +31,7 @@ #ifndef GRADIENT_H #define GRADIENT_H -#include "core/resource.h" +#include "core/io/resource.h" class Gradient : public Resource { GDCLASS(Gradient, Resource); diff --git a/scene/resources/material.cpp b/scene/resources/material.cpp index 1e95a35726..6e08af23f5 100644 --- a/scene/resources/material.cpp +++ b/scene/resources/material.cpp @@ -30,7 +30,7 @@ #include "material.h" -#include "core/engine.h" +#include "core/config/engine.h" #ifdef TOOLS_ENABLED #include "editor/editor_settings.h" @@ -324,7 +324,6 @@ void BaseMaterial3D::init_shaders() { shader_names->rim_texture_channel = "rim_texture_channel"; shader_names->heightmap_texture_channel = "heightmap_texture_channel"; shader_names->refraction_texture_channel = "refraction_texture_channel"; - shader_names->alpha_scissor_threshold = "alpha_scissor_threshold"; shader_names->transmittance_color = "transmittance_color"; shader_names->transmittance_curve = "transmittance_curve"; @@ -349,6 +348,12 @@ void BaseMaterial3D::init_shaders() { shader_names->texture_names[TEXTURE_DETAIL_ALBEDO] = "texture_detail_albedo"; shader_names->texture_names[TEXTURE_DETAIL_NORMAL] = "texture_detail_normal"; shader_names->texture_names[TEXTURE_ORM] = "texture_orm"; + + shader_names->alpha_scissor_threshold = "alpha_scissor_threshold"; + shader_names->alpha_hash_scale = "alpha_hash_scale"; + + shader_names->alpha_antialiasing_edge = "alpha_antialiasing_edge"; + shader_names->albedo_texture_size = "albedo_texture_size"; } Ref<StandardMaterial3D> BaseMaterial3D::materials_for_2d[BaseMaterial3D::MAX_MATERIALS_FOR_2D]; @@ -435,6 +440,8 @@ void BaseMaterial3D::_update_shader() { case BLEND_MODE_MUL: code += "blend_mul"; break; + case BLEND_MODE_MAX: + break; // Internal value, skip. } DepthDrawMode ddm = depth_draw_mode; @@ -452,10 +459,8 @@ void BaseMaterial3D::_update_shader() { case DEPTH_DRAW_DISABLED: code += ",depth_draw_never"; break; - } - - if (transparency == TRANSPARENCY_ALPHA_DEPTH_PRE_PASS) { - code += ",depth_prepass_alpha"; + case DEPTH_DRAW_MAX: + break; // Internal value, skip. } switch (cull_mode) { @@ -468,6 +473,8 @@ void BaseMaterial3D::_update_shader() { case CULL_DISABLED: code += ",cull_disabled"; break; + case CULL_MAX: + break; // Internal value, skip. } switch (diffuse_mode) { case DIFFUSE_BURLEY: @@ -485,6 +492,8 @@ void BaseMaterial3D::_update_shader() { case DIFFUSE_TOON: code += ",diffuse_toon"; break; + case DIFFUSE_MAX: + break; // Internal value, skip. } switch (specular_mode) { case SPECULAR_SCHLICK_GGX: @@ -502,6 +511,8 @@ void BaseMaterial3D::_update_shader() { case SPECULAR_DISABLED: code += ",specular_disabled"; break; + case SPECULAR_MAX: + break; // Internal value, skip. } if (features[FEATURE_SUBSURFACE_SCATTERING] && flags[FLAG_SUBSURFACE_MODE_SKIN]) { code += ",sss_mode_skin"; @@ -525,6 +536,23 @@ void BaseMaterial3D::_update_shader() { if (flags[FLAG_USE_SHADOW_TO_OPACITY]) { code += ",shadow_to_opacity"; } + + if (transparency == TRANSPARENCY_ALPHA_DEPTH_PRE_PASS) { + code += ",depth_prepass_alpha"; + } + + // Although its technically possible to do alpha antialiasing without using alpha hash or alpha scissor, + // it is restricted in the base material because it has no use, and abusing it with regular Alpha blending can + // saturate the MSAA mask + if (transparency == TRANSPARENCY_ALPHA_HASH || transparency == TRANSPARENCY_ALPHA_SCISSOR) { + // alpha antialiasing is only useful in ALPHA_HASH or ALPHA_SCISSOR + if (alpha_antialiasing_mode == ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE) { + code += ",alpha_to_coverage"; + } else if (alpha_antialiasing_mode == ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE_AND_TO_ONE) { + code += ",alpha_to_coverage_and_one"; + } + } + code += ";\n"; code += "uniform vec4 albedo : hint_color;\n"; @@ -541,8 +569,18 @@ void BaseMaterial3D::_update_shader() { code += "uniform float distance_fade_max;\n"; } + // alpha scissor is only valid if there is not antialiasing edge + // alpha hash is valid whenever, but not with alpha scissor if (transparency == TRANSPARENCY_ALPHA_SCISSOR) { code += "uniform float alpha_scissor_threshold;\n"; + } else if (transparency == TRANSPARENCY_ALPHA_HASH) { + code += "uniform float alpha_hash_scale;\n"; + } + // if alpha antialiasing isn't off, add in the edge variable + if (alpha_antialiasing_mode != ALPHA_ANTIALIASING_OFF && + (transparency == TRANSPARENCY_ALPHA_SCISSOR || transparency == TRANSPARENCY_ALPHA_HASH)) { + code += "uniform float alpha_antialiasing_edge;\n"; + code += "uniform ivec2 albedo_texture_size;\n"; } code += "uniform float point_size : hint_range(0,128);\n"; @@ -568,6 +606,8 @@ void BaseMaterial3D::_update_shader() { case TEXTURE_CHANNEL_GRAYSCALE: { code += "uniform sampler2D texture_roughness : hint_roughness_gray," + texfilter_str + ";\n"; } break; + case TEXTURE_CHANNEL_MAX: + break; // Internal value, skip. } code += "uniform float specular;\n"; @@ -731,6 +771,8 @@ void BaseMaterial3D::_update_shader() { code += "\tUV /= vec2(h_frames, v_frames);\n"; code += "\tUV += vec2(mod(particle_frame, h_frames) / h_frames, floor(particle_frame / h_frames) / v_frames);\n"; } break; + case BILLBOARD_MAX: + break; // Internal value, skip. } if (flags[FLAG_FIXED_SIZE]) { @@ -903,6 +945,8 @@ void BaseMaterial3D::_update_shader() { case TEXTURE_CHANNEL_GRAYSCALE: { code += "\tvec4 roughness_texture_channel = vec4(0.333333,0.333333,0.333333,0.0);\n"; } break; + case TEXTURE_CHANNEL_MAX: + break; // Internal value, skip. } if (flags[FLAG_UV1_USE_TRIPLANAR]) { @@ -970,10 +1014,17 @@ void BaseMaterial3D::_update_shader() { code += "\tALBEDO *= 1.0 - ref_amount;\n"; code += "\tALPHA = 1.0;\n"; - } else if (transparency == TRANSPARENCY_ALPHA || transparency == TRANSPARENCY_ALPHA_DEPTH_PRE_PASS || flags[FLAG_USE_SHADOW_TO_OPACITY] || (distance_fade == DISTANCE_FADE_PIXEL_ALPHA) || proximity_fade_enabled) { + } else if (transparency != TRANSPARENCY_DISABLED || flags[FLAG_USE_SHADOW_TO_OPACITY] || (distance_fade == DISTANCE_FADE_PIXEL_ALPHA) || proximity_fade_enabled) { code += "\tALPHA = albedo.a * albedo_tex.a;\n"; + } + if (transparency == TRANSPARENCY_ALPHA_HASH) { + code += "\tALPHA_HASH_SCALE = alpha_hash_scale;\n"; } else if (transparency == TRANSPARENCY_ALPHA_SCISSOR) { - code += "\tif (albedo.a * albedo_tex.a < alpha_scissor_threshold) discard;\n"; + code += "\tALPHA_SCISSOR_THRESHOLD = alpha_scissor_threshold;\n"; + } + if (alpha_antialiasing_mode != ALPHA_ANTIALIASING_OFF && (transparency == TRANSPARENCY_ALPHA_HASH || transparency == TRANSPARENCY_ALPHA_SCISSOR)) { + code += "\tALPHA_ANTIALIASING_EDGE = alpha_antialiasing_edge;\n"; + code += "\tALPHA_TEXTURE_COORDINATE = UV * vec2(albedo_texture_size);\n"; } if (proximity_fade_enabled) { @@ -1143,6 +1194,8 @@ void BaseMaterial3D::_update_shader() { case BLEND_MODE_MUL: { code += "\tvec3 detail = mix(ALBEDO.rgb,ALBEDO.rgb*detail_tex.rgb,detail_tex.a);\n"; } break; + case BLEND_MODE_MAX: + break; // Internal value, skip. } code += "\tvec3 detail_norm = mix(NORMALMAP,detail_norm_tex.rgb,detail_tex.a);\n"; @@ -1424,6 +1477,20 @@ BaseMaterial3D::Transparency BaseMaterial3D::get_transparency() const { return transparency; } +void BaseMaterial3D::set_alpha_antialiasing(AlphaAntiAliasing p_alpha_aa) { + if (alpha_antialiasing_mode == p_alpha_aa) { + return; + } + + alpha_antialiasing_mode = p_alpha_aa; + _queue_shader_change(); + _change_notify(); +} + +BaseMaterial3D::AlphaAntiAliasing BaseMaterial3D::get_alpha_antialiasing() const { + return alpha_antialiasing_mode; +} + void BaseMaterial3D::set_shading_mode(ShadingMode p_shading_mode) { if (shading_mode == p_shading_mode) { return; @@ -1530,6 +1597,10 @@ void BaseMaterial3D::set_texture(TextureParam p_param, const Ref<Texture2D> &p_t textures[p_param] = p_texture; RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); RS::get_singleton()->material_set_param(_get_material(), shader_names->texture_names[p_param], rid); + if (p_texture.is_valid() && p_param == TEXTURE_ALBEDO) { + RS::get_singleton()->material_set_param(_get_material(), shader_names->albedo_texture_size, + Vector2i(p_texture->get_width(), p_texture->get_height())); + } _change_notify(); _queue_shader_change(); } @@ -1605,10 +1676,34 @@ void BaseMaterial3D::_validate_property(PropertyInfo &property) const { property.usage = 0; } + // you can only enable anti-aliasing (in mataerials) on alpha scissor and alpha hash + const bool can_select_aa = (transparency == TRANSPARENCY_ALPHA_SCISSOR || transparency == TRANSPARENCY_ALPHA_HASH); + // alpha anti aliasiasing is only enabled when you can select aa + const bool alpha_aa_enabled = (alpha_antialiasing_mode != ALPHA_ANTIALIASING_OFF) && can_select_aa; + + // alpha scissor slider isn't needed when alpha antialiasing is enabled if (property.name == "alpha_scissor_threshold" && transparency != TRANSPARENCY_ALPHA_SCISSOR) { property.usage = 0; } + // alpha hash scale slider is only needed if transparency is alpha hash + if (property.name == "alpha_hash_scale" && transparency != TRANSPARENCY_ALPHA_HASH) { + property.usage = 0; + } + + if (property.name == "alpha_antialiasing_mode" && !can_select_aa) { + property.usage = 0; + } + + // we cant choose an antialiasing mode if alpha isnt possible + if (property.name == "alpha_antialiasing_edge" && !alpha_aa_enabled) { + property.usage = 0; + } + + if (property.name == "blend_mode" && alpha_aa_enabled) { + property.usage = 0; + } + if ((property.name == "heightmap_min_layers" || property.name == "heightmap_max_layers") && !deep_parallax) { property.usage = 0; } @@ -1845,6 +1940,24 @@ float BaseMaterial3D::get_alpha_scissor_threshold() const { return alpha_scissor_threshold; } +void BaseMaterial3D::set_alpha_hash_scale(float p_scale) { + alpha_hash_scale = p_scale; + RS::get_singleton()->material_set_param(_get_material(), shader_names->alpha_hash_scale, p_scale); +} + +float BaseMaterial3D::get_alpha_hash_scale() const { + return alpha_hash_scale; +} + +void BaseMaterial3D::set_alpha_antialiasing_edge(float p_edge) { + alpha_antialiasing_edge = p_edge; + RS::get_singleton()->material_set_param(_get_material(), shader_names->alpha_antialiasing_edge, p_edge); +} + +float BaseMaterial3D::get_alpha_antialiasing_edge() const { + return alpha_antialiasing_edge; +} + void BaseMaterial3D::set_grow(float p_grow) { grow = p_grow; RS::get_singleton()->material_set_param(_get_material(), shader_names->grow, p_grow); @@ -2033,6 +2146,12 @@ void BaseMaterial3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_transparency", "transparency"), &BaseMaterial3D::set_transparency); ClassDB::bind_method(D_METHOD("get_transparency"), &BaseMaterial3D::get_transparency); + ClassDB::bind_method(D_METHOD("set_alpha_antialiasing", "alpha_aa"), &BaseMaterial3D::set_alpha_antialiasing); + ClassDB::bind_method(D_METHOD("get_alpha_antialiasing"), &BaseMaterial3D::get_alpha_antialiasing); + + ClassDB::bind_method(D_METHOD("set_alpha_antialiasing_edge", "edge"), &BaseMaterial3D::set_alpha_antialiasing_edge); + ClassDB::bind_method(D_METHOD("get_alpha_antialiasing_edge"), &BaseMaterial3D::get_alpha_antialiasing_edge); + ClassDB::bind_method(D_METHOD("set_shading_mode", "shading_mode"), &BaseMaterial3D::set_shading_mode); ClassDB::bind_method(D_METHOD("get_shading_mode"), &BaseMaterial3D::get_shading_mode); @@ -2186,6 +2305,9 @@ void BaseMaterial3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_alpha_scissor_threshold", "threshold"), &BaseMaterial3D::set_alpha_scissor_threshold); ClassDB::bind_method(D_METHOD("get_alpha_scissor_threshold"), &BaseMaterial3D::get_alpha_scissor_threshold); + ClassDB::bind_method(D_METHOD("set_alpha_hash_scale", "threshold"), &BaseMaterial3D::set_alpha_hash_scale); + ClassDB::bind_method(D_METHOD("get_alpha_hash_scale"), &BaseMaterial3D::get_alpha_hash_scale); + ClassDB::bind_method(D_METHOD("set_grow_enabled", "enable"), &BaseMaterial3D::set_grow_enabled); ClassDB::bind_method(D_METHOD("is_grow_enabled"), &BaseMaterial3D::is_grow_enabled); @@ -2217,8 +2339,11 @@ void BaseMaterial3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_distance_fade_min_distance"), &BaseMaterial3D::get_distance_fade_min_distance); ADD_GROUP("Transparency", ""); - ADD_PROPERTY(PropertyInfo(Variant::INT, "transparency", PROPERTY_HINT_ENUM, "Disabled,Alpha,AlphaScissor,DepthPrePass"), "set_transparency", "get_transparency"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "transparency", PROPERTY_HINT_ENUM, "Disabled,Alpha,Alpha Scissor,Alpha Hash,Depth PrePass"), "set_transparency", "get_transparency"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "alpha_scissor_threshold", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_alpha_scissor_threshold", "get_alpha_scissor_threshold"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "alpha_hash_scale", PROPERTY_HINT_RANGE, "0,2,0.01"), "set_alpha_hash_scale", "get_alpha_hash_scale"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alpha_antialiasing_mode", PROPERTY_HINT_ENUM, "Disabled,Alpha Edge Blend,Alpha Edge Clip"), "set_alpha_antialiasing", "get_alpha_antialiasing"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "alpha_antialiasing_edge", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_alpha_antialiasing_edge", "get_alpha_antialiasing_edge"); ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_mode", PROPERTY_HINT_ENUM, "Mix,Add,Sub,Mul"), "set_blend_mode", "get_blend_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mode", PROPERTY_HINT_ENUM, "Back,Front,Disabled"), "set_cull_mode", "get_cull_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "depth_draw_mode", PROPERTY_HINT_ENUM, "Opaque Only,Always,Never"), "set_depth_draw_mode", "get_depth_draw_mode"); @@ -2292,10 +2417,10 @@ void BaseMaterial3D::_bind_methods() { ADD_GROUP("Height", "heightmap_"); ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "heightmap_enabled"), "set_feature", "get_feature", FEATURE_HEIGHT_MAPPING); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "heightmap_scale", PROPERTY_HINT_RANGE, "-16,16,0.01"), "set_heightmap_scale", "get_heightmap_scale"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "heightmap_scale", PROPERTY_HINT_RANGE, "-16,16,0.001"), "set_heightmap_scale", "get_heightmap_scale"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "heightmap_deep_parallax"), "set_heightmap_deep_parallax", "is_heightmap_deep_parallax_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "heightmap_min_layers", PROPERTY_HINT_RANGE, "1,32,1"), "set_heightmap_deep_parallax_min_layers", "get_heightmap_deep_parallax_min_layers"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "heightmap_max_layers", PROPERTY_HINT_RANGE, "1,32,1"), "set_heightmap_deep_parallax_max_layers", "get_heightmap_deep_parallax_max_layers"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "heightmap_min_layers", PROPERTY_HINT_RANGE, "1,64,1"), "set_heightmap_deep_parallax_min_layers", "get_heightmap_deep_parallax_min_layers"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "heightmap_max_layers", PROPERTY_HINT_RANGE, "1,64,1"), "set_heightmap_deep_parallax_max_layers", "get_heightmap_deep_parallax_max_layers"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "heightmap_flip_tangent"), "set_heightmap_deep_parallax_flip_tangent", "get_heightmap_deep_parallax_flip_tangent"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "heightmap_flip_binormal"), "set_heightmap_deep_parallax_flip_binormal", "get_heightmap_deep_parallax_flip_binormal"); ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "heightmap_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture", TEXTURE_HEIGHTMAP); @@ -2414,6 +2539,7 @@ void BaseMaterial3D::_bind_methods() { BIND_ENUM_CONSTANT(TRANSPARENCY_DISABLED); BIND_ENUM_CONSTANT(TRANSPARENCY_ALPHA); BIND_ENUM_CONSTANT(TRANSPARENCY_ALPHA_SCISSOR); + BIND_ENUM_CONSTANT(TRANSPARENCY_ALPHA_HASH); BIND_ENUM_CONSTANT(TRANSPARENCY_ALPHA_DEPTH_PRE_PASS); BIND_ENUM_CONSTANT(TRANSPARENCY_MAX); @@ -2441,6 +2567,10 @@ void BaseMaterial3D::_bind_methods() { BIND_ENUM_CONSTANT(BLEND_MODE_SUB); BIND_ENUM_CONSTANT(BLEND_MODE_MUL); + BIND_ENUM_CONSTANT(ALPHA_ANTIALIASING_OFF); + BIND_ENUM_CONSTANT(ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE); + BIND_ENUM_CONSTANT(ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE_AND_TO_ONE); + BIND_ENUM_CONSTANT(DEPTH_DRAW_OPAQUE_ONLY); BIND_ENUM_CONSTANT(DEPTH_DRAW_ALWAYS); BIND_ENUM_CONSTANT(DEPTH_DRAW_DISABLED); @@ -2506,8 +2636,9 @@ BaseMaterial3D::BaseMaterial3D(bool p_orm) : element(this) { orm = p_orm; // Initialize to the same values as the shader - transparency = TRANSPARENCY_DISABLED; shading_mode = SHADING_MODE_PER_PIXEL; + transparency = TRANSPARENCY_DISABLED; + alpha_antialiasing_mode = ALPHA_ANTIALIASING_OFF; set_albedo(Color(1.0, 1.0, 1.0, 1.0)); set_specular(0.5); set_roughness(1.0); @@ -2539,9 +2670,14 @@ BaseMaterial3D::BaseMaterial3D(bool p_orm) : set_particles_anim_h_frames(1); set_particles_anim_v_frames(1); set_particles_anim_loop(false); - set_alpha_scissor_threshold(0.98); emission_op = EMISSION_OP_ADD; + set_transparency(TRANSPARENCY_DISABLED); + set_alpha_antialiasing(ALPHA_ANTIALIASING_OFF); + set_alpha_scissor_threshold(0.05); + set_alpha_hash_scale(1.0); + set_alpha_antialiasing_edge(0.3); + proximity_fade_enabled = false; distance_fade = DISTANCE_FADE_DISABLED; set_proximity_fade_distance(1); @@ -2582,10 +2718,8 @@ BaseMaterial3D::BaseMaterial3D(bool p_orm) : features[i] = false; } - current_key.key0 = 0; - current_key.key1 = 0; - current_key.invalid_key = 1; texture_filter = TEXTURE_FILTER_LINEAR_WITH_MIPMAPS; + _queue_shader_change(); } @@ -2633,6 +2767,12 @@ bool StandardMaterial3D::_set(const StringName &p_name, const Variant &p_value) set_transparency(TRANSPARENCY_ALPHA_SCISSOR); } return true; + } else if (p_name == "params_use_alpha_hash") { + bool use_hash = p_value; + if (use_hash) { + set_transparency(TRANSPARENCY_ALPHA_HASH); + } + return true; } else if (p_name == "params_depth_draw_mode") { int mode = p_value; if (mode == 3) { @@ -2667,6 +2807,8 @@ bool StandardMaterial3D::_set(const StringName &p_name, const Variant &p_value) { "params_grow", "grow" }, { "params_grow_amount", "grow_amount" }, { "params_alpha_scissor_threshold", "alpha_scissor_threshold" }, + { "params_alpha_hash_scale", "alpha_hash_scale" }, + { "params_alpha_antialiasing_edge", "alpha_antialiasing_edge" }, { "depth_scale", "heightmap_scale" }, { "depth_deep_parallax", "heightmap_deep_parallax" }, diff --git a/scene/resources/material.h b/scene/resources/material.h index b5bdd77eb5..caf28eea18 100644 --- a/scene/resources/material.h +++ b/scene/resources/material.h @@ -31,8 +31,8 @@ #ifndef MATERIAL_H #define MATERIAL_H -#include "core/resource.h" -#include "core/self_list.h" +#include "core/io/resource.h" +#include "core/templates/self_list.h" #include "scene/resources/shader.h" #include "scene/resources/texture.h" #include "servers/rendering/shader_language.h" @@ -145,17 +145,26 @@ public: enum DetailUV { DETAIL_UV_1, - DETAIL_UV_2 + DETAIL_UV_2, + DETAIL_UV_MAX }; enum Transparency { TRANSPARENCY_DISABLED, TRANSPARENCY_ALPHA, TRANSPARENCY_ALPHA_SCISSOR, + TRANSPARENCY_ALPHA_HASH, TRANSPARENCY_ALPHA_DEPTH_PRE_PASS, TRANSPARENCY_MAX, }; + enum AlphaAntiAliasing { + ALPHA_ANTIALIASING_OFF, + ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE, + ALPHA_ANTIALIASING_ALPHA_TO_COVERAGE_AND_TO_ONE, + ALPHA_ANTIALIASING_MAX + }; + enum ShadingMode { SHADING_MODE_UNSHADED, SHADING_MODE_PER_PIXEL, @@ -184,18 +193,21 @@ public: BLEND_MODE_ADD, BLEND_MODE_SUB, BLEND_MODE_MUL, + BLEND_MODE_MAX }; enum DepthDrawMode { DEPTH_DRAW_OPAQUE_ONLY, DEPTH_DRAW_ALWAYS, DEPTH_DRAW_DISABLED, + DEPTH_DRAW_MAX }; enum CullMode { CULL_BACK, CULL_FRONT, - CULL_DISABLED + CULL_DISABLED, + CULL_MAX }; enum Flags { @@ -227,6 +239,7 @@ public: DIFFUSE_LAMBERT_WRAP, DIFFUSE_OREN_NAYAR, DIFFUSE_TOON, + DIFFUSE_MAX }; enum SpecularMode { @@ -235,6 +248,7 @@ public: SPECULAR_PHONG, SPECULAR_TOON, SPECULAR_DISABLED, + SPECULAR_MAX }; enum BillboardMode { @@ -242,6 +256,7 @@ public: BILLBOARD_ENABLED, BILLBOARD_FIXED_Y, BILLBOARD_PARTICLES, + BILLBOARD_MAX }; enum TextureChannel { @@ -249,12 +264,14 @@ public: TEXTURE_CHANNEL_GREEN, TEXTURE_CHANNEL_BLUE, TEXTURE_CHANNEL_ALPHA, - TEXTURE_CHANNEL_GRAYSCALE + TEXTURE_CHANNEL_GRAYSCALE, + TEXTURE_CHANNEL_MAX }; enum EmissionOperator { EMISSION_OP_ADD, - EMISSION_OP_MULTIPLY + EMISSION_OP_MULTIPLY, + EMISSION_OP_MAX }; enum DistanceFadeMode { @@ -262,43 +279,47 @@ public: DISTANCE_FADE_PIXEL_ALPHA, DISTANCE_FADE_PIXEL_DITHER, DISTANCE_FADE_OBJECT_DITHER, + DISTANCE_FADE_MAX }; private: - union MaterialKey { - struct { - uint64_t feature_mask : FEATURE_MAX; - uint64_t detail_uv : 1; - uint64_t blend_mode : 2; - uint64_t depth_draw_mode : 2; - uint64_t cull_mode : 2; - uint64_t flags : FLAG_MAX; - uint64_t detail_blend_mode : 2; - uint64_t diffuse_mode : 3; - uint64_t specular_mode : 3; - uint64_t invalid_key : 1; - uint64_t deep_parallax : 1; - uint64_t billboard_mode : 2; - uint64_t grow : 1; - uint64_t proximity_fade : 1; - uint64_t distance_fade : 2; - uint64_t emission_op : 1; - uint64_t texture_filter : 3; - uint64_t transparency : 2; - uint64_t shading_mode : 2; - uint64_t roughness_channel : 3; - }; - - struct { - uint64_t key0; - uint64_t key1; - }; + struct MaterialKey { + // enum values + uint64_t texture_filter : get_num_bits(TEXTURE_FILTER_MAX - 1); + uint64_t detail_uv : get_num_bits(DETAIL_UV_MAX - 1); + uint64_t transparency : get_num_bits(TRANSPARENCY_MAX - 1); + uint64_t alpha_antialiasing_mode : get_num_bits(ALPHA_ANTIALIASING_MAX - 1); + uint64_t shading_mode : get_num_bits(SHADING_MODE_MAX - 1); + uint64_t blend_mode : get_num_bits(BLEND_MODE_MAX - 1); + uint64_t depth_draw_mode : get_num_bits(DEPTH_DRAW_MAX - 1); + uint64_t cull_mode : get_num_bits(CULL_MAX - 1); + uint64_t diffuse_mode : get_num_bits(DIFFUSE_MAX - 1); + uint64_t specular_mode : get_num_bits(SPECULAR_MAX - 1); + uint64_t billboard_mode : get_num_bits(BILLBOARD_MAX - 1); + uint64_t detail_blend_mode : get_num_bits(BLEND_MODE_MAX - 1); + uint64_t roughness_channel : get_num_bits(TEXTURE_CHANNEL_MAX - 1); + uint64_t emission_op : get_num_bits(EMISSION_OP_MAX - 1); + uint64_t distance_fade : get_num_bits(DISTANCE_FADE_MAX - 1); + + // flag bitfield + uint64_t feature_mask : FEATURE_MAX - 1; + uint64_t flags : FLAG_MAX - 1; + + // booleans + uint64_t deep_parallax : 1; + uint64_t grow : 1; + uint64_t proximity_fade : 1; + + MaterialKey() { + memset(this, 0, sizeof(MaterialKey)); + } bool operator==(const MaterialKey &p_key) const { - return (key0 == p_key.key0) && (key1 == p_key.key1); + return memcmp(this, &p_key, sizeof(MaterialKey)) == 0; } + bool operator<(const MaterialKey &p_key) const { - return (key0 == p_key.key0) ? (key1 < p_key.key1) : (key0 < p_key.key0); + return memcmp(this, &p_key, sizeof(MaterialKey)) < 0; } }; @@ -313,13 +334,7 @@ private: _FORCE_INLINE_ MaterialKey _compute_key() const { MaterialKey mk; - mk.key0 = 0; - mk.key1 = 0; - for (int i = 0; i < FEATURE_MAX; i++) { - if (features[i]) { - mk.feature_mask |= ((uint64_t)1 << i); - } - } + mk.detail_uv = detail_uv; mk.blend_mode = blend_mode; mk.depth_draw_mode = depth_draw_mode; @@ -328,20 +343,28 @@ private: mk.transparency = transparency; mk.shading_mode = shading_mode; mk.roughness_channel = roughness_texture_channel; - for (int i = 0; i < FLAG_MAX; i++) { - if (flags[i]) { - mk.flags |= ((uint64_t)1 << i); - } - } mk.detail_blend_mode = detail_blend_mode; mk.diffuse_mode = diffuse_mode; mk.specular_mode = specular_mode; mk.billboard_mode = billboard_mode; - mk.deep_parallax = deep_parallax ? 1 : 0; + mk.deep_parallax = deep_parallax; mk.grow = grow_enabled; mk.proximity_fade = proximity_fade_enabled; mk.distance_fade = distance_fade; mk.emission_op = emission_op; + mk.alpha_antialiasing_mode = alpha_antialiasing_mode; + + for (int i = 0; i < FEATURE_MAX; i++) { + if (features[i]) { + mk.feature_mask |= ((uint64_t)1 << i); + } + } + + for (int i = 0; i < FLAG_MAX; i++) { + if (flags[i]) { + mk.flags |= ((uint64_t)1 << i); + } + } return mk; } @@ -392,9 +415,14 @@ private: StringName rim_texture_channel; StringName heightmap_texture_channel; StringName refraction_texture_channel; - StringName alpha_scissor_threshold; StringName texture_names[TEXTURE_MAX]; + + StringName alpha_scissor_threshold; + StringName alpha_hash_scale; + + StringName alpha_antialiasing_edge; + StringName albedo_texture_size; }; static Mutex material_mutex; @@ -433,6 +461,8 @@ private: float refraction; float point_size; float alpha_scissor_threshold; + float alpha_hash_scale; + float alpha_antialiasing_edge; bool grow_enabled; float ao_light_affect; float grow; @@ -482,6 +512,8 @@ private: TextureChannel ao_texture_channel; TextureChannel refraction_texture_channel; + AlphaAntiAliasing alpha_antialiasing_mode; + bool features[FEATURE_MAX]; Ref<Texture2D> textures[TEXTURE_MAX]; @@ -584,6 +616,12 @@ public: void set_transparency(Transparency p_transparency); Transparency get_transparency() const; + void set_alpha_antialiasing(AlphaAntiAliasing p_alpha_aa); + AlphaAntiAliasing get_alpha_antialiasing() const; + + void set_alpha_antialiasing_edge(float p_edge); + float get_alpha_antialiasing_edge() const; + void set_shading_mode(ShadingMode p_shading_mode); ShadingMode get_shading_mode() const; @@ -660,6 +698,9 @@ public: void set_alpha_scissor_threshold(float p_threshold); float get_alpha_scissor_threshold() const; + void set_alpha_hash_scale(float p_scale); + float get_alpha_hash_scale() const; + void set_on_top_of_alpha(); void set_proximity_fade(bool p_enable); @@ -707,6 +748,7 @@ VARIANT_ENUM_CAST(BaseMaterial3D::TextureParam) VARIANT_ENUM_CAST(BaseMaterial3D::TextureFilter) VARIANT_ENUM_CAST(BaseMaterial3D::ShadingMode) VARIANT_ENUM_CAST(BaseMaterial3D::Transparency) +VARIANT_ENUM_CAST(BaseMaterial3D::AlphaAntiAliasing) VARIANT_ENUM_CAST(BaseMaterial3D::DetailUV) VARIANT_ENUM_CAST(BaseMaterial3D::Feature) VARIANT_ENUM_CAST(BaseMaterial3D::BlendMode) diff --git a/scene/resources/mesh.cpp b/scene/resources/mesh.cpp index 10f0a040d0..f1c05b8014 100644 --- a/scene/resources/mesh.cpp +++ b/scene/resources/mesh.cpp @@ -30,7 +30,7 @@ #include "mesh.h" -#include "core/pair.h" +#include "core/templates/pair.h" #include "scene/resources/concave_polygon_shape_3d.h" #include "scene/resources/convex_polygon_shape_3d.h" #include "surface_tool.h" @@ -157,7 +157,7 @@ void Mesh::generate_debug_mesh_indices(Vector<Vector3> &r_points) { bool Mesh::surface_is_softbody_friendly(int p_idx) const { const uint32_t surface_format = surface_get_format(p_idx); - return (surface_format & Mesh::ARRAY_FLAG_USE_DYNAMIC_UPDATE && (!(surface_format & Mesh::ARRAY_COMPRESS_NORMAL))); + return (surface_format & Mesh::ARRAY_FLAG_USE_DYNAMIC_UPDATE); } Vector<Face3> Mesh::get_faces() const { @@ -168,7 +168,6 @@ Vector<Face3> Mesh::get_faces() const { return Vector<Face3>(); /* for (int i=0;i<surfaces.size();i++) { - if (RenderingServer::get_singleton()->mesh_surface_get_primitive_type( mesh, i ) != RenderingServer::PRIMITIVE_TRIANGLES ) continue; @@ -181,12 +180,10 @@ Vector<Face3> Mesh::get_faces() const { bool has_indices; if (len>0) { - indices=RenderingServer::get_singleton()->mesh_surface_get_array(mesh, i,RenderingServer::ARRAY_INDEX); has_indices=true; } else { - len=vertices.size(); has_indices=false; } @@ -210,11 +207,9 @@ Vector<Face3> Mesh::get_faces() const { for (int i=0;i<len/3;i++) { - Face3 face; for (int j=0;j<3;j++) { - int idx=i*3+j; face.vertex[j] = has_indices ? verticesptr[ indicesptr[ idx ] ] : verticesptr[idx]; } @@ -485,8 +480,30 @@ void Mesh::_bind_methods() { BIND_ENUM_CONSTANT(PRIMITIVE_TRIANGLES); BIND_ENUM_CONSTANT(PRIMITIVE_TRIANGLE_STRIP); - BIND_ENUM_CONSTANT(BLEND_SHAPE_MODE_NORMALIZED); - BIND_ENUM_CONSTANT(BLEND_SHAPE_MODE_RELATIVE); + BIND_ENUM_CONSTANT(ARRAY_VERTEX); + BIND_ENUM_CONSTANT(ARRAY_NORMAL); + BIND_ENUM_CONSTANT(ARRAY_TANGENT); + BIND_ENUM_CONSTANT(ARRAY_COLOR); + BIND_ENUM_CONSTANT(ARRAY_TEX_UV); + BIND_ENUM_CONSTANT(ARRAY_TEX_UV2); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM0); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM1); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM2); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM3); + BIND_ENUM_CONSTANT(ARRAY_BONES); + BIND_ENUM_CONSTANT(ARRAY_WEIGHTS); + BIND_ENUM_CONSTANT(ARRAY_INDEX); + BIND_ENUM_CONSTANT(ARRAY_MAX); + + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RGBA8_UNORM); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RGBA8_SNORM); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RG_HALF); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RGBA_HALF); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_R_FLOAT); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RG_FLOAT); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RGB_FLOAT); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_RGBA_FLOAT); + BIND_ENUM_CONSTANT(ARRAY_CUSTOM_MAX); BIND_ENUM_CONSTANT(ARRAY_FORMAT_VERTEX); BIND_ENUM_CONSTANT(ARRAY_FORMAT_NORMAL); @@ -494,31 +511,31 @@ void Mesh::_bind_methods() { BIND_ENUM_CONSTANT(ARRAY_FORMAT_COLOR); BIND_ENUM_CONSTANT(ARRAY_FORMAT_TEX_UV); BIND_ENUM_CONSTANT(ARRAY_FORMAT_TEX_UV2); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM0); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM1); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM2); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM3); BIND_ENUM_CONSTANT(ARRAY_FORMAT_BONES); BIND_ENUM_CONSTANT(ARRAY_FORMAT_WEIGHTS); BIND_ENUM_CONSTANT(ARRAY_FORMAT_INDEX); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_NORMAL); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_TANGENT); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_COLOR); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_TEX_UV); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_TEX_UV2); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_INDEX); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_BLEND_SHAPE_MASK); - BIND_ENUM_CONSTANT(ARRAY_FLAG_USE_2D_VERTICES); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM_BASE); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM0_SHIFT); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM1_SHIFT); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM2_SHIFT); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM3_SHIFT); - BIND_ENUM_CONSTANT(ARRAY_COMPRESS_DEFAULT); + BIND_ENUM_CONSTANT(ARRAY_FORMAT_CUSTOM_MASK); + BIND_ENUM_CONSTANT(ARRAY_COMPRESS_FLAGS_BASE); - BIND_ENUM_CONSTANT(ARRAY_VERTEX); - BIND_ENUM_CONSTANT(ARRAY_NORMAL); - BIND_ENUM_CONSTANT(ARRAY_TANGENT); - BIND_ENUM_CONSTANT(ARRAY_COLOR); - BIND_ENUM_CONSTANT(ARRAY_TEX_UV); - BIND_ENUM_CONSTANT(ARRAY_TEX_UV2); - BIND_ENUM_CONSTANT(ARRAY_BONES); - BIND_ENUM_CONSTANT(ARRAY_WEIGHTS); - BIND_ENUM_CONSTANT(ARRAY_INDEX); - BIND_ENUM_CONSTANT(ARRAY_MAX); + BIND_ENUM_CONSTANT(ARRAY_FLAG_USE_2D_VERTICES); + BIND_ENUM_CONSTANT(ARRAY_FLAG_USE_DYNAMIC_UPDATE); + BIND_ENUM_CONSTANT(ARRAY_FLAG_USE_8_BONE_WEIGHTS); + + BIND_ENUM_CONSTANT(BLEND_SHAPE_MODE_NORMALIZED); + BIND_ENUM_CONSTANT(BLEND_SHAPE_MODE_RELATIVE); } void Mesh::clear_cache() const { @@ -565,11 +582,50 @@ Vector<Ref<Shape3D>> Mesh::convex_decompose() const { Mesh::Mesh() { } +#if 0 static Vector<uint8_t> _fix_array_compatibility(const Vector<uint8_t> &p_src, uint32_t p_format, uint32_t p_elements) { - bool vertex_16bit = p_format & ((1 << (Mesh::ARRAY_VERTEX + Mesh::ARRAY_COMPRESS_BASE))); - bool has_bones = (p_format & Mesh::ARRAY_FORMAT_BONES); - bool bone_8 = has_bones && !(p_format & (Mesh::ARRAY_COMPRESS_INDEX << 2)); - bool weight_32 = has_bones && !(p_format & (Mesh::ARRAY_COMPRESS_TEX_UV2 << 2)); + enum ArrayType { + OLD_ARRAY_VERTEX = 0, + OLD_ARRAY_NORMAL = 1, + OLD_ARRAY_TANGENT = 2, + OLD_ARRAY_COLOR = 3, + OLD_ARRAY_TEX_UV = 4, + OLD_ARRAY_TEX_UV2 = 5, + OLD_ARRAY_BONES = 6, + OLD_ARRAY_WEIGHTS = 7, + OLD_ARRAY_INDEX = 8, + OLD_ARRAY_MAX = 9 + }; + + enum ArrayFormat { + /* OLD_ARRAY FORMAT FLAGS */ + OLD_ARRAY_FORMAT_VERTEX = 1 << OLD_ARRAY_VERTEX, // mandatory + OLD_ARRAY_FORMAT_NORMAL = 1 << OLD_ARRAY_NORMAL, + OLD_ARRAY_FORMAT_TANGENT = 1 << OLD_ARRAY_TANGENT, + OLD_ARRAY_FORMAT_COLOR = 1 << OLD_ARRAY_COLOR, + OLD_ARRAY_FORMAT_TEX_UV = 1 << OLD_ARRAY_TEX_UV, + OLD_ARRAY_FORMAT_TEX_UV2 = 1 << OLD_ARRAY_TEX_UV2, + OLD_ARRAY_FORMAT_BONES = 1 << OLD_ARRAY_BONES, + OLD_ARRAY_FORMAT_WEIGHTS = 1 << OLD_ARRAY_WEIGHTS, + OLD_ARRAY_FORMAT_INDEX = 1 << OLD_ARRAY_INDEX, + + OLD_ARRAY_COMPRESS_BASE = (OLD_ARRAY_INDEX + 1), + OLD_ARRAY_COMPRESS_NORMAL = 1 << (OLD_ARRAY_NORMAL + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_TANGENT = 1 << (OLD_ARRAY_TANGENT + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_COLOR = 1 << (OLD_ARRAY_COLOR + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_TEX_UV = 1 << (OLD_ARRAY_TEX_UV + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_TEX_UV2 = 1 << (OLD_ARRAY_TEX_UV2 + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_INDEX = 1 << (OLD_ARRAY_INDEX + OLD_ARRAY_COMPRESS_BASE), + OLD_ARRAY_COMPRESS_DEFAULT = OLD_ARRAY_COMPRESS_NORMAL | OLD_ARRAY_COMPRESS_TANGENT | OLD_ARRAY_COMPRESS_COLOR | OLD_ARRAY_COMPRESS_TEX_UV | OLD_ARRAY_COMPRESS_TEX_UV2, + + OLD_ARRAY_FLAG_USE_2D_VERTICES = OLD_ARRAY_COMPRESS_INDEX << 1, + OLD_ARRAY_FLAG_USE_DYNAMIC_UPDATE = OLD_ARRAY_COMPRESS_INDEX << 3, + }; + + bool vertex_16bit = p_format & ((1 << (OLD_ARRAY_VERTEX + OLD_ARRAY_COMPRESS_BASE))); + bool has_bones = (p_format & OLD_ARRAY_FORMAT_BONES); + bool bone_8 = has_bones && !(p_format & (OLD_ARRAY_COMPRESS_INDEX << 2)); + bool weight_32 = has_bones && !(p_format & (OLD_ARRAY_COMPRESS_TEX_UV2 << 2)); print_line("convert vertex16: " + itos(vertex_16bit) + " convert bone 8 " + itos(bone_8) + " convert weight 32 " + itos(weight_32)); @@ -577,7 +633,7 @@ static Vector<uint8_t> _fix_array_compatibility(const Vector<uint8_t> &p_src, ui return p_src; } - bool vertex_2d = (p_format & (Mesh::ARRAY_COMPRESS_INDEX << 1)); + bool vertex_2d = (p_format & (OLD_ARRAY_COMPRESS_INDEX << 1)); uint32_t src_stride = p_src.size() / p_elements; uint32_t dst_stride = src_stride + (vertex_16bit ? 4 : 0) + (bone_8 ? 4 : 0) - (weight_32 ? 