summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--.github/workflows/android_builds.yml7
-rw-r--r--.github/workflows/static_checks.yml4
-rw-r--r--CONTRIBUTING.md5
-rw-r--r--COPYRIGHT.txt52
-rw-r--r--core/SCsub2
-rw-r--r--core/core_bind.cpp31
-rw-r--r--core/core_bind.h4
-rw-r--r--core/io/resource.cpp1
-rw-r--r--core/math/basis.cpp4
-rw-r--r--core/math/geometry_2d.cpp14
-rw-r--r--core/math/geometry_3d.cpp2
-rw-r--r--core/object/undo_redo.cpp62
-rw-r--r--core/object/undo_redo.h7
-rw-r--r--core/os/os.h3
-rw-r--r--core/templates/local_vector.h14
-rw-r--r--core/variant/variant_op.cpp1
-rw-r--r--doc/classes/Animation.xml2
-rw-r--r--doc/classes/OS.xml59
-rw-r--r--doc/classes/PhysicsDirectSpaceState2D.xml5
-rw-r--r--doc/classes/PhysicsDirectSpaceState3D.xml5
-rw-r--r--doc/classes/Reference.xml2
-rw-r--r--doc/classes/Resource.xml15
-rw-r--r--doc/classes/RichTextLabel.xml1
-rw-r--r--doc/classes/String.xml6
-rw-r--r--doc/classes/UndoRedo.xml29
-rw-r--r--drivers/dummy/rasterizer_dummy.h77
-rw-r--r--drivers/unix/os_unix.cpp91
-rw-r--r--drivers/unix/os_unix.h3
-rw-r--r--editor/editor_export.cpp20
-rw-r--r--editor/editor_file_system.cpp9
-rw-r--r--editor/editor_node.cpp13
-rw-r--r--editor/editor_properties.cpp12
-rw-r--r--editor/editor_properties.h4
-rw-r--r--editor/editor_run.cpp2
-rw-r--r--editor/import/scene_importer_mesh.cpp46
-rw-r--r--editor/plugins/canvas_item_editor_plugin.cpp8
-rw-r--r--editor/plugins/curve_editor_plugin.cpp4
-rw-r--r--editor/plugins/script_editor_plugin.cpp17
-rw-r--r--editor/plugins/sprite_frames_editor_plugin.cpp7
-rw-r--r--editor/plugins/visual_shader_editor_plugin.cpp61
-rw-r--r--editor/plugins/visual_shader_editor_plugin.h9
-rw-r--r--editor/project_manager.cpp19
-rw-r--r--editor/project_settings_editor.cpp9
-rw-r--r--main/main.cpp3
-rw-r--r--modules/bullet/rigid_body_bullet.cpp3
-rw-r--r--modules/bullet/space_bullet.cpp10
-rw-r--r--modules/bullet/space_bullet.h1
-rw-r--r--modules/fbx/data/fbx_mesh_data.cpp24
-rw-r--r--modules/gdscript/gdscript_analyzer.cpp39
-rw-r--r--modules/gdscript/gdscript_byte_codegen.cpp11
-rw-r--r--modules/gdscript/gdscript_byte_codegen.h1
-rw-r--r--modules/gdscript/gdscript_codegen.h1
-rw-r--r--modules/gdscript/gdscript_compiler.cpp12
-rw-r--r--modules/gdscript/gdscript_editor.cpp2
-rw-r--r--modules/gdscript/gdscript_parser.cpp15
-rw-r--r--modules/gdscript/gdscript_parser.h5
-rw-r--r--modules/gdscript/gdscript_vm.cpp8
-rw-r--r--modules/gltf/gltf_document.cpp8
-rw-r--r--modules/meshoptimizer/register_types.cpp4
-rw-r--r--modules/mono/csharp_script.cpp4
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs2
-rwxr-xr-xmodules/mono/editor/GodotTools/GodotTools/Export/XcodeHelper.cs2
-rw-r--r--modules/mono/editor/bindings_generator.cpp2
-rw-r--r--modules/mono/editor/script_class_parser.cpp4
-rw-r--r--modules/mono/mono_gd/gd_mono.cpp20
-rw-r--r--modules/mono/mono_gd/gd_mono_marshal.cpp8
-rw-r--r--modules/mono/utils/mono_reg_utils.cpp2
-rw-r--r--modules/regex/doc_classes/RegEx.xml4
-rw-r--r--modules/webxr/native/library_godot_webxr.js8
-rw-r--r--modules/webxr/webxr_interface_js.cpp6
-rw-r--r--platform/android/export/export.cpp22
-rw-r--r--platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java8
-rw-r--r--platform/iphone/export/export.cpp8
-rw-r--r--platform/javascript/SCsub17
-rw-r--r--platform/javascript/detect.py5
-rw-r--r--platform/javascript/emscripten_helpers.py6
-rw-r--r--platform/javascript/http_client_javascript.cpp4
-rw-r--r--platform/javascript/javascript_main.cpp2
-rw-r--r--platform/javascript/os_javascript.cpp8
-rw-r--r--platform/javascript/os_javascript.h3
-rw-r--r--platform/linuxbsd/crash_handler_linuxbsd.cpp2
-rw-r--r--platform/linuxbsd/display_server_x11.cpp2
-rw-r--r--platform/linuxbsd/os_linuxbsd.cpp20
-rw-r--r--platform/osx/crash_handler_osx.mm2
-rw-r--r--platform/osx/display_server_osx.mm4
-rw-r--r--platform/osx/export/export.cpp6
-rw-r--r--platform/uwp/export/export.cpp4
-rw-r--r--platform/uwp/os_uwp.cpp6
-rw-r--r--platform/uwp/os_uwp.h3
-rw-r--r--platform/windows/export/export.cpp6
-rw-r--r--platform/windows/os_windows.cpp85
-rw-r--r--platform/windows/os_windows.h3
-rw-r--r--scene/2d/collision_polygon_2d.cpp4
-rw-r--r--scene/2d/collision_shape_2d.cpp4
-rw-r--r--scene/2d/navigation_region_2d.cpp16
-rw-r--r--scene/3d/collision_shape_3d.cpp4
-rw-r--r--scene/3d/gpu_particles_collision_3d.cpp4
-rw-r--r--scene/3d/node_3d.cpp4
-rw-r--r--scene/3d/physics_joint_3d.cpp16
-rw-r--r--scene/gui/graph_edit.cpp19
-rw-r--r--scene/gui/rich_text_label.cpp10
-rw-r--r--scene/gui/tab_container.cpp4
-rw-r--r--scene/resources/particles_material.cpp2
-rw-r--r--scene/resources/surface_tool.cpp2
-rw-r--r--scene/resources/surface_tool.h4
-rw-r--r--servers/physics_2d/space_2d_sw.cpp4
-rw-r--r--servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp4
-rw-r--r--servers/physics_3d/space_3d_sw.cpp4
-rw-r--r--servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp2
-rw-r--r--servers/rendering/renderer_rd/renderer_scene_render_forward.cpp2
-rw-r--r--servers/rendering/renderer_rd/renderer_scene_render_rd.cpp16
-rw-r--r--servers/rendering/renderer_rd/renderer_storage_rd.cpp2
-rw-r--r--servers/rendering/renderer_rd/shaders/canvas.glsl10
-rw-r--r--servers/rendering/renderer_rd/shaders/particles.glsl2
-rw-r--r--servers/rendering/shader_language.cpp4
-rw-r--r--servers/rendering/shader_types.cpp2
-rw-r--r--tests/test_local_vector.h229
-rw-r--r--tests/test_main.cpp1
-rw-r--r--tests/test_math.cpp2
-rw-r--r--thirdparty/README.md11
-rw-r--r--thirdparty/meshoptimizer/indexcodec.cpp2
-rw-r--r--thirdparty/meshoptimizer/meshoptimizer.h20
-rw-r--r--thirdparty/meshoptimizer/simplifier.cpp38
-rw-r--r--thirdparty/misc/patches/polypartition-godot-types.patch819
-rw-r--r--thirdparty/misc/polypartition.cpp1849
-rw-r--r--thirdparty/misc/polypartition.h378
-rw-r--r--thirdparty/misc/triangulator.cpp1550
-rw-r--r--thirdparty/misc/triangulator.h306
128 files changed, 4193 insertions, 2340 deletions
diff --git a/.github/workflows/android_builds.yml b/.github/workflows/android_builds.yml
index 143f3961cf..697600abe3 100644
--- a/.github/workflows/android_builds.yml
+++ b/.github/workflows/android_builds.yml
@@ -6,6 +6,7 @@ env:
GODOT_BASE_BRANCH: master
SCONSFLAGS: platform=android verbose=yes warnings=extra werror=yes --jobs=2 module_text_server_fb_enabled=yes
SCONS_CACHE_LIMIT: 4096
+ ANDROID_NDK_VERSION: 21.1.6352462
jobs:
android-template:
@@ -28,6 +29,10 @@ jobs:
with:
java-version: 8
+ - name: Install Android NDK r21
+ run: |
+ sudo ${ANDROID_HOME}/tools/bin/sdkmanager --install 'ndk;${{env.ANDROID_NDK_VERSION}}'
+
# Upload cache on completion and check it out now
- name: Load .scons_cache directory
id: android-template-cache
@@ -59,7 +64,7 @@ jobs:
- name: Compilation
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
- ANDROID_NDK_ROOT: /usr/local/lib/android/sdk/ndk-bundle
+ ANDROID_NDK_ROOT: /usr/local/lib/android/sdk/ndk/${{env.ANDROID_NDK_VERSION}}/
run: |
scons target=release tools=no android_arch=armv7
scons target=release tools=no android_arch=arm64v8
diff --git a/.github/workflows/static_checks.yml b/.github/workflows/static_checks.yml
index da3327246b..12270a848a 100644
--- a/.github/workflows/static_checks.yml
+++ b/.github/workflows/static_checks.yml
@@ -18,7 +18,9 @@ jobs:
- name: Install dependencies
run: |
- sudo apt-get install -qq dos2unix recode clang-format
+ sudo apt-get install -qq dos2unix recode clang-format-11
+ sudo update-alternatives --remove-all clang-format
+ sudo update-alternatives --install /usr/bin/clang-format clang-format /usr/bin/clang-format-11 100
sudo pip3 install black==20.8b1 pygments
- name: File formatting checks (file_format.sh)
diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md
index 1abd76b2ff..4387750f28 100644
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -72,6 +72,11 @@ by drag and dropping the file in the GitHub edition field.
