diff options
Diffstat (limited to 'scene')
246 files changed, 12173 insertions, 4635 deletions
diff --git a/scene/2d/animated_sprite_2d.cpp b/scene/2d/animated_sprite_2d.cpp index fad4784d51..4fc5c4c21f 100644 --- a/scene/2d/animated_sprite_2d.cpp +++ b/scene/2d/animated_sprite_2d.cpp @@ -122,13 +122,13 @@ void AnimatedSprite2D::_validate_property(PropertyInfo &property) const { } property.hint_string += String(E->get()); - if (animation == E) { + if (animation == E->get()) { current_found = true; } } if (!current_found) { - if (property.hint_string == String()) { + if (property.hint_string.is_empty()) { property.hint_string = String(animation); } else { property.hint_string = String(animation) + "," + property.hint_string; diff --git a/scene/2d/area_2d.cpp b/scene/2d/area_2d.cpp index fff9c47d4d..8db1491953 100644 --- a/scene/2d/area_2d.cpp +++ b/scene/2d/area_2d.cpp @@ -33,13 +33,13 @@ #include "scene/scene_string_names.h" #include "servers/audio_server.h" -void Area2D::set_space_override_mode(SpaceOverride p_mode) { - space_override = p_mode; - PhysicsServer2D::get_singleton()->area_set_space_override_mode(get_rid(), PhysicsServer2D::AreaSpaceOverrideMode(p_mode)); +void Area2D::set_gravity_space_override_mode(SpaceOverride p_mode) { + gravity_space_override = p_mode; + PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_GRAVITY_OVERRIDE_MODE, p_mode); } -Area2D::SpaceOverride Area2D::get_space_override_mode() const { - return space_override; +Area2D::SpaceOverride Area2D::get_gravity_space_override_mode() const { + return gravity_space_override; } void Area2D::set_gravity_is_point(bool p_enabled) { @@ -51,21 +51,30 @@ bool Area2D::is_gravity_a_point() const { return gravity_is_point; } -void Area2D::set_gravity_distance_scale(real_t p_scale) { +void Area2D::set_gravity_point_distance_scale(real_t p_scale) { gravity_distance_scale = p_scale; PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_GRAVITY_DISTANCE_SCALE, p_scale); } -real_t Area2D::get_gravity_distance_scale() const { +real_t Area2D::get_gravity_point_distance_scale() const { return gravity_distance_scale; } -void Area2D::set_gravity_vector(const Vector2 &p_vec) { - gravity_vec = p_vec; - PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_GRAVITY_VECTOR, p_vec); +void Area2D::set_gravity_point_center(const Vector2 &p_center) { + gravity_vec = p_center; + PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_GRAVITY_VECTOR, p_center); } -Vector2 Area2D::get_gravity_vector() const { +const Vector2 &Area2D::get_gravity_point_center() const { + return gravity_vec; +} + +void Area2D::set_gravity_direction(const Vector2 &p_direction) { + gravity_vec = p_direction; + PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_GRAVITY_VECTOR, p_direction); +} + +const Vector2 &Area2D::get_gravity_direction() const { return gravity_vec; } @@ -78,6 +87,24 @@ real_t Area2D::get_gravity() const { return gravity; } +void Area2D::set_linear_damp_space_override_mode(SpaceOverride p_mode) { + linear_damp_space_override = p_mode; + PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_LINEAR_DAMP_OVERRIDE_MODE, p_mode); +} + +Area2D::SpaceOverride Area2D::get_linear_damp_space_override_mode() const { + return linear_damp_space_override; +} + +void Area2D::set_angular_damp_space_override_mode(SpaceOverride p_mode) { + angular_damp_space_override = p_mode; + PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_ANGULAR_DAMP_OVERRIDE_MODE, p_mode); +} + +Area2D::SpaceOverride Area2D::get_angular_damp_space_override_mode() const { + return angular_damp_space_override; +} + void Area2D::set_linear_damp(real_t p_linear_damp) { linear_damp = p_linear_damp; PhysicsServer2D::get_singleton()->area_set_param(get_rid(), PhysicsServer2D::AREA_PARAM_LINEAR_DAMP, p_linear_damp); @@ -369,12 +396,11 @@ void Area2D::set_monitoring(bool p_enable) { monitoring = p_enable; if (monitoring) { - PhysicsServer2D::get_singleton()->area_set_monitor_callback(get_rid(), this, SceneStringNames::get_singleton()->_body_inout); - PhysicsServer2D::get_singleton()->area_set_area_monitor_callback(get_rid(), this, SceneStringNames::get_singleton()->_area_inout); - + PhysicsServer2D::get_singleton()->area_set_monitor_callback(get_rid(), callable_mp(this, &Area2D::_body_inout)); + PhysicsServer2D::get_singleton()->area_set_area_monitor_callback(get_rid(), callable_mp(this, &Area2D::_area_inout)); } else { - PhysicsServer2D::get_singleton()->area_set_monitor_callback(get_rid(), nullptr, StringName()); - PhysicsServer2D::get_singleton()->area_set_area_monitor_callback(get_rid(), nullptr, StringName()); + PhysicsServer2D::get_singleton()->area_set_monitor_callback(get_rid(), Callable()); + PhysicsServer2D::get_singleton()->area_set_area_monitor_callback(get_rid(), Callable()); _clear_monitoring(); } } @@ -484,25 +510,56 @@ void Area2D::_validate_property(PropertyInfo &property) const { } property.hint_string = options; + } else if (property.name.begins_with("gravity") && property.name != "gravity_space_override") { + if (gravity_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } else { + if (gravity_is_point) { + if (property.name == "gravity_direction") { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } else { + if (property.name.begins_with("gravity_point_")) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } + } + } else if (property.name.begins_with("linear_damp") && property.name != "linear_damp_space_override") { + if (linear_damp_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } else if (property.name.begins_with("angular_damp") && property.name != "angular_damp_space_override") { + if (angular_damp_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } } } void Area2D::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_space_override_mode", "space_override_mode"), &Area2D::set_space_override_mode); - ClassDB::bind_method(D_METHOD("get_space_override_mode"), &Area2D::get_space_override_mode); + ClassDB::bind_method(D_METHOD("set_gravity_space_override_mode", "space_override_mode"), &Area2D::set_gravity_space_override_mode); + ClassDB::bind_method(D_METHOD("get_gravity_space_override_mode"), &Area2D::get_gravity_space_override_mode); ClassDB::bind_method(D_METHOD("set_gravity_is_point", "enable"), &Area2D::set_gravity_is_point); ClassDB::bind_method(D_METHOD("is_gravity_a_point"), &Area2D::is_gravity_a_point); - ClassDB::bind_method(D_METHOD("set_gravity_distance_scale", "distance_scale"), &Area2D::set_gravity_distance_scale); - ClassDB::bind_method(D_METHOD("get_gravity_distance_scale"), &Area2D::get_gravity_distance_scale); + ClassDB::bind_method(D_METHOD("set_gravity_point_distance_scale", "distance_scale"), &Area2D::set_gravity_point_distance_scale); + ClassDB::bind_method(D_METHOD("get_gravity_point_distance_scale"), &Area2D::get_gravity_point_distance_scale); - ClassDB::bind_method(D_METHOD("set_gravity_vector", "vector"), &Area2D::set_gravity_vector); - ClassDB::bind_method(D_METHOD("get_gravity_vector"), &Area2D::get_gravity_vector); + ClassDB::bind_method(D_METHOD("set_gravity_point_center", "center"), &Area2D::set_gravity_point_center); + ClassDB::bind_method(D_METHOD("get_gravity_point_center"), &Area2D::get_gravity_point_center); + + ClassDB::bind_method(D_METHOD("set_gravity_direction", "direction"), &Area2D::set_gravity_direction); + ClassDB::bind_method(D_METHOD("get_gravity_direction"), &Area2D::get_gravity_direction); ClassDB::bind_method(D_METHOD("set_gravity", "gravity"), &Area2D::set_gravity); ClassDB::bind_method(D_METHOD("get_gravity"), &Area2D::get_gravity); + ClassDB::bind_method(D_METHOD("set_linear_damp_space_override_mode", "space_override_mode"), &Area2D::set_linear_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("get_linear_damp_space_override_mode"), &Area2D::get_linear_damp_space_override_mode); + + ClassDB::bind_method(D_METHOD("set_angular_damp_space_override_mode", "space_override_mode"), &Area2D::set_angular_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("get_angular_damp_space_override_mode"), &Area2D::get_angular_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("set_linear_damp", "linear_damp"), &Area2D::set_linear_damp); ClassDB::bind_method(D_METHOD("get_linear_damp"), &Area2D::get_linear_damp); @@ -530,9 +587,6 @@ void Area2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_audio_bus_override", "enable"), &Area2D::set_audio_bus_override); ClassDB::bind_method(D_METHOD("is_overriding_audio_bus"), &Area2D::is_overriding_audio_bus); - ClassDB::bind_method(D_METHOD("_body_inout"), &Area2D::_body_inout); - ClassDB::bind_method(D_METHOD("_area_inout"), &Area2D::_area_inout); - ADD_SIGNAL(MethodInfo("body_shape_entered", PropertyInfo(Variant::RID, "body_rid"), PropertyInfo(Variant::OBJECT, "body", PROPERTY_HINT_RESOURCE_TYPE, "Node2D"), PropertyInfo(Variant::INT, "body_shape_index"), PropertyInfo(Variant::INT, "local_shape_index"))); ADD_SIGNAL(MethodInfo("body_shape_exited", PropertyInfo(Variant::RID, "body_rid"), PropertyInfo(Variant::OBJECT, "body", PROPERTY_HINT_RESOURCE_TYPE, "Node2D"), PropertyInfo(Variant::INT, "body_shape_index"), PropertyInfo(Variant::INT, "local_shape_index"))); ADD_SIGNAL(MethodInfo("body_entered", PropertyInfo(Variant::OBJECT, "body", PROPERTY_HINT_RESOURCE_TYPE, "Node2D"))); @@ -547,13 +601,20 @@ void Area2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "monitorable"), "set_monitorable", "is_monitorable"); ADD_PROPERTY(PropertyInfo(Variant::INT, "priority", PROPERTY_HINT_RANGE, "0,128,1"), "set_priority", "get_priority"); - ADD_GROUP("Physics Overrides", ""); - ADD_PROPERTY(PropertyInfo(Variant::INT, "space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine"), "set_space_override_mode", "get_space_override_mode"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gravity_point"), "set_gravity_is_point", "is_gravity_a_point"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_distance_scale", PROPERTY_HINT_RANGE, "0,1024,0.001,or_greater,exp"), "set_gravity_distance_scale", "get_gravity_distance_scale"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "gravity_vec"), "set_gravity_vector", "get_gravity_vector"); + ADD_GROUP("Gravity", "gravity_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "gravity_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_gravity_space_override_mode", "get_gravity_space_override_mode"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gravity_point", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_gravity_is_point", "is_gravity_a_point"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_point_distance_scale", PROPERTY_HINT_RANGE, "0,1024,0.001,or_greater,exp"), "set_gravity_point_distance_scale", "get_gravity_point_distance_scale"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "gravity_point_center"), "set_gravity_point_center", "get_gravity_point_center"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "gravity_direction"), "set_gravity_direction", "get_gravity_direction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity", PROPERTY_HINT_RANGE, "-4096,4096,0.001,or_lesser,or_greater"), "set_gravity", "get_gravity"); + + ADD_GROUP("Linear Damp", "linear_damp_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "linear_damp_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_linear_damp_space_override_mode", "get_linear_damp_space_override_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); + + ADD_GROUP("Angular Damp", "angular_damp_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "angular_damp_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_angular_damp_space_override_mode", "get_angular_damp_space_override_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); ADD_GROUP("Audio Bus", "audio_bus_"); @@ -570,7 +631,7 @@ void Area2D::_bind_methods() { Area2D::Area2D() : CollisionObject2D(PhysicsServer2D::get_singleton()->area_create(), true) { set_gravity(980); - set_gravity_vector(Vector2(0, 1)); + set_gravity_direction(Vector2(0, 1)); set_monitoring(true); set_monitorable(true); } diff --git a/scene/2d/area_2d.h b/scene/2d/area_2d.h index 2c29e4660d..98ba270a61 100644 --- a/scene/2d/area_2d.h +++ b/scene/2d/area_2d.h @@ -47,14 +47,19 @@ public: }; private: - SpaceOverride space_override = SPACE_OVERRIDE_DISABLED; + SpaceOverride gravity_space_override = SPACE_OVERRIDE_DISABLED; Vector2 gravity_vec; real_t gravity; bool gravity_is_point = false; real_t gravity_distance_scale = 0.0; + + SpaceOverride linear_damp_space_override = SPACE_OVERRIDE_DISABLED; + SpaceOverride angular_damp_space_override = SPACE_OVERRIDE_DISABLED; real_t linear_damp = 0.1; real_t angular_damp = 1.0; + int priority = 0; + bool monitoring = false; bool monitorable = false; bool locked = false; @@ -133,21 +138,30 @@ protected: void _validate_property(PropertyInfo &property) const override; public: - void set_space_override_mode(SpaceOverride p_mode); - SpaceOverride get_space_override_mode() const; + void set_gravity_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_gravity_space_override_mode() const; void set_gravity_is_point(bool p_enabled); bool is_gravity_a_point() const; - void set_gravity_distance_scale(real_t p_scale); - real_t get_gravity_distance_scale() const; + void set_gravity_point_distance_scale(real_t p_scale); + real_t get_gravity_point_distance_scale() const; - void set_gravity_vector(const Vector2 &p_vec); - Vector2 get_gravity_vector() const; + void set_gravity_point_center(const Vector2 &p_center); + const Vector2 &get_gravity_point_center() const; + + void set_gravity_direction(const Vector2 &p_direction); + const Vector2 &get_gravity_direction() const; void set_gravity(real_t p_gravity); real_t get_gravity() const; + void set_linear_damp_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_linear_damp_space_override_mode() const; + + void set_angular_damp_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_angular_damp_space_override_mode() const; + void set_linear_damp(real_t p_linear_damp); real_t get_linear_damp() const; diff --git a/scene/2d/audio_listener_2d.h b/scene/2d/audio_listener_2d.h index 875887acc6..454053bc4a 100644 --- a/scene/2d/audio_listener_2d.h +++ b/scene/2d/audio_listener_2d.h @@ -43,8 +43,6 @@ private: friend class Viewport; protected: - void _update_listener(); - bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; void _get_property_list(List<PropertyInfo> *p_list) const; diff --git a/scene/2d/audio_stream_player_2d.cpp b/scene/2d/audio_stream_player_2d.cpp index 18a50ae098..8bf95e6965 100644 --- a/scene/2d/audio_stream_player_2d.cpp +++ b/scene/2d/audio_stream_player_2d.cpp @@ -78,7 +78,6 @@ void AudioStreamPlayer2D::_notification(int p_what) { Vector<Ref<AudioStreamPlayback>> playbacks_to_remove; for (Ref<AudioStreamPlayback> &playback : stream_playbacks) { if (playback.is_valid() && !AudioServer::get_singleton()->is_playback_active(playback) && !AudioServer::get_singleton()->is_playback_paused(playback)) { - emit_signal(SNAME("finished")); playbacks_to_remove.push_back(playback); } } @@ -91,11 +90,14 @@ void AudioStreamPlayer2D::_notification(int p_what) { active.clear(); set_physics_process_internal(false); } + if (!playbacks_to_remove.is_empty()) { + emit_signal(SNAME("finished")); + } } while (stream_playbacks.size() > max_polyphony) { AudioServer::get_singleton()->stop_playback_stream(stream_playbacks[0]); - stream_playbacks.remove(0); + stream_playbacks.remove_at(0); } } } @@ -110,7 +112,13 @@ StringName AudioStreamPlayer2D::_get_actual_bus() { PhysicsDirectSpaceState2D *space_state = PhysicsServer2D::get_singleton()->space_get_direct_state(world_2d->get_space()); PhysicsDirectSpaceState2D::ShapeResult sr[MAX_INTERSECT_AREAS]; - int areas = space_state->intersect_point(global_pos, sr, MAX_INTERSECT_AREAS, Set<RID>(), area_mask, false, true); + PhysicsDirectSpaceState2D::PointParameters point_params; + point_params.position = global_pos; + point_params.collision_mask = area_mask; + point_params.collide_with_bodies = false; + point_params.collide_with_areas = true; + + int areas = space_state->intersect_point(point_params, sr, MAX_INTERSECT_AREAS); for (int i = 0; i < areas; i++) { Area2D *area2d = Object::cast_to<Area2D>(sr[i].collider); diff --git a/scene/2d/camera_2d.cpp b/scene/2d/camera_2d.cpp index 8195d98f55..b6902686fe 100644 --- a/scene/2d/camera_2d.cpp +++ b/scene/2d/camera_2d.cpp @@ -176,7 +176,7 @@ Transform2D Camera2D::get_camera_transform() { Rect2 screen_rect(-screen_offset + ret_camera_pos, screen_size * zoom); - if (!limit_smoothing_enabled) { + if (!smoothing_enabled || !limit_smoothing_enabled) { if (screen_rect.position.x < limit[SIDE_LEFT]) { screen_rect.position.x = limit[SIDE_LEFT]; } @@ -232,6 +232,7 @@ void Camera2D::_notification(int p_what) { } break; case NOTIFICATION_ENTER_TREE: { + ERR_FAIL_COND(!is_inside_tree()); if (custom_viewport && ObjectDB::get_instance(custom_viewport_id)) { viewport = custom_viewport; } else { @@ -660,7 +661,7 @@ bool Camera2D::is_margin_drawing_enabled() const { void Camera2D::_validate_property(PropertyInfo &property) const { if (!smoothing_enabled && property.name == "smoothing_speed") { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/2d/collision_object_2d.cpp b/scene/2d/collision_object_2d.cpp index 6916f832d0..bd13d96b01 100644 --- a/scene/2d/collision_object_2d.cpp +++ b/scene/2d/collision_object_2d.cpp @@ -50,7 +50,9 @@ void CollisionObject2D::_notification(int p_what) { } if (!disabled || (disable_mode != DISABLE_MODE_REMOVE)) { - RID space = get_world_2d()->get_space(); + Ref<World2D> world_ref = get_world_2d(); + ERR_FAIL_COND(!world_ref.is_valid()); + RID space = world_ref->get_space(); if (area) { PhysicsServer2D::get_singleton()->area_set_space(rid, space); } else { @@ -432,7 +434,7 @@ void CollisionObject2D::shape_owner_remove_shape(uint32_t p_owner, int p_shape) PhysicsServer2D::get_singleton()->body_remove_shape(rid, index_to_remove); } - shapes[p_owner].shapes.remove(p_shape); + shapes[p_owner].shapes.remove_at(p_shape); for (KeyValue<uint32_t, ShapeData> &E : shapes) { for (int i = 0; i < E.value.shapes.size(); i++) { @@ -454,7 +456,7 @@ void CollisionObject2D::shape_owner_clear_shapes(uint32_t p_owner) { } uint32_t CollisionObject2D::shape_find_owner(int p_shape_index) const { - ERR_FAIL_INDEX_V(p_shape_index, total_subshapes, 0); + ERR_FAIL_INDEX_V(p_shape_index, total_subshapes, UINT32_MAX); for (const KeyValue<uint32_t, ShapeData> &E : shapes) { for (int i = 0; i < E.value.shapes.size(); i++) { @@ -465,7 +467,7 @@ uint32_t CollisionObject2D::shape_find_owner(int p_shape_index) const { } //in theory it should be unreachable - return 0; + ERR_FAIL_V_MSG(UINT32_MAX, "Can't find owner for shape index " + itos(p_shape_index) + "."); } void CollisionObject2D::set_pickable(bool p_enabled) { diff --git a/scene/2d/collision_polygon_2d.cpp b/scene/2d/collision_polygon_2d.cpp index 271a4da705..00bfa62449 100644 --- a/scene/2d/collision_polygon_2d.cpp +++ b/scene/2d/collision_polygon_2d.cpp @@ -131,6 +131,7 @@ void CollisionPolygon2D::_notification(int p_what) { } break; case NOTIFICATION_DRAW: { + ERR_FAIL_COND(!is_inside_tree()); if (!Engine::get_singleton()->is_editor_hint() && !get_tree()->is_debugging_collisions_hint()) { break; } diff --git a/scene/2d/collision_shape_2d.cpp b/scene/2d/collision_shape_2d.cpp index 54cb851216..c7742c7ba5 100644 --- a/scene/2d/collision_shape_2d.cpp +++ b/scene/2d/collision_shape_2d.cpp @@ -88,6 +88,8 @@ void CollisionShape2D::_notification(int p_what) { } break; case NOTIFICATION_DRAW: { + ERR_FAIL_COND(!is_inside_tree()); + if (!Engine::get_singleton()->is_editor_hint() && !get_tree()->is_debugging_collisions_hint()) { break; } diff --git a/scene/2d/cpu_particles_2d.cpp b/scene/2d/cpu_particles_2d.cpp index bf26ec1f20..3bc212ffca 100644 --- a/scene/2d/cpu_particles_2d.cpp +++ b/scene/2d/cpu_particles_2d.cpp @@ -398,6 +398,14 @@ Ref<Gradient> CPUParticles2D::get_color_ramp() const { return color_ramp; } +void CPUParticles2D::set_color_initial_ramp(const Ref<Gradient> &p_ramp) { + color_initial_ramp = p_ramp; +} + +Ref<Gradient> CPUParticles2D::get_color_initial_ramp() const { + return color_initial_ramp; +} + void CPUParticles2D::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); particle_flags[p_particle_flag] = p_enable; @@ -727,9 +735,15 @@ void CPUParticles2D::_particles_process(double p_delta) { p.hue_rot_rand = Math::randf(); p.anim_offset_rand = Math::randf(); + if (color_initial_ramp.is_valid()) { + p.start_color_rand = color_initial_ramp->get_color_at_offset(Math::randf()); + } else { + p.start_color_rand = Color(1, 1, 1, 1); + } + real_t angle1_rad = direction.angle() + Math::deg2rad((Math::randf() * 2.0 - 1.0) * spread); Vector2 rot = Vector2(Math::cos(angle1_rad), Math::sin(angle1_rad)); - p.velocity = rot * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], Math::randf()); + p.velocity = rot * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], (real_t)Math::randf()); real_t base_angle = tex_angle * Math::lerp(parameters_min[PARAM_ANGLE], parameters_max[PARAM_ANGLE], p.angle_rand); p.rotation = Math::deg2rad(base_angle); @@ -890,7 +904,7 @@ void CPUParticles2D::_particles_process(double p_delta) { real_t base_angle = (tex_angle)*Math::lerp(parameters_min[PARAM_ANGLE], parameters_max[PARAM_ANGLE], p.angle_rand); base_angle += p.custom[1] * lifetime * tex_angular_velocity * Math::lerp(parameters_min[PARAM_ANGULAR_VELOCITY], parameters_max[PARAM_ANGULAR_VELOCITY], rand_from_seed(alt_seed)); p.rotation = Math::deg2rad(base_angle); //angle - p.custom[2] = tex_anim_offset * Math::lerp(parameters_min[PARAM_ANIM_OFFSET], parameters_max[PARAM_ANIM_OFFSET], p.anim_offset_rand) + p.custom[1] * tex_anim_speed * Math::lerp(parameters_min[PARAM_ANIM_SPEED], parameters_max[PARAM_ANIM_SPEED], rand_from_seed(alt_seed)); + p.custom[2] = tex_anim_offset * Math::lerp(parameters_min[PARAM_ANIM_OFFSET], parameters_max[PARAM_ANIM_OFFSET], p.anim_offset_rand) + tv * tex_anim_speed * Math::lerp(parameters_min[PARAM_ANIM_SPEED], parameters_max[PARAM_ANIM_SPEED], rand_from_seed(alt_seed)); } //apply color //apply hue rotation @@ -946,7 +960,7 @@ void CPUParticles2D::_particles_process(double p_delta) { p.color.g = color_rgb.y; p.color.b = color_rgb.z; - p.color *= p.base_color; + p.color *= p.base_color * p.start_color_rand; if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { if (p.velocity.length() > 0.0) { @@ -1168,11 +1182,16 @@ void CPUParticles2D::convert_from_particles(Node *p_particles) { set_color(material->get_color()); - Ref<GradientTexture> gt = material->get_color_ramp(); + Ref<GradientTexture1D> gt = material->get_color_ramp(); if (gt.is_valid()) { set_color_ramp(gt->get_gradient()); } + Ref<GradientTexture1D> gti = material->get_color_initial_ramp(); + if (gti.is_valid()) { + set_color_initial_ramp(gti->get_gradient()); + } + set_particle_flag(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY)); set_emission_shape(EmissionShape(material->get_emission_shape())); @@ -1295,6 +1314,9 @@ void CPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &CPUParticles2D::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &CPUParticles2D::get_color_ramp); + ClassDB::bind_method(D_METHOD("set_color_initial_ramp", "ramp"), &CPUParticles2D::set_color_initial_ramp); + ClassDB::bind_method(D_METHOD("get_color_initial_ramp"), &CPUParticles2D::get_color_initial_ramp); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &CPUParticles2D::set_particle_flag); ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &CPUParticles2D::get_particle_flag); @@ -1386,6 +1408,7 @@ void CPUParticles2D::_bind_methods() { ADD_GROUP("Color", ""); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_ramp", PROPERTY_HINT_RESOURCE_TYPE, "Gradient"), "set_color_ramp", "get_color_ramp"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_initial_ramp", PROPERTY_HINT_RESOURCE_TYPE, "Gradient"), "set_color_initial_ramp", "get_color_initial_ramp"); ADD_GROUP("Hue Variation", "hue_"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "hue_variation_min", PROPERTY_HINT_RANGE, "-1,1,0.01"), "set_param_min", "get_param_min", PARAM_HUE_VARIATION); diff --git a/scene/2d/cpu_particles_2d.h b/scene/2d/cpu_particles_2d.h index 4990d443e3..3cb3d64855 100644 --- a/scene/2d/cpu_particles_2d.h +++ b/scene/2d/cpu_particles_2d.h @@ -89,6 +89,7 @@ private: real_t scale_rand = 0.0; real_t hue_rot_rand = 0.0; real_t anim_offset_rand = 0.0; + Color start_color_rand; double time = 0.0; double lifetime = 0.0; Color base_color; @@ -156,6 +157,7 @@ private: Ref<Curve> curve_parameters[PARAM_MAX]; Color color; Ref<Gradient> color_ramp; + Ref<Gradient> color_initial_ramp; bool particle_flags[PARTICLE_FLAG_MAX]; @@ -201,7 +203,6 @@ public: void set_explosiveness_ratio(real_t p_ratio); void set_randomness_ratio(real_t p_ratio); void set_lifetime_randomness(double p_random); - void set_visibility_aabb(const Rect2 &p_aabb); void set_use_local_coordinates(bool p_enable); void set_speed_scale(double p_scale); @@ -213,7 +214,6 @@ public: real_t get_explosiveness_ratio() const; real_t get_randomness_ratio() const; double get_lifetime_randomness() const; - Rect2 get_visibility_aabb() const; bool get_use_local_coordinates() const; double get_speed_scale() const; @@ -226,9 +226,6 @@ public: void set_draw_order(DrawOrder p_order); DrawOrder get_draw_order() const; - void set_draw_passes(int p_count); - int get_draw_passes() const; - void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; @@ -255,6 +252,9 @@ public: void set_color_ramp(const Ref<Gradient> &p_ramp); Ref<Gradient> get_color_ramp() const; + void set_color_initial_ramp(const Ref<Gradient> &p_ramp); + Ref<Gradient> get_color_initial_ramp() const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); bool get_particle_flag(ParticleFlags p_particle_flag) const; @@ -264,7 +264,6 @@ public: void set_emission_points(const Vector<Vector2> &p_points); void set_emission_normals(const Vector<Vector2> &p_normals); void set_emission_colors(const Vector<Color> &p_colors); - void set_emission_point_count(int p_count); void set_scale_curve_x(Ref<Curve> p_scale_curve); void set_scale_curve_y(Ref<Curve> p_scale_curve); void set_split_scale(bool p_split_scale); @@ -275,7 +274,6 @@ public: Vector<Vector2> get_emission_points() const; Vector<Vector2> get_emission_normals() const; Vector<Color> get_emission_colors() const; - int get_emission_point_count() const; Ref<Curve> get_scale_curve_x() const; Ref<Curve> get_scale_curve_y() const; bool get_split_scale(); diff --git a/scene/2d/gpu_particles_2d.cpp b/scene/2d/gpu_particles_2d.cpp index 3637594e1b..4384ec8141 100644 --- a/scene/2d/gpu_particles_2d.cpp +++ b/scene/2d/gpu_particles_2d.cpp @@ -170,6 +170,13 @@ void GPUParticles2D::set_trail_section_subdivisions(int p_subdivisions) { update(); } +#ifdef TOOLS_ENABLED +void GPUParticles2D::set_show_visibility_rect(bool p_show_visibility_rect) { + show_visibility_rect = p_show_visibility_rect; + update(); +} +#endif + bool GPUParticles2D::is_trail_enabled() const { return trail_enabled; } @@ -284,7 +291,7 @@ TypedArray<String> GPUParticles2D::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); if (RenderingServer::get_singleton()->is_low_end()) { - warnings.push_back(TTR("GPU-based particles are not supported by the GLES2 video driver.\nUse the CPUParticles2D node instead. You can use the \"Convert to CPUParticles2D\" option for this purpose.")); + warnings.push_back(TTR("GPU-based particles are not supported by the OpenGL video driver.\nUse the CPUParticles2D node instead. You can use the \"Convert to CPUParticles2D\" option for this purpose.")); } if (process_material.is_null()) { @@ -452,7 +459,7 @@ void GPUParticles2D::_notification(int p_what) { RS::get_singleton()->canvas_item_add_particles(get_canvas_item(), particles, texture_rid); #ifdef TOOLS_ENABLED - if (Engine::get_singleton()->is_editor_hint() && (this == get_tree()->get_edited_scene_root() || get_tree()->get_edited_scene_root()->is_ancestor_of(this))) { + if (show_visibility_rect) { draw_rect(visibility_rect, Color(0, 0.7, 0.9, 0.4), false); } #endif @@ -532,6 +539,7 @@ void GPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_trail_section_subdivisions"), &GPUParticles2D::get_trail_section_subdivisions); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "emitting"), "set_emitting", "is_emitting"); + ADD_PROPERTY_DEFAULT("emitting", true); // Workaround for doctool in headless mode, as dummy rasterizer always returns false. ADD_PROPERTY(PropertyInfo(Variant::INT, "amount", PROPERTY_HINT_RANGE, "1,1000000,1,exp"), "set_amount", "get_amount"); ADD_GROUP("Time", ""); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lifetime", PROPERTY_HINT_RANGE, "0.01,600.0,0.01,or_greater"), "set_lifetime", "get_lifetime"); @@ -587,6 +595,9 @@ GPUParticles2D::GPUParticles2D() { set_speed_scale(1); set_fixed_fps(30); set_collision_base_size(collision_base_size); +#ifdef TOOLS_ENABLED + show_visibility_rect = false; +#endif } GPUParticles2D::~GPUParticles2D() { diff --git a/scene/2d/gpu_particles_2d.h b/scene/2d/gpu_particles_2d.h index d7eee461b4..a9e66b3051 100644 --- a/scene/2d/gpu_particles_2d.h +++ b/scene/2d/gpu_particles_2d.h @@ -58,7 +58,9 @@ private: bool local_coords; int fixed_fps; bool fractional_delta; - +#ifdef TOOLS_ENABLED + bool show_visibility_rect; +#endif Ref<Material> process_material; DrawOrder draw_order; @@ -81,7 +83,6 @@ protected: static void _bind_methods(); virtual void _validate_property(PropertyInfo &property) const override; void _notification(int p_what); - void _update_collision_size(); public: @@ -102,6 +103,10 @@ public: void set_trail_sections(int p_sections); void set_trail_section_subdivisions(int p_subdivisions); +#ifdef TOOLS_ENABLED + void set_show_visibility_rect(bool p_show_visibility_rect); +#endif + bool is_emitting() const; int get_amount() const; double get_lifetime() const; diff --git a/scene/2d/light_2d.cpp b/scene/2d/light_2d.cpp index 1853b3428c..66c0f979ae 100644 --- a/scene/2d/light_2d.cpp +++ b/scene/2d/light_2d.cpp @@ -221,7 +221,7 @@ real_t Light2D::get_shadow_smooth() const { void Light2D::_validate_property(PropertyInfo &property) const { if (!shadow && (property.name == "shadow_color" || property.name == "shadow_filter" || property.name == "shadow_filter_smooth" || property.name == "shadow_item_cull_mask")) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/2d/line_2d.cpp b/scene/2d/line_2d.cpp index 37eb45c21d..00767ec22c 100644 --- a/scene/2d/line_2d.cpp +++ b/scene/2d/line_2d.cpp @@ -148,7 +148,7 @@ void Line2D::add_point(Vector2 p_pos, int p_atpos) { } void Line2D::remove_point(int i) { - _points.remove(i); + _points.remove_at(i); update(); } diff --git a/scene/2d/line_builder.cpp b/scene/2d/line_builder.cpp index a8a2639ccf..05d77f8224 100644 --- a/scene/2d/line_builder.cpp +++ b/scene/2d/line_builder.cpp @@ -128,9 +128,9 @@ void LineBuilder::build() { _interpolate_color = gradient != nullptr; bool retrieve_curve = curve != nullptr; bool distance_required = _interpolate_color || - retrieve_curve || - texture_mode == Line2D::LINE_TEXTURE_TILE || - texture_mode == Line2D::LINE_TEXTURE_STRETCH; + retrieve_curve || + texture_mode == Line2D::LINE_TEXTURE_TILE || + texture_mode == Line2D::LINE_TEXTURE_STRETCH; if (distance_required) { total_distance = calculate_total_distance(points); //Adjust totalDistance. diff --git a/scene/2d/mesh_instance_2d.cpp b/scene/2d/mesh_instance_2d.cpp index 15008390b7..58bff97da9 100644 --- a/scene/2d/mesh_instance_2d.cpp +++ b/scene/2d/mesh_instance_2d.cpp @@ -96,6 +96,10 @@ Rect2 MeshInstance2D::_edit_get_rect() const { return Node2D::_edit_get_rect(); } + +bool MeshInstance2D::_edit_use_rect() const { + return mesh.is_valid(); +} #endif MeshInstance2D::MeshInstance2D() { diff --git a/scene/2d/mesh_instance_2d.h b/scene/2d/mesh_instance_2d.h index adfda4cf7f..f94d53da7d 100644 --- a/scene/2d/mesh_instance_2d.h +++ b/scene/2d/mesh_instance_2d.h @@ -48,6 +48,7 @@ protected: public: #ifdef TOOLS_ENABLED virtual Rect2 _edit_get_rect() const override; + virtual bool _edit_use_rect() const override; #endif void set_mesh(const Ref<Mesh> &p_mesh); diff --git a/scene/2d/navigation_agent_2d.cpp b/scene/2d/navigation_agent_2d.cpp index 2f00978123..7faa964407 100644 --- a/scene/2d/navigation_agent_2d.cpp +++ b/scene/2d/navigation_agent_2d.cpp @@ -184,7 +184,7 @@ Vector2 NavigationAgent2D::get_target_location() const { Vector2 NavigationAgent2D::get_next_location() { update_navigation(); if (navigation_path.size() == 0) { - ERR_FAIL_COND_V(agent_parent == nullptr, Vector2()); + ERR_FAIL_COND_V_MSG(agent_parent == nullptr, Vector2(), "The agent has no parent."); return agent_parent->get_global_position(); } else { return navigation_path[nav_path_index]; @@ -192,7 +192,7 @@ Vector2 NavigationAgent2D::get_next_location() { } real_t NavigationAgent2D::distance_to_target() const { - ERR_FAIL_COND_V(agent_parent == nullptr, 0.0); + ERR_FAIL_COND_V_MSG(agent_parent == nullptr, 0.0, "The agent has no parent."); return agent_parent->get_global_position().distance_to(target_location); } diff --git a/scene/2d/navigation_obstacle_2d.cpp b/scene/2d/navigation_obstacle_2d.cpp index 0a105826c0..8802a1098a 100644 --- a/scene/2d/navigation_obstacle_2d.cpp +++ b/scene/2d/navigation_obstacle_2d.cpp @@ -34,19 +34,41 @@ #include "servers/navigation_server_2d.h" void NavigationObstacle2D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_estimate_radius", "estimate_radius"), &NavigationObstacle2D::set_estimate_radius); + ClassDB::bind_method(D_METHOD("is_radius_estimated"), &NavigationObstacle2D::is_radius_estimated); + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &NavigationObstacle2D::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &NavigationObstacle2D::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "estimate_radius"), "set_estimate_radius", "is_radius_estimated"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,500,0.01"), "set_radius", "get_radius"); +} + +void NavigationObstacle2D::_validate_property(PropertyInfo &p_property) const { + if (p_property.name == "radius") { + if (estimate_radius) { + p_property.usage = PROPERTY_USAGE_NO_EDITOR; + } + } } void NavigationObstacle2D::_notification(int p_what) { switch (p_what) { case NOTIFICATION_READY: { + initialize_agent(); + parent_node2d = Object::cast_to<Node2D>(get_parent()); + if (parent_node2d != nullptr) { + // place agent on navigation map first or else the RVO agent callback creation fails silently later + NavigationServer2D::get_singleton()->agent_set_map(get_rid(), parent_node2d->get_world_2d()->get_navigation_map()); + } set_physics_process_internal(true); } break; case NOTIFICATION_EXIT_TREE: { + parent_node2d = nullptr; set_physics_process_internal(false); } break; case NOTIFICATION_PARENTED: { parent_node2d = Object::cast_to<Node2D>(get_parent()); - update_agent_shape(); + reevaluate_agent_radius(); } break; case NOTIFICATION_UNPARENTED: { parent_node2d = nullptr; @@ -78,7 +100,22 @@ TypedArray<String> NavigationObstacle2D::get_configuration_warnings() const { return warnings; } -void NavigationObstacle2D::update_agent_shape() { +void NavigationObstacle2D::initialize_agent() { + NavigationServer2D::get_singleton()->agent_set_neighbor_dist(agent, 0.0); + NavigationServer2D::get_singleton()->agent_set_max_neighbors(agent, 0); + NavigationServer2D::get_singleton()->agent_set_time_horizon(agent, 0.0); + NavigationServer2D::get_singleton()->agent_set_max_speed(agent, 0.0); +} + +void NavigationObstacle2D::reevaluate_agent_radius() { + if (!estimate_radius) { + NavigationServer2D::get_singleton()->agent_set_radius(agent, radius); + } else if (parent_node2d) { + NavigationServer2D::get_singleton()->agent_set_radius(agent, estimate_agent_radius()); + } +} + +real_t NavigationObstacle2D::estimate_agent_radius() const { if (parent_node2d) { // Estimate the radius of this physics body real_t radius = 0.0; @@ -101,15 +138,21 @@ void NavigationObstacle2D::update_agent_shape() { Vector2 s = parent_node2d->get_global_scale(); radius *= MAX(s.x, s.y); - if (radius == 0.0) { - radius = 1.0; // Never a 0 radius + if (radius > 0.0) { + return radius; } - - // Initialize the Agent as an object - NavigationServer2D::get_singleton()->agent_set_neighbor_dist(agent, 0.0); - NavigationServer2D::get_singleton()->agent_set_max_neighbors(agent, 0); - NavigationServer2D::get_singleton()->agent_set_time_horizon(agent, 0.0); - NavigationServer2D::get_singleton()->agent_set_radius(agent, radius); - NavigationServer2D::get_singleton()->agent_set_max_speed(agent, 0.0); } + return 1.0; // Never a 0 radius +} + +void NavigationObstacle2D::set_estimate_radius(bool p_estimate_radius) { + estimate_radius = p_estimate_radius; + notify_property_list_changed(); + reevaluate_agent_radius(); +} + +void NavigationObstacle2D::set_radius(real_t p_radius) { + ERR_FAIL_COND_MSG(p_radius <= 0.0, "Radius must be greater than 0."); + radius = p_radius; + reevaluate_agent_radius(); } diff --git a/scene/2d/navigation_obstacle_2d.h b/scene/2d/navigation_obstacle_2d.h index 9cffc2c0c3..a5603f059f 100644 --- a/scene/2d/navigation_obstacle_2d.h +++ b/scene/2d/navigation_obstacle_2d.h @@ -40,8 +40,12 @@ class NavigationObstacle2D : public Node { Node2D *parent_node2d = nullptr; RID agent; + bool estimate_radius = true; + real_t radius = 1.0; + protected: static void _bind_methods(); + void _validate_property(PropertyInfo &p_property) const override; void _notification(int p_what); public: @@ -52,10 +56,21 @@ public: return agent; } + void set_estimate_radius(bool p_estimate_radius); + bool is_radius_estimated() const { + return estimate_radius; + } + void set_radius(real_t p_radius); + real_t get_radius() const { + return radius; + } + TypedArray<String> get_configuration_warnings() const override; private: - void update_agent_shape(); + void initialize_agent(); + void reevaluate_agent_radius(); + real_t estimate_agent_radius() const; }; #endif diff --git a/scene/2d/navigation_region_2d.cpp b/scene/2d/navigation_region_2d.cpp index cbf0d50c4e..ecd79c23a7 100644 --- a/scene/2d/navigation_region_2d.cpp +++ b/scene/2d/navigation_region_2d.cpp @@ -207,7 +207,7 @@ void NavigationPolygon::set_outline(int p_idx, const Vector<Vector2> &p_outline) void NavigationPolygon::remove_outline(int p_idx) { ERR_FAIL_INDEX(p_idx, outlines.size()); - outlines.remove(p_idx); + outlines.remove_at(p_idx); rect_cache_dirty = true; } @@ -346,9 +346,9 @@ void NavigationPolygon::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_outlines", "outlines"), &NavigationPolygon::_set_outlines); ClassDB::bind_method(D_METHOD("_get_outlines"), &NavigationPolygon::_get_outlines); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR2_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_vertices", "get_vertices"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "polygons", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_polygons", "_get_polygons"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "outlines", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_outlines", "_get_outlines"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR2_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_vertices", "get_vertices"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "polygons", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_polygons", "_get_polygons"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "outlines", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_outlines", "_get_outlines"); } void NavigationRegion2D::set_enabled(bool p_enabled) { @@ -464,7 +464,7 @@ void NavigationRegion2D::_notification(int p_what) { draw_line(a, b, doors_color); // Draw a circle to illustrate the margins. - real_t angle = b.angle_to_point(a); + real_t angle = a.angle_to_point(b); draw_arc(a, radius, angle + Math_PI / 2.0, angle - Math_PI / 2.0 + Math_TAU, 10, doors_color); draw_arc(b, radius, angle - Math_PI / 2.0, angle + Math_PI / 2.0, 10, doors_color); } diff --git a/scene/2d/path_2d.cpp b/scene/2d/path_2d.cpp index ed30e871d7..40211f2a9b 100644 --- a/scene/2d/path_2d.cpp +++ b/scene/2d/path_2d.cpp @@ -100,16 +100,18 @@ void Path2D::_notification(int p_what) { #endif const Color color = Color(0.5, 0.6, 1.0, 0.7); - for (int i = 0; i < curve->get_point_count(); i++) { - Vector2 prev_p = curve->get_point_position(i); + _cached_draw_pts.resize(curve->get_point_count() * 8); + int count = 0; - for (int j = 1; j <= 8; j++) { - real_t frac = j / 8.0; + for (int i = 0; i < curve->get_point_count(); i++) { + for (int j = 0; j < 8; j++) { + real_t frac = j * (1.0 / 8.0); Vector2 p = curve->interpolate(i, frac); - draw_line(prev_p, p, color, line_width); - prev_p = p; + _cached_draw_pts.set(count++, p); } } + + draw_polyline(_cached_draw_pts, color, line_width, true); } } diff --git a/scene/2d/path_2d.h b/scene/2d/path_2d.h index 3b12f025fc..7e8478283f 100644 --- a/scene/2d/path_2d.h +++ b/scene/2d/path_2d.h @@ -38,6 +38,7 @@ class Path2D : public Node2D { GDCLASS(Path2D, Node2D); Ref<Curve2D> curve; + Vector<Vector2> _cached_draw_pts; void _curve_changed(); diff --git a/scene/2d/physics_body_2d.cpp b/scene/2d/physics_body_2d.cpp index 41288d646f..f0e51097db 100644 --- a/scene/2d/physics_body_2d.cpp +++ b/scene/2d/physics_body_2d.cpp @@ -133,9 +133,12 @@ bool PhysicsBody2D::test_move(const Transform2D &p_from, const Vector2 &p_linear ERR_FAIL_COND_V(!is_inside_tree(), false); PhysicsServer2D::MotionResult *r = nullptr; + PhysicsServer2D::MotionResult temp_result; if (r_collision.is_valid()) { // Needs const_cast because method bindings don't support non-const Ref. r = const_cast<PhysicsServer2D::MotionResult *>(&r_collision->result); + } else { + r = &temp_result; } // Hack in order to work with calling from _process as well as from _physics_process; calling from thread is risky. @@ -143,7 +146,14 @@ bool PhysicsBody2D::test_move(const Transform2D &p_from, const Vector2 &p_linear PhysicsServer2D::MotionParameters parameters(p_from, p_linear_velocity * delta, p_margin); - return PhysicsServer2D::get_singleton()->body_test_motion(get_rid(), parameters, r); + bool colliding = PhysicsServer2D::get_singleton()->body_test_motion(get_rid(), parameters, r); + + if (colliding) { + // Don't report collision when the whole motion is done. + return (r->collision_safe_fraction < 1.0); + } else { + return false; + } } TypedArray<PhysicsBody2D> PhysicsBody2D::get_collision_exceptions() { @@ -684,6 +694,24 @@ real_t RigidDynamicBody2D::get_gravity_scale() const { return gravity_scale; } +void RigidDynamicBody2D::set_linear_damp_mode(DampMode p_mode) { + linear_damp_mode = p_mode; + PhysicsServer2D::get_singleton()->body_set_param(get_rid(), PhysicsServer2D::BODY_PARAM_LINEAR_DAMP_MODE, linear_damp_mode); +} + +RigidDynamicBody2D::DampMode RigidDynamicBody2D::get_linear_damp_mode() const { + return linear_damp_mode; +} + +void RigidDynamicBody2D::set_angular_damp_mode(DampMode p_mode) { + angular_damp_mode = p_mode; + PhysicsServer2D::get_singleton()->body_set_param(get_rid(), PhysicsServer2D::BODY_PARAM_ANGULAR_DAMP_MODE, angular_damp_mode); +} + +RigidDynamicBody2D::DampMode RigidDynamicBody2D::get_angular_damp_mode() const { + return angular_damp_mode; +} + void RigidDynamicBody2D::set_linear_damp(real_t p_linear_damp) { ERR_FAIL_COND(p_linear_damp < -1); linear_damp = p_linear_damp; @@ -916,6 +944,12 @@ void RigidDynamicBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_gravity_scale", "gravity_scale"), &RigidDynamicBody2D::set_gravity_scale); ClassDB::bind_method(D_METHOD("get_gravity_scale"), &RigidDynamicBody2D::get_gravity_scale); + ClassDB::bind_method(D_METHOD("set_linear_damp_mode", "linear_damp_mode"), &RigidDynamicBody2D::set_linear_damp_mode); + ClassDB::bind_method(D_METHOD("get_linear_damp_mode"), &RigidDynamicBody2D::get_linear_damp_mode); + + ClassDB::bind_method(D_METHOD("set_angular_damp_mode", "angular_damp_mode"), &RigidDynamicBody2D::set_angular_damp_mode); + ClassDB::bind_method(D_METHOD("get_angular_damp_mode"), &RigidDynamicBody2D::get_angular_damp_mode); + ClassDB::bind_method(D_METHOD("set_linear_damp", "linear_damp"), &RigidDynamicBody2D::set_linear_damp); ClassDB::bind_method(D_METHOD("get_linear_damp"), &RigidDynamicBody2D::get_linear_damp); @@ -992,9 +1026,11 @@ void RigidDynamicBody2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "freeze_mode", PROPERTY_HINT_ENUM, "Static,Kinematic"), "set_freeze_mode", "get_freeze_mode"); ADD_GROUP("Linear", "linear_"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "linear_velocity"), "set_linear_velocity", "get_linear_velocity"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "linear_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_linear_damp_mode", "get_linear_damp_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); ADD_GROUP("Angular", "angular_"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_velocity"), "set_angular_velocity", "get_angular_velocity"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "angular_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_angular_damp_mode", "get_angular_damp_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); ADD_GROUP("Applied Forces", "applied_"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "applied_force"), "set_applied_force", "get_applied_force"); @@ -1012,6 +1048,9 @@ void RigidDynamicBody2D::_bind_methods() { BIND_ENUM_CONSTANT(CENTER_OF_MASS_MODE_AUTO); BIND_ENUM_CONSTANT(CENTER_OF_MASS_MODE_CUSTOM); + BIND_ENUM_CONSTANT(DAMP_MODE_COMBINE); + BIND_ENUM_CONSTANT(DAMP_MODE_REPLACE); + BIND_ENUM_CONSTANT(CCD_MODE_DISABLED); BIND_ENUM_CONSTANT(CCD_MODE_CAST_RAY); BIND_ENUM_CONSTANT(CCD_MODE_CAST_SHAPE); @@ -1020,7 +1059,7 @@ void RigidDynamicBody2D::_bind_methods() { void RigidDynamicBody2D::_validate_property(PropertyInfo &property) const { if (center_of_mass_mode != CENTER_OF_MASS_MODE_CUSTOM) { if (property.name == "center_of_mass") { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } } @@ -1072,6 +1111,10 @@ bool CharacterBody2D::move_and_slide() { if (bs) { Vector2 local_position = gt.elements[2] - bs->get_transform().elements[2]; current_platform_velocity = bs->get_velocity_at_local_position(local_position); + } else { + // Body is removed or destroyed, invalidate floor. + current_platform_velocity = Vector2(); + platform_rid = RID(); } } else { current_platform_velocity = Vector2(); @@ -1101,7 +1144,7 @@ bool CharacterBody2D::move_and_slide() { } if (motion_mode == MOTION_MODE_GROUNDED) { - _move_and_slide_grounded(delta, was_on_floor, current_platform_velocity); + _move_and_slide_grounded(delta, was_on_floor); } else { _move_and_slide_free(delta); } @@ -1122,14 +1165,11 @@ bool CharacterBody2D::move_and_slide() { return motion_results.size() > 0; } -void CharacterBody2D::_move_and_slide_grounded(double p_delta, bool p_was_on_floor, const Vector2 &p_prev_platform_velocity) { +void CharacterBody2D::_move_and_slide_grounded(double p_delta, bool p_was_on_floor) { Vector2 motion = motion_velocity * p_delta; Vector2 motion_slide_up = motion.slide(up_direction); Vector2 prev_floor_normal = floor_normal; - RID prev_platform_rid = platform_rid; - ObjectID prev_platform_object_id = platform_object_id; - int prev_platform_layer = platform_layer; platform_rid = RID(); platform_object_id = ObjectID(); @@ -1202,12 +1242,8 @@ void CharacterBody2D::_move_and_slide_grounded(double p_delta, bool p_was_on_flo gt.elements[2] -= result.travel; set_global_transform(gt); } - on_floor = true; - platform_rid = prev_platform_rid; - platform_object_id = prev_platform_object_id; - platform_layer = prev_platform_layer; - platform_velocity = p_prev_platform_velocity; - floor_normal = prev_floor_normal; + // Determines if you are on the ground. + _snap_on_floor(true, false); motion_velocity = Vector2(); last_motion = Vector2(); motion = Vector2(); @@ -1281,6 +1317,17 @@ void CharacterBody2D::_move_and_slide_grounded(double p_delta, bool p_was_on_flo _snap_on_floor(p_was_on_floor, vel_dir_facing_up); + // Scales the horizontal velocity according to the wall slope. + if (is_on_wall_only() && motion_slide_up.dot(motion_results.get(0).collision_normal) < 0) { + Vector2 slide_motion = motion_velocity.slide(motion_results.get(0).collision_normal); + if (motion_slide_up.dot(slide_motion) < 0) { + motion_velocity = up_direction * up_direction.dot(motion_velocity); + } else { + // Keeps the vertical motion from motion_velocity and add the horizontal motion of the projection. + motion_velocity = up_direction * up_direction.dot(motion_velocity) + slide_motion.slide(up_direction); + } + } + // Reset the gravity accumulation when touching the ground. if (on_floor && !vel_dir_facing_up) { motion_velocity = motion_velocity.slide(up_direction); @@ -1693,9 +1740,9 @@ void CharacterBody2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "motion_mode", PROPERTY_HINT_ENUM, "Grounded,Free", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_motion_mode", "get_motion_mode"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "up_direction"), "set_up_direction", "get_up_direction"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "motion_velocity", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_motion_velocity", "get_motion_velocity"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "motion_velocity", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_motion_velocity", "get_motion_velocity"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "slide_on_ceiling"), "set_slide_on_ceiling_enabled", "is_slide_on_ceiling_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "max_slides", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_max_slides", "get_max_slides"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "max_slides", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_max_slides", "get_max_slides"); ADD_GROUP("Free Mode", "free_mode_"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "free_mode_min_slide_angle", PROPERTY_HINT_RANGE, "0,180,0.1,radians", PROPERTY_USAGE_DEFAULT), "set_free_mode_min_slide_angle", "get_free_mode_min_slide_angle"); @@ -1722,11 +1769,11 @@ void CharacterBody2D::_bind_methods() { void CharacterBody2D::_validate_property(PropertyInfo &property) const { if (motion_mode == MOTION_MODE_FREE) { if (property.name.begins_with("floor_") || property.name == "up_direction" || property.name == "slide_on_ceiling") { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } else { if (property.name == "free_mode_min_slide_angle") { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } } diff --git a/scene/2d/physics_body_2d.h b/scene/2d/physics_body_2d.h index d1f52b33f2..2abce4b0a5 100644 --- a/scene/2d/physics_body_2d.h +++ b/scene/2d/physics_body_2d.h @@ -127,6 +127,11 @@ public: CENTER_OF_MASS_MODE_CUSTOM, }; + enum DampMode { + DAMP_MODE_COMBINE, + DAMP_MODE_REPLACE, + }; + enum CCDMode { CCD_MODE_DISABLED, CCD_MODE_CAST_RAY, @@ -146,8 +151,12 @@ private: Ref<PhysicsMaterial> physics_material_override; real_t gravity_scale = 1.0; - real_t linear_damp = -1.0; - real_t angular_damp = -1.0; + + DampMode linear_damp_mode = DAMP_MODE_COMBINE; + DampMode angular_damp_mode = DAMP_MODE_COMBINE; + + real_t linear_damp = 0.0; + real_t angular_damp = 0.0; Vector2 linear_velocity; real_t angular_velocity = 0.0; @@ -241,6 +250,12 @@ public: void set_gravity_scale(real_t p_gravity_scale); real_t get_gravity_scale() const; + void set_linear_damp_mode(DampMode p_mode); + DampMode get_linear_damp_mode() const; + + void set_angular_damp_mode(DampMode p_mode); + DampMode get_angular_damp_mode() const; + void set_linear_damp(real_t p_linear_damp); real_t get_linear_damp() const; @@ -300,6 +315,7 @@ private: VARIANT_ENUM_CAST(RigidDynamicBody2D::FreezeMode); VARIANT_ENUM_CAST(RigidDynamicBody2D::CenterOfMassMode); +VARIANT_ENUM_CAST(RigidDynamicBody2D::DampMode); VARIANT_ENUM_CAST(RigidDynamicBody2D::CCDMode); class CharacterBody2D : public PhysicsBody2D { @@ -416,7 +432,7 @@ private: MovingPlatformApplyVelocityOnLeave get_moving_platform_apply_velocity_on_leave() const; void _move_and_slide_free(double p_delta); - void _move_and_slide_grounded(double p_delta, bool p_was_on_floor, const Vector2 &p_prev_platform_velocity); + void _move_and_slide_grounded(double p_delta, bool p_was_on_floor); Ref<KinematicCollision2D> _get_slide_collision(int p_bounce); Ref<KinematicCollision2D> _get_last_slide_collision(); diff --git a/scene/2d/polygon_2d.cpp b/scene/2d/polygon_2d.cpp index 7366be5a7d..7a237bf557 100644 --- a/scene/2d/polygon_2d.cpp +++ b/scene/2d/polygon_2d.cpp @@ -92,7 +92,7 @@ bool Polygon2D::_edit_is_selected_on_click(const Point2 &p_point, double p_toler void Polygon2D::_validate_property(PropertyInfo &property) const { if (!invert && property.name == "invert_border") { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } @@ -532,7 +532,7 @@ Vector<float> Polygon2D::get_bone_weights(int p_index) const { void Polygon2D::erase_bone(int p_idx) { ERR_FAIL_INDEX(p_idx, bone_weights.size()); - bone_weights.remove(p_idx); + bone_weights.remove_at(p_idx); } void Polygon2D::clear_bones() { @@ -554,7 +554,9 @@ void Polygon2D::set_bone_path(int p_index, const NodePath &p_path) { Array Polygon2D::_get_bones() const { Array bones; for (int i = 0; i < get_bone_count(); i++) { - bones.push_back(get_bone_path(i)); + // Convert path property to String to avoid errors due to invalid node path in editor, + // because it's relative to the Skeleton2D node and not Polygon2D. + bones.push_back(String(get_bone_path(i))); bones.push_back(get_bone_weights(i)); } return bones; @@ -564,7 +566,8 @@ void Polygon2D::_set_bones(const Array &p_bones) { ERR_FAIL_COND(p_bones.size() & 1); clear_bones(); for (int i = 0; i < p_bones.size(); i += 2) { - add_bone(p_bones[i], p_bones[i + 1]); + // Convert back from String to NodePath. + add_bone(NodePath(p_bones[i]), p_bones[i + 1]); } } @@ -659,7 +662,7 @@ void Polygon2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR2_ARRAY, "uv"), "set_uv", "get_uv"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "vertex_colors"), "set_vertex_colors", "get_vertex_colors"); ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "polygons"), "set_polygons", "get_polygons"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "bones", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "_set_bones", "_get_bones"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "bones", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "_set_bones", "_get_bones"); ADD_PROPERTY(PropertyInfo(Variant::INT, "internal_vertex_count", PROPERTY_HINT_RANGE, "0,1000"), "set_internal_vertex_count", "get_internal_vertex_count"); } diff --git a/scene/2d/ray_cast_2d.cpp b/scene/2d/ray_cast_2d.cpp index 3ac2128c2e..f9830a8743 100644 --- a/scene/2d/ray_cast_2d.cpp +++ b/scene/2d/ray_cast_2d.cpp @@ -157,6 +157,7 @@ void RayCast2D::_notification(int p_what) { } break; case NOTIFICATION_DRAW: { + ERR_FAIL_COND(!is_inside_tree()); if (!Engine::get_singleton()->is_editor_hint() && !get_tree()->is_debugging_collisions_hint()) { break; } @@ -191,7 +192,17 @@ void RayCast2D::_update_raycast_state() { PhysicsDirectSpaceState2D::RayResult rr; bool prev_collision_state = collided; - if (dss->intersect_ray(gt.get_origin(), gt.xform(to), rr, exclude, collision_mask, collide_with_bodies, collide_with_areas)) { + + PhysicsDirectSpaceState2D::RayParameters ray_params; + ray_params.from = gt.get_origin(); + ray_params.to = gt.xform(to); + ray_params.exclude = exclude; + ray_params.collision_mask = collision_mask; + ray_params.collide_with_bodies = collide_with_bodies; + ray_params.collide_with_areas = collide_with_areas; + ray_params.hit_from_inside = hit_from_inside; + + if (dss->intersect_ray(ray_params, rr)) { collided = true; against = rr.collider_id; collision_point = rr.position; @@ -280,22 +291,30 @@ void RayCast2D::clear_exceptions() { exclude.clear(); } -void RayCast2D::set_collide_with_areas(bool p_clip) { - collide_with_areas = p_clip; +void RayCast2D::set_collide_with_areas(bool p_enabled) { + collide_with_areas = p_enabled; } bool RayCast2D::is_collide_with_areas_enabled() const { return collide_with_areas; } -void RayCast2D::set_collide_with_bodies(bool p_clip) { - collide_with_bodies = p_clip; +void RayCast2D::set_collide_with_bodies(bool p_enabled) { + collide_with_bodies = p_enabled; } bool RayCast2D::is_collide_with_bodies_enabled() const { return collide_with_bodies; } +void RayCast2D::set_hit_from_inside(bool p_enabled) { + hit_from_inside = p_enabled; +} + +bool RayCast2D::is_hit_from_inside_enabled() const { + return hit_from_inside; +} + void RayCast2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_enabled", "enabled"), &RayCast2D::set_enabled); ClassDB::bind_method(D_METHOD("is_enabled"), &RayCast2D::is_enabled); @@ -334,10 +353,14 @@ void RayCast2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collide_with_bodies", "enable"), &RayCast2D::set_collide_with_bodies); ClassDB::bind_method(D_METHOD("is_collide_with_bodies_enabled"), &RayCast2D::is_collide_with_bodies_enabled); + ClassDB::bind_method(D_METHOD("set_hit_from_inside", "enable"), &RayCast2D::set_hit_from_inside); + ClassDB::bind_method(D_METHOD("is_hit_from_inside_enabled"), &RayCast2D::is_hit_from_inside_enabled); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "enabled"), "set_enabled", "is_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "exclude_parent"), "set_exclude_parent_body", "get_exclude_parent_body"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "target_position"), "set_target_position", "get_target_position"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_2D_PHYSICS), "set_collision_mask", "get_collision_mask"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hit_from_inside"), "set_hit_from_inside", "is_hit_from_inside_enabled"); ADD_GROUP("Collide With", "collide_with"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collide_with_areas", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collide_with_areas", "is_collide_with_areas_enabled"); diff --git a/scene/2d/ray_cast_2d.h b/scene/2d/ray_cast_2d.h index 65b6e7899b..3ee09fad32 100644 --- a/scene/2d/ray_cast_2d.h +++ b/scene/2d/ray_cast_2d.h @@ -51,6 +51,8 @@ class RayCast2D : public Node2D { bool collide_with_areas = false; bool collide_with_bodies = true; + bool hit_from_inside = false; + void _draw_debug_shape(); protected: @@ -65,6 +67,9 @@ public: void set_collide_with_bodies(bool p_clip); bool is_collide_with_bodies_enabled() const; + void set_hit_from_inside(bool p_enable); + bool is_hit_from_inside_enabled() const; + void set_enabled(bool p_enabled); bool is_enabled() const; diff --git a/scene/2d/shape_cast_2d.cpp b/scene/2d/shape_cast_2d.cpp new file mode 100644 index 0000000000..50b44eb4ef --- /dev/null +++ b/scene/2d/shape_cast_2d.cpp @@ -0,0 +1,459 @@ +/*************************************************************************/ +/* shape_cast_2d.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "shape_cast_2d.h" + +#include "core/config/engine.h" +#include "core/core_string_names.h" +#include "scene/2d/collision_object_2d.h" +#include "scene/2d/physics_body_2d.h" +#include "scene/resources/circle_shape_2d.h" +#include "servers/physics_2d/godot_physics_server_2d.h" + +void ShapeCast2D::set_target_position(const Vector2 &p_point) { + target_position = p_point; + if (is_inside_tree() && (Engine::get_singleton()->is_editor_hint() || get_tree()->is_debugging_collisions_hint())) { + update(); + } +} + +Vector2 ShapeCast2D::get_target_position() const { + return target_position; +} + +void ShapeCast2D::set_margin(real_t p_margin) { + margin = p_margin; +} + +real_t ShapeCast2D::get_margin() const { + return margin; +} + +void ShapeCast2D::set_max_results(int p_max_results) { + max_results = p_max_results; +} + +int ShapeCast2D::get_max_results() const { + return max_results; +} + +void ShapeCast2D::set_collision_mask(uint32_t p_mask) { + collision_mask = p_mask; +} + +uint32_t ShapeCast2D::get_collision_mask() const { + return collision_mask; +} + +void ShapeCast2D::set_collision_mask_value(int p_layer_number, bool p_value) { + ERR_FAIL_COND_MSG(p_layer_number < 1, "Collision layer number must be between 1 and 32 inclusive."); + ERR_FAIL_COND_MSG(p_layer_number > 32, "Collision layer number must be between 1 and 32 inclusive."); + uint32_t mask = get_collision_mask(); + if (p_value) { + mask |= 1 << (p_layer_number - 1); + } else { + mask &= ~(1 << (p_layer_number - 1)); + } + set_collision_mask(mask); +} + +bool ShapeCast2D::get_collision_mask_value(int p_layer_number) const { + ERR_FAIL_COND_V_MSG(p_layer_number < 1, false, "Collision layer number must be between 1 and 32 inclusive."); + ERR_FAIL_COND_V_MSG(p_layer_number > 32, false, "Collision layer number must be between 1 and 32 inclusive."); + return get_collision_mask() & (1 << (p_layer_number - 1)); +} + +int ShapeCast2D::get_collision_count() const { + return result.size(); +} + +bool ShapeCast2D::is_colliding() const { + return collided; +} + +Object *ShapeCast2D::get_collider(int p_idx) const { + ERR_FAIL_INDEX_V_MSG(p_idx, result.size(), nullptr, "No collider found."); + + if (result[p_idx].collider_id.is_null()) { + return nullptr; + } + return ObjectDB::get_instance(result[p_idx].collider_id); +} + +int ShapeCast2D::get_collider_shape(int p_idx) const { + ERR_FAIL_INDEX_V_MSG(p_idx, result.size(), -1, "No collider shape found."); + return result[p_idx].shape; +} + +Vector2 ShapeCast2D::get_collision_point(int p_idx) const { + ERR_FAIL_INDEX_V_MSG(p_idx, result.size(), Vector2(), "No collision point found."); + return result[p_idx].point; +} + +Vector2 ShapeCast2D::get_collision_normal(int p_idx) const { + ERR_FAIL_INDEX_V_MSG(p_idx, result.size(), Vector2(), "No collision normal found."); + return result[p_idx].normal; +} + +real_t ShapeCast2D::get_closest_collision_safe_fraction() const { + return collision_safe_fraction; +} + +real_t ShapeCast2D::get_closest_collision_unsafe_fraction() const { + return collision_unsafe_fraction; +} + +void ShapeCast2D::set_enabled(bool p_enabled) { + enabled = p_enabled; + update(); + if (is_inside_tree() && !Engine::get_singleton()->is_editor_hint()) { + set_physics_process_internal(p_enabled); + } + if (!p_enabled) { + collided = false; + } +} + +bool ShapeCast2D::is_enabled() const { + return enabled; +} + +void ShapeCast2D::set_shape(const Ref<Shape2D> &p_shape) { + shape = p_shape; + if (p_shape.is_valid()) { + shape->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &ShapeCast2D::_redraw_shape)); + shape_rid = shape->get_rid(); + } + update_configuration_warnings(); + update(); +} + +Ref<Shape2D> ShapeCast2D::get_shape() const { + return shape; +} + +void ShapeCast2D::set_exclude_parent_body(bool p_exclude_parent_body) { + if (exclude_parent_body == p_exclude_parent_body) { + return; + } + exclude_parent_body = p_exclude_parent_body; + + if (!is_inside_tree()) { + return; + } + if (Object::cast_to<CollisionObject2D>(get_parent())) { + if (exclude_parent_body) { + exclude.insert(Object::cast_to<CollisionObject2D>(get_parent())->get_rid()); + } else { + exclude.erase(Object::cast_to<CollisionObject2D>(get_parent())->get_rid()); + } + } +} + +bool ShapeCast2D::get_exclude_parent_body() const { + return exclude_parent_body; +} + +void ShapeCast2D::_redraw_shape() { + update(); +} + +void ShapeCast2D::_notification(int p_what) { + switch (p_what) { + case NOTIFICATION_ENTER_TREE: { + if (enabled && !Engine::get_singleton()->is_editor_hint()) { + set_physics_process_internal(true); + } else { + set_physics_process_internal(false); + } + if (Object::cast_to<CollisionObject2D>(get_parent())) { + if (exclude_parent_body) { + exclude.insert(Object::cast_to<CollisionObject2D>(get_parent())->get_rid()); + } else { + exclude.erase(Object::cast_to<CollisionObject2D>(get_parent())->get_rid()); + } + } + } break; + case NOTIFICATION_EXIT_TREE: { + if (enabled) { + set_physics_process_internal(false); + } + } break; + + case NOTIFICATION_DRAW: { +#ifdef TOOLS_ENABLED + ERR_FAIL_COND(!is_inside_tree()); + if (!Engine::get_singleton()->is_editor_hint() && !get_tree()->is_debugging_collisions_hint()) { + break; + } + if (shape.is_null()) { + break; + } + Color draw_col = get_tree()->get_debug_collisions_color(); + if (!enabled) { + float g = draw_col.get_v(); + draw_col.r = g; + draw_col.g = g; + draw_col.b = g; + } + // Draw continuos chain of shapes along the cast. + const int steps = MAX(2, target_position.length() / shape->get_rect().get_size().length() * 4); + for (int i = 0; i <= steps; ++i) { + Vector2 t = (real_t(i) / steps) * target_position; + draw_set_transform(t, 0.0, Size2(1, 1)); + shape->draw(get_canvas_item(), draw_col); + } + draw_set_transform(Vector2(), 0.0, Size2(1, 1)); + + // Draw an arrow indicating where the ShapeCast is pointing to. + if (target_position != Vector2()) { + Transform2D xf; + xf.rotate(target_position.angle()); + xf.translate(Vector2(target_position.length(), 0)); + + draw_line(Vector2(), target_position, draw_col, 2); + Vector<Vector2> pts; + float tsize = 8; + pts.push_back(xf.xform(Vector2(tsize, 0))); + pts.push_back(xf.xform(Vector2(0, Math_SQRT12 * tsize))); + pts.push_back(xf.xform(Vector2(0, -Math_SQRT12 * tsize))); + Vector<Color> cols; + for (int i = 0; i < 3; i++) + cols.push_back(draw_col); + + draw_primitive(pts, cols, Vector<Vector2>()); + } +#endif + } break; + case NOTIFICATION_INTERNAL_PHYSICS_PROCESS: { + if (!enabled) { + break; + } + _update_shapecast_state(); + } break; + } +} + +void ShapeCast2D::_update_shapecast_state() { + result.clear(); + + ERR_FAIL_COND_MSG(shape.is_null(), "Invalid shape."); + + Ref<World2D> w2d = get_world_2d(); + ERR_FAIL_COND(w2d.is_null()); + + PhysicsDirectSpaceState2D *dss = PhysicsServer2D::get_singleton()->space_get_direct_state(w2d->get_space()); + ERR_FAIL_COND(!dss); + + Transform2D gt = get_global_transform(); + + PhysicsDirectSpaceState2D::ShapeParameters params; + params.shape_rid = shape_rid; + params.transform = gt; + params.motion = gt.basis_xform(target_position); + params.margin = margin; + params.exclude = exclude; + params.collision_mask = collision_mask; + params.collide_with_bodies = collide_with_bodies; + params.collide_with_areas = collide_with_areas; + + collision_safe_fraction = 0.0; + collision_unsafe_fraction = 0.0; + + if (target_position != Vector2()) { + dss->cast_motion(params, collision_safe_fraction, collision_unsafe_fraction); + if (collision_unsafe_fraction < 1.0) { + // Move shape transform to the point of impact, + // so we can collect contact info at that point. + gt.set_origin(gt.get_origin() + params.motion * (collision_unsafe_fraction + CMP_EPSILON)); + params.transform = gt; + } + } + // Regardless of whether the shape is stuck or it's moved along + // the motion vector, we'll only consider static collisions from now on. + params.motion = Vector2(); + + bool intersected = true; + while (intersected && result.size() < max_results) { + PhysicsDirectSpaceState2D::ShapeRestInfo info; + intersected = dss->rest_info(params, &info); + if (intersected) { + result.push_back(info); + params.exclude.insert(info.rid); + } + } + collided = !result.is_empty(); +} + +void ShapeCast2D::force_shapecast_update() { + _update_shapecast_state(); +} + +void ShapeCast2D::add_exception_rid(const RID &p_rid) { + exclude.insert(p_rid); +} + +void ShapeCast2D::add_exception(const Object *p_object) { + ERR_FAIL_NULL(p_object); + const CollisionObject2D *co = Object::cast_to<CollisionObject2D>(p_object); + if (!co) { + return; + } + add_exception_rid(co->get_rid()); +} + +void ShapeCast2D::remove_exception_rid(const RID &p_rid) { + exclude.erase(p_rid); +} + +void ShapeCast2D::remove_exception(const Object *p_object) { + ERR_FAIL_NULL(p_object); + const CollisionObject2D *co = Object::cast_to<CollisionObject2D>(p_object); + if (!co) { + return; + } + remove_exception_rid(co->get_rid()); +} + +void ShapeCast2D::clear_exceptions() { + exclude.clear(); +} + +void ShapeCast2D::set_collide_with_areas(bool p_clip) { + collide_with_areas = p_clip; +} + +bool ShapeCast2D::is_collide_with_areas_enabled() const { + return collide_with_areas; +} + +void ShapeCast2D::set_collide_with_bodies(bool p_clip) { + collide_with_bodies = p_clip; +} + +bool ShapeCast2D::is_collide_with_bodies_enabled() const { + return collide_with_bodies; +} + +Array ShapeCast2D::_get_collision_result() const { + Array ret; + + for (int i = 0; i < result.size(); ++i) { + const PhysicsDirectSpaceState2D::ShapeRestInfo &sri = result[i]; + + Dictionary col; + col["point"] = sri.point; + col["normal"] = sri.normal; + col["rid"] = sri.rid; + col["collider"] = ObjectDB::get_instance(sri.collider_id); + col["collider_id"] = sri.collider_id; + col["shape"] = sri.shape; + col["linear_velocity"] = sri.linear_velocity; + + ret.push_back(col); + } + return ret; +} + +TypedArray<String> ShapeCast2D::get_configuration_warnings() const { + TypedArray<String> warnings = Node2D::get_configuration_warnings(); + + if (shape.is_null()) { + warnings.push_back(TTR("This node cannot interact with other objects unless a Shape2D is assigned.")); + } + return warnings; +} + +void ShapeCast2D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_enabled", "enabled"), &ShapeCast2D::set_enabled); + ClassDB::bind_method(D_METHOD("is_enabled"), &ShapeCast2D::is_enabled); + + ClassDB::bind_method(D_METHOD("set_shape", "shape"), &ShapeCast2D::set_shape); + ClassDB::bind_method(D_METHOD("get_shape"), &ShapeCast2D::get_shape); + + ClassDB::bind_method(D_METHOD("set_target_position", "local_point"), &ShapeCast2D::set_target_position); + ClassDB::bind_method(D_METHOD("get_target_position"), &ShapeCast2D::get_target_position); + + ClassDB::bind_method(D_METHOD("set_margin", "margin"), &ShapeCast2D::set_margin); + ClassDB::bind_method(D_METHOD("get_margin"), &ShapeCast2D::get_margin); + + ClassDB::bind_method(D_METHOD("set_max_results", "max_results"), &ShapeCast2D::set_max_results); + ClassDB::bind_method(D_METHOD("get_max_results"), &ShapeCast2D::get_max_results); + + ClassDB::bind_method(D_METHOD("is_colliding"), &ShapeCast2D::is_colliding); + ClassDB::bind_method(D_METHOD("get_collision_count"), &ShapeCast2D::get_collision_count); + + ClassDB::bind_method(D_METHOD("force_shapecast_update"), &ShapeCast2D::force_shapecast_update); + + ClassDB::bind_method(D_METHOD("get_collider", "index"), &ShapeCast2D::get_collider); + ClassDB::bind_method(D_METHOD("get_collider_shape", "index"), &ShapeCast2D::get_collider_shape); + ClassDB::bind_method(D_METHOD("get_collision_point", "index"), &ShapeCast2D::get_collision_point); + ClassDB::bind_method(D_METHOD("get_collision_normal", "index"), &ShapeCast2D::get_collision_normal); + + ClassDB::bind_method(D_METHOD("get_closest_collision_safe_fraction"), &ShapeCast2D::get_closest_collision_safe_fraction); + ClassDB::bind_method(D_METHOD("get_closest_collision_unsafe_fraction"), &ShapeCast2D::get_closest_collision_unsafe_fraction); + + ClassDB::bind_method(D_METHOD("add_exception_rid", "rid"), &ShapeCast2D::add_exception_rid); + ClassDB::bind_method(D_METHOD("add_exception", "node"), &ShapeCast2D::add_exception); + + ClassDB::bind_method(D_METHOD("remove_exception_rid", "rid"), &ShapeCast2D::remove_exception_rid); + ClassDB::bind_method(D_METHOD("remove_exception", "node"), &ShapeCast2D::remove_exception); + + ClassDB::bind_method(D_METHOD("clear_exceptions"), &ShapeCast2D::clear_exceptions); + + ClassDB::bind_method(D_METHOD("set_collision_mask", "mask"), &ShapeCast2D::set_collision_mask); + ClassDB::bind_method(D_METHOD("get_collision_mask"), &ShapeCast2D::get_collision_mask); + + ClassDB::bind_method(D_METHOD("set_collision_mask_value", "layer_number", "value"), &ShapeCast2D::set_collision_mask_value); + ClassDB::bind_method(D_METHOD("get_collision_mask_value", "layer_number"), &ShapeCast2D::get_collision_mask_value); + + ClassDB::bind_method(D_METHOD("set_exclude_parent_body", "mask"), &ShapeCast2D::set_exclude_parent_body); + ClassDB::bind_method(D_METHOD("get_exclude_parent_body"), &ShapeCast2D::get_exclude_parent_body); + + ClassDB::bind_method(D_METHOD("set_collide_with_areas", "enable"), &ShapeCast2D::set_collide_with_areas); + ClassDB::bind_method(D_METHOD("is_collide_with_areas_enabled"), &ShapeCast2D::is_collide_with_areas_enabled); + + ClassDB::bind_method(D_METHOD("set_collide_with_bodies", "enable"), &ShapeCast2D::set_collide_with_bodies); + ClassDB::bind_method(D_METHOD("is_collide_with_bodies_enabled"), &ShapeCast2D::is_collide_with_bodies_enabled); + + ClassDB::bind_method(D_METHOD("_get_collision_result"), &ShapeCast2D::_get_collision_result); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "enabled"), "set_enabled", "is_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shape", PROPERTY_HINT_RESOURCE_TYPE, "Shape2D"), "set_shape", "get_shape"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "exclude_parent"), "set_exclude_parent_body", "get_exclude_parent_body"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "target_position"), "set_target_position", "get_target_position"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "margin", PROPERTY_HINT_RANGE, "0,100,0.01"), "set_margin", "get_margin"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "max_results"), "set_max_results", "get_max_results"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_2D_PHYSICS), "set_collision_mask", "get_collision_mask"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "collision_result", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "", "_get_collision_result"); + ADD_GROUP("Collide With", "collide_with"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collide_with_areas", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collide_with_areas", "is_collide_with_areas_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collide_with_bodies", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collide_with_bodies", "is_collide_with_bodies_enabled"); +} diff --git a/scene/2d/shape_cast_2d.h b/scene/2d/shape_cast_2d.h new file mode 100644 index 0000000000..fca6b46155 --- /dev/null +++ b/scene/2d/shape_cast_2d.h @@ -0,0 +1,120 @@ +/*************************************************************************/ +/* shape_cast_2d.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef SHAPE_CAST_2D +#define SHAPE_CAST_2D + +#include "scene/2d/node_2d.h" +#include "scene/resources/shape_2d.h" + +class ShapeCast2D : public Node2D { + GDCLASS(ShapeCast2D, Node2D); + + bool enabled = true; + + Ref<Shape2D> shape; + RID shape_rid; + Vector2 target_position = Vector2(0, 50); + + Set<RID> exclude; + real_t margin = 0.0; + uint32_t collision_mask = 1; + bool exclude_parent_body = true; + bool collide_with_areas = false; + bool collide_with_bodies = true; + + // Result + int max_results = 32; + Vector<PhysicsDirectSpaceState2D::ShapeRestInfo> result; + bool collided = false; + real_t collision_safe_fraction = 1.0; + real_t collision_unsafe_fraction = 1.0; + + Array _get_collision_result() const; + void _redraw_shape(); + +protected: + void _notification(int p_what); + void _update_shapecast_state(); + static void _bind_methods(); + +public: + void set_collide_with_areas(bool p_clip); + bool is_collide_with_areas_enabled() const; + + void set_collide_with_bodies(bool p_clip); + bool is_collide_with_bodies_enabled() const; + + void set_enabled(bool p_enabled); + bool is_enabled() const; + + void set_shape(const Ref<Shape2D> &p_shape); + Ref<Shape2D> get_shape() const; + + void set_target_position(const Vector2 &p_point); + Vector2 get_target_position() const; + + void set_margin(real_t p_margin); + real_t get_margin() const; + + void set_max_results(int p_max_results); + int get_max_results() const; + + void set_collision_mask(uint32_t p_mask); + uint32_t get_collision_mask() const; + + void set_collision_mask_value(int p_layer_number, bool p_value); + bool get_collision_mask_value(int p_layer_number) const; + + void set_exclude_parent_body(bool p_exclude_parent_body); + bool get_exclude_parent_body() const; + + void force_shapecast_update(); + bool is_colliding() const; + + int get_collision_count() const; + Object *get_collider(int p_idx) const; + int get_collider_shape(int p_idx) const; + Vector2 get_collision_point(int p_idx) const; + Vector2 get_collision_normal(int p_idx) const; + + real_t get_closest_collision_safe_fraction() const; + real_t get_closest_collision_unsafe_fraction() const; + + void add_exception_rid(const RID &p_rid); + void add_exception(const Object *p_object); + void remove_exception_rid(const RID &p_rid); + void remove_exception(const Object *p_object); + void clear_exceptions(); + + TypedArray<String> get_configuration_warnings() const override; +}; + +#endif diff --git a/scene/2d/skeleton_2d.cpp b/scene/2d/skeleton_2d.cpp index 63a0fb9b89..b558f0aa21 100644 --- a/scene/2d/skeleton_2d.cpp +++ b/scene/2d/skeleton_2d.cpp @@ -165,7 +165,7 @@ void Bone2D::_notification(int p_what) { if (skeleton) { for (int i = 0; i < skeleton->bones.size(); i++) { if (skeleton->bones[i].bone == this) { - skeleton->bones.remove(i); + skeleton->bones.remove_at(i); break; } } diff --git a/scene/2d/sprite_2d.cpp b/scene/2d/sprite_2d.cpp index 5761f19a53..b2302d09db 100644 --- a/scene/2d/sprite_2d.cpp +++ b/scene/2d/sprite_2d.cpp @@ -385,7 +385,7 @@ void Sprite2D::_validate_property(PropertyInfo &property) const { } if (!region_enabled && (property.name == "region_rect" || property.name == "region_filter_clip")) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp index c2f150ce00..084a5a520d 100644 --- a/scene/2d/tile_map.cpp +++ b/scene/2d/tile_map.cpp @@ -34,96 +34,322 @@ #include "servers/navigation_server_2d.h" -void TileMapPattern::set_cell(const Vector2i &p_coords, int p_source_id, const Vector2i p_atlas_coords, int p_alternative_tile) { - ERR_FAIL_COND_MSG(p_coords.x < 0 || p_coords.y < 0, vformat("Cannot set cell with negative coords in a TileMapPattern. Wrong coords: %s", p_coords)); +Map<Vector2i, TileSet::CellNeighbor> TileMap::TerrainConstraint::get_overlapping_coords_and_peering_bits() const { + Map<Vector2i, TileSet::CellNeighbor> output; + Ref<TileSet> tile_set = tile_map->get_tileset(); + ERR_FAIL_COND_V(!tile_set.is_valid(), output); - size = size.max(p_coords + Vector2i(1, 1)); - pattern[p_coords] = TileMapCell(p_source_id, p_atlas_coords, p_alternative_tile); -} - -bool TileMapPattern::has_cell(const Vector2i &p_coords) const { - return pattern.has(p_coords); -} - -void TileMapPattern::remove_cell(const Vector2i &p_coords, bool p_update_size) { - ERR_FAIL_COND(!pattern.has(p_coords)); - - pattern.erase(p_coords); - if (p_update_size) { - size = Vector2i(); - for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { - size = size.max(E.key + Vector2i(1, 1)); + TileSet::TileShape shape = tile_set->get_tile_shape(); + if (shape == TileSet::TILE_SHAPE_SQUARE) { + switch (bit) { + case 0: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_RIGHT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_LEFT_SIDE; + break; + case 1: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER; + break; + case 2: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_SIDE; + break; + case 3: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER; + break; + default: + ERR_FAIL_V(output); + } + } else if (shape == TileSet::TILE_SHAPE_ISOMETRIC) { + switch (bit) { + case 0: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_BOTTOM_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_RIGHT_CORNER)] = TileSet::CELL_NEIGHBOR_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_CORNER; + break; + case 1: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE; + break; + case 2: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_CORNER)] = TileSet::CELL_NEIGHBOR_TOP_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_RIGHT_CORNER; + break; + case 3: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + break; + default: + ERR_FAIL_V(output); + } + } else { + // Half offset shapes. + TileSet::TileOffsetAxis offset_axis = tile_set->get_tile_offset_axis(); + if (offset_axis == TileSet::TILE_OFFSET_AXIS_HORIZONTAL) { + switch (bit) { + case 0: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_RIGHT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_LEFT_SIDE; + break; + case 1: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_CORNER; + break; + case 2: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE; + break; + case 3: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER; + break; + case 4: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + break; + default: + ERR_FAIL_V(output); + } + } else { + switch (bit) { + case 0: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER; + break; + case 1: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE; + break; + case 2: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE)] = TileSet::CELL_NEIGHBOR_LEFT_CORNER; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER; + break; + case 3: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_SIDE; + break; + case 4: + output[base_cell_coords] = TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE; + output[tile_map->get_neighbor_cell(base_cell_coords, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE)] = TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + break; + default: + ERR_FAIL_V(output); + } } } + return output; } -int TileMapPattern::get_cell_source_id(const Vector2i &p_coords) const { - ERR_FAIL_COND_V(!pattern.has(p_coords), TileSet::INVALID_SOURCE); - - return pattern[p_coords].source_id; -} - -Vector2i TileMapPattern::get_cell_atlas_coords(const Vector2i &p_coords) const { - ERR_FAIL_COND_V(!pattern.has(p_coords), TileSetSource::INVALID_ATLAS_COORDS); - - return pattern[p_coords].get_atlas_coords(); -} - -int TileMapPattern::get_cell_alternative_tile(const Vector2i &p_coords) const { - ERR_FAIL_COND_V(!pattern.has(p_coords), TileSetSource::INVALID_TILE_ALTERNATIVE); - - return pattern[p_coords].alternative_tile; -} - -TypedArray<Vector2i> TileMapPattern::get_used_cells() const { - // Returns the cells used in the tilemap. - TypedArray<Vector2i> a; - a.resize(pattern.size()); - int i = 0; - for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { - Vector2i p(E.key.x, E.key.y); - a[i++] = p; - } +TileMap::TerrainConstraint::TerrainConstraint(const TileMap *p_tile_map, const Vector2i &p_position, const TileSet::CellNeighbor &p_bit, int p_terrain) { + // The way we build the constraint make it easy to detect conflicting constraints. + tile_map = p_tile_map; - return a; -} - -Vector2i TileMapPattern::get_size() const { - return size; -} + Ref<TileSet> tile_set = tile_map->get_tileset(); + ERR_FAIL_COND(!tile_set.is_valid()); -void TileMapPattern::set_size(const Vector2i &p_size) { - for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { - Vector2i coords = E.key; - if (p_size.x <= coords.x || p_size.y <= coords.y) { - ERR_FAIL_MSG(vformat("Cannot set pattern size to %s, it contains a tile at %s. Size can only be increased.", p_size, coords)); - }; + TileSet::TileShape shape = tile_set->get_tile_shape(); + if (shape == TileSet::TILE_SHAPE_SQUARE) { + switch (p_bit) { + case TileSet::CELL_NEIGHBOR_RIGHT_SIDE: + bit = 0; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER: + bit = 1; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_SIDE: + bit = 2; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_LEFT_SIDE: + bit = 0; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER); + break; + case TileSet::CELL_NEIGHBOR_TOP_SIDE: + bit = 2; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_SIDE); + break; + default: + ERR_FAIL(); + break; + } + } else if (shape == TileSet::TILE_SHAPE_ISOMETRIC) { + switch (p_bit) { + case TileSet::CELL_NEIGHBOR_RIGHT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE: + bit = 0; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_CORNER: + bit = 1; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE: + bit = 2; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_LEFT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE: + bit = 0; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_CORNER); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE: + bit = 2; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE); + break; + default: + ERR_FAIL(); + break; + } + } else { + // Half-offset shapes + TileSet::TileOffsetAxis offset_axis = tile_set->get_tile_offset_axis(); + if (offset_axis == TileSet::TILE_OFFSET_AXIS_HORIZONTAL) { + switch (p_bit) { + case TileSet::CELL_NEIGHBOR_RIGHT_SIDE: + bit = 0; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER: + bit = 1; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE: + bit = 2; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_CORNER: + bit = 3; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE: + bit = 4; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_LEFT_SIDE: + bit = 0; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER: + bit = 3; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE: + bit = 2; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_CORNER: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE: + bit = 4; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER: + bit = 3; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE); + break; + default: + ERR_FAIL(); + break; + } + } else { + switch (p_bit) { + case TileSet::CELL_NEIGHBOR_RIGHT_CORNER: + bit = 0; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE: + bit = 1; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER: + bit = 2; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_SIDE: + bit = 3; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER: + bit = 0; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE: + bit = 4; + base_cell_coords = p_position; + break; + case TileSet::CELL_NEIGHBOR_LEFT_CORNER: + bit = 2; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE: + bit = 1; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER: + bit = 0; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_SIDE: + bit = 3; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER: + bit = 2; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_SIDE); + break; + case TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE: + bit = 4; + base_cell_coords = p_tile_map->get_neighbor_cell(p_position, TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE); + break; + default: + ERR_FAIL(); + break; + } + } } - - size = p_size; -} - -bool TileMapPattern::is_empty() const { - return pattern.is_empty(); -}; - -void TileMapPattern::clear() { - size = Vector2i(); - pattern.clear(); -}; - -void TileMapPattern::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_cell", "coords", "source_id", "atlas_coords", "alternative_tile"), &TileMapPattern::set_cell, DEFVAL(TileSet::INVALID_SOURCE), DEFVAL(TileSetSource::INVALID_ATLAS_COORDS), DEFVAL(TileSetSource::INVALID_TILE_ALTERNATIVE)); - ClassDB::bind_method(D_METHOD("has_cell", "coords"), &TileMapPattern::has_cell); - ClassDB::bind_method(D_METHOD("remove_cell", "coords"), &TileMapPattern::remove_cell); - ClassDB::bind_method(D_METHOD("get_cell_source_id", "coords"), &TileMapPattern::get_cell_source_id); - ClassDB::bind_method(D_METHOD("get_cell_atlas_coords", "coords"), &TileMapPattern::get_cell_atlas_coords); - ClassDB::bind_method(D_METHOD("get_cell_alternative_tile", "coords"), &TileMapPattern::get_cell_alternative_tile); - - ClassDB::bind_method(D_METHOD("get_used_cells"), &TileMapPattern::get_used_cells); - ClassDB::bind_method(D_METHOD("get_size"), &TileMapPattern::get_size); - ClassDB::bind_method(D_METHOD("set_size", "size"), &TileMapPattern::set_size); - ClassDB::bind_method(D_METHOD("is_empty"), &TileMapPattern::is_empty); + terrain = p_terrain; } Vector2i TileMap::transform_coords_layout(Vector2i p_coords, TileSet::TileOffsetAxis p_offset_axis, TileSet::TileLayout p_from_layout, TileSet::TileLayout p_to_layout) { @@ -260,7 +486,6 @@ int TileMap::get_selected_layer() const { void TileMap::_notification(int p_what) { switch (p_what) { case NOTIFICATION_ENTER_TREE: { - pending_update = true; _clear_internals(); _recreate_internals(); } break; @@ -351,7 +576,7 @@ void TileMap::move_layer(int p_layer, int p_to_pos) { TileMapLayer tl = layers[p_layer]; layers.insert(p_to_pos, tl); - layers.remove(p_to_pos < p_layer ? p_layer + 1 : p_layer); + layers.remove_at(p_to_pos < p_layer ? p_layer + 1 : p_layer); _recreate_internals(); notify_property_list_changed(); @@ -370,7 +595,7 @@ void TileMap::remove_layer(int p_layer) { // Clear before removing the layer. _clear_internals(); - layers.remove(p_layer); + layers.remove_at(p_layer); _recreate_internals(); notify_property_list_changed(); @@ -397,8 +622,8 @@ String TileMap::get_layer_name(int p_layer) const { void TileMap::set_layer_enabled(int p_layer, bool p_enabled) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); layers[p_layer].enabled = p_enabled; - _clear_internals(); - _recreate_internals(); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); emit_signal(SNAME("changed")); update_configuration_warnings(); @@ -412,8 +637,8 @@ bool TileMap::is_layer_enabled(int p_layer) const { void TileMap::set_layer_modulate(int p_layer, Color p_modulate) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); layers[p_layer].modulate = p_modulate; - _clear_internals(); - _recreate_internals(); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); emit_signal(SNAME("changed")); } @@ -425,8 +650,8 @@ Color TileMap::get_layer_modulate(int p_layer) const { void TileMap::set_layer_y_sort_enabled(int p_layer, bool p_y_sort_enabled) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); layers[p_layer].y_sort_enabled = p_y_sort_enabled; - _clear_internals(); - _recreate_internals(); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); emit_signal(SNAME("changed")); update_configuration_warnings(); @@ -440,8 +665,8 @@ bool TileMap::is_layer_y_sort_enabled(int p_layer) const { void TileMap::set_layer_y_sort_origin(int p_layer, int p_y_sort_origin) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); layers[p_layer].y_sort_origin = p_y_sort_origin; - _clear_internals(); - _recreate_internals(); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); emit_signal(SNAME("changed")); } @@ -453,8 +678,8 @@ int TileMap::get_layer_y_sort_origin(int p_layer) const { void TileMap::set_layer_z_index(int p_layer, int p_z_index) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); layers[p_layer].z_index = p_z_index; - _clear_internals(); - _recreate_internals(); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); emit_signal(SNAME("changed")); update_configuration_warnings(); @@ -578,8 +803,10 @@ void TileMap::_update_dirty_quadrants() { } for (unsigned int layer = 0; layer < layers.size(); layer++) { + SelfList<TileMapQuadrant>::List &dirty_quadrant_list = layers[layer].dirty_quadrant_list; + // Update the coords cache. - for (SelfList<TileMapQuadrant> *q = layers[layer].dirty_quadrant_list.first(); q; q = q->next()) { + for (SelfList<TileMapQuadrant> *q = dirty_quadrant_list.first(); q; q = q->next()) { q->self()->map_to_world.clear(); q->self()->world_to_map.clear(); for (Set<Vector2i>::Element *E = q->self()->cells.front(); E; E = E->next()) { @@ -590,15 +817,18 @@ void TileMap::_update_dirty_quadrants() { } } + // Find TileData that need a runtime modification. + _build_runtime_update_tile_data(dirty_quadrant_list); + // Call the update_dirty_quadrant method on plugins. - _rendering_update_dirty_quadrants(layers[layer].dirty_quadrant_list); - _physics_update_dirty_quadrants(layers[layer].dirty_quadrant_list); - _navigation_update_dirty_quadrants(layers[layer].dirty_quadrant_list); - _scenes_update_dirty_quadrants(layers[layer].dirty_quadrant_list); + _rendering_update_dirty_quadrants(dirty_quadrant_list); + _physics_update_dirty_quadrants(dirty_quadrant_list); + _navigation_update_dirty_quadrants(dirty_quadrant_list); + _scenes_update_dirty_quadrants(dirty_quadrant_list); // Redraw the debug canvas_items. RenderingServer *rs = RenderingServer::get_singleton(); - for (SelfList<TileMapQuadrant> *q = layers[layer].dirty_quadrant_list.first(); q; q = q->next()) { + for (SelfList<TileMapQuadrant> *q = dirty_quadrant_list.first(); q; q = q->next()) { rs->canvas_item_clear(q->self()->debug_canvas_item); Transform2D xform; xform.set_origin(map_to_world(q->self()->coords * get_effective_quadrant_size(layer))); @@ -611,8 +841,13 @@ void TileMap::_update_dirty_quadrants() { } // Clear the list - while (layers[layer].dirty_quadrant_list.first()) { - layers[layer].dirty_quadrant_list.remove(layers[layer].dirty_quadrant_list.first()); + while (dirty_quadrant_list.first()) { + // Clear the runtime tile data. + for (const KeyValue<Vector2i, TileData *> &kv : dirty_quadrant_list.first()->self()->runtime_tile_data_cache) { + memdelete(kv.value); + } + + dirty_quadrant_list.remove(dirty_quadrant_list.first()); } } @@ -621,37 +856,43 @@ void TileMap::_update_dirty_quadrants() { _recompute_rect_cache(); } -void TileMap::_recreate_internals() { - for (unsigned int layer = 0; layer < layers.size(); layer++) { - // Make sure that _clear_internals() was called prior. - ERR_FAIL_COND_MSG(layers[layer].quadrant_map.size() > 0, "TileMap layer " + itos(layer) + " had a non-empty quadrant map."); - - if (!layers[layer].enabled) { - continue; - } +void TileMap::_recreate_layer_internals(int p_layer) { + ERR_FAIL_INDEX(p_layer, (int)layers.size()); - // Upadate the layer internals. - _rendering_update_layer(layer); + // Make sure that _clear_internals() was called prior. + ERR_FAIL_COND_MSG(layers[p_layer].quadrant_map.size() > 0, "TileMap layer " + itos(p_layer) + " had a non-empty quadrant map."); - // Recreate the quadrants. - const Map<Vector2i, TileMapCell> &tile_map = layers[layer].tile_map; - for (const KeyValue<Vector2i, TileMapCell> &E : tile_map) { - Vector2i qk = _coords_to_quadrant_coords(layer, Vector2i(E.key.x, E.key.y)); + if (!layers[p_layer].enabled) { + return; + } - Map<Vector2i, TileMapQuadrant>::Element *Q = layers[layer].quadrant_map.find(qk); - if (!Q) { - Q = _create_quadrant(layer, qk); - layers[layer].dirty_quadrant_list.add(&Q->get().dirty_list_element); - } + // Upadate the layer internals. + _rendering_update_layer(p_layer); - Vector2i pk = E.key; - Q->get().cells.insert(pk); + // Recreate the quadrants. + const Map<Vector2i, TileMapCell> &tile_map = layers[p_layer].tile_map; + for (const KeyValue<Vector2i, TileMapCell> &E : tile_map) { + Vector2i qk = _coords_to_quadrant_coords(p_layer, Vector2i(E.key.x, E.key.y)); - _make_quadrant_dirty(Q); + Map<Vector2i, TileMapQuadrant>::Element *Q = layers[p_layer].quadrant_map.find(qk); + if (!Q) { + Q = _create_quadrant(p_layer, qk); + layers[p_layer].dirty_quadrant_list.add(&Q->get().dirty_list_element); } + + Vector2i pk = E.key; + Q->get().cells.insert(pk); + + _make_quadrant_dirty(Q); } - _update_dirty_quadrants(); + _queue_update_dirty_quadrants(); +} + +void TileMap::_recreate_internals() { + for (unsigned int layer = 0; layer < layers.size(); layer++) { + _recreate_layer_internals(layer); + } } void TileMap::_erase_quadrant(Map<Vector2i, TileMapQuadrant>::Element *Q) { @@ -874,7 +1115,13 @@ void TileMap::_rendering_update_dirty_quadrants(SelfList<TileMapQuadrant>::List TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); if (atlas_source) { // Get the tile data. - TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + const TileData *tile_data; + if (q.runtime_tile_data_cache.has(E_cell.value)) { + tile_data = q.runtime_tile_data_cache[E_cell.value]; + } else { + tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + } + Ref<ShaderMaterial> mat = tile_data->get_material(); int z_index = tile_data->get_z_index(); @@ -921,7 +1168,7 @@ void TileMap::_rendering_update_dirty_quadrants(SelfList<TileMapQuadrant>::List } // Drawing the tile in the canvas item. - draw_tile(canvas_item, E_cell.key - position, tile_set, c.source_id, c.get_atlas_coords(), c.alternative_tile, -1, modulate); + draw_tile(canvas_item, E_cell.key - position, tile_set, c.source_id, c.get_atlas_coords(), c.alternative_tile, -1, modulate, tile_data); // --- Occluders --- for (int i = 0; i < tile_set->get_occlusion_layers_count(); i++) { @@ -1012,7 +1259,7 @@ void TileMap::_rendering_draw_quadrant_debug(TileMapQuadrant *p_quadrant) { TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); if (atlas_source) { Vector2i grid_size = atlas_source->get_atlas_grid_size(); - if (!atlas_source->get_texture().is_valid() || c.get_atlas_coords().x >= grid_size.x || c.get_atlas_coords().y >= grid_size.y) { + if (!atlas_source->get_runtime_texture().is_valid() || c.get_atlas_coords().x >= grid_size.x || c.get_atlas_coords().y >= grid_size.y) { // Generate a random color from the hashed values of the tiles. Array to_hash; to_hash.push_back(c.source_id); @@ -1038,7 +1285,7 @@ void TileMap::_rendering_draw_quadrant_debug(TileMapQuadrant *p_quadrant) { } } -void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSet> p_tile_set, int p_atlas_source_id, Vector2i p_atlas_coords, int p_alternative_tile, int p_frame, Color p_modulation) { +void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSet> p_tile_set, int p_atlas_source_id, Vector2i p_atlas_coords, int p_alternative_tile, int p_frame, Color p_modulation, const TileData *p_tile_data_override) { ERR_FAIL_COND(!p_tile_set.is_valid()); ERR_FAIL_COND(!p_tile_set->has_source(p_atlas_source_id)); ERR_FAIL_COND(!p_tile_set->get_source(p_atlas_source_id)->has_tile(p_atlas_coords)); @@ -1052,7 +1299,7 @@ void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSe } // Get the texture. - Ref<Texture2D> tex = atlas_source->get_texture(); + Ref<Texture2D> tex = atlas_source->get_runtime_texture(); if (!tex.is_valid()) { return; } @@ -1064,7 +1311,7 @@ void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSe } // Get tile data. - TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(p_atlas_coords, p_alternative_tile)); + const TileData *tile_data = p_tile_data_override ? p_tile_data_override : Object::cast_to<TileData>(atlas_source->get_tile_data(p_atlas_coords, p_alternative_tile)); // Get the tile modulation. Color modulate = tile_data->get_modulate() * p_modulation; @@ -1074,7 +1321,7 @@ void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSe // Get destination rect. Rect2 dest_rect; - dest_rect.size = atlas_source->get_tile_texture_region(p_atlas_coords).size; + dest_rect.size = atlas_source->get_runtime_tile_texture_region(p_atlas_coords).size; dest_rect.size.x += FP_ADJUST; dest_rect.size.y += FP_ADJUST; @@ -1095,10 +1342,10 @@ void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSe // Draw the tile. if (p_frame >= 0) { - Rect2i source_rect = atlas_source->get_tile_texture_region(p_atlas_coords, p_frame); + Rect2i source_rect = atlas_source->get_runtime_tile_texture_region(p_atlas_coords, p_frame); tex->draw_rect_region(p_canvas_item, dest_rect, source_rect, modulate, transpose, p_tile_set->is_uv_clipping()); } else if (atlas_source->get_tile_animation_frames_count(p_atlas_coords) == 1) { - Rect2i source_rect = atlas_source->get_tile_texture_region(p_atlas_coords, 0); + Rect2i source_rect = atlas_source->get_runtime_tile_texture_region(p_atlas_coords, 0); tex->draw_rect_region(p_canvas_item, dest_rect, source_rect, modulate, transpose, p_tile_set->is_uv_clipping()); } else { real_t speed = atlas_source->get_tile_animation_speed(p_atlas_coords); @@ -1108,7 +1355,7 @@ void TileMap::draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSe real_t frame_duration = atlas_source->get_tile_animation_frame_duration(p_atlas_coords, frame) / speed; RenderingServer::get_singleton()->canvas_item_add_animation_slice(p_canvas_item, animation_duration, time, time + frame_duration, 0.0); - Rect2i source_rect = atlas_source->get_tile_texture_region(p_atlas_coords, frame); + Rect2i source_rect = atlas_source->get_runtime_tile_texture_region(p_atlas_coords, frame); tex->draw_rect_region(p_canvas_item, dest_rect, source_rect, modulate, transpose, p_tile_set->is_uv_clipping()); time += frame_duration; @@ -1223,8 +1470,12 @@ void TileMap::_physics_update_dirty_quadrants(SelfList<TileMapQuadrant>::List &r TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); if (atlas_source) { - TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); - + const TileData *tile_data; + if (q.runtime_tile_data_cache.has(E_cell->get())) { + tile_data = q.runtime_tile_data_cache[E_cell->get()]; + } else { + tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + } for (int tile_set_physics_layer = 0; tile_set_physics_layer < tile_set->get_physics_layers_count(); tile_set_physics_layer++) { Ref<PhysicsMaterial> physics_material = tile_set->get_physics_layer_physics_material(tile_set_physics_layer); uint32_t physics_layer = tile_set->get_physics_layer_collision_layer(tile_set_physics_layer); @@ -1416,7 +1667,12 @@ void TileMap::_navigation_update_dirty_quadrants(SelfList<TileMapQuadrant>::List TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); if (atlas_source) { - TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + const TileData *tile_data; + if (q.runtime_tile_data_cache.has(E_cell->get())) { + tile_data = q.runtime_tile_data_cache[E_cell->get()]; + } else { + tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + } q.navigation_regions[E_cell->get()].resize(tile_set->get_navigation_layers_count()); for (int layer_index = 0; layer_index < tile_set->get_navigation_layers_count(); layer_index++) { @@ -1500,7 +1756,12 @@ void TileMap::_navigation_draw_quadrant_debug(TileMapQuadrant *p_quadrant) { TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); if (atlas_source) { - TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + const TileData *tile_data; + if (p_quadrant->runtime_tile_data_cache.has(E_cell->get())) { + tile_data = p_quadrant->runtime_tile_data_cache[E_cell->get()]; + } else { + tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + } Transform2D xform; xform.set_origin(map_to_world(E_cell->get()) - quadrant_pos); @@ -1667,7 +1928,7 @@ void TileMap::set_cell(int p_layer, const Vector2i &p_coords, int p_source_id, c if ((source_id == TileSet::INVALID_SOURCE || atlas_coords == TileSetSource::INVALID_ATLAS_COORDS || alternative_tile == TileSetSource::INVALID_TILE_ALTERNATIVE) && (source_id != TileSet::INVALID_SOURCE || atlas_coords != TileSetSource::INVALID_ATLAS_COORDS || alternative_tile != TileSetSource::INVALID_TILE_ALTERNATIVE)) { - WARN_PRINT("Setting a cell a cell as empty requires both source_id, atlas_coord and alternative_tile to be set to their respective \"invalid\" values. Values were thus changes accordingly."); + WARN_PRINT("Setting a cell as empty requires both source_id, atlas_coord and alternative_tile to be set to their respective \"invalid\" values. Values were thus changes accordingly."); source_id = TileSet::INVALID_SOURCE; atlas_coords = TileSetSource::INVALID_ATLAS_COORDS; alternative_tile = TileSetSource::INVALID_TILE_ALTERNATIVE; @@ -1788,11 +2049,12 @@ int TileMap::get_cell_alternative_tile(int p_layer, const Vector2i &p_coords, bo return E->get().alternative_tile; } -TileMapPattern *TileMap::get_pattern(int p_layer, TypedArray<Vector2i> p_coords_array) { +Ref<TileMapPattern> TileMap::get_pattern(int p_layer, TypedArray<Vector2i> p_coords_array) { ERR_FAIL_INDEX_V(p_layer, (int)layers.size(), nullptr); ERR_FAIL_COND_V(!tile_set.is_valid(), nullptr); - TileMapPattern *output = memnew(TileMapPattern); + Ref<TileMapPattern> output; + output.instantiate(); if (p_coords_array.is_empty()) { return output; } @@ -1841,7 +2103,7 @@ TileMapPattern *TileMap::get_pattern(int p_layer, TypedArray<Vector2i> p_coords_ return output; } -Vector2i TileMap::map_pattern(Vector2i p_position_in_tilemap, Vector2i p_coords_in_pattern, const TileMapPattern *p_pattern) { +Vector2i TileMap::map_pattern(Vector2i p_position_in_tilemap, Vector2i p_coords_in_pattern, Ref<TileMapPattern> p_pattern) { ERR_FAIL_COND_V(!p_pattern->has_cell(p_coords_in_pattern), Vector2i()); Vector2i output = p_position_in_tilemap + p_coords_in_pattern; @@ -1864,7 +2126,7 @@ Vector2i TileMap::map_pattern(Vector2i p_position_in_tilemap, Vector2i p_coords_ return output; } -void TileMap::set_pattern(int p_layer, Vector2i p_position, const TileMapPattern *p_pattern) { +void TileMap::set_pattern(int p_layer, Vector2i p_position, const Ref<TileMapPattern> p_pattern) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); ERR_FAIL_COND(!tile_set.is_valid()); @@ -1875,6 +2137,242 @@ void TileMap::set_pattern(int p_layer, Vector2i p_position, const TileMapPattern } } +Set<TileSet::TerrainsPattern> TileMap::_get_valid_terrains_patterns_for_constraints(int p_terrain_set, const Vector2i &p_position, Set<TerrainConstraint> p_constraints) { + if (!tile_set.is_valid()) { + return Set<TileSet::TerrainsPattern>(); + } + + // Returns all tiles compatible with the given constraints. + Set<TileSet::TerrainsPattern> compatible_terrain_tile_patterns; + for (TileSet::TerrainsPattern &terrain_pattern : tile_set->get_terrains_pattern_set(p_terrain_set)) { + int valid = true; + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + TileSet::CellNeighbor bit = TileSet::CellNeighbor(i); + if (tile_set->is_valid_peering_bit_terrain(p_terrain_set, bit)) { + // Check if the bit is compatible with the constraints. + TerrainConstraint terrain_bit_constraint = TerrainConstraint(this, p_position, bit, terrain_pattern.get_terrain(bit)); + Set<TerrainConstraint>::Element *in_set_constraint_element = p_constraints.find(terrain_bit_constraint); + if (in_set_constraint_element && in_set_constraint_element->get().get_terrain() != terrain_bit_constraint.get_terrain()) { + valid = false; + break; + } + } + } + + if (valid) { + compatible_terrain_tile_patterns.insert(terrain_pattern); + } + } + + return compatible_terrain_tile_patterns; +} + +Set<TileMap::TerrainConstraint> TileMap::get_terrain_constraints_from_removed_cells_list(int p_layer, const Set<Vector2i> &p_to_replace, int p_terrain_set, bool p_ignore_empty_terrains) const { + if (!tile_set.is_valid()) { + return Set<TerrainConstraint>(); + } + + ERR_FAIL_INDEX_V(p_terrain_set, tile_set->get_terrain_sets_count(), Set<TerrainConstraint>()); + ERR_FAIL_INDEX_V(p_layer, (int)layers.size(), Set<TerrainConstraint>()); + + // Build a set of dummy constraints get the constrained points. + Set<TerrainConstraint> dummy_constraints; + for (Set<Vector2i>::Element *E = p_to_replace.front(); E; E = E->next()) { + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { // Iterates over sides. + TileSet::CellNeighbor bit = TileSet::CellNeighbor(i); + if (tile_set->is_valid_peering_bit_terrain(p_terrain_set, bit)) { + dummy_constraints.insert(TerrainConstraint(this, E->get(), bit, -1)); + } + } + } + + // For each constrained point, we get all overlapping tiles, and select the most adequate terrain for it. + Set<TerrainConstraint> constraints; + for (Set<TerrainConstraint>::Element *E = dummy_constraints.front(); E; E = E->next()) { + TerrainConstraint c = E->get(); + + Map<int, int> terrain_count; + + // Count the number of occurrences per terrain. + Map<Vector2i, TileSet::CellNeighbor> overlapping_terrain_bits = c.get_overlapping_coords_and_peering_bits(); + for (const KeyValue<Vector2i, TileSet::CellNeighbor> &E_overlapping : overlapping_terrain_bits) { + if (!p_to_replace.has(E_overlapping.key)) { + TileData *neighbor_tile_data = nullptr; + TileMapCell neighbor_cell = get_cell(p_layer, E_overlapping.key); + if (neighbor_cell.source_id != TileSet::INVALID_SOURCE) { + Ref<TileSetSource> source = tile_set->get_source(neighbor_cell.source_id); + Ref<TileSetAtlasSource> atlas_source = source; + if (atlas_source.is_valid()) { + TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(neighbor_cell.get_atlas_coords(), neighbor_cell.alternative_tile)); + if (tile_data && tile_data->get_terrain_set() == p_terrain_set) { + neighbor_tile_data = tile_data; + } + } + } + + int terrain = neighbor_tile_data ? neighbor_tile_data->get_peering_bit_terrain(TileSet::CellNeighbor(E_overlapping.value)) : -1; + if (!p_ignore_empty_terrains || terrain >= 0) { + if (!terrain_count.has(terrain)) { + terrain_count[terrain] = 0; + } + terrain_count[terrain] += 1; + } + } + } + + // Get the terrain with the max number of occurrences. + int max = 0; + int max_terrain = -1; + for (const KeyValue<int, int> &E_terrain_count : terrain_count) { + if (E_terrain_count.value > max) { + max = E_terrain_count.value; + max_terrain = E_terrain_count.key; + } + } + + // Set the adequate terrain. + if (max > 0) { + c.set_terrain(max_terrain); + constraints.insert(c); + } + } + + return constraints; +} + +Set<TileMap::TerrainConstraint> TileMap::get_terrain_constraints_from_added_tile(Vector2i p_position, int p_terrain_set, TileSet::TerrainsPattern p_terrains_pattern) const { + if (!tile_set.is_valid()) { + return Set<TerrainConstraint>(); + } + + // Compute the constraints needed from the surrounding tiles. + Set<TerrainConstraint> output; + for (uint32_t i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + TileSet::CellNeighbor side = TileSet::CellNeighbor(i); + if (tile_set->is_valid_peering_bit_terrain(p_terrain_set, side)) { + TerrainConstraint c = TerrainConstraint(this, p_position, side, p_terrains_pattern.get_terrain(side)); + output.insert(c); + } + } + + return output; +} + +Map<Vector2i, TileSet::TerrainsPattern> TileMap::terrain_wave_function_collapse(const Set<Vector2i> &p_to_replace, int p_terrain_set, const Set<TerrainConstraint> p_constraints) { + if (!tile_set.is_valid()) { + return Map<Vector2i, TileSet::TerrainsPattern>(); + } + + // Copy the constraints set. + Set<TerrainConstraint> constraints = p_constraints; + + // Compute all acceptable patterns for each cell. + Map<Vector2i, Set<TileSet::TerrainsPattern>> per_cell_acceptable_tiles; + for (Vector2i cell : p_to_replace) { + per_cell_acceptable_tiles[cell] = _get_valid_terrains_patterns_for_constraints(p_terrain_set, cell, constraints); + } + + // Output map. + Map<Vector2i, TileSet::TerrainsPattern> output; + + // Add all positions to a set. + Set<Vector2i> to_replace = Set<Vector2i>(p_to_replace); + while (!to_replace.is_empty()) { + // Compute the minimum number of tile possibilities for each cell. + int min_nb_possibilities = 100000000; + for (const KeyValue<Vector2i, Set<TileSet::TerrainsPattern>> &E : per_cell_acceptable_tiles) { + min_nb_possibilities = MIN(min_nb_possibilities, E.value.size()); + } + + // Get the set of possible cells to fill, out of the most constrained ones. + LocalVector<Vector2i> to_choose_from; + for (const KeyValue<Vector2i, Set<TileSet::TerrainsPattern>> &E : per_cell_acceptable_tiles) { + if (E.value.size() == min_nb_possibilities) { + to_choose_from.push_back(E.key); + } + } + + // Randomly a cell to fill out of the most constrained. + Vector2i selected_cell_to_replace = to_choose_from[Math::random(0, to_choose_from.size() - 1)]; + + // Get the list of acceptable pattens for the given cell. + Set<TileSet::TerrainsPattern> valid_tiles = per_cell_acceptable_tiles[selected_cell_to_replace]; + if (valid_tiles.is_empty()) { + break; // No possibilities :/ + } + + // Out of the possible patterns, prioritize the one which have the least amount of different terrains. + LocalVector<TileSet::TerrainsPattern> valid_tiles_with_least_amount_of_terrains; + int min_terrain_count = 10000; + LocalVector<int> terrains_counts; + int pattern_index = 0; + for (const TileSet::TerrainsPattern &pattern : valid_tiles) { + Set<int> terrains; + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + TileSet::CellNeighbor side = TileSet::CellNeighbor(i); + if (tile_set->is_valid_peering_bit_terrain(p_terrain_set, side)) { + terrains.insert(pattern.get_terrain(side)); + } + } + min_terrain_count = MIN(min_terrain_count, terrains.size()); + terrains_counts.push_back(terrains.size()); + pattern_index++; + } + pattern_index = 0; + for (const TileSet::TerrainsPattern &pattern : valid_tiles) { + if (terrains_counts[pattern_index] == min_terrain_count) { + valid_tiles_with_least_amount_of_terrains.push_back(pattern); + } + pattern_index++; + } + + // Randomly select a pattern out of the remaining ones. + TileSet::TerrainsPattern selected_terrain_tile_pattern = valid_tiles_with_least_amount_of_terrains[Math::random(0, valid_tiles_with_least_amount_of_terrains.size() - 1)]; + + // Set the selected cell into the output. + output[selected_cell_to_replace] = selected_terrain_tile_pattern; + to_replace.erase(selected_cell_to_replace); + per_cell_acceptable_tiles.erase(selected_cell_to_replace); + + // Add the new constraints from the added tiles. + Set<TerrainConstraint> new_constraints = get_terrain_constraints_from_added_tile(selected_cell_to_replace, p_terrain_set, selected_terrain_tile_pattern); + for (Set<TerrainConstraint>::Element *E_constraint = new_constraints.front(); E_constraint; E_constraint = E_constraint->next()) { + constraints.insert(E_constraint->get()); + } + + // Compute valid tiles again for neighbors. + for (uint32_t i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + TileSet::CellNeighbor side = TileSet::CellNeighbor(i); + if (is_existing_neighbor(side)) { + Vector2i neighbor = get_neighbor_cell(selected_cell_to_replace, side); + if (to_replace.has(neighbor)) { + per_cell_acceptable_tiles[neighbor] = _get_valid_terrains_patterns_for_constraints(p_terrain_set, neighbor, constraints); + } + } + } + } + return output; +} + +void TileMap::set_cells_from_surrounding_terrains(int p_layer, TypedArray<Vector2i> p_coords_array, int p_terrain_set, bool p_ignore_empty_terrains) { + ERR_FAIL_COND(!tile_set.is_valid()); + ERR_FAIL_INDEX(p_layer, (int)layers.size()); + ERR_FAIL_INDEX(p_terrain_set, tile_set->get_terrain_sets_count()); + + Set<Vector2i> coords_set; + for (int i = 0; i < p_coords_array.size(); i++) { + coords_set.insert(p_coords_array[i]); + } + + Set<TileMap::TerrainConstraint> constraints = get_terrain_constraints_from_removed_cells_list(p_layer, coords_set, p_terrain_set, p_ignore_empty_terrains); + + Map<Vector2i, TileSet::TerrainsPattern> wfc_output = terrain_wave_function_collapse(coords_set, p_terrain_set, constraints); + for (const KeyValue<Vector2i, TileSet::TerrainsPattern> &kv : wfc_output) { + TileMapCell cell = tile_set->get_random_tile_from_terrains_pattern(p_terrain_set, kv.value); + set_cell(p_layer, kv.key, cell.source_id, cell.get_atlas_coords(), cell.alternative_tile); + } +} + TileMapCell TileMap::get_cell(int p_layer, const Vector2i &p_coords, bool p_use_proxies) const { ERR_FAIL_INDEX_V(p_layer, (int)layers.size(), TileMapCell()); const Map<Vector2i, TileMapCell> &tile_map = layers[p_layer].tile_map; @@ -1940,6 +2438,17 @@ void TileMap::clear() { used_rect_cache_dirty = true; } +void TileMap::force_update(int p_layer) { + if (p_layer >= 0) { + ERR_FAIL_INDEX(p_layer, (int)layers.size()); + _clear_layer_internals(p_layer); + _recreate_layer_internals(p_layer); + } else { + _clear_internals(); + _recreate_internals(); + } +} + void TileMap::_set_tile_data(int p_layer, const Vector<int> &p_data) { ERR_FAIL_INDEX(p_layer, (int)layers.size()); ERR_FAIL_COND(format > FORMAT_3); @@ -2049,6 +2558,44 @@ Vector<int> TileMap::_get_tile_data(int p_layer) const { return data; } +void TileMap::_build_runtime_update_tile_data(SelfList<TileMapQuadrant>::List &r_dirty_quadrant_list) { + if (GDVIRTUAL_IS_OVERRIDDEN(_use_tile_data_runtime_update) && GDVIRTUAL_IS_OVERRIDDEN(_tile_data_runtime_update)) { + SelfList<TileMapQuadrant> *q_list_element = r_dirty_quadrant_list.first(); + while (q_list_element) { + TileMapQuadrant &q = *q_list_element->self(); + // Iterate over the cells of the quadrant. + for (const KeyValue<Vector2i, Vector2i> &E_cell : q.world_to_map) { + TileMapCell c = get_cell(q.layer, E_cell.value, true); + + TileSetSource *source; + if (tile_set->has_source(c.source_id)) { + source = *tile_set->get_source(c.source_id); + + if (!source->has_tile(c.get_atlas_coords()) || !source->has_alternative_tile(c.get_atlas_coords(), c.alternative_tile)) { + continue; + } + + TileSetAtlasSource *atlas_source = Object::cast_to<TileSetAtlasSource>(source); + if (atlas_source) { + bool ret = false; + if (GDVIRTUAL_CALL(_use_tile_data_runtime_update, q.layer, E_cell.value, ret) && ret) { + TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(c.get_atlas_coords(), c.alternative_tile)); + + // Create the runtime TileData. + TileData *tile_data_runtime_use = tile_data->duplicate(); + tile_data->set_allow_transform(true); + q.runtime_tile_data_cache[E_cell.value] = tile_data_runtime_use; + + GDVIRTUAL_CALL(_tile_data_runtime_update, q.layer, E_cell.value, tile_data_runtime_use); + } + } + } + } + q_list_element = q_list_element->next(); + } + } +} + #ifdef TOOLS_ENABLED Rect2 TileMap::_edit_get_rect() const { // Return the visible rect of the tilemap @@ -2163,7 +2710,7 @@ bool TileMap::_get(const StringName &p_name, Variant &r_ret) const { } void TileMap::_get_property_list(List<PropertyInfo> *p_list) const { - p_list->push_back(PropertyInfo(Variant::INT, "format", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::INT, "format", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); p_list->push_back(PropertyInfo(Variant::NIL, "Layers", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_GROUP)); for (unsigned int i = 0; i < layers.size(); i++) { p_list->push_back(PropertyInfo(Variant::STRING, vformat("layer_%d/name", i), PROPERTY_HINT_NONE)); @@ -2172,7 +2719,7 @@ void TileMap::_get_property_list(List<PropertyInfo> *p_list) const { p_list->push_back(PropertyInfo(Variant::BOOL, vformat("layer_%d/y_sort_enabled", i), PROPERTY_HINT_NONE)); p_list->push_back(PropertyInfo(Variant::INT, vformat("layer_%d/y_sort_origin", i), PROPERTY_HINT_NONE)); p_list->push_back(PropertyInfo(Variant::INT, vformat("layer_%d/z_index", i), PROPERTY_HINT_NONE)); - p_list->push_back(PropertyInfo(Variant::OBJECT, vformat("layer_%d/tile_data", i), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::OBJECT, vformat("layer_%d/tile_data", i), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } } @@ -2426,38 +2973,38 @@ bool TileMap::is_existing_neighbor(TileSet::CellNeighbor p_cell_neighbor) const TileSet::TileShape shape = tile_set->get_tile_shape(); if (shape == TileSet::TILE_SHAPE_SQUARE) { return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER; + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER; } else if (shape == TileSet::TILE_SHAPE_ISOMETRIC) { return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; } else { if (tile_set->get_tile_offset_axis() == TileSet::TILE_OFFSET_AXIS_HORIZONTAL) { return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; } else { return p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE || - p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE || + p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE; } } } @@ -2502,7 +3049,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(is_offset ? 0 : -1, 1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-1, 0); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(is_offset ? 0 : -1, -1); @@ -2526,7 +3073,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(1, is_offset ? 0 : -1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(0, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, is_offset ? 0 : -1); @@ -2553,7 +3100,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(is_offset ? -1 : 0, 1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-1, 0); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(is_offset ? -1 : 0, -1); @@ -2577,7 +3124,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(1, is_offset ? -1 : 0); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(0, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, is_offset ? -1 : 0); @@ -2604,7 +3151,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(-1, 1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-1, 0); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(0, -1); @@ -2627,7 +3174,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(1, -1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(0, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, 0); @@ -2652,7 +3199,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(-1, 1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-2, 1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, 0); @@ -2675,7 +3222,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(1, -1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(1, -2); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(0, -1); @@ -2704,7 +3251,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(-1, 0); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-1, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(0, -1); @@ -2727,7 +3274,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(0, -1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(-1, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, 0); @@ -2752,7 +3299,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) { return p_coords + Vector2i(0, 1); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) { return p_coords + Vector2i(-1, 1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(-1, 0); @@ -2775,7 +3322,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) { return p_coords + Vector2i(1, 0); } else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) || - (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { + (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) { return p_coords + Vector2i(1, -1); } else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) { return p_coords + Vector2i(0, -1); @@ -3076,10 +3623,18 @@ void TileMap::_bind_methods() { ClassDB::bind_method(D_METHOD("get_coords_for_body_rid", "body"), &TileMap::get_coords_for_body_rid); + ClassDB::bind_method(D_METHOD("get_pattern", "layer", "coords_array"), &TileMap::get_pattern); + ClassDB::bind_method(D_METHOD("map_pattern", "position_in_tilemap", "coords_in_pattern", "pattern"), &TileMap::map_pattern); + ClassDB::bind_method(D_METHOD("set_pattern", "layer", "position", "pattern"), &TileMap::set_pattern); + + ClassDB::bind_method(D_METHOD("set_cells_from_surrounding_terrains", "layer", "cells", "terrain_set", "ignore_empty_terrains"), &TileMap::set_cells_from_surrounding_terrains, DEFVAL(true)); + ClassDB::bind_method(D_METHOD("fix_invalid_tiles"), &TileMap::fix_invalid_tiles); ClassDB::bind_method(D_METHOD("clear_layer", "layer"), &TileMap::clear_layer); ClassDB::bind_method(D_METHOD("clear"), &TileMap::clear); + ClassDB::bind_method(D_METHOD("force_update", "layer"), &TileMap::force_update, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_surrounding_tiles", "coords"), &TileMap::get_surrounding_tiles); ClassDB::bind_method(D_METHOD("get_used_cells", "layer"), &TileMap::get_used_cells); @@ -3092,11 +3647,14 @@ void TileMap::_bind_methods() { ClassDB::bind_method(D_METHOD("_update_dirty_quadrants"), &TileMap::_update_dirty_quadrants); - ClassDB::bind_method(D_METHOD("_set_tile_data", "layer"), &TileMap::_set_tile_data); + ClassDB::bind_method(D_METHOD("_set_tile_data", "layer", "data"), &TileMap::_set_tile_data); ClassDB::bind_method(D_METHOD("_get_tile_data", "layer"), &TileMap::_get_tile_data); ClassDB::bind_method(D_METHOD("_tile_set_changed_deferred_update"), &TileMap::_tile_set_changed_deferred_update); + GDVIRTUAL_BIND(_use_tile_data_runtime_update, "layer", "coords"); + GDVIRTUAL_BIND(_tile_data_runtime_update, "layer", "coords", "tile_data"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "tile_set", PROPERTY_HINT_RESOURCE_TYPE, "TileSet"), "set_tileset", "get_tileset"); ADD_PROPERTY(PropertyInfo(Variant::INT, "cell_quadrant_size", PROPERTY_HINT_RANGE, "1,128,1"), "set_quadrant_size", "get_quadrant_size"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_animatable"), "set_collision_animatable", "is_collision_animatable"); @@ -3117,7 +3675,7 @@ void TileMap::_bind_methods() { void TileMap::_tile_set_changed() { emit_signal(SNAME("changed")); _tile_set_changed_deferred_update_needed = true; - call_deferred("_tile_set_changed_deferred_update"); + call_deferred(SNAME("_tile_set_changed_deferred_update")); } void TileMap::_tile_set_changed_deferred_update() { @@ -3139,5 +3697,6 @@ TileMap::~TileMap() { if (tile_set.is_valid()) { tile_set->disconnect("changed", callable_mp(this, &TileMap::_tile_set_changed)); } + _clear_internals(); } diff --git a/scene/2d/tile_map.h b/scene/2d/tile_map.h index e5809deabb..f260422290 100644 --- a/scene/2d/tile_map.h +++ b/scene/2d/tile_map.h @@ -37,51 +37,6 @@ class TileSetAtlasSource; -union TileMapCell { - struct { - int32_t source_id : 16; - int16_t coord_x : 16; - int16_t coord_y : 16; - int32_t alternative_tile : 16; - }; - - uint64_t _u64t; - TileMapCell(int p_source_id = -1, Vector2i p_atlas_coords = TileSetSource::INVALID_ATLAS_COORDS, int p_alternative_tile = TileSetSource::INVALID_TILE_ALTERNATIVE) { - source_id = p_source_id; - set_atlas_coords(p_atlas_coords); - alternative_tile = p_alternative_tile; - } - - Vector2i get_atlas_coords() const { - return Vector2i(coord_x, coord_y); - } - - void set_atlas_coords(const Vector2i &r_coords) { - coord_x = r_coords.x; - coord_y = r_coords.y; - } - - bool operator<(const TileMapCell &p_other) const { - if (source_id == p_other.source_id) { - if (coord_x == p_other.coord_x) { - if (coord_y == p_other.coord_y) { - return alternative_tile < p_other.alternative_tile; - } else { - return coord_y < p_other.coord_y; - } - } else { - return coord_x < p_other.coord_x; - } - } else { - return source_id < p_other.source_id; - } - } - - bool operator!=(const TileMapCell &p_other) const { - return !(source_id == p_other.source_id && coord_x == p_other.coord_x && coord_y == p_other.coord_y && alternative_tile == p_other.alternative_tile); - } -}; - struct TileMapQuadrant { struct CoordsWorldComparator { _ALWAYS_INLINE_ bool operator()(const Vector2i &p_a, const Vector2i &p_b) const { @@ -124,6 +79,9 @@ struct TileMapQuadrant { // Scenes. Map<Vector2i, String> scenes; + // Runtime TileData cache. + Map<Vector2i, TileData *> runtime_tile_data_cache; + void operator=(const TileMapQuadrant &q) { layer = q.layer; coords = q.coords; @@ -150,36 +108,47 @@ struct TileMapQuadrant { } }; -class TileMapPattern : public Object { - GDCLASS(TileMapPattern, Object); +class TileMap : public Node2D { + GDCLASS(TileMap, Node2D); - Vector2i size; - Map<Vector2i, TileMapCell> pattern; +public: + class TerrainConstraint { + private: + const TileMap *tile_map; + Vector2i base_cell_coords = Vector2i(); + int bit = -1; + int terrain = -1; + + public: + bool operator<(const TerrainConstraint &p_other) const { + if (base_cell_coords == p_other.base_cell_coords) { + return bit < p_other.bit; + } + return base_cell_coords < p_other.base_cell_coords; + } -protected: - static void _bind_methods(); + String to_string() const { + return vformat("Constraint {pos:%s, bit:%d, terrain:%d}", base_cell_coords, bit, terrain); + } -public: - void set_cell(const Vector2i &p_coords, int p_source_id, const Vector2i p_atlas_coords, int p_alternative_tile = 0); - bool has_cell(const Vector2i &p_coords) const; - void remove_cell(const Vector2i &p_coords, bool p_update_size = true); - int get_cell_source_id(const Vector2i &p_coords) const; - Vector2i get_cell_atlas_coords(const Vector2i &p_coords) const; - int get_cell_alternative_tile(const Vector2i &p_coords) const; + Vector2i get_base_cell_coords() const { + return base_cell_coords; + } - TypedArray<Vector2i> get_used_cells() const; + Map<Vector2i, TileSet::CellNeighbor> get_overlapping_coords_and_peering_bits() const; - Vector2i get_size() const; - void set_size(const Vector2i &p_size); - bool is_empty() const; + void set_terrain(int p_terrain) { + terrain = p_terrain; + } - void clear(); -}; + int get_terrain() const { + return terrain; + } -class TileMap : public Node2D { - GDCLASS(TileMap, Node2D); + TerrainConstraint(const TileMap *p_tile_map, const Vector2i &p_position, const TileSet::CellNeighbor &p_bit, int p_terrain); + TerrainConstraint() {} + }; -public: enum VisibilityMode { VISIBILITY_MODE_DEFAULT, VISIBILITY_MODE_FORCE_SHOW, @@ -245,6 +214,7 @@ private: void _update_dirty_quadrants(); + void _recreate_layer_internals(int p_layer); void _recreate_internals(); void _erase_quadrant(Map<Vector2i, TileMapQuadrant>::Element *Q); @@ -280,10 +250,15 @@ private: void _scenes_cleanup_quadrant(TileMapQuadrant *p_quadrant); void _scenes_draw_quadrant_debug(TileMapQuadrant *p_quadrant); + // Terrains. + Set<TileSet::TerrainsPattern> _get_valid_terrains_patterns_for_constraints(int p_terrain_set, const Vector2i &p_position, Set<TerrainConstraint> p_constraints); + // Set and get tiles from data arrays. void _set_tile_data(int p_layer, const Vector<int> &p_data); Vector<int> _get_tile_data(int p_layer) const; + void _build_runtime_update_tile_data(SelfList<TileMapQuadrant>::List &r_dirty_quadrant_list); + void _tile_set_changed(); bool _tile_set_changed_deferred_update_needed = false; void _tile_set_changed_deferred_update(); @@ -313,7 +288,7 @@ public: void set_quadrant_size(int p_size); int get_quadrant_size() const; - static void draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSet> p_tile_set, int p_atlas_source_id, Vector2i p_atlas_coords, int p_alternative_tile, int p_frame = -1, Color p_modulation = Color(1.0, 1.0, 1.0, 1.0)); + static void draw_tile(RID p_canvas_item, Vector2i p_position, const Ref<TileSet> p_tile_set, int p_atlas_source_id, Vector2i p_atlas_coords, int p_alternative_tile, int p_frame = -1, Color p_modulation = Color(1.0, 1.0, 1.0, 1.0), const TileData *p_tile_data_override = nullptr); // Layers management. int get_layers_count() const; @@ -338,20 +313,29 @@ public: void set_collision_animatable(bool p_enabled); bool is_collision_animatable() const; + // Debug visibility modes. void set_collision_visibility_mode(VisibilityMode p_show_collision); VisibilityMode get_collision_visibility_mode(); void set_navigation_visibility_mode(VisibilityMode p_show_navigation); VisibilityMode get_navigation_visibility_mode(); + // Cells accessors. void set_cell(int p_layer, const Vector2i &p_coords, int p_source_id = -1, const Vector2i p_atlas_coords = TileSetSource::INVALID_ATLAS_COORDS, int p_alternative_tile = TileSetSource::INVALID_TILE_ALTERNATIVE); int get_cell_source_id(int p_layer, const Vector2i &p_coords, bool p_use_proxies = false) const; Vector2i get_cell_atlas_coords(int p_layer, const Vector2i &p_coords, bool p_use_proxies = false) const; int get_cell_alternative_tile(int p_layer, const Vector2i &p_coords, bool p_use_proxies = false) const; - TileMapPattern *get_pattern(int p_layer, TypedArray<Vector2i> p_coords_array); - Vector2i map_pattern(Vector2i p_position_in_tilemap, Vector2i p_coords_in_pattern, const TileMapPattern *p_pattern); - void set_pattern(int p_layer, Vector2i p_position, const TileMapPattern *p_pattern); + // Patterns. + Ref<TileMapPattern> get_pattern(int p_layer, TypedArray<Vector2i> p_coords_array); + Vector2i map_pattern(Vector2i p_position_in_tilemap, Vector2i p_coords_in_pattern, Ref<TileMapPattern> p_pattern); + void set_pattern(int p_layer, Vector2i p_position, const Ref<TileMapPattern> p_pattern); + + // Terrains. + Set<TerrainConstraint> get_terrain_constraints_from_removed_cells_list(int p_layer, const Set<Vector2i> &p_to_replace, int p_terrain_set, bool p_ignore_empty_terrains = true) const; // Not exposed. + Set<TerrainConstraint> get_terrain_constraints_from_added_tile(Vector2i p_position, int p_terrain_set, TileSet::TerrainsPattern p_terrains_pattern) const; // Not exposed. + Map<Vector2i, TileSet::TerrainsPattern> terrain_wave_function_collapse(const Set<Vector2i> &p_to_replace, int p_terrain_set, const Set<TerrainConstraint> p_constraints); // Not exposed. + void set_cells_from_surrounding_terrains(int p_layer, TypedArray<Vector2i> p_coords_array, int p_terrain_set, bool p_ignore_empty_terrains = true); // Not exposed to users TileMapCell get_cell(int p_layer, const Vector2i &p_coords, bool p_use_proxies = false) const; @@ -383,13 +367,21 @@ public: // Fixing a nclearing methods. void fix_invalid_tiles(); + // Clears tiles from a given layer void clear_layer(int p_layer); void clear(); - // Helpers + // Force a TileMap update + void force_update(int p_layer = -1); + + // Helpers? TypedArray<Vector2i> get_surrounding_tiles(Vector2i coords); void draw_cells_outline(Control *p_control, Set<Vector2i> p_cells, Color p_color, Transform2D p_transform = Transform2D()); + // Virtual function to modify the TileData at runtime + GDVIRTUAL2R(bool, _use_tile_data_runtime_update, int, Vector2i); + GDVIRTUAL3(_tile_data_runtime_update, int, Vector2i, TileData *); + // Configuration warnings. TypedArray<String> get_configuration_warnings() const override; diff --git a/scene/3d/area_3d.cpp b/scene/3d/area_3d.cpp index d411525707..073543638f 100644 --- a/scene/3d/area_3d.cpp +++ b/scene/3d/area_3d.cpp @@ -33,13 +33,13 @@ #include "scene/scene_string_names.h" #include "servers/audio_server.h" -void Area3D::set_space_override_mode(SpaceOverride p_mode) { - space_override = p_mode; - PhysicsServer3D::get_singleton()->area_set_space_override_mode(get_rid(), PhysicsServer3D::AreaSpaceOverrideMode(p_mode)); +void Area3D::set_gravity_space_override_mode(SpaceOverride p_mode) { + gravity_space_override = p_mode; + PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_GRAVITY_OVERRIDE_MODE, p_mode); } -Area3D::SpaceOverride Area3D::get_space_override_mode() const { - return space_override; +Area3D::SpaceOverride Area3D::get_gravity_space_override_mode() const { + return gravity_space_override; } void Area3D::set_gravity_is_point(bool p_enabled) { @@ -51,21 +51,30 @@ bool Area3D::is_gravity_a_point() const { return gravity_is_point; } -void Area3D::set_gravity_distance_scale(real_t p_scale) { +void Area3D::set_gravity_point_distance_scale(real_t p_scale) { gravity_distance_scale = p_scale; PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_GRAVITY_DISTANCE_SCALE, p_scale); } -real_t Area3D::get_gravity_distance_scale() const { +real_t Area3D::get_gravity_point_distance_scale() const { return gravity_distance_scale; } -void Area3D::set_gravity_vector(const Vector3 &p_vec) { - gravity_vec = p_vec; - PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_GRAVITY_VECTOR, p_vec); +void Area3D::set_gravity_point_center(const Vector3 &p_center) { + gravity_vec = p_center; + PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_GRAVITY_VECTOR, p_center); } -Vector3 Area3D::get_gravity_vector() const { +const Vector3 &Area3D::get_gravity_point_center() const { + return gravity_vec; +} + +void Area3D::set_gravity_direction(const Vector3 &p_direction) { + gravity_vec = p_direction; + PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_GRAVITY_VECTOR, p_direction); +} + +const Vector3 &Area3D::get_gravity_direction() const { return gravity_vec; } @@ -78,6 +87,24 @@ real_t Area3D::get_gravity() const { return gravity; } +void Area3D::set_linear_damp_space_override_mode(SpaceOverride p_mode) { + linear_damp_space_override = p_mode; + PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_LINEAR_DAMP_OVERRIDE_MODE, p_mode); +} + +Area3D::SpaceOverride Area3D::get_linear_damp_space_override_mode() const { + return linear_damp_space_override; +} + +void Area3D::set_angular_damp_space_override_mode(SpaceOverride p_mode) { + angular_damp_space_override = p_mode; + PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_ANGULAR_DAMP_OVERRIDE_MODE, p_mode); +} + +Area3D::SpaceOverride Area3D::get_angular_damp_space_override_mode() const { + return angular_damp_space_override; +} + void Area3D::set_linear_damp(real_t p_linear_damp) { linear_damp = p_linear_damp; PhysicsServer3D::get_singleton()->area_set_param(get_rid(), PhysicsServer3D::AREA_PARAM_LINEAR_DAMP, p_linear_damp); @@ -334,11 +361,11 @@ void Area3D::set_monitoring(bool p_enable) { monitoring = p_enable; if (monitoring) { - PhysicsServer3D::get_singleton()->area_set_monitor_callback(get_rid(), this, SceneStringNames::get_singleton()->_body_inout); - PhysicsServer3D::get_singleton()->area_set_area_monitor_callback(get_rid(), this, SceneStringNames::get_singleton()->_area_inout); + PhysicsServer3D::get_singleton()->area_set_monitor_callback(get_rid(), callable_mp(this, &Area3D::_body_inout)); + PhysicsServer3D::get_singleton()->area_set_area_monitor_callback(get_rid(), callable_mp(this, &Area3D::_area_inout)); } else { - PhysicsServer3D::get_singleton()->area_set_monitor_callback(get_rid(), nullptr, StringName()); - PhysicsServer3D::get_singleton()->area_set_area_monitor_callback(get_rid(), nullptr, StringName()); + PhysicsServer3D::get_singleton()->area_set_monitor_callback(get_rid(), Callable()); + PhysicsServer3D::get_singleton()->area_set_area_monitor_callback(get_rid(), Callable()); _clear_monitoring(); } } @@ -579,25 +606,58 @@ void Area3D::_validate_property(PropertyInfo &property) const { } property.hint_string = options; + } else if (property.name.begins_with("gravity") && property.name != "gravity_space_override") { + if (gravity_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } else { + if (gravity_is_point) { + if (property.name == "gravity_direction") { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } else { + if (property.name.begins_with("gravity_point_")) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } + } + } else if (property.name.begins_with("linear_damp") && property.name != "linear_damp_space_override") { + if (linear_damp_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } + } else if (property.name.begins_with("angular_damp") && property.name != "angular_damp_space_override") { + if (angular_damp_space_override == SPACE_OVERRIDE_DISABLED) { + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; + } } + + CollisionObject3D::_validate_property(property); } void Area3D::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_space_override_mode", "enable"), &Area3D::set_space_override_mode); - ClassDB::bind_method(D_METHOD("get_space_override_mode"), &Area3D::get_space_override_mode); + ClassDB::bind_method(D_METHOD("set_gravity_space_override_mode", "space_override_mode"), &Area3D::set_gravity_space_override_mode); + ClassDB::bind_method(D_METHOD("get_gravity_space_override_mode"), &Area3D::get_gravity_space_override_mode); ClassDB::bind_method(D_METHOD("set_gravity_is_point", "enable"), &Area3D::set_gravity_is_point); ClassDB::bind_method(D_METHOD("is_gravity_a_point"), &Area3D::is_gravity_a_point); - ClassDB::bind_method(D_METHOD("set_gravity_distance_scale", "distance_scale"), &Area3D::set_gravity_distance_scale); - ClassDB::bind_method(D_METHOD("get_gravity_distance_scale"), &Area3D::get_gravity_distance_scale); + ClassDB::bind_method(D_METHOD("set_gravity_point_distance_scale", "distance_scale"), &Area3D::set_gravity_point_distance_scale); + ClassDB::bind_method(D_METHOD("get_gravity_point_distance_scale"), &Area3D::get_gravity_point_distance_scale); - ClassDB::bind_method(D_METHOD("set_gravity_vector", "vector"), &Area3D::set_gravity_vector); - ClassDB::bind_method(D_METHOD("get_gravity_vector"), &Area3D::get_gravity_vector); + ClassDB::bind_method(D_METHOD("set_gravity_point_center", "center"), &Area3D::set_gravity_point_center); + ClassDB::bind_method(D_METHOD("get_gravity_point_center"), &Area3D::get_gravity_point_center); + + ClassDB::bind_method(D_METHOD("set_gravity_direction", "direction"), &Area3D::set_gravity_direction); + ClassDB::bind_method(D_METHOD("get_gravity_direction"), &Area3D::get_gravity_direction); ClassDB::bind_method(D_METHOD("set_gravity", "gravity"), &Area3D::set_gravity); ClassDB::bind_method(D_METHOD("get_gravity"), &Area3D::get_gravity); + ClassDB::bind_method(D_METHOD("set_linear_damp_space_override_mode", "space_override_mode"), &Area3D::set_linear_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("get_linear_damp_space_override_mode"), &Area3D::get_linear_damp_space_override_mode); + + ClassDB::bind_method(D_METHOD("set_angular_damp_space_override_mode", "space_override_mode"), &Area3D::set_angular_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("get_angular_damp_space_override_mode"), &Area3D::get_angular_damp_space_override_mode); + ClassDB::bind_method(D_METHOD("set_angular_damp", "angular_damp"), &Area3D::set_angular_damp); ClassDB::bind_method(D_METHOD("get_angular_damp"), &Area3D::get_angular_damp); @@ -628,9 +688,6 @@ void Area3D::_bind_methods() { ClassDB::bind_method(D_METHOD("overlaps_body", "body"), &Area3D::overlaps_body); ClassDB::bind_method(D_METHOD("overlaps_area", "area"), &Area3D::overlaps_area); - ClassDB::bind_method(D_METHOD("_body_inout"), &Area3D::_body_inout); - ClassDB::bind_method(D_METHOD("_area_inout"), &Area3D::_area_inout); - ClassDB::bind_method(D_METHOD("set_audio_bus_override", "enable"), &Area3D::set_audio_bus_override); ClassDB::bind_method(D_METHOD("is_overriding_audio_bus"), &Area3D::is_overriding_audio_bus); @@ -663,14 +720,23 @@ void Area3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "monitorable"), "set_monitorable", "is_monitorable"); ADD_PROPERTY(PropertyInfo(Variant::INT, "priority", PROPERTY_HINT_RANGE, "0,128,1"), "set_priority", "get_priority"); - ADD_GROUP("Physics Overrides", ""); - ADD_PROPERTY(PropertyInfo(Variant::INT, "space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine"), "set_space_override_mode", "get_space_override_mode"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gravity_point"), "set_gravity_is_point", "is_gravity_a_point"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_distance_scale", PROPERTY_HINT_RANGE, "0,1024,0.001,or_greater,exp"), "set_gravity_distance_scale", "get_gravity_distance_scale"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "gravity_vec"), "set_gravity_vector", "get_gravity_vector"); + ADD_GROUP("Gravity", "gravity_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "gravity_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_gravity_space_override_mode", "get_gravity_space_override_mode"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "gravity_point", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_gravity_is_point", "is_gravity_a_point"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_point_distance_scale", PROPERTY_HINT_RANGE, "0,1024,0.001,or_greater,exp"), "set_gravity_point_distance_scale", "get_gravity_point_distance_scale"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "gravity_point_center"), "set_gravity_point_center", "get_gravity_point_center"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "gravity_direction"), "set_gravity_direction", "get_gravity_direction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity", PROPERTY_HINT_RANGE, "-32,32,0.001,or_lesser,or_greater"), "set_gravity", "get_gravity"); + + ADD_GROUP("Linear Damp", "linear_damp_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "linear_damp_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_linear_damp_space_override_mode", "get_linear_damp_space_override_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); + + ADD_GROUP("Angular Damp", "angular_damp_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "angular_damp_space_override", PROPERTY_HINT_ENUM, "Disabled,Combine,Combine-Replace,Replace,Replace-Combine", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_angular_damp_space_override_mode", "get_angular_damp_space_override_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); + + ADD_GROUP("Wind", "wind_"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "wind_force_magnitude", PROPERTY_HINT_RANGE, "0,10,0.001,or_greater"), "set_wind_force_magnitude", "get_wind_force_magnitude"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "wind_attenuation_factor", PROPERTY_HINT_RANGE, "0.0,3.0,0.001,or_greater"), "set_wind_attenuation_factor", "get_wind_attenuation_factor"); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "wind_source_path", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Node3D"), "set_wind_source_path", "get_wind_source_path"); @@ -695,7 +761,7 @@ void Area3D::_bind_methods() { Area3D::Area3D() : CollisionObject3D(PhysicsServer3D::get_singleton()->area_create(), true) { set_gravity(9.8); - set_gravity_vector(Vector3(0, -1, 0)); + set_gravity_direction(Vector3(0, -1, 0)); set_monitoring(true); set_monitorable(true); } diff --git a/scene/3d/area_3d.h b/scene/3d/area_3d.h index 847d1c5966..7f31be2e17 100644 --- a/scene/3d/area_3d.h +++ b/scene/3d/area_3d.h @@ -47,17 +47,23 @@ public: }; private: - SpaceOverride space_override = SPACE_OVERRIDE_DISABLED; + SpaceOverride gravity_space_override = SPACE_OVERRIDE_DISABLED; Vector3 gravity_vec; real_t gravity; bool gravity_is_point = false; real_t gravity_distance_scale = 0.0; + + SpaceOverride linear_damp_space_override = SPACE_OVERRIDE_DISABLED; + SpaceOverride angular_damp_space_override = SPACE_OVERRIDE_DISABLED; real_t angular_damp = 0.1; real_t linear_damp = 0.1; + int priority = 0; + real_t wind_force_magnitude = 0.0; real_t wind_attenuation_factor = 0.0; NodePath wind_source_path; + bool monitoring = false; bool monitorable = false; bool locked = false; @@ -144,21 +150,30 @@ protected: static void _bind_methods(); public: - void set_space_override_mode(SpaceOverride p_mode); - SpaceOverride get_space_override_mode() const; + void set_gravity_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_gravity_space_override_mode() const; void set_gravity_is_point(bool p_enabled); bool is_gravity_a_point() const; - void set_gravity_distance_scale(real_t p_scale); - real_t get_gravity_distance_scale() const; + void set_gravity_point_distance_scale(real_t p_scale); + real_t get_gravity_point_distance_scale() const; - void set_gravity_vector(const Vector3 &p_vec); - Vector3 get_gravity_vector() const; + void set_gravity_point_center(const Vector3 &p_center); + const Vector3 &get_gravity_point_center() const; + + void set_gravity_direction(const Vector3 &p_direction); + const Vector3 &get_gravity_direction() const; void set_gravity(real_t p_gravity); real_t get_gravity() const; + void set_linear_damp_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_linear_damp_space_override_mode() const; + + void set_angular_damp_space_override_mode(SpaceOverride p_mode); + SpaceOverride get_angular_damp_space_override_mode() const; + void set_angular_damp(real_t p_angular_damp); real_t get_angular_damp() const; diff --git a/scene/3d/audio_listener_3d.h b/scene/3d/audio_listener_3d.h index 492cacb0e9..31de3b4fb1 100644 --- a/scene/3d/audio_listener_3d.h +++ b/scene/3d/audio_listener_3d.h @@ -63,9 +63,6 @@ public: virtual Transform3D get_listener_transform() const; - void set_visible_layers(uint32_t p_layers); - uint32_t get_visible_layers() const; - AudioListener3D(); ~AudioListener3D(); }; diff --git a/scene/3d/audio_stream_player_3d.cpp b/scene/3d/audio_stream_player_3d.cpp index 44a685f506..bdcab49e4e 100644 --- a/scene/3d/audio_stream_player_3d.cpp +++ b/scene/3d/audio_stream_player_3d.cpp @@ -292,7 +292,6 @@ void AudioStreamPlayer3D::_notification(int p_what) { Vector<Ref<AudioStreamPlayback>> playbacks_to_remove; for (Ref<AudioStreamPlayback> &playback : stream_playbacks) { if (playback.is_valid() && !AudioServer::get_singleton()->is_playback_active(playback) && !AudioServer::get_singleton()->is_playback_paused(playback)) { - emit_signal(SNAME("finished")); playbacks_to_remove.push_back(playback); } } @@ -305,11 +304,14 @@ void AudioStreamPlayer3D::_notification(int p_what) { active.clear(); set_physics_process_internal(false); } + if (!playbacks_to_remove.is_empty()) { + emit_signal(SNAME("finished")); + } } while (stream_playbacks.size() > max_polyphony) { AudioServer::get_singleton()->stop_playback_stream(stream_playbacks[0]); - stream_playbacks.remove(0); + stream_playbacks.remove_at(0); } } } @@ -325,7 +327,13 @@ Area3D *AudioStreamPlayer3D::_get_overriding_area() { PhysicsDirectSpaceState3D::ShapeResult sr[MAX_INTERSECT_AREAS]; - int areas = space_state->intersect_point(global_pos, sr, MAX_INTERSECT_AREAS, Set<RID>(), area_mask, false, true); + PhysicsDirectSpaceState3D::PointParameters point_params; + point_params.position = global_pos; + point_params.collision_mask = area_mask; + point_params.collide_with_bodies = false; + point_params.collide_with_areas = true; + + int areas = space_state->intersect_point(point_params, sr, MAX_INTERSECT_AREAS); for (int i = 0; i < areas; i++) { if (!sr[i].collider) { @@ -383,7 +391,13 @@ Vector<AudioFrame> AudioStreamPlayer3D::_update_panning() { PhysicsDirectSpaceState3D *space_state = PhysicsServer3D::get_singleton()->space_get_direct_state(world_3d->get_space()); for (Camera3D *camera : cameras) { + if (!camera) { + continue; + } Viewport *vp = camera->get_viewport(); + if (!vp) { + continue; + } if (!vp->is_audio_listener_3d()) { continue; } @@ -638,6 +652,8 @@ void AudioStreamPlayer3D::_validate_property(PropertyInfo &property) const { property.hint_string = options; } + + Node3D::_validate_property(property); } void AudioStreamPlayer3D::_bus_layout_changed() { diff --git a/scene/3d/bone_attachment_3d.cpp b/scene/3d/bone_attachment_3d.cpp index 8e89f4fc54..5dc7382197 100644 --- a/scene/3d/bone_attachment_3d.cpp +++ b/scene/3d/bone_attachment_3d.cpp @@ -58,6 +58,8 @@ void BoneAttachment3D::_validate_property(PropertyInfo &property) const { property.hint_string = ""; } } + + Node3D::_validate_property(property); } bool BoneAttachment3D::_set(const StringName &p_path, const Variant &p_value) { diff --git a/scene/3d/camera_3d.cpp b/scene/3d/camera_3d.cpp index 588d2b5018..cc5b7078e3 100644 --- a/scene/3d/camera_3d.cpp +++ b/scene/3d/camera_3d.cpp @@ -60,17 +60,19 @@ void Camera3D::_update_camera_mode() { void Camera3D::_validate_property(PropertyInfo &p_property) const { if (p_property.name == "fov") { if (mode != PROJECTION_PERSPECTIVE) { - p_property.usage = PROPERTY_USAGE_NOEDITOR; + p_property.usage = PROPERTY_USAGE_NO_EDITOR; } } else if (p_property.name == "size") { if (mode != PROJECTION_ORTHOGONAL && mode != PROJECTION_FRUSTUM) { - p_property.usage = PROPERTY_USAGE_NOEDITOR; + p_property.usage = PROPERTY_USAGE_NO_EDITOR; } } else if (p_property.name == "frustum_offset") { if (mode != PROJECTION_FRUSTUM) { - p_property.usage = PROPERTY_USAGE_NOEDITOR; + p_property.usage = PROPERTY_USAGE_NO_EDITOR; } } + + Node3D::_validate_property(p_property); } void Camera3D::_update_camera() { diff --git a/scene/3d/collision_object_3d.cpp b/scene/3d/collision_object_3d.cpp index 814ed5c2a7..085f1ade66 100644 --- a/scene/3d/collision_object_3d.cpp +++ b/scene/3d/collision_object_3d.cpp @@ -64,7 +64,9 @@ void CollisionObject3D::_notification(int p_what) { } if (!disabled || (disable_mode != DISABLE_MODE_REMOVE)) { - RID space = get_world_3d()->get_space(); + Ref<World3D> world_ref = get_world_3d(); + ERR_FAIL_COND(!world_ref.is_valid()); + RID space = world_ref->get_space(); if (area) { PhysicsServer3D::get_singleton()->area_set_space(rid, space); } else { @@ -626,7 +628,7 @@ void CollisionObject3D::shape_owner_remove_shape(uint32_t p_owner, int p_shape) --debug_shapes_count; } - shapes[p_owner].shapes.remove(p_shape); + shapes[p_owner].shapes.remove_at(p_shape); for (KeyValue<uint32_t, ShapeData> &E : shapes) { for (int i = 0; i < E.value.shapes.size(); i++) { @@ -648,7 +650,7 @@ void CollisionObject3D::shape_owner_clear_shapes(uint32_t p_owner) { } uint32_t CollisionObject3D::shape_find_owner(int p_shape_index) const { - ERR_FAIL_INDEX_V(p_shape_index, total_subshapes, 0); + ERR_FAIL_INDEX_V(p_shape_index, total_subshapes, UINT32_MAX); for (const KeyValue<uint32_t, ShapeData> &E : shapes) { for (int i = 0; i < E.value.shapes.size(); i++) { @@ -659,7 +661,7 @@ uint32_t CollisionObject3D::shape_find_owner(int p_shape_index) const { } //in theory it should be unreachable - return 0; + ERR_FAIL_V_MSG(UINT32_MAX, "Can't find owner for shape index " + itos(p_shape_index) + "."); } CollisionObject3D::CollisionObject3D(RID p_rid, bool p_area) { diff --git a/scene/3d/cpu_particles_3d.cpp b/scene/3d/cpu_particles_3d.cpp index 48ef41e015..905a137001 100644 --- a/scene/3d/cpu_particles_3d.cpp +++ b/scene/3d/cpu_particles_3d.cpp @@ -73,6 +73,7 @@ void CPUParticles3D::set_amount(int p_amount) { } particle_data.resize((12 + 4 + 4) * p_amount); + RS::get_singleton()->multimesh_set_visible_instances(multimesh, -1); RS::get_singleton()->multimesh_allocate_data(multimesh, p_amount, RS::MULTIMESH_TRANSFORM_3D, true, true); particle_order.resize(p_amount); @@ -212,8 +213,7 @@ TypedArray<String> CPUParticles3D::get_configuration_warnings() const { warnings.push_back(TTR("Nothing is visible because no mesh has been assigned.")); } - if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 || - get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) { + if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 || get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) { warnings.push_back(TTR("CPUParticles3D animation requires the usage of a StandardMaterial3D whose Billboard Mode is set to \"Particle Billboard\".")); } @@ -368,6 +368,14 @@ Ref<Gradient> CPUParticles3D::get_color_ramp() const { return color_ramp; } +void CPUParticles3D::set_color_initial_ramp(const Ref<Gradient> &p_ramp) { + color_initial_ramp = p_ramp; +} + +Ref<Gradient> CPUParticles3D::get_color_initial_ramp() const { + return color_initial_ramp; +} + void CPUParticles3D::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); particle_flags[p_particle_flag] = p_enable; @@ -531,6 +539,8 @@ void CPUParticles3D::_validate_property(PropertyInfo &property) const { if (property.name.begins_with("scale_curve_") && !split_scale) { property.usage = PROPERTY_USAGE_NONE; } + + Node3D::_validate_property(property); } static uint32_t idhash(uint32_t x) { @@ -746,10 +756,16 @@ void CPUParticles3D::_particles_process(double p_delta) { p.hue_rot_rand = Math::randf(); p.anim_offset_rand = Math::randf(); + if (color_initial_ramp.is_valid()) { + p.start_color_rand = color_initial_ramp->get_color_at_offset(Math::randf()); + } else { + p.start_color_rand = Color(1, 1, 1, 1); + } + if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { real_t angle1_rad = Math::atan2(direction.y, direction.x) + Math::deg2rad((Math::randf() * 2.0 - 1.0) * spread); Vector3 rot = Vector3(Math::cos(angle1_rad), Math::sin(angle1_rad), 0.0); - p.velocity = rot * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_max[PARAM_INITIAL_LINEAR_VELOCITY], Math::randf()); + p.velocity = rot * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_max[PARAM_INITIAL_LINEAR_VELOCITY], (real_t)Math::randf()); } else { //initiate velocity spread in 3D real_t angle1_rad = Math::deg2rad((Math::randf() * (real_t)2.0 - (real_t)1.0) * spread); @@ -773,7 +789,7 @@ void CPUParticles3D::_particles_process(double p_delta) { binormal.normalize(); Vector3 normal = binormal.cross(direction_nrm); spread_direction = binormal * spread_direction.x + normal * spread_direction.y + direction_nrm * spread_direction.z; - p.velocity = spread_direction * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_max[PARAM_INITIAL_LINEAR_VELOCITY], float(Math::randf())); + p.velocity = spread_direction * Math::lerp(parameters_min[PARAM_INITIAL_LINEAR_VELOCITY], parameters_max[PARAM_INITIAL_LINEAR_VELOCITY], (real_t)Math::randf()); } real_t base_angle = tex_angle * Math::lerp(parameters_min[PARAM_ANGLE], parameters_max[PARAM_ANGLE], p.angle_rand); @@ -879,53 +895,53 @@ void CPUParticles3D::_particles_process(double p_delta) { p.custom[1] = p.time / lifetime; tv = p.time / p.lifetime; - real_t tex_linear_velocity = 0.0; + real_t tex_linear_velocity = 1.0; if (curve_parameters[PARAM_INITIAL_LINEAR_VELOCITY].is_valid()) { tex_linear_velocity = curve_parameters[PARAM_INITIAL_LINEAR_VELOCITY]->interpolate(tv); } - real_t tex_orbit_velocity = 0.0; + real_t tex_orbit_velocity = 1.0; if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { if (curve_parameters[PARAM_ORBIT_VELOCITY].is_valid()) { tex_orbit_velocity = curve_parameters[PARAM_ORBIT_VELOCITY]->interpolate(tv); } } - real_t tex_angular_velocity = 0.0; + real_t tex_angular_velocity = 1.0; if (curve_parameters[PARAM_ANGULAR_VELOCITY].is_valid()) { tex_angular_velocity = curve_parameters[PARAM_ANGULAR_VELOCITY]->interpolate(tv); } - real_t tex_linear_accel = 0.0; + real_t tex_linear_accel = 1.0; if (curve_parameters[PARAM_LINEAR_ACCEL].is_valid()) { tex_linear_accel = curve_parameters[PARAM_LINEAR_ACCEL]->interpolate(tv); } - real_t tex_tangential_accel = 0.0; + real_t tex_tangential_accel = 1.0; if (curve_parameters[PARAM_TANGENTIAL_ACCEL].is_valid()) { tex_tangential_accel = curve_parameters[PARAM_TANGENTIAL_ACCEL]->interpolate(tv); } - real_t tex_radial_accel = 0.0; + real_t tex_radial_accel = 1.0; if (curve_parameters[PARAM_RADIAL_ACCEL].is_valid()) { tex_radial_accel = curve_parameters[PARAM_RADIAL_ACCEL]->interpolate(tv); } - real_t tex_damping = 0.0; + real_t tex_damping = 1.0; if (curve_parameters[PARAM_DAMPING].is_valid()) { tex_damping = curve_parameters[PARAM_DAMPING]->interpolate(tv); } - real_t tex_angle = 0.0; + real_t tex_angle = 1.0; if (curve_parameters[PARAM_ANGLE].is_valid()) { tex_angle = curve_parameters[PARAM_ANGLE]->interpolate(tv); } - real_t tex_anim_speed = 0.0; + real_t tex_anim_speed = 1.0; if (curve_parameters[PARAM_ANIM_SPEED].is_valid()) { tex_anim_speed = curve_parameters[PARAM_ANIM_SPEED]->interpolate(tv); } - real_t tex_anim_offset = 0.0; + real_t tex_anim_offset = 1.0; if (curve_parameters[PARAM_ANIM_OFFSET].is_valid()) { tex_anim_offset = curve_parameters[PARAM_ANIM_OFFSET]->interpolate(tv); } @@ -982,7 +998,7 @@ void CPUParticles3D::_particles_process(double p_delta) { real_t base_angle = (tex_angle)*Math::lerp(parameters_min[PARAM_ANGLE], parameters_max[PARAM_ANGLE], p.angle_rand); base_angle += p.custom[1] * lifetime * tex_angular_velocity * Math::lerp(parameters_min[PARAM_ANGULAR_VELOCITY], parameters_max[PARAM_ANGULAR_VELOCITY], rand_from_seed(alt_seed)); p.custom[0] = Math::deg2rad(base_angle); //angle - p.custom[2] = tex_anim_offset * Math::lerp(parameters_min[PARAM_ANIM_OFFSET], parameters_max[PARAM_ANIM_OFFSET], p.anim_offset_rand) + p.custom[1] * tex_anim_speed * Math::lerp(parameters_min[PARAM_ANIM_SPEED], parameters_max[PARAM_ANIM_SPEED], rand_from_seed(alt_seed)); //angle + p.custom[2] = tex_anim_offset * Math::lerp(parameters_min[PARAM_ANIM_OFFSET], parameters_max[PARAM_ANIM_OFFSET], p.anim_offset_rand) + tv * tex_anim_speed * Math::lerp(parameters_min[PARAM_ANIM_SPEED], parameters_max[PARAM_ANIM_SPEED], rand_from_seed(alt_seed)); //angle } //apply color //apply hue rotation @@ -1044,7 +1060,7 @@ void CPUParticles3D::_particles_process(double p_delta) { p.color.g = color_rgb.y; p.color.b = color_rgb.z; - p.color *= p.base_color; + p.color *= p.base_color * p.start_color_rand; if (particle_flags[PARTICLE_FLAG_DISABLE_Z]) { if (particle_flags[PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY]) { @@ -1326,11 +1342,16 @@ void CPUParticles3D::convert_from_particles(Node *p_particles) { set_color(material->get_color()); - Ref<GradientTexture> gt = material->get_color_ramp(); + Ref<GradientTexture1D> gt = material->get_color_ramp(); if (gt.is_valid()) { set_color_ramp(gt->get_gradient()); } + Ref<GradientTexture1D> gti = material->get_color_initial_ramp(); + if (gti.is_valid()) { + set_color_initial_ramp(gti->get_gradient()); + } + set_particle_flag(PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ALIGN_Y_TO_VELOCITY)); set_particle_flag(PARTICLE_FLAG_ROTATE_Y, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_ROTATE_Y)); set_particle_flag(PARTICLE_FLAG_DISABLE_Z, material->get_particle_flag(ParticlesMaterial::PARTICLE_FLAG_DISABLE_Z)); @@ -1457,6 +1478,9 @@ void CPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &CPUParticles3D::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &CPUParticles3D::get_color_ramp); + ClassDB::bind_method(D_METHOD("set_color_initial_ramp", "ramp"), &CPUParticles3D::set_color_initial_ramp); + ClassDB::bind_method(D_METHOD("get_color_initial_ramp"), &CPUParticles3D::get_color_initial_ramp); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &CPUParticles3D::set_particle_flag); ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &CPUParticles3D::get_particle_flag); @@ -1570,6 +1594,7 @@ void CPUParticles3D::_bind_methods() { ADD_GROUP("Color", ""); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_ramp", PROPERTY_HINT_RESOURCE_TYPE, "Gradient"), "set_color_ramp", "get_color_ramp"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_initial_ramp", PROPERTY_HINT_RESOURCE_TYPE, "Gradient"), "set_color_initial_ramp", "get_color_initial_ramp"); ADD_GROUP("Hue Variation", "hue_"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "hue_variation_min", PROPERTY_HINT_RANGE, "-1,1,0.01"), "set_param_min", "get_param_min", PARAM_HUE_VARIATION); diff --git a/scene/3d/cpu_particles_3d.h b/scene/3d/cpu_particles_3d.h index 160814ead4..6addeab1a6 100644 --- a/scene/3d/cpu_particles_3d.h +++ b/scene/3d/cpu_particles_3d.h @@ -91,6 +91,7 @@ private: real_t scale_rand = 0.0; real_t hue_rot_rand = 0.0; real_t anim_offset_rand = 0.0; + Color start_color_rand; double time = 0.0; double lifetime = 0.0; Color base_color; @@ -160,6 +161,7 @@ private: Ref<Curve> curve_parameters[PARAM_MAX]; Color color = Color(1, 1, 1, 1); Ref<Gradient> color_ramp; + Ref<Gradient> color_initial_ramp; bool particle_flags[PARTICLE_FLAG_MAX] = {}; @@ -209,7 +211,6 @@ public: void set_explosiveness_ratio(real_t p_ratio); void set_randomness_ratio(real_t p_ratio); void set_lifetime_randomness(double p_random); - void set_visibility_aabb(const AABB &p_aabb); void set_use_local_coordinates(bool p_enable); void set_speed_scale(double p_scale); @@ -221,7 +222,6 @@ public: real_t get_explosiveness_ratio() const; real_t get_randomness_ratio() const; double get_lifetime_randomness() const; - AABB get_visibility_aabb() const; bool get_use_local_coordinates() const; double get_speed_scale() const; @@ -234,9 +234,6 @@ public: void set_draw_order(DrawOrder p_order); DrawOrder get_draw_order() const; - void set_draw_passes(int p_count); - int get_draw_passes() const; - void set_mesh(const Ref<Mesh> &p_mesh); Ref<Mesh> get_mesh() const; @@ -266,6 +263,9 @@ public: void set_color_ramp(const Ref<Gradient> &p_ramp); Ref<Gradient> get_color_ramp() const; + void set_color_initial_ramp(const Ref<Gradient> &p_ramp); + Ref<Gradient> get_color_initial_ramp() const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); bool get_particle_flag(ParticleFlags p_particle_flag) const; @@ -275,7 +275,6 @@ public: void set_emission_points(const Vector<Vector3> &p_points); void set_emission_normals(const Vector<Vector3> &p_normals); void set_emission_colors(const Vector<Color> &p_colors); - void set_emission_point_count(int p_count); void set_emission_ring_axis(Vector3 p_axis); void set_emission_ring_height(real_t p_height); void set_emission_ring_radius(real_t p_radius); @@ -291,7 +290,6 @@ public: Vector<Vector3> get_emission_points() const; Vector<Vector3> get_emission_normals() const; Vector<Color> get_emission_colors() const; - int get_emission_point_count() const; Vector3 get_emission_ring_axis() const; real_t get_emission_ring_height() const; real_t get_emission_ring_radius() const; diff --git a/scene/3d/decal.cpp b/scene/3d/decal.cpp index c94a99a203..500bf4d8f5 100644 --- a/scene/3d/decal.cpp +++ b/scene/3d/decal.cpp @@ -158,8 +158,9 @@ Vector<Face3> Decal::get_faces(uint32_t p_usage_flags) const { void Decal::_validate_property(PropertyInfo &property) const { if (!distance_fade_enabled && (property.name == "distance_fade_begin" || property.name == "distance_fade_length")) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } + VisualInstance3D::_validate_property(property); } TypedArray<String> Decal::get_configuration_warnings() const { @@ -174,9 +175,6 @@ TypedArray<String> Decal::get_configuration_warnings() const { } if (cull_mask == 0) { - // NOTE: This warning will not be emitted if none of the 20 checkboxes - // exposed in the editor are checked. This is because there are - // currently 12 unexposed layers in the editor inspector. warnings.push_back(TTR("The decal's Cull Mask has no bits enabled, which means the decal will not paint objects on any layer.