8 : 0); @@ -676,25 +732,11 @@ static Vector<uint8_t> _fix_array_compatibility(const Vector<uint8_t> &p_src, ui return ret; } +#endif bool ArrayMesh::_set(const StringName &p_name, const Variant &p_value) { String sname = p_name; - if (p_name == "blend_shape/names") { - Vector<String> sk = p_value; - int sz = sk.size(); - const String *r = sk.ptr(); - for (int i = 0; i < sz; i++) { - add_blend_shape(r[i]); - } - return true; - } - - if (p_name == "blend_shape/mode") { - set_blend_shape_mode(BlendShapeMode(int(p_value))); - return true; - } - if (sname.begins_with("surface_")) { int sl = sname.find("/"); if (sl == -1) { @@ -732,6 +774,7 @@ bool ArrayMesh::_set(const StringName &p_name, const Variant &p_value) { add_surface_from_arrays(PrimitiveType(int(d["primitive"])), d["arrays"], d["morph_arrays"]); } else if (d.has("array_data")) { +#if 0 //print_line("array data (old style"); //older format (3.x) Vector<uint8_t> array_data = d["array_data"]; @@ -798,6 +841,7 @@ bool ArrayMesh::_set(const StringName &p_name, const Variant &p_value) { } add_surface(format, PrimitiveType(primitive), array_data, vertex_count, array_index_data, index_count, aabb, blend_shapes, bone_aabb); +#endif } else { ERR_FAIL_V(false); } @@ -816,6 +860,28 @@ bool ArrayMesh::_set(const StringName &p_name, const Variant &p_value) { return false; } +void ArrayMesh::_set_blend_shape_names(const PackedStringArray &p_names) { + ERR_FAIL_COND(surfaces.size() > 0); + + blend_shapes.resize(p_names.size()); + for (int i = 0; i < p_names.size(); i++) { + blend_shapes.write[i] = p_names[i]; + } + + if (mesh.is_valid()) { + RS::get_singleton()->mesh_set_blend_shape_count(mesh, blend_shapes.size()); + } +} + +PackedStringArray ArrayMesh::_get_blend_shape_names() const { + PackedStringArray sarr; + sarr.resize(blend_shapes.size()); + for (int i = 0; i < blend_shapes.size(); i++) { + sarr.write[i] = blend_shapes[i]; + } + return sarr; +} + Array ArrayMesh::_get_surfaces() const { if (mesh.is_null()) { return Array(); @@ -829,6 +895,12 @@ Array ArrayMesh::_get_surfaces() const { data["primitive"] = surface.primitive; data["vertex_data"] = surface.vertex_data; data["vertex_count"] = surface.vertex_count; + if (surface.skin_data.size()) { + data["skin_data"] = surface.skin_data; + } + if (surface.attribute_data.size()) { + data["attribute_data"] = surface.attribute_data; + } data["aabb"] = surface.aabb; if (surface.index_count) { data["index_data"] = surface.index_data; @@ -853,9 +925,8 @@ Array ArrayMesh::_get_surfaces() const { data["bone_aabbs"] = bone_aabbs; } - Array blend_shapes; - for (int j = 0; j < surface.blend_shapes.size(); j++) { - blend_shapes.push_back(surface.blend_shapes[j]); + if (surface.blend_shape_data.size()) { + data["blend_shapes"] = surface.blend_shape_data; } if (surfaces[i].material.is_valid()) { @@ -872,7 +943,6 @@ Array ArrayMesh::_get_surfaces() const { ret.push_back(data); } - print_line("Saving surfaces: " + itos(ret.size())); return ret; } @@ -881,6 +951,7 @@ void ArrayMesh::_create_if_empty() const { if (!mesh.is_valid()) { mesh = RS::get_singleton()->mesh_create(); RS::get_singleton()->mesh_set_blend_shape_mode(mesh, (RS::BlendShapeMode)blend_shape_mode); + RS::get_singleton()->mesh_set_blend_shape_count(mesh, blend_shapes.size()); } } @@ -902,6 +973,12 @@ void ArrayMesh::_set_surfaces(const Array &p_surfaces) { surface.primitive = RS::PrimitiveType(int(d["primitive"])); surface.vertex_data = d["vertex_data"]; surface.vertex_count = d["vertex_count"]; + if (d.has("attribute_data")) { + surface.attribute_data = d["attribute_data"]; + } + if (d.has("skin_data")) { + surface.skin_data = d["skin_data"]; + } surface.aabb = d["aabb"]; if (d.has("index_data")) { @@ -929,10 +1006,7 @@ void ArrayMesh::_set_surfaces(const Array &p_surfaces) { } if (d.has("blend_shapes")) { - Array blend_shapes; - for (int j = 0; j < blend_shapes.size(); j++) { - surface.blend_shapes.push_back(blend_shapes[j]); - } + surface.blend_shape_data = d["blend_shapes"]; } Ref<Material> material; @@ -952,15 +1026,7 @@ void ArrayMesh::_set_surfaces(const Array &p_surfaces) { if (d.has("2d")) { _2d = d["2d"]; } - /* - print_line("format: " + itos(surface.format)); - print_line("aabb: " + surface.aabb); - print_line("array size: " + itos(surface.vertex_data.size())); - print_line("vertex count: " + itos(surface.vertex_count)); - print_line("index size: " + itos(surface.index_data.size())); - print_line("index count: " + itos(surface.index_count)); - print_line("primitive: " + itos(surface.primitive)); -*/ + surface_data.push_back(surface); surface_materials.push_back(material); surface_names.push_back(name); @@ -976,7 +1042,7 @@ void ArrayMesh::_set_surfaces(const Array &p_surfaces) { } else { // if mesh does not exist (first time this is loaded, most likely), // we can create it with a single call, which is a lot more efficient and thread friendly - mesh = RS::get_singleton()->mesh_create_from_surfaces(surface_data); + mesh = RS::get_singleton()->mesh_create_from_surfaces(surface_data, blend_shapes.size()); RS::get_singleton()->mesh_set_blend_shape_mode(mesh, (RS::BlendShapeMode)blend_shape_mode); } @@ -988,7 +1054,6 @@ void ArrayMesh::_set_surfaces(const Array &p_surfaces) { s.aabb = surface_data[i].aabb; if (i == 0) { aabb = s.aabb; - blend_shapes.resize(surface_data[i].blend_shapes.size()); } else { aabb.merge_with(s.aabb); } @@ -1012,18 +1077,7 @@ bool ArrayMesh::_get(const StringName &p_name, Variant &r_ret) const { } String sname = p_name; - - if (p_name == "blend_shape/names") { - Vector<String> sk; - for (int i = 0; i < blend_shapes.size(); i++) { - sk.push_back(blend_shapes[i]); - } - r_ret = sk; - return true; - } else if (p_name == "blend_shape/mode") { - r_ret = get_blend_shape_mode(); - return true; - } else if (sname.begins_with("surface_")) { + if (sname.begins_with("surface_")) { int sl = sname.find("/"); if (sl == -1) { return false; @@ -1046,11 +1100,6 @@ void ArrayMesh::_get_property_list(List<PropertyInfo> *p_list) const { return; } - if (blend_shapes.size()) { - p_list->push_back(PropertyInfo(Variant::PACKED_STRING_ARRAY, "blend_shape/names", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::INT, "blend_shape/mode", PROPERTY_HINT_ENUM, "Normalized,Relative")); - } - for (int i = 0; i < surfaces.size(); i++) { p_list->push_back(PropertyInfo(Variant::STRING, "surface_" + itos(i + 1) + "/name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR)); if (surfaces[i].is_2d) { @@ -1076,7 +1125,7 @@ void ArrayMesh::_recompute_aabb() { #ifndef _MSC_VER #warning need to add binding to add_surface using future MeshSurfaceData object #endif -void ArrayMesh::add_surface(uint32_t p_format, PrimitiveType p_primitive, const Vector<uint8_t> &p_array, int p_vertex_count, const Vector<uint8_t> &p_index_array, int p_index_count, const AABB &p_aabb, const Vector<Vector<uint8_t>> &p_blend_shapes, const Vector<AABB> &p_bone_aabb, const Vector<RS::SurfaceData::LOD> &p_lods) { +void ArrayMesh::add_surface(uint32_t p_format, PrimitiveType p_primitive, const Vector<uint8_t> &p_array, const Vector<uint8_t> &p_attribute_array, const Vector<uint8_t> &p_skin_array, int p_vertex_count, const Vector<uint8_t> &p_index_array, int p_index_count, const AABB &p_aabb, const Vector<uint8_t> &p_blend_shape_data, const Vector<AABB> &p_bone_aabbs, const Vector<RS::SurfaceData::LOD> &p_lods) { _create_if_empty(); Surface s; @@ -1096,10 +1145,12 @@ void ArrayMesh::add_surface(uint32_t p_format, PrimitiveType p_primitive, const sd.aabb = p_aabb; sd.vertex_count = p_vertex_count; sd.vertex_data = p_array; + sd.attribute_data = p_attribute_array; + sd.skin_data = p_skin_array; sd.index_count = p_index_count; sd.index_data = p_index_array; - sd.blend_shapes = p_blend_shapes; - sd.bone_aabbs = p_bone_aabb; + sd.blend_shape_data = p_blend_shape_data; + sd.bone_aabbs = p_bone_aabbs; sd.lods = p_lods; RenderingServer::get_singleton()->mesh_add_surface(mesh, sd); @@ -1117,15 +1168,17 @@ void ArrayMesh::add_surface_from_arrays(PrimitiveType p_primitive, const Array & Error err = RS::get_singleton()->mesh_create_surface_data_from_arrays(&surface, (RenderingServer::PrimitiveType)p_primitive, p_arrays, p_blend_shapes, p_lods, p_flags); ERR_FAIL_COND(err != OK); - /* print_line("format: " + itos(surface.format)); + /* Debug code. + print_line("format: " + itos(surface.format)); print_line("aabb: " + surface.aabb); print_line("array size: " + itos(surface.vertex_data.size())); print_line("vertex count: " + itos(surface.vertex_count)); print_line("index size: " + itos(surface.index_data.size())); print_line("index count: " + itos(surface.index_count)); print_line("primitive: " + itos(surface.primitive)); -*/ - add_surface(surface.format, PrimitiveType(surface.primitive), surface.vertex_data, surface.vertex_count, surface.index_data, surface.index_count, surface.aabb, surface.blend_shapes, surface.bone_aabbs, surface.lods); + */ + + add_surface(surface.format, PrimitiveType(surface.primitive), surface.vertex_data, surface.attribute_data, surface.skin_data, surface.vertex_count, surface.index_data, surface.index_count, surface.aabb, surface.blend_shape_data, surface.bone_aabbs, surface.lods); } Array ArrayMesh::surface_get_arrays(int p_surface) const { @@ -1161,7 +1214,10 @@ void ArrayMesh::add_blend_shape(const StringName &p_name) { } blend_shapes.push_back(name); - //RS::get_singleton()->mesh_set_blend_shape_count(mesh, blend_shapes.size()); + + if (mesh.is_valid()) { + RS::get_singleton()->mesh_set_blend_shape_count(mesh, blend_shapes.size()); + } } int ArrayMesh::get_blend_shape_count() const { @@ -1177,6 +1233,10 @@ void ArrayMesh::clear_blend_shapes() { ERR_FAIL_COND_MSG(surfaces.size(), "Can't set shape key count if surfaces are already created."); blend_shapes.clear(); + + if (mesh.is_valid()) { + RS::get_singleton()->mesh_set_blend_shape_count(mesh, 0); + } } void ArrayMesh::set_blend_shape_mode(BlendShapeMode p_mode) { @@ -1314,7 +1374,7 @@ bool (*array_mesh_lightmap_unwrap_callback)(float p_texel_size, const float *p_v struct ArrayMeshLightmapSurface { Ref<Material> material; - Vector<SurfaceTool::Vertex> vertices; + LocalVector<SurfaceTool::Vertex> vertices; Mesh::PrimitiveType primitive; uint32_t format; }; @@ -1355,7 +1415,7 @@ Error ArrayMesh::lightmap_unwrap_cached(int *&r_cache_data, unsigned int &r_cach Array arrays = surface_get_arrays(i); s.material = surface_get_material(i); - s.vertices = SurfaceTool::create_vertex_array_from_triangle_arrays(arrays); + SurfaceTool::create_vertex_array_from_triangle_arrays(arrays, s.vertices); Vector<Vector3> rvertices = arrays[Mesh::ARRAY_VERTEX]; int vc = rvertices.size(); @@ -1458,29 +1518,29 @@ Error ArrayMesh::lightmap_unwrap_cached(int *&r_cache_data, unsigned int &r_cach SurfaceTool::Vertex v = lightmap_surfaces[surface].vertices[uv_indices[gen_vertices[gen_indices[i + j]]].second]; if (lightmap_surfaces[surface].format & ARRAY_FORMAT_COLOR) { - surfaces_tools.write[surface]->add_color(v.color); + surfaces_tools.write[surface]->set_color(v.color); } if (lightmap_surfaces[surface].format & ARRAY_FORMAT_TEX_UV) { - surfaces_tools.write[surface]->add_uv(v.uv); + surfaces_tools.write[surface]->set_uv(v.uv); } if (lightmap_surfaces[surface].format & ARRAY_FORMAT_NORMAL) { - surfaces_tools.write[surface]->add_normal(v.normal); + surfaces_tools.write[surface]->set_normal(v.normal); } if (lightmap_surfaces[surface].format & ARRAY_FORMAT_TANGENT) { Plane t; t.normal = v.tangent; t.d = v.binormal.dot(v.normal.cross(v.tangent)) < 0 ? -1 : 1; - surfaces_tools.write[surface]->add_tangent(t); + surfaces_tools.write[surface]->set_tangent(t); } if (lightmap_surfaces[surface].format & ARRAY_FORMAT_BONES) { - surfaces_tools.write[surface]->add_bones(v.bones); + surfaces_tools.write[surface]->set_bones(v.bones); } if (lightmap_surfaces[surface].format & ARRAY_FORMAT_WEIGHTS) { - surfaces_tools.write[surface]->add_weights(v.weights); + surfaces_tools.write[surface]->set_weights(v.weights); } Vector2 uv2(gen_uvs[gen_indices[i + j] * 2 + 0], gen_uvs[gen_indices[i + j] * 2 + 1]); - surfaces_tools.write[surface]->add_uv2(uv2); + surfaces_tools.write[surface]->set_uv2(uv2); surfaces_tools.write[surface]->add_vertex(v.vertex); } @@ -1513,7 +1573,7 @@ void ArrayMesh::_bind_methods() { ClassDB::bind_method(D_METHOD("set_blend_shape_mode", "mode"), &ArrayMesh::set_blend_shape_mode); ClassDB::bind_method(D_METHOD("get_blend_shape_mode"), &ArrayMesh::get_blend_shape_mode); - ClassDB::bind_method(D_METHOD("add_surface_from_arrays", "primitive", "arrays", "blend_shapes", "lods", "compress_flags"), &ArrayMesh::add_surface_from_arrays, DEFVAL(Array()), DEFVAL(Dictionary()), DEFVAL(ARRAY_COMPRESS_DEFAULT)); + ClassDB::bind_method(D_METHOD("add_surface_from_arrays", "primitive", "arrays", "blend_shapes", "lods", "compress_flags"), &ArrayMesh::add_surface_from_arrays, DEFVAL(Array()), DEFVAL(Dictionary()), DEFVAL(0)); ClassDB::bind_method(D_METHOD("clear_surfaces"), &ArrayMesh::clear_surfaces); ClassDB::bind_method(D_METHOD("surface_update_region", "surf_idx", "offset", "data"), &ArrayMesh::surface_update_region); ClassDB::bind_method(D_METHOD("surface_get_array_len", "surf_idx"), &ArrayMesh::surface_get_array_len); @@ -1536,36 +1596,16 @@ void ArrayMesh::_bind_methods() { ClassDB::bind_method(D_METHOD("set_custom_aabb", "aabb"), &ArrayMesh::set_custom_aabb); ClassDB::bind_method(D_METHOD("get_custom_aabb"), &ArrayMesh::get_custom_aabb); + ClassDB::bind_method(D_METHOD("_set_blend_shape_names", "blend_shape_names"), &ArrayMesh::_set_blend_shape_names); + ClassDB::bind_method(D_METHOD("_get_blend_shape_names"), &ArrayMesh::_get_blend_shape_names); + ClassDB::bind_method(D_METHOD("_set_surfaces", "surfaces"), &ArrayMesh::_set_surfaces); ClassDB::bind_method(D_METHOD("_get_surfaces"), &ArrayMesh::_get_surfaces); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_STRING_ARRAY, "_blend_shape_names", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_blend_shape_names", "_get_blend_shape_names"); ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "_surfaces", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_surfaces", "_get_surfaces"); ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_shape_mode", PROPERTY_HINT_ENUM, "Normalized,Relative"), "set_blend_shape_mode", "get_blend_shape_mode"); ADD_PROPERTY(PropertyInfo(Variant::AABB, "custom_aabb", PROPERTY_HINT_NONE, ""), "set_custom_aabb", "get_custom_aabb"); - - BIND_CONSTANT(NO_INDEX_ARRAY); - BIND_CONSTANT(ARRAY_WEIGHTS_SIZE); - - BIND_ENUM_CONSTANT(ARRAY_VERTEX); - BIND_ENUM_CONSTANT(ARRAY_NORMAL); - BIND_ENUM_CONSTANT(ARRAY_TANGENT); - BIND_ENUM_CONSTANT(ARRAY_COLOR); - BIND_ENUM_CONSTANT(ARRAY_TEX_UV); - BIND_ENUM_CONSTANT(ARRAY_TEX_UV2); - BIND_ENUM_CONSTANT(ARRAY_BONES); - BIND_ENUM_CONSTANT(ARRAY_WEIGHTS); - BIND_ENUM_CONSTANT(ARRAY_INDEX); - BIND_ENUM_CONSTANT(ARRAY_MAX); - - BIND_ENUM_CONSTANT(ARRAY_FORMAT_VERTEX); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_NORMAL); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_TANGENT); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_COLOR); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_TEX_UV); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_TEX_UV2); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_BONES); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_WEIGHTS); - BIND_ENUM_CONSTANT(ARRAY_FORMAT_INDEX); } void ArrayMesh::reload_from_file() { diff --git a/scene/resources/mesh.h b/scene/resources/mesh.h index b0a30a5627..b7f60bf814 100644 --- a/scene/resources/mesh.h +++ b/scene/resources/mesh.h @@ -31,9 +31,9 @@ #ifndef MESH_H #define MESH_H +#include "core/io/resource.h" #include "core/math/face3.h" #include "core/math/triangle_mesh.h" -#include "core/resource.h" #include "scene/resources/material.h" #include "scene/resources/shape_3d.h" #include "servers/rendering_server.h" @@ -50,19 +50,24 @@ protected: public: enum { - NO_INDEX_ARRAY = RenderingServer::NO_INDEX_ARRAY, ARRAY_WEIGHTS_SIZE = RenderingServer::ARRAY_WEIGHTS_SIZE }; - + enum BlendShapeMode { + BLEND_SHAPE_MODE_NORMALIZED = RS::BLEND_SHAPE_MODE_NORMALIZED, + BLEND_SHAPE_MODE_RELATIVE = RS::BLEND_SHAPE_MODE_RELATIVE, + }; enum ArrayType { - ARRAY_VERTEX = RenderingServer::ARRAY_VERTEX, ARRAY_NORMAL = RenderingServer::ARRAY_NORMAL, ARRAY_TANGENT = RenderingServer::ARRAY_TANGENT, ARRAY_COLOR = RenderingServer::ARRAY_COLOR, ARRAY_TEX_UV = RenderingServer::ARRAY_TEX_UV, ARRAY_TEX_UV2 = RenderingServer::ARRAY_TEX_UV2, + ARRAY_CUSTOM0 = RenderingServer::ARRAY_CUSTOM0, + ARRAY_CUSTOM1 = RenderingServer::ARRAY_CUSTOM1, + ARRAY_CUSTOM2 = RenderingServer::ARRAY_CUSTOM2, + ARRAY_CUSTOM3 = RenderingServer::ARRAY_CUSTOM3, ARRAY_BONES = RenderingServer::ARRAY_BONES, ARRAY_WEIGHTS = RenderingServer::ARRAY_WEIGHTS, ARRAY_INDEX = RenderingServer::ARRAY_INDEX, @@ -70,30 +75,47 @@ public: }; + enum ArrayCustomFormat { + ARRAY_CUSTOM_RGBA8_UNORM, + ARRAY_CUSTOM_RGBA8_SNORM, + ARRAY_CUSTOM_RG_HALF, + ARRAY_CUSTOM_RGBA_HALF, + ARRAY_CUSTOM_R_FLOAT, + ARRAY_CUSTOM_RG_FLOAT, + ARRAY_CUSTOM_RGB_FLOAT, + ARRAY_CUSTOM_RGBA_FLOAT, + ARRAY_CUSTOM_MAX + }; + enum ArrayFormat { - /* ARRAY FORMAT FLAGS */ - ARRAY_FORMAT_VERTEX = 1 << ARRAY_VERTEX, // mandatory - ARRAY_FORMAT_NORMAL = 1 << ARRAY_NORMAL, - ARRAY_FORMAT_TANGENT = 1 << ARRAY_TANGENT, - ARRAY_FORMAT_COLOR = 1 << ARRAY_COLOR, - ARRAY_FORMAT_TEX_UV = 1 << ARRAY_TEX_UV, - ARRAY_FORMAT_TEX_UV2 = 1 << ARRAY_TEX_UV2, - ARRAY_FORMAT_BONES = 1 << ARRAY_BONES, - ARRAY_FORMAT_WEIGHTS = 1 << ARRAY_WEIGHTS, - ARRAY_FORMAT_INDEX = 1 << ARRAY_INDEX, - - ARRAY_COMPRESS_BASE = (ARRAY_INDEX + 1), - ARRAY_COMPRESS_NORMAL = 1 << (ARRAY_NORMAL + ARRAY_COMPRESS_BASE), - ARRAY_COMPRESS_TANGENT = 1 << (ARRAY_TANGENT + ARRAY_COMPRESS_BASE), - ARRAY_COMPRESS_COLOR = 1 << (ARRAY_COLOR + ARRAY_COMPRESS_BASE), - ARRAY_COMPRESS_TEX_UV = 1 << (ARRAY_TEX_UV + ARRAY_COMPRESS_BASE), - ARRAY_COMPRESS_TEX_UV2 = 1 << (ARRAY_TEX_UV2 + ARRAY_COMPRESS_BASE), - ARRAY_COMPRESS_INDEX = 1 << (ARRAY_INDEX + ARRAY_COMPRESS_BASE), - - ARRAY_FLAG_USE_2D_VERTICES = ARRAY_COMPRESS_INDEX << 1, - ARRAY_FLAG_USE_DYNAMIC_UPDATE = ARRAY_COMPRESS_INDEX << 3, - - ARRAY_COMPRESS_DEFAULT = ARRAY_COMPRESS_NORMAL | ARRAY_COMPRESS_TANGENT | ARRAY_COMPRESS_COLOR | ARRAY_COMPRESS_TEX_UV | ARRAY_COMPRESS_TEX_UV2 + ARRAY_FORMAT_VERTEX = RS::ARRAY_FORMAT_VERTEX, + ARRAY_FORMAT_NORMAL = RS::ARRAY_FORMAT_NORMAL, + ARRAY_FORMAT_TANGENT = RS::ARRAY_FORMAT_TANGENT, + ARRAY_FORMAT_COLOR = RS::ARRAY_FORMAT_COLOR, + ARRAY_FORMAT_TEX_UV = RS::ARRAY_FORMAT_TEX_UV, + ARRAY_FORMAT_TEX_UV2 = RS::ARRAY_FORMAT_TEX_UV2, + ARRAY_FORMAT_CUSTOM0 = RS::ARRAY_FORMAT_CUSTOM0, + ARRAY_FORMAT_CUSTOM1 = RS::ARRAY_FORMAT_CUSTOM1, + ARRAY_FORMAT_CUSTOM2 = RS::ARRAY_FORMAT_CUSTOM2, + ARRAY_FORMAT_CUSTOM3 = RS::ARRAY_FORMAT_CUSTOM3, + ARRAY_FORMAT_BONES = RS::ARRAY_FORMAT_BONES, + ARRAY_FORMAT_WEIGHTS = RS::ARRAY_FORMAT_WEIGHTS, + ARRAY_FORMAT_INDEX = RS::ARRAY_FORMAT_INDEX, + + ARRAY_FORMAT_BLEND_SHAPE_MASK = RS::ARRAY_FORMAT_BLEND_SHAPE_MASK, + + ARRAY_FORMAT_CUSTOM_BASE = RS::ARRAY_FORMAT_CUSTOM_BASE, + ARRAY_FORMAT_CUSTOM0_SHIFT = RS::ARRAY_FORMAT_CUSTOM0_SHIFT, + ARRAY_FORMAT_CUSTOM1_SHIFT = RS::ARRAY_FORMAT_CUSTOM1_SHIFT, + ARRAY_FORMAT_CUSTOM2_SHIFT = RS::ARRAY_FORMAT_CUSTOM2_SHIFT, + ARRAY_FORMAT_CUSTOM3_SHIFT = RS::ARRAY_FORMAT_CUSTOM3_SHIFT, + + ARRAY_FORMAT_CUSTOM_MASK = RS::ARRAY_FORMAT_CUSTOM_MASK, + ARRAY_COMPRESS_FLAGS_BASE = RS::ARRAY_COMPRESS_FLAGS_BASE, + + ARRAY_FLAG_USE_2D_VERTICES = RS::ARRAY_FLAG_USE_2D_VERTICES, + ARRAY_FLAG_USE_DYNAMIC_UPDATE = RS::ARRAY_FLAG_USE_DYNAMIC_UPDATE, + ARRAY_FLAG_USE_8_BONE_WEIGHTS = RS::ARRAY_FLAG_USE_8_BONE_WEIGHTS, }; @@ -106,12 +128,6 @@ public: PRIMITIVE_MAX = RenderingServer::PRIMITIVE_MAX, }; - enum BlendShapeMode { - - BLEND_SHAPE_MODE_NORMALIZED = RS::BLEND_SHAPE_MODE_NORMALIZED, - BLEND_SHAPE_MODE_RELATIVE = RS::BLEND_SHAPE_MODE_RELATIVE, - }; - virtual int get_surface_count() const = 0; virtual int surface_get_array_len(int p_idx) const = 0; virtual int surface_get_array_index_len(int p_idx) const = 0; @@ -155,6 +171,9 @@ class ArrayMesh : public Mesh { GDCLASS(ArrayMesh, Mesh); RES_BASE_EXTENSION("mesh"); + PackedStringArray _get_blend_shape_names() const; + void _set_blend_shape_names(const PackedStringArray &p_names); + Array _get_surfaces() const; void _set_surfaces(const Array &p_data); @@ -190,9 +209,9 @@ protected: static void _bind_methods(); public: - void add_surface_from_arrays(PrimitiveType p_primitive, const Array &p_arrays, const Array &p_blend_shapes = Array(), const Dictionary &p_lods = Dictionary(), uint32_t p_flags = ARRAY_COMPRESS_DEFAULT); + void add_surface_from_arrays(PrimitiveType p_primitive, const Array &p_arrays, const Array &p_blend_shapes = Array(), const Dictionary &p_lods = Dictionary(), uint32_t p_flags = 0); - void add_surface(uint32_t p_format, PrimitiveType p_primitive, const Vector<uint8_t> &p_array, int p_vertex_count, const Vector<uint8_t> &p_index_array, int p_index_count, const AABB &p_aabb, const Vector<Vector<uint8_t>> &p_blend_shapes = Vector<Vector<uint8_t>>(), const Vector<AABB> &p_bone_aabbs = Vector<AABB>(), const Vector<RS::SurfaceData::LOD> &p_lods = Vector<RS::SurfaceData::LOD>()); + void add_surface(uint32_t p_format, PrimitiveType p_primitive, const Vector<uint8_t> &p_array, const Vector<uint8_t> &p_attribute_array, const Vector<uint8_t> &p_skin_array, int p_vertex_count, const Vector<uint8_t> &p_index_array, int p_index_count, const AABB &p_aabb, const Vector<uint8_t> &p_blend_shape_data = Vector<uint8_t>(), const Vector<AABB> &p_bone_aabbs = Vector<AABB>(), const Vector<RS::SurfaceData::LOD> &p_lods = Vector<RS::SurfaceData::LOD>()); Array surface_get_arrays(int p_surface) const override; Array surface_get_blend_shape_arrays(int p_surface) const override; @@ -247,6 +266,7 @@ public: VARIANT_ENUM_CAST(Mesh::ArrayType); VARIANT_ENUM_CAST(Mesh::ArrayFormat); +VARIANT_ENUM_CAST(Mesh::ArrayCustomFormat); VARIANT_ENUM_CAST(Mesh::PrimitiveType); VARIANT_ENUM_CAST(Mesh::BlendShapeMode); diff --git a/scene/resources/mesh_library.h b/scene/resources/mesh_library.h index 450e2c16e3..0d5fb3005b 100644 --- a/scene/resources/mesh_library.h +++ b/scene/resources/mesh_library.h @@ -31,8 +31,8 @@ #ifndef MESH_LIBRARY_H #define MESH_LIBRARY_H -#include "core/map.h" -#include "core/resource.h" +#include "core/io/resource.h" +#include "core/templates/map.h" #include "mesh.h" #include "scene/3d/navigation_region_3d.h" #include "shape_3d.h" diff --git a/scene/resources/packed_scene.cpp b/scene/resources/packed_scene.cpp index cb201bc539..09674f3465 100644 --- a/scene/resources/packed_scene.cpp +++ b/scene/resources/packed_scene.cpp @@ -30,10 +30,10 @@ #include "packed_scene.h" +#include "core/config/engine.h" +#include "core/config/project_settings.h" #include "core/core_string_names.h" -#include "core/engine.h" #include "core/io/resource_loader.h" -#include "core/project_settings.h" #include "scene/2d/node_2d.h" #include "scene/3d/node_3d.h" #include "scene/gui/control.h" @@ -848,7 +848,7 @@ Error SceneState::pack(Node *p_scene) { Map<Node *, int> node_map; Map<Node *, int> nodepath_map; - //if using scene inheritance, pack the scene it inherits from + // If using scene inheritance, pack the scene it inherits from. if (scene->get_scene_inherited_state().is_valid()) { String path = scene->get_scene_inherited_state()->get_path(); Ref<PackedScene> instance = ResourceLoader::load(path); @@ -856,8 +856,8 @@ Error SceneState::pack(Node *p_scene) { base_scene_idx = _vm_get_variant(instance, variant_map); } } - //instanced, only direct sub-scnes are supported of course + // Instanced, only direct sub-scenes are supported of course. Error err = _parse_node(scene, scene, -1, name_map, variant_map, node_map, nodepath_map); if (err) { clear(); @@ -1481,16 +1481,6 @@ int SceneState::add_name(const StringName &p_name) { return names.size() - 1; } -int SceneState::find_name(const StringName &p_name) const { - for (int i = 0; i < names.size(); i++) { - if (names[i] == p_name) { - return i; - } - } - - return -1; -} - int SceneState::add_value(const Variant &p_value) { variants.push_back(p_value); return variants.size() - 1; diff --git a/scene/resources/packed_scene.h b/scene/resources/packed_scene.h index 004758afa5..fce3891507 100644 --- a/scene/resources/packed_scene.h +++ b/scene/resources/packed_scene.h @@ -31,7 +31,7 @@ #ifndef PACKED_SCENE_H #define PACKED_SCENE_H -#include "core/resource.h" +#include "core/io/resource.h" #include "scene/main/node.h" class SceneState : public Reference { @@ -172,7 +172,6 @@ public: //build API int add_name(const StringName &p_name); - int find_name(const StringName &p_name) const; int add_value(const Variant &p_value); int add_node_path(const NodePath &p_path); int add_node(int p_parent, int p_owner, int p_type, int p_name, int p_instance, int p_index); diff --git a/scene/resources/particles_material.cpp b/scene/resources/particles_material.cpp index 4bbfa8965a..e2f96c54cb 100644 --- a/scene/resources/particles_material.cpp +++ b/scene/resources/particles_material.cpp @@ -98,6 +98,9 @@ void ParticlesMaterial::init_shaders() { shader_names->sub_emitter_frequency = "sub_emitter_frequency"; shader_names->sub_emitter_amount_at_end = "sub_emitter_amount_at_end"; shader_names->sub_emitter_keep_velocity = "sub_emitter_keep_velocity"; + + shader_names->collision_friction = "collision_friction"; + shader_names->collision_bounce = "collision_bounce"; } void ParticlesMaterial::finish_shaders() { @@ -136,6 +139,10 @@ void ParticlesMaterial::_update_shader() { String code = "shader_type particles;\n"; + if (collision_scale) { + code += "render_mode collision_use_scale;\n"; + } + code += "uniform vec3 direction;\n"; code += "uniform float spread;\n"; code += "uniform float flatness;\n"; @@ -247,6 +254,11 @@ void ParticlesMaterial::_update_shader() { code += "uniform sampler2D anim_offset_texture;\n"; } + if (collision_enabled) { + code += "uniform float collision_friction;\n"; + code += "uniform float collision_bounce;\n"; + } + //need a random function code += "\n\n"; code += "float rand_from_seed(inout uint seed) {\n"; @@ -317,7 +329,7 @@ void ParticlesMaterial::_update_shader() { code += " float tex_linear_velocity = 0.0;\n"; } - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " float angle1_rad = rand_from_seed_m1_p1(alt_seed) * spread_rad;\n"; code += " angle1_rad += direction.x != 0.0 ? atan(direction.y, direction.x) : sign(direction.y) * (pi / 2.0);\n"; code += " vec3 rot = vec3(cos(angle1_rad), sin(angle1_rad), 0.0);\n"; @@ -365,7 +377,7 @@ void ParticlesMaterial::_update_shader() { code += " TRANSFORM[3].xyz = texelFetch(emission_texture_points, emission_tex_ofs, 0).xyz;\n"; if (emission_shape == EMISSION_SHAPE_DIRECTED_POINTS) { - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " mat2 rotm;"; code += " rotm[0] = texelFetch(emission_texture_normal, emission_tex_ofs, 0).xy;\n"; code += " rotm[1] = rotm[0].yx * vec2(1.0, -1.0);\n"; @@ -386,7 +398,7 @@ void ParticlesMaterial::_update_shader() { code += " if (RESTART_VELOCITY) VELOCITY = (EMISSION_TRANSFORM * vec4(VELOCITY, 0.0)).xyz;\n"; code += " TRANSFORM = EMISSION_TRANSFORM * TRANSFORM;\n"; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " VELOCITY.z = 0.0;\n"; code += " TRANSFORM[3].z = 0.0;\n"; } @@ -401,7 +413,7 @@ void ParticlesMaterial::_update_shader() { code += " float tex_linear_velocity = 0.0;\n"; } - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { if (tex_parameters[PARAM_ORBIT_VELOCITY].is_valid()) { code += " float tex_orbit_velocity = textureLod(orbit_velocity_texture, vec2(CUSTOM.y, 0.0), 0.0).r;\n"; } else { @@ -459,7 +471,7 @@ void ParticlesMaterial::_update_shader() { code += " vec3 force = gravity;\n"; code += " vec3 pos = TRANSFORM[3].xyz;\n"; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " pos.z = 0.0;\n"; } code += " // apply linear acceleration\n"; @@ -469,17 +481,21 @@ void ParticlesMaterial::_update_shader() { code += " vec3 diff = pos - org;\n"; code += " force += length(diff) > 0.0 ? normalize(diff) * (radial_accel + tex_radial_accel) * mix(1.0, rand_from_seed(alt_seed), radial_accel_random) : vec3(0.0);\n"; code += " // apply tangential acceleration;\n"; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " force += length(diff.yx) > 0.0 ? vec3(normalize(diff.yx * vec2(-1.0, 1.0)), 0.0) * ((tangent_accel + tex_tangent_accel) * mix(1.0, rand_from_seed(alt_seed), tangent_accel_random)) : vec3(0.0);\n"; } else { code += " vec3 crossDiff = cross(normalize(diff), normalize(gravity));\n"; code += " force += length(crossDiff) > 0.0 ? normalize(crossDiff) * ((tangent_accel + tex_tangent_accel) * mix(1.0, rand_from_seed(alt_seed), tangent_accel_random)) : vec3(0.0);\n"; } + if (attractor_interaction_enabled) { + code += " force += ATTRACTOR_FORCE;\n\n"; + } + code += " // apply attractor forces\n"; code += " VELOCITY += force * DELTA;\n"; code += " // orbit velocity\n"; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " float orbit_amount = (orbit_velocity + tex_orbit_velocity) * mix(1.0, rand_from_seed(alt_seed), orbit_velocity_random);\n"; code += " if (orbit_amount != 0.0) {\n"; code += " float ang = orbit_amount * DELTA * pi * 2.0;\n"; @@ -546,8 +562,8 @@ void ParticlesMaterial::_update_shader() { } code += "\n"; - if (flags[FLAG_DISABLE_Z]) { - if (flags[FLAG_ALIGN_Y_TO_VELOCITY]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { code += " if (length(VELOCITY) > 0.0) {\n"; code += " TRANSFORM[1].xyz = normalize(VELOCITY);\n"; code += " } else {\n"; @@ -563,7 +579,7 @@ void ParticlesMaterial::_update_shader() { } else { // orient particle Y towards velocity - if (flags[FLAG_ALIGN_Y_TO_VELOCITY]) { + if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { code += " if (length(VELOCITY) > 0.0) {\n"; code += " TRANSFORM[1].xyz = normalize(VELOCITY);\n"; code += " } else {\n"; @@ -582,7 +598,7 @@ void ParticlesMaterial::_update_shader() { code += " TRANSFORM[2].xyz = normalize(TRANSFORM[2].xyz);\n"; } // turn particle by rotation in Y - if (flags[FLAG_ROTATE_Y]) { + if (particle_flags[PARTICLE_FLAG_ROTATE_Y]) { code += " TRANSFORM = TRANSFORM * mat4(vec4(cos(CUSTOM.x), 0.0, -sin(CUSTOM.x), 0.0), vec4(0.0, 1.0, 0.0, 0.0), vec4(sin(CUSTOM.x), 0.0, cos(CUSTOM.x), 0.0), vec4(0.0, 0.0, 0.0, 1.0));\n"; } } @@ -595,10 +611,17 @@ void ParticlesMaterial::_update_shader() { code += " TRANSFORM[0].xyz *= base_scale;\n"; code += " TRANSFORM[1].xyz *= base_scale;\n"; code += " TRANSFORM[2].xyz *= base_scale;\n"; - if (flags[FLAG_DISABLE_Z]) { + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { code += " VELOCITY.z = 0.0;\n"; code += " TRANSFORM[3].z = 0.0;\n"; } + if (collision_enabled) { + code += " if (COLLIDED) {\n"; + code += " TRANSFORM[3].xyz+=COLLISION_NORMAL * COLLISION_DEPTH;\n"; + code += " VELOCITY -= COLLISION_NORMAL * dot(COLLISION_NORMAL, VELOCITY) * (1.0 + collision_bounce);\n"; + code += " VELOCITY = mix(VELOCITY,vec3(0.0),collision_friction * DELTA * 100.0);\n"; + code += " }\n"; + } if (sub_emitter_mode != SUB_EMITTER_DISABLED) { code += " int emit_count = 0;\n"; switch (sub_emitter_mode) { @@ -609,6 +632,7 @@ void ParticlesMaterial::_update_shader() { } break; case SUB_EMITTER_AT_COLLISION: { //not implemented yet + code += " if (COLLIDED) emit_count = 1;\n"; } break; case SUB_EMITTER_AT_END: { //not implemented yet @@ -892,18 +916,18 @@ Ref<Texture2D> ParticlesMaterial::get_color_ramp() const { return color_ramp; } -void ParticlesMaterial::set_flag(Flags p_flag, bool p_enable) { - ERR_FAIL_INDEX(p_flag, FLAG_MAX); - flags[p_flag] = p_enable; +void ParticlesMaterial::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { + ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); + particle_flags[p_particle_flag] = p_enable; _queue_shader_change(); - if (p_flag == FLAG_DISABLE_Z) { + if (p_particle_flag == PARTICLE_FLAG_DISABLE_Z) { _change_notify(); } } -bool ParticlesMaterial::get_flag(Flags p_flag) const { - ERR_FAIL_INDEX_V(p_flag, FLAG_MAX, false); - return flags[p_flag]; +bool ParticlesMaterial::get_particle_flag(ParticleFlags p_particle_flag) const { + ERR_FAIL_INDEX_V(p_particle_flag, PARTICLE_FLAG_MAX, false); + return particle_flags[p_particle_flag]; } void ParticlesMaterial::set_emission_shape(EmissionShape p_shape) { @@ -1032,7 +1056,7 @@ void ParticlesMaterial::_validate_property(PropertyInfo &property) const { property.usage = 0; } - if (property.name.begins_with("orbit_") && !flags[FLAG_DISABLE_Z]) { + if (property.name.begins_with("orbit_") && !particle_flags[PARTICLE_FLAG_DISABLE_Z]) { property.usage = 0; } } @@ -1072,6 +1096,51 @@ bool ParticlesMaterial::get_sub_emitter_keep_velocity() const { return sub_emitter_keep_velocity; } +void ParticlesMaterial::set_attractor_interaction_enabled(bool p_enable) { + attractor_interaction_enabled = p_enable; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_attractor_interaction_enabled() const { + return attractor_interaction_enabled; +} + +void ParticlesMaterial::set_collision_enabled(bool p_enabled) { + collision_enabled = p_enabled; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_collision_enabled() const { + return collision_enabled; +} + +void ParticlesMaterial::set_collision_use_scale(bool p_scale) { + collision_scale = p_scale; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_collision_using_scale() const { + return collision_scale; +} + +void ParticlesMaterial::set_collision_friction(float p_friction) { + collision_friction = p_friction; + RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_friction, p_friction); +} + +float ParticlesMaterial::get_collision_friction() const { + return collision_friction; +} + +void ParticlesMaterial::set_collision_bounce(float p_bounce) { + collision_bounce = p_bounce; + RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_bounce, p_bounce); +} + +float ParticlesMaterial::get_collision_bounce() const { + return collision_bounce; +} + Shader::Mode ParticlesMaterial::get_shader_mode() const { return Shader::MODE_PARTICLES; } @@ -1101,8 +1170,8 @@ void ParticlesMaterial::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &ParticlesMaterial::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &ParticlesMaterial::get_color_ramp); - ClassDB::bind_method(D_METHOD("set_flag", "flag", "enable"), &ParticlesMaterial::set_flag); - ClassDB::bind_method(D_METHOD("get_flag", "flag"), &ParticlesMaterial::get_flag); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &ParticlesMaterial::set_particle_flag); + ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &ParticlesMaterial::get_particle_flag); ClassDB::bind_method(D_METHOD("set_emission_shape", "shape"), &ParticlesMaterial::set_emission_shape); ClassDB::bind_method(D_METHOD("get_emission_shape"), &ParticlesMaterial::get_emission_shape); @@ -1143,6 +1212,21 @@ void ParticlesMaterial::_bind_methods() { ClassDB::bind_method(D_METHOD("get_sub_emitter_keep_velocity"), &ParticlesMaterial::get_sub_emitter_keep_velocity); ClassDB::bind_method(D_METHOD("set_sub_emitter_keep_velocity", "enable"), &ParticlesMaterial::set_sub_emitter_keep_velocity); + ClassDB::bind_method(D_METHOD("set_attractor_interaction_enabled", "enabled"), &ParticlesMaterial::set_attractor_interaction_enabled); + ClassDB::bind_method(D_METHOD("is_attractor_interaction_enabled"), &ParticlesMaterial::is_attractor_interaction_enabled); + + ClassDB::bind_method(D_METHOD("set_collision_enabled", "enabled"), &ParticlesMaterial::set_collision_enabled); + ClassDB::bind_method(D_METHOD("is_collision_enabled"), &ParticlesMaterial::is_collision_enabled); + + ClassDB::bind_method(D_METHOD("set_collision_use_scale", "radius"), &ParticlesMaterial::set_collision_use_scale); + ClassDB::bind_method(D_METHOD("is_collision_using_scale"), &ParticlesMaterial::is_collision_using_scale); + + ClassDB::bind_method(D_METHOD("set_collision_friction", "friction"), &ParticlesMaterial::set_collision_friction); + ClassDB::bind_method(D_METHOD("get_collision_friction"), &ParticlesMaterial::get_collision_friction); + + ClassDB::bind_method(D_METHOD("set_collision_bounce", "bounce"), &ParticlesMaterial::set_collision_bounce); + ClassDB::bind_method(D_METHOD("get_collision_bounce"), &ParticlesMaterial::get_collision_bounce); + ADD_GROUP("Time", ""); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lifetime_randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_lifetime_randomness", "get_lifetime_randomness"); @@ -1154,10 +1238,10 @@ void ParticlesMaterial::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "emission_normal_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_emission_normal_texture", "get_emission_normal_texture"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "emission_color_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_emission_color_texture", "get_emission_color_texture"); ADD_PROPERTY(PropertyInfo(Variant::INT, "emission_point_count", PROPERTY_HINT_RANGE, "0,1000000,1"), "set_emission_point_count", "get_emission_point_count"); - ADD_GROUP("Flags", "flag_"); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_align_y"), "set_flag", "get_flag", FLAG_ALIGN_Y_TO_VELOCITY); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_rotate_y"), "set_flag", "get_flag", FLAG_ROTATE_Y); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "flag_disable_z"), "set_flag", "get_flag", FLAG_DISABLE_Z); + ADD_GROUP("ParticleFlags", "particle_flag_"); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_align_y"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_rotate_y"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_ROTATE_Y); + ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "particle_flag_disable_z"), "set_particle_flag", "get_particle_flag", PARTICLE_FLAG_DISABLE_Z); ADD_GROUP("Direction", ""); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "direction"), "set_direction", "get_direction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "spread", PROPERTY_HINT_RANGE, "0,180,0.01"), "set_spread", "get_spread"); @@ -1221,6 +1305,14 @@ void ParticlesMaterial::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "sub_emitter_amount_at_end", PROPERTY_HINT_RANGE, "1,32,1"), "set_sub_emitter_amount_at_end", "get_sub_emitter_amount_at_end"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "sub_emitter_keep_velocity"), "set_sub_emitter_keep_velocity", "get_sub_emitter_keep_velocity"); + ADD_GROUP("Attractor Interaction", "attractor_interaction_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "attractor_interaction_enabled"), "set_attractor_interaction_enabled", "is_attractor_interaction_enabled"); + ADD_GROUP("Collision", "collision_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_enabled"), "set_collision_enabled", "is_collision_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_friction", "get_collision_friction"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_bounce", "get_collision_bounce"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_use_scale"), "set_collision_use_scale", "is_collision_using_scale"); + BIND_ENUM_CONSTANT(PARAM_INITIAL_LINEAR_VELOCITY); BIND_ENUM_CONSTANT(PARAM_ANGULAR_VELOCITY); BIND_ENUM_CONSTANT(PARAM_ORBIT_VELOCITY); @@ -1235,10 +1327,10 @@ void ParticlesMaterial::_bind_methods() { BIND_ENUM_CONSTANT(PARAM_ANIM_OFFSET); BIND_ENUM_CONSTANT(PARAM_MAX); - BIND_ENUM_CONSTANT(FLAG_ALIGN_Y_TO_VELOCITY); - BIND_ENUM_CONSTANT(FLAG_ROTATE_Y); - BIND_ENUM_CONSTANT(FLAG_DISABLE_Z); - BIND_ENUM_CONSTANT(FLAG_MAX); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_ROTATE_Y); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_DISABLE_Z); + BIND_ENUM_CONSTANT(PARTICLE_FLAG_MAX); BIND_ENUM_CONSTANT(EMISSION_SHAPE_POINT); BIND_ENUM_CONSTANT(EMISSION_SHAPE_SPHERE); @@ -1283,12 +1375,18 @@ ParticlesMaterial::ParticlesMaterial() : set_sub_emitter_amount_at_end(1); set_sub_emitter_keep_velocity(false); + set_attractor_interaction_enabled(true); + set_collision_enabled(true); + set_collision_bounce(0.0); + set_collision_friction(0.0); + set_collision_use_scale(false); + for (int i = 0; i < PARAM_MAX; i++) { set_param_randomness(Parameter(i), 0); } - for (int i = 0; i < FLAG_MAX; i++) { - flags[i] = false; + for (int i = 0; i < PARTICLE_FLAG_MAX; i++) { + particle_flags[i] = false; } set_color(Color(1, 1, 1, 1)); diff --git a/scene/resources/particles_material.h b/scene/resources/particles_material.h index fa8858f67f..7e8f05b706 100644 --- a/scene/resources/particles_material.h +++ b/scene/resources/particles_material.h @@ -28,7 +28,7 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/resources/material.h" #ifndef PARTICLES_MATERIAL_H @@ -37,11 +37,7 @@ /* TODO: -Path following -*Manual emission --Sub Emitters --Attractors -Emitter positions deformable by bones --Collision -Proper trails */ @@ -65,11 +61,11 @@ public: PARAM_MAX }; - enum Flags { - FLAG_ALIGN_Y_TO_VELOCITY, - FLAG_ROTATE_Y, - FLAG_DISABLE_Z, - FLAG_MAX + enum ParticleFlags { + PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, + PARTICLE_FLAG_ROTATE_Y, + PARTICLE_FLAG_DISABLE_Z, + PARTICLE_FLAG_MAX }; enum EmissionShape { @@ -94,11 +90,14 @@ private: struct { uint32_t texture_mask : 16; uint32_t texture_color : 1; - uint32_t flags : 4; + uint32_t particle_flags : 4; uint32_t emission_shape : 2; uint32_t invalid_key : 1; uint32_t has_emission_color : 1; uint32_t sub_emitter : 2; + uint32_t attractor_enabled : 1; + uint32_t collision_enabled : 1; + uint32_t collision_scale : 1; }; uint32_t key; @@ -125,9 +124,9 @@ private: mk.texture_mask |= (1 << i); } } - for (int i = 0; i < FLAG_MAX; i++) { - if (flags[i]) { - mk.flags |= (1 << i); + for (int i = 0; i < PARTICLE_FLAG_MAX; i++) { + if (particle_flags[i]) { + mk.particle_flags |= (1 << i); } } @@ -135,6 +134,9 @@ private: mk.emission_shape = emission_shape; mk.has_emission_color = emission_shape >= EMISSION_SHAPE_POINTS && emission_color_texture.is_valid(); mk.sub_emitter = sub_emitter_mode; + mk.collision_enabled = collision_enabled; + mk.attractor_enabled = attractor_interaction_enabled; + mk.collision_scale = collision_scale; return mk; } @@ -201,6 +203,9 @@ private: StringName sub_emitter_frequency; StringName sub_emitter_amount_at_end; StringName sub_emitter_keep_velocity; + + StringName collision_friction; + StringName collision_bounce; }; static ShaderNames *shader_names; @@ -222,7 +227,7 @@ private: Color color; Ref<Texture2D> color_ramp; - bool flags[FLAG_MAX]; + bool particle_flags[PARTICLE_FLAG_MAX]; EmissionShape emission_shape; float emission_sphere_radius; @@ -244,6 +249,12 @@ private: bool sub_emitter_keep_velocity; //do not save emission points here + bool attractor_interaction_enabled; + bool collision_enabled; + bool collision_scale; + float collision_friction; + float collision_bounce; + protected: static void _bind_methods(); virtual void _validate_property(PropertyInfo &property) const override; @@ -273,8 +284,8 @@ public: void set_color_ramp(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_color_ramp() const; - void set_flag(Flags p_flag, bool p_enable); - bool get_flag(Flags p_flag) const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); + bool get_particle_flag(ParticleFlags p_particle_flag) const; void set_emission_shape(EmissionShape p_shape); void set_emission_sphere_radius(float p_radius); @@ -298,6 +309,21 @@ public: void set_lifetime_randomness(float p_lifetime); float get_lifetime_randomness() const; + void set_attractor_interaction_enabled(bool p_enable); + bool is_attractor_interaction_enabled() const; + + void set_collision_enabled(bool p_enabled); + bool is_collision_enabled() const; + + void set_collision_use_scale(bool p_scale); + bool is_collision_using_scale() const; + + void set_collision_friction(float p_friction); + float get_collision_friction() const; + + void set_collision_bounce(float p_bounce); + float get_collision_bounce() const; + static void init_shaders(); static void finish_shaders(); static void flush_changes(); @@ -323,7 +349,7 @@ public: }; VARIANT_ENUM_CAST(ParticlesMaterial::Parameter) -VARIANT_ENUM_CAST(ParticlesMaterial::Flags) +VARIANT_ENUM_CAST(ParticlesMaterial::ParticleFlags) VARIANT_ENUM_CAST(ParticlesMaterial::EmissionShape) VARIANT_ENUM_CAST(ParticlesMaterial::SubEmitterMode) diff --git a/scene/resources/physics_material.cpp b/scene/resources/physics_material.cpp index 2a5cd1101a..59bf8c0e13 100644 --- a/scene/resources/physics_material.cpp +++ b/scene/resources/physics_material.cpp @@ -43,9 +43,9 @@ void PhysicsMaterial::_bind_methods() { ClassDB::bind_method(D_METHOD("set_absorbent", "absorbent"), &PhysicsMaterial::set_absorbent); ClassDB::bind_method(D_METHOD("is_absorbent"), &PhysicsMaterial::is_absorbent); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "friction"), "set_friction", "get_friction"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_friction", "get_friction"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "rough"), "set_rough", "is_rough"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bounce"), "set_bounce", "get_bounce"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_bounce", "get_bounce"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "absorbent"), "set_absorbent", "is_absorbent"); } diff --git a/scene/resources/physics_material.h b/scene/resources/physics_material.h index 34aa7066df..e9222ffa1b 100644 --- a/scene/resources/physics_material.h +++ b/scene/resources/physics_material.h @@ -31,7 +31,7 @@ #ifndef PHYSICS_MATERIAL_H #define PHYSICS_MATERIAL_H -#include "core/resource.h" +#include "core/io/resource.h" #include "servers/physics_server_3d.h" class PhysicsMaterial : public Resource { diff --git a/scene/resources/polygon_path_finder.h b/scene/resources/polygon_path_finder.h index baee4dc20d..44a97b4294 100644 --- a/scene/resources/polygon_path_finder.h +++ b/scene/resources/polygon_path_finder.h @@ -31,7 +31,7 @@ #ifndef POLYGON_PATH_FINDER_H #define POLYGON_PATH_FINDER_H -#include "core/resource.h" +#include "core/io/resource.h" class PolygonPathFinder : public Resource { GDCLASS(PolygonPathFinder, Resource); diff --git a/scene/resources/primitive_meshes.cpp b/scene/resources/primitive_meshes.cpp index 8d9c5f07b2..06e181cb99 100644 --- a/scene/resources/primitive_meshes.cpp +++ b/scene/resources/primitive_meshes.cpp @@ -148,7 +148,7 @@ Array PrimitiveMesh::surface_get_blend_shape_arrays(int p_surface) const { uint32_t PrimitiveMesh::surface_get_format(int p_idx) const { ERR_FAIL_INDEX_V(p_idx, 1, 0); - return RS::ARRAY_FORMAT_VERTEX | RS::ARRAY_FORMAT_NORMAL | RS::ARRAY_FORMAT_TANGENT | RS::ARRAY_FORMAT_TEX_UV | RS::ARRAY_FORMAT_INDEX | RS::ARRAY_COMPRESS_DEFAULT; + return RS::ARRAY_FORMAT_VERTEX | RS::ARRAY_FORMAT_NORMAL | RS::ARRAY_FORMAT_TANGENT | RS::ARRAY_FORMAT_TEX_UV | RS::ARRAY_FORMAT_INDEX; } Mesh::PrimitiveType PrimitiveMesh::surface_get_primitive_type(int p_idx) const { @@ -477,10 +477,10 @@ CapsuleMesh::CapsuleMesh() { } /** - CubeMesh + BoxMesh */ -void CubeMesh::_create_mesh_array(Array &p_arr) const { +void BoxMesh::_create_mesh_array(Array &p_arr) const { int i, j, prevrow, thisrow, point; float x, y, z; float onethird = 1.0 / 3.0; @@ -672,16 +672,16 @@ void CubeMesh::_create_mesh_array(Array &p_arr) const { p_arr[RS::ARRAY_INDEX] = indices; } -void CubeMesh::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_size", "size"), &CubeMesh::set_size); - ClassDB::bind_method(D_METHOD("get_size"), &CubeMesh::get_size); +void BoxMesh::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_size", "size"), &BoxMesh::set_size); + ClassDB::bind_method(D_METHOD("get_size"), &BoxMesh::get_size); - ClassDB::bind_method(D_METHOD("set_subdivide_width", "subdivide"), &CubeMesh::set_subdivide_width); - ClassDB::bind_method(D_METHOD("get_subdivide_width"), &CubeMesh::get_subdivide_width); - ClassDB::bind_method(D_METHOD("set_subdivide_height", "divisions"), &CubeMesh::set_subdivide_height); - ClassDB::bind_method(D_METHOD("get_subdivide_height"), &CubeMesh::get_subdivide_height); - ClassDB::bind_method(D_METHOD("set_subdivide_depth", "divisions"), &CubeMesh::set_subdivide_depth); - ClassDB::bind_method(D_METHOD("get_subdivide_depth"), &CubeMesh::get_subdivide_depth); + ClassDB::bind_method(D_METHOD("set_subdivide_width", "subdivide"), &BoxMesh::set_subdivide_width); + ClassDB::bind_method(D_METHOD("get_subdivide_width"), &BoxMesh::get_subdivide_width); + ClassDB::bind_method(D_METHOD("set_subdivide_height", "divisions"), &BoxMesh::set_subdivide_height); + ClassDB::bind_method(D_METHOD("get_subdivide_height"), &BoxMesh::get_subdivide_height); + ClassDB::bind_method(D_METHOD("set_subdivide_depth", "divisions"), &BoxMesh::set_subdivide_depth); + ClassDB::bind_method(D_METHOD("get_subdivide_depth"), &BoxMesh::get_subdivide_depth); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "size"), "set_size", "get_size"); ADD_PROPERTY(PropertyInfo(Variant::INT, "subdivide_width", PROPERTY_HINT_RANGE, "0,100,1,or_greater"), "set_subdivide_width", "get_subdivide_width"); @@ -689,43 +689,43 @@ void CubeMesh::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "subdivide_depth", PROPERTY_HINT_RANGE, "0,100,1,or_greater"), "set_subdivide_depth", "get_subdivide_depth"); } -void CubeMesh::set_size(const Vector3 &p_size) { +void BoxMesh::set_size(const Vector3 &p_size) { size = p_size; _request_update(); } -Vector3 CubeMesh::get_size() const { +Vector3 BoxMesh::get_size() const { return size; } -void CubeMesh::set_subdivide_width(const int p_divisions) { +void BoxMesh::set_subdivide_width(const int p_divisions) { subdivide_w = p_divisions > 0 ? p_divisions : 0; _request_update(); } -int CubeMesh::get_subdivide_width() const { +int BoxMesh::get_subdivide_width() const { return subdivide_w; } -void CubeMesh::set_subdivide_height(const int p_divisions) { +void BoxMesh::set_subdivide_height(const int p_divisions) { subdivide_h = p_divisions > 0 ? p_divisions : 0; _request_update(); } -int CubeMesh::get_subdivide_height() const { +int BoxMesh::get_subdivide_height() const { return subdivide_h; } -void CubeMesh::set_subdivide_depth(const int p_divisions) { +void BoxMesh::set_subdivide_depth(const int p_divisions) { subdivide_d = p_divisions > 0 ? p_divisions : 0; _request_update(); } -int CubeMesh::get_subdivide_depth() const { +int BoxMesh::get_subdivide_depth() const { return subdivide_d; } -CubeMesh::CubeMesh() { +BoxMesh::BoxMesh() { // defaults size = Vector3(2.0, 2.0, 2.0); subdivide_w = 0; diff --git a/scene/resources/primitive_meshes.h b/scene/resources/primitive_meshes.h index f0ae611b5e..02aea9c5c8 100644 --- a/scene/resources/primitive_meshes.h +++ b/scene/resources/primitive_meshes.h @@ -130,10 +130,10 @@ public: }; /** - Similar to test cube but with subdivision support and different texture coordinates + A box */ -class CubeMesh : public PrimitiveMesh { - GDCLASS(CubeMesh, PrimitiveMesh); +class BoxMesh : public PrimitiveMesh { + GDCLASS(BoxMesh, PrimitiveMesh); private: Vector3 size; @@ -158,7 +158,7 @@ public: void set_subdivide_depth(const int p_divisions); int get_subdivide_depth() const; - CubeMesh(); + BoxMesh(); }; /** diff --git a/scene/resources/ray_shape_3d.cpp b/scene/resources/ray_shape_3d.cpp index 39df4c22f9..1705fb0f55 100644 --- a/scene/resources/ray_shape_3d.cpp +++ b/scene/resources/ray_shape_3d.cpp @@ -81,7 +81,7 @@ void RayShape3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_slips_on_slope", "active"), &RayShape3D::set_slips_on_slope); ClassDB::bind_method(D_METHOD("get_slips_on_slope"), &RayShape3D::get_slips_on_slope); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "length", PROPERTY_HINT_RANGE, "0,4096,0.01"), "set_length", "get_length"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "length", PROPERTY_HINT_RANGE, "0,4096,0.001"), "set_length", "get_length"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "slips_on_slope"), "set_slips_on_slope", "get_slips_on_slope"); } diff --git a/scene/resources/resource_format_text.cpp b/scene/resources/resource_format_text.cpp index d4d8018d43..58645dbe65 100644 --- a/scene/resources/resource_format_text.cpp +++ b/scene/resources/resource_format_text.cpp @@ -30,9 +30,9 @@ #include "resource_format_text.h" +#include "core/config/project_settings.h" #include "core/io/resource_format_binary.h" #include "core/os/dir_access.h" -#include "core/project_settings.h" #include "core/version.h" //version 2: changed names for basis, aabb, Vectors, etc. @@ -704,7 +704,6 @@ ResourceLoaderText::ResourceLoaderText() { resources_total = 0; resource_current = 0; - use_sub_threads = false; progress = nullptr; lines = false; @@ -838,6 +837,11 @@ Error ResourceLoaderText::rename_dependencies(FileAccess *p_f, const String &p_p f->seek(tag_end); uint8_t c = f->get_8(); + if (c == '\n' && !f->eof_reached()) { + // Skip first newline character since we added one + c = f->get_8(); + } + while (!f->eof_reached()) { fw->store_8(c); c = f->get_8(); @@ -1763,6 +1767,10 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r } for (int i = 0; i < state->get_connection_count(); i++) { + if (i == 0) { + f->store_line(""); + } + String connstr = "[connection"; connstr += " signal=\"" + String(state->get_connection_signal(i)) + "\""; connstr += " from=\"" + String(state->get_connection_source(i).simplified()) + "\""; @@ -1786,7 +1794,10 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r Vector<NodePath> editable_instances = state->get_editable_instances(); for (int i = 0; i < editable_instances.size(); i++) { - f->store_line("\n[editable path=\"" + editable_instances[i].operator String() + "\"]"); + if (i == 0) { + f->store_line(""); + } + f->store_line("[editable path=\"" + editable_instances[i].operator String() + "\"]"); } } diff --git a/scene/resources/resource_format_text.h b/scene/resources/resource_format_text.h index cf522c9364..ca7b0b021f 100644 --- a/scene/resources/resource_format_text.h +++ b/scene/resources/resource_format_text.h @@ -34,7 +34,7 @@ #include "core/io/resource_loader.h" #include "core/io/resource_saver.h" #include "core/os/file_access.h" -#include "core/variant_parser.h" +#include "core/variant/variant_parser.h" #include "scene/resources/packed_scene.h" class ResourceLoaderText { diff --git a/scene/resources/shader.cpp b/scene/resources/shader.cpp index 92f0353abf..76d37eaa71 100644 --- a/scene/resources/shader.cpp +++ b/scene/resources/shader.cpp @@ -29,6 +29,7 @@ /*************************************************************************/ #include "shader.h" + #include "core/os/file_access.h" #include "scene/scene_string_names.h" #include "servers/rendering/shader_language.h" @@ -80,7 +81,7 @@ void Shader::get_param_list(List<PropertyInfo> *p_params) const { params_cache[pi.name] = E->get().name; if (p_params) { //small little hack - if (pi.type == Variant::_RID) { + if (pi.type == Variant::RID) { pi.type = Variant::OBJECT; } p_params->push_back(pi); diff --git a/scene/resources/shader.h b/scene/resources/shader.h index 7dcec7811a..0feaa179b2 100644 --- a/scene/resources/shader.h +++ b/scene/resources/shader.h @@ -31,9 +31,9 @@ #ifndef SHADER_H #define SHADER_H +#include "core/io/resource.h" #include "core/io/resource_loader.h" #include "core/io/resource_saver.h" -#include "core/resource.h" #include "scene/resources/texture.h" class Shader : public Resource { @@ -42,7 +42,6 @@ class Shader : public Resource { public: enum Mode { - MODE_SPATIAL, MODE_CANVAS_ITEM, MODE_PARTICLES, diff --git a/scene/resources/shape_2d.h b/scene/resources/shape_2d.h index bb4688a02d..495ffdd38b 100644 --- a/scene/resources/shape_2d.h +++ b/scene/resources/shape_2d.h @@ -31,7 +31,7 @@ #ifndef SHAPE_2D_H #define SHAPE_2D_H -#include "core/resource.h" +#include "core/io/resource.h" class Shape2D : public Resource { GDCLASS(Shape2D, Resource); diff --git a/scene/resources/shape_3d.h b/scene/resources/shape_3d.h index eb9607e3a6..5a9c2e3b9c 100644 --- a/scene/resources/shape_3d.h +++ b/scene/resources/shape_3d.h @@ -31,7 +31,7 @@ #ifndef SHAPE_3D_H #define SHAPE_3D_H -#include "core/resource.h" +#include "core/io/resource.h" class ArrayMesh; diff --git a/scene/resources/skin.h b/scene/resources/skin.h index 57aaf1afd4..e6ed4f1768 100644 --- a/scene/resources/skin.h +++ b/scene/resources/skin.h @@ -31,7 +31,7 @@ #ifndef SKIN_H #define SKIN_H -#include "core/resource.h" +#include "core/io/resource.h" class Skin : public Resource { GDCLASS(Skin, Resource) diff --git a/scene/resources/sky_material.cpp b/scene/resources/sky_material.cpp index 69e8e0b5bd..05bb13a1e0 100644 --- a/scene/resources/sky_material.cpp +++ b/scene/resources/sky_material.cpp @@ -568,7 +568,7 @@ PhysicalSkyMaterial::PhysicalSkyMaterial() { code += "\tCOLOR = pow(color, vec3(1.0 / (1.2 + (1.2 * sun_fade))));\n"; code += "\tCOLOR *= exposure;\n"; code += "\t// Make optional, eliminates banding\n"; - code += "\tCOLOR += (hash(EYEDIR * 1741.9782) * 0.08 - 0.04) * 0.008 * dither_strength;\n"; + code += "\tCOLOR += (hash(EYEDIR * 1741.9782) * 0.08 - 0.04) * 0.016 * dither_strength;\n"; code += "}\n"; shader = RS::get_singleton()->shader_create(); diff --git a/scene/resources/sky_material.h b/scene/resources/sky_material.h index 5e23020d66..5411994b7d 100644 --- a/scene/resources/sky_material.h +++ b/scene/resources/sky_material.h @@ -28,7 +28,7 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#include "core/rid.h" +#include "core/templates/rid.h" #include "scene/resources/material.h" #ifndef SKY_MATERIAL_H diff --git a/scene/resources/sphere_shape_3d.cpp b/scene/resources/sphere_shape_3d.cpp index fd33387df6..64e0a701b7 100644 --- a/scene/resources/sphere_shape_3d.cpp +++ b/scene/resources/sphere_shape_3d.cpp @@ -77,7 +77,7 @@ void SphereShape3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_radius", "radius"), &SphereShape3D::set_radius); ClassDB::bind_method(D_METHOD("get_radius"), &SphereShape3D::get_radius); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0,4096,0.01"), "set_radius", "get_radius"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0,4096,0.001"), "set_radius", "get_radius"); } SphereShape3D::SphereShape3D() : diff --git a/scene/resources/style_box.cpp b/scene/resources/style_box.cpp index 7328fbdb10..14197c6c68 100644 --- a/scene/resources/style_box.cpp +++ b/scene/resources/style_box.cpp @@ -130,18 +130,6 @@ Ref<Texture2D> StyleBoxTexture::get_texture() const { return texture; } -void StyleBoxTexture::set_normal_map(Ref<Texture2D> p_normal_map) { - if (normal_map == p_normal_map) { - return; - } - normal_map = p_normal_map; - emit_changed(); -} - -Ref<Texture2D> StyleBoxTexture::get_normal_map() const { - return normal_map; -} - void StyleBoxTexture::set_margin_size(Margin p_margin, float p_size) { ERR_FAIL_INDEX((int)p_margin, 4); @@ -187,12 +175,7 @@ void StyleBoxTexture::draw(RID p_canvas_item, const Rect2 &p_rect) const { rect.size.x += expand_margin[MARGIN_LEFT] + expand_margin[MARGIN_RIGHT]; rect.size.y += expand_margin[MARGIN_TOP] + expand_margin[MARGIN_BOTTOM]; - RID normal_rid; - if (normal_map.is_valid()) { - normal_rid = normal_map->get_rid(); - } - - RenderingServer::get_singleton()->canvas_item_add_nine_patch(p_canvas_item, rect, src_rect, texture->get_rid(), Vector2(margin[MARGIN_LEFT], margin[MARGIN_TOP]), Vector2(margin[MARGIN_RIGHT], margin[MARGIN_BOTTOM]), RS::NinePatchAxisMode(axis_h), RS::NinePatchAxisMode(axis_v), draw_center, modulate, normal_rid); + RenderingServer::get_singleton()->canvas_item_add_nine_patch(p_canvas_item, rect, src_rect, texture->get_rid(), Vector2(margin[MARGIN_LEFT], margin[MARGIN_TOP]), Vector2(margin[MARGIN_RIGHT], margin[MARGIN_BOTTOM]), RS::NinePatchAxisMode(axis_h), RS::NinePatchAxisMode(axis_v), draw_center, modulate); } void StyleBoxTexture::set_draw_center(bool p_enabled) { @@ -288,9 +271,6 @@ void StyleBoxTexture::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &StyleBoxTexture::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &StyleBoxTexture::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &StyleBoxTexture::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &StyleBoxTexture::get_normal_map); - ClassDB::bind_method(D_METHOD("set_margin_size", "margin", "size"), &StyleBoxTexture::set_margin_size); ClassDB::bind_method(D_METHOD("get_margin_size", "margin"), &StyleBoxTexture::get_margin_size); @@ -317,7 +297,6 @@ void StyleBoxTexture::_bind_methods() { ADD_SIGNAL(MethodInfo("texture_changed")); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); ADD_PROPERTY(PropertyInfo(Variant::RECT2, "region_rect"), "set_region_rect", "get_region_rect"); ADD_GROUP("Margin", "margin_"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "margin_left", PROPERTY_HINT_RANGE, "0,2048,1"), "set_margin_size", "get_margin_size", MARGIN_LEFT); @@ -425,16 +404,6 @@ void StyleBoxFlat::set_corner_radius_individual(const int radius_top_left, const emit_changed(); } -int StyleBoxFlat::get_corner_radius_min() const { - int smallest = corner_radius[0]; - for (int i = 1; i < 4; i++) { - if (smallest > corner_radius[i]) { - smallest = corner_radius[i]; - } - } - return smallest; -} - void StyleBoxFlat::set_corner_radius(const Corner p_corner, const int radius) { ERR_FAIL_INDEX((int)p_corner, 4); corner_radius[p_corner] = radius; @@ -911,7 +880,7 @@ void StyleBoxFlat::_bind_methods() { ADD_GROUP("Shadow", "shadow_"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "shadow_color"), "set_shadow_color", "get_shadow_color"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_size"), "set_shadow_size", "get_shadow_size"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_size", PROPERTY_HINT_RANGE, "0,100,1,or_greater"), "set_shadow_size", "get_shadow_size"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "shadow_offset"), "set_shadow_offset", "get_shadow_offset"); ADD_GROUP("Anti Aliasing", "anti_aliasing_"); diff --git a/scene/resources/style_box.h b/scene/resources/style_box.h index 3d29e3bd0f..7dd806e840 100644 --- a/scene/resources/style_box.h +++ b/scene/resources/style_box.h @@ -31,7 +31,7 @@ #ifndef STYLE_BOX_H #define STYLE_BOX_H -#include "core/resource.h" +#include "core/io/resource.h" #include "scene/resources/texture.h" #include "servers/rendering_server.h" @@ -90,7 +90,6 @@ private: float margin[4]; Rect2 region_rect; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; bool draw_center; Color modulate; AxisStretchMode axis_h; @@ -115,9 +114,6 @@ public: void set_texture(Ref<Texture2D> p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(Ref<Texture2D> p_normal_map); - Ref<Texture2D> get_normal_map() const; - void set_draw_center(bool p_enabled); bool is_draw_center_enabled() const; virtual Size2 get_center_size() const override; @@ -188,7 +184,6 @@ public: //CORNER void set_corner_radius_all(int radius); void set_corner_radius_individual(const int radius_top_left, const int radius_top_right, const int radius_botton_right, const int radius_bottom_left); - int get_corner_radius_min() const; void set_corner_radius(Corner p_corner, const int radius); int get_corner_radius(Corner p_corner) const; diff --git a/scene/resources/surface_tool.cpp b/scene/resources/surface_tool.cpp index 1a2dcc84bb..50308d641a 100644 --- a/scene/resources/surface_tool.cpp +++ b/scene/resources/surface_tool.cpp @@ -30,11 +30,12 @@ #include "surface_tool.h" -#include "core/method_bind_ext.gen.inc" - #define _VERTEX_SNAP 0.0001 #define EQ_VERTEX_DIST 0.00001 +SurfaceTool::OptimizeVertexCacheFunc SurfaceTool::optimize_vertex_cache_func = nullptr; +SurfaceTool::SimplifyFunc SurfaceTool::simplify_func = nullptr; + bool SurfaceTool::Vertex::operator==(const Vertex &p_vertex) const { if (vertex != p_vertex.vertex) { return false; @@ -76,6 +77,16 @@ bool SurfaceTool::Vertex::operator==(const Vertex &p_vertex) const { } } + for (int i = 0; i < RS::ARRAY_CUSTOM_COUNT; i++) { + if (custom[i] != p_vertex.custom[i]) { + return false; + } + } + + if (smooth_group != p_vertex.smooth_group) { + return false; + } + return true; } @@ -89,6 +100,8 @@ uint32_t SurfaceTool::VertexHasher::hash(const Vertex &p_vtx) { h = hash_djb2_buffer((const uint8_t *)&p_vtx.color, sizeof(real_t) * 4, h); h = hash_djb2_buffer((const uint8_t *)p_vtx.bones.ptr(), p_vtx.bones.size() * sizeof(int), h); h = hash_djb2_buffer((const uint8_t *)p_vtx.weights.ptr(), p_vtx.weights.size() * sizeof(float), h); + h = hash_djb2_buffer((const uint8_t *)&p_vtx.custom[0], sizeof(Color) * RS::ARRAY_CUSTOM_COUNT, h); + h = hash_djb2_one_32(p_vtx.smooth_group, h); return h; } @@ -113,8 +126,13 @@ void SurfaceTool::add_vertex(const Vector3 &p_vertex) { vtx.bones = last_bones; vtx.tangent = last_tangent.normal; vtx.binormal = last_normal.cross(last_tangent.normal).normalized() * last_tangent.d; + vtx.smooth_group = last_smooth_group; + + for (int i = 0; i < RS::ARRAY_CUSTOM_COUNT; i++) { + vtx.custom[i] = last_custom[i]; + } - const int expected_vertices = 4; + const int expected_vertices = skin_weights == SKIN_8_WEIGHTS ? 8 : 4; if ((format & Mesh::ARRAY_FORMAT_WEIGHTS || format & Mesh::ARRAY_FORMAT_BONES) && (vtx.weights.size() != expected_vertices || vtx.bones.size() != expected_vertices)) { //ensure vertices are the expected amount @@ -165,7 +183,7 @@ void SurfaceTool::add_vertex(const Vector3 &p_vertex) { format |= Mesh::ARRAY_FORMAT_VERTEX; } -void SurfaceTool::add_color(Color p_color) { +void SurfaceTool::set_color(Color p_color) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_COLOR)); @@ -174,7 +192,7 @@ void SurfaceTool::add_color(Color p_color) { last_color = p_color; } -void SurfaceTool::add_normal(const Vector3 &p_normal) { +void SurfaceTool::set_normal(const Vector3 &p_normal) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_NORMAL)); @@ -183,7 +201,7 @@ void SurfaceTool::add_normal(const Vector3 &p_normal) { last_normal = p_normal; } -void SurfaceTool::add_tangent(const Plane &p_tangent) { +void SurfaceTool::set_tangent(const Plane &p_tangent) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_TANGENT)); @@ -191,7 +209,7 @@ void SurfaceTool::add_tangent(const Plane &p_tangent) { last_tangent = p_tangent; } -void SurfaceTool::add_uv(const Vector2 &p_uv) { +void SurfaceTool::set_uv(const Vector2 &p_uv) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_TEX_UV)); @@ -199,7 +217,7 @@ void SurfaceTool::add_uv(const Vector2 &p_uv) { last_uv = p_uv; } -void SurfaceTool::add_uv2(const Vector2 &p_uv2) { +void SurfaceTool::set_uv2(const Vector2 &p_uv2) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_TEX_UV2)); @@ -207,29 +225,45 @@ void SurfaceTool::add_uv2(const Vector2 &p_uv2) { last_uv2 = p_uv2; } -void SurfaceTool::add_bones(const Vector<int> &p_bones) { +void SurfaceTool::set_custom(int p_index, const Color &p_custom) { + ERR_FAIL_INDEX(p_index, RS::ARRAY_CUSTOM_COUNT); + ERR_FAIL_COND(!begun); + ERR_FAIL_COND(last_custom_format[p_index] == CUSTOM_MAX); + static const uint32_t mask[RS::ARRAY_CUSTOM_COUNT] = { Mesh::ARRAY_FORMAT_CUSTOM0, Mesh::ARRAY_FORMAT_CUSTOM1, Mesh::ARRAY_FORMAT_CUSTOM2, Mesh::ARRAY_FORMAT_CUSTOM3 }; + static const uint32_t shift[RS::ARRAY_CUSTOM_COUNT] = { Mesh::ARRAY_FORMAT_CUSTOM0_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM1_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM2_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM3_SHIFT }; + ERR_FAIL_COND(!first && !(format & mask[p_index])); + + if (first) { + format |= mask[p_index]; + format |= last_custom_format[p_index] << shift[p_index]; + } + last_custom[p_index] = p_custom; +} + +void SurfaceTool::set_bones(const Vector<int> &p_bones) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_BONES)); format |= Mesh::ARRAY_FORMAT_BONES; + if (skin_weights == SKIN_8_WEIGHTS) { + format |= Mesh::ARRAY_FLAG_USE_8_BONE_WEIGHTS; + } last_bones = p_bones; } -void SurfaceTool::add_weights(const Vector<float> &p_weights) { +void SurfaceTool::set_weights(const Vector<float> &p_weights) { ERR_FAIL_COND(!begun); ERR_FAIL_COND(!first && !(format & Mesh::ARRAY_FORMAT_WEIGHTS)); format |= Mesh::ARRAY_FORMAT_WEIGHTS; + if (skin_weights == SKIN_8_WEIGHTS) { + format |= Mesh::ARRAY_FLAG_USE_8_BONE_WEIGHTS; + } last_weights = p_weights; } -void SurfaceTool::add_smooth_group(bool p_smooth) { - ERR_FAIL_COND(!begun); - if (index_array.size()) { - smooth_groups[index_array.size()] = p_smooth; - } else { - smooth_groups[vertex_array.size()] = p_smooth; - } +void SurfaceTool::set_smooth_group(uint32_t p_group) { + last_smooth_group = p_group; } void SurfaceTool::add_triangle_fan(const Vector<Vector3> &p_vertices, const Vector<Vector2> &p_uvs, const Vector<Color> &p_colors, const Vector<Vector2> &p_uv2s, const Vector<Vector3> &p_normals, const Vector<Plane> &p_tangents) { @@ -240,15 +274,15 @@ void SurfaceTool::add_triangle_fan(const Vector<Vector3> &p_vertices, const Vect #define ADD_POINT(n) \ { \ if (p_colors.size() > n) \ - add_color(p_colors[n]); \ + set_color(p_colors[n]); \ if (p_uvs.size() > n) \ - add_uv(p_uvs[n]); \ + set_uv(p_uvs[n]); \ if (p_uv2s.size() > n) \ - add_uv2(p_uv2s[n]); \ + set_uv2(p_uv2s[n]); \ if (p_normals.size() > n) \ - add_normal(p_normals[n]); \ + set_normal(p_normals[n]); \ if (p_tangents.size() > n) \ - add_tangent(p_tangents[n]); \ + set_tangent(p_tangents[n]); \ add_vertex(p_vertices[n]); \ } @@ -286,9 +320,8 @@ Array SurfaceTool::commit_to_arrays() { array.resize(varr_len); Vector3 *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx++) { - const Vertex &v = E->get(); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; switch (i) { case Mesh::ARRAY_VERTEX: { @@ -310,9 +343,8 @@ Array SurfaceTool::commit_to_arrays() { array.resize(varr_len); Vector2 *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx++) { - const Vertex &v = E->get(); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; switch (i) { case Mesh::ARRAY_TEX_UV: { @@ -331,9 +363,8 @@ Array SurfaceTool::commit_to_arrays() { array.resize(varr_len * 4); float *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx += 4) { - const Vertex &v = E->get(); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; w[idx + 0] = v.tangent.x; w[idx + 1] = v.tangent.y; @@ -352,27 +383,165 @@ Array SurfaceTool::commit_to_arrays() { array.resize(varr_len); Color *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx++) { - const Vertex &v = E->get(); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + w[idx] = v.color; } a[i] = array; } break; + case Mesh::ARRAY_CUSTOM0: + case Mesh::ARRAY_CUSTOM1: + case Mesh::ARRAY_CUSTOM2: + case Mesh::ARRAY_CUSTOM3: { + int fmt = i - Mesh::ARRAY_CUSTOM0; + switch (last_custom_format[fmt]) { + case CUSTOM_RGBA8_UNORM: { + Vector<uint8_t> array; + array.resize(varr_len * 4); + uint8_t *w = array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 4 + 0] = CLAMP(int32_t(c.r * 255.0), 0, 255); + w[idx * 4 + 1] = CLAMP(int32_t(c.g * 255.0), 0, 255); + w[idx * 4 + 2] = CLAMP(int32_t(c.b * 255.0), 0, 255); + w[idx * 4 + 3] = CLAMP(int32_t(c.a * 255.0), 0, 255); + } + + a[i] = array; + } break; + case CUSTOM_RGBA8_SNORM: { + Vector<uint8_t> array; + array.resize(varr_len * 4); + uint8_t *w = array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 4 + 0] = uint8_t(int8_t(CLAMP(int32_t(c.r * 127.0), -128, 127))); + w[idx * 4 + 1] = uint8_t(int8_t(CLAMP(int32_t(c.g * 127.0), -128, 127))); + w[idx * 4 + 2] = uint8_t(int8_t(CLAMP(int32_t(c.b * 127.0), -128, 127))); + w[idx * 4 + 3] = uint8_t(int8_t(CLAMP(int32_t(c.a * 127.0), -128, 127))); + } + + a[i] = array; + } break; + case CUSTOM_RG_HALF: { + Vector<uint8_t> array; + array.resize(varr_len * 4); + uint16_t *w = (uint16_t *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 2 + 0] = Math::make_half_float(c.r); + w[idx * 2 + 1] = Math::make_half_float(c.g); + } + + a[i] = array; + } break; + case CUSTOM_RGBA_HALF: { + Vector<uint8_t> array; + array.resize(varr_len * 8); + uint16_t *w = (uint16_t *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 4 + 0] = Math::make_half_float(c.r); + w[idx * 4 + 1] = Math::make_half_float(c.g); + w[idx * 4 + 2] = Math::make_half_float(c.b); + w[idx * 4 + 3] = Math::make_half_float(c.a); + } + + a[i] = array; + } break; + case CUSTOM_R_FLOAT: { + Vector<float> array; + array.resize(varr_len); + float *w = (float *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx] = c.r; + } + + a[i] = array; + } break; + case CUSTOM_RG_FLOAT: { + Vector<float> array; + array.resize(varr_len * 2); + float *w = (float *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 2 + 0] = c.r; + w[idx * 2 + 1] = c.g; + } + + a[i] = array; + } break; + case CUSTOM_RGB_FLOAT: { + Vector<float> array; + array.resize(varr_len * 3); + float *w = (float *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 3 + 0] = c.r; + w[idx * 3 + 1] = c.g; + w[idx * 3 + 2] = c.b; + } + + a[i] = array; + } break; + case CUSTOM_RGBA_FLOAT: { + Vector<float> array; + array.resize(varr_len * 4); + float *w = (float *)array.ptrw(); + + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + const Color &c = v.custom[idx]; + w[idx * 4 + 0] = c.r; + w[idx * 4 + 1] = c.g; + w[idx * 4 + 2] = c.b; + w[idx * 4 + 3] = c.a; + } + + a[i] = array; + } break; + default: { + } //unreachable but compiler warning anyway + } + } break; case Mesh::ARRAY_BONES: { + int count = skin_weights == SKIN_8_WEIGHTS ? 