We recommend always attaching a minimal reproduction project, even if the issue
may seem simple to reproduce manually.
+**Note for C# users:** If your issue is not Mono-specific, please upload a
+minimal reproduction project written in GDScript or VisualScript.
+This will make it easier for contributors to reproduce the issue
+locally as not everyone has a Mono setup available.
+
**If you've been asked by a maintainer to upload a minimal reproduction project,
you *must* do so within 7 days.** Otherwise, your bug report will be closed as
it'll be considered too difficult to diagnose.
diff --git a/COPYRIGHT.txt b/COPYRIGHT.txt
index d0055f3687..b9b15abf5d 100644
--- a/COPYRIGHT.txt
+++ b/COPYRIGHT.txt
@@ -30,7 +30,7 @@
# (e.g. a public domain dedication), but as far as Godot Engine is concerned
# the library is considered as a whole under the Zlib license.
#
-# Nota: When linking dynamically against thirdparty libraries instead of
+# Note: When linking dynamically against thirdparty libraries instead of
# building them into the Godot binary, you may remove the corresponding
# license details from this file.
@@ -62,40 +62,34 @@ Copyright: 2006-2020, assimp team
2014-2021, Godot Engine contributors.
License: BSD-3-clause
-Files: ./platform/android/java/lib/aidl/com/android/vending/licensing/
+Files: ./platform/android/java/lib/aidl/com/android/*
./platform/android/java/lib/res/layout/status_bar_ongoing_event_progress_bar.xml
- ./platform/android/java/lib/src/com/google/android/vending/expansion/downloader/
- ./platform/android/java/lib/src/com/google/android/vending/licensing/
+ ./platform/android/java/lib/src/com/google/android/*
./platform/android/java/lib/src/org/godotengine/godot/input/InputManagerCompat.java
./platform/android/java/lib/src/org/godotengine/godot/input/InputManagerV16.java
Comment: The Android Open Source Project
-Copyright: 2008-2013, The Android Open Source Project
+Copyright: 2008-2016, The Android Open Source Project
+ 2002, Google, Inc.
License: Apache-2.0
-Files: ./platform/android/java/src/com/android/vending/licensing/util/Base64.java
- ./platform/android/java/src/com/android/vending/licensing/util/Base64DecoderException.java
-Comment: The Android Open Source Project
-Copyright: 2002, Google Inc.
-License: Apache-2.0
-
-Files: ./servers/physics/gjk_epa.cpp
- ./servers/physics/joints/generic_6dof_joint_sw.cpp
- ./servers/physics/joints/generic_6dof_joint_sw.h
- ./servers/physics/joints/hinge_joint_sw.cpp
- ./servers/physics/joints/hinge_joint_sw.h
- ./servers/physics/joints/jacobian_entry_sw.h
- ./servers/physics/joints/pin_joint_sw.cpp
- ./servers/physics/joints/pin_joint_sw.h
- ./servers/physics/joints/slider_joint_sw.cpp
- ./servers/physics/joints/slider_joint_sw.h
+Files: ./servers/physics_3d/gjk_epa.cpp
+ ./servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp
+ ./servers/physics_3d/joints/generic_6dof_joint_3d_sw.h
+ ./servers/physics_3d/joints/hinge_joint_3d_sw.cpp
+ ./servers/physics_3d/joints/hinge_joint_3d_sw.h
+ ./servers/physics_3d/joints/jacobian_entry_3d_sw.h
+ ./servers/physics_3d/joints/pin_joint_3d_sw.cpp
+ ./servers/physics_3d/joints/pin_joint_3d_sw.h
+ ./servers/physics_3d/joints/slider_joint_3d_sw.cpp
+ ./servers/physics_3d/joints/slider_joint_3d_sw.h
Comment: Bullet Continuous Collision Detection and Physics Library
Copyright: 2003-2008, Erwin Coumans
2007-2021, Juan Linietsky, Ariel Manzur.
2014-2021, Godot Engine contributors.
License: Expat and Zlib
-Files: ./servers/physics/joints/cone_twist_joint_sw.cpp
- ./servers/physics/joints/cone_twist_joint_sw.h
+Files: ./servers/physics_3d/joints/cone_twist_joint_3d_sw.cpp
+ ./servers/physics_3d/joints/cone_twist_joint_3d_sw.h
Comment: Bullet Continuous Collision Detection and Physics Library
Copyright: 2007, Starbreeze Studios
2007-2021, Juan Linietsky, Ariel Manzur.
@@ -326,6 +320,12 @@ Comment: Minimal PCG32 implementation
Copyright: 2014, M.E. O'Neill
License: Apache-2.0
+Files: ./thirdparty/misc/polypartition.cpp
+ ./thirdparty/misc/polypartition.h
+Comment: PolyPartition / Triangulator
+Copyright: 2011-2021, Ivan Fratric and contributors
+License: Expat
+
Files: ./thirdparty/misc/r128.c
./thirdparty/misc/r128.h
Comment: r128 library
@@ -344,12 +344,6 @@ Comment: stb libraries
Copyright: Sean Barrett
License: public-domain or Unlicense or Expat
-Files: ./thirdparty/misc/triangulator.cpp
- ./thirdparty/misc/triangulator.h
-Comment: PolyPartition
-Copyright: 2011, Ivan Fratric
-License: Expat
-
Files: ./thirdparty/misc/yuv2rgb.h
Comment: YUV2RGB
Copyright: 2008-2011, Robin Watts
diff --git a/core/SCsub b/core/SCsub
index c9f84a9a00..21829553a7 100644
--- a/core/SCsub
+++ b/core/SCsub
@@ -54,7 +54,7 @@ thirdparty_misc_sources = [
"smaz.c",
# C++ sources
"pcg.cpp",
- "triangulator.cpp",
+ "polypartition.cpp",
"clipper.cpp",
]
thirdparty_misc_sources = [thirdparty_misc_dir + file for file in thirdparty_misc_sources]
diff --git a/core/core_bind.cpp b/core/core_bind.cpp
index a84a208050..000b628ba7 100644
--- a/core/core_bind.cpp
+++ b/core/core_bind.cpp
@@ -228,24 +228,32 @@ Error _OS::shell_open(String p_uri) {
return OS::get_singleton()->shell_open(p_uri);
}
-int _OS::execute(const String &p_path, const Vector<String> &p_arguments, bool p_blocking, Array p_output, bool p_read_stderr) {
- OS::ProcessID pid = -2;
- int exitcode = 0;
+int _OS::execute(const String &p_path, const Vector<String> &p_arguments, Array r_output, bool p_read_stderr) {
List<String> args;
for (int i = 0; i < p_arguments.size(); i++) {
args.push_back(p_arguments[i]);
}
String pipe;
- Error err = OS::get_singleton()->execute(p_path, args, p_blocking, &pid, &pipe, &exitcode, p_read_stderr);
- p_output.clear();
- p_output.push_back(pipe);
+ int exitcode = 0;
+ Error err = OS::get_singleton()->execute(p_path, args, &pipe, &exitcode, p_read_stderr);
+ r_output.push_back(pipe);
+ if (err != OK) {
+ return -1;
+ }
+ return exitcode;
+}
+
+int _OS::create_process(const String &p_path, const Vector<String> &p_arguments) {
+ List<String> args;
+ for (int i = 0; i < p_arguments.size(); i++) {
+ args.push_back(p_arguments[i]);
+ }
+ OS::ProcessID pid = 0;
+ Error err = OS::get_singleton()->create_process(p_path, args, &pid);
if (err != OK) {
return -1;
- } else if (p_blocking) {
- return exitcode;
- } else {
- return pid;
}
+ return pid;
}
Error _OS::kill(int p_pid) {
@@ -697,7 +705,8 @@ void _OS::_bind_methods() {
ClassDB::bind_method(D_METHOD("get_processor_count"), &_OS::get_processor_count);
ClassDB::bind_method(D_METHOD("get_executable_path"), &_OS::get_executable_path);
- ClassDB::bind_method(D_METHOD("execute", "path", "arguments", "blocking", "output", "read_stderr"), &_OS::execute, DEFVAL(true), DEFVAL(Array()), DEFVAL(false));
+ ClassDB::bind_method(D_METHOD("execute", "path", "arguments", "output", "read_stderr"), &_OS::execute, DEFVAL(Array()), DEFVAL(false));
+ ClassDB::bind_method(D_METHOD("create_process", "path", "arguments"), &_OS::create_process);
ClassDB::bind_method(D_METHOD("kill", "pid"), &_OS::kill);
ClassDB::bind_method(D_METHOD("shell_open", "uri"), &_OS::shell_open);
ClassDB::bind_method(D_METHOD("get_process_id"), &_OS::get_process_id);
diff --git a/core/core_bind.h b/core/core_bind.h
index 30dfa2d7a8..665858cd26 100644
--- a/core/core_bind.h
+++ b/core/core_bind.h
@@ -155,8 +155,8 @@ public:
int get_low_processor_usage_mode_sleep_usec() const;
String get_executable_path() const;
- int execute(const String &p_path, const Vector<String> &p_arguments, bool p_blocking = true, Array p_output = Array(), bool p_read_stderr = false);
-
+ int execute(const String &p_path, const Vector<String> &p_arguments, Array r_output = Array(), bool p_read_stderr = false);
+ int create_process(const String &p_path, const Vector<String> &p_arguments);
Error kill(int p_pid);
Error shell_open(String p_uri);
diff --git a/core/io/resource.cpp b/core/io/resource.cpp
index 716da5e395..2c97e617f2 100644
--- a/core/io/resource.cpp
+++ b/core/io/resource.cpp
@@ -386,6 +386,7 @@ void Resource::_bind_methods() {
ClassDB::bind_method(D_METHOD("is_local_to_scene"), &Resource::is_local_to_scene);
ClassDB::bind_method(D_METHOD("get_local_scene"), &Resource::get_local_scene);
ClassDB::bind_method(D_METHOD("setup_local_to_scene"), &Resource::setup_local_to_scene);
+ ClassDB::bind_method(D_METHOD("emit_changed"), &Resource::emit_changed);
ClassDB::bind_method(D_METHOD("duplicate", "subresources"), &Resource::duplicate, DEFVAL(false));
ADD_SIGNAL(MethodInfo("changed"));
diff --git a/core/math/basis.cpp b/core/math/basis.cpp
index 26b4caba39..cbdd8a8c9f 100644
--- a/core/math/basis.cpp
+++ b/core/math/basis.cpp
@@ -790,8 +790,8 @@ Quat Basis::get_quat() const {
temp[2] = ((m.elements[1][0] - m.elements[0][1]) * s);
} else {
int i = m.elements[0][0] < m.elements[1][1] ?