\nTo resolve this, enable at least one bit in the Cull Mask property.")); } diff --git a/scene/3d/fog_volume.cpp b/scene/3d/fog_volume.cpp new file mode 100644 index 0000000000..694defd7dc --- /dev/null +++ b/scene/3d/fog_volume.cpp @@ -0,0 +1,122 @@ +/*************************************************************************/ +/* fog_volume.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "fog_volume.h" + +/////////////////////////// + +void FogVolume::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &FogVolume::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &FogVolume::get_extents); + ClassDB::bind_method(D_METHOD("set_shape", "shape"), &FogVolume::set_shape); + ClassDB::bind_method(D_METHOD("get_shape"), &FogVolume::get_shape); + ClassDB::bind_method(D_METHOD("set_material", "material"), &FogVolume::set_material); + ClassDB::bind_method(D_METHOD("get_material"), &FogVolume::get_material); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "shape", PROPERTY_HINT_ENUM, "Ellipsoid,Box,World"), "set_shape", "get_shape"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "material", PROPERTY_HINT_RESOURCE_TYPE, "FogMaterial,ShaderMaterial"), "set_material", "get_material"); +} + +void FogVolume::_validate_property(PropertyInfo &property) const { + if (property.name == "extents" && shape == RS::FOG_VOLUME_SHAPE_WORLD) { + property.usage = PROPERTY_USAGE_NONE; + return; + } + VisualInstance3D::_validate_property(property); +} + +void FogVolume::set_extents(const Vector3 &p_extents) { + extents = p_extents; + extents.x = MAX(0.0, extents.x); + extents.y = MAX(0.0, extents.y); + extents.z = MAX(0.0, extents.z); + RS::get_singleton()->fog_volume_set_extents(_get_volume(), extents); + update_gizmos(); +} + +Vector3 FogVolume::get_extents() const { + return extents; +} + +void FogVolume::set_shape(RS::FogVolumeShape p_type) { + shape = p_type; + RS::get_singleton()->fog_volume_set_shape(_get_volume(), shape); + RS::get_singleton()->instance_set_ignore_culling(get_instance(), shape == RS::FOG_VOLUME_SHAPE_WORLD); + update_gizmos(); + notify_property_list_changed(); +} + +RS::FogVolumeShape FogVolume::get_shape() const { + return shape; +} + +void FogVolume::set_material(const Ref<Material> &p_material) { + material = p_material; + RID material_rid; + if (material.is_valid()) { + material_rid = material->get_rid(); + } + RS::get_singleton()->fog_volume_set_material(_get_volume(), material_rid); + update_gizmos(); +} + +Ref<Material> FogVolume::get_material() const { + return material; +} + +AABB FogVolume::get_aabb() const { + if (shape != RS::FOG_VOLUME_SHAPE_WORLD) { + return AABB(-extents, extents * 2); + } + return AABB(); +} + +TypedArray<String> FogVolume::get_configuration_warnings() const { + TypedArray<String> warnings = Node::get_configuration_warnings(); + + Ref<Environment> environment = get_viewport()->find_world_3d()->get_environment(); + + if (environment.is_valid() && !environment->is_volumetric_fog_enabled()) { + warnings.push_back(("Fog Volumes need volumetric fog to be enabled in the scene's Environment in order to be visible.")); + } + + return warnings; +} + +FogVolume::FogVolume() { + volume = RS::get_singleton()->fog_volume_create(); + RS::get_singleton()->fog_volume_set_shape(volume, RS::FOG_VOLUME_SHAPE_BOX); + set_base(volume); +} + +FogVolume::~FogVolume() { + RS::get_singleton()->free(volume); +} diff --git a/scene/3d/proximity_group_3d.h b/scene/3d/fog_volume.h index e45adc3040..0807fb22e6 100644 --- a/scene/3d/proximity_group_3d.h +++ b/scene/3d/fog_volume.h @@ -1,5 +1,5 @@ /*************************************************************************/ -/* proximity_group_3d.h */ +/* fog_volume.h */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,58 +28,45 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef PROXIMITY_GROUP_H -#define PROXIMITY_GROUP_H +#ifndef FOG_VOLUME_H +#define FOG_VOLUME_H -#include "node_3d.h" +#include "core/templates/rid.h" +#include "scene/3d/visual_instance_3d.h" +#include "scene/main/node.h" +#include "scene/main/viewport.h" +#include "scene/resources/material.h" -class ProximityGroup3D : public Node3D { - GDCLASS(ProximityGroup3D, Node3D); +class FogVolume : public VisualInstance3D { + GDCLASS(FogVolume, VisualInstance3D); -public: - enum DispatchMode { - MODE_PROXY, - MODE_SIGNAL, - }; - -private: - Map<StringName, uint32_t> groups; - - String group_name; - DispatchMode dispatch_mode = MODE_PROXY; - Vector3 grid_radius = Vector3(1, 1, 1); - - real_t cell_size = 1.0; - uint32_t group_version = 0; + Vector3 extents = Vector3(1, 1, 1); + Ref<Material> material; + RS::FogVolumeShape shape = RS::FOG_VOLUME_SHAPE_BOX; - void _clear_groups(); - void _update_groups(); - void _add_groups(int *p_cell, String p_base, int p_depth); - void _new_group(StringName p_name); - - void _proximity_group_broadcast(String p_method, Variant p_parameters); + RID volume; protected: - void _notification(int p_what); - + _FORCE_INLINE_ RID _get_volume() { return volume; } static void _bind_methods(); + virtual void _validate_property(PropertyInfo &property) const override; public: - void set_group_name(const String &p_group_name); - String get_group_name() const; + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; - void set_dispatch_mode(DispatchMode p_mode); - DispatchMode get_dispatch_mode() const; + void set_shape(RS::FogVolumeShape p_type); + RS::FogVolumeShape get_shape() const; - void set_grid_radius(const Vector3 &p_radius); - Vector3 get_grid_radius() const; + void set_material(const Ref<Material> &p_material); + Ref<Material> get_material() const; - void broadcast(String p_method, Variant p_parameters); + virtual AABB get_aabb() const override; + virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); } + TypedArray<String> get_configuration_warnings() const override; - ProximityGroup3D(); - ~ProximityGroup3D() {} + FogVolume(); + ~FogVolume(); }; -VARIANT_ENUM_CAST(ProximityGroup3D::DispatchMode); - -#endif // PROXIMITY_GROUP_H +#endif // FOG_VOLUME_H diff --git a/scene/3d/gpu_particles_3d.cpp b/scene/3d/gpu_particles_3d.cpp index 32a62d8c7e..b35a45576f 100644 --- a/scene/3d/gpu_particles_3d.cpp +++ b/scene/3d/gpu_particles_3d.cpp @@ -277,7 +277,7 @@ TypedArray<String> GPUParticles3D::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); if (RenderingServer::get_singleton()->is_low_end()) { - warnings.push_back(TTR("GPU-based particles are not supported by the GLES2 video driver.\nUse the CPUParticles3D node instead. You can use the \"Convert to CPUParticles3D\" option for this purpose.")); + warnings.push_back(TTR("GPU-based particles are not supported by the OpenGL video driver.\nUse the CPUParticles3D node instead. You can use the \"Convert to CPUParticles3D\" option for this purpose.")); } bool meshes_found = false; @@ -388,6 +388,8 @@ void GPUParticles3D::_validate_property(PropertyInfo &property) const { return; } } + + GeometryInstance3D::_validate_property(property); } void GPUParticles3D::emit_particle(const Transform3D &p_transform, const Vector3 &p_velocity, const Color &p_color, const Color &p_custom, uint32_t p_emit_flags) { @@ -562,6 +564,7 @@ void GPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_transform_align"), &GPUParticles3D::get_transform_align); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "emitting"), "set_emitting", "is_emitting"); + ADD_PROPERTY_DEFAULT("emitting", true); // Workaround for doctool in headless mode, as dummy rasterizer always returns false. ADD_PROPERTY(PropertyInfo(Variant::INT, "amount", PROPERTY_HINT_RANGE, "1,1000000,1,exp"), "set_amount", "get_amount"); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "sub_emitter", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "GPUParticles3D"), "set_sub_emitter", "get_sub_emitter"); ADD_GROUP("Time", ""); diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp index 9127168c58..adb532145b 100644 --- a/scene/3d/gpu_particles_collision_3d.cpp +++ b/scene/3d/gpu_particles_collision_3d.cpp @@ -62,68 +62,68 @@ GPUParticlesCollision3D::~GPUParticlesCollision3D() { ///////////////////////////////// -void GPUParticlesCollisionSphere::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesCollisionSphere::set_radius); - ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesCollisionSphere::get_radius); +void GPUParticlesCollisionSphere3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesCollisionSphere3D::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesCollisionSphere3D::get_radius); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); } -void GPUParticlesCollisionSphere::set_radius(real_t p_radius) { +void GPUParticlesCollisionSphere3D::set_radius(real_t p_radius) { radius = p_radius; RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); update_gizmos(); } -real_t GPUParticlesCollisionSphere::get_radius() const { +real_t GPUParticlesCollisionSphere3D::get_radius() const { return radius; } -AABB GPUParticlesCollisionSphere::get_aabb() const { +AABB GPUParticlesCollisionSphere3D::get_aabb() const { return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); } -GPUParticlesCollisionSphere::GPUParticlesCollisionSphere() : +GPUParticlesCollisionSphere3D::GPUParticlesCollisionSphere3D() : GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE) { } -GPUParticlesCollisionSphere::~GPUParticlesCollisionSphere() { +GPUParticlesCollisionSphere3D::~GPUParticlesCollisionSphere3D() { } /////////////////////////// -void GPUParticlesCollisionBox::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionBox::set_extents); - ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionBox::get_extents); +void GPUParticlesCollisionBox3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionBox3D::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionBox3D::get_extents); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); } -void GPUParticlesCollisionBox::set_extents(const Vector3 &p_extents) { +void GPUParticlesCollisionBox3D::set_extents(const Vector3 &p_extents) { extents = p_extents; RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); update_gizmos(); } -Vector3 GPUParticlesCollisionBox::get_extents() const { +Vector3 GPUParticlesCollisionBox3D::get_extents() const { return extents; } -AABB GPUParticlesCollisionBox::get_aabb() const { +AABB GPUParticlesCollisionBox3D::get_aabb() const { return AABB(-extents, extents * 2); } -GPUParticlesCollisionBox::GPUParticlesCollisionBox() : +GPUParticlesCollisionBox3D::GPUParticlesCollisionBox3D() : GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE) { } -GPUParticlesCollisionBox::~GPUParticlesCollisionBox() { +GPUParticlesCollisionBox3D::~GPUParticlesCollisionBox3D() { } /////////////////////////////// /////////////////////////// -void GPUParticlesCollisionSDF::_find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes) { +void GPUParticlesCollisionSDF3D::_find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes) { MeshInstance3D *mi = Object::cast_to<MeshInstance3D>(p_at_node); if (mi && mi->is_visible_in_tree()) { Ref<Mesh> mesh = mi->get_mesh(); @@ -172,7 +172,7 @@ void GPUParticlesCollisionSDF::_find_meshes(const AABB &p_aabb, Node *p_at_node, } } -uint32_t GPUParticlesCollisionSDF::_create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness) { +uint32_t GPUParticlesCollisionSDF3D::_create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness) { if (p_face_count == 1) { return BVH::LEAF_BIT | p_faces[0].index; } @@ -220,7 +220,7 @@ static _FORCE_INLINE_ real_t Vector3_dot2(const Vector3 &p_vec3) { return p_vec3.dot(p_vec3); } -void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance) { +void GPUParticlesCollisionSDF3D::_find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance) { if (p_bvh_cell & BVH::LEAF_BIT) { p_bvh_cell &= BVH::LEAF_MASK; //remove bit @@ -256,10 +256,10 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons Vector2 pq1 = v1 - e1 * CLAMP(v1.dot(e1) / e1.dot(e1), 0.0, 1.0); Vector2 pq2 = v2 - e2 * CLAMP(v2.dot(e2) / e2.dot(e2), 0.0, 1.0); - float s = SGN(e0.x * e2.y - e0.y * e2.x); + float s = SIGN(e0.x * e2.y - e0.y * e2.x); Vector2 d2 = Vector2(pq0.dot(pq0), s * (v0.x * e0.y - v0.y * e0.x)).min(Vector2(pq1.dot(pq1), s * (v1.x * e1.y - v1.y * e1.x))).min(Vector2(pq2.dot(pq2), s * (v2.x * e2.y - v2.y * e2.x))); - inside_d = -Math::sqrt(d2.x) * SGN(d2.y); + inside_d = -Math::sqrt(d2.x) * SIGN(d2.y); } //make sure distance to planes is not shorter if inside @@ -288,15 +288,12 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons Vector3 nor = ba.cross(ac); inside_d = Math::sqrt( - (SGN(ba.cross(nor).dot(pa)) + - SGN(cb.cross(nor).dot(pb)) + - SGN(ac.cross(nor).dot(pc)) < - 2.0) ? - MIN(MIN( - Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa), - Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)), - Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) : - nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor)); + (SIGN(ba.cross(nor).dot(pa)) + SIGN(cb.cross(nor).dot(pb)) + SIGN(ac.cross(nor).dot(pc)) < 2.0) + ? MIN(MIN( + Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa), + Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)), + Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) + : nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor)); closest_distance = MIN(closest_distance, inside_d); } @@ -324,7 +321,7 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons } } -void GPUParticlesCollisionSDF::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *params) { +void GPUParticlesCollisionSDF3D::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *params) { int32_t z_ofs = p_z * params->size.y * params->size.x; for (int32_t y = 0; y < params->size.y; y++) { int32_t y_ofs = z_ofs + y * params->size.x; @@ -341,10 +338,10 @@ void GPUParticlesCollisionSDF::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *pa } } -void GPUParticlesCollisionSDF::_compute_sdf(ComputeSDFParams *params) { +void GPUParticlesCollisionSDF3D::_compute_sdf(ComputeSDFParams *params) { ThreadWorkPool work_pool; work_pool.init(); - work_pool.begin_work(params->size.z, this, &GPUParticlesCollisionSDF::_compute_sdf_z, params); + work_pool.begin_work(params->size.z, this, &GPUParticlesCollisionSDF3D::_compute_sdf_z, params); while (!work_pool.is_done_dispatching()) { OS::get_singleton()->delay_usec(10000); bake_step_function(work_pool.get_work_index() * 100 / params->size.z, "Baking SDF"); @@ -353,7 +350,7 @@ void GPUParticlesCollisionSDF::_compute_sdf(ComputeSDFParams *params) { work_pool.finish(); } -Vector3i GPUParticlesCollisionSDF::get_estimated_cell_size() const { +Vector3i GPUParticlesCollisionSDF3D::get_estimated_cell_size() const { static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; int subdiv = subdivs[get_resolution()]; @@ -368,7 +365,7 @@ Vector3i GPUParticlesCollisionSDF::get_estimated_cell_size() const { return sdf_size; } -Ref<Image> GPUParticlesCollisionSDF::bake() { +Ref<Image> GPUParticlesCollisionSDF3D::bake() { static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; int subdiv = subdivs[get_resolution()]; @@ -504,18 +501,18 @@ Ref<Image> GPUParticlesCollisionSDF::bake() { return ret; } -void GPUParticlesCollisionSDF::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionSDF::set_extents); - ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionSDF::get_extents); +void GPUParticlesCollisionSDF3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionSDF3D::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionSDF3D::get_extents); - ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionSDF::set_resolution); - ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionSDF::get_resolution); + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionSDF3D::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionSDF3D::get_resolution); - ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesCollisionSDF::set_texture); - ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesCollisionSDF::get_texture); + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesCollisionSDF3D::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesCollisionSDF3D::get_texture); - ClassDB::bind_method(D_METHOD("set_thickness", "thickness"), &GPUParticlesCollisionSDF::set_thickness); - ClassDB::bind_method(D_METHOD("get_thickness"), &GPUParticlesCollisionSDF::get_thickness); + ClassDB::bind_method(D_METHOD("set_thickness", "thickness"), &GPUParticlesCollisionSDF3D::set_thickness); + ClassDB::bind_method(D_METHOD("get_thickness"), &GPUParticlesCollisionSDF3D::get_thickness); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "16,32,64,128,256,512"), "set_resolution", "get_resolution"); @@ -531,62 +528,62 @@ void GPUParticlesCollisionSDF::_bind_methods() { BIND_ENUM_CONSTANT(RESOLUTION_MAX); } -void GPUParticlesCollisionSDF::set_thickness(float p_thickness) { +void GPUParticlesCollisionSDF3D::set_thickness(float p_thickness) { thickness = p_thickness; } -float GPUParticlesCollisionSDF::get_thickness() const { +float GPUParticlesCollisionSDF3D::get_thickness() const { return thickness; } -void GPUParticlesCollisionSDF::set_extents(const Vector3 &p_extents) { +void GPUParticlesCollisionSDF3D::set_extents(const Vector3 &p_extents) { extents = p_extents; RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); update_gizmos(); } -Vector3 GPUParticlesCollisionSDF::get_extents() const { +Vector3 GPUParticlesCollisionSDF3D::get_extents() const { return extents; } -void GPUParticlesCollisionSDF::set_resolution(Resolution p_resolution) { +void GPUParticlesCollisionSDF3D::set_resolution(Resolution p_resolution) { resolution = p_resolution; update_gizmos(); } -GPUParticlesCollisionSDF::Resolution GPUParticlesCollisionSDF::get_resolution() const { +GPUParticlesCollisionSDF3D::Resolution GPUParticlesCollisionSDF3D::get_resolution() const { return resolution; } -void GPUParticlesCollisionSDF::set_texture(const Ref<Texture3D> &p_texture) { +void GPUParticlesCollisionSDF3D::set_texture(const Ref<Texture3D> &p_texture) { texture = p_texture; RID tex = texture.is_valid() ? texture->get_rid() : RID(); RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); } -Ref<Texture3D> GPUParticlesCollisionSDF::get_texture() const { +Ref<Texture3D> GPUParticlesCollisionSDF3D::get_texture() const { return texture; } -AABB GPUParticlesCollisionSDF::get_aabb() const { +AABB GPUParticlesCollisionSDF3D::get_aabb() const { return AABB(-extents, extents * 2); } -GPUParticlesCollisionSDF::BakeBeginFunc GPUParticlesCollisionSDF::bake_begin_function = nullptr; -GPUParticlesCollisionSDF::BakeStepFunc GPUParticlesCollisionSDF::bake_step_function = nullptr; -GPUParticlesCollisionSDF::BakeEndFunc GPUParticlesCollisionSDF::bake_end_function = nullptr; +GPUParticlesCollisionSDF3D::BakeBeginFunc GPUParticlesCollisionSDF3D::bake_begin_function = nullptr; +GPUParticlesCollisionSDF3D::BakeStepFunc GPUParticlesCollisionSDF3D::bake_step_function = nullptr; +GPUParticlesCollisionSDF3D::BakeEndFunc GPUParticlesCollisionSDF3D::bake_end_function = nullptr; -GPUParticlesCollisionSDF::GPUParticlesCollisionSDF() : +GPUParticlesCollisionSDF3D::GPUParticlesCollisionSDF3D() : GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE) { } -GPUParticlesCollisionSDF::~GPUParticlesCollisionSDF() { +GPUParticlesCollisionSDF3D::~GPUParticlesCollisionSDF3D() { } //////////////////////////// //////////////////////////// -void GPUParticlesCollisionHeightField::_notification(int p_what) { +void GPUParticlesCollisionHeightField3D::_notification(int p_what) { if (p_what == NOTIFICATION_INTERNAL_PROCESS) { if (update_mode == UPDATE_MODE_ALWAYS) { RS::get_singleton()->particles_collision_height_field_update(_get_collision()); @@ -631,21 +628,21 @@ void GPUParticlesCollisionHeightField::_notification(int p_what) { } } -void GPUParticlesCollisionHeightField::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionHeightField::set_extents); - ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionHeightField::get_extents); +void GPUParticlesCollisionHeightField3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionHeightField3D::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionHeightField3D::get_extents); - ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionHeightField::set_resolution); - ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionHeightField::get_resolution); + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionHeightField3D::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionHeightField3D::get_resolution); - ClassDB::bind_method(D_METHOD("set_update_mode", "update_mode"), &GPUParticlesCollisionHeightField::set_update_mode); - ClassDB::bind_method(D_METHOD("get_update_mode"), &GPUParticlesCollisionHeightField::get_update_mode); + ClassDB::bind_method(D_METHOD("set_update_mode", "update_mode"), &GPUParticlesCollisionHeightField3D::set_update_mode); + ClassDB::bind_method(D_METHOD("get_update_mode"), &GPUParticlesCollisionHeightField3D::get_update_mode); - ClassDB::bind_method(D_METHOD("set_follow_camera_mode", "enabled"), &GPUParticlesCollisionHeightField::set_follow_camera_mode); - ClassDB::bind_method(D_METHOD("is_follow_camera_mode_enabled"), &GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled); + ClassDB::bind_method(D_METHOD("set_follow_camera_mode", "enabled"), &GPUParticlesCollisionHeightField3D::set_follow_camera_mode); + ClassDB::bind_method(D_METHOD("is_follow_camera_mode_enabled"), &GPUParticlesCollisionHeightField3D::is_follow_camera_mode_enabled); - ClassDB::bind_method(D_METHOD("set_follow_camera_push_ratio", "ratio"), &GPUParticlesCollisionHeightField::set_follow_camera_push_ratio); - ClassDB::bind_method(D_METHOD("get_follow_camera_push_ratio"), &GPUParticlesCollisionHeightField::get_follow_camera_push_ratio); + ClassDB::bind_method(D_METHOD("set_follow_camera_push_ratio", "ratio"), &GPUParticlesCollisionHeightField3D::set_follow_camera_push_ratio); + ClassDB::bind_method(D_METHOD("get_follow_camera_push_ratio"), &GPUParticlesCollisionHeightField3D::get_follow_camera_push_ratio); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "256,512,1024,2048,4096,8192"), "set_resolution", "get_resolution"); @@ -666,63 +663,63 @@ void GPUParticlesCollisionHeightField::_bind_methods() { BIND_ENUM_CONSTANT(UPDATE_MODE_ALWAYS); } -void GPUParticlesCollisionHeightField::set_follow_camera_push_ratio(float p_follow_camera_push_ratio) { +void GPUParticlesCollisionHeightField3D::set_follow_camera_push_ratio(float p_follow_camera_push_ratio) { follow_camera_push_ratio = p_follow_camera_push_ratio; } -float GPUParticlesCollisionHeightField::get_follow_camera_push_ratio() const { +float GPUParticlesCollisionHeightField3D::get_follow_camera_push_ratio() const { return follow_camera_push_ratio; } -void GPUParticlesCollisionHeightField::set_extents(const Vector3 &p_extents) { +void GPUParticlesCollisionHeightField3D::set_extents(const Vector3 &p_extents) { extents = p_extents; RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); update_gizmos(); RS::get_singleton()->particles_collision_height_field_update(_get_collision()); } -Vector3 GPUParticlesCollisionHeightField::get_extents() const { +Vector3 GPUParticlesCollisionHeightField3D::get_extents() const { return extents; } -void GPUParticlesCollisionHeightField::set_resolution(Resolution p_resolution) { +void GPUParticlesCollisionHeightField3D::set_resolution(Resolution p_resolution) { resolution = p_resolution; RS::get_singleton()->particles_collision_set_height_field_resolution(_get_collision(), RS::ParticlesCollisionHeightfieldResolution(resolution)); update_gizmos(); RS::get_singleton()->particles_collision_height_field_update(_get_collision()); } -GPUParticlesCollisionHeightField::Resolution GPUParticlesCollisionHeightField::get_resolution() const { +GPUParticlesCollisionHeightField3D::Resolution GPUParticlesCollisionHeightField3D::get_resolution() const { return resolution; } -void GPUParticlesCollisionHeightField::set_update_mode(UpdateMode p_update_mode) { +void GPUParticlesCollisionHeightField3D::set_update_mode(UpdateMode p_update_mode) { update_mode = p_update_mode; set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); } -GPUParticlesCollisionHeightField::UpdateMode GPUParticlesCollisionHeightField::get_update_mode() const { +GPUParticlesCollisionHeightField3D::UpdateMode GPUParticlesCollisionHeightField3D::get_update_mode() const { return update_mode; } -void GPUParticlesCollisionHeightField::set_follow_camera_mode(bool p_enabled) { +void GPUParticlesCollisionHeightField3D::set_follow_camera_mode(bool p_enabled) { follow_camera_mode = p_enabled; set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); } -bool GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled() const { +bool GPUParticlesCollisionHeightField3D::is_follow_camera_mode_enabled() const { return follow_camera_mode; } -AABB GPUParticlesCollisionHeightField::get_aabb() const { +AABB GPUParticlesCollisionHeightField3D::get_aabb() const { return AABB(-extents, extents * 2); } -GPUParticlesCollisionHeightField::GPUParticlesCollisionHeightField() : +GPUParticlesCollisionHeightField3D::GPUParticlesCollisionHeightField3D() : GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE) { } -GPUParticlesCollisionHeightField::~GPUParticlesCollisionHeightField() { +GPUParticlesCollisionHeightField3D::~GPUParticlesCollisionHeightField3D() { } //////////////////////////// @@ -795,104 +792,104 @@ GPUParticlesAttractor3D::~GPUParticlesAttractor3D() { ///////////////////////////////// -void GPUParticlesAttractorSphere::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesAttractorSphere::set_radius); - ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesAttractorSphere::get_radius); +void GPUParticlesAttractorSphere3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesAttractorSphere3D::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesAttractorSphere3D::get_radius); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); } -void GPUParticlesAttractorSphere::set_radius(real_t p_radius) { +void GPUParticlesAttractorSphere3D::set_radius(real_t p_radius) { radius = p_radius; RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); update_gizmos(); } -real_t GPUParticlesAttractorSphere::get_radius() const { +real_t GPUParticlesAttractorSphere3D::get_radius() const { return radius; } -AABB GPUParticlesAttractorSphere::get_aabb() const { +AABB GPUParticlesAttractorSphere3D::get_aabb() const { return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); } -GPUParticlesAttractorSphere::GPUParticlesAttractorSphere() : +GPUParticlesAttractorSphere3D::GPUParticlesAttractorSphere3D() : GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT) { } -GPUParticlesAttractorSphere::~GPUParticlesAttractorSphere() { +GPUParticlesAttractorSphere3D::~GPUParticlesAttractorSphere3D() { } /////////////////////////// -void GPUParticlesAttractorBox::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorBox::set_extents); - ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorBox::get_extents); +void GPUParticlesAttractorBox3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorBox3D::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorBox3D::get_extents); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); } -void GPUParticlesAttractorBox::set_extents(const Vector3 &p_extents) { +void GPUParticlesAttractorBox3D::set_extents(const Vector3 &p_extents) { extents = p_extents; RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); update_gizmos(); } -Vector3 GPUParticlesAttractorBox::get_extents() const { +Vector3 GPUParticlesAttractorBox3D::get_extents() const { return extents; } -AABB GPUParticlesAttractorBox::get_aabb() const { +AABB GPUParticlesAttractorBox3D::get_aabb() const { return AABB(-extents, extents * 2); } -GPUParticlesAttractorBox::GPUParticlesAttractorBox() : +GPUParticlesAttractorBox3D::GPUParticlesAttractorBox3D() : GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT) { } -GPUParticlesAttractorBox::~GPUParticlesAttractorBox() { +GPUParticlesAttractorBox3D::~GPUParticlesAttractorBox3D() { } /////////////////////////// -void GPUParticlesAttractorVectorField::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorVectorField::set_extents); - ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorVectorField::get_extents); +void GPUParticlesAttractorVectorField3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorVectorField3D::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorVectorField3D::get_extents); - ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesAttractorVectorField::set_texture); - ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesAttractorVectorField::get_texture); + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesAttractorVectorField3D::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesAttractorVectorField3D::get_texture); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture"); } -void GPUParticlesAttractorVectorField::set_extents(const Vector3 &p_extents) { +void GPUParticlesAttractorVectorField3D::set_extents(const Vector3 &p_extents) { extents = p_extents; RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); update_gizmos(); } -Vector3 GPUParticlesAttractorVectorField::get_extents() const { +Vector3 GPUParticlesAttractorVectorField3D::get_extents() const { return extents; } -void GPUParticlesAttractorVectorField::set_texture(const Ref<Texture3D> &p_texture) { +void GPUParticlesAttractorVectorField3D::set_texture(const Ref<Texture3D> &p_texture) { texture = p_texture; RID tex = texture.is_valid() ? texture->get_rid() : RID(); RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); } -Ref<Texture3D> GPUParticlesAttractorVectorField::get_texture() const { +Ref<Texture3D> GPUParticlesAttractorVectorField3D::get_texture() const { return texture; } -AABB GPUParticlesAttractorVectorField::get_aabb() const { +AABB GPUParticlesAttractorVectorField3D::get_aabb() const { return AABB(-extents, extents * 2); } -GPUParticlesAttractorVectorField::GPUParticlesAttractorVectorField() : +GPUParticlesAttractorVectorField3D::GPUParticlesAttractorVectorField3D() : GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) { } -GPUParticlesAttractorVectorField::~GPUParticlesAttractorVectorField() { +GPUParticlesAttractorVectorField3D::~GPUParticlesAttractorVectorField3D() { } diff --git a/scene/3d/gpu_particles_collision_3d.h b/scene/3d/gpu_particles_collision_3d.h index fbf68ed6df..5568ecdfc1 100644 --- a/scene/3d/gpu_particles_collision_3d.h +++ b/scene/3d/gpu_particles_collision_3d.h @@ -55,8 +55,8 @@ public: ~GPUParticlesCollision3D(); }; -class GPUParticlesCollisionSphere : public GPUParticlesCollision3D { - GDCLASS(GPUParticlesCollisionSphere, GPUParticlesCollision3D); +class GPUParticlesCollisionSphere3D : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSphere3D, GPUParticlesCollision3D); real_t radius = 1.0; @@ -69,12 +69,12 @@ public: virtual AABB get_aabb() const override; - GPUParticlesCollisionSphere(); - ~GPUParticlesCollisionSphere(); + GPUParticlesCollisionSphere3D(); + ~GPUParticlesCollisionSphere3D(); }; -class GPUParticlesCollisionBox : public GPUParticlesCollision3D { - GDCLASS(GPUParticlesCollisionBox, GPUParticlesCollision3D); +class GPUParticlesCollisionBox3D : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionBox3D, GPUParticlesCollision3D); Vector3 extents = Vector3(1, 1, 1); @@ -87,12 +87,12 @@ public: virtual AABB get_aabb() const override; - GPUParticlesCollisionBox(); - ~GPUParticlesCollisionBox(); + GPUParticlesCollisionBox3D(); + ~GPUParticlesCollisionBox3D(); }; -class GPUParticlesCollisionSDF : public GPUParticlesCollision3D { - GDCLASS(GPUParticlesCollisionSDF, GPUParticlesCollision3D); +class GPUParticlesCollisionSDF3D : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSDF3D, GPUParticlesCollision3D); public: enum Resolution { @@ -184,14 +184,14 @@ public: static BakeStepFunc bake_step_function; static BakeEndFunc bake_end_function; - GPUParticlesCollisionSDF(); - ~GPUParticlesCollisionSDF(); + GPUParticlesCollisionSDF3D(); + ~GPUParticlesCollisionSDF3D(); }; -VARIANT_ENUM_CAST(GPUParticlesCollisionSDF::Resolution) +VARIANT_ENUM_CAST(GPUParticlesCollisionSDF3D::Resolution) -class GPUParticlesCollisionHeightField : public GPUParticlesCollision3D { - GDCLASS(GPUParticlesCollisionHeightField, GPUParticlesCollision3D); +class GPUParticlesCollisionHeightField3D : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionHeightField3D, GPUParticlesCollision3D); public: enum Resolution { @@ -239,12 +239,12 @@ public: virtual AABB get_aabb() const override; - GPUParticlesCollisionHeightField(); - ~GPUParticlesCollisionHeightField(); + GPUParticlesCollisionHeightField3D(); + ~GPUParticlesCollisionHeightField3D(); }; -VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::Resolution) -VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::UpdateMode) +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField3D::Resolution) +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField3D::UpdateMode) class GPUParticlesAttractor3D : public VisualInstance3D { GDCLASS(GPUParticlesAttractor3D, VisualInstance3D); @@ -279,8 +279,8 @@ public: ~GPUParticlesAttractor3D(); }; -class GPUParticlesAttractorSphere : public GPUParticlesAttractor3D { - GDCLASS(GPUParticlesAttractorSphere, GPUParticlesAttractor3D); +class GPUParticlesAttractorSphere3D : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorSphere3D, GPUParticlesAttractor3D); real_t radius = 1.0; @@ -293,12 +293,12 @@ public: virtual AABB get_aabb() const override; - GPUParticlesAttractorSphere(); - ~GPUParticlesAttractorSphere(); + GPUParticlesAttractorSphere3D(); + ~GPUParticlesAttractorSphere3D(); }; -class GPUParticlesAttractorBox : public GPUParticlesAttractor3D { - GDCLASS(GPUParticlesAttractorBox, GPUParticlesAttractor3D); +class GPUParticlesAttractorBox3D : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorBox3D, GPUParticlesAttractor3D); Vector3 extents = Vector3(1, 1, 1); @@ -311,12 +311,12 @@ public: virtual AABB get_aabb() const override; - GPUParticlesAttractorBox(); - ~GPUParticlesAttractorBox(); + GPUParticlesAttractorBox3D(); + ~GPUParticlesAttractorBox3D(); }; -class GPUParticlesAttractorVectorField : public GPUParticlesAttractor3D { - GDCLASS(GPUParticlesAttractorVectorField, GPUParticlesAttractor3D); +class GPUParticlesAttractorVectorField3D : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorVectorField3D, GPUParticlesAttractor3D); Vector3 extents = Vector3(1, 1, 1); Ref<Texture3D> texture; @@ -333,8 +333,8 @@ public: virtual AABB get_aabb() const override; - GPUParticlesAttractorVectorField(); - ~GPUParticlesAttractorVectorField(); + GPUParticlesAttractorVectorField3D(); + ~GPUParticlesAttractorVectorField3D(); }; #endif // GPU_PARTICLES_COLLISION_3D_H diff --git a/scene/3d/light_3d.cpp b/scene/3d/light_3d.cpp index c787ba5087..5d9ae019c2 100644 --- a/scene/3d/light_3d.cpp +++ b/scene/3d/light_3d.cpp @@ -197,24 +197,14 @@ bool Light3D::is_editor_only() const { void Light3D::_validate_property(PropertyInfo &property) const { if (!shadow && (property.name == "shadow_color" || property.name == "shadow_bias" || property.name == "shadow_normal_bias" || property.name == "shadow_reverse_cull_face" || property.name == "shadow_transmittance_bias" || property.name == "shadow_fog_fade" || property.name == "shadow_blur")) { - property.usage = PROPERTY_USAGE_NOEDITOR; - } - - if (get_light_type() == RS::LIGHT_DIRECTIONAL && property.name == "light_size") { - property.usage = PROPERTY_USAGE_NONE; - } - - if (get_light_type() == RS::LIGHT_DIRECTIONAL && property.name == "light_specular") { - property.usage = PROPERTY_USAGE_NONE; - } - - if (get_light_type() == RS::LIGHT_DIRECTIONAL && property.name == "light_projector") { - property.usage = PROPERTY_USAGE_NONE; + property.usage = PROPERTY_USAGE_NO_EDITOR; } if (get_light_type() != RS::LIGHT_DIRECTIONAL && property.name == "light_angular_distance") { + // Angular distance is only used in DirectionalLight3D. property.usage = PROPERTY_USAGE_NONE; } + VisualInstance3D::_validate_property(property); } void Light3D::_bind_methods() { @@ -361,6 +351,7 @@ Light3D::~Light3D() { void DirectionalLight3D::set_shadow_mode(ShadowMode p_mode) { shadow_mode = p_mode; RS::get_singleton()->light_directional_set_shadow_mode(light, RS::LightDirectionalShadowMode(p_mode)); + notify_property_list_changed(); } DirectionalLight3D::ShadowMode DirectionalLight3D::get_shadow_mode() const { @@ -385,6 +376,25 @@ bool DirectionalLight3D::is_sky_only() const { return sky_only; } +void DirectionalLight3D::_validate_property(PropertyInfo &property) const { + if (shadow_mode == SHADOW_ORTHOGONAL && (property.name == "directional_shadow_split_1" || property.name == "directional_shadow_blend_splits")) { + // Split 2 and split blending are only used with the PSSM 2 Splits and PSSM 4 Splits shadow modes. + property.usage = PROPERTY_USAGE_NO_EDITOR; + } + + if ((shadow_mode == SHADOW_ORTHOGONAL || shadow_mode == SHADOW_PARALLEL_2_SPLITS) && (property.name == "directional_shadow_split_2" || property.name == "directional_shadow_split_3")) { + // Splits 3 and 4 are only used with the PSSM 4 Splits shadow mode. + property.usage = PROPERTY_USAGE_NO_EDITOR; + } + + if (property.name == "light_size" || property.name == "light_projector" || property.name == "light_specular") { + // Not implemented in DirectionalLight3D (`light_size` is replaced by `light_angular_distance`). + property.usage = PROPERTY_USAGE_NONE; + } + + Light3D::_validate_property(property); +} + void DirectionalLight3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_shadow_mode", "mode"), &DirectionalLight3D::set_shadow_mode); ClassDB::bind_method(D_METHOD("get_shadow_mode"), &DirectionalLight3D::get_shadow_mode); @@ -400,8 +410,8 @@ void DirectionalLight3D::_bind_methods() { ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_split_1", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_param", "get_param", PARAM_SHADOW_SPLIT_1_OFFSET); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_split_2", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_param", "get_param", PARAM_SHADOW_SPLIT_2_OFFSET); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_split_3", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_param", "get_param", PARAM_SHADOW_SPLIT_3_OFFSET); - ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_fade_start", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_param", "get_param", PARAM_SHADOW_FADE_START); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "directional_shadow_blend_splits"), "set_blend_splits", "is_blend_splits_enabled"); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_fade_start", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_param", "get_param", PARAM_SHADOW_FADE_START); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_max_distance", PROPERTY_HINT_RANGE, "0,8192,0.1,or_greater,exp"), "set_param", "get_param", PARAM_SHADOW_MAX_DISTANCE); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "directional_shadow_pancake_size", PROPERTY_HINT_RANGE, "0,1024,0.1,or_greater,exp"), "set_param", "get_param", PARAM_SHADOW_PANCAKE_SIZE); diff --git a/scene/3d/light_3d.h b/scene/3d/light_3d.h index f788c323f7..a9f5ce27b4 100644 --- a/scene/3d/light_3d.h +++ b/scene/3d/light_3d.h @@ -152,6 +152,7 @@ private: protected: static void _bind_methods(); + virtual void _validate_property(PropertyInfo &property) const override; public: void set_shadow_mode(ShadowMode p_mode); diff --git a/scene/3d/lightmap_gi.cpp b/scene/3d/lightmap_gi.cpp index b56f0fd145..910cf3a37d 100644 --- a/scene/3d/lightmap_gi.cpp +++ b/scene/3d/lightmap_gi.cpp @@ -200,9 +200,9 @@ void LightmapGIData::_bind_methods() { ClassDB::bind_method(D_METHOD("_get_probe_data"), &LightmapGIData::_get_probe_data); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "light_texture", PROPERTY_HINT_RESOURCE_TYPE, "TextureLayered"), "set_light_texture", "get_light_texture"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "uses_spherical_harmonics", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_uses_spherical_harmonics", "is_using_spherical_harmonics"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "user_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_user_data", "_get_user_data"); - ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "probe_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_probe_data", "_get_probe_data"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "uses_spherical_harmonics", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_uses_spherical_harmonics", "is_using_spherical_harmonics"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "user_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_user_data", "_get_user_data"); + ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "probe_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_probe_data", "_get_probe_data"); } LightmapGIData::LightmapGIData() { @@ -614,7 +614,7 @@ void LightmapGI::_gen_new_positions_from_octree(const GenProbesOctree *p_cell, f } LightmapGI::BakeError LightmapGI::bake(Node *p_from_node, String p_image_data_path, Lightmapper::BakeStepFunc p_bake_step, void *p_bake_userdata) { - if (p_image_data_path == "") { + if (p_image_data_path.is_empty()) { if (get_light_data().is_null()) { return BAKE_ERROR_NO_SAVE_PATH; } @@ -1370,6 +1370,7 @@ void LightmapGI::_validate_property(PropertyInfo &property) const { if (property.name == "environment_custom_energy" && environment_mode != ENVIRONMENT_MODE_CUSTOM_COLOR && environment_mode != ENVIRONMENT_MODE_CUSTOM_SKY) { property.usage = PROPERTY_USAGE_NONE; } + VisualInstance3D::_validate_property(property); } void LightmapGI::_bind_methods() { diff --git a/scene/3d/mesh_instance_3d.cpp b/scene/3d/mesh_instance_3d.cpp index c148f95461..ae686143e4 100644 --- a/scene/3d/mesh_instance_3d.cpp +++ b/scene/3d/mesh_instance_3d.cpp @@ -244,7 +244,7 @@ Node *MeshInstance3D::create_trimesh_collision_node() { StaticBody3D *static_body = memnew(StaticBody3D); CollisionShape3D *cshape = memnew(CollisionShape3D); cshape->set_shape(shape); - static_body->add_child(cshape); + static_body->add_child(cshape, true); return static_body; } @@ -253,7 +253,7 @@ void MeshInstance3D::create_trimesh_collision() { ERR_FAIL_COND(!static_body); static_body->set_name(String(get_name()) + "_col"); - add_child(static_body); + add_child(static_body, true); if (get_owner()) { CollisionShape3D *cshape = Object::cast_to<CollisionShape3D>(static_body->get_child(0)); static_body->set_owner(get_owner()); @@ -274,7 +274,7 @@ Node *MeshInstance3D::create_convex_collision_node(bool p_clean, bool p_simplify StaticBody3D *static_body = memnew(StaticBody3D); CollisionShape3D *cshape = memnew(CollisionShape3D); cshape->set_shape(shape); - static_body->add_child(cshape); + static_body->add_child(cshape, true); return static_body; } @@ -283,7 +283,7 @@ void MeshInstance3D::create_convex_collision(bool p_clean, bool p_simplify) { ERR_FAIL_COND(!static_body); static_body->set_name(String(get_name()) + "_col"); - add_child(static_body); + add_child(static_body, true); if (get_owner()) { CollisionShape3D *cshape = Object::cast_to<CollisionShape3D>(static_body->get_child(0)); static_body->set_owner(get_owner()); @@ -306,7 +306,7 @@ Node *MeshInstance3D::create_multiple_convex_collisions_node() { for (int i = 0; i < shapes.size(); i++) { CollisionShape3D *cshape = memnew(CollisionShape3D); cshape->set_shape(shapes[i]); - static_body->add_child(cshape); + static_body->add_child(cshape, true); } return static_body; } @@ -316,7 +316,7 @@ void MeshInstance3D::create_multiple_convex_collisions() { ERR_FAIL_COND(!static_body); static_body->set_name(String(get_name()) + "_col"); - add_child(static_body); + add_child(static_body, true); if (get_owner()) { static_body->set_owner(get_owner()); int count = static_body->get_child_count(); @@ -460,7 +460,7 @@ void MeshInstance3D::create_debug_tangents() { MeshInstance3D *mi = memnew(MeshInstance3D); mi->set_mesh(am); mi->set_name("DebugTangents"); - add_child(mi); + add_child(mi, true); #ifdef TOOLS_ENABLED if (is_inside_tree() && this == get_tree()->get_edited_scene_root()) { diff --git a/scene/3d/navigation_agent_3d.cpp b/scene/3d/navigation_agent_3d.cpp index c2d5c757db..1bc7d20c19 100644 --- a/scene/3d/navigation_agent_3d.cpp +++ b/scene/3d/navigation_agent_3d.cpp @@ -192,7 +192,7 @@ Vector3 NavigationAgent3D::get_target_location() const { Vector3 NavigationAgent3D::get_next_location() { update_navigation(); if (navigation_path.size() == 0) { - ERR_FAIL_COND_V(agent_parent == nullptr, Vector3()); + ERR_FAIL_COND_V_MSG(agent_parent == nullptr, Vector3(), "The agent has no parent."); return agent_parent->get_global_transform().origin; } else { return navigation_path[nav_path_index] - Vector3(0, navigation_height_offset, 0); @@ -200,7 +200,7 @@ Vector3 NavigationAgent3D::get_next_location() { } real_t NavigationAgent3D::distance_to_target() const { - ERR_FAIL_COND_V(agent_parent == nullptr, 0.0); + ERR_FAIL_COND_V_MSG(agent_parent == nullptr, 0.0, "The agent has no parent."); return agent_parent->get_global_transform().origin.distance_to(target_location); } diff --git a/scene/3d/navigation_obstacle_3d.cpp b/scene/3d/navigation_obstacle_3d.cpp index 20ffc3b00e..f9fff802e0 100644 --- a/scene/3d/navigation_obstacle_3d.cpp +++ b/scene/3d/navigation_obstacle_3d.cpp @@ -35,19 +35,41 @@ #include "servers/navigation_server_3d.h" void NavigationObstacle3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_estimate_radius", "estimate_radius"), &NavigationObstacle3D::set_estimate_radius); + ClassDB::bind_method(D_METHOD("is_radius_estimated"), &NavigationObstacle3D::is_radius_estimated); + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &NavigationObstacle3D::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &NavigationObstacle3D::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "estimate_radius"), "set_estimate_radius", "is_radius_estimated"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,100,0.01"), "set_radius", "get_radius"); +} + +void NavigationObstacle3D::_validate_property(PropertyInfo &p_property) const { + if (p_property.name == "radius") { + if (estimate_radius) { + p_property.usage = PROPERTY_USAGE_NO_EDITOR; + } + } } void NavigationObstacle3D::_notification(int p_what) { switch (p_what) { case NOTIFICATION_READY: { + initialize_agent(); + parent_node3d = Object::cast_to<Node3D>(get_parent()); + if (parent_node3d != nullptr) { + // place agent on navigation map first or else the RVO agent callback creation fails silently later + NavigationServer3D::get_singleton()->agent_set_map(get_rid(), parent_node3d->get_world_3d()->get_navigation_map()); + } set_physics_process_internal(true); } break; case NOTIFICATION_EXIT_TREE: { + parent_node3d = nullptr; set_physics_process_internal(false); } break; case NOTIFICATION_PARENTED: { parent_node3d = Object::cast_to<Node3D>(get_parent()); - update_agent_shape(); + reevaluate_agent_radius(); } break; case NOTIFICATION_UNPARENTED: { parent_node3d = nullptr; @@ -86,7 +108,22 @@ TypedArray<String> NavigationObstacle3D::get_configuration_warnings() const { return warnings; } -void NavigationObstacle3D::update_agent_shape() { +void NavigationObstacle3D::initialize_agent() { + NavigationServer3D::get_singleton()->agent_set_neighbor_dist(agent, 0.0); + NavigationServer3D::get_singleton()->agent_set_max_neighbors(agent, 0); + NavigationServer3D::get_singleton()->agent_set_time_horizon(agent, 0.0); + NavigationServer3D::get_singleton()->agent_set_max_speed(agent, 0.0); +} + +void NavigationObstacle3D::reevaluate_agent_radius() { + if (!estimate_radius) { + NavigationServer3D::get_singleton()->agent_set_radius(agent, radius); + } else if (parent_node3d) { + NavigationServer3D::get_singleton()->agent_set_radius(agent, estimate_agent_radius()); + } +} + +real_t NavigationObstacle3D::estimate_agent_radius() const { if (parent_node3d) { // Estimate the radius of this physics body real_t radius = 0.0; @@ -110,15 +147,21 @@ void NavigationObstacle3D::update_agent_shape() { Vector3 s = parent_node3d->get_global_transform().basis.get_scale(); radius *= MAX(s.x, MAX(s.y, s.z)); - if (radius == 0.0) { - radius = 1.0; // Never a 0 radius + if (radius > 0.0) { + return radius; } - - // Initialize the Agent as an object - NavigationServer3D::get_singleton()->agent_set_neighbor_dist(agent, 0.0); - NavigationServer3D::get_singleton()->agent_set_max_neighbors(agent, 0); - NavigationServer3D::get_singleton()->agent_set_time_horizon(agent, 0.0); - NavigationServer3D::get_singleton()->agent_set_radius(agent, radius); - NavigationServer3D::get_singleton()->agent_set_max_speed(agent, 0.0); } + return 1.0; // Never a 0 radius +} + +void NavigationObstacle3D::set_estimate_radius(bool p_estimate_radius) { + estimate_radius = p_estimate_radius; + notify_property_list_changed(); + reevaluate_agent_radius(); +} + +void NavigationObstacle3D::set_radius(real_t p_radius) { + ERR_FAIL_COND_MSG(p_radius <= 0.0, "Radius must be greater than 0."); + radius = p_radius; + reevaluate_agent_radius(); } diff --git a/scene/3d/navigation_obstacle_3d.h b/scene/3d/navigation_obstacle_3d.h index ab0b158303..12c813ab08 100644 --- a/scene/3d/navigation_obstacle_3d.h +++ b/scene/3d/navigation_obstacle_3d.h @@ -39,8 +39,12 @@ class NavigationObstacle3D : public Node { Node3D *parent_node3d = nullptr; RID agent; + bool estimate_radius = true; + real_t radius = 1.0; + protected: static void _bind_methods(); + void _validate_property(PropertyInfo &p_property) const override; void _notification(int p_what); public: @@ -51,10 +55,21 @@ public: return agent; } + void set_estimate_radius(bool p_estimate_radius); + bool is_radius_estimated() const { + return estimate_radius; + } + void set_radius(real_t p_radius); + real_t get_radius() const { + return radius; + } + TypedArray<String> get_configuration_warnings() const override; private: - void update_agent_shape(); + void initialize_agent(); + void reevaluate_agent_radius(); + real_t estimate_agent_radius() const; }; #endif diff --git a/scene/3d/navigation_region_3d.cpp b/scene/3d/navigation_region_3d.cpp index 8a51a259f7..473368cf69 100644 --- a/scene/3d/navigation_region_3d.cpp +++ b/scene/3d/navigation_region_3d.cpp @@ -162,7 +162,7 @@ void _bake_navigation_mesh(void *p_user_data) { } void NavigationRegion3D::bake_navigation_mesh() { - ERR_FAIL_COND(bake_thread.is_started()); + ERR_FAIL_COND_MSG(bake_thread.is_started(), "Unable to start another bake request. The navigation mesh bake thread is already baking a navigation mesh."); BakeThreadsArgs *args = memnew(BakeThreadsArgs); args->nav_region = this; diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp index c96204cf60..ddd9d2da8a 100644 --- a/scene/3d/node_3d.cpp +++ b/scene/3d/node_3d.cpp @@ -44,7 +44,7 @@ definition of invalidation: global is invalid 1) If a node sets a LOCAL, it produces an invalidation of everything above - a) If above is invalid, don't keep invalidating upwards + . a) If above is invalid, don't keep invalidating upwards 2) If a node sets a GLOBAL, it is converted to LOCAL (and forces validation of everything pending below) drawback: setting/reading globals is useful and used very often, and using affine inverses is slow @@ -56,7 +56,7 @@ definition of invalidation: NONE dirty, LOCAL dirty, GLOBAL dirty 1) If a node sets a LOCAL, it must climb the tree and set it as GLOBAL dirty - a) marking GLOBALs as dirty up all the tree must be done always + . a) marking GLOBALs as dirty up all the tree must be done always 2) If a node sets a GLOBAL, it marks local as dirty, and that's all? //is clearing the dirty state correct in this case? @@ -94,11 +94,6 @@ void Node3D::_propagate_transform_changed(Node3D *p_origin) { return; } - /* - if (data.dirty&DIRTY_GLOBAL) - return; //already dirty - */ - data.children_lock++; for (Node3D *&E : data.children) { @@ -220,6 +215,13 @@ void Node3D::_notification(int p_what) { } } +void Node3D::set_basis(const Basis &p_basis) { + set_transform(Transform3D(p_basis, data.local_transform.origin)); +} +void Node3D::set_quaternion(const Quaternion &p_quaternion) { + set_transform(Transform3D(Basis(p_quaternion), data.local_transform.origin)); +} + void Node3D::set_transform(const Transform3D &p_transform) { data.local_transform = p_transform; data.dirty |= DIRTY_VECTORS; @@ -229,11 +231,17 @@ void Node3D::set_transform(const Transform3D &p_transform) { } } +Basis Node3D::get_basis() const { + return get_transform().basis; +} +Quaternion Node3D::get_quaternion() const { + return Quaternion(get_transform().basis); +} + void Node3D::set_global_transform(const Transform3D &p_transform) { - Transform3D xform = - (data.parent && !data.top_level_active) ? - data.parent->get_global_transform().affine_inverse() * p_transform : - p_transform; + Transform3D xform = (data.parent && !data.top_level_active) + ? data.parent->get_global_transform().affine_inverse() * p_transform + : p_transform; set_transform(xform); } @@ -308,6 +316,45 @@ void Node3D::set_position(const Vector3 &p_position) { } } +void Node3D::set_rotation_edit_mode(RotationEditMode p_mode) { + if (data.rotation_edit_mode == p_mode) { + return; + } + data.rotation_edit_mode = p_mode; + notify_property_list_changed(); +} + +Node3D::RotationEditMode Node3D::get_rotation_edit_mode() const { + return data.rotation_edit_mode; +} + +void Node3D::set_rotation_order(RotationOrder p_order) { + Basis::EulerOrder order = Basis::EulerOrder(p_order); + + if (data.rotation_order == order) { + return; + } + + ERR_FAIL_INDEX(int32_t(order), 6); + + if (data.dirty & DIRTY_VECTORS) { + data.rotation = data.local_transform.basis.get_euler_normalized(order); + data.scale = data.local_transform.basis.get_scale(); + data.dirty &= ~DIRTY_VECTORS; + } else { + data.rotation = Basis::from_euler(data.rotation, data.rotation_order).get_euler_normalized(order); + } + + data.rotation_order = order; + //changing rotation order should not affect transform + + notify_property_list_changed(); //will change rotation +} + +Node3D::RotationOrder Node3D::get_rotation_order() const { + return RotationOrder(data.rotation_order); +} + void Node3D::set_rotation(const Vector3 &p_euler_rad) { if (data.dirty & DIRTY_VECTORS) { data.scale = data.local_transform.basis.get_scale(); @@ -324,7 +371,7 @@ void Node3D::set_rotation(const Vector3 &p_euler_rad) { void Node3D::set_scale(const Vector3 &p_scale) { if (data.dirty & DIRTY_VECTORS) { - data.rotation = data.local_transform.basis.get_rotation(); + data.rotation = data.local_transform.basis.get_euler_normalized(data.rotation_order); data.dirty &= ~DIRTY_VECTORS; } @@ -343,7 +390,7 @@ Vector3 Node3D::get_position() const { Vector3 Node3D::get_rotation() const { if (data.dirty & DIRTY_VECTORS) { data.scale = data.local_transform.basis.get_scale(); - data.rotation = data.local_transform.basis.get_rotation(); + data.rotation = data.local_transform.basis.get_euler_normalized(data.rotation_order); data.dirty &= ~DIRTY_VECTORS; } @@ -354,7 +401,7 @@ Vector3 Node3D::get_rotation() const { Vector3 Node3D::get_scale() const { if (data.dirty & DIRTY_VECTORS) { data.scale = data.local_transform.basis.get_scale(); - data.rotation = data.local_transform.basis.get_rotation(); + data.rotation = data.local_transform.basis.get_euler_normalized(data.rotation_order); data.dirty &= ~DIRTY_VECTORS; } @@ -431,7 +478,7 @@ void Node3D::remove_gizmo(Ref<Node3DGizmo> p_gizmo) { int idx = data.gizmos.find(p_gizmo); if (idx != -1) { p_gizmo->free(); - data.gizmos.remove(idx); + data.gizmos.remove_at(idx); } #endif } @@ -484,14 +531,14 @@ void Node3D::_update_gizmos() { #endif } -#ifdef TOOLS_ENABLED void Node3D::set_disable_gizmos(bool p_enabled) { +#ifdef TOOLS_ENABLED data.gizmos_disabled = p_enabled; if (!p_enabled) { clear_gizmos(); } -} #endif +} void Node3D::set_disable_scale(bool p_enabled) { data.disable_scale = p_enabled; @@ -780,6 +827,24 @@ NodePath Node3D::get_visibility_parent() const { return visibility_parent_path; } +void Node3D::_validate_property(PropertyInfo &property) const { + if (data.rotation_edit_mode != ROTATION_EDIT_MODE_BASIS && property.name == "basis") { + property.usage = 0; + } + if (data.rotation_edit_mode == ROTATION_EDIT_MODE_BASIS && property.name == "scale") { + property.usage = 0; + } + if (data.rotation_edit_mode != ROTATION_EDIT_MODE_QUATERNION && property.name == "quaternion") { + property.usage = 0; + } + if (data.rotation_edit_mode != ROTATION_EDIT_MODE_EULER && property.name == "rotation") { + property.usage = 0; + } + if (data.rotation_edit_mode != ROTATION_EDIT_MODE_EULER && property.name == "rotation_order") { + property.usage = 0; + } +} + void Node3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_transform", "local"), &Node3D::set_transform); ClassDB::bind_method(D_METHOD("get_transform"), &Node3D::get_transform); @@ -787,8 +852,16 @@ void Node3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_position"), &Node3D::get_position); ClassDB::bind_method(D_METHOD("set_rotation", "euler"), &Node3D::set_rotation); ClassDB::bind_method(D_METHOD("get_rotation"), &Node3D::get_rotation); + ClassDB::bind_method(D_METHOD("set_rotation_order", "order"), &Node3D::set_rotation_order); + ClassDB::bind_method(D_METHOD("get_rotation_order"), &Node3D::get_rotation_order); + ClassDB::bind_method(D_METHOD("set_rotation_edit_mode", "edit_mode"), &Node3D::set_rotation_edit_mode); + ClassDB::bind_method(D_METHOD("get_rotation_edit_mode"), &Node3D::get_rotation_edit_mode); ClassDB::bind_method(D_METHOD("set_scale", "scale"), &Node3D::set_scale); ClassDB::bind_method(D_METHOD("get_scale"), &Node3D::get_scale); + ClassDB::bind_method(D_METHOD("set_quaternion", "quaternion"), &Node3D::set_quaternion); + ClassDB::bind_method(D_METHOD("get_quaternion"), &Node3D::get_quaternion); + ClassDB::bind_method(D_METHOD("set_basis", "basis"), &Node3D::set_basis); + ClassDB::bind_method(D_METHOD("get_basis"), &Node3D::get_basis); ClassDB::bind_method(D_METHOD("set_global_transform", "global"), &Node3D::set_global_transform); ClassDB::bind_method(D_METHOD("get_global_transform"), &Node3D::get_global_transform); ClassDB::bind_method(D_METHOD("get_parent_node_3d"), &Node3D::get_parent_node_3d); @@ -848,15 +921,29 @@ void Node3D::_bind_methods() { BIND_CONSTANT(NOTIFICATION_EXIT_WORLD); BIND_CONSTANT(NOTIFICATION_VISIBILITY_CHANGED); + BIND_ENUM_CONSTANT(ROTATION_EDIT_MODE_EULER); + BIND_ENUM_CONSTANT(ROTATION_EDIT_MODE_QUATERNION); + BIND_ENUM_CONSTANT(ROTATION_EDIT_MODE_BASIS); + + BIND_ENUM_CONSTANT(ROTATION_ORDER_XYZ); + BIND_ENUM_CONSTANT(ROTATION_ORDER_XZY); + BIND_ENUM_CONSTANT(ROTATION_ORDER_YXZ); + BIND_ENUM_CONSTANT(ROTATION_ORDER_YZX); + BIND_ENUM_CONSTANT(ROTATION_ORDER_ZXY); + BIND_ENUM_CONSTANT(ROTATION_ORDER_ZYX); + //ADD_PROPERTY( PropertyInfo(Variant::TRANSFORM3D,"transform/global",PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR ), "set_global_transform", "get_global_transform") ; ADD_GROUP("Transform", ""); ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM3D, "global_transform", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NONE), "set_global_transform", "get_global_transform"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "position", PROPERTY_HINT_RANGE, "-99999,99999,0,or_greater,or_lesser,noslider,suffix:m", PROPERTY_USAGE_EDITOR), "set_position", "get_position"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "rotation", PROPERTY_HINT_RANGE, "-360,360,0.1,or_lesser,or_greater,radians", PROPERTY_USAGE_EDITOR), "set_rotation", "get_rotation"); + ADD_PROPERTY(PropertyInfo(Variant::QUATERNION, "quaternion", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_quaternion", "get_quaternion"); + ADD_PROPERTY(PropertyInfo(Variant::BASIS, "basis", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_basis", "get_basis"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "scale", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_scale", "get_scale"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "rotation_edit_mode", PROPERTY_HINT_ENUM, "Euler,Quaternion,Basis"), "set_rotation_edit_mode", "get_rotation_edit_mode"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "rotation_order", PROPERTY_HINT_ENUM, "XYZ,XZY,YXZ,YZX,ZXY,ZYX"), "set_rotation_order", "get_rotation_order"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "top_level"), "set_as_top_level", "is_set_as_top_level"); - ADD_GROUP("Matrix", ""); - ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM3D, "transform", PROPERTY_HINT_NONE, ""), "set_transform", "get_transform"); + ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM3D, "transform", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_transform", "get_transform"); ADD_GROUP("Visibility", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "visible"), "set_visible", "is_visible"); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "visibility_parent", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "GeometryInstance3D"), "set_visibility_parent", "get_visibility_parent"); diff --git a/scene/3d/node_3d.h b/scene/3d/node_3d.h index d6dcdd96fe..3e21eb12be 100644 --- a/scene/3d/node_3d.h +++ b/scene/3d/node_3d.h @@ -51,6 +51,23 @@ class Node3D : public Node { GDCLASS(Node3D, Node); OBJ_CATEGORY("3D"); +public: + enum RotationEditMode { + ROTATION_EDIT_MODE_EULER, + ROTATION_EDIT_MODE_QUATERNION, + ROTATION_EDIT_MODE_BASIS, + }; + + enum RotationOrder { + ROTATION_ORDER_XYZ, + ROTATION_ORDER_XZY, + ROTATION_ORDER_YXZ, + ROTATION_ORDER_YZX, + ROTATION_ORDER_ZXY, + ROTATION_ORDER_ZYX + }; + +private: enum TransformDirty { DIRTY_NONE = 0, DIRTY_VECTORS = 1, @@ -63,8 +80,10 @@ class Node3D : public Node { struct Data { mutable Transform3D global_transform; mutable Transform3D local_transform; + mutable Basis::EulerOrder rotation_order = Basis::EULER_ORDER_YXZ; mutable Vector3 rotation; mutable Vector3 scale = Vector3(1, 1, 1); + mutable RotationEditMode rotation_edit_mode = ROTATION_EDIT_MODE_EULER; mutable int dirty = DIRTY_NONE; @@ -116,6 +135,8 @@ protected: void _notification(int p_what); static void _bind_methods(); + virtual void _validate_property(PropertyInfo &property) const override; + public: enum { NOTIFICATION_TRANSFORM_CHANGED = SceneTree::NOTIFICATION_TRANSFORM_CHANGED, @@ -130,17 +151,28 @@ public: Ref<World3D> get_world_3d() const; void set_position(const Vector3 &p_position); + + void set_rotation_edit_mode(RotationEditMode p_mode); + RotationEditMode get_rotation_edit_mode() const; + + void set_rotation_order(RotationOrder p_order); void set_rotation(const Vector3 &p_euler_rad); void set_scale(const Vector3 &p_scale); Vector3 get_position() const; + + RotationOrder get_rotation_order() const; Vector3 get_rotation() const; Vector3 get_scale() const; void set_transform(const Transform3D &p_transform); + void set_basis(const Basis &p_basis); + void set_quaternion(const Quaternion &p_quaternion); void set_global_transform(const Transform3D &p_transform); Transform3D get_transform() const; + Basis get_basis() const; + Quaternion get_quaternion() const; Transform3D get_global_transform() const; #ifdef TOOLS_ENABLED @@ -214,4 +246,7 @@ public: Node3D(); }; +VARIANT_ENUM_CAST(Node3D::RotationEditMode) +VARIANT_ENUM_CAST(Node3D::RotationOrder) + #endif // NODE_3D_H diff --git a/scene/3d/occluder_instance_3d.cpp b/scene/3d/occluder_instance_3d.cpp index f3e174c01b..ac22239d70 100644 --- a/scene/3d/occluder_instance_3d.cpp +++ b/scene/3d/occluder_instance_3d.cpp @@ -130,8 +130,8 @@ void Occluder3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_indices", "indices"), &Occluder3D::set_indices); ClassDB::bind_method(D_METHOD("get_indices"), &Occluder3D::get_indices); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_vertices", "get_vertices"); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "indices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_indices", "get_indices"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_vertices", "get_vertices"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "indices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_indices", "get_indices"); } Occluder3D::Occluder3D() { @@ -291,7 +291,7 @@ void OccluderInstance3D::_bake_node(Node *p_node, PackedVector3Array &r_vertices } OccluderInstance3D::BakeError OccluderInstance3D::bake(Node *p_from_node, String p_occluder_path) { - if (p_occluder_path == "") { + if (p_occluder_path.is_empty()) { if (get_occluder().is_null()) { return BAKE_ERROR_NO_SAVE_PATH; } @@ -329,9 +329,6 @@ TypedArray<String> OccluderInstance3D::get_configuration_warnings() const { } if (bake_mask == 0) { - // NOTE: This warning will not be emitted if none of the 20 checkboxes - // exposed in the editor are checked. This is because there are - // currently 12 unexposed layers in the editor inspector. warnings.push_back(TTR("The Bake Mask has no bits enabled, which means baking will not produce any occluder meshes for this OccluderInstance3D.\nTo resolve this, enable at least one bit in the Bake Mask property.")); } diff --git a/scene/3d/path_3d.cpp b/scene/3d/path_3d.cpp index 9ea37e4bfa..a0eac76e39 100644 --- a/scene/3d/path_3d.cpp +++ b/scene/3d/path_3d.cpp @@ -248,6 +248,7 @@ void PathFollow3D::_validate_property(PropertyInfo &property) const { property.hint_string = "0," + rtos(max) + ",0.01,or_lesser,or_greater"; } + Node3D::_validate_property(property); } TypedArray<String> PathFollow3D::get_configuration_warnings() const { diff --git a/scene/3d/physics_body_3d.cpp b/scene/3d/physics_body_3d.cpp index 8cb348d6e3..393e29e398 100644 --- a/scene/3d/physics_body_3d.cpp +++ b/scene/3d/physics_body_3d.cpp @@ -174,9 +174,12 @@ bool PhysicsBody3D::test_move(const Transform3D &p_from, const Vector3 &p_linear ERR_FAIL_COND_V(!is_inside_tree(), false); PhysicsServer3D::MotionResult *r = nullptr; + PhysicsServer3D::MotionResult temp_result; if (r_collision.is_valid()) { // Needs const_cast because method bindings don't support non-const Ref. r = const_cast<PhysicsServer3D::MotionResult *>(&r_collision->result); + } else { + r = &temp_result; } // Hack in order to work with calling from _process as well as from _physics_process; calling from thread is risky @@ -184,7 +187,14 @@ bool PhysicsBody3D::test_move(const Transform3D &p_from, const Vector3 &p_linear PhysicsServer3D::MotionParameters parameters(p_from, p_linear_velocity * delta, p_margin); - return PhysicsServer3D::get_singleton()->body_test_motion(get_rid(), parameters, r); + bool colliding = PhysicsServer3D::get_singleton()->body_test_motion(get_rid(), parameters, r); + + if (colliding) { + // Don't report collision when the whole motion is done. + return (r->collision_safe_fraction < 1.0); + } else { + return false; + } } void PhysicsBody3D::set_axis_lock(PhysicsServer3D::BodyAxis p_axis, bool p_lock) { @@ -758,8 +768,26 @@ real_t RigidDynamicBody3D::get_gravity_scale() const { return gravity_scale; } +void RigidDynamicBody3D::set_linear_damp_mode(DampMode p_mode) { + linear_damp_mode = p_mode; + PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_LINEAR_DAMP_MODE, linear_damp_mode); +} + +RigidDynamicBody3D::DampMode RigidDynamicBody3D::get_linear_damp_mode() const { + return linear_damp_mode; +} + +void RigidDynamicBody3D::set_angular_damp_mode(DampMode p_mode) { + angular_damp_mode = p_mode; + PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_ANGULAR_DAMP_MODE, angular_damp_mode); +} + +RigidDynamicBody3D::DampMode RigidDynamicBody3D::get_angular_damp_mode() const { + return angular_damp_mode; +} + void RigidDynamicBody3D::set_linear_damp(real_t p_linear_damp) { - ERR_FAIL_COND(p_linear_damp < -1); + ERR_FAIL_COND(p_linear_damp < 0.0); linear_damp = p_linear_damp; PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_LINEAR_DAMP, linear_damp); } @@ -769,7 +797,7 @@ real_t RigidDynamicBody3D::get_linear_damp() const { } void RigidDynamicBody3D::set_angular_damp(real_t p_angular_damp) { - ERR_FAIL_COND(p_angular_damp < -1); + ERR_FAIL_COND(p_angular_damp < 0.0); angular_damp = p_angular_damp; PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_ANGULAR_DAMP, angular_damp); } @@ -970,6 +998,12 @@ void RigidDynamicBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_gravity_scale", "gravity_scale"), &RigidDynamicBody3D::set_gravity_scale); ClassDB::bind_method(D_METHOD("get_gravity_scale"), &RigidDynamicBody3D::get_gravity_scale); + ClassDB::bind_method(D_METHOD("set_linear_damp_mode", "linear_damp_mode"), &RigidDynamicBody3D::set_linear_damp_mode); + ClassDB::bind_method(D_METHOD("get_linear_damp_mode"), &RigidDynamicBody3D::get_linear_damp_mode); + + ClassDB::bind_method(D_METHOD("set_angular_damp_mode", "angular_damp_mode"), &RigidDynamicBody3D::set_angular_damp_mode); + ClassDB::bind_method(D_METHOD("get_angular_damp_mode"), &RigidDynamicBody3D::get_angular_damp_mode); + ClassDB::bind_method(D_METHOD("set_linear_damp", "linear_damp"), &RigidDynamicBody3D::set_linear_damp); ClassDB::bind_method(D_METHOD("get_linear_damp"), &RigidDynamicBody3D::get_linear_damp); @@ -1035,10 +1069,12 @@ void RigidDynamicBody3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "freeze_mode", PROPERTY_HINT_ENUM, "Static,Kinematic"), "set_freeze_mode", "get_freeze_mode"); ADD_GROUP("Linear", "linear_"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "linear_velocity"), "set_linear_velocity", "get_linear_velocity"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "linear_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_linear_damp_mode", "get_linear_damp_mode"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); ADD_GROUP("Angular", "angular_"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "angular_velocity"), "set_angular_velocity", "get_angular_velocity"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "angular_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_angular_damp_mode", "get_angular_damp_mode"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); ADD_SIGNAL(MethodInfo("body_shape_entered", PropertyInfo(Variant::RID, "body_rid"), PropertyInfo(Variant::OBJECT, "body", PROPERTY_HINT_RESOURCE_TYPE, "Node"), PropertyInfo(Variant::INT, "body_shape_index"), PropertyInfo(Variant::INT, "local_shape_index"))); ADD_SIGNAL(MethodInfo("body_shape_exited", PropertyInfo(Variant::RID, "body_rid"), PropertyInfo(Variant::OBJECT, "body", PROPERTY_HINT_RESOURCE_TYPE, "Node"), PropertyInfo(Variant::INT, "body_shape_index"), PropertyInfo(Variant::INT, "local_shape_index"))); @@ -1051,14 +1087,18 @@ void RigidDynamicBody3D::_bind_methods() { BIND_ENUM_CONSTANT(CENTER_OF_MASS_MODE_AUTO); BIND_ENUM_CONSTANT(CENTER_OF_MASS_MODE_CUSTOM); + + BIND_ENUM_CONSTANT(DAMP_MODE_COMBINE); + BIND_ENUM_CONSTANT(DAMP_MODE_REPLACE); } void RigidDynamicBody3D::_validate_property(PropertyInfo &property) const { if (center_of_mass_mode != CENTER_OF_MASS_MODE_CUSTOM) { if (property.name == "center_of_mass") { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } + PhysicsBody3D::_validate_property(property); } RigidDynamicBody3D::RigidDynamicBody3D() : @@ -1115,6 +1155,10 @@ bool CharacterBody3D::move_and_slide() { if (bs) { Vector3 local_position = gt.origin - bs->get_transform().origin; current_platform_velocity = bs->get_velocity_at_local_position(local_position); + } else { + // Body is removed or destroyed, invalidate floor. + current_platform_velocity = Vector3(); + platform_rid = RID(); } } else { current_platform_velocity = Vector3(); @@ -1255,7 +1299,6 @@ void CharacterBody3D::_move_and_slide_grounded(double p_delta, bool p_was_on_flo // in order to avoid blocking lateral motion along a wall. if (motion_angle < .5 * Math_PI) { apply_default_sliding = false; - if (p_was_on_floor && !vel_dir_facing_up) { // Cancel the motion. Transform3D gt = get_global_transform(); @@ -1263,14 +1306,18 @@ void CharacterBody3D::_move_and_slide_grounded(double p_delta, bool p_was_on_flo real_t cancel_dist_max = MIN(0.1, margin * 20); if (travel_total <= margin + CMP_EPSILON) { gt.origin -= result.travel; + result.travel = Vector3(); // Cancel for constant speed computation. } else if (travel_total < cancel_dist_max) { // If the movement is large the body can be prevented from reaching the walls. gt.origin -= result.travel.slide(up_direction); // Keep remaining motion in sync with amount canceled. motion = motion.slide(up_direction); + result.travel = Vector3(); + } else { + // Travel is too high to be safely cancelled, we take it into account. + result.travel = result.travel.slide(up_direction); + motion = motion.normalized() * result.travel.length(); } set_global_transform(gt); - result.travel = Vector3(); // Cancel for constant speed computation. - // Determines if you are on the ground, and limits the possibility of climbing on the walls because of the approximations. _snap_on_floor(true, false); } else { @@ -1281,8 +1328,15 @@ void CharacterBody3D::_move_and_slide_grounded(double p_delta, bool p_was_on_flo // Apply slide on forward in order to allow only lateral motion on next step. Vector3 forward = wall_normal.slide(up_direction).normalized(); motion = motion.slide(forward); - // Avoid accelerating when you jump on the wall and smooth falling. - motion_velocity = motion_velocity.slide(forward); + + // Scales the horizontal velocity according to the wall slope. + if (vel_dir_facing_up) { + Vector3 slide_motion = motion_velocity.slide(result.collisions[0].normal); + // Keeps the vertical motion from motion_velocity and add the horizontal motion of the projection. + motion_velocity = up_direction * up_direction.dot(motion_velocity) + slide_motion.slide(up_direction); + } else { + motion_velocity = motion_velocity.slide(forward); + } // Allow only lateral motion along previous floor when already on floor. // Fixes slowing down when moving in diagonal against an inclined wall. @@ -1540,6 +1594,7 @@ void CharacterBody3D::_set_collision_direction(const PhysicsServer3D::MotionResu Vector3 prev_wall_normal = wall_normal; int wall_collision_count = 0; Vector3 combined_wall_normal; + Vector3 tmp_wall_col; // Avoid duplicate on average calculation. for (int i = p_result.collision_count - 1; i >= 0; i--) { const PhysicsServer3D::MotionCollision &collision = p_result.collisions[i]; @@ -1586,8 +1641,11 @@ void CharacterBody3D::_set_collision_direction(const PhysicsServer3D::MotionResu } // Collect normal for calculating average. - combined_wall_normal += collision.normal; - wall_collision_count++; + if (!collision.normal.is_equal_approx(tmp_wall_col)) { + tmp_wall_col = collision.normal; + combined_wall_normal += collision.normal; + wall_collision_count++; + } } if (r_state.wall) { @@ -1903,8 +1961,8 @@ void CharacterBody3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "motion_mode", PROPERTY_HINT_ENUM, "Grounded,Free", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_UPDATE_ALL_IF_MODIFIED), "set_motion_mode", "get_motion_mode"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "up_direction"), "set_up_direction", "get_up_direction"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "slide_on_ceiling"), "set_slide_on_ceiling_enabled", "is_slide_on_ceiling_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "motion_velocity", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_motion_velocity", "get_motion_velocity"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "max_slides", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_max_slides", "get_max_slides"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "motion_velocity", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_motion_velocity", "get_motion_velocity"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "max_slides", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_max_slides", "get_max_slides"); ADD_GROUP("Free Mode", "free_mode_"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "wall_min_slide_angle", PROPERTY_HINT_RANGE, "0,180,0.1,radians", PROPERTY_USAGE_DEFAULT), "set_wall_min_slide_angle", "get_wall_min_slide_angle"); ADD_GROUP("Floor", "floor_"); @@ -1930,9 +1988,10 @@ void CharacterBody3D::_bind_methods() { void CharacterBody3D::_validate_property(PropertyInfo &property) const { if (motion_mode == MOTION_MODE_FREE) { if (property.name.begins_with("floor_") || property.name == "up_direction" || property.name == "slide_on_ceiling") { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } + PhysicsBody3D::_validate_property(property); } CharacterBody3D::CharacterBody3D() : @@ -2823,6 +2882,12 @@ void PhysicalBone3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_gravity_scale", "gravity_scale"), &PhysicalBone3D::set_gravity_scale); ClassDB::bind_method(D_METHOD("get_gravity_scale"), &PhysicalBone3D::get_gravity_scale); + ClassDB::bind_method(D_METHOD("set_linear_damp_mode", "linear_damp_mode"), &PhysicalBone3D::set_linear_damp_mode); + ClassDB::bind_method(D_METHOD("get_linear_damp_mode"), &PhysicalBone3D::get_linear_damp_mode); + + ClassDB::bind_method(D_METHOD("set_angular_damp_mode", "angular_damp_mode"), &PhysicalBone3D::set_angular_damp_mode); + ClassDB::bind_method(D_METHOD("get_angular_damp_mode"), &PhysicalBone3D::get_angular_damp_mode); + ClassDB::bind_method(D_METHOD("set_linear_damp", "linear_damp"), &PhysicalBone3D::set_linear_damp); ClassDB::bind_method(D_METHOD("get_linear_damp"), &PhysicalBone3D::get_linear_damp); @@ -2843,10 +2908,15 @@ void PhysicalBone3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_friction", "get_friction"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_bounce", "get_bounce"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "gravity_scale", PROPERTY_HINT_RANGE, "-10,10,0.01"), "set_gravity_scale", "get_gravity_scale"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "linear_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_linear_damp_mode", "get_linear_damp_mode"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "linear_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_linear_damp", "get_linear_damp"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "angular_damp_mode", PROPERTY_HINT_ENUM, "Combine,Replace"), "set_angular_damp_mode", "get_angular_damp_mode"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "angular_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater"), "set_angular_damp", "get_angular_damp"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "can_sleep"), "set_can_sleep", "is_able_to_sleep"); + BIND_ENUM_CONSTANT(DAMP_MODE_COMBINE); + BIND_ENUM_CONSTANT(DAMP_MODE_REPLACE); + BIND_ENUM_CONSTANT(JOINT_TYPE_NONE); BIND_ENUM_CONSTANT(JOINT_TYPE_PIN); BIND_ENUM_CONSTANT(JOINT_TYPE_CONE); @@ -3060,7 +3130,7 @@ void PhysicalBone3D::set_joint_rotation(const Vector3 &p_euler_rad) { } Vector3 PhysicalBone3D::get_joint_rotation() const { - return joint_offset.basis.get_rotation(); + return joint_offset.basis.get_euler_normalized(); } const Transform3D &PhysicalBone3D::get_body_offset() const { @@ -3144,8 +3214,27 @@ real_t PhysicalBone3D::get_gravity_scale() const { return gravity_scale; } +void PhysicalBone3D::set_linear_damp_mode(DampMode p_mode) { + linear_damp_mode = p_mode; + PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_LINEAR_DAMP_MODE, linear_damp_mode); +} + +PhysicalBone3D::DampMode PhysicalBone3D::get_linear_damp_mode() const { + return linear_damp_mode; +} + +void PhysicalBone3D::set_angular_damp_mode(DampMode p_mode) { + angular_damp_mode = p_mode; + PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_ANGULAR_DAMP_MODE, angular_damp_mode); +} + +PhysicalBone3D::DampMode PhysicalBone3D::get_angular_damp_mode() const { + return angular_damp_mode; +} + void PhysicalBone3D::set_linear_damp(real_t p_linear_damp) { - ERR_FAIL_COND(p_linear_damp < -1); + ERR_FAIL_COND(p_linear_damp < 0); + linear_damp = p_linear_damp; PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_LINEAR_DAMP, linear_damp); } @@ -3155,7 +3244,8 @@ real_t PhysicalBone3D::get_linear_damp() const { } void PhysicalBone3D::set_angular_damp(real_t p_angular_damp) { - ERR_FAIL_COND(p_angular_damp < -1); + ERR_FAIL_COND(p_angular_damp < 0); + angular_damp = p_angular_damp; PhysicsServer3D::get_singleton()->body_set_param(get_rid(), PhysicsServer3D::BODY_PARAM_ANGULAR_DAMP, angular_damp); } diff --git a/scene/3d/physics_body_3d.h b/scene/3d/physics_body_3d.h index 5677df730c..2ea796d335 100644 --- a/scene/3d/physics_body_3d.h +++ b/scene/3d/physics_body_3d.h @@ -143,6 +143,11 @@ public: CENTER_OF_MASS_MODE_CUSTOM, }; + enum DampMode { + DAMP_MODE_COMBINE, + DAMP_MODE_REPLACE, + }; + private: bool can_sleep = true; bool lock_rotation = false; @@ -160,8 +165,12 @@ private: Vector3 angular_velocity; Basis inverse_inertia_tensor; real_t gravity_scale = 1.0; - real_t linear_damp = -1.0; - real_t angular_damp = -1.0; + + DampMode linear_damp_mode = DAMP_MODE_COMBINE; + DampMode angular_damp_mode = DAMP_MODE_COMBINE; + + real_t linear_damp = 0.0; + real_t angular_damp = 0.0; bool sleeping = false; bool ccd = false; @@ -265,6 +274,12 @@ public: void set_gravity_scale(real_t p_gravity_scale); real_t get_gravity_scale() const; + void set_linear_damp_mode(DampMode p_mode); + DampMode get_linear_damp_mode() const; + + void set_angular_damp_mode(DampMode p_mode); + DampMode get_angular_damp_mode() const; + void set_linear_damp(real_t p_linear_damp); real_t get_linear_damp() const; @@ -310,6 +325,7 @@ private: VARIANT_ENUM_CAST(RigidDynamicBody3D::FreezeMode); VARIANT_ENUM_CAST(RigidDynamicBody3D::CenterOfMassMode); +VARIANT_ENUM_CAST(RigidDynamicBody3D::DampMode); class KinematicCollision3D; @@ -494,6 +510,11 @@ class PhysicalBone3D : public PhysicsBody3D { GDCLASS(PhysicalBone3D, PhysicsBody3D); public: + enum DampMode { + DAMP_MODE_COMBINE, + DAMP_MODE_REPLACE, + }; + enum JointType { JOINT_TYPE_NONE, JOINT_TYPE_PIN, @@ -632,10 +653,14 @@ private: real_t mass = 1.0; real_t friction = 1.0; real_t gravity_scale = 1.0; - real_t linear_damp = -1.0; - real_t angular_damp = -1.0; bool can_sleep = true; + DampMode linear_damp_mode = DAMP_MODE_COMBINE; + DampMode angular_damp_mode = DAMP_MODE_COMBINE; + + real_t linear_damp = 0.0; + real_t angular_damp = 0.0; + protected: bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; @@ -698,6 +723,12 @@ public: void set_gravity_scale(real_t p_gravity_scale); real_t get_gravity_scale() const; + void set_linear_damp_mode(DampMode p_mode); + DampMode get_linear_damp_mode() const; + + void set_angular_damp_mode(DampMode p_mode); + DampMode get_angular_damp_mode() const; + void set_linear_damp(real_t p_linear_damp); real_t get_linear_damp() const; @@ -725,5 +756,6 @@ private: }; VARIANT_ENUM_CAST(PhysicalBone3D::JointType); +VARIANT_ENUM_CAST(PhysicalBone3D::DampMode); #endif // PHYSICS_BODY__H diff --git a/scene/3d/proximity_group_3d.cpp b/scene/3d/proximity_group_3d.cpp deleted file mode 100644 index 23df00c1f6..0000000000 --- a/scene/3d/proximity_group_3d.cpp +++ /dev/null @@ -1,182 +0,0 @@ -/*************************************************************************/ -/* proximity_group_3d.cpp */ -/*************************************************************************/ -/* This file is part of: */ -/* GODOT ENGINE */ -/* https://godotengine.org */ -/*************************************************************************/ -/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ -/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ -/* */ -/* Permission is hereby granted, free of charge, to any person obtaining */ -/* a copy of this software and associated documentation files (the */ -/* "Software"), to deal in the Software without restriction, including */ -/* without limitation the rights to use, copy, modify, merge, publish, */ -/* distribute, sublicense, and/or sell copies of the Software, and to */ -/* permit persons to whom the Software is furnished to do so, subject to */ -/* the following conditions: */ -/* */ -/* The above copyright notice and this permission notice shall be */ -/* included in all copies or substantial portions of the Software. */ -/* */ -/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ -/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ -/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ -/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ -/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ -/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ -/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ -/*************************************************************************/ - -#include "proximity_group_3d.h" - -#include "core/math/math_funcs.h" - -void ProximityGroup3D::_clear_groups() { - Map<StringName, uint32_t>::Element *E; - const int size = 16; - - do { - StringName remove_list[size]; - E = groups.front(); - int num = 0; - while (E && num < size) { - if (E->get() != group_version) { - remove_list[num++] = E->key(); - } - - E = E->next(); - } - for (int i = 0; i < num; i++) { - groups.erase(remove_list[i]); - } - } while (E); -} - -void ProximityGroup3D::_update_groups() { - if (grid_radius == Vector3(0, 0, 0)) { - return; - } - - ++group_version; - - Vector3 pos = get_global_transform().get_origin(); - Vector3 vcell = pos / cell_size; - int cell[3] = { Math::fast_ftoi(vcell.x), Math::fast_ftoi(vcell.y), Math::fast_ftoi(vcell.z) }; - - _add_groups(cell, group_name, 0); - - _clear_groups(); -} - -void ProximityGroup3D::_add_groups(int *p_cell, String p_base, int p_depth) { - p_base = p_base + "|"; - if (grid_radius[p_depth] == 0) { - if (p_depth == 2) { - _new_group(p_base); - } else { - _add_groups(p_cell, p_base, p_depth + 1); - } - } - - int start = p_cell[p_depth] - grid_radius[p_depth]; - int end = p_cell[p_depth] + grid_radius[p_depth]; - - for (int i = start; i <= end; i++) { - String gname = p_base + itos(i); - if (p_depth == 2) { - _new_group(gname); - } else { - _add_groups(p_cell, gname, p_depth + 1); - } - } -} - -void ProximityGroup3D::_new_group(StringName p_name) { - const Map<StringName, uint32_t>::Element *E = groups.find(p_name); - if (!E) { - add_to_group(p_name); - } - - groups[p_name] = group_version; -} - -void ProximityGroup3D::_notification(int p_what) { - switch (p_what) { - case NOTIFICATION_EXIT_TREE: - ++group_version; - _clear_groups(); - break; - case NOTIFICATION_TRANSFORM_CHANGED: - _update_groups(); - break; - } -} - -void ProximityGroup3D::broadcast(String p_method, Variant p_parameters) { - Map<StringName, uint32_t>::Element *E; - E = groups.front(); - while (E) { - get_tree()->call_group_flags(SceneTree::GROUP_CALL_DEFAULT, E->key(), "_proximity_group_broadcast", p_method, p_parameters); - E = E->next(); - } -} - -void ProximityGroup3D::_proximity_group_broadcast(String p_method, Variant p_parameters) { - if (dispatch_mode == MODE_PROXY) { - ERR_FAIL_COND(!is_inside_tree()); - get_parent()->call(p_method, p_parameters); - } else { - emit_signal(SNAME("broadcast"), p_method, p_parameters); - } -} - -void ProximityGroup3D::set_group_name(const String &p_group_name) { - group_name = p_group_name; -} - -String ProximityGroup3D::get_group_name() const { - return group_name; -} - -void ProximityGroup3D::set_dispatch_mode(DispatchMode p_mode) { - dispatch_mode = p_mode; -} - -ProximityGroup3D::DispatchMode ProximityGroup3D::get_dispatch_mode() const { - return dispatch_mode; -} - -void ProximityGroup3D::set_grid_radius(const Vector3 &p_radius) { - grid_radius = p_radius; -} - -Vector3 ProximityGroup3D::get_grid_radius() const { - return grid_radius; -} - -void ProximityGroup3D::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_group_name", "name"), &ProximityGroup3D::set_group_name); - ClassDB::bind_method(D_METHOD("get_group_name"), &ProximityGroup3D::get_group_name); - ClassDB::bind_method(D_METHOD("set_dispatch_mode", "mode"), &ProximityGroup3D::set_dispatch_mode); - ClassDB::bind_method(D_METHOD("get_dispatch_mode"), &ProximityGroup3D::get_dispatch_mode); - ClassDB::bind_method(D_METHOD("set_grid_radius", "radius"), &ProximityGroup3D::set_grid_radius); - ClassDB::bind_method(D_METHOD("get_grid_radius"), &ProximityGroup3D::get_grid_radius); - - ClassDB::bind_method(D_METHOD("broadcast", "method", "parameters"), &ProximityGroup3D::broadcast); - - ClassDB::bind_method(D_METHOD("_proximity_group_broadcast", "method", "parameters"), &ProximityGroup3D::_proximity_group_broadcast); - - ADD_PROPERTY(PropertyInfo(Variant::STRING, "group_name"), "set_group_name", "get_group_name"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "dispatch_mode", PROPERTY_HINT_ENUM, "Proxy,Signal"), "set_dispatch_mode", "get_dispatch_mode"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "grid_radius"), "set_grid_radius", "get_grid_radius"); - - ADD_SIGNAL(MethodInfo("broadcast", PropertyInfo(Variant::STRING, "method"), PropertyInfo(Variant::ARRAY, "parameters"))); - - BIND_ENUM_CONSTANT(MODE_PROXY); - BIND_ENUM_CONSTANT(MODE_SIGNAL); -} - -ProximityGroup3D::ProximityGroup3D() { - set_notify_transform(true); -} diff --git a/scene/3d/ray_cast_3d.cpp b/scene/3d/ray_cast_3d.cpp index fd4c6e7416..bfa397a1f5 100644 --- a/scene/3d/ray_cast_3d.cpp +++ b/scene/3d/ray_cast_3d.cpp @@ -212,9 +212,17 @@ void RayCast3D::_update_raycast_state() { to = Vector3(0, 0.01, 0); } - PhysicsDirectSpaceState3D::RayResult rr; + PhysicsDirectSpaceState3D::RayParameters ray_params; + ray_params.from = gt.get_origin(); + ray_params.to = gt.xform(to); + ray_params.exclude = exclude; + ray_params.collision_mask = collision_mask; + ray_params.collide_with_bodies = collide_with_bodies; + ray_params.collide_with_areas = collide_with_areas; + ray_params.hit_from_inside = hit_from_inside; - if (dss->intersect_ray(gt.get_origin(), gt.xform(to), rr, exclude, collision_mask, collide_with_bodies, collide_with_areas)) { + PhysicsDirectSpaceState3D::RayResult rr; + if (dss->intersect_ray(ray_params, rr)) { collided = true; against = rr.collider_id; collision_point = rr.position; @@ -261,22 +269,30 @@ void RayCast3D::clear_exceptions() { exclude.clear(); } -void RayCast3D::set_collide_with_areas(bool p_clip) { - collide_with_areas = p_clip; +void RayCast3D::set_collide_with_areas(bool p_enabled) { + collide_with_areas = p_enabled; } bool RayCast3D::is_collide_with_areas_enabled() const { return collide_with_areas; } -void RayCast3D::set_collide_with_bodies(bool p_clip) { - collide_with_bodies = p_clip; +void RayCast3D::set_collide_with_bodies(bool p_enabled) { + collide_with_bodies = p_enabled; } bool RayCast3D::is_collide_with_bodies_enabled() const { return collide_with_bodies; } +void RayCast3D::set_hit_from_inside(bool p_enabled) { + hit_from_inside = p_enabled; +} + +bool RayCast3D::is_hit_from_inside_enabled() const { + return hit_from_inside; +} + void RayCast3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_enabled", "enabled"), &RayCast3D::set_enabled); ClassDB::bind_method(D_METHOD("is_enabled"), &RayCast3D::is_enabled); @@ -315,6 +331,9 @@ void RayCast3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collide_with_bodies", "enable"), &RayCast3D::set_collide_with_bodies); ClassDB::bind_method(D_METHOD("is_collide_with_bodies_enabled"), &RayCast3D::is_collide_with_bodies_enabled); + ClassDB::bind_method(D_METHOD("set_hit_from_inside", "enable"), &RayCast3D::set_hit_from_inside); + ClassDB::bind_method(D_METHOD("is_hit_from_inside_enabled"), &RayCast3D::is_hit_from_inside_enabled); + ClassDB::bind_method(D_METHOD("set_debug_shape_custom_color", "debug_shape_custom_color"), &RayCast3D::set_debug_shape_custom_color); ClassDB::bind_method(D_METHOD("get_debug_shape_custom_color"), &RayCast3D::get_debug_shape_custom_color); @@ -325,6 +344,7 @@ void RayCast3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "exclude_parent"), "set_exclude_parent_body", "get_exclude_parent_body"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "target_position"), "set_target_position", "get_target_position"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_mask", "get_collision_mask"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hit_from_inside"), "set_hit_from_inside", "is_hit_from_inside_enabled"); ADD_GROUP("Collide With", "collide_with"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collide_with_areas", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collide_with_areas", "is_collide_with_areas_enabled"); diff --git a/scene/3d/ray_cast_3d.h b/scene/3d/ray_cast_3d.h index 3828bfb4c4..5c2a61c35b 100644 --- a/scene/3d/ray_cast_3d.h +++ b/scene/3d/ray_cast_3d.h @@ -65,18 +65,23 @@ class RayCast3D : public Node3D { bool collide_with_areas = false; bool collide_with_bodies = true; + bool hit_from_inside = false; + protected: void _notification(int p_what); void _update_raycast_state(); static void _bind_methods(); public: - void set_collide_with_areas(bool p_clip); + void set_collide_with_areas(bool p_enabled); bool is_collide_with_areas_enabled() const; - void set_collide_with_bodies(bool p_clip); + void set_collide_with_bodies(bool p_enabled); bool is_collide_with_bodies_enabled() const; + void set_hit_from_inside(bool p_enabled); + bool is_hit_from_inside_enabled() const; + void set_enabled(bool p_enabled); bool is_enabled() const; diff --git a/scene/3d/reflection_probe.cpp b/scene/3d/reflection_probe.cpp index 719dbedd94..f7f19596a7 100644 --- a/scene/3d/reflection_probe.cpp +++ b/scene/3d/reflection_probe.cpp @@ -94,7 +94,7 @@ void ReflectionProbe::set_extents(const Vector3 &p_extents) { } if (extents[i] - 0.01 < ABS(origin_offset[i])) { - origin_offset[i] = SGN(origin_offset[i]) * (extents[i] - 0.01); + origin_offset[i] = SIGN(origin_offset[i]) * (extents[i] - 0.01); } } @@ -113,7 +113,7 @@ void ReflectionProbe::set_origin_offset(const Vector3 &p_extents) { for (int i = 0; i < 3; i++) { if (extents[i] - 0.01 < ABS(origin_offset[i])) { - origin_offset[i] = SGN(origin_offset[i]) * (extents[i] - 0.01); + origin_offset[i] = SIGN(origin_offset[i]) * (extents[i] - 0.01); } } RS::get_singleton()->reflection_probe_set_extents(probe, extents); @@ -185,9 +185,10 @@ Vector<Face3> ReflectionProbe::get_faces(uint32_t p_usage_flags) const { void ReflectionProbe::_validate_property(PropertyInfo &property) const { if (property.name == "interior/ambient_color" || property.name == "interior/ambient_color_energy") { if (ambient_mode != AMBIENT_COLOR) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } + VisualInstance3D::_validate_property(property); } void ReflectionProbe::_bind_methods() { diff --git a/scene/3d/remote_transform_3d.cpp b/scene/3d/remote_transform_3d.cpp index d5fb1fa6ab..d890609e23 100644 --- a/scene/3d/remote_transform_3d.cpp +++ b/scene/3d/remote_transform_3d.cpp @@ -68,7 +68,7 @@ void RemoteTransform3D::_update_remote() { Transform3D our_trans = get_global_transform(); if (update_remote_rotation) { - n->set_rotation(our_trans.basis.get_rotation()); + n->set_rotation(our_trans.basis.get_euler_normalized(Basis::EulerOrder(n->get_rotation_order()))); } if (update_remote_scale) { @@ -90,7 +90,7 @@ void RemoteTransform3D::_update_remote() { Transform3D our_trans = get_transform(); if (update_remote_rotation) { - n->set_rotation(our_trans.basis.get_rotation()); + n->set_rotation(our_trans.basis.get_euler_normalized(Basis::EulerOrder(n->get_rotation_order()))); } if (update_remote_scale) { diff --git a/scene/3d/skeleton_3d.cpp b/scene/3d/skeleton_3d.cpp index fbc3767151..85ef532459 100644 --- a/scene/3d/skeleton_3d.cpp +++ b/scene/3d/skeleton_3d.cpp @@ -155,13 +155,13 @@ bool Skeleton3D::_get(const StringName &p_path, Variant &r_ret) const { void Skeleton3D::_get_property_list(List<PropertyInfo> *p_list) const { for (int i = 0; i < bones.size(); i++) { String prep = "bones/" + itos(i) + "/"; - p_list->push_back(PropertyInfo(Variant::STRING, prep + "name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::INT, prep + "parent", PROPERTY_HINT_RANGE, "-1," + itos(bones.size() - 1) + ",1", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::TRANSFORM3D, prep + "rest", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::BOOL, prep + "enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::VECTOR3, prep + "position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::QUATERNION, prep + "rotation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::VECTOR3, prep + "scale", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING, prep + "name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::INT, prep + "parent", PROPERTY_HINT_RANGE, "-1," + itos(bones.size() - 1) + ",1", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::TRANSFORM3D, prep + "rest", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::BOOL, prep + "enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR3, prep + "position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::QUATERNION, prep + "rotation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR3, prep + "scale", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } #ifndef _3D_DISABLED @@ -178,32 +178,32 @@ void Skeleton3D::_get_property_list(List<PropertyInfo> *p_list) const { } void Skeleton3D::_validate_property(PropertyInfo &property) const { - PackedStringArray spr = property.name.split("/"); - if (spr.size() == 3 && spr[0] == "bones") { - if (spr[2] == "rest") { + PackedStringArray split = property.name.split("/"); + if (split.size() == 3 && split[0] == "bones") { + if (split[2] == "rest") { property.usage |= PROPERTY_USAGE_READ_ONLY; } if (is_show_rest_only()) { - if (spr[2] == "enabled") { + if (split[2] == "enabled") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - if (spr[2] == "position") { + if (split[2] == "position") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - if (spr[2] == "rotation") { + if (split[2] == "rotation") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - if (spr[2] == "scale") { + if (split[2] == "scale") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - } else if (!is_bone_enabled(spr[1].to_int())) { - if (spr[2] == "position") { + } else if (!is_bone_enabled(split[1].to_int())) { + if (split[2] == "position") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - if (spr[2] == "rotation") { + if (split[2] == "rotation") { property.usage |= PROPERTY_USAGE_READ_ONLY; } - if (spr[2] == "scale") { + if (split[2] == "scale") { property.usage |= PROPERTY_USAGE_READ_ONLY; } } @@ -506,7 +506,7 @@ int Skeleton3D::get_bone_axis_forward_enum(int p_bone) { // Skeleton creation api void Skeleton3D::add_bone(const String &p_name) { - ERR_FAIL_COND(p_name == "" || p_name.find(":") != -1 || p_name.find("/") != -1); + ERR_FAIL_COND(p_name.is_empty() || p_name.find(":") != -1 || p_name.find("/") != -1); for (int i = 0; i < bones.size(); i++) { ERR_FAIL_COND(bones[i].name == p_name); @@ -633,7 +633,7 @@ void Skeleton3D::remove_bone_child(int p_bone, int p_child) { int child_idx = bones[p_bone].child_bones.find(p_child); if (child_idx >= 0) { - bones.write[p_bone].child_bones.remove(child_idx); + bones.write[p_bone].child_bones.remove_at(child_idx); } else { WARN_PRINT("Cannot remove child bone: Child bone not found."); } diff --git a/scene/3d/skeleton_ik_3d.cpp b/scene/3d/skeleton_ik_3d.cpp index 2e788051f4..1498955ec0 100644 --- a/scene/3d/skeleton_ik_3d.cpp +++ b/scene/3d/skeleton_ik_3d.cpp @@ -351,6 +351,8 @@ void SkeletonIK3D::_validate_property(PropertyInfo &property) const { property.hint_string = ""; } } + + Node::_validate_property(property); } void SkeletonIK3D::_bind_methods() { diff --git a/scene/3d/skeleton_ik_3d.h b/scene/3d/skeleton_ik_3d.h index 4cf08e7c99..ccb25bcd4c 100644 --- a/scene/3d/skeleton_ik_3d.h +++ b/scene/3d/skeleton_ik_3d.h @@ -137,8 +137,7 @@ class SkeletonIK3D : public Node { FabrikInverseKinematic::Task *task = nullptr; protected: - virtual void - _validate_property(PropertyInfo &property) const override; + virtual void _validate_property(PropertyInfo &property) const override; static void _bind_methods(); virtual void _notification(int p_what); diff --git a/scene/3d/soft_dynamic_body_3d.cpp b/scene/3d/soft_dynamic_body_3d.cpp index 9fceb21790..d9907430fc 100644 --- a/scene/3d/soft_dynamic_body_3d.cpp +++ b/scene/3d/soft_dynamic_body_3d.cpp @@ -100,12 +100,11 @@ SoftDynamicBody3D::PinnedPoint::PinnedPoint(const PinnedPoint &obj_tocopy) { offset = obj_tocopy.offset; } -SoftDynamicBody3D::PinnedPoint &SoftDynamicBody3D::PinnedPoint::operator=(const PinnedPoint &obj) { +void SoftDynamicBody3D::PinnedPoint::operator=(const PinnedPoint &obj) { point_index = obj.point_index; spatial_attachment_path = obj.spatial_attachment_path; spatial_attachment = obj.spatial_attachment; offset = obj.offset; - return *this; } void SoftDynamicBody3D::_update_pickable() { @@ -250,7 +249,7 @@ void SoftDynamicBody3D::_notification(int p_what) { RID space = get_world_3d()->get_space(); PhysicsServer3D::get_singleton()->soft_body_set_space(physics_rid, space); - prepare_physics_server(); + _prepare_physics_server(); } break; case NOTIFICATION_READY: { @@ -284,13 +283,13 @@ void SoftDynamicBody3D::_notification(int p_what) { case NOTIFICATION_DISABLED: { if (is_inside_tree() && (disable_mode == DISABLE_MODE_REMOVE)) { - prepare_physics_server(); + _prepare_physics_server(); } } break; case NOTIFICATION_ENABLED: { if (is_inside_tree() && (disable_mode == DISABLE_MODE_REMOVE)) { - prepare_physics_server(); + _prepare_physics_server(); } } break; @@ -378,7 +377,7 @@ void SoftDynamicBody3D::_bind_methods() { TypedArray<String> SoftDynamicBody3D::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); - if (get_mesh().is_null()) { + if (mesh.is_null()) { warnings.push_back(TTR("This body will be ignored until you set a mesh.")); } @@ -407,11 +406,17 @@ void SoftDynamicBody3D::_update_physics_server() { } void SoftDynamicBody3D::_draw_soft_mesh() { - if (get_mesh().is_null()) { + if (mesh.is_null()) { return; } - const RID mesh_rid = get_mesh()->get_rid(); + RID mesh_rid = mesh->get_rid(); + if (owned_mesh != mesh_rid) { + _become_mesh_owner(); + mesh_rid = mesh->get_rid(); + PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, mesh_rid); + } + if (!rendering_server_handler.is_ready(mesh_rid)) { rendering_server_handler.prepare(mesh_rid, 0); @@ -430,11 +435,11 @@ void SoftDynamicBody3D::_draw_soft_mesh() { rendering_server_handler.commit_changes(); } -void SoftDynamicBody3D::prepare_physics_server() { +void SoftDynamicBody3D::_prepare_physics_server() { #ifdef TOOLS_ENABLED if (Engine::get_singleton()->is_editor_hint()) { - if (get_mesh().is_valid()) { - PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, get_mesh()->get_rid()); + if (mesh.is_valid()) { + PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, mesh->get_rid()); } else { PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, RID()); } @@ -443,9 +448,13 @@ void SoftDynamicBody3D::prepare_physics_server() { } #endif - if (get_mesh().is_valid() && (is_enabled() || (disable_mode != DISABLE_MODE_REMOVE))) { - become_mesh_owner(); - PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, get_mesh()->get_rid()); + if (mesh.is_valid() && (is_enabled() || (disable_mode != DISABLE_MODE_REMOVE))) { + RID mesh_rid = mesh->get_rid(); + if (owned_mesh != mesh_rid) { + _become_mesh_owner(); + mesh_rid = mesh->get_rid(); + } + PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, mesh_rid); RS::get_singleton()->connect("frame_pre_draw", callable_mp(this, &SoftDynamicBody3D::_draw_soft_mesh)); } else { PhysicsServer3D::get_singleton()->soft_body_set_mesh(physics_rid, RID()); @@ -455,38 +464,32 @@ void SoftDynamicBody3D::prepare_physics_server() { } } -void SoftDynamicBody3D::become_mesh_owner() { - if (mesh.is_null()) { - return; - } +void SoftDynamicBody3D::_become_mesh_owner() { + Vector<Ref<Material>> copy_materials; + copy_materials.append_array(surface_override_materials); - if (!mesh_owner) { - mesh_owner = true; + ERR_FAIL_COND(!mesh->get_surface_count()); - Vector<Ref<Material>> copy_materials; - copy_materials.append_array(surface_override_materials); + // Get current mesh array and create new mesh array with necessary flag for SoftDynamicBody + Array surface_arrays = mesh->surface_get_arrays(0); + Array surface_blend_arrays = mesh->surface_get_blend_shape_arrays(0); + Dictionary surface_lods = mesh->surface_get_lods(0); + uint32_t surface_format = mesh->surface_get_format(0); - ERR_FAIL_COND(!mesh->get_surface_count()); + surface_format |= Mesh::ARRAY_FLAG_USE_DYNAMIC_UPDATE; - // Get current mesh array and create new mesh array with necessary flag for SoftDynamicBody - Array surface_arrays = mesh->surface_get_arrays(0); - Array surface_blend_arrays = mesh->surface_get_blend_shape_arrays(0); - Dictionary surface_lods = mesh->surface_get_lods(0); - uint32_t surface_format = mesh->surface_get_format(0); + Ref<ArrayMesh> soft_mesh; + soft_mesh.instantiate(); + soft_mesh->add_surface_from_arrays(Mesh::PRIMITIVE_TRIANGLES, surface_arrays, surface_blend_arrays, surface_lods, surface_format); + soft_mesh->surface_set_material(0, mesh->surface_get_material(0)); - surface_format |= Mesh::ARRAY_FLAG_USE_DYNAMIC_UPDATE; + set_mesh(soft_mesh); - Ref<ArrayMesh> soft_mesh; - soft_mesh.instantiate(); - soft_mesh->add_surface_from_arrays(Mesh::PRIMITIVE_TRIANGLES, surface_arrays, surface_blend_arrays, surface_lods, surface_format); - soft_mesh->surface_set_material(0, mesh->surface_get_material(0)); - - set_mesh(soft_mesh); - - for (int i = copy_materials.size() - 1; 0 <= i; --i) { - set_surface_override_material(i, copy_materials[i]); - } + for (int i = copy_materials.size() - 1; 0 <= i; --i) { + set_surface_override_material(i, copy_materials[i]); } + + owned_mesh = soft_mesh->get_rid(); } void SoftDynamicBody3D::set_collision_mask(uint32_t p_mask) { @@ -548,16 +551,10 @@ void SoftDynamicBody3D::set_disable_mode(DisableMode p_mode) { return; } - bool inside_tree = is_inside_tree(); - - if (inside_tree && (disable_mode == DISABLE_MODE_REMOVE)) { - prepare_physics_server(); - } - disable_mode = p_mode; - if (inside_tree && (disable_mode == DISABLE_MODE_REMOVE)) { - prepare_physics_server(); + if (mesh.is_valid() && is_inside_tree() && !is_enabled()) { + _prepare_physics_server(); } } @@ -775,7 +772,7 @@ void SoftDynamicBody3D::_reset_points_offsets() { void SoftDynamicBody3D::_remove_pinned_point(int p_point_index) { const int id(_has_pinned_point(p_point_index)); if (-1 != id) { - pinned_points.remove(id); + pinned_points.remove_at(id); } } diff --git a/scene/3d/soft_dynamic_body_3d.h b/scene/3d/soft_dynamic_body_3d.h index 5e7fbfe29e..daef9acac0 100644 --- a/scene/3d/soft_dynamic_body_3d.h +++ b/scene/3d/soft_dynamic_body_3d.h @@ -80,7 +80,7 @@ public: PinnedPoint(); PinnedPoint(const PinnedPoint &obj_tocopy); - PinnedPoint &operator=(const PinnedPoint &obj); + void operator=(const PinnedPoint &obj); }; private: @@ -90,7 +90,7 @@ private: DisableMode disable_mode = DISABLE_MODE_REMOVE; - bool mesh_owner = false; + RID owned_mesh; uint32_t collision_mask = 1; uint32_t collision_layer = 1; NodePath parent_collision_ignore; @@ -106,6 +106,12 @@ private: void _update_pickable(); + void _update_physics_server(); + void _draw_soft_mesh(); + + void _prepare_physics_server(); + void _become_mesh_owner(); + protected: bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; @@ -120,14 +126,7 @@ protected: TypedArray<String> get_configuration_warnings() const override; -protected: - void _update_physics_server(); - void _draw_soft_mesh(); - public: - void prepare_physics_server(); - void become_mesh_owner(); - RID get_physics_rid() const { return physics_rid; } void set_collision_mask(uint32_t p_mask); diff --git a/scene/3d/spring_arm_3d.cpp b/scene/3d/spring_arm_3d.cpp index 116cab19b1..0b5af8823b 100644 --- a/scene/3d/spring_arm_3d.cpp +++ b/scene/3d/spring_arm_3d.cpp @@ -149,10 +149,24 @@ void SpringArm3D::process_spring() { //use camera rotation, but spring arm position Transform3D base_transform = camera->get_global_transform(); base_transform.origin = get_global_transform().origin; - get_world_3d()->get_direct_space_state()->cast_motion(camera->get_pyramid_shape_rid(), base_transform, motion, 0, motion_delta, motion_delta_unsafe, excluded_objects, mask); + + PhysicsDirectSpaceState3D::ShapeParameters shape_params; + shape_params.shape_rid = camera->get_pyramid_shape_rid(); + shape_params.transform = base_transform; + shape_params.motion = motion; + shape_params.exclude = excluded_objects; + shape_params.collision_mask = mask; + + get_world_3d()->get_direct_space_state()->cast_motion(shape_params, motion_delta, motion_delta_unsafe); } else { + PhysicsDirectSpaceState3D::RayParameters ray_params; + ray_params.from = get_global_transform().origin; + ray_params.to = get_global_transform().origin + motion; + ray_params.exclude = excluded_objects; + ray_params.collision_mask = mask; + PhysicsDirectSpaceState3D::RayResult r; - bool intersected = get_world_3d()->get_direct_space_state()->intersect_ray(get_global_transform().origin, get_global_transform().origin + motion, r, excluded_objects, mask); + bool intersected = get_world_3d()->get_direct_space_state()->intersect_ray(ray_params, r); if (intersected) { real_t dist = get_global_transform().origin.distance_to(r.position); dist -= margin; @@ -160,7 +174,14 @@ void SpringArm3D::process_spring() { } } } else { - get_world_3d()->get_direct_space_state()->cast_motion(shape->get_rid(), get_global_transform(), motion, 0, motion_delta, motion_delta_unsafe, excluded_objects, mask); + PhysicsDirectSpaceState3D::ShapeParameters shape_params; + shape_params.shape_rid = shape->get_rid(); + shape_params.transform = get_global_transform(); + shape_params.motion = motion; + shape_params.exclude = excluded_objects; + shape_params.collision_mask = mask; + + get_world_3d()->get_direct_space_state()->cast_motion(shape_params, motion_delta, motion_delta_unsafe); } current_spring_length = spring_length * motion_delta; diff --git a/scene/3d/sprite_3d.cpp b/scene/3d/sprite_3d.cpp index 349a534680..09f0187147 100644 --- a/scene/3d/sprite_3d.cpp +++ b/scene/3d/sprite_3d.cpp @@ -625,6 +625,7 @@ void Sprite3D::set_texture(const Ref<Texture2D> &p_texture) { texture->connect(CoreStringNames::get_singleton()->changed, Callable(this, "_queue_update")); } _queue_update(); + emit_signal(SceneStringNames::get_singleton()->texture_changed); } Ref<Texture2D> Sprite3D::get_texture() const { @@ -743,6 +744,8 @@ void Sprite3D::_validate_property(PropertyInfo &property) const { if (property.name == "frame_coords") { property.usage |= PROPERTY_USAGE_KEYING_INCREMENTS; } + + SpriteBase3D::_validate_property(property); } void Sprite3D::_bind_methods() { @@ -778,6 +781,7 @@ void Sprite3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::RECT2, "region_rect"), "set_region_rect", "get_region_rect"); ADD_SIGNAL(MethodInfo("frame_changed")); + ADD_SIGNAL(MethodInfo("texture_changed")); } Sprite3D::Sprite3D() { @@ -994,13 +998,13 @@ void AnimatedSprite3D::_validate_property(PropertyInfo &property) const { } property.hint_string += String(E->get()); - if (animation == E) { + if (animation == E->get()) { current_found = true; } } if (!current_found) { - if (property.hint_string == String()) { + if (property.hint_string.is_empty()) { property.hint_string = String(animation); } else { property.hint_string = String(animation) + "," + property.hint_string; @@ -1015,6 +1019,8 @@ void AnimatedSprite3D::_validate_property(PropertyInfo &property) const { } property.usage |= PROPERTY_USAGE_KEYING_INCREMENTS; } + + SpriteBase3D::_validate_property(property); } void AnimatedSprite3D::_notification(int p_what) { diff --git a/scene/3d/sprite_3d.h b/scene/3d/sprite_3d.h index 90c2a309e1..61448c0e32 100644 --- a/scene/3d/sprite_3d.h +++ b/scene/3d/sprite_3d.h @@ -118,12 +118,6 @@ public: void set_flip_v(bool p_flip); bool is_flipped_v() const; - void set_region_enabled(bool p_region); - bool is_region_enabled() const; - - void set_region_rect(const Rect2 &p_region_rect); - Rect2 get_region_rect() const; - void set_modulate(const Color &p_color); Color get_modulate() const; diff --git a/scene/3d/vehicle_body_3d.cpp b/scene/3d/vehicle_body_3d.cpp index 6761fdd944..90db093137 100644 --- a/scene/3d/vehicle_body_3d.cpp +++ b/scene/3d/vehicle_body_3d.cpp @@ -124,7 +124,7 @@ void VehicleWheel3D::_update(PhysicsDirectBodyState3D *s) { Vector3 relpos = m_raycastInfo.m_contactPointWS - s->get_transform().origin; chassis_velocity_at_contactPoint = s->get_linear_velocity() + - (s->get_angular_velocity()).cross(relpos); // * mPos); + (s->get_angular_velocity()).cross(relpos); // * mPos); real_t projVel = m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint); if (project >= real_t(-0.1)) { @@ -407,7 +407,13 @@ real_t VehicleBody3D::_ray_cast(int p_idx, PhysicsDirectBodyState3D *s) { PhysicsDirectSpaceState3D *ss = s->get_space_state(); - bool col = ss->intersect_ray(source, target, rr, exclude, get_collision_mask()); + PhysicsDirectSpaceState3D::RayParameters ray_params; + ray_params.from = source; + ray_params.to = target; + ray_params.exclude = exclude; + ray_params.collision_mask = get_collision_mask(); + + bool col = ss->intersect_ray(ray_params, rr); wheel.m_raycastInfo.m_groundObject = nullptr; @@ -444,7 +450,7 @@ real_t VehicleBody3D::_ray_cast(int p_idx, PhysicsDirectBodyState3D *s) { //chassis_velocity_at_contactPoint = getRigidBody()->getVelocityInLocalPoint(relpos); chassis_velocity_at_contactPoint = s->get_linear_velocity() + - (s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos); + (s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos); real_t projVel = wheel.m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint); @@ -771,7 +777,7 @@ void VehicleBody3D::_update_friction(PhysicsDirectBodyState3D *s) { VehicleWheel3D &wheelInfo = *wheels[wheel]; Vector3 rel_pos = wheelInfo.m_raycastInfo.m_contactPointWS - - s->get_transform().origin; + s->get_transform().origin; if (m_forwardImpulse[wheel] != real_t(0.)) { s->apply_impulse(m_forwardWS[wheel] * (m_forwardImpulse[wheel]), rel_pos); diff --git a/scene/3d/visual_instance_3d.cpp b/scene/3d/visual_instance_3d.cpp index 73c2887983..d407592376 100644 --- a/scene/3d/visual_instance_3d.cpp +++ b/scene/3d/visual_instance_3d.cpp @@ -152,9 +152,18 @@ Ref<Material> GeometryInstance3D::get_material_override() const { return material_override; } +void GeometryInstance3D::set_transparecy(float p_transparency) { + transparency = CLAMP(p_transparency, 0.0f, 1.0f); + RS::get_singleton()->instance_geometry_set_transparency(get_instance(), transparency); +} + +float GeometryInstance3D::get_transparency() const { + return transparency; +} + void GeometryInstance3D::set_visibility_range_begin(float p_dist) { visibility_range_begin = p_dist; - RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin); + RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin, (RS::VisibilityRangeFadeMode)visibility_range_fade_mode); update_configuration_warnings(); } @@ -164,7 +173,7 @@ float GeometryInstance3D::get_visibility_range_begin() const { void GeometryInstance3D::set_visibility_range_end(float p_dist) { visibility_range_end = p_dist; - RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin); + RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin, (RS::VisibilityRangeFadeMode)visibility_range_fade_mode); update_configuration_warnings(); } @@ -174,7 +183,7 @@ float GeometryInstance3D::get_visibility_range_end() const { void GeometryInstance3D::set_visibility_range_begin_margin(float p_dist) { visibility_range_begin_margin = p_dist; - RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin); + RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin, (RS::VisibilityRangeFadeMode)visibility_range_fade_mode); } float GeometryInstance3D::get_visibility_range_begin_margin() const { @@ -183,13 +192,22 @@ float GeometryInstance3D::get_visibility_range_begin_margin() const { void GeometryInstance3D::set_visibility_range_end_margin(float p_dist) { visibility_range_end_margin = p_dist; - RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin); + RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin, (RS::VisibilityRangeFadeMode)visibility_range_fade_mode); } float GeometryInstance3D::get_visibility_range_end_margin() const { return visibility_range_end_margin; } +void GeometryInstance3D::set_visibility_range_fade_mode(VisibilityRangeFadeMode p_mode) { + visibility_range_fade_mode = p_mode; + RS::get_singleton()->instance_geometry_set_visibility_range(get_instance(), visibility_range_begin, visibility_range_end, visibility_range_begin_margin, visibility_range_end_margin, (RS::VisibilityRangeFadeMode)visibility_range_fade_mode); +} + +GeometryInstance3D::VisibilityRangeFadeMode GeometryInstance3D::get_visibility_range_fade_mode() const { + return visibility_range_fade_mode; +} + void GeometryInstance3D::_notification(int p_what) { } @@ -375,6 +393,9 @@ void GeometryInstance3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_lod_bias", "bias"), &GeometryInstance3D::set_lod_bias); ClassDB::bind_method(D_METHOD("get_lod_bias"), &GeometryInstance3D::get_lod_bias); + ClassDB::bind_method(D_METHOD("set_transparency", "transparency"), &GeometryInstance3D::set_transparecy); + ClassDB::bind_method(D_METHOD("get_transparency"), &GeometryInstance3D::get_transparency); + ClassDB::bind_method(D_METHOD("set_visibility_range_end_margin", "distance"), &GeometryInstance3D::set_visibility_range_end_margin); ClassDB::bind_method(D_METHOD("get_visibility_range_end_margin"), &GeometryInstance3D::get_visibility_range_end_margin); @@ -387,6 +408,9 @@ void GeometryInstance3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_visibility_range_begin", "distance"), &GeometryInstance3D::set_visibility_range_begin); ClassDB::bind_method(D_METHOD("get_visibility_range_begin"), &GeometryInstance3D::get_visibility_range_begin); + ClassDB::bind_method(D_METHOD("set_visibility_range_fade_mode", "mode"), &GeometryInstance3D::set_visibility_range_fade_mode); + ClassDB::bind_method(D_METHOD("get_visibility_range_fade_mode"), &GeometryInstance3D::get_visibility_range_fade_mode); + ClassDB::bind_method(D_METHOD("set_shader_instance_uniform", "uniform", "value"), &GeometryInstance3D::set_shader_instance_uniform); ClassDB::bind_method(D_METHOD("get_shader_instance_uniform", "uniform"), &GeometryInstance3D::get_shader_instance_uniform); @@ -408,6 +432,7 @@ void GeometryInstance3D::_bind_methods() { ADD_GROUP("Geometry", ""); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "material_override", PROPERTY_HINT_RESOURCE_TYPE, "BaseMaterial3D,ShaderMaterial", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_DEFERRED_SET_RESOURCE), "set_material_override", "get_material_override"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "transparency", PROPERTY_HINT_RANGE, "0.0,1.0,0.01"), "set_transparency", "get_transparency"); ADD_PROPERTY(PropertyInfo(Variant::INT, "cast_shadow", PROPERTY_HINT_ENUM, "Off,On,Double-Sided,Shadows Only"), "set_cast_shadows_setting", "get_cast_shadows_setting"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "extra_cull_margin", PROPERTY_HINT_RANGE, "0,16384,0.01"), "set_extra_cull_margin", "get_extra_cull_margin"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lod_bias", PROPERTY_HINT_RANGE, "0.001,128,0.001"), "set_lod_bias", "get_lod_bias"); @@ -421,7 +446,7 @@ void GeometryInstance3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "visibility_range_begin_margin", PROPERTY_HINT_RANGE, "0.0,4096.0,0.01"), "set_visibility_range_begin_margin", "get_visibility_range_begin_margin"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "visibility_range_end", PROPERTY_HINT_RANGE, "0.0,4096.0,0.01"), "set_visibility_range_end", "get_visibility_range_end"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "visibility_range_end_margin", PROPERTY_HINT_RANGE, "0.0,4096.0,0.01"), "set_visibility_range_end_margin", "get_visibility_range_end_margin"); - + ADD_PROPERTY(PropertyInfo(Variant::INT, "visibility_range_fade_mode", PROPERTY_HINT_ENUM, "Disabled,Self,Dependencies"), "set_visibility_range_fade_mode", "get_visibility_range_fade_mode"); //ADD_SIGNAL( MethodInfo("visibility_changed")); BIND_ENUM_CONSTANT(SHADOW_CASTING_SETTING_OFF); @@ -438,6 +463,10 @@ void GeometryInstance3D::_bind_methods() { BIND_ENUM_CONSTANT(LIGHTMAP_SCALE_4X); BIND_ENUM_CONSTANT(LIGHTMAP_SCALE_8X); BIND_ENUM_CONSTANT(LIGHTMAP_SCALE_MAX); + + BIND_ENUM_CONSTANT(VISIBILITY_RANGE_FADE_DISABLED); + BIND_ENUM_CONSTANT(VISIBILITY_RANGE_FADE_SELF); + BIND_ENUM_CONSTANT(VISIBILITY_RANGE_FADE_DEPENDENCIES); } GeometryInstance3D::GeometryInstance3D() { diff --git a/scene/3d/visual_instance_3d.h b/scene/3d/visual_instance_3d.h index 8d24e13d47..acdbc4666a 100644 --- a/scene/3d/visual_instance_3d.h +++ b/scene/3d/visual_instance_3d.h @@ -101,6 +101,12 @@ public: LIGHTMAP_SCALE_MAX, }; + enum VisibilityRangeFadeMode { + VISIBILITY_RANGE_FADE_DISABLED = RS::VISIBILITY_RANGE_FADE_DISABLED, + VISIBILITY_RANGE_FADE_SELF = RS::VISIBILITY_RANGE_FADE_SELF, + VISIBILITY_RANGE_FADE_DEPENDENCIES = RS::VISIBILITY_RANGE_FADE_DEPENDENCIES, + }; + private: ShadowCastingSetting shadow_casting_setting = SHADOW_CASTING_SETTING_ON; Ref<Material> material_override; @@ -109,8 +115,9 @@ private: float visibility_range_end = 0.0; float visibility_range_begin_margin = 0.0; float visibility_range_end_margin = 0.0; + VisibilityRangeFadeMode visibility_range_fade_mode = VISIBILITY_RANGE_FADE_DISABLED; - Vector<NodePath> visibility_range_children; + float transparency = 0.0f; float lod_bias = 1.0; @@ -136,6 +143,9 @@ public: void set_cast_shadows_setting(ShadowCastingSetting p_shadow_casting_setting); ShadowCastingSetting get_cast_shadows_setting() const; + void set_transparecy(float p_transparency); + float get_transparency() const; + void set_visibility_range_begin(float p_dist); float get_visibility_range_begin() const; @@ -148,8 +158,8 @@ public: void set_visibility_range_end_margin(float p_dist); float get_visibility_range_end_margin() const; - void set_visibility_range_parent(const Node *p_parent); - void clear_visibility_range_parent(); + void set_visibility_range_fade_mode(VisibilityRangeFadeMode p_mode); + VisibilityRangeFadeMode get_visibility_range_fade_mode() const; void set_material_override(const Ref<Material> &p_material); Ref<Material> get_material_override() const; @@ -181,5 +191,6 @@ public: VARIANT_ENUM_CAST(GeometryInstance3D::ShadowCastingSetting); VARIANT_ENUM_CAST(GeometryInstance3D::LightmapScale); VARIANT_ENUM_CAST(GeometryInstance3D::GIMode); +VARIANT_ENUM_CAST(GeometryInstance3D::VisibilityRangeFadeMode); #endif diff --git a/scene/3d/voxel_gi.cpp b/scene/3d/voxel_gi.cpp index 377abd5b38..c7108cbae0 100644 --- a/scene/3d/voxel_gi.cpp +++ b/scene/3d/voxel_gi.cpp @@ -225,7 +225,7 @@ void VoxelGIData::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_data", "data"), &VoxelGIData::_set_data); ClassDB::bind_method(D_METHOD("_get_data"), &VoxelGIData::_get_data); - ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); ADD_PROPERTY(PropertyInfo(Variant::INT, "dynamic_range", PROPERTY_HINT_RANGE, "0,8,0.01"), "set_dynamic_range", "get_dynamic_range"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "energy", PROPERTY_HINT_RANGE, "0,64,0.01"), "set_energy", "get_energy"); @@ -403,7 +403,7 @@ void VoxelGI::bake(Node *p_from_node, bool p_create_visual_debug) { if (p_create_visual_debug) { MultiMeshInstance3D *mmi = memnew(MultiMeshInstance3D); mmi->set_multimesh(baker.create_debug_multimesh()); - add_child(mmi); + add_child(mmi, true); #ifdef TOOLS_ENABLED if (is_inside_tree() && get_tree()->get_edited_scene_root() == this) { mmi->set_owner(this); @@ -458,7 +458,7 @@ TypedArray<String> VoxelGI::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); if (RenderingServer::get_singleton()->is_low_end()) { - warnings.push_back(TTR("VoxelGIs are not supported by the GLES2 video driver.\nUse a LightmapGI instead.")); + warnings.push_back(TTR("VoxelGIs are not supported by the OpenGL video driver.\nUse a LightmapGI instead.")); } else if (probe_data.is_null()) { warnings.push_back(TTR("No VoxelGI data set, so this node is disabled. Bake static objects to enable GI.")); } diff --git a/scene/3d/world_environment.cpp b/scene/3d/world_environment.cpp index 26fa43b969..4eeb987dde 100644 --- a/scene/3d/world_environment.cpp +++ b/scene/3d/world_environment.cpp @@ -133,8 +133,8 @@ Ref<CameraEffects> WorldEnvironment::get_camera_effects() const { TypedArray<String> WorldEnvironment::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); - if (!environment.is_valid()) { - warnings.push_back(TTR("WorldEnvironment requires its \"Environment\" property to contain an Environment to have a visible effect.")); + if (!environment.is_valid() && !camera_effects.is_valid()) { + warnings.push_back(TTR("To have any visible effect, WorldEnvironment requires its \"Environment\" property to contain an Environment, its \"Camera Effects\" property to contain a CameraEffects resource, or both.")); } if (!is_inside_tree()) { diff --git a/scene/3d/xr_nodes.cpp b/scene/3d/xr_nodes.cpp index 56edf100f6..a16820cbdc 100644 --- a/scene/3d/xr_nodes.cpp +++ b/scene/3d/xr_nodes.cpp @@ -47,13 +47,45 @@ void XRCamera3D::_notification(int p_what) { case NOTIFICATION_EXIT_TREE: { // need to find our XROrigin3D parent and let it know we're no longer its camera! XROrigin3D *origin = Object::cast_to<XROrigin3D>(get_parent()); - if (origin != nullptr) { - origin->clear_tracked_camera_if(this); + if (origin != nullptr && origin->get_tracked_camera() == this) { + origin->set_tracked_camera(nullptr); } }; break; }; }; +void XRCamera3D::_changed_tracker(const StringName p_tracker_name, int p_tracker_type) { + if (p_tracker_name == tracker_name) { + XRServer *xr_server = XRServer::get_singleton(); + ERR_FAIL_NULL(xr_server); + + tracker = xr_server->get_tracker(p_tracker_name); + if (tracker.is_valid()) { + tracker->connect("pose_changed", callable_mp(this, &XRCamera3D::_pose_changed)); + + Ref<XRPose> pose = tracker->get_pose(pose_name); + if (pose.is_valid()) { + set_transform(pose->get_adjusted_transform()); + } + } + } +} + +void XRCamera3D::_removed_tracker(const StringName p_tracker_name, int p_tracker_type) { + if (p_tracker_name == tracker_name) { + if (tracker.is_valid()) { + tracker->disconnect("pose_changed", callable_mp(this, &XRCamera3D::_pose_changed)); + } + tracker.unref(); + } +} + +void XRCamera3D::_pose_changed(const Ref<XRPose> &p_pose) { + if (p_pose->get_name() == pose_name) { + set_transform(p_pose->get_adjusted_transform()); + } +} + TypedArray<String> XRCamera3D::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); @@ -172,195 +204,217 @@ Vector<Plane> XRCamera3D::get_frustum() const { return cm.get_projection_planes(get_camera_transform()); }; -//////////////////////////////////////////////////////////////////////////////////////////////////// +XRCamera3D::XRCamera3D() { + XRServer *xr_server = XRServer::get_singleton(); + ERR_FAIL_NULL(xr_server); -void XRController3D::_notification(int p_what) { - switch (p_what) { - case NOTIFICATION_ENTER_TREE: { - set_process_internal(true); - }; break; - case NOTIFICATION_EXIT_TREE: { - set_process_internal(false); - }; break; - case NOTIFICATION_INTERNAL_PROCESS: { - // get our XRServer - XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL(xr_server); - - // find the tracker for our controller - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); - if (!tracker.is_valid()) { - // this controller is currently turned off - is_active = false; - button_states = 0; - } else { - is_active = true; - set_transform(tracker->get_transform(true)); - - int joy_id = tracker->get_joy_id(); - if (joy_id >= 0) { - int mask = 1; - // check button states - for (int i = 0; i < 16; i++) { - bool was_pressed = (button_states & mask) == mask; - bool is_pressed = Input::get_singleton()->is_joy_button_pressed(joy_id, (JoyButton)i); - - if (!was_pressed && is_pressed) { - emit_signal(SNAME("button_pressed"), i); - button_states += mask; - } else if (was_pressed && !is_pressed) { - emit_signal(SNAME("button_released"), i); - button_states -= mask; - }; - - mask = mask << 1; - }; - - } else { - button_states = 0; - }; - - // check for an updated mesh - Ref<Mesh> trackerMesh = tracker->get_mesh(); - if (mesh != trackerMesh) { - mesh = trackerMesh; - emit_signal(SNAME("mesh_updated"), mesh); - } - }; - }; break; - default: - break; - }; -}; + xr_server->connect("tracker_added", callable_mp(this, &XRCamera3D::_changed_tracker)); + xr_server->connect("tracker_updated", callable_mp(this, &XRCamera3D::_changed_tracker)); + xr_server->connect("tracker_removed", callable_mp(this, &XRCamera3D::_removed_tracker)); +} -void XRController3D::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_controller_id", "controller_id"), &XRController3D::set_controller_id); - ClassDB::bind_method(D_METHOD("get_controller_id"), &XRController3D::get_controller_id); - ADD_PROPERTY(PropertyInfo(Variant::INT, "controller_id", PROPERTY_HINT_RANGE, "0,32,1"), "set_controller_id", "get_controller_id"); - ClassDB::bind_method(D_METHOD("get_controller_name"), &XRController3D::get_controller_name); +XRCamera3D::~XRCamera3D() { + XRServer *xr_server = XRServer::get_singleton(); + ERR_FAIL_NULL(xr_server); - // passthroughs to information about our related joystick - ClassDB::bind_method(D_METHOD("get_joystick_id"), &XRController3D::get_joystick_id); - ClassDB::bind_method(D_METHOD("is_button_pressed", "button"), &XRController3D::is_button_pressed); - ClassDB::bind_method(D_METHOD("get_joystick_axis", "axis"), &XRController3D::get_joystick_axis); + xr_server->disconnect("tracker_added", callable_mp(this, &XRCamera3D::_changed_tracker)); + xr_server->disconnect("tracker_updated", callable_mp(this, &XRCamera3D::_changed_tracker)); + xr_server->disconnect("tracker_removed", callable_mp(this, &XRCamera3D::_removed_tracker)); +} - ClassDB::bind_method(D_METHOD("get_is_active"), &XRController3D::get_is_active); - ClassDB::bind_method(D_METHOD("get_tracker_hand"), &XRController3D::get_tracker_hand); +//////////////////////////////////////////////////////////////////////////////////////////////////// +// XRNode3D is a node that has it's transform updated by an XRPositionalTracker. +// Note that trackers are only available in runtime and only after an XRInterface registers one. +// So we bind by name and as long as a tracker isn't available, our node remains inactive. - ClassDB::bind_method(D_METHOD("get_rumble"), &XRController3D::get_rumble); - ClassDB::bind_method(D_METHOD("set_rumble", "rumble"), &XRController3D::set_rumble); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "rumble", PROPERTY_HINT_RANGE, "0.0,1.0,0.01"), "set_rumble", "get_rumble"); - ADD_PROPERTY_DEFAULT("rumble", 0.0); +void XRNode3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_tracker", "tracker_name"), &XRNode3D::set_tracker); + ClassDB::bind_method(D_METHOD("get_tracker"), &XRNode3D::get_tracker); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "tracker", PROPERTY_HINT_ENUM_SUGGESTION), "set_tracker", "get_tracker"); - ClassDB::bind_method(D_METHOD("get_mesh"), &XRController3D::get_mesh); + ClassDB::bind_method(D_METHOD("set_pose_name", "pose"), &XRNode3D::set_pose_name); + ClassDB::bind_method(D_METHOD("get_pose_name"), &XRNode3D::get_pose_name); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "pose", PROPERTY_HINT_ENUM_SUGGESTION), "set_pose_name", "get_pose_name"); - ADD_SIGNAL(MethodInfo("button_pressed", PropertyInfo(Variant::INT, "button"))); - ADD_SIGNAL(MethodInfo("button_released", PropertyInfo(Variant::INT, "button"))); - ADD_SIGNAL(MethodInfo("mesh_updated", PropertyInfo(Variant::OBJECT, "mesh", PROPERTY_HINT_RESOURCE_TYPE, "Mesh"))); + ClassDB::bind_method(D_METHOD("get_is_active"), &XRNode3D::get_is_active); + ClassDB::bind_method(D_METHOD("get_has_tracking_data"), &XRNode3D::get_has_tracking_data); + ClassDB::bind_method(D_METHOD("get_pose"), &XRNode3D::get_pose); + ClassDB::bind_method(D_METHOD("trigger_haptic_pulse", "action_name", "frequency", "amplitude", "duration_sec", "delay_sec"), &XRNode3D::trigger_haptic_pulse); }; -void XRController3D::set_controller_id(int p_controller_id) { - // We don't check any bounds here, this controller may not yet be active and just be a place holder until it is. - // Note that setting this to 0 means this node is not bound to a controller yet. - controller_id = p_controller_id; - update_configuration_warnings(); -}; +void XRNode3D::_validate_property(PropertyInfo &property) const { + XRServer *xr_server = XRServer::get_singleton(); + ERR_FAIL_NULL(xr_server); -int XRController3D::get_controller_id() const { - return controller_id; -}; + if (property.name == "tracker") { + PackedStringArray names = xr_server->get_suggested_tracker_names(); + String hint_string; + for (const String &name : names) { + hint_string += name + ","; + } + property.hint_string = hint_string; + } else if (property.name == "pose") { + PackedStringArray names = xr_server->get_suggested_pose_names(tracker_name); + String hint_string; + for (const String &name : names) { + hint_string += name + ","; + } + property.hint_string = hint_string; + } -String XRController3D::get_controller_name() const { - // get our XRServer - XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL_V(xr_server, String()); + Node3D::_validate_property(property); +} - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); - if (!tracker.is_valid()) { - return String("Not connected"); - }; +void XRNode3D::set_tracker(const StringName p_tracker_name) { + if (tracker.is_valid() && tracker->get_tracker_name() == p_tracker_name) { + // didn't change + return; + } - return tracker->get_tracker_name(); -}; + // just in case + _unbind_tracker(); -int XRController3D::get_joystick_id() const { - // get our XRServer - XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL_V(xr_server, 0); + // copy the name + tracker_name = p_tracker_name; + pose_name = "default"; - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); - if (!tracker.is_valid()) { - // No tracker? no joystick id... (0 is our first joystick) - return -1; - }; + // see if it's already available + _bind_tracker(); - return tracker->get_joy_id(); -}; + update_configuration_warnings(); + notify_property_list_changed(); +} -bool XRController3D::is_button_pressed(int p_button) const { - int joy_id = get_joystick_id(); - if (joy_id == -1) { - return false; - }; +StringName XRNode3D::get_tracker() const { + return tracker_name; +} - return Input::get_singleton()->is_joy_button_pressed(joy_id, (JoyButton)p_button); -}; +void XRNode3D::set_pose_name(const StringName p_pose_name) { + pose_name = p_pose_name; -float XRController3D::get_joystick_axis(int p_axis) const { - int joy_id = get_joystick_id(); - if (joy_id == -1) { - return 0.0; - }; + // Update pose if we are bound to a tracker with a valid pose + Ref<XRPose> pose = get_pose(); + if (pose.is_valid()) { + set_transform(pose->get_adjusted_transform()); + } +} - return Input::get_singleton()->get_joy_axis(joy_id, (JoyAxis)p_axis); -}; +StringName XRNode3D::get_pose_name() const { + return pose_name; +} -real_t XRController3D::get_rumble() const { - // get our XRServer +bool XRNode3D::get_is_active() const { + if (tracker.is_null()) { + return false; + } else if (!tracker->has_pose(pose_name)) { + return false; + } else { + return true; + } +} + +bool XRNode3D::get_has_tracking_data() const { + if (tracker.is_null()) { + return false; + } else if (!tracker->has_pose(pose_name)) { + return false; + } else { + return tracker->get_pose(pose_name)->get_has_tracking_data(); + } +} + +void XRNode3D::trigger_haptic_pulse(const String &p_action_name, double p_frequency, double p_amplitude, double p_duration_sec, double p_delay_sec) { + // TODO need to link trackers to the interface that registered them so we can call this on the correct interface. + // For now this works fine as in 99% of the cases we only have our primary interface active XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL_V(xr_server, 0.0); + if (xr_server != nullptr) { + Ref<XRInterface> xr_interface = xr_server->get_primary_interface(); + if (xr_interface.is_valid()) { + xr_interface->trigger_haptic_pulse(p_action_name, tracker_name, p_frequency, p_amplitude, p_duration_sec, p_delay_sec); + } + } +} - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); - if (!tracker.is_valid()) { - return 0.0; - }; +Ref<XRPose> XRNode3D::get_pose() { + if (tracker.is_valid()) { + return tracker->get_pose(pose_name); + } else { + return Ref<XRPose>(); + } +} - return tracker->get_rumble(); -}; +void XRNode3D::_bind_tracker() { + ERR_FAIL_COND_MSG(tracker.is_valid(), "Unbind the current tracker first"); -void XRController3D::set_rumble(real_t p_rumble) { - // get our XRServer XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL(xr_server); + if (xr_server != nullptr) { + tracker = xr_server->get_tracker(tracker_name); + if (tracker.is_null()) { + // It is possible and valid if the tracker isn't available (yet), in this case we just exit + return; + } + + tracker->connect("pose_changed", callable_mp(this, &XRNode3D::_pose_changed)); + + Ref<XRPose> pose = get_pose(); + if (pose.is_valid()) { + set_transform(pose->get_adjusted_transform()); + } + } +} - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); +void XRNode3D::_unbind_tracker() { if (tracker.is_valid()) { - tracker->set_rumble(p_rumble); - }; -}; + tracker->disconnect("pose_changed", callable_mp(this, &XRNode3D::_pose_changed)); -Ref<Mesh> XRController3D::get_mesh() const { - return mesh; + tracker.unref(); + } } -bool XRController3D::get_is_active() const { - return is_active; -}; +void XRNode3D::_changed_tracker(const StringName p_tracker_name, int p_tracker_type) { + if (p_tracker_name == p_tracker_name) { + // just in case unref our current tracker + _unbind_tracker(); -XRPositionalTracker::TrackerHand XRController3D::get_tracker_hand() const { - // get our XRServer + // get our new tracker + _bind_tracker(); + } +} + +void XRNode3D::_removed_tracker(const StringName p_tracker_name, int p_tracker_type) { + if (p_tracker_name == p_tracker_name) { + // unref our tracker, it's no longer available + _unbind_tracker(); + } +} + +void XRNode3D::_pose_changed(const Ref<XRPose> &p_pose) { + if (p_pose.is_valid() && p_pose->get_name() == pose_name) { + set_transform(p_pose->get_adjusted_transform()); + } +} + +XRNode3D::XRNode3D() { XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL_V(xr_server, XRPositionalTracker::TRACKER_HAND_UNKNOWN); + ERR_FAIL_NULL(xr_server); - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_CONTROLLER, controller_id); - if (!tracker.is_valid()) { - return XRPositionalTracker::TRACKER_HAND_UNKNOWN; - }; + xr_server->connect("tracker_added", callable_mp(this, &XRNode3D::_changed_tracker)); + xr_server->connect("tracker_updated", callable_mp(this, &XRNode3D::_changed_tracker)); + xr_server->connect("tracker_removed", callable_mp(this, &XRNode3D::_removed_tracker)); +} - return tracker->get_tracker_hand(); -}; +XRNode3D::~XRNode3D() { + _unbind_tracker(); + + XRServer *xr_server = XRServer::get_singleton(); + ERR_FAIL_NULL(xr_server); + + xr_server->disconnect("tracker_added", callable_mp(this, &XRNode3D::_changed_tracker)); + xr_server->disconnect("tracker_updated", callable_mp(this, &XRNode3D::_changed_tracker)); + xr_server->disconnect("tracker_removed", callable_mp(this, &XRNode3D::_removed_tracker)); +} -TypedArray<String> XRController3D::get_configuration_warnings() const { +TypedArray<String> XRNode3D::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); if (is_visible() && is_inside_tree()) { @@ -370,130 +424,171 @@ TypedArray<String> XRController3D::get_configuration_warnings() const { warnings.push_back(TTR("XRController3D must have an XROrigin3D node as its parent.")); } - if (controller_id == 0) { - warnings.push_back(TTR("The controller ID must not be 0 or this controller won't be bound to an actual controller.")); + if (tracker_name == "") { + warnings.push_back(TTR("No tracker name is set.")); + } + + if (pose_name == "") { + warnings.push_back(TTR("No pose is set.")); } } return warnings; -}; +} //////////////////////////////////////////////////////////////////////////////////////////////////// -void XRAnchor3D::_notification(int p_what) { - switch (p_what) { - case NOTIFICATION_ENTER_TREE: { - set_process_internal(true); - }; break; - case NOTIFICATION_EXIT_TREE: { - set_process_internal(false); - }; break; - case NOTIFICATION_INTERNAL_PROCESS: { - // get our XRServer - XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL(xr_server); - - // find the tracker for our anchor - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_ANCHOR, anchor_id); - if (!tracker.is_valid()) { - // this anchor is currently not available - is_active = false; - } else { - is_active = true; - Transform3D transform; - - // we'll need our world_scale - real_t world_scale = xr_server->get_world_scale(); - - // get our info from our tracker - transform.basis = tracker->get_orientation(); - transform.origin = tracker->get_position(); // <-- already adjusted to world scale - - // our basis is scaled to the size of the plane the anchor is tracking - // extract the size from our basis and reset the scale - size = transform.basis.get_scale() * world_scale; - transform.basis.orthonormalize(); - - // apply our reference frame and set our transform - set_transform(xr_server->get_reference_frame() * transform); - - // check for an updated mesh - Ref<Mesh> trackerMesh = tracker->get_mesh(); - if (mesh != trackerMesh) { - mesh = trackerMesh; - emit_signal(SNAME("mesh_updated"), mesh); - } - }; - }; break; - default: - break; - }; -}; - -void XRAnchor3D::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_anchor_id", "anchor_id"), &XRAnchor3D::set_anchor_id); - ClassDB::bind_method(D_METHOD("get_anchor_id"), &XRAnchor3D::get_anchor_id); - ADD_PROPERTY(PropertyInfo(Variant::INT, "anchor_id", PROPERTY_HINT_RANGE, "0,32,1"), "set_anchor_id", "get_anchor_id"); - ClassDB::bind_method(D_METHOD("get_anchor_name"), &XRAnchor3D::get_anchor_name); +void XRController3D::_bind_methods() { + // passthroughs to information about our related joystick + ClassDB::bind_method(D_METHOD("is_button_pressed", "name"), &XRController3D::is_button_pressed); + ClassDB::bind_method(D_METHOD("get_value", "name"), &XRController3D::get_value); + ClassDB::bind_method(D_METHOD("get_axis", "name"), &XRController3D::get_axis); - ClassDB::bind_method(D_METHOD("get_is_active"), &XRAnchor3D::get_is_active); - ClassDB::bind_method(D_METHOD("get_size"), &XRAnchor3D::get_size); + ClassDB::bind_method(D_METHOD("get_tracker_hand"), &XRController3D::get_tracker_hand); - ClassDB::bind_method(D_METHOD("get_plane"), &XRAnchor3D::get_plane); + ClassDB::bind_method(D_METHOD("get_rumble"), &XRController3D::get_rumble); + ClassDB::bind_method(D_METHOD("set_rumble", "rumble"), &XRController3D::set_rumble); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "rumble", PROPERTY_HINT_RANGE, "0.0,1.0,0.01"), "set_rumble", "get_rumble"); + ADD_PROPERTY_DEFAULT("rumble", 0.0); - ClassDB::bind_method(D_METHOD("get_mesh"), &XRAnchor3D::get_mesh); - ADD_SIGNAL(MethodInfo("mesh_updated", PropertyInfo(Variant::OBJECT, "mesh", PROPERTY_HINT_RESOURCE_TYPE, "Mesh"))); + ADD_SIGNAL(MethodInfo("button_pressed", PropertyInfo(Variant::STRING, "name"))); + ADD_SIGNAL(MethodInfo("button_released", PropertyInfo(Variant::STRING, "name"))); + ADD_SIGNAL(MethodInfo("input_value_changed", PropertyInfo(Variant::STRING, "name"), PropertyInfo(Variant::FLOAT, "value"))); + ADD_SIGNAL(MethodInfo("input_axis_changed", PropertyInfo(Variant::STRING, "name"), PropertyInfo(Variant::VECTOR2, "value"))); }; -void XRAnchor3D::set_anchor_id(int p_anchor_id) { - // We don't check any bounds here, this anchor may not yet be active and just be a place holder until it is. - // Note that setting this to 0 means this node is not bound to an anchor yet. - anchor_id = p_anchor_id; - update_configuration_warnings(); -}; +void XRController3D::_bind_tracker() { + XRNode3D::_bind_tracker(); + if (tracker.is_valid()) { + // bind to input signals + tracker->connect("button_pressed", callable_mp(this, &XRController3D::_button_pressed)); + tracker->connect("button_released", callable_mp(this, &XRController3D::_button_released)); + tracker->connect("input_value_changed", callable_mp(this, &XRController3D::_input_value_changed)); + tracker->connect("input_axis_changed", callable_mp(this, &XRController3D::_input_axis_changed)); + } +} -int XRAnchor3D::get_anchor_id() const { - return anchor_id; -}; +void XRController3D::_unbind_tracker() { + if (tracker.is_valid()) { + // unbind input signals + tracker->disconnect("button_pressed", callable_mp(this, &XRController3D::_button_pressed)); + tracker->disconnect("button_released", callable_mp(this, &XRController3D::_button_released)); + tracker->disconnect("input_value_changed", callable_mp(this, &XRController3D::_input_value_changed)); + tracker->disconnect("input_axis_changed", callable_mp(this, &XRController3D::_input_axis_changed)); + } -Vector3 XRAnchor3D::get_size() const { - return size; -}; + XRNode3D::_unbind_tracker(); +} -String XRAnchor3D::get_anchor_name() const { - // get our XRServer - XRServer *xr_server = XRServer::get_singleton(); - ERR_FAIL_NULL_V(xr_server, String()); +void XRController3D::_button_pressed(const String &p_name) { + // just pass it on... + emit_signal("button_pressed", p_name); +} - Ref<XRPositionalTracker> tracker = xr_server->find_by_type_and_id(XRServer::TRACKER_ANCHOR, anchor_id); - if (!tracker.is_valid()) { - return String("Not connected"); - }; +void XRController3D::_button_released(const String &p_name) { + // just pass it on... + emit_signal("button_released", p_name); +} - return tracker->get_tracker_name(); -}; +void XRController3D::_input_value_changed(const String &p_name, float p_value) { + // just pass it on... + emit_signal("input_value_changed", p_name, p_value); +} -bool XRAnchor3D::get_is_active() const { - return is_active; -}; +void XRController3D::_input_axis_changed(const String &p_name, Vector2 p_value) { + // just pass it on... + emit_signal("input_axis_changed", p_name, p_value); +} -TypedArray<String> XRAnchor3D::get_configuration_warnings() const { - TypedArray<String> warnings = Node::get_configuration_warnings(); +bool XRController3D::is_button_pressed(const StringName &p_name) const { + if (tracker.is_valid()) { + // Inputs should already be of the correct type, our XR runtime handles conversions between raw input and the desired type + bool pressed = tracker->get_input(p_name); + return pressed; + } else { + return false; + } +} - if (is_visible() && is_inside_tree()) { - // must be child node of XROrigin3D! - XROrigin3D *origin = Object::cast_to<XROrigin3D>(get_parent()); - if (origin == nullptr) { - warnings.push_back(TTR("XRAnchor3D must have an XROrigin3D node as its parent.")); - } +float XRController3D::get_value(const StringName &p_name) const { + if (tracker.is_valid()) { + // Inputs should already be of the correct type, our XR runtime handles conversions between raw input and the desired type, but just in case we convert + Variant input = tracker->get_input(p_name); + switch (input.get_type()) { + case Variant::BOOL: { + bool value = input; + return value ? 1.0 : 0.0; + } break; + case Variant::FLOAT: { + float value = input; + return value; + } break; + default: + return 0.0; + }; + } else { + return 0.0; + } +} - if (anchor_id == 0) { - warnings.push_back(TTR("The anchor ID must not be 0 or this anchor won't be bound to an actual anchor.")); +Vector2 XRController3D::get_axis(const StringName &p_name) const { + if (tracker.is_valid()) { + // Inputs should already be of the correct type, our XR runtime handles conversions between raw input and the desired type, but just in case we convert + Variant input = tracker->get_input(p_name); + switch (input.get_type()) { + case Variant::BOOL: { + bool value = input; + return Vector2(value ? 1.0 : 0.0, 0.0); + } break; + case Variant::FLOAT: { + float value = input; + return Vector2(value, 0.0); + } break; + case Variant::VECTOR2: { + Vector2 axis = input; + return axis; + } + default: + return Vector2(); } + } else { + return Vector2(); } +} - return warnings; -}; +real_t XRController3D::get_rumble() const { + if (!tracker.is_valid()) { + return 0.0; + } + + return tracker->get_rumble(); +} + +void XRController3D::set_rumble(real_t p_rumble) { + if (tracker.is_valid()) { + tracker->set_rumble(p_rumble); + } +} + +XRPositionalTracker::TrackerHand XRController3D::get_tracker_hand() const { + // get our XRServer + if (!tracker.is_valid()) { + return XRPositionalTracker::TRACKER_HAND_UNKNOWN; + } + + return tracker->get_tracker_hand(); +} + +//////////////////////////////////////////////////////////////////////////////////////////////////// + +void XRAnchor3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("get_size"), &XRAnchor3D::get_size); + ClassDB::bind_method(D_METHOD("get_plane"), &XRAnchor3D::get_plane); +} + +Vector3 XRAnchor3D::get_size() const { + return size; +} Plane XRAnchor3D::get_plane() const { Vector3 location = get_position(); @@ -502,10 +597,6 @@ Plane XRAnchor3D::get_plane() const { Plane plane(orientation.get_axis(1).normalized(), location); return plane; -}; - -Ref<Mesh> XRAnchor3D::get_mesh() const { - return mesh; } //////////////////////////////////////////////////////////////////////////////////////////////////// @@ -525,23 +616,21 @@ TypedArray<String> XROrigin3D::get_configuration_warnings() const { } return warnings; -}; +} void XROrigin3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_world_scale", "world_scale"), &XROrigin3D::set_world_scale); ClassDB::bind_method(D_METHOD("get_world_scale"), &XROrigin3D::get_world_scale); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "world_scale"), "set_world_scale", "get_world_scale"); -}; +} void XROrigin3D::set_tracked_camera(XRCamera3D *p_tracked_camera) { tracked_camera = p_tracked_camera; -}; +} -void XROrigin3D::clear_tracked_camera_if(XRCamera3D *p_tracked_camera) { - if (tracked_camera == p_tracked_camera) { - tracked_camera = nullptr; - }; -}; +XRCamera3D *XROrigin3D::get_tracked_camera() const { + return tracked_camera; +} real_t XROrigin3D::get_world_scale() const { // get our XRServer @@ -549,7 +638,7 @@ real_t XROrigin3D::get_world_scale() const { ERR_FAIL_NULL_V(xr_server, 1.0); return xr_server->get_world_scale(); -}; +} void XROrigin3D::set_world_scale(real_t p_world_scale) { // get our XRServer @@ -557,7 +646,7 @@ void XROrigin3D::set_world_scale(real_t p_world_scale) { ERR_FAIL_NULL(xr_server); xr_server->set_world_scale(p_world_scale); -}; +} void XROrigin3D::_notification(int p_what) { // get our XRServer @@ -596,4 +685,4 @@ void XROrigin3D::_notification(int p_what) { interface->notification(p_what); } } -}; +} diff --git a/scene/3d/xr_nodes.h b/scene/3d/xr_nodes.h index 6e54ff83d7..5e7d06093d 100644 --- a/scene/3d/xr_nodes.h +++ b/scene/3d/xr_nodes.h @@ -45,8 +45,18 @@ class XRCamera3D : public Camera3D { GDCLASS(XRCamera3D, Camera3D); protected: + // The name and pose for our HMD tracker is currently the only hardcoded bit. + // If we ever are able to support multiple HMDs we may need to make this settable. + StringName tracker_name = "head"; + StringName pose_name = "default"; + Ref<XRPositionalTracker> tracker; + void _notification(int p_what); + void _changed_tracker(const StringName p_tracker_name, int p_tracker_type); + void _removed_tracker(const StringName p_tracker_name, int p_tracker_type); + void _pose_changed(const Ref<XRPose> &p_pose); + public: TypedArray<String> get_configuration_warnings() const override; @@ -55,48 +65,88 @@ public: virtual Vector3 project_position(const Point2 &p_point, real_t p_z_depth) const override; virtual Vector<Plane> get_frustum() const override; - XRCamera3D() {} - ~XRCamera3D() {} + XRCamera3D(); + ~XRCamera3D(); }; /* - XRController3D is a helper node that automatically updates its position based on tracker data. + XRNode3D is a helper node that implements binding to a tracker. It must be a child node of our XROrigin node */ -class XRController3D : public Node3D { - GDCLASS(XRController3D, Node3D); +class XRNode3D : public Node3D { + GDCLASS(XRNode3D, Node3D); private: - int controller_id = 1; + StringName tracker_name; + StringName pose_name = "default"; bool is_active = true; - int button_states = 0; - Ref<Mesh> mesh; protected: - void _notification(int p_what); + Ref<XRPositionalTracker> tracker; + static void _bind_methods(); -public: - void set_controller_id(int p_controller_id); - int get_controller_id() const; - String get_controller_name() const; + virtual void _bind_tracker(); + virtual void _unbind_tracker(); + void _changed_tracker(const StringName p_tracker_name, int p_tracker_type); + void _removed_tracker(const StringName p_tracker_name, int p_tracker_type); - int get_joystick_id() const; - bool is_button_pressed(int p_button) const; - float get_joystick_axis(int p_axis) const; + void _pose_changed(const Ref<XRPose> &p_pose); - real_t get_rumble() const; - void set_rumble(real_t p_rumble); +public: + virtual void _validate_property(PropertyInfo &property) const override; + void set_tracker(const StringName p_tracker_name); + StringName get_tracker() const; + + void set_pose_name(const StringName p_pose); + StringName get_pose_name() const; bool get_is_active() const; - XRPositionalTracker::TrackerHand get_tracker_hand() const; + bool get_has_tracking_data() const; - Ref<Mesh> get_mesh() const; + void trigger_haptic_pulse(const String &p_action_name, double p_frequency, double p_amplitude, double p_duration_sec, double p_delay_sec = 0); + + Ref<XRPose> get_pose(); TypedArray<String> get_configuration_warnings() const override; + XRNode3D(); + ~XRNode3D(); +}; + +/* + XRController3D is a helper node that automatically updates its position based on tracker data. + + It must be a child node of our XROrigin node +*/ + +class XRController3D : public XRNode3D { + GDCLASS(XRController3D, XRNode3D); + +private: +protected: + static void _bind_methods(); + + virtual void _bind_tracker() override; + virtual void _unbind_tracker() override; + + void _button_pressed(const String &p_name); + void _button_released(const String &p_name); + void _input_value_changed(const String &p_name, float p_value); + void _input_axis_changed(const String &p_name, Vector2 p_value); + +public: + bool is_button_pressed(const StringName &p_name) const; + float get_value(const StringName &p_name) const; + Vector2 get_axis(const StringName &p_name) const; + + real_t get_rumble() const; + void set_rumble(real_t p_rumble); + + XRPositionalTracker::TrackerHand get_tracker_hand() const; + XRController3D() {} ~XRController3D() {} }; @@ -106,33 +156,19 @@ public: It must be a child node of our XROrigin3D node */ -class XRAnchor3D : public Node3D { - GDCLASS(XRAnchor3D, Node3D); +class XRAnchor3D : public XRNode3D { + GDCLASS(XRAnchor3D, XRNode3D); private: - int anchor_id = 1; - bool is_active = true; Vector3 size; - Ref<Mesh> mesh; protected: - void _notification(int p_what); static void _bind_methods(); public: - void set_anchor_id(int p_anchor_id); - int get_anchor_id() const; - String get_anchor_name() const; - - bool get_is_active() const; Vector3 get_size() const; - Plane get_plane() const; - Ref<Mesh> get_mesh() const; - - TypedArray<String> get_configuration_warnings() const override; - XRAnchor3D() {} ~XRAnchor3D() {} }; @@ -159,7 +195,7 @@ public: TypedArray<String> get_configuration_warnings() const override; void set_tracked_camera(XRCamera3D *p_tracked_camera); - void clear_tracked_camera_if(XRCamera3D *p_tracked_camera); + XRCamera3D *get_tracked_camera() const; real_t get_world_scale() const; void set_world_scale(real_t p_world_scale); diff --git a/scene/animation/animation_blend_space_1d.cpp b/scene/animation/animation_blend_space_1d.cpp index 0167992baf..9a71e7bf55 100644 --- a/scene/animation/animation_blend_space_1d.cpp +++ b/scene/animation/animation_blend_space_1d.cpp @@ -81,14 +81,14 @@ void AnimationNodeBlendSpace1D::_bind_methods() { ClassDB::bind_method(D_METHOD("_add_blend_point", "index", "node"), &AnimationNodeBlendSpace1D::_add_blend_point); for (int i = 0; i < MAX_BLEND_POINTS; i++) { - ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "blend_point_" + itos(i) + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationRootNode", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_add_blend_point", "get_blend_point_node", i); - ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "blend_point_" + itos(i) + "/pos", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_blend_point_position", "get_blend_point_position", i); + ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "blend_point_" + itos(i) + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationRootNode", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_add_blend_point", "get_blend_point_node", i); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "blend_point_" + itos(i) + "/pos", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_blend_point_position", "get_blend_point_position", i); } - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "min_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_min_space", "get_min_space"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "max_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_max_space", "get_max_space"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "snap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_snap", "get_snap"); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "value_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_value_label", "get_value_label"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "min_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_min_space", "get_min_space"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "max_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_max_space", "get_max_space"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "snap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_snap", "get_snap"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "value_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_value_label", "get_value_label"); } void AnimationNodeBlendSpace1D::get_child_nodes(List<ChildNode> *r_child_nodes) { diff --git a/scene/animation/animation_blend_space_2d.cpp b/scene/animation/animation_blend_space_2d.cpp index 145e7c605b..8b5203961f 100644 --- a/scene/animation/animation_blend_space_2d.cpp +++ b/scene/animation/animation_blend_space_2d.cpp @@ -30,6 +30,7 @@ #include "animation_blend_space_2d.h" +#include "animation_blend_tree.h" #include "core/math/geometry_2d.h" void AnimationNodeBlendSpace2D::get_parameter_list(List<PropertyInfo> *r_list) const { @@ -133,7 +134,7 @@ void AnimationNodeBlendSpace2D::remove_blend_point(int p_point) { } } if (erase) { - triangles.remove(i); + triangles.remove_at(i); i--; } @@ -223,7 +224,7 @@ int AnimationNodeBlendSpace2D::get_triangle_point(int p_triangle, int p_point) { void AnimationNodeBlendSpace2D::remove_triangle(int p_triangle) { ERR_FAIL_INDEX(p_triangle, triangles.size()); - triangles.remove(p_triangle); + triangles.remove_at(p_triangle); } int AnimationNodeBlendSpace2D::get_triangle_count() const { @@ -531,6 +532,12 @@ double AnimationNodeBlendSpace2D::process(double p_time, bool p_seek) { if (new_closest != closest && new_closest != -1) { float from = 0.0; if (blend_mode == BLEND_MODE_DISCRETE_CARRY && closest != -1) { + //for ping-pong loop + Ref<AnimationNodeAnimation> na_c = static_cast<Ref<AnimationNodeAnimation>>(blend_points[closest].node); + Ref<AnimationNodeAnimation> na_n = static_cast<Ref<AnimationNodeAnimation>>(blend_points[new_closest].node); + if (!na_c.is_null() && !na_n.is_null()) { + na_n->set_backward(na_c->is_backward()); + } //see how much animation remains from = length_internal - blend_node(blend_points[closest].name, blend_points[closest].node, p_time, false, 0.0, FILTER_IGNORE, false); } @@ -639,21 +646,21 @@ void AnimationNodeBlendSpace2D::_bind_methods() { ClassDB::bind_method(D_METHOD("_update_triangles"), &AnimationNodeBlendSpace2D::_update_triangles); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "auto_triangles", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_auto_triangles", "get_auto_triangles"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "auto_triangles", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_auto_triangles", "get_auto_triangles"); for (int i = 0; i < MAX_BLEND_POINTS; i++) { - ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "blend_point_" + itos(i) + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationRootNode", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_add_blend_point", "get_blend_point_node", i); - ADD_PROPERTYI(PropertyInfo(Variant::VECTOR2, "blend_point_" + itos(i) + "/pos", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_blend_point_position", "get_blend_point_position", i); + ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "blend_point_" + itos(i) + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationRootNode", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_add_blend_point", "get_blend_point_node", i); + ADD_PROPERTYI(PropertyInfo(Variant::VECTOR2, "blend_point_" + itos(i) + "/pos", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_blend_point_position", "get_blend_point_position", i); } - ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "triangles", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_triangles", "_get_triangles"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_INT32_ARRAY, "triangles", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_triangles", "_get_triangles"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "min_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_min_space", "get_min_space"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "max_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_max_space", "get_max_space"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "snap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_snap", "get_snap"); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "x_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_x_label", "get_x_label"); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "y_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_y_label", "get_y_label"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_mode", PROPERTY_HINT_ENUM, "Interpolated,Discrete,Carry", PROPERTY_USAGE_NOEDITOR), "set_blend_mode", "get_blend_mode"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "min_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_min_space", "get_min_space"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "max_space", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_max_space", "get_max_space"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "snap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_snap", "get_snap"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "x_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_x_label", "get_x_label"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "y_label", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_y_label", "get_y_label"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_mode", PROPERTY_HINT_ENUM, "Interpolated,Discrete,Carry", PROPERTY_USAGE_NO_EDITOR), "set_blend_mode", "get_blend_mode"); ADD_SIGNAL(MethodInfo("triangles_updated")); BIND_ENUM_CONSTANT(BLEND_MODE_INTERPOLATED); diff --git a/scene/animation/animation_blend_tree.cpp b/scene/animation/animation_blend_tree.cpp index 10a66386eb..8f644face5 100644 --- a/scene/animation/animation_blend_tree.cpp +++ b/scene/animation/animation_blend_tree.cpp @@ -30,6 +30,7 @@ #include "animation_blend_tree.h" +#include "scene/resources/animation.h" #include "scene/scene_string_names.h" void AnimationNodeAnimation::set_animation(const StringName &p_name) { @@ -56,7 +57,7 @@ void AnimationNodeAnimation::_validate_property(PropertyInfo &property) const { } anims += String(names[i]); } - if (anims != String()) { + if (!anims.is_empty()) { property.hint = PROPERTY_HINT_ENUM; property.hint_string = anims; } @@ -83,30 +84,55 @@ double AnimationNodeAnimation::process(double p_time, bool p_seek) { } Ref<Animation> anim = ap->get_animation(animation); - - double step; + double anim_size = (double)anim->get_length(); + double step = 0.0; + double prev_time = time; + int pingponged = 0; + bool current_backward = signbit(p_time); if (p_seek) { + step = p_time - time; time = p_time; - step = 0; } else { - time = MAX(0, time + p_time); - step = p_time; + p_time *= backward ? -1.0 : 1.0; + if (!