8 : 4; Vector<int> array; - array.resize(varr_len * 4); + array.resize(varr_len * count); int *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx += 4) { - const Vertex &v = E->get(); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; - ERR_CONTINUE(v.bones.size() != 4); + ERR_CONTINUE(v.bones.size() != count); - for (int j = 0; j < 4; j++) { - w[idx + j] = v.bones[j]; + for (int j = 0; j < count; j++) { + w[idx * count + j] = v.bones[j]; } } @@ -381,16 +550,18 @@ Array SurfaceTool::commit_to_arrays() { } break; case Mesh::ARRAY_WEIGHTS: { Vector<float> array; - array.resize(varr_len * 4); + int count = skin_weights == SKIN_8_WEIGHTS ? 8 : 4; + + array.resize(varr_len * count); float *w = array.ptrw(); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next(), idx += 4) { - const Vertex &v = E->get(); - ERR_CONTINUE(v.weights.size() != 4); + for (uint32_t idx = 0; idx < vertex_array.size(); idx++) { + const Vertex &v = vertex_array[idx]; + + ERR_CONTINUE(v.weights.size() != count); - for (int j = 0; j < 4; j++) { - w[idx + j] = v.weights[j]; + for (int j = 0; j < count; j++) { + w[idx * count + j] = v.weights[j]; } } @@ -404,9 +575,8 @@ Array SurfaceTool::commit_to_arrays() { array.resize(index_array.size()); int *w = array.ptrw(); - int idx = 0; - for (List<int>::Element *E = index_array.front(); E; E = E->next(), idx++) { - w[idx] = E->get(); + for (uint32_t idx = 0; idx < index_array.size(); idx++) { + w[idx] = index_array[idx]; } a[i] = array; @@ -453,15 +623,16 @@ void SurfaceTool::index() { } HashMap<Vertex, int, VertexHasher> indices; - List<Vertex> new_vertices; + LocalVector<Vertex> old_vertex_array = vertex_array; + vertex_array.clear(); - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next()) { - int *idxptr = indices.getptr(E->get()); + for (uint32_t i = 0; i < old_vertex_array.size(); i++) { + int *idxptr = indices.getptr(old_vertex_array[i]); int idx; if (!idxptr) { idx = indices.size(); - new_vertices.push_back(E->get()); - indices[E->get()] = idx; + vertex_array.push_back(old_vertex_array[i]); + indices[old_vertex_array[i]] = idx; } else { idx = *idxptr; } @@ -469,9 +640,6 @@ void SurfaceTool::index() { index_array.push_back(idx); } - vertex_array.clear(); - vertex_array = new_vertices; - format |= Mesh::ARRAY_FORMAT_INDEX; } @@ -479,29 +647,26 @@ void SurfaceTool::deindex() { if (index_array.size() == 0) { return; //nothing to deindex } - Vector<Vertex> varr; - varr.resize(vertex_array.size()); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next()) { - varr.write[idx++] = E->get(); - } + + LocalVector<Vertex> old_vertex_array = vertex_array; vertex_array.clear(); - for (List<int>::Element *E = index_array.front(); E; E = E->next()) { - ERR_FAIL_INDEX(E->get(), varr.size()); - vertex_array.push_back(varr[E->get()]); + for (uint32_t i = 0; i < index_array.size(); i++) { + uint32_t index = index_array[i]; + ERR_FAIL_COND(index >= old_vertex_array.size()); + vertex_array.push_back(old_vertex_array[index]); } format &= ~Mesh::ARRAY_FORMAT_INDEX; index_array.clear(); } -void SurfaceTool::_create_list(const Ref<Mesh> &p_existing, int p_surface, List<Vertex> *r_vertex, List<int> *r_index, int &lformat) { +void SurfaceTool::_create_list(const Ref<Mesh> &p_existing, int p_surface, LocalVector<Vertex> *r_vertex, LocalVector<int> *r_index, uint32_t &lformat) { Array arr = p_existing->surface_get_arrays(p_surface); ERR_FAIL_COND(arr.size() != RS::ARRAY_MAX); _create_list_from_arrays(arr, r_vertex, r_index, lformat); } -Vector<SurfaceTool::Vertex> SurfaceTool::create_vertex_array_from_triangle_arrays(const Array &p_arrays) { - Vector<SurfaceTool::Vertex> ret; +void SurfaceTool::create_vertex_array_from_triangle_arrays(const Array &p_arrays, LocalVector<SurfaceTool::Vertex> &ret, uint32_t *r_format) { + ret.clear(); Vector<Vector3> varr = p_arrays[RS::ARRAY_VERTEX]; Vector<Vector3> narr = p_arrays[RS::ARRAY_NORMAL]; @@ -511,10 +676,14 @@ Vector<SurfaceTool::Vertex> SurfaceTool::create_vertex_array_from_triangle_array Vector<Vector2> uv2arr = p_arrays[RS::ARRAY_TEX_UV2]; Vector<int> barr = p_arrays[RS::ARRAY_BONES]; Vector<float> warr = p_arrays[RS::ARRAY_WEIGHTS]; + Vector<float> custom_float[RS::ARRAY_CUSTOM_COUNT]; int vc = varr.size(); if (vc == 0) { - return ret; + if (r_format) { + *r_format = 0; + } + return; } int lformat = 0; @@ -536,100 +705,40 @@ Vector<SurfaceTool::Vertex> SurfaceTool::create_vertex_array_from_triangle_array if (uv2arr.size()) { lformat |= RS::ARRAY_FORMAT_TEX_UV2; } - if (barr.size()) { + int wcount = 0; + if (barr.size() && warr.size()) { lformat |= RS::ARRAY_FORMAT_BONES; - } - if (warr.size()) { lformat |= RS::ARRAY_FORMAT_WEIGHTS; - } - for (int i = 0; i < vc; i++) { - Vertex v; - if (lformat & RS::ARRAY_FORMAT_VERTEX) { - v.vertex = varr[i]; - } - if (lformat & RS::ARRAY_FORMAT_NORMAL) { - v.normal = narr[i]; - } - if (lformat & RS::ARRAY_FORMAT_TANGENT) { - Plane p(tarr[i * 4 + 0], tarr[i * 4 + 1], tarr[i * 4 + 2], tarr[i * 4 + 3]); - v.tangent = p.normal; - v.binormal = p.normal.cross(v.tangent).normalized() * p.d; - } - if (lformat & RS::ARRAY_FORMAT_COLOR) { - v.color = carr[i]; - } - if (lformat & RS::ARRAY_FORMAT_TEX_UV) { - v.uv = uvarr[i]; - } - if (lformat & RS::ARRAY_FORMAT_TEX_UV2) { - v.uv2 = uv2arr[i]; - } - if (lformat & RS::ARRAY_FORMAT_BONES) { - Vector<int> b; - b.resize(4); - b.write[0] = barr[i * 4 + 0]; - b.write[1] = barr[i * 4 + 1]; - b.write[2] = barr[i * 4 + 2]; - b.write[3] = barr[i * 4 + 3]; - v.bones = b; + wcount = barr.size() / varr.size(); + if (wcount == 8) { + lformat |= RS::ARRAY_FLAG_USE_8_BONE_WEIGHTS; } - if (lformat & RS::ARRAY_FORMAT_WEIGHTS) { - Vector<float> w; - w.resize(4); - w.write[0] = warr[i * 4 + 0]; - w.write[1] = warr[i * 4 + 1]; - w.write[2] = warr[i * 4 + 2]; - w.write[3] = warr[i * 4 + 3]; - v.weights = w; - } - - ret.push_back(v); - } - - return ret; -} - -void SurfaceTool::_create_list_from_arrays(Array arr, List<Vertex> *r_vertex, List<int> *r_index, int &lformat) { - Vector<Vector3> varr = arr[RS::ARRAY_VERTEX]; - Vector<Vector3> narr = arr[RS::ARRAY_NORMAL]; - Vector<float> tarr = arr[RS::ARRAY_TANGENT]; - Vector<Color> carr = arr[RS::ARRAY_COLOR]; - Vector<Vector2> uvarr = arr[RS::ARRAY_TEX_UV]; - Vector<Vector2> uv2arr = arr[RS::ARRAY_TEX_UV2]; - Vector<int> barr = arr[RS::ARRAY_BONES]; - Vector<float> warr = arr[RS::ARRAY_WEIGHTS]; - - int vc = varr.size(); - if (vc == 0) { - return; } - lformat = 0; - if (varr.size()) { - lformat |= RS::ARRAY_FORMAT_VERTEX; - } - if (narr.size()) { - lformat |= RS::ARRAY_FORMAT_NORMAL; - } - if (tarr.size()) { - lformat |= RS::ARRAY_FORMAT_TANGENT; - } - if (carr.size()) { - lformat |= RS::ARRAY_FORMAT_COLOR; - } - if (uvarr.size()) { - lformat |= RS::ARRAY_FORMAT_TEX_UV; - } - if (uv2arr.size()) { - lformat |= RS::ARRAY_FORMAT_TEX_UV2; - } - if (barr.size()) { - lformat |= RS::ARRAY_FORMAT_BONES; - } if (warr.size()) { lformat |= RS::ARRAY_FORMAT_WEIGHTS; } + static const uint32_t custom_mask[RS::ARRAY_CUSTOM_COUNT] = { Mesh::ARRAY_FORMAT_CUSTOM0, Mesh::ARRAY_FORMAT_CUSTOM1, Mesh::ARRAY_FORMAT_CUSTOM2, Mesh::ARRAY_FORMAT_CUSTOM3 }; + static const uint32_t custom_shift[RS::ARRAY_CUSTOM_COUNT] = { Mesh::ARRAY_FORMAT_CUSTOM0_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM1_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM2_SHIFT, Mesh::ARRAY_FORMAT_CUSTOM3_SHIFT }; + + for (int i = 0; i < RS::ARRAY_CUSTOM_COUNT; i++) { + ERR_CONTINUE_MSG(p_arrays[RS::ARRAY_CUSTOM0 + i].get_type() == Variant::PACKED_BYTE_ARRAY, "Extracting Byte/Half formats is not supported"); + if (p_arrays[RS::ARRAY_CUSTOM0 + i].get_type() == Variant::PACKED_FLOAT32_ARRAY) { + lformat |= custom_mask[i]; + custom_float[i] = p_arrays[RS::ARRAY_CUSTOM0 + i]; + int fmt = custom_float[i].size() / varr.size(); + if (fmt == 1) { + lformat |= CUSTOM_R_FLOAT << custom_shift[i]; + } else if (fmt == 2) { + lformat |= CUSTOM_RG_FLOAT << custom_shift[i]; + } else if (fmt == 3) { + lformat |= CUSTOM_RGB_FLOAT << custom_shift[i]; + } else if (fmt == 4) { + lformat |= CUSTOM_RGBA_FLOAT << custom_shift[i]; + } + } + } for (int i = 0; i < vc; i++) { Vertex v; @@ -655,27 +764,44 @@ void SurfaceTool::_create_list_from_arrays(Array arr, List<Vertex> *r_vertex, Li } if (lformat & RS::ARRAY_FORMAT_BONES) { Vector<int> b; - b.resize(4); - b.write[0] = barr[i * 4 + 0]; - b.write[1] = barr[i * 4 + 1]; - b.write[2] = barr[i * 4 + 2]; - b.write[3] = barr[i * 4 + 3]; + b.resize(wcount); + for (int j = 0; j < wcount; j++) { + b.write[j] = barr[i * wcount + j]; + } v.bones = b; } if (lformat & RS::ARRAY_FORMAT_WEIGHTS) { Vector<float> w; - w.resize(4); - w.write[0] = warr[i * 4 + 0]; - w.write[1] = warr[i * 4 + 1]; - w.write[2] = warr[i * 4 + 2]; - w.write[3] = warr[i * 4 + 3]; + w.resize(wcount); + for (int j = 0; j < wcount; j++) { + w.write[j] = warr[i * wcount + j]; + } v.weights = w; } - r_vertex->push_back(v); + for (int j = 0; j < RS::ARRAY_CUSTOM_COUNT; j++) { + if (lformat & custom_mask[j]) { + int cc = custom_float[j].size() / varr.size(); + for (int k = 0; k < cc; k++) { + v.custom[j][k] = custom_float[j][i * cc + k]; + } + } + } + + ret.push_back(v); } + if (r_format) { + *r_format = lformat; + } +} + +void SurfaceTool::_create_list_from_arrays(Array arr, LocalVector<Vertex> *r_vertex, LocalVector<int> *r_index, uint32_t &lformat) { + create_vertex_array_from_triangle_arrays(arr, *r_vertex, &lformat); + ERR_FAIL_COND(r_vertex->size() == 0); + //indices + r_index->clear(); Vector<int> idx = arr[RS::ARRAY_INDEX]; int is = idx.size(); @@ -727,15 +853,15 @@ void SurfaceTool::append_from(const Ref<Mesh> &p_existing, int p_surface, const format = 0; } - int nformat; - List<Vertex> nvertices; - List<int> nindices; + uint32_t nformat; + LocalVector<Vertex> nvertices; + LocalVector<int> nindices; _create_list(p_existing, p_surface, &nvertices, &nindices, nformat); format |= nformat; int vfrom = vertex_array.size(); - for (List<Vertex>::Element *E = nvertices.front(); E; E = E->next()) { - Vertex v = E->get(); + for (uint32_t vi = 0; vi < nvertices.size(); vi++) { + Vertex v = nvertices[vi]; v.vertex = p_xform.xform(v.vertex); if (nformat & RS::ARRAY_FORMAT_NORMAL) { v.normal = p_xform.basis.xform(v.normal); @@ -748,8 +874,8 @@ void SurfaceTool::append_from(const Ref<Mesh> &p_existing, int p_surface, const vertex_array.push_back(v); } - for (List<int>::Element *E = nindices.front(); E; E = E->next()) { - int dst_index = E->get() + vfrom; + for (uint32_t i = 0; i < nindices.size(); i++) { + int dst_index = nindices[i] + vfrom; index_array.push_back(dst_index); } if (index_array.size() % 3) { @@ -760,18 +886,18 @@ void SurfaceTool::append_from(const Ref<Mesh> &p_existing, int p_surface, const //mikktspace callbacks namespace { struct TangentGenerationContextUserData { - Vector<List<SurfaceTool::Vertex>::Element *> vertices; - Vector<List<int>::Element *> indices; + LocalVector<SurfaceTool::Vertex> *vertices; + LocalVector<int> *indices; }; } // namespace int SurfaceTool::mikktGetNumFaces(const SMikkTSpaceContext *pContext) { TangentGenerationContextUserData &triangle_data = *reinterpret_cast<TangentGenerationContextUserData *>(pContext->m_pUserData); - if (triangle_data.indices.size() > 0) { - return triangle_data.indices.size() / 3; + if (triangle_data.indices->size() > 0) { + return triangle_data.indices->size() / 3; } else { - return triangle_data.vertices.size() / 3; + return triangle_data.vertices->size() / 3; } } @@ -782,13 +908,13 @@ int SurfaceTool::mikktGetNumVerticesOfFace(const SMikkTSpaceContext *pContext, c void SurfaceTool::mikktGetPosition(const SMikkTSpaceContext *pContext, float fvPosOut[], const int iFace, const int iVert) { TangentGenerationContextUserData &triangle_data = *reinterpret_cast<TangentGenerationContextUserData *>(pContext->m_pUserData); Vector3 v; - if (triangle_data.indices.size() > 0) { - int index = triangle_data.indices[iFace * 3 + iVert]->get(); - if (index < triangle_data.vertices.size()) { - v = triangle_data.vertices[index]->get().vertex; + if (triangle_data.indices->size() > 0) { + uint32_t index = triangle_data.indices->operator[](iFace * 3 + iVert); + if (index < triangle_data.vertices->size()) { + v = triangle_data.vertices->operator[](index).vertex; } } else { - v = triangle_data.vertices[iFace * 3 + iVert]->get().vertex; + v = triangle_data.vertices->operator[](iFace * 3 + iVert).vertex; } fvPosOut[0] = v.x; @@ -799,13 +925,13 @@ void SurfaceTool::mikktGetPosition(const SMikkTSpaceContext *pContext, float fvP void SurfaceTool::mikktGetNormal(const SMikkTSpaceContext *pContext, float fvNormOut[], const int iFace, const int iVert) { TangentGenerationContextUserData &triangle_data = *reinterpret_cast<TangentGenerationContextUserData *>(pContext->m_pUserData); Vector3 v; - if (triangle_data.indices.size() > 0) { - int index = triangle_data.indices[iFace * 3 + iVert]->get(); - if (index < triangle_data.vertices.size()) { - v = triangle_data.vertices[index]->get().normal; + if (triangle_data.indices->size() > 0) { + uint32_t index = triangle_data.indices->operator[](iFace * 3 + iVert); + if (index < triangle_data.vertices->size()) { + v = triangle_data.vertices->operator[](index).normal; } } else { - v = triangle_data.vertices[iFace * 3 + iVert]->get().normal; + v = triangle_data.vertices->operator[](iFace * 3 + iVert).normal; } fvNormOut[0] = v.x; @@ -816,13 +942,13 @@ void SurfaceTool::mikktGetNormal(const SMikkTSpaceContext *pContext, float fvNor void SurfaceTool::mikktGetTexCoord(const SMikkTSpaceContext *pContext, float fvTexcOut[], const int iFace, const int iVert) { TangentGenerationContextUserData &triangle_data = *reinterpret_cast<TangentGenerationContextUserData *>(pContext->m_pUserData); Vector2 v; - if (triangle_data.indices.size() > 0) { - int index = triangle_data.indices[iFace * 3 + iVert]->get(); - if (index < triangle_data.vertices.size()) { - v = triangle_data.vertices[index]->get().uv; + if (triangle_data.indices->size() > 0) { + uint32_t index = triangle_data.indices->operator[](iFace * 3 + iVert); + if (index < triangle_data.vertices->size()) { + v = triangle_data.vertices->operator[](index).uv; } } else { - v = triangle_data.vertices[iFace * 3 + iVert]->get().uv; + v = triangle_data.vertices->operator[](iFace * 3 + iVert).uv; } fvTexcOut[0] = v.x; @@ -833,13 +959,13 @@ void SurfaceTool::mikktSetTSpaceDefault(const SMikkTSpaceContext *pContext, cons const tbool bIsOrientationPreserving, const int iFace, const int iVert) { TangentGenerationContextUserData &triangle_data = *reinterpret_cast<TangentGenerationContextUserData *>(pContext->m_pUserData); Vertex *vtx = nullptr; - if (triangle_data.indices.size() > 0) { - int index = triangle_data.indices[iFace * 3 + iVert]->get(); - if (index < triangle_data.vertices.size()) { - vtx = &triangle_data.vertices[index]->get(); + if (triangle_data.indices->size() > 0) { + uint32_t index = triangle_data.indices->operator[](iFace * 3 + iVert); + if (index < triangle_data.vertices->size()) { + vtx = &triangle_data.vertices->operator[](index); } } else { - vtx = &triangle_data.vertices[iFace * 3 + iVert]->get(); + vtx = &triangle_data.vertices->operator[](iFace * 3 + iVert); } if (vtx != nullptr) { @@ -865,18 +991,12 @@ void SurfaceTool::generate_tangents() { msc.m_pInterface = &mkif; TangentGenerationContextUserData triangle_data; - triangle_data.vertices.resize(vertex_array.size()); - int idx = 0; - for (List<Vertex>::Element *E = vertex_array.front(); E; E = E->next()) { - triangle_data.vertices.write[idx++] = E; - E->get().binormal = Vector3(); - E->get().tangent = Vector3(); - } - triangle_data.indices.resize(index_array.size()); - idx = 0; - for (List<int>::Element *E = index_array.front(); E; E = E->next()) { - triangle_data.indices.write[idx++] = E; + triangle_data.vertices = &vertex_array; + for (uint32_t i = 0; i < vertex_array.size(); i++) { + vertex_array[i].binormal = Vector3(); + vertex_array[i].tangent = Vector3(); } + triangle_data.indices = &index_array; msc.m_pUserData = &triangle_data; bool res = genTangSpaceDefault(&msc); @@ -892,66 +1012,36 @@ void SurfaceTool::generate_normals(bool p_flip) { deindex(); - HashMap<Vertex, Vector3, VertexHasher> vertex_hash; + ERR_FAIL_COND((vertex_array.size() % 3) != 0); - int count = 0; - bool smooth = false; - if (smooth_groups.has(0)) { - smooth = smooth_groups[0]; - } + HashMap<Vertex, Vector3, VertexHasher> vertex_hash; - List<Vertex>::Element *B = vertex_array.front(); - for (List<Vertex>::Element *E = B; E;) { - List<Vertex>::Element *v[3]; - v[0] = E; - v[1] = v[0]->next(); - ERR_FAIL_COND(!v[1]); - v[2] = v[1]->next(); - ERR_FAIL_COND(!v[2]); - E = v[2]->next(); + for (uint32_t vi = 0; vi < vertex_array.size(); vi += 3) { + Vertex *v = &vertex_array[vi]; Vector3 normal; if (!p_flip) { - normal = Plane(v[0]->get().vertex, v[1]->get().vertex, v[2]->get().vertex).normal; + normal = Plane(v[0].vertex, v[1].vertex, v[2].vertex).normal; } else { - normal = Plane(v[2]->get().vertex, v[1]->get().vertex, v[0]->get().vertex).normal; + normal = Plane(v[2].vertex, v[1].vertex, v[0].vertex).normal; } - if (smooth) { - for (int i = 0; i < 3; i++) { - Vector3 *lv = vertex_hash.getptr(v[i]->get()); - if (!lv) { - vertex_hash.set(v[i]->get(), normal); - } else { - (*lv) += normal; - } - } - } else { - for (int i = 0; i < 3; i++) { - v[i]->get().normal = normal; - } - } - count += 3; - - if (smooth_groups.has(count) || !E) { - if (vertex_hash.size()) { - while (B != E) { - Vector3 *lv = vertex_hash.getptr(B->get()); - if (lv) { - B->get().normal = lv->normalized(); - } - - B = B->next(); - } - + for (int i = 0; i < 3; i++) { + Vector3 *lv = vertex_hash.getptr(v[i]); + if (!lv) { + vertex_hash.set(v[i], normal); } else { - B = E; + (*lv) += normal; } + } + } - vertex_hash.clear(); - if (E) { - smooth = smooth_groups[count]; - } + for (uint32_t vi = 0; vi < vertex_array.size(); vi++) { + Vector3 *lv = vertex_hash.getptr(vertex_array[vi]); + if (!lv) { + vertex_array[vi].normal = Vector3(); + } else { + vertex_array[vi].normal = lv->normalized(); } } @@ -959,7 +1049,6 @@ void SurfaceTool::generate_normals(bool p_flip) { if (was_indexed) { index(); - smooth_groups.clear(); } } @@ -975,22 +1064,97 @@ void SurfaceTool::clear() { last_weights.clear(); index_array.clear(); vertex_array.clear(); - smooth_groups.clear(); material.unref(); + last_smooth_group = 0; + for (int i = 0; i < RS::ARRAY_CUSTOM_COUNT; i++) { + last_custom_format[i] = CUSTOM_MAX; + } + skin_weights = SKIN_4_WEIGHTS; +} + +void SurfaceTool::set_skin_weight_count(SkinWeightCount p_weights) { + ERR_FAIL_COND(begun); + skin_weights = p_weights; +} +SurfaceTool::SkinWeightCount SurfaceTool::get_skin_weight_count() const { + return skin_weights; +} + +void SurfaceTool::set_custom_format(int p_index, CustomFormat p_format) { + ERR_FAIL_INDEX(p_index, RS::ARRAY_CUSTOM_COUNT); + ERR_FAIL_COND(begun); + last_custom_format[p_index] = p_format; +} +SurfaceTool::CustomFormat SurfaceTool::get_custom_format(int p_index) const { + ERR_FAIL_INDEX_V(p_index, RS::ARRAY_CUSTOM_COUNT, CUSTOM_MAX); + return last_custom_format[p_index]; +} +void SurfaceTool::optimize_indices_for_cache() { + ERR_FAIL_COND(optimize_vertex_cache_func == nullptr); + ERR_FAIL_COND(index_array.size() == 0); + + LocalVector old_index_array = index_array; + zeromem(index_array.ptr(), index_array.size() * sizeof(int)); + optimize_vertex_cache_func((unsigned int *)index_array.ptr(), (unsigned int *)old_index_array.ptr(), old_index_array.size(), vertex_array.size()); +} + +float SurfaceTool::get_max_axis_length() const { + ERR_FAIL_COND_V(vertex_array.size() == 0, 0); + + AABB aabb; + for (uint32_t i = 0; i < vertex_array.size(); i++) { + if (i == 0) { + aabb.position = vertex_array[i].vertex; + } else { + aabb.expand_to(vertex_array[i].vertex); + } + } + + return aabb.get_longest_axis_size(); +} +Vector<int> SurfaceTool::generate_lod(float p_threshold, int p_target_index_count) { + Vector<int> lod; + + ERR_FAIL_COND_V(simplify_func == nullptr, lod); + ERR_FAIL_COND_V(vertex_array.size() == 0, lod); + ERR_FAIL_COND_V(index_array.size() == 0, lod); + + lod.resize(index_array.size()); + LocalVector<float> vertices; //uses floats + vertices.resize(vertex_array.size() * 3); + for (uint32_t i = 0; i < vertex_array.size(); i++) { + vertices[i * 3 + 0] = vertex_array[i].vertex.x; + vertices[i * 3 + 1] = vertex_array[i].vertex.y; + vertices[i * 3 + 2] = vertex_array[i].vertex.z; + } + + float error; + uint32_t index_count = simplify_func((unsigned int *)lod.ptrw(), (unsigned int *)index_array.ptr(), index_array.size(), vertices.ptr(), vertex_array.size(), sizeof(float) * 3, p_target_index_count, p_threshold, &error); + ERR_FAIL_COND_V(index_count == 0, lod); + lod.resize(index_count); + + return lod; } void SurfaceTool::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_skin_weight_count", "count"), &SurfaceTool::set_skin_weight_count); + ClassDB::bind_method(D_METHOD("get_skin_weight_count"), &SurfaceTool::get_skin_weight_count); + + ClassDB::bind_method(D_METHOD("set_custom_format", "index", "format"), &SurfaceTool::set_custom_format); + ClassDB::bind_method(D_METHOD("get_custom_format", "index"), &SurfaceTool::get_custom_format); + ClassDB::bind_method(D_METHOD("begin", "primitive"), &SurfaceTool::begin); ClassDB::bind_method(D_METHOD("add_vertex", "vertex"), &SurfaceTool::add_vertex); - ClassDB::bind_method(D_METHOD("add_color", "color"), &SurfaceTool::add_color); - ClassDB::bind_method(D_METHOD("add_normal", "normal"), &SurfaceTool::add_normal); - ClassDB::bind_method(D_METHOD("add_tangent", "tangent"), &SurfaceTool::add_tangent); - ClassDB::bind_method(D_METHOD("add_uv", "uv"), &SurfaceTool::add_uv); - ClassDB::bind_method(D_METHOD("add_uv2", "uv2"), &SurfaceTool::add_uv2); - ClassDB::bind_method(D_METHOD("add_bones", "bones"), &SurfaceTool::add_bones); - ClassDB::bind_method(D_METHOD("add_weights", "weights"), &SurfaceTool::add_weights); - ClassDB::bind_method(D_METHOD("add_smooth_group", "smooth"), &SurfaceTool::add_smooth_group); + ClassDB::bind_method(D_METHOD("set_color", "color"), &SurfaceTool::set_color); + ClassDB::bind_method(D_METHOD("set_normal", "normal"), &SurfaceTool::set_normal); + ClassDB::bind_method(D_METHOD("set_tangent", "tangent"), &SurfaceTool::set_tangent); + ClassDB::bind_method(D_METHOD("set_uv", "uv"), &SurfaceTool::set_uv); + ClassDB::bind_method(D_METHOD("set_uv2", "uv2"), &SurfaceTool::set_uv2); + ClassDB::bind_method(D_METHOD("set_bones", "bones"), &SurfaceTool::set_bones); + ClassDB::bind_method(D_METHOD("set_weights", "weights"), &SurfaceTool::set_weights); + ClassDB::bind_method(D_METHOD("set_custom", "index", "custom"), &SurfaceTool::set_custom); + ClassDB::bind_method(D_METHOD("set_smooth_group", "index"), &SurfaceTool::set_smooth_group); ClassDB::bind_method(D_METHOD("add_triangle_fan", "vertices", "uvs", "colors", "uv2s", "normals", "tangents"), &SurfaceTool::add_triangle_fan, DEFVAL(Vector<Vector2>()), DEFVAL(Vector<Color>()), DEFVAL(Vector<Vector2>()), DEFVAL(Vector<Vector3>()), DEFVAL(Vector<Plane>())); @@ -1001,6 +1165,11 @@ void SurfaceTool::_bind_methods() { ClassDB::bind_method(D_METHOD("generate_normals", "flip"), &SurfaceTool::generate_normals, DEFVAL(false)); ClassDB::bind_method(D_METHOD("generate_tangents"), &SurfaceTool::generate_tangents); + ClassDB::bind_method(D_METHOD("optimize_indices_for_cache"), &SurfaceTool::optimize_indices_for_cache); + + ClassDB::bind_method(D_METHOD("get_max_axis_length"), &SurfaceTool::get_max_axis_length); + ClassDB::bind_method(D_METHOD("generate_lod", "nd_threshold", "target_index_count"), &SurfaceTool::generate_lod, DEFVAL(3)); + ClassDB::bind_method(D_METHOD("set_material", "material"), &SurfaceTool::set_material); ClassDB::bind_method(D_METHOD("clear"), &SurfaceTool::clear); @@ -1008,13 +1177,29 @@ void SurfaceTool::_bind_methods() { ClassDB::bind_method(D_METHOD("create_from", "existing", "surface"), &SurfaceTool::create_from); ClassDB::bind_method(D_METHOD("create_from_blend_shape", "existing", "surface", "blend_shape"), &SurfaceTool::create_from_blend_shape); ClassDB::bind_method(D_METHOD("append_from", "existing", "surface", "transform"), &SurfaceTool::append_from); - ClassDB::bind_method(D_METHOD("commit", "existing", "flags"), &SurfaceTool::commit, DEFVAL(Variant()), DEFVAL(Mesh::ARRAY_COMPRESS_DEFAULT)); + ClassDB::bind_method(D_METHOD("commit", "existing", "flags"), &SurfaceTool::commit, DEFVAL(Variant()), DEFVAL(0)); ClassDB::bind_method(D_METHOD("commit_to_arrays"), &SurfaceTool::commit_to_arrays); + + BIND_ENUM_CONSTANT(CUSTOM_RGBA8_UNORM); + BIND_ENUM_CONSTANT(CUSTOM_RGBA8_SNORM); + BIND_ENUM_CONSTANT(CUSTOM_RG_HALF); + BIND_ENUM_CONSTANT(CUSTOM_RGBA_HALF); + BIND_ENUM_CONSTANT(CUSTOM_R_FLOAT); + BIND_ENUM_CONSTANT(CUSTOM_RG_FLOAT); + BIND_ENUM_CONSTANT(CUSTOM_RGB_FLOAT); + BIND_ENUM_CONSTANT(CUSTOM_RGBA_FLOAT); + BIND_ENUM_CONSTANT(CUSTOM_MAX); + BIND_ENUM_CONSTANT(SKIN_4_WEIGHTS); + BIND_ENUM_CONSTANT(SKIN_8_WEIGHTS); } SurfaceTool::SurfaceTool() { first = false; begun = false; + for (int i = 0; i < RS::ARRAY_CUSTOM_COUNT; i++) { + last_custom_format[i] = CUSTOM_MAX; + } primitive = Mesh::PRIMITIVE_LINES; + skin_weights = SKIN_4_WEIGHTS; format = 0; } diff --git a/scene/resources/surface_tool.h b/scene/resources/surface_tool.h index d7b255e695..0e60bfe389 100644 --- a/scene/resources/surface_tool.h +++ b/scene/resources/surface_tool.h @@ -31,8 +31,8 @@ #ifndef SURFACE_TOOL_H #define SURFACE_TOOL_H +#include "core/templates/local_vector.h" #include "scene/resources/mesh.h" - #include "thirdparty/misc/mikktspace.h" class SurfaceTool : public Reference { @@ -49,12 +49,36 @@ public: Vector2 uv2; Vector<int> bones; Vector<float> weights; + Color custom[RS::ARRAY_CUSTOM_COUNT]; + uint32_t smooth_group = 0; bool operator==(const Vertex &p_vertex) const; Vertex() {} }; + enum CustomFormat { + CUSTOM_RGBA8_UNORM = RS::ARRAY_CUSTOM_RGBA8_UNORM, + CUSTOM_RGBA8_SNORM = RS::ARRAY_CUSTOM_RGBA8_SNORM, + CUSTOM_RG_HALF = RS::ARRAY_CUSTOM_RG_HALF, + CUSTOM_RGBA_HALF = RS::ARRAY_CUSTOM_RGBA_HALF, + CUSTOM_R_FLOAT = RS::ARRAY_CUSTOM_R_FLOAT, + CUSTOM_RG_FLOAT = RS::ARRAY_CUSTOM_RG_FLOAT, + CUSTOM_RGB_FLOAT = RS::ARRAY_CUSTOM_RGB_FLOAT, + CUSTOM_RGBA_FLOAT = RS::ARRAY_CUSTOM_RGBA_FLOAT, + CUSTOM_MAX = RS::ARRAY_CUSTOM_MAX + }; + + enum SkinWeightCount { + SKIN_4_WEIGHTS, + SKIN_8_WEIGHTS + }; + + typedef void (*OptimizeVertexCacheFunc)(unsigned int *destination, const unsigned int *indices, size_t index_count, size_t vertex_count); + static OptimizeVertexCacheFunc optimize_vertex_cache_func; + typedef size_t (*SimplifyFunc)(unsigned int *destination, const unsigned int *indices, size_t index_count, const float *vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float *r_error); + static SimplifyFunc simplify_func; + private: struct VertexHasher { static _FORCE_INLINE_ uint32_t hash(const Vertex &p_vtx); @@ -71,12 +95,11 @@ private: bool begun; bool first; Mesh::PrimitiveType primitive; - int format; + uint32_t format; Ref<Material> material; //arrays - List<Vertex> vertex_array; - List<int> index_array; - Map<int, bool> smooth_groups; + LocalVector<Vertex> vertex_array; + LocalVector<int> index_array; //memory Color last_color; @@ -86,9 +109,16 @@ private: Vector<int> last_bones; Vector<float> last_weights; Plane last_tangent; + uint32_t last_smooth_group = 0; + + SkinWeightCount skin_weights; - void _create_list_from_arrays(Array arr, List<Vertex> *r_vertex, List<int> *r_index, int &lformat); - void _create_list(const Ref<Mesh> &p_existing, int p_surface, List<Vertex> *r_vertex, List<int> *r_index, int &lformat); + Color last_custom[RS::ARRAY_CUSTOM_COUNT]; + + CustomFormat last_custom_format[RS::ARRAY_CUSTOM_COUNT]; + + void _create_list_from_arrays(Array arr, LocalVector<Vertex> *r_vertex, LocalVector<int> *r_index, uint32_t &lformat); + void _create_list(const Ref<Mesh> &p_existing, int p_surface, LocalVector<Vertex> *r_vertex, LocalVector<int> *r_index, uint32_t &lformat); //mikktspace callbacks static int mikktGetNumFaces(const SMikkTSpaceContext *pContext); @@ -103,17 +133,25 @@ protected: static void _bind_methods(); public: + void set_skin_weight_count(SkinWeightCount p_weights); + SkinWeightCount get_skin_weight_count() const; + + void set_custom_format(int p_index, CustomFormat p_format); + CustomFormat get_custom_format(int p_index) const; + void begin(Mesh::PrimitiveType p_primitive); + void set_color(Color p_color); + void set_normal(const Vector3 &p_normal); + void set_tangent(const Plane &p_tangent); + void set_uv(const Vector2 &p_uv); + void set_uv2(const Vector2 &p_uv2); + void set_custom(int p_index, const Color &p_custom); + void set_bones(const Vector<int> &p_bones); + void set_weights(const Vector<float> &p_weights); + void set_smooth_group(uint32_t p_group); + void add_vertex(const Vector3 &p_vertex); - void add_color(Color p_color); - void add_normal(const Vector3 &p_normal); - void add_tangent(const Plane &p_tangent); - void add_uv(const Vector2 &p_uv); - void add_uv2(const Vector2 &p_uv2); - void add_bones(const Vector<int> &p_bones); - void add_weights(const Vector<float> &p_weights); - void add_smooth_group(bool p_smooth); void add_triangle_fan(const Vector<Vector3> &p_vertices, const Vector<Vector2> &p_uvs = Vector<Vector2>(), const Vector<Color> &p_colors = Vector<Color>(), const Vector<Vector2> &p_uv2s = Vector<Vector2>(), const Vector<Vector3> &p_normals = Vector<Vector3>(), const Vector<Plane> &p_tangents = Vector<Plane>()); @@ -124,21 +162,28 @@ public: void generate_normals(bool p_flip = false); void generate_tangents(); + void optimize_indices_for_cache(); + float get_max_axis_length() const; + Vector<int> generate_lod(float p_threshold, int p_target_index_count = 3); + void set_material(const Ref<Material> &p_material); void clear(); - List<Vertex> &get_vertex_array() { return vertex_array; } + LocalVector<Vertex> &get_vertex_array() { return vertex_array; } void create_from_triangle_arrays(const Array &p_arrays); - static Vector<Vertex> create_vertex_array_from_triangle_arrays(const Array &p_arrays); + static void create_vertex_array_from_triangle_arrays(const Array &p_arrays, LocalVector<Vertex> &ret, uint32_t *r_format = nullptr); Array commit_to_arrays(); void create_from(const Ref<Mesh> &p_existing, int p_surface); void create_from_blend_shape(const Ref<Mesh> &p_existing, int p_surface, const String &p_blend_shape_name); void append_from(const Ref<Mesh> &p_existing, int p_surface, const Transform &p_xform); - Ref<ArrayMesh> commit(const Ref<ArrayMesh> &p_existing = Ref<ArrayMesh>(), uint32_t p_flags = Mesh::ARRAY_COMPRESS_DEFAULT); + Ref<ArrayMesh> commit(const Ref<ArrayMesh> &p_existing = Ref<ArrayMesh>(), uint32_t p_flags = 0); SurfaceTool(); }; +VARIANT_ENUM_CAST(SurfaceTool::CustomFormat) +VARIANT_ENUM_CAST(SurfaceTool::SkinWeightCount) + #endif diff --git a/scene/resources/syntax_highlighter.cpp b/scene/resources/syntax_highlighter.cpp index 5d58e71fc5..e3e4373fa9 100644 --- a/scene/resources/syntax_highlighter.cpp +++ b/scene/resources/syntax_highlighter.cpp @@ -30,7 +30,7 @@ #include "syntax_highlighter.h" -#include "core/script_language.h" +#include "core/object/script_language.h" #include "scene/gui/text_edit.h" Dictionary SyntaxHighlighter::get_line_syntax_highlighting(int p_line) { @@ -149,6 +149,13 @@ Dictionary CodeHighlighter::_get_line_syntax_highlighting(int p_line) { color_region_cache[p_line] = -1; int in_region = -1; if (p_line != 0) { + int prev_region_line = p_line - 1; + while (prev_region_line > 0 && !color_region_cache.has(prev_region_line)) { + prev_region_line--; + } + for (int i = prev_region_line; i < p_line - 1; i++) { + get_line_syntax_highlighting(i); + } if (!color_region_cache.has(p_line - 1)) { get_line_syntax_highlighting(p_line - 1); } diff --git a/scene/resources/syntax_highlighter.h b/scene/resources/syntax_highlighter.h index 720227a256..62865920d3 100644 --- a/scene/resources/syntax_highlighter.h +++ b/scene/resources/syntax_highlighter.h @@ -31,7 +31,7 @@ #ifndef SYNTAX_HIGHLIGHTER_H #define SYNTAX_HIGHLIGHTER_H -#include "core/resource.h" +#include "core/io/resource.h" class TextEdit; diff --git a/scene/resources/text_line.cpp b/scene/resources/text_line.cpp new file mode 100644 index 0000000000..cc9b6758b6 --- /dev/null +++ b/scene/resources/text_line.cpp @@ -0,0 +1,369 @@ +/*************************************************************************/ +/* text_line.