- (m.elements[1][1] < m.elements[2][2] ? 2 : 1) :
- (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
+ (m.elements[1][1] < m.elements[2][2] ? 2 : 1) :
+ (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
int j = (i + 1) % 3;
int k = (i + 2) % 3;
diff --git a/core/math/geometry_2d.cpp b/core/math/geometry_2d.cpp
index 5d4c31088b..783750b9e6 100644
--- a/core/math/geometry_2d.cpp
+++ b/core/math/geometry_2d.cpp
@@ -31,7 +31,7 @@
#include "geometry_2d.h"
#include "thirdparty/misc/clipper.hpp"
-#include "thirdparty/misc/triangulator.h"
+#include "thirdparty/misc/polypartition.h"
#define STB_RECT_PACK_IMPLEMENTATION
#include "thirdparty/misc/stb_rect_pack.h"
@@ -39,16 +39,16 @@
Vector<Vector<Vector2>> Geometry2D::decompose_polygon_in_convex(Vector<Point2> polygon) {
Vector<Vector<Vector2>> decomp;
- List<TriangulatorPoly> in_poly, out_poly;
+ List<TPPLPoly> in_poly, out_poly;
- TriangulatorPoly inp;
+ TPPLPoly inp;
inp.Init(polygon.size());
for (int i = 0; i < polygon.size(); i++) {
inp.GetPoint(i) = polygon[i];
}
- inp.SetOrientation(TRIANGULATOR_CCW);
+ inp.SetOrientation(TPPL_ORIENTATION_CCW);
in_poly.push_back(inp);
- TriangulatorPartition tpart;
+ TPPLPartition tpart;
if (tpart.ConvexPartition_HM(&in_poly, &out_poly) == 0) { // Failed.
ERR_PRINT("Convex decomposing failed!");
return decomp;
@@ -56,8 +56,8 @@ Vector<Vector<Vector2>> Geometry2D::decompose_polygon_in_convex(Vector<Point2> p
decomp.resize(out_poly.size());
int idx = 0;
- for (List<TriangulatorPoly>::Element *I = out_poly.front(); I; I = I->next()) {
- TriangulatorPoly &tp = I->get();
+ for (List<TPPLPoly>::Element *I = out_poly.front(); I; I = I->next()) {
+ TPPLPoly &tp = I->get();
decomp.write[idx].resize(tp.GetNumPoints());
diff --git a/core/math/geometry_3d.cpp b/core/math/geometry_3d.cpp
index a918d1de0d..553184303d 100644
--- a/core/math/geometry_3d.cpp
+++ b/core/math/geometry_3d.cpp
@@ -33,7 +33,7 @@
#include "core/string/print_string.h"
#include "thirdparty/misc/clipper.hpp"
-#include "thirdparty/misc/triangulator.h"
+#include "thirdparty/misc/polypartition.h"
void Geometry3D::MeshData::optimize_vertices() {
Map<int, int> vtx_remap;
diff --git a/core/object/undo_redo.cpp b/core/object/undo_redo.cpp
index c699820e75..3b1165b8f6 100644
--- a/core/object/undo_redo.cpp
+++ b/core/object/undo_redo.cpp
@@ -53,6 +53,23 @@ void UndoRedo::_discard_redo() {
actions.resize(current_action + 1);
}
+bool UndoRedo::_redo(bool p_execute) {
+ ERR_FAIL_COND_V(action_level > 0, false);
+
+ if ((current_action + 1) >= actions.size()) {
+ return false; //nothing to redo
+ }
+
+ current_action++;
+ if (p_execute) {
+ _process_operation_list(actions.write[current_action].do_ops.front());
+ }
+ version++;
+ emit_signal("version_changed");
+
+ return true;
+}
+
void UndoRedo::create_action(const String &p_name, MergeMode p_mode) {
uint32_t ticks = OS::get_singleton()->get_ticks_msec();
@@ -242,7 +259,7 @@ bool UndoRedo::is_committing_action() const {
return committing > 0;
}
-void UndoRedo::commit_action() {
+void UndoRedo::commit_action(bool p_execute) {
ERR_FAIL_COND(action_level <= 0);
action_level--;
if (action_level > 0) {
@@ -255,8 +272,9 @@ void UndoRedo::commit_action() {
}
committing++;
- redo(); // perform action
+ _redo(p_execute); // perform action
committing--;
+
if (callback && actions.size() > 0) {
callback(callback_ud, actions[actions.size() - 1].name);
}
@@ -323,19 +341,7 @@ void UndoRedo::_process_operation_list(List<Operation>::Element *E) {
}
bool UndoRedo::redo() {
- ERR_FAIL_COND_V(action_level > 0, false);
-
- if ((current_action + 1) >= actions.size()) {
- return false; //nothing to redo
- }
-
- current_action++;
-
- _process_operation_list(actions.write[current_action].do_ops.front());
- version++;
- emit_signal("version_changed");
-
- return true;
+ return _redo(true);
}
bool UndoRedo::undo() {
@@ -351,6 +357,24 @@ bool UndoRedo::undo() {
return true;
}
+int UndoRedo::get_history_count() {
+ ERR_FAIL_COND_V(action_level > 0, -1);
+
+ return actions.size();
+}
+
+int UndoRedo::get_current_action() {
+ ERR_FAIL_COND_V(action_level > 0, -1);
+
+ return current_action;
+}
+
+String UndoRedo::get_action_name(int p_id) {
+ ERR_FAIL_INDEX_V(p_id, actions.size(), "");
+
+ return actions[p_id].name;
+}
+
void UndoRedo::clear_history(bool p_increase_version) {
ERR_FAIL_COND(action_level > 0);
_discard_redo();
@@ -480,7 +504,7 @@ Variant UndoRedo::_add_undo_method(const Variant **p_args, int p_argcount, Calla
void UndoRedo::_bind_methods() {
ClassDB::bind_method(D_METHOD("create_action", "name", "merge_mode"), &UndoRedo::create_action, DEFVAL(MERGE_DISABLE));
- ClassDB::bind_method(D_METHOD("commit_action"), &UndoRedo::commit_action);
+ ClassDB::bind_method(D_METHOD("commit_action", "execute"), &UndoRedo::commit_action, DEFVAL(true));
ClassDB::bind_method(D_METHOD("is_committing_action"), &UndoRedo::is_committing_action);
{
@@ -505,8 +529,14 @@ void UndoRedo::_bind_methods() {
ClassDB::bind_method(D_METHOD("add_undo_property", "object", "property", "value"), &UndoRedo::add_undo_property);
ClassDB::bind_method(D_METHOD("add_do_reference", "object"), &UndoRedo::add_do_reference);
ClassDB::bind_method(D_METHOD("add_undo_reference", "object"), &UndoRedo::add_undo_reference);
+
+ ClassDB::bind_method(D_METHOD("get_history_count"), &UndoRedo::get_history_count);
+ ClassDB::bind_method(D_METHOD("get_current_action"), &UndoRedo::get_current_action);
+ ClassDB::bind_method(D_METHOD("get_action_name"), &UndoRedo::get_action_name);
ClassDB::bind_method(D_METHOD("clear_history", "increase_version"), &UndoRedo::clear_history, DEFVAL(true));
+
ClassDB::bind_method(D_METHOD("get_current_action_name"), &UndoRedo::get_current_action_name);
+
ClassDB::bind_method(D_METHOD("has_undo"), &UndoRedo::has_undo);
ClassDB::bind_method(D_METHOD("has_redo"), &UndoRedo::has_redo);
ClassDB::bind_method(D_METHOD("get_version"), &UndoRedo::get_version);
diff --git a/core/object/undo_redo.h b/core/object/undo_redo.h
index 7b28b138c1..a08ca7792f 100644
--- a/core/object/undo_redo.h
+++ b/core/object/undo_redo.h
@@ -84,6 +84,7 @@ private:
void _pop_history_tail();
void _process_operation_list(List<Operation>::Element *E);
void _discard_redo();
+ bool _redo(bool p_execute);
CommitNotifyCallback callback = nullptr;
void *callback_ud = nullptr;
@@ -109,11 +110,15 @@ public:
void add_undo_reference(Object *p_object);
bool is_committing_action() const;
- void commit_action();
+ void commit_action(bool p_execute = true);
bool redo();
bool undo();
String get_current_action_name() const;
+
+ int get_history_count();
+ int get_current_action();
+ String get_action_name(int p_id);
void clear_history(bool p_increase_version = true);
bool has_undo();
diff --git a/core/os/os.h b/core/os/os.h
index ed3c6ddc94..e02ce7d5ec 100644
--- a/core/os/os.h
+++ b/core/os/os.h
@@ -129,7 +129,8 @@ public:
virtual int get_low_processor_usage_mode_sleep_usec() const;
virtual String get_executable_path() const;
- virtual Error execute(const String &p_path, const List<String> &p_arguments, bool p_blocking = true, ProcessID *r_child_id = nullptr, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) = 0;
+ virtual Error execute(const String &p_path, const List<String> &p_arguments, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) = 0;
+ virtual Error create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id = nullptr) = 0;
virtual Error kill(const ProcessID &p_pid) = 0;
virtual int get_process_id() const;
virtual void vibrate_handheld(int p_duration_ms = 500);
diff --git a/core/templates/local_vector.h b/core/templates/local_vector.h
index 4ffb93b2ad..ffd17b7ee9 100644
--- a/core/templates/local_vector.h
+++ b/core/templates/local_vector.h
@@ -82,6 +82,19 @@ public:
}
}
+ /// Removes the item copying the last value into the position of the one to
+ /// remove. It's generally faster than `remove`.