(time == anim_size && !current_backward) && !(time == 0 && current_backward)) { + time = time + p_time; + step = p_time; + } } - double anim_size = anim->get_length(); - - if (anim->has_loop()) { + if (anim->get_loop_mode() == Animation::LoopMode::LOOP_PINGPONG) { if (anim_size) { - time = Math::fposmod(time, anim_size); + if ((int)Math::floor(abs(time - prev_time) / anim_size) % 2 == 0) { + if (prev_time > 0 && time <= 0) { + backward = !backward; + pingponged = -1; + } + if (prev_time < anim_size && time >= anim_size) { + backward = !backward; + pingponged = 1; + } + } + time = Math::pingpong(time, anim_size); } - - } else if (time > anim_size) { - time = anim_size; + } else { + if (anim->get_loop_mode() == Animation::LoopMode::LOOP_LINEAR) { + if (anim_size) { + time = Math::fposmod(time, anim_size); + } + } else if (time < 0) { + time = 0; + } else if (time > anim_size) { + time = anim_size; + } + backward = false; } - blend_animation(animation, time, step, p_seek, 1.0); - + if (play_mode == PLAY_MODE_FORWARD) { + blend_animation(animation, time, step, p_seek, 1.0, pingponged); + } else { + blend_animation(animation, anim_size - time, -step, p_seek, 1.0, pingponged); + } set_parameter(this->time, time); return anim_size - time; @@ -116,11 +142,34 @@ String AnimationNodeAnimation::get_caption() const { return "Animation"; } +void AnimationNodeAnimation::set_play_mode(PlayMode p_play_mode) { + play_mode = p_play_mode; +} + +AnimationNodeAnimation::PlayMode AnimationNodeAnimation::get_play_mode() const { + return play_mode; +} + +void AnimationNodeAnimation::set_backward(bool p_backward) { + backward = p_backward; +} + +bool AnimationNodeAnimation::is_backward() const { + return backward; +} + void AnimationNodeAnimation::_bind_methods() { ClassDB::bind_method(D_METHOD("set_animation", "name"), &AnimationNodeAnimation::set_animation); ClassDB::bind_method(D_METHOD("get_animation"), &AnimationNodeAnimation::get_animation); + ClassDB::bind_method(D_METHOD("set_play_mode", "mode"), &AnimationNodeAnimation::set_play_mode); + ClassDB::bind_method(D_METHOD("get_play_mode"), &AnimationNodeAnimation::get_play_mode); + ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "animation"), "set_animation", "get_animation"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "play_mode", PROPERTY_HINT_ENUM, "Forward,Backward"), "set_play_mode", "get_play_mode"); + + BIND_ENUM_CONSTANT(PLAY_MODE_FORWARD); + BIND_ENUM_CONSTANT(PLAY_MODE_BACKWARD); } AnimationNodeAnimation::AnimationNodeAnimation() { @@ -533,7 +582,7 @@ AnimationNodeBlend3::AnimationNodeBlend3() { ///////////////////////////////// void AnimationNodeTimeScale::get_parameter_list(List<PropertyInfo> *r_list) const { - r_list->push_back(PropertyInfo(Variant::FLOAT, scale, PROPERTY_HINT_RANGE, "0,32,0.01,or_greater")); + r_list->push_back(PropertyInfo(Variant::FLOAT, scale, PROPERTY_HINT_RANGE, "-32,32,0.01,or_lesser,or_greater")); } Variant AnimationNodeTimeScale::get_parameter_default_value(const StringName &p_parameter) const { @@ -1112,12 +1161,12 @@ void AnimationNodeBlendTree::_get_property_list(List<PropertyInfo> *p_list) cons for (const StringName &E : names) { String name = E; if (name != "output") { - p_list->push_back(PropertyInfo(Variant::OBJECT, "nodes/" + name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationNode", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::OBJECT, "nodes/" + name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationNode", PROPERTY_USAGE_NO_EDITOR)); } - p_list->push_back(PropertyInfo(Variant::VECTOR2, "nodes/" + name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR2, "nodes/" + name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } - p_list->push_back(PropertyInfo(Variant::ARRAY, "node_connections", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "node_connections", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } void AnimationNodeBlendTree::reset_state() { @@ -1152,7 +1201,7 @@ void AnimationNodeBlendTree::_bind_methods() { ClassDB::bind_method(D_METHOD("set_graph_offset", "offset"), &AnimationNodeBlendTree::set_graph_offset); ClassDB::bind_method(D_METHOD("get_graph_offset"), &AnimationNodeBlendTree::get_graph_offset); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_graph_offset", "get_graph_offset"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_graph_offset", "get_graph_offset"); BIND_CONSTANT(CONNECTION_OK); BIND_CONSTANT(CONNECTION_ERROR_NO_INPUT); diff --git a/scene/animation/animation_blend_tree.h b/scene/animation/animation_blend_tree.h index 258443a999..e55dfb58ed 100644 --- a/scene/animation/animation_blend_tree.h +++ b/scene/animation/animation_blend_tree.h @@ -42,12 +42,12 @@ class AnimationNodeAnimation : public AnimationRootNode { uint64_t last_version = 0; bool skip = false; -protected: - void _validate_property(PropertyInfo &property) const override; - - static void _bind_methods(); - public: + enum PlayMode { + PLAY_MODE_FORWARD, + PLAY_MODE_BACKWARD + }; + void get_parameter_list(List<PropertyInfo> *r_list) const override; static Vector<String> (*get_editable_animation_list)(); @@ -58,9 +58,25 @@ public: void set_animation(const StringName &p_name); StringName get_animation() const; + void set_play_mode(PlayMode p_play_mode); + PlayMode get_play_mode() const; + + void set_backward(bool p_backward); + bool is_backward() const; + AnimationNodeAnimation(); + +protected: + void _validate_property(PropertyInfo &property) const override; + static void _bind_methods(); + +private: + PlayMode play_mode = PLAY_MODE_FORWARD; + bool backward = false; }; +VARIANT_ENUM_CAST(AnimationNodeAnimation::PlayMode) + class AnimationNodeOneShot : public AnimationNode { GDCLASS(AnimationNodeOneShot, AnimationNode); diff --git a/scene/animation/animation_node_state_machine.cpp b/scene/animation/animation_node_state_machine.cpp index 81ecb50ea0..31a1d4d64c 100644 --- a/scene/animation/animation_node_state_machine.cpp +++ b/scene/animation/animation_node_state_machine.cpp @@ -52,7 +52,7 @@ void AnimationNodeStateMachineTransition::set_advance_condition(const StringName String cs = p_condition; ERR_FAIL_COND(cs.find("/") != -1 || cs.find(":") != -1); advance_condition = p_condition; - if (cs != String()) { + if (!cs.is_empty()) { advance_condition_name = "conditions/" + cs; } else { advance_condition_name = StringName(); @@ -464,7 +464,7 @@ double AnimationNodeStateMachinePlayback::process(AnimationNodeStateMachine *p_s } if (path.size()) { //if it came from path, remove path - path.remove(0); + path.remove_at(0); } current = next; if (switch_mode == AnimationNodeStateMachineTransition::SWITCH_MODE_SYNC) { @@ -624,7 +624,7 @@ void AnimationNodeStateMachine::remove_node(const StringName &p_name) { for (int i = 0; i < transitions.size(); i++) { if (transitions[i].from == p_name || transitions[i].to == p_name) { transitions.write[i].transition->disconnect("advance_condition_changed", callable_mp(this, &AnimationNodeStateMachine::_tree_changed)); - transitions.remove(i); + transitions.remove_at(i); i--; } } @@ -751,7 +751,7 @@ void AnimationNodeStateMachine::remove_transition(const StringName &p_from, cons for (int i = 0; i < transitions.size(); i++) { if (transitions[i].from == p_from && transitions[i].to == p_to) { transitions.write[i].transition->disconnect("advance_condition_changed", callable_mp(this, &AnimationNodeStateMachine::_tree_changed)); - transitions.remove(i); + transitions.remove_at(i); return; } } @@ -764,7 +764,7 @@ void AnimationNodeStateMachine::remove_transition(const StringName &p_from, cons void AnimationNodeStateMachine::remove_transition_by_index(int p_transition) { ERR_FAIL_INDEX(p_transition, transitions.size()); transitions.write[p_transition].transition->disconnect("advance_condition_changed", callable_mp(this, &AnimationNodeStateMachine::_tree_changed)); - transitions.remove(p_transition); + transitions.remove_at(p_transition); /*if (playing) { path.clear(); }*/ @@ -909,14 +909,14 @@ void AnimationNodeStateMachine::_get_property_list(List<PropertyInfo> *p_list) c names.sort_custom<StringName::AlphCompare>(); for (const StringName &name : names) { - p_list->push_back(PropertyInfo(Variant::OBJECT, "states/" + name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationNode", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::VECTOR2, "states/" + name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::OBJECT, "states/" + name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "AnimationNode", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR2, "states/" + name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } - p_list->push_back(PropertyInfo(Variant::ARRAY, "transitions", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::STRING_NAME, "start_node", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::STRING_NAME, "end_node", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "transitions", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING_NAME, "start_node", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING_NAME, "end_node", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } void AnimationNodeStateMachine::reset_state() { diff --git a/scene/animation/animation_player.cpp b/scene/animation/animation_player.cpp index 1f000d5f39..c4cb800c24 100644 --- a/scene/animation/animation_player.cpp +++ b/scene/animation/animation_player.cpp @@ -166,15 +166,17 @@ void AnimationPlayer::_validate_property(PropertyInfo &property) const { property.hint_string = hint; } + + Node::_validate_property(property); } void AnimationPlayer::_get_property_list(List<PropertyInfo> *p_list) const { List<PropertyInfo> anim_names; for (const KeyValue<StringName, AnimationData> &E : animation_set) { - anim_names.push_back(PropertyInfo(Variant::OBJECT, "anims/" + String(E.key), PROPERTY_HINT_RESOURCE_TYPE, "Animation", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL | PROPERTY_USAGE_DO_NOT_SHARE_ON_DUPLICATE)); + anim_names.push_back(PropertyInfo(Variant::OBJECT, "anims/" + String(E.key), PROPERTY_HINT_RESOURCE_TYPE, "Animation", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL | PROPERTY_USAGE_DO_NOT_SHARE_ON_DUPLICATE)); if (E.value.next != StringName()) { - anim_names.push_back(PropertyInfo(Variant::STRING, "next/" + String(E.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); + anim_names.push_back(PropertyInfo(Variant::STRING, "next/" + String(E.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); } } @@ -184,7 +186,7 @@ void AnimationPlayer::_get_property_list(List<PropertyInfo> *p_list) const { p_list->push_back(E); } - p_list->push_back(PropertyInfo(Variant::ARRAY, "blend_times", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "blend_times", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); } void AnimationPlayer::advance(float p_time) { @@ -396,12 +398,13 @@ void AnimationPlayer::_ensure_node_caches(AnimationData *p_anim, Node *p_root_ov } } -void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double p_time, double p_delta, float p_interp, bool p_is_current, bool p_seeked, bool p_started) { +void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double p_time, double p_delta, float p_interp, bool p_is_current, bool p_seeked, bool p_started, int p_pingponged) { _ensure_node_caches(p_anim); ERR_FAIL_COND(p_anim->node_cache.size() != p_anim->animation->get_track_count()); Animation *a = p_anim->animation.operator->(); bool can_call = is_inside_tree() && !Engine::get_singleton()->is_editor_hint(); + bool backward = signbit(p_delta); for (int i = 0; i < a->get_track_count(); i++) { // If an animation changes this animation (or it animates itself) @@ -555,8 +558,8 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double continue; //eeh not worth it } - float first_key_time = a->track_get_key_time(i, 0); - float transition = 1.0; + double first_key_time = a->track_get_key_time(i, 0); + double transition = 1.0; int first_key = 0; if (first_key_time == 0.0) { @@ -564,13 +567,13 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double if (key_count == 1) { continue; //with one key we can't do anything } - transition = a->track_get_key_transition(i, 0); + transition = (double)a->track_get_key_transition(i, 0); first_key_time = a->track_get_key_time(i, 1); first_key = 1; } if (p_time < first_key_time) { - float c = Math::ease(p_time / first_key_time, transition); + double c = Math::ease(p_time / first_key_time, transition); Variant first_value = a->track_get_key_value(i, first_key); Variant interp_value; Variant::interpolate(pa->capture, first_value, c, interp_value); @@ -612,7 +615,7 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double } else if (p_is_current && p_delta != 0) { List<int> indices; - a->value_track_get_key_indices(i, p_time, p_delta, &indices); + a->value_track_get_key_indices(i, p_time, p_delta, &indices, p_pingponged); for (int &F : indices) { Variant value = a->track_get_key_value(i, F); @@ -671,7 +674,7 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double List<int> indices; - a->method_track_get_key_indices(i, p_time, p_delta, &indices); + a->method_track_get_key_indices(i, p_time, p_delta, &indices, p_pingponged); for (int &E : indices) { StringName method = a->method_track_get_name(i, E); @@ -726,14 +729,14 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double TrackNodeCache::BezierAnim *ba = &E->get(); - float bezier = a->bezier_track_interpolate(i, p_time); + real_t bezier = a->bezier_track_interpolate(i, p_time); if (ba->accum_pass != accum_pass) { ERR_CONTINUE(cache_update_bezier_size >= NODE_CACHE_UPDATE_MAX); cache_update_bezier[cache_update_bezier_size++] = ba; ba->bezier_accum = bezier; ba->accum_pass = accum_pass; } else { - ba->bezier_accum = Math::lerp(ba->bezier_accum, bezier, p_interp); + ba->bezier_accum = Math::lerp(ba->bezier_accum, (float)bezier, p_interp); } } break; @@ -787,7 +790,7 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double } else { //find stuff to play List<int> to_play; - a->track_get_key_indices_in_range(i, p_time, p_delta, &to_play); + a->track_get_key_indices_in_range(i, p_time, p_delta, &to_play, p_pingponged); if (to_play.size()) { int idx = to_play.back()->get(); @@ -815,12 +818,14 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double nc->audio_start = p_time; } } else if (nc->audio_playing) { - bool loop = a->has_loop(); + bool loop = a->get_loop_mode() != Animation::LoopMode::LOOP_NONE; bool stop = false; - if (!loop && p_time < nc->audio_start) { - stop = true; + if (!loop) { + if ((p_time < nc->audio_start && !backward) || (p_time > nc->audio_start && backward)) { + stop = true; + } } else if (nc->audio_len > 0) { float len = nc->audio_start > p_time ? (a->get_length() - nc->audio_start) + p_time : p_time - nc->audio_start; @@ -861,12 +866,23 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double Ref<Animation> anim = player->get_animation(anim_name); - double at_anim_pos; + double at_anim_pos = 0.0; - if (anim->has_loop()) { - at_anim_pos = Math::fposmod(p_time - pos, (double)anim->get_length()); //seek to loop - } else { - at_anim_pos = MIN((double)anim->get_length(), p_time - pos); //seek to end + switch (anim->get_loop_mode()) { + case Animation::LoopMode::LOOP_NONE: { + at_anim_pos = MIN((double)anim->get_length(), p_time - pos); //seek to end + } break; + + case Animation::LoopMode::LOOP_LINEAR: { + at_anim_pos = Math::fposmod(p_time - pos, (double)anim->get_length()); //seek to loop + } break; + + case Animation::LoopMode::LOOP_PINGPONG: { + at_anim_pos = Math::pingpong(p_time - pos, (double)anim->get_length()); + } break; + + default: + break; } if (player->is_playing() || p_seeked) { @@ -881,7 +897,7 @@ void AnimationPlayer::_animation_process_animation(AnimationData *p_anim, double } else { //find stuff to play List<int> to_play; - a->track_get_key_indices_in_range(i, p_time, p_delta, &to_play); + a->track_get_key_indices_in_range(i, p_time, p_delta, &to_play, p_pingponged); if (to_play.size()) { int idx = to_play.back()->get(); @@ -911,46 +927,73 @@ void AnimationPlayer::_animation_process_data(PlaybackData &cd, double p_delta, double next_pos = cd.pos + delta; real_t len = cd.from->animation->get_length(); - bool loop = cd.from->animation->has_loop(); + int pingponged = 0; + + switch (cd.from->animation->get_loop_mode()) { + case Animation::LoopMode::LOOP_NONE: { + if (next_pos < 0) { + next_pos = 0; + } else if (next_pos > len) { + next_pos = len; + } - if (!loop) { - if (next_pos < 0) { - next_pos = 0; - } else if (next_pos > len) { - next_pos = len; - } + bool backwards = signbit(delta); // Negative zero means playing backwards too + delta = next_pos - cd.pos; // Fix delta (after determination of backwards because negative zero is lost here) + + if (&cd == &playback.current) { + if (!backwards && cd.pos <= len && next_pos == len) { + //playback finished + end_reached = true; + end_notify = cd.pos < len; // Notify only if not already at the end + } - bool backwards = signbit(delta); // Negative zero means playing backwards too - delta = next_pos - cd.pos; // Fix delta (after determination of backwards because negative zero is lost here) + if (backwards && cd.pos >= 0 && next_pos == 0) { + //playback finished + end_reached = true; + end_notify = cd.pos > 0; // Notify only if not already at the beginning + } + } + } break; - if (&cd == &playback.current) { - if (!backwards && cd.pos <= len && next_pos == len) { - //playback finished - end_reached = true; - end_notify = cd.pos < len; // Notify only if not already at the end + case Animation::LoopMode::LOOP_LINEAR: { + double looped_next_pos = Math::fposmod(next_pos, (double)len); + if (looped_next_pos == 0 && next_pos != 0) { + // Loop multiples of the length to it, rather than 0 + // so state at time=length is previewable in the editor + next_pos = len; + } else { + next_pos = looped_next_pos; } + } break; - if (backwards && cd.pos >= 0 && next_pos == 0) { - //playback finished - end_reached = true; - end_notify = cd.pos > 0; // Notify only if not already at the beginning + case Animation::LoopMode::LOOP_PINGPONG: { + if ((int)Math::floor(abs(next_pos - cd.pos) / len) % 2 == 0) { + if (next_pos < 0 && cd.pos >= 0) { + cd.speed_scale *= -1.0; + pingponged = -1; + } + if (next_pos > len && cd.pos <= len) { + cd.speed_scale *= -1.0; + pingponged = 1; + } } - } + double looped_next_pos = Math::pingpong(next_pos, (double)len); + if (looped_next_pos == 0 && next_pos != 0) { + // Loop multiples of the length to it, rather than 0 + // so state at time=length is previewable in the editor + next_pos = len; + } else { + next_pos = looped_next_pos; + } + } break; - } else { - double looped_next_pos = Math::fposmod(next_pos, (double)len); - if (looped_next_pos == 0 && next_pos != 0) { - // Loop multiples of the length to it, rather than 0 - // so state at time=length is previewable in the editor - next_pos = len; - } else { - next_pos = looped_next_pos; - } + default: + break; } cd.pos = next_pos; - _animation_process_animation(cd.from, cd.pos, delta, p_blend, &cd == &playback.current, p_seeked, p_started); + _animation_process_animation(cd.from, cd.pos, delta, p_blend, &cd == &playback.current, p_seeked, p_started, pingponged); } void AnimationPlayer::_animation_process2(double p_delta, bool p_started) { @@ -1373,7 +1416,7 @@ bool AnimationPlayer::is_playing() const { } void AnimationPlayer::set_current_animation(const String &p_anim) { - if (p_anim == "[stop]" || p_anim == "") { + if (p_anim == "[stop]" || p_anim.is_empty()) { stop(); } else if (!is_playing() || playback.assigned != p_anim) { play(p_anim); @@ -1711,7 +1754,7 @@ Ref<AnimatedValuesBackup> AnimationPlayer::backup_animated_values(Node *p_root_o Ref<AnimatedValuesBackup> AnimationPlayer::apply_reset(bool p_user_initiated) { ERR_FAIL_COND_V(!can_apply_reset(), Ref<AnimatedValuesBackup>()); - Ref<Animation> reset_anim = animation_set["RESET"].animation; + Ref<Animation> reset_anim = animation_set[SceneStringNames::get_singleton()->RESET].animation; ERR_FAIL_COND_V(reset_anim.is_null(), Ref<AnimatedValuesBackup>()); Node *root_node = get_node_or_null(root); @@ -1719,8 +1762,8 @@ Ref<AnimatedValuesBackup> AnimationPlayer::apply_reset(bool p_user_initiated) { AnimationPlayer *aux_player = memnew(AnimationPlayer); EditorNode::get_singleton()->add_child(aux_player); - aux_player->add_animation("RESET", reset_anim); - aux_player->set_assigned_animation("RESET"); + aux_player->add_animation(SceneStringNames::get_singleton()->RESET, reset_anim); + aux_player->set_assigned_animation(SceneStringNames::get_singleton()->RESET); // Forcing the use of the original root because the scene where original player belongs may be not the active one Node *root = get_node(get_root()); Ref<AnimatedValuesBackup> old_values = aux_player->backup_animated_values(root); @@ -1742,7 +1785,7 @@ Ref<AnimatedValuesBackup> AnimationPlayer::apply_reset(bool p_user_initiated) { } bool AnimationPlayer::can_apply_reset() const { - return has_animation("RESET") && playback.assigned != StringName("RESET"); + return has_animation(SceneStringNames::get_singleton()->RESET) && playback.assigned != SceneStringNames::get_singleton()->RESET; } #endif @@ -1811,7 +1854,7 @@ void AnimationPlayer::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "root_node"), "set_root", "get_root"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "current_animation", PROPERTY_HINT_ENUM, "", PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_ANIMATE_AS_TRIGGER), "set_current_animation", "get_current_animation"); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "assigned_animation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NONE), "set_assigned_animation", "get_assigned_animation"); - ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "autoplay", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_autoplay", "get_autoplay"); + ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "autoplay", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_autoplay", "get_autoplay"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "reset_on_save", PROPERTY_HINT_NONE, ""), "set_reset_on_save_enabled", "is_reset_on_save_enabled"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "current_animation_length", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NONE), "", "get_current_animation_length"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "current_animation_position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NONE), "", "get_current_animation_position"); diff --git a/scene/animation/animation_player.h b/scene/animation/animation_player.h index 21e309efe0..1b07c086c0 100644 --- a/scene/animation/animation_player.h +++ b/scene/animation/animation_player.h @@ -198,7 +198,7 @@ private: struct PlaybackData { AnimationData *from = nullptr; - float pos = 0.0; + double pos = 0.0; float speed_scale = 1.0; }; @@ -231,7 +231,7 @@ private: NodePath root; - void _animation_process_animation(AnimationData *p_anim, double p_time, double p_delta, float p_interp, bool p_is_current = true, bool p_seeked = false, bool p_started = false); + void _animation_process_animation(AnimationData *p_anim, double p_time, double p_delta, float p_interp, bool p_is_current = true, bool p_seeked = false, bool p_started = false, int p_pingponged = 0); void _ensure_node_caches(AnimationData *p_anim, Node *p_root_override = nullptr); void _animation_process_data(PlaybackData &cd, double p_delta, float p_blend, bool p_seeked, bool p_started); @@ -301,7 +301,6 @@ public: void set_current_animation(const String &p_anim); String get_assigned_animation() const; void set_assigned_animation(const String &p_anim); - void stop_all(); void set_active(bool p_active); bool is_active() const; bool is_valid() const; diff --git a/scene/animation/animation_tree.cpp b/scene/animation/animation_tree.cpp index ccb5fa9472..1d4b5ebf06 100644 --- a/scene/animation/animation_tree.cpp +++ b/scene/animation/animation_tree.cpp @@ -32,6 +32,7 @@ #include "animation_blend_tree.h" #include "core/config/engine.h" +#include "scene/resources/animation.h" #include "scene/scene_string_names.h" #include "servers/audio/audio_stream.h" @@ -87,7 +88,7 @@ void AnimationNode::get_child_nodes(List<ChildNode> *r_child_nodes) { } } -void AnimationNode::blend_animation(const StringName &p_animation, real_t p_time, real_t p_delta, bool p_seeked, real_t p_blend) { +void AnimationNode::blend_animation(const StringName &p_animation, real_t p_time, real_t p_delta, bool p_seeked, real_t p_blend, int p_pingponged) { ERR_FAIL_COND(!state); ERR_FAIL_COND(!state->player->has_animation(p_animation)); @@ -113,6 +114,7 @@ void AnimationNode::blend_animation(const StringName &p_animation, real_t p_time anim_state.time = p_time; anim_state.animation = animation; anim_state.seeked = p_seeked; + anim_state.pingponged = p_pingponged; state->animation_states.push_back(anim_state); } @@ -136,7 +138,7 @@ real_t AnimationNode::_pre_process(const StringName &p_base_path, AnimationNode void AnimationNode::make_invalid(const String &p_reason) { ERR_FAIL_COND(!state); state->valid = false; - if (state->invalid_reasons != String()) { + if (!state->invalid_reasons.is_empty()) { state->invalid_reasons += "\n"; } state->invalid_reasons += String::utf8("• ") + p_reason; @@ -327,7 +329,7 @@ void AnimationNode::set_input_name(int p_input, const String &p_name) { void AnimationNode::remove_input(int p_index) { ERR_FAIL_INDEX(p_index, inputs.size()); - inputs.remove(p_index); + inputs.remove_at(p_index); emit_changed(); } @@ -418,15 +420,15 @@ void AnimationNode::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_filters", "filters"), &AnimationNode::_set_filters); ClassDB::bind_method(D_METHOD("_get_filters"), &AnimationNode::_get_filters); - ClassDB::bind_method(D_METHOD("blend_animation", "animation", "time", "delta", "seeked", "blend"), &AnimationNode::blend_animation); + ClassDB::bind_method(D_METHOD("blend_animation", "animation", "time", "delta", "seeked", "blend", "pingponged"), &AnimationNode::blend_animation, DEFVAL(0)); ClassDB::bind_method(D_METHOD("blend_node", "name", "node", "time", "seek", "blend", "filter", "optimize"), &AnimationNode::blend_node, DEFVAL(FILTER_IGNORE), DEFVAL(true)); ClassDB::bind_method(D_METHOD("blend_input", "input_index", "time", "seek", "blend", "filter", "optimize"), &AnimationNode::blend_input, DEFVAL(FILTER_IGNORE), DEFVAL(true)); ClassDB::bind_method(D_METHOD("set_parameter", "name", "value"), &AnimationNode::set_parameter); ClassDB::bind_method(D_METHOD("get_parameter", "name"), &AnimationNode::get_parameter); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "filter_enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_filter_enabled", "is_filter_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "filters", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_filters", "_get_filters"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "filter_enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_filter_enabled", "is_filter_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "filters", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_filters", "_get_filters"); GDVIRTUAL_BIND(_get_child_nodes); GDVIRTUAL_BIND(_get_parameter_list); @@ -898,6 +900,10 @@ void AnimationTree::_process_graph(real_t p_delta) { double delta = as.delta; real_t weight = as.blend; bool seeked = as.seeked; + int pingponged = as.pingponged; +#ifndef _3D_DISABLED + bool backward = signbit(delta); +#endif // _3D_DISABLED for (int i = 0; i < a->get_track_count(); i++) { NodePath path = a->track_get_path(i); @@ -939,27 +945,63 @@ void AnimationTree::_process_graph(real_t p_delta) { } if (track->root_motion) { - real_t prev_time = time - delta; - if (prev_time < 0) { - if (!a->has_loop()) { - prev_time = 0; - } else { - prev_time = a->get_length() + prev_time; + double prev_time = time - delta; + if (!backward) { + if (prev_time < 0) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = 0; + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } + } + } else { + if (prev_time > a->get_length()) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = (double)a->get_length(); + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } } } Vector3 loc[2]; - if (prev_time > time) { - Error err = a->position_track_interpolate(i, prev_time, &loc[0]); - if (err != OK) { - continue; + if (!backward) { + if (prev_time > time) { + Error err = a->position_track_interpolate(i, prev_time, &loc[0]); + if (err != OK) { + continue; + } + a->position_track_interpolate(i, (double)a->get_length(), &loc[1]); + t->loc += (loc[1] - loc[0]) * blend; + prev_time = 0; + } + } else { + if (prev_time < time) { + Error err = a->position_track_interpolate(i, prev_time, &loc[0]); + if (err != OK) { + continue; + } + a->position_track_interpolate(i, 0, &loc[1]); + t->loc += (loc[1] - loc[0]) * blend; + prev_time = 0; } - - a->position_track_interpolate(i, a->get_length(), &loc[1]); - - t->loc += (loc[1] - loc[0]) * blend; - prev_time = 0; } Error err = a->position_track_interpolate(i, prev_time, &loc[0]); @@ -968,17 +1010,13 @@ void AnimationTree::_process_graph(real_t p_delta) { } a->position_track_interpolate(i, time, &loc[1]); - t->loc += (loc[1] - loc[0]) * blend; - - prev_time = 0; + prev_time = !backward ? 0 : (double)a->get_length(); } else { Vector3 loc; Error err = a->position_track_interpolate(i, time, &loc); - //ERR_CONTINUE(err!=OK); //used for testing, should be removed - if (err != OK) { continue; } @@ -1000,29 +1038,65 @@ void AnimationTree::_process_graph(real_t p_delta) { } if (track->root_motion) { - real_t prev_time = time - delta; - if (prev_time < 0) { - if (!a->has_loop()) { - prev_time = 0; - } else { - prev_time = a->get_length() + prev_time; + double prev_time = time - delta; + if (!backward) { + if (prev_time < 0) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = 0; + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } + } + } else { + if (prev_time > a->get_length()) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = (double)a->get_length(); + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } } } Quaternion rot[2]; - if (prev_time > time) { - Error err = a->rotation_track_interpolate(i, prev_time, &rot[0]); - if (err != OK) { - continue; + if (!backward) { + if (prev_time > time) { + Error err = a->rotation_track_interpolate(i, prev_time, &rot[0]); + if (err != OK) { + continue; + } + a->rotation_track_interpolate(i, (double)a->get_length(), &rot[1]); + Quaternion q = Quaternion().slerp(rot[0].normalized().inverse() * rot[1].normalized(), blend).normalized(); + t->rot = (t->rot * q).normalized(); + prev_time = 0; + } + } else { + if (prev_time < time) { + Error err = a->rotation_track_interpolate(i, prev_time, &rot[0]); + if (err != OK) { + continue; + } + a->rotation_track_interpolate(i, 0, &rot[1]); + Quaternion q = Quaternion().slerp(rot[0].normalized().inverse() * rot[1].normalized(), blend).normalized(); + t->rot = (t->rot * q).normalized(); + prev_time = 0; } - - a->rotation_track_interpolate(i, a->get_length(), &rot[1]); - - Quaternion q = Quaternion().slerp(rot[0].normalized().inverse() * rot[1].normalized(), blend).normalized(); - t->rot = (t->rot * q).normalized(); - - prev_time = 0; } Error err = a->rotation_track_interpolate(i, prev_time, &rot[0]); @@ -1031,18 +1105,14 @@ void AnimationTree::_process_graph(real_t p_delta) { } a->rotation_track_interpolate(i, time, &rot[1]); - Quaternion q = Quaternion().slerp(rot[0].normalized().inverse() * rot[1].normalized(), blend).normalized(); t->rot = (t->rot * q).normalized(); - - prev_time = 0; + prev_time = !backward ? 0 : (double)a->get_length(); } else { Quaternion rot; Error err = a->rotation_track_interpolate(i, time, &rot); - //ERR_CONTINUE(err!=OK); //used for testing, should be removed - if (err != OK) { continue; } @@ -1071,28 +1141,63 @@ void AnimationTree::_process_graph(real_t p_delta) { } if (track->root_motion) { - real_t prev_time = time - delta; - if (prev_time < 0) { - if (!a->has_loop()) { - prev_time = 0; - } else { - prev_time = a->get_length() + prev_time; + double prev_time = time - delta; + if (!backward) { + if (prev_time < 0) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = 0; + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } + } + } else { + if (prev_time > a->get_length()) { + switch (a->get_loop_mode()) { + case Animation::LOOP_NONE: { + prev_time = (double)a->get_length(); + } break; + case Animation::LOOP_LINEAR: { + prev_time = Math::fposmod(prev_time, (double)a->get_length()); + } break; + case Animation::LOOP_PINGPONG: { + prev_time = Math::pingpong(prev_time, (double)a->get_length()); + } break; + default: + break; + } } } Vector3 scale[2]; - if (prev_time > time) { - Error err = a->scale_track_interpolate(i, prev_time, &scale[0]); - if (err != OK) { - continue; + if (!backward) { + if (prev_time > time) { + Error err = a->scale_track_interpolate(i, prev_time, &scale[0]); + if (err != OK) { + continue; + } + a->scale_track_interpolate(i, (double)a->get_length(), &scale[1]); + t->scale += (scale[1] - scale[0]) * blend; + prev_time = 0; + } + } else { + if (prev_time < time) { + Error err = a->scale_track_interpolate(i, prev_time, &scale[0]); + if (err != OK) { + continue; + } + a->scale_track_interpolate(i, 0, &scale[1]); + t->scale += (scale[1] - scale[0]) * blend; + prev_time = 0; } - - a->scale_track_interpolate(i, a->get_length(), &scale[1]); - - t->scale += (scale[1] - scale[0]) * blend; - - prev_time = 0; } Error err = a->scale_track_interpolate(i, prev_time, &scale[0]); @@ -1101,17 +1206,13 @@ void AnimationTree::_process_graph(real_t p_delta) { } a->scale_track_interpolate(i, time, &scale[1]); - t->scale += (scale[1] - scale[0]) * blend; - - prev_time = 0; + prev_time = !backward ? 0 : (double)a->get_length(); } else { Vector3 scale; Error err = a->scale_track_interpolate(i, time, &scale); - //ERR_CONTINUE(err!=OK); //used for testing, should be removed - if (err != OK) { continue; } @@ -1138,8 +1239,7 @@ void AnimationTree::_process_graph(real_t p_delta) { continue; } - t->value = Math::lerp(t->value, value, blend); - + t->value = Math::lerp(t->value, value, (float)blend); #endif // _3D_DISABLED } break; case Animation::TYPE_VALUE: { @@ -1164,7 +1264,7 @@ void AnimationTree::_process_graph(real_t p_delta) { } else { List<int> indices; - a->value_track_get_key_indices(i, time, delta, &indices); + a->value_track_get_key_indices(i, time, delta, &indices, pingponged); for (int &F : indices) { Variant value = a->track_get_key_value(i, F); @@ -1181,7 +1281,7 @@ void AnimationTree::_process_graph(real_t p_delta) { List<int> indices; - a->method_track_get_key_indices(i, time, delta, &indices); + a->method_track_get_key_indices(i, time, delta, &indices, pingponged); for (int &F : indices) { StringName method = a->method_track_get_name(i, F); @@ -1264,7 +1364,7 @@ void AnimationTree::_process_graph(real_t p_delta) { } else { //find stuff to play List<int> to_play; - a->track_get_key_indices_in_range(i, time, delta, &to_play); + a->track_get_key_indices_in_range(i, time, delta, &to_play, pingponged); if (to_play.size()) { int idx = to_play.back()->get(); @@ -1292,12 +1392,20 @@ void AnimationTree::_process_graph(real_t p_delta) { t->start = time; } } else if (t->playing) { - bool loop = a->has_loop(); + bool loop = a->get_loop_mode() != Animation::LoopMode::LOOP_NONE; bool stop = false; - if (!loop && time < t->start) { - stop = true; + if (!loop) { + if (delta > 0) { + if (time < t->start) { + stop = true; + } + } else if (delta < 0) { + if (time > t->start) { + stop = true; + } + } } else if (t->len > 0) { real_t len = t->start > time ? (a->get_length() - t->start) + time : time - t->start; @@ -1331,7 +1439,7 @@ void AnimationTree::_process_graph(real_t p_delta) { continue; } - if (delta == 0 || seeked) { + if (seeked) { //seek int idx = a->track_find_key(i, time); if (idx < 0) { @@ -1347,12 +1455,20 @@ void AnimationTree::_process_graph(real_t p_delta) { Ref<Animation> anim = player2->get_animation(anim_name); - real_t at_anim_pos; - - if (anim->has_loop()) { - at_anim_pos = Math::fposmod(time - pos, (double)anim->get_length()); //seek to loop - } else { - at_anim_pos = MAX(anim->get_length(), time - pos); //seek to end + real_t at_anim_pos = 0.0; + + switch (anim->get_loop_mode()) { + case Animation::LoopMode::LOOP_NONE: { + at_anim_pos = MAX((double)anim->get_length(), time - pos); //seek to end + } break; + case Animation::LoopMode::LOOP_LINEAR: { + at_anim_pos = Math::fposmod(time - pos, (double)anim->get_length()); //seek to loop + } break; + case Animation::LoopMode::LOOP_PINGPONG: { + at_anim_pos = Math::pingpong(time - pos, (double)a->get_length()); + } break; + default: + break; } if (player2->is_playing() || seeked) { @@ -1367,7 +1483,7 @@ void AnimationTree::_process_graph(real_t p_delta) { } else { //find stuff to play List<int> to_play; - a->track_get_key_indices_in_range(i, time, delta, &to_play); + a->track_get_key_indices_in_range(i, time, delta, &to_play, pingponged); if (to_play.size()) { int idx = to_play.back()->get(); diff --git a/scene/animation/animation_tree.h b/scene/animation/animation_tree.h index 21b49937a7..6fc051fa41 100644 --- a/scene/animation/animation_tree.h +++ b/scene/animation/animation_tree.h @@ -57,8 +57,6 @@ public: Vector<Input> inputs; - real_t process_input(int p_input, real_t p_time, bool p_seek, real_t p_blend); - friend class AnimationTree; struct AnimationState { @@ -68,6 +66,7 @@ public: const Vector<real_t> *track_blends = nullptr; real_t blend = 0.0; bool seeked = false; + int pingponged = 0; }; struct State { @@ -85,7 +84,6 @@ public: State *state = nullptr; real_t _pre_process(const StringName &p_base_path, AnimationNode *p_parent, State *p_state, real_t p_time, bool p_seek, const Vector<StringName> &p_connections); - void _pre_update_animations(HashMap<NodePath, int> *track_map); //all this is temporary StringName base_path; @@ -101,17 +99,16 @@ public: real_t _blend_node(const StringName &p_subpath, const Vector<StringName> &p_connections, AnimationNode *p_new_parent, Ref<AnimationNode> p_node, real_t p_time, bool p_seek, real_t p_blend, FilterAction p_filter = FILTER_IGNORE, bool p_optimize = true, real_t *r_max = nullptr); protected: - void blend_animation(const StringName &p_animation, real_t p_time, real_t p_delta, bool p_seeked, real_t p_blend); + void blend_animation(const StringName &p_animation, real_t p_time, real_t p_delta, bool p_seeked, real_t p_blend, int p_pingponged = 0); real_t blend_node(const StringName &p_sub_path, Ref<AnimationNode> p_node, real_t p_time, bool p_seek, real_t p_blend, FilterAction p_filter = FILTER_IGNORE, bool p_optimize = true); real_t blend_input(int p_input, real_t p_time, bool p_seek, real_t p_blend, FilterAction p_filter = FILTER_IGNORE, bool p_optimize = true); + void make_invalid(const String &p_reason); static void _bind_methods(); void _validate_property(PropertyInfo &property) const override; - void _set_parent(Object *p_parent); - GDVIRTUAL0RC(Dictionary, _get_child_nodes) GDVIRTUAL0RC(Array, _get_parameter_list) GDVIRTUAL1RC(Ref<AnimationNode>, _get_child_by_name, StringName) @@ -265,7 +262,6 @@ private: AnimationNode::State state; bool cache_valid = false; void _node_removed(Node *p_node); - void _caches_cleared(); void _clear_caches(); bool _update_caches(AnimationPlayer *player); diff --git a/scene/animation/tween.cpp b/scene/animation/tween.cpp index c43b83747b..da933ae02d 100644 --- a/scene/animation/tween.cpp +++ b/scene/animation/tween.cpp @@ -291,7 +291,7 @@ bool Tween::step(float p_delta) { float temp_delta = rem_delta; // Turns to true if any Tweener returns true (i.e. is still not finished). step_active = tweener->step(temp_delta) || step_active; - step_delta = MIN(temp_delta, rem_delta); + step_delta = MIN(temp_delta, step_delta); } rem_delta = step_delta; @@ -626,7 +626,7 @@ void Tween::_bind_methods() { ClassDB::bind_method(D_METHOD("parallel"), &Tween::parallel); ClassDB::bind_method(D_METHOD("chain"), &Tween::chain); - ClassDB::bind_method(D_METHOD("interpolate_value", "trans_type", "ease_type", "elapsed_time", "initial_value", "delta_value", "duration"), &Tween::interpolate_variant); + ClassDB::bind_method(D_METHOD("interpolate_value", "initial_value", "delta_value", "elapsed_time", "duration", "trans_type", "ease_type"), &Tween::interpolate_variant); ADD_SIGNAL(MethodInfo("step_finished", PropertyInfo(Variant::INT, "idx"))); ADD_SIGNAL(MethodInfo("loop_finished", PropertyInfo(Variant::INT, "loop_count"))); diff --git a/scene/audio/audio_stream_player.cpp b/scene/audio/audio_stream_player.cpp index d2fd65d3d9..3da4f23a08 100644 --- a/scene/audio/audio_stream_player.cpp +++ b/scene/audio/audio_stream_player.cpp @@ -45,7 +45,6 @@ void AudioStreamPlayer::_notification(int p_what) { Vector<Ref<AudioStreamPlayback>> playbacks_to_remove; for (Ref<AudioStreamPlayback> &playback : stream_playbacks) { if (playback.is_valid() && !AudioServer::get_singleton()->is_playback_active(playback) && !AudioServer::get_singleton()->is_playback_paused(playback)) { - emit_signal(SNAME("finished")); playbacks_to_remove.push_back(playback); } } @@ -58,6 +57,9 @@ void AudioStreamPlayer::_notification(int p_what) { active.clear(); set_process_internal(false); } + if (!playbacks_to_remove.is_empty()) { + emit_signal(SNAME("finished")); + } } if (p_what == NOTIFICATION_EXIT_TREE) { @@ -141,7 +143,7 @@ void AudioStreamPlayer::play(float p_from_pos) { set_process_internal(true); while (stream_playbacks.size() > max_polyphony) { AudioServer::get_singleton()->stop_playback_stream(stream_playbacks[0]); - stream_playbacks.remove(0); + stream_playbacks.remove_at(0); } } @@ -292,6 +294,8 @@ void AudioStreamPlayer::_validate_property(PropertyInfo &property) const { property.hint_string = options; } + + Node::_validate_property(property); } void AudioStreamPlayer::_bus_layout_changed() { diff --git a/scene/debugger/scene_debugger.cpp b/scene/debugger/scene_debugger.cpp index 3c8949ddfb..e1594384d5 100644 --- a/scene/debugger/scene_debugger.cpp +++ b/scene/debugger/scene_debugger.cpp @@ -226,7 +226,7 @@ void SceneDebugger::add_to_cache(const String &p_filename, Node *p_node) { return; } - if (EngineDebugger::get_script_debugger() && p_filename != String()) { + if (EngineDebugger::get_script_debugger() && !p_filename.is_empty()) { debugger->live_scene_edit_cache[p_filename].insert(p_node); } } @@ -367,7 +367,7 @@ void SceneDebuggerObject::serialize(Array &r_arr, int p_max_size) { PropertyHint hint = pi.hint; String hint_string = pi.hint_string; - if (!res.is_null()) { + if (!res.is_null() && !res->get_path().is_empty()) { var = res->get_path(); } else { //only send information that can be sent.. int len = 0; //test how big is this to encode diff --git a/scene/gui/aspect_ratio_container.cpp b/scene/gui/aspect_ratio_container.cpp index fb6fa9dec9..9526c5e793 100644 --- a/scene/gui/aspect_ratio_container.cpp +++ b/scene/gui/aspect_ratio_container.cpp @@ -60,12 +60,12 @@ void AspectRatioContainer::set_stretch_mode(StretchMode p_mode) { queue_sort(); } -void AspectRatioContainer::set_alignment_horizontal(AlignMode p_alignment_horizontal) { +void AspectRatioContainer::set_alignment_horizontal(AlignmentMode p_alignment_horizontal) { alignment_horizontal = p_alignment_horizontal; queue_sort(); } -void AspectRatioContainer::set_alignment_vertical(AlignMode p_alignment_vertical) { +void AspectRatioContainer::set_alignment_vertical(AlignmentMode p_alignment_vertical) { alignment_vertical = p_alignment_vertical; queue_sort(); } @@ -107,25 +107,25 @@ void AspectRatioContainer::_notification(int p_what) { float align_x = 0.5; switch (alignment_horizontal) { - case ALIGN_BEGIN: { + case ALIGNMENT_BEGIN: { align_x = 0.0; } break; - case ALIGN_CENTER: { + case ALIGNMENT_CENTER: { align_x = 0.5; } break; - case ALIGN_END: { + case ALIGNMENT_END: { align_x = 1.0; } break; } float align_y = 0.5; switch (alignment_vertical) { - case ALIGN_BEGIN: { + case ALIGNMENT_BEGIN: { align_y = 0.0; } break; - case ALIGN_CENTER: { + case ALIGNMENT_CENTER: { align_y = 0.5; } break; - case ALIGN_END: { + case ALIGNMENT_END: { align_y = 1.0; } break; } @@ -166,7 +166,7 @@ void AspectRatioContainer::_bind_methods() { BIND_ENUM_CONSTANT(STRETCH_FIT); BIND_ENUM_CONSTANT(STRETCH_COVER); - BIND_ENUM_CONSTANT(ALIGN_BEGIN); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_END); + BIND_ENUM_CONSTANT(ALIGNMENT_BEGIN); + BIND_ENUM_CONSTANT(ALIGNMENT_CENTER); + BIND_ENUM_CONSTANT(ALIGNMENT_END); } diff --git a/scene/gui/aspect_ratio_container.h b/scene/gui/aspect_ratio_container.h index c95c6a7274..3cdfc75734 100644 --- a/scene/gui/aspect_ratio_container.h +++ b/scene/gui/aspect_ratio_container.h @@ -48,17 +48,17 @@ public: STRETCH_FIT, STRETCH_COVER, }; - enum AlignMode { - ALIGN_BEGIN, - ALIGN_CENTER, - ALIGN_END, + enum AlignmentMode { + ALIGNMENT_BEGIN, + ALIGNMENT_CENTER, + ALIGNMENT_END, }; private: float ratio = 1.0; StretchMode stretch_mode = STRETCH_FIT; - AlignMode alignment_horizontal = ALIGN_CENTER; - AlignMode alignment_vertical = ALIGN_CENTER; + AlignmentMode alignment_horizontal = ALIGNMENT_CENTER; + AlignmentMode alignment_vertical = ALIGNMENT_CENTER; public: void set_ratio(float p_ratio); @@ -67,14 +67,14 @@ public: void set_stretch_mode(StretchMode p_mode); StretchMode get_stretch_mode() const { return stretch_mode; } - void set_alignment_horizontal(AlignMode p_alignment_horizontal); - AlignMode get_alignment_horizontal() const { return alignment_horizontal; } + void set_alignment_horizontal(AlignmentMode p_alignment_horizontal); + AlignmentMode get_alignment_horizontal() const { return alignment_horizontal; } - void set_alignment_vertical(AlignMode p_alignment_vertical); - AlignMode get_alignment_vertical() const { return alignment_vertical; } + void set_alignment_vertical(AlignmentMode p_alignment_vertical); + AlignmentMode get_alignment_vertical() const { return alignment_vertical; } }; VARIANT_ENUM_CAST(AspectRatioContainer::StretchMode); -VARIANT_ENUM_CAST(AspectRatioContainer::AlignMode); +VARIANT_ENUM_CAST(AspectRatioContainer::AlignmentMode); #endif // ASPECT_RATIO_CONTAINER_H diff --git a/scene/gui/base_button.cpp b/scene/gui/base_button.cpp index bef1011364..f4de48689e 100644 --- a/scene/gui/base_button.cpp +++ b/scene/gui/base_button.cpp @@ -62,7 +62,7 @@ void BaseButton::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mouse_button = p_event; bool ui_accept = p_event->is_action("ui_accept") && !p_event->is_echo(); - bool button_masked = mouse_button.is_valid() && ((1 << (mouse_button->get_button_index() - 1)) & button_mask) != 0; + bool button_masked = mouse_button.is_valid() && (mouse_button_to_mask(mouse_button->get_button_index()) & button_mask) != MouseButton::NONE; if (button_masked || ui_accept) { on_action_event(p_event); return; @@ -313,11 +313,11 @@ BaseButton::ActionMode BaseButton::get_action_mode() const { return action_mode; } -void BaseButton::set_button_mask(int p_mask) { +void BaseButton::set_button_mask(MouseButton p_mask) { button_mask = p_mask; } -int BaseButton::get_button_mask() const { +MouseButton BaseButton::get_button_mask() const { return button_mask; } @@ -355,7 +355,7 @@ String BaseButton::get_tooltip(const Point2 &p_pos) const { String tooltip = Control::get_tooltip(p_pos); if (shortcut_in_tooltip && shortcut.is_valid() && shortcut->has_valid_event()) { String text = shortcut->get_name() + " (" + shortcut->get_as_text() + ")"; - if (tooltip != String() && shortcut->get_name().nocasecmp_to(tooltip) != 0) { + if (!tooltip.is_empty() && shortcut->get_name().nocasecmp_to(tooltip) != 0) { text += "\n" + tooltip; } tooltip = text; diff --git a/scene/gui/base_button.h b/scene/gui/base_button.h index cd6e78464f..3ea59c3ff9 100644 --- a/scene/gui/base_button.h +++ b/scene/gui/base_button.h @@ -45,7 +45,7 @@ public: }; private: - int button_mask = MOUSE_BUTTON_MASK_LEFT; + MouseButton button_mask = MouseButton::MASK_LEFT; bool toggle_mode = false; bool shortcut_in_tooltip = true; bool keep_pressed_outside = false; @@ -118,8 +118,8 @@ public: void set_keep_pressed_outside(bool p_on); bool is_keep_pressed_outside() const; - void set_button_mask(int p_mask); - int get_button_mask() const; + void set_button_mask(MouseButton p_mask); + MouseButton get_button_mask() const; void set_shortcut(const Ref<Shortcut> &p_shortcut); Ref<Shortcut> get_shortcut() const; diff --git a/scene/gui/box_container.cpp b/scene/gui/box_container.cpp index cf2df4e1a2..fc05d51937 100644 --- a/scene/gui/box_container.cpp +++ b/scene/gui/box_container.cpp @@ -154,29 +154,29 @@ void BoxContainer::_resort() { int ofs = 0; if (!has_stretched) { if (!vertical) { - switch (align) { - case ALIGN_BEGIN: + switch (alignment) { + case ALIGNMENT_BEGIN: if (rtl) { ofs = stretch_diff; } break; - case ALIGN_CENTER: + case ALIGNMENT_CENTER: ofs = stretch_diff / 2; break; - case ALIGN_END: + case ALIGNMENT_END: if (!rtl) { ofs = stretch_diff; } break; } } else { - switch (align) { - case ALIGN_BEGIN: + switch (alignment) { + case ALIGNMENT_BEGIN: break; - case ALIGN_CENTER: + case ALIGNMENT_CENTER: ofs = stretch_diff / 2; break; - case ALIGN_END: + case ALIGNMENT_END: ofs = stretch_diff; break; } @@ -295,7 +295,7 @@ void BoxContainer::_notification(int p_what) { _resort(); } break; case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); } break; case NOTIFICATION_TRANSLATION_CHANGED: case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { @@ -304,13 +304,13 @@ void BoxContainer::_notification(int p_what) { } } -void BoxContainer::set_alignment(AlignMode p_align) { - align = p_align; +void BoxContainer::set_alignment(AlignmentMode p_alignment) { + alignment = p_alignment; _resort(); } -BoxContainer::AlignMode BoxContainer::get_alignment() const { - return align; +BoxContainer::AlignmentMode BoxContainer::get_alignment() const { + return alignment; } Control *BoxContainer::add_spacer(bool p_begin) { @@ -340,9 +340,9 @@ void BoxContainer::_bind_methods() { ClassDB::bind_method(D_METHOD("get_alignment"), &BoxContainer::get_alignment); ClassDB::bind_method(D_METHOD("set_alignment", "alignment"), &BoxContainer::set_alignment); - BIND_ENUM_CONSTANT(ALIGN_BEGIN); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_END); + BIND_ENUM_CONSTANT(ALIGNMENT_BEGIN); + BIND_ENUM_CONSTANT(ALIGNMENT_CENTER); + BIND_ENUM_CONSTANT(ALIGNMENT_END); ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Begin,Center,End"), "set_alignment", "get_alignment"); } @@ -354,7 +354,7 @@ MarginContainer *VBoxContainer::add_margin_child(const String &p_label, Control add_child(l, false, INTERNAL_MODE_FRONT); MarginContainer *mc = memnew(MarginContainer); mc->add_theme_constant_override("margin_left", 0); - mc->add_child(p_control); + mc->add_child(p_control, true); add_child(mc, false, INTERNAL_MODE_FRONT); if (p_expand) { mc->set_v_size_flags(SIZE_EXPAND_FILL); diff --git a/scene/gui/box_container.h b/scene/gui/box_container.h index 23feea565c..9bb26ec32c 100644 --- a/scene/gui/box_container.h +++ b/scene/gui/box_container.h @@ -37,15 +37,15 @@ class BoxContainer : public Container { GDCLASS(BoxContainer, Container); public: - enum AlignMode { - ALIGN_BEGIN, - ALIGN_CENTER, - ALIGN_END + enum AlignmentMode { + ALIGNMENT_BEGIN, + ALIGNMENT_CENTER, + ALIGNMENT_END }; private: bool vertical = false; - AlignMode align = ALIGN_BEGIN; + AlignmentMode alignment = ALIGNMENT_BEGIN; void _resort(); @@ -57,8 +57,8 @@ protected: public: Control *add_spacer(bool p_begin = false); - void set_alignment(AlignMode p_align); - AlignMode get_alignment() const; + void set_alignment(AlignmentMode p_alignment); + AlignmentMode get_alignment() const; virtual Size2 get_minimum_size() const override; @@ -84,6 +84,6 @@ public: BoxContainer(true) {} }; -VARIANT_ENUM_CAST(BoxContainer::AlignMode); +VARIANT_ENUM_CAST(BoxContainer::AlignmentMode); #endif // BOX_CONTAINER_H diff --git a/scene/gui/button.cpp b/scene/gui/button.cpp index e253a27e66..8bb41e7abf 100644 --- a/scene/gui/button.cpp +++ b/scene/gui/button.cpp @@ -50,9 +50,9 @@ Size2 Button::get_minimum_size() const { if (!_icon.is_null()) { minsize.height = MAX(minsize.height, _icon->get_height()); - if (icon_align != ALIGN_CENTER) { + if (icon_alignment != HORIZONTAL_ALIGNMENT_CENTER) { minsize.width += _icon->get_width(); - if (xl_text != "") { + if (!xl_text.is_empty()) { minsize.width += get_theme_constant(SNAME("hseparation")); } } else { @@ -82,13 +82,13 @@ void Button::_notification(int p_what) { xl_text = atr(text); _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_THEME_CHANGED: { _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_DRAW: { @@ -111,9 +111,18 @@ void Button::_notification(int p_what) { if (!flat) { style->draw(ci, Rect2(Point2(0, 0), size)); } - color = get_theme_color(SNAME("font_color")); - if (has_theme_color(SNAME("icon_normal_color"))) { - color_icon = get_theme_color(SNAME("icon_normal_color")); + + // Focus colors only take precedence over normal state. + if (has_focus()) { + color = get_theme_color(SNAME("font_focus_color")); + if (has_theme_color(SNAME("icon_focus_color"))) { + color_icon = get_theme_color(SNAME("icon_focus_color")); + } + } else { + color = get_theme_color(SNAME("font_color")); + if (has_theme_color(SNAME("icon_normal_color"))) { + color_icon = get_theme_color(SNAME("icon_normal_color")); + } } } break; case DRAW_HOVER_PRESSED: { @@ -207,19 +216,19 @@ void Button::_notification(int p_what) { } Rect2 icon_region = Rect2(); - TextAlign icon_align_rtl_checked = icon_align; - TextAlign align_rtl_checked = align; + HorizontalAlignment icon_align_rtl_checked = icon_alignment; + HorizontalAlignment align_rtl_checked = alignment; // Swap icon and text alignment sides if right-to-left layout is set. if (rtl) { - if (icon_align == ALIGN_RIGHT) { - icon_align_rtl_checked = ALIGN_LEFT; - } else if (icon_align == ALIGN_LEFT) { - icon_align_rtl_checked = ALIGN_RIGHT; + if (icon_alignment == HORIZONTAL_ALIGNMENT_RIGHT) { + icon_align_rtl_checked = HORIZONTAL_ALIGNMENT_LEFT; + } else if (icon_alignment == HORIZONTAL_ALIGNMENT_LEFT) { + icon_align_rtl_checked = HORIZONTAL_ALIGNMENT_RIGHT; } - if (align == ALIGN_RIGHT) { - align_rtl_checked = ALIGN_LEFT; - } else if (align == ALIGN_LEFT) { - align_rtl_checked = ALIGN_RIGHT; + if (alignment == HORIZONTAL_ALIGNMENT_RIGHT) { + align_rtl_checked = HORIZONTAL_ALIGNMENT_LEFT; + } else if (alignment == HORIZONTAL_ALIGNMENT_LEFT) { + align_rtl_checked = HORIZONTAL_ALIGNMENT_RIGHT; } } if (!_icon.is_null()) { @@ -231,14 +240,14 @@ void Button::_notification(int p_what) { float icon_ofs_region = 0.0; Point2 style_offset; Size2 icon_size = _icon->get_size(); - if (icon_align_rtl_checked == ALIGN_LEFT) { + if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_LEFT) { style_offset.x = style->get_margin(SIDE_LEFT); if (_internal_margin[SIDE_LEFT] > 0) { icon_ofs_region = _internal_margin[SIDE_LEFT] + get_theme_constant(SNAME("hseparation")); } - } else if (icon_align_rtl_checked == ALIGN_CENTER) { + } else if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_CENTER) { style_offset.x = 0.0; - } else if (icon_align_rtl_checked == ALIGN_RIGHT) { + } else if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_RIGHT) { style_offset.x = -style->get_margin(SIDE_RIGHT); if (_internal_margin[SIDE_RIGHT] > 0) { icon_ofs_region = -_internal_margin[SIDE_RIGHT] - get_theme_constant(SNAME("hseparation")); @@ -249,7 +258,7 @@ void Button::_notification(int p_what) { if (expand_icon) { Size2 _size = get_size() - style->get_offset() * 2; _size.width -= get_theme_constant(SNAME("hseparation")) + icon_ofs_region; - if (!clip_text && icon_align_rtl_checked != ALIGN_CENTER) { + if (!clip_text && icon_align_rtl_checked != HORIZONTAL_ALIGNMENT_CENTER) { _size.width -= text_buf->get_size().width; } float icon_width = _icon->get_width() * _size.height / _icon->get_height(); @@ -263,9 +272,9 @@ void Button::_notification(int p_what) { icon_size = Size2(icon_width, icon_height); } - if (icon_align_rtl_checked == ALIGN_LEFT) { + if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_LEFT) { icon_region = Rect2(style_offset + Point2(icon_ofs_region, Math::floor((valign - icon_size.y) * 0.5)), icon_size); - } else if (icon_align_rtl_checked == ALIGN_CENTER) { + } else if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_CENTER) { icon_region = Rect2(style_offset + Point2(icon_ofs_region + Math::floor((size.x - icon_size.x) * 0.5), Math::floor((valign - icon_size.y) * 0.5)), icon_size); } else { icon_region = Rect2(style_offset + Point2(icon_ofs_region + size.x - icon_size.x, Math::floor((valign - icon_size.y) * 0.5)), icon_size); @@ -277,7 +286,7 @@ void Button::_notification(int p_what) { } Point2 icon_ofs = !_icon.is_null() ? Point2(icon_region.size.width + get_theme_constant(SNAME("hseparation")), 0) : Point2(); - if (align_rtl_checked == ALIGN_CENTER && icon_align_rtl_checked == ALIGN_CENTER) { + if (align_rtl_checked == HORIZONTAL_ALIGNMENT_CENTER && icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_CENTER) { icon_ofs.x = 0.0; } int text_clip = size.width - style->get_minimum_size().width - icon_ofs.width; @@ -295,8 +304,9 @@ void Button::_notification(int p_what) { Point2 text_ofs = (size - style->get_minimum_size() - icon_ofs - text_buf->get_size() - Point2(_internal_margin[SIDE_RIGHT] - _internal_margin[SIDE_LEFT], 0)) / 2.0; switch (align_rtl_checked) { - case ALIGN_LEFT: { - if (icon_align_rtl_checked != ALIGN_LEFT) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { + if (icon_align_rtl_checked != HORIZONTAL_ALIGNMENT_LEFT) { icon_ofs.x = 0.0; } if (_internal_margin[SIDE_LEFT] > 0) { @@ -306,23 +316,23 @@ void Button::_notification(int p_what) { } text_ofs.y += style->get_offset().y; } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (text_ofs.x < 0) { text_ofs.x = 0; } - if (icon_align_rtl_checked == ALIGN_LEFT) { + if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_LEFT) { text_ofs += icon_ofs; } text_ofs += style->get_offset(); } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (_internal_margin[SIDE_RIGHT] > 0) { text_ofs.x = size.x - style->get_margin(SIDE_RIGHT) - text_width - _internal_margin[SIDE_RIGHT] - get_theme_constant(SNAME("hseparation")); } else { text_ofs.x = size.x - style->get_margin(SIDE_RIGHT) - text_width; } text_ofs.y += style->get_offset().y; - if (icon_align_rtl_checked == ALIGN_RIGHT) { + if (icon_align_rtl_checked == HORIZONTAL_ALIGNMENT_RIGHT) { text_ofs.x -= icon_ofs.x; } } break; @@ -349,7 +359,7 @@ void Button::_shape() { } else { text_buf->set_direction((TextServer::Direction)text_direction); } - text_buf->add_string(xl_text, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text_buf->add_string(xl_text, font, font_size, opentype_features, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); } void Button::set_text(const String &p_text) { @@ -359,7 +369,7 @@ void Button::set_text(const String &p_text) { _shape(); update(); - minimum_size_changed(); + update_minimum_size(); } } @@ -419,7 +429,7 @@ void Button::set_icon(const Ref<Texture2D> &p_icon) { if (icon != p_icon) { icon = p_icon; update(); - minimum_size_changed(); + update_minimum_size(); } } @@ -431,7 +441,7 @@ void Button::set_expand_icon(bool p_enabled) { if (expand_icon != p_enabled) { expand_icon = p_enabled; update(); - minimum_size_changed(); + update_minimum_size(); } } @@ -454,7 +464,7 @@ void Button::set_clip_text(bool p_enabled) { if (clip_text != p_enabled) { clip_text = p_enabled; update(); - minimum_size_changed(); + update_minimum_size(); } } @@ -462,25 +472,25 @@ bool Button::get_clip_text() const { return clip_text; } -void Button::set_text_align(TextAlign p_align) { - if (align != p_align) { - align = p_align; +void Button::set_text_alignment(HorizontalAlignment p_alignment) { + if (alignment != p_alignment) { + alignment = p_alignment; update(); } } -Button::TextAlign Button::get_text_align() const { - return align; +HorizontalAlignment Button::get_text_alignment() const { + return alignment; } -void Button::set_icon_align(TextAlign p_align) { - icon_align = p_align; - minimum_size_changed(); +void Button::set_icon_alignment(HorizontalAlignment p_alignment) { + icon_alignment = p_alignment; + update_minimum_size(); update(); } -Button::TextAlign Button::get_icon_align() const { - return icon_align; +HorizontalAlignment Button::get_icon_alignment() const { + return icon_alignment; } bool Button::_set(const StringName &p_name, const Variant &p_value) { @@ -549,25 +559,21 @@ void Button::_bind_methods() { ClassDB::bind_method(D_METHOD("is_flat"), &Button::is_flat); ClassDB::bind_method(D_METHOD("set_clip_text", "enabled"), &Button::set_clip_text); ClassDB::bind_method(D_METHOD("get_clip_text"), &Button::get_clip_text); - ClassDB::bind_method(D_METHOD("set_text_align", "align"), &Button::set_text_align); - ClassDB::bind_method(D_METHOD("get_text_align"), &Button::get_text_align); - ClassDB::bind_method(D_METHOD("set_icon_align", "icon_align"), &Button::set_icon_align); - ClassDB::bind_method(D_METHOD("get_icon_align"), &Button::get_icon_align); + ClassDB::bind_method(D_METHOD("set_text_alignment", "alignment"), &Button::set_text_alignment); + ClassDB::bind_method(D_METHOD("get_text_alignment"), &Button::get_text_alignment); + ClassDB::bind_method(D_METHOD("set_icon_alignment", "icon_alignment"), &Button::set_icon_alignment); + ClassDB::bind_method(D_METHOD("get_icon_alignment"), &Button::get_icon_alignment); ClassDB::bind_method(D_METHOD("set_expand_icon", "enabled"), &Button::set_expand_icon); ClassDB::bind_method(D_METHOD("is_expand_icon"), &Button::is_expand_icon); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_MULTILINE_TEXT, "", PROPERTY_USAGE_DEFAULT_INTL), "set_text", "get_text"); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,Left-to-Right,Right-to-Left,Inherited"), "set_text_direction", "get_text_direction"); ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "icon", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_button_icon", "get_button_icon"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "flat"), "set_flat", "is_flat"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clip_text"), "set_clip_text", "get_clip_text"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_text_align", "get_text_align"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "icon_align", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_icon_align", "get_icon_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_text_alignment", "get_text_alignment"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "icon_alignment", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_icon_alignment", "get_icon_alignment"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "expand_icon"), "set_expand_icon", "is_expand_icon"); } diff --git a/scene/gui/button.h b/scene/gui/button.h index fd36cb77af..92d86542a6 100644 --- a/scene/gui/button.h +++ b/scene/gui/button.h @@ -37,13 +37,6 @@ class Button : public BaseButton { GDCLASS(Button, BaseButton); -public: - enum TextAlign { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT - }; - private: bool flat = false; String text; @@ -57,8 +50,8 @@ private: Ref<Texture2D> icon; bool expand_icon = false; bool clip_text = false; - TextAlign align = ALIGN_CENTER; - TextAlign icon_align = ALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_CENTER; + HorizontalAlignment icon_alignment = HORIZONTAL_ALIGNMENT_LEFT; float _internal_margin[4] = {}; void _shape(); @@ -100,16 +93,14 @@ public: void set_clip_text(bool p_enabled); bool get_clip_text() const; - void set_text_align(TextAlign p_align); - TextAlign get_text_align() const; + void set_text_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_text_alignment() const; - void set_icon_align(TextAlign p_align); - TextAlign get_icon_align() const; + void set_icon_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_icon_alignment() const; Button(const String &p_text = String()); ~Button(); }; -VARIANT_ENUM_CAST(Button::TextAlign); - #endif diff --git a/scene/gui/center_container.cpp b/scene/gui/center_container.cpp index 909516e7ef..e17552006f 100644 --- a/scene/gui/center_container.cpp +++ b/scene/gui/center_container.cpp @@ -61,7 +61,7 @@ void CenterContainer::set_use_top_left(bool p_enable) { use_top_left = p_enable; - minimum_size_changed(); + update_minimum_size(); queue_sort(); } diff --git a/scene/gui/check_box.cpp b/scene/gui/check_box.cpp index 411fb2e1f0..134766b05f 100644 --- a/scene/gui/check_box.cpp +++ b/scene/gui/check_box.cpp @@ -123,7 +123,7 @@ CheckBox::CheckBox(const String &p_text) : Button(p_text) { set_toggle_mode(true); - set_text_align(ALIGN_LEFT); + set_text_alignment(HORIZONTAL_ALIGNMENT_LEFT); if (is_layout_rtl()) { _set_internal_margin(SIDE_RIGHT, get_icon_size().width); diff --git a/scene/gui/check_button.cpp b/scene/gui/check_button.cpp index 162a256d23..499bedda52 100644 --- a/scene/gui/check_button.cpp +++ b/scene/gui/check_button.cpp @@ -107,7 +107,7 @@ void CheckButton::_notification(int p_what) { CheckButton::CheckButton() { set_toggle_mode(true); - set_text_align(ALIGN_LEFT); + set_text_alignment(HORIZONTAL_ALIGNMENT_LEFT); if (is_layout_rtl()) { _set_internal_margin(SIDE_LEFT, get_icon_size().width); } else { diff --git a/scene/gui/code_edit.cpp b/scene/gui/code_edit.cpp index da54903871..ba37d51e24 100644 --- a/scene/gui/code_edit.cpp +++ b/scene/gui/code_edit.cpp @@ -129,7 +129,7 @@ void CodeEdit::_notification(int p_what) { } const int scroll_width = code_completion_options_count > code_completion_max_lines ? code_completion_scroll_width : 0; - const int code_completion_base_width = font->get_string_size(code_completion_base).width; + const int code_completion_base_width = font->get_string_size(code_completion_base, font_size).width; if (caret_pos.x - code_completion_base_width + code_completion_rect.size.width + scroll_width > get_size().width) { code_completion_rect.position.x = get_size().width - code_completion_rect.size.width - scroll_width; } else { @@ -170,12 +170,12 @@ void CodeEdit::_notification(int p_what) { if (code_completion_options[l].default_value.get_type() == Variant::COLOR) { draw_rect(Rect2(Point2(code_completion_rect.position.x, icon_area.position.y), icon_area_size), (Color)code_completion_options[l].default_value); } - tl->set_align(HALIGN_RIGHT); + tl->set_horizontal_alignment(HORIZONTAL_ALIGNMENT_RIGHT); } else { if (code_completion_options[l].default_value.get_type() == Variant::COLOR) { draw_rect(Rect2(Point2(code_completion_rect.position.x + code_completion_rect.size.width - icon_area_size.x, icon_area.position.y), icon_area_size), (Color)code_completion_options[l].default_value); } - tl->set_align(HALIGN_LEFT); + tl->set_horizontal_alignment(HORIZONTAL_ALIGNMENT_LEFT); } tl->draw(ci, title_pos, code_completion_options[l].font_color); } @@ -189,7 +189,7 @@ void CodeEdit::_notification(int p_what) { } /* Code hint */ - if (caret_visible && code_hint != "" && (!code_completion_active || (code_completion_below != code_hint_draw_below))) { + if (caret_visible && !code_hint.is_empty() && (!code_completion_active || (code_completion_below != code_hint_draw_below))) { const int font_height = font->get_height(font_size); Ref<StyleBox> sb = get_theme_stylebox(SNAME("panel"), SNAME("TooltipPanel")); Color font_color = get_theme_color(SNAME("font_color"), SNAME("TooltipLabel")); @@ -229,7 +229,7 @@ void CodeEdit::_notification(int p_what) { Point2 round_ofs = hint_ofs + sb->get_offset() + Vector2(0, font->get_ascent(font_size) + font_height * i + yofs); round_ofs = round_ofs.round(); - draw_string(font, round_ofs, line.replace(String::chr(0xFFFF), ""), HALIGN_LEFT, -1, font_size, font_color); + draw_string(font, round_ofs, line.replace(String::chr(0xFFFF), ""), HORIZONTAL_ALIGNMENT_LEFT, -1, font_size, font_color); if (end > 0) { // Draw an underline for the currently edited function parameter. const Vector2 b = hint_ofs + sb->get_offset() + Vector2(begin, font_height + font_height * i + yofs); @@ -263,19 +263,19 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } switch (mb->get_button_index()) { - case MOUSE_BUTTON_WHEEL_UP: { + case MouseButton::WHEEL_UP: { if (code_completion_current_selected > 0) { code_completion_current_selected--; update(); } } break; - case MOUSE_BUTTON_WHEEL_DOWN: { + case MouseButton::WHEEL_DOWN: { if (code_completion_current_selected < code_completion_options.size() - 1) { code_completion_current_selected++; update(); } } break; - case MOUSE_BUTTON_LEFT: { + case MouseButton::LEFT: { code_completion_current_selected = CLAMP(code_completion_line_ofs + (mb->get_position().y - code_completion_rect.position.y) / get_line_height(), 0, code_completion_options.size() - 1); if (mb->is_double_click()) { confirm_code_completion(); @@ -296,11 +296,11 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { mpos.x = get_size().x - mpos.x; } - Point2i pos = get_line_column_at_pos(mpos); + Point2i pos = get_line_column_at_pos(mpos, false); int line = pos.y; int col = pos.x; - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (line != -1 && mb->get_button_index() == MouseButton::LEFT) { if (is_line_folded(line)) { int wrap_index = get_line_wrap_index_at_column(line, col); if (wrap_index == get_line_wrap_count(line)) { @@ -314,18 +314,20 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } } } else { - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { - if (mb->is_command_pressed() && symbol_lookup_word != String()) { + if (mb->get_button_index() == MouseButton::LEFT) { + if (mb->is_command_pressed() && !symbol_lookup_word.is_empty()) { Vector2i mpos = mb->get_position(); if (is_layout_rtl()) { mpos.x = get_size().x - mpos.x; } - Point2i pos = get_line_column_at_pos(mpos); + Point2i pos = get_line_column_at_pos(mpos, false); int line = pos.y; int col = pos.x; - emit_signal(SNAME("symbol_lookup"), symbol_lookup_word, line, col); + if (line != -1) { + emit_signal(SNAME("symbol_lookup"), symbol_lookup_word, line, col); + } return; } } @@ -340,7 +342,7 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } if (symbol_lookup_on_click_enabled) { - if (mm->is_command_pressed() && mm->get_button_mask() == 0 && !is_dragging_cursor()) { + if (mm->is_command_pressed() && mm->get_button_mask() == MouseButton::NONE && !is_dragging_cursor()) { symbol_lookup_new_word = get_word_at_pos(mpos); if (symbol_lookup_new_word != symbol_lookup_word) { emit_signal(SNAME("symbol_validate"), symbol_lookup_new_word); @@ -360,9 +362,9 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { /* Ctrl + Hover symbols */ #ifdef OSX_ENABLED - if (k->get_keycode() == KEY_META) { + if (k->get_keycode() == Key::META) { #else - if (k->get_keycode() == KEY_CTRL) { + if (k->get_keycode() == Key::CTRL) { #endif if (symbol_lookup_on_click_enabled) { if (k->is_pressed() && !is_dragging_cursor()) { @@ -378,7 +380,7 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } /* If a modifier has been pressed, and nothing else, return. */ - if (!k->is_pressed() || k->get_keycode() == KEY_CTRL || k->get_keycode() == KEY_ALT || k->get_keycode() == KEY_SHIFT || k->get_keycode() == KEY_META) { + if (!k->is_pressed() || k->get_keycode() == Key::CTRL || k->get_keycode() == Key::ALT || k->get_keycode() == Key::SHIFT || k->get_keycode() == Key::META) { return; } @@ -528,7 +530,7 @@ void CodeEdit::gui_input(const Ref<InputEvent> &p_gui_input) { /* General overrides */ Control::CursorShape CodeEdit::get_cursor_shape(const Point2 &p_pos) const { - if (symbol_lookup_word != String()) { + if (!symbol_lookup_word.is_empty()) { return CURSOR_POINTING_HAND; } @@ -536,11 +538,11 @@ Control::CursorShape CodeEdit::get_cursor_shape(const Point2 &p_pos) const { return CURSOR_ARROW; } - Point2i pos = get_line_column_at_pos(p_pos); + Point2i pos = get_line_column_at_pos(p_pos, false); int line = pos.y; int col = pos.x; - if (is_line_folded(line)) { + if (line != -1 && is_line_folded(line)) { int wrap_index = get_line_wrap_index_at_column(line, col); if (wrap_index == get_line_wrap_count(line)) { int eol_icon_width = folded_eol_icon->get_width(); @@ -1146,7 +1148,7 @@ bool CodeEdit::is_drawing_executing_lines_gutter() const { } void CodeEdit::_main_gutter_draw_callback(int p_line, int p_gutter, const Rect2 &p_region) { - if (draw_breakpoints) { + if (draw_breakpoints && breakpoint_icon.is_valid()) { bool hovering = p_region.has_point(get_local_mouse_pos()); bool breakpointed = is_line_breakpointed(p_line); @@ -1162,7 +1164,7 @@ void CodeEdit::_main_gutter_draw_callback(int p_line, int p_gutter, const Rect2 } } - if (draw_bookmarks && is_line_bookmarked(p_line)) { + if (draw_bookmarks && is_line_bookmarked(p_line) && bookmark_icon.is_valid()) { int horizontal_padding = p_region.size.x / 2; int vertical_padding = p_region.size.y / 4; @@ -1172,7 +1174,7 @@ void CodeEdit::_main_gutter_draw_callback(int p_line, int p_gutter, const Rect2 bookmark_icon->draw_rect(get_canvas_item(), bookmark_region, false, bookmark_color); } - if (draw_executing_lines && is_line_executing(p_line)) { + if (draw_executing_lines && is_line_executing(p_line) && executing_line_icon.is_valid()) { int horizontal_padding = p_region.size.x / 10; int vertical_padding = p_region.size.y / 4; @@ -1417,40 +1419,23 @@ void CodeEdit::fold_line(int p_line) { /* End line is the same therefore we have a block of single line delimiters. */ if (end_line == p_line) { for (int i = p_line + 1; i <= line_count; i++) { - if (i == line_count) { - end_line = line_count; - break; - } - if ((in_string != -1 && is_in_string(i) == -1) || (in_comment != -1 && is_in_comment(i) == -1)) { - end_line = i - 1; break; } + end_line = i; } } } else { int start_indent = get_indent_level(p_line); for (int i = p_line + 1; i <= line_count; i++) { - if (get_line(p_line).strip_edges().size() == 0 || is_in_string(i) != -1 || is_in_comment(i) != -1) { - end_line = i; + if (get_line(i).strip_edges().size() == 0) { continue; } - - if (i == line_count) { - /* Do not fold empty last line of script if any */ + if (get_indent_level(i) > start_indent) { end_line = i; - if (get_line(i).strip_edges().size() == 0) { - end_line--; - } - break; + continue; } - - if ((get_indent_level(i) <= start_indent && get_line(i).strip_edges().size() != 0)) { - /* Keep an empty line unfolded if any */ - end_line = i - 1; - if (get_line(i - 1).strip_edges().size() == 0 && i - 2 > p_line) { - end_line = i - 2; - } + if (is_in_string(i) == -1 && is_in_comment(i) == -1) { break; } } @@ -2016,10 +2001,14 @@ bool CodeEdit::is_symbol_lookup_on_click_enabled() const { String CodeEdit::get_text_for_symbol_lookup() { Point2i mp = get_local_mouse_pos(); - Point2i pos = get_line_column_at_pos(mp); + Point2i pos = get_line_column_at_pos(mp, false); int line = pos.y; int col = pos.x; + if (line == -1) { + return String(); + } + StringBuilder lookup_text; const int text_size = get_line_count(); for (int i = 0; i < text_size; i++) { @@ -2389,7 +2378,7 @@ void CodeEdit::_update_delimiter_cache(int p_from_line, int p_to_line) { if (start_line != end_line) { if (p_to_line < p_from_line) { for (int i = end_line; i > start_line; i--) { - delimiter_cache.remove(i); + delimiter_cache.remove_at(i); } } else { for (int i = start_line; i < end_line; i++) { @@ -2608,7 +2597,7 @@ void CodeEdit::_add_delimiter(const String &p_start_key, const String &p_end_key delimiter.type = p_type; delimiter.start_key = p_start_key; delimiter.end_key = p_end_key; - delimiter.line_only = p_line_only || p_end_key == ""; + delimiter.line_only = p_line_only || p_end_key.is_empty(); delimiters.insert(at, delimiter); if (!setting_delimiters) { delimiter_cache.clear(); @@ -2626,7 +2615,7 @@ void CodeEdit::_remove_delimiter(const String &p_start_key, DelimiterType p_type break; } - delimiters.remove(i); + delimiters.remove_at(i); if (!setting_delimiters) { delimiter_cache.clear(); _update_delimiter_cache(); @@ -2658,7 +2647,7 @@ void CodeEdit::_set_delimiters(const TypedArray<String> &p_delimiters, Delimiter const String start_key = key.get_slice(" ", 0); const String end_key = key.get_slice_count(" ") > 1 ? key.get_slice(" ", 1) : String(); - _add_delimiter(start_key, end_key, end_key == "", p_type); + _add_delimiter(start_key, end_key, end_key.is_empty(), p_type); } setting_delimiters = false; _update_delimiter_cache(); @@ -2667,7 +2656,7 @@ void CodeEdit::_set_delimiters(const TypedArray<String> &p_delimiters, Delimiter void CodeEdit::_clear_delimiters(DelimiterType p_type) { for (int i = delimiters.size() - 1; i >= 0; i--) { if (delimiters[i].type == p_type) { - delimiters.remove(i); + delimiters.remove_at(i); } } delimiter_cache.clear(); diff --git a/scene/gui/color_picker.cpp b/scene/gui/color_picker.cpp index 894175d559..63ffe7bf95 100644 --- a/scene/gui/color_picker.cpp +++ b/scene/gui/color_picker.cpp @@ -582,7 +582,7 @@ void ColorPicker::_update_text_value() { void ColorPicker::_sample_input(const Ref<InputEvent> &p_event) { const Ref<InputEventMouseButton> mb = p_event; - if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { const Rect2 rect_old = Rect2(Point2(), Size2(sample->get_size().width * 0.5, sample->get_size().height * 0.95)); if (rect_old.has_point(mb->get_position())) { // Revert to the old color when left-clicking the old color sample. @@ -827,13 +827,13 @@ void ColorPicker::_uv_input(const Ref<InputEvent> &p_event, Control *c) { Ref<InputEventMouseButton> bev = p_event; if (bev.is_valid()) { - if (bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_LEFT) { + if (bev->is_pressed() && bev->get_button_index() == MouseButton::LEFT) { Vector2 center = c->get_size() / 2.0; if (picker_type == SHAPE_VHS_CIRCLE) { real_t dist = center.distance_to(bev->get_position()); if (dist <= center.x) { - real_t rad = bev->get_position().angle_to_point(center); + real_t rad = center.angle_to_point(bev->get_position()); h = ((rad >= 0) ? rad : (Math_TAU + rad)) / Math_TAU; s = CLAMP(dist / center.x, 0, 1); } else { @@ -850,7 +850,7 @@ void ColorPicker::_uv_input(const Ref<InputEvent> &p_event, Control *c) { real_t dist = center.distance_to(bev->get_position()); if (dist >= center.x * 0.84 && dist <= center.x) { - real_t rad = bev->get_position().angle_to_point(center); + real_t rad = center.angle_to_point(bev->get_position()); h = ((rad >= 0) ? rad : (Math_TAU + rad)) / Math_TAU; spinning = true; } else { @@ -875,7 +875,7 @@ void ColorPicker::_uv_input(const Ref<InputEvent> &p_event, Control *c) { if (!deferred_mode_enabled) { emit_signal(SNAME("color_changed"), color); } - } else if (deferred_mode_enabled && !bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_LEFT) { + } else if (deferred_mode_enabled && !bev->is_pressed() && bev->get_button_index() == MouseButton::LEFT) { emit_signal(SNAME("color_changed"), color); changing_color = false; spinning = false; @@ -895,12 +895,12 @@ void ColorPicker::_uv_input(const Ref<InputEvent> &p_event, Control *c) { Vector2 center = c->get_size() / 2.0; if (picker_type == SHAPE_VHS_CIRCLE) { real_t dist = center.distance_to(mev->get_position()); - real_t rad = mev->get_position().angle_to_point(center); + real_t rad = center.angle_to_point(mev->get_position()); h = ((rad >= 0) ? rad : (Math_TAU + rad)) / Math_TAU; s = CLAMP(dist / center.x, 0, 1); } else { if (spinning) { - real_t rad = mev->get_position().angle_to_point(center); + real_t rad = center.angle_to_point(mev->get_position()); h = ((rad >= 0) ? rad : (Math_TAU + rad)) / Math_TAU; } else { real_t corner_x = (c == wheel_uv) ? center.x - Math_SQRT12 * c->get_size().width * 0.42 : 0; @@ -929,7 +929,7 @@ void ColorPicker::_w_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> bev = p_event; if (bev.is_valid()) { - if (bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_LEFT) { + if (bev->is_pressed() && bev->get_button_index() == MouseButton::LEFT) { changing_color = true; float y = CLAMP((float)bev->get_position().y, 0, w_edit->get_size().height); if (picker_type == SHAPE_VHS_CIRCLE) { @@ -946,7 +946,7 @@ void ColorPicker::_w_input(const Ref<InputEvent> &p_event) { _update_color(); if (!deferred_mode_enabled) { emit_signal(SNAME("color_changed"), color); - } else if (!bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_LEFT) { + } else if (!bev->is_pressed() && bev->get_button_index() == MouseButton::LEFT) { emit_signal(SNAME("color_changed"), color); } } @@ -977,11 +977,11 @@ void ColorPicker::_preset_input(const Ref<InputEvent> &p_event, const Color &p_c Ref<InputEventMouseButton> bev = p_event; if (bev.is_valid()) { - if (bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_LEFT) { + if (bev->is_pressed() && bev->get_button_index() == MouseButton::LEFT) { set_pick_color(p_color); _update_color(); emit_signal(SNAME("color_changed"), p_color); - } else if (bev->is_pressed() && bev->get_button_index() == MOUSE_BUTTON_RIGHT && presets_enabled) { + } else if (bev->is_pressed() && bev->get_button_index() == MouseButton::RIGHT && presets_enabled) { erase_preset(p_color); emit_signal(SNAME("preset_removed"), p_color); } @@ -994,7 +994,7 @@ void ColorPicker::_screen_input(const Ref<InputEvent> &p_event) { } Ref<InputEventMouseButton> bev = p_event; - if (bev.is_valid() && bev->get_button_index() == MOUSE_BUTTON_LEFT && !bev->is_pressed()) { + if (bev.is_valid() && bev->get_button_index() == MouseButton::LEFT && !bev->is_pressed()) { emit_signal(SNAME("color_changed"), color); screen->hide(); } @@ -1274,7 +1274,7 @@ ColorPicker::ColorPicker() : preset_container->set_columns(preset_column_count); add_child(preset_container, false, INTERNAL_MODE_FRONT); - btn_add_preset->set_icon_align(Button::ALIGN_CENTER); + btn_add_preset->set_icon_alignment(HORIZONTAL_ALIGNMENT_CENTER); btn_add_preset->set_tooltip(RTR("Add current color as a preset.")); btn_add_preset->connect("pressed", callable_mp(this, &ColorPicker::_add_preset_pressed)); preset_container->add_child(btn_add_preset); diff --git a/scene/gui/container.cpp b/scene/gui/container.cpp index a1bd82f6f7..81afa53d85 100644 --- a/scene/gui/container.cpp +++ b/scene/gui/container.cpp @@ -35,7 +35,7 @@ void Container::_child_minsize_changed() { //Size2 ms = get_combined_minimum_size(); //if (ms.width > get_size().width || ms.height > get_size().height) { - minimum_size_changed(); + update_minimum_size(); queue_sort(); } @@ -51,7 +51,7 @@ void Container::add_child_notify(Node *p_child) { control->connect(SNAME("minimum_size_changed"), callable_mp(this, &Container::_child_minsize_changed)); control->connect(SNAME("visibility_changed"), callable_mp(this, &Container::_child_minsize_changed)); - minimum_size_changed(); + update_minimum_size(); queue_sort(); } @@ -62,7 +62,7 @@ void Container::move_child_notify(Node *p_child) { return; } - minimum_size_changed(); + update_minimum_size(); queue_sort(); } @@ -78,7 +78,7 @@ void Container::remove_child_notify(Node *p_child) { control->disconnect("minimum_size_changed", callable_mp(this, &Container::_child_minsize_changed)); control->disconnect("visibility_changed", callable_mp(this, &Container::_child_minsize_changed)); - minimum_size_changed(); + update_minimum_size(); queue_sort(); } diff --git a/scene/gui/control.cpp b/scene/gui/control.cpp index 38da40a402..1fdc30eb6d 100644 --- a/scene/gui/control.cpp +++ b/scene/gui/control.cpp @@ -73,8 +73,8 @@ Dictionary Control::_edit_get_state() const { void Control::_edit_set_state(const Dictionary &p_state) { ERR_FAIL_COND((p_state.size() <= 0) || - !p_state.has("rotation") || !p_state.has("scale") || - !p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets")); + !p_state.has("rotation") || !p_state.has("scale") || + !p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets")); Dictionary state = p_state; set_rotation(state["rotation"]); @@ -192,7 +192,7 @@ void Control::set_custom_minimum_size(const Size2 &p_custom) { return; } data.custom_minimum_size = p_custom; - minimum_size_changed(); + update_minimum_size(); } Size2 Control::get_custom_minimum_size() const { @@ -213,7 +213,7 @@ void Control::_update_minimum_size_cache() { data.minimum_size_valid = true; if (size_changed) { - minimum_size_changed(); + update_minimum_size(); } } @@ -400,7 +400,7 @@ void Control::_get_property_list(List<PropertyInfo> *p_list) const { usage |= PROPERTY_USAGE_STORAGE | PROPERTY_USAGE_CHECKED; } - p_list->push_back(PropertyInfo(Variant::INT, "theme_override_font_sizes/" + E, PROPERTY_HINT_NONE, "", usage)); + p_list->push_back(PropertyInfo(Variant::INT, "theme_override_font_sizes/" + E, PROPERTY_HINT_RANGE, "1,256,1,or_greater", usage)); } } { @@ -637,7 +637,9 @@ void Control::_notification(int p_notification) { } } else { //is a regular root control or top_level - data.RI = get_viewport()->_gui_add_root_control(this); + Viewport *viewport = get_viewport(); + ERR_FAIL_COND(!viewport); + data.RI = viewport->_gui_add_root_control(this); } data.parent_canvas_item = get_parent_item(); @@ -646,7 +648,9 @@ void Control::_notification(int p_notification) { data.parent_canvas_item->connect("item_rect_changed", callable_mp(this, &Control::_size_changed)); } else { //connect viewport - get_viewport()->connect("size_changed", callable_mp(this, &Control::_size_changed)); + Viewport *viewport = get_viewport(); + ERR_FAIL_COND(!viewport); + viewport->connect("size_changed", callable_mp(this, &Control::_size_changed)); } } break; case NOTIFICATION_EXIT_CANVAS: { @@ -655,7 +659,9 @@ void Control::_notification(int p_notification) { data.parent_canvas_item = nullptr; } else if (!is_set_as_top_level()) { //disconnect viewport - get_viewport()->disconnect("size_changed", callable_mp(this, &Control::_size_changed)); + Viewport *viewport = get_viewport(); + ERR_FAIL_COND(!viewport); + viewport->disconnect("size_changed", callable_mp(this, &Control::_size_changed)); } if (data.RI) { @@ -707,7 +713,7 @@ void Control::_notification(int p_notification) { update(); } break; case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_VISIBILITY_CHANGED: { @@ -740,7 +746,7 @@ bool Control::has_point(const Point2 &p_point) const { return Rect2(Point2(), get_size()).has_point(p_point); } -void Control::set_drag_forwarding(Node *p_target) { +void Control::set_drag_forwarding(Object *p_target) { if (p_target) { data.drag_owner = p_target->get_instance_id(); } else { @@ -804,6 +810,10 @@ void Control::set_drag_preview(Control *p_control) { get_viewport()->_gui_set_drag_preview(this, p_control); } +bool Control::is_drag_successful() const { + return is_inside_tree() && get_viewport()->gui_is_drag_successful(); +} + void Control::_call_gui_input(const Ref<InputEvent> &p_event) { emit_signal(SceneStringNames::get_singleton()->gui_input, p_event); //signal should be first, so it's possible to override an event (and then accept it) if (!is_inside_tree() || get_viewport()->is_input_handled()) { @@ -979,7 +989,7 @@ Ref<StyleBox> Control::get_theme_stylebox(const StringName &p_name, const String Ref<Font> Control::get_theme_font(const StringName &p_name, const StringName &p_theme_type) const { if (p_theme_type == StringName() || p_theme_type == get_class_name() || p_theme_type == data.theme_type_variation) { const Ref<Font> *font = data.font_override.getptr(p_name); - if (font) { + if (font && (*font)->get_data_count() > 0) { return *font; } } @@ -992,7 +1002,7 @@ Ref<Font> Control::get_theme_font(const StringName &p_name, const StringName &p_ int Control::get_theme_font_size(const StringName &p_name, const StringName &p_theme_type) const { if (p_theme_type == StringName() || p_theme_type == get_class_name() || p_theme_type == data.theme_type_variation) { const int *font_size = data.font_size_override.getptr(p_name); - if (font_size) { + if (font_size && (*font_size) > 0) { return *font_size; } } @@ -1815,6 +1825,10 @@ Size2 Control::get_size() const { return data.size_cache; } +void Control::reset_size() { + set_size(Size2()); +} + Rect2 Control::get_global_rect() const { return Rect2(get_global_position(), get_size()); } @@ -2520,7 +2534,7 @@ void Control::grab_click_focus() { get_viewport()->_gui_grab_click_focus(this); } -void Control::minimum_size_changed() { +void Control::update_minimum_size() { if (!is_inside_tree() || data.block_minimum_size_adjust) { return; } @@ -2580,20 +2594,10 @@ void Control::warp_mouse(const Point2 &p_to_pos) { } bool Control::is_text_field() const { - /* - if (get_script_instance()) { - Variant v=p_point; - const Variant *p[2]={&v,&p_data}; - Callable::CallError ce; - Variant ret = get_script_instance()->call("is_text_field",p,2,ce); - if (ce.error==Callable::CallError::CALL_OK) - return ret; - } - */ return false; } -Array Control::structured_text_parser(StructuredTextParser p_theme_type, const Array &p_args, const String p_text) const { +Array Control::structured_text_parser(StructuredTextParser p_theme_type, const Array &p_args, const String &p_text) const { Array ret; switch (p_theme_type) { case STRUCTURED_TEXT_URI: { @@ -2692,7 +2696,7 @@ real_t Control::get_rotation() const { void Control::_override_changed() { notification(NOTIFICATION_THEME_CHANGED); emit_signal(SceneStringNames::get_singleton()->theme_changed); - minimum_size_changed(); // overrides are likely to affect minimum size + update_minimum_size(); // Overrides are likely to affect minimum size. } void Control::set_pivot_offset(const Vector2 &p_pivot) { @@ -2787,7 +2791,7 @@ void Control::get_argument_options(const StringName &p_function, int p_idx, List TypedArray<String> Control::get_configuration_warnings() const { TypedArray<String> warnings = Node::get_configuration_warnings(); - if (data.mouse_filter == MOUSE_FILTER_IGNORE && data.tooltip != "") { + if (data.mouse_filter == MOUSE_FILTER_IGNORE && !data.tooltip.is_empty()) { warnings.push_back(TTR("The Hint Tooltip won't be displayed as the control's Mouse Filter is set to \"Ignore\". To solve this, set the Mouse Filter to \"Stop\" or \"Pass\".")); } @@ -2845,6 +2849,7 @@ void Control::_bind_methods() { ClassDB::bind_method(D_METHOD("set_position", "position", "keep_offsets"), &Control::set_position, DEFVAL(false)); ClassDB::bind_method(D_METHOD("_set_position", "position"), &Control::_set_position); ClassDB::bind_method(D_METHOD("set_size", "size", "keep_offsets"), &Control::set_size, DEFVAL(false)); + ClassDB::bind_method(D_METHOD("reset_size"), &Control::reset_size); ClassDB::bind_method(D_METHOD("_set_size", "size"), &Control::_set_size); ClassDB::bind_method(D_METHOD("set_custom_minimum_size", "size"), &Control::set_custom_minimum_size); ClassDB::bind_method(D_METHOD("set_global_position", "position", "keep_offsets"), &Control::set_global_position, DEFVAL(false)); @@ -2968,10 +2973,11 @@ void Control::_bind_methods() { ClassDB::bind_method(D_METHOD("set_drag_forwarding", "target"), &Control::set_drag_forwarding); ClassDB::bind_method(D_METHOD("set_drag_preview", "control"), &Control::set_drag_preview); + ClassDB::bind_method(D_METHOD("is_drag_successful"), &Control::is_drag_successful); ClassDB::bind_method(D_METHOD("warp_mouse", "to_position"), &Control::warp_mouse); - ClassDB::bind_method(D_METHOD("minimum_size_changed"), &Control::minimum_size_changed); + ClassDB::bind_method(D_METHOD("update_minimum_size"), &Control::update_minimum_size); ClassDB::bind_method(D_METHOD("set_layout_direction", "direction"), &Control::set_layout_direction); ClassDB::bind_method(D_METHOD("get_layout_direction"), &Control::get_layout_direction); diff --git a/scene/gui/control.h b/scene/gui/control.h index be692b6a0c..ae9ca1489a 100644 --- a/scene/gui/control.h +++ b/scene/gui/control.h @@ -233,9 +233,6 @@ private: static constexpr unsigned properties_managed_by_container_count = 11; static String properties_managed_by_container[properties_managed_by_container_count]; - // used internally - Control *_find_control_at_pos(CanvasItem *p_node, const Point2 &p_pos, const Transform2D &p_xform, Transform2D &r_inv_xform); - void _window_find_focus_neighbor(const Vector2 &p_dir, Node *p_at, const Point2 *p_points, real_t p_min, real_t &r_closest_dist, Control **r_closest); Control *_get_focus_neighbor(Side p_side, int p_count = 0); @@ -250,7 +247,6 @@ private: void _update_minimum_size(); void _clear_size_warning(); - void _update_scroll(); void _compute_offsets(Rect2 p_rect, const real_t p_anchors[4], real_t (&r_offsets)[4]); void _compute_anchors(Rect2 p_rect, const real_t p_offsets[4], real_t (&r_anchors)[4]); @@ -283,7 +279,7 @@ protected: //virtual void _window_gui_input(InputEvent p_event); - virtual Array structured_text_parser(StructuredTextParser p_theme_type, const Array &p_args, const String p_text) const; + virtual Array structured_text_parser(StructuredTextParser p_theme_type, const Array &p_args, const String &p_text) const; bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; @@ -355,12 +351,13 @@ public: virtual Size2 get_minimum_size() const; virtual Size2 get_combined_minimum_size() const; virtual bool has_point(const Point2 &p_point) const; - virtual void set_drag_forwarding(Node *p_target); + virtual void set_drag_forwarding(Object *p_target); virtual Variant get_drag_data(const Point2 &p_point); virtual bool can_drop_data(const Point2 &p_point, const Variant &p_data) const; virtual void drop_data(const Point2 &p_point, const Variant &p_data); void set_drag_preview(Control *p_control); void force_drag(const Variant &p_data, Control *p_control); + bool is_drag_successful() const; void set_custom_minimum_size(const Size2 &p_custom); Size2 get_custom_minimum_size() const; @@ -404,6 +401,7 @@ public: void set_size(const Size2 &p_size, bool p_keep_offsets = false); Size2 get_size() const; + void reset_size(); Rect2 get_rect() const; Rect2 get_global_rect() const; @@ -443,7 +441,7 @@ public: void set_stretch_ratio(real_t p_ratio); real_t get_stretch_ratio() const; - void minimum_size_changed(); + void update_minimum_size(); /* FOCUS */ diff --git a/scene/gui/dialogs.cpp b/scene/gui/dialogs.cpp index 71d2778cc3..f1725e57ea 100644 --- a/scene/gui/dialogs.cpp +++ b/scene/gui/dialogs.cpp @@ -44,7 +44,7 @@ void AcceptDialog::_input_from_window(const Ref<InputEvent> &p_event) { Ref<InputEventKey> key = p_event; - if (key.is_valid() && key->is_pressed() && key->get_keycode() == KEY_ESCAPE) { + if (key.is_valid() && key->is_pressed() && key->get_keycode() == Key::ESCAPE) { _cancel_pressed(); } } @@ -242,7 +242,7 @@ Button *AcceptDialog::add_button(const String &p_text, bool p_right, const Strin hbc->add_spacer(true); } - if (p_action != "") { + if (!p_action.is_empty()) { button->connect("pressed", callable_mp(this, &AcceptDialog::_custom_action), varray(p_action)); } @@ -251,7 +251,7 @@ Button *AcceptDialog::add_button(const String &p_text, bool p_right, const Strin Button *AcceptDialog::add_cancel_button(const String &p_cancel) { String c = p_cancel; - if (p_cancel == "") { + if (p_cancel.is_empty()) { c = TTRC("Cancel"); } Button *b = swap_cancel_ok ? add_button(c, true) : add_button(c); diff --git a/scene/gui/file_dialog.cpp b/scene/gui/file_dialog.cpp index 973b72973d..08d5df3db8 100644 --- a/scene/gui/file_dialog.cpp +++ b/scene/gui/file_dialog.cpp @@ -51,26 +51,32 @@ VBoxContainer *FileDialog::get_vbox() { void FileDialog::_theme_changed() { Color font_color = vbox->get_theme_color(SNAME("font_color"), SNAME("Button")); Color font_hover_color = vbox->get_theme_color(SNAME("font_hover_color"), SNAME("Button")); + Color font_focus_color = vbox->get_theme_color(SNAME("font_focus_color"), SNAME("Button")); Color font_pressed_color = vbox->get_theme_color(SNAME("font_pressed_color"), SNAME("Button")); dir_up->add_theme_color_override("icon_normal_color", font_color); dir_up->add_theme_color_override("icon_hover_color", font_hover_color); + dir_up->add_theme_color_override("icon_focus_color", font_focus_color); dir_up->add_theme_color_override("icon_pressed_color", font_pressed_color); dir_prev->add_theme_color_override("icon_color_normal", font_color); dir_prev->add_theme_color_override("icon_color_hover", font_hover_color); + dir_prev->add_theme_color_override("icon_focus_color", font_focus_color); dir_prev->add_theme_color_override("icon_color_pressed", font_pressed_color); dir_next->add_theme_color_override("icon_color_normal", font_color); dir_next->add_theme_color_override("icon_color_hover", font_hover_color); + dir_next->add_theme_color_override("icon_focus_color", font_focus_color); dir_next->add_theme_color_override("icon_color_pressed", font_pressed_color); refresh->add_theme_color_override("icon_normal_color", font_color); refresh->add_theme_color_override("icon_hover_color", font_hover_color); + refresh->add_theme_color_override("icon_focus_color", font_focus_color); refresh->add_theme_color_override("icon_pressed_color", font_pressed_color); show_hidden->add_theme_color_override("icon_normal_color", font_color); show_hidden->add_theme_color_override("icon_hover_color", font_hover_color); + show_hidden->add_theme_color_override("icon_focus_color", font_focus_color); show_hidden->add_theme_color_override("icon_pressed_color", font_pressed_color); } @@ -104,7 +110,7 @@ void FileDialog::unhandled_input(const Ref<InputEvent> &p_event) { bool handled = true; switch (k->get_keycode()) { - case KEY_H: { + case Key::H: { if (k->is_command_pressed()) { set_show_hidden_files(!show_hidden_files); } else { @@ -112,10 +118,10 @@ void FileDialog::unhandled_input(const Ref<InputEvent> &p_event) { } } break; - case KEY_F5: { + case Key::F5: { invalidate(); } break; - case KEY_BACKSPACE: { + case Key::BACKSPACE: { _dir_submitted(".."); } break; default: { @@ -342,7 +348,7 @@ bool FileDialog::_is_open_should_be_disabled() { // Opening a file, but selected a folder? Forbidden. return ((mode == FILE_MODE_OPEN_FILE || mode == FILE_MODE_OPEN_FILES) && d["dir"]) || // Flipped case, also forbidden. - (mode == FILE_MODE_OPEN_DIR && !d["dir"]); + (mode == FILE_MODE_OPEN_DIR && !d["dir"]); } void FileDialog::_go_up() { @@ -467,6 +473,13 @@ void FileDialog::update_file_list() { dir_access->list_dir_begin(); + if (dir_access->is_readable(dir_access->get_current_dir().utf8().get_data())) { + message->hide(); + } else { + message->set_text(TTRC("You don't have permission to access contents of this folder.")); + message->show(); + } + TreeItem *root = tree->create_item(); Ref<Texture2D> folder = vbox->get_theme_icon(SNAME("folder"), SNAME("FileDialog")); Ref<Texture2D> file_icon = vbox->get_theme_icon(SNAME("file"), SNAME("FileDialog")); @@ -476,17 +489,11 @@ void FileDialog::update_file_list() { List<String> dirs; bool is_hidden; - String item; - - if (dir_access->is_readable(dir_access->get_current_dir().utf8().get_data())) { - message->hide(); - } else { - message->set_text(TTRC("You don't have permission to access contents of this folder.")); - message->show(); - } + String item = dir_access->get_next(); - while ((item = dir_access->get_next()) != "") { + while (!item.is_empty()) { if (item == "." || item == "..") { + item = dir_access->get_next(); continue; } @@ -499,6 +506,7 @@ void FileDialog::update_file_list() { dirs.push_back(item); } } + item = dir_access->get_next(); } dirs.sort_custom<NaturalNoCaseComparator>(); @@ -992,8 +1000,8 @@ FileDialog::FileDialog() { message = memnew(Label); message->hide(); message->set_anchors_and_offsets_preset(Control::PRESET_WIDE); - message->set_align(Label::ALIGN_CENTER); - message->set_valign(Label::VALIGN_CENTER); + message->set_horizontal_alignment(HORIZONTAL_ALIGNMENT_CENTER); + message->set_vertical_alignment(VERTICAL_ALIGNMENT_CENTER); tree->add_child(message); file_box = memnew(HBoxContainer); diff --git a/scene/gui/gradient_edit.cpp b/scene/gui/gradient_edit.cpp index 5d024d3be7..1210be15ce 100644 --- a/scene/gui/gradient_edit.cpp +++ b/scene/gui/gradient_edit.cpp @@ -39,6 +39,10 @@ GradientEdit::GradientEdit() { picker = memnew(ColorPicker); popup->add_child(picker); + gradient_cache.instantiate(); + preview_texture.instantiate(); + + preview_texture->set_width(1024); add_child(popup, false, INTERNAL_MODE_FRONT); } @@ -47,7 +51,7 @@ int GradientEdit::_get_point_from_pos(int x) { int total_w = get_size().width - get_size().height - draw_spacing; float min_distance = 1e20; for (int i = 0; i < points.size(); i++) { - //Check if we clicked at point + // Check if we clicked at point. float distance = ABS(x - points[i].offset * total_w); float min = (draw_point_width / 2 * 1.7); //make it easier to grab if (distance <= min && distance < min_distance) { @@ -84,8 +88,8 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventKey> k = p_event; - if (k.is_valid() && k->is_pressed() && k->get_keycode() == KEY_DELETE && grabbed != -1) { - points.remove(grabbed); + if (k.is_valid() && k->is_pressed() && k->get_keycode() == Key::KEY_DELETE && grabbed != -1) { + points.remove_at(grabbed); grabbed = -1; grabbing = false; update(); @@ -94,18 +98,18 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { } Ref<InputEventMouseButton> mb = p_event; - //Show color picker on double click. - if (mb.is_valid() && mb->get_button_index() == 1 && mb->is_double_click() && mb->is_pressed()) { + // Show color picker on double click. + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_double_click() && mb->is_pressed()) { grabbed = _get_point_from_pos(mb->get_position().x); _show_color_picker(); accept_event(); } - //Delete point on right click - if (mb.is_valid() && mb->get_button_index() == 2 && mb->is_pressed()) { + // Delete point on right click. + if (mb.is_valid() && mb->get_button_index() == MouseButton::RIGHT && mb->is_pressed()) { grabbed = _get_point_from_pos(mb->get_position().x); if (grabbed != -1) { - points.remove(grabbed); + points.remove_at(grabbed); grabbed = -1; grabbing = false; update(); @@ -114,20 +118,20 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { } } - //Hold alt key to duplicate selected color - if (mb.is_valid() && mb->get_button_index() == 1 && mb->is_pressed() && mb->is_alt_pressed()) { + // Hold alt key to duplicate selected color. + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_pressed() && mb->is_alt_pressed()) { int x = mb->get_position().x; grabbed = _get_point_from_pos(x); if (grabbed != -1) { int total_w = get_size().width - get_size().height - draw_spacing; - Gradient::Point newPoint = points[grabbed]; - newPoint.offset = CLAMP(x / float(total_w), 0, 1); + Gradient::Point new_point = points[grabbed]; + new_point.offset = CLAMP(x / float(total_w), 0, 1); - points.push_back(newPoint); + points.push_back(new_point); points.sort(); for (int i = 0; i < points.size(); ++i) { - if (points[i].offset == newPoint.offset) { + if (points[i].offset == new_point.offset) { grabbed = i; break; } @@ -138,8 +142,8 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { } } - //select - if (mb.is_valid() && mb->get_button_index() == 1 && mb->is_pressed()) { + // Select. + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_pressed()) { update(); int x = mb->get_position().x; int total_w = get_size().width - get_size().height - draw_spacing; @@ -158,16 +162,16 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { return; } - //insert - Gradient::Point newPoint; - newPoint.offset = CLAMP(x / float(total_w), 0, 1); + // Insert point. + Gradient::Point new_point; + new_point.offset = CLAMP(x / float(total_w), 0, 1); Gradient::Point prev; Gradient::Point next; int pos = -1; for (int i = 0; i < points.size(); i++) { - if (points[i].offset < newPoint.offset) { + if (points[i].offset < new_point.offset) { pos = i; } } @@ -191,12 +195,12 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { prev = points[pos]; } - newPoint.color = prev.color.lerp(next.color, (newPoint.offset - prev.offset) / (next.offset - prev.offset)); + new_point.color = prev.color.lerp(next.color, (new_point.offset - prev.offset) / (next.offset - prev.offset)); - points.push_back(newPoint); + points.push_back(new_point); points.sort(); for (int i = 0; i < points.size(); i++) { - if (points[i].offset == newPoint.offset) { + if (points[i].offset == new_point.offset) { grabbed = i; break; } @@ -205,7 +209,7 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { emit_signal(SNAME("ramp_changed")); } - if (mb.is_valid() && mb->get_button_index() == 1 && !mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && !mb->is_pressed()) { if (grabbing) { grabbing = false; emit_signal(SNAME("ramp_changed")); @@ -223,7 +227,7 @@ void GradientEdit::gui_input(const Ref<InputEvent> &p_event) { float newofs = CLAMP(x / float(total_w), 0, 1); // Snap to "round" coordinates if holding Ctrl. - // Be more precise if holding Shift as well + // Be more precise if holding Shift as well. if (mm->is_ctrl_pressed()) { newofs = Math::snapped(newofs, mm->is_shift_pressed() ? 0.025 : 0.1); } else if (mm->is_shift_pressed()) { @@ -299,57 +303,22 @@ void GradientEdit::_notification(int p_what) { int h = get_size().y; if (w == 0 || h == 0) { - return; //Safety check. We have division by 'h'. And in any case there is nothing to draw with such size + return; // Safety check. We have division by 'h'. And in any case there is nothing to draw with such size. } int total_w = get_size().width - get_size().height - draw_spacing; - //Draw checker pattern for ramp + // Draw checker pattern for ramp. draw_texture_rect(get_theme_icon(SNAME("GuiMiniCheckerboard"), SNAME("EditorIcons")), Rect2(0, 0, total_w, h), true); - //Draw color ramp - Gradient::Point prev; - prev.offset = 0; - if (points.size() == 0) { - prev.color = Color(0, 0, 0); //Draw black rectangle if we have no points - } else { - prev.color = points[0].color; //Extend color of first point to the beginning. - } + // Draw color ramp. - for (int i = -1; i < points.size(); i++) { - Gradient::Point next; - //If there is no next point - if (i + 1 == points.size()) { - if (points.size() == 0) { - next.color = Color(0, 0, 0); //Draw black rectangle if we have no points - } else { - next.color = points[i].color; //Extend color of last point to the end. - } - next.offset = 1; - } else { - next = points[i + 1]; - } + gradient_cache->set_points(points); + gradient_cache->set_interpolation_mode(interpolation_mode); + preview_texture->set_gradient(gradient_cache); + draw_texture_rect(preview_texture, Rect2(0, 0, total_w, h)); - if (prev.offset == next.offset) { - prev = next; - continue; - } - - Vector<Vector2> points; - Vector<Color> colors; - points.push_back(Vector2(prev.offset * total_w, h)); - points.push_back(Vector2(prev.offset * total_w, 0)); - points.push_back(Vector2(next.offset * total_w, 0)); - points.push_back(Vector2(next.offset * total_w, h)); - colors.push_back(prev.color); - colors.push_back(prev.color); - colors.push_back(next.color); - colors.push_back(next.color); - draw_primitive(points, colors, Vector<Point2>()); - prev = next; - } - - //Draw point markers + // Draw point markers. for (int i = 0; i < points.size(); i++) { Color col = points[i].color.inverted(); col.a = 0.9; @@ -383,7 +352,7 @@ void GradientEdit::_notification(int p_what) { draw_line(Vector2(total_w + draw_spacing, h), Vector2(total_w + draw_spacing + h, 0), Color(1, 1, 1, 0.6)); } - //Draw borders around color ramp if in focus + // Draw borders around color ramp if in focus. if (has_focus()) { draw_line(Vector2(-1, -1), Vector2(total_w + 1, -1), Color(1, 1, 1, 0.6)); draw_line(Vector2(total_w + 1, -1), Vector2(total_w + 1, h + 1), Color(1, 1, 1, 0.6)); @@ -448,12 +417,21 @@ void GradientEdit::set_points(Vector<Gradient::Point> &p_points) { } points.clear(); points = p_points; + points.sort(); } Vector<Gradient::Point> &GradientEdit::get_points() { return points; } +void GradientEdit::set_interpolation_mode(Gradient::InterpolationMode p_interp_mode) { + interpolation_mode = p_interp_mode; +} + +Gradient::InterpolationMode GradientEdit::get_interpolation_mode() { + return interpolation_mode; +} + void GradientEdit::_bind_methods() { ADD_SIGNAL(MethodInfo("ramp_changed")); } diff --git a/scene/gui/gradient_edit.h b/scene/gui/gradient_edit.h index f3a39daaf6..66b60d87c7 100644 --- a/scene/gui/gradient_edit.h +++ b/scene/gui/gradient_edit.h @@ -45,6 +45,10 @@ class GradientEdit : public Control { bool grabbing = false; int grabbed = -1; Vector<Gradient::Point> points; + Gradient::InterpolationMode interpolation_mode = Gradient::GRADIENT_INTERPOLATE_LINEAR; + + Ref<Gradient> gradient_cache; + Ref<GradientTexture1D> preview_texture; // Make sure to use the scaled value below. const int BASE_SPACING = 3; @@ -69,6 +73,9 @@ public: Vector<Color> get_colors() const; void set_points(Vector<Gradient::Point> &p_points); Vector<Gradient::Point> &get_points(); + void set_interpolation_mode(Gradient::InterpolationMode p_interp_mode); + Gradient::InterpolationMode get_interpolation_mode(); + virtual Size2 get_minimum_size() const override; GradientEdit(); diff --git a/scene/gui/graph_edit.cpp b/scene/gui/graph_edit.cpp index 35e31be9af..32c62b7226 100644 --- a/scene/gui/graph_edit.cpp +++ b/scene/gui/graph_edit.cpp @@ -150,7 +150,7 @@ void GraphEditMinimap::gui_input(const Ref<InputEvent> &p_ev) { Ref<InputEventMouseButton> mb = p_ev; Ref<InputEventMouseMotion> mm = p_ev; - if (mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT) { if (mb->is_pressed()) { is_pressing = true; @@ -501,6 +501,43 @@ void GraphEdit::_notification(int p_what) { } } +void GraphEdit::_update_comment_enclosed_nodes_list(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes) { + Rect2 comment_node_rect = p_node->get_rect(); + Vector<GraphNode *> enclosed_nodes; + + for (int i = 0; i < get_child_count(); i++) { + GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); + if (!gn || gn->is_selected()) { + continue; + } + + Rect2 node_rect = gn->get_rect(); + bool included = comment_node_rect.encloses(node_rect); + if (included) { + enclosed_nodes.push_back(gn); + } + } + + p_comment_enclosed_nodes.set(p_node->get_name(), enclosed_nodes); +} + +void GraphEdit::_set_drag_comment_enclosed_nodes(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes, bool p_drag) { + for (int i = 0; i < p_comment_enclosed_nodes[p_node->get_name()].size(); i++) { + p_comment_enclosed_nodes[p_node->get_name()][i]->set_drag(p_drag); + } +} + +void GraphEdit::_set_position_of_comment_enclosed_nodes(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes, Vector2 p_drag_accum) { + for (int i = 0; i < p_comment_enclosed_nodes[p_node->get_name()].size(); i++) { + Vector2 pos = (p_comment_enclosed_nodes[p_node->get_name()][i]->get_drag_from() * zoom + drag_accum) / zoom; + if (is_using_snap() ^ Input::get_singleton()->is_key_pressed(Key::CTRL)) { + const int snap = get_snap(); + pos = pos.snapped(Vector2(snap, snap)); + } + p_comment_enclosed_nodes[p_node->get_name()][i]->set_position_offset(pos); + } +} + bool GraphEdit::_filter_input(const Point2 &p_point) { Ref<Texture2D> port = get_theme_icon(SNAME("port"), SNAME("GraphNode")); Vector2i port_size = Vector2i(port->get_width(), port->get_height()); @@ -531,7 +568,7 @@ bool GraphEdit::_filter_input(const Point2 &p_point) { void GraphEdit::_top_layer_input(const Ref<InputEvent> &p_ev) { Ref<InputEventMouseButton> mb = p_ev; - if (mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_LEFT && mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_pressed()) { Ref<Texture2D> port = get_theme_icon(SNAME("port"), SNAME("GraphNode")); Vector2i port_size = Vector2i(port->get_width(), port->get_height()); @@ -678,7 +715,7 @@ void GraphEdit::_top_layer_input(const Ref<InputEvent> &p_ev) { } } - if (mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_LEFT && !mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && !mb->is_pressed()) { if (connecting_valid) { if (connecting && connecting_target) { String from = connecting_from; @@ -1031,7 +1068,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { ERR_FAIL_COND(p_ev.is_null()); Ref<InputEventMouseMotion> mm = p_ev; - if (mm.is_valid() && (mm->get_button_mask() & MOUSE_BUTTON_MASK_MIDDLE || (mm->get_button_mask() & MOUSE_BUTTON_MASK_LEFT && Input::get_singleton()->is_key_pressed(KEY_SPACE)))) { + if (mm.is_valid() && ((mm->get_button_mask() & MouseButton::MASK_MIDDLE) != MouseButton::NONE || ((mm->get_button_mask() & MouseButton::MASK_LEFT) != MouseButton::NONE && Input::get_singleton()->is_key_pressed(Key::SPACE)))) { Vector2i relative = Input::get_singleton()->warp_mouse_motion(mm, get_global_rect()); h_scroll->set_value(h_scroll->get_value() - relative.x); v_scroll->set_value(v_scroll->get_value() - relative.y); @@ -1052,12 +1089,15 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { // Snapping can be toggled temporarily by holding down Ctrl. // This is done here as to not toggle the grid when holding down Ctrl. - if (is_using_snap() ^ Input::get_singleton()->is_key_pressed(KEY_CTRL)) { + if (is_using_snap() ^ Input::get_singleton()->is_key_pressed(Key::CTRL)) { const int snap = get_snap(); pos = pos.snapped(Vector2(snap, snap)); } gn->set_position_offset(pos); + if (gn->is_comment()) { + _set_position_of_comment_enclosed_nodes(gn, comment_enclosed_nodes, drag_accum); + } } } } @@ -1101,7 +1141,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { Ref<InputEventMouseButton> b = p_ev; if (b.is_valid()) { - if (b->get_button_index() == MOUSE_BUTTON_RIGHT && b->is_pressed()) { + if (b->get_button_index() == MouseButton::RIGHT && b->is_pressed()) { if (box_selecting) { box_selecting = false; for (int i = get_child_count() - 1; i >= 0; i--) { @@ -1126,13 +1166,13 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { top_layer->update(); minimap->update(); } else { - emit_signal(SNAME("popup_request"), b->get_global_position()); + emit_signal(SNAME("popup_request"), get_screen_position() + b->get_position()); } } } - if (b->get_button_index() == MOUSE_BUTTON_LEFT && !b->is_pressed() && dragging) { - if (!just_selected && drag_accum == Vector2() && Input::get_singleton()->is_key_pressed(KEY_CTRL)) { + if (b->get_button_index() == MouseButton::LEFT && !b->is_pressed() && dragging) { + if (!just_selected && drag_accum == Vector2() && Input::get_singleton()->is_key_pressed(Key::CTRL)) { //deselect current node for (int i = get_child_count() - 1; i >= 0; i--) { GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); @@ -1153,6 +1193,9 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); if (gn && gn->is_selected()) { gn->set_drag(false); + if (gn->is_comment()) { + _set_drag_comment_enclosed_nodes(gn, comment_enclosed_nodes, false); + } } } } @@ -1170,7 +1213,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { connections_layer->update(); } - if (b->get_button_index() == MOUSE_BUTTON_LEFT && b->is_pressed()) { + if (b->get_button_index() == MouseButton::LEFT && b->is_pressed()) { GraphNode *gn = nullptr; for (int i = get_child_count() - 1; i >= 0; i--) { @@ -1196,7 +1239,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { dragging = true; drag_accum = Vector2(); just_selected = !gn->is_selected(); - if (!gn->is_selected() && !Input::get_singleton()->is_key_pressed(KEY_CTRL)) { + if (!gn->is_selected() && !Input::get_singleton()->is_key_pressed(Key::CTRL)) { for (int i = 0; i < get_child_count(); i++) { GraphNode *o_gn = Object::cast_to<GraphNode>(get_child(i)); if (o_gn) { @@ -1220,6 +1263,10 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { } if (o_gn->is_selected()) { o_gn->set_drag(true); + if (o_gn->is_comment()) { + _update_comment_enclosed_nodes_list(o_gn, comment_enclosed_nodes); + _set_drag_comment_enclosed_nodes(o_gn, comment_enclosed_nodes, true); + } } } @@ -1227,7 +1274,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { if (_filter_input(b->get_position())) { return; } - if (Input::get_singleton()->is_key_pressed(KEY_SPACE)) { + if (Input::get_singleton()->is_key_pressed(Key::SPACE)) { return; } @@ -1272,7 +1319,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { } } - if (b->get_button_index() == MOUSE_BUTTON_LEFT && !b->is_pressed() && box_selecting) { + if (b->get_button_index() == MouseButton::LEFT && !b->is_pressed() && box_selecting) { box_selecting = false; box_selecting_rect = Rect2(); previous_selected.clear(); @@ -1280,7 +1327,7 @@ void GraphEdit::gui_input(const Ref<InputEvent> &p_ev) { minimap->update(); } - int scroll_direction = (b->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN) - (b->get_button_index() == MOUSE_BUTTON_WHEEL_UP); + int scroll_direction = (b->get_button_index() == MouseButton::WHEEL_DOWN) - (b->get_button_index() == MouseButton::WHEEL_UP); if (scroll_direction != 0) { if (b->is_ctrl_pressed()) { if (b->is_shift_pressed()) { @@ -2265,7 +2312,7 @@ GraphEdit::GraphEdit() { zoom_hb->add_child(zoom_label); zoom_label->set_visible(false); zoom_label->set_v_size_flags(Control::SIZE_SHRINK_CENTER); - zoom_label->set_align(Label::ALIGN_CENTER); + zoom_label->set_horizontal_alignment(HORIZONTAL_ALIGNMENT_CENTER); zoom_label->set_custom_minimum_size(Size2(48, 0)); _update_zoom_label(); diff --git a/scene/gui/graph_edit.h b/scene/gui/graph_edit.h index 44e50aa3c2..6c11f9df6a 100644 --- a/scene/gui/graph_edit.h +++ b/scene/gui/graph_edit.h @@ -217,6 +217,11 @@ private: Set<int> valid_left_disconnect_types; Set<int> valid_right_disconnect_types; + HashMap<StringName, Vector<GraphNode *>> comment_enclosed_nodes; + void _update_comment_enclosed_nodes_list(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes); + void _set_drag_comment_enclosed_nodes(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes, bool p_drag); + void _set_position_of_comment_enclosed_nodes(GraphNode *p_node, HashMap<StringName, Vector<GraphNode *>> &p_comment_enclosed_nodes, Vector2 p_pos); + HBoxContainer *zoom_hb; friend class GraphEditFilter; diff --git a/scene/gui/graph_node.cpp b/scene/gui/graph_node.cpp index 8462fd259e..7a7b35585e 100644 --- a/scene/gui/graph_node.cpp +++ b/scene/gui/graph_node.cpp @@ -442,7 +442,7 @@ void GraphNode::_notification(int p_what) { case NOTIFICATION_THEME_CHANGED: { _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } break; } @@ -458,7 +458,7 @@ void GraphNode::_shape() { } else { title_buf->set_direction((TextServer::Direction)text_direction); } - title_buf->add_string(title, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + title_buf->add_string(title, font, font_size, opentype_features, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); } #ifdef TOOLS_ENABLED @@ -666,7 +666,7 @@ void GraphNode::set_title(const String &p_title) { _shape(); update(); - minimum_size_changed(); + update_minimum_size(); } String GraphNode::get_title() const { @@ -894,7 +894,7 @@ void GraphNode::gui_input(const Ref<InputEvent> &p_ev) { if (mb.is_valid()) { ERR_FAIL_COND_MSG(get_parent_control() == nullptr, "GraphNode must be the child of a GraphEdit node."); - if (mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { Vector2 mpos = mb->get_position(); if (close_rect.size != Size2() && close_rect.has_point(mpos)) { //send focus to parent @@ -917,7 +917,7 @@ void GraphNode::gui_input(const Ref<InputEvent> &p_ev) { emit_signal(SNAME("raise_request")); } - if (!mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (!mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { resizing = false; } } diff --git a/scene/gui/grid_container.cpp b/scene/gui/grid_container.cpp index 2beb2624d2..624330cdf6 100644 --- a/scene/gui/grid_container.cpp +++ b/scene/gui/grid_container.cpp @@ -182,7 +182,7 @@ void GridContainer::_notification(int p_what) { } break; case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); } break; case NOTIFICATION_TRANSLATION_CHANGED: case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { @@ -195,7 +195,7 @@ void GridContainer::set_columns(int p_columns) { ERR_FAIL_COND(p_columns < 1); columns = p_columns; queue_sort(); - minimum_size_changed(); + update_minimum_size(); } int GridContainer::get_columns() const { diff --git a/scene/gui/item_list.cpp b/scene/gui/item_list.cpp index d10ad90c1f..6deb39b9e2 100644 --- a/scene/gui/item_list.cpp +++ b/scene/gui/item_list.cpp @@ -29,6 +29,7 @@ /*************************************************************************/ #include "item_list.h" + #include "core/config/project_settings.h" #include "core/os/os.h" #include "core/string/translation.h" @@ -42,7 +43,7 @@ void ItemList::_shape(int p_idx) { } else { item.text_buf->set_direction((TextServer::Direction)item.text_direction); } - item.text_buf->add_string(item.text, get_theme_font(SNAME("font")), get_theme_font_size(SNAME("font_size")), item.opentype_features, (item.language != "") ? item.language : TranslationServer::get_singleton()->get_tool_locale()); + item.text_buf->add_string(item.text, get_theme_font(SNAME("font")), get_theme_font_size(SNAME("font_size")), item.opentype_features, (!item.language.is_empty()) ? item.language : TranslationServer::get_singleton()->get_tool_locale()); if (icon_mode == ICON_MODE_TOP && max_text_lines > 0) { item.text_buf->set_flags(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::BREAK_GRAPHEME_BOUND); } else { @@ -55,16 +56,8 @@ void ItemList::_shape(int p_idx) { int ItemList::add_item(const String &p_item, const Ref<Texture2D> &p_texture, bool p_selectable) { Item item; item.icon = p_texture; - item.icon_transposed = false; - item.icon_region = Rect2i(); - item.icon_modulate = Color(1, 1, 1, 1); item.text = p_item; - item.text_buf.instantiate(); item.selectable = p_selectable; - item.selected = false; - item.disabled = false; - item.tooltip_enabled = true; - item.custom_bg = Color(0, 0, 0, 0); items.push_back(item); int item_id = items.size() - 1; @@ -72,27 +65,20 @@ int ItemList::add_item(const String &p_item, const Ref<Texture2D> &p_texture, bo update(); shape_changed = true; + notify_property_list_changed(); return item_id; } int ItemList::add_icon_item(const Ref<Texture2D> &p_item, bool p_selectable) { Item item; item.icon = p_item; - item.icon_transposed = false; - item.icon_region = Rect2i(); - item.icon_modulate = Color(1, 1, 1, 1); - //item.text=p_item; - item.text_buf.instantiate(); item.selectable = p_selectable; - item.selected = false; - item.disabled = false; - item.tooltip_enabled = true; - item.custom_bg = Color(0, 0, 0, 0); items.push_back(item); int item_id = items.size() - 1; update(); shape_changed = true; + notify_property_list_changed(); return item_id; } @@ -395,11 +381,20 @@ void ItemList::move_item(int p_from_idx, int p_to_idx) { } Item item = items[p_from_idx]; - items.remove(p_from_idx); + items.remove_at(p_from_idx); items.insert(p_to_idx, item); update(); shape_changed = true; + notify_property_list_changed(); +} + +void ItemList::set_item_count(int p_count) { + ERR_FAIL_COND(p_count < 0); + items.resize(p_count); + update(); + shape_changed = true; + notify_property_list_changed(); } int ItemList::get_item_count() const { @@ -409,13 +404,14 @@ int ItemList::get_item_count() const { void ItemList::remove_item(int p_idx) { ERR_FAIL_INDEX(p_idx, items.size()); - items.remove(p_idx); + items.remove_at(p_idx); if (current == p_idx) { current = -1; } update(); shape_changed = true; defer_select_single = -1; + notify_property_list_changed(); } void ItemList::clear() { @@ -425,6 +421,7 @@ void ItemList::clear() { update(); shape_changed = true; defer_select_single = -1; + notify_property_list_changed(); } void ItemList::set_fixed_column_width(int p_size) { @@ -550,7 +547,7 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mb = p_event; - if (defer_select_single >= 0 && mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_LEFT && !mb->is_pressed()) { + if (defer_select_single >= 0 && mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && !mb->is_pressed()) { select(defer_select_single, true); emit_signal(SNAME("multi_selected"), defer_select_single, true); @@ -558,7 +555,7 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { return; } - if (mb.is_valid() && (mb->get_button_index() == MOUSE_BUTTON_LEFT || (allow_rmb_select && mb->get_button_index() == MOUSE_BUTTON_RIGHT)) && mb->is_pressed()) { + if (mb.is_valid() && (mb->get_button_index() == MouseButton::LEFT || (allow_rmb_select && mb->get_button_index() == MouseButton::RIGHT)) && mb->is_pressed()) { search_string = ""; //any mousepress cancels Vector2 pos = mb->get_position(); Ref<StyleBox> bg = get_theme_stylebox(SNAME("bg")); @@ -604,16 +601,16 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { } } - if (mb->get_button_index() == MOUSE_BUTTON_RIGHT) { + if (mb->get_button_index() == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), i, get_local_mouse_position()); } } else { - if (!mb->is_double_click() && !mb->is_command_pressed() && select_mode == SELECT_MULTI && items[i].selectable && !items[i].disabled && items[i].selected && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (!mb->is_double_click() && !mb->is_command_pressed() && select_mode == SELECT_MULTI && items[i].selectable && !items[i].disabled && items[i].selected && mb->get_button_index() == MouseButton::LEFT) { defer_select_single = i; return; } - if (items[i].selected && mb->get_button_index() == MOUSE_BUTTON_RIGHT) { + if (items[i].selected && mb->get_button_index() == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), i, get_local_mouse_position()); } else { bool selected = items[i].selected; @@ -628,7 +625,7 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { } } - if (mb->get_button_index() == MOUSE_BUTTON_RIGHT) { + if (mb->get_button_index() == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), i, get_local_mouse_position()); } else if (/*select_mode==SELECT_SINGLE &&*/ mb->is_double_click()) { emit_signal(SNAME("item_activated"), i); @@ -638,7 +635,7 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { return; } - if (mb->get_button_index() == MOUSE_BUTTON_RIGHT) { + if (mb->get_button_index() == MouseButton::RIGHT) { emit_signal(SNAME("rmb_clicked"), mb->get_position()); return; @@ -647,16 +644,16 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { // Since closest is null, more likely we clicked on empty space, so send signal to interested controls. Allows, for example, implement items deselecting. emit_signal(SNAME("nothing_selected")); } - if (mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP && mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::WHEEL_UP && mb->is_pressed()) { scroll_bar->set_value(scroll_bar->get_value() - scroll_bar->get_page() * mb->get_factor() / 8); } - if (mb.is_valid() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN && mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::WHEEL_DOWN && mb->is_pressed()) { scroll_bar->set_value(scroll_bar->get_value() + scroll_bar->get_page() * mb->get_factor() / 8); } if (p_event->is_pressed() && items.size() > 0) { if (p_event->is_action("ui_up")) { - if (search_string != "") { + if (!search_string.is_empty()) { uint64_t now = OS::get_singleton()->get_ticks_msec(); uint64_t diff = now - search_time_msec; @@ -686,7 +683,7 @@ void ItemList::gui_input(const Ref<InputEvent> &p_event) { accept_event(); } } else if (p_event->is_action("ui_down")) { - if (search_string != "") { + if (!search_string.is_empty()) { uint64_t now = OS::get_singleton()->get_ticks_msec(); uint64_t diff = now - search_time_msec; @@ -923,7 +920,7 @@ void ItemList::_notification(int p_what) { minsize = items[i].get_icon_size() * icon_scale; } - if (items[i].text != "") { + if (!items[i].text.is_empty()) { if (icon_mode == ICON_MODE_TOP) { minsize.y += icon_margin; } else { @@ -932,7 +929,7 @@ void ItemList::_notification(int p_what) { } } - if (items[i].text != "") { + if (!items[i].text.is_empty()) { int max_width = -1; if (fixed_column_width) { max_width = fixed_column_width; @@ -1040,7 +1037,7 @@ void ItemList::_notification(int p_what) { } } - minimum_size_changed(); + update_minimum_size(); shape_changed = false; } @@ -1191,7 +1188,7 @@ void ItemList::_notification(int p_what) { draw_texture(items[i].tag_icon, draw_pos + base_ofs); } - if (items[i].text != "") { + if (!items[i].text.is_empty()) { int max_len = -1; Vector2 size2 = items[i].text_buf->get_size(); @@ -1216,7 +1213,7 @@ void ItemList::_notification(int p_what) { text_ofs.x = size.width - text_ofs.x - max_len; } - items.write[i].text_buf->set_align(HALIGN_CENTER); + items.write[i].text_buf->set_alignment(HORIZONTAL_ALIGNMENT_CENTER); if (outline_size > 0 && font_outline_color.a > 0) { items[i].text_buf->draw_outline(get_canvas_item(), text_ofs, outline_size, font_outline_color); @@ -1244,9 +1241,9 @@ void ItemList::_notification(int p_what) { items.write[i].text_buf->set_width(max_len); if (rtl) { - items.write[i].text_buf->set_align(HALIGN_RIGHT); + items.write[i].text_buf->set_alignment(HORIZONTAL_ALIGNMENT_RIGHT); } else { - items.write[i].text_buf->set_align(HALIGN_LEFT); + items.write[i].text_buf->set_alignment(HORIZONTAL_ALIGNMENT_LEFT); } if (outline_size > 0 && font_outline_color.a > 0) { @@ -1363,10 +1360,10 @@ String ItemList::get_tooltip(const Point2 &p_pos) const { if (!items[closest].tooltip_enabled) { return ""; } - if (items[closest].tooltip != "") { + if (!items[closest].tooltip.is_empty()) { return items[closest].tooltip; } - if (items[closest].text != "") { + if (!items[closest].text.is_empty()) { return items[closest].text; } } @@ -1446,32 +1443,6 @@ bool ItemList::is_anything_selected() { return false; } -void ItemList::_set_items(const Array &p_items) { - ERR_FAIL_COND(p_items.size() % 3); - clear(); - - for (int i = 0; i < p_items.size(); i += 3) { - String text = p_items[i + 0]; - Ref<Texture2D> icon = p_items[i + 1]; - bool disabled = p_items[i + 2]; - - int idx = get_item_count(); - add_item(text, icon); - set_item_disabled(idx, disabled); - } -} - -Array ItemList::_get_items() const { - Array items; - for (int i = 0; i < get_item_count(); i++) { - items.push_back(get_item_text(i)); - items.push_back(get_item_icon(i)); - items.push_back(is_item_disabled(i)); - } - - return items; -} - Size2 ItemList::get_minimum_size() const { if (auto_height) { return Size2(0, auto_height_value); @@ -1508,6 +1479,74 @@ TextParagraph::OverrunBehavior ItemList::get_text_overrun_behavior() const { return text_overrun_behavior; } +bool ItemList::_set(const StringName &p_name, const Variant &p_value) { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0].begins_with("item_") && components[0].trim_prefix("item_").is_valid_int()) { + int item_index = components[0].trim_prefix("item_").to_int(); + if (components[1] == "text") { + set_item_text(item_index, p_value); + return true; + } else if (components[1] == "icon") { + set_item_icon(item_index, p_value); + return true; + } else if (components[1] == "disabled") { + set_item_disabled(item_index, p_value); + return true; + } + } +#ifndef DISABLE_DEPRECATED + // Compatibility. + if (p_name == "items") { + Array arr = p_value; + ERR_FAIL_COND_V(arr.size() % 3, false); + clear(); + + for (int i = 0; i < arr.size(); i += 3) { + String text = arr[i + 0]; + Ref<Texture2D> icon = arr[i + 1]; + bool disabled = arr[i + 2]; + + int idx = get_item_count(); + add_item(text, icon); + set_item_disabled(idx, disabled); + } + } +#endif + return false; +} + +bool ItemList::_get(const StringName &p_name, Variant &r_ret) const { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0].begins_with("item_") && components[0].trim_prefix("item_").is_valid_int()) { + int item_index = components[0].trim_prefix("item_").to_int(); + if (components[1] == "text") { + r_ret = get_item_text(item_index); + return true; + } else if (components[1] == "icon") { + r_ret = get_item_icon(item_index); + return true; + } else if (components[1] == "disabled") { + r_ret = is_item_disabled(item_index); + return true; + } + } + return false; +} + +void ItemList::_get_property_list(List<PropertyInfo> *p_list) const { + for (int i = 0; i < items.size(); i++) { + p_list->push_back(PropertyInfo(Variant::STRING, vformat("item_%d/text", i))); + + PropertyInfo pi = PropertyInfo(Variant::OBJECT, vformat("item_%d/icon", i), PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"); + pi.usage &= ~(get_item_icon(i).is_null() ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("item_%d/disabled", i)); + pi.usage &= ~(!is_item_disabled(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + } +} + void ItemList::_bind_methods() { ClassDB::bind_method(D_METHOD("add_item", "text", "icon", "selectable"), &ItemList::add_item, DEFVAL(Variant()), DEFVAL(true)); ClassDB::bind_method(D_METHOD("add_icon_item", "icon", "selectable"), &ItemList::add_icon_item, DEFVAL(true)); @@ -1567,6 +1606,7 @@ void ItemList::_bind_methods() { ClassDB::bind_method(D_METHOD("move_item", "from_idx", "to_idx"), &ItemList::move_item); + ClassDB::bind_method(D_METHOD("set_item_count", "count"), &ItemList::set_item_count); ClassDB::bind_method(D_METHOD("get_item_count"), &ItemList::get_item_count); ClassDB::bind_method(D_METHOD("remove_item", "idx"), &ItemList::remove_item); @@ -1614,20 +1654,16 @@ void ItemList::_bind_methods() { ClassDB::bind_method(D_METHOD("get_v_scroll"), &ItemList::get_v_scroll); - ClassDB::bind_method(D_METHOD("_set_items"), &ItemList::_set_items); - ClassDB::bind_method(D_METHOD("_get_items"), &ItemList::_get_items); - ClassDB::bind_method(D_METHOD("set_text_overrun_behavior", "overrun_behavior"), &ItemList::set_text_overrun_behavior); ClassDB::bind_method(D_METHOD("get_text_overrun_behavior"), &ItemList::get_text_overrun_behavior); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "items", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_items", "_get_items"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "select_mode", PROPERTY_HINT_ENUM, "Single,Multi"), "set_select_mode", "get_select_mode"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_reselect"), "set_allow_reselect", "get_allow_reselect"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_rmb_select"), "set_allow_rmb_select", "get_allow_rmb_select"); ADD_PROPERTY(PropertyInfo(Variant::INT, "max_text_lines", PROPERTY_HINT_RANGE, "1,10,1,or_greater"), "set_max_text_lines", "get_max_text_lines"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "auto_height"), "set_auto_height", "has_auto_height"); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_overrun_behavior", PROPERTY_HINT_ENUM, "Trim Nothing,Trim Characters,Trim Words,Ellipsis,Word Ellipsis"), "set_text_overrun_behavior", "get_text_overrun_behavior"); + ADD_ARRAY_COUNT("Items", "item_count", "set_item_count", "get_item_count", "item_"); ADD_GROUP("Columns", ""); ADD_PROPERTY(PropertyInfo(Variant::INT, "max_columns", PROPERTY_HINT_RANGE, "0,10,1,or_greater"), "set_max_columns", "get_max_columns"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "same_column_width"), "set_same_column_width", "is_same_column_width"); diff --git a/scene/gui/item_list.h b/scene/gui/item_list.h index 148fa7ba9f..e780179e7b 100644 --- a/scene/gui/item_list.h +++ b/scene/gui/item_list.h @@ -54,7 +54,7 @@ private: Ref<Texture2D> icon; bool icon_transposed = false; Rect2i icon_region; - Color icon_modulate; + Color icon_modulate = Color(1, 1, 1, 1); Ref<Texture2D> tag_icon; String text; Ref<TextParagraph> text_buf; @@ -65,11 +65,11 @@ private: bool selectable = false; bool selected = false; bool disabled = false; - bool tooltip_enabled = false; + bool tooltip_enabled = true; Variant metadata; String tooltip; Color custom_fg; - Color custom_bg; + Color custom_bg = Color(0.0, 0.0, 0.0, 0.0); Rect2 rect_cache; Rect2 min_rect_cache; @@ -77,6 +77,10 @@ private: Size2 get_icon_size() const; bool operator<(const Item &p_another) const { return text < p_another.text; } + + Item() { + text_buf.instantiate(); + } }; int current = -1; @@ -119,14 +123,14 @@ private: bool do_autoscroll_to_bottom = false; - Array _get_items() const; - void _set_items(const Array &p_items); - void _scroll_changed(double); void _shape(int p_idx); protected: void _notification(int p_what); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; static void _bind_methods(); public: @@ -199,6 +203,7 @@ public: void move_item(int p_from_idx, int p_to_idx); + void set_item_count(int p_count); int get_item_count() const; void remove_item(int p_idx); diff --git a/scene/gui/label.cpp b/scene/gui/label.cpp index b8cb618171..0a09d87509 100644 --- a/scene/gui/label.cpp +++ b/scene/gui/label.cpp @@ -44,7 +44,7 @@ void Label::set_autowrap_mode(Label::AutowrapMode p_mode) { update(); if (clip || overrun_behavior != OVERRUN_NO_TRIMMING) { - minimum_size_changed(); + update_minimum_size(); } } @@ -96,7 +96,7 @@ void Label::_shape() { if (visible_chars >= 0) { text = text.substr(0, visible_chars); } - TS->shaped_text_add_string(text_rid, text, font->get_rids(), font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + TS->shaped_text_add_string(text_rid, text, font->get_rids(), font_size, opentype_features, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); TS->shaped_text_set_bidi_override(text_rid, structured_text_parser(st_parser, st_args, text)); dirty = false; lines_dirty = true; @@ -175,7 +175,7 @@ void Label::_shape() { if (lines_hidden) { overrun_flags |= TextServer::OVERRUN_ENFORCE_ELLIPSIS; } - if (align == ALIGN_FILL) { + if (horizontal_alignment == HORIZONTAL_ALIGNMENT_FILL) { for (int i = 0; i < lines_rid.size(); i++) { if (i < visible_lines - 1 || lines_rid.size() == 1) { TS->shaped_text_fit_to_width(lines_rid[i], width); @@ -191,7 +191,7 @@ void Label::_shape() { } else { // Autowrap disabled. for (int i = 0; i < lines_rid.size(); i++) { - if (align == ALIGN_FILL) { + if (horizontal_alignment == HORIZONTAL_ALIGNMENT_FILL) { TS->shaped_text_fit_to_width(lines_rid[i], width); overrun_flags |= TextServer::OVERRUN_JUSTIFICATION_AWARE; TS->shaped_text_overrun_trim_to_width(lines_rid[i], width, overrun_flags); @@ -207,7 +207,7 @@ void Label::_shape() { _update_visible(); if (autowrap_mode == AUTOWRAP_OFF || !clip || overrun_behavior == OVERRUN_NO_TRIMMING) { - minimum_size_changed(); + update_minimum_size(); } } @@ -243,11 +243,9 @@ inline void draw_glyph_outline(const Glyph &p_gl, const RID &p_canvas, const Col if (p_gl.font_rid != RID()) { if (p_font_shadow_color.a > 0) { TS->font_draw_glyph(p_gl.font_rid, p_canvas, p_gl.font_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off) + shadow_ofs, p_gl.index, p_font_shadow_color); - if (p_shadow_outline_size > 0) { - TS->font_draw_glyph_outline(p_gl.font_rid, p_canvas, p_gl.font_size, p_shadow_outline_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off) + Vector2(-shadow_ofs.x, shadow_ofs.y), p_gl.index, p_font_shadow_color); - TS->font_draw_glyph_outline(p_gl.font_rid, p_canvas, p_gl.font_size, p_shadow_outline_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off) + Vector2(shadow_ofs.x, -shadow_ofs.y), p_gl.index, p_font_shadow_color); - TS->font_draw_glyph_outline(p_gl.font_rid, p_canvas, p_gl.font_size, p_shadow_outline_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off) + Vector2(-shadow_ofs.x, -shadow_ofs.y), p_gl.index, p_font_shadow_color); - } + } + if (p_font_shadow_color.a > 0 && p_shadow_outline_size > 0) { + TS->font_draw_glyph_outline(p_gl.font_rid, p_canvas, p_gl.font_size, p_shadow_outline_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off) + shadow_ofs, p_gl.index, p_font_shadow_color); } if (p_font_outline_color.a != 0.0 && p_outline_size > 0) { TS->font_draw_glyph_outline(p_gl.font_rid, p_canvas, p_gl.font_size, p_outline_size, p_ofs + Vector2(p_gl.x_off, p_gl.y_off), p_gl.index, p_font_outline_color); @@ -328,21 +326,21 @@ void Label::_notification(int p_what) { int vbegin = 0, vsep = 0; if (lines_visible > 0) { - switch (valign) { - case VALIGN_TOP: { + switch (vertical_alignment) { + case VERTICAL_ALIGNMENT_TOP: { // Nothing. } break; - case VALIGN_CENTER: { + case VERTICAL_ALIGNMENT_CENTER: { vbegin = (size.y - (total_h - line_spacing)) / 2; vsep = 0; } break; - case VALIGN_BOTTOM: { + case VERTICAL_ALIGNMENT_BOTTOM: { vbegin = size.y - (total_h - line_spacing); vsep = 0; } break; - case VALIGN_FILL: { + case VERTICAL_ALIGNMENT_FILL: { vbegin = 0; if (lines_visible > 1) { vsep = (size.y - (total_h - line_spacing)) / (lines_visible - 1); @@ -360,25 +358,25 @@ void Label::_notification(int p_what) { Size2 line_size = TS->shaped_text_get_size(lines_rid[i]); ofs.x = 0; ofs.y += TS->shaped_text_get_ascent(lines_rid[i]) + font->get_spacing(TextServer::SPACING_TOP); - switch (align) { - case ALIGN_FILL: + switch (horizontal_alignment) { + case HORIZONTAL_ALIGNMENT_FILL: if (rtl && autowrap_mode != AUTOWRAP_OFF) { ofs.x = int(size.width - style->get_margin(SIDE_RIGHT) - line_size.width); } else { ofs.x = style->get_offset().x; } break; - case ALIGN_LEFT: { + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl_layout) { ofs.x = int(size.width - style->get_margin(SIDE_RIGHT) - line_size.width); } else { ofs.x = style->get_offset().x; } } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { ofs.x = int(size.width - line_size.width) / 2; } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (rtl_layout) { ofs.x = style->get_offset().x; } else { @@ -397,7 +395,7 @@ void Label::_notification(int p_what) { int ellipsis_gl_size = TS->shaped_text_get_ellipsis_glyph_count(lines_rid[i]); // Draw outline. Note: Do not merge this into the single loop with the main text, to prevent overlaps. - if (font_shadow_color.a > 0 || (font_outline_color.a != 0.0 && outline_size > 0)) { + if ((outline_size > 0 && font_outline_color.a != 0) || (font_shadow_color.a != 0)) { Vector2 offset = ofs; // Draw RTL ellipsis string when necessary. if (rtl && ellipsis_pos >= 0) { @@ -558,29 +556,29 @@ int Label::get_visible_line_count() const { return lines_visible; } -void Label::set_align(Align p_align) { - ERR_FAIL_INDEX((int)p_align, 4); - if (align != p_align) { - if (align == ALIGN_FILL || p_align == ALIGN_FILL) { +void Label::set_horizontal_alignment(HorizontalAlignment p_alignment) { + ERR_FAIL_INDEX((int)p_alignment, 4); + if (horizontal_alignment != p_alignment) { + if (horizontal_alignment == HORIZONTAL_ALIGNMENT_FILL || p_alignment == HORIZONTAL_ALIGNMENT_FILL) { lines_dirty = true; // Reshape lines. } - align = p_align; + horizontal_alignment = p_alignment; } update(); } -Label::Align Label::get_align() const { - return align; +HorizontalAlignment Label::get_horizontal_alignment() const { + return horizontal_alignment; } -void Label::set_valign(VAlign p_align) { - ERR_FAIL_INDEX((int)p_align, 4); - valign = p_align; +void Label::set_vertical_alignment(VerticalAlignment p_alignment) { + ERR_FAIL_INDEX((int)p_alignment, 4); + vertical_alignment = p_alignment; update(); } -Label::VAlign Label::get_valign() const { - return valign; +VerticalAlignment Label::get_vertical_alignment() const { + return vertical_alignment; } void Label::set_text(const String &p_string) { @@ -594,7 +592,7 @@ void Label::set_text(const String &p_string) { visible_chars = get_total_character_count() * percent_visible; } update(); - minimum_size_changed(); + update_minimum_size(); } void Label::set_text_direction(Control::TextDirection p_text_direction) { @@ -670,7 +668,7 @@ String Label::get_language() const { void Label::set_clip_text(bool p_clip) { clip = p_clip; update(); - minimum_size_changed(); + update_minimum_size(); } bool Label::is_clipping_text() const { @@ -684,7 +682,7 @@ void Label::set_text_overrun_behavior(Label::OverrunBehavior p_behavior) { } update(); if (clip || overrun_behavior != OVERRUN_NO_TRIMMING) { - minimum_size_changed(); + update_minimum_size(); } } @@ -811,10 +809,10 @@ void Label::_get_property_list(List<PropertyInfo> *p_list) const { } void Label::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_align", "align"), &Label::set_align); - ClassDB::bind_method(D_METHOD("get_align"), &Label::get_align); - ClassDB::bind_method(D_METHOD("set_valign", "valign"), &Label::set_valign); - ClassDB::bind_method(D_METHOD("get_valign"), &Label::get_valign); + ClassDB::bind_method(D_METHOD("set_horizontal_alignment", "alignment"), &Label::set_horizontal_alignment); + ClassDB::bind_method(D_METHOD("get_horizontal_alignment"), &Label::get_horizontal_alignment); + ClassDB::bind_method(D_METHOD("set_vertical_alignment", "alignment"), &Label::set_vertical_alignment); + ClassDB::bind_method(D_METHOD("get_vertical_alignment"), &Label::get_vertical_alignment); ClassDB::bind_method(D_METHOD("set_text", "text"), &Label::set_text); ClassDB::bind_method(D_METHOD("get_text"), &Label::get_text); ClassDB::bind_method(D_METHOD("set_text_direction", "direction"), &Label::set_text_direction); @@ -849,16 +847,6 @@ void Label::_bind_methods() { ClassDB::bind_method(D_METHOD("set_structured_text_bidi_override_options", "args"), &Label::set_structured_text_bidi_override_options); ClassDB::bind_method(D_METHOD("get_structured_text_bidi_override_options"), &Label::get_structured_text_bidi_override_options); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); - BIND_ENUM_CONSTANT(ALIGN_FILL); - - BIND_ENUM_CONSTANT(VALIGN_TOP); - BIND_ENUM_CONSTANT(VALIGN_CENTER); - BIND_ENUM_CONSTANT(VALIGN_BOTTOM); - BIND_ENUM_CONSTANT(VALIGN_FILL); - BIND_ENUM_CONSTANT(AUTOWRAP_OFF); BIND_ENUM_CONSTANT(AUTOWRAP_ARBITRARY); BIND_ENUM_CONSTANT(AUTOWRAP_WORD); @@ -871,10 +859,11 @@ void Label::_bind_methods() { BIND_ENUM_CONSTANT(OVERRUN_TRIM_WORD_ELLIPSIS); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text", PROPERTY_HINT_MULTILINE_TEXT, "", PROPERTY_USAGE_DEFAULT_INTL), "set_text", "get_text"); + ADD_GROUP("Locale", ""); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,Left-to-Right,Right-to-Left,Inherited"), "set_text_direction", "get_text_direction"); ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "valign", PROPERTY_HINT_ENUM, "Top,Center,Bottom,Fill"), "set_valign", "get_valign"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "horizontal_alignment", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_horizontal_alignment", "get_horizontal_alignment"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "vertical_alignment", PROPERTY_HINT_ENUM, "Top,Center,Bottom,Fill"), "set_vertical_alignment", "get_vertical_alignment"); ADD_PROPERTY(PropertyInfo(Variant::INT, "autowrap_mode", PROPERTY_HINT_ENUM, "Off,Arbitrary,Word,Word (Smart)"), "set_autowrap_mode", "get_autowrap_mode"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clip_text"), "set_clip_text", "is_clipping_text"); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_overrun_behavior", PROPERTY_HINT_ENUM, "Trim Nothing,Trim Characters,Trim Words,Ellipsis,Word Ellipsis"), "set_text_overrun_behavior", "get_text_overrun_behavior"); diff --git a/scene/gui/label.h b/scene/gui/label.h index 8b48eb9670..2ad8ae8818 100644 --- a/scene/gui/label.h +++ b/scene/gui/label.h @@ -37,20 +37,6 @@ class Label : public Control { GDCLASS(Label, Control); public: - enum Align { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT, - ALIGN_FILL - }; - - enum VAlign { - VALIGN_TOP, - VALIGN_CENTER, - VALIGN_BOTTOM, - VALIGN_FILL - }; - enum AutowrapMode { AUTOWRAP_OFF, AUTOWRAP_ARBITRARY, @@ -67,8 +53,8 @@ public: }; private: - Align align = ALIGN_LEFT; - VAlign valign = VALIGN_TOP; + HorizontalAlignment horizontal_alignment = HORIZONTAL_ALIGNMENT_LEFT; + VerticalAlignment vertical_alignment = VERTICAL_ALIGNMENT_TOP; String text; String xl_text; AutowrapMode autowrap_mode = AUTOWRAP_OFF; @@ -109,11 +95,11 @@ protected: public: virtual Size2 get_minimum_size() const override; - void set_align(Align p_align); - Align get_align() const; + void set_horizontal_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_horizontal_alignment() const; - void set_valign(VAlign p_align); - VAlign get_valign() const; + void set_vertical_alignment(VerticalAlignment p_alignment); + VerticalAlignment get_vertical_alignment() const; void set_text(const String &p_string); String get_text() const; @@ -167,8 +153,6 @@ public: ~Label(); }; -VARIANT_ENUM_CAST(Label::Align); -VARIANT_ENUM_CAST(Label::VAlign); VARIANT_ENUM_CAST(Label::AutowrapMode); VARIANT_ENUM_CAST(Label::OverrunBehavior); diff --git a/scene/gui/line_edit.cpp b/scene/gui/line_edit.cpp index 54e7d8f960..810781995e 100644 --- a/scene/gui/line_edit.cpp +++ b/scene/gui/line_edit.cpp @@ -225,17 +225,36 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { // Ignore mouse clicks in IME input mode. return; } - if (b->is_pressed() && b->get_button_index() == MOUSE_BUTTON_RIGHT && context_menu_enabled) { + if (b->is_pressed() && b->get_button_index() == MouseButton::RIGHT && context_menu_enabled) { _ensure_menu(); - menu->set_position(get_screen_transform().xform(get_local_mouse_position())); - menu->set_size(Vector2(1, 1)); + menu->set_position(get_screen_position() + get_local_mouse_position()); + menu->reset_size(); menu->popup(); grab_focus(); accept_event(); return; } - if (b->get_button_index() != MOUSE_BUTTON_LEFT) { + if (is_middle_mouse_paste_enabled() && b->is_pressed() && b->get_button_index() == MouseButton::MIDDLE && is_editable() && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + String paste_buffer = DisplayServer::get_singleton()->clipboard_get_primary().strip_escapes(); + + deselect(); + set_caret_at_pixel_pos(b->get_position().x); + if (!paste_buffer.is_empty()) { + insert_text_at_caret(paste_buffer); + + if (!text_changed_dirty) { + if (is_inside_tree()) { + MessageQueue::get_singleton()->push_call(this, "_text_changed"); + } + text_changed_dirty = true; + } + } + grab_focus(); + return; + } + + if (b->get_button_index() != MouseButton::LEFT) { return; } @@ -249,7 +268,9 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { return; } - shift_selection_check_pre(b->is_shift_pressed()); + if (b->is_shift_pressed()) { + shift_selection_check_pre(true); + } set_caret_at_pixel_pos(b->get_position().x); @@ -271,6 +292,9 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { selection.double_click = true; last_dblclk = 0; caret_column = selection.begin; + if (!pass && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(text); + } } else if (b->is_double_click()) { // Double-click select word. last_dblclk = OS::get_singleton()->get_ticks_msec(); @@ -286,6 +310,9 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { break; } } + if (!pass && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(text.substr(selection.begin, selection.end - selection.begin)); + } } } @@ -295,7 +322,7 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { deselect(); selection.start_column = caret_column; selection.creating = true; - } else if (selection.enabled) { + } else if (selection.enabled && !selection.double_click) { selection.drag_attempt = true; } } @@ -303,6 +330,9 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { update(); } else { + if (selection.enabled && !pass && b->get_button_index() == MouseButton::LEFT && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(text.substr(selection.begin, selection.end - selection.begin)); + } if (!text.is_empty() && is_editable() && clear_button_enabled) { bool press_attempt = clear_button_status.press_attempt; clear_button_status.press_attempt = false; @@ -317,6 +347,9 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { } selection.creating = false; selection.double_click = false; + if (!drag_action) { + selection.drag_attempt = false; + } show_virtual_keyboard(); } @@ -335,12 +368,17 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { } } - if (m->get_button_mask() & MOUSE_BUTTON_LEFT) { + if ((m->get_button_mask() & MouseButton::MASK_LEFT) != MouseButton::NONE) { if (selection.creating) { set_caret_at_pixel_pos(m->get_position().x); selection_fill_at_caret(); } } + + if (drag_action && can_drop_data(m->get_position(), get_viewport()->gui_get_drag_data())) { + drag_caret_force_displayed = true; + set_caret_at_pixel_pos(m->get_position().x); + } } Ref<InputEventKey> k = p_event; @@ -354,8 +392,8 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { if (k->is_action("ui_menu", true)) { _ensure_menu(); Point2 pos = Point2(get_caret_pixel_pos().x, (get_size().y + get_theme_font(SNAME("font"))->get_height(get_theme_font_size(SNAME("font_size")))) / 2); - menu->set_position(get_global_transform().xform(pos)); - menu->set_size(Vector2(1, 1)); + menu->set_position(get_screen_position() + pos); + menu->reset_size(); menu->popup(); menu->grab_focus(); } @@ -510,17 +548,17 @@ void LineEdit::gui_input(const Ref<InputEvent> &p_event) { } } -void LineEdit::set_align(Align p_align) { - ERR_FAIL_INDEX((int)p_align, 4); - if (align != p_align) { - align = p_align; +void LineEdit::set_horizontal_alignment(HorizontalAlignment p_alignment) { + ERR_FAIL_INDEX((int)p_alignment, 4); + if (alignment != p_alignment) { + alignment = p_alignment; _shape(); } update(); } -LineEdit::Align LineEdit::get_align() const { - return align; +HorizontalAlignment LineEdit::get_horizontal_alignment() const { + return alignment; } Variant LineEdit::get_drag_data(const Point2 &p_point) { @@ -541,22 +579,50 @@ bool LineEdit::can_drop_data(const Point2 &p_point, const Variant &p_data) const return drop_override; } - return p_data.get_type() == Variant::STRING; + return is_editable() && p_data.get_type() == Variant::STRING; } void LineEdit::drop_data(const Point2 &p_point, const Variant &p_data) { Control::drop_data(p_point, p_data); - if (p_data.get_type() == Variant::STRING) { + if (p_data.get_type() == Variant::STRING && is_editable()) { set_caret_at_pixel_pos(p_point.x); - int selected = selection.end - selection.begin; - - text.erase(selection.begin, selected); - _shape(); + int caret_column_tmp = caret_column; + bool is_inside_sel = selection.enabled && caret_column >= selection.begin && caret_column <= selection.end; + if (Input::get_singleton()->is_key_pressed(Key::CTRL)) { + is_inside_sel = selection.enabled && caret_column > selection.begin && caret_column < selection.end; + } + if (selection.drag_attempt) { + selection.drag_attempt = false; + if (!is_inside_sel) { + if (!Input::get_singleton()->is_key_pressed(Key::CTRL)) { + if (caret_column_tmp > selection.end) { + caret_column_tmp = caret_column_tmp - (selection.end - selection.begin); + } + selection_delete(); + } - insert_text_at_caret(p_data); - selection.begin = caret_column - selected; - selection.end = caret_column; + set_caret_column(caret_column_tmp); + insert_text_at_caret(p_data); + } + } else if (selection.enabled && caret_column >= selection.begin && caret_column <= selection.end) { + caret_column_tmp = selection.begin; + selection_delete(); + set_caret_column(caret_column_tmp); + insert_text_at_caret(p_data); + grab_focus(); + } else { + insert_text_at_caret(p_data); + grab_focus(); + } + select(caret_column_tmp, caret_column); + if (!text_changed_dirty) { + if (is_inside_tree()) { + MessageQueue::get_singleton()->push_call(this, "_text_changed"); + } + text_changed_dirty = true; + } + update(); } } @@ -636,7 +702,9 @@ void LineEdit::_notification(int p_what) { } Ref<Font> font = get_theme_font(SNAME("font")); - style->draw(ci, Rect2(Point2(), size)); + if (!flat) { + style->draw(ci, Rect2(Point2(), size)); + } if (has_focus()) { get_theme_stylebox(SNAME("focus"))->draw(ci, Rect2(Point2(), size)); @@ -647,23 +715,23 @@ void LineEdit::_notification(int p_what) { float text_width = TS->shaped_text_get_size(text_rid).x; float text_height = TS->shaped_text_get_size(text_rid).y + font->get_spacing(TextServer::SPACING_TOP) + font->get_spacing(TextServer::SPACING_BOTTOM); - switch (align) { - case ALIGN_FILL: - case ALIGN_LEFT: { + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(size.width - style->get_margin(SIDE_RIGHT) - (text_width))); } else { x_ofs = style->get_offset().x; } } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (scroll_offset != 0) { x_ofs = style->get_offset().x; } else { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(size.width - (text_width)) / 2); } } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (rtl) { x_ofs = style->get_offset().x; } else { @@ -701,7 +769,7 @@ void LineEdit::_notification(int p_what) { r_icon->draw(ci, Point2(width - r_icon->get_width() - style->get_margin(SIDE_RIGHT), height / 2 - r_icon->get_height() / 2), color_icon); - if (align == ALIGN_CENTER) { + if (alignment == HORIZONTAL_ALIGNMENT_CENTER) { if (scroll_offset == 0) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(size.width - text_width - r_icon->get_width() - style->get_margin(SIDE_RIGHT) * 2) / 2); } @@ -774,7 +842,7 @@ void LineEdit::_notification(int p_what) { // Draw carets. ofs.x = x_ofs + scroll_offset; - if (draw_caret) { + if (draw_caret || drag_caret_force_displayed) { if (ime_text.length() == 0) { // Normal caret. CaretInfo caret = TS->shaped_text_get_carets(text_rid, caret_column); @@ -892,6 +960,9 @@ void LineEdit::_notification(int p_what) { DisplayServer::get_singleton()->virtual_keyboard_hide(); } + if (deselect_on_focus_loss_enabled && !selection.drag_attempt) { + deselect(); + } } break; case MainLoop::NOTIFICATION_OS_IME_UPDATE: { if (has_focus()) { @@ -903,6 +974,25 @@ void LineEdit::_notification(int p_what) { update(); } } break; + case Control::NOTIFICATION_DRAG_BEGIN: { + drag_action = true; + } break; + case Control::NOTIFICATION_DRAG_END: { + if (is_drag_successful()) { + if (selection.drag_attempt) { + selection.drag_attempt = false; + if (is_editable() && !Input::get_singleton()->is_key_pressed(Key::CTRL)) { + selection_delete(); + } else if (deselect_on_focus_loss_enabled) { + deselect(); + } + } + } else { + selection.drag_attempt = false; + } + drag_action = false; + drag_caret_force_displayed = false; + } break; } } @@ -927,7 +1017,7 @@ void LineEdit::paste_text() { // Strip escape characters like \n and \t as they can't be displayed on LineEdit. String paste_buffer = DisplayServer::get_singleton()->clipboard_get().strip_escapes(); - if (paste_buffer != "") { + if (!paste_buffer.is_empty()) { int prev_len = text.length(); if (selection.enabled) { selection_delete(); @@ -967,6 +1057,9 @@ void LineEdit::undo() { } else if (undo_stack_pos == undo_stack.front()) { return; } + + deselect(); + undo_stack_pos = undo_stack_pos->prev(); TextOperation op = undo_stack_pos->get(); text = op.text; @@ -988,6 +1081,9 @@ void LineEdit::redo() { if (undo_stack_pos == undo_stack.back()) { return; } + + deselect(); + undo_stack_pos = undo_stack_pos->next(); TextOperation op = undo_stack_pos->get(); text = op.text; @@ -1019,23 +1115,23 @@ void LineEdit::set_caret_at_pixel_pos(int p_x) { int x_ofs = 0; float text_width = TS->shaped_text_get_size(text_rid).x; - switch (align) { - case ALIGN_FILL: - case ALIGN_LEFT: { + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - style->get_margin(SIDE_RIGHT) - (text_width))); } else { x_ofs = style->get_offset().x; } } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (scroll_offset != 0) { x_ofs = style->get_offset().x; } else { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - (text_width)) / 2); } } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (rtl) { x_ofs = style->get_offset().x; } else { @@ -1048,7 +1144,7 @@ void LineEdit::set_caret_at_pixel_pos(int p_x) { bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; if (right_icon.is_valid() || display_clear_icon) { Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon(SNAME("clear")) : right_icon; - if (align == ALIGN_CENTER) { + if (alignment == HORIZONTAL_ALIGNMENT_CENTER) { if (scroll_offset == 0) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(SIDE_RIGHT) * 2) / 2); } @@ -1067,23 +1163,23 @@ Vector2i LineEdit::get_caret_pixel_pos() { int x_ofs = 0; float text_width = TS->shaped_text_get_size(text_rid).x; - switch (align) { - case ALIGN_FILL: - case ALIGN_LEFT: { + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - style->get_margin(SIDE_RIGHT) - (text_width))); } else { x_ofs = style->get_offset().x; } } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (scroll_offset != 0) { x_ofs = style->get_offset().x; } else { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - (text_width)) / 2); } } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (rtl) { x_ofs = style->get_offset().x; } else { @@ -1096,7 +1192,7 @@ Vector2i LineEdit::get_caret_pixel_pos() { bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; if (right_icon.is_valid() || display_clear_icon) { Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon(SNAME("clear")) : right_icon; - if (align == ALIGN_CENTER) { + if (alignment == HORIZONTAL_ALIGNMENT_CENTER) { if (scroll_offset == 0) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(SIDE_RIGHT) * 2) / 2); } @@ -1211,7 +1307,7 @@ void LineEdit::delete_char() { return; } - text.erase(caret_column - 1, 1); + text = text.left(caret_column - 1) + text.substr(caret_column); _shape(); set_caret_column(get_caret_column() - 1); @@ -1223,7 +1319,7 @@ void LineEdit::delete_text(int p_from_column, int p_to_column) { ERR_FAIL_COND_MSG(p_from_column < 0 || p_from_column > p_to_column || p_to_column > text.length(), vformat("Positional parameters (from: %d, to: %d) are inverted or outside the text length (%d).", p_from_column, p_to_column, text.length())); - text.erase(p_from_column, p_to_column - p_from_column); + text = text.left(p_from_column) + text.substr(p_to_column); _shape(); caret_column -= CLAMP(caret_column - p_from_column, 0, p_to_column - p_from_column); @@ -1412,23 +1508,23 @@ void LineEdit::set_caret_column(int p_column) { int x_ofs = 0; float text_width = TS->shaped_text_get_size(text_rid).x; - switch (align) { - case ALIGN_FILL: - case ALIGN_LEFT: { + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - style->get_margin(SIDE_RIGHT) - (text_width))); } else { x_ofs = style->get_offset().x; } } break; - case ALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (scroll_offset != 0) { x_ofs = style->get_offset().x; } else { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - (text_width)) / 2); } } break; - case ALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (rtl) { x_ofs = style->get_offset().x; } else { @@ -1442,7 +1538,7 @@ void LineEdit::set_caret_column(int p_column) { bool display_clear_icon = !using_placeholder && is_editable() && clear_button_enabled; if (right_icon.is_valid() || display_clear_icon) { Ref<Texture2D> r_icon = display_clear_icon ? Control::get_theme_icon(SNAME("clear")) : right_icon; - if (align == ALIGN_CENTER) { + if (alignment == HORIZONTAL_ALIGNMENT_CENTER) { if (scroll_offset == 0) { x_ofs = MAX(style->get_margin(SIDE_LEFT), int(get_size().width - text_width - r_icon->get_width() - style->get_margin(SIDE_RIGHT) * 2) / 2); } @@ -1622,7 +1718,7 @@ void LineEdit::set_editable(bool p_editable) { editable = p_editable; - minimum_size_changed(); + update_minimum_size(); update(); } @@ -1852,7 +1948,7 @@ void LineEdit::_editor_settings_changed() { void LineEdit::set_expand_to_text_length_enabled(bool p_enabled) { expand_to_text_length = p_enabled; - minimum_size_changed(); + update_minimum_size(); set_caret_column(caret_column); } @@ -1866,7 +1962,7 @@ void LineEdit::set_clear_button_enabled(bool p_enabled) { } clear_button_enabled = p_enabled; _fit_to_width(); - minimum_size_changed(); + update_minimum_size(); update(); } @@ -1890,6 +1986,14 @@ bool LineEdit::is_virtual_keyboard_enabled() const { return virtual_keyboard_enabled; } +void LineEdit::set_middle_mouse_paste_enabled(bool p_enabled) { + middle_mouse_paste_enabled = p_enabled; +} + +bool LineEdit::is_middle_mouse_paste_enabled() const { + return middle_mouse_paste_enabled; +} + void LineEdit::set_selecting_enabled(bool p_enabled) { selecting_enabled = p_enabled; @@ -1902,13 +2006,24 @@ bool LineEdit::is_selecting_enabled() const { return selecting_enabled; } +void LineEdit::set_deselect_on_focus_loss_enabled(const bool p_enabled) { + deselect_on_focus_loss_enabled = p_enabled; + if (p_enabled && selection.enabled && !has_focus()) { + deselect(); + } +} + +bool LineEdit::is_deselect_on_focus_loss_enabled() const { + return deselect_on_focus_loss_enabled; +} + void LineEdit::set_right_icon(const Ref<Texture2D> &p_icon) { if (right_icon == p_icon) { return; } right_icon = p_icon; _fit_to_width(); - minimum_size_changed(); + update_minimum_size(); update(); } @@ -1916,6 +2031,17 @@ Ref<Texture2D> LineEdit::get_right_icon() { return right_icon; } +void LineEdit::set_flat(bool p_enabled) { + if (flat != p_enabled) { + flat = p_enabled; + update(); + } +} + +bool LineEdit::is_flat() const { + return flat; +} + void LineEdit::_text_changed() { _emit_text_change(); _clear_redo(); @@ -1952,7 +2078,7 @@ void LineEdit::_shape() { const Ref<Font> &font = get_theme_font(SNAME("font")); int font_size = get_theme_font_size(SNAME("font_size")); ERR_FAIL_COND(font.is_null()); - TS->shaped_text_add_string(text_rid, t, font->get_rids(), font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + TS->shaped_text_add_string(text_rid, t, font->get_rids(), font_size, opentype_features, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); TS->shaped_text_set_bidi_override(text_rid, structured_text_parser(st_parser, st_args, t)); full_width = TS->shaped_text_get_size(text_rid).x; @@ -1961,12 +2087,12 @@ void LineEdit::_shape() { Size2 size = TS->shaped_text_get_size(text_rid); if ((expand_to_text_length && old_size.x != size.x) || (old_size.y != size.y)) { - minimum_size_changed(); + update_minimum_size(); } } void LineEdit::_fit_to_width() { - if (align == ALIGN_FILL) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL) { Ref<StyleBox> style = get_theme_stylebox(SNAME("normal")); int t_width = get_size().width - style->get_margin(SIDE_RIGHT) - style->get_margin(SIDE_LEFT); bool using_placeholder = text.is_empty() && ime_text.is_empty(); @@ -2008,25 +2134,25 @@ void LineEdit::_create_undo_state() { undo_stack.push_back(op); } -int LineEdit::_get_menu_action_accelerator(const String &p_action) { +Key LineEdit::_get_menu_action_accelerator(const String &p_action) { const List<Ref<InputEvent>> *events = InputMap::get_singleton()->action_get_events(p_action); if (!events) { - return 0; + return Key::NONE; } // Use first event in the list for the accelerator. const List<Ref<InputEvent>>::Element *first_event = events->front(); if (!first_event) { - return 0; + return Key::NONE; } const Ref<InputEventKey> event = first_event->get(); if (event.is_null()) { - return 0; + return Key::NONE; } // Use physical keycode if non-zero - if (event->get_physical_keycode() != 0) { + if (event->get_physical_keycode() != Key::NONE) { return event->get_physical_keycode_with_modifiers(); } else { return event->get_keycode_with_modifiers(); @@ -2085,15 +2211,15 @@ void LineEdit::_get_property_list(List<PropertyInfo> *p_list) const { void LineEdit::_validate_property(PropertyInfo &property) const { if (!caret_blink_enabled && property.name == "caret_blink_speed") { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } void LineEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("_text_changed"), &LineEdit::_text_changed); - ClassDB::bind_method(D_METHOD("set_align", "align"), &LineEdit::set_align); - ClassDB::bind_method(D_METHOD("get_align"), &LineEdit::get_align); + ClassDB::bind_method(D_METHOD("set_horizontal_alignment", "alignment"), &LineEdit::set_horizontal_alignment); + ClassDB::bind_method(D_METHOD("get_horizontal_alignment"), &LineEdit::get_horizontal_alignment); ClassDB::bind_method(D_METHOD("clear"), &LineEdit::clear); ClassDB::bind_method(D_METHOD("select", "from", "to"), &LineEdit::select, DEFVAL(0), DEFVAL(-1)); @@ -2156,20 +2282,21 @@ void LineEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("is_clear_button_enabled"), &LineEdit::is_clear_button_enabled); ClassDB::bind_method(D_METHOD("set_shortcut_keys_enabled", "enable"), &LineEdit::set_shortcut_keys_enabled); ClassDB::bind_method(D_METHOD("is_shortcut_keys_enabled"), &LineEdit::is_shortcut_keys_enabled); + ClassDB::bind_method(D_METHOD("set_middle_mouse_paste_enabled", "enable"), &LineEdit::set_middle_mouse_paste_enabled); + ClassDB::bind_method(D_METHOD("is_middle_mouse_paste_enabled"), &LineEdit::is_middle_mouse_paste_enabled); ClassDB::bind_method(D_METHOD("set_selecting_enabled", "enable"), &LineEdit::set_selecting_enabled); ClassDB::bind_method(D_METHOD("is_selecting_enabled"), &LineEdit::is_selecting_enabled); + ClassDB::bind_method(D_METHOD("set_deselect_on_focus_loss_enabled", "enable"), &LineEdit::set_deselect_on_focus_loss_enabled); + ClassDB::bind_method(D_METHOD("is_deselect_on_focus_loss_enabled"), &LineEdit::is_deselect_on_focus_loss_enabled); ClassDB::bind_method(D_METHOD("set_right_icon", "icon"), &LineEdit::set_right_icon); ClassDB::bind_method(D_METHOD("get_right_icon"), &LineEdit::get_right_icon); + ClassDB::bind_method(D_METHOD("set_flat", "enabled"), &LineEdit::set_flat); + ClassDB::bind_method(D_METHOD("is_flat"), &LineEdit::is_flat); ADD_SIGNAL(MethodInfo("text_changed", PropertyInfo(Variant::STRING, "new_text"))); ADD_SIGNAL(MethodInfo("text_change_rejected", PropertyInfo(Variant::STRING, "rejected_substring"))); ADD_SIGNAL(MethodInfo("text_submitted", PropertyInfo(Variant::STRING, "new_text"))); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); - BIND_ENUM_CONSTANT(ALIGN_FILL); - BIND_ENUM_CONSTANT(MENU_CUT); BIND_ENUM_CONSTANT(MENU_COPY); BIND_ENUM_CONSTANT(MENU_PASTE); @@ -2201,7 +2328,7 @@ void LineEdit::_bind_methods() { BIND_ENUM_CONSTANT(MENU_MAX); ADD_PROPERTY(PropertyInfo(Variant::STRING, "text"), "set_text", "get_text"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_horizontal_alignment", "get_horizontal_alignment"); ADD_PROPERTY(PropertyInfo(Variant::INT, "max_length", PROPERTY_HINT_RANGE, "0,1000,1,or_greater"), "set_max_length", "get_max_length"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "editable"), "set_editable", "is_editable"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "secret"), "set_secret", "is_secret"); @@ -2211,8 +2338,11 @@ void LineEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "virtual_keyboard_enabled"), "set_virtual_keyboard_enabled", "is_virtual_keyboard_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clear_button_enabled"), "set_clear_button_enabled", "is_clear_button_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "shortcut_keys_enabled"), "set_shortcut_keys_enabled", "is_shortcut_keys_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "middle_mouse_paste_enabled"), "set_middle_mouse_paste_enabled", "is_middle_mouse_paste_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "selecting_enabled"), "set_selecting_enabled", "is_selecting_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "deselect_on_focus_loss_enabled"), "set_deselect_on_focus_loss_enabled", "is_deselect_on_focus_loss_enabled"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "right_icon", PROPERTY_HINT_RESOURCE_TYPE, "Texture"), "set_right_icon", "get_right_icon"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "flat"), "set_flat", "is_flat"); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,Left-to-Right,Right-to-Left,Inherited"), "set_text_direction", "get_text_direction"); ADD_PROPERTY(PropertyInfo(Variant::STRING, "language"), "set_language", "get_language"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "draw_control_chars"), "set_draw_control_chars", "get_draw_control_chars"); @@ -2237,33 +2367,33 @@ void LineEdit::_ensure_menu() { menu_dir = memnew(PopupMenu); menu_dir->set_name("DirMenu"); - menu_dir->add_radio_check_item(RTR("Same as layout direction"), MENU_DIR_INHERITED); - menu_dir->add_radio_check_item(RTR("Auto-detect direction"), MENU_DIR_AUTO); - menu_dir->add_radio_check_item(RTR("Left-to-right"), MENU_DIR_LTR); - menu_dir->add_radio_check_item(RTR("Right-to-left"), MENU_DIR_RTL); - menu->add_child(menu_dir); + menu_dir->add_radio_check_item(RTR("Same as Layout Direction"), MENU_DIR_INHERITED); + menu_dir->add_radio_check_item(RTR("Auto-Detect Direction"), MENU_DIR_AUTO); + menu_dir->add_radio_check_item(RTR("Left-to-Right"), MENU_DIR_LTR); + menu_dir->add_radio_check_item(RTR("Right-to-Left"), MENU_DIR_RTL); + menu->add_child(menu_dir, false, INTERNAL_MODE_FRONT); menu_ctl = memnew(PopupMenu); menu_ctl->set_name("CTLMenu"); - menu_ctl->add_item(RTR("Left-to-right mark (LRM)"), MENU_INSERT_LRM); - menu_ctl->add_item(RTR("Right-to-left mark (RLM)"), MENU_INSERT_RLM); - menu_ctl->add_item(RTR("Start of left-to-right embedding (LRE)"), MENU_INSERT_LRE); - menu_ctl->add_item(RTR("Start of right-to-left embedding (RLE)"), MENU_INSERT_RLE); - menu_ctl->add_item(RTR("Start of left-to-right override (LRO)"), MENU_INSERT_LRO); - menu_ctl->add_item(RTR("Start of right-to-left override (RLO)"), MENU_INSERT_RLO); - menu_ctl->add_item(RTR("Pop direction formatting (PDF)"), MENU_INSERT_PDF); + menu_ctl->add_item(RTR("Left-to-Right Mark (LRM)"), MENU_INSERT_LRM); + menu_ctl->add_item(RTR("Right-to-Left Mark (RLM)"), MENU_INSERT_RLM); + menu_ctl->add_item(RTR("Start of Left-to-Right Embedding (LRE)"), MENU_INSERT_LRE); + menu_ctl->add_item(RTR("Start of Right-to-Left Embedding (RLE)"), MENU_INSERT_RLE); + menu_ctl->add_item(RTR("Start of Left-to-Right Override (LRO)"), MENU_INSERT_LRO); + menu_ctl->add_item(RTR("Start of Right-to-Left Override (RLO)"), MENU_INSERT_RLO); + menu_ctl->add_item(RTR("Pop Direction Formatting (PDF)"), MENU_INSERT_PDF); menu_ctl->add_separator(); - menu_ctl->add_item(RTR("Arabic letter mark (ALM)"), MENU_INSERT_ALM); - menu_ctl->add_item(RTR("Left-to-right isolate (LRI)"), MENU_INSERT_LRI); - menu_ctl->add_item(RTR("Right-to-left isolate (RLI)"), MENU_INSERT_RLI); - menu_ctl->add_item(RTR("First strong isolate (FSI)"), MENU_INSERT_FSI); - menu_ctl->add_item(RTR("Pop direction isolate (PDI)"), MENU_INSERT_PDI); + menu_ctl->add_item(RTR("Arabic Letter Mark (ALM)"), MENU_INSERT_ALM); + menu_ctl->add_item(RTR("Left-to-Right Isolate (LRI)"), MENU_INSERT_LRI); + menu_ctl->add_item(RTR("Right-to-Left Isolate (RLI)"), MENU_INSERT_RLI); + menu_ctl->add_item(RTR("First Strong Isolate (FSI)"), MENU_INSERT_FSI); + menu_ctl->add_item(RTR("Pop Direction Isolate (PDI)"), MENU_INSERT_PDI); menu_ctl->add_separator(); - menu_ctl->add_item(RTR("Zero width joiner (ZWJ)"), MENU_INSERT_ZWJ); - menu_ctl->add_item(RTR("Zero width non-joiner (ZWNJ)"), MENU_INSERT_ZWNJ); - menu_ctl->add_item(RTR("Word joiner (WJ)"), MENU_INSERT_WJ); - menu_ctl->add_item(RTR("Soft hyphen (SHY)"), MENU_INSERT_SHY); - menu->add_child(menu_ctl); + menu_ctl->add_item(RTR("Zero-Width Joiner (ZWJ)"), MENU_INSERT_ZWJ); + menu_ctl->add_item(RTR("Zero-Width Non-Joiner (ZWNJ)"), MENU_INSERT_ZWNJ); + menu_ctl->add_item(RTR("Word Joiner (WJ)"), MENU_INSERT_WJ); + menu_ctl->add_item(RTR("Soft Hyphen (SHY)"), MENU_INSERT_SHY); + menu->add_child(menu_ctl, false, INTERNAL_MODE_FRONT); menu->connect("id_pressed", callable_mp(this, &LineEdit::menu_option)); menu_dir->connect("id_pressed", callable_mp(this, &LineEdit::menu_option)); @@ -2273,29 +2403,29 @@ void LineEdit::_ensure_menu() { // Reorganize context menu. menu->clear(); if (editable) { - menu->add_item(RTR("Cut"), MENU_CUT, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_cut") : 0); + menu->add_item(RTR("Cut"), MENU_CUT, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_cut") : Key::NONE); } - menu->add_item(RTR("Copy"), MENU_COPY, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_copy") : 0); + menu->add_item(RTR("Copy"), MENU_COPY, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_copy") : Key::NONE); if (editable) { - menu->add_item(RTR("Paste"), MENU_PASTE, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_paste") : 0); + menu->add_item(RTR("Paste"), MENU_PASTE, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_paste") : Key::NONE); } menu->add_separator(); if (is_selecting_enabled()) { - menu->add_item(RTR("Select All"), MENU_SELECT_ALL, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_text_select_all") : 0); + menu->add_item(RTR("Select All"), MENU_SELECT_ALL, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_text_select_all") : Key::NONE); } if (editable) { menu->add_item(RTR("Clear"), MENU_CLEAR); menu->add_separator(); - menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_undo") : 0); - menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_redo") : 0); + menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_undo") : Key::NONE); + menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_redo") : Key::NONE); } menu->add_separator(); - menu->add_submenu_item(RTR("Text writing direction"), "DirMenu"); + menu->add_submenu_item(RTR("Text Writing Direction"), "DirMenu"); menu->add_separator(); - menu->add_check_item(RTR("Display control characters"), MENU_DISPLAY_UCC); + menu->add_check_item(RTR("Display Control Characters"), MENU_DISPLAY_UCC); menu->set_item_checked(menu->get_item_index(MENU_DISPLAY_UCC), draw_control_chars); if (editable) { - menu->add_submenu_item(RTR("Insert control character"), "CTLMenu"); + menu->add_submenu_item(RTR("Insert Control Character"), "CTLMenu"); } menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), text_direction == TEXT_DIRECTION_INHERITED); menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_AUTO), text_direction == TEXT_DIRECTION_AUTO); diff --git a/scene/gui/line_edit.h b/scene/gui/line_edit.h index 923024dd56..854e54e8f1 100644 --- a/scene/gui/line_edit.h +++ b/scene/gui/line_edit.h @@ -38,13 +38,6 @@ class LineEdit : public Control { GDCLASS(LineEdit, Control); public: - enum Align { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT, - ALIGN_FILL - }; - enum MenuItems { MENU_CUT, MENU_COPY, @@ -78,7 +71,7 @@ public: }; private: - Align align = ALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_LEFT; bool editable = false; bool pass = false; @@ -97,6 +90,7 @@ private: float full_width = 0.0; bool selecting_enabled = true; + bool deselect_on_focus_loss_enabled = true; bool context_menu_enabled = true; PopupMenu *menu = nullptr; @@ -126,7 +120,13 @@ private: bool virtual_keyboard_enabled = true; + bool middle_mouse_paste_enabled = true; + + bool drag_action = false; + bool drag_caret_force_displayed = false; + Ref<Texture2D> right_icon; + bool flat = false; struct Selection { int begin = 0; @@ -166,7 +166,7 @@ private: void _clear_redo(); void _create_undo_state(); - int _get_menu_action_accelerator(const String &p_action); + Key _get_menu_action_accelerator(const String &p_action); void _shape(); void _fit_to_width(); @@ -187,7 +187,6 @@ private: void _toggle_draw_caret(); void clear_internal(); - void changed_internal(); void _editor_settings_changed(); @@ -212,8 +211,8 @@ protected: void _validate_property(PropertyInfo &property) const override; public: - void set_align(Align p_align); - Align get_align() const; + void set_horizontal_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_horizontal_alignment() const; virtual Variant get_drag_data(const Point2 &p_point) override; virtual bool can_drop_data(const Point2 &p_point, const Variant &p_data) const override; @@ -318,12 +317,21 @@ public: void set_virtual_keyboard_enabled(bool p_enable); bool is_virtual_keyboard_enabled() const; + void set_middle_mouse_paste_enabled(bool p_enabled); + bool is_middle_mouse_paste_enabled() const; + void set_selecting_enabled(bool p_enabled); bool is_selecting_enabled() const; + void set_deselect_on_focus_loss_enabled(const bool p_enabled); + bool is_deselect_on_focus_loss_enabled() const; + void set_right_icon(const Ref<Texture2D> &p_icon); Ref<Texture2D> get_right_icon(); + void set_flat(bool p_enabled); + bool is_flat() const; + virtual bool is_text_field() const override; void show_virtual_keyboard(); @@ -332,7 +340,6 @@ public: ~LineEdit(); }; -VARIANT_ENUM_CAST(LineEdit::Align); VARIANT_ENUM_CAST(LineEdit::MenuItems); #endif diff --git a/scene/gui/link_button.cpp b/scene/gui/link_button.cpp index 925e6f5b97..b59f4fb7d4 100644 --- a/scene/gui/link_button.cpp +++ b/scene/gui/link_button.cpp @@ -42,7 +42,7 @@ void LinkButton::_shape() { text_buf->set_direction((TextServer::Direction)text_direction); } TS->shaped_text_set_bidi_override(text_buf->get_rid(), structured_text_parser(st_parser, st_args, xl_text)); - text_buf->add_string(xl_text, font, font_size, opentype_features, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text_buf->add_string(xl_text, font, font_size, opentype_features, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); } void LinkButton::set_text(const String &p_text) { @@ -52,7 +52,7 @@ void LinkButton::set_text(const String &p_text) { text = p_text; xl_text = atr(text); _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } @@ -149,7 +149,7 @@ void LinkButton::_notification(int p_what) { xl_text = atr(text); _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { @@ -157,7 +157,7 @@ void LinkButton::_notification(int p_what) { } break; case NOTIFICATION_THEME_CHANGED: { _shape(); - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_DRAW: { @@ -168,7 +168,12 @@ void LinkButton::_notification(int p_what) { switch (get_draw_mode()) { case DRAW_NORMAL: { - color = get_theme_color(SNAME("font_color")); + if (has_focus()) { + color = get_theme_color(SNAME("font_focus_color")); + } else { + color = get_theme_color(SNAME("font_color")); + } + do_underline = underline_mode == UNDERLINE_MODE_ALWAYS; } break; case DRAW_HOVER_PRESSED: diff --git a/scene/gui/margin_container.cpp b/scene/gui/margin_container.cpp index 50b4d192a9..af239d67ae 100644 --- a/scene/gui/margin_container.cpp +++ b/scene/gui/margin_container.cpp @@ -90,7 +90,7 @@ void MarginContainer::_notification(int p_what) { } } break; case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); } break; } } diff --git a/scene/gui/menu_button.cpp b/scene/gui/menu_button.cpp index ceb2092e3a..32501b65a0 100644 --- a/scene/gui/menu_button.cpp +++ b/scene/gui/menu_button.cpp @@ -110,14 +110,6 @@ PopupMenu *MenuButton::get_popup() const { return popup; } -void MenuButton::_set_items(const Array &p_items) { - popup->set("items", p_items); -} - -Array MenuButton::_get_items() const { - return popup->get("items"); -} - void MenuButton::set_switch_on_hover(bool p_enabled) { switch_on_hover = p_enabled; } @@ -126,6 +118,16 @@ bool MenuButton::is_switch_on_hover() { return switch_on_hover; } +void MenuButton::set_item_count(int p_count) { + ERR_FAIL_COND(p_count < 0); + popup->set_item_count(p_count); + notify_property_list_changed(); +} + +int MenuButton::get_item_count() const { + return popup->get_item_count(); +} + void MenuButton::_notification(int p_what) { switch (p_what) { case NOTIFICATION_VISIBILITY_CHANGED: { @@ -146,16 +148,66 @@ void MenuButton::_notification(int p_what) { } } +bool MenuButton::_set(const StringName &p_name, const Variant &p_value) { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0] == "popup") { + bool valid; + popup->set(String(p_name).trim_prefix("popup/"), p_value, &valid); + return valid; + } + return false; +} + +bool MenuButton::_get(const StringName &p_name, Variant &r_ret) const { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0] == "popup") { + bool valid; + r_ret = popup->get(String(p_name).trim_prefix("popup/"), &valid); + return valid; + } + return false; +} + +void MenuButton::_get_property_list(List<PropertyInfo> *p_list) const { + for (int i = 0; i < popup->get_item_count(); i++) { + p_list->push_back(PropertyInfo(Variant::STRING, vformat("popup/item_%d/text", i))); + + PropertyInfo pi = PropertyInfo(Variant::OBJECT, vformat("popup/item_%d/icon", i), PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"); + pi.usage &= ~(popup->get_item_icon(i).is_null() ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::INT, vformat("popup/item_%d/checkable", i), PROPERTY_HINT_ENUM, "No,As checkbox,As radio button"); + pi.usage &= ~(!popup->is_item_checkable(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("popup/item_%d/checked", i)); + pi.usage &= ~(!popup->is_item_checked(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::INT, vformat("popup/item_%d/id", i), PROPERTY_HINT_RANGE, "1,10,1,or_greater"); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("popup/item_%d/disabled", i)); + pi.usage &= ~(!popup->is_item_disabled(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("popup/item_%d/separator", i)); + pi.usage &= ~(!popup->is_item_separator(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + } +} + void MenuButton::_bind_methods() { ClassDB::bind_method(D_METHOD("get_popup"), &MenuButton::get_popup); - ClassDB::bind_method(D_METHOD("_set_items"), &MenuButton::_set_items); - ClassDB::bind_method(D_METHOD("_get_items"), &MenuButton::_get_items); ClassDB::bind_method(D_METHOD("set_switch_on_hover", "enable"), &MenuButton::set_switch_on_hover); ClassDB::bind_method(D_METHOD("is_switch_on_hover"), &MenuButton::is_switch_on_hover); ClassDB::bind_method(D_METHOD("set_disable_shortcuts", "disabled"), &MenuButton::set_disable_shortcuts); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "items", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_items", "_get_items"); + ClassDB::bind_method(D_METHOD("set_item_count", "count"), &MenuButton::set_item_count); + ClassDB::bind_method(D_METHOD("get_item_count"), &MenuButton::get_item_count); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "switch_on_hover"), "set_switch_on_hover", "is_switch_on_hover"); + ADD_ARRAY_COUNT("Items", "item_count", "set_item_count", "get_item_count", "popup/item_"); ADD_SIGNAL(MethodInfo("about_to_popup")); } diff --git a/scene/gui/menu_button.h b/scene/gui/menu_button.h index 730495b65d..455b7dc870 100644 --- a/scene/gui/menu_button.h +++ b/scene/gui/menu_button.h @@ -44,15 +44,15 @@ class MenuButton : public Button { Vector2i mouse_pos_adjusted; - Array _get_items() const; - void _set_items(const Array &p_items); - virtual void gui_input(const Ref<InputEvent> &p_event) override; void _popup_visibility_changed(bool p_visible); protected: void _notification(int p_what); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; static void _bind_methods(); virtual void unhandled_key_input(const Ref<InputEvent> &p_event) override; @@ -64,6 +64,9 @@ public: bool is_switch_on_hover(); void set_disable_shortcuts(bool p_disabled); + void set_item_count(int p_count); + int get_item_count() const; + MenuButton(); ~MenuButton(); }; diff --git a/scene/gui/nine_patch_rect.cpp b/scene/gui/nine_patch_rect.cpp index 8bf25ac915..ea5c82306d 100644 --- a/scene/gui/nine_patch_rect.cpp +++ b/scene/gui/nine_patch_rect.cpp @@ -97,7 +97,7 @@ void NinePatchRect::set_texture(const Ref<Texture2D> &p_tex) { if (texture.is_valid()) texture->set_flags(texture->get_flags()&(~Texture::FLAG_REPEAT)); //remove repeat from texture, it looks bad in sprites */ - minimum_size_changed(); + update_minimum_size(); emit_signal(SceneStringNames::get_singleton()->texture_changed); } @@ -109,7 +109,7 @@ void NinePatchRect::set_patch_margin(Side p_side, int p_size) { ERR_FAIL_INDEX((int)p_side, 4); margin[p_side] = p_size; update(); - minimum_size_changed(); + update_minimum_size(); } int NinePatchRect::get_patch_margin(Side p_side) const { diff --git a/scene/gui/option_button.cpp b/scene/gui/option_button.cpp index 2adeb2d947..cbbda09261 100644 --- a/scene/gui/option_button.cpp +++ b/scene/gui/option_button.cpp @@ -71,7 +71,11 @@ void OptionButton::_notification(int p_what) { clr = get_theme_color(SNAME("font_disabled_color")); break; default: - clr = get_theme_color(SNAME("font_color")); + if (has_focus()) { + clr = get_theme_color(SNAME("font_focus_color")); + } else { + clr = get_theme_color(SNAME("font_color")); + } } } @@ -328,7 +332,7 @@ void OptionButton::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_items"), &OptionButton::_set_items); ClassDB::bind_method(D_METHOD("_get_items"), &OptionButton::_get_items); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "items", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_items", "_get_items"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "items", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_items", "_get_items"); // "selected" property must come after "items", otherwise GH-10213 occurs. ADD_PROPERTY(PropertyInfo(Variant::INT, "selected"), "_select_int", "get_selected"); ADD_SIGNAL(MethodInfo("item_selected", PropertyInfo(Variant::INT, "index"))); @@ -337,7 +341,7 @@ void OptionButton::_bind_methods() { OptionButton::OptionButton() { set_toggle_mode(true); - set_text_align(ALIGN_LEFT); + set_text_alignment(HORIZONTAL_ALIGNMENT_LEFT); if (is_layout_rtl()) { if (has_theme_icon(SNAME("arrow"))) { _set_internal_margin(SIDE_LEFT, Control::get_theme_icon(SNAME("arrow"))->get_width()); diff --git a/scene/gui/popup.cpp b/scene/gui/popup.cpp index be05fd5a60..a48ad0f770 100644 --- a/scene/gui/popup.cpp +++ b/scene/gui/popup.cpp @@ -36,7 +36,7 @@ void Popup::_input_from_window(const Ref<InputEvent> &p_event) { Ref<InputEventKey> key = p_event; - if (key.is_valid() && key->is_pressed() && key->get_keycode() == KEY_ESCAPE) { + if (key.is_valid() && key->is_pressed() && key->get_keycode() == Key::ESCAPE) { _close_pressed(); } } @@ -105,8 +105,6 @@ void Popup::_close_pressed() { _deinitialize_visible_parents(); call_deferred(SNAME("hide")); - - emit_signal(SNAME("cancelled")); } void Popup::set_as_minsize() { diff --git a/scene/gui/popup.h b/scene/gui/popup.h index c7090e7231..8458a75eef 100644 --- a/scene/gui/popup.h +++ b/scene/gui/popup.h @@ -80,7 +80,6 @@ protected: virtual Size2 _get_contents_minimum_size() const override; public: - void set_child_rect(Control *p_child); PopupPanel(); }; diff --git a/scene/gui/popup_menu.cpp b/scene/gui/popup_menu.cpp index c0a559e624..a61d77e95c 100644 --- a/scene/gui/popup_menu.cpp +++ b/scene/gui/popup_menu.cpp @@ -39,7 +39,7 @@ String PopupMenu::_get_accel_text(const Item &p_item) const { if (p_item.shortcut.is_valid()) { return p_item.shortcut->get_as_text(); - } else if (p_item.accel) { + } else if (p_item.accel != Key::NONE) { return keycode_get_string(p_item.accel); } return String(); @@ -74,13 +74,13 @@ Size2 PopupMenu::_get_contents_minimum_size() const { size.width += items[i].text_buf->get_size().x; size.height += vseparation; - if (items[i].accel || (items[i].shortcut.is_valid() && items[i].shortcut->has_valid_event())) { + if (items[i].accel != Key::NONE || (items[i].shortcut.is_valid() && items[i].shortcut->has_valid_event())) { int accel_w = hseparation * 2; accel_w += items[i].accel_text_buf->get_size().x; accel_max_w = MAX(accel_w, accel_max_w); } - if (items[i].submenu != "") { + if (!items[i].submenu.is_empty()) { size.width += get_theme_icon(SNAME("submenu"))->get_width(); } @@ -216,7 +216,7 @@ void PopupMenu::_activate_submenu(int p_over) { submenu_pos.x = this_pos.x + submenu_size.width; } - if (submenu_pos.x + submenu_size.width > get_parent_rect().size.width) { + if (submenu_pos.x + submenu_size.width > get_parent_rect().position.x + get_parent_rect().size.width) { submenu_pos.x = this_pos.x - submenu_size.width; } @@ -326,13 +326,13 @@ void PopupMenu::gui_input(const Ref<InputEvent> &p_event) { set_input_as_handled(); } } else if (p_event->is_action("ui_right") && p_event->is_pressed()) { - if (mouse_over >= 0 && mouse_over < items.size() && !items[mouse_over].separator && items[mouse_over].submenu != "" && submenu_over != mouse_over) { + if (mouse_over >= 0 && mouse_over < items.size() && !!items[mouse_over].separator && items[mouse_over].submenu.is_empty() && submenu_over != mouse_over) { _activate_submenu(mouse_over); set_input_as_handled(); } } else if (p_event->is_action("ui_accept") && p_event->is_pressed()) { if (mouse_over >= 0 && mouse_over < items.size() && !items[mouse_over].separator) { - if (items[mouse_over].submenu != "" && submenu_over != mouse_over) { + if (!items[mouse_over].submenu.is_empty() && submenu_over != mouse_over) { _activate_submenu(mouse_over); } else { activate_item(mouse_over); @@ -358,20 +358,20 @@ void PopupMenu::gui_input(const Ref<InputEvent> &p_event) { return; } - int button_idx = b->get_button_index(); + MouseButton button_idx = b->get_button_index(); if (!b->is_pressed()) { // Activate the item on release of either the left mouse button or // any mouse button held down when the popup was opened. // This allows for opening the popup and triggering an action in a single mouse click. - if (button_idx == MOUSE_BUTTON_LEFT || (initial_button_mask & (1 << (button_idx - 1)))) { + if (button_idx == MouseButton::LEFT || (initial_button_mask & mouse_button_to_mask(button_idx)) != MouseButton::NONE) { bool was_during_grabbed_click = during_grabbed_click; during_grabbed_click = false; - initial_button_mask = 0; + initial_button_mask = MouseButton::NONE; // Disable clicks under a time threshold to avoid selection right when opening the popup. uint64_t now = OS::get_singleton()->get_ticks_msec(); uint64_t diff = now - popup_time_msec; - if (diff < 100) { + if (diff < 150) { return; } @@ -387,7 +387,7 @@ void PopupMenu::gui_input(const Ref<InputEvent> &p_event) { return; } - if (items[over].submenu != "") { + if (!items[over].submenu.is_empty()) { _activate_submenu(over); return; } @@ -419,7 +419,7 @@ void PopupMenu::gui_input(const Ref<InputEvent> &p_event) { return; } - if (items[over].submenu != "" && submenu_over != over) { + if (!items[over].submenu.is_empty() && submenu_over != over) { submenu_over = over; submenu_timer->start(); } @@ -558,7 +558,7 @@ void PopupMenu::_draw_items() { if (items[i].separator) { int sep_h = separator->get_center_size().height + separator->get_minimum_size().height; int sep_ofs = Math::floor((h - sep_h) / 2.0); - if (text != String()) { + if (!text.is_empty()) { int text_size = items[i].text_buf->get_size().width; int text_center = display_width / 2; int text_left = text_center - text_size / 2; @@ -599,7 +599,7 @@ void PopupMenu::_draw_items() { } // Submenu arrow on right hand side - if (items[i].submenu != "") { + if (!items[i].submenu.is_empty()) { if (rtl) { submenu->draw(ci, Point2(scroll_width + style->get_margin(SIDE_LEFT) + item_end_padding, item_ofs.y + Math::floor(h - submenu->get_height()) / 2), icon_color); } else { @@ -611,7 +611,7 @@ void PopupMenu::_draw_items() { Color font_outline_color = get_theme_color(SNAME("font_outline_color")); int outline_size = get_theme_constant(SNAME("outline_size")); if (items[i].separator) { - if (text != String()) { + if (!text.is_empty()) { int center = (display_width - items[i].text_buf->get_size().width) / 2; Vector2 text_pos = Point2(center, item_ofs.y + Math::floor((h - items[i].text_buf->get_size().y) / 2.0)); if (outline_size > 0 && font_outline_color.a > 0) { @@ -637,7 +637,7 @@ void PopupMenu::_draw_items() { } // Accelerator / Shortcut - if (items[i].accel || (items[i].shortcut.is_valid() && items[i].shortcut->has_valid_event())) { + if (items[i].accel != Key::NONE || (items[i].shortcut.is_valid() && items[i].shortcut->has_valid_event())) { if (rtl) { item_ofs.x = scroll_width + style->get_margin(SIDE_LEFT) + item_end_padding; } else { @@ -701,7 +701,7 @@ void PopupMenu::_shape_item(int p_item) { } else { items.write[p_item].text_buf->set_direction((TextServer::Direction)items[p_item].text_direction); } - items.write[p_item].text_buf->add_string(items.write[p_item].xl_text, font, font_size, items[p_item].opentype_features, (items[p_item].language != "") ? items[p_item].language : TranslationServer::get_singleton()->get_tool_locale()); + items.write[p_item].text_buf->add_string(items.write[p_item].xl_text, font, font_size, items[p_item].opentype_features, !items[p_item].language.is_empty() ? items[p_item].language : TranslationServer::get_singleton()->get_tool_locale()); items.write[p_item].accel_text_buf->clear(); items.write[p_item].accel_text_buf->set_direction(is_layout_rtl() ? TextServer::DIRECTION_RTL : TextServer::DIRECTION_LTR); @@ -736,7 +736,7 @@ void PopupMenu::_notification(int p_what) { grab_focus(); } break; case NOTIFICATION_WM_MOUSE_EXIT: { - if (mouse_over >= 0 && (items[mouse_over].submenu == "" || submenu_over != -1)) { + if (mouse_over >= 0 && (items[mouse_over].submenu.is_empty() || submenu_over != -1)) { mouse_over = -1; control->update(); } @@ -769,7 +769,7 @@ void PopupMenu::_notification(int p_what) { } for (int i = 0; i < items.size(); i++) { - if (items[i].submenu == "") { + if (items[i].submenu.is_empty()) { continue; } @@ -813,16 +813,17 @@ void PopupMenu::_notification(int p_what) { item.id = p_id == -1 ? items.size() : p_id; \ item.accel = p_accel; -void PopupMenu::add_item(const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_item(const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); items.push_back(item); _shape_item(items.size() - 1); control->update(); child_controls_changed(); + notify_property_list_changed(); } -void PopupMenu::add_icon_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_icon_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.icon = p_icon; @@ -830,9 +831,10 @@ void PopupMenu::add_icon_item(const Ref<Texture2D> &p_icon, const String &p_labe _shape_item(items.size() - 1); control->update(); child_controls_changed(); + notify_property_list_changed(); } -void PopupMenu::add_check_item(const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_check_item(const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.checkable_type = Item::CHECKABLE_TYPE_CHECK_BOX; @@ -842,7 +844,7 @@ void PopupMenu::add_check_item(const String &p_label, int p_id, uint32_t p_accel child_controls_changed(); } -void PopupMenu::add_icon_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_icon_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.icon = p_icon; @@ -853,7 +855,7 @@ void PopupMenu::add_icon_check_item(const Ref<Texture2D> &p_icon, const String & child_controls_changed(); } -void PopupMenu::add_radio_check_item(const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_radio_check_item(const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.checkable_type = Item::CHECKABLE_TYPE_RADIO_BUTTON; @@ -863,7 +865,7 @@ void PopupMenu::add_radio_check_item(const String &p_label, int p_id, uint32_t p child_controls_changed(); } -void PopupMenu::add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, uint32_t p_accel) { +void PopupMenu::add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.icon = p_icon; @@ -874,7 +876,7 @@ void PopupMenu::add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const St child_controls_changed(); } -void PopupMenu::add_multistate_item(const String &p_label, int p_max_states, int p_default_state, int p_id, uint32_t p_accel) { +void PopupMenu::add_multistate_item(const String &p_label, int p_max_states, int p_default_state, int p_id, Key p_accel) { Item item; ITEM_SETUP_WITH_ACCEL(p_label, p_id, p_accel); item.max_states = p_max_states; @@ -1043,7 +1045,7 @@ void PopupMenu::set_item_id(int p_idx, int p_id) { child_controls_changed(); } -void PopupMenu::set_item_accelerator(int p_idx, uint32_t p_accel) { +void PopupMenu::set_item_accelerator(int p_idx, Key p_accel) { ERR_FAIL_INDEX(p_idx, items.size()); items.write[p_idx].accel = p_accel; items.write[p_idx].dirty = true; @@ -1119,8 +1121,8 @@ Ref<Texture2D> PopupMenu::get_item_icon(int p_idx) const { return items[p_idx].icon; } -uint32_t PopupMenu::get_item_accelerator(int p_idx) const { - ERR_FAIL_INDEX_V(p_idx, items.size(), 0); +Key PopupMenu::get_item_accelerator(int p_idx) const { + ERR_FAIL_INDEX_V(p_idx, items.size(), Key::NONE); return items[p_idx].accel; } @@ -1271,30 +1273,38 @@ int PopupMenu::get_current_index() const { return mouse_over; } +void PopupMenu::set_item_count(int p_count) { + ERR_FAIL_COND(p_count < 0); + items.resize(p_count); + control->update(); + child_controls_changed(); + notify_property_list_changed(); +} + int PopupMenu::get_item_count() const { return items.size(); } bool PopupMenu::activate_item_by_event(const Ref<InputEvent> &p_event, bool p_for_global_only) { - Key code = KEY_NONE; + Key code = Key::NONE; Ref<InputEventKey> k = p_event; if (k.is_valid()) { code = k->get_keycode(); - if (code == KEY_NONE) { + if (code == Key::NONE) { code = (Key)k->get_unicode(); } if (k->is_ctrl_pressed()) { - code |= KEY_MASK_CTRL; + code |= KeyModifierMask::CTRL; } if (k->is_alt_pressed()) { - code |= KEY_MASK_ALT; + code |= KeyModifierMask::ALT; } if (k->is_meta_pressed()) { - code |= KEY_MASK_META; + code |= KeyModifierMask::META; } if (k->is_shift_pressed()) { - code |= KEY_MASK_SHIFT; + code |= KeyModifierMask::SHIFT; } } @@ -1308,12 +1318,12 @@ bool PopupMenu::activate_item_by_event(const Ref<InputEvent> &p_event, bool p_fo return true; } - if (code != 0 && items[i].accel == code) { + if (code != Key::NONE && items[i].accel == code) { activate_item(i); return true; } - if (items[i].submenu != "") { + if (!items[i].submenu.is_empty()) { Node *n = get_node(items[i].submenu); if (!n) { continue; @@ -1393,7 +1403,7 @@ void PopupMenu::remove_item(int p_idx) { _unref_shortcut(items[p_idx].shortcut); } - items.remove(p_idx); + items.remove_at(p_idx); control->update(); child_controls_changed(); } @@ -1402,7 +1412,7 @@ void PopupMenu::add_separator(const String &p_text, int p_id) { Item sep; sep.separator = true; sep.id = p_id; - if (p_text != String()) { + if (!p_text.is_empty()) { sep.text = p_text; sep.xl_text = atr(p_text); } @@ -1420,27 +1430,7 @@ void PopupMenu::clear() { mouse_over = -1; control->update(); child_controls_changed(); -} - -Array PopupMenu::_get_items() const { - Array items; - for (int i = 0; i < get_item_count(); i++) { - items.push_back(get_item_text(i)); - items.push_back(get_item_icon(i)); - // For compatibility, use false/true for no/checkbox and integers for other values - int ct = this->items[i].checkable_type; - items.push_back(Variant(ct <= Item::CHECKABLE_TYPE_CHECK_BOX ? is_item_checkable(i) : ct)); - items.push_back(is_item_checked(i)); - items.push_back(is_item_disabled(i)); - - items.push_back(get_item_id(i)); - items.push_back(get_item_accelerator(i)); - items.push_back(get_item_metadata(i)); - items.push_back(get_item_submenu(i)); - items.push_back(is_item_separator(i)); - } - - return items; + notify_property_list_changed(); } void PopupMenu::_ref_shortcut(Ref<Shortcut> p_sc) { @@ -1461,45 +1451,6 @@ void PopupMenu::_unref_shortcut(Ref<Shortcut> p_sc) { } } -void PopupMenu::_set_items(const Array &p_items) { - ERR_FAIL_COND(p_items.size() % 10); - clear(); - - for (int i = 0; i < p_items.size(); i += 10) { - String text = p_items[i + 0]; - Ref<Texture2D> icon = p_items[i + 1]; - // For compatibility, use false/true for no/checkbox and integers for other values - bool checkable = p_items[i + 2]; - bool radio_checkable = (int)p_items[i + 2] == Item::CHECKABLE_TYPE_RADIO_BUTTON; - bool checked = p_items[i + 3]; - bool disabled = p_items[i + 4]; - - int id = p_items[i + 5]; - int accel = p_items[i + 6]; - Variant meta = p_items[i + 7]; - String subm = p_items[i + 8]; - bool sep = p_items[i + 9]; - - int idx = get_item_count(); - add_item(text, id); - set_item_icon(idx, icon); - if (checkable) { - if (radio_checkable) { - set_item_as_radio_checkable(idx, true); - } else { - set_item_as_checkable(idx, true); - } - } - set_item_checked(idx, checked); - set_item_disabled(idx, disabled); - set_item_id(idx, id); - set_item_metadata(idx, meta); - set_item_as_separator(idx, sep); - set_item_accelerator(idx, accel); - set_item_submenu(idx, subm); - } -} - // Hide on item selection determines whether or not the popup will close after item selection void PopupMenu::set_hide_on_item_selection(bool p_enabled) { hide_on_item_selection = p_enabled; @@ -1559,7 +1510,7 @@ void PopupMenu::set_parent_rect(const Rect2 &p_rect) { void PopupMenu::get_translatable_strings(List<String> *p_strings) const { for (int i = 0; i < items.size(); i++) { - if (items[i].xl_text != "") { + if (!items[i].xl_text.is_empty()) { p_strings->push_back(items[i].xl_text); } } @@ -1581,6 +1532,145 @@ void PopupMenu::take_mouse_focus() { } } +bool PopupMenu::_set(const StringName &p_name, const Variant &p_value) { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0].begins_with("item_") && components[0].trim_prefix("item_").is_valid_int()) { + int item_index = components[0].trim_prefix("item_").to_int(); + String property = components[1]; + if (property == "text") { + set_item_text(item_index, p_value); + return true; + } else if (property == "icon") { + set_item_icon(item_index, p_value); + return true; + } else if (property == "checkable") { + bool radio_checkable = (int)p_value == Item::CHECKABLE_TYPE_RADIO_BUTTON; + if (radio_checkable) { + set_item_as_radio_checkable(item_index, true); + } else { + bool checkable = p_value; + set_item_as_checkable(item_index, checkable); + } + return true; + } else if (property == "checked") { + set_item_checked(item_index, p_value); + return true; + } else if (property == "id") { + set_item_id(item_index, p_value); + return true; + } else if (components[1] == "disabled") { + set_item_disabled(item_index, p_value); + return true; + } else if (property == "separator") { + set_item_as_separator(item_index, p_value); + return true; + } + } +#ifndef DISABLE_DEPRECATED + // Compatibility. + if (p_name == "items") { + Array arr = p_value; + ERR_FAIL_COND_V(arr.size() % 10, false); + clear(); + + for (int i = 0; i < arr.size(); i += 10) { + String text = arr[i + 0]; + Ref<Texture2D> icon = arr[i + 1]; + // For compatibility, use false/true for no/checkbox and integers for other values + bool checkable = arr[i + 2]; + bool radio_checkable = (int)arr[i + 2] == Item::CHECKABLE_TYPE_RADIO_BUTTON; + bool checked = arr[i + 3]; + bool disabled = arr[i + 4]; + + int id = arr[i + 5]; + int accel = arr[i + 6]; + Variant meta = arr[i + 7]; + String subm = arr[i + 8]; + bool sep = arr[i + 9]; + + int idx = get_item_count(); + add_item(text, id); + set_item_icon(idx, icon); + if (checkable) { + if (radio_checkable) { + set_item_as_radio_checkable(idx, true); + } else { + set_item_as_checkable(idx, true); + } + } + set_item_checked(idx, checked); + set_item_disabled(idx, disabled); + set_item_id(idx, id); + set_item_metadata(idx, meta); + set_item_as_separator(idx, sep); + set_item_accelerator(idx, (Key)accel); + set_item_submenu(idx, subm); + } + } +#endif + return false; +} + +bool PopupMenu::_get(const StringName &p_name, Variant &r_ret) const { + Vector<String> components = String(p_name).split("/", true, 2); + if (components.size() >= 2 && components[0].begins_with("item_") && components[0].trim_prefix("item_").is_valid_int()) { + int item_index = components[0].trim_prefix("item_").to_int(); + String property = components[1]; + if (property == "text") { + r_ret = get_item_text(item_index); + return true; + } else if (property == "icon") { + r_ret = get_item_icon(item_index); + return true; + } else if (property == "checkable") { + r_ret = this->items[item_index].checkable_type; + return true; + } else if (property == "checked") { + r_ret = is_item_checked(item_index); + return true; + } else if (property == "id") { + r_ret = get_item_id(item_index); + return true; + } else if (components[1] == "disabled") { + r_ret = is_item_disabled(item_index); + return true; + } else if (property == "separator") { + r_ret = is_item_separator(item_index); + return true; + } + } + return false; +} + +void PopupMenu::_get_property_list(List<PropertyInfo> *p_list) const { + for (int i = 0; i < items.size(); i++) { + p_list->push_back(PropertyInfo(Variant::STRING, vformat("item_%d/text", i))); + + PropertyInfo pi = PropertyInfo(Variant::OBJECT, vformat("item_%d/icon", i), PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"); + pi.usage &= ~(get_item_icon(i).is_null() ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::INT, vformat("item_%d/checkable", i), PROPERTY_HINT_ENUM, "No,As checkbox,As radio button"); + pi.usage &= ~(!is_item_checkable(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("item_%d/checked", i)); + pi.usage &= ~(!is_item_checked(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::INT, vformat("item_%d/id", i), PROPERTY_HINT_RANGE, "1,10,1,or_greater"); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("item_%d/disabled", i)); + pi.usage &= ~(!is_item_disabled(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + + pi = PropertyInfo(Variant::BOOL, vformat("item_%d/separator", i)); + pi.usage &= ~(!is_item_separator(i) ? PROPERTY_USAGE_STORAGE : 0); + p_list->push_back(pi); + } +} + void PopupMenu::_bind_methods() { ClassDB::bind_method(D_METHOD("add_item", "label", "id", "accel"), &PopupMenu::add_item, DEFVAL(-1), DEFVAL(0)); ClassDB::bind_method(D_METHOD("add_icon_item", "texture", "label", "id", "accel"), &PopupMenu::add_icon_item, DEFVAL(-1), DEFVAL(0)); @@ -1600,59 +1690,57 @@ void PopupMenu::_bind_methods() { ClassDB::bind_method(D_METHOD("add_submenu_item", "label", "submenu", "id"), &PopupMenu::add_submenu_item, DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("set_item_text", "idx", "text"), &PopupMenu::set_item_text); - ClassDB::bind_method(D_METHOD("set_item_text_direction", "idx", "direction"), &PopupMenu::set_item_text_direction); - ClassDB::bind_method(D_METHOD("set_item_opentype_feature", "idx", "tag", "value"), &PopupMenu::set_item_opentype_feature); - ClassDB::bind_method(D_METHOD("set_item_language", "idx", "language"), &PopupMenu::set_item_language); - ClassDB::bind_method(D_METHOD("set_item_icon", "idx", "icon"), &PopupMenu::set_item_icon); - ClassDB::bind_method(D_METHOD("set_item_checked", "idx", "checked"), &PopupMenu::set_item_checked); - ClassDB::bind_method(D_METHOD("set_item_id", "idx", "id"), &PopupMenu::set_item_id); - ClassDB::bind_method(D_METHOD("set_item_accelerator", "idx", "accel"), &PopupMenu::set_item_accelerator); - ClassDB::bind_method(D_METHOD("set_item_metadata", "idx", "metadata"), &PopupMenu::set_item_metadata); - ClassDB::bind_method(D_METHOD("set_item_disabled", "idx", "disabled"), &PopupMenu::set_item_disabled); - ClassDB::bind_method(D_METHOD("set_item_submenu", "idx", "submenu"), &PopupMenu::set_item_submenu); - ClassDB::bind_method(D_METHOD("set_item_as_separator", "idx", "enable"), &PopupMenu::set_item_as_separator); - ClassDB::bind_method(D_METHOD("set_item_as_checkable", "idx", "enable"), &PopupMenu::set_item_as_checkable); - ClassDB::bind_method(D_METHOD("set_item_as_radio_checkable", "idx", "enable"), &PopupMenu::set_item_as_radio_checkable); - ClassDB::bind_method(D_METHOD("set_item_tooltip", "idx", "tooltip"), &PopupMenu::set_item_tooltip); - ClassDB::bind_method(D_METHOD("set_item_shortcut", "idx", "shortcut", "global"), &PopupMenu::set_item_shortcut, DEFVAL(false)); - ClassDB::bind_method(D_METHOD("set_item_multistate", "idx", "state"), &PopupMenu::set_item_multistate); - ClassDB::bind_method(D_METHOD("set_item_shortcut_disabled", "idx", "disabled"), &PopupMenu::set_item_shortcut_disabled); - - ClassDB::bind_method(D_METHOD("toggle_item_checked", "idx"), &PopupMenu::toggle_item_checked); - ClassDB::bind_method(D_METHOD("toggle_item_multistate", "idx"), &PopupMenu::toggle_item_multistate); - - ClassDB::bind_method(D_METHOD("get_item_text", "idx"), &PopupMenu::get_item_text); - ClassDB::bind_method(D_METHOD("get_item_text_direction", "idx"), &PopupMenu::get_item_text_direction); - ClassDB::bind_method(D_METHOD("get_item_opentype_feature", "idx", "tag"), &PopupMenu::get_item_opentype_feature); - ClassDB::bind_method(D_METHOD("clear_item_opentype_features", "idx"), &PopupMenu::clear_item_opentype_features); - ClassDB::bind_method(D_METHOD("get_item_language", "idx"), &PopupMenu::get_item_language); - ClassDB::bind_method(D_METHOD("get_item_icon", "idx"), &PopupMenu::get_item_icon); - ClassDB::bind_method(D_METHOD("is_item_checked", "idx"), &PopupMenu::is_item_checked); - ClassDB::bind_method(D_METHOD("get_item_id", "idx"), &PopupMenu::get_item_id); + ClassDB::bind_method(D_METHOD("set_item_text", "index", "text"), &PopupMenu::set_item_text); + ClassDB::bind_method(D_METHOD("set_item_text_direction", "index", "direction"), &PopupMenu::set_item_text_direction); + ClassDB::bind_method(D_METHOD("set_item_opentype_feature", "index", "tag", "value"), &PopupMenu::set_item_opentype_feature); + ClassDB::bind_method(D_METHOD("set_item_language", "index", "language"), &PopupMenu::set_item_language); + ClassDB::bind_method(D_METHOD("set_item_icon", "index", "icon"), &PopupMenu::set_item_icon); + ClassDB::bind_method(D_METHOD("set_item_checked", "index", "checked"), &PopupMenu::set_item_checked); + ClassDB::bind_method(D_METHOD("set_item_id", "index", "id"), &PopupMenu::set_item_id); + ClassDB::bind_method(D_METHOD("set_item_accelerator", "index", "accel"), &PopupMenu::set_item_accelerator); + ClassDB::bind_method(D_METHOD("set_item_metadata", "index", "metadata"), &PopupMenu::set_item_metadata); + ClassDB::bind_method(D_METHOD("set_item_disabled", "index", "disabled"), &PopupMenu::set_item_disabled); + ClassDB::bind_method(D_METHOD("set_item_submenu", "index", "submenu"), &PopupMenu::set_item_submenu); + ClassDB::bind_method(D_METHOD("set_item_as_separator", "index", "enable"), &PopupMenu::set_item_as_separator); + ClassDB::bind_method(D_METHOD("set_item_as_checkable", "index", "enable"), &PopupMenu::set_item_as_checkable); + ClassDB::bind_method(D_METHOD("set_item_as_radio_checkable", "index", "enable"), &PopupMenu::set_item_as_radio_checkable); + ClassDB::bind_method(D_METHOD("set_item_tooltip", "index", "tooltip"), &PopupMenu::set_item_tooltip); + ClassDB::bind_method(D_METHOD("set_item_shortcut", "index", "shortcut", "global"), &PopupMenu::set_item_shortcut, DEFVAL(false)); + ClassDB::bind_method(D_METHOD("set_item_multistate", "index", "state"), &PopupMenu::set_item_multistate); + ClassDB::bind_method(D_METHOD("set_item_shortcut_disabled", "index", "disabled"), &PopupMenu::set_item_shortcut_disabled); + + ClassDB::bind_method(D_METHOD("toggle_item_checked", "index"), &PopupMenu::toggle_item_checked); + ClassDB::bind_method(D_METHOD("toggle_item_multistate", "index"), &PopupMenu::toggle_item_multistate); + + ClassDB::bind_method(D_METHOD("get_item_text", "index"), &PopupMenu::get_item_text); + ClassDB::bind_method(D_METHOD("get_item_text_direction", "index"), &PopupMenu::get_item_text_direction); + ClassDB::bind_method(D_METHOD("get_item_opentype_feature", "index", "tag"), &PopupMenu::get_item_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_item_opentype_features", "index"), &PopupMenu::clear_item_opentype_features); + ClassDB::bind_method(D_METHOD("get_item_language", "index"), &PopupMenu::get_item_language); + ClassDB::bind_method(D_METHOD("get_item_icon", "index"), &PopupMenu::get_item_icon); + ClassDB::bind_method(D_METHOD("is_item_checked", "index"), &PopupMenu::is_item_checked); + ClassDB::bind_method(D_METHOD("get_item_id", "index"), &PopupMenu::get_item_id); ClassDB::bind_method(D_METHOD("get_item_index", "id"), &PopupMenu::get_item_index); - ClassDB::bind_method(D_METHOD("get_item_accelerator", "idx"), &PopupMenu::get_item_accelerator); - ClassDB::bind_method(D_METHOD("get_item_metadata", "idx"), &PopupMenu::get_item_metadata); - ClassDB::bind_method(D_METHOD("is_item_disabled", "idx"), &PopupMenu::is_item_disabled); - ClassDB::bind_method(D_METHOD("get_item_submenu", "idx"), &PopupMenu::get_item_submenu); - ClassDB::bind_method(D_METHOD("is_item_separator", "idx"), &PopupMenu::is_item_separator); - ClassDB::bind_method(D_METHOD("is_item_checkable", "idx"), &PopupMenu::is_item_checkable); - ClassDB::bind_method(D_METHOD("is_item_radio_checkable", "idx"), &PopupMenu::is_item_radio_checkable); - ClassDB::bind_method(D_METHOD("is_item_shortcut_disabled", "idx"), &PopupMenu::is_item_shortcut_disabled); - ClassDB::bind_method(D_METHOD("get_item_tooltip", "idx"), &PopupMenu::get_item_tooltip); - ClassDB::bind_method(D_METHOD("get_item_shortcut", "idx"), &PopupMenu::get_item_shortcut); + ClassDB::bind_method(D_METHOD("get_item_accelerator", "index"), &PopupMenu::get_item_accelerator); + ClassDB::bind_method(D_METHOD("get_item_metadata", "index"), &PopupMenu::get_item_metadata); + ClassDB::bind_method(D_METHOD("is_item_disabled", "index"), &PopupMenu::is_item_disabled); + ClassDB::bind_method(D_METHOD("get_item_submenu", "index"), &PopupMenu::get_item_submenu); + ClassDB::bind_method(D_METHOD("is_item_separator", "index"), &PopupMenu::is_item_separator); + ClassDB::bind_method(D_METHOD("is_item_checkable", "index"), &PopupMenu::is_item_checkable); + ClassDB::bind_method(D_METHOD("is_item_radio_checkable", "index"), &PopupMenu::is_item_radio_checkable); + ClassDB::bind_method(D_METHOD("is_item_shortcut_disabled", "index"), &PopupMenu::is_item_shortcut_disabled); + ClassDB::bind_method(D_METHOD("get_item_tooltip", "index"), &PopupMenu::get_item_tooltip); + ClassDB::bind_method(D_METHOD("get_item_shortcut", "index"), &PopupMenu::get_item_shortcut); ClassDB::bind_method(D_METHOD("get_current_index"), &PopupMenu::get_current_index); + ClassDB::bind_method(D_METHOD("set_item_count", "count"), &PopupMenu::set_item_count); ClassDB::bind_method(D_METHOD("get_item_count"), &PopupMenu::get_item_count); - ClassDB::bind_method(D_METHOD("remove_item", "idx"), &PopupMenu::remove_item); + ClassDB::bind_method(D_METHOD("remove_item", "index"), &PopupMenu::remove_item); ClassDB::bind_method(D_METHOD("add_separator", "label", "id"), &PopupMenu::add_separator, DEFVAL(String()), DEFVAL(-1)); ClassDB::bind_method(D_METHOD("clear"), &PopupMenu::clear); - ClassDB::bind_method(D_METHOD("_set_items"), &PopupMenu::_set_items); - ClassDB::bind_method(D_METHOD("_get_items"), &PopupMenu::_get_items); - ClassDB::bind_method(D_METHOD("set_hide_on_item_selection", "enable"), &PopupMenu::set_hide_on_item_selection); ClassDB::bind_method(D_METHOD("is_hide_on_item_selection"), &PopupMenu::is_hide_on_item_selection); @@ -1668,13 +1756,14 @@ void PopupMenu::_bind_methods() { ClassDB::bind_method(D_METHOD("set_allow_search", "allow"), &PopupMenu::set_allow_search); ClassDB::bind_method(D_METHOD("get_allow_search"), &PopupMenu::get_allow_search); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "items", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_items", "_get_items"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hide_on_item_selection"), "set_hide_on_item_selection", "is_hide_on_item_selection"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hide_on_checkable_item_selection"), "set_hide_on_checkable_item_selection", "is_hide_on_checkable_item_selection"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hide_on_state_item_selection"), "set_hide_on_state_item_selection", "is_hide_on_state_item_selection"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "submenu_popup_delay"), "set_submenu_popup_delay", "get_submenu_popup_delay"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_search"), "set_allow_search", "get_allow_search"); + ADD_ARRAY_COUNT("Items", "item_count", "set_item_count", "get_item_count", "item_"); + ADD_SIGNAL(MethodInfo("id_pressed", PropertyInfo(Variant::INT, "id"))); ADD_SIGNAL(MethodInfo("id_focused", PropertyInfo(Variant::INT, "id"))); ADD_SIGNAL(MethodInfo("index_pressed", PropertyInfo(Variant::INT, "index"))); diff --git a/scene/gui/popup_menu.h b/scene/gui/popup_menu.h index 428076c6da..22912fb59c 100644 --- a/scene/gui/popup_menu.h +++ b/scene/gui/popup_menu.h @@ -66,7 +66,7 @@ class PopupMenu : public Popup { Variant metadata; String submenu; String tooltip; - uint32_t accel = 0; + Key accel = Key::NONE; int _ofs_cache = 0; int _height_cache = 0; int h_ofs = 0; @@ -92,7 +92,7 @@ class PopupMenu : public Popup { Timer *submenu_timer; List<Rect2> autohide_areas; Vector<Item> items; - int initial_button_mask = 0; + MouseButton initial_button_mask = MouseButton::NONE; bool during_grabbed_click = false; int mouse_over = -1; int submenu_over = -1; @@ -117,9 +117,6 @@ class PopupMenu : public Popup { bool hide_on_multistate_item_selection = false; Vector2 moved; - Array _get_items() const; - void _set_items(const Array &p_items); - Map<Ref<Shortcut>, int> shortcut_refcount; void _ref_shortcut(Ref<Shortcut> p_sc); @@ -141,6 +138,9 @@ class PopupMenu : public Popup { protected: void _notification(int p_what); + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; static void _bind_methods(); public: @@ -148,14 +148,14 @@ public: // this value should be updated to reflect the new size. static const int ITEM_PROPERTY_SIZE = 10; - void add_item(const String &p_label, int p_id = -1, uint32_t p_accel = 0); - void add_icon_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, uint32_t p_accel = 0); - void add_check_item(const String &p_label, int p_id = -1, uint32_t p_accel = 0); - void add_icon_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, uint32_t p_accel = 0); - void add_radio_check_item(const String &p_label, int p_id = -1, uint32_t p_accel = 0); - void add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, uint32_t p_accel = 0); + void add_item(const String &p_label, int p_id = -1, Key p_accel = Key::NONE); + void add_icon_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, Key p_accel = Key::NONE); + void add_check_item(const String &p_label, int p_id = -1, Key p_accel = Key::NONE); + void add_icon_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, Key p_accel = Key::NONE); + void add_radio_check_item(const String &p_label, int p_id = -1, Key p_accel = Key::NONE); + void add_icon_radio_check_item(const Ref<Texture2D> &p_icon, const String &p_label, int p_id = -1, Key p_accel = Key::NONE); - void add_multistate_item(const String &p_label, int p_max_states, int p_default_state = 0, int p_id = -1, uint32_t p_accel = 0); + void add_multistate_item(const String &p_label, int p_max_states, int p_default_state = 0, int p_id = -1, Key p_accel = Key::NONE); void add_shortcut(const Ref<Shortcut> &p_shortcut, int p_id = -1, bool p_global = false); void add_icon_shortcut(const Ref<Texture2D> &p_icon, const Ref<Shortcut> &p_shortcut, int p_id = -1, bool p_global = false); @@ -175,7 +175,7 @@ public: void set_item_icon(int p_idx, const Ref<Texture2D> &p_icon); void set_item_checked(int p_idx, bool p_checked); void set_item_id(int p_idx, int p_id); - void set_item_accelerator(int p_idx, uint32_t p_accel); + void set_item_accelerator(int p_idx, Key p_accel); void set_item_metadata(int p_idx, const Variant &p_meta); void set_item_disabled(int p_idx, bool p_disabled); void set_item_submenu(int p_idx, const String &p_submenu); @@ -200,7 +200,7 @@ public: bool is_item_checked(int p_idx) const; int get_item_id(int p_idx) const; int get_item_index(int p_id) const; - uint32_t get_item_accelerator(int p_idx) const; + Key get_item_accelerator(int p_idx) const; Variant get_item_metadata(int p_idx) const; bool is_item_disabled(int p_idx) const; String get_item_submenu(int p_idx) const; @@ -213,6 +213,8 @@ public: int get_item_state(int p_idx) const; int get_current_index() const; + + void set_item_count(int p_count); int get_item_count() const; bool activate_item_by_event(const Ref<InputEvent> &p_event, bool p_for_global_only = false); diff --git a/scene/gui/range.cpp b/scene/gui/range.cpp index 92d4261d8d..c4f05a7975 100644 --- a/scene/gui/range.cpp +++ b/scene/gui/range.cpp @@ -61,6 +61,11 @@ void Range::_changed_notify(const char *p_what) { update(); } +void Range::_validate_values() { + shared->max = MAX(shared->max, shared->min); + shared->page = CLAMP(shared->page, 0, shared->max - shared->min); +} + void Range::Shared::emit_changed(const char *p_what) { for (Set<Range *>::Element *E = owners.front(); E; E = E->next()) { Range *r = E->get(); @@ -100,6 +105,7 @@ void Range::set_value(double p_val) { void Range::set_min(double p_min) { shared->min = p_min; set_value(shared->val); + _validate_values(); shared->emit_changed("min"); @@ -109,6 +115,7 @@ void Range::set_min(double p_min) { void Range::set_max(double p_max) { shared->max = p_max; set_value(shared->val); + _validate_values(); shared->emit_changed("max"); } @@ -121,6 +128,7 @@ void Range::set_step(double p_step) { void Range::set_page(double p_page) { shared->page = p_page; set_value(shared->val); + _validate_values(); shared->emit_changed("page"); } @@ -270,6 +278,12 @@ void Range::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "rounded"), "set_use_rounded_values", "is_using_rounded_values"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_greater"), "set_allow_greater", "is_greater_allowed"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_lesser"), "set_allow_lesser", "is_lesser_allowed"); + + ADD_LINKED_PROPERTY("min_value", "value"); + ADD_LINKED_PROPERTY("min_value", "max_value"); + ADD_LINKED_PROPERTY("min_value", "page"); + ADD_LINKED_PROPERTY("max_value", "value"); + ADD_LINKED_PROPERTY("max_value", "page"); } void Range::set_use_rounded_values(bool p_enable) { diff --git a/scene/gui/range.h b/scene/gui/range.h index 7a129e88d6..0dc702b19c 100644 --- a/scene/gui/range.h +++ b/scene/gui/range.h @@ -59,6 +59,7 @@ class Range : public Control { void _value_changed_notify(); void _changed_notify(const char *p_what = ""); + void _validate_values(); protected: virtual void _value_changed(double) {} diff --git a/scene/gui/rich_text_label.cpp b/scene/gui/rich_text_label.cpp index 4588966d88..7ed8056826 100644 --- a/scene/gui/rich_text_label.cpp +++ b/scene/gui/rich_text_label.cpp @@ -36,7 +36,7 @@ #include "scene/scene_string_names.h" #include "servers/display_server.h" -#include "modules/modules_enabled.gen.h" +#include "modules/modules_enabled.gen.h" // For regex. #ifdef MODULE_REGEX_ENABLED #include "modules/regex/regex.h" #endif @@ -383,7 +383,7 @@ void RichTextLabel::_shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> // Add indent. l.offset.x = _find_margin(l.from, p_base_font, p_base_font_size); l.text_buf->set_width(p_width - l.offset.x); - l.text_buf->set_align((HAlign)_find_align(l.from)); + l.text_buf->set_alignment(_find_alignment(l.from)); l.text_buf->set_direction(_find_direction(l.from)); if (tab_size > 0) { // Align inline tabs. @@ -486,7 +486,7 @@ void RichTextLabel::_shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> remaining_characters -= cell_ch; table->columns.write[column].min_width = MAX(table->columns[column].min_width, ceil(frame->lines[i].text_buf->get_size().x)); - table->columns.write[column].max_width = MAX(table->columns[column].max_width, ceil(frame->lines[i].text_buf->get_non_wraped_size().x)); + table->columns.write[column].max_width = MAX(table->columns[column].max_width, ceil(frame->lines[i].text_buf->get_non_wrapped_size().x)); } idx++; } @@ -621,7 +621,7 @@ void RichTextLabel::_shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> } } -int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_shadow_color, bool p_shadow_as_outline, const Point2 &p_shadow_ofs) { +int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_shadow_color, int p_shadow_outline_size, const Point2 &p_shadow_ofs) { Vector2 off; ERR_FAIL_COND_V(p_frame == nullptr, 0); @@ -670,7 +670,7 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o prefix = segment + prefix; } } - if (prefix != "") { + if (!prefix.is_empty()) { Ref<Font> font = _find_font(l.from); if (font.is_null()) { font = get_theme_font(SNAME("normal_font")); @@ -684,13 +684,13 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o if (!lrtl && p_frame == main) { // Skip Scrollbar. offx -= scroll_w; } - font->draw_string(ci, p_ofs + Vector2(p_width - l.offset.x + offx, l.text_buf->get_line_ascent(0)), " " + prefix, HALIGN_LEFT, l.offset.x, font_size, _find_color(l.from, p_base_color)); + font->draw_string(ci, p_ofs + Vector2(p_width - l.offset.x + offx, l.text_buf->get_line_ascent(0)), " " + prefix, HORIZONTAL_ALIGNMENT_LEFT, l.offset.x, font_size, _find_color(l.from, p_base_color)); } else { float offx = 0.0f; if (lrtl && p_frame == main) { // Skip Scrollbar. offx += scroll_w; } - font->draw_string(ci, p_ofs + Vector2(offx, l.text_buf->get_line_ascent(0)), prefix + " ", HALIGN_RIGHT, l.offset.x, font_size, _find_color(l.from, p_base_color)); + font->draw_string(ci, p_ofs + Vector2(offx, l.text_buf->get_line_ascent(0)), prefix + " ", HORIZONTAL_ALIGNMENT_RIGHT, l.offset.x, font_size, _find_color(l.from, p_base_color)); } } @@ -734,17 +734,17 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o } // Draw text. - switch (l.text_buf->get_align()) { - case HALIGN_FILL: - case HALIGN_LEFT: { + switch (l.text_buf->get_alignment()) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { off.x += width - length; } } break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { off.x += Math::floor((width - length) / 2.0); } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (!rtl) { off.x += width - length; } @@ -804,7 +804,7 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o } for (int j = 0; j < frame->lines.size(); j++) { - _draw_line(frame, j, p_ofs + rect.position + off + Vector2(0, frame->lines[j].offset.y), rect.size.x, p_base_color, p_outline_size, p_outline_color, p_font_shadow_color, p_shadow_as_outline, p_shadow_ofs); + _draw_line(frame, j, p_ofs + rect.position + off + Vector2(0, frame->lines[j].offset.y), rect.size.x, p_base_color, p_outline_size, p_outline_color, p_font_shadow_color, p_shadow_outline_size, p_shadow_ofs); } idx++; } @@ -824,7 +824,8 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o Item *it = _get_item_at_pos(it_from, it_to, glyphs[i].start); int size = _find_outline_size(it, p_outline_size); Color font_color = _find_outline_color(it, p_outline_color); - if (size <= 0) { + Color font_shadow_color = p_font_shadow_color; + if ((size <= 0 || font_color.a == 0) && (font_shadow_color.a == 0)) { gloff.x += glyphs[i].advance; continue; } @@ -871,9 +872,10 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o faded_visibility = faded_visibility < 0.0f ? 0.0f : faded_visibility; } font_color.a = faded_visibility; + font_shadow_color.a = faded_visibility; } - bool visible = (font_color.a != 0); + bool visible = (font_color.a != 0) || (font_shadow_color.a != 0); for (int j = 0; j < fx_stack.size(); j++) { ItemFX *item_fx = fx_stack[j]; @@ -942,18 +944,19 @@ int RichTextLabel::_draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_o } } - Point2 shadow_ofs(get_theme_constant(SNAME("shadow_offset_x")), get_theme_constant(SNAME("shadow_offset_y"))); - // Draw glyph outlines. for (int j = 0; j < glyphs[i].repeat; j++) { if (visible) { if (frid != RID()) { - if (p_shadow_as_outline) { - TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(-shadow_ofs.x, shadow_ofs.y), gl, p_font_shadow_color); - TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(shadow_ofs.x, -shadow_ofs.y), gl, p_font_shadow_color); - TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff + Vector2(-shadow_ofs.x, -shadow_ofs.y), gl, p_font_shadow_color); + if (font_shadow_color.a > 0) { + TS->font_draw_glyph(frid, ci, glyphs[i].font_size, p_ofs + fx_offset + gloff + p_shadow_ofs, gl, font_shadow_color); + } + if (font_shadow_color.a > 0 && p_shadow_outline_size > 0) { + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, p_shadow_outline_size, p_ofs + fx_offset + gloff + p_shadow_ofs, gl, font_shadow_color); + } + if (font_color.a != 0.0 && size > 0) { + TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff, gl, font_color); } - TS->font_draw_glyph_outline(frid, ci, glyphs[i].font_size, size, p_ofs + fx_offset + gloff, gl, font_color); } } gloff.x += glyphs[i].advance; @@ -1211,17 +1214,17 @@ float RichTextLabel::_find_click_in_line(ItemFrame *p_frame, int p_line, const V } } - switch (l.text_buf->get_align()) { - case HALIGN_FILL: - case HALIGN_LEFT: { + switch (l.text_buf->get_alignment()) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { off.x += width - length; } } break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { off.x += Math::floor((width - length) / 2.0); } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (!rtl) { off.x += width - length; } @@ -1420,7 +1423,7 @@ void RichTextLabel::_notification(int p_what) { } break; case NOTIFICATION_THEME_CHANGED: case NOTIFICATION_ENTER_TREE: { - if (text != "") { + if (!text.is_empty()) { set_text(text); } @@ -1470,7 +1473,7 @@ void RichTextLabel::_notification(int p_what) { Color outline_color = get_theme_color(SNAME("font_outline_color")); int outline_size = get_theme_constant(SNAME("outline_size")); Color font_shadow_color = get_theme_color(SNAME("font_shadow_color")); - bool use_outline = get_theme_constant(SNAME("shadow_as_outline")); + int shadow_outline_size = get_theme_constant(SNAME("shadow_outline_size")); Point2 shadow_ofs(get_theme_constant(SNAME("shadow_offset_x")), get_theme_constant(SNAME("shadow_offset_y"))); visible_paragraph_count = 0; @@ -1480,7 +1483,7 @@ void RichTextLabel::_notification(int p_what) { Point2 ofs = text_rect.get_position() + Vector2(0, main->lines[from_line].offset.y - vofs); while (ofs.y < size.height && from_line < main->lines.size()) { visible_paragraph_count++; - visible_line_count += _draw_line(main, from_line, ofs, text_rect.size.x, base_color, outline_size, outline_color, font_shadow_color, use_outline, shadow_ofs); + visible_line_count += _draw_line(main, from_line, ofs, text_rect.size.x, base_color, outline_size, outline_color, font_shadow_color, shadow_outline_size, shadow_ofs); ofs.y += main->lines[from_line].text_buf->get_size().y + get_theme_constant(SNAME("line_separation")); from_line++; } @@ -1491,7 +1494,13 @@ void RichTextLabel::_notification(int p_what) { _update_fx(main, dt); update(); } - } + } break; + case NOTIFICATION_FOCUS_EXIT: { + if (deselect_on_focus_loss_enabled) { + selection.active = false; + update(); + } + } break; } } @@ -1536,7 +1545,7 @@ void RichTextLabel::gui_input(const Ref<InputEvent> &p_event) { return; } - if (b->get_button_index() == MOUSE_BUTTON_LEFT) { + if (b->get_button_index() == MouseButton::LEFT) { if (b->is_pressed() && !b->is_double_click()) { scroll_updated = false; ItemFrame *c_frame = nullptr; @@ -1596,12 +1605,18 @@ void RichTextLabel::gui_input(const Ref<InputEvent> &p_event) { selection.to_char = words[i + 1]; selection.active = true; + if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(get_selected_text()); + } update(); break; } } } } else if (!b->is_pressed()) { + if (selection.enabled && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(get_selected_text()); + } selection.click_item = nullptr; if (!b->is_double_click() && !scroll_updated) { @@ -1621,12 +1636,12 @@ void RichTextLabel::gui_input(const Ref<InputEvent> &p_event) { } } - if (b->get_button_index() == MOUSE_BUTTON_WHEEL_UP) { + if (b->get_button_index() == MouseButton::WHEEL_UP) { if (scroll_active) { vscroll->set_value(vscroll->get_value() - vscroll->get_page() * b->get_factor() * 0.5 / 8); } } - if (b->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN) { + if (b->get_button_index() == MouseButton::WHEEL_DOWN) { if (scroll_active) { vscroll->set_value(vscroll->get_value() + vscroll->get_page() * b->get_factor() * 0.5 / 8); } @@ -1719,6 +1734,7 @@ void RichTextLabel::gui_input(const Ref<InputEvent> &p_event) { swap = true; } else if (selection.from_char == selection.to_char) { selection.active = false; + update(); return; } } @@ -1934,19 +1950,19 @@ int RichTextLabel::_find_margin(Item *p_item, const Ref<Font> &p_base_font, int return margin; } -RichTextLabel::Align RichTextLabel::_find_align(Item *p_item) { +HorizontalAlignment RichTextLabel::_find_alignment(Item *p_item) { Item *item = p_item; while (item) { if (item->type == ITEM_PARAGRAPH) { ItemParagraph *p = static_cast<ItemParagraph *>(item); - return p->align; + return p->alignment; } item = item->parent; } - return default_align; + return default_alignment; } TextServer::Direction RichTextLabel::_find_direction(Item *p_item) { @@ -2174,7 +2190,7 @@ void RichTextLabel::_validate_line_caches(ItemFrame *p_frame) { updating_scroll = false; if (fit_content_height) { - minimum_size_changed(); + update_minimum_size(); } return; } @@ -2211,7 +2227,7 @@ void RichTextLabel::_validate_line_caches(ItemFrame *p_frame) { updating_scroll = false; if (fit_content_height) { - minimum_size_changed(); + update_minimum_size(); } } @@ -2308,7 +2324,7 @@ void RichTextLabel::_add_item(Item *p_item, bool p_enter, bool p_ensure_newline) _invalidate_current_line(current_frame); if (fixed_width != -1) { - minimum_size_changed(); + update_minimum_size(); } } @@ -2318,7 +2334,7 @@ void RichTextLabel::_remove_item(Item *p_item, const int p_line, const int p_sub p_item->parent->subitems.erase(p_item); // If a newline was erased, all lines AFTER the newline need to be decremented. if (p_item->type == ITEM_NEWLINE) { - current_frame->lines.remove(p_line); + current_frame->lines.remove_at(p_line); for (int i = 0; i < current->subitems.size(); i++) { if (current->subitems[i]->line > p_subitem_line) { current->subitems[i]->line--; @@ -2335,7 +2351,7 @@ void RichTextLabel::_remove_item(Item *p_item, const int p_line, const int p_sub } } -void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, const int p_height, const Color &p_color, InlineAlign p_align) { +void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, const int p_height, const Color &p_color, InlineAlignment p_alignment) { if (current->type == ITEM_TABLE) { return; } @@ -2347,7 +2363,7 @@ void RichTextLabel::add_image(const Ref<Texture2D> &p_image, const int p_width, item->image = p_image; item->color = p_color; - item->inline_align = p_align; + item->inline_align = p_alignment; if (p_width > 0) { // custom width @@ -2407,7 +2423,7 @@ bool RichTextLabel::remove_line(const int p_line) { } if (!had_newline) { - current_frame->lines.remove(p_line); + current_frame->lines.remove_at(p_line); if (current_frame->lines.size() == 0) { current_frame->lines.resize(1); } @@ -2539,11 +2555,11 @@ void RichTextLabel::push_strikethrough() { _add_item(item, true); } -void RichTextLabel::push_paragraph(Align p_align, Control::TextDirection p_direction, const String &p_language, Control::StructuredTextParser p_st_parser) { +void RichTextLabel::push_paragraph(HorizontalAlignment p_alignment, Control::TextDirection p_direction, const String &p_language, Control::StructuredTextParser p_st_parser) { ERR_FAIL_COND(current->type == ITEM_TABLE); ItemParagraph *item = memnew(ItemParagraph); - item->align = p_align; + item->alignment = p_alignment; item->direction = p_direction; item->language = p_language; item->st_parser = p_st_parser; @@ -2579,13 +2595,13 @@ void RichTextLabel::push_meta(const Variant &p_meta) { _add_item(item, true); } -void RichTextLabel::push_table(int p_columns, InlineAlign p_align) { +void RichTextLabel::push_table(int p_columns, InlineAlignment p_alignment) { ERR_FAIL_COND(p_columns < 1); ItemTable *item = memnew(ItemTable); item->columns.resize(p_columns); item->total_width = 0; - item->inline_align = p_align; + item->inline_align = p_alignment; for (int i = 0; i < item->columns.size(); i++) { item->columns.write[i].expand = false; item->columns.write[i].expand_ratio = 1; @@ -2739,7 +2755,7 @@ void RichTextLabel::clear() { } if (fixed_width != -1) { - minimum_size_changed(); + update_minimum_size(); } } @@ -2756,7 +2772,7 @@ int RichTextLabel::get_tab_size() const { void RichTextLabel::set_fit_content_height(bool p_enabled) { if (p_enabled != fit_content_height) { fit_content_height = p_enabled; - minimum_size_changed(); + update_minimum_size(); } } @@ -2810,12 +2826,12 @@ bool RichTextLabel::is_scroll_following() const { return scroll_follow; } -Error RichTextLabel::parse_bbcode(const String &p_bbcode) { +void RichTextLabel::parse_bbcode(const String &p_bbcode) { clear(); - return append_text(p_bbcode); + append_text(p_bbcode); } -Error RichTextLabel::append_text(const String &p_bbcode) { +void RichTextLabel::append_text(const String &p_bbcode) { int pos = 0; List<String> tag_stack; @@ -2942,35 +2958,35 @@ Error RichTextLabel::append_text(const String &p_bbcode) { columns = 1; } - int align = INLINE_ALIGN_TOP; + int alignment = INLINE_ALIGNMENT_TOP; if (subtag.size() > 2) { if (subtag[1] == "top" || subtag[1] == "t") { - align = INLINE_ALIGN_TOP_TO; + alignment = INLINE_ALIGNMENT_TOP_TO; } else if (subtag[1] == "center" || subtag[1] == "c") { - align = INLINE_ALIGN_CENTER_TO; + alignment = INLINE_ALIGNMENT_CENTER_TO; } else if (subtag[1] == "bottom" || subtag[1] == "b") { - align = INLINE_ALIGN_BOTTOM_TO; + alignment = INLINE_ALIGNMENT_BOTTOM_TO; } if (subtag[2] == "top" || subtag[2] == "t") { - align |= INLINE_ALIGN_TO_TOP; + alignment |= INLINE_ALIGNMENT_TO_TOP; } else if (subtag[2] == "center" || subtag[2] == "c") { - align |= INLINE_ALIGN_TO_CENTER; + alignment |= INLINE_ALIGNMENT_TO_CENTER; } else if (subtag[2] == "baseline" || subtag[2] == "l") { - align |= INLINE_ALIGN_TO_BASELINE; + alignment |= INLINE_ALIGNMENT_TO_BASELINE; } else if (subtag[2] == "bottom" || subtag[2] == "b") { - align |= INLINE_ALIGN_TO_BOTTOM; + alignment |= INLINE_ALIGNMENT_TO_BOTTOM; } } else if (subtag.size() > 1) { if (subtag[1] == "top" || subtag[1] == "t") { - align = INLINE_ALIGN_TOP; + alignment = INLINE_ALIGNMENT_TOP; } else if (subtag[1] == "center" || subtag[1] == "c") { - align = INLINE_ALIGN_CENTER; + alignment = INLINE_ALIGNMENT_CENTER; } else if (subtag[1] == "bottom" || subtag[1] == "b") { - align = INLINE_ALIGN_BOTTOM; + alignment = INLINE_ALIGNMENT_BOTTOM; } } - push_table(columns, (InlineAlign)align); + push_table(columns, (InlineAlignment)alignment); pos = brk_end + 1; tag_stack.push_front("table"); } else if (tag == "cell") { @@ -3083,15 +3099,15 @@ Error RichTextLabel::append_text(const String &p_bbcode) { add_text(String::chr(0x00AD)); pos = brk_end + 1; } else if (tag == "center") { - push_paragraph(ALIGN_CENTER); + push_paragraph(HORIZONTAL_ALIGNMENT_CENTER); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "fill") { - push_paragraph(ALIGN_FILL); + push_paragraph(HORIZONTAL_ALIGNMENT_FILL); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "right") { - push_paragraph(ALIGN_RIGHT); + push_paragraph(HORIZONTAL_ALIGNMENT_RIGHT); pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "ul") { @@ -3130,12 +3146,12 @@ Error RichTextLabel::append_text(const String &p_bbcode) { pos = brk_end + 1; tag_stack.push_front(tag); } else if (tag == "p") { - push_paragraph(ALIGN_LEFT); + push_paragraph(HORIZONTAL_ALIGNMENT_LEFT); pos = brk_end + 1; tag_stack.push_front("p"); } else if (tag.begins_with("p ")) { Vector<String> subtag = tag.substr(2, tag.length()).split(" "); - Align align = ALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_LEFT; Control::TextDirection dir = Control::TEXT_DIRECTION_INHERITED; String lang; Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; @@ -3144,13 +3160,13 @@ Error RichTextLabel::append_text(const String &p_bbcode) { if (subtag_a.size() == 2) { if (subtag_a[0] == "align") { if (subtag_a[1] == "l" || subtag_a[1] == "left") { - align = ALIGN_LEFT; + alignment = HORIZONTAL_ALIGNMENT_LEFT; } else if (subtag_a[1] == "c" || subtag_a[1] == "center") { - align = ALIGN_CENTER; + alignment = HORIZONTAL_ALIGNMENT_CENTER; } else if (subtag_a[1] == "r" || subtag_a[1] == "right") { - align = ALIGN_RIGHT; + alignment = HORIZONTAL_ALIGNMENT_RIGHT; } else if (subtag_a[1] == "f" || subtag_a[1] == "fill") { - align = ALIGN_FILL; + alignment = HORIZONTAL_ALIGNMENT_FILL; } } else if (subtag_a[0] == "dir" || subtag_a[0] == "direction") { if (subtag_a[1] == "a" || subtag_a[1] == "auto") { @@ -3181,7 +3197,7 @@ Error RichTextLabel::append_text(const String &p_bbcode) { } } } - push_paragraph(align, dir, lang, st_parser); + push_paragraph(alignment, dir, lang, st_parser); pos = brk_end + 1; tag_stack.push_front("p"); } else if (tag == "url") { @@ -3249,33 +3265,33 @@ Error RichTextLabel::append_text(const String &p_bbcode) { pos = end; tag_stack.push_front(bbcode_name); } else if (tag.begins_with("img")) { - int align = INLINE_ALIGN_CENTER; + int alignment = INLINE_ALIGNMENT_CENTER; if (tag.begins_with("img=")) { Vector<String> subtag = tag.substr(4, tag.length()).split(","); if (subtag.size() > 1) { if (subtag[0] == "top" || subtag[0] == "t") { - align = INLINE_ALIGN_TOP_TO; + alignment = INLINE_ALIGNMENT_TOP_TO; } else if (subtag[0] == "center" || subtag[0] == "c") { - align = INLINE_ALIGN_CENTER_TO; + alignment = INLINE_ALIGNMENT_CENTER_TO; } else if (subtag[0] == "bottom" || subtag[0] == "b") { - align = INLINE_ALIGN_BOTTOM_TO; + alignment = INLINE_ALIGNMENT_BOTTOM_TO; } if (subtag[1] == "top" || subtag[1] == "t") { - align |= INLINE_ALIGN_TO_TOP; + alignment |= INLINE_ALIGNMENT_TO_TOP; } else if (subtag[1] == "center" || subtag[1] == "c") { - align |= INLINE_ALIGN_TO_CENTER; + alignment |= INLINE_ALIGNMENT_TO_CENTER; } else if (subtag[1] == "baseline" || subtag[1] == "l") { - align |= INLINE_ALIGN_TO_BASELINE; + alignment |= INLINE_ALIGNMENT_TO_BASELINE; } else if (subtag[1] == "bottom" || subtag[1] == "b") { - align |= INLINE_ALIGN_TO_BOTTOM; + alignment |= INLINE_ALIGNMENT_TO_BOTTOM; } } else if (subtag.size() > 0) { if (subtag[0] == "top" || subtag[0] == "t") { - align = INLINE_ALIGN_TOP; + alignment = INLINE_ALIGNMENT_TOP; } else if (subtag[0] == "center" || subtag[0] == "c") { - align = INLINE_ALIGN_CENTER; + alignment = INLINE_ALIGNMENT_CENTER; } else if (subtag[0] == "bottom" || subtag[0] == "b") { - align = INLINE_ALIGN_BOTTOM; + alignment = INLINE_ALIGNMENT_BOTTOM; } } } @@ -3317,7 +3333,7 @@ Error RichTextLabel::append_text(const String &p_bbcode) { } } - add_image(texture, width, height, color, (InlineAlign)align); + add_image(texture, width, height, color, (InlineAlignment)alignment); } pos = end; @@ -3511,7 +3527,7 @@ Error RichTextLabel::append_text(const String &p_bbcode) { pos = brk_pos + 1; } else { String identifier = expr[0]; - expr.remove(0); + expr.remove_at(0); Dictionary properties = parse_expressions_for_values(expr); Ref<RichTextEffect> effect = _get_custom_effect_by_code(identifier); @@ -3538,8 +3554,6 @@ Error RichTextLabel::append_text(const String &p_bbcode) { break; } } - - return OK; } void RichTextLabel::scroll_to_paragraph(int p_paragraph) { @@ -3604,6 +3618,14 @@ void RichTextLabel::set_selection_enabled(bool p_enabled) { } } +void RichTextLabel::set_deselect_on_focus_loss_enabled(const bool p_enabled) { + deselect_on_focus_loss_enabled = p_enabled; + if (p_enabled && selection.active && !has_focus()) { + selection.active = false; + update(); + } +} + bool RichTextLabel::_search_table(ItemTable *p_table, List<Item *>::Element *p_from, const String &p_string, bool p_reverse_search) { List<Item *>::Element *E = p_from; while (E != nullptr) { @@ -3779,45 +3801,32 @@ String RichTextLabel::_get_line_text(ItemFrame *p_frame, int p_line, Selection p } } for (Item *it = l.from; it && it != it_to; it = _get_next_item(it)) { + if (it->type == ITEM_TABLE) { + ItemTable *table = static_cast<ItemTable *>(it); + for (Item *E : table->subitems) { + ERR_CONTINUE(E->type != ITEM_FRAME); // Children should all be frames. + ItemFrame *frame = static_cast<ItemFrame *>(E); + for (int i = 0; i < frame->lines.size(); i++) { + text += _get_line_text(frame, i, p_selection); + } + } + } if ((p_selection.to_item != nullptr) && (p_selection.to_item->index < l.from->index)) { - break; + continue; } if ((p_selection.from_item != nullptr) && (p_selection.from_item->index >= end_idx)) { - break; + continue; } - switch (it->type) { - case ITEM_NEWLINE: { - text += "\n"; - } break; - case ITEM_TEXT: { - ItemText *t = (ItemText *)it; - text += t->text; - } break; - case ITEM_IMAGE: { - text += " "; - } break; - case ITEM_TABLE: { - ItemTable *table = static_cast<ItemTable *>(it); - int idx = 0; - int col_count = table->columns.size(); - for (Item *E : table->subitems) { - ERR_CONTINUE(E->type != ITEM_FRAME); // Children should all be frames. - ItemFrame *frame = static_cast<ItemFrame *>(E); - int column = idx % col_count; - - for (int i = 0; i < frame->lines.size(); i++) { - text += _get_line_text(frame, i, p_selection); - } - if (column == col_count - 1) { - text += "\n"; - } else { - text += " "; - } - idx++; - } - } break; - default: - break; + if (it->type == ITEM_DROPCAP) { + const ItemDropcap *dc = static_cast<ItemDropcap *>(it); + text += dc->text; + } else if (it->type == ITEM_TEXT) { + const ItemText *t = static_cast<ItemText *>(it); + text += t->text; + } else if (it->type == ITEM_NEWLINE) { + text += "\n"; + } else if (it->type == ITEM_IMAGE) { + text += " "; } } if ((l.from != nullptr) && (p_frame == p_selection.to_frame) && (p_selection.to_item != nullptr) && (p_selection.to_item->index >= l.from->index) && (p_selection.to_item->index < end_idx)) { @@ -3844,7 +3853,7 @@ String RichTextLabel::get_selected_text() const { void RichTextLabel::selection_copy() { String text = get_selected_text(); - if (text != "") { + if (!text.is_empty()) { DisplayServer::get_singleton()->clipboard_set(text); } } @@ -3853,6 +3862,10 @@ bool RichTextLabel::is_selection_enabled() const { return selection.enabled; } +bool RichTextLabel::is_deselect_on_focus_loss_enabled() const { + return deselect_on_focus_loss_enabled; +} + int RichTextLabel::get_selection_from() const { if (!selection.active || !selection.enabled) { return -1; @@ -3992,7 +4005,7 @@ float RichTextLabel::get_percent_visible() const { void RichTextLabel::set_effects(Array p_effects) { custom_effects = p_effects; - if ((text != "") && use_bbcode) { + if ((!text.is_empty()) && use_bbcode) { parse_bbcode(text); } } @@ -4007,7 +4020,7 @@ void RichTextLabel::install_effect(const Variant effect) { if (rteffect.is_valid()) { custom_effects.push_back(effect); - if ((text != "") && use_bbcode) { + if ((!text.is_empty()) && use_bbcode) { parse_bbcode(text); } } @@ -4037,7 +4050,7 @@ void RichTextLabel::_bind_methods() { ClassDB::bind_method(D_METHOD("get_parsed_text"), &RichTextLabel::get_parsed_text); ClassDB::bind_method(D_METHOD("add_text", "text"), &RichTextLabel::add_text); ClassDB::bind_method(D_METHOD("set_text", "text"), &RichTextLabel::set_text); - ClassDB::bind_method(D_METHOD("add_image", "image", "width", "height", "color", "inline_align"), &RichTextLabel::add_image, DEFVAL(0), DEFVAL(0), DEFVAL(Color(1.0, 1.0, 1.0)), DEFVAL(INLINE_ALIGN_CENTER)); + ClassDB::bind_method(D_METHOD("add_image", "image", "width", "height", "color", "inline_align"), &RichTextLabel::add_image, DEFVAL(0), DEFVAL(0), DEFVAL(Color(1.0, 1.0, 1.0)), DEFVAL(INLINE_ALIGNMENT_CENTER)); ClassDB::bind_method(D_METHOD("newline"), &RichTextLabel::add_newline); ClassDB::bind_method(D_METHOD("remove_line", "line"), &RichTextLabel::remove_line); ClassDB::bind_method(D_METHOD("push_font", "font"), &RichTextLabel::push_font); @@ -4051,13 +4064,13 @@ void RichTextLabel::_bind_methods() { ClassDB::bind_method(D_METHOD("push_color", "color"), &RichTextLabel::push_color); ClassDB::bind_method(D_METHOD("push_outline_size", "outline_size"), &RichTextLabel::push_outline_size); ClassDB::bind_method(D_METHOD("push_outline_color", "color"), &RichTextLabel::push_outline_color); - ClassDB::bind_method(D_METHOD("push_paragraph", "align", "base_direction", "language", "st_parser"), &RichTextLabel::push_paragraph, DEFVAL(TextServer::DIRECTION_AUTO), DEFVAL(""), DEFVAL(STRUCTURED_TEXT_DEFAULT)); + ClassDB::bind_method(D_METHOD("push_paragraph", "alignment", "base_direction", "language", "st_parser"), &RichTextLabel::push_paragraph, DEFVAL(TextServer::DIRECTION_AUTO), DEFVAL(""), DEFVAL(STRUCTURED_TEXT_DEFAULT)); ClassDB::bind_method(D_METHOD("push_indent", "level"), &RichTextLabel::push_indent); ClassDB::bind_method(D_METHOD("push_list", "level", "type", "capitalize"), &RichTextLabel::push_list); ClassDB::bind_method(D_METHOD("push_meta", "data"), &RichTextLabel::push_meta); ClassDB::bind_method(D_METHOD("push_underline"), &RichTextLabel::push_underline); ClassDB::bind_method(D_METHOD("push_strikethrough"), &RichTextLabel::push_strikethrough); - ClassDB::bind_method(D_METHOD("push_table", "columns", "inline_align"), &RichTextLabel::push_table, DEFVAL(INLINE_ALIGN_TOP)); + ClassDB::bind_method(D_METHOD("push_table", "columns", "inline_align"), &RichTextLabel::push_table, DEFVAL(INLINE_ALIGNMENT_TOP)); ClassDB::bind_method(D_METHOD("push_dropcap", "string", "font", "size", "dropcap_margins", "color", "outline_size", "outline_color"), &RichTextLabel::push_dropcap, DEFVAL(Rect2()), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(0, 0, 0, 0))); ClassDB::bind_method(D_METHOD("set_table_column_expand", "column", "expand", "ratio"), &RichTextLabel::set_table_column_expand); ClassDB::bind_method(D_METHOD("set_cell_row_background_color", "odd_row_bg", "even_row_bg"), &RichTextLabel::set_cell_row_background_color); @@ -4106,6 +4119,9 @@ void RichTextLabel::_bind_methods() { ClassDB::bind_method(D_METHOD("set_selection_enabled", "enabled"), &RichTextLabel::set_selection_enabled); ClassDB::bind_method(D_METHOD("is_selection_enabled"), &RichTextLabel::is_selection_enabled); + ClassDB::bind_method(D_METHOD("set_deselect_on_focus_loss_enabled", "enable"), &RichTextLabel::set_deselect_on_focus_loss_enabled); + ClassDB::bind_method(D_METHOD("is_deselect_on_focus_loss_enabled"), &RichTextLabel::is_deselect_on_focus_loss_enabled); + ClassDB::bind_method(D_METHOD("get_selection_from"), &RichTextLabel::get_selection_from); ClassDB::bind_method(D_METHOD("get_selection_to"), &RichTextLabel::get_selection_to); @@ -4157,6 +4173,8 @@ void RichTextLabel::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "selection_enabled"), "set_selection_enabled", "is_selection_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "override_selected_font_color"), "set_override_selected_font_color", "is_overriding_selected_font_color"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "deselect_on_focus_loss_enabled"), "set_deselect_on_focus_loss_enabled", "is_deselect_on_focus_loss_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "custom_effects", PROPERTY_HINT_ARRAY_TYPE, vformat("%s/%s:%s", Variant::OBJECT, PROPERTY_HINT_RESOURCE_TYPE, "RichTextEffect"), (PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_SCRIPT_VARIABLE)), "set_effects", "get_effects"); ADD_PROPERTY(PropertyInfo(Variant::INT, "text_direction", PROPERTY_HINT_ENUM, "Auto,Left-to-Right,Right-to-Left,Inherited"), "set_text_direction", "get_text_direction"); @@ -4170,11 +4188,6 @@ void RichTextLabel::_bind_methods() { ADD_SIGNAL(MethodInfo("meta_hover_started", PropertyInfo(Variant::NIL, "meta", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NIL_IS_VARIANT))); ADD_SIGNAL(MethodInfo("meta_hover_ended", PropertyInfo(Variant::NIL, "meta", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NIL_IS_VARIANT))); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); - BIND_ENUM_CONSTANT(ALIGN_FILL); - BIND_ENUM_CONSTANT(LIST_NUMBERS); BIND_ENUM_CONSTANT(LIST_LETTERS); BIND_ENUM_CONSTANT(LIST_ROMAN); @@ -4250,7 +4263,7 @@ int RichTextLabel::get_total_character_count() const { void RichTextLabel::set_fixed_size_to_width(int p_width) { fixed_width = p_width; - minimum_size_changed(); + update_minimum_size(); } Size2 RichTextLabel::get_minimum_size() const { diff --git a/scene/gui/rich_text_label.h b/scene/gui/rich_text_label.h index 94f02a3989..58a531e5ad 100644 --- a/scene/gui/rich_text_label.h +++ b/scene/gui/rich_text_label.h @@ -39,13 +39,6 @@ class RichTextLabel : public Control { GDCLASS(RichTextLabel, Control); public: - enum Align { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT, - ALIGN_FILL - }; - enum ListType { LIST_NUMBERS, LIST_LETTERS, @@ -160,7 +153,7 @@ private: struct ItemImage : public Item { Ref<Texture2D> image; - InlineAlign inline_align = INLINE_ALIGN_CENTER; + InlineAlignment inline_align = INLINE_ALIGNMENT_CENTER; Size2 size; Color color; ItemImage() { type = ITEM_IMAGE; } @@ -210,7 +203,7 @@ private: }; struct ItemParagraph : public Item { - Align align = ALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_LEFT; String language; Control::TextDirection direction = Control::TEXT_DIRECTION_AUTO; Control::StructuredTextParser st_parser = STRUCTURED_TEXT_DEFAULT; @@ -247,7 +240,7 @@ private: int total_width = 0; int total_height = 0; - InlineAlign inline_align = INLINE_ALIGN_TOP; + InlineAlignment inline_align = INLINE_ALIGNMENT_TOP; ItemTable() { type = ITEM_TABLE; } }; @@ -278,12 +271,12 @@ private: uint64_t offset_random(int index) { return (_current_rng >> (index % 64)) | - (_current_rng << (64 - (index % 64))); + (_current_rng << (64 - (index % 64))); } uint64_t offset_previous_random(int index) { return (_previous_rng >> (index % 64)) | - (_previous_rng << (64 - (index % 64))); + (_previous_rng << (64 - (index % 64))); } }; @@ -360,7 +353,7 @@ private: bool underline_meta = true; bool override_selected_font_color = false; - Align default_align = ALIGN_LEFT; + HorizontalAlignment default_alignment = HORIZONTAL_ALIGNMENT_LEFT; ItemMeta *meta_hovering = nullptr; Variant current_meta; @@ -399,6 +392,7 @@ private: }; Selection selection; + bool deselect_on_focus_loss_enabled = true; int visible_characters = -1; float percent_visible = 1.0; @@ -411,7 +405,7 @@ private: void _shape_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width, int *r_char_offset); void _resize_line(ItemFrame *p_frame, int p_line, const Ref<Font> &p_base_font, int p_base_font_size, int p_width); - int _draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_shadow_color, bool p_shadow_as_outline, const Point2 &shadow_ofs); + int _draw_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Color &p_base_color, int p_outline_size, const Color &p_outline_color, const Color &p_font_shadow_color, int p_shadow_outline_size, const Point2 &p_shadow_ofs); float _find_click_in_line(ItemFrame *p_frame, int p_line, const Vector2 &p_ofs, int p_width, const Point2i &p_click, ItemFrame **r_click_frame = nullptr, int *r_click_line = nullptr, Item **r_click_item = nullptr, int *r_click_char = nullptr); String _roman(int p_num, bool p_capitalize) const; @@ -427,7 +421,7 @@ private: ItemDropcap *_find_dc_item(Item *p_item); int _find_list(Item *p_item, Vector<int> &r_index, Vector<ItemList *> &r_list); int _find_margin(Item *p_item, const Ref<Font> &p_base_font, int p_base_font_size); - Align _find_align(Item *p_item); + HorizontalAlignment _find_alignment(Item *p_item); TextServer::Direction _find_direction(Item *p_item); Control::StructuredTextParser _find_stt(Item *p_item); String _find_language(Item *p_item); @@ -468,7 +462,7 @@ private: public: String get_parsed_text() const; void add_text(const String &p_text); - void add_image(const Ref<Texture2D> &p_image, const int p_width = 0, const int p_height = 0, const Color &p_color = Color(1.0, 1.0, 1.0), InlineAlign p_align = INLINE_ALIGN_CENTER); + void add_image(const Ref<Texture2D> &p_image, const int p_width = 0, const int p_height = 0, const Color &p_color = Color(1.0, 1.0, 1.0), InlineAlignment p_alignment = INLINE_ALIGNMENT_CENTER); void add_newline(); bool remove_line(const int p_line); void push_dropcap(const String &p_string, const Ref<Font> &p_font, int p_size, const Rect2 &p_dropcap_margins = Rect2(), const Color &p_color = Color(1, 1, 1), int p_ol_size = 0, const Color &p_ol_color = Color(0, 0, 0, 0)); @@ -485,11 +479,11 @@ public: void push_outline_color(const Color &p_color); void push_underline(); void push_strikethrough(); - void push_paragraph(Align p_align, Control::TextDirection p_direction = Control::TEXT_DIRECTION_INHERITED, const String &p_language = "", Control::StructuredTextParser p_st_parser = STRUCTURED_TEXT_DEFAULT); + void push_paragraph(HorizontalAlignment p_alignment, Control::TextDirection p_direction = Control::TEXT_DIRECTION_INHERITED, const String &p_language = "", Control::StructuredTextParser p_st_parser = STRUCTURED_TEXT_DEFAULT); void push_indent(int p_level); void push_list(int p_level, ListType p_list, bool p_capitalize); void push_meta(const Variant &p_meta); - void push_table(int p_columns, InlineAlign p_align = INLINE_ALIGN_TOP); + void push_table(int p_columns, InlineAlignment p_alignment = INLINE_ALIGNMENT_TOP); void push_fade(int p_start_index, int p_length); void push_shake(int p_strength, float p_rate); void push_wave(float p_frequency, float p_amplitude); @@ -551,9 +545,11 @@ public: int get_selection_to() const; String get_selected_text() const; void selection_copy(); + void set_deselect_on_focus_loss_enabled(const bool p_enabled); + bool is_deselect_on_focus_loss_enabled() const; - Error parse_bbcode(const String &p_bbcode); - Error append_text(const String &p_bbcode); + void parse_bbcode(const String &p_bbcode); + void append_text(const String &p_bbcode); void set_use_bbcode(bool p_enable); bool is_using_bbcode() const; @@ -592,7 +588,6 @@ public: ~RichTextLabel(); }; -VARIANT_ENUM_CAST(RichTextLabel::Align); VARIANT_ENUM_CAST(RichTextLabel::ListType); VARIANT_ENUM_CAST(RichTextLabel::ItemType); diff --git a/scene/gui/scroll_bar.cpp b/scene/gui/scroll_bar.cpp index 4a3a6837d5..8c292e663e 100644 --- a/scene/gui/scroll_bar.cpp +++ b/scene/gui/scroll_bar.cpp @@ -54,17 +54,17 @@ void ScrollBar::gui_input(const Ref<InputEvent> &p_event) { if (b.is_valid()) { accept_event(); - if (b->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN && b->is_pressed()) { + if (b->get_button_index() == MouseButton::WHEEL_DOWN && b->is_pressed()) { set_value(get_value() + get_page() / 4.0); accept_event(); } - if (b->get_button_index() == MOUSE_BUTTON_WHEEL_UP && b->is_pressed()) { + if (b->get_button_index() == MouseButton::WHEEL_UP && b->is_pressed()) { set_value(get_value() - get_page() / 4.0); accept_event(); } - if (b->get_button_index() != MOUSE_BUTTON_LEFT) { + if (b->get_button_index() != MouseButton::LEFT) { return; } @@ -525,7 +525,7 @@ void ScrollBar::_drag_node_input(const Ref<InputEvent> &p_input) { Ref<InputEventMouseButton> mb = p_input; if (mb.is_valid()) { - if (mb->get_button_index() != 1) { + if (mb->get_button_index() != MouseButton::LEFT) { return; } diff --git a/scene/gui/scroll_container.cpp b/scene/gui/scroll_container.cpp index 0c0ec39c7f..dcd2c32a3b 100644 --- a/scene/gui/scroll_container.cpp +++ b/scene/gui/scroll_container.cpp @@ -49,10 +49,10 @@ Size2 ScrollContainer::get_minimum_size() const { } Size2 minsize = c->get_combined_minimum_size(); - if (!scroll_h) { + if (horizontal_scroll_mode == SCROLL_MODE_DISABLED) { min_size.x = MAX(min_size.x, minsize.x); } - if (!scroll_v) { + if (vertical_scroll_mode == SCROLL_MODE_DISABLED) { min_size.y = MAX(min_size.y, minsize.y); } } @@ -92,7 +92,7 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { Ref<InputEventMouseButton> mb = p_gui_input; if (mb.is_valid()) { - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP && mb->is_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_UP && mb->is_pressed()) { // only horizontal is enabled, scroll horizontally if (h_scroll->is_visible() && (!v_scroll->is_visible() || mb->is_shift_pressed())) { h_scroll->set_value(h_scroll->get_value() - h_scroll->get_page() / 8 * mb->get_factor()); @@ -101,7 +101,7 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { } } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN && mb->is_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_DOWN && mb->is_pressed()) { // only horizontal is enabled, scroll horizontally if (h_scroll->is_visible() && (!v_scroll->is_visible() || mb->is_shift_pressed())) { h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() / 8 * mb->get_factor()); @@ -110,13 +110,13 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { } } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT && mb->is_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_LEFT && mb->is_pressed()) { if (h_scroll->is_visible_in_tree()) { h_scroll->set_value(h_scroll->get_value() - h_scroll->get_page() * mb->get_factor() / 8); } } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT && mb->is_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_RIGHT && mb->is_pressed()) { if (h_scroll->is_visible_in_tree()) { h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * mb->get_factor() / 8); } @@ -130,7 +130,7 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { return; } - if (mb->get_button_index() != MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() != MouseButton::LEFT) { return; } @@ -170,7 +170,7 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { Vector2 motion = mm->get_relative(); drag_accum -= motion; - if (beyond_deadzone || (scroll_h && Math::abs(drag_accum.x) > deadzone) || (scroll_v && Math::abs(drag_accum.y) > deadzone)) { + if (beyond_deadzone || (horizontal_scroll_mode != SCROLL_MODE_DISABLED && Math::abs(drag_accum.x) > deadzone) || (vertical_scroll_mode != SCROLL_MODE_DISABLED && Math::abs(drag_accum.y) > deadzone)) { if (!beyond_deadzone) { propagate_notification(NOTIFICATION_SCROLL_BEGIN); emit_signal(SNAME("scroll_started")); @@ -180,12 +180,12 @@ void ScrollContainer::gui_input(const Ref<InputEvent> &p_gui_input) { drag_accum = -motion; } Vector2 diff = drag_from + drag_accum; - if (scroll_h) { + if (horizontal_scroll_mode != SCROLL_MODE_DISABLED) { h_scroll->set_value(diff.x); } else { drag_accum.x = 0; } - if (scroll_v) { + if (vertical_scroll_mode != SCROLL_MODE_DISABLED) { v_scroll->set_value(diff.y); } else { drag_accum.y = 0; @@ -286,7 +286,7 @@ void ScrollContainer::_update_dimensions() { child_max_size.y = MAX(child_max_size.y, minsize.y); Rect2 r = Rect2(-Size2(get_h_scroll(), get_v_scroll()), minsize); - if (!scroll_h || (!h_scroll->is_visible_in_tree() && c->get_h_size_flags() & SIZE_EXPAND)) { + if (horizontal_scroll_mode == SCROLL_MODE_DISABLED || (!h_scroll->is_visible_in_tree() && c->get_h_size_flags() & SIZE_EXPAND)) { r.position.x = 0; if (c->get_h_size_flags() & SIZE_EXPAND) { r.size.width = MAX(size.width, minsize.width); @@ -294,7 +294,7 @@ void ScrollContainer::_update_dimensions() { r.size.width = minsize.width; } } - if (!scroll_v || (!v_scroll->is_visible_in_tree() && c->get_v_size_flags() & SIZE_EXPAND)) { + if (vertical_scroll_mode == SCROLL_MODE_DISABLED || (!v_scroll->is_visible_in_tree() && c->get_v_size_flags() & SIZE_EXPAND)) { r.position.y = 0; if (c->get_v_size_flags() & SIZE_EXPAND) { r.size.height = MAX(size.height, minsize.height); @@ -320,7 +320,9 @@ void ScrollContainer::_notification(int p_what) { }; if (p_what == NOTIFICATION_READY) { - get_viewport()->connect("gui_focus_changed", callable_mp(this, &ScrollContainer::_gui_focus_changed)); + Viewport *viewport = get_viewport(); + ERR_FAIL_COND(!viewport); + viewport->connect("gui_focus_changed", callable_mp(this, &ScrollContainer::_gui_focus_changed)); _update_dimensions(); } @@ -362,10 +364,10 @@ void ScrollContainer::_notification(int p_what) { turnoff_v = true; } - if (scroll_h) { + if (horizontal_scroll_mode != SCROLL_MODE_DISABLED) { h_scroll->set_value(pos.x); } - if (scroll_v) { + if (vertical_scroll_mode != SCROLL_MODE_DISABLED) { v_scroll->set_value(pos.y); } @@ -411,17 +413,17 @@ void ScrollContainer::update_scrollbars() { Size2 hmin; Size2 vmin; - if (scroll_h) { + if (horizontal_scroll_mode != SCROLL_MODE_DISABLED) { hmin = h_scroll->get_combined_minimum_size(); } - if (scroll_v) { + if (vertical_scroll_mode != SCROLL_MODE_DISABLED) { vmin = v_scroll->get_combined_minimum_size(); } Size2 min = child_max_size; - bool hide_scroll_h = !scroll_h || min.width <= size.width || !h_scroll_visible; - bool hide_scroll_v = !scroll_v || min.height <= size.height || !v_scroll_visible; + bool hide_scroll_h = horizontal_scroll_mode != SCROLL_MODE_SHOW_ALWAYS && (horizontal_scroll_mode == SCROLL_MODE_DISABLED || horizontal_scroll_mode == SCROLL_MODE_SHOW_NEVER || (horizontal_scroll_mode == SCROLL_MODE_AUTO && min.width <= size.width)); + bool hide_scroll_v = vertical_scroll_mode != SCROLL_MODE_SHOW_ALWAYS && (vertical_scroll_mode == SCROLL_MODE_DISABLED || vertical_scroll_mode == SCROLL_MODE_SHOW_NEVER || (vertical_scroll_mode == SCROLL_MODE_AUTO && min.height <= size.height)); h_scroll->set_max(min.width); h_scroll->set_page(size.width - (hide_scroll_v ? 0 : vmin.width)); @@ -459,58 +461,32 @@ int ScrollContainer::get_v_scroll() const { return v_scroll->get_value(); } -void ScrollContainer::set_enable_h_scroll(bool p_enable) { - if (scroll_h == p_enable) { +void ScrollContainer::set_horizontal_scroll_mode(ScrollMode p_mode) { + if (horizontal_scroll_mode == p_mode) { return; } - scroll_h = p_enable; - minimum_size_changed(); + horizontal_scroll_mode = p_mode; + update_minimum_size(); queue_sort(); } -bool ScrollContainer::is_h_scroll_enabled() const { - return scroll_h; +ScrollContainer::ScrollMode ScrollContainer::get_horizontal_scroll_mode() const { + return horizontal_scroll_mode; } -void ScrollContainer::set_enable_v_scroll(bool p_enable) { - if (scroll_v == p_enable) { +void ScrollContainer::set_vertical_scroll_mode(ScrollMode p_mode) { + if (vertical_scroll_mode == p_mode) { return; } - scroll_v = p_enable; - minimum_size_changed(); + vertical_scroll_mode = p_mode; + update_minimum_size(); queue_sort(); } -bool ScrollContainer::is_v_scroll_enabled() const { - return scroll_v; -} - -void ScrollContainer::set_h_scroll_visible(bool p_visible) { - if (h_scroll_visible == p_visible) { - return; - } - - h_scroll_visible = p_visible; - update_scrollbars(); -} - -bool ScrollContainer::is_h_scroll_visible() const { - return h_scroll_visible; -} - -void ScrollContainer::set_v_scroll_visible(bool p_visible) { - if (v_scroll_visible == p_visible) { - return; - } - - v_scroll_visible = p_visible; - update_scrollbars(); -} - -bool ScrollContainer::is_v_scroll_visible() const { - return v_scroll_visible; +ScrollContainer::ScrollMode ScrollContainer::get_vertical_scroll_mode() const { + return vertical_scroll_mode; } int ScrollContainer::get_deadzone() const { @@ -573,17 +549,11 @@ void ScrollContainer::_bind_methods() { ClassDB::bind_method(D_METHOD("set_v_scroll", "value"), &ScrollContainer::set_v_scroll); ClassDB::bind_method(D_METHOD("get_v_scroll"), &ScrollContainer::get_v_scroll); - ClassDB::bind_method(D_METHOD("set_enable_h_scroll", "enable"), &ScrollContainer::set_enable_h_scroll); - ClassDB::bind_method(D_METHOD("is_h_scroll_enabled"), &ScrollContainer::is_h_scroll_enabled); - - ClassDB::bind_method(D_METHOD("set_enable_v_scroll", "enable"), &ScrollContainer::set_enable_v_scroll); - ClassDB::bind_method(D_METHOD("is_v_scroll_enabled"), &ScrollContainer::is_v_scroll_enabled); + ClassDB::bind_method(D_METHOD("set_horizontal_scroll_mode", "enable"), &ScrollContainer::set_horizontal_scroll_mode); + ClassDB::bind_method(D_METHOD("get_horizontal_scroll_mode"), &ScrollContainer::get_horizontal_scroll_mode); - ClassDB::bind_method(D_METHOD("set_h_scroll_visible", "visible"), &ScrollContainer::set_h_scroll_visible); - ClassDB::bind_method(D_METHOD("is_h_scroll_visible"), &ScrollContainer::is_h_scroll_visible); - - ClassDB::bind_method(D_METHOD("set_v_scroll_visible", "visible"), &ScrollContainer::set_v_scroll_visible); - ClassDB::bind_method(D_METHOD("is_v_scroll_visible"), &ScrollContainer::is_v_scroll_visible); + ClassDB::bind_method(D_METHOD("set_vertical_scroll_mode", "enable"), &ScrollContainer::set_vertical_scroll_mode); + ClassDB::bind_method(D_METHOD("get_vertical_scroll_mode"), &ScrollContainer::get_vertical_scroll_mode); ClassDB::bind_method(D_METHOD("set_deadzone", "deadzone"), &ScrollContainer::set_deadzone); ClassDB::bind_method(D_METHOD("get_deadzone"), &ScrollContainer::get_deadzone); @@ -603,12 +573,15 @@ void ScrollContainer::_bind_methods() { ADD_GROUP("Scroll", "scroll_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "scroll_horizontal"), "set_h_scroll", "get_h_scroll"); ADD_PROPERTY(PropertyInfo(Variant::INT, "scroll_vertical"), "set_v_scroll", "get_v_scroll"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "scroll_horizontal_enabled"), "set_enable_h_scroll", "is_h_scroll_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "scroll_vertical_enabled"), "set_enable_v_scroll", "is_v_scroll_enabled"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "scroll_horizontal_visible"), "set_h_scroll_visible", "is_h_scroll_visible"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "scroll_vertical_visible"), "set_v_scroll_visible", "is_v_scroll_visible"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "horizontal_scroll_mode", PROPERTY_HINT_ENUM, "Disabled,Auto,Always Show,Never Show"), "set_horizontal_scroll_mode", "get_horizontal_scroll_mode"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "vertical_scroll_mode", PROPERTY_HINT_ENUM, "Disabled,Auto,Always Show,Never Show"), "set_vertical_scroll_mode", "get_vertical_scroll_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "scroll_deadzone"), "set_deadzone", "get_deadzone"); + BIND_ENUM_CONSTANT(SCROLL_MODE_DISABLED); + BIND_ENUM_CONSTANT(SCROLL_MODE_AUTO); + BIND_ENUM_CONSTANT(SCROLL_MODE_SHOW_ALWAYS); + BIND_ENUM_CONSTANT(SCROLL_MODE_SHOW_NEVER); + GLOBAL_DEF("gui/common/default_scroll_deadzone", 0); }; diff --git a/scene/gui/scroll_container.h b/scene/gui/scroll_container.h index 9f4ec558dc..0cec4db57a 100644 --- a/scene/gui/scroll_container.h +++ b/scene/gui/scroll_container.h @@ -38,6 +38,15 @@ class ScrollContainer : public Container { GDCLASS(ScrollContainer, Container); +public: + enum ScrollMode { + SCROLL_MODE_DISABLED = 0, + SCROLL_MODE_AUTO, + SCROLL_MODE_SHOW_ALWAYS, + SCROLL_MODE_SHOW_NEVER, + }; + +private: HScrollBar *h_scroll; VScrollBar *v_scroll; @@ -54,11 +63,8 @@ class ScrollContainer : public Container { bool drag_touching_deaccel = false; bool beyond_deadzone = false; - bool scroll_h = true; - bool scroll_v = true; - - bool h_scroll_visible = true; - bool v_scroll_visible = true; + ScrollMode horizontal_scroll_mode = SCROLL_MODE_AUTO; + ScrollMode vertical_scroll_mode = SCROLL_MODE_AUTO; int deadzone = 0; bool follow_focus = false; @@ -68,7 +74,6 @@ class ScrollContainer : public Container { protected: Size2 get_minimum_size() const override; - virtual void gui_input(const Ref<InputEvent> &p_gui_input) override; void _gui_focus_changed(Control *p_control); void _update_dimensions(); void _notification(int p_what); @@ -80,23 +85,19 @@ protected: void _update_scrollbar_position(); public: + virtual void gui_input(const Ref<InputEvent> &p_gui_input) override; + void set_h_scroll(int p_pos); int get_h_scroll() const; void set_v_scroll(int p_pos); int get_v_scroll() const; - void set_enable_h_scroll(bool p_enable); - bool is_h_scroll_enabled() const; - - void set_enable_v_scroll(bool p_enable); - bool is_v_scroll_enabled() const; + void set_horizontal_scroll_mode(ScrollMode p_mode); + ScrollMode get_horizontal_scroll_mode() const; - void set_h_scroll_visible(bool p_visible); - bool is_h_scroll_visible() const; - - void set_v_scroll_visible(bool p_visible); - bool is_v_scroll_visible() const; + void set_vertical_scroll_mode(ScrollMode p_mode); + ScrollMode get_vertical_scroll_mode() const; int get_deadzone() const; void set_deadzone(int p_deadzone); @@ -113,4 +114,6 @@ public: ScrollContainer(); }; +VARIANT_ENUM_CAST(ScrollContainer::ScrollMode); + #endif diff --git a/scene/gui/slider.cpp b/scene/gui/slider.cpp index 352f87954e..f8cabe172c 100644 --- a/scene/gui/slider.cpp +++ b/scene/gui/slider.cpp @@ -55,7 +55,7 @@ void Slider::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mb = p_event; if (mb.is_valid()) { - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() == MouseButton::LEFT) { if (mb->is_pressed()) { Ref<Texture2D> grabber = get_theme_icon(mouse_inside || has_focus() ? "grabber_highlight" : "grabber"); grab.pos = orientation == VERTICAL ? mb->get_position().y : mb->get_position().x; @@ -74,10 +74,10 @@ void Slider::gui_input(const Ref<InputEvent> &p_event) { grab.active = false; } } else if (scrollable) { - if (mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP) { + if (mb->is_pressed() && mb->get_button_index() == MouseButton::WHEEL_UP) { grab_focus(); set_value(get_value() + get_step()); - } else if (mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN) { + } else if (mb->is_pressed() && mb->get_button_index() == MouseButton::WHEEL_DOWN) { grab_focus(); set_value(get_value() - get_step()); } @@ -142,7 +142,7 @@ void Slider::gui_input(const Ref<InputEvent> &p_event) { void Slider::_notification(int p_what) { switch (p_what) { case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_MOUSE_ENTER: { diff --git a/scene/gui/spin_box.cpp b/scene/gui/spin_box.cpp index 0446e1b402..8d6315d085 100644 --- a/scene/gui/spin_box.cpp +++ b/scene/gui/spin_box.cpp @@ -41,10 +41,10 @@ Size2 SpinBox::get_minimum_size() const { void SpinBox::_value_changed(double) { String value = TS->format_number(String::num(get_value(), Math::range_step_decimals(get_step()))); - if (prefix != "") { + if (!prefix.is_empty()) { value = prefix + " " + value; } - if (suffix != "") { + if (!suffix.is_empty()) { value += " " + suffix; } line_edit->set_text(value); @@ -85,7 +85,7 @@ void SpinBox::_line_edit_input(const Ref<InputEvent> &p_event) { } void SpinBox::_range_click_timeout() { - if (!drag.enabled && Input::get_singleton()->is_mouse_button_pressed(MOUSE_BUTTON_LEFT)) { + if (!drag.enabled && Input::get_singleton()->is_mouse_button_pressed(MouseButton::LEFT)) { bool up = get_local_mouse_position().y < (get_size().height / 2); set_value(get_value() + (up ? get_step() : -get_step())); @@ -121,7 +121,7 @@ void SpinBox::gui_input(const Ref<InputEvent> &p_event) { bool up = mb->get_position().y < (get_size().height / 2); switch (mb->get_button_index()) { - case MOUSE_BUTTON_LEFT: { + case MouseButton::LEFT: { line_edit->grab_focus(); set_value(get_value() + (up ? get_step() : -get_step())); @@ -133,17 +133,17 @@ void SpinBox::gui_input(const Ref<InputEvent> &p_event) { drag.allowed = true; drag.capture_pos = mb->get_position(); } break; - case MOUSE_BUTTON_RIGHT: { + case MouseButton::RIGHT: { line_edit->grab_focus(); set_value((up ? get_max() : get_min())); } break; - case MOUSE_BUTTON_WHEEL_UP: { + case MouseButton::WHEEL_UP: { if (line_edit->has_focus()) { set_value(get_value() + get_step() * mb->get_factor()); accept_event(); } } break; - case MOUSE_BUTTON_WHEEL_DOWN: { + case MouseButton::WHEEL_DOWN: { if (line_edit->has_focus()) { set_value(get_value() - get_step() * mb->get_factor()); accept_event(); @@ -154,7 +154,7 @@ void SpinBox::gui_input(const Ref<InputEvent> &p_event) { } } - if (mb.is_valid() && !mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && !mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { //set_default_cursor_shape(CURSOR_ARROW); range_click_timer->stop(); _release_mouse(); @@ -163,10 +163,10 @@ void SpinBox::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseMotion> mm = p_event; - if (mm.is_valid() && mm->get_button_mask() & MOUSE_BUTTON_MASK_LEFT) { + if (mm.is_valid() && (mm->get_button_mask() & MouseButton::MASK_LEFT) != MouseButton::NONE) { if (drag.enabled) { drag.diff_y += mm->get_relative().y; - float diff_y = -0.01 * Math::pow(ABS(drag.diff_y), 1.8f) * SGN(drag.diff_y); + float diff_y = -0.01 * Math::pow(ABS(drag.diff_y), 1.8f) * SIGN(drag.diff_y); set_value(CLAMP(drag.base_val + get_step() * diff_y, get_min(), get_max())); } else if (drag.allowed && drag.capture_pos.distance_to(mm->get_position()) > 2) { Input::get_singleton()->set_mouse_mode(Input::MOUSE_MODE_CAPTURED); @@ -220,19 +220,19 @@ void SpinBox::_notification(int p_what) { } else if (p_what == NOTIFICATION_TRANSLATION_CHANGED) { _value_changed(0); } else if (p_what == NOTIFICATION_THEME_CHANGED) { - call_deferred(SNAME("minimum_size_changed")); - get_line_edit()->call_deferred(SNAME("minimum_size_changed")); + call_deferred(SNAME("update_minimum_size")); + get_line_edit()->call_deferred(SNAME("update_minimum_size")); } else if (p_what == NOTIFICATION_LAYOUT_DIRECTION_CHANGED || p_what == NOTIFICATION_TRANSLATION_CHANGED) { update(); } } -void SpinBox::set_align(LineEdit::Align p_align) { - line_edit->set_align(p_align); +void SpinBox::set_horizontal_alignment(HorizontalAlignment p_alignment) { + line_edit->set_horizontal_alignment(p_alignment); } -LineEdit::Align SpinBox::get_align() const { - return line_edit->get_align(); +HorizontalAlignment SpinBox::get_horizontal_alignment() const { + return line_edit->get_horizontal_alignment(); } void SpinBox::set_suffix(const String &p_suffix) { @@ -284,8 +284,8 @@ void SpinBox::apply() { } void SpinBox::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_align", "align"), &SpinBox::set_align); - ClassDB::bind_method(D_METHOD("get_align"), &SpinBox::get_align); + ClassDB::bind_method(D_METHOD("set_horizontal_alignment", "alignment"), &SpinBox::set_horizontal_alignment); + ClassDB::bind_method(D_METHOD("get_horizontal_alignment"), &SpinBox::get_horizontal_alignment); ClassDB::bind_method(D_METHOD("set_suffix", "suffix"), &SpinBox::set_suffix); ClassDB::bind_method(D_METHOD("get_suffix"), &SpinBox::get_suffix); ClassDB::bind_method(D_METHOD("set_prefix", "prefix"), &SpinBox::set_prefix); @@ -297,7 +297,7 @@ void SpinBox::_bind_methods() { ClassDB::bind_method(D_METHOD("apply"), &SpinBox::apply); ClassDB::bind_method(D_METHOD("get_line_edit"), &SpinBox::get_line_edit); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_horizontal_alignment", "get_horizontal_alignment"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "editable"), "set_editable", "is_editable"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "update_on_text_changed"), "set_update_on_text_changed", "get_update_on_text_changed"); ADD_PROPERTY(PropertyInfo(Variant::STRING, "prefix"), "set_prefix", "get_prefix"); @@ -310,7 +310,7 @@ SpinBox::SpinBox() { line_edit->set_anchors_and_offsets_preset(Control::PRESET_WIDE); line_edit->set_mouse_filter(MOUSE_FILTER_PASS); - line_edit->set_align(LineEdit::ALIGN_LEFT); + line_edit->set_horizontal_alignment(HORIZONTAL_ALIGNMENT_LEFT); line_edit->connect("text_submitted", callable_mp(this, &SpinBox::_text_submitted), Vector<Variant>(), CONNECT_DEFERRED); line_edit->connect("focus_exited", callable_mp(this, &SpinBox::_line_edit_focus_exit), Vector<Variant>(), CONNECT_DEFERRED); diff --git a/scene/gui/spin_box.h b/scene/gui/spin_box.h index f2299ce1c2..736a5d873d 100644 --- a/scene/gui/spin_box.h +++ b/scene/gui/spin_box.h @@ -79,8 +79,8 @@ public: virtual Size2 get_minimum_size() const override; - void set_align(LineEdit::Align p_align); - LineEdit::Align get_align() const; + void set_horizontal_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_horizontal_alignment() const; void set_editable(bool p_enabled); bool is_editable() const; diff --git a/scene/gui/split_container.cpp b/scene/gui/split_container.cpp index 4736a1ad37..106bb7949f 100644 --- a/scene/gui/split_container.cpp +++ b/scene/gui/split_container.cpp @@ -201,7 +201,7 @@ void SplitContainer::_notification(int p_what) { } } break; case NOTIFICATION_THEME_CHANGED: { - minimum_size_changed(); + update_minimum_size(); } break; } } @@ -216,7 +216,7 @@ void SplitContainer::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mb = p_event; if (mb.is_valid()) { - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() == MouseButton::LEFT) { if (mb->is_pressed()) { int sep = get_theme_constant(SNAME("separation")); diff --git a/scene/gui/tabs.cpp b/scene/gui/tab_bar.cpp index 0755a79eee..3d88c117e7 100644 --- a/scene/gui/tabs.cpp +++ b/scene/gui/tab_bar.cpp @@ -1,5 +1,5 @@ /*************************************************************************/ -/* tabs.cpp */ +/* tab_bar.cpp */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,7 +28,7 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#include "tabs.h" +#include "tab_bar.h" #include "core/object/message_queue.h" #include "core/string/translation.h" @@ -37,7 +37,7 @@ #include "scene/gui/label.h" #include "scene/gui/texture_rect.h" -Size2 Tabs::get_minimum_size() const { +Size2 TabBar::get_minimum_size() const { Ref<StyleBox> tab_unselected = get_theme_stylebox(SNAME("tab_unselected")); Ref<StyleBox> tab_selected = get_theme_stylebox(SNAME("tab_selected")); Ref<StyleBox> tab_disabled = get_theme_stylebox(SNAME("tab_disabled")); @@ -50,7 +50,7 @@ Size2 Tabs::get_minimum_size() const { Ref<Texture2D> tex = tabs[i].icon; if (tex.is_valid()) { ms.height = MAX(ms.height, tex->get_size().height); - if (tabs[i].text != "") { + if (!tabs[i].text.is_empty()) { ms.width += get_theme_constant(SNAME("hseparation")); } } @@ -90,7 +90,7 @@ Size2 Tabs::get_minimum_size() const { return ms; } -void Tabs::gui_input(const Ref<InputEvent> &p_event) { +void TabBar::gui_input(const Ref<InputEvent> &p_event) { ERR_FAIL_COND(p_event.is_null()); Ref<InputEventMouseMotion> mm = p_event; @@ -143,7 +143,7 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mb = p_event; if (mb.is_valid()) { - if (mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP && !mb->is_command_pressed()) { + if (mb->is_pressed() && mb->get_button_index() == MouseButton::WHEEL_UP && !mb->is_command_pressed()) { if (scrolling_enabled && buttons_visible) { if (offset > 0) { offset--; @@ -152,7 +152,7 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { } } - if (mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN && !mb->is_command_pressed()) { + if (mb->is_pressed() && mb->get_button_index() == MouseButton::WHEEL_DOWN && !mb->is_command_pressed()) { if (scrolling_enabled && buttons_visible) { if (missing_right) { offset++; @@ -162,9 +162,9 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { } } - if (rb_pressing && !mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (rb_pressing && !mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { if (rb_hover != -1) { - //pressed + // Right mouse button clicked. emit_signal(SNAME("tab_rmb_clicked"), rb_hover); } @@ -172,18 +172,18 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { update(); } - if (cb_pressing && !mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (cb_pressing && !mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { if (cb_hover != -1) { - //pressed - emit_signal(SNAME("tab_closed"), cb_hover); + // Close button pressed. + emit_signal(SNAME("tab_close_pressed"), cb_hover); } cb_pressing = false; update(); } - if (mb->is_pressed() && (mb->get_button_index() == MOUSE_BUTTON_LEFT || (select_with_rmb && mb->get_button_index() == MOUSE_BUTTON_RIGHT))) { - // clicks + if (mb->is_pressed() && (mb->get_button_index() == MouseButton::LEFT || (select_with_rmb && mb->get_button_index() == MouseButton::RIGHT))) { + // Clicks. Point2 pos = mb->get_position(); if (buttons_visible) { @@ -222,6 +222,11 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { } } + if (tabs.is_empty()) { + // Return early if there are no actual tabs to handle input for. + return; + } + int found = -1; for (int i = offset; i <= max_drawn_tab; i++) { if (tabs[i].rb_rect.has_point(pos)) { @@ -230,7 +235,7 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { return; } - if (tabs[i].cb_rect.has_point(pos)) { + if (tabs[i].cb_rect.has_point(pos) && (cb_displaypolicy == CLOSE_BUTTON_SHOW_ALWAYS || (cb_displaypolicy == CLOSE_BUTTON_SHOW_ACTIVE_ONLY && i == current))) { cb_pressing = true; update(); return; @@ -252,7 +257,7 @@ void Tabs::gui_input(const Ref<InputEvent> &p_event) { } } -void Tabs::_shape(int p_tab) { +void TabBar::_shape(int p_tab) { Ref<Font> font = get_theme_font(SNAME("font")); int font_size = get_theme_font_size(SNAME("font_size")); @@ -265,10 +270,10 @@ void Tabs::_shape(int p_tab) { tabs.write[p_tab].text_buf->set_direction((TextServer::Direction)tabs[p_tab].text_direction); } - tabs.write[p_tab].text_buf->add_string(tabs.write[p_tab].xl_text, font, font_size, tabs[p_tab].opentype_features, (tabs[p_tab].language != "") ? tabs[p_tab].language : TranslationServer::get_singleton()->get_tool_locale()); + tabs.write[p_tab].text_buf->add_string(tabs.write[p_tab].xl_text, font, font_size, tabs[p_tab].opentype_features, !tabs[p_tab].language.is_empty() ? tabs[p_tab].language : TranslationServer::get_singleton()->get_tool_locale()); } -void Tabs::_notification(int p_what) { +void TabBar::_notification(int p_what) { switch (p_what) { case NOTIFICATION_LAYOUT_DIRECTION_CHANGED: { _update_cache(); @@ -280,7 +285,7 @@ void Tabs::_notification(int p_what) { _shape(i); } _update_cache(); - minimum_size_changed(); + update_minimum_size(); update(); } break; case NOTIFICATION_RESIZED: { @@ -314,9 +319,9 @@ void Tabs::_notification(int p_what) { mw += get_tab_width(i); } - if (tab_align == ALIGN_CENTER) { + if (tab_alignment == ALIGNMENT_CENTER) { w = (get_size().width - mw) / 2; - } else if (tab_align == ALIGN_RIGHT) { + } else if (tab_alignment == ALIGNMENT_RIGHT) { w = get_size().width - mw; } @@ -380,7 +385,7 @@ void Tabs::_notification(int p_what) { } else { icon->draw(ci, Point2i(w, sb->get_margin(SIDE_TOP) + ((sb_rect.size.y - sb_ms.y) - icon->get_height()) / 2)); } - if (tabs[i].text != "") { + if (!tabs[i].text.is_empty()) { w += icon->get_width() + get_theme_constant(SNAME("hseparation")); } } @@ -505,11 +510,11 @@ void Tabs::_notification(int p_what) { } } -int Tabs::get_tab_count() const { +int TabBar::get_tab_count() const { return tabs.size(); } -void Tabs::set_current_tab(int p_current) { +void TabBar::set_current_tab(int p_current) { if (current == p_current) { return; } @@ -524,40 +529,40 @@ void Tabs::set_current_tab(int p_current) { emit_signal(SNAME("tab_changed"), p_current); } -int Tabs::get_current_tab() const { +int TabBar::get_current_tab() const { return current; } -int Tabs::get_previous_tab() const { +int TabBar::get_previous_tab() const { return previous; } -int Tabs::get_hovered_tab() const { +int TabBar::get_hovered_tab() const { return hover; } -int Tabs::get_tab_offset() const { +int TabBar::get_tab_offset() const { return offset; } -bool Tabs::get_offset_buttons_visible() const { +bool TabBar::get_offset_buttons_visible() const { return buttons_visible; } -void Tabs::set_tab_title(int p_tab, const String &p_title) { +void TabBar::set_tab_title(int p_tab, const String &p_title) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].text = p_title; _shape(p_tab); update(); - minimum_size_changed(); + update_minimum_size(); } -String Tabs::get_tab_title(int p_tab) const { +String TabBar::get_tab_title(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), ""); return tabs[p_tab].text; } -void Tabs::set_tab_text_direction(int p_tab, Control::TextDirection p_text_direction) { +void TabBar::set_tab_text_direction(int p_tab, Control::TextDirection p_text_direction) { ERR_FAIL_INDEX(p_tab, tabs.size()); ERR_FAIL_COND((int)p_text_direction < -1 || (int)p_text_direction > 3); if (tabs[p_tab].text_direction != p_text_direction) { @@ -567,19 +572,19 @@ void Tabs::set_tab_text_direction(int p_tab, Control::TextDirection p_text_direc } } -Control::TextDirection Tabs::get_tab_text_direction(int p_tab) const { +Control::TextDirection TabBar::get_tab_text_direction(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), Control::TEXT_DIRECTION_INHERITED); return tabs[p_tab].text_direction; } -void Tabs::clear_tab_opentype_features(int p_tab) { +void TabBar::clear_tab_opentype_features(int p_tab) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].opentype_features.clear(); _shape(p_tab); update(); } -void Tabs::set_tab_opentype_feature(int p_tab, const String &p_name, int p_value) { +void TabBar::set_tab_opentype_feature(int p_tab, const String &p_name, int p_value) { ERR_FAIL_INDEX(p_tab, tabs.size()); int32_t tag = TS->name_to_tag(p_name); if (!tabs[p_tab].opentype_features.has(tag) || (int)tabs[p_tab].opentype_features[tag] != p_value) { @@ -589,7 +594,7 @@ void Tabs::set_tab_opentype_feature(int p_tab, const String &p_name, int p_value } } -int Tabs::get_tab_opentype_feature(int p_tab, const String &p_name) const { +int TabBar::get_tab_opentype_feature(int p_tab, const String &p_name) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), -1); int32_t tag = TS->name_to_tag(p_name); if (!tabs[p_tab].opentype_features.has(tag)) { @@ -598,7 +603,7 @@ int Tabs::get_tab_opentype_feature(int p_tab, const String &p_name) const { return tabs[p_tab].opentype_features[tag]; } -void Tabs::set_tab_language(int p_tab, const String &p_language) { +void TabBar::set_tab_language(int p_tab, const String &p_language) { ERR_FAIL_INDEX(p_tab, tabs.size()); if (tabs[p_tab].language != p_language) { tabs.write[p_tab].language = p_language; @@ -607,54 +612,54 @@ void Tabs::set_tab_language(int p_tab, const String &p_language) { } } -String Tabs::get_tab_language(int p_tab) const { +String TabBar::get_tab_language(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), ""); return tabs[p_tab].language; } -void Tabs::set_tab_icon(int p_tab, const Ref<Texture2D> &p_icon) { +void TabBar::set_tab_icon(int p_tab, const Ref<Texture2D> &p_icon) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].icon = p_icon; update(); - minimum_size_changed(); + update_minimum_size(); } -Ref<Texture2D> Tabs::get_tab_icon(int p_tab) const { +Ref<Texture2D> TabBar::get_tab_icon(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), Ref<Texture2D>()); return tabs[p_tab].icon; } -void Tabs::set_tab_disabled(int p_tab, bool p_disabled) { +void TabBar::set_tab_disabled(int p_tab, bool p_disabled) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].disabled = p_disabled; update(); } -bool Tabs::get_tab_disabled(int p_tab) const { +bool TabBar::get_tab_disabled(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), false); return tabs[p_tab].disabled; } -void Tabs::set_tab_right_button(int p_tab, const Ref<Texture2D> &p_right_button) { +void TabBar::set_tab_right_button(int p_tab, const Ref<Texture2D> &p_right_button) { ERR_FAIL_INDEX(p_tab, tabs.size()); tabs.write[p_tab].right_button = p_right_button; _update_cache(); update(); - minimum_size_changed(); + update_minimum_size(); } -Ref<Texture2D> Tabs::get_tab_right_button(int p_tab) const { +Ref<Texture2D> TabBar::get_tab_right_button(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), Ref<Texture2D>()); return tabs[p_tab].right_button; } -void Tabs::_update_hover() { +void TabBar::_update_hover() { if (!is_inside_tree()) { return; } const Point2 &pos = get_local_mouse_position(); - // test hovering to display right or close button + // test hovering to display right or close button. int hover_now = -1; int hover_buttons = -1; for (int i = offset; i < tabs.size(); i++) { @@ -679,13 +684,13 @@ void Tabs::_update_hover() { emit_signal(SNAME("tab_hovered"), hover); } - if (hover_buttons == -1) { // no hover + if (hover_buttons == -1) { // No hover. rb_hover = hover_buttons; cb_hover = hover_buttons; } } -void Tabs::_update_cache() { +void TabBar::_update_cache() { Ref<StyleBox> tab_disabled = get_theme_stylebox(SNAME("tab_disabled")); Ref<StyleBox> tab_unselected = get_theme_stylebox(SNAME("tab_unselected")); Ref<StyleBox> tab_selected = get_theme_stylebox(SNAME("tab_selected")); @@ -748,7 +753,7 @@ void Tabs::_update_cache() { } } -void Tabs::_on_mouse_exited() { +void TabBar::_on_mouse_exited() { rb_hover = -1; cb_hover = -1; hover = -1; @@ -756,7 +761,7 @@ void Tabs::_on_mouse_exited() { update(); } -void Tabs::add_tab(const String &p_str, const Ref<Texture2D> &p_icon) { +void TabBar::add_tab(const String &p_str, const Ref<Texture2D> &p_icon) { Tab t; t.text = p_str; t.xl_text = atr(p_str); @@ -772,10 +777,10 @@ void Tabs::add_tab(const String &p_str, const Ref<Texture2D> &p_icon) { _update_cache(); call_deferred(SNAME("_update_hover")); update(); - minimum_size_changed(); + update_minimum_size(); } -void Tabs::clear_tabs() { +void TabBar::clear_tabs() { tabs.clear(); current = 0; previous = 0; @@ -783,16 +788,16 @@ void Tabs::clear_tabs() { update(); } -void Tabs::remove_tab(int p_idx) { +void TabBar::remove_tab(int p_idx) { ERR_FAIL_INDEX(p_idx, tabs.size()); - tabs.remove(p_idx); + tabs.remove_at(p_idx); if (current >= p_idx) { current--; } _update_cache(); call_deferred(SNAME("_update_hover")); update(); - minimum_size_changed(); + update_minimum_size(); if (current < 0) { current = 0; @@ -805,7 +810,7 @@ void Tabs::remove_tab(int p_idx) { _ensure_no_over_offset(); } -Variant Tabs::get_drag_data(const Point2 &p_point) { +Variant TabBar::get_drag_data(const Point2 &p_point) { if (!drag_to_rearrange_enabled) { return Variant(); } @@ -839,7 +844,7 @@ Variant Tabs::get_drag_data(const Point2 &p_point) { return drag_data; } -bool Tabs::can_drop_data(const Point2 &p_point, const Variant &p_data) const { +bool TabBar::can_drop_data(const Point2 &p_point, const Variant &p_data) const { if (!drag_to_rearrange_enabled) { return false; } @@ -855,9 +860,9 @@ bool Tabs::can_drop_data(const Point2 &p_point, const Variant &p_data) const { if (from_path == to_path) { return true; } else if (get_tabs_rearrange_group() != -1) { - // drag and drop between other Tabs + // Drag and drop between other TabBars. Node *from_node = get_node(from_path); - Tabs *from_tabs = Object::cast_to<Tabs>(from_node); + TabBar *from_tabs = Object::cast_to<TabBar>(from_node); if (from_tabs && from_tabs->get_tabs_rearrange_group() == get_tabs_rearrange_group()) { return true; } @@ -866,7 +871,7 @@ bool Tabs::can_drop_data(const Point2 &p_point, const Variant &p_data) const { return false; } -void Tabs::drop_data(const Point2 &p_point, const Variant &p_data) { +void TabBar::drop_data(const Point2 &p_point, const Variant &p_data) { if (!drag_to_rearrange_enabled) { return; } @@ -890,9 +895,9 @@ void Tabs::drop_data(const Point2 &p_point, const Variant &p_data) { emit_signal(SNAME("active_tab_rearranged"), hover_now); set_current_tab(hover_now); } else if (get_tabs_rearrange_group() != -1) { - // drag and drop between Tabs + // Drag and drop between Tabs. Node *from_node = get_node(from_path); - Tabs *from_tabs = Object::cast_to<Tabs>(from_node); + TabBar *from_tabs = Object::cast_to<TabBar>(from_node); if (from_tabs && from_tabs->get_tabs_rearrange_group() == get_tabs_rearrange_group()) { if (tab_from_id >= from_tabs->get_tab_count()) { return; @@ -912,7 +917,7 @@ void Tabs::drop_data(const Point2 &p_point, const Variant &p_data) { update(); } -int Tabs::get_tab_idx_at_point(const Point2 &p_point) const { +int TabBar::get_tab_idx_at_point(const Point2 &p_point) const { int hover_now = -1; for (int i = offset; i <= max_drawn_tab; i++) { Rect2 rect = get_tab_rect(i); @@ -924,30 +929,30 @@ int Tabs::get_tab_idx_at_point(const Point2 &p_point) const { return hover_now; } -void Tabs::set_tab_align(TabAlign p_align) { - ERR_FAIL_INDEX(p_align, ALIGN_MAX); - tab_align = p_align; +void TabBar::set_tab_alignment(AlignmentMode p_alignment) { + ERR_FAIL_INDEX(p_alignment, ALIGNMENT_MAX); + tab_alignment = p_alignment; update(); } -Tabs::TabAlign Tabs::get_tab_align() const { - return tab_align; +TabBar::AlignmentMode TabBar::get_tab_alignment() const { + return tab_alignment; } -void Tabs::set_clip_tabs(bool p_clip_tabs) { +void TabBar::set_clip_tabs(bool p_clip_tabs) { if (clip_tabs == p_clip_tabs) { return; } clip_tabs = p_clip_tabs; update(); - minimum_size_changed(); + update_minimum_size(); } -bool Tabs::get_clip_tabs() const { +bool TabBar::get_clip_tabs() const { return clip_tabs; } -void Tabs::move_tab(int from, int to) { +void TabBar::move_tab(int from, int to) { if (from == to) { return; } @@ -956,14 +961,14 @@ void Tabs::move_tab(int from, int to) { ERR_FAIL_INDEX(to, tabs.size()); Tab tab_from = tabs[from]; - tabs.remove(from); + tabs.remove_at(from); tabs.insert(to, tab_from); _update_cache(); update(); } -int Tabs::get_tab_width(int p_idx) const { +int TabBar::get_tab_width(int p_idx) const { ERR_FAIL_INDEX_V(p_idx, tabs.size(), 0); Ref<StyleBox> tab_unselected = get_theme_stylebox(SNAME("tab_unselected")); @@ -975,7 +980,7 @@ int Tabs::get_tab_width(int p_idx) const { Ref<Texture2D> tex = tabs[p_idx].icon; if (tex.is_valid()) { x += tex->get_width(); - if (tabs[p_idx].text != "") { + if (!tabs[p_idx].text.is_empty()) { x += get_theme_constant(SNAME("hseparation")); } } @@ -1005,7 +1010,7 @@ int Tabs::get_tab_width(int p_idx) const { return x; } -void Tabs::_ensure_no_over_offset() { +void TabBar::_ensure_no_over_offset() { if (!is_inside_tree()) { return; } @@ -1031,7 +1036,7 @@ void Tabs::_ensure_no_over_offset() { } } -void Tabs::ensure_tab_visible(int p_idx) { +void TabBar::ensure_tab_visible(int p_idx) { if (!is_inside_tree()) { return; } @@ -1068,7 +1073,7 @@ void Tabs::ensure_tab_visible(int p_idx) { } } -Rect2 Tabs::get_tab_rect(int p_tab) const { +Rect2 TabBar::get_tab_rect(int p_tab) const { ERR_FAIL_INDEX_V(p_tab, tabs.size(), Rect2()); if (is_layout_rtl()) { return Rect2(get_size().width - tabs[p_tab].ofs_cache - tabs[p_tab].size_cache, 0, tabs[p_tab].size_cache, get_size().height); @@ -1077,112 +1082,112 @@ Rect2 Tabs::get_tab_rect(int p_tab) const { } } -void Tabs::set_tab_close_display_policy(CloseButtonDisplayPolicy p_policy) { +void TabBar::set_tab_close_display_policy(CloseButtonDisplayPolicy p_policy) { ERR_FAIL_INDEX(p_policy, CLOSE_BUTTON_MAX); cb_displaypolicy = p_policy; update(); } -Tabs::CloseButtonDisplayPolicy Tabs::get_tab_close_display_policy() const { +TabBar::CloseButtonDisplayPolicy TabBar::get_tab_close_display_policy() const { return cb_displaypolicy; } -void Tabs::set_min_width(int p_width) { +void TabBar::set_min_width(int p_width) { min_width = p_width; } -void Tabs::set_scrolling_enabled(bool p_enabled) { +void TabBar::set_scrolling_enabled(bool p_enabled) { scrolling_enabled = p_enabled; } -bool Tabs::get_scrolling_enabled() const { +bool TabBar::get_scrolling_enabled() const { return scrolling_enabled; } -void Tabs::set_drag_to_rearrange_enabled(bool p_enabled) { +void TabBar::set_drag_to_rearrange_enabled(bool p_enabled) { drag_to_rearrange_enabled = p_enabled; } -bool Tabs::get_drag_to_rearrange_enabled() const { +bool TabBar::get_drag_to_rearrange_enabled() const { return drag_to_rearrange_enabled; } -void Tabs::set_tabs_rearrange_group(int p_group_id) { +void TabBar::set_tabs_rearrange_group(int p_group_id) { tabs_rearrange_group = p_group_id; } -int Tabs::get_tabs_rearrange_group() const { +int TabBar::get_tabs_rearrange_group() const { return tabs_rearrange_group; } -void Tabs::set_select_with_rmb(bool p_enabled) { +void TabBar::set_select_with_rmb(bool p_enabled) { select_with_rmb = p_enabled; } -bool Tabs::get_select_with_rmb() const { +bool TabBar::get_select_with_rmb() const { return select_with_rmb; } -void Tabs::_bind_methods() { - ClassDB::bind_method(D_METHOD("_update_hover"), &Tabs::_update_hover); - ClassDB::bind_method(D_METHOD("get_tab_count"), &Tabs::get_tab_count); - ClassDB::bind_method(D_METHOD("set_current_tab", "tab_idx"), &Tabs::set_current_tab); - ClassDB::bind_method(D_METHOD("get_current_tab"), &Tabs::get_current_tab); - ClassDB::bind_method(D_METHOD("get_previous_tab"), &Tabs::get_previous_tab); - ClassDB::bind_method(D_METHOD("set_tab_title", "tab_idx", "title"), &Tabs::set_tab_title); - ClassDB::bind_method(D_METHOD("get_tab_title", "tab_idx"), &Tabs::get_tab_title); - ClassDB::bind_method(D_METHOD("set_tab_text_direction", "tab_idx", "direction"), &Tabs::set_tab_text_direction); - ClassDB::bind_method(D_METHOD("get_tab_text_direction", "tab_idx"), &Tabs::get_tab_text_direction); - ClassDB::bind_method(D_METHOD("set_tab_opentype_feature", "tab_idx", "tag", "values"), &Tabs::set_tab_opentype_feature); - ClassDB::bind_method(D_METHOD("get_tab_opentype_feature", "tab_idx", "tag"), &Tabs::get_tab_opentype_feature); - ClassDB::bind_method(D_METHOD("clear_tab_opentype_features", "tab_idx"), &Tabs::clear_tab_opentype_features); - ClassDB::bind_method(D_METHOD("set_tab_language", "tab_idx", "language"), &Tabs::set_tab_language); - ClassDB::bind_method(D_METHOD("get_tab_language", "tab_idx"), &Tabs::get_tab_language); - ClassDB::bind_method(D_METHOD("set_tab_icon", "tab_idx", "icon"), &Tabs::set_tab_icon); - ClassDB::bind_method(D_METHOD("get_tab_icon", "tab_idx"), &Tabs::get_tab_icon); - ClassDB::bind_method(D_METHOD("set_tab_disabled", "tab_idx", "disabled"), &Tabs::set_tab_disabled); - ClassDB::bind_method(D_METHOD("get_tab_disabled", "tab_idx"), &Tabs::get_tab_disabled); - ClassDB::bind_method(D_METHOD("remove_tab", "tab_idx"), &Tabs::remove_tab); - ClassDB::bind_method(D_METHOD("add_tab", "title", "icon"), &Tabs::add_tab, DEFVAL(""), DEFVAL(Ref<Texture2D>())); - ClassDB::bind_method(D_METHOD("set_tab_align", "align"), &Tabs::set_tab_align); - ClassDB::bind_method(D_METHOD("get_tab_align"), &Tabs::get_tab_align); - ClassDB::bind_method(D_METHOD("set_clip_tabs", "clip_tabs"), &Tabs::set_clip_tabs); - ClassDB::bind_method(D_METHOD("get_clip_tabs"), &Tabs::get_clip_tabs); - ClassDB::bind_method(D_METHOD("get_tab_offset"), &Tabs::get_tab_offset); - ClassDB::bind_method(D_METHOD("get_offset_buttons_visible"), &Tabs::get_offset_buttons_visible); - ClassDB::bind_method(D_METHOD("ensure_tab_visible", "idx"), &Tabs::ensure_tab_visible); - ClassDB::bind_method(D_METHOD("get_tab_rect", "tab_idx"), &Tabs::get_tab_rect); - ClassDB::bind_method(D_METHOD("move_tab", "from", "to"), &Tabs::move_tab); - ClassDB::bind_method(D_METHOD("set_tab_close_display_policy", "policy"), &Tabs::set_tab_close_display_policy); - ClassDB::bind_method(D_METHOD("get_tab_close_display_policy"), &Tabs::get_tab_close_display_policy); - ClassDB::bind_method(D_METHOD("set_scrolling_enabled", "enabled"), &Tabs::set_scrolling_enabled); - ClassDB::bind_method(D_METHOD("get_scrolling_enabled"), &Tabs::get_scrolling_enabled); - ClassDB::bind_method(D_METHOD("set_drag_to_rearrange_enabled", "enabled"), &Tabs::set_drag_to_rearrange_enabled); - ClassDB::bind_method(D_METHOD("get_drag_to_rearrange_enabled"), &Tabs::get_drag_to_rearrange_enabled); - ClassDB::bind_method(D_METHOD("set_tabs_rearrange_group", "group_id"), &Tabs::set_tabs_rearrange_group); - ClassDB::bind_method(D_METHOD("get_tabs_rearrange_group"), &Tabs::get_tabs_rearrange_group); - - ClassDB::bind_method(D_METHOD("set_select_with_rmb", "enabled"), &Tabs::set_select_with_rmb); - ClassDB::bind_method(D_METHOD("get_select_with_rmb"), &Tabs::get_select_with_rmb); +void TabBar::_bind_methods() { + ClassDB::bind_method(D_METHOD("_update_hover"), &TabBar::_update_hover); + ClassDB::bind_method(D_METHOD("get_tab_count"), &TabBar::get_tab_count); + ClassDB::bind_method(D_METHOD("set_current_tab", "tab_idx"), &TabBar::set_current_tab); + ClassDB::bind_method(D_METHOD("get_current_tab"), &TabBar::get_current_tab); + ClassDB::bind_method(D_METHOD("get_previous_tab"), &TabBar::get_previous_tab); + ClassDB::bind_method(D_METHOD("set_tab_title", "tab_idx", "title"), &TabBar::set_tab_title); + ClassDB::bind_method(D_METHOD("get_tab_title", "tab_idx"), &TabBar::get_tab_title); + ClassDB::bind_method(D_METHOD("set_tab_text_direction", "tab_idx", "direction"), &TabBar::set_tab_text_direction); + ClassDB::bind_method(D_METHOD("get_tab_text_direction", "tab_idx"), &TabBar::get_tab_text_direction); + ClassDB::bind_method(D_METHOD("set_tab_opentype_feature", "tab_idx", "tag", "values"), &TabBar::set_tab_opentype_feature); + ClassDB::bind_method(D_METHOD("get_tab_opentype_feature", "tab_idx", "tag"), &TabBar::get_tab_opentype_feature); + ClassDB::bind_method(D_METHOD("clear_tab_opentype_features", "tab_idx"), &TabBar::clear_tab_opentype_features); + ClassDB::bind_method(D_METHOD("set_tab_language", "tab_idx", "language"), &TabBar::set_tab_language); + ClassDB::bind_method(D_METHOD("get_tab_language", "tab_idx"), &TabBar::get_tab_language); + ClassDB::bind_method(D_METHOD("set_tab_icon", "tab_idx", "icon"), &TabBar::set_tab_icon); + ClassDB::bind_method(D_METHOD("get_tab_icon", "tab_idx"), &TabBar::get_tab_icon); + ClassDB::bind_method(D_METHOD("set_tab_disabled", "tab_idx", "disabled"), &TabBar::set_tab_disabled); + ClassDB::bind_method(D_METHOD("get_tab_disabled", "tab_idx"), &TabBar::get_tab_disabled); + ClassDB::bind_method(D_METHOD("remove_tab", "tab_idx"), &TabBar::remove_tab); + ClassDB::bind_method(D_METHOD("add_tab", "title", "icon"), &TabBar::add_tab, DEFVAL(""), DEFVAL(Ref<Texture2D>())); + ClassDB::bind_method(D_METHOD("set_tab_alignment", "alignment"), &TabBar::set_tab_alignment); + ClassDB::bind_method(D_METHOD("get_tab_alignment"), &TabBar::get_tab_alignment); + ClassDB::bind_method(D_METHOD("set_clip_tabs", "clip_tabs"), &TabBar::set_clip_tabs); + ClassDB::bind_method(D_METHOD("get_clip_tabs"), &TabBar::get_clip_tabs); + ClassDB::bind_method(D_METHOD("get_tab_offset"), &TabBar::get_tab_offset); + ClassDB::bind_method(D_METHOD("get_offset_buttons_visible"), &TabBar::get_offset_buttons_visible); + ClassDB::bind_method(D_METHOD("ensure_tab_visible", "idx"), &TabBar::ensure_tab_visible); + ClassDB::bind_method(D_METHOD("get_tab_rect", "tab_idx"), &TabBar::get_tab_rect); + ClassDB::bind_method(D_METHOD("move_tab", "from", "to"), &TabBar::move_tab); + ClassDB::bind_method(D_METHOD("set_tab_close_display_policy", "policy"), &TabBar::set_tab_close_display_policy); + ClassDB::bind_method(D_METHOD("get_tab_close_display_policy"), &TabBar::get_tab_close_display_policy); + ClassDB::bind_method(D_METHOD("set_scrolling_enabled", "enabled"), &TabBar::set_scrolling_enabled); + ClassDB::bind_method(D_METHOD("get_scrolling_enabled"), &TabBar::get_scrolling_enabled); + ClassDB::bind_method(D_METHOD("set_drag_to_rearrange_enabled", "enabled"), &TabBar::set_drag_to_rearrange_enabled); + ClassDB::bind_method(D_METHOD("get_drag_to_rearrange_enabled"), &TabBar::get_drag_to_rearrange_enabled); + ClassDB::bind_method(D_METHOD("set_tabs_rearrange_group", "group_id"), &TabBar::set_tabs_rearrange_group); + ClassDB::bind_method(D_METHOD("get_tabs_rearrange_group"), &TabBar::get_tabs_rearrange_group); + + ClassDB::bind_method(D_METHOD("set_select_with_rmb", "enabled"), &TabBar::set_select_with_rmb); + ClassDB::bind_method(D_METHOD("get_select_with_rmb"), &TabBar::get_select_with_rmb); ADD_SIGNAL(MethodInfo("tab_changed", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("tab_rmb_clicked", PropertyInfo(Variant::INT, "tab"))); - ADD_SIGNAL(MethodInfo("tab_closed", PropertyInfo(Variant::INT, "tab"))); + ADD_SIGNAL(MethodInfo("tab_close_pressed", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("tab_hovered", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("active_tab_rearranged", PropertyInfo(Variant::INT, "idx_to"))); ADD_SIGNAL(MethodInfo("tab_clicked", PropertyInfo(Variant::INT, "tab"))); ADD_PROPERTY(PropertyInfo(Variant::INT, "current_tab", PROPERTY_HINT_RANGE, "-1,4096,1", PROPERTY_USAGE_EDITOR), "set_current_tab", "get_current_tab"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_align", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_tab_align", "get_tab_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_alignment", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_tab_alignment", "get_tab_alignment"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "clip_tabs"), "set_clip_tabs", "get_clip_tabs"); ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_close_display_policy", PROPERTY_HINT_ENUM, "Show Never,Show Active Only,Show Always"), "set_tab_close_display_policy", "get_tab_close_display_policy"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "scrolling_enabled"), "set_scrolling_enabled", "get_scrolling_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "drag_to_rearrange_enabled"), "set_drag_to_rearrange_enabled", "get_drag_to_rearrange_enabled"); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); - BIND_ENUM_CONSTANT(ALIGN_MAX); + BIND_ENUM_CONSTANT(ALIGNMENT_LEFT); + BIND_ENUM_CONSTANT(ALIGNMENT_CENTER); + BIND_ENUM_CONSTANT(ALIGNMENT_RIGHT); + BIND_ENUM_CONSTANT(ALIGNMENT_MAX); BIND_ENUM_CONSTANT(CLOSE_BUTTON_SHOW_NEVER); BIND_ENUM_CONSTANT(CLOSE_BUTTON_SHOW_ACTIVE_ONLY); @@ -1190,6 +1195,6 @@ void Tabs::_bind_methods() { BIND_ENUM_CONSTANT(CLOSE_BUTTON_MAX); } -Tabs::Tabs() { - connect("mouse_exited", callable_mp(this, &Tabs::_on_mouse_exited)); +TabBar::TabBar() { + connect("mouse_exited", callable_mp(this, &TabBar::_on_mouse_exited)); } diff --git a/scene/gui/tabs.h b/scene/gui/tab_bar.h index b044453803..2d211937fc 100644 --- a/scene/gui/tabs.h +++ b/scene/gui/tab_bar.h @@ -1,5 +1,5 @@ /*************************************************************************/ -/* tabs.h */ +/* tab_bar.h */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,21 +28,21 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef TABS_H -#define TABS_H +#ifndef TAB_BAR_H +#define TAB_BAR_H #include "scene/gui/control.h" #include "scene/resources/text_line.h" -class Tabs : public Control { - GDCLASS(Tabs, Control); +class TabBar : public Control { + GDCLASS(TabBar, Control); public: - enum TabAlign { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT, - ALIGN_MAX + enum AlignmentMode { + ALIGNMENT_LEFT, + ALIGNMENT_CENTER, + ALIGNMENT_RIGHT, + ALIGNMENT_MAX, }; enum CloseButtonDisplayPolicy { @@ -83,8 +83,7 @@ private: Vector<Tab> tabs; int current = 0; int previous = 0; - int _get_top_margin() const; - TabAlign tab_align = ALIGN_CENTER; + AlignmentMode tab_alignment = ALIGNMENT_CENTER; bool clip_tabs = true; int rb_hover = -1; bool rb_pressing = false; @@ -146,8 +145,8 @@ public: void set_tab_right_button(int p_tab, const Ref<Texture2D> &p_right_button); Ref<Texture2D> get_tab_right_button(int p_tab) const; - void set_tab_align(TabAlign p_align); - TabAlign get_tab_align() const; + void set_tab_alignment(AlignmentMode p_alignment); + AlignmentMode get_tab_alignment() const; void set_clip_tabs(bool p_clip_tabs); bool get_clip_tabs() const; @@ -187,10 +186,10 @@ public: Rect2 get_tab_rect(int p_tab) const; Size2 get_minimum_size() const override; - Tabs(); + TabBar(); }; -VARIANT_ENUM_CAST(Tabs::TabAlign); -VARIANT_ENUM_CAST(Tabs::CloseButtonDisplayPolicy); +VARIANT_ENUM_CAST(TabBar::AlignmentMode); +VARIANT_ENUM_CAST(TabBar::CloseButtonDisplayPolicy); -#endif // TABS_H +#endif // TAB_BAR_H diff --git a/scene/gui/tab_container.cpp b/scene/gui/tab_container.cpp index c8a0501d8a..fd5df5c93b 100644 --- a/scene/gui/tab_container.cpp +++ b/scene/gui/tab_container.cpp @@ -78,7 +78,7 @@ void TabContainer::gui_input(const Ref<InputEvent> &p_event) { Popup *popup = get_popup(); - if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { Point2 pos = mb->get_position(); Size2 size = get_size(); @@ -406,14 +406,14 @@ void TabContainer::_notification(int p_what) { } // Find the offset at which to draw tabs, according to the alignment. - switch (align) { - case ALIGN_LEFT: + switch (alignment) { + case ALIGNMENT_LEFT: tabs_ofs_cache = header_x; break; - case ALIGN_CENTER: + case ALIGNMENT_CENTER: tabs_ofs_cache = header_x + (header_width / 2) - (all_tabs_width / 2); break; - case ALIGN_RIGHT: + case ALIGNMENT_RIGHT: tabs_ofs_cache = header_x + header_width - all_tabs_width; break; } @@ -561,7 +561,7 @@ void TabContainer::_draw_tab(Ref<StyleBox> &p_tab_style, Color &p_font_color, in if (icon.is_valid()) { int y = y_center - (icon->get_height() / 2); icon->draw(canvas, Point2i(x_content, y)); - if (text != "") { + if (!text.is_empty()) { x_content += icon->get_width() + icon_text_distance; } } @@ -600,7 +600,7 @@ void TabContainer::_on_theme_changed() { _refresh_texts(); - minimum_size_changed(); + update_minimum_size(); if (get_tab_count() > 0) { _repaint(); update(); @@ -656,7 +656,7 @@ int TabContainer::_get_tab_width(int p_index) const { Ref<Texture2D> icon = control->get_meta("_tab_icon"); if (icon.is_valid()) { width += icon->get_width(); - if (text != "") { + if (!text.is_empty()) { width += get_theme_constant(SNAME("icon_separation")); } } @@ -967,14 +967,14 @@ int TabContainer::get_tab_idx_at_point(const Point2 &p_point) const { return -1; } -void TabContainer::set_tab_align(TabAlign p_align) { - ERR_FAIL_INDEX(p_align, 3); - align = p_align; +void TabContainer::set_tab_alignment(AlignmentMode p_alignment) { + ERR_FAIL_INDEX(p_alignment, 3); + alignment = p_alignment; update(); } -TabContainer::TabAlign TabContainer::get_tab_align() const { - return align; +TabContainer::AlignmentMode TabContainer::get_tab_alignment() const { + return alignment; } void TabContainer::set_tabs_visible(bool p_visible) { @@ -995,7 +995,7 @@ void TabContainer::set_tabs_visible(bool p_visible) { } update(); - minimum_size_changed(); + update_minimum_size(); } bool TabContainer::are_tabs_visible() const { @@ -1108,7 +1108,7 @@ void TabContainer::get_translatable_strings(List<String> *p_strings) const { String name = c->get_meta("_tab_name"); - if (name != "") { + if (!name.is_empty()) { p_strings->push_back(name); } } @@ -1198,8 +1198,8 @@ void TabContainer::_bind_methods() { ClassDB::bind_method(D_METHOD("get_previous_tab"), &TabContainer::get_previous_tab); ClassDB::bind_method(D_METHOD("get_current_tab_control"), &TabContainer::get_current_tab_control); ClassDB::bind_method(D_METHOD("get_tab_control", "tab_idx"), &TabContainer::get_tab_control); - ClassDB::bind_method(D_METHOD("set_tab_align", "align"), &TabContainer::set_tab_align); - ClassDB::bind_method(D_METHOD("get_tab_align"), &TabContainer::get_tab_align); + ClassDB::bind_method(D_METHOD("set_tab_alignment", "alignment"), &TabContainer::set_tab_alignment); + ClassDB::bind_method(D_METHOD("get_tab_alignment"), &TabContainer::get_tab_alignment); ClassDB::bind_method(D_METHOD("set_tabs_visible", "visible"), &TabContainer::set_tabs_visible); ClassDB::bind_method(D_METHOD("are_tabs_visible"), &TabContainer::are_tabs_visible); ClassDB::bind_method(D_METHOD("set_all_tabs_in_front", "is_front"), &TabContainer::set_all_tabs_in_front); @@ -1230,16 +1230,16 @@ void TabContainer::_bind_methods() { ADD_SIGNAL(MethodInfo("tab_selected", PropertyInfo(Variant::INT, "tab"))); ADD_SIGNAL(MethodInfo("pre_popup_pressed")); - ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_align", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_tab_align", "get_tab_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "tab_alignment", PROPERTY_HINT_ENUM, "Left,Center,Right"), "set_tab_alignment", "get_tab_alignment"); ADD_PROPERTY(PropertyInfo(Variant::INT, "current_tab", PROPERTY_HINT_RANGE, "-1,4096,1", PROPERTY_USAGE_EDITOR), "set_current_tab", "get_current_tab"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "tabs_visible"), "set_tabs_visible", "are_tabs_visible"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "all_tabs_in_front"), "set_all_tabs_in_front", "is_all_tabs_in_front"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "drag_to_rearrange_enabled"), "set_drag_to_rearrange_enabled", "get_drag_to_rearrange_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_hidden_tabs_for_min_size"), "set_use_hidden_tabs_for_min_size", "get_use_hidden_tabs_for_min_size"); - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); + BIND_ENUM_CONSTANT(ALIGNMENT_LEFT); + BIND_ENUM_CONSTANT(ALIGNMENT_CENTER); + BIND_ENUM_CONSTANT(ALIGNMENT_RIGHT); } TabContainer::TabContainer() { diff --git a/scene/gui/tab_container.h b/scene/gui/tab_container.h index fe96df25e8..6dfeb2b625 100644 --- a/scene/gui/tab_container.h +++ b/scene/gui/tab_container.h @@ -39,10 +39,10 @@ class TabContainer : public Container { GDCLASS(TabContainer, Container); public: - enum TabAlign { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT + enum AlignmentMode { + ALIGNMENT_LEFT, + ALIGNMENT_CENTER, + ALIGNMENT_RIGHT, }; private: @@ -56,7 +56,7 @@ private: bool buttons_visible_cache = false; bool menu_hovered = false; int highlight_arrow = -1; - TabAlign align = ALIGN_CENTER; + AlignmentMode alignment = ALIGNMENT_CENTER; int _get_top_margin() const; mutable ObjectID popup_obj_id; bool drag_to_rearrange_enabled = false; @@ -90,8 +90,8 @@ protected: static void _bind_methods(); public: - void set_tab_align(TabAlign p_align); - TabAlign get_tab_align() const; + void set_tab_alignment(AlignmentMode p_alignment); + AlignmentMode get_tab_alignment() const; void set_tabs_visible(bool p_visible); bool are_tabs_visible() const; @@ -136,6 +136,6 @@ public: TabContainer(); }; -VARIANT_ENUM_CAST(TabContainer::TabAlign); +VARIANT_ENUM_CAST(TabContainer::AlignmentMode); #endif // TAB_CONTAINER_H diff --git a/scene/gui/text_edit.cpp b/scene/gui/text_edit.cpp index f03eebd543..c9060033f2 100644 --- a/scene/gui/text_edit.cpp +++ b/scene/gui/text_edit.cpp @@ -39,6 +39,7 @@ #include "core/os/os.h" #include "core/string/string_builder.h" #include "core/string/translation.h" +#include "label.h" #include "scene/main/window.h" @@ -154,30 +155,30 @@ _FORCE_INLINE_ const String &TextEdit::Text::operator[](int p_line) const { void TextEdit::Text::_calculate_line_height() { int height = 0; - for (int i = 0; i < text.size(); i++) { + for (const Line &l : text) { // Found another line with the same height...nothing to update. - if (text[i].height == line_height) { + if (l.height == line_height) { height = line_height; break; } - height = MAX(height, text[i].height); + height = MAX(height, l.height); } line_height = height; } void TextEdit::Text::_calculate_max_line_width() { int width = 0; - for (int i = 0; i < text.size(); i++) { - if (is_hidden(i)) { + for (const Line &l : text) { + if (l.hidden) { continue; } // Found another line with the same width...nothing to update. - if (text[i].width == max_width) { + if (l.width == max_width) { width = max_width; break; } - width = MAX(width, text[i].width); + width = MAX(width, l.width); } max_width = width; } @@ -215,7 +216,7 @@ void TextEdit::Text::invalidate_cache(int p_line, int p_column, const String &p_ // Update height. const int old_height = text.write[p_line].height; const int wrap_amount = get_line_wrap_amount(p_line); - int height = font->get_height(font_size); + int height = font_height; for (int i = 0; i <= wrap_amount; i++) { height = MAX(height, text[p_line].data_buf->get_line_size(i).y); } @@ -266,6 +267,13 @@ void TextEdit::Text::invalidate_all() { return; } + max_width = -1; + line_height = -1; + + if (!font.is_null() && font_size > 0) { + font_height = font->get_height(font_size); + } + for (int i = 0; i < text.size(); i++) { invalidate_cache(i); } @@ -274,7 +282,15 @@ void TextEdit::Text::invalidate_all() { void TextEdit::Text::clear() { text.clear(); - insert(0, "", Array()); + + max_width = -1; + line_height = -1; + + Line line; + line.gutters.resize(gutter_count); + line.data = ""; + text.insert(0, line); + invalidate_cache(0); } int TextEdit::Text::get_max_width() const { @@ -289,30 +305,64 @@ void TextEdit::Text::set(int p_line, const String &p_text, const Array &p_bidi_o invalidate_cache(p_line); } -void TextEdit::Text::insert(int p_at, const String &p_text, const Array &p_bidi_override) { - Line line; - line.gutters.resize(gutter_count); - line.hidden = false; - line.data = p_text; - line.bidi_override = p_bidi_override; - text.insert(p_at, line); +void TextEdit::Text::insert(int p_at, const Vector<String> &p_text, const Vector<Array> &p_bidi_override) { + int new_line_count = p_text.size() - 1; + if (new_line_count > 0) { + text.resize(text.size() + new_line_count); + for (int i = (text.size() - 1); i > p_at; i--) { + if ((i - new_line_count) <= 0) { + break; + } + text.write[i] = text[i - new_line_count]; + } + } - invalidate_cache(p_at); + for (int i = 0; i < p_text.size(); i++) { + if (i == 0) { + set(p_at + i, p_text[i], p_bidi_override[i]); + continue; + } + Line line; + line.gutters.resize(gutter_count); + line.data = p_text[i]; + line.bidi_override = p_bidi_override[i]; + text.write[p_at + i] = line; + invalidate_cache(p_at + i); + } } -void TextEdit::Text::remove(int p_at) { - int height = text[p_at].height; - int width = text[p_at].width; +void TextEdit::Text::remove_range(int p_from_line, int p_to_line) { + if (p_from_line == p_to_line) { + return; + } + + bool dirty_height = false; + bool dirty_width = false; + for (int i = p_from_line; i < p_to_line; i++) { + if (!dirty_height && text[i].height == line_height) { + dirty_height = true; + } - text.remove(p_at); + if (!dirty_width && text[i].width == max_width) { + dirty_width = true; + } - // If this is the tallest line, we need to get the next tallest. - if (height == line_height) { + if (dirty_height && dirty_width) { + break; + } + } + + int diff = (p_to_line - p_from_line); + for (int i = p_to_line; i < text.size() - 1; i++) { + text.write[(i - diff) + 1] = text[i + 1]; + } + text.resize(text.size() - diff); + + if (dirty_height) { _calculate_line_height(); } - // If this is the longest line, we need to get the next longest. - if (width == max_width) { + if (dirty_width) { _calculate_max_line_width(); } } @@ -330,7 +380,7 @@ void TextEdit::Text::add_gutter(int p_at) { void TextEdit::Text::remove_gutter(int p_gutter) { for (int i = 0; i < text.size(); i++) { - text.write[i].gutters.remove(p_gutter); + text.write[i].gutters.remove_at(p_gutter); } gutter_count--; } @@ -600,7 +650,7 @@ void TextEdit::_notification(int p_what) { String highlighted_text = get_selected_text(); // Check if highlighted words contain only whitespaces (tabs or spaces). - bool only_whitespaces_highlighted = highlighted_text.strip_edges() == String(); + bool only_whitespaces_highlighted = highlighted_text.strip_edges().is_empty(); const int caret_wrap_index = get_caret_wrap_index(); @@ -608,7 +658,7 @@ void TextEdit::_notification(int p_what) { int draw_amount = visible_rows + (smooth_scroll_enabled ? 