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "text_line.h" + +void TextLine::_bind_methods() { + ClassDB::bind_method(D_METHOD("clear"), &TextLine::clear); + + ClassDB::bind_method(D_METHOD("set_direction", "direction"), &TextLine::set_direction); + ClassDB::bind_method(D_METHOD("get_direction"), &TextLine::get_direction); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "direction", PROPERTY_HINT_ENUM, "Auto,Light-to-right,Right-to-left"), "set_direction", "get_direction"); + + ClassDB::bind_method(D_METHOD("set_orientation", "orientation"), &TextLine::set_orientation); + ClassDB::bind_method(D_METHOD("get_orientation"), &TextLine::get_orientation); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "orientation", PROPERTY_HINT_ENUM, "Horizontal,Orientation"), "set_orientation", "get_orientation"); + + ClassDB::bind_method(D_METHOD("set_preserve_invalid", "enabled"), &TextLine::set_preserve_invalid); + ClassDB::bind_method(D_METHOD("get_preserve_invalid"), &TextLine::get_preserve_invalid); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "preserve_invalid"), "set_preserve_invalid", "get_preserve_invalid"); + + ClassDB::bind_method(D_METHOD("set_preserve_control", "enabled"), &TextLine::set_preserve_control); + ClassDB::bind_method(D_METHOD("get_preserve_control"), &TextLine::get_preserve_control); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "preserve_control"), "set_preserve_control", "get_preserve_control"); + + ClassDB::bind_method(D_METHOD("set_bidi_override", "override"), &TextLine::_set_bidi_override); + + ClassDB::bind_method(D_METHOD("add_string", "text", "fonts", "size", "opentype_features", "language"), &TextLine::add_string, DEFVAL(Dictionary()), DEFVAL("")); + ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextLine::add_object, DEFVAL(VALIGN_CENTER), DEFVAL(1)); + ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextLine::resize_object, DEFVAL(VALIGN_CENTER)); + + ClassDB::bind_method(D_METHOD("set_width", "width"), &TextLine::set_width); + ClassDB::bind_method(D_METHOD("get_width"), &TextLine::get_width); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "width"), "set_width", "get_width"); + + ClassDB::bind_method(D_METHOD("set_align", "align"), &TextLine::set_align); + ClassDB::bind_method(D_METHOD("get_align"), &TextLine::get_align); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + + ClassDB::bind_method(D_METHOD("tab_align", "tab_stops"), &TextLine::tab_align); + + ClassDB::bind_method(D_METHOD("set_flags", "flags"), &TextLine::set_flags); + ClassDB::bind_method(D_METHOD("get_flags"), &TextLine::get_flags); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "flags", PROPERTY_HINT_FLAGS, "Kashida justification,Word justification,Trim edge spaces after justification,Justification only after last tab"), "set_flags", "get_flags"); + + ClassDB::bind_method(D_METHOD("get_objects"), &TextLine::get_objects); + ClassDB::bind_method(D_METHOD("get_object_rect", "key"), &TextLine::get_object_rect); + + ClassDB::bind_method(D_METHOD("get_size"), &TextLine::get_size); + + ClassDB::bind_method(D_METHOD("get_rid"), &TextLine::get_rid); + + ClassDB::bind_method(D_METHOD("get_line_ascent"), &TextLine::get_line_ascent); + ClassDB::bind_method(D_METHOD("get_line_descent"), &TextLine::get_line_descent); + ClassDB::bind_method(D_METHOD("get_line_width"), &TextLine::get_line_width); + ClassDB::bind_method(D_METHOD("get_line_underline_position"), &TextLine::get_line_underline_position); + ClassDB::bind_method(D_METHOD("get_line_underline_thickness"), &TextLine::get_line_underline_thickness); + + ClassDB::bind_method(D_METHOD("draw", "canvas", "pos", "color"), &TextLine::draw, DEFVAL(Color(1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_outline", "canvas", "pos", "outline_size", "color"), &TextLine::draw_outline, DEFVAL(1), DEFVAL(Color(1, 1, 1))); + + ClassDB::bind_method(D_METHOD("hit_test", "coords"), &TextLine::hit_test); +} + +void TextLine::_shape() { + if (dirty) { + if (!tab_stops.empty()) { + TS->shaped_text_tab_align(rid, tab_stops); + } + if (align == HALIGN_FILL) { + TS->shaped_text_fit_to_width(rid, width, flags); + } + dirty = false; + } +} + +RID TextLine::get_rid() const { + return rid; +} + +void TextLine::clear() { + TS->shaped_text_clear(rid); + spacing_top = 0; + spacing_bottom = 0; +} + +void TextLine::set_preserve_invalid(bool p_enabled) { + TS->shaped_text_set_preserve_invalid(rid, p_enabled); + dirty = true; +} + +bool TextLine::get_preserve_invalid() const { + return TS->shaped_text_get_preserve_invalid(rid); +} + +void TextLine::set_preserve_control(bool p_enabled) { + TS->shaped_text_set_preserve_control(rid, p_enabled); + dirty = true; +} + +bool TextLine::get_preserve_control() const { + return TS->shaped_text_get_preserve_control(rid); +} + +void TextLine::set_direction(TextServer::Direction p_direction) { + TS->shaped_text_set_direction(rid, p_direction); + dirty = true; +} + +TextServer::Direction TextLine::get_direction() const { + return TS->shaped_text_get_direction(rid); +} + +void TextLine::set_orientation(TextServer::Orientation p_orientation) { + TS->shaped_text_set_orientation(rid, p_orientation); + dirty = true; +} + +TextServer::Orientation TextLine::get_orientation() const { + return TS->shaped_text_get_orientation(rid); +} + +void TextLine::_set_bidi_override(const Array &p_override) { + Vector<Vector2i> overrides; + for (int i = 0; i < p_override.size(); i++) { + overrides.push_back(p_override[i]); + } + set_bidi_override(overrides); +} + +void TextLine::set_bidi_override(const Vector<Vector2i> &p_override) { + TS->shaped_text_set_bidi_override(rid, p_override); + dirty = true; +} + +bool TextLine::add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features, const String &p_language) { + bool res = TS->shaped_text_add_string(rid, p_text, p_fonts->get_rids(), p_size, p_opentype_features, p_language); + spacing_top = p_fonts->get_spacing(Font::SPACING_TOP); + spacing_bottom = p_fonts->get_spacing(Font::SPACING_BOTTOM); + dirty = true; + return res; +} + +bool TextLine::add_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align, int p_length) { + bool res = TS->shaped_text_add_object(rid, p_key, p_size, p_inline_align, p_length); + dirty = true; + return res; +} + +bool TextLine::resize_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align) { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_resize_object(rid, p_key, p_size, p_inline_align); +} + +Array TextLine::get_objects() const { + return TS->shaped_text_get_objects(rid); +} + +Rect2 TextLine::get_object_rect(Variant p_key) const { + return TS->shaped_text_get_object_rect(rid, p_key); +} + +void TextLine::set_align(HAlign p_align) { + if (align != p_align) { + if (align == HALIGN_FILL || p_align == HALIGN_FILL) { + align = p_align; + dirty = true; + } else { + align = p_align; + } + } +} + +HAlign TextLine::get_align() const { + return align; +} + +void TextLine::tab_align(const Vector<float> &p_tab_stops) { + tab_stops = p_tab_stops; + dirty = true; +} + +void TextLine::set_flags(uint8_t p_flags) { + if (flags != p_flags) { + flags = p_flags; + dirty = true; + } +} + +uint8_t TextLine::get_flags() const { + return flags; +} + +void TextLine::set_width(float p_width) { + width = p_width; + if (align == HALIGN_FILL) { + dirty = true; + } +} + +float TextLine::get_width() const { + return width; +} + +Size2 TextLine::get_size() const { + const_cast<TextLine *>(this)->_shape(); + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + return Size2(TS->shaped_text_get_size(rid).x, TS->shaped_text_get_size(rid).y + spacing_top + spacing_bottom); + } else { + return Size2(TS->shaped_text_get_size(rid).x + spacing_top + spacing_bottom, TS->shaped_text_get_size(rid).y); + } +} + +float TextLine::get_line_ascent() const { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_get_ascent(rid) + spacing_top; +} + +float TextLine::get_line_descent() const { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_get_descent(rid) + spacing_bottom; +} + +float TextLine::get_line_width() const { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_get_width(rid); +} + +float TextLine::get_line_underline_position() const { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_get_underline_position(rid); +} + +float TextLine::get_line_underline_thickness() const { + const_cast<TextLine *>(this)->_shape(); + return TS->shaped_text_get_underline_thickness(rid); +} + +void TextLine::draw(RID p_canvas, const Vector2 &p_pos, const Color &p_color) const { + const_cast<TextLine *>(this)->_shape(); + + Vector2 ofs = p_pos; + + float length = TS->shaped_text_get_width(rid); + if (width > 0) { + switch (align) { + case HALIGN_FILL: + case HALIGN_LEFT: + break; + case HALIGN_CENTER: { + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += Math::floor((width - length) / 2.0); + } else { + ofs.y += Math::floor((width - length) / 2.0); + } + } break; + case HALIGN_RIGHT: { + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += width - length; + } else { + ofs.y += width - length; + } + } break; + } + } + + float clip_l; + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.y += TS->shaped_text_get_ascent(rid) + spacing_top; + clip_l = MAX(0, p_pos.x - ofs.x); + } else { + ofs.x += TS->shaped_text_get_ascent(rid) + spacing_top; + clip_l = MAX(0, p_pos.y - ofs.y); + } + return TS->shaped_text_draw(rid, p_canvas, ofs, clip_l, clip_l + width, p_color); +} + +void TextLine::draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outline_size, const Color &p_color) const { + const_cast<TextLine *>(this)->_shape(); + + Vector2 ofs = p_pos; + + float length = TS->shaped_text_get_width(rid); + if (width > 0) { + switch (align) { + case HALIGN_FILL: + case HALIGN_LEFT: + break; + case HALIGN_CENTER: { + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += Math::floor((width - length) / 2.0); + } else { + ofs.y += Math::floor((width - length) / 2.0); + } + } break; + case HALIGN_RIGHT: { + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += width - length; + } else { + ofs.y += width - length; + } + } break; + } + } + + float clip_l; + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.y += TS->shaped_text_get_ascent(rid) + spacing_top; + clip_l = MAX(0, p_pos.x - ofs.x); + } else { + ofs.x += TS->shaped_text_get_ascent(rid) + spacing_top; + clip_l = MAX(0, p_pos.y - ofs.y); + } + return TS->shaped_text_draw_outline(rid, p_canvas, ofs, clip_l, clip_l + width, p_outline_size, p_color); +} + +int TextLine::hit_test(float p_coords) const { + const_cast<TextLine *>(this)->_shape(); + + return TS->shaped_text_hit_test_position(rid, p_coords); +} + +TextLine::TextLine(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features, const String &p_language, TextServer::Direction p_direction, TextServer::Orientation p_orientation) { + rid = TS->create_shaped_text(p_direction, p_orientation); + spacing_top = p_fonts->get_spacing(Font::SPACING_TOP); + spacing_bottom = p_fonts->get_spacing(Font::SPACING_BOTTOM); + TS->shaped_text_add_string(rid, p_text, p_fonts->get_rids(), p_size, p_opentype_features, p_language); +} + +TextLine::TextLine() { + rid = TS->create_shaped_text(); +} + +TextLine::~TextLine() { + TS->free(rid); +} diff --git a/scene/resources/text_line.h b/scene/resources/text_line.h new file mode 100644 index 0000000000..6ed3558bd9 --- /dev/null +++ b/scene/resources/text_line.h @@ -0,0 +1,116 @@ +/*************************************************************************/ +/* text_line.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef TEXT_LINE_H +#define TEXT_LINE_H + +#include "scene/resources/font.h" +#include "servers/text_server.h" + +/*************************************************************************/ + +class TextLine : public Reference { + GDCLASS(TextLine, Reference); + + RID rid; + int spacing_top = 0; + int spacing_bottom = 0; + + bool dirty = true; + + float width = -1; + uint8_t flags = TextServer::JUSTIFICATION_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA; + HAlign align = HALIGN_LEFT; + + Vector<float> tab_stops; + +protected: + static void _bind_methods(); + + void _shape(); + +public: + RID get_rid() const; + + void clear(); + + void set_direction(TextServer::Direction p_direction); + TextServer::Direction get_direction() const; + + void set_bidi_override(const Vector<Vector2i> &p_override); + + void set_orientation(TextServer::Orientation p_orientation); + TextServer::Orientation get_orientation() const; + + void set_preserve_invalid(bool p_enabled); + bool get_preserve_invalid() const; + + void set_preserve_control(bool p_enabled); + bool get_preserve_control() const; + + bool add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = ""); + bool add_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align = VALIGN_CENTER, int p_length = 1); + bool resize_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align = VALIGN_CENTER); + + void set_align(HAlign p_align); + HAlign get_align() const; + + void tab_align(const Vector<float> &p_tab_stops); + + void set_flags(uint8_t p_flags); + uint8_t get_flags() const; + + void set_width(float p_width); + float get_width() const; + + Array get_objects() const; + Rect2 get_object_rect(Variant p_key) const; + + Size2 get_size() const; + + float get_line_ascent() const; + float get_line_descent() const; + float get_line_width() const; + float get_line_underline_position() const; + float get_line_underline_thickness() const; + + void draw(RID p_canvas, const Vector2 &p_pos, const Color &p_color = Color(1, 1, 1)) const; + void draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outline_size = 1, const Color &p_color = Color(1, 1, 1)) const; + + int hit_test(float p_coords) const; + + void _set_bidi_override(const Array &p_override); + + TextLine(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = "", TextServer::Direction p_direction = TextServer::DIRECTION_AUTO, TextServer::Orientation p_orientation = TextServer::ORIENTATION_HORIZONTAL); + TextLine(); + ~TextLine(); +}; + +#endif // TEXT_LINE_H diff --git a/scene/resources/text_paragraph.cpp b/scene/resources/text_paragraph.cpp new file mode 100644 index 0000000000..fd6dd071eb --- /dev/null +++ b/scene/resources/text_paragraph.cpp @@ -0,0 +1,532 @@ +/*************************************************************************/ +/* text_paragraph.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "scene/resources/text_paragraph.h" + +void TextParagraph::_bind_methods() { + ClassDB::bind_method(D_METHOD("clear"), &TextParagraph::clear); + + ClassDB::bind_method(D_METHOD("set_direction", "direction"), &TextParagraph::set_direction); + ClassDB::bind_method(D_METHOD("get_direction"), &TextParagraph::get_direction); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "direction", PROPERTY_HINT_ENUM, "Auto,Light-to-right,Right-to-left"), "set_direction", "get_direction"); + + ClassDB::bind_method(D_METHOD("set_orientation", "orientation"), &TextParagraph::set_orientation); + ClassDB::bind_method(D_METHOD("get_orientation"), &TextParagraph::get_orientation); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "orientation", PROPERTY_HINT_ENUM, "Horizontal,Orientation"), "set_orientation", "get_orientation"); + + ClassDB::bind_method(D_METHOD("set_preserve_invalid", "enabled"), &TextParagraph::set_preserve_invalid); + ClassDB::bind_method(D_METHOD("get_preserve_invalid"), &TextParagraph::get_preserve_invalid); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "preserve_invalid"), "set_preserve_invalid", "get_preserve_invalid"); + + ClassDB::bind_method(D_METHOD("set_preserve_control", "enabled"), &TextParagraph::set_preserve_control); + ClassDB::bind_method(D_METHOD("get_preserve_control"), &TextParagraph::get_preserve_control); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "preserve_control"), "set_preserve_control", "get_preserve_control"); + + ClassDB::bind_method(D_METHOD("set_bidi_override", "override"), &TextParagraph::_set_bidi_override); + + ClassDB::bind_method(D_METHOD("add_string", "text", "fonts", "size", "opentype_features", "language"), &TextParagraph::add_string, DEFVAL(Dictionary()), DEFVAL("")); + ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextParagraph::add_object, DEFVAL(VALIGN_CENTER), DEFVAL(1)); + ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextParagraph::resize_object, DEFVAL(VALIGN_CENTER)); + + ClassDB::bind_method(D_METHOD("set_align", "align"), &TextParagraph::set_align); + ClassDB::bind_method(D_METHOD("get_align"), &TextParagraph::get_align); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + + ClassDB::bind_method(D_METHOD("tab_align", "tab_stops"), &TextParagraph::tab_align); + + ClassDB::bind_method(D_METHOD("set_flags", "flags"), &TextParagraph::set_flags); + ClassDB::bind_method(D_METHOD("get_flags"), &TextParagraph::get_flags); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "flags", PROPERTY_HINT_FLAGS, "Kashida justification,Word justification,Trim edge spaces after justification,Justification only after last tab,Break mandatory,Break words,Break graphemes"), "set_flags", "get_flags"); + + ClassDB::bind_method(D_METHOD("set_width", "width"), &TextParagraph::set_width); + ClassDB::bind_method(D_METHOD("get_width"), &TextParagraph::get_width); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "width"), "set_width", "get_width"); + + ClassDB::bind_method(D_METHOD("get_non_wraped_size"), &TextParagraph::get_non_wraped_size); + ClassDB::bind_method(D_METHOD("get_size"), &TextParagraph::get_size); + + ClassDB::bind_method(D_METHOD("get_rid"), &TextParagraph::get_rid); + ClassDB::bind_method(D_METHOD("get_line_rid", "line"), &TextParagraph::get_line_rid); + + ClassDB::bind_method(D_METHOD("get_line_count"), &TextParagraph::get_line_count); + + ClassDB::bind_method(D_METHOD("get_line_objects", "line"), &TextParagraph::get_line_objects); + ClassDB::bind_method(D_METHOD("get_line_object_rect", "line", "key"), &TextParagraph::get_line_object_rect); + ClassDB::bind_method(D_METHOD("get_line_size", "line"), &TextParagraph::get_line_size); + ClassDB::bind_method(D_METHOD("get_line_range", "line"), &TextParagraph::get_line_range); + ClassDB::bind_method(D_METHOD("get_line_ascent", "line"), &TextParagraph::get_line_ascent); + ClassDB::bind_method(D_METHOD("get_line_descent", "line"), &TextParagraph::get_line_descent); + ClassDB::bind_method(D_METHOD("get_line_width", "line"), &TextParagraph::get_line_width); + ClassDB::bind_method(D_METHOD("get_line_underline_position", "line"), &TextParagraph::get_line_underline_position); + ClassDB::bind_method(D_METHOD("get_line_underline_thickness", "line"), &TextParagraph::get_line_underline_thickness); + + ClassDB::bind_method(D_METHOD("draw", "canvas", "pos", "color"), &TextParagraph::draw, DEFVAL(Color(1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_outline", "canvas", "outline_size", "color"), &TextParagraph::draw_outline, DEFVAL(1), DEFVAL(Color(1, 1, 1))); + + ClassDB::bind_method(D_METHOD("draw_line", "canvas", "pos", "line", "color"), &TextParagraph::draw_line, DEFVAL(Color(1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_line_outline", "canvas", "pos", "line", "outline_size", "color"), &TextParagraph::draw_line_outline, DEFVAL(1), DEFVAL(Color(1, 1, 1))); + + ClassDB::bind_method(D_METHOD("hit_test", "coords"), &TextParagraph::hit_test); +} + +void TextParagraph::_shape_lines() { + if (dirty_lines) { + for (int i = 0; i < lines.size(); i++) { + TS->free(lines[i]); + } + lines.clear(); + + if (!tab_stops.empty()) { + TS->shaped_text_tab_align(rid, tab_stops); + } + + Vector<Vector2i> line_breaks = TS->shaped_text_get_line_breaks(rid, width, 0, flags); + for (int i = 0; i < line_breaks.size(); i++) { + RID line = TS->shaped_text_substr(rid, line_breaks[i].x, line_breaks[i].y - line_breaks[i].x); + if (!tab_stops.empty()) { + TS->shaped_text_tab_align(line, tab_stops); + } + if (align == HALIGN_FILL && (line_breaks.size() == 1 || i < line_breaks.size() - 1)) { + TS->shaped_text_fit_to_width(line, width, flags); + } + lines.push_back(line); + } + dirty_lines = false; + } +} + +RID TextParagraph::get_rid() const { + return rid; +} + +RID TextParagraph::get_line_rid(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), RID()); + return lines[p_line]; +} + +void TextParagraph::clear() { + spacing_top = 0; + spacing_bottom = 0; + for (int i = 0; i < lines.size(); i++) { + TS->free(lines[i]); + } + lines.clear(); + TS->shaped_text_clear(rid); +} + +void TextParagraph::set_preserve_invalid(bool p_enabled) { + TS->shaped_text_set_preserve_invalid(rid, p_enabled); + dirty_lines = true; +} + +bool TextParagraph::get_preserve_invalid() const { + return TS->shaped_text_get_preserve_invalid(rid); +} + +void TextParagraph::set_preserve_control(bool p_enabled) { + TS->shaped_text_set_preserve_control(rid, p_enabled); + dirty_lines = true; +} + +bool TextParagraph::get_preserve_control() const { + return TS->shaped_text_get_preserve_control(rid); +} + +void TextParagraph::set_direction(TextServer::Direction p_direction) { + TS->shaped_text_set_direction(rid, p_direction); + dirty_lines = true; +} + +TextServer::Direction TextParagraph::get_direction() const { + const_cast<TextParagraph *>(this)->_shape_lines(); + return TS->shaped_text_get_direction(rid); +} + +void TextParagraph::set_orientation(TextServer::Orientation p_orientation) { + TS->shaped_text_set_orientation(rid, p_orientation); + dirty_lines = true; +} + +TextServer::Orientation TextParagraph::get_orientation() const { + const_cast<TextParagraph *>(this)->_shape_lines(); + return TS->shaped_text_get_orientation(rid); +} + +bool TextParagraph::add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features, const String &p_language) { + bool res = TS->shaped_text_add_string(rid, p_text, p_fonts->get_rids(), p_size, p_opentype_features, p_language); + spacing_top = p_fonts->get_spacing(Font::SPACING_TOP); + spacing_bottom = p_fonts->get_spacing(Font::SPACING_BOTTOM); + dirty_lines = true; + return res; +} + +void TextParagraph::_set_bidi_override(const Array &p_override) { + Vector<Vector2i> overrides; + for (int i = 0; i < p_override.size(); i++) { + overrides.push_back(p_override[i]); + } + set_bidi_override(overrides); +} + +void TextParagraph::set_bidi_override(const Vector<Vector2i> &p_override) { + TS->shaped_text_set_bidi_override(rid, p_override); + dirty_lines = true; +} + +bool TextParagraph::add_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align, int p_length) { + bool res = TS->shaped_text_add_object(rid, p_key, p_size, p_inline_align, p_length); + dirty_lines = true; + return res; +} + +bool TextParagraph::resize_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align) { + bool res = TS->shaped_text_resize_object(rid, p_key, p_size, p_inline_align); + dirty_lines = true; + return res; +} + +void TextParagraph::set_align(HAlign p_align) { + if (align != p_align) { + if (align == HALIGN_FILL || p_align == HALIGN_FILL) { + align = p_align; + dirty_lines = true; + } else { + align = p_align; + } + } +} + +HAlign TextParagraph::get_align() const { + return align; +} + +void TextParagraph::tab_align(const Vector<float> &p_tab_stops) { + tab_stops = p_tab_stops; + dirty_lines = true; +} + +void TextParagraph::set_flags(uint8_t p_flags) { + if (flags != p_flags) { + flags = p_flags; + dirty_lines = true; + } +} + +uint8_t TextParagraph::get_flags() const { + return flags; +} + +void TextParagraph::set_width(float p_width) { + if (width != p_width) { + width = p_width; + dirty_lines = true; + } +} + +float TextParagraph::get_width() const { + return width; +} + +Size2 TextParagraph::get_non_wraped_size() const { + const_cast<TextParagraph *>(this)->_shape_lines(); + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + return Size2(TS->shaped_text_get_size(rid).x, TS->shaped_text_get_size(rid).y + spacing_top + spacing_bottom); + } else { + return Size2(TS->shaped_text_get_size(rid).x + spacing_top + spacing_bottom, TS->shaped_text_get_size(rid).y); + } +} + +Size2 TextParagraph::get_size() const { + const_cast<TextParagraph *>(this)->_shape_lines(); + Size2 size; + for (int i = 0; i < lines.size(); i++) { + Size2 lsize = TS->shaped_text_get_size(lines[i]); + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + size.x = MAX(size.x, lsize.x); + size.y += lsize.y + spacing_top + spacing_bottom; + } else { + size.x += lsize.x + spacing_top + spacing_bottom; + size.y = MAX(size.y, lsize.y); + } + } + return size; +} + +int TextParagraph::get_line_count() const { + const_cast<TextParagraph *>(this)->_shape_lines(); + return lines.size(); +} + +Array TextParagraph::get_line_objects(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), Array()); + return TS->shaped_text_get_objects(lines[p_line]); +} + +Rect2 TextParagraph::get_line_object_rect(int p_line, Variant p_key) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), Rect2()); + Rect2 xrect = TS->shaped_text_get_object_rect(lines[p_line], p_key); + for (int i = 0; i < p_line; i++) { + Size2 lsize = TS->shaped_text_get_size(lines[i]); + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + xrect.position.y += lsize.y + spacing_top + spacing_bottom; + } else { + xrect.position.x += lsize.x + spacing_top + spacing_bottom; + } + } + return xrect; +} + +Size2 TextParagraph::get_line_size(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), Size2()); + if (TS->shaped_text_get_orientation(lines[p_line]) == TextServer::ORIENTATION_HORIZONTAL) { + return Size2(TS->shaped_text_get_size(lines[p_line]).x, TS->shaped_text_get_size(lines[p_line]).y + spacing_top + spacing_bottom); + } else { + return Size2(TS->shaped_text_get_size(lines[p_line]).x + spacing_top + spacing_bottom, TS->shaped_text_get_size(lines[p_line]).y); + } +} + +Vector2i TextParagraph::get_line_range(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), Vector2i()); + return TS->shaped_text_get_range(lines[p_line]); +} + +float TextParagraph::get_line_ascent(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), 0.f); + return TS->shaped_text_get_ascent(lines[p_line]) + spacing_top; +} + +float TextParagraph::get_line_descent(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), 0.f); + return TS->shaped_text_get_descent(lines[p_line]) + spacing_bottom; +} + +float TextParagraph::get_line_width(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), 0.f); + return TS->shaped_text_get_width(lines[p_line]); +} + +float TextParagraph::get_line_underline_position(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), 0.f); + return TS->shaped_text_get_underline_position(lines[p_line]); +} + +float TextParagraph::get_line_underline_thickness(int p_line) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND_V(p_line < 0 || p_line >= lines.size(), 0.f); + return TS->shaped_text_get_underline_thickness(lines[p_line]); +} + +void TextParagraph::draw(RID p_canvas, const Vector2 &p_pos, const Color &p_color) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + Vector2 ofs = p_pos; + for (int i = 0; i < lines.size(); i++) { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x = p_pos.x; + ofs.y += TS->shaped_text_get_ascent(lines[i]) + spacing_top; + } else { + ofs.y = p_pos.y; + ofs.x += TS->shaped_text_get_ascent(lines[i]) + spacing_top; + } + float length = TS->shaped_text_get_width(lines[i]); + if (width > 0) { + switch (align) { + case HALIGN_FILL: + case HALIGN_LEFT: + break; + case HALIGN_CENTER: { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += Math::floor((width - length) / 2.0); + } else { + ofs.y += Math::floor((width - length) / 2.0); + } + } break; + case HALIGN_RIGHT: { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += width - length; + } else { + ofs.y += width - length; + } + } break; + } + } + float clip_l; + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + clip_l = MAX(0, p_pos.x - ofs.x); + } else { + clip_l = MAX(0, p_pos.y - ofs.y); + } + TS->shaped_text_draw(lines[i], p_canvas, ofs, clip_l, clip_l + width, p_color); + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x = p_pos.x; + ofs.y += TS->shaped_text_get_descent(lines[i]) + spacing_bottom; + } else { + ofs.y = p_pos.y; + ofs.x += TS->shaped_text_get_descent(lines[i]) + spacing_bottom; + } + } +} + +void TextParagraph::draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outline_size, const Color &p_color) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + Vector2 ofs = p_pos; + for (int i = 0; i < lines.size(); i++) { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x = p_pos.x; + ofs.y += TS->shaped_text_get_ascent(lines[i]) + spacing_top; + } else { + ofs.y = p_pos.y; + ofs.x += TS->shaped_text_get_ascent(lines[i]) + spacing_top; + } + float length = TS->shaped_text_get_width(lines[i]); + if (width > 0) { + switch (align) { + case HALIGN_FILL: + case HALIGN_LEFT: + break; + case HALIGN_CENTER: { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += Math::floor((width - length) / 2.0); + } else { + ofs.y += Math::floor((width - length) / 2.0); + } + } break; + case HALIGN_RIGHT: { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x += width - length; + } else { + ofs.y += width - length; + } + } break; + } + } + float clip_l; + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + clip_l = MAX(0, p_pos.x - ofs.x); + } else { + clip_l = MAX(0, p_pos.y - ofs.y); + } + TS->shaped_text_draw_outline(lines[i], p_canvas, ofs, clip_l, clip_l + width, p_outline_size, p_color); + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.x = p_pos.x; + ofs.y += TS->shaped_text_get_descent(lines[i]) + spacing_bottom; + } else { + ofs.y = p_pos.y; + ofs.x += TS->shaped_text_get_descent(lines[i]) + spacing_bottom; + } + } +} + +int TextParagraph::hit_test(const Point2 &p_coords) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + Vector2 ofs; + if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { + if (ofs.y < 0) + return 0; + } else { + if (ofs.x < 0) + return 0; + } + for (int i = 0; i < lines.size(); i++) { + if (TS->shaped_text_get_orientation(lines[i]) == TextServer::ORIENTATION_HORIZONTAL) { + if ((p_coords.y >= ofs.y) && (p_coords.y <= ofs.y + TS->shaped_text_get_size(lines[i]).y)) { + return TS->shaped_text_hit_test_position(lines[i], p_coords.x); + } + ofs.y += TS->shaped_text_get_size(lines[i]).y + spacing_bottom + spacing_top; + } else { + if ((p_coords.x >= ofs.x) && (p_coords.x <= ofs.x + TS->shaped_text_get_size(lines[i]).x)) { + return TS->shaped_text_hit_test_position(lines[i], p_coords.y); + } + ofs.y += TS->shaped_text_get_size(lines[i]).x + spacing_bottom + spacing_top; + } + } + return TS->shaped_text_get_range(rid).y; +} + +void TextParagraph::draw_line(RID p_canvas, const Vector2 &p_pos, int p_line, const Color &p_color) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND(p_line < 0 || p_line >= lines.size()); + + Vector2 ofs = p_pos; + if (TS->shaped_text_get_orientation(lines[p_line]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.y += TS->shaped_text_get_ascent(lines[p_line]) + spacing_top; + } else { + ofs.x += TS->shaped_text_get_ascent(lines[p_line]) + spacing_top; + } + return TS->shaped_text_draw(lines[p_line], p_canvas, ofs, -1, -1, p_color); +} + +void TextParagraph::draw_line_outline(RID p_canvas, const Vector2 &p_pos, int p_line, int p_outline_size, const Color &p_color) const { + const_cast<TextParagraph *>(this)->_shape_lines(); + ERR_FAIL_COND(p_line < 0 || p_line >= lines.size()); + + Vector2 ofs = p_pos; + if (TS->shaped_text_get_orientation(lines[p_line]) == TextServer::ORIENTATION_HORIZONTAL) { + ofs.y += TS->shaped_text_get_ascent(lines[p_line]) + spacing_top; + } else { + ofs.x += TS->shaped_text_get_ascent(lines[p_line]) + spacing_top; + } + return TS->shaped_text_draw_outline(lines[p_line], p_canvas, ofs, -1, -1, p_outline_size, p_color); +} + +TextParagraph::TextParagraph(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features, const String &p_language, float p_width, TextServer::Direction p_direction, TextServer::Orientation p_orientation) { + rid = TS->create_shaped_text(p_direction, p_orientation); + TS->shaped_text_add_string(rid, p_text, p_fonts->get_rids(), p_size, p_opentype_features, p_language); + spacing_top = p_fonts->get_spacing(Font::SPACING_TOP); + spacing_bottom = p_fonts->get_spacing(Font::SPACING_BOTTOM); + width = p_width; +} + +TextParagraph::TextParagraph() { + rid = TS->create_shaped_text(); +} + +TextParagraph::~TextParagraph() { + for (int i = 0; i < lines.size(); i++) { + TS->free(lines[i]); + } + lines.clear(); + TS->free(rid); +} diff --git a/scene/resources/text_paragraph.h b/scene/resources/text_paragraph.h new file mode 100644 index 0000000000..f7f49e9058 --- /dev/null +++ b/scene/resources/text_paragraph.h @@ -0,0 +1,126 @@ +/*************************************************************************/ +/* text_paragraph.