+ void remove_unordered(U p_index) {
+ ERR_FAIL_INDEX(p_index, count);
+ count--;
+ if (count > p_index) {
+ data[p_index] = data[count];
+ }
+ if (!__has_trivial_destructor(T) && !force_trivial) {
+ data[count].~T();
+ }
+ }
+
void erase(const T &p_val) {
int64_t idx = find(p_val);
if (idx >= 0) {
@@ -105,6 +118,7 @@ public:
}
}
_FORCE_INLINE_ bool is_empty() const { return count == 0; }
+ _FORCE_INLINE_ U get_capacity() const { return capacity; }
_FORCE_INLINE_ void reserve(U p_size) {
p_size = nearest_power_of_2_templated(p_size);
if (p_size > capacity) {
diff --git a/core/variant/variant_op.cpp b/core/variant/variant_op.cpp
index e9c817bc9f..e0a3cf4215 100644
--- a/core/variant/variant_op.cpp
+++ b/core/variant/variant_op.cpp
@@ -318,6 +318,7 @@ public:
r_valid = true;
}
static void validated_evaluate(const Variant *left, const Variant *right, Variant *r_ret) {
+ VariantTypeChanger<R>::change(r_ret);
*VariantGetInternalPtr<R>::get_ptr(r_ret) = *VariantGetInternalPtr<A>::get_ptr(left) & *VariantGetInternalPtr<B>::get_ptr(right);
}
static void ptr_evaluate(const void *left, const void *right, void *r_ret) {
diff --git a/doc/classes/Animation.xml b/doc/classes/Animation.xml
index d26c0e8605..9720405ffd 100644
--- a/doc/classes/Animation.xml
+++ b/doc/classes/Animation.xml
@@ -168,7 +168,7 @@
<argument index="2" name="stream" type="Resource">
</argument>
<description>
- Sets the stream of the key identified by [code]key_idx[/code] to value [code]offset[/code]. The [code]track_idx[/code] must be the index of an Audio Track.
+ Sets the stream of the key identified by [code]key_idx[/code] to value [code]stream[/code]. The [code]track_idx[/code] must be the index of an Audio Track.
</description>
</method>
<method name="bezier_track_get_key_in_handle" qualifiers="const">
diff --git a/doc/classes/OS.xml b/doc/classes/OS.xml
index 65a815a603..ed94f9d90f 100644
--- a/doc/classes/OS.xml
+++ b/doc/classes/OS.xml
@@ -25,6 +25,29 @@
[b]Note:[/b] This method is implemented on Linux, macOS and Windows.
</description>
</method>
+ <method name="create_process">
+ <return type="int">
+ </return>
+ <argument index="0" name="path" type="String">
+ </argument>
+ <argument index="1" name="arguments" type="PackedStringArray">
+ </argument>
+ <description>
+ Creates a new process that runs independently of Godot. It will not terminate if Godot terminates. The file specified in [code]path[/code] must exist and be executable. Platform path resolution will be used. The [code]arguments[/code] are used in the given order and separated by a space.
+ If the process creation succeeds, the method will return the new process ID, which you can use to monitor the process (and potentially terminate it with [method kill]). If the process creation fails, the method will return [code]-1[/code].
+ For example, running another instance of the project:
+ [codeblocks]
+ [gdscript]
+ var pid = OS.create_process(OS.get_executable_path(), [])
+ [/gdscript]
+ [csharp]
+ var pid = OS.CreateProcess(OS.GetExecutablePath(), new string[] {});
+ [/csharp]
+ [/codeblocks]
+ See [method execute] if you wish to run an external command and retrieve the results.
+ [b]Note:[/b] This method is implemented on Android, iOS, Linux, macOS and Windows.
+ </description>
+ </method>
<method name="delay_msec" qualifiers="const">
<return type="void">
</return>
@@ -71,48 +94,34 @@
</argument>
<argument index="1" name="arguments" type="PackedStringArray">
</argument>
- <argument index="2" name="blocking" type="bool" default="true">
- </argument>
- <argument index="3" name="output" type="Array" default="[ ]">
+ <argument index="2" name="output" type="Array" default="[ ]">
</argument>
- <argument index="4" name="read_stderr" type="bool" default="false">
+ <argument index="3" name="read_stderr" type="bool" default="false">
</argument>
<description>
- Execute the file at the given path with the arguments passed as an array of strings. Platform path resolution will take place. The resolved file must exist and be executable.
- The arguments are used in the given order and separated by a space, so [code]OS.execute("ping", ["-w", "3", "godotengine.org"], false)[/code] will resolve to [code]ping -w 3 godotengine.org[/code] in the system's shell.
- This method has slightly different behavior based on whether the [code]blocking[/code] mode is enabled.
- If [code]blocking[/code] is [code]true[/code], the Godot thread will pause its execution while waiting for the process to terminate. The shell output of the process will be written to the [code]output[/code] array as a single string. When the process terminates, the Godot thread will resume execution.
- If [code]blocking[/code] is [code]false[/code], the Godot thread will continue while the new process runs. It is not possible to retrieve the shell output in non-blocking mode, so [code]output[/code] will be empty.
- The return value also depends on the blocking mode. When blocking, the method will return an exit code of the process. When non-blocking, the method returns a process ID, which you can use to monitor the process (and potentially terminate it with [method kill]). If the process forking (non-blocking) or opening (blocking) fails, the method will return [code]-1[/code] or another exit code.
- Example of blocking mode and retrieving the shell output:
+ Executes a command. The file specified in [code]path[/code] must exist and be executable. Platform path resolution will be used. The [code]arguments[/code] are used in the given order and separated by a space. If an [code]output[/code] [Array] is provided, the complete shell output of the process will be appended as a single [String] element in [code]output[/code]. If [code]read_stderr[/code] is [code]true[/code], the output to the standard error stream will be included too.
+ If the command is successfully executed, the method will return the exit code of the command, or [code]-1[/code] if it fails.
+ [b]Note:[/b] The Godot thread will pause its execution until the executed command terminates. Use [Thread] to create a separate thread that will not pause the Godot thread, or use [method create_process] to create a completely independent process.
+ For example, to retrieve a list of the working directory's contents:
[codeblocks]
[gdscript]
var output = []
- var exit_code = OS.execute("ls", ["-l", "/tmp"], true, output)
+ var exit_code = OS.execute("ls", ["-l", "/tmp"], output)
[/gdscript]
[csharp]
var output = new Godot.Collections.Array();
- int exitCode = OS.Execute("ls", new string[] {"-l", "/tmp"}, true, output);
- [/csharp]
- [/codeblocks]
- Example of non-blocking mode, running another instance of the project and storing its process ID:
- [codeblocks]
- [gdscript]
- var pid = OS.execute(OS.get_executable_path(), [], false)
- [/gdscript]
- [csharp]
- var pid = OS.Execute(OS.GetExecutablePath(), new string[] {}, false);
+ int exitCode = OS.Execute("ls", new string[] {"-l", "/tmp"}, output);
[/csharp]
[/codeblocks]
- If you wish to access a shell built-in or perform a composite command, a platform-specific shell can be invoked. For example:
+ To execute a composite command, a platform-specific shell can be invoked. For example:
[codeblocks]
[gdscript]
var output = []
- OS.execute("CMD.exe", ["/C", "cd %TEMP% &amp;&amp; dir"], true, output)
+ OS.execute("CMD.exe", ["/C", "cd %TEMP% &amp;&amp; dir"], output)
[/gdscript]
[csharp]
var output = new Godot.Collections.Array();
- OS.Execute("CMD.exe", new string[] {"/C", "cd %TEMP% &amp;&amp; dir"}, true, output);
+ OS.Execute("CMD.exe", new string[] {"/C", "cd %TEMP% &amp;&amp; dir"}, output);
[/csharp]
[/codeblocks]
[b]Note:[/b] This method is implemented on Android, iOS, Linux, macOS and Windows.
diff --git a/doc/classes/PhysicsDirectSpaceState2D.xml b/doc/classes/PhysicsDirectSpaceState2D.xml
index c26cf0514c..b6f95305ed 100644
--- a/doc/classes/PhysicsDirectSpaceState2D.xml
+++ b/doc/classes/PhysicsDirectSpaceState2D.xml
@@ -16,8 +16,9 @@
<argument index="0" name="shape" type="PhysicsShapeQueryParameters2D">
</argument>
<description>
- Checks how far the shape can travel toward a point. If the shape can not move, the array will be empty.
- [b]Note:[/b] Both the shape and the motion are supplied through a [PhysicsShapeQueryParameters2D] object. The method will return an array with two floats between 0 and 1, both representing a fraction of [code]motion[/code]. The first is how far the shape can move without triggering a collision, and the second is the point at which a collision will occur. If no collision is detected, the returned array will be [code][1, 1][/code].
+ Checks how far a [Shape2D] can move without colliding. All the parameters for the query, including the shape and the motion, are supplied through a [PhysicsShapeQueryParameters2D] object.
+ Returns an array with the safe and unsafe proportions (between 0 and 1) of the motion. The safe proportion is the maximum fraction of the motion that can be made without a collision. The unsafe proportion is the minimum fraction of the distance that must be moved for a collision. If no collision is detected a result of [code][1.0, 1.0][/code] will be returned.
+ [b]Note:[/b] Any [Shape2D]s that the shape is already colliding with e.g. inside of, will be ignored. Use [method collide_shape] to determine the [Shape2D]s that the shape is already colliding with.
</description>
</method>
<method name="collide_shape">
diff --git a/doc/classes/PhysicsDirectSpaceState3D.xml b/doc/classes/PhysicsDirectSpaceState3D.xml
index 789e8cc731..243d071c56 100644
--- a/doc/classes/PhysicsDirectSpaceState3D.xml
+++ b/doc/classes/PhysicsDirectSpaceState3D.xml
@@ -18,8 +18,9 @@
<argument index="1" name="motion" type="Vector3">
</argument>
<description>
- Checks whether the shape can travel to a point. The method will return an array with two floats between 0 and 1, both representing a fraction of [code]motion[/code]. The first is how far the shape can move without triggering a collision, and the second is the point at which a collision will occur. If no collision is detected, the returned array will be [code][1, 1][/code].
- If the shape can not move, the returned array will be [code][0, 0][/code] under Bullet, and empty under GodotPhysics3D.
+ Checks how far a [Shape3D] can move without colliding. All the parameters for the query, including the shape, are supplied through a [PhysicsShapeQueryParameters3D] object.
+ Returns an array with the safe and unsafe proportions (between 0 and 1) of the motion. The safe proportion is the maximum fraction of the motion that can be made without a collision. The unsafe proportion is the minimum fraction of the distance that must be moved for a collision. If no collision is detected a result of [code][1.0, 1.0][/code] will be returned.