1 : 0); draw_amount += get_line_wrap_count(first_visible_line + 1); - // minimap + // Draw minimap. if (draw_minimap) { int minimap_visible_lines = get_minimap_visible_lines(); int minimap_line_height = (minimap_char_size.y + minimap_line_spacing); @@ -788,8 +838,9 @@ void TextEdit::_notification(int p_what) { bottom_limit_y -= style_normal->get_margin(SIDE_BOTTOM); } - // draw main text + // Draw main text. caret.visible = false; + line_drawing_cache.clear(); int row_height = get_line_height(); int line = first_visible_line; for (int i = 0; i < draw_amount; i++) { @@ -810,6 +861,8 @@ void TextEdit::_notification(int p_what) { continue; } + LineDrawingCache cache_entry; + Dictionary color_map = _get_line_syntax_highlighting(line); // Ensure we at least use the font color. @@ -899,6 +952,8 @@ void TextEdit::_notification(int p_what) { if (line_wrap_index == 0) { // Only do these if we are on the first wrapped part of a line. + cache_entry.y_offset = ofs_y; + int gutter_offset = style_normal->get_margin(SIDE_LEFT); for (int g = 0; g < gutters.size(); g++) { const GutterInfo gutter = gutters[g]; @@ -910,7 +965,7 @@ void TextEdit::_notification(int p_what) { switch (gutter.type) { case GUTTER_TYPE_STRING: { const String &text = get_line_gutter_text(line, g); - if (text == "") { + if (text.is_empty()) { break; } @@ -1050,7 +1105,7 @@ void TextEdit::_notification(int p_what) { while (highlighted_word_col != -1) { Vector<Vector2> sel = TS->shaped_text_get_selection(rid, highlighted_word_col + start, highlighted_word_col + lookup_symbol_word.length() + start); for (int j = 0; j < sel.size(); j++) { - Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y, sel[j].y - sel[j].x, row_height); + Rect2 rect = Rect2(sel[j].x + char_margin + ofs_x, ofs_y + (line_spacing / 2), sel[j].y - sel[j].x, row_height); if (rect.position.x + rect.size.x <= xmargin_beg || rect.position.x > xmargin_end) { continue; } @@ -1060,9 +1115,9 @@ void TextEdit::_notification(int p_what) { } else if (rect.position.x + rect.size.x > xmargin_end) { rect.size.x = xmargin_end - rect.position.x; } - rect.position.y = TS->shaped_text_get_ascent(rid) + font->get_underline_position(font_size); - rect.size.y = font->get_underline_thickness(font_size); - draw_rect(rect, font_selected_color); + rect.position.y += ceil(TS->shaped_text_get_ascent(rid)) + ceil(font->get_underline_position(font_size)); + rect.size.y = MAX(1, font->get_underline_thickness(font_size)); + draw_rect(rect, color); } highlighted_word_col = _get_column_pos_of_word(lookup_symbol_word, str, SEARCH_MATCH_CASE | SEARCH_WHOLE_WORDS, highlighted_word_col + 1); @@ -1076,6 +1131,10 @@ void TextEdit::_notification(int p_what) { int gl_size = TS->shaped_text_get_glyph_count(rid); ofs_y += ldata->get_line_ascent(line_wrap_index); + + int first_visible_char = TS->shaped_text_get_range(rid).y; + int last_visible_char = TS->shaped_text_get_range(rid).x; + int char_ofs = 0; if (outline_size > 0 && outline_color.a > 0) { for (int j = 0; j < gl_size; j++) { @@ -1143,21 +1202,36 @@ void TextEdit::_notification(int p_what) { } } + bool had_glyphs_drawn = false; for (int k = 0; k < glyphs[j].repeat; k++) { if (!clipped && (char_ofs + char_margin) >= xmargin_beg && (char_ofs + glyphs[j].advance + char_margin) <= xmargin_end) { if (glyphs[j].font_rid != RID()) { TS->font_draw_glyph(glyphs[j].font_rid, ci, glyphs[j].font_size, Vector2(char_margin + char_ofs + ofs_x + glyphs[j].x_off, ofs_y + glyphs[j].y_off), glyphs[j].index, current_color); + had_glyphs_drawn = true; } else if ((glyphs[j].flags & TextServer::GRAPHEME_IS_VIRTUAL) != TextServer::GRAPHEME_IS_VIRTUAL) { TS->draw_hex_code_box(ci, glyphs[j].font_size, Vector2(char_margin + char_ofs + ofs_x + glyphs[j].x_off, ofs_y + glyphs[j].y_off), glyphs[j].index, current_color); + had_glyphs_drawn = true; } } char_ofs += glyphs[j].advance; } + + if (had_glyphs_drawn) { + if (first_visible_char > glyphs[j].start) { + first_visible_char = glyphs[j].start; + } else if (last_visible_char < glyphs[j].end) { + last_visible_char = glyphs[j].end; + } + } + if ((char_ofs + char_margin) >= xmargin_end) { break; } } + cache_entry.first_visible_chars.push_back(first_visible_char); + cache_entry.last_visible_chars.push_back(last_visible_char); + // is_line_folded if (line_wrap_index == line_wrap_amount && line < text.size() - 1 && _is_line_hidden(line + 1)) { int xofs = char_ofs + char_margin + ofs_x + (folded_eol_icon->get_width() / 2); @@ -1200,7 +1274,7 @@ void TextEdit::_notification(int p_what) { if (caret.draw_pos.x >= xmargin_beg && caret.draw_pos.x < xmargin_end) { caret.visible = true; - if (draw_caret) { + if (draw_caret || drag_caret_force_displayed) { if (caret_type == CaretType::CARET_TYPE_BLOCK || overtype_mode) { //Block or underline caret, draw trailing carets at full height. int h = font->get_height(font_size); @@ -1308,6 +1382,8 @@ void TextEdit::_notification(int p_what) { } } } + + line_drawing_cache[line] = cache_entry; } if (has_focus()) { @@ -1364,6 +1440,10 @@ void TextEdit::_notification(int p_what) { if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_VIRTUAL_KEYBOARD) && virtual_keyboard_enabled) { DisplayServer::get_singleton()->virtual_keyboard_hide(); } + + if (deselect_on_focus_loss_enabled && !selection.drag_attempt) { + deselect(); + } } break; case MainLoop::NOTIFICATION_OS_IME_UPDATE: { if (has_focus()) { @@ -1381,6 +1461,30 @@ void TextEdit::_notification(int p_what) { update(); } } break; + case Control::NOTIFICATION_DRAG_BEGIN: { + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; + drag_action = true; + dragging_minimap = false; + dragging_selection = false; + can_drag_minimap = false; + click_select_held->stop(); + } break; + case Control::NOTIFICATION_DRAG_END: { + if (is_drag_successful()) { + if (selection.drag_attempt) { + selection.drag_attempt = false; + if (is_editable() && !Input::get_singleton()->is_key_pressed(Key::CTRL)) { + delete_selection(); + } else if (deselect_on_focus_loss_enabled) { + deselect(); + } + } + } else { + selection.drag_attempt = false; + } + drag_action = false; + drag_caret_force_displayed = false; + } break; } } @@ -1403,7 +1507,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } if (mb->is_pressed()) { - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP && !mb->is_command_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_UP && !mb->is_command_pressed()) { if (mb->is_shift_pressed()) { h_scroll->set_value(h_scroll->get_value() - (100 * mb->get_factor())); } else if (mb->is_alt_pressed()) { @@ -1414,7 +1518,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { _scroll_up(3 * mb->get_factor()); } } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN && !mb->is_command_pressed()) { + if (mb->get_button_index() == MouseButton::WHEEL_DOWN && !mb->is_command_pressed()) { if (mb->is_shift_pressed()) { h_scroll->set_value(h_scroll->get_value() + (100 * mb->get_factor())); } else if (mb->is_alt_pressed()) { @@ -1425,13 +1529,13 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { _scroll_down(3 * mb->get_factor()); } } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT) { + if (mb->get_button_index() == MouseButton::WHEEL_LEFT) { h_scroll->set_value(h_scroll->get_value() - (100 * mb->get_factor())); } - if (mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT) { + if (mb->get_button_index() == MouseButton::WHEEL_RIGHT) { h_scroll->set_value(h_scroll->get_value() + (100 * mb->get_factor())); } - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() == MouseButton::LEFT) { _reset_caret_blink_timer(); Point2i pos = get_line_column_at_pos(mpos); @@ -1465,6 +1569,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { set_caret_line(row, false, false); set_caret_column(col); + selection.drag_attempt = false; if (mb->is_shift_pressed() && (caret.column != prev_col || caret.line != prev_line)) { if (!selection.active) { @@ -1508,6 +1613,9 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { update(); } + } else if (is_mouse_over_selection()) { + selection.selecting_mode = SelectionMode::SELECTION_MODE_NONE; + selection.drag_attempt = true; } else { selection.active = false; selection.selecting_mode = SelectionMode::SELECTION_MODE_POINTER; @@ -1521,6 +1629,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { if (!mb->is_double_click() && (OS::get_singleton()->get_ticks_msec() - last_dblclk) < triple_click_timeout && mb->get_position().distance_to(last_dblclk_pos) < triple_click_tolerance) { // Triple-click select line. selection.selecting_mode = SelectionMode::SELECTION_MODE_LINE; + selection.drag_attempt = false; _update_selection_mode_line(); last_dblclk = 0; } else if (mb->is_double_click() && text[caret.line].length()) { @@ -1534,7 +1643,11 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { update(); } - if (mb->get_button_index() == MOUSE_BUTTON_RIGHT && context_menu_enabled) { + if (is_middle_mouse_paste_enabled() && mb->get_button_index() == MouseButton::MIDDLE && DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + paste_primary_clipboard(); + } + + if (mb->get_button_index() == MouseButton::RIGHT && context_menu_enabled) { _reset_caret_blink_timer(); Point2i pos = get_line_column_at_pos(mpos); @@ -1560,17 +1673,26 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } _generate_context_menu(); - menu->set_position(get_screen_transform().xform(mpos)); - menu->set_size(Vector2(1, 1)); + menu->set_position(get_screen_position() + mpos); + menu->reset_size(); menu->popup(); grab_focus(); } } else { - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() == MouseButton::LEFT) { + if (selection.drag_attempt && is_mouse_over_selection()) { + selection.active = false; + } dragging_minimap = false; dragging_selection = false; can_drag_minimap = false; click_select_held->stop(); + if (!drag_action) { + selection.drag_attempt = false; + } + if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(get_selected_text()); + } } // Notify to show soft keyboard. @@ -1602,7 +1724,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { mpos.x = get_size().x - mpos.x; } - if (mm->get_button_mask() & MOUSE_BUTTON_MASK_LEFT && get_viewport()->gui_get_drag_data() == Variant()) { // Ignore if dragging. + if ((mm->get_button_mask() & MouseButton::MASK_LEFT) != MouseButton::NONE && get_viewport()->gui_get_drag_data() == Variant()) { // Ignore if dragging. _reset_caret_blink_timer(); if (draw_minimap && !dragging_selection) { @@ -1652,6 +1774,14 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { hovered_gutter = current_hovered_gutter; update(); } + + if (drag_action && can_drop_data(mpos, get_viewport()->gui_get_drag_data())) { + drag_caret_force_displayed = true; + Point2i pos = get_line_column_at_pos(get_local_mouse_pos()); + set_caret_line(pos.y, false); + set_caret_column(pos.x); + dragging_selection = true; + } } if (draw_minimap && !dragging_selection) { @@ -1670,7 +1800,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } // If a modifier has been pressed, and nothing else, return. - if (k->get_keycode() == KEY_CTRL || k->get_keycode() == KEY_ALT || k->get_keycode() == KEY_SHIFT || k->get_keycode() == KEY_META) { + if (k->get_keycode() == Key::CTRL || k->get_keycode() == Key::ALT || k->get_keycode() == Key::SHIFT || k->get_keycode() == Key::META) { return; } @@ -1790,8 +1920,8 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { if (context_menu_enabled) { _generate_context_menu(); adjust_viewport_to_caret(); - menu->set_position(get_screen_transform().xform(get_caret_draw_pos())); - menu->set_size(Vector2(1, 1)); + menu->set_position(get_screen_position() + get_caret_draw_pos()); + menu->reset_size(); menu->popup(); menu->grab_focus(); } @@ -1887,7 +2017,7 @@ void TextEdit::gui_input(const Ref<InputEvent> &p_gui_input) { } // Handle Unicode (if no modifiers active). Tab has a value of 0x09. - if (allow_unicode_handling && editable && (k->get_unicode() >= 32 || k->get_keycode() == KEY_TAB)) { + if (allow_unicode_handling && editable && (k->get_unicode() >= 32 || k->get_keycode() == Key::TAB)) { handle_unicode_input(k->get_unicode()); accept_event(); return; @@ -2347,7 +2477,7 @@ void TextEdit::_update_caches() { } else { dir = (TextServer::Direction)text_direction; } - text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.set_direction_and_language(dir, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); text.set_font_features(opentype_features); text.set_draw_control_chars(draw_control_chars); text.set_font(font); @@ -2369,6 +2499,75 @@ bool TextEdit::is_text_field() const { return true; } +Variant TextEdit::get_drag_data(const Point2 &p_point) { + if (selection.active && selection.drag_attempt) { + String t = get_selected_text(); + Label *l = memnew(Label); + l->set_text(t); + set_drag_preview(l); + return t; + } + + return Variant(); +} + +bool TextEdit::can_drop_data(const Point2 &p_point, const Variant &p_data) const { + bool drop_override = Control::can_drop_data(p_point, p_data); // In case user wants to drop custom data. + if (drop_override) { + return drop_override; + } + + return is_editable() && p_data.get_type() == Variant::STRING; +} + +void TextEdit::drop_data(const Point2 &p_point, const Variant &p_data) { + Control::drop_data(p_point, p_data); + + if (p_data.get_type() == Variant::STRING && is_editable()) { + Point2i pos = get_line_column_at_pos(get_local_mouse_pos()); + int caret_row_tmp = pos.y; + int caret_column_tmp = pos.x; + if (selection.drag_attempt) { + selection.drag_attempt = false; + if (!is_mouse_over_selection(!Input::get_singleton()->is_key_pressed(Key::CTRL))) { + begin_complex_operation(); + if (!Input::get_singleton()->is_key_pressed(Key::CTRL)) { + if (caret_row_tmp > selection.to_line) { + caret_row_tmp = caret_row_tmp - (selection.to_line - selection.from_line); + } else if (caret_row_tmp == selection.to_line && caret_column_tmp >= selection.to_column) { + caret_column_tmp = caret_column_tmp - (selection.to_column - selection.from_column); + } + delete_selection(); + } else { + deselect(); + } + + set_caret_line(caret_row_tmp, true, false); + set_caret_column(caret_column_tmp); + insert_text_at_caret(p_data); + end_complex_operation(); + } + } else if (is_mouse_over_selection()) { + caret_row_tmp = selection.from_line; + caret_column_tmp = selection.from_column; + set_caret_line(caret_row_tmp, true, false); + set_caret_column(caret_column_tmp); + insert_text_at_caret(p_data); + grab_focus(); + } else { + deselect(); + set_caret_line(caret_row_tmp, true, false); + set_caret_column(caret_column_tmp); + insert_text_at_caret(p_data); + grab_focus(); + } + + if (caret_row_tmp != caret.line || caret_column_tmp != caret.column) { + select(caret_row_tmp, caret_column_tmp, caret.line, caret.column); + } + } +} + Control::CursorShape TextEdit::get_cursor_shape(const Point2 &p_pos) const { Point2i pos = get_line_column_at_pos(p_pos); int row = pos.y; @@ -2461,7 +2660,7 @@ void TextEdit::set_text_direction(Control::TextDirection p_text_direction) { } else { dir = (TextServer::Direction)text_direction; } - text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.set_direction_and_language(dir, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); text.invalidate_all(); if (menu_dir) { @@ -2512,7 +2711,7 @@ void TextEdit::set_language(const String &p_language) { } else { dir = (TextServer::Direction)text_direction; } - text.set_direction_and_language(dir, (language != "") ? language : TranslationServer::get_singleton()->get_tool_locale()); + text.set_direction_and_language(dir, (!language.is_empty()) ? language : TranslationServer::get_singleton()->get_tool_locale()); text.invalidate_all(); update(); } @@ -2596,6 +2795,14 @@ bool TextEdit::is_virtual_keyboard_enabled() const { return virtual_keyboard_enabled; } +void TextEdit::set_middle_mouse_paste_enabled(bool p_enabled) { + middle_mouse_paste_enabled = p_enabled; +} + +bool TextEdit::is_middle_mouse_paste_enabled() const { + return middle_mouse_paste_enabled; +} + // Text manipulation void TextEdit::clear() { setting_text = true; @@ -2859,6 +3066,16 @@ Point2i TextEdit::get_next_visible_line_index_offset_from(int p_line_from, int p } } wrap_index = get_line_wrap_count(MIN(i, text.size() - 1)) - MAX(0, num_visible - p_visible_amount); + + // If we are a hidden line, then we are the last line as we cannot reach "p_visible_amount". + // This means we need to backtrack to get last visible line. + // Currently, line 0 cannot be hidden so this should always be valid. + int line = (p_line_from + num_total) - 1; + if (_is_line_hidden(line)) { + Point2i backtrack = get_next_visible_line_index_offset_from(line, 0, -1); + num_total = num_total - (backtrack.x - 1); + wrap_index = backtrack.y; + } } else { p_visible_amount = ABS(p_visible_amount); int i; @@ -2915,6 +3132,13 @@ void TextEdit::paste() { _paste_internal(); } +void TextEdit::paste_primary_clipboard() { + if (GDVIRTUAL_CALL(_paste_primary_clipboard)) { + return; + } + _paste_primary_clipboard_internal(); +} + // Context menu. PopupMenu *TextEdit::get_menu() const { const_cast<TextEdit *>(this)->_generate_context_menu(); @@ -3360,7 +3584,7 @@ String TextEdit::get_word_at_pos(const Vector2 &p_pos) const { return String(); } -Point2i TextEdit::get_line_column_at_pos(const Point2i &p_pos) const { +Point2i TextEdit::get_line_column_at_pos(const Point2i &p_pos, bool p_allow_out_of_bounds) const { float rows = p_pos.y; rows -= style_normal->get_margin(SIDE_TOP); rows /= get_line_height(); @@ -3370,8 +3594,9 @@ Point2i TextEdit::get_line_column_at_pos(const Point2i &p_pos) const { int wrap_index = 0; if (get_line_wrapping_mode() != LineWrappingMode::LINE_WRAPPING_NONE || _is_hiding_enabled()) { - Point2i f_ofs = get_next_visible_line_index_offset_from(first_vis_line, caret.wrap_ofs, rows + (1 * SGN(rows))); + Point2i f_ofs = get_next_visible_line_index_offset_from(first_vis_line, caret.wrap_ofs, rows + (1 * SIGN(rows))); wrap_index = f_ofs.y; + if (rows < 0) { row = first_vis_line - (f_ofs.x - 1); } else { @@ -3383,37 +3608,86 @@ Point2i TextEdit::get_line_column_at_pos(const Point2i &p_pos) const { row = 0; } - int col = 0; - if (row >= text.size()) { row = text.size() - 1; - col = text[row].size(); - } else { - int colx = p_pos.x - (style_normal->get_margin(SIDE_LEFT) + gutters_width + gutter_padding); - colx += caret.x_ofs; - col = _get_char_pos_for_line(colx, row, wrap_index); - if (get_line_wrapping_mode() != LineWrappingMode::LINE_WRAPPING_NONE && wrap_index < get_line_wrap_count(row)) { - // Move back one if we are at the end of the row. - Vector<String> rows2 = get_line_wrapped_text(row); - int row_end_col = 0; - for (int i = 0; i < wrap_index + 1; i++) { - row_end_col += rows2[i].length(); - } - if (col >= row_end_col) { - col -= 1; - } + } + + int visible_lines = get_visible_line_count_in_range(first_vis_line, row); + if (rows > visible_lines) { + if (!p_allow_out_of_bounds) { + return Point2i(-1, -1); } + return Point2i(text[row].size(), row); + } - RID text_rid = text.get_line_data(row)->get_line_rid(wrap_index); - if (is_layout_rtl()) { - colx = TS->shaped_text_get_size(text_rid).x - colx; + int col = 0; + int colx = p_pos.x - (style_normal->get_margin(SIDE_LEFT) + gutters_width + gutter_padding); + colx += caret.x_ofs; + col = _get_char_pos_for_line(colx, row, wrap_index); + if (get_line_wrapping_mode() != LineWrappingMode::LINE_WRAPPING_NONE && wrap_index < get_line_wrap_count(row)) { + // Move back one if we are at the end of the row. + Vector<String> rows2 = get_line_wrapped_text(row); + int row_end_col = 0; + for (int i = 0; i < wrap_index + 1; i++) { + row_end_col += rows2[i].length(); + } + if (col >= row_end_col) { + col -= 1; } - col = TS->shaped_text_hit_test_position(text_rid, colx); } + RID text_rid = text.get_line_data(row)->get_line_rid(wrap_index); + if (is_layout_rtl()) { + colx = TS->shaped_text_get_size(text_rid).x - colx; + } + col = TS->shaped_text_hit_test_position(text_rid, colx); + return Point2i(col, row); } +Point2i TextEdit::get_pos_at_line_column(int p_line, int p_column) const { + Rect2i rect = get_rect_at_line_column(p_line, p_column); + return rect.position + Vector2i(0, get_line_height()); +} + +Rect2i TextEdit::get_rect_at_line_column(int p_line, int p_column) const { + ERR_FAIL_INDEX_V(p_line, text.size(), Rect2i(-1, -1, 0, 0)); + ERR_FAIL_COND_V(p_column < 0, Rect2i(-1, -1, 0, 0)); + ERR_FAIL_COND_V(p_column > text[p_line].length(), Rect2i(-1, -1, 0, 0)); + + if (line_drawing_cache.size() == 0 || !line_drawing_cache.has(p_line)) { + // Line is not in the cache, which means it's outside of the viewing area. + return Rect2i(-1, -1, 0, 0); + } + LineDrawingCache cache_entry = line_drawing_cache[p_line]; + + int wrap_index = get_line_wrap_index_at_column(p_line, p_column); + if (wrap_index >= cache_entry.first_visible_chars.size()) { + // Line seems to be wrapped beyond the viewable area. + return Rect2i(-1, -1, 0, 0); + } + + int first_visible_char = cache_entry.first_visible_chars[wrap_index]; + int last_visible_char = cache_entry.last_visible_chars[wrap_index]; + if (p_column < first_visible_char || p_column > last_visible_char) { + // Character is outside of the viewing area, no point calculating its position. + return Rect2i(-1, -1, 0, 0); + } + + Point2i pos, size; + pos.y = cache_entry.y_offset + get_line_height() * wrap_index; + pos.x = get_total_gutter_width() + style_normal->get_margin(SIDE_LEFT) - get_h_scroll(); + + RID text_rid = text.get_line_data(p_line)->get_line_rid(wrap_index); + Vector2 col_bounds = TS->shaped_text_get_grapheme_bounds(text_rid, p_column); + pos.x += col_bounds.x; + size.x = col_bounds.y - col_bounds.x; + + size.y = get_line_height(); + + return Rect2i(pos, size); +} + int TextEdit::get_minimap_line_at_pos(const Point2i &p_pos) const { float rows = p_pos.y; rows -= style_normal->get_margin(SIDE_TOP); @@ -3445,7 +3719,7 @@ int TextEdit::get_minimap_line_at_pos(const Point2i &p_pos) const { int row = minimap_line + Math::floor(rows); if (get_line_wrapping_mode() != LineWrappingMode::LINE_WRAPPING_NONE || _is_hiding_enabled()) { - int f_ofs = get_next_visible_line_index_offset_from(minimap_line, caret.wrap_ofs, rows + (1 * SGN(rows))).x - 1; + int f_ofs = get_next_visible_line_index_offset_from(minimap_line, caret.wrap_ofs, rows + (1 * SIGN(rows))).x - 1; if (rows < 0) { row = minimap_line - f_ofs; } else { @@ -3468,6 +3742,21 @@ bool TextEdit::is_dragging_cursor() const { return dragging_selection || dragging_minimap; } +bool TextEdit::is_mouse_over_selection(bool p_edges) const { + if (!has_selection()) { + return false; + } + Point2i pos = get_line_column_at_pos(get_local_mouse_pos()); + int row = pos.y; + int col = pos.x; + if (p_edges) { + if ((row == selection.from_line && col == selection.from_column) || (row == selection.to_line && col == selection.to_column)) { + return true; + } + } + return (row >= selection.from_line && row <= selection.to_line && (row > selection.from_line || col > selection.from_column) && (row < selection.to_line || col < selection.to_column)); +} + /* Caret */ void TextEdit::set_caret_type(CaretType p_type) { caret_type = p_type; @@ -3647,6 +3936,17 @@ bool TextEdit::is_selecting_enabled() const { return selecting_enabled; } +void TextEdit::set_deselect_on_focus_loss_enabled(const bool p_enabled) { + deselect_on_focus_loss_enabled = p_enabled; + if (p_enabled && selection.active && !has_focus()) { + deselect(); + } +} + +bool TextEdit::is_deselect_on_focus_loss_enabled() const { + return deselect_on_focus_loss_enabled; +} + void TextEdit::set_override_selected_font_color(bool p_override_selected_font_color) { override_selected_font_color = p_override_selected_font_color; } @@ -3660,8 +3960,10 @@ void TextEdit::set_selection_mode(SelectionMode p_mode, int p_line, int p_column if (p_line >= 0) { ERR_FAIL_INDEX(p_line, text.size()); selection.selecting_line = p_line; + selection.selecting_column = CLAMP(selection.selecting_column, 0, text[selection.selecting_line].length()); } if (p_column >= 0) { + ERR_FAIL_INDEX(selection.selecting_line, text.size()); ERR_FAIL_INDEX(p_column, text[selection.selecting_line].length()); selection.selecting_column = p_column; } @@ -3841,7 +4143,7 @@ void TextEdit::delete_selection() { update(); } -/* line wrapping. */ +/* Line wrapping. */ void TextEdit::set_line_wrapping_mode(LineWrappingMode p_wrapping_mode) { if (line_wrapping_mode != p_wrapping_mode) { line_wrapping_mode = p_wrapping_mode; @@ -3973,15 +4275,7 @@ double TextEdit::get_scroll_pos_for_line(int p_line, int p_wrap_index) const { return p_line; } - // Count the number of visible lines up to this line. - double new_line_scroll_pos = 0.0; - int to = CLAMP(p_line, 0, text.size() - 1); - for (int i = 0; i < to; i++) { - if (!text.is_hidden(i)) { - new_line_scroll_pos++; - new_line_scroll_pos += get_line_wrap_count(i); - } - } + double new_line_scroll_pos = get_visible_line_count_in_range(0, CLAMP(p_line, 0, text.size() - 1)); new_line_scroll_pos += p_wrap_index; return new_line_scroll_pos; } @@ -4038,14 +4332,18 @@ int TextEdit::get_visible_line_count() const { return _get_control_height() / get_line_height(); } -int TextEdit::get_total_visible_line_count() const { - /* Returns the total number of (lines + wraped - hidden). */ +int TextEdit::get_visible_line_count_in_range(int p_from_line, int p_to_line) const { + ERR_FAIL_INDEX_V(p_from_line, text.size(), 0); + ERR_FAIL_INDEX_V(p_to_line, text.size(), 0); + ERR_FAIL_COND_V(p_from_line > p_to_line, 0); + + /* Returns the total number of (lines + wrapped - hidden). */ if (!_is_hiding_enabled() && get_line_wrapping_mode() == LineWrappingMode::LINE_WRAPPING_NONE) { - return text.size(); + return p_to_line - p_from_line; } int total_rows = 0; - for (int i = 0; i < text.size(); i++) { + for (int i = p_from_line; i <= p_to_line; i++) { if (!text.is_hidden(i)) { total_rows++; total_rows += get_line_wrap_count(i); @@ -4054,6 +4352,10 @@ int TextEdit::get_total_visible_line_count() const { return total_rows; } +int TextEdit::get_total_visible_line_count() const { + return get_visible_line_count_in_range(0, text.size() - 1); +} + // Auto adjust void TextEdit::adjust_viewport_to_caret() { // Make sure Caret is visible on the screen. @@ -4222,7 +4524,7 @@ void TextEdit::add_gutter(int p_at) { void TextEdit::remove_gutter(int p_gutter) { ERR_FAIL_INDEX(p_gutter, gutters.size()); - gutters.remove(p_gutter); + gutters.remove_at(p_gutter); for (int i = 0; i < text.size() + 1; i++) { text.remove_gutter(p_gutter); @@ -4536,6 +4838,9 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("set_virtual_keyboard_enabled", "enabled"), &TextEdit::set_virtual_keyboard_enabled); ClassDB::bind_method(D_METHOD("is_virtual_keyboard_enabled"), &TextEdit::is_virtual_keyboard_enabled); + ClassDB::bind_method(D_METHOD("set_middle_mouse_paste_enabled", "enabled"), &TextEdit::set_middle_mouse_paste_enabled); + ClassDB::bind_method(D_METHOD("is_middle_mouse_paste_enabled"), &TextEdit::is_middle_mouse_paste_enabled); + // Text manipulation ClassDB::bind_method(D_METHOD("clear"), &TextEdit::clear); @@ -4575,6 +4880,7 @@ void TextEdit::_bind_methods() { GDVIRTUAL_BIND(_cut) GDVIRTUAL_BIND(_copy) GDVIRTUAL_BIND(_paste) + GDVIRTUAL_BIND(_paste_primary_clipboard) // Context Menu BIND_ENUM_CONSTANT(MENU_CUT); @@ -4640,10 +4946,14 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("get_word_at_pos", "position"), &TextEdit::get_word_at_pos); - ClassDB::bind_method(D_METHOD("get_line_column_at_pos", "position"), &TextEdit::get_line_column_at_pos); + ClassDB::bind_method(D_METHOD("get_line_column_at_pos", "position", "allow_out_of_bounds"), &TextEdit::get_line_column_at_pos, DEFVAL(true)); + ClassDB::bind_method(D_METHOD("get_pos_at_line_column", "line", "column"), &TextEdit::get_pos_at_line_column); + ClassDB::bind_method(D_METHOD("get_rect_at_line_column", "line", "column"), &TextEdit::get_rect_at_line_column); + ClassDB::bind_method(D_METHOD("get_minimap_line_at_pos", "position"), &TextEdit::get_minimap_line_at_pos); ClassDB::bind_method(D_METHOD("is_dragging_cursor"), &TextEdit::is_dragging_cursor); + ClassDB::bind_method(D_METHOD("is_mouse_over_selection", "edges"), &TextEdit::is_mouse_over_selection); /* Caret. */ BIND_ENUM_CONSTANT(CARET_TYPE_LINE); @@ -4690,6 +5000,9 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("set_selecting_enabled", "enable"), &TextEdit::set_selecting_enabled); ClassDB::bind_method(D_METHOD("is_selecting_enabled"), &TextEdit::is_selecting_enabled); + ClassDB::bind_method(D_METHOD("set_deselect_on_focus_loss_enabled", "enable"), &TextEdit::set_deselect_on_focus_loss_enabled); + ClassDB::bind_method(D_METHOD("is_deselect_on_focus_loss_enabled"), &TextEdit::is_deselect_on_focus_loss_enabled); + ClassDB::bind_method(D_METHOD("set_override_selected_font_color", "override"), &TextEdit::set_override_selected_font_color); ClassDB::bind_method(D_METHOD("is_overriding_selected_font_color"), &TextEdit::is_overriding_selected_font_color); @@ -4715,7 +5028,7 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("deselect"), &TextEdit::deselect); ClassDB::bind_method(D_METHOD("delete_selection"), &TextEdit::delete_selection); - /* line wrapping. */ + /* Line wrapping. */ BIND_ENUM_CONSTANT(LINE_WRAPPING_NONE); BIND_ENUM_CONSTANT(LINE_WRAPPING_BOUNDARY); @@ -4761,6 +5074,7 @@ void TextEdit::_bind_methods() { ClassDB::bind_method(D_METHOD("get_last_full_visible_line_wrap_index"), &TextEdit::get_last_full_visible_line_wrap_index); ClassDB::bind_method(D_METHOD("get_visible_line_count"), &TextEdit::get_visible_line_count); + ClassDB::bind_method(D_METHOD("get_visible_line_count_in_range", "from_line", "to_line"), &TextEdit::get_visible_line_count_in_range); ClassDB::bind_method(D_METHOD("get_total_visible_line_count"), &TextEdit::get_total_visible_line_count); // Auto adjust @@ -4849,8 +5163,9 @@ void TextEdit::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "context_menu_enabled"), "set_context_menu_enabled", "is_context_menu_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "shortcut_keys_enabled"), "set_shortcut_keys_enabled", "is_shortcut_keys_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "selecting_enabled"), "set_selecting_enabled", "is_selecting_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "deselect_on_focus_loss_enabled"), "set_deselect_on_focus_loss_enabled", "is_deselect_on_focus_loss_enabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "virtual_keyboard_enabled"), "set_virtual_keyboard_enabled", "is_virtual_keyboard_enabled"); - + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "middle_mouse_paste_enabled"), "set_middle_mouse_paste_enabled", "is_middle_mouse_paste_enabled"); ADD_PROPERTY(PropertyInfo(Variant::INT, "wrap_mode", PROPERTY_HINT_ENUM, "None,Boundary"), "set_line_wrapping_mode", "get_line_wrapping_mode"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "override_selected_font_color"), "set_override_selected_font_color", "is_overriding_selected_font_color"); @@ -5141,6 +5456,24 @@ void TextEdit::_paste_internal() { end_complex_operation(); } +void TextEdit::_paste_primary_clipboard_internal() { + if (!is_editable() || !DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + return; + } + + String paste_buffer = DisplayServer::get_singleton()->clipboard_get_primary(); + + Point2i pos = get_line_column_at_pos(get_local_mouse_pos()); + deselect(); + set_caret_line(pos.y, true, false); + set_caret_column(pos.x); + if (!paste_buffer.is_empty()) { + insert_text_at_caret(paste_buffer); + } + + grab_focus(); +} + /* Text. */ // Context menu. void TextEdit::_generate_context_menu() { @@ -5150,32 +5483,32 @@ void TextEdit::_generate_context_menu() { menu_dir = memnew(PopupMenu); menu_dir->set_name("DirMenu"); - menu_dir->add_radio_check_item(RTR("Same as layout direction"), MENU_DIR_INHERITED); - menu_dir->add_radio_check_item(RTR("Auto-detect direction"), MENU_DIR_AUTO); - menu_dir->add_radio_check_item(RTR("Left-to-right"), MENU_DIR_LTR); - menu_dir->add_radio_check_item(RTR("Right-to-left"), MENU_DIR_RTL); + menu_dir->add_radio_check_item(RTR("Same as Layout Direction"), MENU_DIR_INHERITED); + menu_dir->add_radio_check_item(RTR("Auto-Detect Direction"), MENU_DIR_AUTO); + menu_dir->add_radio_check_item(RTR("Left-to-Right"), MENU_DIR_LTR); + menu_dir->add_radio_check_item(RTR("Right-to-Left"), MENU_DIR_RTL); menu->add_child(menu_dir, false, INTERNAL_MODE_FRONT); menu_ctl = memnew(PopupMenu); menu_ctl->set_name("CTLMenu"); - menu_ctl->add_item(RTR("Left-to-right mark (LRM)"), MENU_INSERT_LRM); - menu_ctl->add_item(RTR("Right-to-left mark (RLM)"), MENU_INSERT_RLM); - menu_ctl->add_item(RTR("Start of left-to-right embedding (LRE)"), MENU_INSERT_LRE); - menu_ctl->add_item(RTR("Start of right-to-left embedding (RLE)"), MENU_INSERT_RLE); - menu_ctl->add_item(RTR("Start of left-to-right override (LRO)"), MENU_INSERT_LRO); - menu_ctl->add_item(RTR("Start of right-to-left override (RLO)"), MENU_INSERT_RLO); - menu_ctl->add_item(RTR("Pop direction formatting (PDF)"), MENU_INSERT_PDF); + menu_ctl->add_item(RTR("Left-to-Right Mark (LRM)"), MENU_INSERT_LRM); + menu_ctl->add_item(RTR("Right-to-Left Mark (RLM)"), MENU_INSERT_RLM); + menu_ctl->add_item(RTR("Start of Left-to-Right Embedding (LRE)"), MENU_INSERT_LRE); + menu_ctl->add_item(RTR("Start of Right-to-Left Embedding (RLE)"), MENU_INSERT_RLE); + menu_ctl->add_item(RTR("Start of Left-to-Right Override (LRO)"), MENU_INSERT_LRO); + menu_ctl->add_item(RTR("Start of Right-to-Left Override (RLO)"), MENU_INSERT_RLO); + menu_ctl->add_item(RTR("Pop Direction Formatting (PDF)"), MENU_INSERT_PDF); menu_ctl->add_separator(); - menu_ctl->add_item(RTR("Arabic letter mark (ALM)"), MENU_INSERT_ALM); - menu_ctl->add_item(RTR("Left-to-right isolate (LRI)"), MENU_INSERT_LRI); - menu_ctl->add_item(RTR("Right-to-left isolate (RLI)"), MENU_INSERT_RLI); - menu_ctl->add_item(RTR("First strong isolate (FSI)"), MENU_INSERT_FSI); - menu_ctl->add_item(RTR("Pop direction isolate (PDI)"), MENU_INSERT_PDI); + menu_ctl->add_item(RTR("Arabic Letter Mark (ALM)"), MENU_INSERT_ALM); + menu_ctl->add_item(RTR("Left-to-Right Isolate (LRI)"), MENU_INSERT_LRI); + menu_ctl->add_item(RTR("Right-to-Left Isolate (RLI)"), MENU_INSERT_RLI); + menu_ctl->add_item(RTR("First Strong Isolate (FSI)"), MENU_INSERT_FSI); + menu_ctl->add_item(RTR("Pop Direction Isolate (PDI)"), MENU_INSERT_PDI); menu_ctl->add_separator(); - menu_ctl->add_item(RTR("Zero width joiner (ZWJ)"), MENU_INSERT_ZWJ); - menu_ctl->add_item(RTR("Zero width non-joiner (ZWNJ)"), MENU_INSERT_ZWNJ); - menu_ctl->add_item(RTR("Word joiner (WJ)"), MENU_INSERT_WJ); - menu_ctl->add_item(RTR("Soft hyphen (SHY)"), MENU_INSERT_SHY); + menu_ctl->add_item(RTR("Zero-Width Joiner (ZWJ)"), MENU_INSERT_ZWJ); + menu_ctl->add_item(RTR("Zero-Width Non-Joiner (ZWNJ)"), MENU_INSERT_ZWNJ); + menu_ctl->add_item(RTR("Word Joiner (WJ)"), MENU_INSERT_WJ); + menu_ctl->add_item(RTR("Soft Hyphen (SHY)"), MENU_INSERT_SHY); menu->add_child(menu_ctl, false, INTERNAL_MODE_FRONT); menu->connect("id_pressed", callable_mp(this, &TextEdit::menu_option)); @@ -5186,29 +5519,29 @@ void TextEdit::_generate_context_menu() { // Reorganize context menu. menu->clear(); if (editable) { - menu->add_item(RTR("Cut"), MENU_CUT, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_cut") : 0); + menu->add_item(RTR("Cut"), MENU_CUT, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_cut") : Key::NONE); } - menu->add_item(RTR("Copy"), MENU_COPY, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_copy") : 0); + menu->add_item(RTR("Copy"), MENU_COPY, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_copy") : Key::NONE); if (editable) { - menu->add_item(RTR("Paste"), MENU_PASTE, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_paste") : 0); + menu->add_item(RTR("Paste"), MENU_PASTE, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_paste") : Key::NONE); } menu->add_separator(); if (is_selecting_enabled()) { - menu->add_item(RTR("Select All"), MENU_SELECT_ALL, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_text_select_all") : 0); + menu->add_item(RTR("Select All"), MENU_SELECT_ALL, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_text_select_all") : Key::NONE); } if (editable) { menu->add_item(RTR("Clear"), MENU_CLEAR); menu->add_separator(); - menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_undo") : 0); - menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_redo") : 0); + menu->add_item(RTR("Undo"), MENU_UNDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_undo") : Key::NONE); + menu->add_item(RTR("Redo"), MENU_REDO, is_shortcut_keys_enabled() ? _get_menu_action_accelerator("ui_redo") : Key::NONE); } menu->add_separator(); - menu->add_submenu_item(RTR("Text writing direction"), "DirMenu"); + menu->add_submenu_item(RTR("Text Writing Direction"), "DirMenu"); menu->add_separator(); - menu->add_check_item(RTR("Display control characters"), MENU_DISPLAY_UCC); + menu->add_check_item(RTR("Display Control Characters"), MENU_DISPLAY_UCC); menu->set_item_checked(menu->get_item_index(MENU_DISPLAY_UCC), draw_control_chars); if (editable) { - menu->add_submenu_item(RTR("Insert control character"), "CTLMenu"); + menu->add_submenu_item(RTR("Insert Control Character"), "CTLMenu"); } menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_INHERITED), text_direction == TEXT_DIRECTION_INHERITED); menu_dir->set_item_checked(menu_dir->get_item_index(MENU_DIR_AUTO), text_direction == TEXT_DIRECTION_AUTO); @@ -5221,25 +5554,25 @@ void TextEdit::_generate_context_menu() { } } -int TextEdit::_get_menu_action_accelerator(const String &p_action) { +Key TextEdit::_get_menu_action_accelerator(const String &p_action) { const List<Ref<InputEvent>> *events = InputMap::get_singleton()->action_get_events(p_action); if (!events) { - return 0; + return Key::NONE; } // Use first event in the list for the accelerator. const List<Ref<InputEvent>>::Element *first_event = events->front(); if (!first_event) { - return 0; + return Key::NONE; } const Ref<InputEventKey> event = first_event->get(); if (event.is_null()) { - return 0; + return Key::NONE; } // Use physical keycode if non-zero - if (event->get_physical_keycode() != 0) { + if (event->get_physical_keycode() != Key::NONE) { return event->get_physical_keycode_with_modifiers(); } else { return event->get_keycode_with_modifiers(); @@ -5394,10 +5727,10 @@ int TextEdit::_get_column_x_offset_for_line(int p_char, int p_line) const { /* Selection */ void TextEdit::_click_selection_held() { - // Warning: is_mouse_button_pressed(MOUSE_BUTTON_LEFT) returns false for double+ clicks, so this doesn't work for MODE_WORD + // Warning: is_mouse_button_pressed(MouseButton::LEFT) returns false for double+ clicks, so this doesn't work for MODE_WORD // and MODE_LINE. However, moving the mouse triggers _gui_input, which calls these functions too, so that's not a huge problem. // I'm unsure if there's an actual fix that doesn't have a ton of side effects. - if (Input::get_singleton()->is_mouse_button_pressed(MOUSE_BUTTON_LEFT) && selection.selecting_mode != SelectionMode::SELECTION_MODE_NONE) { + if (Input::get_singleton()->is_mouse_button_pressed(MouseButton::LEFT) && selection.selecting_mode != SelectionMode::SELECTION_MODE_NONE) { switch (selection.selecting_mode) { case SelectionMode::SELECTION_MODE_POINTER: { _update_selection_mode_pointer(); @@ -5477,6 +5810,10 @@ void TextEdit::_update_selection_mode_word() { } } + if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(get_selected_text()); + } + update(); click_select_held->start(); @@ -5504,6 +5841,10 @@ void TextEdit::_update_selection_mode_line() { set_caret_column(0); select(selection.selecting_line, selection.selecting_column, line, col); + if (DisplayServer::get_singleton()->has_feature(DisplayServer::FEATURE_CLIPBOARD_PRIMARY)) { + DisplayServer::get_singleton()->clipboard_set_primary(get_selected_text()); + } + update(); click_select_held->start(); @@ -5689,7 +6030,7 @@ double TextEdit::_get_v_scroll_offset() const { } void TextEdit::_scroll_up(real_t p_delta) { - if (scrolling && smooth_scroll_enabled && SGN(target_v_scroll - v_scroll->get_value()) != SGN(-p_delta)) { + if (scrolling && smooth_scroll_enabled && SIGN(target_v_scroll - v_scroll->get_value()) != SIGN(-p_delta)) { scrolling = false; minimap_clicked = false; } @@ -5716,7 +6057,7 @@ void TextEdit::_scroll_up(real_t p_delta) { } void TextEdit::_scroll_down(real_t p_delta) { - if (scrolling && smooth_scroll_enabled && SGN(target_v_scroll - v_scroll->get_value()) != SGN(p_delta)) { + if (scrolling && smooth_scroll_enabled && SIGN(target_v_scroll - v_scroll->get_value()) != SIGN(p_delta)) { scrolling = false; minimap_clicked = false; } @@ -5997,11 +6338,11 @@ void TextEdit::_base_insert_text(int p_line, int p_char, const String &p_text, i ERR_FAIL_COND(p_char < 0); /* STEP 1: Remove \r from source text and separate in substrings. */ - - Vector<String> substrings = p_text.replace("\r", "").split("\n"); + const String text_to_insert = p_text.replace("\r", ""); + Vector<String> substrings = text_to_insert.split("\n"); // Is this just a new empty line? - bool shift_first_line = p_char == 0 && p_text.replace("\r", "") == "\n"; + bool shift_first_line = p_char == 0 && substrings.size() == 2 && text_to_insert == "\n"; /* STEP 2: Add spaces if the char is greater than the end of the line. */ while (p_char > text[p_line].length()) { @@ -6009,24 +6350,19 @@ void TextEdit::_base_insert_text(int p_line, int p_char, const String &p_text, i } /* STEP 3: Separate dest string in pre and post text. */ - - String preinsert_text = text[p_line].substr(0, p_char); String postinsert_text = text[p_line].substr(p_char, text[p_line].size()); - for (int j = 0; j < substrings.size(); j++) { - // Insert the substrings. - - if (j == 0) { - text.set(p_line, preinsert_text + substrings[j], structured_text_parser(st_parser, st_args, preinsert_text + substrings[j])); - } else { - text.insert(p_line + j, substrings[j], structured_text_parser(st_parser, st_args, substrings[j])); - } + substrings.write[0] = text[p_line].substr(0, p_char) + substrings[0]; + substrings.write[substrings.size() - 1] += postinsert_text; - if (j == substrings.size() - 1) { - text.set(p_line + j, text[p_line + j] + postinsert_text, structured_text_parser(st_parser, st_args, text[p_line + j] + postinsert_text)); - } + Vector<Array> bidi_override; + bidi_override.resize(substrings.size()); + for (int i = 0; i < substrings.size(); i++) { + bidi_override.write[i] = structured_text_parser(st_parser, st_args, substrings[i]); } + text.insert(p_line, substrings, bidi_override); + if (shift_first_line) { text.move_gutters(p_line, p_line + 1); text.set_hidden(p_line + 1, text.is_hidden(p_line)); @@ -6059,7 +6395,7 @@ String TextEdit::_base_get_text(int p_from_line, int p_from_column, int p_to_lin ERR_FAIL_COND_V(p_to_line < p_from_line, String()); // 'from > to'. ERR_FAIL_COND_V(p_to_line == p_from_line && p_to_column < p_from_column, String()); // 'from > to'. - String ret; + StringBuilder ret; for (int i = p_from_line; i <= p_to_line; i++) { int begin = (i == p_from_line) ? p_from_column : 0; @@ -6071,7 +6407,7 @@ String TextEdit::_base_get_text(int p_from_line, int p_from_column, int p_to_lin ret += text[i].substr(begin, end - begin); } - return ret; + return ret.as_string(); } void TextEdit::_base_remove_text(int p_from_line, int p_from_column, int p_to_line, int p_to_column) { @@ -6085,9 +6421,7 @@ void TextEdit::_base_remove_text(int p_from_line, int p_from_column, int p_to_li String pre_text = text[p_from_line].substr(0, p_from_column); String post_text = text[p_to_line].substr(p_to_column, text[p_to_line].length()); - for (int i = p_from_line; i < p_to_line; i++) { - text.remove(p_from_line + 1); - } + text.remove_range(p_from_line, p_to_line); text.set(p_from_line, pre_text + post_text, structured_text_parser(st_parser, st_args, pre_text + post_text)); if (!text_changed_dirty && !setting_text) { diff --git a/scene/gui/text_edit.h b/scene/gui/text_edit.h index 16c1ee9ff9..df3edca943 100644 --- a/scene/gui/text_edit.h +++ b/scene/gui/text_edit.h @@ -159,6 +159,7 @@ private: mutable Vector<Line> text; Ref<Font> font; int font_size = -1; + int font_height = 0; Dictionary opentype_features; String language; @@ -204,8 +205,8 @@ private: } } bool is_hidden(int p_line) const { return text[p_line].hidden; } - void insert(int p_at, const String &p_text, const Array &p_bidi_override); - void remove(int p_at); + void insert(int p_at, const Vector<String> &p_text, const Vector<Array> &p_bidi_override); + void remove_range(int p_from_line, int p_to_line); int size() const { return text.size(); } void clear(); @@ -269,8 +270,9 @@ private: bool context_menu_enabled = true; bool shortcut_keys_enabled = true; bool virtual_keyboard_enabled = true; + bool middle_mouse_paste_enabled = true; - // Overridable actions + // Overridable actions. String cut_copy_line = ""; // Context menu. @@ -279,7 +281,7 @@ private: PopupMenu *menu_ctl = nullptr; void _generate_context_menu(); - int _get_menu_action_accelerator(const String &p_action); + Key _get_menu_action_accelerator(const String &p_action); /* Versioning */ struct TextOperation { @@ -335,6 +337,14 @@ private: Variant tooltip_ud; /* Mouse */ + struct LineDrawingCache { + int y_offset = 0; + Vector<int> first_visible_chars; + Vector<int> last_visible_chars; + }; + + Map<int, LineDrawingCache> line_drawing_cache; + int _get_char_pos_for_line(int p_px, int p_line, int p_wrap_index = 0) const; /* Caret. */ @@ -366,6 +376,9 @@ private: bool caret_mid_grapheme_enabled = false; + bool drag_action = false; + bool drag_caret_force_displayed = false; + void _emit_caret_changed(); void _reset_caret_blink_timer(); @@ -391,9 +404,11 @@ private: int to_column = 0; bool shiftclick_left = false; + bool drag_attempt = false; } selection; bool selecting_enabled = true; + bool deselect_on_focus_loss_enabled = true; Color font_selected_color = Color(1, 1, 1); Color selection_color = Color(1, 1, 1); @@ -413,7 +428,7 @@ private: void _pre_shift_selection(); void _post_shift_selection(); - /* line wrapping. */ + /* Line wrapping. */ LineWrappingMode line_wrapping_mode = LineWrappingMode::LINE_WRAPPING_NONE; int wrap_at_column = 0; @@ -453,14 +468,14 @@ private: void _scroll_lines_up(); void _scroll_lines_down(); - // Minimap + // Minimap. bool draw_minimap = false; int minimap_width = 80; Point2 minimap_char_size = Point2(1, 2); int minimap_line_spacing = 1; - // minimap scroll + // Minimap scroll. bool minimap_clicked = false; bool hovering_minimap = false; bool dragging_minimap = false; @@ -586,12 +601,14 @@ protected: virtual void _cut_internal(); virtual void _copy_internal(); virtual void _paste_internal(); + virtual void _paste_primary_clipboard_internal(); GDVIRTUAL1(_handle_unicode_input, int) GDVIRTUAL0(_backspace) GDVIRTUAL0(_cut) GDVIRTUAL0(_copy) GDVIRTUAL0(_paste) + GDVIRTUAL0(_paste_primary_clipboard) public: /* General overrides. */ @@ -599,6 +616,9 @@ public: virtual Size2 get_minimum_size() const override; virtual bool is_text_field() const override; virtual CursorShape get_cursor_shape(const Point2 &p_pos = Point2i()) const override; + virtual Variant get_drag_data(const Point2 &p_point) override; + virtual bool can_drop_data(const Point2 &p_point, const Variant &p_data) const override; + virtual void drop_data(const Point2 &p_point, const Variant &p_data) override; virtual String get_tooltip(const Point2 &p_pos) const override; void set_tooltip_request_func(Object *p_obj, const StringName &p_function, const Variant &p_udata); @@ -640,6 +660,9 @@ public: void set_virtual_keyboard_enabled(bool p_enabled); bool is_virtual_keyboard_enabled() const; + void set_middle_mouse_paste_enabled(bool p_enabled); + bool is_middle_mouse_paste_enabled() const; + // Text manipulation void clear(); @@ -674,6 +697,7 @@ public: void cut(); void copy(); void paste(); + void paste_primary_clipboard(); // Context menu. PopupMenu *get_menu() const; @@ -708,10 +732,14 @@ public: String get_word_at_pos(const Vector2 &p_pos) const; - Point2i get_line_column_at_pos(const Point2i &p_pos) const; + Point2i get_line_column_at_pos(const Point2i &p_pos, bool p_allow_out_of_bounds = true) const; + Point2i get_pos_at_line_column(int p_line, int p_column) const; + Rect2i get_rect_at_line_column(int p_line, int p_column) const; + int get_minimap_line_at_pos(const Point2i &p_pos) const; bool is_dragging_cursor() const; + bool is_mouse_over_selection(bool p_edges = true) const; /* Caret */ void set_caret_type(CaretType p_type); @@ -746,6 +774,9 @@ public: void set_selecting_enabled(const bool p_enabled); bool is_selecting_enabled() const; + void set_deselect_on_focus_loss_enabled(const bool p_enabled); + bool is_deselect_on_focus_loss_enabled() const; + void set_override_selected_font_color(bool p_override_selected_font_color); bool is_overriding_selected_font_color() const; @@ -771,7 +802,7 @@ public: void deselect(); void delete_selection(); - /* line wrapping. */ + /* Line wrapping. */ void set_line_wrapping_mode(LineWrappingMode p_wrapping_mode); LineWrappingMode get_line_wrapping_mode() const; @@ -811,6 +842,7 @@ public: int get_last_full_visible_line_wrap_index() const; int get_visible_line_count() const; + int get_visible_line_count_in_range(int p_from, int p_to) const; int get_total_visible_line_count() const; // Auto Adjust diff --git a/scene/gui/texture_button.cpp b/scene/gui/texture_button.cpp index 8659ea06a2..3f0d907a7e 100644 --- a/scene/gui/texture_button.cpp +++ b/scene/gui/texture_button.cpp @@ -289,19 +289,19 @@ void TextureButton::_bind_methods() { void TextureButton::set_normal_texture(const Ref<Texture2D> &p_normal) { normal = p_normal; update(); - minimum_size_changed(); + update_minimum_size(); } void TextureButton::set_pressed_texture(const Ref<Texture2D> &p_pressed) { pressed = p_pressed; update(); - minimum_size_changed(); + update_minimum_size(); } void TextureButton::set_hover_texture(const Ref<Texture2D> &p_hover) { hover = p_hover; update(); - minimum_size_changed(); + update_minimum_size(); } void TextureButton::set_disabled_texture(const Ref<Texture2D> &p_disabled) { @@ -312,7 +312,7 @@ void TextureButton::set_disabled_texture(const Ref<Texture2D> &p_disabled) { void TextureButton::set_click_mask(const Ref<BitMap> &p_click_mask) { click_mask = p_click_mask; update(); - minimum_size_changed(); + update_minimum_size(); } Ref<Texture2D> TextureButton::get_normal_texture() const { @@ -349,7 +349,7 @@ bool TextureButton::get_expand() const { void TextureButton::set_expand(bool p_expand) { expand = p_expand; - minimum_size_changed(); + update_minimum_size(); update(); } diff --git a/scene/gui/texture_progress_bar.cpp b/scene/gui/texture_progress_bar.cpp index fe11de128a..6a926a0364 100644 --- a/scene/gui/texture_progress_bar.cpp +++ b/scene/gui/texture_progress_bar.cpp @@ -35,7 +35,7 @@ void TextureProgressBar::set_under_texture(const Ref<Texture2D> &p_texture) { under = p_texture; update(); - minimum_size_changed(); + update_minimum_size(); } Ref<Texture2D> TextureProgressBar::get_under_texture() const { @@ -46,7 +46,7 @@ void TextureProgressBar::set_over_texture(const Ref<Texture2D> &p_texture) { over = p_texture; update(); if (under.is_null()) { - minimum_size_changed(); + update_minimum_size(); } } @@ -58,7 +58,7 @@ void TextureProgressBar::set_stretch_margin(Side p_side, int p_size) { ERR_FAIL_INDEX((int)p_side, 4); stretch_margin[p_side] = p_size; update(); - minimum_size_changed(); + update_minimum_size(); } int TextureProgressBar::get_stretch_margin(Side p_side) const { @@ -69,7 +69,7 @@ int TextureProgressBar::get_stretch_margin(Side p_side) const { void TextureProgressBar::set_nine_patch_stretch(bool p_stretch) { nine_patch_stretch = p_stretch; update(); - minimum_size_changed(); + update_minimum_size(); } bool TextureProgressBar::get_nine_patch_stretch() const { @@ -93,7 +93,7 @@ Size2 TextureProgressBar::get_minimum_size() const { void TextureProgressBar::set_progress_texture(const Ref<Texture2D> &p_texture) { progress = p_texture; update(); - minimum_size_changed(); + update_minimum_size(); } Ref<Texture2D> TextureProgressBar::get_progress_texture() const { @@ -387,7 +387,6 @@ void TextureProgressBar::draw_nine_patch_stretched(const Ref<Texture2D> &p_textu } void TextureProgressBar::_notification(int p_what) { - const float corners[12] = { -0.125, -0.375, -0.625, -0.875, 0.125, 0.375, 0.625, 0.875, 1.125, 1.375, 1.625, 1.875 }; switch (p_what) { case NOTIFICATION_DRAW: { if (nine_patch_stretch && (mode == FILL_LEFT_TO_RIGHT || mode == FILL_RIGHT_TO_LEFT || mode == FILL_TOP_TO_BOTTOM || mode == FILL_BOTTOM_TO_TOP || mode == FILL_BILINEAR_LEFT_AND_RIGHT || mode == FILL_BILINEAR_TOP_AND_BOTTOM)) { @@ -452,7 +451,7 @@ void TextureProgressBar::_notification(int p_what) { float val = get_as_ratio() * rad_max_degrees / 360; if (val == 1) { Rect2 region = Rect2(progress_offset, s); - Rect2 source = Rect2(Point2(), s); + Rect2 source = Rect2(Point2(), progress->get_size()); draw_texture_rect_region(progress, region, source, tint_progress); } else if (val != 0) { Array pts; @@ -466,16 +465,14 @@ void TextureProgressBar::_notification(int p_what) { } float end = start + direction * val; - pts.append(start); - pts.append(end); float from = MIN(start, end); float to = MAX(start, end); - for (int i = 0; i < 12; i++) { - if (corners[i] > from && corners[i] < to) { - pts.append(corners[i]); - } + pts.append(from); + for (float corner = Math::floor(from * 4 + 0.5) * 0.25 + 0.125; corner < to; corner += 0.25) { + pts.append(corner); } - pts.sort(); + pts.append(to); + Vector<Point2> uvs; Vector<Point2> points; uvs.push_back(get_relative_center()); @@ -492,6 +489,8 @@ void TextureProgressBar::_notification(int p_what) { colors.push_back(tint_progress); draw_polygon(points, colors, uvs, progress); } + + // Draw a reference cross. if (Engine::get_singleton()->is_editor_hint()) { Point2 p; @@ -502,6 +501,7 @@ void TextureProgressBar::_notification(int p_what) { } p *= get_relative_center(); + p += progress_offset; p = p.floor(); draw_line(p - Point2(8, 0), p + Point2(8, 0), Color(0.9, 0.5, 0.5), 2); draw_line(p - Point2(0, 8), p + Point2(0, 8), Color(0.9, 0.5, 0.5), 2); diff --git a/scene/gui/texture_rect.cpp b/scene/gui/texture_rect.cpp index 1cba88e06f..85c15cdae7 100644 --- a/scene/gui/texture_rect.cpp +++ b/scene/gui/texture_rect.cpp @@ -152,7 +152,7 @@ void TextureRect::_bind_methods() { void TextureRect::_texture_changed() { if (texture.is_valid()) { update(); - minimum_size_changed(); + update_minimum_size(); } } @@ -172,7 +172,7 @@ void TextureRect::set_texture(const Ref<Texture2D> &p_tex) { } update(); - minimum_size_changed(); + update_minimum_size(); } Ref<Texture2D> TextureRect::get_texture() const { @@ -182,7 +182,7 @@ Ref<Texture2D> TextureRect::get_texture() const { void TextureRect::set_expand(bool p_expand) { expand = p_expand; update(); - minimum_size_changed(); + update_minimum_size(); } bool TextureRect::has_expand() const { diff --git a/scene/gui/tree.cpp b/scene/gui/tree.cpp index 3f041bf65a..5a6ac7c0d2 100644 --- a/scene/gui/tree.cpp +++ b/scene/gui/tree.cpp @@ -848,7 +848,7 @@ String TreeItem::get_button_tooltip(int p_column, int p_idx) const { void TreeItem::erase_button(int p_column, int p_idx) { ERR_FAIL_INDEX(p_column, cells.size()); ERR_FAIL_INDEX(p_idx, cells[p_column].buttons.size()); - cells.write[p_column].buttons.remove(p_idx); + cells.write[p_column].buttons.remove_at(p_idx); _changed_notify(p_column); } @@ -1002,18 +1002,18 @@ bool TreeItem::is_custom_set_as_button(int p_column) const { return cells[p_column].custom_button; } -void TreeItem::set_text_align(int p_column, TextAlign p_align) { +void TreeItem::set_text_alignment(int p_column, HorizontalAlignment p_alignment) { ERR_FAIL_INDEX(p_column, cells.size()); - cells.write[p_column].text_align = p_align; + cells.write[p_column].text_alignment = p_alignment; cells.write[p_column].cached_minimum_size_dirty = true; _changed_notify(p_column); } -TreeItem::TextAlign TreeItem::get_text_align(int p_column) const { - ERR_FAIL_INDEX_V(p_column, cells.size(), ALIGN_LEFT); - return cells[p_column].text_align; +HorizontalAlignment TreeItem::get_text_alignment(int p_column) const { + ERR_FAIL_INDEX_V(p_column, cells.size(), HORIZONTAL_ALIGNMENT_LEFT); + return cells[p_column].text_alignment; } void TreeItem::set_expand_right(int p_column, bool p_enable) { @@ -1231,8 +1231,8 @@ void TreeItem::_bind_methods() { ClassDB::bind_method(D_METHOD("set_tooltip", "column", "tooltip"), &TreeItem::set_tooltip); ClassDB::bind_method(D_METHOD("get_tooltip", "column"), &TreeItem::get_tooltip); - ClassDB::bind_method(D_METHOD("set_text_align", "column", "text_align"), &TreeItem::set_text_align); - ClassDB::bind_method(D_METHOD("get_text_align", "column"), &TreeItem::get_text_align); + ClassDB::bind_method(D_METHOD("set_text_alignment", "column", "text_alignment"), &TreeItem::set_text_alignment); + ClassDB::bind_method(D_METHOD("get_text_alignment", "column"), &TreeItem::get_text_alignment); ClassDB::bind_method(D_METHOD("set_expand_right", "column", "enable"), &TreeItem::set_expand_right); ClassDB::bind_method(D_METHOD("get_expand_right", "column"), &TreeItem::get_expand_right); @@ -1278,10 +1278,6 @@ void TreeItem::_bind_methods() { BIND_ENUM_CONSTANT(CELL_MODE_RANGE); BIND_ENUM_CONSTANT(CELL_MODE_ICON); BIND_ENUM_CONSTANT(CELL_MODE_CUSTOM); - - BIND_ENUM_CONSTANT(ALIGN_LEFT); - BIND_ENUM_CONSTANT(ALIGN_CENTER); - BIND_ENUM_CONSTANT(ALIGN_RIGHT); } void TreeItem::clear_children() { @@ -1477,16 +1473,17 @@ void Tree::draw_item_rect(TreeItem::Cell &p_cell, const Rect2i &p_rect, const Co } w += ts.width; - switch (p_cell.text_align) { - case TreeItem::ALIGN_LEFT: + switch (p_cell.text_alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: { if (rtl) { rect.position.x += MAX(0, (rect.size.width - w)); } - break; - case TreeItem::ALIGN_CENTER: + } break; + case HORIZONTAL_ALIGNMENT_CENTER: rect.position.x += MAX(0, (rect.size.width - w) / 2); break; - case TreeItem::ALIGN_RIGHT: + case HORIZONTAL_ALIGNMENT_RIGHT: if (!rtl) { rect.position.x += MAX(0, (rect.size.width - w)); } @@ -1539,7 +1536,7 @@ void Tree::update_column(int p_col) { columns.write[p_col].text_buf->set_direction((TextServer::Direction)columns[p_col].text_direction); } - columns.write[p_col].text_buf->add_string(columns[p_col].title, cache.font, cache.font_size, columns[p_col].opentype_features, (columns[p_col].language != "") ? columns[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); + columns.write[p_col].text_buf->add_string(columns[p_col].title, cache.font, cache.font_size, columns[p_col].opentype_features, !columns[p_col].language.is_empty() ? columns[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); } void Tree::update_item_cell(TreeItem *p_item, int p_col) { @@ -1547,7 +1544,7 @@ void Tree::update_item_cell(TreeItem *p_item, int p_col) { p_item->cells.write[p_col].text_buf->clear(); if (p_item->cells[p_col].mode == TreeItem::CELL_MODE_RANGE) { - if (p_item->cells[p_col].text != "") { + if (!p_item->cells[p_col].text.is_empty()) { if (!p_item->cells[p_col].editable) { return; } @@ -1574,7 +1571,7 @@ void Tree::update_item_cell(TreeItem *p_item, int p_col) { valtext = p_item->cells[p_col].text; } - if (p_item->cells[p_col].suffix != String()) { + if (!p_item->cells[p_col].suffix.is_empty()) { valtext += " " + p_item->cells[p_col].suffix; } @@ -1597,7 +1594,7 @@ void Tree::update_item_cell(TreeItem *p_item, int p_col) { } else { font_size = cache.font_size; } - p_item->cells.write[p_col].text_buf->add_string(valtext, font, font_size, p_item->cells[p_col].opentype_features, (p_item->cells[p_col].language != "") ? p_item->cells[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); + p_item->cells.write[p_col].text_buf->add_string(valtext, font, font_size, p_item->cells[p_col].opentype_features, !p_item->cells[p_col].language.is_empty() ? p_item->cells[p_col].language : TranslationServer::get_singleton()->get_tool_locale()); TS->shaped_text_set_bidi_override(p_item->cells[p_col].text_buf->get_rid(), structured_text_parser(p_item->cells[p_col].st_parser, p_item->cells[p_col].st_args, valtext)); p_item->cells.write[p_col].dirty = false; } @@ -1663,7 +1660,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if (p_item->cells[i].expand_right) { int plus = 1; - while (i + plus < columns.size() && !p_item->cells[i + plus].editable && p_item->cells[i + plus].mode == TreeItem::CELL_MODE_STRING && p_item->cells[i + plus].text == "" && p_item->cells[i + plus].icon.is_null()) { + while (i + plus < columns.size() && !p_item->cells[i + plus].editable && p_item->cells[i + plus].mode == TreeItem::CELL_MODE_STRING && p_item->cells[i + plus].text.is_empty() && p_item->cells[i + plus].icon.is_null()) { w += get_column_width(i + plus); plus++; skip2++; @@ -1860,7 +1857,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 } break; case TreeItem::CELL_MODE_RANGE: { - if (p_item->cells[i].text != "") { + if (!p_item->cells[i].text.is_empty()) { if (!p_item->cells[i].editable) { break; } @@ -1955,7 +1952,7 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if (p_item->cells[i].custom_button) { if (cache.hover_item == p_item && cache.hover_cell == i) { - if (Input::get_singleton()->is_mouse_button_pressed(MOUSE_BUTTON_LEFT)) { + if (Input::get_singleton()->is_mouse_button_pressed(MouseButton::LEFT)) { draw_style_box(cache.custom_button_pressed, ir); } else { draw_style_box(cache.custom_button_hover, ir); @@ -2256,7 +2253,7 @@ Rect2 Tree::search_item_rect(TreeItem *p_from, TreeItem *p_item) { } void Tree::_range_click_timeout() { - if (range_item_last && !range_drag_enabled && Input::get_singleton()->is_mouse_button_pressed(MOUSE_BUTTON_LEFT)) { + if (range_item_last && !range_drag_enabled && Input::get_singleton()->is_mouse_button_pressed(MouseButton::LEFT)) { Point2 pos = get_local_mouse_position() - cache.bg->get_offset(); if (show_column_titles) { pos.y -= _get_title_button_height(); @@ -2284,7 +2281,7 @@ void Tree::_range_click_timeout() { propagate_mouse_activated = false; // done from outside, so signal handler can't clear the tree in the middle of emit (which is a common case) blocked++; - propagate_mouse_event(pos + cache.offset, 0, 0, x_limit + cache.offset.width, false, root, MOUSE_BUTTON_LEFT, mb); + propagate_mouse_event(pos + cache.offset, 0, 0, x_limit + cache.offset.width, false, root, MouseButton::LEFT, mb); blocked--; if (range_click_timer->is_one_shot()) { @@ -2307,7 +2304,7 @@ void Tree::_range_click_timeout() { } } -int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int x_limit, bool p_double_click, TreeItem *p_item, int p_button, const Ref<InputEventWithModifiers> &p_mod) { +int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int x_limit, bool p_double_click, TreeItem *p_item, MouseButton p_button, const Ref<InputEventWithModifiers> &p_mod) { int item_h = compute_item_height(p_item) + cache.vseparation; bool skip = (p_item == root && hide_root); @@ -2340,7 +2337,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int if (p_item->cells[i].expand_right) { int plus = 1; - while (i + plus < columns.size() && !p_item->cells[i + plus].editable && p_item->cells[i + plus].mode == TreeItem::CELL_MODE_STRING && p_item->cells[i + plus].text == "" && p_item->cells[i + plus].icon.is_null()) { + while (i + plus < columns.size() && !p_item->cells[i + plus].editable && p_item->cells[i + plus].mode == TreeItem::CELL_MODE_STRING && p_item->cells[i + plus].text.is_empty() && p_item->cells[i + plus].icon.is_null()) { col_width += cache.hseparation; col_width += get_column_width(i + plus); plus++; @@ -2427,7 +2424,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int col_width -= w + cache.button_margin; } - if (p_button == MOUSE_BUTTON_LEFT || (p_button == MOUSE_BUTTON_RIGHT && allow_rmb_select)) { + if (p_button == MouseButton::LEFT || (p_button == MouseButton::RIGHT && allow_rmb_select)) { /* process selection */ if (p_double_click && (!c.editable || c.mode == TreeItem::CELL_MODE_CUSTOM || c.mode == TreeItem::CELL_MODE_ICON /*|| c.mode==TreeItem::CELL_MODE_CHECK*/)) { //it's confusing for check @@ -2439,10 +2436,10 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int } if (select_mode == SELECT_MULTI && p_mod->is_command_pressed() && c.selectable) { - if (!c.selected || p_button == MOUSE_BUTTON_RIGHT) { + if (!c.selected || p_button == MouseButton::RIGHT) { p_item->select(col); emit_signal(SNAME("multi_selected"), p_item, col, true); - if (p_button == MOUSE_BUTTON_RIGHT) { + if (p_button == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), get_local_mouse_position()); } @@ -2459,21 +2456,21 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int bool inrange = false; select_single_item(p_item, root, col, selected_item, &inrange); - if (p_button == MOUSE_BUTTON_RIGHT) { + if (p_button == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), get_local_mouse_position()); } } else { int icount = _count_selected_items(root); - if (select_mode == SELECT_MULTI && icount > 1 && p_button != MOUSE_BUTTON_RIGHT) { + if (select_mode == SELECT_MULTI && icount > 1 && p_button != MouseButton::RIGHT) { single_select_defer = p_item; single_select_defer_column = col; } else { - if (p_button != MOUSE_BUTTON_RIGHT || !c.selected) { + if (p_button != MouseButton::RIGHT || !c.selected) { select_single_item(p_item, root, col); } - if (p_button == MOUSE_BUTTON_RIGHT) { + if (p_button == MouseButton::RIGHT) { emit_signal(SNAME("item_rmb_selected"), get_local_mouse_position()); } } @@ -2523,7 +2520,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int } break; case TreeItem::CELL_MODE_RANGE: { - if (c.text != "") { + if (!c.text.is_empty()) { //if (x >= (get_column_width(col)-item_h/2)) { popup_menu->clear(); for (int i = 0; i < c.text.get_slice_count(","); i++) { @@ -2532,7 +2529,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int } popup_menu->set_size(Size2(col_width, 0)); - popup_menu->set_position(get_global_position() + Point2i(col_ofs, _get_title_button_height() + y_ofs + item_h) - cache.offset); + popup_menu->set_position(get_screen_position() + Point2i(col_ofs, _get_title_button_height() + y_ofs + item_h) - cache.offset); popup_menu->popup(); popup_edited_item = p_item; popup_edited_item_col = col; @@ -2543,7 +2540,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int /* touching the combo */ bool up = p_pos.y < (item_h / 2); - if (p_button == MOUSE_BUTTON_LEFT) { + if (p_button == MouseButton::LEFT) { if (range_click_timer->get_time_left() == 0) { range_item_last = p_item; range_up_last = up; @@ -2560,13 +2557,13 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int item_edited(col, p_item); - } else if (p_button == MOUSE_BUTTON_RIGHT) { + } else if (p_button == MouseButton::RIGHT) { p_item->set_range(col, (up ? c.max : c.min)); item_edited(col, p_item); - } else if (p_button == MOUSE_BUTTON_WHEEL_UP) { + } else if (p_button == MouseButton::WHEEL_UP) { p_item->set_range(col, c.val + c.step); item_edited(col, p_item); - } else if (p_button == MOUSE_BUTTON_WHEEL_DOWN) { + } else if (p_button == MouseButton::WHEEL_DOWN) { p_item->set_range(col, c.val - c.step); item_edited(col, p_item); } @@ -2599,14 +2596,14 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int } if (!p_item->cells[col].custom_button || !on_arrow) { - item_edited(col, p_item, p_button == MOUSE_BUTTON_LEFT); + item_edited(col, p_item, p_button == MouseButton::LEFT); } click_handled = true; return -1; } break; }; - if (!bring_up_editor || p_button != MOUSE_BUTTON_LEFT) { + if (!bring_up_editor || p_button != MouseButton::LEFT) { return -1; } @@ -2646,7 +2643,7 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int item_h += child_h; } } - if (p_item == root && p_button == MOUSE_BUTTON_RIGHT) { + if (p_item == root && p_button == MouseButton::RIGHT) { emit_signal(SNAME("empty_rmb"), get_local_mouse_position()); } } @@ -2655,9 +2652,9 @@ int Tree::propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int } void Tree::_text_editor_modal_close() { - if (Input::get_singleton()->is_key_pressed(KEY_ESCAPE) || - Input::get_singleton()->is_key_pressed(KEY_KP_ENTER) || - Input::get_singleton()->is_key_pressed(KEY_ENTER)) { + if (Input::get_singleton()->is_key_pressed(Key::ESCAPE) || + Input::get_singleton()->is_key_pressed(Key::KP_ENTER) || + Input::get_singleton()->is_key_pressed(Key::ENTER)) { return; } @@ -3048,7 +3045,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { return; } else { - if (k->get_keycode() != KEY_SHIFT) { + if (k->get_keycode() != Key::SHIFT) { last_keypress = 0; } } @@ -3164,7 +3161,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } else { const TreeItem::Cell &c = popup_edited_item->cells[popup_edited_item_col]; float diff_y = -mm->get_relative().y; - diff_y = Math::pow(ABS(diff_y), 1.8f) * SGN(diff_y); + diff_y = Math::pow(ABS(diff_y), 1.8f) * SIGN(diff_y); diff_y *= 0.1; range_drag_base = CLAMP(range_drag_base + c.step * diff_y, c.min, c.max); popup_edited_item->set_range(popup_edited_item_col, range_drag_base); @@ -3189,7 +3186,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { bool rtl = is_layout_rtl(); if (!b->is_pressed()) { - if (b->get_button_index() == MOUSE_BUTTON_LEFT) { + if (b->get_button_index() == MouseButton::LEFT) { Point2 pos = b->get_position(); if (rtl) { pos.x = get_size().width - pos.x; @@ -3270,8 +3267,8 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } switch (b->get_button_index()) { - case MOUSE_BUTTON_RIGHT: - case MOUSE_BUTTON_LEFT: { + case MouseButton::RIGHT: + case MouseButton::LEFT: { Ref<StyleBox> bg = cache.bg; Point2 pos = b->get_position(); @@ -3284,7 +3281,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { pos.y -= _get_title_button_height(); if (pos.y < 0) { - if (b->get_button_index() == MOUSE_BUTTON_LEFT) { + if (b->get_button_index() == MouseButton::LEFT) { pos.x += cache.offset.x; int len = 0; for (int i = 0; i < columns.size(); i++) { @@ -3302,7 +3299,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } } if (!root || (!root->get_first_child() && hide_root)) { - if (b->get_button_index() == MOUSE_BUTTON_RIGHT && allow_rmb_select) { + if (b->get_button_index() == MouseButton::RIGHT && allow_rmb_select) { emit_signal(SNAME("empty_tree_rmb_selected"), get_local_mouse_position()); } break; @@ -3329,7 +3326,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } } - if (b->get_button_index() == MOUSE_BUTTON_RIGHT) { + if (b->get_button_index() == MouseButton::RIGHT) { break; } @@ -3352,7 +3349,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { set_physics_process_internal(true); } - if (b->get_button_index() == MOUSE_BUTTON_LEFT) { + if (b->get_button_index() == MouseButton::LEFT) { if (get_item_at_position(b->get_position()) == nullptr && !b->is_shift_pressed() && !b->is_ctrl_pressed() && !b->is_command_pressed()) { emit_signal(SNAME("nothing_selected")); } @@ -3365,7 +3362,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } } break; - case MOUSE_BUTTON_WHEEL_UP: { + case MouseButton::WHEEL_UP: { double prev_value = v_scroll->get_value(); v_scroll->set_value(v_scroll->get_value() - v_scroll->get_page() * b->get_factor() / 8); if (v_scroll->get_value() != prev_value) { @@ -3373,7 +3370,7 @@ void Tree::gui_input(const Ref<InputEvent> &p_event) { } } break; - case MOUSE_BUTTON_WHEEL_DOWN: { + case MouseButton::WHEEL_DOWN: { double prev_value = v_scroll->get_value(); v_scroll->set_value(v_scroll->get_value() + v_scroll->get_page() * b->get_factor() / 8); if (v_scroll->get_value() != prev_value) { @@ -3433,7 +3430,7 @@ bool Tree::edit_selected() { item_edited(col, s); return true; - } else if (c.mode == TreeItem::CELL_MODE_RANGE && c.text != "") { + } else if (c.mode == TreeItem::CELL_MODE_RANGE && !c.text.is_empty()) { popup_menu->clear(); for (int i = 0; i < c.text.get_slice_count(","); i++) { String s2 = c.text.get_slicec(',', i); @@ -3441,7 +3438,7 @@ bool Tree::edit_selected() { } popup_menu->set_size(Size2(rect.size.width, 0)); - popup_menu->set_position(get_global_position() + rect.position + Point2i(0, rect.size.height)); + popup_menu->set_position(get_screen_position() + rect.position + Point2i(0, rect.size.height)); popup_menu->popup(); popup_edited_item = s; popup_edited_item_col = col; @@ -3570,7 +3567,9 @@ int Tree::_get_title_button_height() const { void Tree::_notification(int p_what) { if (p_what == NOTIFICATION_FOCUS_ENTER) { - focus_in_id = get_viewport()->get_processed_events_count(); + if (get_viewport()) { + focus_in_id = get_viewport()->get_processed_events_count(); + } } if (p_what == NOTIFICATION_MOUSE_EXIT) { if (cache.hover_type != Cache::CLICK_NONE) { @@ -4035,7 +4034,7 @@ int Tree::get_column_minimum_width(int p_column) const { // Check if the visible title of the column is wider. if (show_column_titles) { - min_width = MAX(cache.font->get_string_size(columns[p_column].title).width + cache.bg->get_margin(SIDE_LEFT) + cache.bg->get_margin(SIDE_RIGHT), min_width); + min_width = MAX(cache.font->get_string_size(columns[p_column].title, cache.font_size).width + cache.bg->get_margin(SIDE_LEFT) + cache.bg->get_margin(SIDE_RIGHT), min_width); } if (!columns[p_column].clip_content) { @@ -4368,7 +4367,7 @@ void Tree::scroll_to_item(TreeItem *p_item) { void Tree::set_h_scroll_enabled(bool p_enable) { h_scroll_enabled = p_enable; - minimum_size_changed(); + update_minimum_size(); } bool Tree::is_h_scroll_enabled() const { @@ -4377,7 +4376,7 @@ bool Tree::is_h_scroll_enabled() const { void Tree::set_v_scroll_enabled(bool p_enable) { v_scroll_enabled = p_enable; - minimum_size_changed(); + update_minimum_size(); } bool Tree::is_v_scroll_enabled() const { @@ -4680,7 +4679,7 @@ String Tree::get_tooltip(const Point2 &p_pos) const { Size2 size = b->get_size() + cache.button_pressed->get_minimum_size(); if (pos.x > col_width - size.width) { String tooltip = c.buttons[j].tooltip; - if (tooltip != "") { + if (!tooltip.is_empty()) { return tooltip; } } @@ -4828,6 +4827,7 @@ void Tree::_bind_methods() { ClassDB::bind_method(D_METHOD("get_allow_reselect"), &Tree::get_allow_reselect); ADD_PROPERTY(PropertyInfo(Variant::INT, "columns"), "set_columns", "get_columns"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "column_titles_visible"), "set_column_titles_visible", "are_column_titles_visible"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_reselect"), "set_allow_reselect", "get_allow_reselect"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "allow_rmb_select"), "set_allow_rmb_select", "get_allow_rmb_select"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "hide_folding"), "set_hide_folding", "is_folding_hidden"); diff --git a/scene/gui/tree.h b/scene/gui/tree.h index 6ca9458e9b..a190567f0f 100644 --- a/scene/gui/tree.h +++ b/scene/gui/tree.h @@ -52,12 +52,6 @@ public: CELL_MODE_CUSTOM, ///< Contains a custom value, show a string, and an edit button }; - enum TextAlign { - ALIGN_LEFT, - ALIGN_CENTER, - ALIGN_RIGHT - }; - private: friend class Tree; @@ -98,7 +92,7 @@ private: Size2i cached_minimum_size; bool cached_minimum_size_dirty = true; - TextAlign text_align = ALIGN_LEFT; + HorizontalAlignment text_alignment = HORIZONTAL_ALIGNMENT_LEFT; Variant meta; String tooltip; @@ -171,7 +165,7 @@ private: } if (parent) { if (!parent->children_cache.is_empty()) { - parent->children_cache.remove(get_index()); + parent->children_cache.remove_at(get_index()); } if (parent->first_child == this) { parent->first_child = next; @@ -316,8 +310,8 @@ public: void set_tooltip(int p_column, const String &p_tooltip); String get_tooltip(int p_column) const; - void set_text_align(int p_column, TextAlign p_align); - TextAlign get_text_align(int p_column) const; + void set_text_alignment(int p_column, HorizontalAlignment p_alignment); + HorizontalAlignment get_text_alignment(int p_column) const; void set_expand_right(int p_column, bool p_enable); bool get_expand_right(int p_column) const; @@ -359,7 +353,6 @@ public: }; VARIANT_ENUM_CAST(TreeItem::TreeCellMode); -VARIANT_ENUM_CAST(TreeItem::TextAlign); class VBoxContainer; @@ -462,7 +455,7 @@ private: void draw_item_rect(TreeItem::Cell &p_cell, const Rect2i &p_rect, const Color &p_color, const Color &p_icon_color, int p_ol_size, const Color &p_ol_color); int draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 &p_draw_size, TreeItem *p_item); void select_single_item(TreeItem *p_selected, TreeItem *p_current, int p_col, TreeItem *p_prev = nullptr, bool *r_in_range = nullptr, bool p_force_deselect = false); - int propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int x_limit, bool p_double_click, TreeItem *p_item, int p_button, const Ref<InputEventWithModifiers> &p_mod); + int propagate_mouse_event(const Point2i &p_pos, int x_ofs, int y_ofs, int x_limit, bool p_double_click, TreeItem *p_item, MouseButton p_button, const Ref<InputEventWithModifiers> &p_mod); void _text_editor_submit(String p_text); void _text_editor_modal_close(); void value_editor_changed(double p_value); diff --git a/scene/gui/video_player.cpp b/scene/gui/video_stream_player.cpp index 989aabc549..a11d56a2ed 100644 --- a/scene/gui/video_player.cpp +++ b/scene/gui/video_stream_player.cpp @@ -1,5 +1,5 @@ /*************************************************************************/ -/* video_player.cpp */ +/* video_stream_player.cpp */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,13 +28,13 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#include "video_player.h" +#include "video_stream_player.h" #include "core/os/os.h" #include "scene/scene_string_names.h" #include "servers/audio_server.h" -int VideoPlayer::sp_get_channel_count() const { +int VideoStreamPlayer::sp_get_channel_count() const { if (playback.is_null()) { return 0; } @@ -42,7 +42,7 @@ int VideoPlayer::sp_get_channel_count() const { return playback->get_channels(); } -bool VideoPlayer::mix(AudioFrame *p_buffer, int p_frames) { +bool VideoStreamPlayer::mix(AudioFrame *p_buffer, int p_frames) { // Check the amount resampler can really handle. // If it cannot, wait "wait_resampler_phase_limit" times. // This mechanism contributes to smoother pause/unpause operation. @@ -56,11 +56,11 @@ bool VideoPlayer::mix(AudioFrame *p_buffer, int p_frames) { } // Called from main thread (e.g. VideoStreamPlaybackTheora::update). -int VideoPlayer::_audio_mix_callback(void *p_udata, const float *p_data, int p_frames) { +int VideoStreamPlayer::_audio_mix_callback(void *p_udata, const float *p_data, int p_frames) { ERR_FAIL_NULL_V(p_udata, 0); ERR_FAIL_NULL_V(p_data, 0); - VideoPlayer *vp = (VideoPlayer *)p_udata; + VideoStreamPlayer *vp = (VideoStreamPlayer *)p_udata; int todo = MIN(vp->resampler.get_writer_space(), p_frames); @@ -75,13 +75,13 @@ int VideoPlayer::_audio_mix_callback(void *p_udata, const float *p_data, int p_f return todo; } -void VideoPlayer::_mix_audios(void *p_self) { +void VideoStreamPlayer::_mix_audios(void *p_self) { ERR_FAIL_NULL(p_self); - reinterpret_cast<VideoPlayer *>(p_self)->_mix_audio(); + reinterpret_cast<VideoStreamPlayer *>(p_self)->_mix_audio(); } // Called from audio thread -void VideoPlayer::_mix_audio() { +void VideoStreamPlayer::_mix_audio() { if (!stream.is_valid()) { return; } @@ -126,7 +126,7 @@ void VideoPlayer::_mix_audio() { } } -void VideoPlayer::_notification(int p_notification) { +void VideoStreamPlayer::_notification(int p_notification) { switch (p_notification) { case NOTIFICATION_ENTER_TREE: { AudioServer::get_singleton()->add_mix_callback(_mix_audios, this); @@ -180,7 +180,7 @@ void VideoPlayer::_notification(int p_notification) { }; }; -Size2 VideoPlayer::get_minimum_size() const { +Size2 VideoStreamPlayer::get_minimum_size() const { if (!expand && !texture.is_null()) { return texture->get_size(); } else { @@ -188,17 +188,17 @@ Size2 VideoPlayer::get_minimum_size() const { } } -void VideoPlayer::set_expand(bool p_expand) { +void VideoStreamPlayer::set_expand(bool p_expand) { expand = p_expand; update(); - minimum_size_changed(); + update_minimum_size(); } -bool VideoPlayer::has_expand() const { +bool VideoStreamPlayer::has_expand() const { return expand; } -void VideoPlayer::set_stream(const Ref<VideoStream> &p_stream) { +void VideoStreamPlayer::set_stream(const Ref<VideoStream> &p_stream) { stop(); AudioServer::get_singleton()->lock(); @@ -241,15 +241,15 @@ void VideoPlayer::set_stream(const Ref<VideoStream> &p_stream) { update(); if (!expand) { - minimum_size_changed(); + update_minimum_size(); } }; -Ref<VideoStream> VideoPlayer::get_stream() const { +Ref<VideoStream> VideoStreamPlayer::get_stream() const { return stream; }; -void VideoPlayer::play() { +void VideoStreamPlayer::play() { ERR_FAIL_COND(!is_inside_tree()); if (playback.is_null()) { return; @@ -262,7 +262,7 @@ void VideoPlayer::play() { last_audio_time = 0; }; -void VideoPlayer::stop() { +void VideoStreamPlayer::stop() { if (!is_inside_tree()) { return; } @@ -277,7 +277,7 @@ void VideoPlayer::stop() { last_audio_time = 0; }; -bool VideoPlayer::is_playing() const { +bool VideoStreamPlayer::is_playing() const { if (playback.is_null()) { return false; } @@ -285,7 +285,7 @@ bool VideoPlayer::is_playing() const { return playback->is_playing(); }; -void VideoPlayer::set_paused(bool p_paused) { +void VideoStreamPlayer::set_paused(bool p_paused) { paused = p_paused; if (playback.is_valid()) { playback->set_paused(p_paused); @@ -294,35 +294,35 @@ void VideoPlayer::set_paused(bool p_paused) { last_audio_time = 0; }; -bool VideoPlayer::is_paused() const { +bool VideoStreamPlayer::is_paused() const { return paused; } -void VideoPlayer::set_buffering_msec(int p_msec) { +void VideoStreamPlayer::set_buffering_msec(int p_msec) { buffering_ms = p_msec; } -int VideoPlayer::get_buffering_msec() const { +int VideoStreamPlayer::get_buffering_msec() const { return buffering_ms; } -void VideoPlayer::set_audio_track(int p_track) { +void VideoStreamPlayer::set_audio_track(int p_track) { audio_track = p_track; } -int VideoPlayer::get_audio_track() const { +int VideoStreamPlayer::get_audio_track() const { return audio_track; } -void VideoPlayer::set_volume(float p_vol) { +void VideoStreamPlayer::set_volume(float p_vol) { volume = p_vol; }; -float VideoPlayer::get_volume() const { +float VideoStreamPlayer::get_volume() const { return volume; }; -void VideoPlayer::set_volume_db(float p_db) { +void VideoStreamPlayer::set_volume_db(float p_db) { if (p_db < -79) { set_volume(0); } else { @@ -330,7 +330,7 @@ void VideoPlayer::set_volume_db(float p_db) { } }; -float VideoPlayer::get_volume_db() const { +float VideoStreamPlayer::get_volume_db() const { if (volume == 0) { return -80; } else { @@ -338,27 +338,27 @@ float VideoPlayer::get_volume_db() const { } }; -String VideoPlayer::get_stream_name() const { +String VideoStreamPlayer::get_stream_name() const { if (stream.is_null()) { return "<No Stream>"; } return stream->get_name(); }; -float VideoPlayer::get_stream_position() const { +float VideoStreamPlayer::get_stream_position() const { if (playback.is_null()) { return 0; } return playback->get_playback_position(); }; -void VideoPlayer::set_stream_position(float p_position) { +void VideoStreamPlayer::set_stream_position(float p_position) { if (playback.is_valid()) { playback->seek(p_position); } } -Ref<Texture2D> VideoPlayer::get_video_texture() const { +Ref<Texture2D> VideoStreamPlayer::get_video_texture() const { if (playback.is_valid()) { return playback->get_texture(); } @@ -366,22 +366,22 @@ Ref<Texture2D> VideoPlayer::get_video_texture() const { return Ref<Texture2D>(); } -void VideoPlayer::set_autoplay(bool p_enable) { +void VideoStreamPlayer::set_autoplay(bool p_enable) { autoplay = p_enable; }; -bool VideoPlayer::has_autoplay() const { +bool VideoStreamPlayer::has_autoplay() const { return autoplay; }; -void VideoPlayer::set_bus(const StringName &p_bus) { +void VideoStreamPlayer::set_bus(const StringName &p_bus) { //if audio is active, must lock this AudioServer::get_singleton()->lock(); bus = p_bus; AudioServer::get_singleton()->unlock(); } -StringName VideoPlayer::get_bus() const { +StringName VideoStreamPlayer::get_bus() const { for (int i = 0; i < AudioServer::get_singleton()->get_bus_count(); i++) { if (AudioServer::get_singleton()->get_bus_name(i) == bus) { return bus; @@ -390,7 +390,7 @@ StringName VideoPlayer::get_bus() const { return "Master"; } -void VideoPlayer::_validate_property(PropertyInfo &p_property) const { +void VideoStreamPlayer::_validate_property(PropertyInfo &p_property) const { if (p_property.name == "bus") { String options; for (int i = 0; i < AudioServer::get_singleton()->get_bus_count(); i++) { @@ -405,45 +405,45 @@ void VideoPlayer::_validate_property(PropertyInfo &p_property) const { } } -void VideoPlayer::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_stream", "stream"), &VideoPlayer::set_stream); - ClassDB::bind_method(D_METHOD("get_stream"), &VideoPlayer::get_stream); +void VideoStreamPlayer::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_stream", "stream"), &VideoStreamPlayer::set_stream); + ClassDB::bind_method(D_METHOD("get_stream"), &VideoStreamPlayer::get_stream); - ClassDB::bind_method(D_METHOD("play"), &VideoPlayer::play); - ClassDB::bind_method(D_METHOD("stop"), &VideoPlayer::stop); + ClassDB::bind_method(D_METHOD("play"), &VideoStreamPlayer::play); + ClassDB::bind_method(D_METHOD("stop"), &VideoStreamPlayer::stop); - ClassDB::bind_method(D_METHOD("is_playing"), &VideoPlayer::is_playing); + ClassDB::bind_method(D_METHOD("is_playing"), &VideoStreamPlayer::is_playing); - ClassDB::bind_method(D_METHOD("set_paused", "paused"), &VideoPlayer::set_paused); - ClassDB::bind_method(D_METHOD("is_paused"), &VideoPlayer::is_paused); + ClassDB::bind_method(D_METHOD("set_paused", "paused"), &VideoStreamPlayer::set_paused); + ClassDB::bind_method(D_METHOD("is_paused"), &VideoStreamPlayer::is_paused); - ClassDB::bind_method(D_METHOD("set_volume", "volume"), &VideoPlayer::set_volume); - ClassDB::bind_method(D_METHOD("get_volume"), &VideoPlayer::get_volume); + ClassDB::bind_method(D_METHOD("set_volume", "volume"), &VideoStreamPlayer::set_volume); + ClassDB::bind_method(D_METHOD("get_volume"), &VideoStreamPlayer::get_volume); - ClassDB::bind_method(D_METHOD("set_volume_db", "db"), &VideoPlayer::set_volume_db); - ClassDB::bind_method(D_METHOD("get_volume_db"), &VideoPlayer::get_volume_db); + ClassDB::bind_method(D_METHOD("set_volume_db", "db"), &VideoStreamPlayer::set_volume_db); + ClassDB::bind_method(D_METHOD("get_volume_db"), &VideoStreamPlayer::get_volume_db); - ClassDB::bind_method(D_METHOD("set_audio_track", "track"), &VideoPlayer::set_audio_track); - ClassDB::bind_method(D_METHOD("get_audio_track"), &VideoPlayer::get_audio_track); + ClassDB::bind_method(D_METHOD("set_audio_track", "track"), &VideoStreamPlayer::set_audio_track); + ClassDB::bind_method(D_METHOD("get_audio_track"), &VideoStreamPlayer::get_audio_track); - ClassDB::bind_method(D_METHOD("get_stream_name"), &VideoPlayer::get_stream_name); + ClassDB::bind_method(D_METHOD("get_stream_name"), &VideoStreamPlayer::get_stream_name); - ClassDB::bind_method(D_METHOD("set_stream_position", "position"), &VideoPlayer::set_stream_position); - ClassDB::bind_method(D_METHOD("get_stream_position"), &VideoPlayer::get_stream_position); + ClassDB::bind_method(D_METHOD("set_stream_position", "position"), &VideoStreamPlayer::set_stream_position); + ClassDB::bind_method(D_METHOD("get_stream_position"), &VideoStreamPlayer::get_stream_position); - ClassDB::bind_method(D_METHOD("set_autoplay", "enabled"), &VideoPlayer::set_autoplay); - ClassDB::bind_method(D_METHOD("has_autoplay"), &VideoPlayer::has_autoplay); + ClassDB::bind_method(D_METHOD("set_autoplay", "enabled"), &VideoStreamPlayer::set_autoplay); + ClassDB::bind_method(D_METHOD("has_autoplay"), &VideoStreamPlayer::has_autoplay); - ClassDB::bind_method(D_METHOD("set_expand", "enable"), &VideoPlayer::set_expand); - ClassDB::bind_method(D_METHOD("has_expand"), &VideoPlayer::has_expand); + ClassDB::bind_method(D_METHOD("set_expand", "enable"), &VideoStreamPlayer::set_expand); + ClassDB::bind_method(D_METHOD("has_expand"), &VideoStreamPlayer::has_expand); - ClassDB::bind_method(D_METHOD("set_buffering_msec", "msec"), &VideoPlayer::set_buffering_msec); - ClassDB::bind_method(D_METHOD("get_buffering_msec"), &VideoPlayer::get_buffering_msec); + ClassDB::bind_method(D_METHOD("set_buffering_msec", "msec"), &VideoStreamPlayer::set_buffering_msec); + ClassDB::bind_method(D_METHOD("get_buffering_msec"), &VideoStreamPlayer::get_buffering_msec); - ClassDB::bind_method(D_METHOD("set_bus", "bus"), &VideoPlayer::set_bus); - ClassDB::bind_method(D_METHOD("get_bus"), &VideoPlayer::get_bus); + ClassDB::bind_method(D_METHOD("set_bus", "bus"), &VideoStreamPlayer::set_bus); + ClassDB::bind_method(D_METHOD("get_bus"), &VideoStreamPlayer::get_bus); - ClassDB::bind_method(D_METHOD("get_video_texture"), &VideoPlayer::get_video_texture); + ClassDB::bind_method(D_METHOD("get_video_texture"), &VideoStreamPlayer::get_video_texture); ADD_SIGNAL(MethodInfo("finished")); @@ -461,9 +461,9 @@ void VideoPlayer::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "bus", PROPERTY_HINT_ENUM, ""), "set_bus", "get_bus"); } -VideoPlayer::VideoPlayer() {} +VideoStreamPlayer::VideoStreamPlayer() {} -VideoPlayer::~VideoPlayer() { +VideoStreamPlayer::~VideoStreamPlayer() { // if (stream_rid.is_valid()) // AudioServer::get_singleton()->free(stream_rid); resampler.clear(); //Not necessary here, but make in consistent with other "stream_player" classes diff --git a/scene/gui/video_player.h b/scene/gui/video_stream_player.h index 0edad296a1..ad4a3dd9e9 100644 --- a/scene/gui/video_player.h +++ b/scene/gui/video_stream_player.h @@ -1,5 +1,5 @@ /*************************************************************************/ -/* video_player.h */ +/* video_stream_player.h */ /*************************************************************************/ /* This file is part of: */ /* GODOT ENGINE */ @@ -28,16 +28,16 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef VIDEO_PLAYER_H -#define VIDEO_PLAYER_H +#ifndef VIDEO_STREAM_PLAYER_H +#define VIDEO_STREAM_PLAYER_H #include "scene/gui/control.h" #include "scene/resources/video_stream.h" #include "servers/audio/audio_rb_resampler.h" #include "servers/audio_server.h" -class VideoPlayer : public Control { - GDCLASS(VideoPlayer, Control); +class VideoStreamPlayer : public Control { + GDCLASS(VideoStreamPlayer, Control); struct Output { AudioFrame vol; @@ -119,8 +119,8 @@ public: void set_bus(const StringName &p_bus); StringName get_bus() const; - VideoPlayer(); - ~VideoPlayer(); + VideoStreamPlayer(); + ~VideoStreamPlayer(); }; -#endif // VIDEO_PLAYER_H +#endif // VIDEO_STREAM_PLAYER_H diff --git a/scene/main/canvas_item.cpp b/scene/main/canvas_item.cpp index 916833c9a7..2022a9a46e 100644 --- a/scene/main/canvas_item.cpp +++ b/scene/main/canvas_item.cpp @@ -274,9 +274,7 @@ void CanvasItem::_exit_canvas() { void CanvasItem::_notification(int p_what) { switch (p_what) { case NOTIFICATION_ENTER_TREE: { - _update_texture_filter_changed(false); - _update_texture_repeat_changed(false); - + ERR_FAIL_COND(!is_inside_tree()); first_draw = true; Node *parent = get_parent(); if (parent) { @@ -305,6 +303,10 @@ void CanvasItem::_notification(int p_what) { } } _enter_canvas(); + + _update_texture_filter_changed(false); + _update_texture_repeat_changed(false); + if (!block_transform_notify && !xform_change.in_list()) { get_tree()->xform_change_list.add(&xform_change); } @@ -647,16 +649,16 @@ void CanvasItem::draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Tex RenderingServer::get_singleton()->canvas_item_add_multimesh(canvas_item, p_multimesh->get_rid(), texture_rid); } -void CanvasItem::draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align, real_t p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { +void CanvasItem::draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment, real_t p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_font.is_null()); - p_font->draw_string(canvas_item, p_pos, p_text, p_align, p_width, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); + p_font->draw_string(canvas_item, p_pos, p_text, p_alignment, p_width, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); } -void CanvasItem::draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align, real_t p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { +void CanvasItem::draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment, real_t p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_font.is_null()); - p_font->draw_multiline_string(canvas_item, p_pos, p_text, p_align, p_width, p_max_lines, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); + p_font->draw_multiline_string(canvas_item, p_pos, p_text, p_alignment, p_width, p_max_lines, p_size, p_modulate, p_outline_size, p_outline_modulate, p_flags); } real_t CanvasItem::draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate) const { @@ -892,9 +894,9 @@ void CanvasItem::_bind_methods() { ClassDB::bind_method(D_METHOD("draw_primitive", "points", "colors", "uvs", "texture", "width"), &CanvasItem::draw_primitive, DEFVAL(Ref<Texture2D>()), DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_polygon", "points", "colors", "uvs", "texture"), &CanvasItem::draw_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); ClassDB::bind_method(D_METHOD("draw_colored_polygon", "points", "color", "uvs", "texture"), &CanvasItem::draw_colored_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); - ClassDB::bind_method(D_METHOD("draw_string", "font", "pos", "text", "align", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("draw_multiline_string", "font", "pos", "text", "align", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_multiline_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("draw_char", "font", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &CanvasItem::draw_char, DEFVAL(""), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); + ClassDB::bind_method(D_METHOD("draw_string", "font", "pos", "text", "alignment", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_string, DEFVAL(HORIZONTAL_ALIGNMENT_LEFT), DEFVAL(-1), DEFVAL(Font::DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_multiline_string", "font", "pos", "text", "alignment", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &CanvasItem::draw_multiline_string, DEFVAL(HORIZONTAL_ALIGNMENT_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(Font::DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_char", "font", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &CanvasItem::draw_char, DEFVAL(""), DEFVAL(Font::DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); ClassDB::bind_method(D_METHOD("draw_mesh", "mesh", "texture", "transform", "modulate"), &CanvasItem::draw_mesh, DEFVAL(Transform2D()), DEFVAL(Color(1, 1, 1, 1))); ClassDB::bind_method(D_METHOD("draw_multimesh", "multimesh", "texture"), &CanvasItem::draw_multimesh); ClassDB::bind_method(D_METHOD("draw_set_transform", "position", "rotation", "scale"), &CanvasItem::draw_set_transform, DEFVAL(0.0), DEFVAL(Size2(1.0, 1.0))); diff --git a/scene/main/canvas_item.h b/scene/main/canvas_item.h index ba9f47119d..26a7068e68 100644 --- a/scene/main/canvas_item.h +++ b/scene/main/canvas_item.h @@ -34,10 +34,10 @@ #include "scene/main/node.h" #include "scene/main/scene_tree.h" #include "scene/resources/canvas_item_material.h" +#include "scene/resources/font.h" #include "servers/text_server.h" class CanvasLayer; -class Font; class MultiMesh; class StyleBox; class Window; @@ -235,9 +235,9 @@ public: void draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1)); void draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture); - void draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, real_t p_width = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; - void draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, real_t p_width = -1, int p_max_lines = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; - real_t draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next = "", int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; + void draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment = HORIZONTAL_ALIGNMENT_LEFT, real_t p_width = -1, int p_size = Font::DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + void draw_multiline_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment = HORIZONTAL_ALIGNMENT_LEFT, real_t p_width = -1, int p_max_lines = -1, int p_size = Font::DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + real_t draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next = "", int p_size = Font::DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; void draw_set_transform(const Point2 &p_offset, real_t p_rot = 0.0, const Size2 &p_scale = Size2(1.0, 1.0)); void draw_set_transform_matrix(const Transform2D &p_matrix); diff --git a/scene/main/canvas_layer.cpp b/scene/main/canvas_layer.cpp index 4540e42b4c..cd7534f73c 100644 --- a/scene/main/canvas_layer.cpp +++ b/scene/main/canvas_layer.cpp @@ -128,7 +128,7 @@ void CanvasLayer::_notification(int p_what) { } else { vp = Node::get_viewport(); } - ERR_FAIL_COND(!vp); + ERR_FAIL_NULL_MSG(vp, "Viewport is not initialized."); vp->_canvas_layer_add(this); viewport = vp->get_viewport_rid(); @@ -140,6 +140,8 @@ void CanvasLayer::_notification(int p_what) { } break; case NOTIFICATION_EXIT_TREE: { + ERR_FAIL_NULL_MSG(vp, "Viewport is not initialized."); + vp->_canvas_layer_remove(this); RenderingServer::get_singleton()->viewport_remove_canvas(viewport, canvas); viewport = RID(); @@ -160,6 +162,8 @@ Size2 CanvasLayer::get_viewport_size() const { return Size2(1, 1); } + ERR_FAIL_NULL_V_MSG(vp, Size2(1, 1), "Viewport is not initialized."); + Rect2 r = vp->get_visible_rect(); return r.size; } @@ -169,7 +173,7 @@ RID CanvasLayer::get_viewport() const { } void CanvasLayer::set_custom_viewport(Node *p_viewport) { - ERR_FAIL_NULL(p_viewport); + ERR_FAIL_NULL_MSG(p_viewport, "Cannot set viewport to nullptr."); if (is_inside_tree()) { vp->_canvas_layer_remove(this); RenderingServer::get_singleton()->viewport_remove_canvas(viewport, canvas); @@ -252,7 +256,7 @@ void CanvasLayer::_update_follow_viewport(bool p_force_exit) { void CanvasLayer::_validate_property(PropertyInfo &property) const { if (!follow_viewport && property.name == "follow_viewport_scale") { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/main/http_request.cpp b/scene/main/http_request.cpp index a4fcc04e20..4797729871 100644 --- a/scene/main/http_request.cpp +++ b/scene/main/http_request.cpp @@ -243,7 +243,7 @@ bool HTTPRequest::_handle_response(bool *ret_value) { } } - if (new_request != "") { + if (!new_request.is_empty()) { // Process redirect client->close(); int new_redirs = redirections + 1; // Because _request() will clear it @@ -363,7 +363,7 @@ bool HTTPRequest::_update_connection() { return true; } - if (download_to_file != String()) { + if (!download_to_file.is_empty()) { file = FileAccess::open(download_to_file, FileAccess::WRITE); if (!file) { call_deferred(SNAME("_request_done"), RESULT_DOWNLOAD_FILE_CANT_OPEN, response_code, response_headers, PackedByteArray()); diff --git a/scene/main/node.cpp b/scene/main/node.cpp index 189aebb47d..87f77ed4bd 100644 --- a/scene/main/node.cpp +++ b/scene/main/node.cpp @@ -114,7 +114,7 @@ void Node::_notification(int p_notification) { get_multiplayer()->scene_enter_exit_notify(data.scene_file_path, this, false); } } break; - case NOTIFICATION_PATH_CHANGED: { + case NOTIFICATION_PATH_RENAMED: { if (data.path_cache) { memdelete(data.path_cache); data.path_cache = nullptr; @@ -332,7 +332,7 @@ void Node::_move_child(Node *p_child, int p_pos, bool p_ignore_end) { int motion_from = MIN(p_pos, p_child->data.pos); int motion_to = MAX(p_pos, p_child->data.pos); - data.children.remove(p_child->data.pos); + data.children.remove_at(p_child->data.pos); data.children.insert(p_pos, p_child); if (data.tree) { @@ -892,14 +892,14 @@ void Node::_set_name_nocheck(const StringName &p_name) { void Node::set_name(const String &p_name) { String name = p_name.validate_node_name(); - ERR_FAIL_COND(name == ""); + ERR_FAIL_COND(name.is_empty()); data.name = name; if (data.parent) { data.parent->_validate_child_name(this); } - propagate_notification(NOTIFICATION_PATH_CHANGED); + propagate_notification(NOTIFICATION_PATH_RENAMED); if (is_inside_tree()) { emit_signal(SNAME("renamed")); @@ -908,17 +908,12 @@ void Node::set_name(const String &p_name) { } } -static bool node_hrcr = false; static SafeRefCount node_hrcr_count; void Node::init_node_hrcr() { node_hrcr_count.init(1); } -void Node::set_human_readable_collision_renaming(bool p_enabled) { - node_hrcr = p_enabled; -} - #ifdef TOOLS_ENABLED String Node::validate_child_name(Node *p_child) { StringName name = p_child->data.name; @@ -930,9 +925,8 @@ String Node::validate_child_name(Node *p_child) { void Node::_validate_child_name(Node *p_child, bool p_force_human_readable) { /* Make sure the name is unique */ - if (node_hrcr || p_force_human_readable) { + if (p_force_human_readable) { //this approach to autoset node names is human readable but very slow - //it's turned on while running in the editor StringName name = p_child->data.name; _generate_serial_child_name(p_child, name); @@ -1214,7 +1208,7 @@ void Node::remove_child(Node *p_child) { remove_child_notify(p_child); p_child->notification(NOTIFICATION_UNPARENTED); - data.children.remove(idx); + data.children.remove_at(idx); //update pointer and size child_count = data.children.size(); @@ -1899,6 +1893,56 @@ Node *Node::get_deepest_editable_node(Node *p_start_node) const { return node; } +#ifdef TOOLS_ENABLED +void Node::set_property_pinned(const String &p_property, bool p_pinned) { + bool current_pinned = false; + bool has_pinned = has_meta("_edit_pinned_properties_"); + Array pinned; + String psa = get_property_store_alias(p_property); + if (has_pinned) { + pinned = get_meta("_edit_pinned_properties_"); + current_pinned = pinned.has(psa); + } + + if (current_pinned != p_pinned) { + if (p_pinned) { + pinned.append(psa); + if (!has_pinned) { + set_meta("_edit_pinned_properties_", pinned); + } + } else { + pinned.erase(psa); + if (pinned.is_empty()) { + remove_meta("_edit_pinned_properties_"); + } + } + } +} + +bool Node::is_property_pinned(const StringName &p_property) const { + if (!has_meta("_edit_pinned_properties_")) { + return false; + } + Array pinned = get_meta("_edit_pinned_properties_"); + String psa = get_property_store_alias(p_property); + return pinned.has(psa); +} + +StringName Node::get_property_store_alias(const StringName &p_property) const { + return p_property; +} +#endif + +void Node::get_storable_properties(Set<StringName> &r_storable_properties) const { + List<PropertyInfo> pi; + get_property_list(&pi); + for (List<PropertyInfo>::Element *E = pi.front(); E; E = E->next()) { + if ((E->get().usage & PROPERTY_USAGE_STORAGE)) { + r_storable_properties.insert(E->get().name); + } + } +} + String Node::to_string() { if (get_script_instance()) { bool valid; @@ -1946,7 +1990,7 @@ Node *Node::_duplicate(int p_flags, Map<const Node *, Node *> *r_duplimap) const nip->set_instance_path(ip->get_instance_path()); node = nip; - } else if ((p_flags & DUPLICATE_USE_INSTANCING) && get_scene_file_path() != String()) { + } else if ((p_flags & DUPLICATE_USE_INSTANCING) && !get_scene_file_path().is_empty()) { Ref<PackedScene> res = ResourceLoader::load(get_scene_file_path()); ERR_FAIL_COND_V(res.is_null(), nullptr); PackedScene::GenEditState ges = PackedScene::GEN_EDIT_STATE_DISABLED; @@ -1970,7 +2014,7 @@ Node *Node::_duplicate(int p_flags, Map<const Node *, Node *> *r_duplimap) const ERR_FAIL_COND_V(!node, nullptr); } - if (get_scene_file_path() != "") { //an instance + if (!get_scene_file_path().is_empty()) { //an instance node->set_scene_file_path(get_scene_file_path()); node->data.editable_instance = data.editable_instance; } @@ -2002,7 +2046,7 @@ Node *Node::_duplicate(int p_flags, Map<const Node *, Node *> *r_duplimap) const node_tree.push_back(descendant); - if (descendant->get_scene_file_path() != "" && instance_roots.has(descendant->get_owner())) { + if (!descendant->get_scene_file_path().is_empty() && instance_roots.has(descendant->get_owner())) { instance_roots.push_back(descendant); } } @@ -2750,7 +2794,11 @@ void Node::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_import_path", "import_path"), &Node::set_import_path); ClassDB::bind_method(D_METHOD("_get_import_path"), &Node::get_import_path); - ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "_import_path", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_import_path", "_get_import_path"); +#ifdef TOOLS_ENABLED + ClassDB::bind_method(D_METHOD("_set_property_pinned", "property", "pinned"), &Node::set_property_pinned); +#endif + + ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "_import_path", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_import_path", "_get_import_path"); { MethodInfo mi; @@ -2781,7 +2829,7 @@ void Node::_bind_methods() { BIND_CONSTANT(NOTIFICATION_INSTANCED); BIND_CONSTANT(NOTIFICATION_DRAG_BEGIN); BIND_CONSTANT(NOTIFICATION_DRAG_END); - BIND_CONSTANT(NOTIFICATION_PATH_CHANGED); + BIND_CONSTANT(NOTIFICATION_PATH_RENAMED); BIND_CONSTANT(NOTIFICATION_INTERNAL_PROCESS); BIND_CONSTANT(NOTIFICATION_INTERNAL_PHYSICS_PROCESS); BIND_CONSTANT(NOTIFICATION_POST_ENTER_TREE); @@ -2841,7 +2889,7 @@ void Node::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "process_priority"), "set_process_priority", "get_process_priority"); ADD_GROUP("Editor Description", "editor_"); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "editor_description", PROPERTY_HINT_MULTILINE_TEXT, "", PROPERTY_USAGE_EDITOR | PROPERTY_USAGE_INTERNAL), "set_editor_description", "get_editor_description"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "editor_description", PROPERTY_HINT_MULTILINE_TEXT), "set_editor_description", "get_editor_description"); GDVIRTUAL_BIND(_process, "delta"); GDVIRTUAL_BIND(_physics_process, "delta"); diff --git a/scene/main/node.h b/scene/main/node.h index e59a7a390a..dc74a33580 100644 --- a/scene/main/node.h +++ b/scene/main/node.h @@ -256,7 +256,7 @@ public: NOTIFICATION_INSTANCED = 20, NOTIFICATION_DRAG_BEGIN = 21, NOTIFICATION_DRAG_END = 22, - NOTIFICATION_PATH_CHANGED = 23, + NOTIFICATION_PATH_RENAMED = 23, //NOTIFICATION_TRANSLATION_CHANGED = 24, moved below NOTIFICATION_INTERNAL_PROCESS = 25, NOTIFICATION_INTERNAL_PHYSICS_PROCESS = 26, @@ -363,6 +363,13 @@ public: bool is_editable_instance(const Node *p_node) const; Node *get_deepest_editable_node(Node *p_start_node) const; +#ifdef TOOLS_ENABLED + void set_property_pinned(const String &p_property, bool p_pinned); + bool is_property_pinned(const StringName &p_property) const; + virtual StringName get_property_store_alias(const StringName &p_property) const; +#endif + void get_storable_properties(Set<StringName> &r_storable_properties) const; + virtual String to_string() override; /* NOTIFICATIONS */ @@ -437,7 +444,6 @@ public: void queue_delete(); //hacks for speed - static void set_human_readable_collision_renaming(bool p_enabled); static void init_node_hrcr(); void force_parent_owned() { data.parent_owned = true; } //hack to avoid duplicate nodes diff --git a/scene/main/resource_preloader.cpp b/scene/main/resource_preloader.cpp index f4c90ee668..c44b55284d 100644 --- a/scene/main/resource_preloader.cpp +++ b/scene/main/resource_preloader.cpp @@ -147,7 +147,7 @@ void ResourcePreloader::_bind_methods() { ClassDB::bind_method(D_METHOD("get_resource", "name"), &ResourcePreloader::get_resource); ClassDB::bind_method(D_METHOD("get_resource_list"), &ResourcePreloader::_get_resource_list); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "resources", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_resources", "_get_resources"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "resources", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_resources", "_get_resources"); } ResourcePreloader::ResourcePreloader() { diff --git a/scene/main/scene_tree.cpp b/scene/main/scene_tree.cpp index a122241cd0..2af8024fe4 100644 --- a/scene/main/scene_tree.cpp +++ b/scene/main/scene_tree.cpp @@ -510,7 +510,7 @@ bool SceneTree::process(double p_time) { cpath = fallback->get_path(); } if (cpath != env_path) { - if (env_path != String()) { + if (!env_path.is_empty()) { fallback = ResourceLoader::load(env_path); if (fallback.is_null()) { //could not load fallback, set as empty @@ -1290,7 +1290,7 @@ void SceneTree::get_argument_options(const StringName &p_function, int p_idx, Li dir_access->list_dir_begin(); String filename = dir_access->get_next(); - while (filename != "") { + while (!filename.is_empty()) { if (filename == "." || filename == "..") { filename = dir_access->get_next(); continue; @@ -1400,7 +1400,7 @@ SceneTree::SceneTree() { ResourceLoader::get_recognized_extensions_for_type("Environment", &exts); String ext_hint; for (const String &E : exts) { - if (ext_hint != String()) { + if (!ext_hint.is_empty()) { ext_hint += ","; } ext_hint += "*." + E; @@ -1410,7 +1410,7 @@ SceneTree::SceneTree() { // Setup property. ProjectSettings::get_singleton()->set_custom_property_info("rendering/environment/defaults/default_environment", PropertyInfo(Variant::STRING, "rendering/viewport/default_environment", PROPERTY_HINT_FILE, ext_hint)); env_path = env_path.strip_edges(); - if (env_path != String()) { + if (!env_path.is_empty()) { Ref<Environment> env = ResourceLoader::load(env_path); if (env.is_valid()) { root->get_world_3d()->set_fallback_environment(env); diff --git a/scene/main/scene_tree.h b/scene/main/scene_tree.h index 19331c1906..7a4f9f9c52 100644 --- a/scene/main/scene_tree.h +++ b/scene/main/scene_tree.h @@ -136,7 +136,6 @@ private: void _flush_ugc(); _FORCE_INLINE_ void _update_group_order(Group &g, bool p_use_priority = false); - void _update_listener(); Array _get_nodes_in_group(const StringName &p_group); @@ -265,9 +264,6 @@ public: void set_pause(bool p_enabled); bool is_paused() const; - void set_camera(const RID &p_camera); - RID get_camera() const; - #ifdef DEBUG_ENABLED void set_debug_collisions_hint(bool p_enabled); bool is_debugging_collisions_hint() const; diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp index 0e62e6e30a..af4032a77d 100644 --- a/scene/main/viewport.cpp +++ b/scene/main/viewport.cpp @@ -55,6 +55,7 @@ #include "scene/resources/world_2d.h" #include "scene/scene_string_names.h" #include "servers/audio_server.h" +#include "servers/rendering/rendering_server_globals.h" void ViewportTexture::setup_local_to_scene() { Node *local_scene = get_local_scene(); @@ -290,7 +291,7 @@ void Viewport::_sub_window_grab_focus(Window *p_window) { if (p_window->get_flag(Window::FLAG_NO_FOCUS)) { // Can only move to foreground, but no focus granted. SubWindow sw = gui.sub_windows[index]; - gui.sub_windows.remove(index); + gui.sub_windows.remove_at(index); gui.sub_windows.push_back(sw); index = gui.sub_windows.size() - 1; _sub_window_update_order(); @@ -318,7 +319,7 @@ void Viewport::_sub_window_grab_focus(Window *p_window) { { // Move to foreground. SubWindow sw = gui.sub_windows[index]; - gui.sub_windows.remove(index); + gui.sub_windows.remove_at(index); gui.sub_windows.push_back(sw); index = gui.sub_windows.size() - 1; _sub_window_update_order(); @@ -335,7 +336,7 @@ void Viewport::_sub_window_remove(Window *p_window) { for (int i = 0; i < gui.sub_windows.size(); i++) { if (gui.sub_windows[i].window == p_window) { RS::get_singleton()->free(gui.sub_windows[i].canvas_item); - gui.sub_windows.remove(i); + gui.sub_windows.remove_at(i); break; } } @@ -395,14 +396,15 @@ void Viewport::_notification(int p_what) { #ifndef _3D_DISABLED PhysicsServer3D::get_singleton()->space_set_debug_contacts(find_world_3d()->get_space(), get_tree()->get_collision_debug_contact_count()); contact_3d_debug_multimesh = RenderingServer::get_singleton()->multimesh_create(); - RenderingServer::get_singleton()->multimesh_allocate_data(contact_3d_debug_multimesh, get_tree()->get_collision_debug_contact_count(), RS::MULTIMESH_TRANSFORM_3D, true); + RenderingServer::get_singleton()->multimesh_allocate_data(contact_3d_debug_multimesh, get_tree()->get_collision_debug_contact_count(), RS::MULTIMESH_TRANSFORM_3D, false); RenderingServer::get_singleton()->multimesh_set_visible_instances(contact_3d_debug_multimesh, 0); RenderingServer::get_singleton()->multimesh_set_mesh(contact_3d_debug_multimesh, get_tree()->get_debug_contact_mesh()->get_rid()); contact_3d_debug_instance = RenderingServer::get_singleton()->instance_create(); RenderingServer::get_singleton()->instance_set_base(contact_3d_debug_instance, contact_3d_debug_multimesh); RenderingServer::get_singleton()->instance_set_scenario(contact_3d_debug_instance, find_world_3d()->get_scenario()); - //RenderingServer::get_singleton()->instance_geometry_set_flag(contact_3d_debug_instance, RS::INSTANCE_FLAG_VISIBLE_IN_ALL_ROOMS, true); + RenderingServer::get_singleton()->instance_geometry_set_flag(contact_3d_debug_instance, RS::INSTANCE_FLAG_DRAW_NEXT_FRAME_IF_VISIBLE, true); #endif // _3D_DISABLED + set_physics_process_internal(true); } } break; @@ -584,9 +586,9 @@ void Viewport::_process_picking() { physics_last_mouse_state.meta = mb->is_meta_pressed(); if (mb->is_pressed()) { - physics_last_mouse_state.mouse_mask |= (MouseButton)(1 << (mb->get_button_index() - 1)); + physics_last_mouse_state.mouse_mask |= mouse_button_to_mask(mb->get_button_index()); } else { - physics_last_mouse_state.mouse_mask &= (MouseButton) ~(1 << (mb->get_button_index() - 1)); + physics_last_mouse_state.mouse_mask &= ~mouse_button_to_mask(mb->get_button_index()); // If touch mouse raised, assume we don't know last mouse pos until new events come if (mb->get_device() == InputEvent::DEVICE_ID_TOUCH_MOUSE) { @@ -638,7 +640,13 @@ void Viewport::_process_picking() { Vector2 point = canvas_transform.affine_inverse().xform(pos); - int rc = ss2d->intersect_point_on_canvas(point, canvas_layer_id, res, 64, Set<RID>(), 0xFFFFFFFF, true, true, true); + PhysicsDirectSpaceState2D::PointParameters point_params; + point_params.position = point; + point_params.canvas_instance_id = canvas_layer_id; + point_params.collide_with_areas = true; + point_params.pick_point = true; + + int rc = ss2d->intersect_point(point_params, res, 64); for (int i = 0; i < rc; i++) { if (res[i].collider_id.is_valid() && res[i].collider) { CollisionObject2D *co = Object::cast_to<CollisionObject2D>(res[i].collider); @@ -690,7 +698,7 @@ void Viewport::_process_picking() { if (co && camera_3d) { _collision_object_3d_input_event(co, camera_3d, ev, Vector3(), Vector3(), 0); captured = true; - if (mb.is_valid() && mb->get_button_index() == 1 && !mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && !mb->is_pressed()) { physics_object_capture = ObjectID(); } @@ -706,7 +714,7 @@ void Viewport::_process_picking() { if (ObjectDB::get_instance(last_id) && last_object) { // Good, exists. _collision_object_3d_input_event(last_object, camera_3d, ev, result.position, result.normal, result.shape); - if (last_object->get_capture_input_on_drag() && mb.is_valid() && mb->get_button_index() == 1 && mb->is_pressed()) { + if (last_object->get_capture_input_on_drag() && mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_pressed()) { physics_object_capture = last_id; } } @@ -715,10 +723,17 @@ void Viewport::_process_picking() { if (camera_3d) { Vector3 from = camera_3d->project_ray_origin(pos); Vector3 dir = camera_3d->project_ray_normal(pos); + real_t far = camera_3d->far; PhysicsDirectSpaceState3D *space = PhysicsServer3D::get_singleton()->space_get_direct_state(find_world_3d()->get_space()); if (space) { - bool col = space->intersect_ray(from, from + dir * 10000, result, Set<RID>(), 0xFFFFFFFF, true, true, true); + PhysicsDirectSpaceState3D::RayParameters ray_params; + ray_params.from = from; + ray_params.to = from + dir * far; + ray_params.collide_with_areas = true; + ray_params.pick_ray = true; + + bool col = space->intersect_ray(ray_params, result); ObjectID new_collider; if (col) { CollisionObject3D *co = Object::cast_to<CollisionObject3D>(result.collider); @@ -727,7 +742,7 @@ void Viewport::_process_picking() { last_object = co; last_id = result.collider_id; new_collider = last_id; - if (co->get_capture_input_on_drag() && mb.is_valid() && mb->get_button_index() == 1 && mb->is_pressed()) { + if (co->get_capture_input_on_drag() && mb.is_valid() && mb->get_button_index() == MouseButton::LEFT && mb->is_pressed()) { physics_object_capture = last_id; } } @@ -1168,7 +1183,7 @@ void Viewport::_gui_show_tooltip() { Control *tooltip_owner = nullptr; String tooltip_text = _gui_get_tooltip( gui.tooltip_control, - gui.tooltip_control->get_global_transform().xform_inv(gui.last_mouse_pos), + gui.tooltip_control->get_screen_transform().xform_inv(gui.last_mouse_pos), &tooltip_owner); tooltip_text = tooltip_text.strip_edges(); if (tooltip_text.is_empty()) { @@ -1246,10 +1261,10 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu Ref<InputEventMouseButton> mb = p_input; bool cant_stop_me_now = (mb.is_valid() && - (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN || - mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP || - mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT || - mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT)); + (mb->get_button_index() == MouseButton::WHEEL_DOWN || + mb->get_button_index() == MouseButton::WHEEL_UP || + mb->get_button_index() == MouseButton::WHEEL_LEFT || + mb->get_button_index() == MouseButton::WHEEL_RIGHT)); Ref<InputEventPanGesture> pn = p_input; cant_stop_me_now = pn.is_valid() || cant_stop_me_now; @@ -1432,21 +1447,21 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { gui.last_mouse_pos = mpos; if (mb->is_pressed()) { Size2 pos = mpos; - if (gui.mouse_focus_mask) { + if (gui.mouse_focus_mask != MouseButton::NONE) { // Do not steal mouse focus and stuff while a focus mask exists. - gui.mouse_focus_mask |= 1 << (mb->get_button_index() - 1); // Add the button to the mask. + gui.mouse_focus_mask |= mouse_button_to_mask(mb->get_button_index()); } else { gui.mouse_focus = gui_find_control(pos); gui.last_mouse_focus = gui.mouse_focus; if (!gui.mouse_focus) { - gui.mouse_focus_mask = 0; + gui.mouse_focus_mask = MouseButton::NONE; return; } - gui.mouse_focus_mask = 1 << (mb->get_button_index() - 1); + gui.mouse_focus_mask = mouse_button_to_mask(mb->get_button_index()); - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb->get_button_index() == MouseButton::LEFT) { gui.drag_accum = Vector2(); gui.drag_attempted = false; } @@ -1469,7 +1484,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } #endif - if (mb->get_button_index() == MOUSE_BUTTON_LEFT) { // Assign focus. + if (mb->get_button_index() == MouseButton::LEFT) { // Assign focus. CanvasItem *ci = gui.mouse_focus; while (ci) { Control *control = Object::cast_to<Control>(ci); @@ -1500,10 +1515,11 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { set_input_as_handled(); - if (gui.drag_data.get_type() != Variant::NIL && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (gui.drag_data.get_type() != Variant::NIL && mb->get_button_index() == MouseButton::LEFT) { // Alternate drop use (when using force_drag(), as proposed by #5342). + gui.drag_successful = false; if (gui.mouse_focus) { - _gui_drop(gui.mouse_focus, pos, false); + gui.drag_successful = _gui_drop(gui.mouse_focus, pos, false); } gui.drag_data = Variant(); @@ -1520,9 +1536,10 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { _gui_cancel_tooltip(); } else { - if (gui.drag_data.get_type() != Variant::NIL && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (gui.drag_data.get_type() != Variant::NIL && mb->get_button_index() == MouseButton::LEFT) { + gui.drag_successful = false; if (gui.drag_mouse_over) { - _gui_drop(gui.drag_mouse_over, gui.drag_mouse_over_pos, false); + gui.drag_successful = _gui_drop(gui.drag_mouse_over, gui.drag_mouse_over_pos, false); } Control *drag_preview = _gui_get_drag_preview(); @@ -1538,7 +1555,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { // Change mouse accordingly. } - gui.mouse_focus_mask &= ~(1 << (mb->get_button_index() - 1)); // Remove from mask. + gui.mouse_focus_mask &= ~mouse_button_to_mask(mb->get_button_index()); // Remove from mask. if (!gui.mouse_focus) { // Release event is only sent if a mouse focus (previously pressed button) exists. @@ -1557,7 +1574,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { // Disable mouse focus if needed before calling input, // this makes popups on mouse press event work better, // as the release will never be received otherwise. - if (gui.mouse_focus_mask == 0) { + if (gui.mouse_focus_mask == MouseButton::NONE) { gui.mouse_focus = nullptr; gui.forced_mouse_focus = false; } @@ -1577,7 +1594,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { over = gui_find_control(mpos); } - if (gui.mouse_focus_mask == 0 && over != gui.mouse_over) { + if (gui.mouse_focus_mask == MouseButton::NONE && over != gui.mouse_over) { if (gui.mouse_over) { _gui_call_notification(gui.mouse_over, Control::NOTIFICATION_MOUSE_EXIT); } @@ -1605,7 +1622,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { Control *over = nullptr; // Drag & drop. - if (!gui.drag_attempted && gui.mouse_focus && mm->get_button_mask() & MOUSE_BUTTON_MASK_LEFT) { + if (!gui.drag_attempted && gui.mouse_focus && (mm->get_button_mask() & MouseButton::MASK_LEFT) != MouseButton::NONE) { gui.drag_accum += mm->get_relative(); float len = gui.drag_accum.length(); if (len > 10) { @@ -1619,7 +1636,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { if (gui.drag_data.get_type() != Variant::NIL) { gui.mouse_focus = nullptr; gui.forced_mouse_focus = false; - gui.mouse_focus_mask = 0; + gui.mouse_focus_mask = MouseButton::NONE; break; } else { Control *drag_preview = _gui_get_drag_preview(); @@ -1688,16 +1705,14 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { mm->set_speed(speed); mm->set_relative(rel); - if (mm->get_button_mask() == 0) { + if (mm->get_button_mask() == MouseButton::NONE) { // Nothing pressed. - bool can_tooltip = true; - bool is_tooltip_shown = false; if (gui.tooltip_popup) { - if (can_tooltip && gui.tooltip_control) { - String tooltip = _gui_get_tooltip(over, gui.tooltip_control->get_global_transform().xform_inv(mpos)); + if (gui.tooltip_control) { + String tooltip = _gui_get_tooltip(over, gui.tooltip_control->get_screen_transform().xform_inv(mpos)); if (tooltip.length() == 0) { _gui_cancel_tooltip(); @@ -1721,7 +1736,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { } } - if (can_tooltip && !is_tooltip_shown) { + if (!is_tooltip_shown && over->can_process()) { if (gui.tooltip_timer.is_valid()) { gui.tooltip_timer->release_connections(); gui.tooltip_timer = Ref<SceneTreeTimer>(); @@ -1741,7 +1756,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { Control *c = over; Vector2 cpos = pos; while (c) { - if (gui.mouse_focus_mask != 0 || c->has_point(cpos)) { + if (gui.mouse_focus_mask != MouseButton::NONE || c->has_point(cpos)) { cursor_shape = c->get_cursor_shape(cpos); } else { cursor_shape = Control::CURSOR_ARROW; @@ -1854,14 +1869,12 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) { Transform2D localizer = gui.drag_mouse_over->get_global_transform_with_canvas().affine_inverse(); gui.drag_mouse_over_pos = localizer.xform(viewport_pos); - if (mm->get_button_mask() & MOUSE_BUTTON_MASK_LEFT) { - bool can_drop = _gui_drop(gui.drag_mouse_over, gui.drag_mouse_over_pos, true); + bool can_drop = _gui_drop(gui.drag_mouse_over, gui.drag_mouse_over_pos, true); - if (!can_drop) { - ds_cursor_shape = DisplayServer::CURSOR_FORBIDDEN; - } else { - ds_cursor_shape = DisplayServer::CURSOR_CAN_DROP; - } + if (!can_drop) { + ds_cursor_shape = DisplayServer::CURSOR_FORBIDDEN; + } else { + ds_cursor_shape = DisplayServer::CURSOR_CAN_DROP; } } @@ -2029,6 +2042,7 @@ void Viewport::_gui_force_drag(Control *p_base, const Variant &p_data, Control * if (p_control) { _gui_set_drag_preview(p_base, p_control); } + _propagate_viewport_notification(this, NOTIFICATION_DRAG_BEGIN); } void Viewport::_gui_set_drag_preview(Control *p_base, Control *p_control) { @@ -2095,7 +2109,7 @@ void Viewport::_gui_remove_control(Control *p_control) { if (gui.mouse_focus == p_control) { gui.mouse_focus = nullptr; gui.forced_mouse_focus = false; - gui.mouse_focus_mask = 0; + gui.mouse_focus_mask = MouseButton::NONE; } if (gui.last_mouse_focus == p_control) { gui.last_mouse_focus = nullptr; @@ -2165,13 +2179,13 @@ void Viewport::_gui_accept_event() { void Viewport::_drop_mouse_focus() { Control *c = gui.mouse_focus; - int mask = gui.mouse_focus_mask; + MouseButton mask = gui.mouse_focus_mask; gui.mouse_focus = nullptr; gui.forced_mouse_focus = false; - gui.mouse_focus_mask = 0; + gui.mouse_focus_mask = MouseButton::NONE; for (int i = 0; i < 3; i++) { - if (mask & (1 << i)) { + if ((int)mask & (1 << i)) { Ref<InputEventMouseButton> mb; mb.instantiate(); mb->set_position(c->get_local_mouse_position()); @@ -2192,7 +2206,10 @@ void Viewport::_drop_physics_mouseover(bool p_paused_only) { if (physics_object_over.is_valid()) { CollisionObject3D *co = Object::cast_to<CollisionObject3D>(ObjectDB::get_instance(physics_object_over)); if (co) { - if (!(p_paused_only && co->can_process())) { + if (!co->is_inside_tree()) { + physics_object_over = ObjectID(); + physics_object_capture = ObjectID(); + } else if (!(p_paused_only && co->can_process())) { co->_mouse_exit(); physics_object_over = ObjectID(); physics_object_capture = ObjectID(); @@ -2213,7 +2230,7 @@ void Viewport::_cleanup_mouseover_colliders(bool p_clean_all_frames, bool p_paus Object *o = ObjectDB::get_instance(E->key()); if (o) { CollisionObject2D *co = Object::cast_to<CollisionObject2D>(o); - if (co) { + if (co && co->is_inside_tree()) { if (p_clean_all_frames && p_paused_only && co->can_process()) { continue; } @@ -2239,7 +2256,7 @@ void Viewport::_cleanup_mouseover_colliders(bool p_clean_all_frames, bool p_paus Object *o = ObjectDB::get_instance(E->key().first); if (o) { CollisionObject2D *co = Object::cast_to<CollisionObject2D>(o); - if (co) { + if (co && co->is_inside_tree()) { if (p_clean_all_frames && p_paused_only && co->can_process()) { continue; } @@ -2277,11 +2294,11 @@ void Viewport::_post_gui_grab_click_focus() { return; } - int mask = gui.mouse_focus_mask; + MouseButton mask = gui.mouse_focus_mask; Point2 click = gui.mouse_focus->get_global_transform_with_canvas().affine_inverse().xform(gui.last_mouse_pos); for (int i = 0; i < 3; i++) { - if (mask & (1 << i)) { + if ((int)mask & (1 << i)) { Ref<InputEventMouseButton> mb; mb.instantiate(); @@ -2299,7 +2316,7 @@ void Viewport::_post_gui_grab_click_focus() { click = gui.mouse_focus->get_global_transform_with_canvas().affine_inverse().xform(gui.last_mouse_pos); for (int i = 0; i < 3; i++) { - if (mask & (1 << i)) { + if ((int)mask & (1 << i)) { Ref<InputEventMouseButton> mb; mb.instantiate(); @@ -2396,7 +2413,7 @@ bool Viewport::_sub_windows_forward_input(const Ref<InputEvent> &p_event) { ERR_FAIL_COND_V(gui.subwindow_focused == nullptr, false); Ref<InputEventMouseButton> mb = p_event; - if (mb.is_valid() && !mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && !mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { if (gui.subwindow_drag == SUB_WINDOW_DRAG_CLOSE) { if (gui.subwindow_drag_close_rect.has_point(mb->get_position())) { // Close window. @@ -2521,7 +2538,7 @@ bool Viewport::_sub_windows_forward_input(const Ref<InputEvent> &p_event) { Ref<InputEventMouseButton> mb = p_event; // If the event is a mouse button, we need to check whether another window was clicked. - if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MOUSE_BUTTON_LEFT) { + if (mb.is_valid() && mb->is_pressed() && mb->get_button_index() == MouseButton::LEFT) { bool click_on_window = false; for (int i = gui.sub_windows.size() - 1; i >= 0; i--) { SubWindow &sw = gui.sub_windows.write[i]; @@ -2879,6 +2896,10 @@ bool Viewport::gui_is_dragging() const { return gui.dragging; } +bool Viewport::gui_is_drag_successful() const { + return gui.drag_successful; +} + void Viewport::set_input_as_handled() { _drop_physics_mouseover(); @@ -3025,7 +3046,7 @@ void Viewport::pass_mouse_focus_to(Viewport *p_viewport, Control *p_control) { gui.mouse_focus = nullptr; gui.forced_mouse_focus = false; - gui.mouse_focus_mask = 0; + gui.mouse_focus_mask = MouseButton::NONE; } } @@ -3451,17 +3472,60 @@ bool Viewport::is_using_xr() { return use_xr; } -void Viewport::set_scale_3d(float p_scale_3d) { +void Viewport::set_scaling_3d_mode(Scaling3DMode p_scaling_3d_mode) { + if (scaling_3d_mode == p_scaling_3d_mode) { + return; + } + + scaling_3d_mode = p_scaling_3d_mode; + RS::get_singleton()->viewport_set_scaling_3d_mode(viewport, (RS::ViewportScaling3DMode)(int)p_scaling_3d_mode); +} + +Viewport::Scaling3DMode Viewport::get_scaling_3d_mode() const { + return scaling_3d_mode; +} + +void Viewport::set_scaling_3d_scale(float p_scaling_3d_scale) { // Clamp to reasonable values that are actually useful. // Values above 2.0 don't serve a practical purpose since the viewport // isn't displayed with mipmaps. - scale_3d = CLAMP(p_scale_3d, 0.1, 2.0); + scaling_3d_scale = CLAMP(p_scaling_3d_scale, 0.1, 2.0); + + RS::get_singleton()->viewport_set_scaling_3d_scale(viewport, scaling_3d_scale); +} + +float Viewport::get_scaling_3d_scale() const { + return scaling_3d_scale; +} - RS::get_singleton()->viewport_set_scale_3d(viewport, scale_3d); +void Viewport::set_fsr_sharpness(float p_fsr_sharpness) { + if (fsr_sharpness == p_fsr_sharpness) { + return; + } + + if (p_fsr_sharpness < 0.0f) { + p_fsr_sharpness = 0.0f; + } + + fsr_sharpness = p_fsr_sharpness; + RS::get_singleton()->viewport_set_fsr_sharpness(viewport, p_fsr_sharpness); } -float Viewport::get_scale_3d() const { - return scale_3d; +float Viewport::get_fsr_sharpness() const { + return fsr_sharpness; +} + +void Viewport::set_fsr_mipmap_bias(float p_fsr_mipmap_bias) { + if (fsr_mipmap_bias == p_fsr_mipmap_bias) { + return; + } + + fsr_mipmap_bias = p_fsr_mipmap_bias; + RS::get_singleton()->viewport_set_fsr_mipmap_bias(viewport, p_fsr_mipmap_bias); +} + +float Viewport::get_fsr_mipmap_bias() const { + return fsr_mipmap_bias; } #endif // _3D_DISABLED @@ -3518,6 +3582,7 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("gui_get_drag_data"), &Viewport::gui_get_drag_data); ClassDB::bind_method(D_METHOD("gui_is_dragging"), &Viewport::gui_is_dragging); + ClassDB::bind_method(D_METHOD("gui_is_drag_successful"), &Viewport::gui_is_drag_successful); ClassDB::bind_method(D_METHOD("set_disable_input", "disable"), &Viewport::set_disable_input); ClassDB::bind_method(D_METHOD("is_input_disabled"), &Viewport::is_input_disabled); @@ -3588,12 +3653,20 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_use_xr", "use"), &Viewport::set_use_xr); ClassDB::bind_method(D_METHOD("is_using_xr"), &Viewport::is_using_xr); - ClassDB::bind_method(D_METHOD("set_scale_3d", "scale"), &Viewport::set_scale_3d); - ClassDB::bind_method(D_METHOD("get_scale_3d"), &Viewport::get_scale_3d); + ClassDB::bind_method(D_METHOD("set_scaling_3d_mode", "scaling_3d_mode"), &Viewport::set_scaling_3d_mode); + ClassDB::bind_method(D_METHOD("get_scaling_3d_mode"), &Viewport::get_scaling_3d_mode); + + ClassDB::bind_method(D_METHOD("set_scaling_3d_scale", "scale"), &Viewport::set_scaling_3d_scale); + ClassDB::bind_method(D_METHOD("get_scaling_3d_scale"), &Viewport::get_scaling_3d_scale); + + ClassDB::bind_method(D_METHOD("set_fsr_sharpness", "fsr_sharpness"), &Viewport::set_fsr_sharpness); + ClassDB::bind_method(D_METHOD("get_fsr_sharpness"), &Viewport::get_fsr_sharpness); + + ClassDB::bind_method(D_METHOD("set_fsr_mipmap_bias", "fsr_mipmap_bias"), &Viewport::set_fsr_mipmap_bias); + ClassDB::bind_method(D_METHOD("get_fsr_mipmap_bias"), &Viewport::get_fsr_mipmap_bias); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "disable_3d"), "set_disable_3d", "is_3d_disabled"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_xr"), "set_use_xr", "is_using_xr"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "scale_3d", PROPERTY_HINT_RANGE, "0.25,2.0,0.01"), "set_scale_3d", "get_scale_3d"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "audio_listener_enable_3d"), "set_as_audio_listener_3d", "is_audio_listener_3d"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "own_world_3d"), "set_use_own_world_3d", "is_using_own_world_3d"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "world_3d", PROPERTY_HINT_RESOURCE_TYPE, "World3D"), "set_world_3d", "get_world_3d"); @@ -3610,6 +3683,13 @@ void Viewport::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_occlusion_culling"), "set_use_occlusion_culling", "is_using_occlusion_culling"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lod_threshold", PROPERTY_HINT_RANGE, "0,1024,0.1"), "set_lod_threshold", "get_lod_threshold"); ADD_PROPERTY(PropertyInfo(Variant::INT, "debug_draw", PROPERTY_HINT_ENUM, "Disabled,Unshaded,Overdraw,Wireframe"), "set_debug_draw", "get_debug_draw"); +#ifndef _3D_DISABLED + ADD_GROUP("Scaling 3D", ""); + ADD_PROPERTY(PropertyInfo(Variant::INT, "scaling_3d_mode", PROPERTY_HINT_ENUM, "Disabled (Slowest),Bilinear (Fastest),FSR (Fast)"), "set_scaling_3d_mode", "get_scaling_3d_mode"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "scaling_3d_scale", PROPERTY_HINT_RANGE, "0.25,2.0,0.01"), "set_scaling_3d_scale", "get_scaling_3d_scale"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fsr_mipmap_bias", PROPERTY_HINT_RANGE, "-2,2,0.1"), "set_fsr_mipmap_bias", "get_fsr_mipmap_bias"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fsr_sharpness", PROPERTY_HINT_RANGE, "0,2,0.1"), "set_fsr_sharpness", "get_fsr_sharpness"); +#endif ADD_GROUP("Canvas Items", "canvas_item_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "canvas_item_default_texture_filter", PROPERTY_HINT_ENUM, "Nearest,Linear,Linear Mipmap,Nearest Mipmap"), "set_default_canvas_item_texture_filter", "get_default_canvas_item_texture_filter"); ADD_PROPERTY(PropertyInfo(Variant::INT, "canvas_item_default_texture_repeat", PROPERTY_HINT_ENUM, "Disabled,Enabled,Mirror"), "set_default_canvas_item_texture_repeat", "get_default_canvas_item_texture_repeat"); @@ -3646,6 +3726,10 @@ void Viewport::_bind_methods() { BIND_ENUM_CONSTANT(SHADOW_ATLAS_QUADRANT_SUBDIV_1024); BIND_ENUM_CONSTANT(SHADOW_ATLAS_QUADRANT_SUBDIV_MAX); + BIND_ENUM_CONSTANT(SCALING_3D_MODE_BILINEAR); + BIND_ENUM_CONSTANT(SCALING_3D_MODE_FSR); + BIND_ENUM_CONSTANT(SCALING_3D_MODE_MAX); + BIND_ENUM_CONSTANT(MSAA_DISABLED); BIND_ENUM_CONSTANT(MSAA_2X); BIND_ENUM_CONSTANT(MSAA_4X); @@ -3749,7 +3833,16 @@ Viewport::Viewport() { ProjectSettings::get_singleton()->set_custom_property_info("gui/timers/tooltip_delay_sec", PropertyInfo(Variant::FLOAT, "gui/timers/tooltip_delay_sec", PROPERTY_HINT_RANGE, "0,5,0.01,or_greater")); // No negative numbers #ifndef _3D_DISABLED - set_scale_3d(GLOBAL_GET("rendering/3d/viewport/scale")); + Viewport::Scaling3DMode scaling_3d_mode = (Viewport::Scaling3DMode)(int)GLOBAL_GET("rendering/scaling_3d/mode"); + set_scaling_3d_mode(scaling_3d_mode); + + set_scaling_3d_scale(GLOBAL_GET("rendering/scaling_3d/scale")); + + float fsr_sharpness = GLOBAL_GET("rendering/scaling_3d/fsr_sharpness"); + set_fsr_sharpness(fsr_sharpness); + + float fsr_mipmap_bias = GLOBAL_GET("rendering/scaling_3d/fsr_mipmap_bias"); + set_fsr_mipmap_bias(fsr_mipmap_bias); #endif // _3D_DISABLED set_sdf_oversize(sdf_oversize); // Set to server. @@ -3857,7 +3950,7 @@ void SubViewport::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "size_2d_override_stretch"), "set_size_2d_override_stretch", "is_size_2d_override_stretch_enabled"); ADD_GROUP("Render Target", "render_target_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "render_target_clear_mode", PROPERTY_HINT_ENUM, "Always,Never,Next Frame"), "set_clear_mode", "get_clear_mode"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "render_target_update_mode", PROPERTY_HINT_ENUM, "Disabled,Once,When Visible,Always"), "set_update_mode", "get_update_mode"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "render_target_update_mode", PROPERTY_HINT_ENUM, "Disabled,Once,When Visible,When Parent Visible,Always"), "set_update_mode", "get_update_mode"); BIND_ENUM_CONSTANT(CLEAR_MODE_ALWAYS); BIND_ENUM_CONSTANT(CLEAR_MODE_NEVER); diff --git a/scene/main/viewport.h b/scene/main/viewport.h index 1f19ff04c9..38d43e1e59 100644 --- a/scene/main/viewport.h +++ b/scene/main/viewport.h @@ -89,6 +89,12 @@ class Viewport : public Node { GDCLASS(Viewport, Node); public: + enum Scaling3DMode { + SCALING_3D_MODE_BILINEAR, + SCALING_3D_MODE_FSR, + SCALING_3D_MODE_MAX + }; + enum ShadowAtlasQuadrantSubdiv { SHADOW_ATLAS_QUADRANT_SUBDIV_DISABLED, SHADOW_ATLAS_QUADRANT_SUBDIV_1, @@ -244,7 +250,7 @@ private: bool control = false; bool shift = false; bool meta = false; - int mouse_mask = 0; + MouseButton mouse_mask = MouseButton::NONE; } physics_last_mouse_state; @@ -284,6 +290,11 @@ private: MSAA msaa = MSAA_DISABLED; ScreenSpaceAA screen_space_aa = SCREEN_SPACE_AA_DISABLED; + + Scaling3DMode scaling_3d_mode = SCALING_3D_MODE_BILINEAR; + float scaling_3d_scale = 1.0; + float fsr_sharpness = 0.2f; + float fsr_mipmap_bias = 0.0f; bool use_debanding = false; float lod_threshold = 1.0; bool use_occlusion_culling = false; @@ -327,7 +338,7 @@ private: Control *mouse_focus = nullptr; Control *last_mouse_focus = nullptr; Control *mouse_click_grabber = nullptr; - int mouse_focus_mask = 0; + MouseButton mouse_focus_mask = MouseButton::NONE; Control *key_focus = nullptr; Control *mouse_over = nullptr; Control *drag_mouse_over = nullptr; @@ -348,6 +359,7 @@ private: List<Control *> roots; int canvas_sort_index = 0; //for sorting items with canvas as root bool dragging = false; + bool drag_successful = false; bool embed_subwindows_hint = false; bool embedding_subwindows = false; @@ -503,6 +515,18 @@ public: void set_screen_space_aa(ScreenSpaceAA p_screen_space_aa); ScreenSpaceAA get_screen_space_aa() const; + void set_scaling_3d_mode(Scaling3DMode p_scaling_3d_mode); + Scaling3DMode get_scaling_3d_mode() const; + + void set_scaling_3d_scale(float p_scaling_3d_scale); + float get_scaling_3d_scale() const; + + void set_fsr_sharpness(float p_fsr_sharpness); + float get_fsr_sharpness() const; + + void set_fsr_mipmap_bias(float p_fsr_mipmap_bias); + float get_fsr_mipmap_bias() const; + void set_use_debanding(bool p_use_debanding); bool is_using_debanding() const; @@ -556,6 +580,7 @@ public: bool is_handling_input_locally() const; bool gui_is_dragging() const; + bool gui_is_drag_successful() const; Control *gui_find_control(const Point2 &p_global); @@ -584,7 +609,6 @@ public: #ifndef _3D_DISABLED bool use_xr = false; - float scale_3d = 1.0; friend class AudioListener3D; AudioListener3D *audio_listener_3d = nullptr; Set<AudioListener3D *> audio_listener_3d_set; @@ -655,9 +679,6 @@ public: void set_use_xr(bool p_use_xr); bool is_using_xr(); - - void set_scale_3d(float p_scale_3d); - float get_scale_3d() const; #endif // _3D_DISABLED Viewport(); @@ -712,6 +733,7 @@ public: SubViewport(); ~SubViewport(); }; +VARIANT_ENUM_CAST(Viewport::Scaling3DMode); VARIANT_ENUM_CAST(SubViewport::UpdateMode); VARIANT_ENUM_CAST(Viewport::ShadowAtlasQuadrantSubdiv); VARIANT_ENUM_CAST(Viewport::MSAA); diff --git a/scene/main/window.cpp b/scene/main/window.cpp index a0f62c853f..20f8b30dc6 100644 --- a/scene/main/window.cpp +++ b/scene/main/window.cpp @@ -88,6 +88,10 @@ Size2i Window::get_size() const { return size; } +void Window::reset_size() { + set_size(Size2i()); +} + Size2i Window::get_real_size() const { if (window_id != DisplayServer::INVALID_WINDOW_ID) { return DisplayServer::get_singleton()->window_get_real_size(window_id); @@ -895,7 +899,7 @@ void Window::_window_input(const Ref<InputEvent> &p_ev) { if (EngineDebugger::is_active()) { //quit from game window using F8 Ref<InputEventKey> k = p_ev; - if (k.is_valid() && k->is_pressed() && !k->is_echo() && k->get_keycode() == KEY_F8) { + if (k.is_valid() && k->is_pressed() && !k->is_echo() && k->get_keycode() == Key::F8) { EngineDebugger::get_singleton()->send_message("request_quit", Array()); } } @@ -1410,6 +1414,7 @@ void Window::_bind_methods() { ClassDB::bind_method(D_METHOD("set_size", "size"), &Window::set_size); ClassDB::bind_method(D_METHOD("get_size"), &Window::get_size); + ClassDB::bind_method(D_METHOD("reset_size"), &Window::reset_size); ClassDB::bind_method(D_METHOD("get_real_size"), &Window::get_real_size); diff --git a/scene/main/window.h b/scene/main/window.h index def6eab7b8..0b1075ff76 100644 --- a/scene/main/window.h +++ b/scene/main/window.h @@ -178,6 +178,7 @@ public: void set_size(const Size2i &p_size); Size2i get_size() const; + void reset_size(); Size2i get_real_size() const; diff --git a/scene/property_utils.cpp b/scene/property_utils.cpp new file mode 100644 index 0000000000..e3c65bbc6e --- /dev/null +++ b/scene/property_utils.cpp @@ -0,0 +1,188 @@ +/*************************************************************************/ +/* property_utils.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "property_utils.h" + +#include "core/config/engine.h" +#include "core/templates/local_vector.h" +#include "scene/resources/packed_scene.h" + +#ifdef TOOLS_ENABLED +#include "editor/editor_node.h" +#endif // TOOLS_ENABLED + +bool PropertyUtils::is_property_value_different(const Variant &p_a, const Variant &p_b) { + if (p_a.get_type() == Variant::FLOAT && p_b.get_type() == Variant::FLOAT) { + //this must be done because, as some scenes save as text, there might be a tiny difference in floats due to numerical error + return !Math::is_equal_approx((float)p_a, (float)p_b); + } else { + // For our purposes, treating null object as NIL is the right thing to do + const Variant &a = p_a.get_type() == Variant::OBJECT && (Object *)p_a == nullptr ? Variant() : p_a; + const Variant &b = p_b.get_type() == Variant::OBJECT && (Object *)p_b == nullptr ? Variant() : p_b; + return a != b; + } +} + +Variant PropertyUtils::get_property_default_value(const Object *p_object, const StringName &p_property, const Vector<SceneState::PackState> *p_states_stack_cache, bool p_update_exports, const Node *p_owner, bool *r_is_class_default) { + // This function obeys the way property values are set when an object is instantiated, + // which is the following (the latter wins): + // 1. Default value from builtin class + // 2. Default value from script exported variable (from the topmost script) + // 3. Value overrides from the instantiation/inheritance stack + + if (r_is_class_default) { + *r_is_class_default = false; + } + + Ref<Script> topmost_script; + + if (const Node *node = Object::cast_to<Node>(p_object)) { + // Check inheritance/instantiation ancestors + const Vector<SceneState::PackState> &states_stack = p_states_stack_cache ? *p_states_stack_cache : PropertyUtils::get_node_states_stack(node, p_owner); + for (int i = 0; i < states_stack.size(); ++i) { + const SceneState::PackState &ia = states_stack[i]; + bool found = false; + Variant value_in_ancestor = ia.state->get_property_value(ia.node, p_property, found); + if (found) { + return value_in_ancestor; + } + // Save script for later + bool has_script = false; + Variant script = ia.state->get_property_value(ia.node, SNAME("script"), has_script); + if (has_script) { + Ref<Script> scr = script; + if (scr.is_valid()) { + topmost_script = scr; + } + } + } + } + + // Let's see what default is set by the topmost script having a default, if any + if (topmost_script.is_null()) { + topmost_script = p_object->get_script(); + } + if (topmost_script.is_valid()) { + // Should be called in the editor only and not at runtime, + // otherwise it can cause problems because of missing instance state support + if (p_update_exports && Engine::get_singleton()->is_editor_hint()) { + topmost_script->update_exports(); + } + Variant default_value; + if (topmost_script->get_property_default_value(p_property, default_value)) { + return default_value; + } + } + + // Fall back to the default from the native class + if (r_is_class_default) { + *r_is_class_default = true; + } + return ClassDB::class_get_default_property_value(p_object->get_class_name(), p_property); +} + +// Like SceneState::PackState, but using a raw pointer to avoid the cost of +// updating the reference count during the internal work of the functions below +namespace { +struct _FastPackState { + SceneState *state = nullptr; + int node = -1; +}; +} // namespace + +static bool _collect_inheritance_chain(const Ref<SceneState> &p_state, const NodePath &p_path, LocalVector<_FastPackState> &r_states_stack) { + bool found = false; + + LocalVector<_FastPackState> inheritance_states; + + Ref<SceneState> state = p_state; + while (state.is_valid()) { + int node = state->find_node_by_path(p_path); + if (node >= 0) { + // This one has state for this node + inheritance_states.push_back({ state.ptr(), node }); + found = true; + } + state = state->get_base_scene_state(); + } + + for (int i = inheritance_states.size() - 1; i >= 0; --i) { + r_states_stack.push_back(inheritance_states[i]); + } + + return found; +} + +Vector<SceneState::PackState> PropertyUtils::get_node_states_stack(const Node *p_node, const Node *p_owner, bool *r_instantiated_by_owner) { + if (r_instantiated_by_owner) { + *r_instantiated_by_owner = true; + } + + LocalVector<_FastPackState> states_stack; + { + const Node *owner = p_owner; +#ifdef TOOLS_ENABLED + if (!p_owner && Engine::get_singleton()->is_editor_hint()) { + owner = EditorNode::get_singleton()->get_edited_scene(); + } +#endif + + const Node *n = p_node; + while (n) { + if (n == owner) { + const Ref<SceneState> &state = n->get_scene_inherited_state(); + if (_collect_inheritance_chain(state, n->get_path_to(p_node), states_stack)) { + if (r_instantiated_by_owner) { + *r_instantiated_by_owner = false; + } + } + break; + } else if (!n->get_scene_file_path().is_empty()) { + const Ref<SceneState> &state = n->get_scene_instance_state(); + _collect_inheritance_chain(state, n->get_path_to(p_node), states_stack); + } + n = n->get_owner(); + } + } + + // Convert to the proper type for returning, inverting the vector on the go + // (it was more convenient to fill the vector in reverse order) + Vector<SceneState::PackState> states_stack_ret; + { + states_stack_ret.resize(states_stack.size()); + _FastPackState *ps = states_stack.ptr(); + for (int i = states_stack.size() - 1; i >= 0; --i) { + states_stack_ret.write[i].state.reference_ptr(ps->state); + states_stack_ret.write[i].node = ps->node; + ++ps; + } + } + return states_stack_ret; +} diff --git a/scene/property_utils.h b/scene/property_utils.h new file mode 100644 index 0000000000..fde9163548 --- /dev/null +++ b/scene/property_utils.h @@ -0,0 +1,51 @@ +/*************************************************************************/ +/* property_utils.