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef TEXT_PARAGRAPH_H +#define TEXT_PARAGRAPH_H + +#include "scene/resources/font.h" +#include "servers/text_server.h" + +/*************************************************************************/ + +class TextParagraph : public Reference { + GDCLASS(TextParagraph, Reference); + + RID rid; + Vector<RID> lines; + int spacing_top = 0; + int spacing_bottom = 0; + + bool dirty_lines = true; + + float width = -1; + uint8_t flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA; + HAlign align = HALIGN_LEFT; + + Vector<float> tab_stops; + +protected: + static void _bind_methods(); + + void _shape_lines(); + +public: + RID get_rid() const; + RID get_line_rid(int p_line) const; + + void clear(); + + void set_direction(TextServer::Direction p_direction); + TextServer::Direction get_direction() const; + + void set_orientation(TextServer::Orientation p_orientation); + TextServer::Orientation get_orientation() const; + + void set_preserve_invalid(bool p_enabled); + bool get_preserve_invalid() const; + + void set_preserve_control(bool p_enabled); + bool get_preserve_control() const; + + void set_bidi_override(const Vector<Vector2i> &p_override); + + bool add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = ""); + bool add_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align = VALIGN_CENTER, int p_length = 1); + bool resize_object(Variant p_key, const Size2 &p_size, VAlign p_inline_align = VALIGN_CENTER); + + void set_align(HAlign p_align); + HAlign get_align() const; + + void tab_align(const Vector<float> &p_tab_stops); + + void set_flags(uint8_t p_flags); + uint8_t get_flags() const; + + void set_width(float p_width); + float get_width() const; + + Size2 get_non_wraped_size() const; + + Size2 get_size() const; + + int get_line_count() const; + + Array get_line_objects(int p_line) const; + Rect2 get_line_object_rect(int p_line, Variant p_key) const; + Size2 get_line_size(int p_line) const; + float get_line_ascent(int p_line) const; + float get_line_descent(int p_line) const; + float get_line_width(int p_line) const; + Vector2i get_line_range(int p_line) const; + float get_line_underline_position(int p_line) const; + float get_line_underline_thickness(int p_line) const; + + void draw(RID p_canvas, const Vector2 &p_pos, const Color &p_color = Color(1, 1, 1)) const; + void draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outline_size = 1, const Color &p_color = Color(1, 1, 1)) const; + + void draw_line(RID p_canvas, const Vector2 &p_pos, int p_line, const Color &p_color = Color(1, 1, 1)) const; + void draw_line_outline(RID p_canvas, const Vector2 &p_pos, int p_line, int p_outline_size = 1, const Color &p_color = Color(1, 1, 1)) const; + + int hit_test(const Point2 &p_coords) const; + + void _set_bidi_override(const Array &p_override); + + TextParagraph(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = "", float p_width = -1.f, TextServer::Direction p_direction = TextServer::DIRECTION_AUTO, TextServer::Orientation p_orientation = TextServer::ORIENTATION_HORIZONTAL); + TextParagraph(); + ~TextParagraph(); +}; + +#endif // TEXT_PARAGRAPH_H diff --git a/scene/resources/texture.cpp b/scene/resources/texture.cpp index 39237e1a33..706b18d2b5 100644 --- a/scene/resources/texture.cpp +++ b/scene/resources/texture.cpp @@ -32,7 +32,6 @@ #include "core/core_string_names.h" #include "core/io/image_loader.h" -#include "core/method_bind_ext.gen.inc" #include "core/os/os.h" #include "mesh.h" #include "scene/resources/bit_map.h" @@ -46,28 +45,21 @@ bool Texture2D::is_pixel_opaque(int p_x, int p_y) const { return true; } -void Texture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, get_size()), get_rid(), false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); +void Texture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, get_size()), get_rid(), false, p_modulate, p_transpose); } -void Texture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, get_rid(), p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); +void Texture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, get_rid(), p_tile, p_modulate, p_transpose); } -void Texture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, get_rid(), p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); +void Texture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, get_rid(), p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool Texture2D::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { r_rect = p_rect; r_src_rect = p_src_rect; - return true; } @@ -76,9 +68,9 @@ void Texture2D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_height"), &Texture2D::get_height); ClassDB::bind_method(D_METHOD("get_size"), &Texture2D::get_size); ClassDB::bind_method(D_METHOD("has_alpha"), &Texture2D::has_alpha); - ClassDB::bind_method(D_METHOD("draw", "canvas_item", "position", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat"), &Texture2D::draw, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT)); - ClassDB::bind_method(D_METHOD("draw_rect", "canvas_item", "rect", "tile", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat"), &Texture2D::draw_rect, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT)); - ClassDB::bind_method(D_METHOD("draw_rect_region", "canvas_item", "rect", "src_rect", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat", "clip_uv"), &Texture2D::draw_rect_region, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT), DEFVAL(true)); + ClassDB::bind_method(D_METHOD("draw", "canvas_item", "position", "modulate", "transpose"), &Texture2D::draw, DEFVAL(Color(1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_rect", "canvas_item", "rect", "tile", "modulate", "transpose"), &Texture2D::draw_rect, DEFVAL(Color(1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_rect_region", "canvas_item", "rect", "src_rect", "modulate", "transpose", "clip_uv"), &Texture2D::draw_rect_region, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(true)); ClassDB::bind_method(D_METHOD("get_data"), &Texture2D::get_data); ADD_GROUP("", ""); @@ -159,7 +151,7 @@ void ImageTexture::_reload_hook(const RID &p_hook) { } void ImageTexture::create_from_image(const Ref<Image> &p_image) { - ERR_FAIL_COND(p_image.is_null()); + ERR_FAIL_COND_MSG(p_image.is_null(), "Invalid image"); w = p_image->get_width(); h = p_image->get_height(); format = p_image->get_format(); @@ -182,11 +174,14 @@ Image::Format ImageTexture::get_format() const { } void ImageTexture::update(const Ref<Image> &p_image, bool p_immediate) { - ERR_FAIL_COND(p_image.is_null()); - ERR_FAIL_COND(texture.is_null()); - ERR_FAIL_COND(p_image->get_width() != w || p_image->get_height() != h); - ERR_FAIL_COND(p_image->get_format() != format); - ERR_FAIL_COND(mipmaps != p_image->has_mipmaps()); + ERR_FAIL_COND_MSG(p_image.is_null(), "Invalid image"); + ERR_FAIL_COND_MSG(texture.is_null(), "Texture is not initialized."); + ERR_FAIL_COND_MSG(p_image->get_width() != w || p_image->get_height() != h, + "The new image dimensions must match the texture size."); + ERR_FAIL_COND_MSG(p_image->get_format() != format, + "The new image format must match the texture's image format."); + ERR_FAIL_COND_MSG(mipmaps != p_image->has_mipmaps(), + "The new image mipmaps configuration must match the texture's image mipmaps configuration"); if (p_immediate) { RenderingServer::get_singleton()->texture_2d_update_immediate(texture, p_image); @@ -233,31 +228,25 @@ bool ImageTexture::has_alpha() const { return (format == Image::FORMAT_LA8 || format == Image::FORMAT_RGBA8); } -void ImageTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void ImageTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose); } -void ImageTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void ImageTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose); } -void ImageTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void ImageTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool ImageTexture::is_pixel_opaque(int p_x, int p_y) const { @@ -512,7 +501,7 @@ Error StreamTexture2D::_load_data(const String &p_path, int &tw, int &th, int &t ERR_FAIL_COND_V(image.is_null(), ERR_INVALID_PARAMETER); FileAccess *f = FileAccess::open(p_path, FileAccess::READ); - ERR_FAIL_COND_V(!f, ERR_CANT_OPEN); + ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, vformat("Unable to open file: %s.", p_path)); uint8_t header[4]; f->get_buffer(header, 4); @@ -652,31 +641,25 @@ RID StreamTexture2D::get_rid() const { return texture; } -void StreamTexture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void StreamTexture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose); } -void StreamTexture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void StreamTexture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose); } -void StreamTexture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void StreamTexture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool StreamTexture2D::has_alpha() const { @@ -913,7 +896,7 @@ Image::Format StreamTexture3D::get_format() const { Error StreamTexture3D::_load_data(const String &p_path, Vector<Ref<Image>> &r_data, Image::Format &r_format, int &r_width, int &r_height, int &r_depth, bool &r_mipmaps) { FileAccessRef f = FileAccess::open(p_path, FileAccess::READ); - ERR_FAIL_COND_V(!f, ERR_CANT_OPEN); + ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, vformat("Unable to open file: %s.", p_path)); uint8_t header[4]; f->get_buffer(header, 4); @@ -1204,7 +1187,7 @@ void AtlasTexture::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "filter_clip"), "set_filter_clip", "has_filter_clip"); } -void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if (!atlas.is_valid()) { return; } @@ -1219,12 +1202,10 @@ void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_m rc.size.height = atlas->get_height(); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(p_pos + margin.position, rc.size), atlas->get_rid(), rc, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(p_pos + margin.position, rc.size), atlas->get_rid(), rc, p_modulate, p_transpose, filter_clip); } -void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if (!atlas.is_valid()) { return; } @@ -1242,12 +1223,10 @@ void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile Vector2 scale = p_rect.size / (region.size + margin.size); Rect2 dr(p_rect.position + margin.position * scale, rc.size * scale); - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), rc, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), rc, p_modulate, p_transpose, filter_clip); } -void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { //this might not necessarily work well if using a rect, needs to be fixed properly if (!atlas.is_valid()) { return; @@ -1257,9 +1236,7 @@ void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, cons Rect2 src_c; get_rect_region(p_rect, p_src_rect, dr, src_c); - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), src_c, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), src_c, p_modulate, p_transpose, filter_clip); } bool AtlasTexture::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { @@ -1276,7 +1253,7 @@ bool AtlasTexture::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Vector2 scale = p_rect.size / src.size; src.position += (rc.position - margin.position); - Rect2 src_c = rc.clip(src); + Rect2 src_c = rc.intersection(src); if (src_c.size == Size2()) { return false; } @@ -1364,7 +1341,7 @@ Ref<Texture2D> MeshTexture::get_base_texture() const { return base_texture; } -void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1374,12 +1351,10 @@ void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_mo SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } -void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1398,12 +1373,10 @@ void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } -void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1422,9 +1395,7 @@ void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } bool MeshTexture::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { @@ -1569,14 +1540,14 @@ void LargeTexture::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); } -void LargeTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void LargeTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { for (int i = 0; i < pieces.size(); i++) { // TODO - pieces[i].texture->draw(p_canvas_item, pieces[i].offset + p_pos, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + pieces[i].texture->draw(p_canvas_item, pieces[i].offset + p_pos, p_modulate, p_transpose); } } -void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { //tiling not supported for this if (size.x == 0 || size.y == 0) { return; @@ -1586,11 +1557,11 @@ void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile for (int i = 0; i < pieces.size(); i++) { // TODO - pieces[i].texture->draw_rect(p_canvas_item, Rect2(pieces[i].offset * scale + p_rect.position, pieces[i].texture->get_size() * scale), false, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + pieces[i].texture->draw_rect(p_canvas_item, Rect2(pieces[i].offset * scale + p_rect.position, pieces[i].texture->get_size() * scale), false, p_modulate, p_transpose); } } -void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { //tiling not supported for this if (p_src_rect.size.x == 0 || p_src_rect.size.y == 0) { return; @@ -1604,12 +1575,12 @@ void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, cons if (!p_src_rect.intersects(rect)) { continue; } - Rect2 local = p_src_rect.clip(rect); + Rect2 local = p_src_rect.intersection(rect); Rect2 target = local; target.size *= scale; target.position = p_rect.position + (p_src_rect.position + rect.position) * scale; local.position -= rect.position; - pieces[i].texture->draw_rect_region(p_canvas_item, target, local, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat, false); + pieces[i].texture->draw_rect_region(p_canvas_item, target, local, p_modulate, p_transpose, false); } } @@ -1739,12 +1710,6 @@ CurveTexture::~CurveTexture() { ////////////////// -//setter and getter names for property serialization -#define COLOR_RAMP_GET_OFFSETS "get_offsets" -#define COLOR_RAMP_GET_COLORS "get_colors" -#define COLOR_RAMP_SET_OFFSETS "set_offsets" -#define COLOR_RAMP_SET_COLORS "set_colors" - GradientTexture::GradientTexture() { update_pending = false; width = 2048; @@ -2363,7 +2328,7 @@ Error StreamTextureLayered::_load_data(const String &p_path, Vector<Ref<Image>> ERR_FAIL_COND_V(images.size() != 0, ERR_INVALID_PARAMETER); FileAccessRef f = FileAccess::open(p_path, FileAccess::READ); - ERR_FAIL_COND_V(!f, ERR_CANT_OPEN); + ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, vformat("Unable to open file: %s.", p_path)); uint8_t header[4]; f->get_buffer(header, 4); diff --git a/scene/resources/texture.h b/scene/resources/texture.h index eebbf4f233..a8d8b785fa 100644 --- a/scene/resources/texture.h +++ b/scene/resources/texture.h @@ -31,13 +31,13 @@ #ifndef TEXTURE_H #define TEXTURE_H +#include "core/io/resource.h" #include "core/io/resource_loader.h" #include "core/math/rect2.h" #include "core/os/file_access.h" #include "core/os/mutex.h" #include "core/os/rw_lock.h" #include "core/os/thread_safe.h" -#include "core/resource.h" #include "scene/resources/curve.h" #include "scene/resources/gradient.h" #include "servers/camera_server.h" @@ -66,9 +66,9 @@ public: virtual bool has_alpha() const = 0; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const; virtual Ref<Image> get_data() const { return Ref<Image>(); } @@ -115,9 +115,9 @@ public: virtual RID get_rid() const override; bool has_alpha() const override; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -194,9 +194,9 @@ public: virtual void set_path(const String &p_path, bool p_take_over) override; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool has_alpha() const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -246,9 +246,9 @@ public: void set_filter_clip(const bool p_enable); bool has_filter_clip() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -285,9 +285,9 @@ public: void set_base_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_base_texture() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -331,9 +331,9 @@ public: Ref<Texture2D> get_piece_texture(int p_idx) const; Ref<Image> to_image() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -664,7 +664,6 @@ public: }; /* enum CubeMapSide { - CUBEMAP_LEFT, CUBEMAP_RIGHT, CUBEMAP_BOTTOM, diff --git a/scene/resources/theme.cpp b/scene/resources/theme.cpp index 6a85d357ff..c8bfcdfab4 100644 --- a/scene/resources/theme.cpp +++ b/scene/resources/theme.cpp @@ -30,17 +30,17 @@ #include "theme.h" #include "core/os/file_access.h" -#include "core/print_string.h" +#include "core/string/print_string.h" void Theme::_emit_theme_changed() { emit_changed(); } -Vector<String> Theme::_get_icon_list(const String &p_type) const { +Vector<String> Theme::_get_icon_list(const String &p_node_type) const { Vector<String> ilret; List<StringName> il; - get_icon_list(p_type, &il); + get_icon_list(p_node_type, &il); ilret.resize(il.size()); int i = 0; @@ -51,11 +51,11 @@ Vector<String> Theme::_get_icon_list(const String &p_type) const { return ilret; } -Vector<String> Theme::_get_stylebox_list(const String &p_type) const { +Vector<String> Theme::_get_icon_type_list() const { Vector<String> ilret; List<StringName> il; - get_stylebox_list(p_type, &il); + get_icon_type_list(&il); ilret.resize(il.size()); int i = 0; @@ -66,11 +66,11 @@ Vector<String> Theme::_get_stylebox_list(const String &p_type) const { return ilret; } -Vector<String> Theme::_get_stylebox_types() const { +Vector<String> Theme::_get_stylebox_list(const String &p_node_type) const { Vector<String> ilret; List<StringName> il; - get_stylebox_types(&il); + get_stylebox_list(p_node_type, &il); ilret.resize(il.size()); int i = 0; @@ -81,11 +81,11 @@ Vector<String> Theme::_get_stylebox_types() const { return ilret; } -Vector<String> Theme::_get_font_list(const String &p_type) const { +Vector<String> Theme::_get_stylebox_type_list() const { Vector<String> ilret; List<StringName> il; - get_font_list(p_type, &il); + get_stylebox_type_list(&il); ilret.resize(il.size()); int i = 0; @@ -96,11 +96,11 @@ Vector<String> Theme::_get_font_list(const String &p_type) const { return ilret; } -Vector<String> Theme::_get_color_list(const String &p_type) const { +Vector<String> Theme::_get_font_list(const String &p_node_type) const { Vector<String> ilret; List<StringName> il; - get_color_list(p_type, &il); + get_font_list(p_node_type, &il); ilret.resize(il.size()); int i = 0; @@ -111,11 +111,11 @@ Vector<String> Theme::_get_color_list(const String &p_type) const { return ilret; } -Vector<String> Theme::_get_constant_list(const String &p_type) const { +Vector<String> Theme::_get_font_type_list() const { Vector<String> ilret; List<StringName> il; - get_constant_list(p_type, &il); + get_font_type_list(&il); ilret.resize(il.size()); int i = 0; @@ -126,7 +126,82 @@ Vector<String> Theme::_get_constant_list(const String &p_type) const { return ilret; } -Vector<String> Theme::_get_type_list(const String &p_type) const { +Vector<String> Theme::_get_font_size_list(const String &p_node_type) const { + Vector<String> ilret; + List<StringName> il; + + get_font_size_list(p_node_type, &il); + ilret.resize(il.size()); + + int i = 0; + String *w = ilret.ptrw(); + for (List<StringName>::Element *E = il.front(); E; E = E->next(), i++) { + w[i] = E->get(); + } + return ilret; +} + +Vector<String> Theme::_get_color_list(const String &p_node_type) const { + Vector<String> ilret; + List<StringName> il; + + get_color_list(p_node_type, &il); + ilret.resize(il.size()); + + int i = 0; + String *w = ilret.ptrw(); + for (List<StringName>::Element *E = il.front(); E; E = E->next(), i++) { + w[i] = E->get(); + } + return ilret; +} + +Vector<String> Theme::_get_color_type_list() const { + Vector<String> ilret; + List<StringName> il; + + get_color_type_list(&il); + ilret.resize(il.size()); + + int i = 0; + String *w = ilret.ptrw(); + for (List<StringName>::Element *E = il.front(); E; E = E->next(), i++) { + w[i] = E->get(); + } + return ilret; +} + +Vector<String> Theme::_get_constant_list(const String &p_node_type) const { + Vector<String> ilret; + List<StringName> il; + + get_constant_list(p_node_type, &il); + ilret.resize(il.size()); + + int i = 0; + String *w = ilret.ptrw(); + for (List<StringName>::Element *E = il.front(); E; E = E->next(), i++) { + w[i] = E->get(); + } + return ilret; +} + +Vector<String> Theme::_get_constant_type_list() const { + Vector<String> ilret; + List<StringName> il; + + get_constant_type_list(&il); + ilret.resize(il.size()); + + int i = 0; + String *w = ilret.ptrw(); + for (List<StringName>::Element *E = il.front(); E; E = E->next(), i++) { + w[i] = E->get(); + } + return ilret; +} + +Vector<String> Theme::_get_type_list() const { Vector<String> ilret; List<StringName> il; @@ -291,11 +366,27 @@ Ref<Font> Theme::get_default_theme_font() const { return default_theme_font; } +void Theme::set_default_theme_font_size(int p_font_size) { + if (default_theme_font_size == p_font_size) { + return; + } + + default_theme_font_size = p_font_size; + + _change_notify(); + emit_changed(); +} + +int Theme::get_default_theme_font_size() const { + return default_theme_font_size; +} + Ref<Theme> Theme::project_default_theme; Ref<Theme> Theme::default_theme; Ref<Texture2D> Theme::default_icon; Ref<StyleBox> Theme::default_style; Ref<Font> Theme::default_font; +int Theme::default_font_size = 16; Ref<Theme> Theme::get_default() { return default_theme; @@ -325,19 +416,23 @@ void Theme::set_default_font(const Ref<Font> &p_font) { default_font = p_font; } -void Theme::set_icon(const StringName &p_name, const StringName &p_type, const Ref<Texture2D> &p_icon) { +void Theme::set_default_font_size(int p_font_size) { + default_font_size = p_font_size; +} + +void Theme::set_icon(const StringName &p_name, const StringName &p_node_type, const Ref<Texture2D> &p_icon) { //ERR_FAIL_COND(p_icon.is_null()); - bool new_value = !icon_map.has(p_type) || !icon_map[p_type].has(p_name); + bool new_value = !icon_map.has(p_node_type) || !icon_map[p_node_type].has(p_name); - if (icon_map[p_type].has(p_name) && icon_map[p_type][p_name].is_valid()) { - icon_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + if (icon_map[p_node_type].has(p_name) && icon_map[p_node_type][p_name].is_valid()) { + icon_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); } - icon_map[p_type][p_name] = p_icon; + icon_map[p_node_type][p_name] = p_icon; if (p_icon.is_valid()) { - icon_map[p_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); + icon_map[p_node_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); } if (new_value) { @@ -346,176 +441,200 @@ void Theme::set_icon(const StringName &p_name, const StringName &p_type, const R } } -Ref<Texture2D> Theme::get_icon(const StringName &p_name, const StringName &p_type) const { - if (icon_map.has(p_type) && icon_map[p_type].has(p_name) && icon_map[p_type][p_name].is_valid()) { - return icon_map[p_type][p_name]; +Ref<Texture2D> Theme::get_icon(const StringName &p_name, const StringName &p_node_type) const { + if (icon_map.has(p_node_type) && icon_map[p_node_type].has(p_name) && icon_map[p_node_type][p_name].is_valid()) { + return icon_map[p_node_type][p_name]; } else { return default_icon; } } -bool Theme::has_icon(const StringName &p_name, const StringName &p_type) const { - return (icon_map.has(p_type) && icon_map[p_type].has(p_name) && icon_map[p_type][p_name].is_valid()); +bool Theme::has_icon(const StringName &p_name, const StringName &p_node_type) const { + return (icon_map.has(p_node_type) && icon_map[p_node_type].has(p_name) && icon_map[p_node_type][p_name].is_valid()); } -void Theme::clear_icon(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!icon_map.has(p_type)); - ERR_FAIL_COND(!icon_map[p_type].has(p_name)); +void Theme::clear_icon(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!icon_map.has(p_node_type)); + ERR_FAIL_COND(!icon_map[p_node_type].has(p_name)); - if (icon_map[p_type][p_name].is_valid()) { - icon_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + if (icon_map[p_node_type][p_name].is_valid()) { + icon_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); } - icon_map[p_type].erase(p_name); + icon_map[p_node_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_icon_list(StringName p_type, List<StringName> *p_list) const { +void Theme::get_icon_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!icon_map.has(p_type)) { + if (!icon_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = icon_map[p_type].next(key))) { + while ((key = icon_map[p_node_type].next(key))) { p_list->push_back(*key); } } -void Theme::set_shader(const StringName &p_name, const StringName &p_type, const Ref<Shader> &p_shader) { - bool new_value = !shader_map.has(p_type) || !shader_map[p_type].has(p_name); +void Theme::get_icon_type_list(List<StringName> *p_list) const { + ERR_FAIL_NULL(p_list); - shader_map[p_type][p_name] = p_shader; + const StringName *key = nullptr; + while ((key = icon_map.next(key))) { + p_list->push_back(*key); + } +} + +void Theme::set_stylebox(const StringName &p_name, const StringName &p_node_type, const Ref<StyleBox> &p_style) { + //ERR_FAIL_COND(p_style.is_null()); + + bool new_value = !style_map.has(p_node_type) || !style_map[p_node_type].has(p_name); + + if (style_map[p_node_type].has(p_name) && style_map[p_node_type][p_name].is_valid()) { + style_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + } + + style_map[p_node_type][p_name] = p_style; + + if (p_style.is_valid()) { + style_map[p_node_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); + } if (new_value) { _change_notify(); - emit_changed(); } + emit_changed(); } -Ref<Shader> Theme::get_shader(const StringName &p_name, const StringName &p_type) const { - if (shader_map.has(p_type) && shader_map[p_type].has(p_name) && shader_map[p_type][p_name].is_valid()) { - return shader_map[p_type][p_name]; +Ref<StyleBox> Theme::get_stylebox(const StringName &p_name, const StringName &p_node_type) const { + if (style_map.has(p_node_type) && style_map[p_node_type].has(p_name) && style_map[p_node_type][p_name].is_valid()) { + return style_map[p_node_type][p_name]; } else { - return nullptr; + return default_style; } } -bool Theme::has_shader(const StringName &p_name, const StringName &p_type) const { - return (shader_map.has(p_type) && shader_map[p_type].has(p_name) && shader_map[p_type][p_name].is_valid()); +bool Theme::has_stylebox(const StringName &p_name, const StringName &p_node_type) const { + return (style_map.has(p_node_type) && style_map[p_node_type].has(p_name) && style_map[p_node_type][p_name].is_valid()); } -void Theme::clear_shader(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!shader_map.has(p_type)); - ERR_FAIL_COND(!shader_map[p_type].has(p_name)); +void Theme::clear_stylebox(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!style_map.has(p_node_type)); + ERR_FAIL_COND(!style_map[p_node_type].has(p_name)); + + if (style_map[p_node_type][p_name].is_valid()) { + style_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + } + + style_map[p_node_type].erase(p_name); - shader_map[p_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_shader_list(const StringName &p_type, List<StringName> *p_list) const { +void Theme::get_stylebox_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!shader_map.has(p_type)) { + if (!style_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = shader_map[p_type].next(key))) { + while ((key = style_map[p_node_type].next(key))) { p_list->push_back(*key); } } -void Theme::set_stylebox(const StringName &p_name, const StringName &p_type, const Ref<StyleBox> &p_style) { - //ERR_FAIL_COND(p_style.is_null()); +void Theme::get_stylebox_type_list(List<StringName> *p_list) const { + ERR_FAIL_NULL(p_list); + + const StringName *key = nullptr; + while ((key = style_map.next(key))) { + p_list->push_back(*key); + } +} - bool new_value = !style_map.has(p_type) || !style_map[p_type].has(p_name); +void Theme::set_font(const StringName &p_name, const StringName &p_node_type, const Ref<Font> &p_font) { + //ERR_FAIL_COND(p_font.is_null()); - if (style_map[p_type].has(p_name) && style_map[p_type][p_name].is_valid()) { - style_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + bool new_value = !font_map.has(p_node_type) || !font_map[p_node_type].has(p_name); + + if (font_map[p_node_type][p_name].is_valid()) { + font_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); } - style_map[p_type][p_name] = p_style; + font_map[p_node_type][p_name] = p_font; - if (p_style.is_valid()) { - style_map[p_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); + if (p_font.is_valid()) { + font_map[p_node_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); } if (new_value) { _change_notify(); + emit_changed(); } - emit_changed(); } -Ref<StyleBox> Theme::get_stylebox(const StringName &p_name, const StringName &p_type) const { - if (style_map.has(p_type) && style_map[p_type].has(p_name) && style_map[p_type][p_name].is_valid()) { - return style_map[p_type][p_name]; +Ref<Font> Theme::get_font(const StringName &p_name, const StringName &p_node_type) const { + if (font_map.has(p_node_type) && font_map[p_node_type].has(p_name) && font_map[p_node_type][p_name].is_valid()) { + return font_map[p_node_type][p_name]; + } else if (default_theme_font.is_valid()) { + return default_theme_font; } else { - return default_style; + return default_font; } } -bool Theme::has_stylebox(const StringName &p_name, const StringName &p_type) const { - return (style_map.has(p_type) && style_map[p_type].has(p_name) && style_map[p_type][p_name].is_valid()); +bool Theme::has_font(const StringName &p_name, const StringName &p_node_type) const { + return ((font_map.has(p_node_type) && font_map[p_node_type].has(p_name) && font_map[p_node_type][p_name].is_valid()) || default_theme_font.is_valid()); } -void Theme::clear_stylebox(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!style_map.has(p_type)); - ERR_FAIL_COND(!style_map[p_type].has(p_name)); +void Theme::clear_font(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!font_map.has(p_node_type)); + ERR_FAIL_COND(!font_map[p_node_type].has(p_name)); - if (style_map[p_type][p_name].is_valid()) { - style_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); + if (font_map[p_node_type][p_name].is_valid()) { + font_map[p_node_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); } - style_map[p_type].erase(p_name); - + font_map[p_node_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_stylebox_list(StringName p_type, List<StringName> *p_list) const { +void Theme::get_font_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!style_map.has(p_type)) { + if (!font_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = style_map[p_type].next(key))) { + while ((key = font_map[p_node_type].next(key))) { p_list->push_back(*key); } } -void Theme::get_stylebox_types(List<StringName> *p_list) const { +void Theme::get_font_type_list(List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); const StringName *key = nullptr; - while ((key = style_map.next(key))) { + while ((key = font_map.next(key))) { p_list->push_back(*key); } } -void Theme::set_font(const StringName &p_name, const StringName &p_type, const Ref<Font> &p_font) { - //ERR_FAIL_COND(p_font.is_null()); +void Theme::set_font_size(const StringName &p_name, const StringName &p_node_type, int p_font_size) { + bool new_value = !font_size_map.has(p_node_type) || !font_size_map[p_node_type].has(p_name); - bool new_value = !font_map.has(p_type) || !font_map[p_type].has(p_name); - - if (font_map[p_type][p_name].is_valid()) { - font_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); - } - - font_map[p_type][p_name] = p_font; - - if (p_font.is_valid()) { - font_map[p_type][p_name]->connect("changed", callable_mp(this, &Theme::_emit_theme_changed), varray(), CONNECT_REFERENCE_COUNTED); - } + font_size_map[p_node_type][p_name] = p_font_size; if (new_value) { _change_notify(); @@ -523,51 +642,47 @@ void Theme::set_font(const StringName &p_name, const StringName &p_type, const R } } -Ref<Font> Theme::get_font(const StringName &p_name, const StringName &p_type) const { - if (font_map.has(p_type) && font_map[p_type].has(p_name) && font_map[p_type][p_name].is_valid()) { - return font_map[p_type][p_name]; - } else if (default_theme_font.is_valid()) { - return default_theme_font; +int Theme::get_font_size(const StringName &p_name, const StringName &p_node_type) const { + if (font_size_map.has(p_node_type) && font_size_map[p_node_type].has(p_name) && (font_size_map[p_node_type][p_name] > 0)) { + return font_size_map[p_node_type][p_name]; + } else if (default_theme_font_size > 0) { + return default_theme_font_size; } else { - return default_font; + return default_font_size; } } -bool Theme::has_font(const StringName &p_name, const StringName &p_type) const { - return (font_map.has(p_type) && font_map[p_type].has(p_name) && font_map[p_type][p_name].is_valid()); +bool Theme::has_font_size(const StringName &p_name, const StringName &p_node_type) const { + return ((font_size_map.has(p_node_type) && font_size_map[p_node_type].has(p_name) && (font_size_map[p_node_type][p_name] > 0)) || (default_theme_font_size > 0)); } -void Theme::clear_font(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!font_map.has(p_type)); - ERR_FAIL_COND(!font_map[p_type].has(p_name)); +void Theme::clear_font_size(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!font_size_map.has(p_node_type)); + ERR_FAIL_COND(!font_size_map[p_node_type].has(p_name)); - if (font_map[p_type][p_name].is_valid()) { - font_map[p_type][p_name]->disconnect("changed", callable_mp(this, &Theme::_emit_theme_changed)); - } - - font_map[p_type].erase(p_name); + font_size_map[p_node_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_font_list(StringName p_type, List<StringName> *p_list) const { +void Theme::get_font_size_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!font_map.has(p_type)) { + if (!font_size_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = font_map[p_type].next(key))) { + while ((key = font_size_map[p_node_type].next(key))) { p_list->push_back(*key); } } -void Theme::set_color(const StringName &p_name, const StringName &p_type, const Color &p_color) { - bool new_value = !color_map.has(p_type) || !color_map[p_type].has(p_name); +void Theme::set_color(const StringName &p_name, const StringName &p_node_type, const Color &p_color) { + bool new_value = !color_map.has(p_node_type) || !color_map[p_node_type].has(p_name); - color_map[p_type][p_name] = p_color; + color_map[p_node_type][p_name] = p_color; if (new_value) { _change_notify(); @@ -575,44 +690,53 @@ void Theme::set_color(const StringName &p_name, const StringName &p_type, const } } -Color Theme::get_color(const StringName &p_name, const StringName &p_type) const { - if (color_map.has(p_type) && color_map[p_type].has(p_name)) { - return color_map[p_type][p_name]; +Color Theme::get_color(const StringName &p_name, const StringName &p_node_type) const { + if (color_map.has(p_node_type) && color_map[p_node_type].has(p_name)) { + return color_map[p_node_type][p_name]; } else { return Color(); } } -bool Theme::has_color(const StringName &p_name, const StringName &p_type) const { - return (color_map.has(p_type) && color_map[p_type].has(p_name)); +bool Theme::has_color(const StringName &p_name, const StringName &p_node_type) const { + return (color_map.has(p_node_type) && color_map[p_node_type].has(p_name)); } -void Theme::clear_color(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!color_map.has(p_type)); - ERR_FAIL_COND(!color_map[p_type].has(p_name)); +void Theme::clear_color(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!color_map.has(p_node_type)); + ERR_FAIL_COND(!color_map[p_node_type].has(p_name)); - color_map[p_type].erase(p_name); + color_map[p_node_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_color_list(StringName p_type, List<StringName> *p_list) const { +void Theme::get_color_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!color_map.has(p_type)) { + if (!color_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = color_map[p_type].next(key))) { + while ((key = color_map[p_node_type].next(key))) { + p_list->push_back(*key); + } +} + +void Theme::get_color_type_list(List<StringName> *p_list) const { + ERR_FAIL_NULL(p_list); + + const StringName *key = nullptr; + while ((key = color_map.next(key))) { p_list->push_back(*key); } } -void Theme::set_constant(const StringName &p_name, const StringName &p_type, int p_constant) { - bool new_value = !constant_map.has(p_type) || !constant_map[p_type].has(p_name); - constant_map[p_type][p_name] = p_constant; +void Theme::set_constant(const StringName &p_name, const StringName &p_node_type, int p_constant) { + bool new_value = !constant_map.has(p_node_type) || !constant_map[p_node_type].has(p_name); + constant_map[p_node_type][p_name] = p_constant; if (new_value) { _change_notify(); @@ -620,37 +744,46 @@ void Theme::set_constant(const StringName &p_name, const StringName &p_type, int } } -int Theme::get_constant(const StringName &p_name, const StringName &p_type) const { - if (constant_map.has(p_type) && constant_map[p_type].has(p_name)) { - return constant_map[p_type][p_name]; +int Theme::get_constant(const StringName &p_name, const StringName &p_node_type) const { + if (constant_map.has(p_node_type) && constant_map[p_node_type].has(p_name)) { + return constant_map[p_node_type][p_name]; } else { return 0; } } -bool Theme::has_constant(const StringName &p_name, const StringName &p_type) const { - return (constant_map.has(p_type) && constant_map[p_type].has(p_name)); +bool Theme::has_constant(const StringName &p_name, const StringName &p_node_type) const { + return (constant_map.has(p_node_type) && constant_map[p_node_type].has(p_name)); } -void Theme::clear_constant(const StringName &p_name, const StringName &p_type) { - ERR_FAIL_COND(!constant_map.has(p_type)); - ERR_FAIL_COND(!constant_map[p_type].has(p_name)); +void Theme::clear_constant(const StringName &p_name, const StringName &p_node_type) { + ERR_FAIL_COND(!constant_map.has(p_node_type)); + ERR_FAIL_COND(!constant_map[p_node_type].has(p_name)); - constant_map[p_type].erase(p_name); + constant_map[p_node_type].erase(p_name); _change_notify(); emit_changed(); } -void Theme::get_constant_list(StringName p_type, List<StringName> *p_list) const { +void Theme::get_constant_list(StringName p_node_type, List<StringName> *p_list) const { ERR_FAIL_NULL(p_list); - if (!constant_map.has(p_type)) { + if (!constant_map.has(p_node_type)) { return; } const StringName *key = nullptr; - while ((key = constant_map[p_type].next(key))) { + while ((key = constant_map[p_node_type].next(key))) { + p_list->push_back(*key); + } +} + +void Theme::get_constant_type_list(List<StringName> *p_list) const { + ERR_FAIL_NULL(p_list); + + const StringName *key = nullptr; + while ((key = constant_map.next(key))) { p_list->push_back(*key); } } @@ -699,7 +832,6 @@ void Theme::clear() { icon_map.clear(); style_map.clear(); font_map.clear(); - shader_map.clear(); color_map.clear(); constant_map.clear(); @@ -754,7 +886,6 @@ void Theme::copy_theme(const Ref<Theme> &p_other) { color_map = p_other->color_map; constant_map = p_other->constant_map; - shader_map = p_other->shader_map; _change_notify(); emit_changed(); @@ -800,48 +931,62 @@ void Theme::get_type_list(List<StringName> *p_list) const { } void Theme::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_icon", "name", "type", "texture"), &Theme::set_icon); - ClassDB::bind_method(D_METHOD("get_icon", "name", "type"), &Theme::get_icon); - ClassDB::bind_method(D_METHOD("has_icon", "name", "type"), &Theme::has_icon); - ClassDB::bind_method(D_METHOD("clear_icon", "name", "type"), &Theme::clear_icon); - ClassDB::bind_method(D_METHOD("get_icon_list", "type"), &Theme::_get_icon_list); - - ClassDB::bind_method(D_METHOD("set_stylebox", "name", "type", "texture"), &Theme::set_stylebox); - ClassDB::bind_method(D_METHOD("get_stylebox", "name", "type"), &Theme::get_stylebox); - ClassDB::bind_method(D_METHOD("has_stylebox", "name", "type"), &Theme::has_stylebox); - ClassDB::bind_method(D_METHOD("clear_stylebox", "name", "type"), &Theme::clear_stylebox); - ClassDB::bind_method(D_METHOD("get_stylebox_list", "type"), &Theme::_get_stylebox_list); - ClassDB::bind_method(D_METHOD("get_stylebox_types"), &Theme::_get_stylebox_types); - - ClassDB::bind_method(D_METHOD("set_font", "name", "type", "font"), &Theme::set_font); - ClassDB::bind_method(D_METHOD("get_font", "name", "type"), &Theme::get_font); - ClassDB::bind_method(D_METHOD("has_font", "name", "type"), &Theme::has_font); - ClassDB::bind_method(D_METHOD("clear_font", "name", "type"), &Theme::clear_font); - ClassDB::bind_method(D_METHOD("get_font_list", "type"), &Theme::_get_font_list); - - ClassDB::bind_method(D_METHOD("set_color", "name", "type", "color"), &Theme::set_color); - ClassDB::bind_method(D_METHOD("get_color", "name", "type"), &Theme::get_color); - ClassDB::bind_method(D_METHOD("has_color", "name", "type"), &Theme::has_color); - ClassDB::bind_method(D_METHOD("clear_color", "name", "type"), &Theme::clear_color); - ClassDB::bind_method(D_METHOD("get_color_list", "type"), &Theme::_get_color_list); - - ClassDB::bind_method(D_METHOD("set_constant", "name", "type", "constant"), &Theme::set_constant); - ClassDB::bind_method(D_METHOD("get_constant", "name", "type"), &Theme::get_constant); - ClassDB::bind_method(D_METHOD("has_constant", "name", "type"), &Theme::has_constant); - ClassDB::bind_method(D_METHOD("clear_constant", "name", "type"), &Theme::clear_constant); - ClassDB::bind_method(D_METHOD("get_constant_list", "type"), &Theme::_get_constant_list); + ClassDB::bind_method(D_METHOD("set_icon", "name", "node_type", "texture"), &Theme::set_icon); + ClassDB::bind_method(D_METHOD("get_icon", "name", "node_type"), &Theme::get_icon); + ClassDB::bind_method(D_METHOD("has_icon", "name", "node_type"), &Theme::has_icon); + ClassDB::bind_method(D_METHOD("clear_icon", "name", "node_type"), &Theme::clear_icon); + ClassDB::bind_method(D_METHOD("get_icon_list", "node_type"), &Theme::_get_icon_list); + ClassDB::bind_method(D_METHOD("get_icon_type_list"), &Theme::_get_icon_type_list); + + ClassDB::bind_method(D_METHOD("set_stylebox", "name", "node_type", "texture"), &Theme::set_stylebox); + ClassDB::bind_method(D_METHOD("get_stylebox", "name", "node_type"), &Theme::get_stylebox); + ClassDB::bind_method(D_METHOD("has_stylebox", "name", "node_type"), &Theme::has_stylebox); + ClassDB::bind_method(D_METHOD("clear_stylebox", "name", "node_type"), &Theme::clear_stylebox); + ClassDB::bind_method(D_METHOD("get_stylebox_list", "node_type"), &Theme::_get_stylebox_list); + ClassDB::bind_method(D_METHOD("get_stylebox_type_list"), &Theme::_get_stylebox_type_list); + + ClassDB::bind_method(D_METHOD("set_font", "name", "node_type", "font"), &Theme::set_font); + ClassDB::bind_method(D_METHOD("get_font", "name", "node_type"), &Theme::get_font); + ClassDB::bind_method(D_METHOD("has_font", "name", "node_type"), &Theme::has_font); + ClassDB::bind_method(D_METHOD("clear_font", "name", "node_type"), &Theme::clear_font); + ClassDB::bind_method(D_METHOD("get_font_list", "node_type"), &Theme::_get_font_list); + ClassDB::bind_method(D_METHOD("get_font_type_list"), &Theme::_get_font_type_list); + + ClassDB::bind_method(D_METHOD("set_font_size", "name", "node_type", "font_size"), &Theme::set_font_size); + ClassDB::bind_method(D_METHOD("get_font_size", "name", "node_type"), &Theme::get_font_size); + ClassDB::bind_method(D_METHOD("has_font_size", "name", "node_type"), &Theme::has_font_size); + ClassDB::bind_method(D_METHOD("clear_font_size", "name", "node_type"), &Theme::clear_font_size); + ClassDB::bind_method(D_METHOD("get_font_size_list", "node_type"), &Theme::_get_font_size_list); + + ClassDB::bind_method(D_METHOD("set_color", "name", "node_type", "color"), &Theme::set_color); + ClassDB::bind_method(D_METHOD("get_color", "name", "node_type"), &Theme::get_color); + ClassDB::bind_method(D_METHOD("has_color", "name", "node_type"), &Theme::has_color); + ClassDB::bind_method(D_METHOD("clear_color", "name", "node_type"), &Theme::clear_color); + ClassDB::bind_method(D_METHOD("get_color_list", "node_type"), &Theme::_get_color_list); + ClassDB::bind_method(D_METHOD("get_color_type_list"), &Theme::_get_color_type_list); + + ClassDB::bind_method(D_METHOD("set_constant", "name", "node_type", "constant"), &Theme::set_constant); + ClassDB::bind_method(D_METHOD("get_constant", "name", "node_type"), &Theme::get_constant); + ClassDB::bind_method(D_METHOD("has_constant", "name", "node_type"), &Theme::has_constant); + ClassDB::bind_method(D_METHOD("clear_constant", "name", "node_type"), &Theme::clear_constant); + ClassDB::bind_method(D_METHOD("get_constant_list", "node_type"), &Theme::_get_constant_list); + ClassDB::bind_method(D_METHOD("get_constant_type_list"), &Theme::_get_constant_type_list); ClassDB::bind_method(D_METHOD("clear"), &Theme::clear); ClassDB::bind_method(D_METHOD("set_default_font", "font"), &Theme::set_default_theme_font); ClassDB::bind_method(D_METHOD("get_default_font"), &Theme::get_default_theme_font); - ClassDB::bind_method(D_METHOD("get_type_list", "type"), &Theme::_get_type_list); + ClassDB::bind_method(D_METHOD("set_default_font_size", "font_size"), &Theme::set_default_theme_font_size); + ClassDB::bind_method(D_METHOD("get_default_font_size"), &Theme::get_default_theme_font_size); + + ClassDB::bind_method(D_METHOD("get_type_list"), &Theme::_get_type_list); ClassDB::bind_method("copy_default_theme", &Theme::copy_default_theme); ClassDB::bind_method(D_METHOD("copy_theme", "other"), &Theme::copy_theme); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "default_font", PROPERTY_HINT_RESOURCE_TYPE, "Font"), "set_default_font", "get_default_font"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "default_font_size"), "set_default_font_size", "get_default_font_size"); } Theme::Theme() { diff --git a/scene/resources/theme.h b/scene/resources/theme.h index 3c72ddd8a2..ad05e0e2f5 100644 --- a/scene/resources/theme.h +++ b/scene/resources/theme.h @@ -31,10 +31,9 @@ #ifndef THEME_H #define THEME_H +#include "core/io/resource.h" #include "core/io/resource_loader.h" -#include "core/resource.h" #include "scene/resources/font.h" -#include "scene/resources/shader.h" #include "scene/resources/style_box.h" #include "scene/resources/texture.h" @@ -47,17 +46,22 @@ class Theme : public Resource { HashMap<StringName, HashMap<StringName, Ref<Texture2D>>> icon_map; HashMap<StringName, HashMap<StringName, Ref<StyleBox>>> style_map; HashMap<StringName, HashMap<StringName, Ref<Font>>> font_map; - HashMap<StringName, HashMap<StringName, Ref<Shader>>> shader_map; + HashMap<StringName, HashMap<StringName, int>> font_size_map; HashMap<StringName, HashMap<StringName, Color>> color_map; HashMap<StringName, HashMap<StringName, int>> constant_map; - Vector<String> _get_icon_list(const String &p_type) const; - Vector<String> _get_stylebox_list(const String &p_type) const; - Vector<String> _get_stylebox_types() const; - Vector<String> _get_font_list(const String &p_type) const; - Vector<String> _get_color_list(const String &p_type) const; - Vector<String> _get_constant_list(const String &p_type) const; - Vector<String> _get_type_list(const String &p_type) const; + Vector<String> _get_icon_list(const String &p_node_type) const; + Vector<String> _get_icon_type_list() const; + Vector<String> _get_stylebox_list(const String &p_node_type) const; + Vector<String> _get_stylebox_type_list() const; + Vector<String> _get_font_list(const String &p_node_type) const; + Vector<String> _get_font_type_list() const; + Vector<String> _get_font_size_list(const String &p_node_type) const; + Vector<String> _get_color_list(const String &p_node_type) const; + Vector<String> _get_color_type_list() const; + Vector<String> _get_constant_list(const String &p_node_type) const; + Vector<String> _get_constant_type_list() const; + Vector<String> _get_type_list() const; protected: bool _set(const StringName &p_name, const Variant &p_value); @@ -69,8 +73,10 @@ protected: static Ref<Texture2D> default_icon; static Ref<StyleBox> default_style; static Ref<Font> default_font; + static int default_font_size; Ref<Font> default_theme_font; + int default_theme_font_size = -1; static void _bind_methods(); @@ -84,46 +90,54 @@ public: static void set_default_icon(const Ref<Texture2D> &p_icon); static void set_default_style(const Ref<StyleBox> &p_style); static void set_default_font(const Ref<Font> &p_font); + static void set_default_font_size(int p_font_size); void set_default_theme_font(const Ref<Font> &p_default_font); Ref<Font> get_default_theme_font() const; - void set_icon(const StringName &p_name, const StringName &p_type, const Ref<Texture2D> &p_icon); - Ref<Texture2D> get_icon(const StringName &p_name, const StringName &p_type) const; - bool has_icon(const StringName &p_name, const StringName &p_type) const; - void clear_icon(const StringName &p_name, const StringName &p_type); - void get_icon_list(StringName p_type, List<StringName> *p_list) const; - - void set_shader(const StringName &p_name, const StringName &p_type, const Ref<Shader> &p_shader); - Ref<Shader> get_shader(const StringName &p_name, const StringName &p_type) const; - bool has_shader(const StringName &p_name, const StringName &p_type) const; - void clear_shader(const StringName &p_name, const StringName &p_type); - void get_shader_list(const StringName &p_type, List<StringName> *p_list) const; - - void set_stylebox(const StringName &p_name, const StringName &p_type, const Ref<StyleBox> &p_style); - Ref<StyleBox> get_stylebox(const StringName &p_name, const StringName &p_type) const; - bool has_stylebox(const StringName &p_name, const StringName &p_type) const; - void clear_stylebox(const StringName &p_name, const StringName &p_type); - void get_stylebox_list(StringName p_type, List<StringName> *p_list) const; - void get_stylebox_types(List<StringName> *p_list) const; - - void set_font(const StringName &p_name, const StringName &p_type, const Ref<Font> &p_font); - Ref<Font> get_font(const StringName &p_name, const StringName &p_type) const; - bool has_font(const StringName &p_name, const StringName &p_type) const; - void clear_font(const StringName &p_name, const StringName &p_type); - void get_font_list(StringName p_type, List<StringName> *p_list) const; - - void set_color(const StringName &p_name, const StringName &p_type, const Color &p_color); - Color get_color(const StringName &p_name, const StringName &p_type) const; - bool has_color(const StringName &p_name, const StringName &p_type) const; - void clear_color(const StringName &p_name, const StringName &p_type); - void get_color_list(StringName p_type, List<StringName> *p_list) const; - - void set_constant(const StringName &p_name, const StringName &p_type, int p_constant); - int get_constant(const StringName &p_name, const StringName &p_type) const; - bool has_constant(const StringName &p_name, const StringName &p_type) const; - void clear_constant(const StringName &p_name, const StringName &p_type); - void get_constant_list(StringName p_type, List<StringName> *p_list) const; + void set_default_theme_font_size(int p_font_size); + int get_default_theme_font_size() const; + + void set_icon(const StringName &p_name, const StringName &p_node_type, const Ref<Texture2D> &p_icon); + Ref<Texture2D> get_icon(const StringName &p_name, const StringName &p_node_type) const; + bool has_icon(const StringName &p_name, const StringName &p_node_type) const; + void clear_icon(const StringName &p_name, const StringName &p_node_type); + void get_icon_list(StringName p_node_type, List<StringName> *p_list) const; + void get_icon_type_list(List<StringName> *p_list) const; + + void set_stylebox(const StringName &p_name, const StringName &p_node_type, const Ref<StyleBox> &p_style); + Ref<StyleBox> get_stylebox(const StringName &p_name, const StringName &p_node_type) const; + bool has_stylebox(const StringName &p_name, const StringName &p_node_type) const; + void clear_stylebox(const StringName &p_name, const StringName &p_node_type); + void get_stylebox_list(StringName p_node_type, List<StringName> *p_list) const; + void get_stylebox_type_list(List<StringName> *p_list) const; + + void set_font(const StringName &p_name, const StringName &p_node_type, const Ref<Font> &p_font); + Ref<Font> get_font(const StringName &p_name, const StringName &p_node_type) const; + bool has_font(const StringName &p_name, const StringName &p_node_type) const; + void clear_font(const StringName &p_name, const StringName &p_node_type); + void get_font_list(StringName p_node_type, List<StringName> *p_list) const; + void get_font_type_list(List<StringName> *p_list) const; + + void set_font_size(const StringName &p_name, const StringName &p_node_type, int p_font_size); + int get_font_size(const StringName &p_name, const StringName &p_node_type) const; + bool has_font_size(const StringName &p_name, const StringName &p_node_type) const; + void clear_font_size(const StringName &p_name, const StringName &p_node_type); + void get_font_size_list(StringName p_node_type, List<StringName> *p_list) const; + + void set_color(const StringName &p_name, const StringName &p_node_type, const Color &p_color); + Color get_color(const StringName &p_name, const StringName &p_node_type) const; + bool has_color(const StringName &p_name, const StringName &p_node_type) const; + void clear_color(const StringName &p_name, const StringName &p_node_type); + void get_color_list(StringName p_node_type, List<StringName> *p_list) const; + void get_color_type_list(List<StringName> *p_list) const; + + void set_constant(const StringName &p_name, const StringName &p_node_type, int p_constant); + int get_constant(const StringName &p_name, const StringName &p_node_type) const; + bool has_constant(const StringName &p_name, const StringName &p_node_type) const; + void clear_constant(const StringName &p_name, const StringName &p_node_type); + void get_constant_list(StringName p_node_type, List<StringName> *p_list) const; + void get_constant_type_list(List<StringName> *p_list) const; void get_type_list(List<StringName> *p_list) const; diff --git a/scene/resources/tile_set.cpp b/scene/resources/tile_set.cpp index 84b067d1e2..4581763e9c 100644 --- a/scene/resources/tile_set.cpp +++ b/scene/resources/tile_set.cpp @@ -30,9 +30,9 @@ #include "tile_set.h" -#include "core/array.h" -#include "core/engine.h" +#include "core/config/engine.h" #include "core/math/geometry_2d.h" +#include "core/variant/array.h" bool TileSet::_set(const StringName &p_name, const Variant &p_value) { String n = p_name; @@ -51,8 +51,6 @@ bool TileSet::_set(const StringName &p_name, const Variant &p_value) { tile_set_name(id, p_value); } else if (what == "texture") { tile_set_texture(id, p_value); - } else if (what == "normal_map") { - tile_set_normal_map(id, p_value); } else if (what == "tex_offset") { tile_set_texture_offset(id, p_value); } else if (what == "material") { @@ -226,8 +224,6 @@ bool TileSet::_get(const StringName &p_name, Variant &r_ret) const { r_ret = tile_get_name(id); } else if (what == "texture") { r_ret = tile_get_texture(id); - } else if (what == "normal_map") { - r_ret = tile_get_normal_map(id); } else if (what == "tex_offset") { r_ret = tile_get_texture_offset(id); } else if (what == "material") { @@ -331,7 +327,6 @@ void TileSet::_get_property_list(List<PropertyInfo> *p_list) const { String pre = itos(id) + "/"; p_list->push_back(PropertyInfo(Variant::STRING, pre + "name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::VECTOR2, pre + "tex_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::COLOR, pre + "modulate", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); @@ -402,17 +397,6 @@ Ref<Texture2D> TileSet::tile_get_texture(int p_id) const { return tile_map[p_id].texture; } -void TileSet::tile_set_normal_map(int p_id, const Ref<Texture2D> &p_normal_map) { - ERR_FAIL_COND(!tile_map.has(p_id)); - tile_map[p_id].normal_map = p_normal_map; - emit_changed(); -} - -Ref<Texture2D> TileSet::tile_get_normal_map(int p_id) const { - ERR_FAIL_COND_V(!tile_map.has(p_id), Ref<Texture2D>()); - return tile_map[p_id].normal_map; -} - void TileSet::tile_set_material(int p_id, const Ref<ShaderMaterial> &p_material) { ERR_FAIL_COND(!tile_map.has(p_id)); tile_map[p_id].material = p_material; @@ -1128,8 +1112,6 @@ void TileSet::_bind_methods() { ClassDB::bind_method(D_METHOD("tile_get_name", "id"), &TileSet::tile_get_name); ClassDB::bind_method(D_METHOD("tile_set_texture", "id", "texture"), &TileSet::tile_set_texture); ClassDB::bind_method(D_METHOD("tile_get_texture", "id"), &TileSet::tile_get_texture); - ClassDB::bind_method(D_METHOD("tile_set_normal_map", "id", "normal_map"), &TileSet::tile_set_normal_map); - ClassDB::bind_method(D_METHOD("tile_get_normal_map", "id"), &TileSet::tile_get_normal_map); ClassDB::bind_method(D_METHOD("tile_set_material", "id", "material"), &TileSet::tile_set_material); ClassDB::bind_method(D_METHOD("tile_get_material", "id"), &TileSet::tile_get_material); ClassDB::bind_method(D_METHOD("tile_set_modulate", "id", "color"), &TileSet::tile_set_modulate); diff --git a/scene/resources/tile_set.h b/scene/resources/tile_set.h index 78f34e46ce..79f1b4aa95 100644 --- a/scene/resources/tile_set.h +++ b/scene/resources/tile_set.h @@ -31,8 +31,8 @@ #ifndef TILE_SET_H #define TILE_SET_H -#include "core/array.h" -#include "core/resource.h" +#include "core/io/resource.h" +#include "core/variant/array.h" #include "scene/2d/light_occluder_2d.h" #include "scene/2d/navigation_region_2d.h" #include "scene/resources/convex_polygon_shape_2d.h" @@ -106,7 +106,6 @@ private: struct TileData { String name; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; Vector2 offset; Rect2i region; Vector<ShapeData> shapes_data; @@ -149,9 +148,6 @@ public: void tile_set_texture(int p_id, const Ref<Texture2D> &p_texture); Ref<Texture2D> tile_get_texture(int p_id) const; - void tile_set_normal_map(int p_id, const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> tile_get_normal_map(int p_id) const; - void tile_set_texture_offset(int p_id, const Vector2 &p_offset); Vector2 tile_get_texture_offset(int p_id) const; diff --git a/scene/resources/visual_shader.cpp b/scene/resources/visual_shader.cpp index 803ab265d4..34129e35da 100644 --- a/scene/resources/visual_shader.cpp +++ b/scene/resources/visual_shader.cpp @@ -30,7 +30,7 @@ #include "visual_shader.h" -#include "core/vmap.h" +#include "core/templates/vmap.h" #include "servers/rendering/shader_types.h" #include "visual_shader_nodes.h" @@ -65,20 +65,16 @@ bool VisualShaderNode::is_port_separator(int p_index) const { bool VisualShaderNode::is_output_port_connected(int p_port) const { if (connected_output_ports.has(p_port)) { - return connected_output_ports[p_port]; + return connected_output_ports[p_port] > 0; } return false; } void VisualShaderNode::set_output_port_connected(int p_port, bool p_connected) { if (p_connected) { - connected_output_ports[p_port] = true; - ++connected_output_count; + connected_output_ports[p_port]++; } else { - --connected_output_count; - if (connected_output_count == 0) { - connected_output_ports[p_port] = false; - } + connected_output_ports[p_port]--; } } @@ -101,6 +97,14 @@ bool VisualShaderNode::is_code_generated() const { return true; } +bool VisualShaderNode::is_show_prop_names() const { + return false; +} + +bool VisualShaderNode::is_use_prop_slots() const { + return false; +} + Vector<VisualShader::DefaultTextureParam> VisualShaderNode::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { return Vector<VisualShader::DefaultTextureParam>(); } @@ -807,8 +811,12 @@ String VisualShader::generate_preview_shader(Type p_type, int p_node, int p_port #define IS_SYMBOL_CHAR(m_d) (((m_d) >= 'a' && (m_d) <= 'z') || ((m_d) >= 'A' && (m_d) <= 'Z') || ((m_d) >= '0' && (m_d) <= '9') || (m_d) == '_') -String VisualShader::validate_port_name(const String &p_name, const List<String> &p_input_ports, const List<String> &p_output_ports) const { - String name = p_name; +String VisualShader::validate_port_name(const String &p_port_name, VisualShaderNode *p_node, int p_port_id, bool p_output) const { + String name = p_port_name; + + if (name == String()) { + return String(); + } while (name.length() && !IS_INITIAL_CHAR(name[0])) { name = name.substr(1, name.length() - 1); @@ -826,29 +834,28 @@ String VisualShader::validate_port_name(const String &p_name, const List<String> } name = valid_name; + } else { + return String(); } - String valid_name = name; - bool is_equal = false; + List<String> input_names; + List<String> output_names; - for (int i = 0; i < p_input_ports.size(); i++) { - if (name == p_input_ports[i]) { - is_equal = true; - break; + for (int i = 0; i < p_node->get_input_port_count(); i++) { + if (!p_output && i == p_port_id) { + continue; } - } - - if (!is_equal) { - for (int i = 0; i < p_output_ports.size(); i++) { - if (name == p_output_ports[i]) { - is_equal = true; - break; - } + if (name == p_node->get_input_port_name(i)) { + return String(); } } - - if (is_equal) { - name = ""; + for (int i = 0; i < p_node->get_output_port_count(); i++) { + if (p_output && i == p_port_id) { + continue; + } + if (name == p_node->get_output_port_name(i)) { + return String(); + } } return name; @@ -988,7 +995,7 @@ bool VisualShader::_set(const StringName &p_name, const Variant &p_value) { set_node_position(type, id, p_value); return true; } else if (what == "size") { - ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->set_size(p_value); + ((VisualShaderNodeResizableBase *)get_node(type, id).ptr())->set_size(p_value); return true; } else if (what == "input_ports") { ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->set_inputs(p_value); @@ -1055,7 +1062,7 @@ bool VisualShader::_get(const StringName &p_name, Variant &r_ret) const { r_ret = get_node_position(type, id); return true; } else if (what == "size") { - r_ret = ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->get_size(); + r_ret = ((VisualShaderNodeResizableBase *)get_node(type, id).ptr())->get_size(); return true; } else if (what == "input_ports") { r_ret = ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->get_inputs(); @@ -1239,9 +1246,9 @@ Error VisualShader::_write_node(Type type, StringBuilder &global_code, StringBui } else if (in_type == VisualShaderNode::PORT_TYPE_BOOLEAN && out_type == VisualShaderNode::PORT_TYPE_SCALAR_INT) { inputs[i] = src_var + " > 0 ? true : false"; } else if (in_type == VisualShaderNode::PORT_TYPE_SCALAR && out_type == VisualShaderNode::PORT_TYPE_BOOLEAN) { - inputs[i] = src_var + " ? 1.0 : 0.0"; + inputs[i] = "(" + src_var + " ? 1.0 : 0.0)"; } else if (in_type == VisualShaderNode::PORT_TYPE_SCALAR_INT && out_type == VisualShaderNode::PORT_TYPE_BOOLEAN) { - inputs[i] = src_var + " ? 1 : 0"; + inputs[i] = "(" + src_var + " ? 1 : 0)"; } else if (in_type == VisualShaderNode::PORT_TYPE_VECTOR && out_type == VisualShaderNode::PORT_TYPE_BOOLEAN) { inputs[i] = "vec3(" + src_var + " ? 1.0 : 0.0)"; } else if (in_type == VisualShaderNode::PORT_TYPE_SCALAR && out_type == VisualShaderNode::PORT_TYPE_SCALAR_INT) { @@ -1702,12 +1709,13 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "view", "VIEW" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light", "LIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_color", "LIGHT_COLOR" }, - { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "attenuation", "ATTENUATION" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "attenuation", "ATTENUATION" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "albedo", "ALBEDO" }, - { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "transmission", "TRANSMISSION" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "backlight", "BACKLIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "diffuse", "DIFFUSE_LIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "specular", "SPECULAR_LIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "roughness", "ROUGHNESS" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "metallic", "METALLIC" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "world", "WORLD_MATRIX" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "inv_camera", "INV_CAMERA_MATRIX" }, @@ -1719,17 +1727,17 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_BOOLEAN, "output_is_srgb", "OUTPUT_IS_SRGB" }, // Canvas Item, Vertex { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_VECTOR, "vertex", "vec3(VERTEX, 0.0)" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_VECTOR, "uv", "vec3(UV,0.0)" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_VECTOR, "uv", "vec3(UV, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_VECTOR, "color", "COLOR.rgb" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_SCALAR, "alpha", "COLOR.a" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_SCALAR, "point_size", "POINT_SIZE" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_VECTOR, "texture_pixel_size", "vec3(TEXTURE_PIXEL_SIZE, 1.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_TRANSFORM, "world", "WORLD_MATRIX" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_TRANSFORM, "projection", "PROJECTION_MATRIX" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_TRANSFORM, "extra", "EXTRA_MATRIX" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_TRANSFORM, "canvas", "CANVAS_MATRIX" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_TRANSFORM, "screen", "SCREEN_MATRIX" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_SCALAR, "light_pass", "float(AT_LIGHT_PASS ? 1.0 : 0.0)" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_VERTEX, VisualShaderNode::PORT_TYPE_BOOLEAN, "at_light_pass", "AT_LIGHT_PASS" }, // Canvas Item, Fragment { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "fragcoord", "FRAGCOORD.xyz" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "uv", "vec3(UV, 0.0)" }, @@ -1740,29 +1748,34 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "screen_pixel_size", "vec3(SCREEN_PIXEL_SIZE, 1.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "point_coord", "vec3(POINT_COORD, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "light_pass", "float(AT_LIGHT_PASS ? 1.0 : 0.0)" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_BOOLEAN, "at_light_pass", "AT_LIGHT_PASS" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SAMPLER, "texture", "TEXTURE" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SAMPLER, "normal_texture", "NORMAL_TEXTURE" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SAMPLER, "screen_texture", "SCREEN_TEXTURE" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "specular_shininess", "SPECULAR_SHININESS.rgb" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "specular_shininess_alpha", "SPECULAR_SHININESS.a" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SAMPLER, "specular_shininess_texture", "SPECULAR_SHININESS_TEXTURE" }, // Canvas Item, Light { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "fragcoord", "FRAGCOORD.xyz" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "uv", "vec3(UV, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "normal", "NORMAL" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "color", "COLOR.rgb" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "alpha", "COLOR.a" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_vec", "vec3(LIGHT_VEC, 0.0)" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "light_height", "LIGHT_HEIGHT" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light", "LIGHT.rgb" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "light_alpha", "LIGHT.a" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_color", "LIGHT_COLOR.rgb" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "light_alpha", "LIGHT_COLOR.a" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_uv", "vec3(LIGHT_UV, 0.0)" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "shadow_color", "SHADOW_COLOR.rgb" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "shadow_alpha", "SHADOW_COLOR.a" }, - { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "shadow_vec", "vec3(SHADOW_VEC, 0.0)" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "light_color_alpha", "LIGHT_COLOR.a" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_position", "LIGHT_POSITION" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "light_vertex", "LIGHT_VERTEX" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "shadow_color", "SHADOW_MODULATE.rgb" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "shadow_alpha", "SHADOW_MODULATE.a" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "screen_uv", "vec3(SCREEN_UV, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "texture_pixel_size", "vec3(TEXTURE_PIXEL_SIZE, 1.