+ [b]Note:[/b] Any [Shape3D]s that the shape is already colliding with e.g. inside of, will be ignored. Use [method collide_shape] to determine the [Shape3D]s that the shape is already colliding with.
</description>
</method>
<method name="collide_shape">
diff --git a/doc/classes/Reference.xml b/doc/classes/Reference.xml
index 44ee6fbda1..724d2db924 100644
--- a/doc/classes/Reference.xml
+++ b/doc/classes/Reference.xml
@@ -5,7 +5,7 @@
</brief_description>
<description>
Base class for any object that keeps a reference count. [Resource] and many other helper objects inherit this class.
- Unlike [Object]s, References keep an internal reference counter so that they are automatically released when no longer in use, and only then. References therefore do not need to be freed manually with [method Object.free].
+ Unlike other [Object] types, References keep an internal reference counter so that they are automatically released when no longer in use, and only then. References therefore do not need to be freed manually with [method Object.free].
In the vast majority of use cases, instantiating and using [Reference]-derived types is all you need to do. The methods provided in this class are only for advanced users, and can cause issues if misused.
[b]Note:[/b] In C#, references will not be freed instantly after they are no longer in use. Instead, garbage collection will run periodically and will free references that are no longer in use. This means that unused references will linger on for a while before being removed.
</description>
diff --git a/doc/classes/Resource.xml b/doc/classes/Resource.xml
index 54984b7785..a9697c7fce 100644
--- a/doc/classes/Resource.xml
+++ b/doc/classes/Resource.xml
@@ -4,7 +4,7 @@
Base class for all resources.
</brief_description>
<description>
- Resource is the base class for all Godot-specific resource types, serving primarily as data containers. Unlike [Object]s, they are reference-counted and freed when no longer in use. They are also cached once loaded from disk, so that any further attempts to load a resource from a given path will return the same reference (all this in contrast to a [Node], which is not reference-counted and can be instanced from disk as many times as desired). Resources can be saved externally on disk or bundled into another object, such as a [Node] or another resource.
+ Resource is the base class for all Godot-specific resource types, serving primarily as data containers. Since they inherit from [Reference], resources are reference-counted and freed when no longer in use. They are also cached once loaded from disk, so that any further attempts to load a resource from a given path will return the same reference (all this in contrast to a [Node], which is not reference-counted and can be instanced from disk as many times as desired). Resources can be saved externally on disk or bundled into another object, such as a [Node] or another resource.
[b]Note:[/b] In C#, resources will not be freed instantly after they are no longer in use. Instead, garbage collection will run periodically and will free resources that are no longer in use. This means that unused resources will linger on for a while before being removed.
</description>
<tutorials>
@@ -29,6 +29,19 @@
[b]Note:[/b] If [code]subresources[/code] is [code]true[/code], this method will only perform a shallow copy. Nested resources within subresources will not be duplicated and will still be shared.
</description>
</method>
+ <method name="emit_changed">
+ <return type="void">
+ </return>
+ <description>
+ Emits the [signal changed] signal.
+ If external objects which depend on this resource should be updated, this method must be called manually whenever the state of this resource has changed (such as modification of properties).
+ The method is equivalent to:
+ [codeblock]
+ emit_signal("changed")
+ [/codeblock]
+ [b]Note:[/b] This method is called automatically for built-in resources.
+ </description>
+ </method>
<method name="get_local_scene" qualifiers="const">
<return type="Node">
</return>
diff --git a/doc/classes/RichTextLabel.xml b/doc/classes/RichTextLabel.xml
index 147e41bf1b..a182abc17b 100644
--- a/doc/classes/RichTextLabel.xml
+++ b/doc/classes/RichTextLabel.xml
@@ -455,6 +455,7 @@
</member>
<member name="visible_characters" type="int" setter="set_visible_characters" getter="get_visible_characters" default="-1">
The restricted number of characters to display in the label. If [code]-1[/code], all characters will be displayed.
+ [b]Note:[/b] Setting this property updates [member percent_visible] based on current [method get_total_character_count].
</member>
</members>
<signals>
diff --git a/doc/classes/String.xml b/doc/classes/String.xml
index 79f21a0e70..fcc70d166e 100644
--- a/doc/classes/String.xml
+++ b/doc/classes/String.xml
@@ -406,7 +406,8 @@
<argument index="0" name="chars" type="String">
</argument>
<description>
- Returns a copy of the string with characters removed from the left.
+ Returns a copy of the string with characters removed from the left. The [code]chars[/code] argument is a string specifying the set of characters to be removed.
+ [b]Note:[/b] The [code]chars[/code] is not a prefix. See [method trim_prefix] method that will remove a single prefix string rather than a set of characters.
</description>
</method>
<method name="match">
@@ -698,7 +699,8 @@
<argument index="0" name="chars" type="String">
</argument>
<description>
- Returns a copy of the string with characters removed from the right.
+ Returns a copy of the string with characters removed from the right. The [code]chars[/code] argument is a string specifying the set of characters to be removed.
+ [b]Note:[/b] The [code]chars[/code] is not a suffix. See [method trim_suffix] method that will remove a single suffix string rather than a set of characters.
</description>
</method>
<method name="sha1_buffer">
diff --git a/doc/classes/UndoRedo.xml b/doc/classes/UndoRedo.xml
index 2cc3e974e2..0e4a76a1a9 100644
--- a/doc/classes/UndoRedo.xml
+++ b/doc/classes/UndoRedo.xml
@@ -110,8 +110,10 @@
<method name="commit_action">
<return type="void">
</return>
+ <argument index="0" name="execute" type="bool" default="true">
+ </argument>
<description>
- Commit the action. All "do" methods/properties are called/set when this function is called.
+ Commit the action. If [code]execute[/code] is true (default), all "do" methods/properties are called/set when this function is called.
</description>
</method>
<method name="create_action">
@@ -126,11 +128,34 @@
The way actions are merged is dictated by the [code]merge_mode[/code] argument. See [enum MergeMode] for details.
</description>
</method>
+ <method name="get_action_name">
+ <return type="String">
+ </return>
+ <argument index="0" name="arg0" type="int">
+ </argument>
+ <description>
+ Gets the action name from its index.
+ </description>
+ </method>
+ <method name="get_current_action">
+ <return type="int">
+ </return>
+ <description>
+ Gets the index of the current action.
+ </description>
+ </method>
<method name="get_current_action_name" qualifiers="const">
<return type="String">
</return>
<description>
- Gets the name of the current action.
+ Gets the name of the current action, equivalent to [code]get_action_name(get_current_action())[/code].
+ </description>
+ </method>
+ <method name="get_history_count">
+ <return type="int">
+ </return>
+ <description>
+ Return how many element are in the history.
</description>
</method>
<method name="get_version" qualifiers="const">
diff --git a/drivers/dummy/rasterizer_dummy.h b/drivers/dummy/rasterizer_dummy.h
index 2c95c7dbec..2507add506 100644
--- a/drivers/dummy/rasterizer_dummy.h
+++ b/drivers/dummy/rasterizer_dummy.h
@@ -40,6 +40,29 @@
class RasterizerSceneDummy : public RendererSceneRender {
public:
+ GeometryInstance *geometry_instance_create(RID p_base) override { return nullptr; }
+ void geometry_instance_set_skeleton(GeometryInstance *p_geometry_instance, RID p_skeleton) override {}
+ void geometry_instance_set_material_override(GeometryInstance *p_geometry_instance, RID p_override) override {}
+ void geometry_instance_set_surface_materials(GeometryInstance *p_geometry_instance, const Vector<RID> &p_material) override {}
+ void geometry_instance_set_mesh_instance(GeometryInstance *p_geometry_instance, RID p_mesh_instance) override {}
+ void geometry_instance_set_transform(GeometryInstance *p_geometry_instance, const Transform &p_transform, const AABB &p_aabb, const AABB &p_transformed_aabbb) override {}
+ void geometry_instance_set_layer_mask(GeometryInstance *p_geometry_instance, uint32_t p_layer_mask) override {}
+ void geometry_instance_set_lod_bias(GeometryInstance *p_geometry_instance, float p_lod_bias) override {}
+ void geometry_instance_set_use_baked_light(GeometryInstance *p_geometry_instance, bool p_enable) override {}
+ void geometry_instance_set_use_dynamic_gi(GeometryInstance *p_geometry_instance, bool p_enable) override {}
+ void geometry_instance_set_use_lightmap(GeometryInstance *p_geometry_instance, RID p_lightmap_instance, const Rect2 &p_lightmap_uv_scale, int p_lightmap_slice_index) override {}
+ void geometry_instance_set_lightmap_capture(GeometryInstance *p_geometry_instance, const Color *p_sh9) override {}
+ void geometry_instance_set_instance_shader_parameters_offset(GeometryInstance *p_geometry_instance, int32_t p_offset) override {}
+ void geometry_instance_set_cast_double_sided_shadows(GeometryInstance *p_geometry_instance, bool p_enable) override {}
+
+ uint32_t geometry_instance_get_pair_mask() override { return 0; }
+ void geometry_instance_pair_light_instances(GeometryInstance *p_geometry_instance, const RID *p_light_instances, uint32_t p_light_instance_count) override {}
+ void geometry_instance_pair_reflection_probe_instances(GeometryInstance *p_geometry_instance, const RID *p_reflection_probe_instances, uint32_t p_reflection_probe_instance_count) override {}
+ void geometry_instance_pair_decal_instances(GeometryInstance *p_geometry_instance, const RID *p_decal_instances, uint32_t p_decal_instance_count) override {}
+ void geometry_instance_pair_gi_probe_instances(GeometryInstance *p_geometry_instance, const RID *p_gi_probe_instances, uint32_t p_gi_probe_instance_count) override {}
+
+ void geometry_instance_free(GeometryInstance *p_geometry_instance) override {}
+
/* SHADOW ATLAS API */
RID shadow_atlas_create() override { return RID(); }
@@ -57,7 +80,7 @@ public:
int sdfgi_get_pending_region_count(RID p_render_buffers) const override { return 0; }
AABB sdfgi_get_pending_region_bounds(RID p_render_buffers, int p_region) const override { return AABB(); }
uint32_t sdfgi_get_pending_region_cascade(RID p_render_buffers, int p_region) const override { return 0; }
- void sdfgi_update_probes(RID p_render_buffers, RID p_environment, const RID *p_directional_light_instances, uint32_t p_directional_light_count, const RID *p_positional_light_instances, uint32_t p_positional_light_count) override {}
+ void sdfgi_update_probes(RID p_render_buffers, RID p_environment, const Vector<RID> &p_directional_lights, const RID *p_positional_light_instances, uint32_t p_positional_light_count) override {}
/* SKY API */
@@ -129,6 +152,7 @@ public:
void light_instance_mark_visible(RID p_light_instance) override {}
RID reflection_atlas_create() override { return RID(); }
+ int reflection_atlas_get_size(RID p_ref_atlas) const override { return 0; }
void reflection_atlas_set_size(RID p_ref_atlas, int p_reflection_size, int p_reflection_count) override {}
RID reflection_probe_instance_create(RID p_probe) override { return RID(); }
@@ -142,19 +166,22 @@ public:
RID decal_instance_create(RID p_decal) override { return RID(); }
void decal_instance_set_transform(RID p_decal, const Transform &p_transform) override {}
+ RID lightmap_instance_create(RID p_lightmap) override { return RID(); }
+ void lightmap_instance_set_transform(RID p_lightmap, const Transform &p_transform) override {}
+
RID gi_probe_instance_create(RID p_gi_probe) override { return RID(); }
void gi_probe_instance_set_transform_to_data(RID p_probe, const Transform &p_xform) override {}
bool gi_probe_needs_update(RID p_probe) const override { return false; }
- void gi_probe_update(RID p_probe, bool p_update_light_instances, const Vector<RID> &p_light_instances, int p_dynamic_object_count, InstanceBase **p_dynamic_objects) override {}
+ void gi_probe_update(RID p_probe, bool p_update_light_instances, const Vector<RID> &p_light_instances, const PagedArray<RendererSceneRender::GeometryInstance *> &p_dynamic_objects) override {}
void gi_probe_set_quality(RS::GIProbeQuality) override {}
- void render_scene(RID p_render_buffers, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID *p_light_cull_result, int p_light_cull_count, RID *p_reflection_probe_cull_result, int p_reflection_probe_cull_count, RID *p_gi_probe_cull_result, int p_gi_probe_cull_count, RID *p_decal_cull_result, int p_decal_cull_count, InstanceBase **p_lightmap_cull_result, int p_lightmap_cull_count, RID p_environment, RID p_camera_effects, RID p_shadow_atlas, RID p_reflection_atlas, RID p_reflection_probe, int p_reflection_probe_pass) override {}
- void render_shadow(RID p_light, RID p_shadow_atlas, int p_pass, InstanceBase **p_cull_result, int p_cull_count) override {}
- void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) override {}
- void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count) override {}
- void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) override {}
- void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) override {}
+ void render_scene(RID p_render_buffers, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, const PagedArray<GeometryInstance *> &p_instances, const PagedArray<RID> &p_lights, const PagedArray<RID> &p_reflection_probes, const PagedArray<RID> &p_gi_probes, const PagedArray<RID> &p_decals, const PagedArray<RID> &p_lightmaps, RID p_environment, RID p_camera_effects, RID p_shadow_atlas, RID p_reflection_atlas, RID p_reflection_probe, int p_reflection_probe_pass, float p_screen_lod_threshold) override {}
+ void render_shadow(RID p_light, RID p_shadow_atlas, int p_pass, const PagedArray<GeometryInstance *> &p_instances, const Plane &p_camera_plane = Plane(), float p_lod_distance_multiplier = 0, float p_screen_lod_threshold = 0.0) override {}
+ void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, const PagedArray<GeometryInstance *> &p_instances, RID p_framebuffer, const Rect2i &p_region) override {}
+ void render_sdfgi(RID p_render_buffers, int p_region, const PagedArray<GeometryInstance *> &p_instances) override {}
+ void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const PagedArray<RID> *p_positional_lights) override {}
+ void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, const PagedArray<GeometryInstance *> &p_instances) override {}
void set_scene_pass(uint64_t p_pass) override {}
void set_time(double p_time, double p_step) override {}
@@ -370,6 +397,8 @@ public:
RID shader_get_default_texture_param(RID p_shader, const StringName &p_name) const override { return RID(); }
Variant shader_get_param_default(RID p_material, const StringName &p_param) const override { return Variant(); }
+ RS::ShaderNativeSourceCode shader_get_native_source_code(RID p_shader) const override { return RS::ShaderNativeSourceCode(); };
+
/* COMMON MATERIAL API */
RID material_create() override { return RID(); }
@@ -385,7 +414,7 @@ public:
bool material_is_animated(RID p_material) override { return false; }
bool material_casts_shadows(RID p_material) override { return false; }
void material_get_instance_shader_parameters(RID p_material, List<InstanceShaderParam> *r_parameters) override {}
- void material_update_dependency(RID p_material, InstanceBaseDependency *p_instance) override {}
+ void material_update_dependency(RID p_material, DependencyTracker *p_instance) override {}
/* MESH API */
@@ -397,6 +426,16 @@ public:
return mesh_owner.make_rid(mesh);
}
+ void mesh_set_blend_shape_count(RID p_mesh, int p_blend_shape_count) override {}
+ bool mesh_needs_instance(RID p_mesh, bool p_has_skeleton) override { return false; }
+ RID mesh_instance_create(RID p_base) override { return RID(); }
+ void mesh_instance_set_skeleton(RID p_mesh_instance, RID p_skeleton) override {}
+ void mesh_instance_set_blend_shape_weight(RID p_mesh_instance, int p_shape, float p_weight) override {}
+ void mesh_instance_check_for_update(RID p_mesh_instance) override {}
+ void update_mesh_instances() override {}
+ void reflection_probe_set_lod_threshold(RID p_probe, float p_ratio) override {}
+ float reflection_probe_get_lod_threshold(RID p_probe) const override { return 0.0; }
+
void mesh_add_surface(RID p_mesh, const RS::SurfaceData &p_surface) override {}
#if 0
@@ -644,8 +683,8 @@ public:
float reflection_probe_get_origin_max_distance(RID p_probe) const override { return 0.0; }
bool reflection_probe_renders_shadows(RID p_probe) const override { return false; }
- void base_update_dependency(RID p_base, InstanceBaseDependency *p_instance) override {}
- void skeleton_update_dependency(RID p_base, InstanceBaseDependency *p_instance) override {}
+ void base_update_dependency(RID p_base, DependencyTracker *p_instance) override {}
+ void skeleton_update_dependency(RID p_base, DependencyTracker *p_instance) override {}
/* DECAL API */
@@ -712,10 +751,10 @@ public:
/* LIGHTMAP CAPTURE */
#if 0
struct Instantiable {
- SelfList<RendererSceneRender::InstanceBase>::List instance_list;
+ SelfList<RendererSceneRender::GeometryInstance>::List instance_list;
_FORCE_INLINE_ void instance_change_notify(bool p_aabb = true, bool p_materials = true) override {
- SelfList<RendererSceneRender::InstanceBase> *instances = instance_list.first();
+ SelfList<RendererSceneRender::GeometryInstance> *instances = instance_list.first();
while (instances) override {
//instances->self()->base_changed(p_aabb, p_materials);
instances = instances->next();
@@ -723,9 +762,9 @@ public:
}
_FORCE_INLINE_ void instance_remove_deps() override {
- SelfList<RendererSceneRender::InstanceBase> *instances = instance_list.first();
+ SelfList<RendererSceneRender::GeometryInstance> *instances = instance_list.first();
while (instances) override {
- SelfList<RendererSceneRender::InstanceBase> *next = instances->next();
+ SelfList<RendererSceneRender::GeometryInstance> *next = instances->next();
//instances->self()->base_removed();
instances = next;
}
@@ -828,8 +867,8 @@ public:
int particles_get_draw_passes(RID p_particles) const override { return 0; }
RID particles_get_draw_pass_mesh(RID p_particles, int p_pass) const override { return RID(); }
- void particles_add_collision(RID p_particles, InstanceBaseDependency *p_instance) override {}
- void particles_remove_collision(RID p_particles, InstanceBaseDependency *p_instance) override {}
+ void particles_add_collision(RID p_particles, RID p_instance) override {}
+ void particles_remove_collision(RID p_particles, RID p_instance) override {}
void update_particles() override {}
@@ -850,6 +889,10 @@ public:
bool particles_collision_is_heightfield(RID p_particles_collision) const override { return false; }
RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const override { return RID(); }
+ RID particles_collision_instance_create(RID p_collision) override { return RID(); };
+ void particles_collision_instance_set_transform(RID p_collision_instance, const Transform &p_transform) override{};
+ void particles_collision_instance_set_active(RID p_collision_instance, bool p_active) override{};
+
/* GLOBAL VARIABLES */
void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value) override {}
diff --git a/drivers/unix/os_unix.cpp b/drivers/unix/os_unix.cpp
index d9c2a754d6..d94c2126ef 100644
--- a/drivers/unix/os_unix.cpp
+++ b/drivers/unix/os_unix.cpp
@@ -234,8 +234,11 @@ OS::TimeZoneInfo OS_Unix::get_time_zone_info() const {
}
void OS_Unix::delay_usec(uint32_t p_usec) const {
- struct timespec rem = { static_cast<time_t>(p_usec / 1000000), (static_cast<long>(p_usec) % 1000000) * 1000 };
- while (nanosleep(&rem, &rem) == EINTR) {
+ struct timespec requested = { static_cast<time_t>(p_usec / 1000000), (static_cast<long>(p_usec) % 1000000) * 1000 };
+ struct timespec remaining;
+ while (nanosleep(&requested, &remaining) == -1 && errno == EINTR) {
+ requested.tv_sec = remaining.tv_sec;
+ requested.tv_nsec = remaining.tv_nsec;
}
}
@@ -254,31 +257,26 @@ uint64_t OS_Unix::get_ticks_usec() const {
return longtime;
}
-Error OS_Unix::execute(const String &p_path, const List<String> &p_arguments, bool p_blocking, ProcessID *r_child_id, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+Error OS_Unix::execute(const String &p_path, const List<String> &p_arguments, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
#ifdef __EMSCRIPTEN__
// Don't compile this code at all to avoid undefined references.
// Actual virtual call goes to OS_JavaScript.