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef PROPERTY_UTILS_H +#define PROPERTY_UTILS_H + +#include "scene/main/node.h" +#include "scene/resources/packed_scene.h" + +class PropertyUtils { +public: + static bool is_property_value_different(const Variant &p_a, const Variant &p_b); + // Gets the most pure default value, the one that would be set when the node has just been instantiated + static Variant get_property_default_value(const Object *p_object, const StringName &p_property, const Vector<SceneState::PackState> *p_states_stack_cache = nullptr, bool p_update_exports = false, const Node *p_owner = nullptr, bool *r_is_class_default = nullptr); + + // Gets the instance/inheritance states of this node, in order of precedence, + // that is, from the topmost (the most able to override values) to the lowermost + // (Note that in nested instancing the one with the greatest precedence is the furthest + // in the tree, since every owner found while traversing towards the root gets a chance + // to override property values.) + static Vector<SceneState::PackState> get_node_states_stack(const Node *p_node, const Node *p_owner = nullptr, bool *r_instantiated_by_owner = nullptr); +}; + +#endif // PROPERTY_UTILS_H diff --git a/scene/register_scene_types.cpp b/scene/register_scene_types.cpp index bf8f7291be..9023b758b6 100644 --- a/scene/register_scene_types.cpp +++ b/scene/register_scene_types.cpp @@ -63,6 +63,7 @@ #include "scene/2d/position_2d.h" #include "scene/2d/ray_cast_2d.h" #include "scene/2d/remote_transform_2d.h" +#include "scene/2d/shape_cast_2d.h" #include "scene/2d/skeleton_2d.h" #include "scene/2d/sprite_2d.h" #include "scene/2d/tile_map.h" @@ -115,14 +116,14 @@ #include "scene/gui/spin_box.h" #include "scene/gui/split_container.h" #include "scene/gui/subviewport_container.h" +#include "scene/gui/tab_bar.h" #include "scene/gui/tab_container.h" -#include "scene/gui/tabs.h" #include "scene/gui/text_edit.h" #include "scene/gui/texture_button.h" #include "scene/gui/texture_progress_bar.h" #include "scene/gui/texture_rect.h" #include "scene/gui/tree.h" -#include "scene/gui/video_player.h" +#include "scene/gui/video_stream_player.h" #include "scene/main/canvas_item.h" #include "scene/main/canvas_layer.h" #include "scene/main/http_request.h" @@ -213,6 +214,7 @@ #include "scene/3d/collision_shape_3d.h" #include "scene/3d/cpu_particles_3d.h" #include "scene/3d/decal.h" +#include "scene/3d/fog_volume.h" #include "scene/3d/gpu_particles_3d.h" #include "scene/3d/gpu_particles_collision_3d.h" #include "scene/3d/importer_mesh_instance_3d.h" @@ -230,7 +232,6 @@ #include "scene/3d/path_3d.h" #include "scene/3d/physics_body_3d.h" #include "scene/3d/position_3d.h" -#include "scene/3d/proximity_group_3d.h" #include "scene/3d/ray_cast_3d.h" #include "scene/3d/reflection_probe.h" #include "scene/3d/remote_transform_3d.h" @@ -245,6 +246,7 @@ #include "scene/3d/world_environment.h" #include "scene/3d/xr_nodes.h" #include "scene/resources/environment.h" +#include "scene/resources/fog_material.h" #include "scene/resources/importer_mesh.h" #include "scene/resources/mesh_library.h" #endif @@ -262,7 +264,7 @@ static Ref<ResourceFormatLoaderShader> resource_loader_shader; void register_scene_types() { SceneStringNames::create(); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init Node::init_node_hrcr(); @@ -287,7 +289,7 @@ void register_scene_types() { resource_loader_shader.instantiate(); ResourceLoader::add_resource_format_loader(resource_loader_shader, true); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(Object); @@ -309,7 +311,7 @@ void register_scene_types() { GDREGISTER_CLASS(ButtonGroup); GDREGISTER_VIRTUAL_CLASS(BaseButton); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(Control); GDREGISTER_CLASS(Button); @@ -330,7 +332,7 @@ void register_scene_types() { GDREGISTER_CLASS(Panel); GDREGISTER_VIRTUAL_CLASS(Range); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(TextureRect); GDREGISTER_CLASS(ColorRect); @@ -338,7 +340,7 @@ void register_scene_types() { GDREGISTER_CLASS(ReferenceRect); GDREGISTER_CLASS(AspectRatioContainer); GDREGISTER_CLASS(TabContainer); - GDREGISTER_CLASS(Tabs); + GDREGISTER_CLASS(TabBar); GDREGISTER_VIRTUAL_CLASS(Separator); GDREGISTER_CLASS(HSeparator); GDREGISTER_CLASS(VSeparator); @@ -352,13 +354,13 @@ void register_scene_types() { GDREGISTER_CLASS(ScrollContainer); GDREGISTER_CLASS(PanelContainer); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(TextureProgressBar); GDREGISTER_CLASS(ItemList); GDREGISTER_CLASS(LineEdit); - GDREGISTER_CLASS(VideoPlayer); + GDREGISTER_CLASS(VideoStreamPlayer); #ifndef ADVANCED_GUI_DISABLED GDREGISTER_CLASS(FileDialog); @@ -391,7 +393,7 @@ void register_scene_types() { GDREGISTER_CLASS(GraphNode); GDREGISTER_CLASS(GraphEdit); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init bool swap_cancel_ok = false; if (DisplayServer::get_singleton()) { @@ -431,9 +433,9 @@ void register_scene_types() { GDREGISTER_CLASS(AnimationNodeTimeSeek); GDREGISTER_CLASS(AnimationNodeTransition); - GDREGISTER_CLASS(ShaderGlobalsOverride); //can be used in any shader + GDREGISTER_CLASS(ShaderGlobalsOverride); // can be used in any shader - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init /* REGISTER 3D */ @@ -450,6 +452,7 @@ void register_scene_types() { GDREGISTER_CLASS(Camera3D); GDREGISTER_CLASS(AudioListener3D); GDREGISTER_CLASS(XRCamera3D); + GDREGISTER_VIRTUAL_CLASS(XRNode3D); GDREGISTER_CLASS(XRController3D); GDREGISTER_CLASS(XRAnchor3D); GDREGISTER_CLASS(XROrigin3D); @@ -473,21 +476,21 @@ void register_scene_types() { GDREGISTER_VIRTUAL_CLASS(Lightmapper); GDREGISTER_CLASS(GPUParticles3D); GDREGISTER_VIRTUAL_CLASS(GPUParticlesCollision3D); - GDREGISTER_CLASS(GPUParticlesCollisionBox); - GDREGISTER_CLASS(GPUParticlesCollisionSphere); - GDREGISTER_CLASS(GPUParticlesCollisionSDF); - GDREGISTER_CLASS(GPUParticlesCollisionHeightField); + GDREGISTER_CLASS(GPUParticlesCollisionBox3D); + GDREGISTER_CLASS(GPUParticlesCollisionSphere3D); + GDREGISTER_CLASS(GPUParticlesCollisionSDF3D); + GDREGISTER_CLASS(GPUParticlesCollisionHeightField3D); GDREGISTER_VIRTUAL_CLASS(GPUParticlesAttractor3D); - GDREGISTER_CLASS(GPUParticlesAttractorBox); - GDREGISTER_CLASS(GPUParticlesAttractorSphere); - GDREGISTER_CLASS(GPUParticlesAttractorVectorField); + GDREGISTER_CLASS(GPUParticlesAttractorBox3D); + GDREGISTER_CLASS(GPUParticlesAttractorSphere3D); + GDREGISTER_CLASS(GPUParticlesAttractorVectorField3D); GDREGISTER_CLASS(CPUParticles3D); GDREGISTER_CLASS(Position3D); GDREGISTER_CLASS(RootMotionView); - ClassDB::set_class_enabled("RootMotionView", false); //disabled by default, enabled by editor + ClassDB::set_class_enabled("RootMotionView", false); // disabled by default, enabled by editor - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_VIRTUAL_CLASS(CollisionObject3D); GDREGISTER_VIRTUAL_CLASS(PhysicsBody3D); @@ -507,7 +510,6 @@ void register_scene_types() { GDREGISTER_CLASS(VehicleBody3D); GDREGISTER_CLASS(VehicleWheel3D); GDREGISTER_CLASS(Area3D); - GDREGISTER_CLASS(ProximityGroup3D); GDREGISTER_CLASS(CollisionShape3D); GDREGISTER_CLASS(CollisionPolygon3D); GDREGISTER_CLASS(RayCast3D); @@ -519,6 +521,8 @@ void register_scene_types() { GDREGISTER_CLASS(VisibleOnScreenNotifier3D); GDREGISTER_CLASS(VisibleOnScreenEnabler3D); GDREGISTER_CLASS(WorldEnvironment); + GDREGISTER_CLASS(FogVolume); + GDREGISTER_CLASS(FogMaterial); GDREGISTER_CLASS(RemoteTransform3D); GDREGISTER_VIRTUAL_CLASS(Joint3D); @@ -532,7 +536,7 @@ void register_scene_types() { GDREGISTER_CLASS(NavigationAgent3D); GDREGISTER_CLASS(NavigationObstacle3D); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init #endif /* REGISTER SHADER */ @@ -623,6 +627,7 @@ void register_scene_types() { GDREGISTER_CLASS(VisualShaderNodeParticleSphereEmitter); GDREGISTER_CLASS(VisualShaderNodeParticleBoxEmitter); GDREGISTER_CLASS(VisualShaderNodeParticleRingEmitter); + GDREGISTER_CLASS(VisualShaderNodeParticleMeshEmitter); GDREGISTER_CLASS(VisualShaderNodeParticleMultiplyByAxisAngle); GDREGISTER_CLASS(VisualShaderNodeParticleConeVelocity); GDREGISTER_CLASS(VisualShaderNodeParticleRandomness); @@ -660,6 +665,7 @@ void register_scene_types() { GDREGISTER_CLASS(CollisionShape2D); GDREGISTER_CLASS(CollisionPolygon2D); GDREGISTER_CLASS(RayCast2D); + GDREGISTER_CLASS(ShapeCast2D); GDREGISTER_CLASS(VisibleOnScreenNotifier2D); GDREGISTER_CLASS(VisibleOnScreenEnabler2D); GDREGISTER_CLASS(Polygon2D); @@ -672,7 +678,7 @@ void register_scene_types() { GDREGISTER_CLASS(OccluderPolygon2D); GDREGISTER_CLASS(BackBufferCopy); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(Camera2D); GDREGISTER_CLASS(AudioListener2D); @@ -684,6 +690,7 @@ void register_scene_types() { GDREGISTER_VIRTUAL_CLASS(TileSetSource); GDREGISTER_CLASS(TileSetAtlasSource); GDREGISTER_CLASS(TileSetScenesCollectionSource); + GDREGISTER_CLASS(TileMapPattern); GDREGISTER_CLASS(TileData); GDREGISTER_CLASS(TileMap); GDREGISTER_CLASS(ParallaxBackground); @@ -703,7 +710,7 @@ void register_scene_types() { GDREGISTER_CLASS(PhysicalBone2D); GDREGISTER_CLASS(SkeletonModification2DPhysicalBones); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init /* REGISTER RESOURCES */ @@ -744,7 +751,7 @@ void register_scene_types() { GDREGISTER_CLASS(MeshLibrary); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_VIRTUAL_CLASS(Shape3D); GDREGISTER_CLASS(SeparationRayShape3D); @@ -766,7 +773,7 @@ void register_scene_types() { ClassDB::register_class<SkeletonModification3DTwoBoneIK>(); ClassDB::register_class<SkeletonModification3DStackHolder>(); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(VelocityTracker3D); #endif @@ -785,7 +792,8 @@ void register_scene_types() { GDREGISTER_CLASS(MeshTexture); GDREGISTER_CLASS(CurveTexture); GDREGISTER_CLASS(CurveXYZTexture); - GDREGISTER_CLASS(GradientTexture); + GDREGISTER_CLASS(GradientTexture1D); + GDREGISTER_CLASS(GradientTexture2D); GDREGISTER_CLASS(ProxyTexture); GDREGISTER_CLASS(AnimatedTexture); GDREGISTER_CLASS(CameraTexture); @@ -821,7 +829,7 @@ void register_scene_types() { GDREGISTER_CLASS(BitMap); GDREGISTER_CLASS(Gradient); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_CLASS(AudioStreamPlayer); GDREGISTER_CLASS(AudioStreamPlayer2D); @@ -831,7 +839,7 @@ void register_scene_types() { GDREGISTER_VIRTUAL_CLASS(VideoStream); GDREGISTER_CLASS(AudioStreamSample); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_VIRTUAL_CLASS(Shape2D); GDREGISTER_CLASS(WorldBoundaryShape2D); @@ -852,13 +860,13 @@ void register_scene_types() { GDREGISTER_CLASS(NavigationAgent2D); GDREGISTER_CLASS(NavigationObstacle2D); - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init GDREGISTER_VIRTUAL_CLASS(SceneState); GDREGISTER_CLASS(PackedScene); GDREGISTER_CLASS(SceneTree); - GDREGISTER_VIRTUAL_CLASS(SceneTreeTimer); //sorry, you can't create it + GDREGISTER_VIRTUAL_CLASS(SceneTreeTimer); // sorry, you can't create it #ifndef DISABLE_DEPRECATED // Dropped in 4.0, near approximation. @@ -915,6 +923,7 @@ void register_scene_types() { ClassDB::add_compatibility_class("EditorSpatialGizmo", "EditorNode3DGizmo"); ClassDB::add_compatibility_class("EditorSpatialGizmoPlugin", "EditorNode3DGizmoPlugin"); ClassDB::add_compatibility_class("Generic6DOFJoint", "Generic6DOFJoint3D"); + ClassDB::add_compatibility_class("GradientTexture", "GradientTexture1D"); ClassDB::add_compatibility_class("HeightMapShape", "HeightMapShape3D"); ClassDB::add_compatibility_class("HingeJoint", "HingeJoint3D"); ClassDB::add_compatibility_class("Joint", "Joint3D"); @@ -922,6 +931,7 @@ void register_scene_types() { ClassDB::add_compatibility_class("KinematicBody2D", "CharacterBody2D"); ClassDB::add_compatibility_class("KinematicCollision", "KinematicCollision3D"); ClassDB::add_compatibility_class("Light", "Light3D"); + ClassDB::add_compatibility_class("Light2D", "PointLight2D"); ClassDB::add_compatibility_class("LineShape2D", "WorldBoundaryShape2D"); ClassDB::add_compatibility_class("Listener", "AudioListener3D"); ClassDB::add_compatibility_class("MeshInstance", "MeshInstance3D"); @@ -940,10 +950,8 @@ void register_scene_types() { ClassDB::add_compatibility_class("Path", "Path3D"); ClassDB::add_compatibility_class("PathFollow", "PathFollow3D"); ClassDB::add_compatibility_class("PhysicalBone", "PhysicalBone3D"); - ClassDB::add_compatibility_class("Physics2DDirectBodyStateSW", "PhysicsDirectBodyState2DSW"); ClassDB::add_compatibility_class("Physics2DDirectBodyState", "PhysicsDirectBodyState2D"); ClassDB::add_compatibility_class("Physics2DDirectSpaceState", "PhysicsDirectSpaceState2D"); - ClassDB::add_compatibility_class("Physics2DServerSW", "PhysicsServer2DSW"); ClassDB::add_compatibility_class("Physics2DServer", "PhysicsServer2D"); ClassDB::add_compatibility_class("Physics2DShapeQueryParameters", "PhysicsShapeQueryParameters2D"); ClassDB::add_compatibility_class("Physics2DTestMotionResult", "PhysicsTestMotionResult2D"); @@ -955,7 +963,6 @@ void register_scene_types() { ClassDB::add_compatibility_class("PinJoint", "PinJoint3D"); ClassDB::add_compatibility_class("PlaneShape", "WorldBoundaryShape3D"); ClassDB::add_compatibility_class("ProceduralSky", "Sky"); - ClassDB::add_compatibility_class("ProximityGroup", "ProximityGroup3D"); ClassDB::add_compatibility_class("RayCast", "RayCast3D"); ClassDB::add_compatibility_class("RayShape", "SeparationRayShape3D"); ClassDB::add_compatibility_class("RayShape2D", "SeparationRayShape2D"); @@ -977,13 +984,17 @@ void register_scene_types() { ClassDB::add_compatibility_class("SpringArm", "SpringArm3D"); ClassDB::add_compatibility_class("Sprite", "Sprite2D"); ClassDB::add_compatibility_class("StaticBody", "StaticBody3D"); + ClassDB::add_compatibility_class("StreamTexture", "StreamTexture2D"); ClassDB::add_compatibility_class("TextureProgress", "TextureProgressBar"); ClassDB::add_compatibility_class("VehicleBody", "VehicleBody3D"); ClassDB::add_compatibility_class("VehicleWheel", "VehicleWheel3D"); + ClassDB::add_compatibility_class("VideoPlayer", "VideoStreamPlayer"); ClassDB::add_compatibility_class("ViewportContainer", "SubViewportContainer"); ClassDB::add_compatibility_class("Viewport", "SubViewport"); ClassDB::add_compatibility_class("VisibilityEnabler", "VisibleOnScreenEnabler3D"); ClassDB::add_compatibility_class("VisibilityNotifier", "VisibleOnScreenNotifier3D"); + ClassDB::add_compatibility_class("VisibilityNotifier2D", "VisibleOnScreenNotifier2D"); + ClassDB::add_compatibility_class("VisibilityNotifier3D", "VisibleOnScreenNotifier3D"); ClassDB::add_compatibility_class("VisualServer", "RenderingServer"); ClassDB::add_compatibility_class("VisualShaderNodeScalarConstant", "VisualShaderNodeFloatConstant"); ClassDB::add_compatibility_class("VisualShaderNodeScalarFunc", "VisualShaderNodeFloatFunc"); @@ -1001,14 +1012,9 @@ void register_scene_types() { ClassDB::add_compatibility_class("VisualShaderNodeScalarSwitch", "VisualShaderNodeSwitch"); ClassDB::add_compatibility_class("VisualShaderNodeScalarTransformMult", "VisualShaderNodeTransformOp"); ClassDB::add_compatibility_class("World", "World3D"); - ClassDB::add_compatibility_class("StreamTexture", "StreamTexture2D"); - ClassDB::add_compatibility_class("Light2D", "PointLight2D"); - ClassDB::add_compatibility_class("VisibilityNotifier2D", "VisibleOnScreenNotifier2D"); - ClassDB::add_compatibility_class("VisibilityNotifier3D", "VisibleOnScreenNotifier3D"); - #endif /* DISABLE_DEPRECATED */ - OS::get_singleton()->yield(); //may take time to init + OS::get_singleton()->yield(); // may take time to init for (int i = 0; i < 20; i++) { GLOBAL_DEF_BASIC(vformat("layer_names/2d_render/layer_%d", i + 1), ""); @@ -1022,6 +1028,16 @@ void register_scene_types() { GLOBAL_DEF_BASIC(vformat("layer_names/3d_navigation/layer_%d", i + 1), ""); } + if (RenderingServer::get_singleton()) { + ColorPicker::init_shaders(); // RenderingServer needs to exist for this to succeed. + } + + SceneDebugger::initialize(); + + NativeExtensionManager::get_singleton()->initialize_extensions(NativeExtension::INITIALIZATION_LEVEL_SCENE); +} + +void initialize_theme() { bool default_theme_hidpi = GLOBAL_DEF("gui/theme/use_hidpi", false); ProjectSettings::get_singleton()->set_custom_property_info("gui/theme/use_hidpi", PropertyInfo(Variant::BOOL, "gui/theme/use_hidpi", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_RESTART_IF_CHANGED)); String theme_path = GLOBAL_DEF_RST("gui/theme/custom", ""); @@ -1030,7 +1046,7 @@ void register_scene_types() { ProjectSettings::get_singleton()->set_custom_property_info("gui/theme/custom_font", PropertyInfo(Variant::STRING, "gui/theme/custom_font", PROPERTY_HINT_FILE, "*.tres,*.res,*.font", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_RESTART_IF_CHANGED)); Ref<Font> font; - if (font_path != String()) { + if (!font_path.is_empty()) { font = ResourceLoader::load(font_path); if (!font.is_valid()) { ERR_PRINT("Error loading custom font '" + font_path + "'"); @@ -1040,10 +1056,9 @@ void register_scene_types() { // Always make the default theme to avoid invalid default font/icon/style in the given theme. if (RenderingServer::get_singleton()) { make_default_theme(default_theme_hidpi, font); - ColorPicker::init_shaders(); // RenderingServer needs to exist for this to succeed. } - if (theme_path != String()) { + if (!theme_path.is_empty()) { Ref<Theme> theme = ResourceLoader::load(theme_path); if (theme.is_valid()) { Theme::set_project_default(theme); @@ -1054,9 +1069,6 @@ void register_scene_types() { ERR_PRINT("Error loading custom theme '" + theme_path + "'"); } } - SceneDebugger::initialize(); - - NativeExtensionManager::get_singleton()->initialize_extensions(NativeExtension::INITIALIZATION_LEVEL_SCENE); } void unregister_scene_types() { @@ -1086,7 +1098,7 @@ void unregister_scene_types() { ResourceLoader::remove_resource_format_loader(resource_loader_shader); resource_loader_shader.unref(); - //StandardMaterial3D is not initialised when 3D is disabled, so it shouldn't be cleaned up either + // StandardMaterial3D is not initialised when 3D is disabled, so it shouldn't be cleaned up either #ifndef _3D_DISABLED BaseMaterial3D::finish_shaders(); #endif // _3D_DISABLED diff --git a/scene/register_scene_types.h b/scene/register_scene_types.h index 1ff542eef8..32ab165fb3 100644 --- a/scene/register_scene_types.h +++ b/scene/register_scene_types.h @@ -34,4 +34,6 @@ void register_scene_types(); void unregister_scene_types(); +void initialize_theme(); + #endif diff --git a/scene/resources/animation.cpp b/scene/resources/animation.cpp index 08b78a39b1..255d0ececd 100644 --- a/scene/resources/animation.cpp +++ b/scene/resources/animation.cpp @@ -30,13 +30,40 @@ #include "animation.h" +#include "core/io/marshalls.h" #include "core/math/geometry_3d.h" #include "scene/scene_string_names.h" bool Animation::_set(const StringName &p_name, const Variant &p_value) { String name = p_name; - if (name.begins_with("tracks/")) { + if (p_name == SNAME("_compression")) { + ERR_FAIL_COND_V(tracks.size() > 0, false); //can only set compression if no tracks exist + Dictionary comp = p_value; + ERR_FAIL_COND_V(!comp.has("fps"), false); + ERR_FAIL_COND_V(!comp.has("bounds"), false); + ERR_FAIL_COND_V(!comp.has("pages"), false); + ERR_FAIL_COND_V(!comp.has("format_version"), false); + uint32_t format_version = comp["format_version"]; + ERR_FAIL_COND_V(format_version > Compression::FORMAT_VERSION, false); // version does not match this supported version + compression.fps = comp["fps"]; + Array bounds = comp["bounds"]; + compression.bounds.resize(bounds.size()); + for (int i = 0; i < bounds.size(); i++) { + compression.bounds[i] = bounds[i]; + } + Array pages = comp["pages"]; + compression.pages.resize(pages.size()); + for (int i = 0; i < pages.size(); i++) { + Dictionary page = pages[i]; + ERR_FAIL_COND_V(!page.has("data"), false); + ERR_FAIL_COND_V(!page.has("time_offset"), false); + compression.pages[i].data = page["data"]; + compression.pages[i].time_offset = page["time_offset"]; + } + compression.enabled = true; + return true; + } else if (name.begins_with("tracks/")) { int track = name.get_slicec('/', 1).to_int(); String what = name.get_slicec('/', 2); @@ -72,6 +99,34 @@ bool Animation::_set(const StringName &p_name, const Variant &p_value) { if (what == "path") { track_set_path(track, p_value); + } else if (what == "compressed_track") { + int index = p_value; + ERR_FAIL_COND_V(!compression.enabled, false); + ERR_FAIL_UNSIGNED_INDEX_V((uint32_t)index, compression.bounds.size(), false); + Track *t = tracks[track]; + t->interpolation = INTERPOLATION_LINEAR; //only linear supported + switch (t->type) { + case TYPE_POSITION_3D: { + PositionTrack *tt = static_cast<PositionTrack *>(t); + tt->compressed_track = index; + } break; + case TYPE_ROTATION_3D: { + RotationTrack *rt = static_cast<RotationTrack *>(t); + rt->compressed_track = index; + } break; + case TYPE_SCALE_3D: { + ScaleTrack *st = static_cast<ScaleTrack *>(t); + st->compressed_track = index; + } break; + case TYPE_BLEND_SHAPE: { + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + bst->compressed_track = index; + } break; + default: { + return false; + } + } + return true; } else if (what == "interp") { track_set_interpolation_type(track, InterpolationType(p_value.operator int())); } else if (what == "loop_wrap") { @@ -262,7 +317,7 @@ bool Animation::_set(const StringName &p_name, const Variant &p_value) { Vector<real_t> times = d["times"]; Vector<real_t> values = d["points"]; - ERR_FAIL_COND_V(times.size() * 5 != values.size(), false); + ERR_FAIL_COND_V(times.size() * 6 != values.size(), false); if (times.size()) { int valcount = times.size(); @@ -275,11 +330,12 @@ bool Animation::_set(const StringName &p_name, const Variant &p_value) { for (int i = 0; i < valcount; i++) { bt->values.write[i].time = rt[i]; bt->values.write[i].transition = 0; //unused in bezier - bt->values.write[i].value.value = rv[i * 5 + 0]; - bt->values.write[i].value.in_handle.x = rv[i * 5 + 1]; - bt->values.write[i].value.in_handle.y = rv[i * 5 + 2]; - bt->values.write[i].value.out_handle.x = rv[i * 5 + 3]; - bt->values.write[i].value.out_handle.y = rv[i * 5 + 4]; + bt->values.write[i].value.value = rv[i * 6 + 0]; + bt->values.write[i].value.in_handle.x = rv[i * 6 + 1]; + bt->values.write[i].value.in_handle.y = rv[i * 6 + 2]; + bt->values.write[i].value.out_handle.x = rv[i * 6 + 3]; + bt->values.write[i].value.out_handle.y = rv[i * 6 + 4]; + bt->values.write[i].value.handle_mode = static_cast<HandleMode>((int)rv[i * 6 + 5]); } } @@ -369,10 +425,33 @@ bool Animation::_set(const StringName &p_name, const Variant &p_value) { bool Animation::_get(const StringName &p_name, Variant &r_ret) const { String name = p_name; - if (name == "length") { + if (p_name == SNAME("_compression")) { + ERR_FAIL_COND_V(!compression.enabled, false); + Dictionary comp; + comp["fps"] = compression.fps; + Array bounds; + bounds.resize(compression.bounds.size()); + for (uint32_t i = 0; i < compression.bounds.size(); i++) { + bounds[i] = compression.bounds[i]; + } + comp["bounds"] = bounds; + Array pages; + pages.resize(compression.pages.size()); + for (uint32_t i = 0; i < compression.pages.size(); i++) { + Dictionary page; + page["data"] = compression.pages[i].data; + page["time_offset"] = compression.pages[i].time_offset; + pages[i] = page; + } + comp["pages"] = pages; + comp["format_version"] = Compression::FORMAT_VERSION; + + r_ret = comp; + return true; + } else if (name == "length") { r_ret = length; - } else if (name == "loop") { - r_ret = loop; + } else if (name == "loop_mode") { + r_ret = loop_mode; } else if (name == "step") { r_ret = step; } else if (name.begins_with("tracks/")) { @@ -414,6 +493,34 @@ bool Animation::_get(const StringName &p_name, Variant &r_ret) const { } else if (what == "path") { r_ret = track_get_path(track); + } else if (what == "compressed_track") { + ERR_FAIL_COND_V(!compression.enabled, false); + Track *t = tracks[track]; + switch (t->type) { + case TYPE_POSITION_3D: { + PositionTrack *tt = static_cast<PositionTrack *>(t); + r_ret = tt->compressed_track; + } break; + case TYPE_ROTATION_3D: { + RotationTrack *rt = static_cast<RotationTrack *>(t); + r_ret = rt->compressed_track; + } break; + case TYPE_SCALE_3D: { + ScaleTrack *st = static_cast<ScaleTrack *>(t); + r_ret = st->compressed_track; + } break; + case TYPE_BLEND_SHAPE: { + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + r_ret = bst->compressed_track; + } break; + default: { + r_ret = Variant(); + ERR_FAIL_V(false); + } + } + + return true; + } else if (what == "interp") { r_ret = track_get_interpolation_type(track); } else if (what == "loop_wrap") { @@ -592,7 +699,7 @@ bool Animation::_get(const StringName &p_name, Variant &r_ret) const { int kk = bt->values.size(); key_times.resize(kk); - key_points.resize(kk * 5); + key_points.resize(kk * 6); real_t *wti = key_times.ptrw(); real_t *wpo = key_points.ptrw(); @@ -603,11 +710,12 @@ bool Animation::_get(const StringName &p_name, Variant &r_ret) const { for (int i = 0; i < kk; i++) { wti[idx] = vls[i].time; - wpo[idx * 5 + 0] = vls[i].value.value; - wpo[idx * 5 + 1] = vls[i].value.in_handle.x; - wpo[idx * 5 + 2] = vls[i].value.in_handle.y; - wpo[idx * 5 + 3] = vls[i].value.out_handle.x; - wpo[idx * 5 + 4] = vls[i].value.out_handle.y; + wpo[idx * 6 + 0] = vls[i].value.value; + wpo[idx * 6 + 1] = vls[i].value.in_handle.x; + wpo[idx * 6 + 2] = vls[i].value.in_handle.y; + wpo[idx * 6 + 3] = vls[i].value.out_handle.x; + wpo[idx * 6 + 4] = vls[i].value.out_handle.y; + wpo[idx * 6 + 5] = (double)vls[i].value.handle_mode; idx++; } @@ -692,14 +800,21 @@ bool Animation::_get(const StringName &p_name, Variant &r_ret) const { } void Animation::_get_property_list(List<PropertyInfo> *p_list) const { + if (compression.enabled) { + p_list->push_back(PropertyInfo(Variant::DICTIONARY, "_compression", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + } for (int i = 0; i < tracks.size(); i++) { - p_list->push_back(PropertyInfo(Variant::STRING, "tracks/" + itos(i) + "/type", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::NODE_PATH, "tracks/" + itos(i) + "/path", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::INT, "tracks/" + itos(i) + "/interp", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/loop_wrap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/imported", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); - p_list->push_back(PropertyInfo(Variant::ARRAY, "tracks/" + itos(i) + "/keys", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::STRING, "tracks/" + itos(i) + "/type", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/imported", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/enabled", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::NODE_PATH, "tracks/" + itos(i) + "/path", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + if (track_is_compressed(i)) { + p_list->push_back(PropertyInfo(Variant::INT, "tracks/" + itos(i) + "/compressed_track", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + } else { + p_list->push_back(PropertyInfo(Variant::INT, "tracks/" + itos(i) + "/interp", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::BOOL, "tracks/" + itos(i) + "/loop_wrap", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "tracks/" + itos(i) + "/keys", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); + } } } @@ -765,21 +880,25 @@ void Animation::remove_track(int p_track) { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + ERR_FAIL_COND_MSG(tt->compressed_track >= 0, "Compressed tracks can't be manually removed. Call clear() to get rid of compression first."); _clear(tt->positions); } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + ERR_FAIL_COND_MSG(rt->compressed_track >= 0, "Compressed tracks can't be manually removed. Call clear() to get rid of compression first."); _clear(rt->rotations); } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + ERR_FAIL_COND_MSG(st->compressed_track >= 0, "Compressed tracks can't be manually removed. Call clear() to get rid of compression first."); _clear(st->scales); } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + ERR_FAIL_COND_MSG(bst->compressed_track >= 0, "Compressed tracks can't be manually removed. Call clear() to get rid of compression first."); _clear(bst->blend_shapes); } break; @@ -811,7 +930,7 @@ void Animation::remove_track(int p_track) { } memdelete(t); - tracks.remove(p_track); + tracks.remove_at(p_track); emit_changed(); emit_signal(SceneStringNames::get_singleton()->tracks_changed); } @@ -837,9 +956,9 @@ NodePath Animation::track_get_path(int p_track) const { return tracks[p_track]->path; } -int Animation::find_track(const NodePath &p_path) const { +int Animation::find_track(const NodePath &p_path, const TrackType p_type) const { for (int i = 0; i < tracks.size(); i++) { - if (tracks[i]->path == p_path) { + if (tracks[i]->path == p_path && tracks[i]->type == p_type) { return i; } }; @@ -907,6 +1026,8 @@ int Animation::position_track_insert_key(int p_track, double p_time, const Vecto PositionTrack *tt = static_cast<PositionTrack *>(t); + ERR_FAIL_COND_V(tt->compressed_track >= 0, -1); + TKey<Vector3> tkey; tkey.time = p_time; tkey.value = p_position; @@ -922,6 +1043,19 @@ Error Animation::position_track_get_key(int p_track, int p_key, Vector3 *r_posit PositionTrack *tt = static_cast<PositionTrack *>(t); ERR_FAIL_COND_V(t->type != TYPE_POSITION_3D, ERR_INVALID_PARAMETER); + + if (tt->compressed_track >= 0) { + Vector3i key; + double time; + bool fetch_success = _fetch_compressed_by_index<3>(tt->compressed_track, p_key, key, time); + if (!fetch_success) { + return ERR_INVALID_PARAMETER; + } + + *r_position = _uncompress_pos_scale(tt->compressed_track, key); + return OK; + } + ERR_FAIL_INDEX_V(p_key, tt->positions.size(), ERR_INVALID_PARAMETER); *r_position = tt->positions[p_key].value; @@ -936,6 +1070,14 @@ Error Animation::position_track_interpolate(int p_track, double p_time, Vector3 PositionTrack *tt = static_cast<PositionTrack *>(t); + if (tt->compressed_track >= 0) { + if (_pos_scale_interpolate_compressed(tt->compressed_track, p_time, *r_interpolation)) { + return OK; + } else { + return ERR_UNAVAILABLE; + } + } + bool ok = false; Vector3 tk = _interpolate(tt->positions, p_time, tt->interpolation, tt->loop_wrap, &ok); @@ -956,6 +1098,8 @@ int Animation::rotation_track_insert_key(int p_track, double p_time, const Quate RotationTrack *rt = static_cast<RotationTrack *>(t); + ERR_FAIL_COND_V(rt->compressed_track >= 0, -1); + TKey<Quaternion> tkey; tkey.time = p_time; tkey.value = p_rotation; @@ -971,6 +1115,19 @@ Error Animation::rotation_track_get_key(int p_track, int p_key, Quaternion *r_ro RotationTrack *rt = static_cast<RotationTrack *>(t); ERR_FAIL_COND_V(t->type != TYPE_ROTATION_3D, ERR_INVALID_PARAMETER); + + if (rt->compressed_track >= 0) { + Vector3i key; + double time; + bool fetch_success = _fetch_compressed_by_index<3>(rt->compressed_track, p_key, key, time); + if (!fetch_success) { + return ERR_INVALID_PARAMETER; + } + + *r_rotation = _uncompress_quaternion(key); + return OK; + } + ERR_FAIL_INDEX_V(p_key, rt->rotations.size(), ERR_INVALID_PARAMETER); *r_rotation = rt->rotations[p_key].value; @@ -985,6 +1142,14 @@ Error Animation::rotation_track_interpolate(int p_track, double p_time, Quaterni RotationTrack *rt = static_cast<RotationTrack *>(t); + if (rt->compressed_track >= 0) { + if (_rotation_interpolate_compressed(rt->compressed_track, p_time, *r_interpolation)) { + return OK; + } else { + return ERR_UNAVAILABLE; + } + } + bool ok = false; Quaternion tk = _interpolate(rt->rotations, p_time, rt->interpolation, rt->loop_wrap, &ok); @@ -1005,6 +1170,8 @@ int Animation::scale_track_insert_key(int p_track, double p_time, const Vector3 ScaleTrack *st = static_cast<ScaleTrack *>(t); + ERR_FAIL_COND_V(st->compressed_track >= 0, -1); + TKey<Vector3> tkey; tkey.time = p_time; tkey.value = p_scale; @@ -1020,6 +1187,19 @@ Error Animation::scale_track_get_key(int p_track, int p_key, Vector3 *r_scale) c ScaleTrack *st = static_cast<ScaleTrack *>(t); ERR_FAIL_COND_V(t->type != TYPE_SCALE_3D, ERR_INVALID_PARAMETER); + + if (st->compressed_track >= 0) { + Vector3i key; + double time; + bool fetch_success = _fetch_compressed_by_index<3>(st->compressed_track, p_key, key, time); + if (!fetch_success) { + return ERR_INVALID_PARAMETER; + } + + *r_scale = _uncompress_pos_scale(st->compressed_track, key); + return OK; + } + ERR_FAIL_INDEX_V(p_key, st->scales.size(), ERR_INVALID_PARAMETER); *r_scale = st->scales[p_key].value; @@ -1034,6 +1214,14 @@ Error Animation::scale_track_interpolate(int p_track, double p_time, Vector3 *r_ ScaleTrack *st = static_cast<ScaleTrack *>(t); + if (st->compressed_track >= 0) { + if (_pos_scale_interpolate_compressed(st->compressed_track, p_time, *r_interpolation)) { + return OK; + } else { + return ERR_UNAVAILABLE; + } + } + bool ok = false; Vector3 tk = _interpolate(st->scales, p_time, st->interpolation, st->loop_wrap, &ok); @@ -1052,6 +1240,8 @@ int Animation::blend_shape_track_insert_key(int p_track, double p_time, float p_ BlendShapeTrack *st = static_cast<BlendShapeTrack *>(t); + ERR_FAIL_COND_V(st->compressed_track >= 0, -1); + TKey<float> tkey; tkey.time = p_time; tkey.value = p_blend_shape; @@ -1065,11 +1255,24 @@ Error Animation::blend_shape_track_get_key(int p_track, int p_key, float *r_blen ERR_FAIL_INDEX_V(p_track, tracks.size(), ERR_INVALID_PARAMETER); Track *t = tracks[p_track]; - BlendShapeTrack *st = static_cast<BlendShapeTrack *>(t); + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); ERR_FAIL_COND_V(t->type != TYPE_BLEND_SHAPE, ERR_INVALID_PARAMETER); - ERR_FAIL_INDEX_V(p_key, st->blend_shapes.size(), ERR_INVALID_PARAMETER); - *r_blend_shape = st->blend_shapes[p_key].value; + if (bst->compressed_track >= 0) { + Vector3i key; + double time; + bool fetch_success = _fetch_compressed_by_index<1>(bst->compressed_track, p_key, key, time); + if (!fetch_success) { + return ERR_INVALID_PARAMETER; + } + + *r_blend_shape = _uncompress_blend_shape(key); + return OK; + } + + ERR_FAIL_INDEX_V(p_key, bst->blend_shapes.size(), ERR_INVALID_PARAMETER); + + *r_blend_shape = bst->blend_shapes[p_key].value; return OK; } @@ -1079,11 +1282,19 @@ Error Animation::blend_shape_track_interpolate(int p_track, double p_time, float Track *t = tracks[p_track]; ERR_FAIL_COND_V(t->type != TYPE_BLEND_SHAPE, ERR_INVALID_PARAMETER); - BlendShapeTrack *st = static_cast<BlendShapeTrack *>(t); + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + + if (bst->compressed_track >= 0) { + if (_blend_shape_interpolate_compressed(bst->compressed_track, p_time, *r_interpolation)) { + return OK; + } else { + return ERR_UNAVAILABLE; + } + } bool ok = false; - float tk = _interpolate(st->blend_shapes, p_time, st->interpolation, st->loop_wrap, &ok); + float tk = _interpolate(bst->blend_shapes, p_time, bst->interpolation, bst->loop_wrap, &ok); if (!ok) { return ERR_UNAVAILABLE; @@ -1105,56 +1316,68 @@ void Animation::track_remove_key(int p_track, int p_idx) { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + + ERR_FAIL_COND(tt->compressed_track >= 0); + ERR_FAIL_INDEX(p_idx, tt->positions.size()); - tt->positions.remove(p_idx); + tt->positions.remove_at(p_idx); } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + + ERR_FAIL_COND(rt->compressed_track >= 0); + ERR_FAIL_INDEX(p_idx, rt->rotations.size()); - rt->rotations.remove(p_idx); + rt->rotations.remove_at(p_idx); } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + + ERR_FAIL_COND(st->compressed_track >= 0); + ERR_FAIL_INDEX(p_idx, st->scales.size()); - st->scales.remove(p_idx); + st->scales.remove_at(p_idx); } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + + ERR_FAIL_COND(bst->compressed_track >= 0); + ERR_FAIL_INDEX(p_idx, bst->blend_shapes.size()); - bst->blend_shapes.remove(p_idx); + bst->blend_shapes.remove_at(p_idx); } break; case TYPE_VALUE: { ValueTrack *vt = static_cast<ValueTrack *>(t); ERR_FAIL_INDEX(p_idx, vt->values.size()); - vt->values.remove(p_idx); + vt->values.remove_at(p_idx); } break; case TYPE_METHOD: { MethodTrack *mt = static_cast<MethodTrack *>(t); ERR_FAIL_INDEX(p_idx, mt->methods.size()); - mt->methods.remove(p_idx); + mt->methods.remove_at(p_idx); } break; case TYPE_BEZIER: { BezierTrack *bz = static_cast<BezierTrack *>(t); ERR_FAIL_INDEX(p_idx, bz->values.size()); - bz->values.remove(p_idx); + bz->values.remove_at(p_idx); } break; case TYPE_AUDIO: { AudioTrack *ad = static_cast<AudioTrack *>(t); ERR_FAIL_INDEX(p_idx, ad->values.size()); - ad->values.remove(p_idx); + ad->values.remove_at(p_idx); } break; case TYPE_ANIMATION: { AnimationTrack *an = static_cast<AnimationTrack *>(t); ERR_FAIL_INDEX(p_idx, an->values.size()); - an->values.remove(p_idx); + an->values.remove_at(p_idx); } break; } @@ -1169,6 +1392,21 @@ int Animation::track_find_key(int p_track, double p_time, bool p_exact) const { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + + if (tt->compressed_track >= 0) { + double time; + double time_next; + Vector3i key; + Vector3i key_next; + uint32_t key_index; + bool fetch_compressed_success = _fetch_compressed<3>(tt->compressed_track, p_time, key, time, key_next, time_next, &key_index); + ERR_FAIL_COND_V(!fetch_compressed_success, -1); + if (p_exact && time != p_time) { + return -1; + } + return key_index; + } + int k = _find(tt->positions, p_time); if (k < 0 || k >= tt->positions.size()) { return -1; @@ -1181,6 +1419,21 @@ int Animation::track_find_key(int p_track, double p_time, bool p_exact) const { } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + + if (rt->compressed_track >= 0) { + double time; + double time_next; + Vector3i key; + Vector3i key_next; + uint32_t key_index; + bool fetch_compressed_success = _fetch_compressed<3>(rt->compressed_track, p_time, key, time, key_next, time_next, &key_index); + ERR_FAIL_COND_V(!fetch_compressed_success, -1); + if (p_exact && time != p_time) { + return -1; + } + return key_index; + } + int k = _find(rt->rotations, p_time); if (k < 0 || k >= rt->rotations.size()) { return -1; @@ -1193,6 +1446,21 @@ int Animation::track_find_key(int p_track, double p_time, bool p_exact) const { } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + + if (st->compressed_track >= 0) { + double time; + double time_next; + Vector3i key; + Vector3i key_next; + uint32_t key_index; + bool fetch_compressed_success = _fetch_compressed<3>(st->compressed_track, p_time, key, time, key_next, time_next, &key_index); + ERR_FAIL_COND_V(!fetch_compressed_success, -1); + if (p_exact && time != p_time) { + return -1; + } + return key_index; + } + int k = _find(st->scales, p_time); if (k < 0 || k >= st->scales.size()) { return -1; @@ -1205,6 +1473,21 @@ int Animation::track_find_key(int p_track, double p_time, bool p_exact) const { } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + + if (bst->compressed_track >= 0) { + double time; + double time_next; + Vector3i key; + Vector3i key_next; + uint32_t key_index; + bool fetch_compressed_success = _fetch_compressed<1>(bst->compressed_track, p_time, key, time, key_next, time_next, &key_index); + ERR_FAIL_COND_V(!fetch_compressed_success, -1); + if (p_exact && time != p_time) { + return -1; + } + return key_index; + } + int k = _find(bst->blend_shapes, p_time); if (k < 0 || k >= bst->blend_shapes.size()) { return -1; @@ -1342,7 +1625,7 @@ void Animation::track_insert_key(int p_track, double p_time, const Variant &p_ke BezierTrack *bt = static_cast<BezierTrack *>(t); Array arr = p_key; - ERR_FAIL_COND(arr.size() != 5); + ERR_FAIL_COND(arr.size() != 6); TKey<BezierKey> k; k.time = p_time; @@ -1351,6 +1634,7 @@ void Animation::track_insert_key(int p_track, double p_time, const Variant &p_ke k.value.in_handle.y = arr[2]; k.value.out_handle.x = arr[3]; k.value.out_handle.y = arr[4]; + k.value.handle_mode = static_cast<HandleMode>((int)arr[5]); _insert(p_time, bt->values, k); } break; @@ -1392,18 +1676,30 @@ int Animation::track_get_key_count(int p_track) const { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + if (tt->compressed_track >= 0) { + return _get_compressed_key_count(tt->compressed_track); + } return tt->positions.size(); } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + if (rt->compressed_track >= 0) { + return _get_compressed_key_count(rt->compressed_track); + } return rt->rotations.size(); } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + if (st->compressed_track >= 0) { + return _get_compressed_key_count(st->compressed_track); + } return st->scales.size(); } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + return _get_compressed_key_count(bst->compressed_track); + } return bst->blend_shapes.size(); } break; case TYPE_VALUE: { @@ -1438,28 +1734,24 @@ Variant Animation::track_get_key_value(int p_track, int p_key_idx) const { switch (t->type) { case TYPE_POSITION_3D: { - PositionTrack *tt = static_cast<PositionTrack *>(t); - ERR_FAIL_INDEX_V(p_key_idx, tt->positions.size(), Variant()); - - return tt->positions[p_key_idx].value; + Vector3 value; + position_track_get_key(p_track, p_key_idx, &value); + return value; } break; case TYPE_ROTATION_3D: { - RotationTrack *rt = static_cast<RotationTrack *>(t); - ERR_FAIL_INDEX_V(p_key_idx, rt->rotations.size(), Variant()); - - return rt->rotations[p_key_idx].value; + Quaternion value; + rotation_track_get_key(p_track, p_key_idx, &value); + return value; } break; case TYPE_SCALE_3D: { - ScaleTrack *st = static_cast<ScaleTrack *>(t); - ERR_FAIL_INDEX_V(p_key_idx, st->scales.size(), Variant()); - - return st->scales[p_key_idx].value; + Vector3 value; + scale_track_get_key(p_track, p_key_idx, &value); + return value; } break; case TYPE_BLEND_SHAPE: { - BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); - ERR_FAIL_INDEX_V(p_key_idx, bst->blend_shapes.size(), Variant()); - - return bst->blend_shapes[p_key_idx].value; + float value; + blend_shape_track_get_key(p_track, p_key_idx, &value); + return value; } break; case TYPE_VALUE: { ValueTrack *vt = static_cast<ValueTrack *>(t); @@ -1481,12 +1773,13 @@ Variant Animation::track_get_key_value(int p_track, int p_key_idx) const { ERR_FAIL_INDEX_V(p_key_idx, bt->values.size(), Variant()); Array arr; - arr.resize(5); + arr.resize(6); arr[0] = bt->values[p_key_idx].value.value; arr[1] = bt->values[p_key_idx].value.in_handle.x; arr[2] = bt->values[p_key_idx].value.in_handle.y; arr[3] = bt->values[p_key_idx].value.out_handle.x; arr[4] = bt->values[p_key_idx].value.out_handle.y; + arr[5] = (double)bt->values[p_key_idx].value.handle_mode; return arr; } break; @@ -1520,21 +1813,49 @@ double Animation::track_get_key_time(int p_track, int p_key_idx) const { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + if (tt->compressed_track >= 0) { + Vector3i value; + double time; + bool fetch_compressed_success = _fetch_compressed_by_index<3>(tt->compressed_track, p_key_idx, value, time); + ERR_FAIL_COND_V(!fetch_compressed_success, false); + return time; + } ERR_FAIL_INDEX_V(p_key_idx, tt->positions.size(), -1); return tt->positions[p_key_idx].time; } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + if (rt->compressed_track >= 0) { + Vector3i value; + double time; + bool fetch_compressed_success = _fetch_compressed_by_index<3>(rt->compressed_track, p_key_idx, value, time); + ERR_FAIL_COND_V(!fetch_compressed_success, false); + return time; + } ERR_FAIL_INDEX_V(p_key_idx, rt->rotations.size(), -1); return rt->rotations[p_key_idx].time; } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + if (st->compressed_track >= 0) { + Vector3i value; + double time; + bool fetch_compressed_success = _fetch_compressed_by_index<3>(st->compressed_track, p_key_idx, value, time); + ERR_FAIL_COND_V(!fetch_compressed_success, false); + return time; + } ERR_FAIL_INDEX_V(p_key_idx, st->scales.size(), -1); return st->scales[p_key_idx].time; } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + Vector3i value; + double time; + bool fetch_compressed_success = _fetch_compressed_by_index<1>(bst->compressed_track, p_key_idx, value, time); + ERR_FAIL_COND_V(!fetch_compressed_success, false); + return time; + } ERR_FAIL_INDEX_V(p_key_idx, bst->blend_shapes.size(), -1); return bst->blend_shapes[p_key_idx].time; } break; @@ -1580,37 +1901,41 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->positions.size()); TKey<Vector3> key = tt->positions[p_key_idx]; key.time = p_time; - tt->positions.remove(p_key_idx); + tt->positions.remove_at(p_key_idx); _insert(p_time, tt->positions, key); return; } case TYPE_ROTATION_3D: { RotationTrack *tt = static_cast<RotationTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->rotations.size()); TKey<Quaternion> key = tt->rotations[p_key_idx]; key.time = p_time; - tt->rotations.remove(p_key_idx); + tt->rotations.remove_at(p_key_idx); _insert(p_time, tt->rotations, key); return; } case TYPE_SCALE_3D: { ScaleTrack *tt = static_cast<ScaleTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->scales.size()); TKey<Vector3> key = tt->scales[p_key_idx]; key.time = p_time; - tt->scales.remove(p_key_idx); + tt->scales.remove_at(p_key_idx); _insert(p_time, tt->scales, key); return; } case TYPE_BLEND_SHAPE: { BlendShapeTrack *tt = static_cast<BlendShapeTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->blend_shapes.size()); TKey<float> key = tt->blend_shapes[p_key_idx]; key.time = p_time; - tt->blend_shapes.remove(p_key_idx); + tt->blend_shapes.remove_at(p_key_idx); _insert(p_time, tt->blend_shapes, key); return; } @@ -1619,7 +1944,7 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { ERR_FAIL_INDEX(p_key_idx, vt->values.size()); TKey<Variant> key = vt->values[p_key_idx]; key.time = p_time; - vt->values.remove(p_key_idx); + vt->values.remove_at(p_key_idx); _insert(p_time, vt->values, key); return; } @@ -1628,7 +1953,7 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { ERR_FAIL_INDEX(p_key_idx, mt->methods.size()); MethodKey key = mt->methods[p_key_idx]; key.time = p_time; - mt->methods.remove(p_key_idx); + mt->methods.remove_at(p_key_idx); _insert(p_time, mt->methods, key); return; } @@ -1637,7 +1962,7 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { ERR_FAIL_INDEX(p_key_idx, bt->values.size()); TKey<BezierKey> key = bt->values[p_key_idx]; key.time = p_time; - bt->values.remove(p_key_idx); + bt->values.remove_at(p_key_idx); _insert(p_time, bt->values, key); return; } @@ -1646,7 +1971,7 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { ERR_FAIL_INDEX(p_key_idx, at->values.size()); TKey<AudioKey> key = at->values[p_key_idx]; key.time = p_time; - at->values.remove(p_key_idx); + at->values.remove_at(p_key_idx); _insert(p_time, at->values, key); return; } @@ -1655,7 +1980,7 @@ void Animation::track_set_key_time(int p_track, int p_key_idx, double p_time) { ERR_FAIL_INDEX(p_key_idx, at->values.size()); TKey<StringName> key = at->values[p_key_idx]; key.time = p_time; - at->values.remove(p_key_idx); + at->values.remove_at(p_key_idx); _insert(p_time, at->values, key); return; } @@ -1671,21 +1996,33 @@ real_t Animation::track_get_key_transition(int p_track, int p_key_idx) const { switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + if (tt->compressed_track >= 0) { + return 1.0; + } ERR_FAIL_INDEX_V(p_key_idx, tt->positions.size(), -1); return tt->positions[p_key_idx].transition; } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + if (rt->compressed_track >= 0) { + return 1.0; + } ERR_FAIL_INDEX_V(p_key_idx, rt->rotations.size(), -1); return rt->rotations[p_key_idx].transition; } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + if (st->compressed_track >= 0) { + return 1.0; + } ERR_FAIL_INDEX_V(p_key_idx, st->scales.size(), -1); return st->scales[p_key_idx].transition; } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + return 1.0; + } ERR_FAIL_INDEX_V(p_key_idx, bst->blend_shapes.size(), -1); return bst->blend_shapes[p_key_idx].transition; } break; @@ -1715,6 +2052,35 @@ real_t Animation::track_get_key_transition(int p_track, int p_key_idx) const { ERR_FAIL_V(0); } +bool Animation::track_is_compressed(int p_track) const { + ERR_FAIL_INDEX_V(p_track, tracks.size(), false); + Track *t = tracks[p_track]; + + switch (t->type) { + case TYPE_POSITION_3D: { + PositionTrack *tt = static_cast<PositionTrack *>(t); + return tt->compressed_track >= 0; + } break; + case TYPE_ROTATION_3D: { + RotationTrack *rt = static_cast<RotationTrack *>(t); + return rt->compressed_track >= 0; + } break; + case TYPE_SCALE_3D: { + ScaleTrack *st = static_cast<ScaleTrack *>(t); + return st->compressed_track >= 0; + } break; + case TYPE_BLEND_SHAPE: { + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + return bst->compressed_track >= 0; + } break; + default: { + return false; //animation does not really use transitions + } break; + } + + ERR_FAIL_V(false); +} + void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p_value) { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; @@ -1723,6 +2089,7 @@ void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p case TYPE_POSITION_3D: { ERR_FAIL_COND((p_value.get_type() != Variant::VECTOR3) && (p_value.get_type() != Variant::VECTOR3I)); PositionTrack *tt = static_cast<PositionTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->positions.size()); tt->positions.write[p_key_idx].value = p_value; @@ -1731,6 +2098,7 @@ void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p case TYPE_ROTATION_3D: { ERR_FAIL_COND((p_value.get_type() != Variant::QUATERNION) && (p_value.get_type() != Variant::BASIS)); RotationTrack *rt = static_cast<RotationTrack *>(t); + ERR_FAIL_COND(rt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, rt->rotations.size()); rt->rotations.write[p_key_idx].value = p_value; @@ -1739,6 +2107,7 @@ void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p case TYPE_SCALE_3D: { ERR_FAIL_COND((p_value.get_type() != Variant::VECTOR3) && (p_value.get_type() != Variant::VECTOR3I)); ScaleTrack *st = static_cast<ScaleTrack *>(t); + ERR_FAIL_COND(st->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, st->scales.size()); st->scales.write[p_key_idx].value = p_value; @@ -1747,6 +2116,7 @@ void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p case TYPE_BLEND_SHAPE: { ERR_FAIL_COND((p_value.get_type() != Variant::FLOAT) && (p_value.get_type() != Variant::INT)); BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + ERR_FAIL_COND(bst->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, bst->blend_shapes.size()); bst->blend_shapes.write[p_key_idx].value = p_value; @@ -1778,13 +2148,14 @@ void Animation::track_set_key_value(int p_track, int p_key_idx, const Variant &p ERR_FAIL_INDEX(p_key_idx, bt->values.size()); Array arr = p_value; - ERR_FAIL_COND(arr.size() != 5); + ERR_FAIL_COND(arr.size() != 6); bt->values.write[p_key_idx].value.value = arr[0]; bt->values.write[p_key_idx].value.in_handle.x = arr[1]; bt->values.write[p_key_idx].value.in_handle.y = arr[2]; bt->values.write[p_key_idx].value.out_handle.x = arr[3]; bt->values.write[p_key_idx].value.out_handle.y = arr[4]; + bt->values.write[p_key_idx].value.handle_mode = static_cast<HandleMode>((int)arr[5]); } break; case TYPE_AUDIO: { @@ -1820,21 +2191,25 @@ void Animation::track_set_key_transition(int p_track, int p_key_idx, real_t p_tr switch (t->type) { case TYPE_POSITION_3D: { PositionTrack *tt = static_cast<PositionTrack *>(t); + ERR_FAIL_COND(tt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, tt->positions.size()); tt->positions.write[p_key_idx].transition = p_transition; } break; case TYPE_ROTATION_3D: { RotationTrack *rt = static_cast<RotationTrack *>(t); + ERR_FAIL_COND(rt->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, rt->rotations.size()); rt->rotations.write[p_key_idx].transition = p_transition; } break; case TYPE_SCALE_3D: { ScaleTrack *st = static_cast<ScaleTrack *>(t); + ERR_FAIL_COND(st->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, st->scales.size()); st->scales.write[p_key_idx].transition = p_transition; } break; case TYPE_BLEND_SHAPE: { BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + ERR_FAIL_COND(bst->compressed_track >= 0); ERR_FAIL_INDEX(p_key_idx, bst->blend_shapes.size()); bst->blend_shapes.write[p_key_idx].transition = p_transition; } break; @@ -1861,7 +2236,7 @@ void Animation::track_set_key_transition(int p_track, int p_key_idx, real_t p_tr } template <class K> -int Animation::_find(const Vector<K> &p_keys, double p_time) const { +int Animation::_find(const Vector<K> &p_keys, double p_time, bool p_backward) const { int len = p_keys.size(); if (len == 0) { return -2; @@ -1891,8 +2266,14 @@ int Animation::_find(const Vector<K> &p_keys, double p_time) const { } } - if (keys[middle].time > p_time) { - middle--; + if (!p_backward) { + if (keys[middle].time > p_time) { + middle--; + } + } else { + if (keys[middle].time < p_time) { + middle++; + } } return middle; @@ -1949,10 +2330,11 @@ Variant Animation::_cubic_interpolate(const Variant &p_pre_a, const Variant &p_a real_t t2 = t * t; real_t t3 = t2 * t; - return 0.5f * ((p1 * 2.0f) + - (-p0 + p2) * t + - (2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 + - (-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3); + return 0.5f * + ((p1 * 2.0f) + + (-p0 + p2) * t + + (2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 + + (-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3); } else if ((vformat & (vformat - 1))) { return p_a; //can't interpolate, mix of types @@ -2014,7 +2396,7 @@ real_t Animation::_cubic_interpolate(const real_t &p_pre_a, const real_t &p_a, c } template <class T> -T Animation::_interpolate(const Vector<TKey<T>> &p_keys, double p_time, InterpolationType p_interp, bool p_loop_wrap, bool *p_ok) const { +T Animation::_interpolate(const Vector<TKey<T>> &p_keys, double p_time, InterpolationType p_interp, bool p_loop_wrap, bool *p_ok, bool p_backward) const { int len = _find(p_keys, length) + 1; // try to find last key (there may be more past the end) if (len <= 0) { @@ -2032,7 +2414,7 @@ T Animation::_interpolate(const Vector<TKey<T>> &p_keys, double p_time, Interpol return p_keys[0].value; } - int idx = _find(p_keys, p_time); + int idx = _find(p_keys, p_time, p_backward); ERR_FAIL_COND_V(idx == -2, T()); @@ -2041,24 +2423,42 @@ T Animation::_interpolate(const Vector<TKey<T>> &p_keys, double p_time, Interpol real_t c = 0.0; // prepare for all cases of interpolation - if (loop && p_loop_wrap) { + if ((loop_mode == LOOP_LINEAR || loop_mode == LOOP_PINGPONG) && p_loop_wrap) { // loop - if (idx >= 0) { - if ((idx + 1) < len) { - next = idx + 1; - real_t delta = p_keys[next].time - p_keys[idx].time; - real_t from = p_time - p_keys[idx].time; - - if (Math::is_zero_approx(delta)) { - c = 0; + if (!p_backward) { + // no backward + if (idx >= 0) { + if (idx < len - 1) { + next = idx + 1; + real_t delta = p_keys[next].time - p_keys[idx].time; + real_t from = p_time - p_keys[idx].time; + + if (Math::is_zero_approx(delta)) { + c = 0; + } else { + c = from / delta; + } } else { - c = from / delta; + next = 0; + real_t delta = (length - p_keys[idx].time) + p_keys[next].time; + real_t from = p_time - p_keys[idx].time; + + if (Math::is_zero_approx(delta)) { + c = 0; + } else { + c = from / delta; + } } - } else { + // on loop, behind first key + idx = len - 1; next = 0; - real_t delta = (length - p_keys[idx].time) + p_keys[next].time; - real_t from = p_time - p_keys[idx].time; + real_t endtime = (length - p_keys[idx].time); + if (endtime < 0) { // may be keys past the end + endtime = 0; + } + real_t delta = endtime + p_keys[next].time; + real_t from = endtime + p_time; if (Math::is_zero_approx(delta)) { c = 0; @@ -2066,49 +2466,81 @@ T Animation::_interpolate(const Vector<TKey<T>> &p_keys, double p_time, Interpol c = from / delta; } } - } else { - // on loop, behind first key - idx = len - 1; - next = 0; - real_t endtime = (length - p_keys[idx].time); - if (endtime < 0) { // may be keys past the end - endtime = 0; - } - real_t delta = endtime + p_keys[next].time; - real_t from = endtime + p_time; - - if (Math::is_zero_approx(delta)) { - c = 0; + // backward + if (idx <= len - 1) { + if (idx > 0) { + next = idx - 1; + real_t delta = (length - p_keys[next].time) - (length - p_keys[idx].time); + real_t from = (length - p_time) - (length - p_keys[idx].time); + + if (Math::is_zero_approx(delta)) + c = 0; + else + c = from / delta; + } else { + next = len - 1; + real_t delta = p_keys[idx].time + (length - p_keys[next].time); + real_t from = (length - p_time) - (length - p_keys[idx].time); + + if (Math::is_zero_approx(delta)) + c = 0; + else + c = from / delta; + } } else { - c = from / delta; + // on loop, in front of last key + idx = 0; + next = len - 1; + real_t endtime = p_keys[idx].time; + if (endtime > length) // may be keys past the end + endtime = length; + real_t delta = p_keys[next].time - endtime; + real_t from = p_time - endtime; + + if (Math::is_zero_approx(delta)) + c = 0; + else + c = from / delta; } } - } else { // no loop - - if (idx >= 0) { - if ((idx + 1) < len) { - next = idx + 1; - real_t delta = p_keys[next].time - p_keys[idx].time; - real_t from = p_time - p_keys[idx].time; - - if (Math::is_zero_approx(delta)) { - c = 0; + if (!p_backward) { + if (idx >= 0) { + if (idx < len - 1) { + next = idx + 1; + real_t delta = p_keys[next].time - p_keys[idx].time; + real_t from = p_time - p_keys[idx].time; + + if (Math::is_zero_approx(delta)) { + c = 0; + } else { + c = from / delta; + } } else { - c = from / delta; + next = idx; } - } else { - next = idx; + idx = next = 0; } - } else { - // only allow extending first key to anim start if looping - if (loop) { - idx = next = 0; + if (idx <= len - 1) { + if (idx > 0) { + next = idx - 1; + real_t delta = (length - p_keys[next].time) - (length - p_keys[idx].time); + real_t from = (length - p_time) - (length - p_keys[idx].time); + + if (Math::is_zero_approx(delta)) { + c = 0; + } else { + c = from / delta; + } + + } else { + next = idx; + } } else { - result = false; + idx = next = len - 1; } } } @@ -2212,7 +2644,7 @@ void Animation::_value_track_get_key_indices_in_range(const ValueTrack *vt, doub } } -void Animation::value_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices) const { +void Animation::value_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged) const { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; ERR_FAIL_COND(t->type != TYPE_VALUE); @@ -2226,30 +2658,50 @@ void Animation::value_track_get_key_indices(int p_track, double p_time, double p SWAP(from_time, to_time); } - if (loop) { - from_time = Math::fposmod(from_time, length); - to_time = Math::fposmod(to_time, length); + switch (loop_mode) { + case LOOP_NONE: { + if (from_time < 0) { + from_time = 0; + } + if (from_time > length) { + from_time = length; + } - if (from_time > to_time) { - // handle loop by splitting - _value_track_get_key_indices_in_range(vt, from_time, length, p_indices); - _value_track_get_key_indices_in_range(vt, 0, to_time, p_indices); - return; - } - } else { - if (from_time < 0) { - from_time = 0; - } - if (from_time > length) { - from_time = length; - } + if (to_time < 0) { + to_time = 0; + } + if (to_time > length) { + to_time = length; + } + } break; + case LOOP_LINEAR: { + from_time = Math::fposmod(from_time, length); + to_time = Math::fposmod(to_time, length); - if (to_time < 0) { - to_time = 0; - } - if (to_time > length) { - to_time = length; - } + if (from_time > to_time) { + // handle loop by splitting + _value_track_get_key_indices_in_range(vt, from_time, length, p_indices); + _value_track_get_key_indices_in_range(vt, 0, to_time, p_indices); + return; + } + } break; + case LOOP_PINGPONG: { + from_time = Math::pingpong(from_time, length); + to_time = Math::pingpong(to_time, length); + + if (p_pingponged == -1) { + // handle loop by splitting + _value_track_get_key_indices_in_range(vt, 0, from_time, p_indices); + _value_track_get_key_indices_in_range(vt, 0, to_time, p_indices); + return; + } + if (p_pingponged == 1) { + // handle loop by splitting + _value_track_get_key_indices_in_range(vt, from_time, length, p_indices); + _value_track_get_key_indices_in_range(vt, to_time, length, p_indices); + return; + } + } break; } _value_track_get_key_indices_in_range(vt, from_time, to_time, p_indices); @@ -2308,7 +2760,7 @@ void Animation::_track_get_key_indices_in_range(const Vector<T> &p_array, double } } -void Animation::track_get_key_indices_in_range(int p_track, double p_time, double p_delta, List<int> *p_indices) const { +void Animation::track_get_key_indices_in_range(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged) const { ERR_FAIL_INDEX(p_track, tracks.size()); const Track *t = tracks[p_track]; @@ -2319,137 +2771,309 @@ void Animation::track_get_key_indices_in_range(int p_track, double p_time, doubl SWAP(from_time, to_time); } - if (loop) { - if (from_time > length || from_time < 0) { - from_time = Math::fposmod(from_time, length); - } - - if (to_time > length || to_time < 0) { - to_time = Math::fposmod(to_time, length); - } - - if (from_time > to_time) { - // handle loop by splitting - - switch (t->type) { - case TYPE_POSITION_3D: { - const PositionTrack *tt = static_cast<const PositionTrack *>(t); - _track_get_key_indices_in_range(tt->positions, from_time, length, p_indices); - _track_get_key_indices_in_range(tt->positions, 0, to_time, p_indices); - - } break; - case TYPE_ROTATION_3D: { - const RotationTrack *rt = static_cast<const RotationTrack *>(t); - _track_get_key_indices_in_range(rt->rotations, from_time, length, p_indices); - _track_get_key_indices_in_range(rt->rotations, 0, to_time, p_indices); - - } break; - case TYPE_SCALE_3D: { - const ScaleTrack *st = static_cast<const ScaleTrack *>(t); - _track_get_key_indices_in_range(st->scales, from_time, length, p_indices); - _track_get_key_indices_in_range(st->scales, 0, to_time, p_indices); - - } break; - case TYPE_BLEND_SHAPE: { - const BlendShapeTrack *bst = static_cast<const BlendShapeTrack *>(t); - _track_get_key_indices_in_range(bst->blend_shapes, from_time, length, p_indices); - _track_get_key_indices_in_range(bst->blend_shapes, 0, to_time, p_indices); - - } break; - case TYPE_VALUE: { - const ValueTrack *vt = static_cast<const ValueTrack *>(t); - _track_get_key_indices_in_range(vt->values, from_time, length, p_indices); - _track_get_key_indices_in_range(vt->values, 0, to_time, p_indices); - - } break; - case TYPE_METHOD: { - const MethodTrack *mt = static_cast<const MethodTrack *>(t); - _track_get_key_indices_in_range(mt->methods, from_time, length, p_indices); - _track_get_key_indices_in_range(mt->methods, 0, to_time, p_indices); - - } break; - case TYPE_BEZIER: { - const BezierTrack *bz = static_cast<const BezierTrack *>(t); - _track_get_key_indices_in_range(bz->values, from_time, length, p_indices); - _track_get_key_indices_in_range(bz->values, 0, to_time, p_indices); - - } break; - case TYPE_AUDIO: { - const AudioTrack *ad = static_cast<const AudioTrack *>(t); - _track_get_key_indices_in_range(ad->values, from_time, length, p_indices); - _track_get_key_indices_in_range(ad->values, 0, to_time, p_indices); + switch (loop_mode) { + case LOOP_NONE: { + if (from_time < 0) { + from_time = 0; + } + if (from_time > length) { + from_time = length; + } - } break; - case TYPE_ANIMATION: { - const AnimationTrack *an = static_cast<const AnimationTrack *>(t); - _track_get_key_indices_in_range(an->values, from_time, length, p_indices); - _track_get_key_indices_in_range(an->values, 0, to_time, p_indices); + if (to_time < 0) { + to_time = 0; + } + if (to_time > length) { + to_time = length; + } + } break; + case LOOP_LINEAR: { + if (from_time > length || from_time < 0) { + from_time = Math::fposmod(from_time, length); + } + if (to_time > length || to_time < 0) { + to_time = Math::fposmod(to_time, length); + } - } break; + if (from_time > to_time) { + // handle loop by splitting + switch (t->type) { + case TYPE_POSITION_3D: { + const PositionTrack *tt = static_cast<const PositionTrack *>(t); + if (tt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(tt->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(tt->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(tt->positions, from_time, length, p_indices); + _track_get_key_indices_in_range(tt->positions, 0, to_time, p_indices); + } + } break; + case TYPE_ROTATION_3D: { + const RotationTrack *rt = static_cast<const RotationTrack *>(t); + if (rt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(rt->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(rt->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(rt->rotations, from_time, length, p_indices); + _track_get_key_indices_in_range(rt->rotations, 0, to_time, p_indices); + } + } break; + case TYPE_SCALE_3D: { + const ScaleTrack *st = static_cast<const ScaleTrack *>(t); + if (st->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(st->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(st->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(st->scales, from_time, length, p_indices); + _track_get_key_indices_in_range(st->scales, 0, to_time, p_indices); + } + } break; + case TYPE_BLEND_SHAPE: { + const BlendShapeTrack *bst = static_cast<const BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + _get_compressed_key_indices_in_range<1>(bst->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<1>(bst->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(bst->blend_shapes, from_time, length, p_indices); + _track_get_key_indices_in_range(bst->blend_shapes, 0, to_time, p_indices); + } + } break; + case TYPE_VALUE: { + const ValueTrack *vt = static_cast<const ValueTrack *>(t); + _track_get_key_indices_in_range(vt->values, from_time, length, p_indices); + _track_get_key_indices_in_range(vt->values, 0, to_time, p_indices); + } break; + case TYPE_METHOD: { + const MethodTrack *mt = static_cast<const MethodTrack *>(t); + _track_get_key_indices_in_range(mt->methods, from_time, length, p_indices); + _track_get_key_indices_in_range(mt->methods, 0, to_time, p_indices); + } break; + case TYPE_BEZIER: { + const BezierTrack *bz = static_cast<const BezierTrack *>(t); + _track_get_key_indices_in_range(bz->values, from_time, length, p_indices); + _track_get_key_indices_in_range(bz->values, 0, to_time, p_indices); + } break; + case TYPE_AUDIO: { + const AudioTrack *ad = static_cast<const AudioTrack *>(t); + _track_get_key_indices_in_range(ad->values, from_time, length, p_indices); + _track_get_key_indices_in_range(ad->values, 0, to_time, p_indices); + } break; + case TYPE_ANIMATION: { + const AnimationTrack *an = static_cast<const AnimationTrack *>(t); + _track_get_key_indices_in_range(an->values, from_time, length, p_indices); + _track_get_key_indices_in_range(an->values, 0, to_time, p_indices); + } break; + } + return; + } + } break; + case LOOP_PINGPONG: { + if (from_time > length || from_time < 0) { + from_time = Math::pingpong(from_time, length); + } + if (to_time > length || to_time < 0) { + to_time = Math::pingpong(to_time, length); } - return; - } - } else { - if (from_time < 0) { - from_time = 0; - } - if (from_time > length) { - from_time = length; - } - if (to_time < 0) { - to_time = 0; - } - if (to_time > length) { - to_time = length; - } + if ((int)Math::floor(abs(p_delta) / length) % 2 == 0) { + if (p_pingponged == -1) { + // handle loop by splitting + switch (t->type) { + case TYPE_POSITION_3D: { + const PositionTrack *tt = static_cast<const PositionTrack *>(t); + if (tt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(tt->compressed_track, 0, from_time, p_indices); + _get_compressed_key_indices_in_range<3>(tt->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(tt->positions, 0, from_time, p_indices); + _track_get_key_indices_in_range(tt->positions, 0, to_time, p_indices); + } + } break; + case TYPE_ROTATION_3D: { + const RotationTrack *rt = static_cast<const RotationTrack *>(t); + if (rt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(rt->compressed_track, 0, from_time, p_indices); + _get_compressed_key_indices_in_range<3>(rt->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(rt->rotations, 0, from_time, p_indices); + _track_get_key_indices_in_range(rt->rotations, 0, to_time, p_indices); + } + } break; + case TYPE_SCALE_3D: { + const ScaleTrack *st = static_cast<const ScaleTrack *>(t); + if (st->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(st->compressed_track, 0, from_time, p_indices); + _get_compressed_key_indices_in_range<3>(st->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(st->scales, 0, from_time, p_indices); + _track_get_key_indices_in_range(st->scales, 0, to_time, p_indices); + } + } break; + case TYPE_BLEND_SHAPE: { + const BlendShapeTrack *bst = static_cast<const BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + _get_compressed_key_indices_in_range<1>(bst->compressed_track, 0, from_time, p_indices); + _get_compressed_key_indices_in_range<1>(bst->compressed_track, 0, to_time, p_indices); + } else { + _track_get_key_indices_in_range(bst->blend_shapes, 0, from_time, p_indices); + _track_get_key_indices_in_range(bst->blend_shapes, 0, to_time, p_indices); + } + } break; + case TYPE_VALUE: { + const ValueTrack *vt = static_cast<const ValueTrack *>(t); + _track_get_key_indices_in_range(vt->values, 0, from_time, p_indices); + _track_get_key_indices_in_range(vt->values, 0, to_time, p_indices); + } break; + case TYPE_METHOD: { + const MethodTrack *mt = static_cast<const MethodTrack *>(t); + _track_get_key_indices_in_range(mt->methods, 0, from_time, p_indices); + _track_get_key_indices_in_range(mt->methods, 0, to_time, p_indices); + } break; + case TYPE_BEZIER: { + const BezierTrack *bz = static_cast<const BezierTrack *>(t); + _track_get_key_indices_in_range(bz->values, 0, from_time, p_indices); + _track_get_key_indices_in_range(bz->values, 0, to_time, p_indices); + } break; + case TYPE_AUDIO: { + const AudioTrack *ad = static_cast<const AudioTrack *>(t); + _track_get_key_indices_in_range(ad->values, 0, from_time, p_indices); + _track_get_key_indices_in_range(ad->values, 0, to_time, p_indices); + } break; + case TYPE_ANIMATION: { + const AnimationTrack *an = static_cast<const AnimationTrack *>(t); + _track_get_key_indices_in_range(an->values, 0, from_time, p_indices); + _track_get_key_indices_in_range(an->values, 0, to_time, p_indices); + } break; + } + return; + } + if (p_pingponged == 1) { + // handle loop by splitting + switch (t->type) { + case TYPE_POSITION_3D: { + const PositionTrack *tt = static_cast<const PositionTrack *>(t); + if (tt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(tt->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(tt->compressed_track, to_time, length, p_indices); + } else { + _track_get_key_indices_in_range(tt->positions, from_time, length, p_indices); + _track_get_key_indices_in_range(tt->positions, to_time, length, p_indices); + } + } break; + case TYPE_ROTATION_3D: { + const RotationTrack *rt = static_cast<const RotationTrack *>(t); + if (rt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(rt->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(rt->compressed_track, to_time, length, p_indices); + } else { + _track_get_key_indices_in_range(rt->rotations, from_time, length, p_indices); + _track_get_key_indices_in_range(rt->rotations, to_time, length, p_indices); + } + } break; + case TYPE_SCALE_3D: { + const ScaleTrack *st = static_cast<const ScaleTrack *>(t); + if (st->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(st->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<3>(st->compressed_track, to_time, length, p_indices); + } else { + _track_get_key_indices_in_range(st->scales, from_time, length, p_indices); + _track_get_key_indices_in_range(st->scales, to_time, length, p_indices); + } + } break; + case TYPE_BLEND_SHAPE: { + const BlendShapeTrack *bst = static_cast<const BlendShapeTrack *>(t); + if (bst->compressed_track >= 0) { + _get_compressed_key_indices_in_range<1>(bst->compressed_track, from_time, length, p_indices); + _get_compressed_key_indices_in_range<1>(bst->compressed_track, to_time, length, p_indices); + } else { + _track_get_key_indices_in_range(bst->blend_shapes, from_time, length, p_indices); + _track_get_key_indices_in_range(bst->blend_shapes, to_time, length, p_indices); + } + } break; + case TYPE_VALUE: { + const ValueTrack *vt = static_cast<const ValueTrack *>(t); + _track_get_key_indices_in_range(vt->values, from_time, length, p_indices); + _track_get_key_indices_in_range(vt->values, to_time, length, p_indices); + } break; + case TYPE_METHOD: { + const MethodTrack *mt = static_cast<const MethodTrack *>(t); + _track_get_key_indices_in_range(mt->methods, from_time, length, p_indices); + _track_get_key_indices_in_range(mt->methods, to_time, length, p_indices); + } break; + case TYPE_BEZIER: { + const BezierTrack *bz = static_cast<const BezierTrack *>(t); + _track_get_key_indices_in_range(bz->values, from_time, length, p_indices); + _track_get_key_indices_in_range(bz->values, to_time, length, p_indices); + } break; + case TYPE_AUDIO: { + const AudioTrack *ad = static_cast<const AudioTrack *>(t); + _track_get_key_indices_in_range(ad->values, from_time, length, p_indices); + _track_get_key_indices_in_range(ad->values, to_time, length, p_indices); + } break; + case TYPE_ANIMATION: { + const AnimationTrack *an = static_cast<const AnimationTrack *>(t); + _track_get_key_indices_in_range(an->values, from_time, length, p_indices); + _track_get_key_indices_in_range(an->values, to_time, length, p_indices); + } break; + } + return; + } + } + } break; } switch (t->type) { case TYPE_POSITION_3D: { const PositionTrack *tt = static_cast<const PositionTrack *>(t); - _track_get_key_indices_in_range(tt->positions, from_time, to_time, p_indices); - + if (tt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(tt->compressed_track, from_time, to_time - from_time, p_indices); + } else { + _track_get_key_indices_in_range(tt->positions, from_time, to_time, p_indices); + } } break; case TYPE_ROTATION_3D: { const RotationTrack *rt = static_cast<const RotationTrack *>(t); - _track_get_key_indices_in_range(rt->rotations, from_time, to_time, p_indices); - + if (rt->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(rt->compressed_track, from_time, to_time - from_time, p_indices); + } else { + _track_get_key_indices_in_range(rt->rotations, from_time, to_time, p_indices); + } } break; case TYPE_SCALE_3D: { const ScaleTrack *st = static_cast<const ScaleTrack *>(t); - _track_get_key_indices_in_range(st->scales, from_time, to_time, p_indices); - + if (st->compressed_track >= 0) { + _get_compressed_key_indices_in_range<3>(st->compressed_track, from_time, to_time - from_time, p_indices); + } else { + _track_get_key_indices_in_range(st->scales, from_time, to_time, p_indices); + } } break; case TYPE_BLEND_SHAPE: { const BlendShapeTrack *bst = static_cast<const BlendShapeTrack *>(t); - _track_get_key_indices_in_range(bst->blend_shapes, from_time, to_time, p_indices); - + if (bst->compressed_track >= 0) { + _get_compressed_key_indices_in_range<1>(bst->compressed_track, from_time, to_time - from_time, p_indices); + } else { + _track_get_key_indices_in_range(bst->blend_shapes, from_time, to_time, p_indices); + } } break; case TYPE_VALUE: { const ValueTrack *vt = static_cast<const ValueTrack *>(t); _track_get_key_indices_in_range(vt->values, from_time, to_time, p_indices); - } break; case TYPE_METHOD: { const MethodTrack *mt = static_cast<const MethodTrack *>(t); _track_get_key_indices_in_range(mt->methods, from_time, to_time, p_indices); - } break; case TYPE_BEZIER: { const BezierTrack *bz = static_cast<const BezierTrack *>(t); _track_get_key_indices_in_range(bz->values, from_time, to_time, p_indices); - } break; case TYPE_AUDIO: { const AudioTrack *ad = static_cast<const AudioTrack *>(t); _track_get_key_indices_in_range(ad->values, from_time, to_time, p_indices); - } break; case TYPE_ANIMATION: { const AnimationTrack *an = static_cast<const AnimationTrack *>(t); _track_get_key_indices_in_range(an->values, from_time, to_time, p_indices); - } break; } } @@ -2487,7 +3111,7 @@ void Animation::_method_track_get_key_indices_in_range(const MethodTrack *mt, do } } -void Animation::method_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices) const { +void Animation::method_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged) const { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; ERR_FAIL_COND(t->type != TYPE_METHOD); @@ -2501,35 +3125,58 @@ void Animation::method_track_get_key_indices(int p_track, double p_time, double SWAP(from_time, to_time); } - if (loop) { - if (from_time > length || from_time < 0) { - from_time = Math::fposmod(from_time, length); - } + switch (loop_mode) { + case LOOP_NONE: { + if (from_time < 0) { + from_time = 0; + } + if (from_time > length) { + from_time = length; + } - if (to_time > length || to_time < 0) { - to_time = Math::fposmod(to_time, length); - } + if (to_time < 0) { + to_time = 0; + } + if (to_time > length) { + to_time = length; + } + } break; + case LOOP_LINEAR: { + if (from_time > length || from_time < 0) { + from_time = Math::fposmod(from_time, length); + } + if (to_time > length || to_time < 0) { + to_time = Math::fposmod(to_time, length); + } - if (from_time > to_time) { - // handle loop by splitting - _method_track_get_key_indices_in_range(mt, from_time, length, p_indices); - _method_track_get_key_indices_in_range(mt, 0, to_time, p_indices); - return; - } - } else { - if (from_time < 0) { - from_time = 0; - } - if (from_time > length) { - from_time = length; - } + if (from_time > to_time) { + // handle loop by splitting + _method_track_get_key_indices_in_range(mt, from_time, length, p_indices); + _method_track_get_key_indices_in_range(mt, 0, to_time, p_indices); + return; + } + } break; + case LOOP_PINGPONG: { + if (from_time > length || from_time < 0) { + from_time = Math::pingpong(from_time, length); + } + if (to_time > length || to_time < 0) { + to_time = Math::pingpong(to_time, length); + } - if (to_time < 0) { - to_time = 0; - } - if (to_time > length) { - to_time = length; - } + if (p_pingponged == -1) { + _method_track_get_key_indices_in_range(mt, 0, from_time, p_indices); + _method_track_get_key_indices_in_range(mt, 0, to_time, p_indices); + return; + } + if (p_pingponged == 1) { + _method_track_get_key_indices_in_range(mt, from_time, length, p_indices); + _method_track_get_key_indices_in_range(mt, to_time, length, p_indices); + return; + } + } break; + default: + break; } _method_track_get_key_indices_in_range(mt, from_time, to_time, p_indices); @@ -2561,7 +3208,7 @@ StringName Animation::method_track_get_name(int p_track, int p_key_idx) const { return pm->methods[p_key_idx].method; } -int Animation::bezier_track_insert_key(int p_track, double p_time, real_t p_value, const Vector2 &p_in_handle, const Vector2 &p_out_handle) { +int Animation::bezier_track_insert_key(int p_track, double p_time, real_t p_value, const Vector2 &p_in_handle, const Vector2 &p_out_handle, const HandleMode p_handle_mode) { ERR_FAIL_INDEX_V(p_track, tracks.size(), -1); Track *t = tracks[p_track]; ERR_FAIL_COND_V(t->type != TYPE_BEZIER, -1); @@ -2579,6 +3226,7 @@ int Animation::bezier_track_insert_key(int p_track, double p_time, real_t p_valu if (k.value.out_handle.x < 0) { k.value.out_handle.x = 0; } + k.value.handle_mode = p_handle_mode; int key = _insert(p_time, bt->values, k); @@ -2587,6 +3235,30 @@ int Animation::bezier_track_insert_key(int p_track, double p_time, real_t p_valu return key; } +void Animation::bezier_track_set_key_handle_mode(int p_track, int p_index, HandleMode p_mode, double p_balanced_value_time_ratio) { + ERR_FAIL_INDEX(p_track, tracks.size()); + Track *t = tracks[p_track]; + ERR_FAIL_COND(t->type != TYPE_BEZIER); + + BezierTrack *bt = static_cast<BezierTrack *>(t); + + ERR_FAIL_INDEX(p_index, bt->values.size()); + + bt->values.write[p_index].value.handle_mode = p_mode; + + if (p_mode == HANDLE_MODE_BALANCED) { + Transform2D xform; + xform.set_scale(Vector2(1.0, 1.0 / p_balanced_value_time_ratio)); + + Vector2 vec_in = xform.xform(bt->values[p_index].value.in_handle); + Vector2 vec_out = xform.xform(bt->values[p_index].value.out_handle); + + bt->values.write[p_index].value.in_handle = xform.affine_inverse().xform(-vec_out.normalized() * vec_in.length()); + } + + emit_changed(); +} + void Animation::bezier_track_set_key_value(int p_track, int p_index, real_t p_value) { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; @@ -2600,7 +3272,7 @@ void Animation::bezier_track_set_key_value(int p_track, int p_index, real_t p_va emit_changed(); } -void Animation::bezier_track_set_key_in_handle(int p_track, int p_index, const Vector2 &p_handle) { +void Animation::bezier_track_set_key_in_handle(int p_track, int p_index, const Vector2 &p_handle, double p_balanced_value_time_ratio) { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; ERR_FAIL_COND(t->type != TYPE_BEZIER); @@ -2609,14 +3281,26 @@ void Animation::bezier_track_set_key_in_handle(int p_track, int p_index, const V ERR_FAIL_INDEX(p_index, bt->values.size()); - bt->values.write[p_index].value.in_handle = p_handle; - if (bt->values[p_index].value.in_handle.x > 0) { - bt->values.write[p_index].value.in_handle.x = 0; + Vector2 in_handle = p_handle; + if (in_handle.x > 0) { + in_handle.x = 0; + } + bt->values.write[p_index].value.in_handle = in_handle; + + if (bt->values[p_index].value.handle_mode == HANDLE_MODE_BALANCED) { + Transform2D xform; + xform.set_scale(Vector2(1.0, 1.0 / p_balanced_value_time_ratio)); + + Vector2 vec_out = xform.xform(bt->values[p_index].value.out_handle); + Vector2 vec_in = xform.xform(in_handle); + + bt->values.write[p_index].value.out_handle = xform.affine_inverse().xform(-vec_in.normalized() * vec_out.length()); } + emit_changed(); } -void Animation::bezier_track_set_key_out_handle(int p_track, int p_index, const Vector2 &p_handle) { +void Animation::bezier_track_set_key_out_handle(int p_track, int p_index, const Vector2 &p_handle, double p_balanced_value_time_ratio) { ERR_FAIL_INDEX(p_track, tracks.size()); Track *t = tracks[p_track]; ERR_FAIL_COND(t->type != TYPE_BEZIER); @@ -2625,10 +3309,22 @@ void Animation::bezier_track_set_key_out_handle(int p_track, int p_index, const ERR_FAIL_INDEX(p_index, bt->values.size()); - bt->values.write[p_index].value.out_handle = p_handle; - if (bt->values[p_index].value.out_handle.x < 0) { - bt->values.write[p_index].value.out_handle.x = 0; + Vector2 out_handle = p_handle; + if (out_handle.x < 0) { + out_handle.x = 0; } + bt->values.write[p_index].value.out_handle = out_handle; + + if (bt->values[p_index].value.handle_mode == HANDLE_MODE_BALANCED) { + Transform2D xform; + xform.set_scale(Vector2(1.0, 1.0 / p_balanced_value_time_ratio)); + + Vector2 vec_in = xform.xform(bt->values[p_index].value.in_handle); + Vector2 vec_out = xform.xform(out_handle); + + bt->values.write[p_index].value.in_handle = xform.affine_inverse().xform(-vec_out.normalized() * vec_in.length()); + } + emit_changed(); } @@ -2644,6 +3340,18 @@ real_t Animation::bezier_track_get_key_value(int p_track, int p_index) const { return bt->values[p_index].value.value; } +int Animation::bezier_track_get_key_handle_mode(int p_track, int p_index) const { + ERR_FAIL_INDEX_V(p_track, tracks.size(), 0); + Track *t = tracks[p_track]; + ERR_FAIL_COND_V(t->type != TYPE_BEZIER, 0); + + BezierTrack *bt = static_cast<BezierTrack *>(t); + + ERR_FAIL_INDEX_V(p_index, bt->values.size(), 0); + + return bt->values[p_index].value.handle_mode; +} + Vector2 Animation::bezier_track_get_key_in_handle(int p_track, int p_index) const { ERR_FAIL_INDEX_V(p_track, tracks.size(), Vector2()); Track *t = tracks[p_track]; @@ -2915,13 +3623,13 @@ real_t Animation::get_length() const { return length; } -void Animation::set_loop(bool p_enabled) { - loop = p_enabled; +void Animation::set_loop_mode(Animation::LoopMode p_loop_mode) { + loop_mode = p_loop_mode; emit_changed(); } -bool Animation::has_loop() const { - return loop; +Animation::LoopMode Animation::get_loop_mode() const { + return loop_mode; } void Animation::track_set_imported(int p_track, bool p_imported) { @@ -2971,7 +3679,7 @@ void Animation::track_move_to(int p_track, int p_to_index) { } Track *track = tracks.get(p_track); - tracks.remove(p_track); + tracks.remove_at(p_track); // Take into account that the position of the tracks that come after the one removed will change. tracks.insert(p_to_index > p_track ? p_to_index - 1 : p_to_index, track); @@ -3027,7 +3735,7 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("track_get_type", "track_idx"), &Animation::track_get_type); ClassDB::bind_method(D_METHOD("track_get_path", "track_idx"), &Animation::track_get_path); ClassDB::bind_method(D_METHOD("track_set_path", "track_idx", "path"), &Animation::track_set_path); - ClassDB::bind_method(D_METHOD("find_track", "path"), &Animation::find_track); + ClassDB::bind_method(D_METHOD("find_track", "path", "type"), &Animation::find_track); ClassDB::bind_method(D_METHOD("track_move_up", "track_idx"), &Animation::track_move_up); ClassDB::bind_method(D_METHOD("track_move_down", "track_idx"), &Animation::track_move_down); @@ -3064,6 +3772,8 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("track_set_interpolation_loop_wrap", "track_idx", "interpolation"), &Animation::track_set_interpolation_loop_wrap); ClassDB::bind_method(D_METHOD("track_get_interpolation_loop_wrap", "track_idx"), &Animation::track_get_interpolation_loop_wrap); + ClassDB::bind_method(D_METHOD("track_is_compressed", "track_idx"), &Animation::track_is_compressed); + ClassDB::bind_method(D_METHOD("value_track_set_update_mode", "track_idx", "mode"), &Animation::value_track_set_update_mode); ClassDB::bind_method(D_METHOD("value_track_get_update_mode", "track_idx"), &Animation::value_track_get_update_mode); @@ -3074,11 +3784,11 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("method_track_get_name", "track_idx", "key_idx"), &Animation::method_track_get_name); ClassDB::bind_method(D_METHOD("method_track_get_params", "track_idx", "key_idx"), &Animation::method_track_get_params); - ClassDB::bind_method(D_METHOD("bezier_track_insert_key", "track_idx", "time", "value", "in_handle", "out_handle"), &Animation::bezier_track_insert_key, DEFVAL(Vector2()), DEFVAL(Vector2())); + ClassDB::bind_method(D_METHOD("bezier_track_insert_key", "track_idx", "time", "value", "in_handle", "out_handle", "handle_mode"), &Animation::bezier_track_insert_key, DEFVAL(Vector2()), DEFVAL(Vector2()), DEFVAL(Animation::HandleMode::HANDLE_MODE_BALANCED)); ClassDB::bind_method(D_METHOD("bezier_track_set_key_value", "track_idx", "key_idx", "value"), &Animation::bezier_track_set_key_value); - ClassDB::bind_method(D_METHOD("bezier_track_set_key_in_handle", "track_idx", "key_idx", "in_handle"), &Animation::bezier_track_set_key_in_handle); - ClassDB::bind_method(D_METHOD("bezier_track_set_key_out_handle", "track_idx", "key_idx", "out_handle"), &Animation::bezier_track_set_key_out_handle); + ClassDB::bind_method(D_METHOD("bezier_track_set_key_in_handle", "track_idx", "key_idx", "in_handle", "balanced_value_time_ratio"), &Animation::bezier_track_set_key_in_handle, DEFVAL(1.0)); + ClassDB::bind_method(D_METHOD("bezier_track_set_key_out_handle", "track_idx", "key_idx", "out_handle", "balanced_value_time_ratio"), &Animation::bezier_track_set_key_out_handle, DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("bezier_track_get_key_value", "track_idx", "key_idx"), &Animation::bezier_track_get_key_value); ClassDB::bind_method(D_METHOD("bezier_track_get_key_in_handle", "track_idx", "key_idx"), &Animation::bezier_track_get_key_in_handle); @@ -3094,6 +3804,9 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("audio_track_get_key_start_offset", "track_idx", "key_idx"), &Animation::audio_track_get_key_start_offset); ClassDB::bind_method(D_METHOD("audio_track_get_key_end_offset", "track_idx", "key_idx"), &Animation::audio_track_get_key_end_offset); + ClassDB::bind_method(D_METHOD("bezier_track_set_key_handle_mode", "track_idx", "key_idx", "key_handle_mode", "balanced_value_time_ratio"), &Animation::bezier_track_set_key_handle_mode, DEFVAL(1.0)); + ClassDB::bind_method(D_METHOD("bezier_track_get_key_handle_mode", "track_idx", "key_idx"), &Animation::bezier_track_get_key_handle_mode); + ClassDB::bind_method(D_METHOD("animation_track_insert_key", "track_idx", "time", "animation"), &Animation::animation_track_insert_key); ClassDB::bind_method(D_METHOD("animation_track_set_key_animation", "track_idx", "key_idx", "animation"), &Animation::animation_track_set_key_animation); ClassDB::bind_method(D_METHOD("animation_track_get_key_animation", "track_idx", "key_idx"), &Animation::animation_track_get_key_animation); @@ -3101,8 +3814,8 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("set_length", "time_sec"), &Animation::set_length); ClassDB::bind_method(D_METHOD("get_length"), &Animation::get_length); - ClassDB::bind_method(D_METHOD("set_loop", "enabled"), &Animation::set_loop); - ClassDB::bind_method(D_METHOD("has_loop"), &Animation::has_loop); + ClassDB::bind_method(D_METHOD("set_loop_mode", "loop_mode"), &Animation::set_loop_mode); + ClassDB::bind_method(D_METHOD("get_loop_mode"), &Animation::get_loop_mode); ClassDB::bind_method(D_METHOD("set_step", "size_sec"), &Animation::set_step); ClassDB::bind_method(D_METHOD("get_step"), &Animation::get_step); @@ -3110,8 +3823,10 @@ void Animation::_bind_methods() { ClassDB::bind_method(D_METHOD("clear"), &Animation::clear); ClassDB::bind_method(D_METHOD("copy_track", "track_idx", "to_animation"), &Animation::copy_track); + ClassDB::bind_method(D_METHOD("compress", "page_size", "fps", "split_tolerance"), &Animation::compress, DEFVAL(8192), DEFVAL(120), DEFVAL(4.0)); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "length", PROPERTY_HINT_RANGE, "0.001,99999,0.001"), "set_length", "get_length"); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "loop"), "set_loop", "has_loop"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "loop_mode"), "set_loop_mode", "get_loop_mode"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "step", PROPERTY_HINT_RANGE, "0,4096,0.001"), "set_step", "get_step"); ADD_SIGNAL(MethodInfo("tracks_changed")); @@ -3134,6 +3849,13 @@ void Animation::_bind_methods() { BIND_ENUM_CONSTANT(UPDATE_DISCRETE); BIND_ENUM_CONSTANT(UPDATE_TRIGGER); BIND_ENUM_CONSTANT(UPDATE_CAPTURE); + + BIND_ENUM_CONSTANT(LOOP_NONE); + BIND_ENUM_CONSTANT(LOOP_LINEAR); + BIND_ENUM_CONSTANT(LOOP_PINGPONG); + + BIND_ENUM_CONSTANT(HANDLE_MODE_FREE); + BIND_ENUM_CONSTANT(HANDLE_MODE_BALANCED); } void Animation::clear() { @@ -3141,8 +3863,12 @@ void Animation::clear() { memdelete(tracks[i]); } tracks.clear(); - loop = false; + loop_mode = LOOP_NONE; length = 1; + compression.enabled = false; + compression.bounds.clear(); + compression.pages.clear(); + compression.fps = 120; emit_changed(); emit_signal(SceneStringNames::get_singleton()->tracks_changed); } @@ -3272,13 +3998,12 @@ bool Animation::_blend_shape_track_optimize_key(const TKey<float> &t0, const TKe float v1 = t1.value; float v2 = t2.value; - if (Math::is_equal_approx(v1, v2, p_allowed_unit_error)) { + if (Math::is_equal_approx(v1, v2, (float)p_allowed_unit_error)) { //0 and 2 are close, let's see if 1 is close - if (!Math::is_equal_approx(v0, v1, p_allowed_unit_error)) { + if (!Math::is_equal_approx(v0, v1, (float)p_allowed_unit_error)) { //not close, not optimizable return false; } - } else { /* TODO eventually discuss a way to optimize these better. @@ -3332,7 +4057,7 @@ void Animation::_position_track_optimize(int p_idx, real_t p_allowed_linear_err, prev_erased = true; } - tt->positions.remove(i); + tt->positions.remove_at(i); i--; } else { @@ -3367,7 +4092,7 @@ void Animation::_rotation_track_optimize(int p_idx, real_t p_allowed_angular_err prev_erased = true; } - tt->rotations.remove(i); + tt->rotations.remove_at(i); i--; } else { @@ -3401,7 +4126,7 @@ void Animation::_scale_track_optimize(int p_idx, real_t p_allowed_linear_err) { prev_erased = true; } - tt->scales.remove(i); + tt->scales.remove_at(i); i--; } else { @@ -3436,7 +4161,7 @@ void Animation::_blend_shape_track_optimize(int p_idx, real_t p_allowed_linear_e prev_erased = true; } - tt->blend_shapes.remove(i); + tt->blend_shapes.remove_at(i); i--; } else { @@ -3447,6 +4172,9 @@ void Animation::_blend_shape_track_optimize(int p_idx, real_t p_allowed_linear_e void Animation::optimize(real_t p_allowed_linear_err, real_t p_allowed_angular_err, real_t p_max_optimizable_angle) { for (int i = 0; i < tracks.size(); i++) { + if (track_is_compressed(i)) { + continue; //not possible to optimize compressed track + } if (tracks[i]->type == TYPE_POSITION_3D) { _position_track_optimize(i, p_allowed_linear_err, p_allowed_angular_err); } else if (tracks[i]->type == TYPE_ROTATION_3D) { @@ -3459,6 +4187,1154 @@ void Animation::optimize(real_t p_allowed_linear_err, real_t p_allowed_angular_e } } +#define print_animc(m_str) +//#define print_animc(m_str) print_line(m_str); + +struct AnimationCompressionDataState { + enum { + MIN_OPTIMIZE_PACKETS = 5, + MAX_PACKETS = 16 + }; + + uint32_t components = 3; + LocalVector<uint8_t> data; //commited packets + struct PacketData { + int32_t data[3] = { 0, 0, 0 }; + uint32_t frame = 0; + }; + + float split_tolerance = 1.5; + + LocalVector<PacketData> temp_packets; + + //used for rollback if the new frame does not fit + int32_t validated_packet_count = -1; + + static int32_t _compute_delta16_signed(int32_t p_from, int32_t p_to) { + int32_t delta = p_to - p_from; + if (delta > 32767) { + return delta - 65536; // use wrap around + } else if (delta < -32768) { + return 65536 + delta; // use wrap around + } + return delta; + } + + static uint32_t _compute_shift_bits_signed(int32_t p_delta) { + if (p_delta == 0) { + return 0; + } else if (p_delta < 0) { + p_delta = ABS(p_delta) - 1; + if (p_delta == 0) { + return 1; + } + } + return nearest_shift(p_delta); + } + + void _compute_max_shifts(uint32_t p_from, uint32_t p_to, uint32_t *max_shifts, uint32_t &max_frame_delta_shift) const { + for (uint32_t j = 0; j < components; j++) { + max_shifts[j] = 0; + } + max_frame_delta_shift = 0; + + for (uint32_t i = p_from + 1; i <= p_to; i++) { + int32_t frame_delta = temp_packets[i].frame - temp_packets[i - 1].frame; + max_frame_delta_shift = MAX(max_frame_delta_shift, nearest_shift(frame_delta)); + for (uint32_t j = 0; j < components; j++) { + int32_t diff = _compute_delta16_signed(temp_packets[i - 1].data[j], temp_packets[i].data[j]); + uint32_t shift = _compute_shift_bits_signed(diff); + max_shifts[j] = MAX(shift, max_shifts[j]); + } + } + } + + bool insert_key(uint32_t p_frame, const Vector3i &p_key) { + if (temp_packets.size() == MAX_PACKETS) { + commit_temp_packets(); + } + PacketData packet; + packet.frame = p_frame; + for (int i = 0; i < 3; i++) { + ERR_FAIL_COND_V(p_key[i] > 65535, false); // Sanity check + packet.data[i] = p_key[i]; + } + + temp_packets.push_back(packet); + + if (temp_packets.size() >= MIN_OPTIMIZE_PACKETS) { + uint32_t max_shifts[3] = { 0, 0, 0 }; // Base sizes, 16 bit + uint32_t max_frame_delta_shift = 0; + // Compute the average shift before the packet was added + _compute_max_shifts(0, temp_packets.size() - 2, max_shifts, max_frame_delta_shift); + + float prev_packet_size_avg = 0; + prev_packet_size_avg = float(1 << max_frame_delta_shift); + for (uint32_t i = 0; i < components; i++) { + prev_packet_size_avg += float(1 << max_shifts[i]); + } + prev_packet_size_avg /= float(1 + components); + + _compute_max_shifts(temp_packets.size() - 2, temp_packets.size() - 1, max_shifts, max_frame_delta_shift); + + float new_packet_size_avg = 0; + new_packet_size_avg = float(1 << max_frame_delta_shift); + for (uint32_t i = 0; i < components; i++) { + new_packet_size_avg += float(1 << max_shifts[i]); + } + new_packet_size_avg /= float(1 + components); + + print_animc("packet count: " + rtos(temp_packets.size() - 1) + " size avg " + rtos(prev_packet_size_avg) + " new avg " + rtos(new_packet_size_avg)); + float ratio = (prev_packet_size_avg < new_packet_size_avg) ? (new_packet_size_avg / prev_packet_size_avg) : (prev_packet_size_avg / new_packet_size_avg); + + if (ratio > split_tolerance) { + print_animc("split!"); + temp_packets.resize(temp_packets.size() - 1); + commit_temp_packets(); + temp_packets.push_back(packet); + } + } + + return temp_packets.size() == 1; // First key + } + + uint32_t get_temp_packet_size() const { + if (temp_packets.size() == 0) { + return 0; + } else if (temp_packets.size() == 1) { + return components == 1 ? 4 : 8; // 1 component packet is 16 bits and 16 bits unused. 3 component packets is 48 bits and 16 bits unused + } + uint32_t max_shifts[3] = { 0, 0, 0 }; //base sizes, 16 bit + uint32_t max_frame_delta_shift = 0; + + _compute_max_shifts(0, temp_packets.size() - 1, max_shifts, max_frame_delta_shift); + + uint32_t size_bits = 16; //base value (all 4 bits of shift sizes for x,y,z,time) + size_bits += max_frame_delta_shift * (temp_packets.size() - 1); //times + for (uint32_t j = 0; j < components; j++) { + size_bits += 16; //base value + uint32_t shift = max_shifts[j]; + if (shift > 0) { + shift += 1; //if not zero, add sign bit + } + size_bits += shift * (temp_packets.size() - 1); + } + if (size_bits % 8 != 0) { //wrap to 8 bits + size_bits += 8 - (size_bits % 8); + } + uint32_t size_bytes = size_bits / 8; //wrap to words + if (size_bytes % 4 != 0) { + size_bytes += 4 - (size_bytes % 4); + } + return size_bytes; + } + + static void _push_bits(LocalVector<uint8_t> &data, uint32_t &r_buffer, uint32_t &r_bits_used, uint32_t p_value, uint32_t p_bits) { + r_buffer |= p_value << r_bits_used; + r_bits_used += p_bits; + while (r_bits_used >= 8) { + uint8_t byte = r_buffer & 0xFF; + data.push_back(byte); + r_buffer >>= 8; + r_bits_used -= 8; + } + } + + void commit_temp_packets() { + if (temp_packets.size() == 0) { + return; //nohing to do + } +#define DEBUG_PACKET_PUSH +#ifdef DEBUG_PACKET_PUSH +#ifndef _MSC_VER +#warning Debugging packet push, disable this code in production to gain a bit more import performance. +#endif + uint32_t debug_packet_push = get_temp_packet_size(); + uint32_t debug_data_size = data.size(); +#endif + // Store header + + uint8_t header[8]; + uint32_t header_bytes = 0; + for (uint32_t i = 0; i < components; i++) { + encode_uint16(temp_packets[0].data[i], &header[header_bytes]); + header_bytes += 2; + } + + uint32_t max_shifts[3] = { 0, 0, 0 }; //base sizes, 16 bit + uint32_t max_frame_delta_shift = 0; + + if (temp_packets.size() > 1) { + _compute_max_shifts(0, temp_packets.size() - 1, max_shifts, max_frame_delta_shift); + uint16_t shift_header = (max_frame_delta_shift - 1) << 12; + for (uint32_t i = 0; i < components; i++) { + shift_header |= max_shifts[i] << (4 * i); + } + + encode_uint16(shift_header, &header[header_bytes]); + header_bytes += 2; + } + + while (header_bytes % 4 != 0) { + header[header_bytes++] = 0; + } + + for (uint32_t i = 0; i < header_bytes; i++) { + data.push_back(header[i]); + } + + if (temp_packets.size() == 1) { + temp_packets.clear(); + validated_packet_count = 0; + return; //only header stored, nothing else to do + } + + uint32_t bit_buffer = 0; + uint32_t bits_used = 0; + + for (uint32_t i = 1; i < temp_packets.size(); i++) { + uint32_t frame_delta = temp_packets[i].frame - temp_packets[i - 1].frame; + _push_bits(data, bit_buffer, bits_used, frame_delta, max_frame_delta_shift); + + for (uint32_t j = 0; j < components; j++) { + if (max_shifts[j] == 0) { + continue; // Zero delta, do not store + } + int32_t delta = _compute_delta16_signed(temp_packets[i - 1].data[j], temp_packets[i].data[j]); + + ERR_FAIL_COND(delta < -32768 || delta > 32767); //sanity check + + uint16_t deltau; + if (delta < 0) { + deltau = (ABS(delta) - 1) | (1 << max_shifts[j]); + } else { + deltau = delta; + } + _push_bits(data, bit_buffer, bits_used, deltau, max_shifts[j] + 1); // Include sign bit + } + } + if (bits_used != 0) { + ERR_FAIL_COND(bit_buffer > 0xFF); // Sanity check + data.push_back(bit_buffer); + } + + while (data.size() % 4 != 0) { + data.push_back(0); //pad to align with 4 + } + + temp_packets.clear(); + validated_packet_count = 0; + +#ifdef DEBUG_PACKET_PUSH + ERR_FAIL_COND((data.size() - debug_data_size) != debug_packet_push); +#endif + } +}; + +struct AnimationCompressionTimeState { + struct Packet { + uint32_t frame; + uint32_t offset; + uint32_t count; + }; + + LocalVector<Packet> packets; + //used for rollback + int32_t key_index = 0; + int32_t validated_packet_count = 0; + int32_t validated_key_index = -1; + bool needs_start_frame = false; +}; + +Vector3i Animation::_compress_key(uint32_t p_track, const AABB &p_bounds, int32_t p_key, float p_time) { + Vector3i values; + TrackType tt = track_get_type(p_track); + switch (tt) { + case TYPE_POSITION_3D: { + Vector3 pos; + if (p_key >= 0) { + position_track_get_key(p_track, p_key, &pos); + } else { + position_track_interpolate(p_track, p_time, &pos); + } + pos = (pos - p_bounds.position) / p_bounds.size; + for (int j = 0; j < 3; j++) { + values[j] = CLAMP(int32_t(pos[j] * 65535.0), 0, 65535); + } + } break; + case TYPE_ROTATION_3D: { + Quaternion rot; + if (p_key >= 0) { + rotation_track_get_key(p_track, p_key, &rot); + } else { + rotation_track_interpolate(p_track, p_time, &rot); + } + Vector3 axis = rot.get_axis(); + float angle = rot.get_angle(); + angle = Math::fposmod(double(angle), double(Math_PI * 2.0)); + Vector2 oct = axis.octahedron_encode(); + Vector3 rot_norm(oct.x, oct.y, angle / (Math_PI * 2.0)); // high resolution rotation in 0-1 angle. + + for (int j = 0; j < 3; j++) { + values[j] = CLAMP(int32_t(rot_norm[j] * 65535.0), 0, 65535); + } + } break; + case TYPE_SCALE_3D: { + Vector3 scale; + if (p_key >= 0) { + scale_track_get_key(p_track, p_key, &scale); + } else { + scale_track_interpolate(p_track, p_time, &scale); + } + scale = (scale - p_bounds.position) / p_bounds.size; + for (int j = 0; j < 3; j++) { + values[j] = CLAMP(int32_t(scale[j] * 65535.0), 0, 65535); + } + } break; + case TYPE_BLEND_SHAPE: { + float blend; + if (p_key >= 0) { + blend_shape_track_get_key(p_track, p_key, &blend); + } else { + blend_shape_track_interpolate(p_track, p_time, &blend); + } + + blend = (blend / float(Compression::BLEND_SHAPE_RANGE)) * 0.5 + 0.5; + values[0] = CLAMP(int32_t(blend * 65535.0), 0, 65535); + } break; + default: { + ERR_FAIL_V(Vector3i()); //sanity check + } break; + } + + return values; +} + +struct AnimationCompressionBufferBitsRead { + uint32_t buffer = 0; + uint32_t used = 0; + const uint8_t *src_data = nullptr; + + _FORCE_INLINE_ uint32_t read(uint32_t p_bits) { + uint32_t output = 0; + uint32_t written = 0; + while (p_bits > 0) { + if (used == 0) { + used = 8; + buffer = *src_data; + src_data++; + } + uint32_t to_write = MIN(used, p_bits); + output |= (buffer & ((1 << to_write) - 1)) << written; + buffer >>= to_write; + used -= to_write; + p_bits -= to_write; + written += to_write; + } + return output; + } +}; + +void Animation::compress(uint32_t p_page_size, uint32_t p_fps, float p_split_tolerance) { + ERR_FAIL_COND_MSG(compression.enabled, "This animation is already compressed"); + + p_split_tolerance = CLAMP(p_split_tolerance, 1.1, 8.0); + compression.pages.clear(); + + uint32_t base_page_size = 0; // Before compressing pages, compute how large the "end page" datablock is. + LocalVector<uint32_t> tracks_to_compress; + LocalVector<AABB> track_bounds; + const uint32_t time_packet_size = 4; + + const uint32_t track_header_size = 4 + 4 + 4; // pointer to time (4 bytes), amount of time keys (4 bytes) pointer to track data (4 bytes) + + for (int i = 0; i < get_track_count(); i++) { + TrackType type = track_get_type(i); + if (type != TYPE_POSITION_3D && type != TYPE_ROTATION_3D && type != TYPE_SCALE_3D && type != TYPE_BLEND_SHAPE) { + continue; + } + if (track_get_key_count(i) == 0) { + continue; //do not compress, no keys + } + base_page_size += track_header_size; //pointer to beginning of each track timeline and amount of time keys + base_page_size += time_packet_size; //for end of track time marker + base_page_size += (type == TYPE_BLEND_SHAPE) ? 4 : 8; // at least the end of track packet (at much 8 bytes). This could be less, but have to be pessimistic. + tracks_to_compress.push_back(i); + + AABB bounds; + + if (type == TYPE_POSITION_3D) { + AABB aabb; + int kcount = track_get_key_count(i); + for (int j = 0; j < kcount; j++) { + Vector3 pos; + position_track_get_key(i, j, &pos); + if (j == 0) { + aabb.position = pos; + } else { + aabb.expand_to(pos); + } + } + for (int j = 0; j < 3; j++) { + //cant have zero + if (aabb.size[j] < CMP_EPSILON) { + aabb.size[j] = CMP_EPSILON; + } + } + bounds = aabb; + } + if (type == TYPE_SCALE_3D) { + AABB aabb; + int kcount = track_get_key_count(i); + for (int j = 0; j < kcount; j++) { + Vector3 scale; + scale_track_get_key(i, j, &scale); + if (j == 0) { + aabb.position = scale; + } else { + aabb.expand_to(scale); + } + } + for (int j = 0; j < 3; j++) { + //cant have zero + if (aabb.size[j] < CMP_EPSILON) { + aabb.size[j] = CMP_EPSILON; + } + } + bounds = aabb; + } + + track_bounds.push_back(bounds); + } + + if (tracks_to_compress.size() == 0) { + return; //nothing to compress + } + + print_animc("Anim Compression:"); + print_animc("-----------------"); + print_animc("Tracks to compress: " + itos(tracks_to_compress.size())); + + uint32_t current_frame = 0; + uint32_t base_page_frame = 0; + double frame_len = 1.0 / double(p_fps); + const uint32_t max_frames_per_page = 65536; + + print_animc("Frame Len: " + rtos(frame_len)); + + LocalVector<AnimationCompressionDataState> data_tracks; + LocalVector<AnimationCompressionTimeState> time_tracks; + + data_tracks.resize(tracks_to_compress.size()); + time_tracks.resize(tracks_to_compress.size()); + + for (uint32_t i = 0; i < data_tracks.size(); i++) { + data_tracks[i].split_tolerance = p_split_tolerance; + if (track_get_type(tracks_to_compress[i]) == TYPE_BLEND_SHAPE) { + data_tracks[i].components = 1; + } else { + data_tracks[i].components = 3; + } + } + + while (true) { + // Begin by finding the keyframe in all tracks with the time closest to the current time + const uint32_t FRAME_MAX = 0xFFFFFFFF; + const int32_t NO_TRACK_FOUND = -1; + uint32_t best_frame = FRAME_MAX; + uint32_t best_invalid_frame = FRAME_MAX; + int32_t best_frame_track = NO_TRACK_FOUND; // Default is -1, which means all keyframes for this page are exhausted. + bool start_frame = false; + + for (uint32_t i = 0; i < tracks_to_compress.size(); i++) { + uint32_t uncomp_track = tracks_to_compress[i]; + + if (time_tracks[i].key_index == track_get_key_count(uncomp_track)) { + if (time_tracks[i].needs_start_frame) { + start_frame = true; + best_frame = base_page_frame; + best_frame_track = i; + time_tracks[i].needs_start_frame = false; + break; + } else { + continue; // This track is exhausted (all keys were added already), don't consider. + } + } + + uint32_t key_frame = double(track_get_key_time(uncomp_track, time_tracks[i].key_index)) / frame_len; + + if (time_tracks[i].needs_start_frame && key_frame > base_page_frame) { + start_frame = true; + best_frame = base_page_frame; + best_frame_track = i; + time_tracks[i].needs_start_frame = false; + break; + } + + ERR_FAIL_COND(key_frame < base_page_frame); // Sanity check, should never happen + + if (key_frame - base_page_frame >= max_frames_per_page) { + // Invalid because beyond the max frames allowed per page + best_invalid_frame = MIN(best_invalid_frame, key_frame); + } else if (key_frame < best_frame) { + best_frame = key_frame; + best_frame_track = i; + } + } + + print_animc("*KEY*: Current Frame: " + itos(current_frame) + " Best Frame: " + rtos(best_frame) + " Best Track: " + itos(best_frame_track) + " Start: " + String(start_frame ? "true" : "false")); + + if (!start_frame && best_frame > current_frame) { + // Any case where the current frame advanced, either because nothing was found or because something was found greater than the current one. + print_animc("\tAdvance Condition."); + bool rollback = false; + + // The frame has advanced, time to validate the previous frame + uint32_t current_page_size = base_page_size; + for (uint32_t i = 0; i < data_tracks.size(); i++) { + uint32_t track_size = data_tracks[i].data.size(); // track size + track_size += data_tracks[i].get_temp_packet_size(); // Add the temporary data + if (track_size > Compression::MAX_DATA_TRACK_SIZE) { + rollback = true; //track to large, time track can't point to keys any longer, because key offset is 12 bits + break; + } + current_page_size += track_size; + } + for (uint32_t i = 0; i < time_tracks.size(); i++) { + current_page_size += time_tracks[i].packets.size() * 4; // time packet is 32 bits + } + + if (!rollback && current_page_size > p_page_size) { + rollback = true; + } + + print_animc("\tCurrent Page Size: " + itos(current_page_size) + "/" + itos(p_page_size) + " Rollback? " + String(rollback ? "YES!" : "no")); + + if (rollback) { + // Not valid any longer, so rollback and commit page + + for (uint32_t i = 0; i < data_tracks.size(); i++) { + data_tracks[i].temp_packets.resize(data_tracks[i].validated_packet_count); + } + for (uint32_t i = 0; i < time_tracks.size(); i++) { + time_tracks[i].key_index = time_tracks[i].validated_key_index; //rollback key + time_tracks[i].packets.resize(time_tracks[i].validated_packet_count); + } + + } else { + // All valid, so save rollback information + for (uint32_t i = 0; i < data_tracks.size(); i++) { + data_tracks[i].validated_packet_count = data_tracks[i].temp_packets.size(); + } + for (uint32_t i = 0; i < time_tracks.size(); i++) { + time_tracks[i].validated_key_index = time_tracks[i].key_index; + time_tracks[i].validated_packet_count = time_tracks[i].packets.size(); + } + + // Accept this frame as the frame being processed (as long as it exists) + if (best_frame != FRAME_MAX) { + current_frame = best_frame; + print_animc("\tValidated, New Current Frame: " + itos(current_frame)); + } + } + + if (rollback || best_frame == FRAME_MAX) { + // Commit the page if had to rollback or if no track was found + print_animc("\tCommiting page.."); + + // The end frame for the page depends entirely on whether its valid or + // no more keys were found. + // If not valid, then the end frame is the current frame (as this means the current frame is being rolled back + // If valid, then the end frame is the next invalid one (in case more frames exist), or the current frame in case no more frames exist. + uint32_t page_end_frame = (rollback || best_frame == FRAME_MAX) ? current_frame : best_invalid_frame; + + print_animc("\tEnd Frame: " + itos(page_end_frame) + ", " + rtos(page_end_frame * frame_len) + "s"); + + // Add finalizer frames and commit pending tracks + uint32_t finalizer_local_frame = page_end_frame - base_page_frame; + + uint32_t total_page_size = 0; + + for (uint32_t i = 0; i < data_tracks.size(); i++) { + if (data_tracks[i].temp_packets.size() == 0 || (data_tracks[i].temp_packets[data_tracks[i].temp_packets.size() - 1].frame) < finalizer_local_frame) { + // Add finalizer frame if it makes sense + Vector3i values = _compress_key(tracks_to_compress[i], track_bounds[i], -1, page_end_frame * frame_len); + + bool first_key = data_tracks[i].insert_key(finalizer_local_frame, values); + if (first_key) { + AnimationCompressionTimeState::Packet p; + p.count = 1; + p.frame = finalizer_local_frame; + p.offset = data_tracks[i].data.size(); + time_tracks[i].packets.push_back(p); + } else { + ERR_FAIL_COND(time_tracks[i].packets.size() == 0); + time_tracks[i].packets[time_tracks[i].packets.size() - 1].count++; + } + } + + data_tracks[i].commit_temp_packets(); + total_page_size += data_tracks[i].data.size(); + total_page_size += time_tracks[i].packets.size() * 4; + total_page_size += track_header_size; + + print_animc("\tTrack " + itos(i) + " time packets: " + itos(time_tracks[i].packets.size()) + " Packet data: " + itos(data_tracks[i].data.size())); + } + + print_animc("\tTotal page Size: " + itos(total_page_size) + "/" + itos(p_page_size)); + + // Create Page + Vector<uint8_t> page_data; + page_data.resize(total_page_size); + { + uint8_t *page_ptr = page_data.ptrw(); + uint32_t base_offset = data_tracks.size() * track_header_size; + + for (uint32_t i = 0; i < data_tracks.size(); i++) { + encode_uint32(base_offset, page_ptr + (track_header_size * i + 0)); + uint16_t *key_time_ptr = (uint16_t *)(page_ptr + base_offset); + for (uint32_t j = 0; j < time_tracks[i].packets.size(); j++) { + key_time_ptr[j * 2 + 0] = uint16_t(time_tracks[i].packets[j].frame); + uint16_t ptr = time_tracks[i].packets[j].offset / 4; + ptr |= (time_tracks[i].packets[j].count - 1) << 12; + key_time_ptr[j * 2 + 1] = ptr; + base_offset += 4; + } + encode_uint32(time_tracks[i].packets.size(), page_ptr + (track_header_size * i + 4)); + encode_uint32(base_offset, page_ptr + (track_header_size * i + 8)); + memcpy(page_ptr + base_offset, data_tracks[i].data.ptr(), data_tracks[i].data.size()); + base_offset += data_tracks[i].data.size(); + + //reset track + data_tracks[i].data.clear(); + data_tracks[i].temp_packets.clear(); + data_tracks[i].validated_packet_count = -1; + + time_tracks[i].needs_start_frame = true; //Not required the first time, but from now on it is. + time_tracks[i].packets.clear(); + time_tracks[i].validated_key_index = -1; + time_tracks[i].validated_packet_count = 0; + } + } + + Compression::Page page; + page.data = page_data; + page.time_offset = base_page_frame * frame_len; + compression.pages.push_back(page); + + if (!rollback && best_invalid_frame == FRAME_MAX) { + break; // No more pages to add. + } + + current_frame = page_end_frame; + base_page_frame = page_end_frame; + + continue; // Start over + } + } + + // A key was found for the current frame and all is ok + + uint32_t comp_track = best_frame_track; + Vector3i values; + + if (start_frame) { + // Interpolate + values = _compress_key(tracks_to_compress[comp_track], track_bounds[comp_track], -1, base_page_frame * frame_len); + } else { + uint32_t key = time_tracks[comp_track].key_index; + values = _compress_key(tracks_to_compress[comp_track], track_bounds[comp_track], key); + time_tracks[comp_track].key_index++; //goto next key (but could be rolled back if beyond page size). + } + + bool first_key = data_tracks[comp_track].insert_key(best_frame - base_page_frame, values); + if (first_key) { + AnimationCompressionTimeState::Packet p; + p.count = 1; + p.frame = best_frame - base_page_frame; + p.offset = data_tracks[comp_track].data.size(); + time_tracks[comp_track].packets.push_back(p); + } else { + ERR_CONTINUE(time_tracks[comp_track].packets.size() == 0); + time_tracks[comp_track].packets[time_tracks[comp_track].packets.size() - 1].count++; + } + } + + compression.bounds = track_bounds; + compression.fps = p_fps; + compression.enabled = true; + + for (uint32_t i = 0; i < tracks_to_compress.size(); i++) { + Track *t = tracks[tracks_to_compress[i]]; + t->interpolation = INTERPOLATION_LINEAR; //only linear supported + switch (t->type) { + case TYPE_POSITION_3D: { + PositionTrack *tt = static_cast<PositionTrack *>(t); + tt->positions.clear(); + tt->compressed_track = i; + } break; + case TYPE_ROTATION_3D: { + RotationTrack *rt = static_cast<RotationTrack *>(t); + rt->rotations.clear(); + rt->compressed_track = i; + } break; + case TYPE_SCALE_3D: { + ScaleTrack *st = static_cast<ScaleTrack *>(t); + st->scales.clear(); + st->compressed_track = i; + print_line("Scale Bounds " + itos(i) + ": " + track_bounds[i]); + } break; + case TYPE_BLEND_SHAPE: { + BlendShapeTrack *bst = static_cast<BlendShapeTrack *>(t); + bst->blend_shapes.clear(); + bst->compressed_track = i; + } break; + default: { + } + } + } +#if 1 + uint32_t orig_size = 0; + for (int i = 0; i < get_track_count(); i++) { + switch (track_get_type(i)) { + case TYPE_SCALE_3D: + case TYPE_POSITION_3D: { + orig_size += sizeof(TKey<Vector3>) * track_get_key_count(i); + } break; + case TYPE_ROTATION_3D: { + orig_size += sizeof(TKey<Quaternion>) * track_get_key_count(i); + } break; + case TYPE_BLEND_SHAPE: { + orig_size += sizeof(TKey<float>) * track_get_key_count(i); + } break; + default: { + } + } + } + + uint32_t new_size = 0; + for (uint32_t i = 0; i < compression.pages.size(); i++) { + new_size += compression.pages[i].data.size(); + } + + print_line("Original size: " + itos(orig_size) + " - Compressed size: " + itos(new_size) + " " + String::num(float(new_size) / float(orig_size) * 100, 2) + "% pages: " + itos(compression.pages.size())); +#endif +} + +bool Animation::_rotation_interpolate_compressed(uint32_t p_compressed_track, double p_time, Quaternion &r_ret) const { + Vector3i current; + Vector3i next; + double time_current; + double time_next; + + if (!_fetch_compressed<3>(p_compressed_track, p_time, current, time_current, next, time_next)) { + return false; //some sort of problem + } + + if (time_current >= p_time || time_current == time_next) { + r_ret = _uncompress_quaternion(current); + } else if (p_time >= time_next) { + r_ret = _uncompress_quaternion(next); + } else { + double c = (p_time - time_current) / (time_next - time_current); + Quaternion from = _uncompress_quaternion(current); + Quaternion to = _uncompress_quaternion(next); + r_ret = from.slerp(to, c); + } + + return true; +} + +bool Animation::_pos_scale_interpolate_compressed(uint32_t p_compressed_track, double p_time, Vector3 &r_ret) const { + Vector3i current; + Vector3i next; + double time_current; + double time_next; + + if (!_fetch_compressed<3>(p_compressed_track, p_time, current, time_current, next, time_next)) { + return false; //some sort of problem + } + + if (time_current >= p_time || time_current == time_next) { + r_ret = _uncompress_pos_scale(p_compressed_track, current); + } else if (p_time >= time_next) { + r_ret = _uncompress_pos_scale(p_compressed_track, next); + } else { + double c = (p_time - time_current) / (time_next - time_current); + Vector3 from = _uncompress_pos_scale(p_compressed_track, current); + Vector3 to = _uncompress_pos_scale(p_compressed_track, next); + r_ret = from.lerp(to, c); + } + + return true; +} +bool Animation::_blend_shape_interpolate_compressed(uint32_t p_compressed_track, double p_time, float &r_ret) const { + Vector3i current; + Vector3i next; + double time_current; + double time_next; + + if (!_fetch_compressed<1>(p_compressed_track, p_time, current, time_current, next, time_next)) { + return false; //some sort of problem + } + + if (time_current >= p_time || time_current == time_next) { + r_ret = _uncompress_blend_shape(current); + } else if (p_time >= time_next) { + r_ret = _uncompress_blend_shape(next); + } else { + float c = (p_time - time_current) / (time_next - time_current); + float from = _uncompress_blend_shape(current); + float to = _uncompress_blend_shape(next); + r_ret = Math::lerp(from, to, c); + } + + return true; +} + +template <uint32_t COMPONENTS> +bool Animation::_fetch_compressed(uint32_t p_compressed_track, double p_time, Vector3i &r_current_value, double &r_current_time, Vector3i &r_next_value, double &r_next_time, uint32_t *key_index) const { + ERR_FAIL_COND_V(!compression.enabled, false); + ERR_FAIL_UNSIGNED_INDEX_V(p_compressed_track, compression.bounds.size(), false); + p_time = CLAMP(p_time, 0, length); + if (key_index) { + *key_index = 0; + } + + double frame_to_sec = 1.0 / double(compression.fps); + + int32_t page_index = -1; + for (uint32_t i = 0; i < compression.pages.size(); i++) { + if (compression.pages[i].time_offset > p_time) { + break; + } + page_index = i; + } + + ERR_FAIL_COND_V(page_index == -1, false); //should not happen + + double page_base_time = compression.pages[page_index].time_offset; + const uint8_t *page_data = compression.pages[page_index].data.ptr(); +#ifndef _MSC_VER +#warning Little endian assumed. No major big endian hardware exists any longer, but in case it does it will need to be supported +#endif + const uint32_t *indices = (const uint32_t *)page_data; + const uint16_t *time_keys = (const uint16_t *)&page_data[indices[p_compressed_track * 3 + 0]]; + uint32_t time_key_count = indices[p_compressed_track * 3 + 1]; + + int32_t packet_idx = 0; + double packet_time = double(time_keys[0]) * frame_to_sec + page_base_time; + uint32_t base_frame = time_keys[0]; + + for (uint32_t i = 1; i < time_key_count; i++) { + uint32_t f = time_keys[i * 2 + 0]; + double frame_time = double(f) * frame_to_sec + page_base_time; + + if (frame_time > p_time) { + break; + } + + if (key_index) { + (*key_index) += (time_keys[(i - 1) * 2 + 1] >> 12) + 1; + } + + packet_idx = i; + packet_time = frame_time; + base_frame = f; + } + + const uint8_t *data_keys_base = (const uint8_t *)&page_data[indices[p_compressed_track * 3 + 2]]; + + uint16_t time_key_data = time_keys[packet_idx * 2 + 1]; + uint32_t data_offset = (time_key_data & 0xFFF) * 4; // lower 12 bits + uint32_t data_count = (time_key_data >> 12) + 1; + + const uint16_t *data_key = (const uint16_t *)(data_keys_base + data_offset); + + uint16_t decode[COMPONENTS]; + uint16_t decode_next[COMPONENTS]; + + for (uint32_t i = 0; i < COMPONENTS; i++) { + decode[i] = data_key[i]; + decode_next[i] = data_key[i]; + } + + double next_time = packet_time; + + if (p_time > packet_time) { // If its equal or less, then don't bother + if (data_count > 1) { + //decode forward + uint32_t bit_width[COMPONENTS]; + for (uint32_t i = 0; i < COMPONENTS; i++) { + bit_width[i] = (data_key[COMPONENTS] >> (i * 4)) & 0xF; + } + + uint32_t frame_bit_width = (data_key[COMPONENTS] >> 12) + 1; + + AnimationCompressionBufferBitsRead buffer; + + buffer.src_data = (const uint8_t *)&data_key[COMPONENTS + 1]; + + for (uint32_t i = 1; i < data_count; i++) { + uint32_t frame_delta = buffer.read(frame_bit_width); + base_frame += frame_delta; + + for (uint32_t j = 0; j < COMPONENTS; j++) { + if (bit_width[j] == 0) { + continue; // do none + } + uint32_t valueu = buffer.read(bit_width[j] + 1); + bool sign = valueu & (1 << bit_width[j]); + int16_t value = valueu & ((1 << bit_width[j]) - 1); + if (sign) { + value = -value - 1; + } + + decode_next[j] += value; + } + + next_time = double(base_frame) * frame_to_sec + page_base_time; + if (p_time < next_time) { + break; + } + + packet_time = next_time; + + for (uint32_t j = 0; j < COMPONENTS; j++) { + decode[j] = decode_next[j]; + } + + if (key_index) { + (*key_index)++; + } + } + } + + if (p_time > next_time) { // > instead of >= because if its equal, then it will be properly interpolated anyway + // So, the last frame found still has a time that is less than the required frame, + // will have to interpolate with the first frame of the next timekey. + + if ((uint32_t)packet_idx < time_key_count - 1) { // Sanity check but should not matter much, otherwise current next packet is last packet + + uint16_t time_key_data_next = time_keys[(packet_idx + 1) * 2 + 1]; + uint32_t data_offset_next = (time_key_data_next & 0xFFF) * 4; // Lower 12 bits + + const uint16_t *data_key_next = (const uint16_t *)(data_keys_base + data_offset_next); + base_frame = time_keys[(packet_idx + 1) * 2 + 0]; + next_time = double(base_frame) * frame_to_sec + page_base_time; + for (uint32_t i = 0; i < COMPONENTS; i++) { + decode_next[i] = data_key_next[i]; + } + } + } + } + + r_current_time = packet_time; + r_next_time = next_time; + + for (uint32_t i = 0; i < COMPONENTS; i++) { + r_current_value[i] = decode[i]; + r_next_value[i] = decode_next[i]; + } + + return true; +} + +template <uint32_t COMPONENTS> +void Animation::_get_compressed_key_indices_in_range(uint32_t p_compressed_track, double p_time, double p_delta, List<int> *r_indices) const { + ERR_FAIL_COND(!compression.enabled); + ERR_FAIL_UNSIGNED_INDEX(p_compressed_track, compression.bounds.size()); + + double frame_to_sec = 1.0 / double(compression.fps); + uint32_t key_index = 0; + + for (uint32_t p = 0; p < compression.pages.size(); p++) { + if (compression.pages[p].time_offset >= p_time + p_delta) { + // Page beyond range + return; + } + + // Page within range + + uint32_t page_index = p; + + double page_base_time = compression.pages[page_index].time_offset; + const uint8_t *page_data = compression.pages[page_index].data.ptr(); +#ifndef _MSC_VER +#warning Little endian assumed. No major big endian hardware exists any longer, but in case it does it will need to be supported +#endif + const uint32_t *indices = (const uint32_t *)page_data; + const uint16_t *time_keys = (const uint16_t *)&page_data[indices[p_compressed_track * 3 + 0]]; + uint32_t time_key_count = indices[p_compressed_track * 3 + 1]; + + for (uint32_t i = 0; i < time_key_count; i++) { + uint32_t f = time_keys[i * 2 + 0]; + double frame_time = f * frame_to_sec + page_base_time; + if (frame_time >= p_time + p_delta) { + return; + } else if (frame_time >= p_time) { + r_indices->push_back(key_index); + } + + key_index++; + + const uint8_t *data_keys_base = (const uint8_t *)&page_data[indices[p_compressed_track * 3 + 2]]; + + uint16_t time_key_data = time_keys[i * 2 + 1]; + uint32_t data_offset = (time_key_data & 0xFFF) * 4; // lower 12 bits + uint32_t data_count = (time_key_data >> 12) + 1; + + const uint16_t *data_key = (const uint16_t *)(data_keys_base + data_offset); + + if (data_count > 1) { + //decode forward + uint32_t bit_width[COMPONENTS]; + for (uint32_t j = 0; j < COMPONENTS; j++) { + bit_width[j] = (data_key[COMPONENTS] >> (j * 4)) & 0xF; + } + + uint32_t frame_bit_width = (data_key[COMPONENTS] >> 12) + 1; + + AnimationCompressionBufferBitsRead buffer; + + buffer.src_data = (const uint8_t *)&data_key[COMPONENTS + 1]; + + for (uint32_t j = 1; j < data_count; j++) { + uint32_t frame_delta = buffer.read(frame_bit_width); + f += frame_delta; + + frame_time = f * frame_to_sec + page_base_time; + if (frame_time >= p_time + p_delta) { + return; + } else if (frame_time >= p_time) { + r_indices->push_back(key_index); + } + + for (uint32_t k = 0; k < COMPONENTS; k++) { + if (bit_width[k] == 0) { + continue; // do none + } + buffer.read(bit_width[k] + 1); // skip + } + + key_index++; + } + } + } + } +} + +int Animation::_get_compressed_key_count(uint32_t p_compressed_track) const { + ERR_FAIL_COND_V(!compression.enabled, -1); + ERR_FAIL_UNSIGNED_INDEX_V(p_compressed_track, compression.bounds.size(), -1); + + int key_count = 0; + + for (uint32_t i = 0; i < compression.pages.size(); i++) { + const uint8_t *page_data = compression.pages[i].data.ptr(); +#ifndef _MSC_VER +#warning Little endian assumed. No major big endian hardware exists any longer, but in case it does it will need to be supported +#endif + const uint32_t *indices = (const uint32_t *)page_data; + const uint16_t *time_keys = (const uint16_t *)&page_data[indices[p_compressed_track * 3 + 0]]; + uint32_t time_key_count = indices[p_compressed_track * 3 + 1]; + + for (uint32_t j = 0; j < time_key_count; j++) { + key_count += (time_keys[j * 2 + 1] >> 12) + 1; + } + } + + return key_count; +} + +Quaternion Animation::_uncompress_quaternion(const Vector3i &p_value) const { + Vector3 axis = Vector3::octahedron_decode(Vector2(float(p_value.x) / 65535.0, float(p_value.y) / 65535.0)); + float angle = (float(p_value.z) / 65535.0) * 2.0 * Math_PI; + return Quaternion(axis, angle); +} +Vector3 Animation::_uncompress_pos_scale(uint32_t p_compressed_track, const Vector3i &p_value) const { + Vector3 pos_norm(float(p_value.x) / 65535.0, float(p_value.y) / 65535.0, float(p_value.z) / 65535.0); + return compression.bounds[p_compressed_track].position + pos_norm * compression.bounds[p_compressed_track].size; +} +float Animation::_uncompress_blend_shape(const Vector3i &p_value) const { + float bsn = float(p_value.x) / 65535.0; + return (bsn * 2.0 - 1.0) * float(Compression::BLEND_SHAPE_RANGE); +} + +template <uint32_t COMPONENTS> +bool Animation::_fetch_compressed_by_index(uint32_t p_compressed_track, int p_index, Vector3i &r_value, double &r_time) const { + ERR_FAIL_COND_V(!compression.enabled, false); + ERR_FAIL_UNSIGNED_INDEX_V(p_compressed_track, compression.bounds.size(), false); + + for (uint32_t i = 0; i < compression.pages.size(); i++) { + const uint8_t *page_data = compression.pages[i].data.ptr(); +#ifndef _MSC_VER +#warning Little endian assumed. No major big endian hardware exists any longer, but in case it does it will need to be supported +#endif + const uint32_t *indices = (const uint32_t *)page_data; + const uint16_t *time_keys = (const uint16_t *)&page_data[indices[p_compressed_track * 3 + 0]]; + uint32_t time_key_count = indices[p_compressed_track * 3 + 1]; + const uint8_t *data_keys_base = (const uint8_t *)&page_data[indices[p_compressed_track * 3 + 2]]; + + for (uint32_t j = 0; j < time_key_count; j++) { + uint32_t subkeys = (time_keys[j * 2 + 1] >> 12) + 1; + if ((uint32_t)p_index < subkeys) { + uint16_t data_offset = (time_keys[j * 2 + 1] & 0xFFF) * 4; + + const uint16_t *data_key = (const uint16_t *)(data_keys_base + data_offset); + + uint16_t frame = time_keys[j * 2 + 0]; + uint16_t decode[COMPONENTS]; + + for (uint32_t k = 0; k < COMPONENTS; k++) { + decode[k] = data_key[k]; + } + + if (p_index > 0) { + uint32_t bit_width[COMPONENTS]; + for (uint32_t k = 0; k < COMPONENTS; k++) { + bit_width[k] = (data_key[COMPONENTS] >> (k * 4)) & 0xF; + } + uint32_t frame_bit_width = (data_key[COMPONENTS] >> 12) + 1; + + AnimationCompressionBufferBitsRead buffer; + buffer.src_data = (const uint8_t *)&data_key[COMPONENTS + 1]; + + for (int k = 0; k < p_index; k++) { + uint32_t frame_delta = buffer.read(frame_bit_width); + frame += frame_delta; + for (uint32_t l = 0; l < COMPONENTS; l++) { + if (bit_width[l] == 0) { + continue; // do none + } + uint32_t valueu = buffer.read(bit_width[l] + 1); + bool sign = valueu & (1 << bit_width[l]); + int16_t value = valueu & ((1 << bit_width[l]) - 1); + if (sign) { + value = -value - 1; + } + + decode[l] += value; + } + } + } + + r_time = compression.pages[i].time_offset + double(frame) / double(compression.fps); + for (uint32_t l = 0; l < COMPONENTS; l++) { + r_value[l] = decode[l]; + } + + return true; + + } else { + p_index -= subkeys; + } + } + } + + return false; +} + Animation::Animation() {} Animation::~Animation() { diff --git a/scene/resources/animation.h b/scene/resources/animation.h index 4ee0741d87..8e4287e4fb 100644 --- a/scene/resources/animation.h +++ b/scene/resources/animation.h @@ -32,6 +32,7 @@ #define ANIMATION_H #include "core/io/resource.h" +#include "core/templates/local_vector.h" #define ANIM_MIN_LENGTH 0.001 @@ -63,7 +64,17 @@ public: UPDATE_DISCRETE, UPDATE_TRIGGER, UPDATE_CAPTURE, + }; + + enum LoopMode { + LOOP_NONE, + LOOP_LINEAR, + LOOP_PINGPONG, + }; + enum HandleMode { + HANDLE_MODE_FREE, + HANDLE_MODE_BALANCED, }; private: @@ -98,7 +109,7 @@ private: struct PositionTrack : public Track { Vector<TKey<Vector3>> positions; - + int32_t compressed_track = -1; PositionTrack() { type = TYPE_POSITION_3D; } }; @@ -106,7 +117,7 @@ private: struct RotationTrack : public Track { Vector<TKey<Quaternion>> rotations; - + int32_t compressed_track = -1; RotationTrack() { type = TYPE_ROTATION_3D; } }; @@ -114,6 +125,7 @@ private: struct ScaleTrack : public Track { Vector<TKey<Vector3>> scales; + int32_t compressed_track = -1; ScaleTrack() { type = TYPE_SCALE_3D; } }; @@ -121,6 +133,7 @@ private: struct BlendShapeTrack : public Track { Vector<TKey<float>> blend_shapes; + int32_t compressed_track = -1; BlendShapeTrack() { type = TYPE_BLEND_SHAPE; } }; @@ -149,10 +162,10 @@ private: }; /* BEZIER TRACK */ - struct BezierKey { Vector2 in_handle; //relative (x always <0) Vector2 out_handle; //relative (x always >0) + HandleMode handle_mode = HANDLE_MODE_BALANCED; real_t value = 0.0; }; @@ -205,7 +218,8 @@ private: int _insert(double p_time, T &p_keys, const V &p_value); template <class K> - inline int _find(const Vector<K> &p_keys, double p_time) const; + + inline int _find(const Vector<K> &p_keys, double p_time, bool p_backward = false) const; _FORCE_INLINE_ Vector3 _interpolate(const Vector3 &p_a, const Vector3 &p_b, real_t p_c) const; _FORCE_INLINE_ Quaternion _interpolate(const Quaternion &p_a, const Quaternion &p_b, real_t p_c) const; @@ -218,7 +232,7 @@ private: _FORCE_INLINE_ real_t _cubic_interpolate(const real_t &p_pre_a, const real_t &p_a, const real_t &p_b, const real_t &p_post_b, real_t p_c) const; template <class T> - _FORCE_INLINE_ T _interpolate(const Vector<TKey<T>> &p_keys, double p_time, InterpolationType p_interp, bool p_loop_wrap, bool *p_ok) const; + _FORCE_INLINE_ T _interpolate(const Vector<TKey<T>> &p_keys, double p_time, InterpolationType p_interp, bool p_loop_wrap, bool *p_ok, bool p_backward = false) const; template <class T> _FORCE_INLINE_ void _track_get_key_indices_in_range(const Vector<T> &p_array, double from_time, double to_time, List<int> *p_indices) const; @@ -228,7 +242,91 @@ private: double length = 1.0; real_t step = 0.1; - bool loop = false; + LoopMode loop_mode = LOOP_NONE; + int pingponged = 0; + + /* Animation compression page format (version 1): + * + * Animation uses bitwidth based compression separated into small pages. The intention is that pages fit easily in the cache, so decoding is cache efficient. + * The page-based nature also makes future animation streaming from disk possible. + * + * Actual format: + * + * num_compressed_tracks = bounds.size() + * header : (x num_compressed_tracks) + * ------- + * timeline_keys_offset : uint32_t - offset to time keys + * timeline_size : uint32_t - amount of time keys + * data_keys_offset : uint32_t offset to key data + * + * time key (uint32_t): + * ------------------ + * frame : bits 0-15 - time offset of key, computed as: page.time_offset + frame * (1.0/fps) + * data_key_offset : bits 16-27 - offset to key data, computed as: data_keys_offset * 4 + data_key_offset + * data_key_count : bits 28-31 - amount of data keys pointed to, computed as: data_key_count+1 (max 16) + * + * data key: + * --------- + * X / Blend Shape : uint16_t - X coordinate of XYZ vector key, or Blend Shape value. If Blend shape, Y and Z are not present and can be ignored. + * Y : uint16_t + * Z : uint16_t + * If data_key_count+1 > 1 (if more than 1 key is stored): + * data_bitwidth : uint16_t - This is only present if data_key_count > 1. Contains delta bitwidth information. + * X / Blend Shape delta bitwidth: bits 0-3 - + * if 0, nothing is present for X (use the first key-value for subsequent keys), + * else assume the number of bits present for each element (+ 1 for sign). Assumed always 16 bits, delta max signed 15 bits, with underflow and overflow supported. + * Y delta bitwidth : bits 4-7 + * Z delta bitwidth : bits 8-11 + * FRAME delta bitwidth : 12-15 bits - always present (obviously), actual bitwidth is FRAME+1 + * Data key is 4 bytes long for Blend Shapes, 8 bytes long for pos/rot/scale. + * + * delta keys: + * ----------- + * Compressed format is packed in the following format after the data key, containing delta keys one after the next in a tightly bit packed fashion. + * FRAME bits -> X / Blend Shape Bits (if bitwidth > 0) -> Y Bits (if not Blend Shape and Y Bitwidth > 0) -> Z Bits (if not Blend Shape and Z Bitwidth > 0) + * + * data key format: + * ---------------- + * Decoding keys means starting from the base key and going key by key applying deltas until the proper position is reached needed for interpolation. + * Resulting values are uint32_t + * data for X / Blend Shape, Y and Z must be normalized first: unorm = float(data) / 65535.0 + * **Blend Shape**: (unorm * 2.0 - 1.0) * Compression::BLEND_SHAPE_RANGE + * **Pos/Scale**: unorm_vec3 * bounds[track].size + bounds[track].position + * **Rotation**: Quaternion(Vector3::octahedron_decode(unorm_vec3.xy),unorm_vec3.z * Math_PI * 2.0) + * **Frame**: page.time_offset + frame * (1.0/fps) + */ + + struct Compression { + enum { + MAX_DATA_TRACK_SIZE = 16384, + BLEND_SHAPE_RANGE = 8, // - 8.0 to 8.0 + FORMAT_VERSION = 1 + }; + struct Page { + Vector<uint8_t> data; + double time_offset; + }; + + uint32_t fps = 120; + LocalVector<Page> pages; + LocalVector<AABB> bounds; //used by position and scale tracks (which contain index to track and index to bounds). + bool enabled = false; + } compression; + + Vector3i _compress_key(uint32_t p_track, const AABB &p_bounds, int32_t p_key = -1, float p_time = 0.0); + bool _rotation_interpolate_compressed(uint32_t p_compressed_track, double p_time, Quaternion &r_ret) const; + bool _pos_scale_interpolate_compressed(uint32_t p_compressed_track, double p_time, Vector3 &r_ret) const; + bool _blend_shape_interpolate_compressed(uint32_t p_compressed_track, double p_time, float &r_ret) const; + template <uint32_t COMPONENTS> + bool _fetch_compressed(uint32_t p_compressed_track, double p_time, Vector3i &r_current_value, double &r_current_time, Vector3i &r_next_value, double &r_next_time, uint32_t *key_index = nullptr) const; + template <uint32_t COMPONENTS> + bool _fetch_compressed_by_index(uint32_t p_compressed_track, int p_index, Vector3i &r_value, double &r_time) const; + int _get_compressed_key_count(uint32_t p_compressed_track) const; + template <uint32_t COMPONENTS> + void _get_compressed_key_indices_in_range(uint32_t p_compressed_track, double p_time, double p_delta, List<int> *r_indices) const; + _FORCE_INLINE_ Quaternion _uncompress_quaternion(const Vector3i &p_value) const; + _FORCE_INLINE_ Vector3 _uncompress_pos_scale(uint32_t p_compressed_track, const Vector3i &p_value) const; + _FORCE_INLINE_ float _uncompress_blend_shape(const Vector3i &p_value) const; // bind helpers private: @@ -281,8 +379,7 @@ public: void track_set_path(int p_track, const NodePath &p_path); NodePath track_get_path(int p_track) const; - int find_track(const NodePath &p_path) const; - // transform + int find_track(const NodePath &p_path, const TrackType p_type) const; void track_move_up(int p_track); void track_move_down(int p_track); @@ -306,6 +403,7 @@ public: Variant track_get_key_value(int p_track, int p_key_idx) const; double track_get_key_time(int p_track, int p_key_idx) const; real_t track_get_key_transition(int p_track, int p_key_idx) const; + bool track_is_compressed(int p_track) const; int position_track_insert_key(int p_track, double p_time, const Vector3 &p_position); Error position_track_get_key(int p_track, int p_key, Vector3 *r_position) const; @@ -326,11 +424,13 @@ public: void track_set_interpolation_type(int p_track, InterpolationType p_interp); InterpolationType track_get_interpolation_type(int p_track) const; - int bezier_track_insert_key(int p_track, double p_time, real_t p_value, const Vector2 &p_in_handle, const Vector2 &p_out_handle); + int bezier_track_insert_key(int p_track, double p_time, real_t p_value, const Vector2 &p_in_handle, const Vector2 &p_out_handle, const HandleMode p_handle_mode = HandleMode::HANDLE_MODE_BALANCED); + void bezier_track_set_key_handle_mode(int p_track, int p_index, HandleMode p_mode, double p_balanced_value_time_ratio = 1.0); void bezier_track_set_key_value(int p_track, int p_index, real_t p_value); - void bezier_track_set_key_in_handle(int p_track, int p_index, const Vector2 &p_handle); - void bezier_track_set_key_out_handle(int p_track, int p_index, const Vector2 &p_handle); + void bezier_track_set_key_in_handle(int p_track, int p_index, const Vector2 &p_handle, double p_balanced_value_time_ratio = 1.0); + void bezier_track_set_key_out_handle(int p_track, int p_index, const Vector2 &p_handle, double p_balanced_value_time_ratio = 1.0); real_t bezier_track_get_key_value(int p_track, int p_index) const; + int bezier_track_get_key_handle_mode(int p_track, int p_index) const; Vector2 bezier_track_get_key_in_handle(int p_track, int p_index) const; Vector2 bezier_track_get_key_out_handle(int p_track, int p_index) const; @@ -352,23 +452,23 @@ public: bool track_get_interpolation_loop_wrap(int p_track) const; Variant value_track_interpolate(int p_track, double p_time) const; - void value_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices) const; + void value_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged = 0) const; void value_track_set_update_mode(int p_track, UpdateMode p_mode); UpdateMode value_track_get_update_mode(int p_track) const; - void method_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices) const; + void method_track_get_key_indices(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged = 0) const; Vector<Variant> method_track_get_params(int p_track, int p_key_idx) const; StringName method_track_get_name(int p_track, int p_key_idx) const; void copy_track(int p_track, Ref<Animation> p_to_animation); - void track_get_key_indices_in_range(int p_track, double p_time, double p_delta, List<int> *p_indices) const; + void track_get_key_indices_in_range(int p_track, double p_time, double p_delta, List<int> *p_indices, int p_pingponged = 0) const; void set_length(real_t p_length); real_t get_length() const; - void set_loop(bool p_enabled); - bool has_loop() const; + void set_loop_mode(LoopMode p_loop_mode); + LoopMode get_loop_mode() const; void set_step(real_t p_step); real_t get_step() const; @@ -376,6 +476,7 @@ public: void clear(); void optimize(real_t p_allowed_linear_err = 0.05, real_t p_allowed_angular_err = 0.01, real_t p_max_optimizable_angle = Math_PI * 0.125); + void compress(uint32_t p_page_size = 8192, uint32_t p_fps = 120, float p_split_tolerance = 4.0); // 4.0 seems to be the split tolerance sweet spot from many tests Animation(); ~Animation(); @@ -384,5 +485,7 @@ public: VARIANT_ENUM_CAST(Animation::TrackType); VARIANT_ENUM_CAST(Animation::InterpolationType); VARIANT_ENUM_CAST(Animation::UpdateMode); +VARIANT_ENUM_CAST(Animation::HandleMode); +VARIANT_ENUM_CAST(Animation::LoopMode); #endif diff --git a/scene/resources/audio_stream_sample.cpp b/scene/resources/audio_stream_sample.cpp index d018103e64..d3fab802c5 100644 --- a/scene/resources/audio_stream_sample.cpp +++ b/scene/resources/audio_stream_sample.cpp @@ -299,7 +299,7 @@ int AudioStreamPlaybackSample::mix(AudioFrame *p_buffer, float p_rate_scale, int if (loop_format != AudioStreamSample::LOOP_DISABLED && offset < loop_begin_fp) { /* loopstart reached */ - if (loop_format == AudioStreamSample::LOOP_PING_PONG) { + if (loop_format == AudioStreamSample::LOOP_PINGPONG) { /* bounce ping pong */ offset = loop_begin_fp + (loop_begin_fp - offset); increment = -increment; @@ -320,7 +320,7 @@ int AudioStreamPlaybackSample::mix(AudioFrame *p_buffer, float p_rate_scale, int if (loop_format != AudioStreamSample::LOOP_DISABLED && offset >= loop_end_fp) { /* loopend reached */ - if (loop_format == AudioStreamSample::LOOP_PING_PONG) { + if (loop_format == AudioStreamSample::LOOP_PINGPONG) { /* bounce ping pong */ offset = loop_end_fp - (offset - loop_end_fp); increment = -increment; @@ -636,7 +636,7 @@ void AudioStreamSample::_bind_methods() { ClassDB::bind_method(D_METHOD("save_to_wav", "path"), &AudioStreamSample::save_to_wav); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_BYTE_ARRAY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_data", "get_data"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_BYTE_ARRAY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_data", "get_data"); ADD_PROPERTY(PropertyInfo(Variant::INT, "format", PROPERTY_HINT_ENUM, "8-Bit,16-Bit,IMA-ADPCM"), "set_format", "get_format"); ADD_PROPERTY(PropertyInfo(Variant::INT, "loop_mode", PROPERTY_HINT_ENUM, "Disabled,Forward,Ping-Pong,Backward"), "set_loop_mode", "get_loop_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "loop_begin"), "set_loop_begin", "get_loop_begin"); @@ -650,7 +650,7 @@ void AudioStreamSample::_bind_methods() { BIND_ENUM_CONSTANT(LOOP_DISABLED); BIND_ENUM_CONSTANT(LOOP_FORWARD); - BIND_ENUM_CONSTANT(LOOP_PING_PONG); + BIND_ENUM_CONSTANT(LOOP_PINGPONG); BIND_ENUM_CONSTANT(LOOP_BACKWARD); } diff --git a/scene/resources/audio_stream_sample.h b/scene/resources/audio_stream_sample.h index 24198e3c98..0eb34be9bf 100644 --- a/scene/resources/audio_stream_sample.h +++ b/scene/resources/audio_stream_sample.h @@ -92,7 +92,7 @@ public: enum LoopMode { LOOP_DISABLED, LOOP_FORWARD, - LOOP_PING_PONG, + LOOP_PINGPONG, LOOP_BACKWARD }; diff --git a/scene/resources/bit_map.cpp b/scene/resources/bit_map.cpp index 49ed9dcb82..16f1507c34 100644 --- a/scene/resources/bit_map.cpp +++ b/scene/resources/bit_map.cpp @@ -674,7 +674,7 @@ void BitMap::_bind_methods() { ClassDB::bind_method(D_METHOD("grow_mask", "pixels", "rect"), &BitMap::grow_mask); ClassDB::bind_method(D_METHOD("opaque_to_polygons", "rect", "epsilon"), &BitMap::_opaque_to_polygons_bind, DEFVAL(2.0)); - ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); } BitMap::BitMap() {} diff --git a/scene/resources/camera_effects.cpp b/scene/resources/camera_effects.cpp index b633196424..0df372ea1b 100644 --- a/scene/resources/camera_effects.cpp +++ b/scene/resources/camera_effects.cpp @@ -149,7 +149,7 @@ void CameraEffects::_validate_property(PropertyInfo &property) const { if ((!dof_blur_far_enabled && (property.name == "dof_blur_far_distance" || property.name == "dof_blur_far_transition")) || (!dof_blur_near_enabled && (property.name == "dof_blur_near_distance" || property.name == "dof_blur_near_transition")) || (!override_exposure_enabled && property.name == "override_exposure")) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/resources/concave_polygon_shape_3d.cpp b/scene/resources/concave_polygon_shape_3d.cpp index 3fed700383..03854683bd 100644 --- a/scene/resources/concave_polygon_shape_3d.cpp +++ b/scene/resources/concave_polygon_shape_3d.cpp @@ -108,7 +108,7 @@ void ConcavePolygonShape3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_backface_collision_enabled", "enabled"), &ConcavePolygonShape3D::set_backface_collision_enabled); ClassDB::bind_method(D_METHOD("is_backface_collision_enabled"), &ConcavePolygonShape3D::is_backface_collision_enabled); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_faces", "get_faces"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_faces", "get_faces"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "backface_collision"), "set_backface_collision_enabled", "is_backface_collision_enabled"); } diff --git a/scene/resources/curve.cpp b/scene/resources/curve.cpp index 9dc76dcf44..bf3efd7599 100644 --- a/scene/resources/curve.cpp +++ b/scene/resources/curve.cpp @@ -33,15 +33,15 @@ #include "core/core_string_names.h" template <class T> -static _FORCE_INLINE_ T _bezier_interp(real_t t, T start, T control_1, T control_2, T end) { +static _FORCE_INLINE_ T _bezier_interp(real_t p_t, T p_start, T p_control_1, T p_control_2, T p_end) { /* Formula from Wikipedia article on Bezier curves. */ - real_t omt = (1.0 - t); + real_t omt = (1.0 - p_t); real_t omt2 = omt * omt; real_t omt3 = omt2 * omt; - real_t t2 = t * t; - real_t t3 = t2 * t; + real_t t2 = p_t * p_t; + real_t t3 = t2 * p_t; - return start * omt3 + control_1 * omt2 * t * 3.0 + control_2 * omt * t2 * 3.0 + end * t3; + return p_start * omt3 + p_control_1 * omt2 * p_t * 3.0 + p_control_2 * omt * t2 * 3.0 + p_end * t3; } const char *Curve::SIGNAL_RANGE_CHANGED = "range_changed"; @@ -49,46 +49,46 @@ const char *Curve::SIGNAL_RANGE_CHANGED = "range_changed"; Curve::Curve() { } -int Curve::add_point(Vector2 p_pos, real_t left_tangent, real_t right_tangent, TangentMode left_mode, TangentMode right_mode) { +int Curve::add_point(Vector2 p_position, real_t p_left_tangent, real_t p_right_tangent, TangentMode p_left_mode, TangentMode p_right_mode) { // Add a point and preserve order // Curve bounds is in 0..1 - if (p_pos.x > MAX_X) { - p_pos.x = MAX_X; - } else if (p_pos.x < MIN_X) { - p_pos.x = MIN_X; + if (p_position.x > MAX_X) { + p_position.x = MAX_X; + } else if (p_position.x < MIN_X) { + p_position.x = MIN_X; } int ret = -1; if (_points.size() == 0) { - _points.push_back(Point(p_pos, left_tangent, right_tangent, left_mode, right_mode)); + _points.push_back(Point(p_position, p_left_tangent, p_right_tangent, p_left_mode, p_right_mode)); ret = 0; } else if (_points.size() == 1) { // TODO Is the `else` able to handle this block already? - real_t diff = p_pos.x - _points[0].pos.x; + real_t diff = p_position.x - _points[0].position.x; if (diff > 0) { - _points.push_back(Point(p_pos, left_tangent, right_tangent, left_mode, right_mode)); + _points.push_back(Point(p_position, p_left_tangent, p_right_tangent, p_left_mode, p_right_mode)); ret = 1; } else { - _points.insert(0, Point(p_pos, left_tangent, right_tangent, left_mode, right_mode)); + _points.insert(0, Point(p_position, p_left_tangent, p_right_tangent, p_left_mode, p_right_mode)); ret = 0; } } else { - int i = get_index(p_pos.x); + int i = get_index(p_position.x); - if (i == 0 && p_pos.x < _points[0].pos.x) { + if (i == 0 && p_position.x < _points[0].position.x) { // Insert before anything else - _points.insert(0, Point(p_pos, left_tangent, right_tangent, left_mode, right_mode)); + _points.insert(0, Point(p_position, p_left_tangent, p_right_tangent, p_left_mode, p_right_mode)); ret = 0; } else { // Insert between i and i+1 ++i; - _points.insert(i, Point(p_pos, left_tangent, right_tangent, left_mode, right_mode)); + _points.insert(i, Point(p_position, p_left_tangent, p_right_tangent, p_left_mode, p_right_mode)); ret = i; } } @@ -100,7 +100,7 @@ int Curve::add_point(Vector2 p_pos, real_t left_tangent, real_t right_tangent, T return ret; } -int Curve::get_index(real_t offset) const { +int Curve::get_index(real_t p_offset) const { // Lower-bound float binary search int imin = 0; @@ -109,13 +109,13 @@ int Curve::get_index(real_t offset) const { while (imax - imin > 1) { int m = (imin + imax) / 2; - real_t a = _points[m].pos.x; - real_t b = _points[m + 1].pos.x; + real_t a = _points[m].position.x; + real_t b = _points[m + 1].position.x; - if (a < offset && b < offset) { + if (a < p_offset && b < p_offset) { imin = m; - } else if (a > offset) { + } else if (a > p_offset) { imax = m; } else { @@ -124,7 +124,7 @@ int Curve::get_index(real_t offset) const { } // Will happen if the offset is out of bounds - if (offset > _points[imax].pos.x) { + if (p_offset > _points[imax].position.x) { return imax; } return imin; @@ -134,9 +134,9 @@ void Curve::clean_dupes() { bool dirty = false; for (int i = 1; i < _points.size(); ++i) { - real_t diff = _points[i - 1].pos.x - _points[i].pos.x; + real_t diff = _points[i - 1].position.x - _points[i].position.x; if (diff <= CMP_EPSILON) { - _points.remove(i); + _points.remove_at(i); --i; dirty = true; } @@ -147,67 +147,67 @@ void Curve::clean_dupes() { } } -void Curve::set_point_left_tangent(int i, real_t tangent) { - ERR_FAIL_INDEX(i, _points.size()); - _points.write[i].left_tangent = tangent; - _points.write[i].left_mode = TANGENT_FREE; +void Curve::set_point_left_tangent(int p_index, real_t p_tangent) { + ERR_FAIL_INDEX(p_index, _points.size()); + _points.write[p_index].left_tangent = p_tangent; + _points.write[p_index].left_mode = TANGENT_FREE; mark_dirty(); } -void Curve::set_point_right_tangent(int i, real_t tangent) { - ERR_FAIL_INDEX(i, _points.size()); - _points.write[i].right_tangent = tangent; - _points.write[i].right_mode = TANGENT_FREE; +void Curve::set_point_right_tangent(int p_index, real_t p_tangent) { + ERR_FAIL_INDEX(p_index, _points.size()); + _points.write[p_index].right_tangent = p_tangent; + _points.write[p_index].right_mode = TANGENT_FREE; mark_dirty(); } -void Curve::set_point_left_mode(int i, TangentMode p_mode) { - ERR_FAIL_INDEX(i, _points.size()); - _points.write[i].left_mode = p_mode; - if (i > 0) { +void Curve::set_point_left_mode(int p_index, TangentMode p_mode) { + ERR_FAIL_INDEX(p_index, _points.size()); + _points.write[p_index].left_mode = p_mode; + if (p_index > 0) { if (p_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i - 1].pos - _points[i].pos).normalized(); - _points.write[i].left_tangent = v.y / v.x; + Vector2 v = (_points[p_index - 1].position - _points[p_index].position).normalized(); + _points.write[p_index].left_tangent = v.y / v.x; } } mark_dirty(); } -void Curve::set_point_right_mode(int i, TangentMode p_mode) { - ERR_FAIL_INDEX(i, _points.size()); - _points.write[i].right_mode = p_mode; - if (i + 1 < _points.size()) { +void Curve::set_point_right_mode(int p_index, TangentMode p_mode) { + ERR_FAIL_INDEX(p_index, _points.size()); + _points.write[p_index].right_mode = p_mode; + if (p_index + 1 < _points.size()) { if (p_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i + 1].pos - _points[i].pos).normalized(); - _points.write[i].right_tangent = v.y / v.x; + Vector2 v = (_points[p_index + 1].position - _points[p_index].position).normalized(); + _points.write[p_index].right_tangent = v.y / v.x; } } mark_dirty(); } -real_t Curve::get_point_left_tangent(int i) const { - ERR_FAIL_INDEX_V(i, _points.size(), 0); - return _points[i].left_tangent; +real_t Curve::get_point_left_tangent(int p_index) const { + ERR_FAIL_INDEX_V(p_index, _points.size(), 0); + return _points[p_index].left_tangent; } -real_t Curve::get_point_right_tangent(int i) const { - ERR_FAIL_INDEX_V(i, _points.size(), 0); - return _points[i].right_tangent; +real_t Curve::get_point_right_tangent(int p_index) const { + ERR_FAIL_INDEX_V(p_index, _points.size(), 0); + return _points[p_index].right_tangent; } -Curve::TangentMode Curve::get_point_left_mode(int i) const { - ERR_FAIL_INDEX_V(i, _points.size(), TANGENT_FREE); - return _points[i].left_mode; +Curve::TangentMode Curve::get_point_left_mode(int p_index) const { + ERR_FAIL_INDEX_V(p_index, _points.size(), TANGENT_FREE); + return _points[p_index].left_mode; } -Curve::TangentMode Curve::get_point_right_mode(int i) const { - ERR_FAIL_INDEX_V(i, _points.size(), TANGENT_FREE); - return _points[i].right_mode; +Curve::TangentMode Curve::get_point_right_mode(int p_index) const { + ERR_FAIL_INDEX_V(p_index, _points.size(), TANGENT_FREE); + return _points[p_index].right_mode; } void Curve::remove_point(int p_index) { ERR_FAIL_INDEX(p_index, _points.size()); - _points.remove(p_index); + _points.remove_at(p_index); mark_dirty(); } @@ -216,18 +216,18 @@ void Curve::clear_points() { mark_dirty(); } -void Curve::set_point_value(int p_index, real_t pos) { +void Curve::set_point_value(int p_index, real_t p_position) { ERR_FAIL_INDEX(p_index, _points.size()); - _points.write[p_index].pos.y = pos; + _points.write[p_index].position.y = p_position; update_auto_tangents(p_index); mark_dirty(); } -int Curve::set_point_offset(int p_index, float offset) { +int Curve::set_point_offset(int p_index, real_t p_offset) { ERR_FAIL_INDEX_V(p_index, _points.size(), -1); Point p = _points[p_index]; remove_point(p_index); - int i = add_point(Vector2(offset, p.pos.y)); + int i = add_point(Vector2(p_offset, p.position.y)); _points.write[i].left_tangent = p.left_tangent; _points.write[i].right_tangent = p.right_tangent; _points.write[i].left_mode = p.left_mode; @@ -241,7 +241,7 @@ int Curve::set_point_offset(int p_index, float offset) { Vector2 Curve::get_point_position(int p_index) const { ERR_FAIL_INDEX_V(p_index, _points.size(), Vector2(0, 0)); - return _points[p_index].pos; + return _points[p_index].position; } Curve::Point Curve::get_point(int p_index) const { @@ -249,35 +249,35 @@ Curve::Point Curve::get_point(int p_index) const { return _points[p_index]; } -void Curve::update_auto_tangents(int i) { - Point &p = _points.write[i]; +void Curve::update_auto_tangents(int p_index) { + Point &p = _points.write[p_index]; - if (i > 0) { + if (p_index > 0) { if (p.left_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i - 1].pos - p.pos).normalized(); + Vector2 v = (_points[p_index - 1].position - p.position).normalized(); p.left_tangent = v.y / v.x; } - if (_points[i - 1].right_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i - 1].pos - p.pos).normalized(); - _points.write[i - 1].right_tangent = v.y / v.x; + if (_points[p_index - 1].right_mode == TANGENT_LINEAR) { + Vector2 v = (_points[p_index - 1].position - p.position).normalized(); + _points.write[p_index - 1].right_tangent = v.y / v.x; } } - if (i + 1 < _points.size()) { + if (p_index + 1 < _points.size()) { if (p.right_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i + 1].pos - p.pos).normalized(); + Vector2 v = (_points[p_index + 1].position - p.position).normalized(); p.right_tangent = v.y / v.x; } - if (_points[i + 1].left_mode == TANGENT_LINEAR) { - Vector2 v = (_points[i + 1].pos - p.pos).normalized(); - _points.write[i + 1].left_tangent = v.y / v.x; + if (_points[p_index + 1].left_mode == TANGENT_LINEAR) { + Vector2 v = (_points[p_index + 1].position - p.position).normalized(); + _points.write[p_index + 1].left_tangent = v.y / v.x; } } } #define MIN_Y_RANGE 0.01 -void Curve::set_min_value(float p_min) { +void Curve::set_min_value(real_t p_min) { if (_minmax_set_once & 0b11 && p_min > _max_value - MIN_Y_RANGE) { _min_value = _max_value - MIN_Y_RANGE; } else { @@ -289,7 +289,7 @@ void Curve::set_min_value(float p_min) { emit_signal(SNAME(SIGNAL_RANGE_CHANGED)); } -void Curve::set_max_value(float p_max) { +void Curve::set_max_value(real_t p_max) { if (_minmax_set_once & 0b11 && p_max < _min_value + MIN_Y_RANGE) { _max_value = _min_value + MIN_Y_RANGE; } else { @@ -299,32 +299,32 @@ void Curve::set_max_value(float p_max) { emit_signal(SNAME(SIGNAL_RANGE_CHANGED)); } -real_t Curve::interpolate(real_t offset) const { +real_t Curve::interpolate(real_t p_offset) const { if (_points.size() == 0) { return 0; } if (_points.size() == 1) { - return _points[0].pos.y; + return _points[0].position.y; } - int i = get_index(offset); + int i = get_index(p_offset); if (i == _points.size() - 1) { - return _points[i].pos.y; + return _points[i].position.y; } - real_t local = offset - _points[i].pos.x; + real_t local = p_offset - _points[i].position.x; if (i == 0 && local <= 0) { - return _points[0].pos.y; + return _points[0].position.y; } return interpolate_local_nocheck(i, local); } -real_t Curve::interpolate_local_nocheck(int index, real_t local_offset) const { - const Point a = _points[index]; - const Point b = _points[index + 1]; +real_t Curve::interpolate_local_nocheck(int p_index, real_t p_local_offset) const { + const Point a = _points[p_index]; + const Point b = _points[p_index + 1]; /* Cubic bezier * @@ -341,16 +341,16 @@ real_t Curve::interpolate_local_nocheck(int index, real_t local_offset) const { */ // Control points are chosen at equal distances - real_t d = b.pos.x - a.pos.x; - if (Math::abs(d) <= CMP_EPSILON) { - return b.pos.y; + real_t d = b.position.x - a.position.x; + if (Math::is_zero_approx(d)) { + return b.position.y; } - local_offset /= d; + p_local_offset /= d; d /= 3.0; - real_t yac = a.pos.y + d * a.right_tangent; - real_t ybc = b.pos.y - d * b.left_tangent; + real_t yac = a.position.y + d * a.right_tangent; + real_t ybc = b.position.y - d * b.left_tangent; - real_t y = _bezier_interp(local_offset, a.pos.y, yac, ybc, b.pos.y); + real_t y = _bezier_interp(p_local_offset, a.position.y, yac, ybc, b.position.y); return y; } @@ -369,7 +369,7 @@ Array Curve::get_data() const { const Point p = _points[j]; int i = j * ELEMS; - output[i] = p.pos; + output[i] = p.position; output[i + 1] = p.left_tangent; output[i + 2] = p.right_tangent; output[i + 3] = p.left_mode; @@ -379,39 +379,39 @@ Array Curve::get_data() const { return output; } -void Curve::set_data(Array input) { +void Curve::set_data(const Array p_input) { const unsigned int ELEMS = 5; - ERR_FAIL_COND(input.size() % ELEMS != 0); + ERR_FAIL_COND(p_input.size() % ELEMS != 0); _points.clear(); // Validate input - for (int i = 0; i < input.size(); i += ELEMS) { - ERR_FAIL_COND(input[i].get_type() != Variant::VECTOR2); - ERR_FAIL_COND(!input[i + 1].is_num()); - ERR_FAIL_COND(input[i + 2].get_type() != Variant::FLOAT); + for (int i = 0; i < p_input.size(); i += ELEMS) { + ERR_FAIL_COND(p_input[i].get_type() != Variant::VECTOR2); + ERR_FAIL_COND(!p_input[i + 1].is_num()); + ERR_FAIL_COND(p_input[i + 2].get_type() != Variant::FLOAT); - ERR_FAIL_COND(input[i + 3].get_type() != Variant::INT); - int left_mode = input[i + 3]; + ERR_FAIL_COND(p_input[i + 3].get_type() != Variant::INT); + int left_mode = p_input[i + 3]; ERR_FAIL_COND(left_mode < 0 || left_mode >= TANGENT_MODE_COUNT); - ERR_FAIL_COND(input[i + 4].get_type() != Variant::INT); - int right_mode = input[i + 4]; + ERR_FAIL_COND(p_input[i + 4].get_type() != Variant::INT); + int right_mode = p_input[i + 4]; ERR_FAIL_COND(right_mode < 0 || right_mode >= TANGENT_MODE_COUNT); } - _points.resize(input.size() / ELEMS); + _points.resize(p_input.size() / ELEMS); for (int j = 0; j < _points.size(); ++j) { Point &p = _points.write[j]; int i = j * ELEMS; - p.pos = input[i]; - p.left_tangent = input[i + 1]; - p.right_tangent = input[i + 2]; + p.position = p_input[i]; + p.left_tangent = p_input[i + 1]; + p.right_tangent = p_input[i + 2]; // TODO For some reason the compiler won't convert from Variant to enum - int left_mode = input[i + 3]; - int right_mode = input[i + 4]; + int left_mode = p_input[i + 3]; + int right_mode = p_input[i + 4]; p.left_mode = (TangentMode)left_mode; p.right_mode = (TangentMode)right_mode; } @@ -431,8 +431,8 @@ void Curve::bake() { } if (_points.size() != 0) { - _baked_cache.write[0] = _points[0].pos.y; - _baked_cache.write[_baked_cache.size() - 1] = _points[_points.size() - 1].pos.y; + _baked_cache.write[0] = _points[0].position.y; + _baked_cache.write[_baked_cache.size() - 1] = _points[_points.size() - 1].position.y; } _baked_cache_dirty = false; @@ -445,7 +445,7 @@ void Curve::set_bake_resolution(int p_resolution) { _baked_cache_dirty = true; } -real_t Curve::interpolate_baked(real_t offset) const { +real_t Curve::interpolate_baked(real_t p_offset) const { if (_baked_cache_dirty) { // Last-second bake if not done already const_cast<Curve *>(this)->bake(); @@ -456,13 +456,13 @@ real_t Curve::interpolate_baked(real_t offset) const { if (_points.size() == 0) { return 0; } - return _points[0].pos.y; + return _points[0].position.y; } else if (_baked_cache.size() == 1) { return _baked_cache[0]; } // Get interpolation index - real_t fi = offset * _baked_cache.size(); + real_t fi = p_offset * _baked_cache.size(); int i = Math::floor(fi); if (i < 0) { i = 0; @@ -481,7 +481,7 @@ real_t Curve::interpolate_baked(real_t offset) const { } } -void Curve::ensure_default_setup(float p_min, float p_max) { +void Curve::ensure_default_setup(real_t p_min, real_t p_max) { if (_points.size() == 0 && _min_value == 0 && _max_value == 1) { add_point(Vector2(0, 1)); add_point(Vector2(1, 1)); @@ -522,7 +522,7 @@ void Curve::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "min_value", PROPERTY_HINT_RANGE, "-1024,1024,0.01"), "set_min_value", "get_min_value"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "max_value", PROPERTY_HINT_RANGE, "-1024,1024,0.01"), "set_max_value", "get_max_value"); ADD_PROPERTY(PropertyInfo(Variant::INT, "bake_resolution", PROPERTY_HINT_RANGE, "1,1000,1"), "set_bake_resolution", "get_bake_resolution"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); ADD_SIGNAL(MethodInfo(SIGNAL_RANGE_CHANGED)); @@ -535,9 +535,9 @@ int Curve2D::get_point_count() const { return points.size(); } -void Curve2D::add_point(const Vector2 &p_pos, const Vector2 &p_in, const Vector2 &p_out, int p_atpos) { +void Curve2D::add_point(const Vector2 &p_position, const Vector2 &p_in, const Vector2 &p_out, int p_atpos) { Point n; - n.pos = p_pos; + n.position = p_position; n.in = p_in; n.out = p_out; if (p_atpos >= 0 && p_atpos < points.size()) { @@ -550,17 +550,17 @@ void Curve2D::add_point(const Vector2 &p_pos, const Vector2 &p_in, const Vector2 emit_signal(CoreStringNames::get_singleton()->changed); } -void Curve2D::set_point_position(int p_index, const Vector2 &p_pos) { +void Curve2D::set_point_position(int p_index, const Vector2 &p_position) { ERR_FAIL_INDEX(p_index, points.size()); - points.write[p_index].pos = p_pos; + points.write[p_index].position = p_position; baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } Vector2 Curve2D::get_point_position(int p_index) const { ERR_FAIL_INDEX_V(p_index, points.size(), Vector2()); - return points[p_index].pos; + return points[p_index].position; } void Curve2D::set_point_in(int p_index, const Vector2 &p_in) { @@ -591,7 +591,7 @@ Vector2 Curve2D::get_point_out(int p_index) const { void Curve2D::remove_point(int p_index) { ERR_FAIL_INDEX(p_index, points.size()); - points.remove(p_index); + points.remove_at(p_index); baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } @@ -604,19 +604,19 @@ void Curve2D::clear_points() { } } -Vector2 Curve2D::interpolate(int p_index, float p_offset) const { +Vector2 Curve2D::interpolate(int p_index, const real_t p_offset) const { int pc = points.size(); ERR_FAIL_COND_V(pc == 0, Vector2()); if (p_index >= pc - 1) { - return points[pc - 1].pos; + return points[pc - 1].position; } else if (p_index < 0) { - return points[0].pos; + return points[0].position; } - Vector2 p0 = points[p_index].pos; + Vector2 p0 = points[p_index].position; Vector2 p1 = p0 + points[p_index].out; - Vector2 p3 = points[p_index + 1].pos; + Vector2 p3 = points[p_index + 1].position; Vector2 p2 = p3 + points[p_index + 1].in; return _bezier_interp(p_offset, p0, p1, p2, p3); @@ -632,15 +632,15 @@ Vector2 Curve2D::interpolatef(real_t p_findex) const { return interpolate((int)p_findex, Math::fmod(p_findex, (real_t)1.0)); } -void