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "point_coord", "vec3(POINT_COORD, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SAMPLER, "texture", "TEXTURE" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "specular_shininess", "SPECULAR_SHININESS.rgb" }, + { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "specular_shininess_alpha", "SPECULAR_SHININESS.a" }, // Particles, Emit { Shader::MODE_PARTICLES, VisualShader::TYPE_EMIT, VisualShaderNode::PORT_TYPE_VECTOR, "color", "COLOR.rgb" }, @@ -1844,7 +1857,6 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { }; const VisualShaderNodeInput::Port VisualShaderNodeInput::preview_ports[] = { - // Spatial, Fragment { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "normal", "vec3(0.0, 0.0, 1.0)" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "tangent", "vec3(0.0, 1.0, 0.0)" }, @@ -1858,7 +1870,7 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::preview_ports[] = { { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "side", "1.0" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, - { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "viewport_size", "vec3(1.0,1.0, 0.0)" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "viewport_size", "vec3(1.0, 1.0, 0.0)" }, // Spatial, Light { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "normal", "vec3(0.0, 0.0, 1.0)" }, @@ -1950,7 +1962,7 @@ String VisualShaderNodeInput::generate_code(Shader::Mode p_mode, VisualShader::T code = "\t" + p_output_vars[0] + " = vec3(0.0);\n"; } break; case PORT_TYPE_TRANSFORM: { - code = "\t" + p_output_vars[0] + " = mat4( vec4(1.0,0.0,0.0,0.0), vec4(0.0,1.0,0.0,0.0), vec4(0.0,0.0,1.0,0.0), vec4(0.0,0.0,0.0,1.0) );\n"; + code = "\t" + p_output_vars[0] + " = mat4(vec4(1.0, 0.0, 0.0, 0.0), vec4(0.0, 1.0, 0.0, 0.0), vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0));\n"; } break; case PORT_TYPE_BOOLEAN: { code = "\t" + p_output_vars[0] + " = false;\n"; @@ -2123,6 +2135,15 @@ void VisualShaderNodeUniformRef::clear_uniforms() { uniforms.clear(); } +bool VisualShaderNodeUniformRef::has_uniform(const String &p_name) { + for (List<VisualShaderNodeUniformRef::Uniform>::Element *E = uniforms.front(); E; E = E->next()) { + if (E->get().name == p_name) { + return true; + } + } + return false; +} + String VisualShaderNodeUniformRef::get_caption() const { return "UniformRef"; } @@ -2140,10 +2161,6 @@ String VisualShaderNodeUniformRef::get_input_port_name(int p_port) const { } int VisualShaderNodeUniformRef::get_output_port_count() const { - if (uniform_name == "[None]") { - return 0; - } - switch (uniform_type) { case UniformType::UNIFORM_TYPE_FLOAT: return 1; @@ -2162,7 +2179,7 @@ int VisualShaderNodeUniformRef::get_output_port_count() const { default: break; } - return 0; + return 1; } VisualShaderNodeUniformRef::PortType VisualShaderNodeUniformRef::get_output_port_type(int p_port) const { @@ -2222,8 +2239,8 @@ String VisualShaderNodeUniformRef::get_output_port_name(int p_port) const { void VisualShaderNodeUniformRef::set_uniform_name(const String &p_name) { uniform_name = p_name; - if (p_name != "[None]") { - uniform_type = get_uniform_type_by_name(p_name); + if (uniform_name != "[None]") { + uniform_type = get_uniform_type_by_name(uniform_name); } else { uniform_type = UniformType::UNIFORM_TYPE_FLOAT; } @@ -2264,6 +2281,9 @@ VisualShaderNodeUniformRef::UniformType VisualShaderNodeUniformRef::get_uniform_ String VisualShaderNodeUniformRef::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { switch (uniform_type) { case UniformType::UNIFORM_TYPE_FLOAT: + if (uniform_name == "[None]") { + return "\t" + p_output_vars[0] + " = 0.0;\n"; + } return "\t" + p_output_vars[0] + " = " + get_uniform_name() + ";\n"; case UniformType::UNIFORM_TYPE_INT: return "\t" + p_output_vars[0] + " = " + get_uniform_name() + ";\n"; @@ -2286,16 +2306,29 @@ String VisualShaderNodeUniformRef::generate_code(Shader::Mode p_mode, VisualShad return ""; } +void VisualShaderNodeUniformRef::_set_uniform_type(int p_uniform_type) { + uniform_type = (UniformType)p_uniform_type; +} + +int VisualShaderNodeUniformRef::_get_uniform_type() const { + return (int)uniform_type; +} + void VisualShaderNodeUniformRef::_bind_methods() { ClassDB::bind_method(D_METHOD("set_uniform_name", "name"), &VisualShaderNodeUniformRef::set_uniform_name); ClassDB::bind_method(D_METHOD("get_uniform_name"), &VisualShaderNodeUniformRef::get_uniform_name); + ClassDB::bind_method(D_METHOD("_set_uniform_type", "type"), &VisualShaderNodeUniformRef::_set_uniform_type); + ClassDB::bind_method(D_METHOD("_get_uniform_type"), &VisualShaderNodeUniformRef::_get_uniform_type); + ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "uniform_name", PROPERTY_HINT_ENUM, ""), "set_uniform_name", "get_uniform_name"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "uniform_type", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_uniform_type", "_get_uniform_type"); } Vector<StringName> VisualShaderNodeUniformRef::get_editable_properties() const { Vector<StringName> props; props.push_back("uniform_name"); + props.push_back("uniform_type"); return props; } @@ -2336,9 +2369,9 @@ const VisualShaderNodeOutput::Port VisualShaderNodeOutput::ports[] = { { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "anisotropy", "ANISOTROPY" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "anisotropy_flow", "ANISOTROPY_FLOW:xy" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "subsurf_scatter", "SSS_STRENGTH" }, - { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "transmission", "TRANSMISSION" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_VECTOR, "backlight", "BACKLIGHT" }, - { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "alpha_scissor", "ALPHA_SCISSOR" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "alpha_scissor_threshold", "ALPHA_SCISSOR_THRESHOLD" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_FRAGMENT, VisualShaderNode::PORT_TYPE_SCALAR, "ao_light_affect", "AO_LIGHT_AFFECT" }, // Spatial, Light @@ -2456,7 +2489,7 @@ String VisualShaderNodeOutput::get_output_port_name(int p_port) const { bool VisualShaderNodeOutput::is_port_separator(int p_index) const { if (shader_mode == Shader::MODE_SPATIAL && shader_type == VisualShader::TYPE_FRAGMENT) { String name = get_input_port_name(p_index); - return (name == "Normal" || name == "Rim" || name == "Alpha Scissor"); + return (name == "Normal" || name == "Rim" || name == "Alpha Scissor Threshold"); } return false; } @@ -2571,20 +2604,37 @@ Vector<StringName> VisualShaderNodeUniform::get_editable_properties() const { VisualShaderNodeUniform::VisualShaderNodeUniform() { } -////////////// GroupBase - -String VisualShaderNodeGroupBase::get_caption() const { - return "Group"; -} +////////////// ResizeableBase -void VisualShaderNodeGroupBase::set_size(const Vector2 &p_size) { +void VisualShaderNodeResizableBase::set_size(const Vector2 &p_size) { size = p_size; } -Vector2 VisualShaderNodeGroupBase::get_size() const { +Vector2 VisualShaderNodeResizableBase::get_size() const { return size; } +void VisualShaderNodeResizableBase::set_allow_v_resize(bool p_enabled) { + allow_v_resize = p_enabled; +} + +bool VisualShaderNodeResizableBase::is_allow_v_resize() const { + return allow_v_resize; +} + +void VisualShaderNodeResizableBase::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_size", "size"), &VisualShaderNodeResizableBase::set_size); + ClassDB::bind_method(D_METHOD("get_size"), &VisualShaderNodeResizableBase::get_size); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "size"), "set_size", "get_size"); +} + +VisualShaderNodeResizableBase::VisualShaderNodeResizableBase() { + set_allow_v_resize(true); +} + +////////////// GroupBase + void VisualShaderNodeGroupBase::set_inputs(const String &p_inputs) { if (inputs == p_inputs) { return; @@ -2700,6 +2750,7 @@ void VisualShaderNodeGroupBase::add_input_port(int p_id, int p_type, const Strin } _apply_port_changes(); + emit_changed(); } void VisualShaderNodeGroupBase::remove_input_port(int p_id) { @@ -2719,11 +2770,14 @@ void VisualShaderNodeGroupBase::remove_input_port(int p_id) { inputs.erase(index, count); inputs_strings = inputs.split(";", false); + inputs = inputs.substr(0, index); + for (int i = p_id; i < inputs_strings.size(); i++) { - inputs = inputs.replace_first(inputs_strings[i].split(",")[0], itos(i)); + inputs += inputs_strings[i].replace_first(inputs_strings[i].split(",")[0], itos(i)) + ";"; } _apply_port_changes(); + emit_changed(); } int VisualShaderNodeGroupBase::get_input_port_count() const { @@ -2768,6 +2822,7 @@ void VisualShaderNodeGroupBase::add_output_port(int p_id, int p_type, const Stri } _apply_port_changes(); + emit_changed(); } void VisualShaderNodeGroupBase::remove_output_port(int p_id) { @@ -2787,11 +2842,14 @@ void VisualShaderNodeGroupBase::remove_output_port(int p_id) { outputs.erase(index, count); outputs_strings = outputs.split(";", false); + outputs = outputs.substr(0, index); + for (int i = p_id; i < outputs_strings.size(); i++) { - outputs = outputs.replace_first(outputs_strings[i].split(",")[0], itos(i)); + outputs += outputs_strings[i].replace_first(outputs_strings[i].split(",")[0], itos(i)) + ";"; } _apply_port_changes(); + emit_changed(); } int VisualShaderNodeGroupBase::get_output_port_count() const { @@ -2838,6 +2896,7 @@ void VisualShaderNodeGroupBase::set_input_port_type(int p_id, int p_type) { inputs = inputs.insert(index, itos(p_type)); _apply_port_changes(); + emit_changed(); } VisualShaderNodeGroupBase::PortType VisualShaderNodeGroupBase::get_input_port_type(int p_id) const { @@ -2873,6 +2932,7 @@ void VisualShaderNodeGroupBase::set_input_port_name(int p_id, const String &p_na inputs = inputs.insert(index, p_name); _apply_port_changes(); + emit_changed(); } String VisualShaderNodeGroupBase::get_input_port_name(int p_id) const { @@ -2908,6 +2968,7 @@ void VisualShaderNodeGroupBase::set_output_port_type(int p_id, int p_type) { outputs = outputs.insert(index, itos(p_type)); _apply_port_changes(); + emit_changed(); } VisualShaderNodeGroupBase::PortType VisualShaderNodeGroupBase::get_output_port_type(int p_id) const { @@ -2943,6 +3004,7 @@ void VisualShaderNodeGroupBase::set_output_port_name(int p_id, const String &p_n outputs = outputs.insert(index, p_name); _apply_port_changes(); + emit_changed(); } String VisualShaderNodeGroupBase::get_output_port_name(int p_id) const { @@ -3003,9 +3065,6 @@ bool VisualShaderNodeGroupBase::is_editable() const { } void VisualShaderNodeGroupBase::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_size", "size"), &VisualShaderNodeGroupBase::set_size); - ClassDB::bind_method(D_METHOD("get_size"), &VisualShaderNodeGroupBase::get_size); - ClassDB::bind_method(D_METHOD("set_inputs", "inputs"), &VisualShaderNodeGroupBase::set_inputs); ClassDB::bind_method(D_METHOD("get_inputs"), &VisualShaderNodeGroupBase::get_inputs); @@ -3033,8 +3092,6 @@ void VisualShaderNodeGroupBase::_bind_methods() { ClassDB::bind_method(D_METHOD("get_free_input_port_id"), &VisualShaderNodeGroupBase::get_free_input_port_id); ClassDB::bind_method(D_METHOD("get_free_output_port_id"), &VisualShaderNodeGroupBase::get_free_output_port_id); - - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "size"), "set_size", "get_size"); } String VisualShaderNodeGroupBase::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { @@ -3053,6 +3110,7 @@ String VisualShaderNodeExpression::get_caption() const { void VisualShaderNodeExpression::set_expression(const String &p_expression) { expression = p_expression; + emit_changed(); } String VisualShaderNodeExpression::get_expression() const { diff --git a/scene/resources/visual_shader.h b/scene/resources/visual_shader.h index 513a17b024..a38c2886e2 100644 --- a/scene/resources/visual_shader.h +++ b/scene/resources/visual_shader.h @@ -31,7 +31,7 @@ #ifndef VISUAL_SHADER_H #define VISUAL_SHADER_H -#include "core/string_builder.h" +#include "core/string/string_builder.h" #include "scene/gui/control.h" #include "scene/resources/shader.h" @@ -175,7 +175,7 @@ public: String generate_preview_shader(Type p_type, int p_node, int p_port, Vector<DefaultTextureParam> &r_default_tex_params) const; - String validate_port_name(const String &p_name, const List<String> &p_input_ports, const List<String> &p_output_ports) const; + String validate_port_name(const String &p_port_name, VisualShaderNode *p_node, int p_port_id, bool p_output) const; String validate_uniform_name(const String &p_name, const Ref<VisualShaderNodeUniform> &p_uniform) const; VisualShader(); @@ -193,8 +193,7 @@ class VisualShaderNode : public Resource { Map<int, Variant> default_input_values; Map<int, bool> connected_input_ports; - Map<int, bool> connected_output_ports; - int connected_output_count = 0; + Map<int, int> connected_output_ports; protected: bool simple_decl = true; @@ -242,6 +241,8 @@ public: virtual bool is_generate_input_var(int p_port) const; virtual bool is_code_generated() const; + virtual bool is_show_prop_names() const; + virtual bool is_use_prop_slots() const; virtual Vector<StringName> get_editable_properties() const; @@ -454,6 +455,7 @@ protected: public: static void add_uniform(const String &p_name, UniformType p_type); static void clear_uniforms(); + static bool has_uniform(const String &p_name); public: virtual String get_caption() const override; @@ -469,6 +471,9 @@ public: void set_uniform_name(const String &p_name); String get_uniform_name() const; + void _set_uniform_type(int p_uniform_type); + int _get_uniform_type() const; + int get_uniforms_count() const; String get_uniform_name_by_index(int p_idx) const; UniformType get_uniform_type_by_name(const String &p_name) const; @@ -481,14 +486,33 @@ public: VisualShaderNodeUniformRef(); }; -class VisualShaderNodeGroupBase : public VisualShaderNode { - GDCLASS(VisualShaderNodeGroupBase, VisualShaderNode); +class VisualShaderNodeResizableBase : public VisualShaderNode { + GDCLASS(VisualShaderNodeResizableBase, VisualShaderNode); + +protected: + Vector2 size = Size2(0, 0); + bool allow_v_resize = true; + +protected: + static void _bind_methods(); + +public: + void set_size(const Vector2 &p_size); + Vector2 get_size() const; + + bool is_allow_v_resize() const; + void set_allow_v_resize(bool p_enabled); + + VisualShaderNodeResizableBase(); +}; + +class VisualShaderNodeGroupBase : public VisualShaderNodeResizableBase { + GDCLASS(VisualShaderNodeGroupBase, VisualShaderNodeResizableBase); private: void _apply_port_changes(); protected: - Vector2 size = Size2(0, 0); String inputs = ""; String outputs = ""; bool editable = false; @@ -506,11 +530,6 @@ protected: static void _bind_methods(); public: - virtual String get_caption() const override; - - void set_size(const Vector2 &p_size); - Vector2 get_size() const; - void set_inputs(const String &p_inputs); String get_inputs() const; diff --git a/scene/resources/visual_shader_nodes.cpp b/scene/resources/visual_shader_nodes.cpp index 0e10682daf..a3358ea8c7 100644 --- a/scene/resources/visual_shader_nodes.cpp +++ b/scene/resources/visual_shader_nodes.cpp @@ -452,7 +452,7 @@ String VisualShaderNodeTexture::get_output_port_name(int p_port) const { String VisualShaderNodeTexture::get_input_port_default_hint(int p_port) const { if (p_port == 0) { - return "UV.xy"; + return "default"; } return ""; } @@ -491,15 +491,22 @@ String VisualShaderNodeTexture::generate_global(Shader::Mode p_mode, VisualShade } String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + String default_uv; + if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) { + default_uv = "UV.xy"; + } else { + default_uv = "vec2(0.0)"; + } + if (source == SOURCE_TEXTURE) { String id = make_unique_id(p_type, p_id, "tex"); String code; if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\tvec4 " + id + "_read = texture(" + id + ", UV.xy);\n"; + code += "\tvec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n"; } else { - code += "\tvec4 " + id + "_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n"; + code += "\tvec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { @@ -525,9 +532,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", UV.xy);\n"; + code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { - code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { @@ -549,9 +556,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String() || p_for_preview) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, UV.xy, 0.0 );\n"; + code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", 0.0 );\n"; } else { - code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, UV.xy, " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { @@ -572,9 +579,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 _tex_read = texture(TEXTURE , UV.xy);\n"; + code += "\t\tvec4 _tex_read = texture(TEXTURE, " + default_uv + ");\n"; } else { - code += "\t\tvec4 _tex_read = textureLod(TEXTURE, UV.xy, " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 _tex_read = textureLod(TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { @@ -595,9 +602,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 _tex_read = texture(NORMAL_TEXTURE, UV.xy);\n"; + code += "\t\tvec4 _tex_read = texture(NORMAL_TEXTURE, " + default_uv + ");\n"; } else { - code += "\t\tvec4 _tex_read = textureLod(NORMAL_TEXTURE, UV.xy, " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 _tex_read = textureLod(NORMAL_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { @@ -628,9 +635,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tfloat _depth = texture(DEPTH_TEXTURE, UV.xy).r;\n"; + code += "\t\tfloat _depth = texture(DEPTH_TEXTURE, " + default_uv + ").r;\n"; } else { - code += "\t\tfloat _depth = textureLod(DEPTH_TEXTURE, UV.xy, " + p_input_vars[1] + ").r;\n"; + code += "\t\tfloat _depth = textureLod(DEPTH_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ").r;\n"; } } else if (p_input_vars[1] == String()) { @@ -717,6 +724,10 @@ Vector<StringName> VisualShaderNodeTexture::get_editable_properties() const { } String VisualShaderNodeTexture::get_warning(Shader::Mode p_mode, VisualShader::Type p_type) const { + if (is_input_port_connected(2) && source != SOURCE_PORT) { + return TTR("The sampler port is connected but not used. Consider changing the source to 'SamplerPort'."); + } + if (source == SOURCE_TEXTURE) { return String(); // all good } @@ -775,6 +786,90 @@ void VisualShaderNodeTexture::_bind_methods() { VisualShaderNodeTexture::VisualShaderNodeTexture() { } +////////////// Curve + +String VisualShaderNodeCurveTexture::get_caption() const { + return "CurveTexture"; +} + +int VisualShaderNodeCurveTexture::get_input_port_count() const { + return 1; +} + +VisualShaderNodeCurveTexture::PortType VisualShaderNodeCurveTexture::get_input_port_type(int p_port) const { + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeCurveTexture::get_input_port_name(int p_port) const { + return String(); +} + +int VisualShaderNodeCurveTexture::get_output_port_count() const { + return 1; +} + +VisualShaderNodeCurveTexture::PortType VisualShaderNodeCurveTexture::get_output_port_type(int p_port) const { + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeCurveTexture::get_output_port_name(int p_port) const { + return String(); +} + +void VisualShaderNodeCurveTexture::set_texture(Ref<CurveTexture> p_texture) { + texture = p_texture; + emit_changed(); +} + +Ref<CurveTexture> VisualShaderNodeCurveTexture::get_texture() const { + return texture; +} + +Vector<StringName> VisualShaderNodeCurveTexture::get_editable_properties() const { + Vector<StringName> props; + props.push_back("texture"); + return props; +} + +String VisualShaderNodeCurveTexture::generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { + return "uniform sampler2D " + make_unique_id(p_type, p_id, "curve") + ";\n"; +} + +String VisualShaderNodeCurveTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + if (p_input_vars[0] == String()) { + return "\t" + p_output_vars[0] + " = 0.0;\n"; + } + String id = make_unique_id(p_type, p_id, "curve"); + String code; + code += "\t" + p_output_vars[0] + " = texture(" + id + ", vec2(" + p_input_vars[0] + ", 0.0)).r;\n"; + return code; +} + +Vector<VisualShader::DefaultTextureParam> VisualShaderNodeCurveTexture::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "curve"); + dtp.param = texture; + Vector<VisualShader::DefaultTextureParam> ret; + ret.push_back(dtp); + return ret; +} + +void VisualShaderNodeCurveTexture::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &VisualShaderNodeCurveTexture::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &VisualShaderNodeCurveTexture::get_texture); + + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "CurveTexture"), "set_texture", "get_texture"); +} + +bool VisualShaderNodeCurveTexture::is_use_prop_slots() const { + return true; +} + +VisualShaderNodeCurveTexture::VisualShaderNodeCurveTexture() { + simple_decl = true; + allow_v_resize = false; +} + ////////////// Sample3D int VisualShaderNodeSample3D::get_input_port_count() const { @@ -819,12 +914,19 @@ String VisualShaderNodeSample3D::get_output_port_name(int p_port) const { String VisualShaderNodeSample3D::get_input_port_default_hint(int p_port) const { if (p_port == 0) { - return "vec3(UV.xy, 0.0)"; + return "default"; } return ""; } String VisualShaderNodeSample3D::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + String default_uv; + if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) { + default_uv = "vec3(UV, 0.0)"; + } else { + default_uv = "vec3(0.0)"; + } + String code; if (source == SOURCE_TEXTURE || source == SOURCE_PORT) { String id; @@ -837,9 +939,9 @@ String VisualShaderNodeSample3D::generate_code(Shader::Mode p_mode, VisualShader if (id != String()) { if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", vec3(UV.xy, 0.0));\n"; + code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { - code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", vec3(UV.xy, 0.0), " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { //no lod @@ -882,6 +984,10 @@ void VisualShaderNodeSample3D::_bind_methods() { } String VisualShaderNodeSample3D::get_warning(Shader::Mode p_mode, VisualShader::Type p_type) const { + if (is_input_port_connected(2) && source != SOURCE_PORT) { + return TTR("The sampler port is connected but not used. Consider changing the source to 'SamplerPort'."); + } + if (source == SOURCE_TEXTURE) { return String(); // all good } @@ -1085,6 +1191,13 @@ String VisualShaderNodeCubemap::generate_global(Shader::Mode p_mode, VisualShade } String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + String default_uv; + if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) { + default_uv = "vec3(UV, 0.0)"; + } else { + default_uv = "vec3(0.0)"; + } + String code; String id; if (source == SOURCE_TEXTURE) { @@ -1108,9 +1221,9 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader: if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 " + id + "_read = texture(" + id + " , vec3(UV, 0.0));\n"; + code += "\t\tvec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n"; } else { - code += "\t\tvec4 " + id + "_read = textureLod(" + id + " , vec3(UV, 0.0)" + " , " + p_input_vars[1] + " );\n"; + code += "\t\tvec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + " );\n"; } } else if (p_input_vars[1] == String()) { @@ -1128,7 +1241,7 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader: String VisualShaderNodeCubemap::get_input_port_default_hint(int p_port) const { if (p_port == 0) { - return "vec3(UV, 0.0)"; + return "default"; } return ""; } @@ -1171,6 +1284,13 @@ Vector<StringName> VisualShaderNodeCubemap::get_editable_properties() const { return props; } +String VisualShaderNodeCubemap::get_warning(Shader::Mode p_mode, VisualShader::Type p_type) const { + if (is_input_port_connected(2) && source != SOURCE_PORT) { + return TTR("The sampler port is connected but not used. Consider changing the source to 'SamplerPort'."); + } + return String(); +} + void VisualShaderNodeCubemap::_bind_methods() { ClassDB::bind_method(D_METHOD("set_source", "value"), &VisualShaderNodeCubemap::set_source); ClassDB::bind_method(D_METHOD("get_source"), &VisualShaderNodeCubemap::get_source); @@ -3490,6 +3610,14 @@ String VisualShaderNodeFloatUniform::generate_code(Shader::Mode p_mode, VisualSh return "\t" + p_output_vars[0] + " = " + get_uniform_name() + ";\n"; } +bool VisualShaderNodeFloatUniform::is_show_prop_names() const { + return true; +} + +bool VisualShaderNodeFloatUniform::is_use_prop_slots() const { + return true; +} + void VisualShaderNodeFloatUniform::set_hint(Hint p_hint) { hint = p_hint; emit_changed(); @@ -3649,6 +3777,14 @@ String VisualShaderNodeIntUniform::generate_code(Shader::Mode p_mode, VisualShad return "\t" + p_output_vars[0] + " = " + get_uniform_name() + ";\n"; } +bool VisualShaderNodeIntUniform::is_show_prop_names() const { + return true; +} + +bool VisualShaderNodeIntUniform::is_use_prop_slots() const { + return true; +} + void VisualShaderNodeIntUniform::set_hint(Hint p_hint) { hint = p_hint; emit_changed(); @@ -3823,6 +3959,14 @@ String VisualShaderNodeBooleanUniform::generate_code(Shader::Mode p_mode, Visual return "\t" + p_output_vars[0] + " = " + get_uniform_name() + ";\n"; } +bool VisualShaderNodeBooleanUniform::is_show_prop_names() const { + return true; +} + +bool VisualShaderNodeBooleanUniform::is_use_prop_slots() const { + return true; +} + void VisualShaderNodeBooleanUniform::_bind_methods() { ClassDB::bind_method(D_METHOD("set_default_value_enabled", "enabled"), &VisualShaderNodeBooleanUniform::set_default_value_enabled); ClassDB::bind_method(D_METHOD("is_default_value_enabled"), &VisualShaderNodeBooleanUniform::is_default_value_enabled); @@ -3913,6 +4057,10 @@ String VisualShaderNodeColorUniform::generate_code(Shader::Mode p_mode, VisualSh return code; } +bool VisualShaderNodeColorUniform::is_show_prop_names() const { + return true; +} + void VisualShaderNodeColorUniform::_bind_methods() { ClassDB::bind_method(D_METHOD("set_default_value_enabled", "enabled"), &VisualShaderNodeColorUniform::set_default_value_enabled); ClassDB::bind_method(D_METHOD("is_default_value_enabled"), &VisualShaderNodeColorUniform::is_default_value_enabled); @@ -4012,6 +4160,14 @@ void VisualShaderNodeVec3Uniform::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "default_value"), "set_default_value", "get_default_value"); } +bool VisualShaderNodeVec3Uniform::is_show_prop_names() const { + return true; +} + +bool VisualShaderNodeVec3Uniform::is_use_prop_slots() const { + return true; +} + bool VisualShaderNodeVec3Uniform::is_qualifier_supported(Qualifier p_qual) const { return true; // all qualifiers are supported } @@ -4104,6 +4260,14 @@ void VisualShaderNodeTransformUniform::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM, "default_value"), "set_default_value", "get_default_value"); } +bool VisualShaderNodeTransformUniform::is_show_prop_names() const { + return true; +} + +bool VisualShaderNodeTransformUniform::is_use_prop_slots() const { + return true; +} + bool VisualShaderNodeTransformUniform::is_qualifier_supported(Qualifier p_qual) const { return true; // all qualifiers are supported } @@ -4202,13 +4366,20 @@ bool VisualShaderNodeTextureUniform::is_code_generated() const { } String VisualShaderNodeTextureUniform::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + String default_uv; + if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) { + default_uv = "UV.xy"; + } else { + default_uv = "vec2(0.0)"; + } + String id = get_uniform_name(); String code = "\t{\n"; if (p_input_vars[0] == String()) { // Use UV by default. if (p_input_vars[1] == String()) { - code += "\t\tvec4 n_tex_read = texture(" + id + ", UV.xy);\n"; + code += "\t\tvec4 n_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { - code += "\t\tvec4 n_tex_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n"; + code += "\t\tvec4 n_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } } else if (p_input_vars[1] == String()) { //no lod @@ -4269,7 +4440,7 @@ void VisualShaderNodeTextureUniform::_bind_methods() { String VisualShaderNodeTextureUniform::get_input_port_default_hint(int p_port) const { if (p_port == 0) { - return "UV.xy"; + return "default"; } return ""; } @@ -5169,7 +5340,7 @@ int VisualShaderNodeMultiplyAdd::get_input_port_count() const { } VisualShaderNodeMultiplyAdd::PortType VisualShaderNodeMultiplyAdd::get_input_port_type(int p_port) const { - if (type == TYPE_SCALAR) { + if (op_type == OP_TYPE_SCALAR) { return PORT_TYPE_SCALAR; } return PORT_TYPE_VECTOR; @@ -5191,7 +5362,7 @@ int VisualShaderNodeMultiplyAdd::get_output_port_count() const { } VisualShaderNodeMultiplyAdd::PortType VisualShaderNodeMultiplyAdd::get_output_port_type(int p_port) const { - if (type == TYPE_SCALAR) { + if (op_type == OP_TYPE_SCALAR) { return PORT_TYPE_SCALAR; } else { return PORT_TYPE_VECTOR; @@ -5206,10 +5377,10 @@ String VisualShaderNodeMultiplyAdd::generate_code(Shader::Mode p_mode, VisualSha return "\t" + p_output_vars[0] + " = fma(" + p_input_vars[0] + ", " + p_input_vars[1] + ", " + p_input_vars[2] + ");\n"; } -void VisualShaderNodeMultiplyAdd::set_type(Type p_type) { - ERR_FAIL_INDEX((int)p_type, TYPE_MAX); - if (p_type != type) { - if (p_type == TYPE_SCALAR) { +void VisualShaderNodeMultiplyAdd::set_op_type(OpType p_op_type) { + ERR_FAIL_INDEX((int)p_op_type, OP_TYPE_MAX); + if (p_op_type != op_type) { + if (p_op_type == OP_TYPE_SCALAR) { set_input_port_default_value(0, 0.0); set_input_port_default_value(1, 0.0); set_input_port_default_value(2, 0.0); @@ -5219,29 +5390,29 @@ void VisualShaderNodeMultiplyAdd::set_type(Type p_type) { set_input_port_default_value(2, Vector3(0.0, 0.0, 0.0)); } } - type = p_type; + op_type = p_op_type; emit_changed(); } -VisualShaderNodeMultiplyAdd::Type VisualShaderNodeMultiplyAdd::get_type() const { - return type; +VisualShaderNodeMultiplyAdd::OpType VisualShaderNodeMultiplyAdd::get_op_type() const { + return op_type; } Vector<StringName> VisualShaderNodeMultiplyAdd::get_editable_properties() const { Vector<StringName> props; - props.push_back("type"); + props.push_back("op_type"); return props; } void VisualShaderNodeMultiplyAdd::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_type", "type"), &VisualShaderNodeMultiplyAdd::set_type); - ClassDB::bind_method(D_METHOD("get_type"), &VisualShaderNodeMultiplyAdd::get_type); + ClassDB::bind_method(D_METHOD("set_op_type", "type"), &VisualShaderNodeMultiplyAdd::set_op_type); + ClassDB::bind_method(D_METHOD("get_op_type"), &VisualShaderNodeMultiplyAdd::get_op_type); - ADD_PROPERTY(PropertyInfo(Variant::INT, "type", PROPERTY_HINT_ENUM, "Scalar,Vector"), "set_type", "get_type"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "op_type", PROPERTY_HINT_ENUM, "Scalar,Vector"), "set_op_type", "get_op_type"); - BIND_ENUM_CONSTANT(TYPE_SCALAR); - BIND_ENUM_CONSTANT(TYPE_VECTOR); - BIND_ENUM_CONSTANT(TYPE_MAX); + BIND_ENUM_CONSTANT(OP_TYPE_SCALAR); + BIND_ENUM_CONSTANT(OP_TYPE_VECTOR); + BIND_ENUM_CONSTANT(OP_TYPE_MAX); } VisualShaderNodeMultiplyAdd::VisualShaderNodeMultiplyAdd() { diff --git a/scene/resources/visual_shader_nodes.h b/scene/resources/visual_shader_nodes.h index 06ad42adf5..4b39c76388 100644 --- a/scene/resources/visual_shader_nodes.h +++ b/scene/resources/visual_shader_nodes.h @@ -284,6 +284,39 @@ VARIANT_ENUM_CAST(VisualShaderNodeTexture::Source) /////////////////////////////////////// +class VisualShaderNodeCurveTexture : public VisualShaderNodeResizableBase { + GDCLASS(VisualShaderNodeCurveTexture, VisualShaderNodeResizableBase); + Ref<CurveTexture> texture; + +protected: + static void _bind_methods(); + +public: + virtual String get_caption() const override; + + virtual int get_input_port_count() const override; + virtual PortType get_input_port_type(int p_port) const override; + virtual String get_input_port_name(int p_port) const override; + + virtual int get_output_port_count() const override; + virtual PortType get_output_port_type(int p_port) const override; + virtual String get_output_port_name(int p_port) const override; + + virtual Vector<VisualShader::DefaultTextureParam> get_default_texture_parameters(VisualShader::Type p_type, int p_id) const override; + virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; + virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + + void set_texture(Ref<CurveTexture> p_value); + Ref<CurveTexture> get_texture() const; + + virtual Vector<StringName> get_editable_properties() const override; + virtual bool is_use_prop_slots() const override; + + VisualShaderNodeCurveTexture(); +}; + +/////////////////////////////////////// + class VisualShaderNodeSample3D : public VisualShaderNode { GDCLASS(VisualShaderNodeSample3D, VisualShaderNode); @@ -415,6 +448,7 @@ public: TextureType get_texture_type() const; virtual Vector<StringName> get_editable_properties() const override; + virtual String get_warning(Shader::Mode p_mode, VisualShader::Type p_type) const override; VisualShaderNodeCubemap(); }; @@ -1529,6 +1563,9 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + virtual bool is_use_prop_slots() const override; + void set_hint(Hint p_hint); Hint get_hint() const; @@ -1591,6 +1628,9 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + virtual bool is_use_prop_slots() const override; + void set_hint(Hint p_hint); Hint get_hint() const; @@ -1644,6 +1684,9 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + virtual bool is_use_prop_slots() const override; + void set_default_value_enabled(bool p_enabled); bool is_default_value_enabled() const; @@ -1683,6 +1726,8 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + void set_default_value_enabled(bool p_enabled); bool is_default_value_enabled() const; @@ -1722,6 +1767,9 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + virtual bool is_use_prop_slots() const override; + void set_default_value_enabled(bool p_enabled); bool is_default_value_enabled() const; @@ -1761,6 +1809,9 @@ public: virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + virtual bool is_show_prop_names() const override; + virtual bool is_use_prop_slots() const override; + void set_default_value_enabled(bool p_enabled); bool is_default_value_enabled() const; @@ -2121,14 +2172,14 @@ class VisualShaderNodeMultiplyAdd : public VisualShaderNode { GDCLASS(VisualShaderNodeMultiplyAdd, VisualShaderNode); public: - enum Type { - TYPE_SCALAR, - TYPE_VECTOR, - TYPE_MAX, + enum OpType { + OP_TYPE_SCALAR, + OP_TYPE_VECTOR, + OP_TYPE_MAX, }; protected: - Type type = TYPE_SCALAR; + OpType op_type = OP_TYPE_SCALAR; protected: static void _bind_methods(); @@ -2146,14 +2197,14 @@ public: virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty - void set_type(Type p_type); - Type get_type() const; + void set_op_type(OpType p_type); + OpType get_op_type() const; virtual Vector<StringName> get_editable_properties() const override; VisualShaderNodeMultiplyAdd(); }; -VARIANT_ENUM_CAST(VisualShaderNodeMultiplyAdd::Type) +VARIANT_ENUM_CAST(VisualShaderNodeMultiplyAdd::OpType) #endif // VISUAL_SHADER_NODES_H diff --git a/scene/resources/world_2d.cpp b/scene/resources/world_2d.cpp index d2bc2bea31..41d3fe20be 100644 --- a/scene/resources/world_2d.cpp +++ b/scene/resources/world_2d.cpp @@ -30,7 +30,7 @@ #include "world_2d.h" -#include "core/project_settings.h" +#include "core/config/project_settings.h" #include "scene/2d/camera_2d.h" #include "scene/2d/visibility_notifier_2d.h" #include "scene/main/window.h" @@ -341,8 +341,8 @@ void World2D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_direct_space_state"), &World2D::get_direct_space_state); - ADD_PROPERTY(PropertyInfo(Variant::_RID, "canvas", PROPERTY_HINT_NONE, "", 0), "", "get_canvas"); - ADD_PROPERTY(PropertyInfo(Variant::_RID, "space", PROPERTY_HINT_NONE, "", 0), "", "get_space"); + ADD_PROPERTY(PropertyInfo(Variant::RID, "canvas", PROPERTY_HINT_NONE, "", 0), "", "get_canvas"); + ADD_PROPERTY(PropertyInfo(Variant::RID, "space", PROPERTY_HINT_NONE, "", 0), "", "get_space"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "direct_space_state", PROPERTY_HINT_RESOURCE_TYPE, "PhysicsDirectSpaceState2D", 0), "", "get_direct_space_state"); } diff --git a/scene/resources/world_2d.h b/scene/resources/world_2d.h index c330719104..11614f9aa4 100644 --- a/scene/resources/world_2d.h +++ b/scene/resources/world_2d.h @@ -31,8 +31,8 @@ #ifndef WORLD_2D_H #define WORLD_2D_H -#include "core/project_settings.h" -#include "core/resource.h" +#include "core/config/project_settings.h" +#include "core/io/resource.h" #include "servers/physics_server_2d.h" class VisibilityNotifier2D; diff --git a/scene/resources/world_3d.cpp b/scene/resources/world_3d.cpp index 8100f150ef..b8fb3825ce 100644 --- a/scene/resources/world_3d.cpp +++ b/scene/resources/world_3d.cpp @@ -321,8 +321,8 @@ void World3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "environment", PROPERTY_HINT_RESOURCE_TYPE, "Environment"), "set_environment", "get_environment"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "fallback_environment", PROPERTY_HINT_RESOURCE_TYPE, "Environment"), "set_fallback_environment", "get_fallback_environment"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "camera_effects", PROPERTY_HINT_RESOURCE_TYPE, "CameraEffects"), "set_camera_effects", "get_camera_effects"); - ADD_PROPERTY(PropertyInfo(Variant::_RID, "space", PROPERTY_HINT_NONE, "", 0), "", "get_space"); - ADD_PROPERTY(PropertyInfo(Variant::_RID, "scenario", PROPERTY_HINT_NONE, "", 0), "", "get_scenario"); + ADD_PROPERTY(PropertyInfo(Variant::RID, "space", PROPERTY_HINT_NONE, "", 0), "", "get_space"); + ADD_PROPERTY(PropertyInfo(Variant::RID, "scenario", PROPERTY_HINT_NONE, "", 0), "", "get_scenario"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "direct_space_state", PROPERTY_HINT_RESOURCE_TYPE, "PhysicsDirectSpaceState3D", 0), "", "get_direct_space_state"); } diff --git a/scene/resources/world_3d.h b/scene/resources/world_3d.h index 02a821637f..93e9c72e59 100644 --- a/scene/resources/world_3d.h +++ b/scene/resources/world_3d.h @@ -31,7 +31,7 @@ #ifndef WORLD_3D_H #define WORLD_3D_H -#include "core/resource.h" +#include "core/io/resource.h" #include "scene/resources/camera_effects.h" #include "scene/resources/environment.h" #include "servers/physics_server_3d.h" diff --git a/scene/scene_string_names.cpp b/scene/scene_string_names.cpp index 7cf9a4fedd..a72066e7a8 100644 --- a/scene/scene_string_names.cpp +++ b/scene/scene_string_names.cpp @@ -41,7 +41,7 @@ SceneStringNames::SceneStringNames() { doubledot = StaticCString::create(".."); draw = StaticCString::create("draw"); _draw = StaticCString::create("_draw"); - hide = StaticCString::create("hide"); + hidden = StaticCString::create("hidden"); visibility_changed = StaticCString::create("visibility_changed"); input_event = StaticCString::create("input_event"); shader = StaticCString::create("shader"); @@ -104,6 +104,7 @@ SceneStringNames::SceneStringNames() { _update_xform = StaticCString::create("_update_xform"); _clips_input = StaticCString::create("_clips_input"); + _structured_text_parser = StaticCString::create("_structured_text_parser"); _proxgroup_add = StaticCString::create("_proxgroup_add"); _proxgroup_remove = StaticCString::create("_proxgroup_remove"); diff --git a/scene/scene_string_names.h b/scene/scene_string_names.h index 1ae244492e..b4d2429d7f 100644 --- a/scene/scene_string_names.h +++ b/scene/scene_string_names.h @@ -31,8 +31,8 @@ #ifndef SCENE_STRING_NAMES_H #define SCENE_STRING_NAMES_H -#include "core/node_path.h" -#include "core/string_name.h" +#include "core/string/node_path.h" +#include "core/string/string_name.h" class SceneStringNames { friend void register_scene_types(); @@ -58,7 +58,7 @@ public: StringName dot; StringName doubledot; StringName draw; - StringName hide; + StringName hidden; StringName visibility_changed; StringName input_event; StringName _input_event; @@ -130,6 +130,7 @@ public: StringName _update_xform; StringName _clips_input; + StringName _structured_text_parser; StringName _proxgroup_add; StringName _proxgroup_remove; |