ERR_FAIL_V(ERR_BUG);
#else
- if (p_blocking && r_pipe) {
- String argss;
- argss = "\"" + p_path + "\"";
-
+ if (r_pipe) {
+ String command = "\"" + p_path + "\"";
for (int i = 0; i < p_arguments.size(); i++) {
- argss += String(" \"") + p_arguments[i] + "\"";
+ command += String(" \"") + p_arguments[i] + "\"";
}
-
if (read_stderr) {
- argss += " 2>&1"; // Read stderr too
+ command += " 2>&1"; // Include stderr
} else {
- argss += " 2>/dev/null"; //silence stderr
+ command += " 2>/dev/null"; // Silence stderr
}
- FILE *f = popen(argss.utf8().get_data(), "r");
-
- ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, "Cannot pipe stream from process running with following arguments '" + argss + "'.");
+ FILE *f = popen(command.utf8().get_data(), "r");
+ ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, "Cannot create pipe from command: " + command);
char buf[65535];
-
while (fgets(buf, 65535, f)) {
if (p_pipe_mutex) {
p_pipe_mutex->lock();
@@ -289,10 +287,10 @@ Error OS_Unix::execute(const String &p_path, const List<String> &p_arguments, bo
}
}
int rv = pclose(f);
+
if (r_exitcode) {
*r_exitcode = WEXITSTATUS(rv);
}
-
return OK;
}
@@ -300,14 +298,7 @@ Error OS_Unix::execute(const String &p_path, const List<String> &p_arguments, bo
ERR_FAIL_COND_V(pid < 0, ERR_CANT_FORK);
if (pid == 0) {
- // is child
-
- if (!p_blocking) {
- // For non blocking calls, create a new session-ID so parent won't wait for it.
- // This ensures the process won't go zombie at end.
- setsid();
- }
-
+ // The child process
Vector<CharString> cs;
cs.push_back(p_path.utf8());
for (int i = 0; i < p_arguments.size(); i++) {
@@ -321,24 +312,56 @@ Error OS_Unix::execute(const String &p_path, const List<String> &p_arguments, bo
args.push_back(0);
execvp(p_path.utf8().get_data(), &args[0]);
- // still alive? something failed..
- fprintf(stderr, "**ERROR** OS_Unix::execute - Could not create child process while executing: %s\n", p_path.utf8().get_data());
+ // The execvp() function only returns if an error occurs.
+ ERR_PRINT("Could not create child process: " + p_path);
raise(SIGKILL);
}
- if (p_blocking) {
- int status;
- waitpid(pid, &status, 0);
- if (r_exitcode) {
- *r_exitcode = WIFEXITED(status) ? WEXITSTATUS(status) : status;
+ int status;
+ waitpid(pid, &status, 0);
+ if (r_exitcode) {
+ *r_exitcode = WIFEXITED(status) ? WEXITSTATUS(status) : status;
+ }
+ return OK;
+#endif
+}
+
+Error OS_Unix::create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id) {
+#ifdef __EMSCRIPTEN__
+ // Don't compile this code at all to avoid undefined references.
+ // Actual virtual call goes to OS_JavaScript.
+ ERR_FAIL_V(ERR_BUG);
+#else
+ pid_t pid = fork();
+ ERR_FAIL_COND_V(pid < 0, ERR_CANT_FORK);
+
+ if (pid == 0) {
+ // The new process
+ // Create a new session-ID so parent won't wait for it.
+ // This ensures the process won't go zombie at the end.
+ setsid();
+
+ Vector<CharString> cs;
+ cs.push_back(p_path.utf8());
+ for (int i = 0; i < p_arguments.size(); i++) {
+ cs.push_back(p_arguments[i].utf8());
}
- } else {
- if (r_child_id) {
- *r_child_id = pid;
+ Vector<char *> args;
+ for (int i = 0; i < cs.size(); i++) {
+ args.push_back((char *)cs[i].get_data());
}
+ args.push_back(0);
+
+ execvp(p_path.utf8().get_data(), &args[0]);
+ // The execvp() function only returns if an error occurs.
+ ERR_PRINT("Could not create child process: " + p_path);
+ raise(SIGKILL);
}
+ if (r_child_id) {
+ *r_child_id = pid;
+ }
return OK;
#endif
}
diff --git a/drivers/unix/os_unix.h b/drivers/unix/os_unix.h
index 7d1f1c82c2..6c79d984e9 100644
--- a/drivers/unix/os_unix.h
+++ b/drivers/unix/os_unix.h
@@ -82,7 +82,8 @@ public:
virtual void delay_usec(uint32_t p_usec) const override;
virtual uint64_t get_ticks_usec() const override;
- virtual Error execute(const String &p_path, const List<String> &p_arguments, bool p_blocking = true, ProcessID *r_child_id = nullptr, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ virtual Error execute(const String &p_path, const List<String> &p_arguments, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ virtual Error create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id = nullptr) override;
virtual Error kill(const ProcessID &p_pid) override;
virtual int get_process_id() const override;
diff --git a/editor/editor_export.cpp b/editor/editor_export.cpp
index fd4423646f..dd3e81c8c0 100644
--- a/editor/editor_export.cpp
+++ b/editor/editor_export.cpp
@@ -732,6 +732,26 @@ Error EditorExportPlatform::export_project_files(const Ref<EditorExportPreset> &
_export_find_dependencies(files[i], paths);
}
+
+ // Add autoload resources and their dependencies
+ List<PropertyInfo> props;
+ ProjectSettings::get_singleton()->get_property_list(&props);
+
+ for (List<PropertyInfo>::Element *E = props.front(); E; E = E->next()) {
+ const PropertyInfo &pi = E->get();
+
+ if (!pi.name.begins_with("autoload/")) {
+ continue;
+ }
+
+ String autoload_path = ProjectSettings::get_singleton()->get(pi.name);
+
+ if (autoload_path.begins_with("*")) {
+ autoload_path = autoload_path.substr(1);
+ }
+
+ _export_find_dependencies(autoload_path, paths);
+ }
}
//add native icons to non-resource include list
diff --git a/editor/editor_file_system.cpp b/editor/editor_file_system.cpp
index 208f678947..76814ea378 100644
--- a/editor/editor_file_system.cpp
+++ b/editor/editor_file_system.cpp
@@ -1477,20 +1477,21 @@ void EditorFileSystem::update_file(const String &p_file) {
String type = ResourceLoader::get_resource_type(p_file);
if (cpos == -1) {
- //the file did not exist, it was added
+ // The file did not exist, it was added.
- late_added_files.insert(p_file); //remember that it was added. This mean it will be scanned and imported on editor restart
+ late_added_files.insert(p_file); // Remember that it was added. This mean it will be scanned and imported on editor restart.
int idx = 0;
+ String file_name = p_file.get_file();
for (int i = 0; i < fs->files.size(); i++) {
- if (p_file < fs->files[i]->file) {
+ if (file_name < fs->files[i]->file) {
break;
}
idx++;
}
EditorFileSystemDirectory::FileInfo *fi = memnew(EditorFileSystemDirectory::FileInfo);
- fi->file = p_file.get_file();
+ fi->file = file_name;
fi->import_modified_time = 0;
fi->import_valid = ResourceLoader::is_import_valid(p_file);
diff --git a/editor/editor_node.cpp b/editor/editor_node.cpp
index 6f03518029..b41bf81161 100644
--- a/editor/editor_node.cpp
+++ b/editor/editor_node.cpp
@@ -2855,8 +2855,7 @@ void EditorNode::_discard_changes(const String &p_str) {
args.push_back(exec.get_base_dir());
args.push_back("--project-manager");
- OS::ProcessID pid = 0;
- Error err = OS::get_singleton()->execute(exec, args, false, &pid);
+ Error err = OS::get_singleton()->create_process(exec, args);
ERR_FAIL_COND(err);
} break;
}
@@ -4703,8 +4702,8 @@ void EditorNode::_scene_tab_closed(int p_tab, int option) {
}
bool unsaved = (p_tab == editor_data.get_edited_scene()) ?