Curve2D::_bake_segment2d(Map<float, Vector2> &r_bake, float p_begin, float p_end, const Vector2 &p_a, const Vector2 &p_out, const Vector2 &p_b, const Vector2 &p_in, int p_depth, int p_max_depth, float p_tol) const { - float mp = p_begin + (p_end - p_begin) * 0.5; +void Curve2D::_bake_segment2d(Map<real_t, Vector2> &r_bake, real_t p_begin, real_t p_end, const Vector2 &p_a, const Vector2 &p_out, const Vector2 &p_b, const Vector2 &p_in, int p_depth, int p_max_depth, real_t p_tol) const { + real_t mp = p_begin + (p_end - p_begin) * 0.5; Vector2 beg = _bezier_interp(p_begin, p_a, p_a + p_out, p_b + p_in, p_b); Vector2 mid = _bezier_interp(mp, p_a, p_a + p_out, p_b + p_in, p_b); Vector2 end = _bezier_interp(p_end, p_a, p_a + p_out, p_b + p_in, p_b); Vector2 na = (mid - beg).normalized(); Vector2 nb = (end - mid).normalized(); - float dp = na.dot(nb); + real_t dp = na.dot(nb); if (dp < Math::cos(Math::deg2rad(p_tol))) { r_bake[mp] = mid; @@ -668,47 +668,47 @@ void Curve2D::_bake() const { if (points.size() == 1) { baked_point_cache.resize(1); - baked_point_cache.set(0, points[0].pos); + baked_point_cache.set(0, points[0].position); baked_dist_cache.resize(1); baked_dist_cache.set(0, 0.0); return; } - Vector2 pos = points[0].pos; - float dist = 0.0; + Vector2 position = points[0].position; + real_t dist = 0.0; List<Vector2> pointlist; - List<float> distlist; + List<real_t> distlist; - pointlist.push_back(pos); //start always from origin + pointlist.push_back(position); //start always from origin distlist.push_back(0.0); for (int i = 0; i < points.size() - 1; i++) { - float step = 0.1; // at least 10 substeps ought to be enough? - float p = 0.0; + real_t step = 0.1; // at least 10 substeps ought to be enough? + real_t p = 0.0; while (p < 1.0) { - float np = p + step; + real_t np = p + step; if (np > 1.0) { np = 1.0; } - Vector2 npp = _bezier_interp(np, points[i].pos, points[i].pos + points[i].out, points[i + 1].pos + points[i + 1].in, points[i + 1].pos); - float d = pos.distance_to(npp); + Vector2 npp = _bezier_interp(np, points[i].position, points[i].position + points[i].out, points[i + 1].position + points[i + 1].in, points[i + 1].position); + real_t d = position.distance_to(npp); if (d > bake_interval) { // OK! between P and NP there _has_ to be Something, let's go searching! int iterations = 10; //lots of detail! - float low = p; - float hi = np; - float mid = low + (hi - low) * 0.5; + real_t low = p; + real_t hi = np; + real_t mid = low + (hi - low) * 0.5; for (int j = 0; j < iterations; j++) { - npp = _bezier_interp(mid, points[i].pos, points[i].pos + points[i].out, points[i + 1].pos + points[i + 1].in, points[i + 1].pos); - d = pos.distance_to(npp); + npp = _bezier_interp(mid, points[i].position, points[i].position + points[i].out, points[i + 1].position + points[i + 1].in, points[i + 1].position); + d = position.distance_to(npp); if (bake_interval < d) { hi = mid; @@ -718,11 +718,11 @@ void Curve2D::_bake() const { mid = low + (hi - low) * 0.5; } - pos = npp; + position = npp; p = mid; dist += d; - pointlist.push_back(pos); + pointlist.push_back(position); distlist.push_back(dist); } else { p = np; @@ -730,9 +730,9 @@ void Curve2D::_bake() const { } } - Vector2 lastpos = points[points.size() - 1].pos; + Vector2 lastpos = points[points.size() - 1].position; - float rem = pos.distance_to(lastpos); + real_t rem = position.distance_to(lastpos); dist += rem; baked_max_ofs = dist; pointlist.push_back(lastpos); @@ -742,7 +742,7 @@ void Curve2D::_bake() const { baked_dist_cache.resize(distlist.size()); Vector2 *w = baked_point_cache.ptrw(); - float *wd = baked_dist_cache.ptrw(); + real_t *wd = baked_dist_cache.ptrw(); for (int i = 0; i < pointlist.size(); i++) { w[i] = pointlist[i]; @@ -750,7 +750,7 @@ void Curve2D::_bake() const { } } -float Curve2D::get_baked_length() const { +real_t Curve2D::get_baked_length() const { if (baked_cache_dirty) { _bake(); } @@ -758,7 +758,7 @@ float Curve2D::get_baked_length() const { return baked_max_ofs; } -Vector2 Curve2D::interpolate_baked(float p_offset, bool p_cubic) const { +Vector2 Curve2D::interpolate_baked(real_t p_offset, bool p_cubic) const { if (baked_cache_dirty) { _bake(); } @@ -784,7 +784,7 @@ Vector2 Curve2D::interpolate_baked(float p_offset, bool p_cubic) const { int start = 0, end = bpc, idx = (end + start) / 2; // binary search to find baked points while (start < idx) { - float offset = baked_dist_cache[idx]; + real_t offset = baked_dist_cache[idx]; if (p_offset <= offset) { end = idx; } else { @@ -793,13 +793,13 @@ Vector2 Curve2D::interpolate_baked(float p_offset, bool p_cubic) const { idx = (end + start) / 2; } - float offset_begin = baked_dist_cache[idx]; - float offset_end = baked_dist_cache[idx + 1]; + real_t offset_begin = baked_dist_cache[idx]; + real_t offset_end = baked_dist_cache[idx + 1]; - float idx_interval = offset_end - offset_begin; + real_t idx_interval = offset_end - offset_begin; ERR_FAIL_COND_V_MSG(p_offset < offset_begin || p_offset > offset_end, Vector2(), "failed to find baked segment"); - float frac = (p_offset - offset_begin) / idx_interval; + real_t frac = (p_offset - offset_begin) / idx_interval; if (p_cubic) { Vector2 pre = idx > 0 ? r[idx - 1] : r[idx]; @@ -818,13 +818,13 @@ PackedVector2Array Curve2D::get_baked_points() const { return baked_point_cache; } -void Curve2D::set_bake_interval(float p_tolerance) { +void Curve2D::set_bake_interval(real_t p_tolerance) { bake_interval = p_tolerance; baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } -float Curve2D::get_bake_interval() const { +real_t Curve2D::get_bake_interval() const { return bake_interval; } @@ -846,16 +846,16 @@ Vector2 Curve2D::get_closest_point(const Vector2 &p_to_point) const { const Vector2 *r = baked_point_cache.ptr(); Vector2 nearest; - float nearest_dist = -1.0f; + real_t nearest_dist = -1.0f; for (int i = 0; i < pc - 1; i++) { Vector2 origin = r[i]; Vector2 direction = (r[i + 1] - origin) / bake_interval; - float d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); + real_t d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); Vector2 proj = origin + direction * d; - float dist = proj.distance_squared_to(p_to_point); + real_t dist = proj.distance_squared_to(p_to_point); if (nearest_dist < 0.0f || dist < nearest_dist) { nearest = proj; @@ -866,7 +866,7 @@ Vector2 Curve2D::get_closest_point(const Vector2 &p_to_point) const { return nearest; } -float Curve2D::get_closest_offset(const Vector2 &p_to_point) const { +real_t Curve2D::get_closest_offset(const Vector2 &p_to_point) const { // Brute force method if (baked_cache_dirty) { @@ -883,18 +883,18 @@ float Curve2D::get_closest_offset(const Vector2 &p_to_point) const { const Vector2 *r = baked_point_cache.ptr(); - float nearest = 0.0f; - float nearest_dist = -1.0f; - float offset = 0.0f; + real_t nearest = 0.0f; + real_t nearest_dist = -1.0f; + real_t offset = 0.0f; for (int i = 0; i < pc - 1; i++) { Vector2 origin = r[i]; Vector2 direction = (r[i + 1] - origin) / bake_interval; - float d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); + real_t d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); Vector2 proj = origin + direction * d; - float dist = proj.distance_squared_to(p_to_point); + real_t dist = proj.distance_squared_to(p_to_point); if (nearest_dist < 0.0f || dist < nearest_dist) { nearest = offset + d; @@ -917,7 +917,7 @@ Dictionary Curve2D::_get_data() const { for (int i = 0; i < points.size(); i++) { w[i * 3 + 0] = points[i].in; w[i * 3 + 1] = points[i].out; - w[i * 3 + 2] = points[i].pos; + w[i * 3 + 2] = points[i].position; } dc["points"] = d; @@ -937,42 +937,42 @@ void Curve2D::_set_data(const Dictionary &p_data) { for (int i = 0; i < points.size(); i++) { points.write[i].in = r[i * 3 + 0]; points.write[i].out = r[i * 3 + 1]; - points.write[i].pos = r[i * 3 + 2]; + points.write[i].position = r[i * 3 + 2]; } baked_cache_dirty = true; } -PackedVector2Array Curve2D::tessellate(int p_max_stages, float p_tolerance) const { +PackedVector2Array Curve2D::tessellate(int p_max_stages, real_t p_tolerance) const { PackedVector2Array tess; if (points.size() == 0) { return tess; } - Vector<Map<float, Vector2>> midpoints; + Vector<Map<real_t, Vector2>> midpoints; midpoints.resize(points.size() - 1); int pc = 1; for (int i = 0; i < points.size() - 1; i++) { - _bake_segment2d(midpoints.write[i], 0, 1, points[i].pos, points[i].out, points[i + 1].pos, points[i + 1].in, 0, p_max_stages, p_tolerance); + _bake_segment2d(midpoints.write[i], 0, 1, points[i].position, points[i].out, points[i + 1].position, points[i + 1].in, 0, p_max_stages, p_tolerance); pc++; pc += midpoints[i].size(); } tess.resize(pc); Vector2 *bpw = tess.ptrw(); - bpw[0] = points[0].pos; + bpw[0] = points[0].position; int pidx = 0; for (int i = 0; i < points.size() - 1; i++) { - for (const KeyValue<float, Vector2> &E : midpoints[i]) { + for (const KeyValue<real_t, Vector2> &E : midpoints[i]) { pidx++; bpw[pidx] = E.value; } pidx++; - bpw[pidx] = points[i + 1].pos; + bpw[pidx] = points[i + 1].position; } return tess; @@ -1006,7 +1006,7 @@ void Curve2D::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_data"), &Curve2D::_set_data); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bake_interval", PROPERTY_HINT_RANGE, "0.01,512,0.01"), "set_bake_interval", "get_bake_interval"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); } Curve2D::Curve2D() { @@ -1026,9 +1026,9 @@ int Curve3D::get_point_count() const { return points.size(); } -void Curve3D::add_point(const Vector3 &p_pos, const Vector3 &p_in, const Vector3 &p_out, int p_atpos) { +void Curve3D::add_point(const Vector3 &p_position, const Vector3 &p_in, const Vector3 &p_out, int p_atpos) { Point n; - n.pos = p_pos; + n.position = p_position; n.in = p_in; n.out = p_out; if (p_atpos >= 0 && p_atpos < points.size()) { @@ -1041,20 +1041,20 @@ void Curve3D::add_point(const Vector3 &p_pos, const Vector3 &p_in, const Vector3 emit_signal(CoreStringNames::get_singleton()->changed); } -void Curve3D::set_point_position(int p_index, const Vector3 &p_pos) { +void Curve3D::set_point_position(int p_index, const Vector3 &p_position) { ERR_FAIL_INDEX(p_index, points.size()); - points.write[p_index].pos = p_pos; + points.write[p_index].position = p_position; baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } Vector3 Curve3D::get_point_position(int p_index) const { ERR_FAIL_INDEX_V(p_index, points.size(), Vector3()); - return points[p_index].pos; + return points[p_index].position; } -void Curve3D::set_point_tilt(int p_index, float p_tilt) { +void Curve3D::set_point_tilt(int p_index, real_t p_tilt) { ERR_FAIL_INDEX(p_index, points.size()); points.write[p_index].tilt = p_tilt; @@ -1062,7 +1062,7 @@ void Curve3D::set_point_tilt(int p_index, float p_tilt) { emit_signal(CoreStringNames::get_singleton()->changed); } -float Curve3D::get_point_tilt(int p_index) const { +real_t Curve3D::get_point_tilt(int p_index) const { ERR_FAIL_INDEX_V(p_index, points.size(), 0); return points[p_index].tilt; } @@ -1095,7 +1095,7 @@ Vector3 Curve3D::get_point_out(int p_index) const { void Curve3D::remove_point(int p_index) { ERR_FAIL_INDEX(p_index, points.size()); - points.remove(p_index); + points.remove_at(p_index); baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } @@ -1108,19 +1108,19 @@ void Curve3D::clear_points() { } } -Vector3 Curve3D::interpolate(int p_index, float p_offset) const { +Vector3 Curve3D::interpolate(int p_index, real_t p_offset) const { int pc = points.size(); ERR_FAIL_COND_V(pc == 0, Vector3()); if (p_index >= pc - 1) { - return points[pc - 1].pos; + return points[pc - 1].position; } else if (p_index < 0) { - return points[0].pos; + return points[0].position; } - Vector3 p0 = points[p_index].pos; + Vector3 p0 = points[p_index].position; Vector3 p1 = p0 + points[p_index].out; - Vector3 p3 = points[p_index + 1].pos; + Vector3 p3 = points[p_index + 1].position; Vector3 p2 = p3 + points[p_index + 1].in; return _bezier_interp(p_offset, p0, p1, p2, p3); @@ -1136,15 +1136,15 @@ Vector3 Curve3D::interpolatef(real_t p_findex) const { return interpolate((int)p_findex, Math::fmod(p_findex, (real_t)1.0)); } -void Curve3D::_bake_segment3d(Map<float, Vector3> &r_bake, float p_begin, float p_end, const Vector3 &p_a, const Vector3 &p_out, const Vector3 &p_b, const Vector3 &p_in, int p_depth, int p_max_depth, float p_tol) const { - float mp = p_begin + (p_end - p_begin) * 0.5; +void Curve3D::_bake_segment3d(Map<real_t, Vector3> &r_bake, real_t p_begin, real_t p_end, const Vector3 &p_a, const Vector3 &p_out, const Vector3 &p_b, const Vector3 &p_in, int p_depth, int p_max_depth, real_t p_tol) const { + real_t mp = p_begin + (p_end - p_begin) * 0.5; Vector3 beg = _bezier_interp(p_begin, p_a, p_a + p_out, p_b + p_in, p_b); Vector3 mid = _bezier_interp(mp, p_a, p_a + p_out, p_b + p_in, p_b); Vector3 end = _bezier_interp(p_end, p_a, p_a + p_out, p_b + p_in, p_b); Vector3 na = (mid - beg).normalized(); Vector3 nb = (end - mid).normalized(); - float dp = na.dot(nb); + real_t dp = na.dot(nb); if (dp < Math::cos(Math::deg2rad(p_tol))) { r_bake[mp] = mid; @@ -1173,7 +1173,7 @@ void Curve3D::_bake() const { if (points.size() == 1) { baked_point_cache.resize(1); - baked_point_cache.set(0, points[0].pos); + baked_point_cache.set(0, points[0].position); baked_tilt_cache.resize(1); baked_tilt_cache.set(0, points[0].tilt); baked_dist_cache.resize(1); @@ -1189,39 +1189,39 @@ void Curve3D::_bake() const { return; } - Vector3 pos = points[0].pos; - float dist = 0.0; + Vector3 position = points[0].position; + real_t dist = 0.0; List<Plane> pointlist; - List<float> distlist; + List<real_t> distlist; - pointlist.push_back(Plane(pos, points[0].tilt)); + pointlist.push_back(Plane(position, points[0].tilt)); distlist.push_back(0.0); for (int i = 0; i < points.size() - 1; i++) { - float step = 0.1; // at least 10 substeps ought to be enough? - float p = 0.0; + real_t step = 0.1; // at least 10 substeps ought to be enough? + real_t p = 0.0; while (p < 1.0) { - float np = p + step; + real_t np = p + step; if (np > 1.0) { np = 1.0; } - Vector3 npp = _bezier_interp(np, points[i].pos, points[i].pos + points[i].out, points[i + 1].pos + points[i + 1].in, points[i + 1].pos); - float d = pos.distance_to(npp); + Vector3 npp = _bezier_interp(np, points[i].position, points[i].position + points[i].out, points[i + 1].position + points[i + 1].in, points[i + 1].position); + real_t d = position.distance_to(npp); if (d > bake_interval) { // OK! between P and NP there _has_ to be Something, let's go searching! int iterations = 10; //lots of detail! - float low = p; - float hi = np; - float mid = low + (hi - low) * 0.5; + real_t low = p; + real_t hi = np; + real_t mid = low + (hi - low) * 0.5; for (int j = 0; j < iterations; j++) { - npp = _bezier_interp(mid, points[i].pos, points[i].pos + points[i].out, points[i + 1].pos + points[i + 1].in, points[i + 1].pos); - d = pos.distance_to(npp); + npp = _bezier_interp(mid, points[i].position, points[i].position + points[i].out, points[i + 1].position + points[i + 1].in, points[i + 1].position); + d = position.distance_to(npp); if (bake_interval < d) { hi = mid; @@ -1231,10 +1231,10 @@ void Curve3D::_bake() const { mid = low + (hi - low) * 0.5; } - pos = npp; + position = npp; p = mid; Plane post; - post.normal = pos; + post.normal = position; post.d = Math::lerp(points[i].tilt, points[i + 1].tilt, mid); dist += d; @@ -1246,10 +1246,10 @@ void Curve3D::_bake() const { } } - Vector3 lastpos = points[points.size() - 1].pos; - float lastilt = points[points.size() - 1].tilt; + Vector3 lastpos = points[points.size() - 1].position; + real_t lastilt = points[points.size() - 1].tilt; - float rem = pos.distance_to(lastpos); + real_t rem = position.distance_to(lastpos); dist += rem; baked_max_ofs = dist; pointlist.push_back(Plane(lastpos, lastilt)); @@ -1266,7 +1266,7 @@ void Curve3D::_bake() const { Vector3 *up_write = baked_up_vector_cache.ptrw(); baked_dist_cache.resize(pointlist.size()); - float *wd = baked_dist_cache.ptrw(); + real_t *wd = baked_dist_cache.ptrw(); Vector3 sideways; Vector3 up; @@ -1288,7 +1288,7 @@ void Curve3D::_bake() const { forward = idx > 0 ? (w[idx] - w[idx - 1]).normalized() : prev_forward; - float y_dot = prev_up.dot(forward); + real_t y_dot = prev_up.dot(forward); if (y_dot > (1.0f - CMP_EPSILON)) { sideways = prev_sideways; @@ -1315,7 +1315,7 @@ void Curve3D::_bake() const { } } -float Curve3D::get_baked_length() const { +real_t Curve3D::get_baked_length() const { if (baked_cache_dirty) { _bake(); } @@ -1323,7 +1323,7 @@ float Curve3D::get_baked_length() const { return baked_max_ofs; } -Vector3 Curve3D::interpolate_baked(float p_offset, bool p_cubic) const { +Vector3 Curve3D::interpolate_baked(real_t p_offset, bool p_cubic) const { if (baked_cache_dirty) { _bake(); } @@ -1349,7 +1349,7 @@ Vector3 Curve3D::interpolate_baked(float p_offset, bool p_cubic) const { int start = 0, end = bpc, idx = (end + start) / 2; // binary search to find baked points while (start < idx) { - float offset = baked_dist_cache[idx]; + real_t offset = baked_dist_cache[idx]; if (p_offset <= offset) { end = idx; } else { @@ -1358,13 +1358,13 @@ Vector3 Curve3D::interpolate_baked(float p_offset, bool p_cubic) const { idx = (end + start) / 2; } - float offset_begin = baked_dist_cache[idx]; - float offset_end = baked_dist_cache[idx + 1]; + real_t offset_begin = baked_dist_cache[idx]; + real_t offset_end = baked_dist_cache[idx + 1]; - float idx_interval = offset_end - offset_begin; + real_t idx_interval = offset_end - offset_begin; ERR_FAIL_COND_V_MSG(p_offset < offset_begin || p_offset > offset_end, Vector3(), "failed to find baked segment"); - float frac = (p_offset - offset_begin) / idx_interval; + real_t frac = (p_offset - offset_begin) / idx_interval; if (p_cubic) { Vector3 pre = idx > 0 ? r[idx - 1] : r[idx]; @@ -1375,7 +1375,7 @@ Vector3 Curve3D::interpolate_baked(float p_offset, bool p_cubic) const { } } -float Curve3D::interpolate_baked_tilt(float p_offset) const { +real_t Curve3D::interpolate_baked_tilt(real_t p_offset) const { if (baked_cache_dirty) { _bake(); } @@ -1399,7 +1399,7 @@ float Curve3D::interpolate_baked_tilt(float p_offset) const { } int idx = Math::floor((double)p_offset / (double)bake_interval); - float frac = Math::fmod(p_offset, bake_interval); + real_t frac = Math::fmod(p_offset, bake_interval); if (idx >= bpc - 1) { return r[bpc - 1]; @@ -1414,7 +1414,7 @@ float Curve3D::interpolate_baked_tilt(float p_offset) const { return Math::lerp(r[idx], r[idx + 1], (real_t)frac); } -Vector3 Curve3D::interpolate_baked_up_vector(float p_offset, bool p_apply_tilt) const { +Vector3 Curve3D::interpolate_baked_up_vector(real_t p_offset, bool p_apply_tilt) const { if (baked_cache_dirty) { _bake(); } @@ -1432,10 +1432,10 @@ Vector3 Curve3D::interpolate_baked_up_vector(float p_offset, bool p_apply_tilt) const Vector3 *rp = baked_point_cache.ptr(); const real_t *rt = baked_tilt_cache.ptr(); - float offset = CLAMP(p_offset, 0.0f, baked_max_ofs); + real_t offset = CLAMP(p_offset, 0.0f, baked_max_ofs); int idx = Math::floor((double)offset / (double)bake_interval); - float frac = Math::fmod(offset, bake_interval) / bake_interval; + real_t frac = Math::fmod(offset, bake_interval) / bake_interval; if (idx == count - 1) { return p_apply_tilt ? r[idx].rotated((rp[idx] - rp[idx - 1]).normalized(), rt[idx]) : r[idx]; @@ -1503,16 +1503,16 @@ Vector3 Curve3D::get_closest_point(const Vector3 &p_to_point) const { const Vector3 *r = baked_point_cache.ptr(); Vector3 nearest; - float nearest_dist = -1.0f; + real_t nearest_dist = -1.0f; for (int i = 0; i < pc - 1; i++) { Vector3 origin = r[i]; Vector3 direction = (r[i + 1] - origin) / bake_interval; - float d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); + real_t d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); Vector3 proj = origin + direction * d; - float dist = proj.distance_squared_to(p_to_point); + real_t dist = proj.distance_squared_to(p_to_point); if (nearest_dist < 0.0f || dist < nearest_dist) { nearest = proj; @@ -1523,7 +1523,7 @@ Vector3 Curve3D::get_closest_point(const Vector3 &p_to_point) const { return nearest; } -float Curve3D::get_closest_offset(const Vector3 &p_to_point) const { +real_t Curve3D::get_closest_offset(const Vector3 &p_to_point) const { // Brute force method if (baked_cache_dirty) { @@ -1540,18 +1540,18 @@ float Curve3D::get_closest_offset(const Vector3 &p_to_point) const { const Vector3 *r = baked_point_cache.ptr(); - float nearest = 0.0f; - float nearest_dist = -1.0f; - float offset = 0.0f; + real_t nearest = 0.0f; + real_t nearest_dist = -1.0f; + real_t offset = 0.0f; for (int i = 0; i < pc - 1; i++) { Vector3 origin = r[i]; Vector3 direction = (r[i + 1] - origin) / bake_interval; - float d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); + real_t d = CLAMP((p_to_point - origin).dot(direction), 0.0f, bake_interval); Vector3 proj = origin + direction * d; - float dist = proj.distance_squared_to(p_to_point); + real_t dist = proj.distance_squared_to(p_to_point); if (nearest_dist < 0.0f || dist < nearest_dist) { nearest = offset + d; @@ -1564,13 +1564,13 @@ float Curve3D::get_closest_offset(const Vector3 &p_to_point) const { return nearest; } -void Curve3D::set_bake_interval(float p_tolerance) { +void Curve3D::set_bake_interval(real_t p_tolerance) { bake_interval = p_tolerance; baked_cache_dirty = true; emit_signal(CoreStringNames::get_singleton()->changed); } -float Curve3D::get_bake_interval() const { +real_t Curve3D::get_bake_interval() const { return bake_interval; } @@ -1597,7 +1597,7 @@ Dictionary Curve3D::_get_data() const { for (int i = 0; i < points.size(); i++) { w[i * 3 + 0] = points[i].in; w[i * 3 + 1] = points[i].out; - w[i * 3 + 2] = points[i].pos; + w[i * 3 + 2] = points[i].position; wt[i] = points[i].tilt; } @@ -1622,43 +1622,43 @@ void Curve3D::_set_data(const Dictionary &p_data) { for (int i = 0; i < points.size(); i++) { points.write[i].in = r[i * 3 + 0]; points.write[i].out = r[i * 3 + 1]; - points.write[i].pos = r[i * 3 + 2]; + points.write[i].position = r[i * 3 + 2]; points.write[i].tilt = rt[i]; } baked_cache_dirty = true; } -PackedVector3Array Curve3D::tessellate(int p_max_stages, float p_tolerance) const { +PackedVector3Array Curve3D::tessellate(int p_max_stages, real_t p_tolerance) const { PackedVector3Array tess; if (points.size() == 0) { return tess; } - Vector<Map<float, Vector3>> midpoints; + Vector<Map<real_t, Vector3>> midpoints; midpoints.resize(points.size() - 1); int pc = 1; for (int i = 0; i < points.size() - 1; i++) { - _bake_segment3d(midpoints.write[i], 0, 1, points[i].pos, points[i].out, points[i + 1].pos, points[i + 1].in, 0, p_max_stages, p_tolerance); + _bake_segment3d(midpoints.write[i], 0, 1, points[i].position, points[i].out, points[i + 1].position, points[i + 1].in, 0, p_max_stages, p_tolerance); pc++; pc += midpoints[i].size(); } tess.resize(pc); Vector3 *bpw = tess.ptrw(); - bpw[0] = points[0].pos; + bpw[0] = points[0].position; int pidx = 0; for (int i = 0; i < points.size() - 1; i++) { - for (const KeyValue<float, Vector3> &E : midpoints[i]) { + for (const KeyValue<real_t, Vector3> &E : midpoints[i]) { pidx++; bpw[pidx] = E.value; } pidx++; - bpw[pidx] = points[i + 1].pos; + bpw[pidx] = points[i + 1].position; } return tess; @@ -1699,7 +1699,7 @@ void Curve3D::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_data"), &Curve3D::_set_data); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "bake_interval", PROPERTY_HINT_RANGE, "0.01,512,0.01"), "set_bake_interval", "get_bake_interval"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); ADD_GROUP("Up Vector", "up_vector_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "up_vector_enabled"), "set_up_vector_enabled", "is_up_vector_enabled"); diff --git a/scene/resources/curve.h b/scene/resources/curve.h index 5808fd6508..16facda85a 100644 --- a/scene/resources/curve.h +++ b/scene/resources/curve.h @@ -50,7 +50,7 @@ public: }; struct Point { - Vector2 pos; + Vector2 position; real_t left_tangent = 0.0; real_t right_tangent = 0.0; TangentMode left_mode = TANGENT_FREE; @@ -59,12 +59,12 @@ public: Point() { } - Point(Vector2 p_pos, + Point(const Vector2 &p_position, real_t p_left = 0.0, real_t p_right = 0.0, TangentMode p_left_mode = TANGENT_FREE, TangentMode p_right_mode = TANGENT_FREE) { - pos = p_pos; + position = p_position; left_tangent = p_left; right_tangent = p_right; left_mode = p_left_mode; @@ -76,7 +76,7 @@ public: int get_point_count() const { return _points.size(); } - int add_point(Vector2 p_pos, + int add_point(Vector2 p_position, real_t left_tangent = 0, real_t right_tangent = 0, TangentMode left_mode = TANGENT_FREE, @@ -85,34 +85,34 @@ public: void remove_point(int p_index); void clear_points(); - int get_index(real_t offset) const; + int get_index(real_t p_offset) const; - void set_point_value(int p_index, real_t pos); - int set_point_offset(int p_index, float offset); + void set_point_value(int p_index, real_t p_position); + int set_point_offset(int p_index, real_t p_offset); Vector2 get_point_position(int p_index) const; Point get_point(int p_index) const; - float get_min_value() const { return _min_value; } - void set_min_value(float p_min); + real_t get_min_value() const { return _min_value; } + void set_min_value(real_t p_min); - float get_max_value() const { return _max_value; } - void set_max_value(float p_max); + real_t get_max_value() const { return _max_value; } + void set_max_value(real_t p_max); - real_t interpolate(real_t offset) const; - real_t interpolate_local_nocheck(int index, real_t local_offset) const; + real_t interpolate(real_t p_offset) const; + real_t interpolate_local_nocheck(int p_index, real_t p_local_offset) const; void clean_dupes(); - void set_point_left_tangent(int i, real_t tangent); - void set_point_right_tangent(int i, real_t tangent); - void set_point_left_mode(int i, TangentMode p_mode); - void set_point_right_mode(int i, TangentMode p_mode); + void set_point_left_tangent(int p_index, real_t p_tangent); + void set_point_right_tangent(int p_index, real_t p_tangent); + void set_point_left_mode(int p_index, TangentMode p_mode); + void set_point_right_mode(int p_index, TangentMode p_mode); - real_t get_point_left_tangent(int i) const; - real_t get_point_right_tangent(int i) const; - TangentMode get_point_left_mode(int i) const; - TangentMode get_point_right_mode(int i) const; + real_t get_point_left_tangent(int p_index) const; + real_t get_point_right_tangent(int p_index) const; + TangentMode get_point_left_mode(int p_index) const; + TangentMode get_point_right_mode(int p_index) const; void update_auto_tangents(int i); @@ -122,9 +122,9 @@ public: void bake(); int get_bake_resolution() const { return _bake_resolution; } void set_bake_resolution(int p_resolution); - real_t interpolate_baked(real_t offset) const; + real_t interpolate_baked(real_t p_offset) const; - void ensure_default_setup(float p_min, float p_max); + void ensure_default_setup(real_t p_min, real_t p_max); protected: static void _bind_methods(); @@ -136,8 +136,8 @@ private: bool _baked_cache_dirty = false; Vector<real_t> _baked_cache; int _bake_resolution = 100; - float _min_value = 0.0; - float _max_value = 1.0; + real_t _min_value = 0.0; + real_t _max_value = 1.0; int _minmax_set_once = 0b00; // Encodes whether min and max have been set a first time, first bit for min and second for max. }; @@ -149,26 +149,26 @@ class Curve2D : public Resource { struct Point { Vector2 in; Vector2 out; - Vector2 pos; + Vector2 position; }; Vector<Point> points; struct BakedPoint { - float ofs = 0.0; + real_t ofs = 0.0; Vector2 point; }; mutable bool baked_cache_dirty = false; mutable PackedVector2Array baked_point_cache; - mutable PackedFloat32Array baked_dist_cache; - mutable float baked_max_ofs = 0.0; + mutable Vector<real_t> baked_dist_cache; + mutable real_t baked_max_ofs = 0.0; void _bake() const; - float bake_interval = 5.0; + real_t bake_interval = 5.0; - void _bake_segment2d(Map<float, Vector2> &r_bake, float p_begin, float p_end, const Vector2 &p_a, const Vector2 &p_out, const Vector2 &p_b, const Vector2 &p_in, int p_depth, int p_max_depth, float p_tol) const; + void _bake_segment2d(Map<real_t, Vector2> &r_bake, real_t p_begin, real_t p_end, const Vector2 &p_a, const Vector2 &p_out, const Vector2 &p_b, const Vector2 &p_in, int p_depth, int p_max_depth, real_t p_tol) const; Dictionary _get_data() const; void _set_data(const Dictionary &p_data); @@ -177,8 +177,8 @@ protected: public: int get_point_count() const; - void add_point(const Vector2 &p_pos, const Vector2 &p_in = Vector2(), const Vector2 &p_out = Vector2(), int p_atpos = -1); - void set_point_position(int p_index, const Vector2 &p_pos); + void add_point(const Vector2 &p_position, const Vector2 &p_in = Vector2(), const Vector2 &p_out = Vector2(), int p_atpos = -1); + void set_point_position(int p_index, const Vector2 &p_position); Vector2 get_point_position(int p_index) const; void set_point_in(int p_index, const Vector2 &p_in); Vector2 get_point_in(int p_index) const; @@ -187,19 +187,19 @@ public: void remove_point(int p_index); void clear_points(); - Vector2 interpolate(int p_index, float p_offset) const; + Vector2 interpolate(int p_index, real_t p_offset) const; Vector2 interpolatef(real_t p_findex) const; - void set_bake_interval(float p_tolerance); - float get_bake_interval() const; + void set_bake_interval(real_t p_tolerance); + real_t get_bake_interval() const; - float get_baked_length() const; - Vector2 interpolate_baked(float p_offset, bool p_cubic = false) const; + real_t get_baked_length() const; + Vector2 interpolate_baked(real_t p_offset, bool p_cubic = false) const; PackedVector2Array get_baked_points() const; //useful for going through Vector2 get_closest_point(const Vector2 &p_to_point) const; - float get_closest_offset(const Vector2 &p_to_point) const; + real_t get_closest_offset(const Vector2 &p_to_point) const; - PackedVector2Array tessellate(int p_max_stages = 5, float p_tolerance = 4) const; //useful for display + PackedVector2Array tessellate(int p_max_stages = 5, real_t p_tolerance = 4) const; //useful for display Curve2D(); }; @@ -210,14 +210,14 @@ class Curve3D : public Resource { struct Point { Vector3 in; Vector3 out; - Vector3 pos; - float tilt = 0.0; + Vector3 position; + real_t tilt = 0.0; }; Vector<Point> points; struct BakedPoint { - float ofs = 0.0; + real_t ofs = 0.0; Vector3 point; }; @@ -225,15 +225,15 @@ class Curve3D : public Resource { mutable PackedVector3Array baked_point_cache; mutable Vector<real_t> baked_tilt_cache; mutable PackedVector3Array baked_up_vector_cache; - mutable PackedFloat32Array baked_dist_cache; - mutable float baked_max_ofs = 0.0; + mutable Vector<real_t> baked_dist_cache; + mutable real_t baked_max_ofs = 0.0; void _bake() const; - float bake_interval = 0.2; + real_t bake_interval = 0.2; bool up_vector_enabled = true; - void _bake_segment3d(Map<float, Vector3> &r_bake, float p_begin, float p_end, const Vector3 &p_a, const Vector3 &p_out, const Vector3 &p_b, const Vector3 &p_in, int p_depth, int p_max_depth, float p_tol) const; + void _bake_segment3d(Map<real_t, Vector3> &r_bake, real_t p_begin, real_t p_end, const Vector3 &p_a, const Vector3 &p_out, const Vector3 &p_b, const Vector3 &p_in, int p_depth, int p_max_depth, real_t p_tol) const; Dictionary _get_data() const; void _set_data(const Dictionary &p_data); @@ -242,11 +242,11 @@ protected: public: int get_point_count() const; - void add_point(const Vector3 &p_pos, const Vector3 &p_in = Vector3(), const Vector3 &p_out = Vector3(), int p_atpos = -1); - void set_point_position(int p_index, const Vector3 &p_pos); + void add_point(const Vector3 &p_position, const Vector3 &p_in = Vector3(), const Vector3 &p_out = Vector3(), int p_atpos = -1); + void set_point_position(int p_index, const Vector3 &p_position); Vector3 get_point_position(int p_index) const; - void set_point_tilt(int p_index, float p_tilt); - float get_point_tilt(int p_index) const; + void set_point_tilt(int p_index, real_t p_tilt); + real_t get_point_tilt(int p_index) const; void set_point_in(int p_index, const Vector3 &p_in); Vector3 get_point_in(int p_index) const; void set_point_out(int p_index, const Vector3 &p_out); @@ -254,25 +254,25 @@ public: void remove_point(int p_index); void clear_points(); - Vector3 interpolate(int p_index, float p_offset) const; + Vector3 interpolate(int p_index, real_t p_offset) const; Vector3 interpolatef(real_t p_findex) const; - void set_bake_interval(float p_tolerance); - float get_bake_interval() const; + void set_bake_interval(real_t p_tolerance); + real_t get_bake_interval() const; void set_up_vector_enabled(bool p_enable); bool is_up_vector_enabled() const; - float get_baked_length() const; - Vector3 interpolate_baked(float p_offset, bool p_cubic = false) const; - float interpolate_baked_tilt(float p_offset) const; - Vector3 interpolate_baked_up_vector(float p_offset, bool p_apply_tilt = false) const; + real_t get_baked_length() const; + Vector3 interpolate_baked(real_t p_offset, bool p_cubic = false) const; + real_t interpolate_baked_tilt(real_t p_offset) const; + Vector3 interpolate_baked_up_vector(real_t p_offset, bool p_apply_tilt = false) const; PackedVector3Array get_baked_points() const; //useful for going through Vector<real_t> get_baked_tilts() const; //useful for going through PackedVector3Array get_baked_up_vectors() const; Vector3 get_closest_point(const Vector3 &p_to_point) const; - float get_closest_offset(const Vector3 &p_to_point) const; + real_t get_closest_offset(const Vector3 &p_to_point) const; - PackedVector3Array tessellate(int p_max_stages = 5, float p_tolerance = 4) const; //useful for display + PackedVector3Array tessellate(int p_max_stages = 5, real_t p_tolerance = 4) const; //useful for display Curve3D(); }; diff --git a/scene/resources/default_theme/default_theme.cpp b/scene/resources/default_theme/default_theme.cpp index 54bb7a82cf..a1d76ef352 100644 --- a/scene/resources/default_theme/default_theme.cpp +++ b/scene/resources/default_theme/default_theme.cpp @@ -147,6 +147,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const Color control_font_lower_color = Color(0.63, 0.63, 0.63); Color control_font_low_color = Color(0.69, 0.69, 0.69); Color control_font_hover_color = Color(0.94, 0.94, 0.94); + Color control_font_focus_color = Color(0.94, 0.94, 0.94); Color control_font_disabled_color = Color(0.9, 0.9, 0.9, 0.2); Color control_font_pressed_color = Color(1, 1, 1); @@ -185,6 +186,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_color", "Button", control_font_color); theme->set_color("font_pressed_color", "Button", control_font_pressed_color); theme->set_color("font_hover_color", "Button", control_font_hover_color); + theme->set_color("font_focus_color", "Button", control_font_focus_color); theme->set_color("font_hover_pressed_color", "Button", control_font_pressed_color); theme->set_color("font_disabled_color", "Button", control_font_disabled_color); theme->set_color("font_outline_color", "Button", Color(1, 1, 1)); @@ -193,6 +195,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("icon_pressed_color", "Button", Color(1, 1, 1, 1)); theme->set_color("icon_hover_color", "Button", Color(1, 1, 1, 1)); theme->set_color("icon_hover_pressed_color", "Button", Color(1, 1, 1, 1)); + theme->set_color("icon_focus_color", "Button", Color(1, 1, 1, 1)); theme->set_color("icon_disabled_color", "Button", Color(1, 1, 1, 1)); theme->set_constant("hseparation", "Button", 2 * scale); @@ -207,6 +210,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_color", "LinkButton", control_font_color); theme->set_color("font_pressed_color", "LinkButton", control_font_pressed_color); theme->set_color("font_hover_color", "LinkButton", control_font_hover_color); + theme->set_color("font_focus_color", "LinkButton", control_font_focus_color); theme->set_color("font_outline_color", "LinkButton", Color(1, 1, 1)); theme->set_constant("outline_size", "LinkButton", 0); @@ -245,6 +249,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_color", "OptionButton", control_font_color); theme->set_color("font_pressed_color", "OptionButton", control_font_pressed_color); theme->set_color("font_hover_color", "OptionButton", control_font_hover_color); + theme->set_color("font_focus_color", "OptionButton", control_font_focus_color); theme->set_color("font_disabled_color", "OptionButton", control_font_disabled_color); theme->set_color("font_outline_color", "OptionButton", Color(1, 1, 1)); @@ -266,6 +271,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_color", "MenuButton", control_font_color); theme->set_color("font_pressed_color", "MenuButton", control_font_pressed_color); theme->set_color("font_hover_color", "MenuButton", control_font_hover_color); + theme->set_color("font_focus_color", "MenuButton", control_font_focus_color); theme->set_color("font_disabled_color", "MenuButton", Color(1, 1, 1, 0.3)); theme->set_color("font_outline_color", "MenuButton", Color(1, 1, 1)); @@ -308,6 +314,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_pressed_color", "CheckBox", control_font_pressed_color); theme->set_color("font_hover_color", "CheckBox", control_font_hover_color); theme->set_color("font_hover_pressed_color", "CheckBox", control_font_pressed_color); + theme->set_color("font_focus_color", "CheckBox", control_font_focus_color); theme->set_color("font_disabled_color", "CheckBox", control_font_disabled_color); theme->set_color("font_outline_color", "CheckBox", Color(1, 1, 1)); @@ -347,6 +354,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_pressed_color", "CheckButton", control_font_pressed_color); theme->set_color("font_hover_color", "CheckButton", control_font_hover_color); theme->set_color("font_hover_pressed_color", "CheckButton", control_font_pressed_color); + theme->set_color("font_focus_color", "CheckButton", control_font_focus_color); theme->set_color("font_disabled_color", "CheckButton", control_font_disabled_color); theme->set_color("font_outline_color", "CheckButton", Color(1, 1, 1)); @@ -785,30 +793,30 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("icon_separation", "TabContainer", 4 * scale); theme->set_constant("outline_size", "TabContainer", 0); - // Tabs + // TabBar - theme->set_stylebox("tab_selected", "Tabs", sb_expand(make_stylebox(tab_current_png, 4, 3, 4, 1, 16, 3, 16, 2), 2, 2, 2, 2)); - theme->set_stylebox("tab_unselected", "Tabs", sb_expand(make_stylebox(tab_behind_png, 5, 4, 5, 1, 16, 5, 16, 2), 3, 3, 3, 3)); - theme->set_stylebox("tab_disabled", "Tabs", sb_expand(make_stylebox(tab_disabled_png, 5, 5, 5, 1, 16, 6, 16, 4), 3, 0, 3, 3)); - theme->set_stylebox("close_bg_pressed", "Tabs", make_stylebox(button_pressed_png, 4, 4, 4, 4)); - theme->set_stylebox("close_bg_highlight", "Tabs", make_stylebox(button_normal_png, 4, 4, 4, 4)); + theme->set_stylebox("tab_selected", "TabBar", sb_expand(make_stylebox(tab_current_png, 4, 3, 4, 1, 16, 3, 16, 2), 2, 2, 2, 2)); + theme->set_stylebox("tab_unselected", "TabBar", sb_expand(make_stylebox(tab_behind_png, 5, 4, 5, 1, 16, 5, 16, 2), 3, 3, 3, 3)); + theme->set_stylebox("tab_disabled", "TabBar", sb_expand(make_stylebox(tab_disabled_png, 5, 5, 5, 1, 16, 6, 16, 4), 3, 0, 3, 3)); + theme->set_stylebox("close_bg_pressed", "TabBar", make_stylebox(button_pressed_png, 4, 4, 4, 4)); + theme->set_stylebox("close_bg_highlight", "TabBar", make_stylebox(button_normal_png, 4, 4, 4, 4)); - theme->set_icon("increment", "Tabs", make_icon(scroll_button_right_png)); - theme->set_icon("increment_highlight", "Tabs", make_icon(scroll_button_right_hl_png)); - theme->set_icon("decrement", "Tabs", make_icon(scroll_button_left_png)); - theme->set_icon("decrement_highlight", "Tabs", make_icon(scroll_button_left_hl_png)); - theme->set_icon("close", "Tabs", make_icon(tab_close_png)); + theme->set_icon("increment", "TabBar", make_icon(scroll_button_right_png)); + theme->set_icon("increment_highlight", "TabBar", make_icon(scroll_button_right_hl_png)); + theme->set_icon("decrement", "TabBar", make_icon(scroll_button_left_png)); + theme->set_icon("decrement_highlight", "TabBar", make_icon(scroll_button_left_hl_png)); + theme->set_icon("close", "TabBar", make_icon(tab_close_png)); - theme->set_font("font", "Tabs", Ref<Font>()); - theme->set_font_size("font_size", "Tabs", -1); + theme->set_font("font", "TabBar", Ref<Font>()); + theme->set_font_size("font_size", "TabBar", -1); - theme->set_color("font_selected_color", "Tabs", control_font_hover_color); - theme->set_color("font_unselected_color", "Tabs", control_font_low_color); - theme->set_color("font_disabled_color", "Tabs", control_font_disabled_color); - theme->set_color("font_outline_color", "Tabs", Color(1, 1, 1)); + theme->set_color("font_selected_color", "TabBar", control_font_hover_color); + theme->set_color("font_unselected_color", "TabBar", control_font_low_color); + theme->set_color("font_disabled_color", "TabBar", control_font_disabled_color); + theme->set_color("font_outline_color", "TabBar", Color(1, 1, 1)); - theme->set_constant("hseparation", "Tabs", 4 * scale); - theme->set_constant("outline_size", "Tabs", 0); + theme->set_constant("hseparation", "TabBar", 4 * scale); + theme->set_constant("outline_size", "TabBar", 0); // Separators @@ -867,6 +875,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_color("font_color", "ColorPickerButton", Color(1, 1, 1, 1)); theme->set_color("font_pressed_color", "ColorPickerButton", Color(0.8, 0.8, 0.8, 1)); theme->set_color("font_hover_color", "ColorPickerButton", Color(1, 1, 1, 1)); + theme->set_color("font_focus_color", "ColorPickerButton", Color(1, 1, 1, 1)); theme->set_color("font_disabled_color", "ColorPickerButton", Color(0.9, 0.9, 0.9, 0.3)); theme->set_color("font_outline_color", "ColorPickerButton", Color(1, 1, 1)); @@ -931,7 +940,7 @@ void fill_default_theme(Ref<Theme> &theme, const Ref<Font> &default_font, const theme->set_constant("shadow_offset_x", "RichTextLabel", 1 * scale); theme->set_constant("shadow_offset_y", "RichTextLabel", 1 * scale); - theme->set_constant("shadow_as_outline", "RichTextLabel", 0 * scale); + theme->set_constant("shadow_outline_size", "RichTextLabel", 1 * scale); theme->set_constant("line_separation", "RichTextLabel", 0 * scale); theme->set_constant("table_hseparation", "RichTextLabel", 3 * scale); @@ -1030,7 +1039,6 @@ void make_default_theme(bool p_hidpi, Ref<Font> p_font) { dynamic_font_data.instantiate(); dynamic_font_data->set_data_ptr(_font_OpenSans_SemiBold, _font_OpenSans_SemiBold_size); dynamic_font->add_data(dynamic_font_data); - dynamic_font->set_base_size(default_font_size); default_font = dynamic_font; } diff --git a/scene/resources/default_theme/overbright_indicator.png b/scene/resources/default_theme/overbright_indicator.png Binary files differindex 89f800c230..e13f15dd02 100644 --- a/scene/resources/default_theme/overbright_indicator.png +++ b/scene/resources/default_theme/overbright_indicator.png diff --git a/scene/resources/default_theme/theme_data.h b/scene/resources/default_theme/theme_data.h index 6a556c1112..57ff9a5325 100644 --- a/scene/resources/default_theme/theme_data.h +++ b/scene/resources/default_theme/theme_data.h @@ -50,6 +50,10 @@ static const unsigned char checked_disabled_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x28, 0x2d, 0xf, 0x53, 0x0, 0x0, 0x0, 0x9, 0x70, 0x48, 0x59, 0x73, 0x0, 0x0, 0xb, 0x13, 0x0, 0x0, 0xb, 0x13, 0x1, 0x0, 0x9a, 0x9c, 0x18, 0x0, 0x0, 0x0, 0x99, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x73, 0x72, 0x7b, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x82, 0x80, 0x8a, 0x90, 0x90, 0x93, 0x6a, 0x69, 0x70, 0x6a, 0x68, 0x70, 0x93, 0x93, 0x95, 0x58, 0x58, 0x5c, 0x58, 0x58, 0x5b, 0x7d, 0x7d, 0x7f, 0x58, 0x58, 0x5b, 0xa4, 0xa4, 0xa4, 0x9e, 0x9e, 0xa0, 0x9e, 0x9e, 0x9e, 0x9b, 0x9b, 0x9c, 0x9b, 0x9b, 0x9b, 0x9a, 0x9a, 0x9a, 0x99, 0x99, 0x99, 0x98, 0x98, 0x98, 0x97, 0x97, 0x97, 0x96, 0x96, 0x96, 0x95, 0x95, 0x95, 0x93, 0x93, 0x94, 0x8f, 0x8f, 0x8f, 0x86, 0x86, 0x88, 0x85, 0x85, 0x86, 0x82, 0x82, 0x83, 0x81, 0x81, 0x83, 0x7f, 0x7f, 0x81, 0x7c, 0x7c, 0x7e, 0x7a, 0x7a, 0x7d, 0x78, 0x78, 0x7b, 0x71, 0x71, 0x74, 0x68, 0x68, 0x6c, 0x66, 0x66, 0x6a, 0x65, 0x65, 0x68, 0x63, 0x63, 0x66, 0x5f, 0x5f, 0x63, 0x5c, 0x5c, 0x60, 0x5c, 0x5c, 0x5f, 0x5a, 0x5a, 0x5e, 0x59, 0x59, 0x5d, 0x59, 0x59, 0x5c, 0x58, 0x58, 0x5b, 0x57, 0x57, 0x5a, 0x56, 0x56, 0x59, 0x10, 0x13, 0xbb, 0xf, 0x0, 0x0, 0x0, 0x10, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x7, 0x27, 0x27, 0x50, 0x66, 0x68, 0x6a, 0x81, 0xb4, 0xb4, 0xdd, 0xfa, 0xfa, 0xfb, 0xfb, 0x5b, 0xd1, 0xf1, 0xe6, 0x0, 0x0, 0x0, 0x96, 0x49, 0x44, 0x41, 0x54, 0x78, 0x5e, 0x5d, 0x8f, 0xc9, 0x12, 0x82, 0x30, 0x14, 0x4, 0x87, 0x18, 0x50, 0x51, 0x44, 0x25, 0x42, 0x4, 0x77, 0xc4, 0x8d, 0x97, 0x0, 0xf9, 0xff, 0x8f, 0xb3, 0x88, 0xa4, 0x4a, 0xed, 0x63, 0x5f, 0xa6, 0x7, 0xf8, 0x7, 0x1e, 0xe3, 0x7e, 0x60, 0x19, 0x4f, 0x46, 0x1e, 0x0, 0x36, 0x8d, 0x4c, 0x67, 0x59, 0x65, 0x33, 0x6, 0x80, 0x47, 0xad, 0x56, 0x3d, 0xb7, 0x3c, 0x5d, 0x70, 0x0, 0xbe, 0xd1, 0x44, 0x65, 0x4d, 0x94, 0xc8, 0xc2, 0xf8, 0x0, 0x82, 0x4e, 0x91, 0x94, 0x15, 0x5d, 0xd2, 0xec, 0xde, 0x5, 0x83, 0x38, 0xc8, 0xe3, 0x63, 0x23, 0xce, 0xca, 0x9, 0x7a, 0x6e, 0xf3, 0x93, 0x48, 0x1a, 0x27, 0x14, 0x35, 0x3b, 0xb9, 0x5e, 0x56, 0xe4, 0x84, 0x22, 0xba, 0xa, 0x51, 0xd0, 0xb7, 0xa8, 0xcb, 0xfd, 0xcb, 0x9, 0x3b, 0xfb, 0x41, 0xdb, 0x59, 0x17, 0xa6, 0x94, 0x6e, 0xe3, 0x3e, 0x8c, 0x85, 0xf1, 0x90, 0x6e, 0xe6, 0x21, 0xfb, 0x39, 0xe7, 0x73, 0xe6, 0xfd, 0x5f, 0x7, 0xde, 0xc3, 0xb5, 0x16, 0x87, 0xb0, 0x9e, 0x42, 0x46, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; +static const unsigned char checker_bg_png[] = { + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x8, 0x0, 0x0, 0x0, 0x8, 0x8, 0x0, 0x0, 0x0, 0x0, 0xe1, 0x64, 0xe1, 0x57, 0x0, 0x0, 0x0, 0x14, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xfc, 0xcf, 0xc0, 0xc0, 0xd0, 0x0, 0xc4, 0xf8, 0x18, 0xf5, 0x84, 0x19, 0x0, 0x9f, 0x5f, 0xa, 0x1, 0xf8, 0xef, 0x65, 0xf4, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 +}; + static const unsigned char close_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x4, 0x0, 0x0, 0x0, 0xb5, 0xfa, 0x37, 0xea, 0x0, 0x0, 0x0, 0x62, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x63, 0xa0, 0x16, 0xe0, 0x8c, 0xe0, 0x11, 0x43, 0xe6, 0xf3, 0x88, 0x71, 0x46, 0xa0, 0x48, 0x73, 0xfc, 0xe3, 0xb8, 0xcc, 0x23, 0x86, 0x90, 0xe6, 0xb8, 0xcc, 0xf1, 0xf, 0x49, 0x9, 0x8f, 0x28, 0xe7, 0x25, 0x8e, 0xff, 0x1c, 0xd7, 0xb9, 0x24, 0x91, 0x79, 0xdc, 0x12, 0x40, 0xe, 0xa6, 0x12, 0x54, 0x69, 0x4c, 0x25, 0xb7, 0x38, 0xae, 0x21, 0xa4, 0x31, 0x94, 0x80, 0x24, 0x81, 0xf0, 0x36, 0x48, 0x1a, 0xaf, 0x2, 0x88, 0x5b, 0xf0, 0x5a, 0x81, 0xa1, 0x4, 0xe1, 0x34, 0x84, 0x73, 0xb1, 0x4a, 0xa3, 0x7b, 0x9a, 0x70, 0x40, 0x11, 0xe, 0x6a, 0xca, 0x1, 0x0, 0x2a, 0x28, 0x37, 0x83, 0x3e, 0x27, 0xb0, 0x34, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -218,10 +222,6 @@ static const unsigned char indeterminate_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x28, 0x2d, 0xf, 0x53, 0x0, 0x0, 0x0, 0x36, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x4d, 0x4b, 0x59, 0x4d, 0x4b, 0x59, 0x4d, 0x4b, 0x59, 0x4d, 0x4b, 0x59, 0x4d, 0x4b, 0x59, 0x38, 0x37, 0x40, 0x20, 0x20, 0x24, 0x20, 0x20, 0x24, 0x38, 0x36, 0x40, 0x20, 0x20, 0x25, 0x1e, 0x1e, 0x22, 0x1f, 0x1f, 0x23, 0x20, 0x20, 0x24, 0x22, 0x22, 0x27, 0x23, 0x23, 0x28, 0x25, 0x25, 0x2a, 0xfe, 0xfe, 0xfe, 0x98, 0x4d, 0x2d, 0x9a, 0x0, 0x0, 0x0, 0x12, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x7, 0x27, 0x50, 0x66, 0x68, 0xb4, 0xfa, 0xfb, 0xb4, 0xfa, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x1c, 0x77, 0x5e, 0x7f, 0x0, 0x0, 0x0, 0x59, 0x49, 0x44, 0x41, 0x54, 0x18, 0x95, 0x85, 0xcf, 0xc1, 0x12, 0x80, 0x20, 0x8, 0x45, 0xd1, 0x4, 0x14, 0xd, 0xc5, 0xfa, 0xff, 0x9f, 0x8d, 0x9c, 0x6c, 0x9a, 0xb4, 0xe9, 0x2e, 0xcf, 0x42, 0x9e, 0xcb, 0x32, 0xe4, 0x0, 0xc9, 0xb7, 0x8, 0xc1, 0x19, 0x40, 0x60, 0xc9, 0x2d, 0xe1, 0x0, 0x6, 0xc8, 0x45, 0x6b, 0x4b, 0xb, 0xa3, 0x1, 0x89, 0x6e, 0x57, 0x2a, 0x64, 0xe0, 0x73, 0xed, 0x50, 0xb3, 0x9f, 0xc3, 0x7e, 0xf7, 0x5, 0x7f, 0x6f, 0xc, 0x67, 0x9f, 0xc3, 0xe2, 0x39, 0xc, 0x52, 0xec, 0xd3, 0xd7, 0x4, 0xb3, 0xcf, 0xbd, 0x3a, 0x0, 0xa0, 0xa2, 0x8, 0xbc, 0xf6, 0x84, 0x3a, 0x9d, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; -static const unsigned char indeterminate_disabled_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x3, 0x0, 0x0, 0x0, 0x28, 0x2d, 0xf, 0x53, 0x0, 0x0, 0x0, 0x3c, 0x50, 0x4c, 0x54, 0x45, 0x0, 0x0, 0x0, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x7a, 0x78, 0x83, 0x6a, 0x69, 0x70, 0x6a, 0x68, 0x70, 0x58, 0x58, 0x5c, 0x58, 0x58, 0x5b, 0x58, 0x58, 0x5b, 0x5c, 0x5c, 0x5f, 0x5a, 0x5a, 0x5e, 0x59, 0x59, 0x5d, 0x58, 0x58, 0x5b, 0x57, 0x57, 0x5a, 0x56, 0x56, 0x59, 0xff, 0x0, 0x0, 0xff, 0xff, 0xff, 0x9e, 0x9e, 0x9e, 0x8c, 0x93, 0x80, 0x95, 0x0, 0x0, 0x0, 0x14, 0x74, 0x52, 0x4e, 0x53, 0x0, 0x7, 0x27, 0x50, 0x66, 0x68, 0xb4, 0xb4, 0xfa, 0xfa, 0xfb, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, 0x6c, 0xb9, 0x8d, 0x1e, 0x0, 0x0, 0x0, 0x59, 0x49, 0x44, 0x41, 0x54, 0x18, 0x95, 0x85, 0xcf, 0xd1, 0xe, 0x80, 0x20, 0x8, 0x85, 0xe1, 0x4, 0xd4, 0x30, 0x51, 0xb6, 0xde, 0xff, 0x5d, 0x23, 0x97, 0xad, 0xa5, 0xad, 0xff, 0xf2, 0xbb, 0x90, 0xe3, 0xb2, 0xc, 0x39, 0x40, 0xf2, 0x2d, 0x42, 0x70, 0x6, 0x10, 0x58, 0x6b, 0x4b, 0x39, 0x80, 0x1, 0x72, 0x91, 0xdc, 0x92, 0xc2, 0x68, 0x40, 0x2a, 0xdb, 0x95, 0x28, 0x19, 0xf8, 0x9a, 0x3b, 0xe4, 0xea, 0xe7, 0xb0, 0xdf, 0x7d, 0xc1, 0xdf, 0x1b, 0xc3, 0xd9, 0xe7, 0xb0, 0x74, 0xe, 0x83, 0x98, 0xfa, 0xf4, 0x35, 0xc2, 0xec, 0x73, 0xaf, 0xe, 0x57, 0x20, 0x8, 0x2c, 0x1a, 0x56, 0xe5, 0x32, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 -}; - static const unsigned char line_edit_png[] = { 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0xa, 0x0, 0x0, 0x0, 0xa, 0x4, 0x3, 0x0, 0x0, 0x0, 0x7f, 0x1c, 0xd2, 0x8e, 0x0, 0x0, 0x0, 0x2a, 0x50, 0x4c, 0x54, 0x45, 0x17, 0x16, 0x1a, 0x1d, 0x1c, 0x21, 0x20, 0x1e, 0x24, 0x21, 0x1f, 0x25, 0x1d, 0x1c, 0x21, 0x20, 0x1e, 0x24, 0x1d, 0x1c, 0x21, 0x1d, 0x1c, 0x21, 0x24, 0x22, 0x29, 0x28, 0x26, 0x2d, 0x28, 0x26, 0x2e, 0x2b, 0x2a, 0x31, 0x2c, 0x2a, 0x32, 0xff, 0xff, 0xff, 0xb9, 0x11, 0x56, 0x3e, 0x0, 0x0, 0x0, 0x8, 0x74, 0x52, 0x4e, 0x53, 0x6f, 0xef, 0xf7, 0xf7, 0xf0, 0xf9, 0xf1, 0xee, 0xcf, 0x21, 0xd2, 0xdf, 0x0, 0x0, 0x0, 0x2d, 0x49, 0x44, 0x41, 0x54, 0x8, 0xd7, 0x63, 0x60, 0x54, 0x36, 0x36, 0x12, 0x60, 0xf0, 0x98, 0xb5, 0x6a, 0x65, 0xb, 0x43, 0xe4, 0x9e, 0x33, 0xa7, 0xa7, 0x32, 0x58, 0x9d, 0x39, 0x73, 0x66, 0x31, 0x16, 0x12, 0x22, 0xb, 0x52, 0xd9, 0xc6, 0xc0, 0x2, 0xd4, 0x55, 0x0, 0x0, 0xc, 0x14, 0x1a, 0x90, 0x55, 0x1a, 0xec, 0xdb, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; @@ -275,7 +275,7 @@ static const unsigned char option_button_pressed_mirrored_png[] = { }; static const unsigned char overbright_indicator_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x4, 0x3, 0x0, 0x0, 0x0, 0xed, 0xdd, 0xe2, 0x52, 0x0, 0x0, 0x1, 0x85, 0x69, 0x43, 0x43, 0x50, 0x49, 0x43, 0x43, 0x20, 0x70, 0x72, 0x6f, 0x66, 0x69, 0x6c, 0x65, 0x0, 0x0, 0x78, 0x9c, 0x7d, 0x91, 0x3d, 0x48, 0xc3, 0x40, 0x1c, 0xc5, 0x5f, 0x53, 0xa5, 0x2a, 0x2d, 0xe, 0x16, 0x11, 0x75, 0xc8, 0x50, 0x9d, 0x2c, 0x8a, 0x8a, 0x38, 0x6a, 0x15, 0x8a, 0x50, 0x21, 0xd4, 0xa, 0xad, 0x3a, 0x98, 0x5c, 0xfa, 0x21, 0x34, 0x69, 0x48, 0x52, 0x5c, 0x1c, 0x5, 0xd7, 0x82, 0x83, 0x1f, 0x8b, 0x55, 0x7, 0x17, 0x67, 0x5d, 0x1d, 0x5c, 0x5, 0x41, 0xf0, 0x3, 0xc4, 0xc5, 0xd5, 0x49, 0xd1, 0x45, 0x4a, 0xfc, 0x5f, 0x5a, 0x68, 0x11, 0xe3, 0xc1, 0x71, 0x3f, 0xde, 0xdd, 0x7b, 0xdc, 0xbd, 0x3, 0x84, 0x6a, 0x91, 0x69, 0x56, 0xdb, 0x18, 0xa0, 0xe9, 0xb6, 0x99, 0x8c, 0xc7, 0xc4, 0x74, 0x66, 0x45, 0xc, 0xbc, 0xa2, 0x13, 0x3, 0x8, 0xa1, 0x17, 0xa3, 0x32, 0xb3, 0x8c, 0x59, 0x49, 0x4a, 0xc0, 0x73, 0x7c, 0xdd, 0xc3, 0xc7, 0xd7, 0xbb, 0x28, 0xcf, 0xf2, 0x3e, 0xf7, 0xe7, 0x8, 0xa9, 0x59, 0x8b, 0x1, 0x3e, 0x91, 0x78, 0x86, 0x19, 0xa6, 0x4d, 0xbc, 0x4e, 0x3c, 0xb5, 0x69, 0x1b, 0x9c, 0xf7, 0x89, 0xc3, 0xac, 0x20, 0xab, 0xc4, 0xe7, 0xc4, 0x23, 0x26, 0x5d, 0x90, 0xf8, 0x91, 0xeb, 0x4a, 0x9d, 0xdf, 0x38, 0xe7, 0x5d, 0x16, 0x78, 0x66, 0xd8, 0x4c, 0x25, 0xe7, 0x88, 0xc3, 0xc4, 0x62, 0xbe, 0x85, 0x95, 0x16, 0x66, 0x5, 0x53, 0x23, 0x9e, 0x24, 0x8e, 0xa8, 0x9a, 0x4e, 0xf9, 0x42, 0xba, 0xce, 0x2a, 0xe7, 0x2d, 0xce, 0x5a, 0xb1, 0xcc, 0x1a, 0xf7, 0xe4, 0x2f, 0xc, 0x66, 0xf5, 0xe5, 0x25, 0xae, 0xd3, 0x1c, 0x44, 0x1c, 0xb, 0x58, 0x84, 0x4, 0x11, 0xa, 0xca, 0xd8, 0x40, 0x11, 0x36, 0xa2, 0xb4, 0xea, 0xa4, 0x58, 0x48, 0xd2, 0x7e, 0xcc, 0xc3, 0xdf, 0xef, 0xfa, 0x25, 0x72, 0x29, 0xe4, 0xda, 0x0, 0x23, 0xc7, 0x3c, 0x4a, 0xd0, 0x20, 0xbb, 0x7e, 0xf0, 0x3f, 0xf8, 0xdd, 0xad, 0x95, 0x9b, 0x18, 0xaf, 0x27, 0x5, 0x63, 0x40, 0xfb, 0x8b, 0xe3, 0x7c, 0xc, 0x1, 0x81, 0x5d, 0xa0, 0x56, 0x71, 0x9c, 0xef, 0x63, 0xc7, 0xa9, 0x9d, 0x0, 0xfe, 0x67, 0xe0, 0x4a, 0x6f, 0xfa, 0x4b, 0x55, 0x60, 0xfa, 0x93, 0xf4, 0x4a, 0x53, 0x8b, 0x1c, 0x1, 0xdd, 0xdb, 0xc0, 0xc5, 0x75, 0x53, 0x53, 0xf6, 0x80, 0xcb, 0x1d, 0xa0, 0xef, 0xc9, 0x90, 0x4d, 0xd9, 0x95, 0xfc, 0x34, 0x85, 0x5c, 0xe, 0x78, 0x3f, 0xa3, 0x6f, 0xca, 0x0, 0x3d, 0xb7, 0x40, 0xd7, 0x6a, 0xbd, 0xb7, 0xc6, 0x3e, 0x4e, 0x1f, 0x80, 0x14, 0x75, 0x95, 0xb8, 0x1, 0xe, 0xe, 0x81, 0xe1, 0x3c, 0x65, 0xaf, 0x79, 0xbc, 0xbb, 0xa3, 0xb5, 0xb7, 0x7f, 0xcf, 0x34, 0xfa, 0xfb, 0x1, 0x8e, 0x80, 0x72, 0xb2, 0xed, 0x78, 0xfa, 0x7b, 0x0, 0x0, 0x0, 0x9, 0x70, 0x48, 0x59, 0x73, 0x0, 0x0, 0xe, 0xc4, 0x0, 0x0, 0xe, 0xc4, 0x1, 0x95, 0x2b, 0xe, 0x1b, 0x0, 0x0, 0x0, 0x15, 0x50, 0x4c, 0x54, 0x45, 0xff, 0xff, 0xff, 0x63, 0x63, 0x66, 0x0, 0x0, 0x3, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x0, 0x0, 0x4, 0x0, 0x0, 0x0, 0x4c, 0x39, 0x3a, 0xe, 0x0, 0x0, 0x0, 0x6, 0x74, 0x52, 0x4e, 0x53, 0xff, 0xff, 0xff, 0x7f, 0x0, 0x80, 0x2c, 0x16, 0xc1, 0x6d, 0x0, 0x0, 0x0, 0x1, 0x62, 0x4b, 0x47, 0x44, 0x6, 0x61, 0x66, 0xb8, 0x7d, 0x0, 0x0, 0x0, 0x32, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, 0x62, 0x0, 0x1, 0x46, 0x65, 0x17, 0x17, 0x30, 0x43, 0xc8, 0x4, 0x50, 0x88, 0x1c, 0x52, 0x1, 0x0, 0x2, 0x40, 0x14, 0xbb, 0x70, 0x8b, 0x40, 0xff, 0x2c, 0x18, 0xbe, 0xc6, 0xed, 0x8d, 0x42, 0xa1, 0x50, 0x28, 0x14, 0xa, 0x85, 0xbd, 0xb0, 0x13, 0xfc, 0x71, 0x1, 0xca, 0xf, 0x19, 0x62, 0x24, 0xd6, 0x8, 0xaa, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 + 0x89, 0x50, 0x4e, 0x47, 0xd, 0xa, 0x1a, 0xa, 0x0, 0x0, 0x0, 0xd, 0x49, 0x48, 0x44, 0x52, 0x0, 0x0, 0x0, 0x10, 0x0, 0x0, 0x0, 0x10, 0x8, 0x6, 0x0, 0x0, 0x0, 0x1f, 0xf3, 0xff, 0x61, 0x0, 0x0, 0x0, 0x9, 0x70, 0x48, 0x59, 0x73, 0x0, 0x0, 0xe, 0xc3, 0x0, 0x0, 0xe, 0xc3, 0x1, 0xc7, 0x6f, 0xa8, 0x64, 0x0, 0x0, 0x0, 0x19, 0x74, 0x45, 0x58, 0x74, 0x53, 0x6f, 0x66, 0x74, 0x77, 0x61, 0x72, 0x65, 0x0, 0x77, 0x77, 0x77, 0x2e, 0x69, 0x6e, 0x6b, 0x73, 0x63, 0x61, 0x70, 0x65, 0x2e, 0x6f, 0x72, 0x67, 0x9b, 0xee, 0x3c, 0x1a, 0x0, 0x0, 0x0, 0x5f, 0x49, 0x44, 0x41, 0x54, 0x38, 0x8d, 0xcd, 0xcd, 0x4b, 0xe, 0x80, 0x20, 0xc, 0x45, 0xd1, 0x9b, 0xea, 0xbe, 0x40, 0x97, 0x87, 0x8b, 0xae, 0x13, 0x34, 0x88, 0x1f, 0xa, 0x9d, 0xf8, 0x92, 0xe, 0xcf, 0x2d, 0x80, 0xda, 0x4f, 0x14, 0x26, 0x5, 0x49, 0x14, 0x53, 0xcb, 0x42, 0x58, 0xe, 0xbc, 0x51, 0xcd, 0x85, 0x9b, 0x81, 0x16, 0xfe, 0xc, 0x58, 0xf0, 0x6b, 0xc0, 0x8a, 0x1f, 0x3, 0x3d, 0xf8, 0x16, 0xe8, 0xc5, 0x97, 0x40, 0x81, 0x53, 0x9b, 0x55, 0x81, 0x91, 0xcf, 0x67, 0x20, 0xc6, 0x75, 0xe8, 0x73, 0x9e, 0xc, 0x7f, 0xce, 0x73, 0x61, 0x80, 0xd9, 0x83, 0x7f, 0xb0, 0x1d, 0xec, 0x30, 0xf0, 0x78, 0x5a, 0x7, 0xa8, 0x21, 0x0, 0x0, 0x0, 0x0, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 }; static const unsigned char panel_bg_png[] = { diff --git a/scene/resources/environment.cpp b/scene/resources/environment.cpp index be0d3a140e..4c25ed589b 100644 --- a/scene/resources/environment.cpp +++ b/scene/resources/environment.cpp @@ -782,7 +782,7 @@ void Environment::_update_fog() { // Volumetric Fog void Environment::_update_volumetric_fog() { - RS::get_singleton()->environment_set_volumetric_fog(environment, volumetric_fog_enabled, volumetric_fog_density, volumetric_fog_light, volumetric_fog_light_energy, volumetric_fog_length, volumetric_fog_detail_spread, volumetric_fog_gi_inject, volumetric_fog_temporal_reproject, volumetric_fog_temporal_reproject_amount); + RS::get_singleton()->environment_set_volumetric_fog(environment, volumetric_fog_enabled, volumetric_fog_density, volumetric_fog_albedo, volumetric_fog_emission, volumetric_fog_emission_energy, volumetric_fog_anisotropy, volumetric_fog_length, volumetric_fog_detail_spread, volumetric_fog_gi_inject, volumetric_fog_temporal_reproject, volumetric_fog_temporal_reproject_amount, volumetric_fog_ambient_inject); } void Environment::set_volumetric_fog_enabled(bool p_enable) { @@ -795,26 +795,39 @@ bool Environment::is_volumetric_fog_enabled() const { return volumetric_fog_enabled; } void Environment::set_volumetric_fog_density(float p_density) { - p_density = CLAMP(p_density, 0.0000001, 1.0); volumetric_fog_density = p_density; _update_volumetric_fog(); } float Environment::get_volumetric_fog_density() const { return volumetric_fog_density; } -void Environment::set_volumetric_fog_light(Color p_color) { - volumetric_fog_light = p_color; +void Environment::set_volumetric_fog_albedo(Color p_color) { + volumetric_fog_albedo = p_color; _update_volumetric_fog(); } -Color Environment::get_volumetric_fog_light() const { - return volumetric_fog_light; +Color Environment::get_volumetric_fog_albedo() const { + return volumetric_fog_albedo; } -void Environment::set_volumetric_fog_light_energy(float p_begin) { - volumetric_fog_light_energy = p_begin; +void Environment::set_volumetric_fog_emission(Color p_color) { + volumetric_fog_emission = p_color; _update_volumetric_fog(); } -float Environment::get_volumetric_fog_light_energy() const { - return volumetric_fog_light_energy; +Color Environment::get_volumetric_fog_emission() const { + return volumetric_fog_emission; +} +void Environment::set_volumetric_fog_emission_energy(float p_begin) { + volumetric_fog_emission_energy = p_begin; + _update_volumetric_fog(); +} +float Environment::get_volumetric_fog_emission_energy() const { + return volumetric_fog_emission_energy; +} +void Environment::set_volumetric_fog_anisotropy(float p_anisotropy) { + volumetric_fog_anisotropy = p_anisotropy; + _update_volumetric_fog(); +} +float Environment::get_volumetric_fog_anisotropy() const { + return volumetric_fog_anisotropy; } void Environment::set_volumetric_fog_length(float p_length) { volumetric_fog_length = p_length; @@ -824,6 +837,7 @@ float Environment::get_volumetric_fog_length() const { return volumetric_fog_length; } void Environment::set_volumetric_fog_detail_spread(float p_detail_spread) { + p_detail_spread = CLAMP(p_detail_spread, 0.5, 6.0); volumetric_fog_detail_spread = p_detail_spread; _update_volumetric_fog(); } @@ -838,6 +852,13 @@ void Environment::set_volumetric_fog_gi_inject(float p_gi_inject) { float Environment::get_volumetric_fog_gi_inject() const { return volumetric_fog_gi_inject; } +void Environment::set_volumetric_fog_ambient_inject(float p_ambient_inject) { + volumetric_fog_ambient_inject = p_ambient_inject; + _update_volumetric_fog(); +} +float Environment::get_volumetric_fog_ambient_inject() const { + return volumetric_fog_ambient_inject; +} void Environment::set_volumetric_fog_temporal_reprojection_enabled(bool p_enable) { volumetric_fog_temporal_reproject = p_enable; @@ -896,7 +917,7 @@ float Environment::get_adjustment_saturation() const { void Environment::set_adjustment_color_correction(Ref<Texture> p_color_correction) { adjustment_color_correction = p_color_correction; - Ref<GradientTexture> grad_tex = p_color_correction; + Ref<GradientTexture1D> grad_tex = p_color_correction; if (grad_tex.is_valid()) { if (!grad_tex->is_connected(CoreStringNames::get_singleton()->changed, callable_mp(this, &Environment::_update_adjustment))) { grad_tex->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &Environment::_update_adjustment)); @@ -933,39 +954,39 @@ void Environment::_update_adjustment() { void Environment::_validate_property(PropertyInfo &property) const { if (property.name == "sky" || property.name == "sky_custom_fov" || property.name == "sky_rotation" || property.name == "ambient_light/sky_contribution") { if (bg_mode != BG_SKY && ambient_source != AMBIENT_SOURCE_SKY && reflection_source != REFLECTION_SOURCE_SKY) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } if (property.name == "fog_aerial_perspective") { if (bg_mode != BG_SKY) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } if (property.name == "glow_intensity" && glow_blend_mode == GLOW_BLEND_MODE_MIX) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } if (property.name == "glow_mix" && glow_blend_mode != GLOW_BLEND_MODE_MIX) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } if (property.name == "background_color") { if (bg_mode != BG_COLOR && ambient_source != AMBIENT_SOURCE_COLOR) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } if (property.name == "background_canvas_max_layer") { if (bg_mode != BG_CANVAS) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; } } if (property.name == "background_camera_feed_id") { if (bg_mode != BG_CAMERA_FEED) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } @@ -997,7 +1018,7 @@ void Environment::_validate_property(PropertyInfo &property) const { String enabled = prefix + "enabled"; if (property.name.begins_with(prefix) && property.name != enabled && !bool(get(enabled))) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; return; } @@ -1010,7 +1031,7 @@ void Environment::_validate_property(PropertyInfo &property) const { String prefix = String(*prefixes); if (property.name.begins_with(prefix)) { - property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + property.usage = PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL; return; } @@ -1295,18 +1316,24 @@ void Environment::_bind_methods() { ClassDB::bind_method(D_METHOD("set_volumetric_fog_enabled", "enabled"), &Environment::set_volumetric_fog_enabled); ClassDB::bind_method(D_METHOD("is_volumetric_fog_enabled"), &Environment::is_volumetric_fog_enabled); - ClassDB::bind_method(D_METHOD("set_volumetric_fog_light", "color"), &Environment::set_volumetric_fog_light); - ClassDB::bind_method(D_METHOD("get_volumetric_fog_light"), &Environment::get_volumetric_fog_light); + ClassDB::bind_method(D_METHOD("set_volumetric_fog_emission", "color"), &Environment::set_volumetric_fog_emission); + ClassDB::bind_method(D_METHOD("get_volumetric_fog_emission"), &Environment::get_volumetric_fog_emission); + ClassDB::bind_method(D_METHOD("set_volumetric_fog_albedo", "color"), &Environment::set_volumetric_fog_albedo); + ClassDB::bind_method(D_METHOD("get_volumetric_fog_albedo"), &Environment::get_volumetric_fog_albedo); ClassDB::bind_method(D_METHOD("set_volumetric_fog_density", "density"), &Environment::set_volumetric_fog_density); ClassDB::bind_method(D_METHOD("get_volumetric_fog_density"), &Environment::get_volumetric_fog_density); - ClassDB::bind_method(D_METHOD("set_volumetric_fog_light_energy", "begin"), &Environment::set_volumetric_fog_light_energy); - ClassDB::bind_method(D_METHOD("get_volumetric_fog_light_energy"), &Environment::get_volumetric_fog_light_energy); + ClassDB::bind_method(D_METHOD("set_volumetric_fog_emission_energy", "begin"), &Environment::set_volumetric_fog_emission_energy); + ClassDB::bind_method(D_METHOD("get_volumetric_fog_emission_energy"), &Environment::get_volumetric_fog_emission_energy); + ClassDB::bind_method(D_METHOD("set_volumetric_fog_anisotropy", "anisotropy"), &Environment::set_volumetric_fog_anisotropy); + ClassDB::bind_method(D_METHOD("get_volumetric_fog_anisotropy"), &Environment::get_volumetric_fog_anisotropy); ClassDB::bind_method(D_METHOD("set_volumetric_fog_length", "length"), &Environment::set_volumetric_fog_length); ClassDB::bind_method(D_METHOD("get_volumetric_fog_length"), &Environment::get_volumetric_fog_length); ClassDB::bind_method(D_METHOD("set_volumetric_fog_detail_spread", "detail_spread"), &Environment::set_volumetric_fog_detail_spread); ClassDB::bind_method(D_METHOD("get_volumetric_fog_detail_spread"), &Environment::get_volumetric_fog_detail_spread); ClassDB::bind_method(D_METHOD("set_volumetric_fog_gi_inject", "gi_inject"), &Environment::set_volumetric_fog_gi_inject); ClassDB::bind_method(D_METHOD("get_volumetric_fog_gi_inject"), &Environment::get_volumetric_fog_gi_inject); + ClassDB::bind_method(D_METHOD("set_volumetric_fog_ambient_inject", "enabled"), &Environment::set_volumetric_fog_ambient_inject); + ClassDB::bind_method(D_METHOD("get_volumetric_fog_ambient_inject"), &Environment::get_volumetric_fog_ambient_inject); ClassDB::bind_method(D_METHOD("set_volumetric_fog_temporal_reprojection_enabled", "enabled"), &Environment::set_volumetric_fog_temporal_reprojection_enabled); ClassDB::bind_method(D_METHOD("is_volumetric_fog_temporal_reprojection_enabled"), &Environment::is_volumetric_fog_temporal_reprojection_enabled); ClassDB::bind_method(D_METHOD("set_volumetric_fog_temporal_reprojection_amount", "temporal_reprojection_amount"), &Environment::set_volumetric_fog_temporal_reprojection_amount); @@ -1315,11 +1342,14 @@ void Environment::_bind_methods() { ADD_GROUP("Volumetric Fog", "volumetric_fog_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "volumetric_fog_enabled"), "set_volumetric_fog_enabled", "is_volumetric_fog_enabled"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_density", PROPERTY_HINT_RANGE, "0,1,0.0001,or_greater"), "set_volumetric_fog_density", "get_volumetric_fog_density"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "volumetric_fog_light", PROPERTY_HINT_COLOR_NO_ALPHA), "set_volumetric_fog_light", "get_volumetric_fog_light"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_light_energy", PROPERTY_HINT_RANGE, "0,1024,0.01,or_greater"), "set_volumetric_fog_light_energy", "get_volumetric_fog_light_energy"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_gi_inject", PROPERTY_HINT_RANGE, "0.00,16,0.01,exp"), "set_volumetric_fog_gi_inject", "get_volumetric_fog_gi_inject"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "volumetric_fog_albedo", PROPERTY_HINT_COLOR_NO_ALPHA), "set_volumetric_fog_albedo", "get_volumetric_fog_albedo"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "volumetric_fog_emission", PROPERTY_HINT_COLOR_NO_ALPHA), "set_volumetric_fog_emission", "get_volumetric_fog_emission"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_emission_energy", PROPERTY_HINT_RANGE, "0,1024,0.01,or_greater"), "set_volumetric_fog_emission_energy", "get_volumetric_fog_emission_energy"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_gi_inject", PROPERTY_HINT_RANGE, "0.0,16,0.01,exp"), "set_volumetric_fog_gi_inject", "get_volumetric_fog_gi_inject"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_anisotropy", PROPERTY_HINT_RANGE, "-0.9,0.9,0.01"), "set_volumetric_fog_anisotropy", "get_volumetric_fog_anisotropy"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_length", PROPERTY_HINT_RANGE, "0,1024,0.01,or_greater"), "set_volumetric_fog_length", "get_volumetric_fog_length"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_detail_spread", PROPERTY_HINT_EXP_EASING, "0.01,16,0.01"), "set_volumetric_fog_detail_spread", "get_volumetric_fog_detail_spread"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_detail_spread", PROPERTY_HINT_EXP_EASING), "set_volumetric_fog_detail_spread", "get_volumetric_fog_detail_spread"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_ambient_inject", PROPERTY_HINT_RANGE, "0.0,16,0.01,exp"), "set_volumetric_fog_ambient_inject", "get_volumetric_fog_ambient_inject"); ADD_SUBGROUP("Temporal Reprojection", "volumetric_fog_temporal_reprojection_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "volumetric_fog_temporal_reprojection_enabled"), "set_volumetric_fog_temporal_reprojection_enabled", "is_volumetric_fog_temporal_reprojection_enabled"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "volumetric_fog_temporal_reprojection_amount", PROPERTY_HINT_RANGE, "0.0,0.999,0.001"), "set_volumetric_fog_temporal_reprojection_amount", "get_volumetric_fog_temporal_reprojection_amount"); @@ -1381,11 +1411,6 @@ void Environment::_bind_methods() { BIND_ENUM_CONSTANT(SDFGI_Y_SCALE_DISABLED); BIND_ENUM_CONSTANT(SDFGI_Y_SCALE_75_PERCENT); BIND_ENUM_CONSTANT(SDFGI_Y_SCALE_50_PERCENT); - - BIND_ENUM_CONSTANT(VOLUMETRIC_FOG_SHADOW_FILTER_DISABLED); - BIND_ENUM_CONSTANT(VOLUMETRIC_FOG_SHADOW_FILTER_LOW); - BIND_ENUM_CONSTANT(VOLUMETRIC_FOG_SHADOW_FILTER_MEDIUM); - BIND_ENUM_CONSTANT(VOLUMETRIC_FOG_SHADOW_FILTER_HIGH); } Environment::Environment() { diff --git a/scene/resources/environment.h b/scene/resources/environment.h index 46842754f4..024bef34de 100644 --- a/scene/resources/environment.h +++ b/scene/resources/environment.h @@ -90,13 +90,6 @@ public: GLOW_BLEND_MODE_MIX, }; - enum VolumetricFogShadowFilter { - VOLUMETRIC_FOG_SHADOW_FILTER_DISABLED, - VOLUMETRIC_FOG_SHADOW_FILTER_LOW, - VOLUMETRIC_FOG_SHADOW_FILTER_MEDIUM, - VOLUMETRIC_FOG_SHADOW_FILTER_HIGH, - }; - private: RID environment; @@ -190,12 +183,15 @@ private: // Volumetric Fog bool volumetric_fog_enabled = false; - float volumetric_fog_density = 0.01; - Color volumetric_fog_light = Color(0.0, 0.0, 0.0); - float volumetric_fog_light_energy = 1.0; + float volumetric_fog_density = 0.05; + Color volumetric_fog_albedo = Color(1.0, 1.0, 1.0); + Color volumetric_fog_emission = Color(0.0, 0.0, 0.0); + float volumetric_fog_emission_energy = 1.0; + float volumetric_fog_anisotropy = 0.2; float volumetric_fog_length = 64.0; float volumetric_fog_detail_spread = 2.0; float volumetric_fog_gi_inject = 0.0; + float volumetric_fog_ambient_inject = false; bool volumetric_fog_temporal_reproject = true; float volumetric_fog_temporal_reproject_amount = 0.9; void _update_volumetric_fog(); @@ -375,16 +371,22 @@ public: bool is_volumetric_fog_enabled() const; void set_volumetric_fog_density(float p_density); float get_volumetric_fog_density() const; - void set_volumetric_fog_light(Color p_color); - Color get_volumetric_fog_light() const; - void set_volumetric_fog_light_energy(float p_begin); - float get_volumetric_fog_light_energy() const; + void set_volumetric_fog_albedo(Color p_color); + Color get_volumetric_fog_albedo() const; + void set_volumetric_fog_emission(Color p_color); + Color get_volumetric_fog_emission() const; + void set_volumetric_fog_emission_energy(float p_begin); + float get_volumetric_fog_emission_energy() const; + void set_volumetric_fog_anisotropy(float p_anisotropy); + float get_volumetric_fog_anisotropy() const; void set_volumetric_fog_length(float p_length); float get_volumetric_fog_length() const; void set_volumetric_fog_detail_spread(float p_detail_spread); float get_volumetric_fog_detail_spread() const; void set_volumetric_fog_gi_inject(float p_gi_inject); float get_volumetric_fog_gi_inject() const; + void set_volumetric_fog_ambient_inject(float p_ambient_inject); + float get_volumetric_fog_ambient_inject() const; void set_volumetric_fog_temporal_reprojection_enabled(bool p_enable); bool is_volumetric_fog_temporal_reprojection_enabled() const; void set_volumetric_fog_temporal_reprojection_amount(float p_amount); @@ -413,6 +415,5 @@ VARIANT_ENUM_CAST(Environment::ToneMapper) VARIANT_ENUM_CAST(Environment::SDFGICascades) VARIANT_ENUM_CAST(Environment::SDFGIYScale) VARIANT_ENUM_CAST(Environment::GlowBlendMode) -VARIANT_ENUM_CAST(Environment::VolumetricFogShadowFilter) #endif // ENVIRONMENT_H diff --git a/scene/resources/fog_material.cpp b/scene/resources/fog_material.cpp new file mode 100644 index 0000000000..978aaca33d --- /dev/null +++ b/scene/resources/fog_material.cpp @@ -0,0 +1,181 @@ +/*************************************************************************/ +/* fog_material.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "fog_material.h" + +#include "core/version.h" + +Mutex FogMaterial::shader_mutex; +RID FogMaterial::shader; + +void FogMaterial::set_density(float p_density) { + density = p_density; + RS::get_singleton()->material_set_param(_get_material(), "density", density); +} + +float FogMaterial::get_density() const { + return density; +} + +void FogMaterial::set_albedo(Color p_albedo) { + albedo = p_albedo; + RS::get_singleton()->material_set_param(_get_material(), "albedo", albedo); +} + +Color FogMaterial::get_albedo() const { + return albedo; +} + +void FogMaterial::set_emission(Color p_emission) { + emission = p_emission; + RS::get_singleton()->material_set_param(_get_material(), "emission", emission); +} + +Color FogMaterial::get_emission() const { + return emission; +} + +void FogMaterial::set_height_falloff(float p_falloff) { + height_falloff = MAX(p_falloff, 0.0f); + RS::get_singleton()->material_set_param(_get_material(), "height_falloff", height_falloff); +} + +float FogMaterial::get_height_falloff() const { + return height_falloff; +} + +void FogMaterial::set_edge_fade(float p_edge_fade) { + edge_fade = MAX(p_edge_fade, 0.0f); + RS::get_singleton()->material_set_param(_get_material(), "edge_fade", edge_fade); +} + +float FogMaterial::get_edge_fade() const { + return edge_fade; +} + +void FogMaterial::set_density_texture(const Ref<Texture3D> &p_texture) { + density_texture = p_texture; + RID tex_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); + RS::get_singleton()->material_set_param(_get_material(), "density_texture", tex_rid); +} + +Ref<Texture3D> FogMaterial::get_density_texture() const { + return density_texture; +} + +Shader::Mode FogMaterial::get_shader_mode() const { + return Shader::MODE_FOG; +} + +RID FogMaterial::get_shader_rid() const { + _update_shader(); + return shader; +} + +RID FogMaterial::get_rid() const { + _update_shader(); + if (!shader_set) { + RS::get_singleton()->material_set_shader(_get_material(), shader); + shader_set = true; + } + return _get_material(); +} + +void FogMaterial::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_density", "density"), &FogMaterial::set_density); + ClassDB::bind_method(D_METHOD("get_density"), &FogMaterial::get_density); + ClassDB::bind_method(D_METHOD("set_albedo", "albedo"), &FogMaterial::set_albedo); + ClassDB::bind_method(D_METHOD("get_albedo"), &FogMaterial::get_albedo); + ClassDB::bind_method(D_METHOD("set_emission", "emission"), &FogMaterial::set_emission); + ClassDB::bind_method(D_METHOD("get_emission"), &FogMaterial::get_emission); + ClassDB::bind_method(D_METHOD("set_height_falloff", "height_falloff"), &FogMaterial::set_height_falloff); + ClassDB::bind_method(D_METHOD("get_height_falloff"), &FogMaterial::get_height_falloff); + ClassDB::bind_method(D_METHOD("set_edge_fade", "edge_fade"), &FogMaterial::set_edge_fade); + ClassDB::bind_method(D_METHOD("get_edge_fade"), &FogMaterial::get_edge_fade); + ClassDB::bind_method(D_METHOD("set_density_texture", "density_texture"), &FogMaterial::set_density_texture); + ClassDB::bind_method(D_METHOD("get_density_texture"), &FogMaterial::get_density_texture); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "density", PROPERTY_HINT_RANGE, "0.0,16.0,0.0001,or_greater,or_lesser"), "set_density", "get_density"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "albedo", PROPERTY_HINT_COLOR_NO_ALPHA), "set_albedo", "get_albedo"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "emission", PROPERTY_HINT_COLOR_NO_ALPHA), "set_emission", "get_emission"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "height_falloff", PROPERTY_HINT_EXP_EASING, "attenuation"), "set_height_falloff", "get_height_falloff"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "edge_fade", PROPERTY_HINT_EXP_EASING), "set_edge_fade", "get_edge_fade"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "density_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_density_texture", "get_density_texture"); +} + +void FogMaterial::cleanup_shader() { + if (shader.is_valid()) { + RS::get_singleton()->free(shader); + } +} + +void FogMaterial::_update_shader() { + shader_mutex.lock(); + if (shader.is_null()) { + shader = RS::get_singleton()->shader_create(); + + // Add a comment to describe the shader origin (useful when converting to ShaderMaterial). + RS::get_singleton()->shader_set_code(shader, R"( +// NOTE: Shader automatically converted from )" VERSION_NAME " " VERSION_FULL_CONFIG R"('s FogMaterial. + +shader_type fog; + +uniform float density : hint_range(0, 1, 0.0001) = 1.0; +uniform vec4 albedo : hint_color = vec4(1.0); +uniform vec4 emission : hint_color = vec4(0, 0, 0, 1); +uniform float height_falloff = 0.0; +uniform float edge_fade = 0.1; +uniform sampler3D density_texture: hint_white; + + +void fog() { + DENSITY = density * clamp(exp2(-height_falloff * (WORLD_POSITION.y - OBJECT_POSITION.y)), 0.0, 1.0); + DENSITY *= texture(density_texture, UVW).r; + DENSITY *= pow(clamp(-SDF / min(min(EXTENTS.x, EXTENTS.y), EXTENTS.z), 0.0, 1.0), edge_fade); + ALBEDO = albedo.rgb; + EMISSION = emission.rgb; +} +)"); + } + shader_mutex.unlock(); +} + +FogMaterial::FogMaterial() { + set_density(1.0); + set_albedo(Color(1, 1, 1, 1)); + set_emission(Color(0, 0, 0, 1)); + + set_height_falloff(0.0); + set_edge_fade(0.1); +} + +FogMaterial::~FogMaterial() { + RS::get_singleton()->material_set_shader(_get_material(), RID()); +} diff --git a/scene/resources/fog_material.h b/scene/resources/fog_material.h new file mode 100644 index 0000000000..e256bd4719 --- /dev/null +++ b/scene/resources/fog_material.h @@ -0,0 +1,87 @@ +/*************************************************************************/ +/* fog_material.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef FOG_MATERIAL_H +#define FOG_MATERIAL_H + +#include "scene/resources/material.h" + +class FogMaterial : public Material { + GDCLASS(FogMaterial, Material); + +private: + float density = 1.0; + Color albedo = Color(1, 1, 1, 1); + Color emission = Color(0, 0, 0, 0); + + float height_falloff = 0.0; + + float edge_fade = 0.1; + + Ref<Texture3D> density_texture; + + static Mutex shader_mutex; + static RID shader; + static void _update_shader(); + mutable bool shader_set = false; + +protected: + static void _bind_methods(); + +public: + void set_density(float p_density); + float get_density() const; + + void set_albedo(Color p_color); + Color get_albedo() const; + + void set_emission(Color p_color); + Color get_emission() const; + + void set_height_falloff(float p_falloff); + float get_height_falloff() const; + + void set_edge_fade(float p_edge_fade); + float get_edge_fade() const; + + void set_density_texture(const Ref<Texture3D> &p_texture); + Ref<Texture3D> get_density_texture() const; + + virtual Shader::Mode get_shader_mode() const override; + virtual RID get_shader_rid() const override; + virtual RID get_rid() const override; + + static void cleanup_shader(); + + FogMaterial(); + virtual ~FogMaterial(); +}; + +#endif // FOG_MATERIAL_H diff --git a/scene/resources/font.cpp b/scene/resources/font.cpp index 04e2b0dc70..e5740472c6 100644 --- a/scene/resources/font.cpp +++ b/scene/resources/font.cpp @@ -70,6 +70,15 @@ void FontData::_bind_methods() { ClassDB::bind_method(D_METHOD("set_antialiased", "antialiased"), &FontData::set_antialiased); ClassDB::bind_method(D_METHOD("is_antialiased"), &FontData::is_antialiased); + ClassDB::bind_method(D_METHOD("set_font_name", "name"), &FontData::set_font_name); + ClassDB::bind_method(D_METHOD("get_font_name"), &FontData::get_font_name); + + ClassDB::bind_method(D_METHOD("set_font_style_name", "name"), &FontData::set_font_style_name); + ClassDB::bind_method(D_METHOD("get_font_style_name"), &FontData::get_font_style_name); + + ClassDB::bind_method(D_METHOD("set_font_style", "style"), &FontData::set_font_style); + ClassDB::bind_method(D_METHOD("get_font_style"), &FontData::get_font_style); + ClassDB::bind_method(D_METHOD("set_multichannel_signed_distance_field", "msdf"), &FontData::set_multichannel_signed_distance_field); ClassDB::bind_method(D_METHOD("is_multichannel_signed_distance_field"), &FontData::is_multichannel_signed_distance_field); @@ -79,6 +88,9 @@ void FontData::_bind_methods() { ClassDB::bind_method(D_METHOD("set_msdf_size", "msdf_size"), &FontData::set_msdf_size); ClassDB::bind_method(D_METHOD("get_msdf_size"), &FontData::get_msdf_size); + ClassDB::bind_method(D_METHOD("set_fixed_size", "fixed_size"), &FontData::set_fixed_size); + ClassDB::bind_method(D_METHOD("get_fixed_size"), &FontData::get_fixed_size); + ClassDB::bind_method(D_METHOD("set_force_autohinter", "force_autohinter"), &FontData::set_force_autohinter); ClassDB::bind_method(D_METHOD("is_force_autohinter"), &FontData::is_force_autohinter); @@ -190,6 +202,15 @@ bool FontData::_set(const StringName &p_name, const Variant &p_value) { } else if (tokens[0] == "antialiased") { set_antialiased(p_value); return true; + } else if (tokens[0] == "font_name") { + set_font_name(p_value); + return true; + } else if (tokens[0] == "style_name") { + set_font_style_name(p_value); + return true; + } else if (tokens[0] == "font_style") { + set_font_style(p_value); + return true; } else if (tokens[0] == "multichannel_signed_distance_field") { set_multichannel_signed_distance_field(p_value); return true; @@ -295,6 +316,15 @@ bool FontData::_get(const StringName &p_name, Variant &r_ret) const { } else if (tokens[0] == "antialiased") { r_ret = is_antialiased(); return true; + } else if (tokens[0] == "font_name") { + r_ret = get_font_name(); + return true; + } else if (tokens[0] == "style_name") { + r_ret = get_font_style_name(); + return true; + } else if (tokens[0] == "font_style") { + r_ret = get_font_style(); + return true; } else if (tokens[0] == "multichannel_signed_distance_field") { r_ret = is_multichannel_signed_distance_field(); return true; @@ -394,6 +424,9 @@ bool FontData::_get(const StringName &p_name, Variant &r_ret) const { void FontData::_get_property_list(List<PropertyInfo> *p_list) const { p_list->push_back(PropertyInfo(Variant::PACKED_BYTE_ARRAY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); + p_list->push_back(PropertyInfo(Variant::STRING, "font_name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); + p_list->push_back(PropertyInfo(Variant::STRING, "style_name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); + p_list->push_back(PropertyInfo(Variant::INT, "font_style", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); p_list->push_back(PropertyInfo(Variant::BOOL, "antialiased", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); p_list->push_back(PropertyInfo(Variant::BOOL, "multichannel_signed_distance_field", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); p_list->push_back(PropertyInfo(Variant::INT, "msdf_pixel_range", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_STORAGE)); @@ -510,6 +543,36 @@ PackedByteArray FontData::get_data() const { return data; } +void FontData::set_font_name(const String &p_name) { + _ensure_rid(0); + TS->font_set_name(cache[0], p_name); +} + +String FontData::get_font_name() const { + _ensure_rid(0); + return TS->font_get_name(cache[0]); +} + +void FontData::set_font_style_name(const String &p_name) { + _ensure_rid(0); + TS->font_set_style_name(cache[0], p_name); +} + +String FontData::get_font_style_name() const { + _ensure_rid(0); + return TS->font_get_style_name(cache[0]); +} + +void FontData::set_font_style(uint32_t p_style) { + _ensure_rid(0); + TS->font_set_style(cache[0], p_style); +} + +uint32_t FontData::get_font_style() const { + _ensure_rid(0); + return TS->font_get_style(cache[0]); +} + void FontData::set_antialiased(bool p_antialiased) { if (antialiased != p_antialiased) { antialiased = p_antialiased; @@ -689,7 +752,7 @@ void FontData::remove_cache(int p_cache_index) { if (cache[p_cache_index].is_valid()) { TS->free(cache.write[p_cache_index]); } - cache.remove(p_cache_index); + cache.remove_at(p_cache_index); emit_changed(); } @@ -1072,10 +1135,6 @@ void Font::_bind_methods() { ClassDB::bind_method(D_METHOD("clear_data"), &Font::clear_data); ClassDB::bind_method(D_METHOD("remove_data", "idx"), &Font::remove_data); - ClassDB::bind_method(D_METHOD("set_base_size", "size"), &Font::set_base_size); - ClassDB::bind_method(D_METHOD("get_base_size"), &Font::get_base_size); - ADD_PROPERTY(PropertyInfo(Variant::INT, "base_size"), "set_base_size", "get_base_size"); - ClassDB::bind_method(D_METHOD("set_variation_coordinates", "variation_coordinates"), &Font::set_variation_coordinates); ClassDB::bind_method(D_METHOD("get_variation_coordinates"), &Font::get_variation_coordinates); ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "variation_coordinates"), "set_variation_coordinates", "get_variation_coordinates"); @@ -1087,20 +1146,20 @@ void Font::_bind_methods() { ADD_PROPERTYI(PropertyInfo(Variant::INT, "spacing_top"), "set_spacing", "get_spacing", TextServer::SPACING_TOP); ADD_PROPERTYI(PropertyInfo(Variant::INT, "spacing_bottom"), "set_spacing", "get_spacing", TextServer::SPACING_BOTTOM); - ClassDB::bind_method(D_METHOD("get_height", "size"), &Font::get_height, DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("get_ascent", "size"), &Font::get_ascent, DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("get_descent", "size"), &Font::get_descent, DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("get_underline_position", "size"), &Font::get_underline_position, DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("get_underline_thickness", "size"), &Font::get_underline_thickness, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_height", "size"), &Font::get_height, DEFVAL(DEFAULT_FONT_SIZE)); + ClassDB::bind_method(D_METHOD("get_ascent", "size"), &Font::get_ascent, DEFVAL(DEFAULT_FONT_SIZE)); + ClassDB::bind_method(D_METHOD("get_descent", "size"), &Font::get_descent, DEFVAL(DEFAULT_FONT_SIZE)); + ClassDB::bind_method(D_METHOD("get_underline_position", "size"), &Font::get_underline_position, DEFVAL(DEFAULT_FONT_SIZE)); + ClassDB::bind_method(D_METHOD("get_underline_thickness", "size"), &Font::get_underline_thickness, DEFVAL(DEFAULT_FONT_SIZE)); - ClassDB::bind_method(D_METHOD("get_string_size", "text", "size", "align", "width", "flags"), &Font::get_string_size, DEFVAL(-1), DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("get_multiline_string_size", "text", "width", "size", "flags"), &Font::get_multiline_string_size, DEFVAL(-1), DEFVAL(-1), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("get_string_size", "text", "size", "alignment", "width", "flags"), &Font::get_string_size, DEFVAL(DEFAULT_FONT_SIZE), DEFVAL(HORIZONTAL_ALIGNMENT_LEFT), DEFVAL(-1), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("get_multiline_string_size", "text", "width", "size", "flags"), &Font::get_multiline_string_size, DEFVAL(-1), DEFVAL(DEFAULT_FONT_SIZE), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("draw_string", "canvas_item", "pos", "text", "align", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("draw_multiline_string", "canvas_item", "pos", "text", "align", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_multiline_string, DEFVAL(HALIGN_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_string", "canvas_item", "pos", "text", "alignment", "width", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_string, DEFVAL(HORIZONTAL_ALIGNMENT_LEFT), DEFVAL(-1), DEFVAL(DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); + ClassDB::bind_method(D_METHOD("draw_multiline_string", "canvas_item", "pos", "text", "alignment", "width", "max_lines", "size", "modulate", "outline_size", "outline_modulate", "flags"), &Font::draw_multiline_string, DEFVAL(HORIZONTAL_ALIGNMENT_LEFT), DEFVAL(-1), DEFVAL(-1), DEFVAL(DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0)), DEFVAL(TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND)); - ClassDB::bind_method(D_METHOD("get_char_size", "char", "next", "size"), &Font::get_char_size, DEFVAL(0), DEFVAL(-1)); - ClassDB::bind_method(D_METHOD("draw_char", "canvas_item", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &Font::draw_char, DEFVAL(0), DEFVAL(-1), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); + ClassDB::bind_method(D_METHOD("get_char_size", "char", "next", "size"), &Font::get_char_size, DEFVAL(0), DEFVAL(DEFAULT_FONT_SIZE)); + ClassDB::bind_method(D_METHOD("draw_char", "canvas_item", "pos", "char", "next", "size", "modulate", "outline_size", "outline_modulate"), &Font::draw_char, DEFVAL(0), DEFVAL(DEFAULT_FONT_SIZE), DEFVAL(Color(1, 1, 1)), DEFVAL(0), DEFVAL(Color(1, 1, 1, 0))); ClassDB::bind_method(D_METHOD("has_char", "char"), &Font::has_char); ClassDB::bind_method(D_METHOD("get_supported_chars"), &Font::get_supported_chars); @@ -1195,7 +1254,6 @@ void Font::reset_state() { data.clear(); rids.clear(); - base_size = 16; variation_coordinates.clear(); spacing_bottom = 0; spacing_top = 0; @@ -1298,8 +1356,8 @@ void Font::remove_data(int p_idx) { data.write[p_idx]->disconnect(SNAME("changed"), callable_mp(this, &Font::_data_changed)); } - data.remove(p_idx); - rids.remove(p_idx); + data.remove_at(p_idx); + rids.remove_at(p_idx); cache.clear(); cache_wrap.clear(); @@ -1308,14 +1366,6 @@ void Font::remove_data(int p_idx) { notify_property_list_changed(); } -void Font::set_base_size(int p_size) { - base_size = p_size; -} - -int Font::get_base_size() const { - return base_size; -} - void Font::set_variation_coordinates(const Dictionary &p_variation_coordinates) { _data_changed(); variation_coordinates = p_variation_coordinates; @@ -1355,87 +1405,78 @@ int Font::get_spacing(TextServer::SpacingType p_spacing) const { } real_t Font::get_height(int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; real_t ret = 0.f; for (int i = 0; i < data.size(); i++) { _ensure_rid(i); - ret = MAX(ret, TS->font_get_ascent(rids[i], size) + TS->font_get_descent(rids[i], size)); + ret = MAX(ret, TS->font_get_ascent(rids[i], p_size) + TS->font_get_descent(rids[i], p_size)); } return ret + spacing_bottom + spacing_top; } real_t Font::get_ascent(int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; real_t ret = 0.f; for (int i = 0; i < data.size(); i++) { _ensure_rid(i); - ret = MAX(ret, TS->font_get_ascent(rids[i], size)); + ret = MAX(ret, TS->font_get_ascent(rids[i], p_size)); } return ret + spacing_top; } real_t Font::get_descent(int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; real_t ret = 0.f; for (int i = 0; i < data.size(); i++) { _ensure_rid(i); - ret = MAX(ret, TS->font_get_descent(rids[i], size)); + ret = MAX(ret, TS->font_get_descent(rids[i], p_size)); } return ret + spacing_bottom; } real_t Font::get_underline_position(int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; real_t ret = 0.f; for (int i = 0; i < data.size(); i++) { _ensure_rid(i); - ret = MAX(ret, TS->font_get_underline_position(rids[i], size)); + ret = MAX(ret, TS->font_get_underline_position(rids[i], p_size)); } return ret + spacing_top; } real_t Font::get_underline_thickness(int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; real_t ret = 0.f; for (int i = 0; i < data.size(); i++) { _ensure_rid(i); - ret = MAX(ret, TS->font_get_underline_thickness(rids[i], size)); + ret = MAX(ret, TS->font_get_underline_thickness(rids[i], p_size)); } return ret; } -Size2 Font::get_string_size(const String &p_text, int p_size, HAlign p_align, real_t p_width, uint16_t p_flags) const { +Size2 Font::get_string_size(const String &p_text, int p_size, HorizontalAlignment p_alignment, float p_width, uint16_t p_flags) const { ERR_FAIL_COND_V(data.is_empty(), Size2()); - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); } uint64_t hash = p_text.hash64(); - if (p_align == HALIGN_FILL) { + if (p_alignment == HORIZONTAL_ALIGNMENT_FILL) { hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); hash = hash_djb2_one_64(p_flags, hash); } - hash = hash_djb2_one_64(size, hash); + hash = hash_djb2_one_64(p_size, hash); Ref<TextLine> buffer; if (cache.has(hash)) { buffer = cache.get(hash); } else { buffer.instantiate(); - buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + buffer->add_string(p_text, Ref<Font>(this), p_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); cache.insert(hash, buffer); } return buffer->get_size(); } -Size2 Font::get_multiline_string_size(const String &p_text, real_t p_width, int p_size, uint16_t p_flags) const { +Size2 Font::get_multiline_string_size(const String &p_text, float p_width, int p_size, uint16_t p_flags) const { ERR_FAIL_COND_V(data.is_empty(), Size2()); - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); } @@ -1443,14 +1484,14 @@ Size2 Font::get_multiline_string_size(const String &p_text, real_t p_width, int uint64_t hash = p_text.hash64(); uint64_t wrp_hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); wrp_hash = hash_djb2_one_64(p_flags, wrp_hash); - wrp_hash = hash_djb2_one_64(size, wrp_hash); + wrp_hash = hash_djb2_one_64(p_size, wrp_hash); Ref<TextParagraph> lines_buffer; if (cache_wrap.has(wrp_hash)) { lines_buffer = cache_wrap.get(wrp_hash); } else { lines_buffer.instantiate(); - lines_buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + lines_buffer->add_string(p_text, Ref<Font>(this), p_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); lines_buffer->set_width(p_width); lines_buffer->set_flags(p_flags); cache_wrap.insert(wrp_hash, lines_buffer); @@ -1470,28 +1511,26 @@ Size2 Font::get_multiline_string_size(const String &p_text, real_t p_width, int return ret; } -void Font::draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align, real_t p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { +void Font::draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment, float p_width, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { ERR_FAIL_COND(data.is_empty()); - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); } uint64_t hash = p_text.hash64(); - if (p_align == HALIGN_FILL) { + if (p_alignment == HORIZONTAL_ALIGNMENT_FILL) { hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); hash = hash_djb2_one_64(p_flags, hash); } - hash = hash_djb2_one_64(size, hash); + hash = hash_djb2_one_64(p_size, hash); Ref<TextLine> buffer; if (cache.has(hash)) { buffer = cache.get(hash); } else { buffer.instantiate(); - buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + buffer->add_string(p_text, Ref<Font>(this), p_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); cache.insert(hash, buffer); } @@ -1503,7 +1542,7 @@ void Font::draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_t } buffer->set_width(p_width); - buffer->set_align(p_align); + buffer->set_horizontal_alignment(p_alignment); buffer->set_flags(p_flags); if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { @@ -1512,11 +1551,9 @@ void Font::draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_t buffer->draw(p_canvas_item, ofs, p_modulate); } -void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align, float p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { +void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment, float p_width, int p_max_lines, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate, uint16_t p_flags) const { ERR_FAIL_COND(data.is_empty()); - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); } @@ -1524,20 +1561,20 @@ void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const S uint64_t hash = p_text.hash64(); uint64_t wrp_hash = hash_djb2_one_64(hash_djb2_one_float(p_width), hash); wrp_hash = hash_djb2_one_64(p_flags, wrp_hash); - wrp_hash = hash_djb2_one_64(size, wrp_hash); + wrp_hash = hash_djb2_one_64(p_size, wrp_hash); Ref<TextParagraph> lines_buffer; if (cache_wrap.has(wrp_hash)) { lines_buffer = cache_wrap.get(wrp_hash); } else { lines_buffer.instantiate(); - lines_buffer->add_string(p_text, Ref<Font>(this), size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); + lines_buffer->add_string(p_text, Ref<Font>(this), p_size, Dictionary(), TranslationServer::get_singleton()->get_tool_locale()); lines_buffer->set_width(p_width); lines_buffer->set_flags(p_flags); cache_wrap.insert(wrp_hash, lines_buffer); } - lines_buffer->set_align(p_align); + lines_buffer->set_alignment(p_alignment); Vector2 lofs = p_pos; for (int i = 0; i < lines_buffer->get_line_count(); i++) { @@ -1551,7 +1588,7 @@ void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const S } } if (p_width > 0) { - lines_buffer->set_align(p_align); + lines_buffer->set_alignment(p_alignment); } if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { @@ -1573,16 +1610,14 @@ void Font::draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const S } Size2 Font::get_char_size(char32_t p_char, char32_t p_next, int p_size) const { - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); if (data[i]->has_char(p_char)) { - int32_t glyph_a = TS->font_get_glyph_index(rids[i], size, p_char, 0); - Size2 ret = Size2(TS->font_get_glyph_advance(rids[i], size, glyph_a).x, TS->font_get_ascent(rids[i], size) + TS->font_get_descent(rids[i], size)); + int32_t glyph_a = TS->font_get_glyph_index(rids[i], p_size, p_char, 0); + Size2 ret = Size2(TS->font_get_glyph_advance(rids[i], p_size, glyph_a).x, TS->font_get_ascent(rids[i], p_size) + TS->font_get_descent(rids[i], p_size)); if ((p_next != 0) && data[i]->has_char(p_next)) { - int32_t glyph_b = TS->font_get_glyph_index(rids[i], size, p_next, 0); - ret.x -= TS->font_get_kerning(rids[i], size, Vector2i(glyph_a, glyph_b)).x; + int32_t glyph_b = TS->font_get_glyph_index(rids[i], p_size, p_next, 0); + ret.x -= TS->font_get_kerning(rids[i], p_size, Vector2i(glyph_a, glyph_b)).x; } return ret; } @@ -1591,22 +1626,20 @@ Size2 Font::get_char_size(char32_t p_char, char32_t p_next, int p_size) const { } real_t Font::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next, int p_size, const Color &p_modulate, int p_outline_size, const Color &p_outline_modulate) const { - int size = (p_size <= 0) ? base_size : p_size; - for (int i = 0; i < data.size(); i++) { _ensure_rid(i); if (data[i]->has_char(p_char)) { - int32_t glyph_a = TS->font_get_glyph_index(rids[i], size, p_char, 0); - real_t ret = TS->font_get_glyph_advance(rids[i], size, glyph_a).x; + int32_t glyph_a = TS->font_get_glyph_index(rids[i], p_size, p_char, 0); + real_t ret = TS->font_get_glyph_advance(rids[i], p_size, glyph_a).x; if ((p_next != 0) && data[i]->has_char(p_next)) { - int32_t glyph_b = TS->font_get_glyph_index(rids[i], size, p_next, 0); - ret -= TS->font_get_kerning(rids[i], size, Vector2i(glyph_a, glyph_b)).x; + int32_t glyph_b = TS->font_get_glyph_index(rids[i], p_size, p_next, 0); + ret -= TS->font_get_kerning(rids[i], p_size, Vector2i(glyph_a, glyph_b)).x; } if (p_outline_size > 0 && p_outline_modulate.a != 0.0f) { - TS->font_draw_glyph_outline(rids[i], p_canvas_item, size, p_outline_size, p_pos, glyph_a, p_outline_modulate); + TS->font_draw_glyph_outline(rids[i], p_canvas_item, p_size, p_outline_size, p_pos, glyph_a, p_outline_modulate); } - TS->font_draw_glyph(rids[i], p_canvas_item, size, p_pos, glyph_a, p_modulate); + TS->font_draw_glyph(rids[i], p_canvas_item, p_size, p_pos, glyph_a, p_modulate); return ret; } } diff --git a/scene/resources/font.h b/scene/resources/font.h index e65fdb0751..fb662037a1 100644 --- a/scene/resources/font.h +++ b/scene/resources/font.h @@ -79,6 +79,15 @@ public: virtual PackedByteArray get_data() const; // Common properties. + virtual void set_font_name(const String &p_name); + virtual String get_font_name() const; + + virtual void set_font_style_name(const String &p_name); + virtual String get_font_style_name() const; + + virtual void set_font_style(uint32_t p_style); + virtual uint32_t get_font_style() const; + virtual void set_antialiased(bool p_antialiased); virtual bool is_antialiased() const; @@ -219,7 +228,6 @@ class Font : public Resource { mutable Vector<RID> rids; // Font config. - int base_size = 16; Dictionary variation_coordinates; int spacing_bottom = 0; int spacing_top = 0; @@ -237,6 +245,8 @@ protected: virtual void reset_state() override; public: + static const int DEFAULT_FONT_SIZE = 16; + Dictionary get_feature_list() const; // Font data. @@ -249,9 +259,6 @@ public: virtual void remove_data(int p_idx); // Font configuration. - virtual void set_base_size(int p_size); - virtual int get_base_size() const; - virtual void set_variation_coordinates(const Dictionary &p_variation_coordinates); virtual Dictionary get_variation_coordinates() const; @@ -259,26 +266,26 @@ public: virtual int get_spacing(TextServer::SpacingType p_spacing) const; // Font metrics. - virtual real_t get_height(int p_size = -1) const; - virtual real_t get_ascent(int p_size = -1) const; - virtual real_t get_descent(int p_size = -1) const; - virtual real_t get_underline_position(int p_size = -1) const; - virtual real_t get_underline_thickness(int p_size = -1) const; + virtual real_t get_height(int p_size = DEFAULT_FONT_SIZE) const; + virtual real_t get_ascent(int p_size = DEFAULT_FONT_SIZE) const; + virtual real_t get_descent(int p_size = DEFAULT_FONT_SIZE) const; + virtual real_t get_underline_position(int p_size = DEFAULT_FONT_SIZE) const; + virtual real_t get_underline_thickness(int p_size = DEFAULT_FONT_SIZE) const; // Drawing string. - virtual Size2 get_string_size(const String &p_text, int p_size = -1, HAlign p_align = HALIGN_LEFT, real_t p_width = -1, uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; - virtual Size2 get_multiline_string_size(const String &p_text, real_t p_width = -1, int p_size = -1, uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND) const; + virtual Size2 get_string_size(const String &p_text, int p_size = DEFAULT_FONT_SIZE, HorizontalAlignment p_alignment = HORIZONTAL_ALIGNMENT_LEFT, float p_width = -1, uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + virtual Size2 get_multiline_string_size(const String &p_text, float p_width = -1, int p_size = DEFAULT_FONT_SIZE, uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND) const; - virtual void draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, real_t p_width = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; - virtual void draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HAlign p_align = HALIGN_LEFT, real_t p_width = -1, int p_max_lines = -1, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + virtual void draw_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment = HORIZONTAL_ALIGNMENT_LEFT, float p_width = -1, int p_size = DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; + virtual void draw_multiline_string(RID p_canvas_item, const Point2 &p_pos, const String &p_text, HorizontalAlignment p_alignment = HORIZONTAL_ALIGNMENT_LEFT, float p_width = -1, int p_max_lines = -1, int p_size = DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0), uint16_t p_flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA | TextServer::JUSTIFICATION_WORD_BOUND) const; // Helper functions. virtual bool has_char(char32_t p_char) const; virtual String get_supported_chars() const; // Drawing char. - virtual Size2 get_char_size(char32_t p_char, char32_t p_next = 0, int p_size = -1) const; - virtual real_t draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, int p_size = -1, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; + virtual Size2 get_char_size(char32_t p_char, char32_t p_next = 0, int p_size = DEFAULT_FONT_SIZE) const; + virtual real_t draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_char, char32_t p_next = 0, int p_size = DEFAULT_FONT_SIZE, const Color &p_modulate = Color(1, 1, 1), int p_outline_size = 0, const Color &p_outline_modulate = Color(1, 1, 1, 0)) const; Vector<RID> get_rids() const; diff --git a/scene/resources/gradient.cpp b/scene/resources/gradient.cpp index 7b9b942142..95ec141df6 100644 --- a/scene/resources/gradient.cpp +++ b/scene/resources/gradient.cpp @@ -51,6 +51,8 @@ void Gradient::_bind_methods() { ClassDB::bind_method(D_METHOD("set_offset", "point", "offset"), &Gradient::set_offset); ClassDB::bind_method(D_METHOD("get_offset", "point"), &Gradient::get_offset); + ClassDB::bind_method(D_METHOD("reverse"), &Gradient::reverse); + ClassDB::bind_method(D_METHOD("set_color", "point", "color"), &Gradient::set_color); ClassDB::bind_method(D_METHOD("get_color", "point"), &Gradient::get_color); @@ -64,8 +66,18 @@ void Gradient::_bind_methods() { ClassDB::bind_method(D_METHOD("set_colors", "colors"), &Gradient::set_colors); ClassDB::bind_method(D_METHOD("get_colors"), &Gradient::get_colors); + ClassDB::bind_method(D_METHOD("set_interpolation_mode", "interpolation_mode"), &Gradient::set_interpolation_mode); + ClassDB::bind_method(D_METHOD("get_interpolation_mode"), &Gradient::get_interpolation_mode); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "interpolation_mode", PROPERTY_HINT_ENUM, "Linear,Constant,Cubic"), "set_interpolation_mode", "get_interpolation_mode"); + + ADD_GROUP("Raw data", ""); ADD_PROPERTY(PropertyInfo(Variant::PACKED_FLOAT32_ARRAY, "offsets"), "set_offsets", "get_offsets"); ADD_PROPERTY(PropertyInfo(Variant::PACKED_COLOR_ARRAY, "colors"), "set_colors", "get_colors"); + + BIND_ENUM_CONSTANT(GRADIENT_INTERPOLATE_LINEAR); + BIND_ENUM_CONSTANT(GRADIENT_INTERPOLATE_CONSTANT); + BIND_ENUM_CONSTANT(GRADIENT_INTERPOLATE_CUBIC); } Vector<float> Gradient::get_offsets() const { @@ -86,6 +98,15 @@ Vector<Color> Gradient::get_colors() const { return colors; } +void Gradient::set_interpolation_mode(Gradient::InterpolationMode p_interp_mode) { + interpolation_mode = p_interp_mode; + emit_signal(CoreStringNames::get_singleton()->changed); +} + +Gradient::InterpolationMode Gradient::get_interpolation_mode() { + return interpolation_mode; +} + void Gradient::set_offsets(const Vector<float> &p_offsets) { points.resize(p_offsets.size()); for (int i = 0; i < points.size(); i++) { @@ -123,7 +144,16 @@ void Gradient::add_point(float p_offset, const Color &p_color) { void Gradient::remove_point(int p_index) { ERR_FAIL_INDEX(p_index, points.size()); ERR_FAIL_COND(points.size() <= 1); - points.remove(p_index); + points.remove_at(p_index); + emit_signal(CoreStringNames::get_singleton()->changed); +} + +void Gradient::reverse() { + for (int i = 0; i < points.size(); i++) { + points.write[i].offset = 1.0 - points[i].offset; + } + + _update_sorting(); emit_signal(CoreStringNames::get_singleton()->changed); } diff --git a/scene/resources/gradient.h b/scene/resources/gradient.h index cf5b179c45..eb438d0bba 100644 --- a/scene/resources/gradient.h +++ b/scene/resources/gradient.h @@ -38,6 +38,12 @@ class Gradient : public Resource { OBJ_SAVE_TYPE(Gradient); public: + enum InterpolationMode { + GRADIENT_INTERPOLATE_LINEAR, + GRADIENT_INTERPOLATE_CONSTANT, + GRADIENT_INTERPOLATE_CUBIC, + }; + struct Point { float offset = 0.0; Color color; @@ -49,6 +55,8 @@ public: private: Vector<Point> points; bool is_sorted = true; + InterpolationMode interpolation_mode = GRADIENT_INTERPOLATE_LINEAR; + _FORCE_INLINE_ void _update_sorting() { if (!is_sorted) { points.sort(); @@ -65,9 +73,9 @@ public: void add_point(float p_offset, const Color &p_color); void remove_point(int p_index); - void set_points(Vector<Point> &p_points); Vector<Point> &get_points(); + void reverse(); void set_offset(int pos, const float offset); float get_offset(int pos); @@ -81,6 +89,13 @@ public: void set_colors(const Vector<Color> &p_colors); Vector<Color> get_colors() const; + void set_interpolation_mode(InterpolationMode p_interp_mode); + InterpolationMode get_interpolation_mode(); + + _FORCE_INLINE_ float cubic_interpolate(float p0, float p1, float p2, float p3, float x) { + return p1 + 0.5 * x * (p2 - p0 + x * (2.0 * p0 - 5.0 * p1 + 4.0 * p2 - p3 + x * (3.0 * (p1 - p2) + p3 - p0))); + } + _FORCE_INLINE_ Color get_color_at_offset(float p_offset) { if (points.is_empty()) { return Color(0, 0, 0, 1); @@ -88,7 +103,7 @@ public: _update_sorting(); - //binary search + // Binary search. int low = 0; int high = points.size() - 1; int middle = 0; @@ -111,7 +126,7 @@ public: } } - //return interpolated value + // Return interpolated value. if (points[middle].offset > p_offset) { middle--; } @@ -125,10 +140,44 @@ public: } const Point &pointFirst = points[first]; const Point &pointSecond = points[second]; - return pointFirst.color.lerp(pointSecond.color, (p_offset - pointFirst.offset) / (pointSecond.offset - pointFirst.offset)); + + switch (interpolation_mode) { + case GRADIENT_INTERPOLATE_LINEAR: { + return pointFirst.color.lerp(pointSecond.color, (p_offset - pointFirst.offset) / (pointSecond.offset - pointFirst.offset)); + } break; + case GRADIENT_INTERPOLATE_CONSTANT: { + return pointFirst.color; + } break; + case GRADIENT_INTERPOLATE_CUBIC: { + int p0 = first - 1; + int p3 = second + 1; + if (p3 >= points.size()) { + p3 = second; + } + if (p0 < 0) { + p0 = first; + } + const Point &pointP0 = points[p0]; + const Point &pointP3 = points[p3]; + + float x = (p_offset - pointFirst.offset) / (pointSecond.offset - pointFirst.offset); + float r = cubic_interpolate(pointP0.color.r, pointFirst.color.r, pointSecond.color.r, pointP3.color.r, x); + float g = cubic_interpolate(pointP0.color.g, pointFirst.color.g, pointSecond.color.g, pointP3.color.g, x); + float b = cubic_interpolate(pointP0.color.b, pointFirst.color.b, pointSecond.color.b, pointP3.color.b, x); + float a = cubic_interpolate(pointP0.color.a, pointFirst.color.a, pointSecond.color.a, pointP3.color.a, x); + + return Color(r, g, b, a); + } break; + default: { + // Fallback to linear interpolation. + return pointFirst.color.lerp(pointSecond.color, (p_offset - pointFirst.offset) / (pointSecond.offset - pointFirst.offset)); + } + } } int get_points_count() const; }; +VARIANT_ENUM_CAST(Gradient::InterpolationMode); + #endif // GRADIENT_H diff --git a/scene/resources/immediate_mesh.cpp b/scene/resources/immediate_mesh.cpp index fe7124de9e..4f9a055bfb 100644 --- a/scene/resources/immediate_mesh.cpp +++ b/scene/resources/immediate_mesh.cpp @@ -144,6 +144,7 @@ void ImmediateMesh::surface_add_vertex_2d(const Vector2 &p_vertex) { active_surface_data.vertex_2d = true; } + void ImmediateMesh::surface_end() { ERR_FAIL_COND_MSG(!surface_active, "Not creating any surface. Use surface_begin() to do it."); ERR_FAIL_COND_MSG(!vertices.size(), "No vertices were added, surface can't be created."); @@ -185,7 +186,7 @@ void ImmediateMesh::surface_end() { vtx[2] = vertices[i].z; } if (i == 0) { - aabb.position = vertices[i]; + aabb = AABB(vertices[i], SMALL_VEC3); // Must have a bit of size. } else { aabb.expand_to(vertices[i]); } diff --git a/scene/resources/immediate_mesh.h b/scene/resources/immediate_mesh.h index 6673ee6f3d..92bf91441d 100644 --- a/scene/resources/immediate_mesh.h +++ b/scene/resources/immediate_mesh.h @@ -75,6 +75,8 @@ class ImmediateMesh : public Mesh { Vector<uint8_t> surface_vertex_create_cache; Vector<uint8_t> surface_attribute_create_cache; + const Vector3 SMALL_VEC3 = Vector3(CMP_EPSILON, CMP_EPSILON, CMP_EPSILON); + protected: static void _bind_methods(); diff --git a/scene/resources/importer_mesh.cpp b/scene/resources/importer_mesh.cpp index 076b8312b6..b2b90f019e 100644 --- a/scene/resources/importer_mesh.cpp +++ b/scene/resources/importer_mesh.cpp @@ -485,7 +485,7 @@ void ImporterMesh::generate_lods(float p_normal_merge_angle, float p_normal_spli raycaster->intersect(rays); LocalVector<Vector3> ray_normals; - LocalVector<float> ray_normal_weights; + LocalVector<real_t> ray_normal_weights; ray_normals.resize(new_index_count); ray_normal_weights.resize(new_index_count); @@ -517,10 +517,10 @@ void ImporterMesh::generate_lods(float p_normal_merge_angle, float p_normal_spli Vector3 normal = n0 * w + n1 * u + n2 * v; Vector2 orig_uv = ray_uvs[j]; - float orig_bary[3] = { 1.0f - orig_uv.x - orig_uv.y, orig_uv.x, orig_uv.y }; + real_t orig_bary[3] = { 1.0f - orig_uv.x - orig_uv.y, orig_uv.x, orig_uv.y }; for (int k = 0; k < 3; k++) { int idx = orig_tri_id * 3 + k; - float weight = orig_bary[k]; + real_t weight = orig_bary[k]; ray_normals[idx] += normal * weight; ray_normal_weights[idx] += weight; } @@ -653,7 +653,7 @@ Ref<ArrayMesh> ImporterMesh::get_mesh(const Ref<ArrayMesh> &p_base) { if (surfaces[i].material.is_valid()) { mesh->surface_set_material(mesh->get_surface_count() - 1, surfaces[i].material); } - if (surfaces[i].name != String()) { + if (!surfaces[i].name.is_empty()) { mesh->surface_set_name(mesh->get_surface_count() - 1, surfaces[i].name); } } @@ -839,7 +839,7 @@ Dictionary ImporterMesh::_get_data() const { d["material"] = surfaces[i].material; } - if (surfaces[i].name != String()) { + if (!surfaces[i].name.is_empty()) { d["name"] = surfaces[i].name; } @@ -1243,5 +1243,5 @@ void ImporterMesh::_bind_methods() { ClassDB::bind_method(D_METHOD("set_lightmap_size_hint", "size"), &ImporterMesh::set_lightmap_size_hint); ClassDB::bind_method(D_METHOD("get_lightmap_size_hint"), &ImporterMesh::get_lightmap_size_hint); - ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "_set_data", "_get_data"); } diff --git a/scene/resources/material.cpp b/scene/resources/material.cpp index abb3381c4e..98bda4ad1b 100644 --- a/scene/resources/material.cpp +++ b/scene/resources/material.cpp @@ -1086,7 +1086,7 @@ void BaseMaterial3D::_update_shader() { code += " ALPHA = 1.0;\n"; } else if (transparency != TRANSPARENCY_DISABLED || flags[FLAG_USE_SHADOW_TO_OPACITY] || (distance_fade == DISTANCE_FADE_PIXEL_ALPHA) || proximity_fade_enabled) { - code += " ALPHA = albedo.a * albedo_tex.a;\n"; + code += " ALPHA *= albedo.a * albedo_tex.a;\n"; } if (transparency == TRANSPARENCY_ALPHA_HASH) { code += " ALPHA_HASH_SCALE = alpha_hash_scale;\n"; @@ -1100,7 +1100,7 @@ void BaseMaterial3D::_update_shader() { if (proximity_fade_enabled) { code += " float depth_tex = textureLod(DEPTH_TEXTURE,SCREEN_UV,0.0).r;\n"; - code += " vec4 world_pos = INV_PROJECTION_MATRIX * vec4(SCREEN_UV*2.0-1.0,depth_tex*2.0-1.0,1.0);\n"; + code += " vec4 world_pos = INV_PROJECTION_MATRIX * vec4(SCREEN_UV*2.0-1.0,depth_tex,1.0);\n"; code += " world_pos.xyz/=world_pos.w;\n"; code += " ALPHA*=clamp(1.0-smoothstep(world_pos.z+proximity_fade_distance,world_pos.z,VERTEX.z),0.0,1.0);\n"; } @@ -1658,13 +1658,28 @@ bool BaseMaterial3D::get_feature(Feature p_feature) const { void BaseMaterial3D::set_texture(TextureParam p_param, const Ref<Texture2D> &p_texture) { ERR_FAIL_INDEX(p_param, TEXTURE_MAX); + + if (get_texture(TEXTURE_ROUGHNESS).is_null() && p_texture.is_valid() && p_param == TEXTURE_ROUGHNESS) { + // If no roughness texture is currently set, automatically set the recommended value + // for roughness when using a roughness map. + set_roughness(1.0); + } + + if (get_texture(TEXTURE_METALLIC).is_null() && p_texture.is_valid() && p_param == TEXTURE_METALLIC) { + // If no metallic texture is currently set, automatically set the recommended value + // for metallic when using a metallic map. + set_metallic(1.0); + } + textures[p_param] = p_texture; RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); RS::get_singleton()->material_set_param(_get_material(), shader_names->texture_names[p_param], rid); + if (p_texture.is_valid() && p_param == TEXTURE_ALBEDO) { RS::get_singleton()->material_set_param(_get_material(), shader_names->albedo_texture_size, Vector2i(p_texture->get_width(), p_texture->get_height())); } + notify_property_list_changed(); _queue_shader_change(); } @@ -1695,7 +1710,7 @@ BaseMaterial3D::TextureFilter BaseMaterial3D::get_texture_filter() const { void BaseMaterial3D::_validate_feature(const String &text, Feature feature, PropertyInfo &property) const { if (property.name.begins_with(text) && property.name != text + "_enabled" && !features[feature]) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } @@ -1729,23 +1744,23 @@ void BaseMaterial3D::_validate_property(PropertyInfo &property) const { } if (property.name == "billboard_keep_scale" && billboard_mode == BILLBOARD_DISABLED) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } if (property.name == "grow_amount" && !grow_enabled) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } if (property.name == "point_size" && !flags[FLAG_USE_POINT_SIZE]) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } if (property.name == "proximity_fade_distance" && !proximity_fade_enabled) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } if ((property.name == "distance_fade_max_distance" || property.name == "distance_fade_min_distance") && distance_fade == DISTANCE_FADE_DISABLED) { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } // you can only enable anti-aliasing (in materials) on alpha scissor and alpha hash @@ -2884,7 +2899,7 @@ bool StandardMaterial3D::_set(const StringName &p_name, const Variant &p_value) idx++; } - print_line("remapped parameter not found: " + String(p_name)); + WARN_PRINT("Godot 3.x SpatialMaterial remapped parameter not found: " + String(p_name)); return true; } diff --git a/scene/resources/mesh.cpp b/scene/resources/mesh.cpp index 7ffe0b03e1..bd63d17424 100644 --- a/scene/resources/mesh.cpp +++ b/scene/resources/mesh.cpp @@ -994,9 +994,9 @@ bool ArrayMesh::_set(const StringName &p_name, const Variant &p_value) { } //clear unused flags - print_line("format pre: " + itos(old_format)); + print_verbose("Mesh format pre-conversion: " + itos(old_format)); - print_line("format post: " + itos(new_format)); + print_verbose("Mesh format post-conversion: " + itos(new_format)); ERR_FAIL_COND_V(!d.has("aabb"), false); AABB aabb = d["aabb"]; @@ -1104,7 +1104,7 @@ Array ArrayMesh::_get_surfaces() const { data["material"] = surfaces[i].material; } - if (surfaces[i].name != String()) { + if (!surfaces[i].name.is_empty()) { data["name"] = surfaces[i].name; } @@ -1842,8 +1842,8 @@ void ArrayMesh::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_surfaces", "surfaces"), &ArrayMesh::_set_surfaces); ClassDB::bind_method(D_METHOD("_get_surfaces"), &ArrayMesh::_get_surfaces); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_STRING_ARRAY, "_blend_shape_names", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_blend_shape_names", "_get_blend_shape_names"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "_surfaces", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_surfaces", "_get_surfaces"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_STRING_ARRAY, "_blend_shape_names", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_blend_shape_names", "_get_blend_shape_names"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "_surfaces", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_surfaces", "_get_surfaces"); ADD_PROPERTY(PropertyInfo(Variant::INT, "blend_shape_mode", PROPERTY_HINT_ENUM, "Normalized,Relative"), "set_blend_shape_mode", "get_blend_shape_mode"); ADD_PROPERTY(PropertyInfo(Variant::AABB, "custom_aabb", PROPERTY_HINT_NONE, ""), "set_custom_aabb", "get_custom_aabb"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shadow_mesh", PROPERTY_HINT_RESOURCE_TYPE, "ArrayMesh"), "set_shadow_mesh", "get_shadow_mesh"); diff --git a/scene/resources/mesh.h b/scene/resources/mesh.h index 8d5571d67c..a95b4d4a5e 100644 --- a/scene/resources/mesh.h +++ b/scene/resources/mesh.h @@ -278,7 +278,6 @@ public: int surface_get_array_index_len(int p_idx) const override; uint32_t surface_get_format(int p_idx) const override; PrimitiveType surface_get_primitive_type(int p_idx) const override; - bool surface_is_alpha_sorting_enabled(int p_idx) const; virtual void surface_set_material(int p_idx, const Ref<Material> &p_material) override; virtual Ref<Material> surface_get_material(int p_idx) const override; diff --git a/scene/resources/mesh_data_tool.cpp b/scene/resources/mesh_data_tool.cpp index 04b2437ae8..9ecd8ec2f3 100644 --- a/scene/resources/mesh_data_tool.cpp +++ b/scene/resources/mesh_data_tool.cpp @@ -421,6 +421,7 @@ Vector<int> MeshDataTool::get_vertex_bones(int p_idx) const { void MeshDataTool::set_vertex_bones(int p_idx, const Vector<int> &p_bones) { ERR_FAIL_INDEX(p_idx, vertices.size()); + ERR_FAIL_COND(p_bones.size() != 4); vertices.write[p_idx].bones = p_bones; format |= Mesh::ARRAY_FORMAT_BONES; } @@ -432,6 +433,7 @@ Vector<float> MeshDataTool::get_vertex_weights(int p_idx) const { void MeshDataTool::set_vertex_weights(int p_idx, const Vector<float> &p_weights) { ERR_FAIL_INDEX(p_idx, vertices.size()); + ERR_FAIL_COND(p_weights.size() != 4); vertices.write[p_idx].weights = p_weights; format |= Mesh::ARRAY_FORMAT_WEIGHTS; } diff --git a/scene/resources/navigation_mesh.cpp b/scene/resources/navigation_mesh.cpp index d87056f55d..db091ec37b 100644 --- a/scene/resources/navigation_mesh.cpp +++ b/scene/resources/navigation_mesh.cpp @@ -477,8 +477,8 @@ void NavigationMesh::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_polygons", "polygons"), &NavigationMesh::_set_polygons); ClassDB::bind_method(D_METHOD("_get_polygons"), &NavigationMesh::_get_polygons); - ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_vertices", "get_vertices"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "polygons", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_polygons", "_get_polygons"); + ADD_PROPERTY(PropertyInfo(Variant::PACKED_VECTOR3_ARRAY, "vertices", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_vertices", "get_vertices"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "polygons", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_polygons", "_get_polygons"); ADD_PROPERTY(PropertyInfo(Variant::INT, "sample_partition_type/sample_partition_type", PROPERTY_HINT_ENUM, "Watershed,Monotone,Layers"), "set_sample_partition_type", "get_sample_partition_type"); ADD_PROPERTY(PropertyInfo(Variant::INT, "geometry/parsed_geometry_type", PROPERTY_HINT_ENUM, "Mesh Instances,Static Colliders,Both"), "set_parsed_geometry_type", "get_parsed_geometry_type"); diff --git a/scene/resources/navigation_mesh.h b/scene/resources/navigation_mesh.h index 1cdf7a07ed..009239838f 100644 --- a/scene/resources/navigation_mesh.h +++ b/scene/resources/navigation_mesh.h @@ -85,7 +85,7 @@ protected: float cell_size = 0.3f; float cell_height = 0.2f; float agent_height = 2.0f; - float agent_radius = 0.6f; + float agent_radius = 1.0f; float agent_max_climb = 0.9f; float agent_max_slope = 45.0f; float region_min_size = 8.0f; diff --git a/scene/resources/packed_scene.cpp b/scene/resources/packed_scene.cpp index 60cda637ca..e6b499d4f1 100644 --- a/scene/resources/packed_scene.cpp +++ b/scene/resources/packed_scene.cpp @@ -34,10 +34,12 @@ #include "core/config/project_settings.h" #include "core/core_string_names.h" #include "core/io/resource_loader.h" +#include "editor/editor_inspector.h" #include "scene/2d/node_2d.h" #include "scene/3d/node_3d.h" #include "scene/gui/control.h" #include "scene/main/instance_placeholder.h" +#include "scene/property_utils.h" #define PACKED_SCENE_VERSION 2 @@ -45,6 +47,30 @@ bool SceneState::can_instantiate() const { return nodes.size() > 0; } +static Array _sanitize_node_pinned_properties(Node *p_node) { + if (!p_node->has_meta("_edit_pinned_properties_")) { + return Array(); + } + Array pinned = p_node->get_meta("_edit_pinned_properties_"); + if (pinned.is_empty()) { + return Array(); + } + Set<StringName> storable_properties; + p_node->get_storable_properties(storable_properties); + int i = 0; + do { + if (storable_properties.has(pinned[i])) { + i++; + } else { + pinned.remove_at(i); + } + } while (i < pinned.size()); + if (pinned.is_empty()) { + p_node->remove_meta("_edit_pinned_properties_"); + } + return pinned; +} + Node *SceneState::instantiate(GenEditState p_edit_state) const { // nodes where instancing failed (because something is missing) List<Node *> stray_instances; @@ -227,7 +253,7 @@ Node *SceneState::instantiate(GenEditState p_edit_state) const { } else { Node *base = i == 0 ? node : ret_nodes[0]; - if (p_edit_state == GEN_EDIT_STATE_MAIN) { + if (p_edit_state == GEN_EDIT_STATE_MAIN || p_edit_state == GEN_EDIT_STATE_MAIN_INHERITED) { //for the main scene, use the resource as is res->configure_for_local_scene(base, resources_local_to_scene); resources_local_to_scene[res] = res; @@ -289,6 +315,13 @@ Node *SceneState::instantiate(GenEditState p_edit_state) const { node->_set_owner_nocheck(owner); } } + + // we only want to deal with pinned flag if instancing as pure main (no instance, no inheriting) + if (p_edit_state == GEN_EDIT_STATE_MAIN) { + _sanitize_node_pinned_properties(node); + } else { + node->remove_meta("_edit_pinned_properties_"); + } } ret_nodes[i] = node; @@ -384,7 +417,7 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map // save the child instantiated scenes that are chosen as editable, so they can be restored // upon load back - if (p_node != p_owner && p_node->get_scene_file_path() != String() && p_owner->is_editable_instance(p_node)) { + if (p_node != p_owner && !p_node->get_scene_file_path().is_empty() && p_owner->is_editable_instance(p_node)) { editable_instances.push_back(p_owner->get_path_to(p_node)); // Node is the root of an editable instance. is_editable_instance = true; @@ -415,61 +448,22 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map // with the instance states, we can query for identical properties/groups // and only save what has changed - List<PackState> pack_state_stack; - - bool instantiated_by_owner = true; - - { - Node *n = p_node; - - while (n) { - if (n == p_owner) { - Ref<SceneState> state = n->get_scene_inherited_state(); - if (state.is_valid()) { - int node = state->find_node_by_path(n->get_path_to(p_node)); - if (node >= 0) { - //this one has state for this node, save - PackState ps; - ps.node = node; - ps.state = state; - pack_state_stack.push_back(ps); - instantiated_by_owner = false; - } - } - - if (p_node->get_scene_file_path() != String() && p_node->get_owner() == p_owner && instantiated_by_owner) { - if (p_node->get_scene_instance_load_placeholder()) { - //it's a placeholder, use the placeholder path - nd.instance = _vm_get_variant(p_node->get_scene_file_path(), variant_map); - nd.instance |= FLAG_INSTANCE_IS_PLACEHOLDER; - } else { - //must instance ourselves - Ref<PackedScene> instance = ResourceLoader::load(p_node->get_scene_file_path()); - if (!instance.is_valid()) { - return ERR_CANT_OPEN; - } + bool instantiated_by_owner = false; + Vector<SceneState::PackState> states_stack = PropertyUtils::get_node_states_stack(p_node, p_owner, &instantiated_by_owner); - nd.instance = _vm_get_variant(instance, variant_map); - } - } - n = nullptr; - } else { - if (n->get_scene_file_path() != String()) { - //is an instance - Ref<SceneState> state = n->get_scene_instance_state(); - if (state.is_valid()) { - int node = state->find_node_by_path(n->get_path_to(p_node)); - if (node >= 0) { - //this one has state for this node, save - PackState ps; - ps.node = node; - ps.state = state; - pack_state_stack.push_back(ps); - } - } - } - n = n->get_owner(); + if (!p_node->get_scene_file_path().is_empty() && p_node->get_owner() == p_owner && instantiated_by_owner) { + if (p_node->get_scene_instance_load_placeholder()) { + //it's a placeholder, use the placeholder path + nd.instance = _vm_get_variant(p_node->get_scene_file_path(), variant_map); + nd.instance |= FLAG_INSTANCE_IS_PLACEHOLDER; + } else { + //must instance ourselves + Ref<PackedScene> instance = ResourceLoader::load(p_node->get_scene_file_path()); + if (!instance.is_valid()) { + return ERR_CANT_OPEN; } + + nd.instance = _vm_get_variant(instance, variant_map); } } @@ -478,88 +472,37 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map List<PropertyInfo> plist; p_node->get_property_list(&plist); - StringName type = p_node->get_class(); - Ref<Script> script = p_node->get_script(); - if (Engine::get_singleton()->is_editor_hint() && script.is_valid()) { - // Should be called in the editor only and not at runtime, - // otherwise it can cause problems because of missing instance state support. - script->update_exports(); - } + Array pinned_props = _sanitize_node_pinned_properties(p_node); for (const PropertyInfo &E : plist) { if (!(E.usage & PROPERTY_USAGE_STORAGE)) { continue; } - String name = E.name; - Variant value = p_node->get(E.name); - - bool isdefault = false; - Variant default_value = ClassDB::class_get_default_property_value(type, name); - - if (default_value.get_type() != Variant::NIL) { - isdefault = bool(Variant::evaluate(Variant::OP_EQUAL, value, default_value)); - } + Variant forced_value; - if (!isdefault && script.is_valid() && script->get_property_default_value(name, default_value)) { - isdefault = bool(Variant::evaluate(Variant::OP_EQUAL, value, default_value)); - } - // the version above makes more sense, because it does not rely on placeholder or usage flag - // in the script, just the default value function. - // if (E.usage & PROPERTY_USAGE_SCRIPT_DEFAULT_VALUE) { - // isdefault = true; //is script default value - // } - - if (pack_state_stack.size()) { - // we are on part of an instantiated subscene - // or part of instantiated scene. - // only save what has been changed - // only save changed properties in instance - - if ((E.usage & PROPERTY_USAGE_NO_INSTANCE_STATE) || E.name == "__meta__") { - //property has requested that no instance state is saved, sorry - //also, meta won't be overridden or saved + // If instance or inheriting, not saving if property requested so, or it's meta + if (states_stack.size()) { + if ((E.usage & PROPERTY_USAGE_NO_INSTANCE_STATE)) { continue; } - - bool exists = false; - Variant original; - - for (List<PackState>::Element *F = pack_state_stack.back(); F; F = F->prev()) { - //check all levels of pack to see if the property exists somewhere - const PackState &ps = F->get(); - - original = ps.state->get_property_value(ps.node, E.name, exists); - if (exists) { - break; - } - } - - if (exists) { - //check if already exists and did not change - if (value.get_type() == Variant::FLOAT && original.get_type() == Variant::FLOAT) { - //this must be done because, as some scenes save as text, there might be a tiny difference in floats due to numerical error - float a = value; - float b = original; - - if (Math::is_equal_approx(a, b)) { - continue; - } - } else if (bool(Variant::evaluate(Variant::OP_EQUAL, value, original))) { - continue; + // Meta is normally not saved in instances/inherited (see GH-12838), but we need to save the pinned list + if (E.name == "__meta__") { + if (pinned_props.size()) { + Dictionary meta_override; + meta_override["_edit_pinned_properties_"] = pinned_props; + forced_value = meta_override; } } + } - if (!exists && isdefault) { - //does not exist in original node, but it's the default value - //so safe to skip too. - continue; - } + StringName name = E.name; + Variant value = forced_value.get_type() == Variant::NIL ? p_node->get(name) : forced_value; - } else { - if (isdefault) { - //it's the default value, no point in saving it + if (!pinned_props.has(name) && forced_value.get_type() == Variant::NIL) { + Variant default_value = PropertyUtils::get_property_default_value(p_node, name, &states_stack, true); + if (!PropertyUtils::is_property_value_different(value, default_value)) { continue; } } @@ -585,10 +528,9 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map */ bool skip = false; - for (const PackState &F : pack_state_stack) { + for (const SceneState::PackState &ia : states_stack) { //check all levels of pack to see if the group was added somewhere - const PackState &ps = F; - if (ps.state->is_node_in_group(ps.node, gi.name)) { + if (ia.state->is_node_in_group(ia.node, gi.name)) { skip = true; break; } @@ -618,7 +560,7 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map // Save the right type. If this node was created by an instance // then flag that the node should not be created but reused - if (pack_state_stack.is_empty() && !is_editable_instance) { + if (states_stack.is_empty() && !is_editable_instance) { //this node is not part of an instancing process, so save the type nd.type = _nm_get_string(p_node->get_class(), name_map); } else { @@ -635,7 +577,7 @@ Error SceneState::_parse_node(Node *p_owner, Node *p_node, int p_parent_idx, Map bool save_node = nd.properties.size() || nd.groups.size(); // some local properties or groups exist save_node = save_node || p_node == p_owner; // owner is always saved - save_node = save_node || (p_node->get_owner() == p_owner && instantiated_by_owner); //part of scene and not instantiated + save_node = save_node || (p_node->get_owner() == p_owner && instantiated_by_owner); //part of scene and not instanced int idx = nodes.size(); int parent_node = NO_PARENT_SAVED; @@ -714,7 +656,7 @@ Error SceneState::_parse_connections(Node *p_owner, Node *p_node, Map<StringName ERR_CONTINUE(!common_parent); - if (common_parent != p_owner && common_parent->get_scene_file_path() == String()) { + if (common_parent != p_owner && common_parent->get_scene_file_path().is_empty()) { common_parent = common_parent->get_owner(); } @@ -774,7 +716,7 @@ Error SceneState::_parse_connections(Node *p_owner, Node *p_node, Map<StringName nl = nullptr; } else { - if (nl->get_scene_file_path() != String()) { + if (!nl->get_scene_file_path().is_empty()) { //is an instance Ref<SceneState> state = nl->get_scene_instance_state(); if (state.is_valid()) { @@ -932,7 +874,7 @@ void SceneState::clear() { base_scene_idx = -1; } -Ref<SceneState> SceneState::_get_base_scene_state() const { +Ref<SceneState> SceneState::get_base_scene_state() const { if (base_scene_idx >= 0) { Ref<PackedScene> ps = variants[base_scene_idx]; if (ps.is_valid()) { @@ -947,8 +889,8 @@ int SceneState::find_node_by_path(const NodePath &p_node) const { ERR_FAIL_COND_V_MSG(node_path_cache.size() == 0, -1, "This operation requires the node cache to have been built."); if (!node_path_cache.has(p_node)) { - if (_get_base_scene_state().is_valid()) { - int idx = _get_base_scene_state()->find_node_by_path(p_node); + if (get_base_scene_state().is_valid()) { + int idx = get_base_scene_state()->find_node_by_path(p_node); if (idx != -1) { int rkey = _find_base_scene_node_remap_key(idx); if (rkey == -1) { @@ -963,11 +905,11 @@ int SceneState::find_node_by_path(const NodePath &p_node) const { int nid = node_path_cache[p_node]; - if (_get_base_scene_state().is_valid() && !base_scene_node_remap.has(nid)) { + if (get_base_scene_state().is_valid() && !base_scene_node_remap.has(nid)) { //for nodes that _do_ exist in current scene, still try to look for //the node in the instantiated scene, as a property may be missing //from the local one - int idx = _get_base_scene_state()->find_node_by_path(p_node); + int idx = get_base_scene_state()->find_node_by_path(p_node); if (idx != -1) { base_scene_node_remap[nid] = idx; } @@ -1007,7 +949,7 @@ Variant SceneState::get_property_value(int p_node, const StringName &p_property, //property not found, try on instance if (base_scene_node_remap.has(p_node)) { - return _get_base_scene_state()->get_property_value(base_scene_node_remap[p_node], p_property, found); + return get_base_scene_state()->get_property_value(base_scene_node_remap[p_node], p_property, found); } return Variant(); @@ -1026,7 +968,7 @@ bool SceneState::is_node_in_group(int p_node, const StringName &p_group) const { } if (base_scene_node_remap.has(p_node)) { - return _get_base_scene_state()->is_node_in_group(base_scene_node_remap[p_node], p_group); + return get_base_scene_state()->is_node_in_group(base_scene_node_remap[p_node], p_group); } return false; @@ -1065,7 +1007,7 @@ bool SceneState::is_connection(int p_node, const StringName &p_signal, int p_to_ } if (base_scene_node_remap.has(p_node) && base_scene_node_remap.has(p_to_node)) { - return _get_base_scene_state()->is_connection(base_scene_node_remap[p_node], p_signal, base_scene_node_remap[p_to_node], p_to_method); + return get_base_scene_state()->is_connection(base_scene_node_remap[p_node], p_signal, base_scene_node_remap[p_to_node], p_to_method); } return false; @@ -1488,7 +1430,7 @@ bool SceneState::has_connection(const NodePath &p_node_from, const StringName &p } } - ss = ss->_get_base_scene_state(); + ss = ss->get_base_scene_state(); } while (ss.is_valid()); return false; @@ -1610,6 +1552,7 @@ void SceneState::_bind_methods() { BIND_ENUM_CONSTANT(GEN_EDIT_STATE_DISABLED); BIND_ENUM_CONSTANT(GEN_EDIT_STATE_INSTANCE); BIND_ENUM_CONSTANT(GEN_EDIT_STATE_MAIN); + BIND_ENUM_CONSTANT(GEN_EDIT_STATE_MAIN_INHERITED); } SceneState::SceneState() { @@ -1651,7 +1594,7 @@ Node *PackedScene::instantiate(GenEditState p_edit_state) const { s->set_scene_instance_state(state); } - if (get_path() != "" && get_path().find("::") == -1) { + if (!is_built_in()) { s->set_scene_file_path(get_path()); } @@ -1701,6 +1644,7 @@ void PackedScene::_bind_methods() { BIND_ENUM_CONSTANT(GEN_EDIT_STATE_DISABLED); BIND_ENUM_CONSTANT(GEN_EDIT_STATE_INSTANCE); BIND_ENUM_CONSTANT(GEN_EDIT_STATE_MAIN); + BIND_ENUM_CONSTANT(GEN_EDIT_STATE_MAIN_INHERITED); } PackedScene::PackedScene() { diff --git a/scene/resources/packed_scene.h b/scene/resources/packed_scene.h index 55708f7914..a03da558e4 100644 --- a/scene/resources/packed_scene.h +++ b/scene/resources/packed_scene.h @@ -69,11 +69,6 @@ class SceneState : public RefCounted { Vector<int> groups; }; - struct PackState { - Ref<SceneState> state; - int node = -1; - }; - Vector<NodeData> nodes; struct ConnectionData { @@ -94,8 +89,6 @@ class SceneState : public RefCounted { uint64_t last_modified_time = 0; - _FORCE_INLINE_ Ref<SceneState> _get_base_scene_state() const; - static bool disable_placeholders; Vector<String> _get_node_groups(int p_idx) const; @@ -117,6 +110,12 @@ public: GEN_EDIT_STATE_DISABLED, GEN_EDIT_STATE_INSTANCE, GEN_EDIT_STATE_MAIN, + GEN_EDIT_STATE_MAIN_INHERITED, + }; + + struct PackState { + Ref<SceneState> state; + int node = -1; }; static void set_disable_placeholders(bool p_disable); @@ -139,6 +138,8 @@ public: bool can_instantiate() const; Node *instantiate(GenEditState p_edit_state) const; + Ref<SceneState> get_base_scene_state() const; + //unbuild API int get_node_count() const; @@ -207,6 +208,7 @@ public: GEN_EDIT_STATE_DISABLED, GEN_EDIT_STATE_INSTANCE, GEN_EDIT_STATE_MAIN, + GEN_EDIT_STATE_MAIN_INHERITED, }; Error pack(Node *p_scene); diff --git a/scene/resources/particles_material.cpp b/scene/resources/particles_material.cpp index d9ec0bfd69..90ef78ccd9 100644 --- a/scene/resources/particles_material.cpp +++ b/scene/resources/particles_material.cpp @@ -85,6 +85,7 @@ void ParticlesMaterial::init_shaders() { shader_names->color = "color_value"; shader_names->color_ramp = "color_ramp"; + shader_names->color_initial_ramp = "color_initial_ramp"; shader_names->emission_sphere_radius = "emission_sphere_radius"; shader_names->emission_box_extents = "emission_box_extents"; @@ -232,6 +233,10 @@ void ParticlesMaterial::_update_shader() { code += "uniform sampler2D color_ramp;\n"; } + if (color_initial_ramp.is_valid()) { + code += "uniform sampler2D color_initial_ramp;\n"; + } + if (tex_parameters[PARAM_INITIAL_LINEAR_VELOCITY].is_valid()) { code += "uniform sampler2D linear_velocity_texture;\n"; } @@ -311,6 +316,9 @@ void ParticlesMaterial::_update_shader() { code += " float scale_rand = rand_from_seed(alt_seed);\n"; code += " float hue_rot_rand = rand_from_seed(alt_seed);\n"; code += " float anim_offset_rand = rand_from_seed(alt_seed);\n"; + if (color_initial_ramp.is_valid()) { + code += " float color_initial_rand = rand_from_seed(alt_seed);\n"; + } code += " float pi = 3.14159;\n"; code += " float degree_to_rad = pi / 180.0;\n"; code += "\n"; @@ -462,6 +470,10 @@ void ParticlesMaterial::_update_shader() { code += " float scale_rand = rand_from_seed(alt_seed);\n"; code += " float hue_rot_rand = rand_from_seed(alt_seed);\n"; code += " float anim_offset_rand = rand_from_seed(alt_seed);\n"; + if (color_initial_ramp.is_valid()) { + code += " float color_initial_rand = rand_from_seed(alt_seed);\n"; + } + code += " float pi = 3.14159;\n"; code += " float degree_to_rad = pi / 180.0;\n"; code += "\n"; @@ -584,7 +596,7 @@ void ParticlesMaterial::_update_shader() { code += " float base_angle = (tex_angle) * mix(initial_angle_min, initial_angle_max, rand_from_seed(alt_seed));\n"; code += " base_angle += CUSTOM.y * LIFETIME * (tex_angular_velocity) * mix(angular_velocity_min,angular_velocity_max, rand_from_seed(alt_seed));\n"; code += " CUSTOM.x = base_angle * degree_to_rad;\n"; // angle - code += " CUSTOM.z = (tex_anim_offset) * mix(anim_offset_min, anim_offset_max, rand_from_seed(alt_seed)) + CUSTOM.y * tex_anim_speed * mix(anim_speed_min, anim_speed_max, rand_from_seed(alt_seed));\n"; // angle + code += " CUSTOM.z = (tex_anim_offset) * mix(anim_offset_min, anim_offset_max, rand_from_seed(alt_seed)) + tv * tex_anim_speed * mix(anim_speed_min, anim_speed_max, rand_from_seed(alt_seed));\n"; // angle // apply color // apply hue rotation @@ -620,6 +632,12 @@ void ParticlesMaterial::_update_shader() { } else { code += " COLOR = hue_rot_mat * color_value;\n"; } + + if (color_initial_ramp.is_valid()) { + code += " vec4 start_color = textureLod(color_initial_ramp, vec2(color_initial_rand, 0.0), 0.0);\n"; + code += " COLOR *= start_color;\n"; + } + if (emission_color_texture.is_valid() && (emission_shape == EMISSION_SHAPE_POINTS || emission_shape == EMISSION_SHAPE_DIRECTED_POINTS)) { code += " COLOR *= texelFetch(emission_texture_color, emission_tex_ofs, 0);\n"; } @@ -988,6 +1006,18 @@ Ref<Texture2D> ParticlesMaterial::get_color_ramp() const { return color_ramp; } +void ParticlesMaterial::set_color_initial_ramp(const Ref<Texture2D> &p_texture) { + color_initial_ramp = p_texture; + RID tex_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); + RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->color_initial_ramp, tex_rid); + _queue_shader_change(); + notify_property_list_changed(); +} + +Ref<Texture2D> ParticlesMaterial::get_color_initial_ramp() const { + return color_initial_ramp; +} + void ParticlesMaterial::set_particle_flag(ParticleFlags p_particle_flag, bool p_enable) { ERR_FAIL_INDEX(p_particle_flag, PARTICLE_FLAG_MAX); particle_flags[p_particle_flag] = p_enable; @@ -1282,6 +1312,9 @@ void ParticlesMaterial::_bind_methods() { ClassDB::bind_method(D_METHOD("set_color_ramp", "ramp"), &ParticlesMaterial::set_color_ramp); ClassDB::bind_method(D_METHOD("get_color_ramp"), &ParticlesMaterial::get_color_ramp); + ClassDB::bind_method(D_METHOD("set_color_initial_ramp", "ramp"), &ParticlesMaterial::set_color_initial_ramp); + ClassDB::bind_method(D_METHOD("get_color_initial_ramp"), &ParticlesMaterial::get_color_initial_ramp); + ClassDB::bind_method(D_METHOD("set_particle_flag", "particle_flag", "enable"), &ParticlesMaterial::set_particle_flag); ClassDB::bind_method(D_METHOD("get_particle_flag", "particle_flag"), &ParticlesMaterial::get_particle_flag); @@ -1413,7 +1446,8 @@ void ParticlesMaterial::_bind_methods() { ADD_PROPERTYI(PropertyInfo(Variant::OBJECT, "scale_curve", PROPERTY_HINT_RESOURCE_TYPE, "CurveTexture,CurveXYZTexture"), "set_param_texture", "get_param_texture", PARAM_SCALE); ADD_GROUP("Color", ""); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_ramp", PROPERTY_HINT_RESOURCE_TYPE, "GradientTexture"), "set_color_ramp", "get_color_ramp"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_ramp", PROPERTY_HINT_RESOURCE_TYPE, "GradientTexture1D"), "set_color_ramp", "get_color_ramp"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "color_initial_ramp", PROPERTY_HINT_RESOURCE_TYPE, "GradientTexture1D"), "set_color_initial_ramp", "get_color_initial_ramp"); ADD_GROUP("Hue Variation", "hue_"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "hue_variation_min", PROPERTY_HINT_RANGE, "-1,1,0.01"), "set_param_min", "get_param_min", PARAM_HUE_VARIATION); diff --git a/scene/resources/particles_material.h b/scene/resources/particles_material.h index 36bc456978..9c0bbe3b5d 100644 --- a/scene/resources/particles_material.h +++ b/scene/resources/particles_material.h @@ -194,6 +194,7 @@ private: StringName color; StringName color_ramp; + StringName color_initial_ramp; StringName emission_sphere_radius; StringName emission_box_extents; @@ -237,6 +238,7 @@ private: Ref<Texture2D> tex_parameters[PARAM_MAX]; Color color; Ref<Texture2D> color_ramp; + Ref<Texture2D> color_initial_ramp; bool particle_flags[PARTICLE_FLAG_MAX]; @@ -299,6 +301,9 @@ public: void set_color_ramp(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_color_ramp() const; + void set_color_initial_ramp(const Ref<Texture2D> &p_texture); + Ref<Texture2D> get_color_initial_ramp() const; + void set_particle_flag(ParticleFlags p_particle_flag, bool p_enable); bool get_particle_flag(ParticleFlags p_particle_flag) const; diff --git a/scene/resources/polygon_path_finder.cpp b/scene/resources/polygon_path_finder.cpp index 4dd3c874cb..ec2022ed2f 100644 --- a/scene/resources/polygon_path_finder.cpp +++ b/scene/resources/polygon_path_finder.cpp @@ -556,7 +556,7 @@ void PolygonPathFinder::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_data"), &PolygonPathFinder::_set_data); ClassDB::bind_method(D_METHOD("_get_data"), &PolygonPathFinder::_get_data); - ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); + ADD_PROPERTY(PropertyInfo(Variant::DICTIONARY, "data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); } PolygonPathFinder::PolygonPathFinder() { diff --git a/scene/resources/resource_format_text.cpp b/scene/resources/resource_format_text.cpp index 77d915aef9..0e354ebff4 100644 --- a/scene/resources/resource_format_text.cpp +++ b/scene/resources/resource_format_text.cpp @@ -274,12 +274,12 @@ Ref<PackedScene> ResourceLoaderText::_parse_node_tag(VariantParser::ResourcePars } } - if (assign != String()) { + if (!assign.is_empty()) { int nameidx = packed_scene->get_state()->add_name(assign); int valueidx = packed_scene->get_state()->add_value(value); packed_scene->get_state()->add_node_property(node_id, nameidx, valueidx); //it's assignment - } else if (next_tag.name != String()) { + } else if (!next_tag.name.is_empty()) { break; } } @@ -350,7 +350,7 @@ Ref<PackedScene> ResourceLoaderText::_parse_node_tag(VariantParser::ResourcePars } else if (next_tag.name == "editable") { if (!next_tag.fields.has("path")) { error = ERR_FILE_CORRUPT; - error_text = "missing 'path' field from connection tag"; + error_text = "missing 'path' field from editable tag"; _printerr(); return Ref<PackedScene>(); } @@ -575,12 +575,12 @@ Error ResourceLoaderText::load() { return error; } - if (assign != String()) { + if (!assign.is_empty()) { if (do_assign) { res->set(assign, value); } //it's assignment - } else if (next_tag.name != String()) { + } else if (!next_tag.name.is_empty()) { error = OK; break; } else { @@ -659,10 +659,10 @@ Error ResourceLoaderText::load() { return error; } - if (assign != String()) { + if (!assign.is_empty()) { resource->set(assign, value); //it's assignment - } else if (next_tag.name != String()) { + } else if (!next_tag.name.is_empty()) { error = ERR_FILE_CORRUPT; error_text = "Extra tag found when parsing main resource file"; _printerr(); @@ -1166,13 +1166,13 @@ Error ResourceLoaderText::save_as_binary(FileAccess *p_f, const String &p_path) return error; } - if (assign != String()) { + if (!assign.is_empty()) { Map<StringName, int> empty_string_map; //unused bs_save_unicode_string(wf2, assign, true); ResourceFormatSaverBinaryInstance::write_variant(wf2, value, dummy_read.resource_index_map, dummy_read.external_resources, empty_string_map); prop_count++; - } else if (next_tag.name != String()) { + } else if (!next_tag.name.is_empty()) { error = OK; break; } else { @@ -1350,7 +1350,7 @@ RES ResourceFormatLoaderText::load(const String &p_path, const String &p_origina ERR_FAIL_COND_V_MSG(err != OK, RES(), "Cannot open file '" + p_path + "'."); ResourceLoaderText loader; - String path = p_original_path != "" ? p_original_path : p_path; + String path = !p_original_path.is_empty() ? p_original_path : p_path; loader.cache_mode = p_cache_mode; loader.use_sub_threads = p_use_sub_threads; loader.local_path = ProjectSettings::get_singleton()->localize_path(path); @@ -1369,7 +1369,7 @@ RES ResourceFormatLoaderText::load(const String &p_path, const String &p_origina } void ResourceFormatLoaderText::get_recognized_extensions_for_type(const String &p_type, List<String> *p_extensions) const { - if (p_type == "") { + if (p_type.is_empty()) { get_recognized_extensions(p_extensions); return; } @@ -1492,7 +1492,7 @@ String ResourceFormatSaverTextInstance::_write_resource(const RES &res) { } else { if (internal_resources.has(res)) { return "SubResource( \"" + internal_resources[res] + "\" )"; - } else if (res->get_path().length() && res->get_path().find("::") == -1) { + } else if (!res->is_built_in()) { if (res->get_path() == local_path) { //circular reference attempt return "null"; } @@ -1515,7 +1515,7 @@ void ResourceFormatSaverTextInstance::_find_resources(const Variant &p_variant, return; } - if (!p_main && (!bundle_resources) && res->get_path().length() && res->get_path().find("::") == -1) { + if (!p_main && (!bundle_resources) && !res->is_built_in()) { if (res->get_path() == local_path) { ERR_PRINT("Circular reference to resource being saved found: '" + local_path + "' will be null next time it's loaded."); return; @@ -1655,7 +1655,7 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r Set<String> cached_ids_found; for (KeyValue<RES, String> &E : external_resources) { String cached_id = E.key->get_id_for_path(local_path); - if (cached_id == "" || cached_ids_found.has(cached_id)) { + if (cached_id.is_empty() || cached_ids_found.has(cached_id)) { int sep_pos = E.value.find("_"); if (sep_pos != -1) { E.value = E.value.substr(0, sep_pos + 1); // Keep the order found, for improved thread loading performance. @@ -1728,8 +1728,8 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r for (List<RES>::Element *E = saved_resources.front(); E; E = E->next()) { RES res = E->get(); - if (E->next() && (res->get_path() == "" || res->get_path().find("::") != -1)) { - if (res->get_scene_unique_id() != "") { + if (E->next() && res->is_built_in()) { + if (!res->get_scene_unique_id().is_empty()) { if (used_unique_ids.has(res->get_scene_unique_id())) { res->set_scene_unique_id(""); // Repeated. } else { @@ -1752,7 +1752,7 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r f->store_line("[resource]"); } else { String line = "[sub_resource "; - if (res->get_scene_unique_id() == "") { + if (res->get_scene_unique_id().is_empty()) { String new_id; while (true) { new_id = res->get_class() + "_" + Resource::generate_scene_unique_id(); @@ -1866,7 +1866,7 @@ Error ResourceFormatSaverTextInstance::save(const String &p_path, const RES &p_r f->store_string(header); - if (instance_placeholder != String()) { + if (!instance_placeholder.is_empty()) { String vars; f->store_string(" instance_placeholder="); VariantWriter::write_to_string(instance_placeholder, vars, _write_resources, this); diff --git a/scene/resources/shader.cpp b/scene/resources/shader.cpp index 242e20f3b0..84fa07e4f4 100644 --- a/scene/resources/shader.cpp +++ b/scene/resources/shader.cpp @@ -49,6 +49,8 @@ void Shader::set_code(const String &p_code) { mode = MODE_PARTICLES; } else if (type == "sky") { mode = MODE_SKY; + } else if (type == "fog") { + mode = MODE_FOG; } else { mode = MODE_SPATIAL; } @@ -95,28 +97,36 @@ RID Shader::get_rid() const { return shader; } -void Shader::set_default_texture_param(const StringName &p_param, const Ref<Texture2D> &p_texture) { +void Shader::set_default_texture_param(const StringName &p_param, const Ref<Texture2D> &p_texture, int p_index) { if (p_texture.is_valid()) { - default_textures[p_param] = p_texture; - RS::get_singleton()->shader_set_default_texture_param(shader, p_param, p_texture->get_rid()); + if (!default_textures.has(p_param)) { + default_textures[p_param] = Map<int, Ref<Texture2D>>(); + } + default_textures[p_param][p_index] = p_texture; + RS::get_singleton()->shader_set_default_texture_param(shader, p_param, p_texture->get_rid(), p_index); } else { - default_textures.erase(p_param); - RS::get_singleton()->shader_set_default_texture_param(shader, p_param, RID()); + if (default_textures.has(p_param) && default_textures[p_param].has(p_index)) { + default_textures[p_param].erase(p_index); + + if (default_textures[p_param].is_empty()) { + default_textures.erase(p_param); + } + } + RS::get_singleton()->shader_set_default_texture_param(shader, p_param, RID(), p_index); } emit_changed(); } -Ref<Texture2D> Shader::get_default_texture_param(const StringName &p_param) const { - if (default_textures.has(p_param)) { - return default_textures[p_param]; - } else { - return Ref<Texture2D>(); +Ref<Texture2D> Shader::get_default_texture_param(const StringName &p_param, int p_index) const { + if (default_textures.has(p_param) && default_textures[p_param].has(p_index)) { + return default_textures[p_param][p_index]; } + return Ref<Texture2D>(); } void Shader::get_default_texture_param_list(List<StringName> *r_textures) const { - for (const KeyValue<StringName, Ref<Texture2D>> &E : default_textures) { + for (const KeyValue<StringName, Map<int, Ref<Texture2D>>> &E : default_textures) { r_textures->push_back(E.key); } } @@ -138,17 +148,18 @@ void Shader::_bind_methods() { ClassDB::bind_method(D_METHOD("set_code", "code"), &Shader::set_code); ClassDB::bind_method(D_METHOD("get_code"), &Shader::get_code); - ClassDB::bind_method(D_METHOD("set_default_texture_param", "param", "texture"), &Shader::set_default_texture_param); - ClassDB::bind_method(D_METHOD("get_default_texture_param", "param"), &Shader::get_default_texture_param); + ClassDB::bind_method(D_METHOD("set_default_texture_param", "param", "texture", "index"), &Shader::set_default_texture_param, DEFVAL(0)); + ClassDB::bind_method(D_METHOD("get_default_texture_param", "param", "index"), &Shader::get_default_texture_param, DEFVAL(0)); ClassDB::bind_method(D_METHOD("has_param", "name"), &Shader::has_param); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "code", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_code", "get_code"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "code", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_code", "get_code"); BIND_ENUM_CONSTANT(MODE_SPATIAL); BIND_ENUM_CONSTANT(MODE_CANVAS_ITEM); BIND_ENUM_CONSTANT(MODE_PARTICLES); BIND_ENUM_CONSTANT(MODE_SKY); + BIND_ENUM_CONSTANT(MODE_FOG); } Shader::Shader() { diff --git a/scene/resources/shader.h b/scene/resources/shader.h index 6563181ca2..c688dc1bab 100644 --- a/scene/resources/shader.h +++ b/scene/resources/shader.h @@ -46,6 +46,7 @@ public: MODE_CANVAS_ITEM, MODE_PARTICLES, MODE_SKY, + MODE_FOG, MODE_MAX }; @@ -58,7 +59,7 @@ private: // conversion fast and save memory. mutable bool params_cache_dirty = true; mutable Map<StringName, StringName> params_cache; //map a shader param to a material param.. - Map<StringName, Ref<Texture2D>> default_textures; + Map<StringName, Map<int, Ref<Texture2D>>> default_textures; virtual void _update_shader() const; //used for visual shader protected: @@ -74,8 +75,8 @@ public: void get_param_list(List<PropertyInfo> *p_params) const; bool has_param(const StringName &p_param) const; - void set_default_texture_param(const StringName &p_param, const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_default_texture_param(const StringName &p_param) const; + void set_default_texture_param(const StringName &p_param, const Ref<Texture2D> &p_texture, int p_index = 0); + Ref<Texture2D> get_default_texture_param(const StringName &p_param, int p_index = 0) const; void get_default_texture_param_list(List<StringName> *r_textures) const; virtual bool is_text_shader() const; diff --git a/scene/resources/shape_2d.h b/scene/resources/shape_2d.h index 14bdd60e4b..7c5d1344e8 100644 --- a/scene/resources/shape_2d.h +++ b/scene/resources/shape_2d.h @@ -64,7 +64,6 @@ public: static bool is_collision_outline_enabled(); - Shape2D(); ~Shape2D(); }; diff --git a/scene/resources/skeleton_modification_2d_ccdik.cpp b/scene/resources/skeleton_modification_2d_ccdik.cpp index 6eab8d4afe..bea42109cb 100644 --- a/scene/resources/skeleton_modification_2d_ccdik.cpp +++ b/scene/resources/skeleton_modification_2d_ccdik.cpp @@ -205,8 +205,8 @@ void SkeletonModification2DCCDIK::_execute_ccdik_joint(int p_joint_idx, Node2D * } else { // How to rotate from the tip: get the difference of rotation needed from the tip to the target, from the perspective of the joint. // Because we are only using the offset, we do not need to account for the bone angle of the Bone2D node. - float joint_to_tip = operation_transform.get_origin().angle_to_point(p_tip->get_global_position()); - float joint_to_target = operation_transform.get_origin().angle_to_point(p_target->get_global_position()); + float joint_to_tip = p_tip->get_global_position().angle_to_point(operation_transform.get_origin()); + float joint_to_target = p_target->get_global_position().angle_to_point(operation_transform.get_origin()); operation_transform.set_rotation( operation_transform.get_rotation() + (joint_to_target - joint_to_tip)); } diff --git a/scene/resources/skeleton_modification_2d_jiggle.cpp b/scene/resources/skeleton_modification_2d_jiggle.cpp index 84abc9d020..31045455a3 100644 --- a/scene/resources/skeleton_modification_2d_jiggle.cpp +++ b/scene/resources/skeleton_modification_2d_jiggle.cpp @@ -194,9 +194,13 @@ void SkeletonModification2DJiggle::_execute_jiggle_joint(int p_joint_idx, Node2D PhysicsDirectSpaceState2D *space_state = PhysicsServer2D::get_singleton()->space_get_direct_state(world_2d->get_space()); PhysicsDirectSpaceState2D::RayResult ray_result; + PhysicsDirectSpaceState2D::RayParameters ray_params; + ray_params.from = operation_bone_trans.get_origin(); + ray_params.to = jiggle_data_chain[p_joint_idx].dynamic_position; + ray_params.collision_mask = collision_mask; + // Add exception support? - bool ray_hit = space_state->intersect_ray(operation_bone_trans.get_origin(), jiggle_data_chain[p_joint_idx].dynamic_position, - ray_result, Set<RID>(), collision_mask); + bool ray_hit = space_state->intersect_ray(ray_params, ray_result); if (ray_hit) { jiggle_data_chain.write[p_joint_idx].dynamic_position = jiggle_data_chain[p_joint_idx].last_noncollision_position; diff --git a/scene/resources/skeleton_modification_2d_lookat.cpp b/scene/resources/skeleton_modification_2d_lookat.cpp index 2da770f012..740937fc44 100644 --- a/scene/resources/skeleton_modification_2d_lookat.cpp +++ b/scene/resources/skeleton_modification_2d_lookat.cpp @@ -241,7 +241,7 @@ int SkeletonModification2DLookAt::get_bone_index() const { void SkeletonModification2DLookAt::set_bone_index(int p_bone_idx) { ERR_FAIL_COND_MSG(p_bone_idx < 0, "Bone index is out of range: The index is too low!"); - if (is_setup) { + if (is_setup && stack) { if (stack->skeleton) { ERR_FAIL_INDEX_MSG(p_bone_idx, stack->skeleton->get_bone_count(), "Passed-in Bone index is out of range!"); bone_idx = p_bone_idx; diff --git a/scene/resources/skeleton_modification_3d_jiggle.cpp b/scene/resources/skeleton_modification_3d_jiggle.cpp index a6bcb0176a..2535f2b987 100644 --- a/scene/resources/skeleton_modification_3d_jiggle.cpp +++ b/scene/resources/skeleton_modification_3d_jiggle.cpp @@ -206,8 +206,12 @@ void SkeletonModification3DJiggle::_execute_jiggle_joint(int p_joint_idx, Node3D Transform3D new_bone_trans_world = stack->skeleton->global_pose_to_world_transform(new_bone_trans); Transform3D dynamic_position_world = stack->skeleton->global_pose_to_world_transform(Transform3D(Basis(), jiggle_data_chain[p_joint_idx].dynamic_position)); - bool ray_hit = space_state->intersect_ray(new_bone_trans_world.origin, dynamic_position_world.get_origin(), - ray_result, Set<RID>(), collision_mask); + PhysicsDirectSpaceState3D::RayParameters ray_params; + ray_params.from = new_bone_trans_world.origin; + ray_params.to = dynamic_position_world.get_origin(); + ray_params.collision_mask = collision_mask; + + bool ray_hit = space_state->intersect_ray(ray_params, ray_result); if (ray_hit) { jiggle_data_chain[p_joint_idx].dynamic_position = jiggle_data_chain[p_joint_idx].last_noncollision_position; diff --git a/scene/resources/skeleton_modification_stack_2d.cpp b/scene/resources/skeleton_modification_stack_2d.cpp index db9fe62b4d..e596390f78 100644 --- a/scene/resources/skeleton_modification_stack_2d.cpp +++ b/scene/resources/skeleton_modification_stack_2d.cpp @@ -172,7 +172,7 @@ void SkeletonModificationStack2D::add_modification(Ref<SkeletonModification2D> p void SkeletonModificationStack2D::delete_modification(int p_mod_idx) { ERR_FAIL_INDEX(p_mod_idx, modifications.size()); - modifications.remove(p_mod_idx); + modifications.remove_at(p_mod_idx); #ifdef TOOLS_ENABLED set_editor_gizmos_dirty(true); @@ -195,6 +195,7 @@ void SkeletonModificationStack2D::set_modification(int p_mod_idx, Ref<SkeletonMo } void SkeletonModificationStack2D::set_modification_count(int p_count) { + ERR_FAIL_COND_MSG(p_count < 0, "Modification count cannot be less than zero."); modifications.resize(p_count); notify_property_list_changed(); diff --git a/scene/resources/skeleton_modification_stack_3d.cpp b/scene/resources/skeleton_modification_stack_3d.cpp index a724b732b9..e5b7771251 100644 --- a/scene/resources/skeleton_modification_stack_3d.cpp +++ b/scene/resources/skeleton_modification_stack_3d.cpp @@ -125,6 +125,7 @@ Ref<SkeletonModification3D> SkeletonModificationStack3D::get_modification(int p_ } void SkeletonModificationStack3D::add_modification(Ref<SkeletonModification3D> p_mod) { + ERR_FAIL_NULL(p_mod); p_mod->_setup_modification(this); modifications.push_back(p_mod); } @@ -132,7 +133,7 @@ void SkeletonModificationStack3D::add_modification(Ref<SkeletonModification3D> p void SkeletonModificationStack3D::delete_modification(int p_mod_idx) { const int modifications_size = modifications.size(); ERR_FAIL_INDEX(p_mod_idx, modifications_size); - modifications.remove(p_mod_idx); + modifications.remove_at(p_mod_idx); } void SkeletonModificationStack3D::set_modification(int p_mod_idx, Ref<SkeletonModification3D> p_mod) { @@ -140,7 +141,7 @@ void SkeletonModificationStack3D::set_modification(int p_mod_idx, Ref<SkeletonMo ERR_FAIL_INDEX(p_mod_idx, modifications_size); if (p_mod == nullptr) { - modifications.remove(p_mod_idx); + modifications.remove_at(p_mod_idx); } else { p_mod->_setup_modification(this); modifications[p_mod_idx] = p_mod; @@ -148,6 +149,7 @@ void SkeletonModificationStack3D::set_modification(int p_mod_idx, Ref<SkeletonMo } void SkeletonModificationStack3D::set_modification_count(int p_count) { + ERR_FAIL_COND_MSG(p_count < 0, "Modification count cannot be less than zero."); modifications.resize(p_count); notify_property_list_changed(); } diff --git a/scene/resources/skin.cpp b/scene/resources/skin.cpp index 710612ae05..15cdb86bab 100644 --- a/scene/resources/skin.cpp +++ b/scene/resources/skin.cpp @@ -133,7 +133,7 @@ void Skin::_get_property_list(List<PropertyInfo> *p_list) const { p_list->push_back(PropertyInfo(Variant::INT, "bind_count", PROPERTY_HINT_RANGE, "0,16384,1,or_greater")); for (int i = 0; i < get_bind_count(); i++) { p_list->push_back(PropertyInfo(Variant::STRING_NAME, "bind/" + itos(i) + "/name")); - p_list->push_back(PropertyInfo(Variant::INT, "bind/" + itos(i) + "/bone", PROPERTY_HINT_RANGE, "0,16384,1,or_greater", get_bind_name(i) != StringName() ? PROPERTY_USAGE_NOEDITOR : PROPERTY_USAGE_DEFAULT)); + p_list->push_back(PropertyInfo(Variant::INT, "bind/" + itos(i) + "/bone", PROPERTY_HINT_RANGE, "0,16384,1,or_greater", get_bind_name(i) != StringName() ? PROPERTY_USAGE_NO_EDITOR : PROPERTY_USAGE_DEFAULT)); p_list->push_back(PropertyInfo(Variant::TRANSFORM3D, "bind/" + itos(i) + "/pose")); } } diff --git a/scene/resources/sky_material.cpp b/scene/resources/sky_material.cpp index de94c92cac..ff388e288c 100644 --- a/scene/resources/sky_material.cpp +++ b/scene/resources/sky_material.cpp @@ -37,7 +37,7 @@ RID ProceduralSkyMaterial::shader; void ProceduralSkyMaterial::set_sky_top_color(const Color &p_sky_top) { sky_top_color = p_sky_top; - RS::get_singleton()->material_set_param(_get_material(), "sky_top_color", sky_top_color.to_linear()); + RS::get_singleton()->material_set_param(_get_material(), "sky_top_color", sky_top_color); } Color ProceduralSkyMaterial::get_sky_top_color() const { @@ -46,7 +46,7 @@ Color ProceduralSkyMaterial::get_sky_top_color() const { void ProceduralSkyMaterial::set_sky_horizon_color(const Color &p_sky_horizon) { sky_horizon_color = p_sky_horizon; - RS::get_singleton()->material_set_param(_get_material(), "sky_horizon_color", sky_horizon_color.to_linear()); + RS::get_singleton()->material_set_param(_get_material(), "sky_horizon_color", sky_horizon_color); } Color ProceduralSkyMaterial::get_sky_horizon_color() const { @@ -73,7 +73,7 @@ float ProceduralSkyMaterial::get_sky_energy() const { void ProceduralSkyMaterial::set_ground_bottom_color(const Color &p_ground_bottom) { ground_bottom_color = p_ground_bottom; - RS::get_singleton()->material_set_param(_get_material(), "ground_bottom_color", ground_bottom_color.to_linear()); + RS::get_singleton()->material_set_param(_get_material(), "ground_bottom_color", ground_bottom_color); } Color ProceduralSkyMaterial::get_ground_bottom_color() const { @@ -82,7 +82,7 @@ Color ProceduralSkyMaterial::get_ground_bottom_color() const { void ProceduralSkyMaterial::set_ground_horizon_color(const Color &p_ground_horizon) { ground_horizon_color = p_ground_horizon; - RS::get_singleton()->material_set_param(_get_material(), "ground_horizon_color", ground_horizon_color.to_linear()); + RS::get_singleton()->material_set_param(_get_material(), "ground_horizon_color", ground_horizon_color); } Color ProceduralSkyMaterial::get_ground_horizon_color() const { @@ -564,10 +564,10 @@ void PhysicalSkyMaterial::_update_shader() { shader_type sky; uniform float rayleigh : hint_range(0, 64) = 2.0; -uniform vec4 rayleigh_color : hint_color = vec4(0.056, 0.14, 0.3, 1.0); +uniform vec4 rayleigh_color : hint_color = vec4(0.26, 0.41, 0.58, 1.0); uniform float mie : hint_range(0, 1) = 0.005; uniform float mie_eccentricity : hint_range(-1, 1) = 0.8; -uniform vec4 mie_color : hint_color = vec4(0.36, 0.56, 0.82, 1.0); +uniform vec4 mie_color : hint_color = vec4(0.63, 0.77, 0.92, 1.0); uniform float turbidity : hint_range(0, 1000) = 10.0; uniform float sun_disk_scale : hint_range(0, 360) = 1.0; @@ -661,10 +661,10 @@ void sky() { PhysicalSkyMaterial::PhysicalSkyMaterial() { set_rayleigh_coefficient(2.0); - set_rayleigh_color(Color(0.056, 0.14, 0.3)); + set_rayleigh_color(Color(0.26, 0.41, 0.58)); set_mie_coefficient(0.005); set_mie_eccentricity(0.8); - set_mie_color(Color(0.36, 0.56, 0.82)); + set_mie_color(Color(0.63, 0.77, 0.92)); set_turbidity(10.0); set_sun_disk_scale(1.0); set_ground_color(Color(1.0, 1.0, 1.0)); diff --git a/scene/resources/sprite_frames.cpp b/scene/resources/sprite_frames.cpp index 01afb00283..71ed96cf15 100644 --- a/scene/resources/sprite_frames.cpp +++ b/scene/resources/sprite_frames.cpp @@ -56,7 +56,7 @@ void SpriteFrames::remove_frame(const StringName &p_anim, int p_idx) { Map<StringName, Anim>::Element *E = animations.find(p_anim); ERR_FAIL_COND_MSG(!E, "Animation '" + String(p_anim) + "' doesn't exist."); - E->get().frames.remove(p_idx); + E->get().frames.remove_at(p_idx); emit_changed(); } @@ -233,7 +233,7 @@ void SpriteFrames::_bind_methods() { ClassDB::bind_method(D_METHOD("_set_animations"), &SpriteFrames::_set_animations); ClassDB::bind_method(D_METHOD("_get_animations"), &SpriteFrames::_get_animations); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "animations", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_animations", "_get_animations"); //compatibility + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "animations", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_animations", "_get_animations"); //compatibility } SpriteFrames::SpriteFrames() { diff --git a/scene/resources/style_box.cpp b/scene/resources/style_box.cpp index 3381043d29..b960944d99 100644 --- a/scene/resources/style_box.cpp +++ b/scene/resources/style_box.cpp @@ -790,7 +790,7 @@ float StyleBoxFlat::get_style_margin(Side p_side) const { void StyleBoxFlat::_validate_property(PropertyInfo &property) const { if (!anti_aliased && property.name == "anti_aliasing_size") { - property.usage = PROPERTY_USAGE_NOEDITOR; + property.usage = PROPERTY_USAGE_NO_EDITOR; } } diff --git a/scene/resources/syntax_highlighter.cpp b/scene/resources/syntax_highlighter.cpp index 52a3abf74d..800752d597 100644 --- a/scene/resources/syntax_highlighter.cpp +++ b/scene/resources/syntax_highlighter.cpp @@ -493,7 +493,7 @@ void CodeHighlighter::add_color_region(const String &p_start_key, const String & color_region.color = p_color; color_region.start_key = p_start_key; color_region.end_key = p_end_key; - color_region.line_only = p_line_only || p_end_key == ""; + color_region.line_only = p_line_only || p_end_key.is_empty(); color_regions.insert(at, color_region); clear_highlighting_cache(); } @@ -501,7 +501,7 @@ void CodeHighlighter::add_color_region(const String &p_start_key, const String & void CodeHighlighter::remove_color_region(const String &p_start_key) { for (int i = 0; i < color_regions.size(); i++) { if (color_regions[i].start_key == p_start_key) { - color_regions.remove(i); + color_regions.remove_at(i); break; } } @@ -529,7 +529,7 @@ void CodeHighlighter::set_color_regions(const Dictionary &p_color_regions) { String start_key = key.get_slice(" ", 0); String end_key = key.get_slice_count(" ") > 1 ? key.get_slice(" ", 1) : String(); - add_color_region(start_key, end_key, p_color_regions[key], end_key == ""); + add_color_region(start_key, end_key, p_color_regions[key], end_key.is_empty()); } clear_highlighting_cache(); } diff --git a/scene/resources/text_file.cpp b/scene/resources/text_file.cpp index 33bb0a83e9..1dc46711f8 100644 --- a/scene/resources/text_file.cpp +++ b/scene/resources/text_file.cpp @@ -33,7 +33,7 @@ #include "core/io/file_access.h" bool TextFile::has_text() const { - return text != ""; + return !text.is_empty(); } String TextFile::get_text() const { diff --git a/scene/resources/text_line.cpp b/scene/resources/text_line.cpp index 0094518967..cfd7e1d876 100644 --- a/scene/resources/text_line.cpp +++ b/scene/resources/text_line.cpp @@ -56,18 +56,18 @@ void TextLine::_bind_methods() { ClassDB::bind_method(D_METHOD("set_bidi_override", "override"), &TextLine::set_bidi_override); ClassDB::bind_method(D_METHOD("add_string", "text", "fonts", "size", "opentype_features", "language"), &TextLine::add_string, DEFVAL(Dictionary()), DEFVAL("")); - ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextLine::add_object, DEFVAL(INLINE_ALIGN_CENTER), DEFVAL(1)); - ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextLine::resize_object, DEFVAL(INLINE_ALIGN_CENTER)); + ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextLine::add_object, DEFVAL(INLINE_ALIGNMENT_CENTER), DEFVAL(1)); + ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextLine::resize_object, DEFVAL(INLINE_ALIGNMENT_CENTER)); ClassDB::bind_method(D_METHOD("set_width", "width"), &TextLine::set_width); ClassDB::bind_method(D_METHOD("get_width"), &TextLine::get_width); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "width"), "set_width", "get_width"); - ClassDB::bind_method(D_METHOD("set_align", "align"), &TextLine::set_align); - ClassDB::bind_method(D_METHOD("get_align"), &TextLine::get_align); + ClassDB::bind_method(D_METHOD("set_horizontal_alignment", "alignment"), &TextLine::set_horizontal_alignment); + ClassDB::bind_method(D_METHOD("get_horizontal_alignment"), &TextLine::get_horizontal_alignment); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_horizontal_alignment", "get_horizontal_alignment"); ClassDB::bind_method(D_METHOD("tab_align", "tab_stops"), &TextLine::tab_align); @@ -135,14 +135,14 @@ void TextLine::_shape() { break; } - if (align == HALIGN_FILL) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL) { TS->shaped_text_fit_to_width(rid, width, flags); overrun_flags |= TextServer::OVERRUN_JUSTIFICATION_AWARE; TS->shaped_text_overrun_trim_to_width(rid, width, overrun_flags); } else { TS->shaped_text_overrun_trim_to_width(rid, width, overrun_flags); } - } else if (align == HALIGN_FILL) { + } else if (alignment == HORIZONTAL_ALIGNMENT_FILL) { TS->shaped_text_fit_to_width(rid, width, flags); } dirty = false; @@ -209,13 +209,13 @@ bool TextLine::add_string(const String &p_text, const Ref<Font> &p_fonts, int p_ return res; } -bool TextLine::add_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align, int p_length) { +bool TextLine::add_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align, int p_length) { bool res = TS->shaped_text_add_object(rid, p_key, p_size, p_inline_align, p_length); dirty = true; return res; } -bool TextLine::resize_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align) { +bool TextLine::resize_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align) { const_cast<TextLine *>(this)->_shape(); return TS->shaped_text_resize_object(rid, p_key, p_size, p_inline_align); } @@ -228,19 +228,19 @@ Rect2 TextLine::get_object_rect(Variant p_key) const { return TS->shaped_text_get_object_rect(rid, p_key); } -void TextLine::set_align(HAlign p_align) { - if (align != p_align) { - if (align == HALIGN_FILL || p_align == HALIGN_FILL) { - align = p_align; +void TextLine::set_horizontal_alignment(HorizontalAlignment p_alignment) { + if (alignment != p_alignment) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL || p_alignment == HORIZONTAL_ALIGNMENT_FILL) { + alignment = p_alignment; dirty = true; } else { - align = p_align; + alignment = p_alignment; } } } -HAlign TextLine::get_align() const { - return align; +HorizontalAlignment TextLine::get_horizontal_alignment() const { + return alignment; } void TextLine::tab_align(const Vector<float> &p_tab_stops) { @@ -272,7 +272,7 @@ TextLine::OverrunBehavior TextLine::get_text_overrun_behavior() const { void TextLine::set_width(float p_width) { width = p_width; - if (align == HALIGN_FILL || overrun_behavior != OVERRUN_NO_TRIMMING) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL || overrun_behavior != OVERRUN_NO_TRIMMING) { dirty = true; } } @@ -322,18 +322,18 @@ void TextLine::draw(RID p_canvas, const Vector2 &p_pos, const Color &p_color) co float length = TS->shaped_text_get_width(rid); if (width > 0) { - switch (align) { - case HALIGN_FILL: - case HALIGN_LEFT: + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += Math::floor((width - length) / 2.0); } else { ofs.y += Math::floor((width - length) / 2.0); } } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += width - length; } else { @@ -361,18 +361,18 @@ void TextLine::draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outline_si float length = TS->shaped_text_get_width(rid); if (width > 0) { - switch (align) { - case HALIGN_FILL: - case HALIGN_LEFT: + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: + case HORIZONTAL_ALIGNMENT_LEFT: break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += Math::floor((width - length) / 2.0); } else { ofs.y += Math::floor((width - length) / 2.0); } } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += width - length; } else { diff --git a/scene/resources/text_line.h b/scene/resources/text_line.h index 43739f27ec..bab17a3024 100644 --- a/scene/resources/text_line.h +++ b/scene/resources/text_line.h @@ -57,7 +57,7 @@ private: float width = -1.0; uint16_t flags = TextServer::JUSTIFICATION_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA; - HAlign align = HALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_LEFT; OverrunBehavior overrun_behavior = OVERRUN_TRIM_ELLIPSIS; Vector<float> tab_stops; @@ -87,11 +87,11 @@ public: bool get_preserve_control() const; bool add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = ""); - bool add_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align = INLINE_ALIGN_CENTER, int p_length = 1); - bool resize_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align = INLINE_ALIGN_CENTER); + bool add_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align = INLINE_ALIGNMENT_CENTER, int p_length = 1); + bool resize_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align = INLINE_ALIGNMENT_CENTER); - void set_align(HAlign p_align); - HAlign get_align() const; + void set_horizontal_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_horizontal_alignment() const; void tab_align(const Vector<float> &p_tab_stops); diff --git a/scene/resources/text_paragraph.cpp b/scene/resources/text_paragraph.cpp index b2e18e2451..130b83ea99 100644 --- a/scene/resources/text_paragraph.cpp +++ b/scene/resources/text_paragraph.cpp @@ -38,6 +38,11 @@ void TextParagraph::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "direction", PROPERTY_HINT_ENUM, "Auto,Light-to-right,Right-to-left"), "set_direction", "get_direction"); + ClassDB::bind_method(D_METHOD("set_custom_punctuation", "custom_punctuation"), &TextParagraph::set_custom_punctuation); + ClassDB::bind_method(D_METHOD("get_custom_punctuation"), &TextParagraph::get_custom_punctuation); + + ADD_PROPERTY(PropertyInfo(Variant::STRING, "custom_punctuation"), "set_custom_punctuation", "get_custom_punctuation"); + ClassDB::bind_method(D_METHOD("set_orientation", "orientation"), &TextParagraph::set_orientation); ClassDB::bind_method(D_METHOD("get_orientation"), &TextParagraph::get_orientation); @@ -59,13 +64,13 @@ void TextParagraph::_bind_methods() { ClassDB::bind_method(D_METHOD("clear_dropcap"), &TextParagraph::clear_dropcap); ClassDB::bind_method(D_METHOD("add_string", "text", "fonts", "size", "opentype_features", "language"), &TextParagraph::add_string, DEFVAL(Dictionary()), DEFVAL("")); - ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextParagraph::add_object, DEFVAL(INLINE_ALIGN_CENTER), DEFVAL(1)); - ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextParagraph::resize_object, DEFVAL(INLINE_ALIGN_CENTER)); + ClassDB::bind_method(D_METHOD("add_object", "key", "size", "inline_align", "length"), &TextParagraph::add_object, DEFVAL(INLINE_ALIGNMENT_CENTER), DEFVAL(1)); + ClassDB::bind_method(D_METHOD("resize_object", "key", "size", "inline_align"), &TextParagraph::resize_object, DEFVAL(INLINE_ALIGNMENT_CENTER)); - ClassDB::bind_method(D_METHOD("set_align", "align"), &TextParagraph::set_align); - ClassDB::bind_method(D_METHOD("get_align"), &TextParagraph::get_align); + ClassDB::bind_method(D_METHOD("set_alignment", "alignment"), &TextParagraph::set_alignment); + ClassDB::bind_method(D_METHOD("get_alignment"), &TextParagraph::get_alignment); - ADD_PROPERTY(PropertyInfo(Variant::INT, "align", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_align", "get_align"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "alignment", PROPERTY_HINT_ENUM, "Left,Center,Right,Fill"), "set_alignment", "get_alignment"); ClassDB::bind_method(D_METHOD("tab_align", "tab_stops"), &TextParagraph::tab_align); @@ -84,7 +89,7 @@ void TextParagraph::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "width"), "set_width", "get_width"); - ClassDB::bind_method(D_METHOD("get_non_wraped_size"), &TextParagraph::get_non_wraped_size); + ClassDB::bind_method(D_METHOD("get_non_wrapped_size"), &TextParagraph::get_non_wrapped_size); ClassDB::bind_method(D_METHOD("get_size"), &TextParagraph::get_size); ClassDB::bind_method(D_METHOD("get_rid"), &TextParagraph::get_rid); @@ -218,7 +223,7 @@ void TextParagraph::_shape_lines() { if (lines_hidden) { overrun_flags |= TextServer::OVERRUN_ENFORCE_ELLIPSIS; } - if (align == HALIGN_FILL) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL) { for (int i = 0; i < lines_rid.size(); i++) { if (i < visible_lines - 1 || lines_rid.size() == 1) { TS->shaped_text_fit_to_width(lines_rid[i], width, flags); @@ -234,7 +239,7 @@ void TextParagraph::_shape_lines() { } else { // Autowrap disabled. for (int i = 0; i < lines_rid.size(); i++) { - if (align == HALIGN_FILL) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL) { TS->shaped_text_fit_to_width(lines_rid[i], width, flags); overrun_flags |= TextServer::OVERRUN_JUSTIFICATION_AWARE; TS->shaped_text_overrun_trim_to_width(lines_rid[i], width, overrun_flags); @@ -304,6 +309,15 @@ TextServer::Direction TextParagraph::get_direction() const { return TS->shaped_text_get_direction(rid); } +void TextParagraph::set_custom_punctuation(const String &p_punct) { + TS->shaped_text_set_custom_punctuation(rid, p_punct); + lines_dirty = true; +} + +String TextParagraph::get_custom_punctuation() const { + return TS->shaped_text_get_custom_punctuation(rid); +} + void TextParagraph::set_orientation(TextServer::Orientation p_orientation) { TS->shaped_text_set_orientation(rid, p_orientation); TS->shaped_text_set_orientation(dropcap_rid, p_orientation); @@ -352,31 +366,31 @@ void TextParagraph::set_bidi_override(const Array &p_override) { lines_dirty = true; } -bool TextParagraph::add_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align, int p_length) { +bool TextParagraph::add_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align, int p_length) { bool res = TS->shaped_text_add_object(rid, p_key, p_size, p_inline_align, p_length); lines_dirty = true; return res; } -bool TextParagraph::resize_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align) { +bool TextParagraph::resize_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align) { bool res = TS->shaped_text_resize_object(rid, p_key, p_size, p_inline_align); lines_dirty = true; return res; } -void TextParagraph::set_align(HAlign p_align) { - if (align != p_align) { - if (align == HALIGN_FILL || p_align == HALIGN_FILL) { - align = p_align; +void TextParagraph::set_alignment(HorizontalAlignment p_alignment) { + if (alignment != p_alignment) { + if (alignment == HORIZONTAL_ALIGNMENT_FILL || p_alignment == HORIZONTAL_ALIGNMENT_FILL) { + alignment = p_alignment; lines_dirty = true; } else { - align = p_align; + alignment = p_alignment; } } } -HAlign TextParagraph::get_align() const { - return align; +HorizontalAlignment TextParagraph::get_alignment() const { + return alignment; } void TextParagraph::tab_align(const Vector<float> &p_tab_stops) { @@ -417,7 +431,7 @@ float TextParagraph::get_width() const { return width; } -Size2 TextParagraph::get_non_wraped_size() const { +Size2 TextParagraph::get_non_wrapped_size() const { const_cast<TextParagraph *>(this)->_shape_lines(); if (TS->shaped_text_get_orientation(rid) == TextServer::ORIENTATION_HORIZONTAL) { return Size2(TS->shaped_text_get_size(rid).x, TS->shaped_text_get_size(rid).y + spacing_top + spacing_bottom); @@ -582,8 +596,8 @@ void TextParagraph::draw(RID p_canvas, const Vector2 &p_pos, const Color &p_colo } float line_width = TS->shaped_text_get_width(lines_rid[i]); if (width > 0) { - switch (align) { - case HALIGN_FILL: + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: if (TS->shaped_text_get_direction(lines_rid[i]) == TextServer::DIRECTION_RTL) { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += l_width - line_width; @@ -592,16 +606,16 @@ void TextParagraph::draw(RID p_canvas, const Vector2 &p_pos, const Color &p_colo } } break; - case HALIGN_LEFT: + case HORIZONTAL_ALIGNMENT_LEFT: break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += Math::floor((l_width - line_width) / 2.0); } else { ofs.y += Math::floor((l_width - line_width) / 2.0); } } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += l_width - line_width; } else { @@ -674,8 +688,8 @@ void TextParagraph::draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outli } float length = TS->shaped_text_get_width(lines_rid[i]); if (width > 0) { - switch (align) { - case HALIGN_FILL: + switch (alignment) { + case HORIZONTAL_ALIGNMENT_FILL: if (TS->shaped_text_get_direction(lines_rid[i]) == TextServer::DIRECTION_RTL) { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += l_width - length; @@ -684,16 +698,16 @@ void TextParagraph::draw_outline(RID p_canvas, const Vector2 &p_pos, int p_outli } } break; - case HALIGN_LEFT: + case HORIZONTAL_ALIGNMENT_LEFT: break; - case HALIGN_CENTER: { + case HORIZONTAL_ALIGNMENT_CENTER: { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += Math::floor((l_width - length) / 2.0); } else { ofs.y += Math::floor((l_width - length) / 2.0); } } break; - case HALIGN_RIGHT: { + case HORIZONTAL_ALIGNMENT_RIGHT: { if (TS->shaped_text_get_orientation(lines_rid[i]) == TextServer::ORIENTATION_HORIZONTAL) { ofs.x += l_width - length; } else { diff --git a/scene/resources/text_paragraph.h b/scene/resources/text_paragraph.h index 69c50559df..1faa3f3a7b 100644 --- a/scene/resources/text_paragraph.h +++ b/scene/resources/text_paragraph.h @@ -66,7 +66,7 @@ private: uint16_t flags = TextServer::BREAK_MANDATORY | TextServer::BREAK_WORD_BOUND | TextServer::JUSTIFICATION_WORD_BOUND | TextServer::JUSTIFICATION_KASHIDA; OverrunBehavior overrun_behavior = OVERRUN_NO_TRIMMING; - HAlign align = HALIGN_LEFT; + HorizontalAlignment alignment = HORIZONTAL_ALIGNMENT_LEFT; Vector<float> tab_stops; @@ -96,15 +96,18 @@ public: void set_bidi_override(const Array &p_override); + void set_custom_punctuation(const String &p_punct); + String get_custom_punctuation() const; + bool set_dropcap(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Rect2 &p_dropcap_margins = Rect2(), const Dictionary &p_opentype_features = Dictionary(), const String &p_language = ""); void clear_dropcap(); bool add_string(const String &p_text, const Ref<Font> &p_fonts, int p_size, const Dictionary &p_opentype_features = Dictionary(), const String &p_language = ""); - bool add_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align = INLINE_ALIGN_CENTER, int p_length = 1); - bool resize_object(Variant p_key, const Size2 &p_size, InlineAlign p_inline_align = INLINE_ALIGN_CENTER); + bool add_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align = INLINE_ALIGNMENT_CENTER, int p_length = 1); + bool resize_object(Variant p_key, const Size2 &p_size, InlineAlignment p_inline_align = INLINE_ALIGNMENT_CENTER); - void set_align(HAlign p_align); - HAlign get_align() const; + void set_alignment(HorizontalAlignment p_alignment); + HorizontalAlignment get_alignment() const; void tab_align(const Vector<float> &p_tab_stops); @@ -120,7 +123,7 @@ public: void set_max_lines_visible(int p_lines); int get_max_lines_visible() const; - Size2 get_non_wraped_size() const; + Size2 get_non_wrapped_size() const; Size2 get_size() const; diff --git a/scene/resources/texture.cpp b/scene/resources/texture.cpp index 1b3a7a5f2a..13c3f6ea1d 100644 --- a/scene/resources/texture.cpp +++ b/scene/resources/texture.cpp @@ -32,6 +32,7 @@ #include "core/core_string_names.h" #include "core/io/image_loader.h" +#include "core/math/geometry_2d.h" #include "core/os/os.h" #include "mesh.h" #include "scene/resources/bit_map.h" @@ -552,7 +553,7 @@ Error StreamTexture2D::load(const String &p_path) { path_to_file = p_path; format = image->get_format(); - if (get_path() == String()) { + if (get_path().is_empty()) { //temporarily set path if no path set for resource, helps find errors RenderingServer::get_singleton()->texture_set_path(texture, p_path); } @@ -926,7 +927,7 @@ Error StreamTexture3D::load(const String &p_path) { path_to_file = p_path; - if (get_path() == String()) { + if (get_path().is_empty()) { //temporarily set path if no path set for resource, helps find errors RenderingServer::get_singleton()->texture_set_path(texture, p_path); } @@ -1502,6 +1503,7 @@ Ref<Curve> CurveTexture::get_curve() const { } void CurveTexture::set_texture_mode(TextureMode p_mode) { + ERR_FAIL_COND(p_mode < TEXTURE_MODE_RGB || p_mode > TEXTURE_MODE_RED); if (texture_mode == p_mode) { return; } @@ -1727,53 +1729,53 @@ CurveXYZTexture::~CurveXYZTexture() { ////////////////// -GradientTexture::GradientTexture() { +GradientTexture1D::GradientTexture1D() { _queue_update(); } -GradientTexture::~GradientTexture() { +GradientTexture1D::~GradientTexture1D() { if (texture.is_valid()) { RS::get_singleton()->free(texture); } } -void GradientTexture::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_gradient", "gradient"), &GradientTexture::set_gradient); - ClassDB::bind_method(D_METHOD("get_gradient"), &GradientTexture::get_gradient); +void GradientTexture1D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_gradient", "gradient"), &GradientTexture1D::set_gradient); + ClassDB::bind_method(D_METHOD("get_gradient"), &GradientTexture1D::get_gradient); - ClassDB::bind_method(D_METHOD("set_width", "width"), &GradientTexture::set_width); + ClassDB::bind_method(D_METHOD("set_width", "width"), &GradientTexture1D::set_width); // The `get_width()` method is already exposed by the parent class Texture2D. - ClassDB::bind_method(D_METHOD("set_use_hdr", "enabled"), &GradientTexture::set_use_hdr); - ClassDB::bind_method(D_METHOD("is_using_hdr"), &GradientTexture::is_using_hdr); + ClassDB::bind_method(D_METHOD("set_use_hdr", "enabled"), &GradientTexture1D::set_use_hdr); + ClassDB::bind_method(D_METHOD("is_using_hdr"), &GradientTexture1D::is_using_hdr); - ClassDB::bind_method(D_METHOD("_update"), &GradientTexture::_update); + ClassDB::bind_method(D_METHOD("_update"), &GradientTexture1D::_update); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "gradient", PROPERTY_HINT_RESOURCE_TYPE, "Gradient"), "set_gradient", "get_gradient"); ADD_PROPERTY(PropertyInfo(Variant::INT, "width", PROPERTY_HINT_RANGE, "1,4096"), "set_width", "get_width"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_hdr"), "set_use_hdr", "is_using_hdr"); } -void GradientTexture::set_gradient(Ref<Gradient> p_gradient) { +void GradientTexture1D::set_gradient(Ref<Gradient> p_gradient) { if (p_gradient == gradient) { return; } if (gradient.is_valid()) { - gradient->disconnect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture::_update)); + gradient->disconnect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture1D::_update)); } gradient = p_gradient; if (gradient.is_valid()) { - gradient->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture::_update)); + gradient->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture1D::_update)); } _update(); emit_changed(); } -Ref<Gradient> GradientTexture::get_gradient() const { +Ref<Gradient> GradientTexture1D::get_gradient() const { return gradient; } -void GradientTexture::_queue_update() { +void GradientTexture1D::_queue_update() { if (update_pending) { return; } @@ -1782,7 +1784,7 @@ void GradientTexture::_queue_update() { call_deferred(SNAME("_update")); } -void GradientTexture::_update() { +void GradientTexture1D::_update() { update_pending = false; if (gradient.is_null()) { @@ -1837,17 +1839,17 @@ void GradientTexture::_update() { emit_changed(); } -void GradientTexture::set_width(int p_width) { +void GradientTexture1D::set_width(int p_width) { ERR_FAIL_COND(p_width <= 0); width = p_width; _queue_update(); } -int GradientTexture::get_width() const { +int GradientTexture1D::get_width() const { return width; } -void GradientTexture::set_use_hdr(bool p_enabled) { +void GradientTexture1D::set_use_hdr(bool p_enabled) { if (p_enabled == use_hdr) { return; } @@ -1856,17 +1858,271 @@ void GradientTexture::set_use_hdr(bool p_enabled) { _queue_update(); } -bool GradientTexture::is_using_hdr() const { +bool GradientTexture1D::is_using_hdr() const { return use_hdr; } -Ref<Image> GradientTexture::get_image() const { +Ref<Image> GradientTexture1D::get_image() const { if (!texture.is_valid()) { return Ref<Image>(); } return RenderingServer::get_singleton()->texture_2d_get(texture); } +GradientTexture2D::GradientTexture2D() { + _queue_update(); +} + +GradientTexture2D::~GradientTexture2D() { + if (texture.is_valid()) { + RS::get_singleton()->free(texture); + } +} + +void GradientTexture2D::set_gradient(Ref<Gradient> p_gradient) { + if (gradient == p_gradient) { + return; + } + if (gradient.is_valid()) { + gradient->disconnect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture2D::_queue_update)); + } + gradient = p_gradient; + if (gradient.is_valid()) { + gradient->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &GradientTexture2D::_queue_update)); + } + _queue_update(); +} + +Ref<Gradient> GradientTexture2D::get_gradient() const { + return gradient; +} + +void GradientTexture2D::_queue_update() { + if (update_pending) { + return; + } + update_pending = true; + call_deferred("_update"); +} + +void GradientTexture2D::_update() { + update_pending = false; + + if (gradient.is_null()) { + return; + } + Ref<Image> image; + image.instantiate(); + + if (gradient->get_points_count() <= 1) { // No need to interpolate. + image->create(width, height, false, (use_hdr) ? Image::FORMAT_RGBAF : Image::FORMAT_RGBA8); + image->fill((gradient->get_points_count() == 1) ? gradient->get_color(0) : Color(0, 0, 0, 1)); + } else { + if (use_hdr) { + image->create(width, height, false, Image::FORMAT_RGBAF); + Gradient &g = **gradient; + // `create()` isn't available for non-uint8_t data, so fill in the data manually. + for (int y = 0; y < height; y++) { + for (int x = 0; x < width; x++) { + float ofs = _get_gradient_offset_at(x, y); + image->set_pixel(x, y, g.get_color_at_offset(ofs)); + } + } + } else { + Vector<uint8_t> data; + data.resize(width * height * 4); + { + uint8_t *wd8 = data.ptrw(); + Gradient &g = **gradient; + for (int y = 0; y < height; y++) { + for (int x = 0; x < width; x++) { + float ofs = _get_gradient_offset_at(x, y); + const Color &c = g.get_color_at_offset(ofs); + + wd8[(x + (y * width)) * 4 + 0] = uint8_t(CLAMP(c.r * 255.0, 0, 255)); + wd8[(x + (y * width)) * 4 + 1] = uint8_t(CLAMP(c.g * 255.0, 0, 255)); + wd8[(x + (y * width)) * 4 + 2] = uint8_t(CLAMP(c.b * 255.0, 0, 255)); + wd8[(x + (y * width)) * 4 + 3] = uint8_t(CLAMP(c.a * 255.0, 0, 255)); + } + } + } + image->create(width, height, false, Image::FORMAT_RGBA8, data); + } + } + + if (texture.is_valid()) { + RID new_texture = RS::get_singleton()->texture_2d_create(image); + RS::get_singleton()->texture_replace(texture, new_texture); + } else { + texture = RS::get_singleton()->texture_2d_create(image); + } + emit_changed(); +} + +float GradientTexture2D::_get_gradient_offset_at(int x, int y) const { + if (fill_to == fill_from) { + return 0; + } + float ofs = 0; + Vector2 pos; + if (width > 1) { + pos.x = static_cast<float>(x) / (width - 1); + } + if (height > 1) { + pos.y = static_cast<float>(y) / (height - 1); + } + if (fill == Fill::FILL_LINEAR) { + Vector2 segment[2]; + segment[0] = fill_from; + segment[1] = fill_to; + Vector2 closest = Geometry2D::get_closest_point_to_segment_uncapped(pos, &segment[0]); + ofs = (closest - fill_from).length() / (fill_to - fill_from).length(); + if ((closest - fill_from).dot(fill_to - fill_from) < 0) { + ofs *= -1; + } + } else if (fill == Fill::FILL_RADIAL) { + ofs = (pos - fill_from).length() / (fill_to - fill_from).length(); + } + if (repeat == Repeat::REPEAT_NONE) { + ofs = CLAMP(ofs, 0.0, 1.0); + } else if (repeat == Repeat::REPEAT) { + ofs = Math::fmod(ofs, 1.0f); + if (ofs < 0) { + ofs = 1 + ofs; + } + } else if (repeat == Repeat::REPEAT_MIRROR) { + ofs = Math::abs(ofs); + ofs = Math::fmod(ofs, 2.0f); + if (ofs > 1.0) { + ofs = 2.0 - ofs; + } + } + return ofs; +} + +void GradientTexture2D::set_width(int p_width) { + width = p_width; + _queue_update(); +} + +int GradientTexture2D::get_width() const { + return width; +} + +void GradientTexture2D::set_height(int p_height) { + height = p_height; + _queue_update(); +} +int GradientTexture2D::get_height() const { + return height; +} + +void GradientTexture2D::set_use_hdr(bool p_enabled) { + if (p_enabled == use_hdr) { + return; + } + + use_hdr = p_enabled; + _queue_update(); +} + +bool GradientTexture2D::is_using_hdr() const { + return use_hdr; +} + +void GradientTexture2D::set_fill_from(Vector2 p_fill_from) { + fill_from = p_fill_from; + _queue_update(); +} + +Vector2 GradientTexture2D::get_fill_from() const { + return fill_from; +} + +void GradientTexture2D::set_fill_to(Vector2 p_fill_to) { + fill_to = p_fill_to; + _queue_update(); +} + +Vector2 GradientTexture2D::get_fill_to() const { + return fill_to; +} + +void GradientTexture2D::set_fill(Fill p_fill) { + fill = p_fill; + _queue_update(); +} + +GradientTexture2D::Fill GradientTexture2D::get_fill() const { + return fill; +} + +void GradientTexture2D::set_repeat(Repeat p_repeat) { + repeat = p_repeat; + _queue_update(); +} + +GradientTexture2D::Repeat GradientTexture2D::get_repeat() const { + return repeat; +} + +RID GradientTexture2D::get_rid() const { + if (!texture.is_valid()) { + texture = RS::get_singleton()->texture_2d_placeholder_create(); + } + return texture; +} + +Ref<Image> GradientTexture2D::get_image() const { + if (!texture.is_valid()) { + return Ref<Image>(); + } + return RenderingServer::get_singleton()->texture_2d_get(texture); +} + +void GradientTexture2D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_gradient", "gradient"), &GradientTexture2D::set_gradient); + ClassDB::bind_method(D_METHOD("get_gradient"), &GradientTexture2D::get_gradient); + + ClassDB::bind_method(D_METHOD("set_width", "width"), &GradientTexture2D::set_width); + ClassDB::bind_method(D_METHOD("set_height", "height"), &GradientTexture2D::set_height); + + ClassDB::bind_method(D_METHOD("set_use_hdr", "enabled"), &GradientTexture2D::set_use_hdr); + ClassDB::bind_method(D_METHOD("is_using_hdr"), &GradientTexture2D::is_using_hdr); + + ClassDB::bind_method(D_METHOD("set_fill", "fill"), &GradientTexture2D::set_fill); + ClassDB::bind_method(D_METHOD("get_fill"), &GradientTexture2D::get_fill); + ClassDB::bind_method(D_METHOD("set_fill_from", "fill_from"), &GradientTexture2D::set_fill_from); + ClassDB::bind_method(D_METHOD("get_fill_from"), &GradientTexture2D::get_fill_from); + ClassDB::bind_method(D_METHOD("set_fill_to", "fill_to"), &GradientTexture2D::set_fill_to); + ClassDB::bind_method(D_METHOD("get_fill_to"), &GradientTexture2D::get_fill_to); + + ClassDB::bind_method(D_METHOD("set_repeat", "repeat"), &GradientTexture2D::set_repeat); + ClassDB::bind_method(D_METHOD("get_repeat"), &GradientTexture2D::get_repeat); + + ClassDB::bind_method(D_METHOD("_update"), &GradientTexture2D::_update); + + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "gradient", PROPERTY_HINT_RESOURCE_TYPE, "Gradient", PROPERTY_USAGE_DEFAULT | PROPERTY_USAGE_EDITOR_INSTANTIATE_OBJECT), "set_gradient", "get_gradient"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "width", PROPERTY_HINT_RANGE, "1,2048,1,or_greater"), "set_width", "get_width"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "height", PROPERTY_HINT_RANGE, "1,2048,1,or_greater"), "set_height", "get_height"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_hdr"), "set_use_hdr", "is_using_hdr"); + + ADD_GROUP("Fill", "fill_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "fill", PROPERTY_HINT_ENUM, "Linear,Radial"), "set_fill", "get_fill"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "fill_from"), "set_fill_from", "get_fill_from"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "fill_to"), "set_fill_to", "get_fill_to"); + + ADD_GROUP("Repeat", "repeat_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "repeat", PROPERTY_HINT_ENUM, "No Repeat,Repeat,Mirror Repeat"), "set_repeat", "get_repeat"); + + BIND_ENUM_CONSTANT(FILL_LINEAR); + BIND_ENUM_CONSTANT(FILL_RADIAL); + + BIND_ENUM_CONSTANT(REPEAT_NONE); + BIND_ENUM_CONSTANT(REPEAT); + BIND_ENUM_CONSTANT(REPEAT_MIRROR); +} + ////////////////////////////////////// void ProxyTexture::_bind_methods() { @@ -2424,7 +2680,7 @@ Error StreamTextureLayered::load(const String &p_path) { path_to_file = p_path; - if (get_path() == String()) { + if (get_path().is_empty()) { //temporarily set path if no path set for resource, helps find errors RenderingServer::get_singleton()->texture_set_path(texture, p_path); } @@ -2615,15 +2871,6 @@ RID CameraTexture::get_rid() const { } } -void CameraTexture::set_flags(uint32_t p_flags) { - // not supported -} - -uint32_t CameraTexture::get_flags() const { - // not supported - return 0; -} - Ref<Image> CameraTexture::get_image() const { // not (yet) supported return Ref<Image>(); diff --git a/scene/resources/texture.h b/scene/resources/texture.h index 862b9a47a6..5b69711de6 100644 --- a/scene/resources/texture.h +++ b/scene/resources/texture.h @@ -669,8 +669,8 @@ public: ~CurveXYZTexture(); }; -class GradientTexture : public Texture2D { - GDCLASS(GradientTexture, Texture2D); +class GradientTexture1D : public Texture2D { + GDCLASS(GradientTexture1D, Texture2D); public: struct Point { @@ -710,10 +710,81 @@ public: virtual Ref<Image> get_image() const override; - GradientTexture(); - virtual ~GradientTexture(); + GradientTexture1D(); + virtual ~GradientTexture1D(); }; +class GradientTexture2D : public Texture2D { + GDCLASS(GradientTexture2D, Texture2D); + +public: + enum Fill { + FILL_LINEAR, + FILL_RADIAL, + }; + enum Repeat { + REPEAT_NONE, + REPEAT, + REPEAT_MIRROR, + }; + +private: + Ref<Gradient> gradient; + mutable RID texture; + + int width = 64; + int height = 64; + + bool use_hdr = false; + + Vector2 fill_from; + Vector2 fill_to = Vector2(1, 0); + + Fill fill = FILL_LINEAR; + Repeat repeat = REPEAT_NONE; + + float _get_gradient_offset_at(int x, int y) const; + + bool update_pending = false; + void _queue_update(); + void _update(); + +protected: + static void _bind_methods(); + +public: + void set_gradient(Ref<Gradient> p_gradient); + Ref<Gradient> get_gradient() const; + + void set_width(int p_width); + virtual int get_width() const override; + void set_height(int p_height); + virtual int get_height() const override; + + void set_use_hdr(bool p_enabled); + bool is_using_hdr() const; + + void set_fill(Fill p_fill); + Fill get_fill() const; + void set_fill_from(Vector2 p_fill_from); + Vector2 get_fill_from() const; + void set_fill_to(Vector2 p_fill_to); + Vector2 get_fill_to() const; + + void set_repeat(Repeat p_repeat); + Repeat get_repeat() const; + + virtual RID get_rid() const override; + virtual bool has_alpha() const override { return true; } + virtual Ref<Image> get_image() const override; + + GradientTexture2D(); + virtual ~GradientTexture2D(); +}; + +VARIANT_ENUM_CAST(GradientTexture2D::Fill); +VARIANT_ENUM_CAST(GradientTexture2D::Repeat); + class ProxyTexture : public Texture2D { GDCLASS(ProxyTexture, Texture2D); @@ -829,9 +900,6 @@ public: virtual RID get_rid() const override; virtual bool has_alpha() const override; - virtual void set_flags(uint32_t p_flags); - virtual uint32_t get_flags() const; - virtual Ref<Image> get_image() const override; void set_camera_feed_id(int p_new_id); diff --git a/scene/resources/theme.cpp b/scene/resources/theme.cpp index 65cdc1e24e..99977a20f2 100644 --- a/scene/resources/theme.cpp +++ b/scene/resources/theme.cpp @@ -169,7 +169,7 @@ void Theme::_get_property_list(List<PropertyInfo> *p_list) const { const StringName *key2 = nullptr; while ((key2 = font_size_map[*key].next(key2))) { - list.push_back(PropertyInfo(Variant::INT, String() + *key + "/font_sizes/" + *key2)); + list.push_back(PropertyInfo(Variant::INT, String() + *key + "/font_sizes/" + *key2, PROPERTY_HINT_RANGE, "0,256,1,or_greater")); } } @@ -1655,7 +1655,7 @@ void Theme::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "default_base_scale", PROPERTY_HINT_RANGE, "0.0,2.0,0.01,or_greater"), "set_default_base_scale", "get_default_base_scale"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "default_font", PROPERTY_HINT_RESOURCE_TYPE, "Font"), "set_default_font", "get_default_font"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "default_font_size"), "set_default_font_size", "get_default_font_size"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "default_font_size", PROPERTY_HINT_RANGE, "0,256,1,or_greater"), "set_default_font_size", "get_default_font_size"); BIND_ENUM_CONSTANT(DATA_TYPE_COLOR); BIND_ENUM_CONSTANT(DATA_TYPE_CONSTANT); diff --git a/scene/resources/tile_set.cpp b/scene/resources/tile_set.cpp index b988b2ab3e..34fe7c0b87 100644 --- a/scene/resources/tile_set.cpp +++ b/scene/resources/tile_set.cpp @@ -31,6 +31,7 @@ #include "tile_set.h" #include "core/core_string_names.h" +#include "core/io/marshalls.h" #include "core/math/geometry_2d.h" #include "core/templates/local_vector.h" @@ -39,8 +40,275 @@ #include "scene/resources/convex_polygon_shape_2d.h" #include "servers/navigation_server_2d.h" +/////////////////////////////// TileMapPattern ////////////////////////////////////// + +void TileMapPattern::_set_tile_data(const Vector<int> &p_data) { + int c = p_data.size(); + const int *r = p_data.ptr(); + + int offset = 3; + ERR_FAIL_COND_MSG(c % offset != 0, "Corrupted tile data."); + + clear(); + + for (int i = 0; i < c; i += offset) { + const uint8_t *ptr = (const uint8_t *)&r[i]; + uint8_t local[12]; + for (int j = 0; j < 12; j++) { + local[j] = ptr[j]; + } + +#ifdef BIG_ENDIAN_ENABLED + SWAP(local[0], local[3]); + SWAP(local[1], local[2]); + SWAP(local[4], local[7]); + SWAP(local[5], local[6]); + SWAP(local[8], local[11]); + SWAP(local[9], local[10]); +#endif + + int16_t x = decode_uint16(&local[0]); + int16_t y = decode_uint16(&local[2]); + uint16_t source_id = decode_uint16(&local[4]); + uint16_t atlas_coords_x = decode_uint16(&local[6]); + uint16_t atlas_coords_y = decode_uint16(&local[8]); + uint16_t alternative_tile = decode_uint16(&local[10]); + set_cell(Vector2i(x, y), source_id, Vector2i(atlas_coords_x, atlas_coords_y), alternative_tile); + } + emit_signal(SNAME("changed")); +} + +Vector<int> TileMapPattern::_get_tile_data() const { + // Export tile data to raw format + Vector<int> data; + data.resize(pattern.size() * 3); + int *w = data.ptrw(); + + // Save in highest format + + int idx = 0; + for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { + uint8_t *ptr = (uint8_t *)&w[idx]; + encode_uint16((int16_t)(E.key.x), &ptr[0]); + encode_uint16((int16_t)(E.key.y), &ptr[2]); + encode_uint16(E.value.source_id, &ptr[4]); + encode_uint16(E.value.coord_x, &ptr[6]); + encode_uint16(E.value.coord_y, &ptr[8]); + encode_uint16(E.value.alternative_tile, &ptr[10]); + idx += 3; + } + + return data; +} + +void TileMapPattern::set_cell(const Vector2i &p_coords, int p_source_id, const Vector2i p_atlas_coords, int p_alternative_tile) { + ERR_FAIL_COND_MSG(p_coords.x < 0 || p_coords.y < 0, vformat("Cannot set cell with negative coords in a TileMapPattern. Wrong coords: %s", p_coords)); + + size = size.max(p_coords + Vector2i(1, 1)); + pattern[p_coords] = TileMapCell(p_source_id, p_atlas_coords, p_alternative_tile); + emit_changed(); +} + +bool TileMapPattern::has_cell(const Vector2i &p_coords) const { + return pattern.has(p_coords); +} + +void TileMapPattern::remove_cell(const Vector2i &p_coords, bool p_update_size) { + ERR_FAIL_COND(!pattern.has(p_coords)); + + pattern.erase(p_coords); + if (p_update_size) { + size = Vector2i(); + for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { + size = size.max(E.key + Vector2i(1, 1)); + } + } + emit_changed(); +} + +int TileMapPattern::get_cell_source_id(const Vector2i &p_coords) const { + ERR_FAIL_COND_V(!pattern.has(p_coords), TileSet::INVALID_SOURCE); + + return pattern[p_coords].source_id; +} + +Vector2i TileMapPattern::get_cell_atlas_coords(const Vector2i &p_coords) const { + ERR_FAIL_COND_V(!pattern.has(p_coords), TileSetSource::INVALID_ATLAS_COORDS); + + return pattern[p_coords].get_atlas_coords(); +} + +int TileMapPattern::get_cell_alternative_tile(const Vector2i &p_coords) const { + ERR_FAIL_COND_V(!pattern.has(p_coords), TileSetSource::INVALID_TILE_ALTERNATIVE); + + return pattern[p_coords].alternative_tile; +} + +TypedArray<Vector2i> TileMapPattern::get_used_cells() const { + // Returns the cells used in the tilemap. + TypedArray<Vector2i> a; + a.resize(pattern.size()); + int i = 0; + for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { + Vector2i p(E.key.x, E.key.y); + a[i++] = p; + } + + return a; +} + +Vector2i TileMapPattern::get_size() const { + return size; +} + +void TileMapPattern::set_size(const Vector2i &p_size) { + for (const KeyValue<Vector2i, TileMapCell> &E : pattern) { + Vector2i coords = E.key; + if (p_size.x <= coords.x || p_size.y <= coords.y) { + ERR_FAIL_MSG(vformat("Cannot set pattern size to %s, it contains a tile at %s. Size can only be increased.", p_size, coords)); + }; + } + + size = p_size; + emit_changed(); +} + +bool TileMapPattern::is_empty() const { + return pattern.is_empty(); +}; + +void TileMapPattern::clear() { + size = Vector2i(); + pattern.clear(); + emit_changed(); +}; + +bool TileMapPattern::_set(const StringName &p_name, const Variant &p_value) { + if (p_name == "tile_data") { + if (p_value.is_array()) { + _set_tile_data(p_value); + return true; + } + return false; + } + return false; +} + +bool TileMapPattern::_get(const StringName &p_name, Variant &r_ret) const { + if (p_name == "tile_data") { + r_ret = _get_tile_data(); + return true; + } + return false; +} + +void TileMapPattern::_get_property_list(List<PropertyInfo> *p_list) const { + p_list->push_back(PropertyInfo(Variant::OBJECT, "tile_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL)); +} + +void TileMapPattern::_bind_methods() { + ClassDB::bind_method(D_METHOD("_set_tile_data", "data"), &TileMapPattern::_set_tile_data); + ClassDB::bind_method(D_METHOD("_get_tile_data"), &TileMapPattern::_get_tile_data); + + ClassDB::bind_method(D_METHOD("set_cell", "coords", "source_id", "atlas_coords", "alternative_tile"), &TileMapPattern::set_cell, DEFVAL(TileSet::INVALID_SOURCE), DEFVAL(TileSetSource::INVALID_ATLAS_COORDS), DEFVAL(TileSetSource::INVALID_TILE_ALTERNATIVE)); + ClassDB::bind_method(D_METHOD("has_cell", "coords"), &TileMapPattern::has_cell); + ClassDB::bind_method(D_METHOD("remove_cell", "coords", "update_size"), &TileMapPattern::remove_cell); + ClassDB::bind_method(D_METHOD("get_cell_source_id", "coords"), &TileMapPattern::get_cell_source_id); + ClassDB::bind_method(D_METHOD("get_cell_atlas_coords", "coords"), &TileMapPattern::get_cell_atlas_coords); + ClassDB::bind_method(D_METHOD("get_cell_alternative_tile", "coords"), &TileMapPattern::get_cell_alternative_tile); + + ClassDB::bind_method(D_METHOD("get_used_cells"), &TileMapPattern::get_used_cells); + ClassDB::bind_method(D_METHOD("get_size"), &TileMapPattern::get_size); + ClassDB::bind_method(D_METHOD("set_size", "size"), &TileMapPattern::set_size); + ClassDB::bind_method(D_METHOD("is_empty"), &TileMapPattern::is_empty); +} + /////////////////////////////// TileSet ////////////////////////////////////// +bool TileSet::TerrainsPattern::is_valid() const { + return valid; +} + +bool TileSet::TerrainsPattern::is_erase_pattern() const { + return not_empty_terrains_count == 0; +} + +bool TileSet::TerrainsPattern::operator<(const TerrainsPattern &p_terrains_pattern) const { + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (is_valid_bit[i] != p_terrains_pattern.is_valid_bit[i]) { + return is_valid_bit[i] < p_terrains_pattern.is_valid_bit[i]; + } + } + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (is_valid_bit[i] && bits[i] != p_terrains_pattern.bits[i]) { + return bits[i] < p_terrains_pattern.bits[i]; + } + } + return false; +} + +bool TileSet::TerrainsPattern::operator==(const TerrainsPattern &p_terrains_pattern) const { + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (is_valid_bit[i] != p_terrains_pattern.is_valid_bit[i]) { + return false; + } + if (is_valid_bit[i] && bits[i] != p_terrains_pattern.bits[i]) { + return false; + } + } + return true; +} + +void TileSet::TerrainsPattern::set_terrain(TileSet::CellNeighbor p_peering_bit, int p_terrain) { + ERR_FAIL_COND(p_peering_bit == TileSet::CELL_NEIGHBOR_MAX); + ERR_FAIL_COND(!is_valid_bit[p_peering_bit]); + ERR_FAIL_COND(p_terrain < -1); + + // Update the "is_erase_pattern" status. + if (p_terrain >= 0 && bits[p_peering_bit] < 0) { + not_empty_terrains_count++; + } else if (p_terrain < 0 && bits[p_peering_bit] >= 0) { + not_empty_terrains_count--; + } + + bits[p_peering_bit] = p_terrain; +} + +int TileSet::TerrainsPattern::get_terrain(TileSet::CellNeighbor p_peering_bit) const { + ERR_FAIL_COND_V(p_peering_bit == TileSet::CELL_NEIGHBOR_MAX, -1); + ERR_FAIL_COND_V(!is_valid_bit[p_peering_bit], -1); + return bits[p_peering_bit]; +} + +void TileSet::TerrainsPattern::set_terrains_from_array(Array p_terrains) { + int in_array_index = 0; + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (is_valid_bit[i]) { + ERR_FAIL_COND(in_array_index >= p_terrains.size()); + set_terrain(TileSet::CellNeighbor(i), p_terrains[in_array_index]); + in_array_index++; + } + } +} + +Array TileSet::TerrainsPattern::get_terrains_as_array() const { + Array output; + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (is_valid_bit[i]) { + output.push_back(bits[i]); + } + } + return output; +} +TileSet::TerrainsPattern::TerrainsPattern(const TileSet *p_tile_set, int p_terrain_set) { + ERR_FAIL_COND(p_terrain_set < 0); + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + is_valid_bit[i] = (p_tile_set->is_valid_peering_bit_terrain(p_terrain_set, TileSet::CellNeighbor(i))); + bits[i] = -1; + } + valid = true; +} + const int TileSet::INVALID_SOURCE = -1; const char *TileSet::CELL_NEIGHBOR_ENUM_TO_TEXT[] = { @@ -117,6 +385,64 @@ int TileSet::get_next_source_id() const { return next_source_id; } +void TileSet::_update_terrains_cache() { + if (terrains_cache_dirty) { + // Organizes tiles into structures. + per_terrain_pattern_tiles.resize(terrain_sets.size()); + for (int i = 0; i < (int)per_terrain_pattern_tiles.size(); i++) { + per_terrain_pattern_tiles[i].clear(); + } + + for (const KeyValue<int, Ref<TileSetSource>> &kv : sources) { + Ref<TileSetSource> source = kv.value; + Ref<TileSetAtlasSource> atlas_source = source; + if (atlas_source.is_valid()) { + for (int tile_index = 0; tile_index < source->get_tiles_count(); tile_index++) { + Vector2i tile_id = source->get_tile_id(tile_index); + for (int alternative_index = 0; alternative_index < source->get_alternative_tiles_count(tile_id); alternative_index++) { + int alternative_id = source->get_alternative_tile_id(tile_id, alternative_index); + + // Executed for each tile_data. + TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(tile_id, alternative_id)); + int terrain_set = tile_data->get_terrain_set(); + if (terrain_set >= 0) { + TileMapCell cell; + cell.source_id = kv.key; + cell.set_atlas_coords(tile_id); + cell.alternative_tile = alternative_id; + + TileSet::TerrainsPattern terrains_pattern = tile_data->get_terrains_pattern(); + + // Terrain bits. + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + CellNeighbor bit = CellNeighbor(i); + if (is_valid_peering_bit_terrain(terrain_set, bit)) { + int terrain = terrains_pattern.get_terrain(bit); + if (terrain >= 0) { + per_terrain_pattern_tiles[terrain_set][terrains_pattern].insert(cell); + } + } + } + } + } + } + } + } + + // Add the empty cell in the possible patterns and cells. + for (int i = 0; i < terrain_sets.size(); i++) { + TileSet::TerrainsPattern empty_pattern(this, i); + + TileMapCell empty_cell; + empty_cell.source_id = TileSet::INVALID_SOURCE; + empty_cell.set_atlas_coords(TileSetSource::INVALID_ATLAS_COORDS); + empty_cell.alternative_tile = TileSetSource::INVALID_TILE_ALTERNATIVE; + per_terrain_pattern_tiles[i][empty_pattern].insert(empty_cell); + } + terrains_cache_dirty = false; + } +} + void TileSet::_compute_next_source_id() { while (sources.has(next_source_id)) { next_source_id = (next_source_id + 1) % 1073741824; // 2 ** 30 @@ -137,6 +463,7 @@ int TileSet::add_source(Ref<TileSetSource> p_tile_set_source, int p_atlas_source sources[new_source_id]->connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &TileSet::_source_changed)); + terrains_cache_dirty = true; emit_changed(); return new_source_id; @@ -152,6 +479,7 @@ void TileSet::remove_source(int p_source_id) { source_ids.erase(p_source_id); source_ids.sort(); + terrains_cache_dirty = true; emit_changed(); } @@ -173,6 +501,7 @@ void TileSet::set_source_id(int p_source_id, int p_new_source_id) { _compute_next_source_id(); + terrains_cache_dirty = true; emit_changed(); } @@ -231,7 +560,7 @@ void TileSet::move_occlusion_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, occlusion_layers.size()); ERR_FAIL_INDEX(p_to_pos, occlusion_layers.size() + 1); occlusion_layers.insert(p_to_pos, occlusion_layers[p_from_index]); - occlusion_layers.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + occlusion_layers.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_occlusion_layer(p_from_index, p_to_pos); } @@ -241,7 +570,7 @@ void TileSet::move_occlusion_layer(int p_from_index, int p_to_pos) { void TileSet::remove_occlusion_layer(int p_index) { ERR_FAIL_INDEX(p_index, occlusion_layers.size()); - occlusion_layers.remove(p_index); + occlusion_layers.remove_at(p_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->remove_occlusion_layer(p_index); } @@ -294,7 +623,7 @@ void TileSet::move_physics_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, physics_layers.size()); ERR_FAIL_INDEX(p_to_pos, physics_layers.size() + 1); physics_layers.insert(p_to_pos, physics_layers[p_from_index]); - physics_layers.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + physics_layers.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_physics_layer(p_from_index, p_to_pos); } @@ -304,7 +633,7 @@ void TileSet::move_physics_layer(int p_from_index, int p_to_pos) { void TileSet::remove_physics_layer(int p_index) { ERR_FAIL_INDEX(p_index, physics_layers.size()); - physics_layers.remove(p_index); + physics_layers.remove_at(p_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->remove_physics_layer(p_index); } @@ -361,6 +690,7 @@ void TileSet::add_terrain_set(int p_index) { } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -368,21 +698,23 @@ void TileSet::move_terrain_set(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, terrain_sets.size()); ERR_FAIL_INDEX(p_to_pos, terrain_sets.size() + 1); terrain_sets.insert(p_to_pos, terrain_sets[p_from_index]); - terrain_sets.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + terrain_sets.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_terrain_set(p_from_index, p_to_pos); } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } void TileSet::remove_terrain_set(int p_index) { ERR_FAIL_INDEX(p_index, terrain_sets.size()); - terrain_sets.remove(p_index); + terrain_sets.remove_at(p_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->remove_terrain_set(p_index); } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -394,6 +726,7 @@ void TileSet::set_terrain_set_mode(int p_terrain_set, TerrainMode p_terrain_mode } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -428,6 +761,7 @@ void TileSet::add_terrain(int p_terrain_set, int p_index) { } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -438,11 +772,12 @@ void TileSet::move_terrain(int p_terrain_set, int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, terrains.size()); ERR_FAIL_INDEX(p_to_pos, terrains.size() + 1); terrains.insert(p_to_pos, terrains[p_from_index]); - terrains.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + terrains.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_terrain(p_terrain_set, p_from_index, p_to_pos); } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -451,11 +786,12 @@ void TileSet::remove_terrain(int p_terrain_set, int p_index) { Vector<Terrain> &terrains = terrain_sets.write[p_terrain_set].terrains; ERR_FAIL_INDEX(p_index, terrains.size()); - terrains.remove(p_index); + terrains.remove_at(p_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->remove_terrain(p_terrain_set, p_index); } notify_property_list_changed(); + terrains_cache_dirty = true; emit_changed(); } @@ -605,7 +941,7 @@ void TileSet::move_navigation_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, navigation_layers.size()); ERR_FAIL_INDEX(p_to_pos, navigation_layers.size() + 1); navigation_layers.insert(p_to_pos, navigation_layers[p_from_index]); - navigation_layers.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + navigation_layers.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_navigation_layer(p_from_index, p_to_pos); } @@ -615,7 +951,7 @@ void TileSet::move_navigation_layer(int p_from_index, int p_to_pos) { void TileSet::remove_navigation_layer(int p_index) { ERR_FAIL_INDEX(p_index, navigation_layers.size()); - navigation_layers.remove(p_index); + navigation_layers.remove_at(p_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->remove_navigation_layer(p_index); } @@ -658,7 +994,7 @@ void TileSet::move_custom_data_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, custom_data_layers.size()); ERR_FAIL_INDEX(p_to_pos, custom_data_layers.size() + 1); custom_data_layers.insert(p_to_pos, custom_data_layers[p_from_index]); - custom_data_layers.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + custom_data_layers.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); for (KeyValue<int, Ref<TileSetSource>> source : sources) { source.value->move_custom_data_layer(p_from_index, p_to_pos); } @@ -668,7 +1004,7 @@ void TileSet::move_custom_data_layer(int p_from_index, int p_to_pos) { void TileSet::remove_custom_data_layer(int p_index) { ERR_FAIL_INDEX(p_index, custom_data_layers.size()); - custom_data_layers.remove(p_index); + custom_data_layers.remove_at(p_index); for (KeyValue<String, int> E : custom_data_layers_by_name) { if (E.value == p_index) { custom_data_layers_by_name.erase(E.key); @@ -982,6 +1318,103 @@ void TileSet::clear_tile_proxies() { emit_changed(); } +int TileSet::add_pattern(Ref<TileMapPattern> p_pattern, int p_index) { + ERR_FAIL_COND_V(!p_pattern.is_valid(), -1); + ERR_FAIL_COND_V_MSG(p_pattern->is_empty(), -1, "Cannot add an empty pattern to the TileSet."); + for (unsigned int i = 0; i < patterns.size(); i++) { + ERR_FAIL_COND_V_MSG(patterns[i] == p_pattern, -1, "TileSet has already this pattern."); + } + ERR_FAIL_COND_V(p_index > (int)patterns.size(), -1); + if (p_index < 0) { + p_index = patterns.size(); + } + patterns.insert(p_index, p_pattern); + emit_changed(); + return p_index; +} + +Ref<TileMapPattern> TileSet::get_pattern(int p_index) { + ERR_FAIL_INDEX_V(p_index, (int)patterns.size(), Ref<TileMapPattern>()); + return patterns[p_index]; +} + +void TileSet::remove_pattern(int p_index) { + ERR_FAIL_INDEX(p_index, (int)patterns.size()); + patterns.remove_at(p_index); + emit_changed(); +} + +int TileSet::get_patterns_count() { + return patterns.size(); +} + +Set<TileSet::TerrainsPattern> TileSet::get_terrains_pattern_set(int p_terrain_set) { + ERR_FAIL_INDEX_V(p_terrain_set, terrain_sets.size(), Set<TileSet::TerrainsPattern>()); + _update_terrains_cache(); + + Set<TileSet::TerrainsPattern> output; + for (KeyValue<TileSet::TerrainsPattern, Set<TileMapCell>> kv : per_terrain_pattern_tiles[p_terrain_set]) { + output.insert(kv.key); + } + return output; +} + +Set<TileMapCell> TileSet::get_tiles_for_terrains_pattern(int p_terrain_set, TerrainsPattern p_terrain_tile_pattern) { + ERR_FAIL_INDEX_V(p_terrain_set, terrain_sets.size(), Set<TileMapCell>()); + _update_terrains_cache(); + return per_terrain_pattern_tiles[p_terrain_set][p_terrain_tile_pattern]; +} + +TileMapCell TileSet::get_random_tile_from_terrains_pattern(int p_terrain_set, TileSet::TerrainsPattern p_terrain_tile_pattern) { + ERR_FAIL_INDEX_V(p_terrain_set, terrain_sets.size(), TileMapCell()); + _update_terrains_cache(); + + // Count the sum of probabilities. + double sum = 0.0; + Set<TileMapCell> set = per_terrain_pattern_tiles[p_terrain_set][p_terrain_tile_pattern]; + for (Set<TileMapCell>::Element *E = set.front(); E; E = E->next()) { + if (E->get().source_id >= 0) { + Ref<TileSetSource> source = sources[E->get().source_id]; + Ref<TileSetAtlasSource> atlas_source = source; + if (atlas_source.is_valid()) { + TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(E->get().get_atlas_coords(), E->get().alternative_tile)); + sum += tile_data->get_probability(); + } else { + sum += 1.0; + } + } else { + sum += 1.0; + } + } + + // Generate a random number. + double count = 0.0; + double picked = Math::random(0.0, sum); + + // Pick the tile. + for (Set<TileMapCell>::Element *E = set.front(); E; E = E->next()) { + if (E->get().source_id >= 0) { + Ref<TileSetSource> source = sources[E->get().source_id]; + + Ref<TileSetAtlasSource> atlas_source = source; + if (atlas_source.is_valid()) { + TileData *tile_data = Object::cast_to<TileData>(atlas_source->get_tile_data(E->get().get_atlas_coords(), E->get().alternative_tile)); + count += tile_data->get_probability(); + } else { + count += 1.0; + } + } else { + count += 1.0; + } + + if (count >= picked) { + return E->get(); + } + } + + ERR_FAIL_V(TileMapCell()); +} + Vector<Vector2> TileSet::get_tile_shape_polygon() { Vector<Vector2> points; if (tile_shape == TileSet::TILE_SHAPE_SQUARE) { @@ -1296,6 +1729,7 @@ Vector<Vector<Ref<Texture2D>>> TileSet::generate_terrains_icons(Size2i p_size) { } void TileSet::_source_changed() { + terrains_cache_dirty = true; emit_changed(); } @@ -2483,6 +2917,12 @@ bool TileSet::_set(const StringName &p_name, const Variant &p_value) { return true; } return false; + } else if (components.size() == 1 && components[0].begins_with("pattern_") && components[0].trim_prefix("pattern_").is_valid_int()) { + int pattern_index = components[0].trim_prefix("pattern_").to_int(); + for (int i = patterns.size(); i <= pattern_index; i++) { + add_pattern(p_value); + } + return true; } #ifndef DISABLE_DEPRECATED @@ -2606,6 +3046,13 @@ bool TileSet::_get(const StringName &p_name, Variant &r_ret) const { return true; } return false; + } else if (components.size() == 1 && components[0].begins_with("pattern_") && components[0].trim_prefix("pattern_").is_valid_int()) { + int pattern_index = components[0].trim_prefix("pattern_").to_int(); + if (pattern_index < 0 || pattern_index >= (int)patterns.size()) { + return false; + } + r_ret = patterns[pattern_index]; + return true; } return false; @@ -2677,15 +3124,20 @@ void TileSet::_get_property_list(List<PropertyInfo> *p_list) const { // Sources. // Note: sources have to be listed in at the end as some TileData rely on the TileSet properties being initialized first. for (const KeyValue<int, Ref<TileSetSource>> &E_source : sources) { - p_list->push_back(PropertyInfo(Variant::INT, vformat("sources/%d", E_source.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::INT, vformat("sources/%d", E_source.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } // Tile Proxies. // Note: proxies need to be set after sources are set. p_list->push_back(PropertyInfo(Variant::NIL, "Tile Proxies", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_GROUP)); - p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/source_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/coords_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/alternative_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/source_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/coords_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::ARRAY, "tile_proxies/alternative_level", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + + // Patterns. + for (unsigned int pattern_index = 0; pattern_index < patterns.size(); pattern_index++) { + p_list->push_back(PropertyInfo(Variant::OBJECT, vformat("pattern_%d", pattern_index), PROPERTY_HINT_RESOURCE_TYPE, "TileMapPattern", PROPERTY_USAGE_NO_EDITOR)); + } } void TileSet::_validate_property(PropertyInfo &property) const { @@ -2799,6 +3251,12 @@ void TileSet::_bind_methods() { ClassDB::bind_method(D_METHOD("cleanup_invalid_tile_proxies"), &TileSet::cleanup_invalid_tile_proxies); ClassDB::bind_method(D_METHOD("clear_tile_proxies"), &TileSet::clear_tile_proxies); + // Patterns + ClassDB::bind_method(D_METHOD("add_pattern", "pattern", "index"), &TileSet::add_pattern, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("get_pattern", "index"), &TileSet::get_pattern, DEFVAL(-1)); + ClassDB::bind_method(D_METHOD("remove_pattern", "index"), &TileSet::remove_pattern); + ClassDB::bind_method(D_METHOD("get_patterns_count"), &TileSet::get_patterns_count); + ADD_GROUP("Rendering", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "uv_clipping"), "set_uv_clipping", "is_uv_clipping"); ADD_ARRAY("occlusion_layers", "occlusion_layer_"); @@ -2901,6 +3359,10 @@ void TileSetAtlasSource::set_tile_set(const TileSet *p_tile_set) { } } +const TileSet *TileSetAtlasSource::get_tile_set() const { + return tile_set; +} + void TileSetAtlasSource::notify_tile_data_properties_should_change() { // Set the TileSet on all TileData. for (KeyValue<Vector2i, TileAlternativesData> &E_tile : tiles) { @@ -3064,9 +3526,18 @@ void TileSetAtlasSource::reset_state() { } void TileSetAtlasSource::set_texture(Ref<Texture2D> p_texture) { + if (texture.is_valid()) { + texture->disconnect(SNAME("changed"), callable_mp(this, &TileSetAtlasSource::_queue_update_padded_texture)); + } + texture = p_texture; + if (texture.is_valid()) { + texture->connect(SNAME("changed"), callable_mp(this, &TileSetAtlasSource::_queue_update_padded_texture)); + } + _clear_tiles_outside_texture(); + _queue_update_padded_texture(); emit_changed(); } @@ -3083,8 +3554,10 @@ void TileSetAtlasSource::set_margins(Vector2i p_margins) { } _clear_tiles_outside_texture(); + _queue_update_padded_texture(); emit_changed(); } + Vector2i TileSetAtlasSource::get_margins() const { return margins; } @@ -3098,8 +3571,10 @@ void TileSetAtlasSource::set_separation(Vector2i p_separation) { } _clear_tiles_outside_texture(); + _queue_update_padded_texture(); emit_changed(); } + Vector2i TileSetAtlasSource::get_separation() const { return separation; } @@ -3113,12 +3588,27 @@ void TileSetAtlasSource::set_texture_region_size(Vector2i p_tile_size) { } _clear_tiles_outside_texture(); + _queue_update_padded_texture(); emit_changed(); } + Vector2i TileSetAtlasSource::get_texture_region_size() const { return texture_region_size; } +void TileSetAtlasSource::set_use_texture_padding(bool p_use_padding) { + if (use_texture_padding == p_use_padding) { + return; + } + use_texture_padding = p_use_padding; + _queue_update_padded_texture(); + emit_changed(); +} + +bool TileSetAtlasSource::get_use_texture_padding() const { + return use_texture_padding; +} + Vector2i TileSetAtlasSource::get_atlas_grid_size() const { Ref<Texture2D> texture = get_texture(); if (!texture.is_valid()) { @@ -3279,35 +3769,35 @@ void TileSetAtlasSource::_get_property_list(List<PropertyInfo> *p_list) const { List<PropertyInfo> tile_property_list; // size_in_atlas - property_info = PropertyInfo(Variant::VECTOR2I, "size_in_atlas", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::VECTOR2I, "size_in_atlas", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (E_tile.value.size_in_atlas == Vector2i(1, 1)) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } tile_property_list.push_back(property_info); // next_alternative_id - property_info = PropertyInfo(Variant::INT, "next_alternative_id", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::INT, "next_alternative_id", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (E_tile.value.next_alternative_id == 1) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } tile_property_list.push_back(property_info); // animation_columns. - property_info = PropertyInfo(Variant::INT, "animation_columns", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::INT, "animation_columns", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (E_tile.value.animation_columns == 0) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } tile_property_list.push_back(property_info); // animation_separation. - property_info = PropertyInfo(Variant::INT, "animation_separation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::INT, "animation_separation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (E_tile.value.animation_separation == Vector2i()) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } tile_property_list.push_back(property_info); // animation_speed. - property_info = PropertyInfo(Variant::FLOAT, "animation_speed", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::FLOAT, "animation_speed", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (E_tile.value.animation_speed == 1.0) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } @@ -3319,7 +3809,7 @@ void TileSetAtlasSource::_get_property_list(List<PropertyInfo> *p_list) const { // animation_frame_*. bool store_durations = tiles[E_tile.key].animation_frames_durations.size() >= 2; for (int i = 0; i < (int)tiles[E_tile.key].animation_frames_durations.size(); i++) { - property_info = PropertyInfo(Variant::FLOAT, vformat("animation_frame_%d/duration", i), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR); + property_info = PropertyInfo(Variant::FLOAT, vformat("animation_frame_%d/duration", i), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR); if (!store_durations) { property_info.usage ^= PROPERTY_USAGE_STORAGE; } @@ -3328,7 +3818,7 @@ void TileSetAtlasSource::_get_property_list(List<PropertyInfo> *p_list) const { for (const KeyValue<int, TileData *> &E_alternative : E_tile.value.alternatives) { // Add a dummy property to show the alternative exists. - tile_property_list.push_back(PropertyInfo(Variant::INT, vformat("%d", E_alternative.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + tile_property_list.push_back(PropertyInfo(Variant::INT, vformat("%d", E_alternative.key), PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); // Get the alternative tile's properties and append them to the list of properties. List<PropertyInfo> alternative_property_list; @@ -3377,6 +3867,7 @@ void TileSetAtlasSource::create_tile(const Vector2i p_atlas_coords, const Vector tiles_ids.sort(); _create_coords_mapping_cache(p_atlas_coords); + _queue_update_padded_texture(); emit_signal(SNAME("changed")); } @@ -3397,6 +3888,8 @@ void TileSetAtlasSource::remove_tile(Vector2i p_atlas_coords) { tiles_ids.erase(p_atlas_coords); tiles_ids.sort(); + _queue_update_padded_texture(); + emit_signal(SNAME("changed")); } @@ -3425,6 +3918,7 @@ void TileSetAtlasSource::set_tile_animation_columns(const Vector2i p_atlas_coord tiles[p_atlas_coords].animation_columns = p_frame_columns; _create_coords_mapping_cache(p_atlas_coords); + _queue_update_padded_texture(); emit_signal(SNAME("changed")); } @@ -3447,6 +3941,7 @@ void TileSetAtlasSource::set_tile_animation_separation(const Vector2i p_atlas_co tiles[p_atlas_coords].animation_separation = p_separation; _create_coords_mapping_cache(p_atlas_coords); + _queue_update_padded_texture(); emit_signal(SNAME("changed")); } @@ -3474,19 +3969,24 @@ void TileSetAtlasSource::set_tile_animation_frames_count(const Vector2i p_atlas_ ERR_FAIL_COND_MSG(!tiles.has(p_atlas_coords), vformat("TileSetAtlasSource has no tile at %s.", Vector2i(p_atlas_coords))); ERR_FAIL_COND(p_frames_count < 1); + int old_size = tiles[p_atlas_coords].animation_frames_durations.size(); + if (p_frames_count == old_size) { + return; + } + TileAlternativesData &tad = tiles[p_atlas_coords]; bool room_for_tile = has_room_for_tile(p_atlas_coords, tad.size_in_atlas, tad.animation_columns, tad.animation_separation, p_frames_count, p_atlas_coords); ERR_FAIL_COND_MSG(!room_for_tile, "Cannot set animation columns count, tiles are already present in the space the tile would cover."); _clear_coords_mapping_cache(p_atlas_coords); - int old_size = tiles[p_atlas_coords].animation_frames_durations.size(); tiles[p_atlas_coords].animation_frames_durations.resize(p_frames_count); for (int i = old_size; i < p_frames_count; i++) { tiles[p_atlas_coords].animation_frames_durations[i] = 1.0; } _create_coords_mapping_cache(p_atlas_coords); + _queue_update_padded_texture(); notify_property_list_changed(); @@ -3625,6 +4125,31 @@ Vector2i TileSetAtlasSource::get_tile_effective_texture_offset(Vector2i p_atlas_ return effective_texture_offset; } +// Getters for texture and tile region (padded or not) +Ref<Texture2D> TileSetAtlasSource::get_runtime_texture() const { + if (use_texture_padding) { + return padded_texture; + } else { + return texture; + } +} + +Rect2i TileSetAtlasSource::get_runtime_tile_texture_region(Vector2i p_atlas_coords, int p_frame) const { + ERR_FAIL_COND_V_MSG(!tiles.has(p_atlas_coords), Rect2i(), vformat("TileSetAtlasSource has no tile at %s.", String(p_atlas_coords))); + ERR_FAIL_INDEX_V(p_frame, (int)tiles[p_atlas_coords].animation_frames_durations.size(), Rect2i()); + + Rect2i src_rect = get_tile_texture_region(p_atlas_coords, p_frame); + if (use_texture_padding) { + const TileAlternativesData &tad = tiles[p_atlas_coords]; + Vector2i frame_coords = p_atlas_coords + (tad.size_in_atlas + tad.animation_separation) * ((tad.animation_columns > 0) ? Vector2i(p_frame % tad.animation_columns, p_frame / tad.animation_columns) : Vector2i(p_frame, 0)); + Vector2i base_pos = frame_coords * (texture_region_size + Vector2i(2, 2)) + Vector2i(1, 1); + + return Rect2i(base_pos, src_rect.size); + } else { + return src_rect; + } +} + void TileSetAtlasSource::move_tile_in_atlas(Vector2i p_atlas_coords, Vector2i p_new_atlas_coords, Vector2i p_new_size) { ERR_FAIL_COND_MSG(!tiles.has(p_atlas_coords), vformat("TileSetAtlasSource has no tile at %s.", String(p_atlas_coords))); @@ -3655,6 +4180,7 @@ void TileSetAtlasSource::move_tile_in_atlas(Vector2i p_atlas_coords, Vector2i p_ tiles[new_atlas_coords].size_in_atlas = new_size; _create_coords_mapping_cache(new_atlas_coords); + _queue_update_padded_texture(); emit_signal(SNAME("changed")); } @@ -3746,11 +4272,14 @@ void TileSetAtlasSource::_bind_methods() { ClassDB::bind_method(D_METHOD("get_separation"), &TileSetAtlasSource::get_separation); ClassDB::bind_method(D_METHOD("set_texture_region_size", "texture_region_size"), &TileSetAtlasSource::set_texture_region_size); ClassDB::bind_method(D_METHOD("get_texture_region_size"), &TileSetAtlasSource::get_texture_region_size); + ClassDB::bind_method(D_METHOD("set_use_texture_padding", "use_texture_padding"), &TileSetAtlasSource::set_use_texture_padding); + ClassDB::bind_method(D_METHOD("get_use_texture_padding"), &TileSetAtlasSource::get_use_texture_padding); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NOEDITOR), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "margins", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_margins", "get_margins"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "separation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_separation", "get_separation"); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "texture_region_size", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_texture_region_size", "get_texture_region_size"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NO_EDITOR), "set_texture", "get_texture"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "margins", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_margins", "get_margins"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "separation", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_separation", "get_separation"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2I, "texture_region_size", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_texture_region_size", "get_texture_region_size"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_texture_padding", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_use_texture_padding", "get_use_texture_padding"); // Base tiles ClassDB::bind_method(D_METHOD("create_tile", "atlas_coords", "size"), &TileSetAtlasSource::create_tile, DEFVAL(Vector2i(1, 1))); @@ -3785,6 +4314,11 @@ void TileSetAtlasSource::_bind_methods() { // Helpers. ClassDB::bind_method(D_METHOD("get_atlas_grid_size"), &TileSetAtlasSource::get_atlas_grid_size); ClassDB::bind_method(D_METHOD("get_tile_texture_region", "atlas_coords", "frame"), &TileSetAtlasSource::get_tile_texture_region, DEFVAL(0)); + + // Getters for texture and tile region (padded or not) + ClassDB::bind_method(D_METHOD("_update_padded_texture"), &TileSetAtlasSource::_update_padded_texture); + ClassDB::bind_method(D_METHOD("get_runtime_texture"), &TileSetAtlasSource::get_runtime_texture); + ClassDB::bind_method(D_METHOD("get_runtime_tile_texture_region", "atlas_coords", "frame"), &TileSetAtlasSource::get_runtime_tile_texture_region); } TileSetAtlasSource::~TileSetAtlasSource() { @@ -3871,6 +4405,69 @@ void TileSetAtlasSource::_clear_tiles_outside_texture() { } } +void TileSetAtlasSource::_queue_update_padded_texture() { + padded_texture_needs_update = true; + call_deferred("_update_padded_texture"); +} + +void TileSetAtlasSource::_update_padded_texture() { + if (!padded_texture_needs_update) { + return; + } + padded_texture_needs_update = false; + padded_texture = Ref<ImageTexture>(); + + if (!texture.is_valid()) { + return; + } + + if (!use_texture_padding) { + return; + } + + Size2 size = get_atlas_grid_size() * (texture_region_size + Vector2i(2, 2)); + + Ref<Image> src = texture->get_image(); + + Ref<Image> image; + image.instantiate(); + image->create(size.x, size.y, false, Image::FORMAT_RGBA8); + + for (KeyValue<Vector2i, TileAlternativesData> kv : tiles) { + for (int frame = 0; frame < (int)kv.value.animation_frames_durations.size(); frame++) { + // Compute the source rects. + Rect2i src_rect = get_tile_texture_region(kv.key, frame); + + Rect2i top_src_rect = Rect2i(src_rect.position, Vector2i(src_rect.size.x, 1)); + Rect2i bottom_src_rect = Rect2i(src_rect.position + Vector2i(0, src_rect.size.y - 1), Vector2i(src_rect.size.x, 1)); + Rect2i left_src_rect = Rect2i(src_rect.position, Vector2i(1, src_rect.size.y)); + Rect2i right_src_rect = Rect2i(src_rect.position + Vector2i(src_rect.size.x - 1, 0), Vector2i(1, src_rect.size.y)); + + // Copy the tile and the paddings. + Vector2i frame_coords = kv.key + (kv.value.size_in_atlas + kv.value.animation_separation) * ((kv.value.animation_columns > 0) ? Vector2i(frame % kv.value.animation_columns, frame / kv.value.animation_columns) : Vector2i(frame, 0)); + Vector2i base_pos = frame_coords * (texture_region_size + Vector2i(2, 2)) + Vector2i(1, 1); + + image->blit_rect(*src, src_rect, base_pos); + + image->blit_rect(*src, top_src_rect, base_pos + Vector2i(0, -1)); + image->blit_rect(*src, bottom_src_rect, base_pos + Vector2i(0, src_rect.size.y)); + image->blit_rect(*src, left_src_rect, base_pos + Vector2i(-1, 0)); + image->blit_rect(*src, right_src_rect, base_pos + Vector2i(src_rect.size.x, 0)); + + image->set_pixelv(base_pos + Vector2i(-1, -1), src->get_pixelv(src_rect.position)); + image->set_pixelv(base_pos + Vector2i(src_rect.size.x, -1), src->get_pixelv(src_rect.position + Vector2i(src_rect.size.x - 1, 0))); + image->set_pixelv(base_pos + Vector2i(-1, src_rect.size.y), src->get_pixelv(src_rect.position + Vector2i(0, src_rect.size.y - 1))); + image->set_pixelv(base_pos + Vector2i(src_rect.size.x, src_rect.size.y), src->get_pixelv(src_rect.position + Vector2i(src_rect.size.x - 1, src_rect.size.y - 1))); + } + } + + if (!padded_texture.is_valid()) { + padded_texture.instantiate(); + } + padded_texture->create_from_image(image); + emit_changed(); +} + /////////////////////////////// TileSetScenesCollectionSource ////////////////////////////////////// void TileSetScenesCollectionSource::_compute_next_alternative_id() { @@ -4110,12 +4707,12 @@ void TileData::move_occlusion_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, occluders.size()); ERR_FAIL_INDEX(p_to_pos, occluders.size() + 1); occluders.insert(p_to_pos, occluders[p_from_index]); - occluders.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + occluders.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); } void TileData::remove_occlusion_layer(int p_index) { ERR_FAIL_INDEX(p_index, occluders.size()); - occluders.remove(p_index); + occluders.remove_at(p_index); } void TileData::add_physics_layer(int p_to_pos) { @@ -4130,12 +4727,12 @@ void TileData::move_physics_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, physics.size()); ERR_FAIL_INDEX(p_to_pos, physics.size() + 1); physics.insert(p_to_pos, physics[p_from_index]); - physics.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + physics.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); } void TileData::remove_physics_layer(int p_index) { ERR_FAIL_INDEX(p_index, physics.size()); - physics.remove(p_index); + physics.remove_at(p_index); } void TileData::add_terrain_set(int p_to_pos) { @@ -4219,12 +4816,12 @@ void TileData::move_navigation_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, navigation.size()); ERR_FAIL_INDEX(p_to_pos, navigation.size() + 1); navigation.insert(p_to_pos, navigation[p_from_index]); - navigation.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + navigation.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); } void TileData::remove_navigation_layer(int p_index) { ERR_FAIL_INDEX(p_index, navigation.size()); - navigation.remove(p_index); + navigation.remove_at(p_index); } void TileData::add_custom_data_layer(int p_to_pos) { @@ -4239,12 +4836,12 @@ void TileData::move_custom_data_layer(int p_from_index, int p_to_pos) { ERR_FAIL_INDEX(p_from_index, custom_data.size()); ERR_FAIL_INDEX(p_to_pos, custom_data.size() + 1); custom_data.insert(p_to_pos, navigation[p_from_index]); - custom_data.remove(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); + custom_data.remove_at(p_to_pos < p_from_index ? p_from_index + 1 : p_from_index); } void TileData::remove_custom_data_layer(int p_index) { ERR_FAIL_INDEX(p_index, custom_data.size()); - custom_data.remove(p_index); + custom_data.remove_at(p_index); } void TileData::reset_state() { @@ -4262,6 +4859,37 @@ bool TileData::is_allowing_transform() const { return allow_transform; } +TileData *TileData::duplicate() { + TileData *output = memnew(TileData); + output->tile_set = tile_set; + + output->allow_transform = allow_transform; + + // Rendering + output->flip_h = flip_h; + output->flip_v = flip_v; + output->transpose = transpose; + output->tex_offset = tex_offset; + output->material = material; + output->modulate = modulate; + output->z_index = z_index; + output->y_sort_origin = y_sort_origin; + output->occluders = occluders; + // Physics + output->physics = physics; + // Terrain + output->terrain_set = -1; + memcpy(output->terrain_peering_bits, terrain_peering_bits, 16 * sizeof(int)); + // Navigation + output->navigation = navigation; + // Misc + output->probability = probability; + // Custom data + output->custom_data = custom_data; + + return output; +} + // Rendering void TileData::set_flip_h(bool p_flip_h) { ERR_FAIL_COND_MSG(!allow_transform && p_flip_h, "Transform is only allowed for alternative tiles (with its alternative_id != 0)"); @@ -4369,6 +4997,9 @@ real_t TileData::get_constant_angular_velocity(int p_layer_id) const { void TileData::set_collision_polygons_count(int p_layer_id, int p_polygons_count) { ERR_FAIL_INDEX(p_layer_id, physics.size()); ERR_FAIL_COND(p_polygons_count < 0); + if (p_polygons_count == physics.write[p_layer_id].polygons.size()) { + return; + } physics.write[p_layer_id].polygons.resize(p_polygons_count); notify_property_list_changed(); emit_signal(SNAME("changed")); @@ -4388,7 +5019,7 @@ void TileData::add_collision_polygon(int p_layer_id) { void TileData::remove_collision_polygon(int p_layer_id, int p_polygon_index) { ERR_FAIL_INDEX(p_layer_id, physics.size()); ERR_FAIL_INDEX(p_polygon_index, physics[p_layer_id].polygons.size()); - physics.write[p_layer_id].polygons.remove(p_polygon_index); + physics.write[p_layer_id].polygons.remove_at(p_polygon_index); emit_signal(SNAME("changed")); } @@ -4457,8 +5088,8 @@ int TileData::get_collision_polygon_shapes_count(int p_layer_id, int p_polygon_i Ref<ConvexPolygonShape2D> TileData::get_collision_polygon_shape(int p_layer_id, int p_polygon_index, int shape_index) const { ERR_FAIL_INDEX_V(p_layer_id, physics.size(), 0); ERR_FAIL_INDEX_V(p_polygon_index, physics[p_layer_id].polygons.size(), Ref<ConvexPolygonShape2D>()); - ERR_FAIL_INDEX_V(shape_index, (int)physics[p_layer_id].polygons[shape_index].shapes.size(), Ref<ConvexPolygonShape2D>()); - return physics[p_layer_id].polygons[shape_index].shapes[shape_index]; + ERR_FAIL_INDEX_V(shape_index, (int)physics[p_layer_id].polygons[p_polygon_index].shapes.size(), Ref<ConvexPolygonShape2D>()); + return physics[p_layer_id].polygons[p_polygon_index].shapes[shape_index]; } // Terrain @@ -4505,6 +5136,18 @@ bool TileData::is_valid_peering_bit_terrain(TileSet::CellNeighbor p_peering_bit) return tile_set->is_valid_peering_bit_terrain(terrain_set, p_peering_bit); } +TileSet::TerrainsPattern TileData::get_terrains_pattern() const { + ERR_FAIL_COND_V(!tile_set, TileSet::TerrainsPattern()); + + TileSet::TerrainsPattern output(tile_set, terrain_set); + for (int i = 0; i < TileSet::CELL_NEIGHBOR_MAX; i++) { + if (tile_set->is_valid_peering_bit_terrain(terrain_set, TileSet::CellNeighbor(i))) { + output.set_terrain(TileSet::CellNeighbor(i), get_peering_bit_terrain(TileSet::CellNeighbor(i))); + } + } + return output; +} + // Navigation void TileData::set_navigation_polygon(int p_layer_id, Ref<NavigationPolygon> p_navigation_polygon) { ERR_FAIL_INDEX(p_layer_id, navigation.size()); @@ -4562,9 +5205,6 @@ bool TileData::_set(const StringName &p_name, const Variant &p_value) { ERR_FAIL_COND_V(layer_index < 0, false); if (components[1] == "polygon") { Ref<OccluderPolygon2D> polygon = p_value; - if (!polygon.is_valid()) { - return false; - } if (layer_index >= occluders.size()) { if (tile_set) { @@ -4636,9 +5276,6 @@ bool TileData::_set(const StringName &p_name, const Variant &p_value) { ERR_FAIL_COND_V(layer_index < 0, false); if (components[1] == "polygon") { Ref<NavigationPolygon> polygon = p_value; - if (!polygon.is_valid()) { - return false; - } if (layer_index >= navigation.size()) { if (tile_set) { diff --git a/scene/resources/tile_set.h b/scene/resources/tile_set.h index 351bdff89d..d2238c26d2 100644 --- a/scene/resources/tile_set.h +++ b/scene/resources/tile_set.h @@ -60,6 +60,84 @@ class TileSetPluginAtlasRendering; class TileSetPluginAtlasPhysics; class TileSetPluginAtlasNavigation; +union TileMapCell { + struct { + int32_t source_id : 16; + int16_t coord_x : 16; + int16_t coord_y : 16; + int32_t alternative_tile : 16; + }; + + uint64_t _u64t; + TileMapCell(int p_source_id = -1, Vector2i p_atlas_coords = Vector2i(-1, -1), int p_alternative_tile = -1) { // default are INVALID_SOURCE, INVALID_ATLAS_COORDS, INVALID_TILE_ALTERNATIVE + source_id = p_source_id; + set_atlas_coords(p_atlas_coords); + alternative_tile = p_alternative_tile; + } + + Vector2i get_atlas_coords() const { + return Vector2i(coord_x, coord_y); + } + + void set_atlas_coords(const Vector2i &r_coords) { + coord_x = r_coords.x; + coord_y = r_coords.y; + } + + bool operator<(const TileMapCell &p_other) const { + if (source_id == p_other.source_id) { + if (coord_x == p_other.coord_x) { + if (coord_y == p_other.coord_y) { + return alternative_tile < p_other.alternative_tile; + } else { + return coord_y < p_other.coord_y; + } + } else { + return coord_x < p_other.coord_x; + } + } else { + return source_id < p_other.source_id; + } + } + + bool operator!=(const TileMapCell &p_other) const { + return !(source_id == p_other.source_id && coord_x == p_other.coord_x && coord_y == p_other.coord_y && alternative_tile == p_other.alternative_tile); + } +}; + +class TileMapPattern : public Resource { + GDCLASS(TileMapPattern, Resource); + + Vector2i size; + Map<Vector2i, TileMapCell> pattern; + + void _set_tile_data(const Vector<int> &p_data); + Vector<int> _get_tile_data() const; + +protected: + bool _set(const StringName &p_name, const Variant &p_value); + bool _get(const StringName &p_name, Variant &r_ret) const; + void _get_property_list(List<PropertyInfo> *p_list) const; + + static void _bind_methods(); + +public: + void set_cell(const Vector2i &p_coords, int p_source_id, const Vector2i p_atlas_coords, int p_alternative_tile = 0); + bool has_cell(const Vector2i &p_coords) const; + void remove_cell(const Vector2i &p_coords, bool p_update_size = true); + int get_cell_source_id(const Vector2i &p_coords) const; + Vector2i get_cell_atlas_coords(const Vector2i &p_coords) const; + int get_cell_alternative_tile(const Vector2i &p_coords) const; + + TypedArray<Vector2i> get_used_cells() const; + + Vector2i get_size() const; + void set_size(const Vector2i &p_size); + bool is_empty() const; + + void clear(); +}; + class TileSet : public Resource { GDCLASS(TileSet, Resource); @@ -176,6 +254,30 @@ public: Vector2 offset; }; + class TerrainsPattern { + bool valid = false; + int bits[TileSet::CELL_NEIGHBOR_MAX]; + bool is_valid_bit[TileSet::CELL_NEIGHBOR_MAX]; + + int not_empty_terrains_count = 0; + + public: + bool is_valid() const; + bool is_erase_pattern() const; + + bool operator<(const TerrainsPattern &p_terrains_pattern) const; + bool operator==(const TerrainsPattern &p_terrains_pattern) const; + + void set_terrain(TileSet::CellNeighbor p_peering_bit, int p_terrain); + int get_terrain(TileSet::CellNeighbor p_peering_bit) const; + + void set_terrains_from_array(Array p_terrains); + Array get_terrains_as_array() const; + + TerrainsPattern(const TileSet *p_tile_set, int p_terrain_set); + TerrainsPattern() {} + }; + protected: bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; @@ -225,6 +327,10 @@ private: Map<TerrainMode, Map<CellNeighbor, Ref<ArrayMesh>>> terrain_bits_meshes; bool terrain_bits_meshes_dirty = true; + LocalVector<Map<TileSet::TerrainsPattern, Set<TileMapCell>>> per_terrain_pattern_tiles; // Cached data. + bool terrains_cache_dirty = true; + void _update_terrains_cache(); + // Navigation struct NavigationLayer { uint32_t layers = 1; @@ -245,6 +351,8 @@ private: int next_source_id = 0; // --------------------- + LocalVector<Ref<TileMapPattern>> patterns; + void _compute_next_source_id(); void _source_changed(); @@ -384,6 +492,17 @@ public: void cleanup_invalid_tile_proxies(); void clear_tile_proxies(); + // Patterns. + int add_pattern(Ref<TileMapPattern> p_pattern, int p_index = -1); + Ref<TileMapPattern> get_pattern(int p_index); + void remove_pattern(int p_index); + int get_patterns_count(); + + // Terrains. + Set<TerrainsPattern> get_terrains_pattern_set(int p_terrain_set); + Set<TileMapCell> get_tiles_for_terrains_pattern(int p_terrain_set, TerrainsPattern p_terrain_tile_pattern); + TileMapCell get_random_tile_from_terrains_pattern(int p_terrain_set, TerrainsPattern p_terrain_tile_pattern); + // Helpers Vector<Vector2> get_tile_shape_polygon(); void draw_tile_shape(CanvasItem *p_canvas_item, Transform2D p_transform, Color p_color, bool p_filled = false, Ref<Texture2D> p_texture = Ref<Texture2D>()); @@ -484,6 +603,12 @@ private: void _clear_tiles_outside_texture(); + bool use_texture_padding = true; + Ref<ImageTexture> padded_texture; + bool padded_texture_needs_update = false; + void _queue_update_padded_texture(); + void _update_padded_texture(); + protected: bool _set(const StringName &p_name, const Variant &p_value); bool _get(const StringName &p_name, Variant &r_ret) const; @@ -494,6 +619,7 @@ protected: public: // Not exposed. virtual void set_tile_set(const TileSet *p_tile_set) override; + const TileSet *get_tile_set() const; virtual void notify_tile_data_properties_should_change() override; virtual void add_occlusion_layer(int p_index) override; virtual void move_occlusion_layer(int p_from_index, int p_to_pos) override; @@ -525,6 +651,10 @@ public: void set_texture_region_size(Vector2i p_tile_size); Vector2i get_texture_region_size() const; + // Padding. + void set_use_texture_padding(bool p_use_padding); + bool get_use_texture_padding() const; + // Base tiles. void create_tile(const Vector2i p_atlas_coords, const Vector2i p_size = Vector2i(1, 1)); void remove_tile(Vector2i p_atlas_coords); @@ -570,6 +700,10 @@ public: Rect2i get_tile_texture_region(Vector2i p_atlas_coords, int p_frame = 0) const; Vector2i get_tile_effective_texture_offset(Vector2i p_atlas_coords, int p_alternative_tile) const; + // Getters for texture and tile region (padded or not) + Ref<Texture2D> get_runtime_texture() const; + Rect2i get_runtime_tile_texture_region(Vector2i p_atlas_coords, int p_frame = 0) const; + ~TileSetAtlasSource(); }; @@ -647,7 +781,7 @@ private: }; Vector2 linear_velocity; - float angular_velocity = 0.0; + double angular_velocity = 0.0; Vector<PolygonShapeTileData> polygons; }; Vector<PhysicsLayerTileData> physics; @@ -698,6 +832,9 @@ public: void set_allow_transform(bool p_allow_transform); bool is_allowing_transform() const; + // To duplicate a TileData object, needed for runtiume update. + TileData *duplicate(); + // Rendering void set_flip_h(bool p_flip_h); bool get_flip_h() const; @@ -745,6 +882,8 @@ public: int get_peering_bit_terrain(TileSet::CellNeighbor p_peering_bit) const; bool is_valid_peering_bit_terrain(TileSet::CellNeighbor p_peering_bit) const; + TileSet::TerrainsPattern get_terrains_pattern() const; // Not exposed. + // Navigation void set_navigation_polygon(int p_layer_id, Ref<NavigationPolygon> p_navigation_polygon); Ref<NavigationPolygon> get_navigation_polygon(int p_layer_id) const; diff --git a/scene/resources/visual_shader.cpp b/scene/resources/visual_shader.cpp index 0dc83b4bb8..10e75fb023 100644 --- a/scene/resources/visual_shader.cpp +++ b/scene/resources/visual_shader.cpp @@ -36,6 +36,11 @@ #include "visual_shader_particle_nodes.h" #include "visual_shader_sdf_nodes.h" +String make_unique_id(VisualShader::Type p_type, int p_id, const String &p_name) { + static const char *typepf[VisualShader::TYPE_MAX] = { "vtx", "frg", "lgt", "start", "process", "collide", "start_custom", "process_custom", "sky", "fog" }; + return p_name + "_" + String(typepf[p_type]) + "_" + itos(p_id); +} + bool VisualShaderNode::is_simple_decl() const { return simple_decl; } @@ -199,6 +204,10 @@ Vector<StringName> VisualShaderNode::get_editable_properties() const { return Vector<StringName>(); } +Map<StringName, String> VisualShaderNode::get_editable_properties_names() const { + return Map<StringName, String>(); +} + Array VisualShaderNode::get_default_input_values() const { Array ret; for (const KeyValue<int, Variant> &E : default_input_values) { @@ -246,8 +255,8 @@ void VisualShaderNode::_bind_methods() { ClassDB::bind_method(D_METHOD("get_default_input_values"), &VisualShaderNode::get_default_input_values); ADD_PROPERTY(PropertyInfo(Variant::INT, "output_port_for_preview"), "set_output_port_for_preview", "get_output_port_for_preview"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "default_input_values", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "set_default_input_values", "get_default_input_values"); - ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "expanded_output_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_output_ports_expanded", "_get_output_ports_expanded"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "default_input_values", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "set_default_input_values", "get_default_input_values"); + ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "expanded_output_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_output_ports_expanded", "_get_output_ports_expanded"); ADD_SIGNAL(MethodInfo("editor_refresh_request")); BIND_ENUM_CONSTANT(PORT_TYPE_SCALAR); @@ -350,7 +359,7 @@ String VisualShaderNodeCustom::generate_code(Shader::Mode p_mode, VisualShader:: } String code = " {\n"; String _code; - GDVIRTUAL_CALL(_get_code, input_vars, output_vars, (int)p_mode, (int)p_type, _code); + GDVIRTUAL_CALL(_get_code, input_vars, output_vars, p_mode, p_type, _code); bool nend = _code.ends_with("\n"); _code = _code.insert(0, " "); _code = _code.replace("\n", "\n "); @@ -358,7 +367,7 @@ String VisualShaderNodeCustom::generate_code(Shader::Mode p_mode, VisualShader:: if (!nend) { code += "\n }"; } else { - code.remove(code.size() - 1); + code.remove_at(code.size() - 1); code += "}"; } code += "\n"; @@ -367,7 +376,7 @@ String VisualShaderNodeCustom::generate_code(Shader::Mode p_mode, VisualShader:: String VisualShaderNodeCustom::generate_global_per_node(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { String ret; - if (GDVIRTUAL_CALL(_get_global_code, (int)p_mode, ret)) { + if (GDVIRTUAL_CALL(_get_global_code, p_mode, ret)) { String code = "// " + get_caption() + "\n"; code += ret; code += "\n"; @@ -431,7 +440,7 @@ void VisualShaderNodeCustom::_bind_methods() { ClassDB::bind_method(D_METHOD("_is_initialized"), &VisualShaderNodeCustom::_is_initialized); ClassDB::bind_method(D_METHOD("_set_input_port_default_value", "port", "value"), &VisualShaderNodeCustom::_set_input_port_default_value); - ADD_PROPERTY(PropertyInfo(Variant::BOOL, "initialized", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_initialized", "_is_initialized"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "initialized", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_initialized", "_is_initialized"); } VisualShaderNodeCustom::VisualShaderNodeCustom() { @@ -970,7 +979,7 @@ String VisualShader::generate_preview_shader(Type p_type, int p_node, int p_port String VisualShader::validate_port_name(const String &p_port_name, VisualShaderNode *p_node, int p_port_id, bool p_output) const { String name = p_port_name; - if (name == String()) { + if (name.is_empty()) { return String(); } @@ -978,7 +987,7 @@ String VisualShader::validate_port_name(const String &p_port_name, VisualShaderN name = name.substr(1, name.length() - 1); } - if (name != String()) { + if (!name.is_empty()) { String valid_name; for (int i = 0; i < name.length(); i++) { @@ -1022,7 +1031,7 @@ String VisualShader::validate_uniform_name(const String &p_name, const Ref<Visua while (name.length() && !IS_INITIAL_CHAR(name[0])) { name = name.substr(1, name.length() - 1); } - if (name != String()) { + if (!name.is_empty()) { String valid_name; for (int i = 0; i < name.length(); i++) { @@ -1036,7 +1045,7 @@ String VisualShader::validate_uniform_name(const String &p_name, const Ref<Visua name = valid_name; } - if (name == String()) { + if (name.is_empty()) { name = p_uniform->get_caption(); } @@ -1066,7 +1075,7 @@ String VisualShader::validate_uniform_name(const String &p_name, const Ref<Visua while (name.length() && name[name.length() - 1] >= '0' && name[name.length() - 1] <= '9') { name = name.substr(0, name.length() - 1); } - ERR_FAIL_COND_V(name == String(), String()); + ERR_FAIL_COND_V(name.is_empty(), String()); name += itos(attempt); } else { break; @@ -1096,6 +1105,7 @@ static const char *type_string[VisualShader::TYPE_MAX] = { "start_custom", "process_custom", "sky", + "fog", }; bool VisualShader::_set(const StringName &p_name, const Variant &p_value) { @@ -1245,7 +1255,7 @@ void VisualShader::reset_state() { } void VisualShader::_get_property_list(List<PropertyInfo> *p_list) const { //mode - p_list->push_back(PropertyInfo(Variant::INT, "mode", PROPERTY_HINT_ENUM, "Node3D,CanvasItem,Particles,Sky")); + p_list->push_back(PropertyInfo(Variant::INT, "mode", PROPERTY_HINT_ENUM, "Node3D,CanvasItem,Particles,Sky,Fog")); //render modes Map<String, String> blend_mode_enums; @@ -1290,20 +1300,20 @@ void VisualShader::_get_property_list(List<PropertyInfo> *p_list) const { prop_name += "/" + itos(E.key); if (E.key != NODE_ID_OUTPUT) { - p_list->push_back(PropertyInfo(Variant::OBJECT, prop_name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "VisualShaderNode", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_DO_NOT_SHARE_ON_DUPLICATE)); + p_list->push_back(PropertyInfo(Variant::OBJECT, prop_name + "/node", PROPERTY_HINT_RESOURCE_TYPE, "VisualShaderNode", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_DO_NOT_SHARE_ON_DUPLICATE)); } - p_list->push_back(PropertyInfo(Variant::VECTOR2, prop_name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR2, prop_name + "/position", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); if (Object::cast_to<VisualShaderNodeGroupBase>(E.value.node.ptr()) != nullptr) { - p_list->push_back(PropertyInfo(Variant::VECTOR2, prop_name + "/size", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/input_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/output_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::VECTOR2, prop_name + "/size", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/input_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/output_ports", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } if (Object::cast_to<VisualShaderNodeExpression>(E.value.node.ptr()) != nullptr) { - p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/expression", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::STRING, prop_name + "/expression", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } } - p_list->push_back(PropertyInfo(Variant::PACKED_INT32_ARRAY, "nodes/" + String(type_string[i]) + "/connections", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); + p_list->push_back(PropertyInfo(Variant::PACKED_INT32_ARRAY, "nodes/" + String(type_string[i]) + "/connections", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR)); } } @@ -1558,7 +1568,7 @@ Error VisualShader::_write_node(Type type, StringBuilder &global_code, StringBui } node_code += vsnode->generate_code(get_mode(), type, node, inputs, outputs, for_preview); - if (node_code != String()) { + if (!node_code.is_empty()) { code += node_name; code += node_code; code += "\n"; @@ -1636,7 +1646,7 @@ void VisualShader::_update_shader() const { Vector<VisualShader::DefaultTextureParam> default_tex_params; Set<StringName> classes; Map<int, int> insertion_pos; - static const char *shader_mode_str[Shader::MODE_MAX] = { "spatial", "canvas_item", "particles", "sky" }; + static const char *shader_mode_str[Shader::MODE_MAX] = { "spatial", "canvas_item", "particles", "sky", "fog" }; global_code += String() + "shader_type " + shader_mode_str[shader_mode] + ";\n"; @@ -1654,7 +1664,7 @@ void VisualShader::_update_shader() const { String mode = ShaderTypes::get_singleton()->get_modes(RenderingServer::ShaderMode(shader_mode))[i]; if (mode.begins_with(render_mode_enums[idx].string)) { if (count == which) { - if (render_mode != String()) { + if (!render_mode.is_empty()) { render_mode += ", "; } render_mode += mode; @@ -1672,7 +1682,7 @@ void VisualShader::_update_shader() const { for (int i = 0; i < ShaderTypes::get_singleton()->get_modes(RenderingServer::ShaderMode(shader_mode)).size(); i++) { String mode = ShaderTypes::get_singleton()->get_modes(RenderingServer::ShaderMode(shader_mode))[i]; if (flags.has(mode)) { - if (render_mode != String()) { + if (!render_mode.is_empty()) { render_mode += ", "; } render_mode += mode; @@ -1680,11 +1690,11 @@ void VisualShader::_update_shader() const { } } - if (render_mode != String()) { + if (!render_mode.is_empty()) { global_code += "render_mode " + render_mode + ";\n\n"; } - static const char *func_name[TYPE_MAX] = { "vertex", "fragment", "light", "start", "process", "collide", "start_custom", "process_custom", "sky" }; + static const char *func_name[TYPE_MAX] = { "vertex", "fragment", "light", "start", "process", "collide", "start_custom", "process_custom", "sky", "fog" }; String global_expressions; Set<String> used_uniform_names; @@ -1755,7 +1765,7 @@ void VisualShader::_update_shader() const { StringBuilder func_code; bool is_empty_func = false; - if (shader_mode != Shader::MODE_PARTICLES && shader_mode != Shader::MODE_SKY) { + if (shader_mode != Shader::MODE_PARTICLES && shader_mode != Shader::MODE_SKY && shader_mode != Shader::MODE_FOG) { is_empty_func = true; } @@ -1824,6 +1834,8 @@ void VisualShader::_update_shader() const { code += " vec3 __vec3_buff2;\n"; code += " float __scalar_buff1;\n"; code += " float __scalar_buff2;\n"; + code += " int __scalar_ibuff;\n"; + code += " vec4 __vec4_buff;\n"; code += " vec3 __ndiff = normalize(__diff);\n\n"; } if (has_start) { @@ -1921,6 +1933,10 @@ void VisualShader::_update_shader() const { global_compute_code += " return mat4(vec4(oc * axis.x * axis.x + c, oc * axis.x * axis.y - axis.z * s, oc * axis.z * axis.x + axis.y * s, 0), vec4(oc * axis.x * axis.y + axis.z * s, oc * axis.y * axis.y + c, oc * axis.y * axis.z - axis.x * s, 0), vec4(oc * axis.z * axis.x - axis.y * s, oc * axis.y * axis.z + axis.x * s, oc * axis.z * axis.z + c, 0), vec4(0, 0, 0, 1));\n"; global_compute_code += "}\n\n"; + global_compute_code += "vec2 __get_random_unit_vec2(inout uint seed) {\n"; + global_compute_code += " return normalize(vec2(__rand_from_seed_m1_p1(seed), __rand_from_seed_m1_p1(seed)));\n"; + global_compute_code += "}\n\n"; + global_compute_code += "vec3 __get_random_unit_vec3(inout uint seed) {\n"; global_compute_code += " return normalize(vec3(__rand_from_seed_m1_p1(seed), __rand_from_seed_m1_p1(seed), __rand_from_seed_m1_p1(seed)));\n"; global_compute_code += "}\n\n"; @@ -1947,7 +1963,9 @@ void VisualShader::_update_shader() const { const_cast<VisualShader *>(this)->set_code(final_code); for (int i = 0; i < default_tex_params.size(); i++) { - const_cast<VisualShader *>(this)->set_default_texture_param(default_tex_params[i].name, default_tex_params[i].param); + for (int j = 0; j < default_tex_params[i].params.size(); j++) { + const_cast<VisualShader *>(this)->set_default_texture_param(default_tex_params[i].name, default_tex_params[i].params[j], j); + } } if (previous_code != final_code) { const_cast<VisualShader *>(this)->emit_signal(SNAME("changed")); @@ -2016,8 +2034,8 @@ void VisualShader::_bind_methods() { ClassDB::bind_method(D_METHOD("_update_shader"), &VisualShader::_update_shader); - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_graph_offset", "get_graph_offset"); - ADD_PROPERTY(PropertyInfo(Variant::STRING, "engine_version", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR), "set_engine_version", "get_engine_version"); + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "graph_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_graph_offset", "get_graph_offset"); + ADD_PROPERTY(PropertyInfo(Variant::STRING, "engine_version", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR), "set_engine_version", "get_engine_version"); ADD_PROPERTY_DEFAULT("code", ""); // Inherited from Shader, prevents showing default code as override in docs. @@ -2030,6 +2048,7 @@ void VisualShader::_bind_methods() { BIND_ENUM_CONSTANT(TYPE_START_CUSTOM); BIND_ENUM_CONSTANT(TYPE_PROCESS_CUSTOM); BIND_ENUM_CONSTANT(TYPE_SKY); + BIND_ENUM_CONSTANT(TYPE_FOG); BIND_ENUM_CONSTANT(TYPE_MAX); BIND_CONSTANT(NODE_ID_INVALID); @@ -2307,6 +2326,16 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_VECTOR, "sky_coords", "vec3(SKY_COORDS, 0.0)" }, { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, + // Fog, Fog + + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "world_position", "WORLD_POSITION" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "object_position", "OBJECT_POSITION" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "uvw", "UVW" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "extents", "EXTENTS" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_TRANSFORM, "transform", "TRANSFORM" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_SCALAR, "sdf", "SDF" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, + { Shader::MODE_MAX, VisualShader::TYPE_MAX, VisualShaderNode::PORT_TYPE_TRANSFORM, nullptr, nullptr }, }; @@ -2373,11 +2402,6 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::preview_ports[] = { { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "screen_uv", "vec3(SCREEN_UV, 0.0)" }, { Shader::MODE_CANVAS_ITEM, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, - // Sky - - { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_VECTOR, "screen_uv", "vec3(SCREEN_UV, 0.0)" }, - { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, - // Particles { Shader::MODE_PARTICLES, VisualShader::TYPE_START, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, @@ -2386,6 +2410,15 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::preview_ports[] = { { Shader::MODE_PARTICLES, VisualShader::TYPE_START_CUSTOM, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, { Shader::MODE_PARTICLES, VisualShader::TYPE_PROCESS_CUSTOM, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, + // Sky + + { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_VECTOR, "screen_uv", "vec3(SCREEN_UV, 0.0)" }, + { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, + + // Fog + + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_SCALAR, "time", "TIME" }, + { Shader::MODE_MAX, VisualShader::TYPE_MAX, VisualShaderNode::PORT_TYPE_TRANSFORM, nullptr, nullptr }, }; @@ -2435,7 +2468,7 @@ String VisualShaderNodeInput::generate_code(Shader::Mode p_mode, VisualShader::T idx++; } - if (code == String()) { + if (code.is_empty()) { switch (get_output_port_type(0)) { case PORT_TYPE_SCALAR: { code = " " + p_output_vars[0] + " = 0.0;\n"; @@ -2469,7 +2502,7 @@ String VisualShaderNodeInput::generate_code(Shader::Mode p_mode, VisualShader::T idx++; } - if (code == String()) { + if (code.is_empty()) { code = " " + p_output_vars[0] + " = 0.0;\n"; //default (none found) is scalar } @@ -2572,7 +2605,7 @@ void VisualShaderNodeInput::_validate_property(PropertyInfo &property) const { while (ports[idx].mode != Shader::MODE_MAX) { if (ports[idx].mode == shader_mode && ports[idx].shader_type == shader_type) { - if (port_list != String()) { + if (!port_list.is_empty()) { port_list += ","; } port_list += ports[idx].name; @@ -2580,7 +2613,7 @@ void VisualShaderNodeInput::_validate_property(PropertyInfo &property) const { idx++; } - if (port_list == "") { + if (port_list.is_empty()) { port_list = TTR("None"); } property.hint_string = port_list; @@ -2834,7 +2867,7 @@ void VisualShaderNodeUniformRef::_bind_methods() { ClassDB::bind_method(D_METHOD("_get_uniform_type"), &VisualShaderNodeUniformRef::_get_uniform_type); ADD_PROPERTY(PropertyInfo(Variant::STRING_NAME, "uniform_name", PROPERTY_HINT_ENUM, ""), "set_uniform_name", "get_uniform_name"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "uniform_type", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_uniform_type", "_get_uniform_type"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "uniform_type", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NO_EDITOR | PROPERTY_USAGE_INTERNAL), "_set_uniform_type", "_get_uniform_type"); } Vector<StringName> VisualShaderNodeUniformRef::get_editable_properties() const { @@ -2933,6 +2966,13 @@ const VisualShaderNodeOutput::Port VisualShaderNodeOutput::ports[] = { { Shader::MODE_SKY, VisualShader::TYPE_SKY, VisualShaderNode::PORT_TYPE_SCALAR, "fog_alpha", "FOG.a" }, //////////////////////////////////////////////////////////////////////// + // Fog, Fog. + //////////////////////////////////////////////////////////////////////// + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_SCALAR, "density", "DENSITY" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "albedo", "ALBEDO" }, + { Shader::MODE_FOG, VisualShader::TYPE_FOG, VisualShaderNode::PORT_TYPE_VECTOR, "emission", "EMISSION" }, + + //////////////////////////////////////////////////////////////////////// { Shader::MODE_MAX, VisualShader::TYPE_MAX, VisualShaderNode::PORT_TYPE_TRANSFORM, nullptr, nullptr }, }; @@ -3023,7 +3063,7 @@ String VisualShaderNodeOutput::generate_code(Shader::Mode p_mode, VisualShader:: String code; while (ports[idx].mode != Shader::MODE_MAX) { if (ports[idx].mode == shader_mode && ports[idx].shader_type == shader_type) { - if (p_input_vars[count] != String()) { + if (!p_input_vars[count].is_empty()) { String s = ports[idx].string; if (s.find(":") != -1) { code += " " + s.get_slicec(':', 0) + " = " + p_input_vars[count] + "." + s.get_slicec(':', 1) + ";\n"; @@ -3413,7 +3453,7 @@ void VisualShaderNodeGroupBase::add_input_port(int p_id, int p_type, const Strin count++; } - inputs.erase(index, count); + inputs = inputs.left(index) + inputs.substr(index + count); inputs = inputs.insert(index, itos(i)); index += inputs_strings[i].size(); } @@ -3436,7 +3476,7 @@ void VisualShaderNodeGroupBase::remove_input_port(int p_id) { } index += inputs_strings[i].size(); } - inputs.erase(index, count); + inputs = inputs.left(index) + inputs.substr(index + count); inputs_strings = inputs.split(";", false); inputs = inputs.substr(0, index); @@ -3489,7 +3529,7 @@ void VisualShaderNodeGroupBase::add_output_port(int p_id, int p_type, const Stri count++; } - outputs.erase(index, count); + outputs = outputs.left(index) + outputs.substr(index + count); outputs = outputs.insert(index, itos(i)); index += outputs_strings[i].size(); } @@ -3512,7 +3552,7 @@ void VisualShaderNodeGroupBase::remove_output_port(int p_id) { } index += outputs_strings[i].size(); } - outputs.erase(index, count); + outputs = outputs.left(index) + outputs.substr(index + count); outputs_strings = outputs.split(";", false); outputs = outputs.substr(0, index); @@ -3564,8 +3604,7 @@ void VisualShaderNodeGroupBase::set_input_port_type(int p_id, int p_type) { index += inputs_strings[i].size(); } - inputs.erase(index, count); - + inputs = inputs.left(index) + inputs.substr(index + count); inputs = inputs.insert(index, itos(p_type)); _apply_port_changes(); @@ -3600,8 +3639,7 @@ void VisualShaderNodeGroupBase::set_input_port_name(int p_id, const String &p_na index += inputs_strings[i].size(); } - inputs.erase(index, count); - + inputs = inputs.left(index) + inputs.substr(index + count); inputs = inputs.insert(index, p_name); _apply_port_changes(); @@ -3636,7 +3674,7 @@ void VisualShaderNodeGroupBase::set_output_port_type(int p_id, int p_type) { index += output_strings[i].size(); } - outputs.erase(index, count); + outputs = outputs.left(index) + outputs.substr(index + count); outputs = outputs.insert(index, itos(p_type)); @@ -3672,7 +3710,7 @@ void VisualShaderNodeGroupBase::set_output_port_name(int p_id, const String &p_n index += output_strings[i].size(); } - outputs.erase(index, count); + outputs = outputs.left(index) + outputs.substr(index + count); outputs = outputs.insert(index, p_name); diff --git a/scene/resources/visual_shader.h b/scene/resources/visual_shader.h index f910f28536..5bb9d45f39 100644 --- a/scene/resources/visual_shader.h +++ b/scene/resources/visual_shader.h @@ -57,6 +57,7 @@ public: TYPE_START_CUSTOM, TYPE_PROCESS_CUSTOM, TYPE_SKY, + TYPE_FOG, TYPE_MAX }; @@ -69,7 +70,7 @@ public: struct DefaultTextureParam { StringName name; - Ref<Texture2D> param; + List<Ref<Texture2D>> params; }; private: @@ -271,6 +272,7 @@ public: void set_disabled(bool p_disabled = true); virtual Vector<StringName> get_editable_properties() const; + virtual Map<StringName, String> get_editable_properties_names() const; virtual Vector<VisualShader::DefaultTextureParam> get_default_texture_parameters(VisualShader::Type p_type, int p_id) const; virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const; @@ -326,8 +328,8 @@ protected: GDVIRTUAL0RC(int, _get_output_port_count) GDVIRTUAL1RC(int, _get_output_port_type, int) GDVIRTUAL1RC(String, _get_output_port_name, int) - GDVIRTUAL4RC(String, _get_code, Vector<String>, TypedArray<String>, int, int) - GDVIRTUAL1RC(String, _get_global_code, int) + GDVIRTUAL4RC(String, _get_code, Vector<String>, TypedArray<String>, Shader::Mode, VisualShader::Type) + GDVIRTUAL1RC(String, _get_global_code, Shader::Mode) GDVIRTUAL0RC(bool, _is_highend) protected: @@ -695,4 +697,6 @@ public: VisualShaderNodeGlobalExpression(); }; +extern String make_unique_id(VisualShader::Type p_type, int p_id, const String &p_name); + #endif // VISUAL_SHADER_H diff --git a/scene/resources/visual_shader_nodes.cpp b/scene/resources/visual_shader_nodes.cpp index c3d9ef7b04..51e7ec8092 100644 --- a/scene/resources/visual_shader_nodes.cpp +++ b/scene/resources/visual_shader_nodes.cpp @@ -494,15 +494,10 @@ String VisualShaderNodeTexture::get_input_port_default_hint(int p_port) const { return ""; } -static String make_unique_id(VisualShader::Type p_type, int p_id, const String &p_name) { - static const char *typepf[VisualShader::TYPE_MAX] = { "vtx", "frg", "lgt" }; - return p_name + "_" + String(typepf[p_type]) + "_" + itos(p_id); -} - Vector<VisualShader::DefaultTextureParam> VisualShaderNodeTexture::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "tex"); - dtp.param = texture; + dtp.params.push_back(texture); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -540,15 +535,15 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (source == SOURCE_TEXTURE) { String id = make_unique_id(p_type, p_id, "tex"); String code; - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n"; } else { code += " vec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 " + id + "_read = texture(" + id + ", " + p_input_vars[0] + ".xy);\n"; } else { @@ -565,18 +560,18 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: String code; code += " {\n"; - if (id == String()) { + if (id.is_empty()) { code += " vec4 " + id + "_tex_read = vec4(0.0);\n"; } else { - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { code += " vec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 " + id + "_tex_read = texture(" + id + ", " + p_input_vars[0] + ".xy);\n"; } else { @@ -592,15 +587,15 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (source == SOURCE_SCREEN && (p_mode == Shader::MODE_SPATIAL || p_mode == Shader::MODE_CANVAS_ITEM) && p_type == VisualShader::TYPE_FRAGMENT) { String code = " {\n"; - if (p_input_vars[0] == String() || p_for_preview) { // Use UV by default. + if (p_input_vars[0].is_empty() || p_for_preview) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", 0.0 );\n"; } else { code += " vec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 _tex_read = textureLod(SCREEN_TEXTURE, " + p_input_vars[0] + ".xy, 0.0);\n"; } else { @@ -615,15 +610,15 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (source == SOURCE_2D_TEXTURE && p_mode == Shader::MODE_CANVAS_ITEM && p_type == VisualShader::TYPE_FRAGMENT) { String code = " {\n"; - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 _tex_read = texture(TEXTURE, " + default_uv + ");\n"; } else { code += " vec4 _tex_read = textureLod(TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 _tex_read = texture(TEXTURE, " + p_input_vars[0] + ".xy);\n"; } else { @@ -638,15 +633,15 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (source == SOURCE_2D_NORMAL && p_mode == Shader::MODE_CANVAS_ITEM && p_type == VisualShader::TYPE_FRAGMENT) { String code = " {\n"; - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 _tex_read = texture(NORMAL_TEXTURE, " + default_uv + ");\n"; } else { code += " vec4 _tex_read = textureLod(NORMAL_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 _tex_read = texture(NORMAL_TEXTURE, " + p_input_vars[0] + ".xy);\n"; } else { @@ -671,15 +666,15 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader: if (source == SOURCE_DEPTH && p_mode == Shader::MODE_SPATIAL && p_type == VisualShader::TYPE_FRAGMENT) { String code = " {\n"; - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " float _depth = texture(DEPTH_TEXTURE, " + default_uv + ").r;\n"; } else { code += " float _depth = textureLod(DEPTH_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ").r;\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " float _depth = texture(DEPTH_TEXTURE, " + p_input_vars[0] + ".xy).r;\n"; } else { @@ -888,7 +883,7 @@ String VisualShaderNodeCurveTexture::generate_global(Shader::Mode p_mode, Visual } String VisualShaderNodeCurveTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - if (p_input_vars[0] == String()) { + if (p_input_vars[0].is_empty()) { return " " + p_output_vars[0] + " = 0.0;\n"; } String id = make_unique_id(p_type, p_id, "curve"); @@ -900,7 +895,7 @@ String VisualShaderNodeCurveTexture::generate_code(Shader::Mode p_mode, VisualSh Vector<VisualShader::DefaultTextureParam> VisualShaderNodeCurveTexture::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "curve"); - dtp.param = texture; + dtp.params.push_back(texture); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -973,7 +968,7 @@ String VisualShaderNodeCurveXYZTexture::generate_global(Shader::Mode p_mode, Vis } String VisualShaderNodeCurveXYZTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - if (p_input_vars[0] == String()) { + if (p_input_vars[0].is_empty()) { return " " + p_output_vars[0] + " = vec3(0.0);\n"; } String id = make_unique_id(p_type, p_id, "curve3d"); @@ -985,7 +980,7 @@ String VisualShaderNodeCurveXYZTexture::generate_code(Shader::Mode p_mode, Visua Vector<VisualShader::DefaultTextureParam> VisualShaderNodeCurveXYZTexture::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "curve3d"); - dtp.param = texture; + dtp.params.push_back(texture); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -1081,14 +1076,14 @@ String VisualShaderNodeSample3D::generate_code(Shader::Mode p_mode, VisualShader } else { id = p_input_vars[2]; } - if (id != String()) { - if (p_input_vars[0] == String()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (!id.is_empty()) { + if (p_input_vars[0].is_empty()) { // Use UV by default. + if (p_input_vars[1].is_empty()) { code += " vec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { code += " vec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 " + id + "_tex_read = texture(" + id + ", " + p_input_vars[0] + ");\n"; } else { @@ -1167,7 +1162,7 @@ String VisualShaderNodeTexture2DArray::get_input_port_name(int p_port) const { Vector<VisualShader::DefaultTextureParam> VisualShaderNodeTexture2DArray::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "tex3d"); - dtp.param = texture_array; + dtp.params.push_back(texture_array); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -1224,7 +1219,7 @@ String VisualShaderNodeTexture3D::get_input_port_name(int p_port) const { Vector<VisualShader::DefaultTextureParam> VisualShaderNodeTexture3D::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "tex3d"); - dtp.param = texture; + dtp.params.push_back(texture); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -1323,7 +1318,7 @@ bool VisualShaderNodeCubemap::is_output_port_expandable(int p_port) const { Vector<VisualShader::DefaultTextureParam> VisualShaderNodeCubemap::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { VisualShader::DefaultTextureParam dtp; dtp.name = make_unique_id(p_type, p_id, "cube"); - dtp.param = cube_map; + dtp.params.push_back(cube_map); Vector<VisualShader::DefaultTextureParam> ret; ret.push_back(dtp); return ret; @@ -1369,7 +1364,7 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader: code += " {\n"; - if (id == String()) { + if (id.is_empty()) { code += " vec4 " + id + "_read = vec4(0.0);\n"; code += " " + p_output_vars[0] + " = " + id + "_read.rgb;\n"; code += " " + p_output_vars[1] + " = " + id + "_read.a;\n"; @@ -1377,15 +1372,15 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader: return code; } - if (p_input_vars[0] == String()) { // Use UV by default. + if (p_input_vars[0].is_empty()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n"; } else { code += " vec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + " );\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 " + id + "_read = texture(" + id + ", " + p_input_vars[0] + ");\n"; } else { @@ -1652,6 +1647,21 @@ String VisualShaderNodeIntOp::generate_code(Shader::Mode p_mode, VisualShader::T case OP_MIN: code += "min(" + p_input_vars[0] + ", " + p_input_vars[1] + ");\n"; break; + case OP_BITWISE_AND: + code += p_input_vars[0] + " & " + p_input_vars[1] + ";\n"; + break; + case OP_BITWISE_OR: + code += p_input_vars[0] + " | " + p_input_vars[1] + ";\n"; + break; + case OP_BITWISE_XOR: + code += p_input_vars[0] + " ^ " + p_input_vars[1] + ";\n"; + break; + case OP_BITWISE_LEFT_SHIFT: + code += p_input_vars[0] + " << " + p_input_vars[1] + ";\n"; + break; + case OP_BITWISE_RIGHT_SHIFT: + code += p_input_vars[0] + " >> " + p_input_vars[1] + ";\n"; + break; default: break; } @@ -1682,7 +1692,7 @@ void VisualShaderNodeIntOp::_bind_methods() { ClassDB::bind_method(D_METHOD("set_operator", "op"), &VisualShaderNodeIntOp::set_operator); ClassDB::bind_method(D_METHOD("get_operator"), &VisualShaderNodeIntOp::get_operator); - ADD_PROPERTY(PropertyInfo(Variant::INT, "operator", PROPERTY_HINT_ENUM, "Add,Subtract,Multiply,Divide,Remainder,Max,Min"), "set_operator", "get_operator"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "operator", PROPERTY_HINT_ENUM, "Add,Subtract,Multiply,Divide,Remainder,Max,Min,Bitwise AND,Bitwise OR,Bitwise XOR,Bitwise Left Shift,Bitwise Right Shift"), "set_operator", "get_operator"); BIND_ENUM_CONSTANT(OP_ADD); BIND_ENUM_CONSTANT(OP_SUB); @@ -1691,6 +1701,11 @@ void VisualShaderNodeIntOp::_bind_methods() { BIND_ENUM_CONSTANT(OP_MOD); BIND_ENUM_CONSTANT(OP_MAX); BIND_ENUM_CONSTANT(OP_MIN); + BIND_ENUM_CONSTANT(OP_BITWISE_AND); + BIND_ENUM_CONSTANT(OP_BITWISE_OR); + BIND_ENUM_CONSTANT(OP_BITWISE_XOR); + BIND_ENUM_CONSTANT(OP_BITWISE_LEFT_SHIFT); + BIND_ENUM_CONSTANT(OP_BITWISE_RIGHT_SHIFT); BIND_ENUM_CONSTANT(OP_ENUM_SIZE); } @@ -2338,7 +2353,8 @@ String VisualShaderNodeIntFunc::generate_code(Shader::Mode p_mode, VisualShader: static const char *functions[FUNC_MAX] = { "abs($)", "-($)", - "sign($)" + "sign($)", + "~($)" }; return " " + p_output_vars[0] + " = " + String(functions[func]).replace("$", p_input_vars[0]) + ";\n"; @@ -2367,11 +2383,12 @@ void VisualShaderNodeIntFunc::_bind_methods() { ClassDB::bind_method(D_METHOD("set_function", "func"), &VisualShaderNodeIntFunc::set_function); ClassDB::bind_method(D_METHOD("get_function"), &VisualShaderNodeIntFunc::get_function); - ADD_PROPERTY(PropertyInfo(Variant::INT, "function", PROPERTY_HINT_ENUM, "Abs,Negate,Sign"), "set_function", "get_function"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "function", PROPERTY_HINT_ENUM, "Abs,Negate,Sign,Bitwise NOT"), "set_function", "get_function"); BIND_ENUM_CONSTANT(FUNC_ABS); BIND_ENUM_CONSTANT(FUNC_NEGATE); BIND_ENUM_CONSTANT(FUNC_SIGN); + BIND_ENUM_CONSTANT(FUNC_BITWISE_NOT); BIND_ENUM_CONSTANT(FUNC_MAX); } @@ -4885,13 +4902,13 @@ String VisualShaderNodeTextureUniform::generate_code(Shader::Mode p_mode, Visual String id = get_uniform_name(); String code = " {\n"; - if (p_input_vars[0] == String()) { // Use UV by default. - if (p_input_vars[1] == String()) { + if (p_input_vars[0].is_empty()) { // Use UV by default. + if (p_input_vars[1].is_empty()) { code += " vec4 n_tex_read = texture(" + id + ", " + default_uv + ");\n"; } else { code += " vec4 n_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n"; } - } else if (p_input_vars[1] == String()) { + } else if (p_input_vars[1].is_empty()) { //no lod code += " vec4 n_tex_read = texture(" + id + ", " + p_input_vars[0] + ".xy);\n"; } else { @@ -5053,11 +5070,11 @@ String VisualShaderNodeTextureUniformTriplanar::generate_code(Shader::Mode p_mod String id = get_uniform_name(); String code = " {\n"; - if (p_input_vars[0] == String() && p_input_vars[1] == String()) { + if (p_input_vars[0].is_empty() && p_input_vars[1].is_empty()) { code += " vec4 n_tex_read = triplanar_texture(" + id + ", triplanar_power_normal, triplanar_pos);\n"; - } else if (p_input_vars[0] != String() && p_input_vars[1] == String()) { + } else if (!p_input_vars[0].is_empty() && p_input_vars[1].is_empty()) { code += " vec4 n_tex_read = triplanar_texture(" + id + ", " + p_input_vars[0] + ", triplanar_pos);\n"; - } else if (p_input_vars[0] == String() && p_input_vars[1] != String()) { + } else if (p_input_vars[0].is_empty() && !p_input_vars[1].is_empty()) { code += " vec4 n_tex_read = triplanar_texture(" + id + ", triplanar_power_normal, " + p_input_vars[1] + ");\n"; } else { code += " vec4 n_tex_read = triplanar_texture(" + id + ", " + p_input_vars[0] + ", " + p_input_vars[1] + ");\n"; @@ -5583,12 +5600,12 @@ bool VisualShaderNodeFresnel::is_generate_input_var(int p_port) const { String VisualShaderNodeFresnel::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { String normal; String view; - if (p_input_vars[0] == String()) { + if (p_input_vars[0].is_empty()) { normal = "NORMAL"; } else { normal = p_input_vars[0]; } - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { view = "VIEW"; } else { view = p_input_vars[1]; diff --git a/scene/resources/visual_shader_nodes.h b/scene/resources/visual_shader_nodes.h index 2c952300fe..2f3400404c 100644 --- a/scene/resources/visual_shader_nodes.h +++ b/scene/resources/visual_shader_nodes.h @@ -579,6 +579,11 @@ public: OP_MOD, OP_MAX, OP_MIN, + OP_BITWISE_AND, + OP_BITWISE_OR, + OP_BITWISE_XOR, + OP_BITWISE_LEFT_SHIFT, + OP_BITWISE_RIGHT_SHIFT, OP_ENUM_SIZE, }; @@ -882,6 +887,7 @@ public: FUNC_ABS, FUNC_NEGATE, FUNC_SIGN, + FUNC_BITWISE_NOT, FUNC_MAX, }; diff --git a/scene/resources/visual_shader_particle_nodes.cpp b/scene/resources/visual_shader_particle_nodes.cpp index 18b933e5cf..a7c20b2cb9 100644 --- a/scene/resources/visual_shader_particle_nodes.cpp +++ b/scene/resources/visual_shader_particle_nodes.cpp @@ -30,6 +30,8 @@ #include "visual_shader_particle_nodes.h" +#include "core/core_string_names.h" + // VisualShaderNodeParticleEmitter int VisualShaderNodeParticleEmitter::get_output_port_count() const { @@ -51,6 +53,38 @@ bool VisualShaderNodeParticleEmitter::has_output_port_preview(int p_port) const return false; } +void VisualShaderNodeParticleEmitter::set_mode_2d(bool p_enabled) { + mode_2d = p_enabled; + emit_changed(); +} + +bool VisualShaderNodeParticleEmitter::is_mode_2d() const { + return mode_2d; +} + +Vector<StringName> VisualShaderNodeParticleEmitter::get_editable_properties() const { + Vector<StringName> props; + props.push_back("mode_2d"); + return props; +} + +Map<StringName, String> VisualShaderNodeParticleEmitter::get_editable_properties_names() const { + Map<StringName, String> names; + names.insert("mode_2d", TTR("2D Mode")); + return names; +} + +bool VisualShaderNodeParticleEmitter::is_show_prop_names() const { + return true; +} + +void VisualShaderNodeParticleEmitter::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_mode_2d", "enabled"), &VisualShaderNodeParticleEmitter::set_mode_2d); + ClassDB::bind_method(D_METHOD("is_mode_2d"), &VisualShaderNodeParticleEmitter::is_mode_2d); + + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "mode_2d"), "set_mode_2d", "is_mode_2d"); +} + VisualShaderNodeParticleEmitter::VisualShaderNodeParticleEmitter() { } @@ -79,15 +113,27 @@ String VisualShaderNodeParticleSphereEmitter::get_input_port_name(int p_port) co String VisualShaderNodeParticleSphereEmitter::generate_global_per_node(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { String code; + + code += "vec2 __get_random_point_in_circle(inout uint seed, float radius, float inner_radius) {\n"; + code += " return __get_random_unit_vec2(seed) * __randf_range(seed, inner_radius, radius);\n"; + code += "}\n\n"; + code += "vec3 __get_random_point_in_sphere(inout uint seed, float radius, float inner_radius) {\n"; code += " return __get_random_unit_vec3(seed) * __randf_range(seed, inner_radius, radius);\n"; code += "}\n\n"; + return code; } String VisualShaderNodeParticleSphereEmitter::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { String code; - code += " " + p_output_vars[0] + " = __get_random_point_in_sphere(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + ");\n"; + + if (mode_2d) { + code += " " + p_output_vars[0] + " = vec3(__get_random_point_in_circle(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + "), 0.0);\n"; + } else { + code += " " + p_output_vars[0] + " = __get_random_point_in_sphere(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + ");\n"; + } + return code; } @@ -122,16 +168,27 @@ String VisualShaderNodeParticleBoxEmitter::get_input_port_name(int p_port) const String VisualShaderNodeParticleBoxEmitter::generate_global_per_node(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { String code; - code += "vec3 __get_random_point_in_box(inout uint seed, vec3 extents) {\n"; + + code += "vec2 __get_random_point_in_box2d(inout uint seed, vec2 extents) {\n"; + code += " vec2 half_extents = extents / 2.0;\n"; + code += " return vec2(__randf_range(seed, -half_extents.x, half_extents.x), __randf_range(seed, -half_extents.y, half_extents.y));\n"; + code += "}\n\n"; + + code += "vec3 __get_random_point_in_box3d(inout uint seed, vec3 extents) {\n"; code += " vec3 half_extents = extents / 2.0;\n"; code += " return vec3(__randf_range(seed, -half_extents.x, half_extents.x), __randf_range(seed, -half_extents.y, half_extents.y), __randf_range(seed, -half_extents.z, half_extents.z));\n"; code += "}\n\n"; + return code; } String VisualShaderNodeParticleBoxEmitter::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { String code; - code += " " + p_output_vars[0] + " = __get_random_point_in_box(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ");\n"; + if (mode_2d) { + code += " " + p_output_vars[0] + " = vec3(__get_random_point_in_box2d(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ".xy), 0.0);\n"; + } else { + code += " " + p_output_vars[0] + " = __get_random_point_in_box3d(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ");\n"; + } return code; } @@ -166,17 +223,31 @@ String VisualShaderNodeParticleRingEmitter::get_input_port_name(int p_port) cons String VisualShaderNodeParticleRingEmitter::generate_global_per_node(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { String code; - code += "vec3 __get_random_point_on_ring(inout uint seed, float radius, float inner_radius, float height) {\n"; - code += " float angle = __rand_from_seed(seed) * PI * 2.0;\n"; + + code += "vec2 __get_random_point_on_ring2d(inout uint seed, float radius, float inner_radius) {\n"; + code += " float angle = __rand_from_seed(seed) * TAU;\n"; + code += " vec2 ring = vec2(sin(angle), cos(angle)) * __randf_range(seed, inner_radius, radius);\n"; + code += " return vec2(ring.x, ring.y);\n"; + code += "}\n\n"; + + code += "vec3 __get_random_point_on_ring3d(inout uint seed, float radius, float inner_radius, float height) {\n"; + code += " float angle = __rand_from_seed(seed) * TAU;\n"; code += " vec2 ring = vec2(sin(angle), cos(angle)) * __randf_range(seed, inner_radius, radius);\n"; code += " return vec3(ring.x, __randf_range(seed, min(0.0, height), max(0.0, height)), ring.y);\n"; code += "}\n\n"; + return code; } String VisualShaderNodeParticleRingEmitter::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { String code; - code = " " + p_output_vars[0] + " = __get_random_point_on_ring(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + ", " + (p_input_vars[2].is_empty() ? (String)get_input_port_default_value(2) : p_input_vars[2]) + ");\n"; + + if (mode_2d) { + code = " " + p_output_vars[0] + " = vec3(__get_random_point_on_ring2d(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + "), 0.0);\n"; + } else { + code = " " + p_output_vars[0] + " = __get_random_point_on_ring3d(__seed, " + (p_input_vars[0].is_empty() ? (String)get_input_port_default_value(0) : p_input_vars[0]) + ", " + (p_input_vars[1].is_empty() ? (String)get_input_port_default_value(1) : p_input_vars[1]) + ", " + (p_input_vars[2].is_empty() ? (String)get_input_port_default_value(2) : p_input_vars[2]) + ");\n"; + } + return code; } @@ -186,6 +257,461 @@ VisualShaderNodeParticleRingEmitter::VisualShaderNodeParticleRingEmitter() { set_input_port_default_value(2, 0.0); } +// VisualShaderNodeParticleMeshEmitter + +String VisualShaderNodeParticleMeshEmitter::get_caption() const { + return "MeshEmitter"; +} + +int VisualShaderNodeParticleMeshEmitter::get_output_port_count() const { + return 6; +} + +VisualShaderNodeParticleBoxEmitter::PortType VisualShaderNodeParticleMeshEmitter::get_output_port_type(int p_port) const { + switch (p_port) { + case 0: + return PORT_TYPE_VECTOR; // position + case 1: + return PORT_TYPE_VECTOR; // normal + case 2: + return PORT_TYPE_VECTOR; // color + case 3: + return PORT_TYPE_SCALAR; // alpha + case 4: + return PORT_TYPE_VECTOR; // uv + case 5: + return PORT_TYPE_VECTOR; // uv2 + } + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeParticleMeshEmitter::get_output_port_name(int p_port) const { + switch (p_port) { + case 0: + return "position"; + case 1: + return "normal"; + case 2: + return "color"; + case 3: + return "alpha"; + case 4: + return "uv"; + case 5: + return "uv2"; + } + return String(); +} + +int VisualShaderNodeParticleMeshEmitter::get_input_port_count() const { + return 0; +} + +VisualShaderNodeParticleBoxEmitter::PortType VisualShaderNodeParticleMeshEmitter::get_input_port_type(int p_port) const { + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeParticleMeshEmitter::get_input_port_name(int p_port) const { + return String(); +} + +String VisualShaderNodeParticleMeshEmitter::generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { + String code; + + if (is_output_port_connected(0)) { // position + code += "uniform sampler2D " + make_unique_id(p_type, p_id, "mesh_vx") + ";\n"; + } + + if (is_output_port_connected(1)) { // normal + code += "uniform sampler2D " + make_unique_id(p_type, p_id, "mesh_nm") + ";\n"; + } + + if (is_output_port_connected(2) || is_output_port_connected(3)) { // color & alpha + code += "uniform sampler2D " + make_unique_id(p_type, p_id, "mesh_col") + ";\n"; + } + + if (is_output_port_connected(4)) { // uv + code += "uniform sampler2D " + make_unique_id(p_type, p_id, "mesh_uv") + ";\n"; + } + + if (is_output_port_connected(5)) { // uv2 + code += "uniform sampler2D " + make_unique_id(p_type, p_id, "mesh_uv2") + ";\n"; + } + + return code; +} + +String VisualShaderNodeParticleMeshEmitter::_generate_code(VisualShader::Type p_type, int p_id, const String *p_output_vars, int p_index, const String &p_texture_name, bool p_ignore_mode2d) const { + String code; + if (is_output_port_connected(p_index)) { + if (mode_2d && !p_ignore_mode2d) { + code += " " + p_output_vars[p_index] + " = vec3("; + code += "texelFetch("; + code += make_unique_id(p_type, p_id, p_texture_name) + ", "; + code += "ivec2(__scalar_ibuff, 0), 0).xy, 0.0);\n"; + } else { + code += " " + p_output_vars[p_index] + " = texelFetch("; + code += make_unique_id(p_type, p_id, p_texture_name) + ", "; + code += "ivec2(__scalar_ibuff, 0), 0).xyz;\n"; + } + } + return code; +} + +String VisualShaderNodeParticleMeshEmitter::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + String code; + code += " __scalar_ibuff = int(__rand_from_seed(__seed) * 65535.0) % " + itos(position_texture->get_width()) + ";\n"; + + code += _generate_code(p_type, p_id, p_output_vars, 0, "mesh_vx"); + code += _generate_code(p_type, p_id, p_output_vars, 1, "mesh_nm"); + + if (is_output_port_connected(2) || is_output_port_connected(3)) { + code += " __vec4_buff = texelFetch("; + code += make_unique_id(p_type, p_id, "mesh_col") + ", "; + code += "ivec2(__scalar_ibuff, 0), 0);\n"; + if (is_output_port_connected(2)) { + code += " " + p_output_vars[2] + " = __vec4_buff.rgb;\n"; + } else { + code += " " + p_output_vars[2] + " = vec3(0.0);\n"; + } + if (is_output_port_connected(3)) { + code += " " + p_output_vars[3] + " = __vec4_buff.a;\n"; + } else { + code += " " + p_output_vars[3] + " = 0.0;\n"; + } + } + + code += _generate_code(p_type, p_id, p_output_vars, 4, "mesh_uv", true); + code += _generate_code(p_type, p_id, p_output_vars, 5, "mesh_uv2", true); + + return code; +} + +Vector<VisualShader::DefaultTextureParam> VisualShaderNodeParticleMeshEmitter::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { + Vector<VisualShader::DefaultTextureParam> ret; + + if (is_output_port_connected(0)) { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "mesh_vx"); + dtp.params.push_back(position_texture); + ret.push_back(dtp); + } + + if (is_output_port_connected(1)) { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "mesh_nm"); + dtp.params.push_back(normal_texture); + ret.push_back(dtp); + } + + if (is_output_port_connected(2) || is_output_port_connected(3)) { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "mesh_col"); + dtp.params.push_back(color_texture); + ret.push_back(dtp); + } + + if (is_output_port_connected(4)) { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "mesh_uv"); + dtp.params.push_back(uv_texture); + ret.push_back(dtp); + } + + if (is_output_port_connected(5)) { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "mesh_uv2"); + dtp.params.push_back(uv2_texture); + ret.push_back(dtp); + } + + return ret; +} + +void VisualShaderNodeParticleMeshEmitter::_update_texture(const Vector<Vector2> &p_array, Ref<ImageTexture> &r_texture) { + Ref<Image> image; + image.instantiate(); + + if (p_array.size() == 0) { + image->create(1, 1, false, Image::Format::FORMAT_RGBF); + } else { + image->create(p_array.size(), 1, false, Image::Format::FORMAT_RGBF); + } + + for (int i = 0; i < p_array.size(); i++) { + Vector2 v = p_array[i]; + image->set_pixel(i, 0, Color(v.x, v.y, 0)); + } + if (r_texture->get_width() != p_array.size() || p_array.size() == 0) { + r_texture->create_from_image(image); + } else { + r_texture->update(image); + } +} + +void VisualShaderNodeParticleMeshEmitter::_update_texture(const Vector<Vector3> &p_array, Ref<ImageTexture> &r_texture) { + Ref<Image> image; + image.instantiate(); + + if (p_array.size() == 0) { + image->create(1, 1, false, Image::Format::FORMAT_RGBF); + } else { + image->create(p_array.size(), 1, false, Image::Format::FORMAT_RGBF); + } + + for (int i = 0; i < p_array.size(); i++) { + Vector3 v = p_array[i]; + image->set_pixel(i, 0, Color(v.x, v.y, v.z)); + } + if (r_texture->get_width() != p_array.size() || p_array.size() == 0) { + r_texture->create_from_image(image); + } else { + r_texture->update(image); + } +} + +void VisualShaderNodeParticleMeshEmitter::_update_texture(const Vector<Color> &p_array, Ref<ImageTexture> &r_texture) { + Ref<Image> image; + image.instantiate(); + + if (p_array.size() == 0) { + image->create(1, 1, false, Image::Format::FORMAT_RGBA8); + } else { + image->create(p_array.size(), 1, false, Image::Format::FORMAT_RGBA8); + } + + for (int i = 0; i < p_array.size(); i++) { + image->set_pixel(i, 0, p_array[i]); + } + if (r_texture->get_width() != p_array.size() || p_array.size() == 0) { + r_texture->create_from_image(image); + } else { + r_texture->update(image); + } +} + +void VisualShaderNodeParticleMeshEmitter::_update_textures() { + if (!mesh.is_valid()) { + return; + } + + Vector<Vector3> vertices; + Vector<Vector3> normals; + Vector<Color> colors; + Vector<Vector2> uvs; + Vector<Vector2> uvs2; + + const int surface_count = mesh->get_surface_count(); + + if (use_all_surfaces) { + for (int i = 0; i < surface_count; i++) { + const Array surface_arrays = mesh->surface_get_arrays(i); + const int surface_arrays_size = surface_arrays.size(); + + // position + if (surface_arrays_size > Mesh::ARRAY_VERTEX) { + Array vertex_array = surface_arrays[Mesh::ARRAY_VERTEX]; + for (int j = 0; j < vertex_array.size(); j++) { + vertices.push_back((Vector3)vertex_array[j]); + } + } + + // normal + if (surface_arrays_size > Mesh::ARRAY_NORMAL) { + Array normal_array = surface_arrays[Mesh::ARRAY_NORMAL]; + for (int j = 0; j < normal_array.size(); j++) { + normals.push_back((Vector3)normal_array[j]); + } + } + + // color + if (surface_arrays_size > Mesh::ARRAY_COLOR) { + Array color_array = surface_arrays[Mesh::ARRAY_COLOR]; + for (int j = 0; j < color_array.size(); j++) { + colors.push_back((Color)color_array[j]); + } + } + + // uv + if (surface_arrays_size > Mesh::ARRAY_TEX_UV) { + Array uv_array = surface_arrays[Mesh::ARRAY_TEX_UV]; + for (int j = 0; j < uv_array.size(); j++) { + uvs.push_back((Vector2)uv_array[j]); + } + } + + // uv2 + if (surface_arrays_size > Mesh::ARRAY_TEX_UV2) { + Array uv2_array = surface_arrays[Mesh::ARRAY_TEX_UV2]; + for (int j = 0; j < uv2_array.size(); j++) { + uvs2.push_back((Vector2)uv2_array[j]); + } + } + } + } else { + if (surface_index >= 0 && surface_index < surface_count) { + const Array surface_arrays = mesh->surface_get_arrays(surface_index); + const int surface_arrays_size = surface_arrays.size(); + + // position + if (surface_arrays_size > Mesh::ARRAY_VERTEX) { + Array vertex_array = surface_arrays[Mesh::ARRAY_VERTEX]; + for (int i = 0; i < vertex_array.size(); i++) { + vertices.push_back((Vector3)vertex_array[i]); + } + } + + // normal + if (surface_arrays_size > Mesh::ARRAY_NORMAL) { + Array normal_array = surface_arrays[Mesh::ARRAY_NORMAL]; + for (int i = 0; i < normal_array.size(); i++) { + normals.push_back((Vector3)normal_array[i]); + } + } + + // color + if (surface_arrays_size > Mesh::ARRAY_COLOR) { + Array color_array = surface_arrays[Mesh::ARRAY_COLOR]; + for (int i = 0; i < color_array.size(); i++) { + colors.push_back((Color)color_array[i]); + } + } + + // uv + if (surface_arrays_size > Mesh::ARRAY_TEX_UV) { + Array uv_array = surface_arrays[Mesh::ARRAY_TEX_UV]; + for (int j = 0; j < uv_array.size(); j++) { + uvs.push_back((Vector2)uv_array[j]); + } + } + + // uv2 + if (surface_arrays_size > Mesh::ARRAY_TEX_UV2) { + Array uv2_array = surface_arrays[Mesh::ARRAY_TEX_UV2]; + for (int j = 0; j < uv2_array.size(); j++) { + uvs2.push_back((Vector2)uv2_array[j]); + } + } + } + } + + _update_texture(vertices, position_texture); + _update_texture(normals, normal_texture); + _update_texture(colors, color_texture); + _update_texture(uvs, uv_texture); + _update_texture(uvs2, uv2_texture); +} + +void VisualShaderNodeParticleMeshEmitter::set_mesh(Ref<Mesh> p_mesh) { + if (mesh == p_mesh) { + return; + } + + if (mesh.is_valid()) { + Callable callable = callable_mp(this, &VisualShaderNodeParticleMeshEmitter::_update_textures); + + if (mesh->is_connected(CoreStringNames::get_singleton()->changed, callable)) { + mesh->disconnect(CoreStringNames::get_singleton()->changed, callable); + } + } + + mesh = p_mesh; + + if (mesh.is_valid()) { + Callable callable = callable_mp(this, &VisualShaderNodeParticleMeshEmitter::_update_textures); + + if (!mesh->is_connected(CoreStringNames::get_singleton()->changed, callable)) { + mesh->connect(CoreStringNames::get_singleton()->changed, callable); + } + } + + emit_changed(); +} + +Ref<Mesh> VisualShaderNodeParticleMeshEmitter::get_mesh() const { + return mesh; +} + +void VisualShaderNodeParticleMeshEmitter::set_use_all_surfaces(bool p_enabled) { + if (use_all_surfaces == p_enabled) { + return; + } + use_all_surfaces = p_enabled; + emit_changed(); +} + +bool VisualShaderNodeParticleMeshEmitter::is_use_all_surfaces() const { + return use_all_surfaces; +} + +void VisualShaderNodeParticleMeshEmitter::set_surface_index(int p_surface_index) { + if (mesh.is_valid()) { + if (mesh->get_surface_count() > 0) { + p_surface_index = CLAMP(p_surface_index, 0, mesh->get_surface_count() - 1); + } else { + p_surface_index = 0; + } + } else if (p_surface_index < 0) { + p_surface_index = 0; + } + if (surface_index == p_surface_index) { + return; + } + surface_index = p_surface_index; + emit_changed(); +} + +int VisualShaderNodeParticleMeshEmitter::get_surface_index() const { + return surface_index; +} + +Vector<StringName> VisualShaderNodeParticleMeshEmitter::get_editable_properties() const { + Vector<StringName> props = VisualShaderNodeParticleEmitter::get_editable_properties(); + + props.push_back("mesh"); + props.push_back("use_all_surfaces"); + if (!use_all_surfaces) { + props.push_back("surface_index"); + } + + return props; +} + +Map<StringName, String> VisualShaderNodeParticleMeshEmitter::get_editable_properties_names() const { + Map<StringName, String> names = VisualShaderNodeParticleEmitter::get_editable_properties_names(); + + names.insert("mesh", TTR("Mesh")); + names.insert("use_all_surfaces", TTR("Use All Surfaces")); + if (!use_all_surfaces) { + names.insert("surface_index", TTR("Surface Index")); + } + + return names; +} + +void VisualShaderNodeParticleMeshEmitter::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_mesh", "mesh"), &VisualShaderNodeParticleMeshEmitter::set_mesh); + ClassDB::bind_method(D_METHOD("get_mesh"), &VisualShaderNodeParticleMeshEmitter::get_mesh); + ClassDB::bind_method(D_METHOD("set_use_all_surfaces", "enabled"), &VisualShaderNodeParticleMeshEmitter::set_use_all_surfaces); + ClassDB::bind_method(D_METHOD("is_use_all_surfaces"), &VisualShaderNodeParticleMeshEmitter::is_use_all_surfaces); + ClassDB::bind_method(D_METHOD("set_surface_index", "surface_index"), &VisualShaderNodeParticleMeshEmitter::set_surface_index); + ClassDB::bind_method(D_METHOD("get_surface_index"), &VisualShaderNodeParticleMeshEmitter::get_surface_index); + + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "mesh", PROPERTY_HINT_RESOURCE_TYPE, "Mesh"), "set_mesh", "get_mesh"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_all_surfaces"), "set_use_all_surfaces", "is_use_all_surfaces"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "surface_index"), "set_surface_index", "get_surface_index"); +} + +VisualShaderNodeParticleMeshEmitter::VisualShaderNodeParticleMeshEmitter() { + connect(CoreStringNames::get_singleton()->changed, callable_mp(this, &VisualShaderNodeParticleMeshEmitter::_update_textures)); + + position_texture.instantiate(); + normal_texture.instantiate(); + color_texture.instantiate(); + uv_texture.instantiate(); + uv2_texture.instantiate(); +} + // VisualShaderNodeParticleMultiplyByAxisAngle void VisualShaderNodeParticleMultiplyByAxisAngle::_bind_methods() { @@ -265,7 +791,6 @@ bool VisualShaderNodeParticleMultiplyByAxisAngle::is_degrees_mode() const { Vector<StringName> VisualShaderNodeParticleMultiplyByAxisAngle::get_editable_properties() const { Vector<StringName> props; props.push_back("degrees_mode"); - props.push_back("axis_amount"); return props; } diff --git a/scene/resources/visual_shader_particle_nodes.h b/scene/resources/visual_shader_particle_nodes.h index b8bc7992cc..ae7ea69225 100644 --- a/scene/resources/visual_shader_particle_nodes.h +++ b/scene/resources/visual_shader_particle_nodes.h @@ -38,12 +38,23 @@ class VisualShaderNodeParticleEmitter : public VisualShaderNode { GDCLASS(VisualShaderNodeParticleEmitter, VisualShaderNode); +protected: + bool mode_2d = false; + static void _bind_methods(); + public: virtual int get_output_port_count() const override; virtual PortType get_output_port_type(int p_port) const override; virtual String get_output_port_name(int p_port) const override; virtual bool has_output_port_preview(int p_port) const override; + void set_mode_2d(bool p_enabled); + bool is_mode_2d() const; + + Vector<StringName> get_editable_properties() const override; + virtual Map<StringName, String> get_editable_properties_names() const override; + bool is_show_prop_names() const override; + VisualShaderNodeParticleEmitter(); }; @@ -95,6 +106,58 @@ public: VisualShaderNodeParticleRingEmitter(); }; +class VisualShaderNodeParticleMeshEmitter : public VisualShaderNodeParticleEmitter { + GDCLASS(VisualShaderNodeParticleMeshEmitter, VisualShaderNodeParticleEmitter); + Ref<Mesh> mesh; + bool use_all_surfaces = true; + int surface_index = 0; + + Ref<ImageTexture> position_texture; + Ref<ImageTexture> normal_texture; + Ref<ImageTexture> color_texture; + Ref<ImageTexture> uv_texture; + Ref<ImageTexture> uv2_texture; + + String _generate_code(VisualShader::Type p_type, int p_id, const String *p_output_vars, int p_index, const String &p_texture_name, bool p_ignore_mode2d = false) const; + + void _update_texture(const Vector<Vector2> &p_array, Ref<ImageTexture> &r_texture); + void _update_texture(const Vector<Vector3> &p_array, Ref<ImageTexture> &r_texture); + void _update_texture(const Vector<Color> &p_array, Ref<ImageTexture> &r_texture); + void _update_textures(); + +protected: + static void _bind_methods(); + +public: + virtual String get_caption() const override; + + virtual int get_output_port_count() const override; + virtual PortType get_output_port_type(int p_port) const override; + virtual String get_output_port_name(int p_port) const override; + + virtual int get_input_port_count() const override; + virtual PortType get_input_port_type(int p_port) const override; + virtual String get_input_port_name(int p_port) const override; + + virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; + virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; + + void set_mesh(Ref<Mesh> p_mesh); + Ref<Mesh> get_mesh() const; + + void set_use_all_surfaces(bool p_enabled); + bool is_use_all_surfaces() const; + + void set_surface_index(int p_surface_index); + int get_surface_index() const; + + Vector<StringName> get_editable_properties() const override; + Map<StringName, String> get_editable_properties_names() const override; + Vector<VisualShader::DefaultTextureParam> get_default_texture_parameters(VisualShader::Type p_type, int p_id) const override; + + VisualShaderNodeParticleMeshEmitter(); +}; + class VisualShaderNodeParticleMultiplyByAxisAngle : public VisualShaderNode { GDCLASS(VisualShaderNodeParticleMultiplyByAxisAngle, VisualShaderNode); bool degrees_mode = true; diff --git a/scene/resources/visual_shader_sdf_nodes.cpp b/scene/resources/visual_shader_sdf_nodes.cpp index 14c655b129..0fe7c33396 100644 --- a/scene/resources/visual_shader_sdf_nodes.cpp +++ b/scene/resources/visual_shader_sdf_nodes.cpp @@ -61,7 +61,7 @@ String VisualShaderNodeSDFToScreenUV::get_output_port_name(int p_port) const { } String VisualShaderNodeSDFToScreenUV::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - return " " + p_output_vars[0] + " = vec3(sdf_to_screen_uv(" + (p_input_vars[0] == String() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; + return " " + p_output_vars[0] + " = vec3(sdf_to_screen_uv(" + (p_input_vars[0].is_empty() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; } VisualShaderNodeSDFToScreenUV::VisualShaderNodeSDFToScreenUV() { @@ -105,7 +105,7 @@ String VisualShaderNodeScreenUVToSDF::get_input_port_default_hint(int p_port) co } String VisualShaderNodeScreenUVToSDF::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - return " " + p_output_vars[0] + " = vec3(screen_uv_to_sdf(" + (p_input_vars[0] == String() ? "SCREEN_UV" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; + return " " + p_output_vars[0] + " = vec3(screen_uv_to_sdf(" + (p_input_vars[0].is_empty() ? "SCREEN_UV" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; } VisualShaderNodeScreenUVToSDF::VisualShaderNodeScreenUVToSDF() { @@ -142,7 +142,7 @@ String VisualShaderNodeTextureSDF::get_output_port_name(int p_port) const { } String VisualShaderNodeTextureSDF::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - return " " + p_output_vars[0] + " = texture_sdf(" + (p_input_vars[0] == String() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + ");\n"; + return " " + p_output_vars[0] + " = texture_sdf(" + (p_input_vars[0].is_empty() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + ");\n"; } VisualShaderNodeTextureSDF::VisualShaderNodeTextureSDF() { @@ -179,7 +179,7 @@ String VisualShaderNodeTextureSDFNormal::get_output_port_name(int p_port) const } String VisualShaderNodeTextureSDFNormal::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { - return " " + p_output_vars[0] + " = vec3(texture_sdf_normal(" + (p_input_vars[0] == String() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; + return " " + p_output_vars[0] + " = vec3(texture_sdf_normal(" + (p_input_vars[0].is_empty() ? "vec2(0.0)" : p_input_vars[0] + ".xy") + "), 0.0f);\n"; } VisualShaderNodeTextureSDFNormal::VisualShaderNodeTextureSDFNormal() { @@ -242,13 +242,13 @@ String VisualShaderNodeSDFRaymarch::generate_code(Shader::Mode p_mode, VisualSha code += " {\n"; - if (p_input_vars[0] == String()) { + if (p_input_vars[0].is_empty()) { code += " vec2 __from_pos = vec2(0.0f);\n"; } else { code += " vec2 __from_pos = " + p_input_vars[0] + ".xy;\n"; } - if (p_input_vars[1] == String()) { + if (p_input_vars[1].is_empty()) { code += " vec2 __to_pos = vec2(0.0f);\n"; } else { code += " vec2 __to_pos = " + p_input_vars[1] + ".xy;\n"; diff --git a/scene/resources/world_3d.cpp b/scene/resources/world_3d.cpp index 42047f104f..0e1b343eac 100644 --- a/scene/resources/world_3d.cpp +++ b/scene/resources/world_3d.cpp @@ -144,9 +144,9 @@ World3D::World3D() { PhysicsServer3D::get_singleton()->area_set_param(space, PhysicsServer3D::AREA_PARAM_GRAVITY, GLOBAL_DEF("physics/3d/default_gravity", 9.8)); PhysicsServer3D::get_singleton()->area_set_param(space, PhysicsServer3D::AREA_PARAM_GRAVITY_VECTOR, GLOBAL_DEF("physics/3d/default_gravity_vector", Vector3(0, -1, 0))); PhysicsServer3D::get_singleton()->area_set_param(space, PhysicsServer3D::AREA_PARAM_LINEAR_DAMP, GLOBAL_DEF("physics/3d/default_linear_damp", 0.1)); - ProjectSettings::get_singleton()->set_custom_property_info("physics/3d/default_linear_damp", PropertyInfo(Variant::FLOAT, "physics/3d/default_linear_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater")); + ProjectSettings::get_singleton()->set_custom_property_info("physics/3d/default_linear_damp", PropertyInfo(Variant::FLOAT, "physics/3d/default_linear_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater")); PhysicsServer3D::get_singleton()->area_set_param(space, PhysicsServer3D::AREA_PARAM_ANGULAR_DAMP, GLOBAL_DEF("physics/3d/default_angular_damp", 0.1)); - ProjectSettings::get_singleton()->set_custom_property_info("physics/3d/default_angular_damp", PropertyInfo(Variant::FLOAT, "physics/3d/default_angular_damp", PROPERTY_HINT_RANGE, "-1,100,0.001,or_greater")); + ProjectSettings::get_singleton()->set_custom_property_info("physics/3d/default_angular_damp", PropertyInfo(Variant::FLOAT, "physics/3d/default_angular_damp", PROPERTY_HINT_RANGE, "0,100,0.001,or_greater")); navigation_map = NavigationServer3D::get_singleton()->map_create(); NavigationServer3D::get_singleton()->map_set_active(navigation_map, true); diff --git a/scene/scene_string_names.cpp b/scene/scene_string_names.cpp index 186764e69e..a5ed27cb7b 100644 --- a/scene/scene_string_names.cpp +++ b/scene/scene_string_names.cpp @@ -61,6 +61,7 @@ SceneStringNames::SceneStringNames() { animation_finished = StaticCString::create("animation_finished"); animation_changed = StaticCString::create("animation_changed"); animation_started = StaticCString::create("animation_started"); + RESET = StaticCString::create("RESET"); pose_updated = StaticCString::create("pose_updated"); bone_pose_changed = StaticCString::create("bone_pose_changed"); diff --git a/scene/scene_string_names.h b/scene/scene_string_names.h index 67007c85e0..b1ace1748c 100644 --- a/scene/scene_string_names.h +++ b/scene/scene_string_names.h @@ -97,6 +97,7 @@ public: StringName animation_finished; StringName animation_changed; StringName animation_started; + StringName RESET; StringName pose_updated; StringName bone_pose_changed; |