- saved_version != editor_data.get_undo_redo().get_version() :
- editor_data.get_scene_version(p_tab) != 0;
+ saved_version != editor_data.get_undo_redo().get_version() :
+ editor_data.get_scene_version(p_tab) != 0;
if (unsaved) {
save_confirmation->get_ok_button()->set_text(TTR("Save & Close"));
save_confirmation->set_text(vformat(TTR("Save changes to '%s' before closing?"), scene->get_filename() != "" ? scene->get_filename() : "unsaved scene"));
@@ -5139,9 +5138,7 @@ void EditorNode::_global_menu_new_window(const Variant &p_tag) {
List<String> args;
args.push_back("-p");
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- OS::get_singleton()->execute(exec, args, false, &pid);
+ OS::get_singleton()->create_process(exec, args);
}
}
@@ -5467,7 +5464,7 @@ void EditorNode::_print_handler(void *p_this, const String &p_string, bool p_err
static void _execute_thread(void *p_ud) {
EditorNode::ExecuteThreadArgs *eta = (EditorNode::ExecuteThreadArgs *)p_ud;
- Error err = OS::get_singleton()->execute(eta->path, eta->args, true, nullptr, &eta->output, &eta->exitcode, true, &eta->execute_output_mutex);
+ Error err = OS::get_singleton()->execute(eta->path, eta->args, &eta->output, &eta->exitcode, true, &eta->execute_output_mutex);
print_verbose("Thread exit status: " + itos(eta->exitcode));
if (err != OK) {
eta->exitcode = err;
diff --git a/editor/editor_properties.cpp b/editor/editor_properties.cpp
index 3fa183e10c..4d8a4f46b2 100644
--- a/editor/editor_properties.cpp
+++ b/editor/editor_properties.cpp
@@ -2148,6 +2148,12 @@ void EditorPropertyColor::_color_changed(const Color &p_color) {
emit_changed(get_edited_property(), p_color, "", true);
}
+void EditorPropertyColor::_popup_closed() {
+ if (picker->get_pick_color() != last_color) {
+ emit_changed(get_edited_property(), picker->get_pick_color(), "", false);
+ }
+}
+
void EditorPropertyColor::_picker_created() {
// get default color picker mode from editor settings
int default_color_mode = EDITOR_GET("interface/inspector/default_color_picker_mode");
@@ -2158,6 +2164,10 @@ void EditorPropertyColor::_picker_created() {
}
}
+void EditorPropertyColor::_picker_opening() {
+ last_color = picker->get_pick_color();
+}
+
void EditorPropertyColor::_bind_methods() {
}
@@ -2191,7 +2201,9 @@ EditorPropertyColor::EditorPropertyColor() {
add_child(picker);
picker->set_flat(true);
picker->connect("color_changed", callable_mp(this, &EditorPropertyColor::_color_changed));
+ picker->connect("popup_closed", callable_mp(this, &EditorPropertyColor::_popup_closed));
picker->connect("picker_created", callable_mp(this, &EditorPropertyColor::_picker_created));
+ picker->get_popup()->connect("about_to_popup", callable_mp(this, &EditorPropertyColor::_picker_opening));
}
////////////// NODE PATH //////////////////////
diff --git a/editor/editor_properties.h b/editor/editor_properties.h
index 856a406e62..4775259111 100644
--- a/editor/editor_properties.h
+++ b/editor/editor_properties.h
@@ -547,7 +547,11 @@ class EditorPropertyColor : public EditorProperty {
GDCLASS(EditorPropertyColor, EditorProperty);
ColorPickerButton *picker;
void _color_changed(const Color &p_color);
+ void _popup_closed();
void _picker_created();
+ void _picker_opening();
+
+ Color last_color;
protected:
static void _bind_methods();
diff --git a/editor/editor_run.cpp b/editor/editor_run.cpp
index 6fae56074d..e46f4eb65a 100644
--- a/editor/editor_run.cpp
+++ b/editor/editor_run.cpp
@@ -201,7 +201,7 @@ Error EditorRun::run(const String &p_scene, const String &p_custom_args, const L
int instances = EditorSettings::get_singleton()->get_project_metadata("debug_options", "run_debug_instances", 1);
for (int i = 0; i < instances; i++) {
OS::ProcessID pid = 0;
- Error err = OS::get_singleton()->execute(exec, args, false, &pid);
+ Error err = OS::get_singleton()->create_process(exec, args, &pid);
ERR_FAIL_COND_V(err, err);
pids.push_back(pid);
}
diff --git a/editor/import/scene_importer_mesh.cpp b/editor/import/scene_importer_mesh.cpp
index cd7d58c6f6..620437af0e 100644
--- a/editor/import/scene_importer_mesh.cpp
+++ b/editor/import/scene_importer_mesh.cpp
@@ -140,6 +140,12 @@ void EditorSceneImporterMesh::generate_lods() {
if (!SurfaceTool::simplify_func) {
return;
}
+ if (!SurfaceTool::simplify_scale_func) {
+ return;
+ }
+ if (!SurfaceTool::simplify_sloppy_func) {
+ return;
+ }
for (int i = 0; i < surfaces.size(); i++) {
if (surfaces[i].primitive != Mesh::PRIMITIVE_TRIANGLES) {
@@ -157,20 +163,52 @@ void EditorSceneImporterMesh::generate_lods() {
int min_indices = 10;
int index_target = indices.size() / 2;
- print_line("total: " + itos(indices.size()));
+ print_line("Total indices: " + itos(indices.size()));
+ float mesh_scale = SurfaceTool::simplify_scale_func((const float *)vertices_ptr, vertex_count, sizeof(Vector3));
+ const float target_error = 1e-3f;
+ float abs_target_error = target_error / mesh_scale;
while (index_target > min_indices) {
float error;
Vector<int> new_indices;
new_indices.resize(indices.size());
- size_t new_len = SurfaceTool::simplify_func((unsigned int *)new_indices.ptrw(), (const unsigned int *)indices.ptr(), indices.size(), (const float *)vertices_ptr, vertex_count, sizeof(Vector3), index_target, 1e20, &error);
- print_line("shoot for " + itos(index_target) + ", got " + itos(new_len) + " distance " + rtos(error));
+ size_t new_len = SurfaceTool::simplify_func((unsigned int *)new_indices.ptrw(), (const unsigned int *)indices.ptr(), indices.size(), (const float *)vertices_ptr, vertex_count, sizeof(Vector3), index_target, abs_target_error, &error);
if ((int)new_len > (index_target * 120 / 100)) {
+ // Attribute discontinuities break normals.
+ bool is_sloppy = false;
+ if (is_sloppy) {
+ abs_target_error = target_error / mesh_scale;
+ index_target = new_len;
+ while (index_target > min_indices) {
+ Vector<int> sloppy_new_indices;
+ sloppy_new_indices.resize(indices.size());
+ new_len = SurfaceTool::simplify_sloppy_func((unsigned int *)sloppy_new_indices.ptrw(), (const unsigned int *)indices.ptr(), indices.size(), (const float *)vertices_ptr, vertex_count, sizeof(Vector3), index_target, abs_target_error, &error);
+ if ((int)new_len > (index_target * 120 / 100)) {
+ break; // 20 percent tolerance
+ }
+ sloppy_new_indices.resize(new_len);
+ Surface::LOD lod;
+ lod.distance = error * mesh_scale;
+ abs_target_error = lod.distance;
+ if (Math::is_equal_approx(abs_target_error, 0.0f)) {
+ return;
+ }
+ lod.indices = sloppy_new_indices;
+ print_line("Lod " + itos(surfaces.write[i].lods.size()) + " shoot for " + itos(index_target / 3) + " triangles, got " + itos(new_len / 3) + " triangles. Distance " + rtos(lod.distance) + ". Use simplify sloppy.");
+ surfaces.write[i].lods.push_back(lod);
+ index_target /= 2;
+ }
+ }
break; // 20 percent tolerance
}
new_indices.resize(new_len);
Surface::LOD lod;
- lod.distance = error;
+ lod.distance = error * mesh_scale;
+ abs_target_error = lod.distance;
+ if (Math::is_equal_approx(abs_target_error, 0.0f)) {
+ return;
+ }
lod.indices = new_indices;
+ print_line("Lod " + itos(surfaces.write[i].lods.size()) + " shoot for " + itos(index_target / 3) + " triangles, got " + itos(new_len / 3) + " triangles. Distance " + rtos(lod.distance));
surfaces.write[i].lods.push_back(lod);
index_target /= 2;
}
diff --git a/editor/plugins/canvas_item_editor_plugin.cpp b/editor/plugins/canvas_item_editor_plugin.cpp
index 498f9d5c19..49af478307 100644
--- a/editor/plugins/canvas_item_editor_plugin.cpp
+++ b/editor/plugins/canvas_item_editor_plugin.cpp
@@ -3149,16 +3149,16 @@ void CanvasItemEditor::_draw_ruler_tool() {
float arc_1_start_angle =
end_to_begin.x < 0 ?
- (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0) :
- (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
+ (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0) :
+ (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
float arc_1_end_angle = arc_1_start_angle + vertical_angle_rad;
// Constrain arc to triangle height & max size
float arc_1_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.y)), arc_max_radius);
float arc_2_start_angle =
end_to_begin.x < 0 ?
- (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad) :
- (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
+ (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad) :
+ (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
float arc_2_end_angle = arc_2_start_angle + horizontal_angle_rad;
// Constrain arc to triangle width & max size
float arc_2_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.x)), arc_max_radius);
diff --git a/editor/plugins/curve_editor_plugin.cpp b/editor/plugins/curve_editor_plugin.cpp
index 88e56ccfb9..bff5cb8d2a 100644
--- a/editor/plugins/curve_editor_plugin.cpp
+++ b/editor/plugins/curve_editor_plugin.cpp
@@ -353,8 +353,8 @@ void CurveEditor::open_context_menu(Vector2 pos) {
_context_menu->add_check_item(TTR("Linear"), CONTEXT_LINEAR);
bool is_linear = _selected_tangent == TANGENT_LEFT ?
- _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR :
- _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
+ _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR :
+ _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
_context_menu->set_item_checked(_context_menu->get_item_index(CONTEXT_LINEAR), is_linear);
diff --git a/editor/plugins/script_editor_plugin.cpp b/editor/plugins/script_editor_plugin.cpp
index 1af790c48d..216c0c3bef 100644
--- a/editor/plugins/script_editor_plugin.cpp
+++ b/editor/plugins/script_editor_plugin.cpp
@@ -1954,7 +1954,20 @@ void ScriptEditor::_update_script_names() {
Vector<String> disambiguated_script_names;
Vector<String> full_script_paths;
for (int j = 0; j < sedata.size(); j++) {
- disambiguated_script_names.append(sedata[j].name.replace("(*)", "").get_file());
+ String name = sedata[j].name.replace("(*)", "");
+ ScriptListName script_display = (ScriptListName)(int)EditorSettings::get_singleton()->get("text_editor/script_list/list_script_names_as");
+ switch (script_display) {
+ case DISPLAY_NAME: {
+ name = name.get_file();
+ } break;
+ case DISPLAY_DIR_AND_NAME: {
+ name = name.get_base_dir().get_file().plus_file(name.get_file());
+ } break;
+ default:
+ break;
+ }
+
+ disambiguated_script_names.append(name);
full_script_paths.append(sedata[j].tooltip);
}
@@ -2198,7 +2211,7 @@ bool ScriptEditor::edit(const RES &p_resource, int p_line, int p_col, bool p_gra
args.push_back(script_path);
}
- Error err = OS::get_singleton()->execute(path, args, false);
+ Error err = OS::get_singleton()->create_process(path, args);
if (err == OK) {
return false;
}
diff --git a/editor/plugins/sprite_frames_editor_plugin.cpp b/editor/plugins/sprite_frames_editor_plugin.cpp
index 2aa6ad0eaa..0547f99079 100644
--- a/editor/plugins/sprite_frames_editor_plugin.cpp
+++ b/editor/plugins/sprite_frames_editor_plugin.cpp
@@ -32,6 +32,7 @@
#include "core/config/project_settings.h"
#include "core/io/resource_loader.h"
+#include "core/os/keyboard.h"
#include "editor/editor_scale.h"
#include "editor/editor_settings.h"
#include "scene/3d/sprite_3d.h"
@@ -952,7 +953,11 @@ void SpriteFramesEditor::drop_data_fw(const Point2 &p_point, const Variant &p_da
if (String(d["type"]) == "files") {
Vector<String> files = d["files"];
- _file_load_request(files, at_pos);
+ if (Input::get_singleton()->is_key_pressed(KEY_CONTROL)) {
+ _prepare_sprite_sheet(files[0]);
+ } else {
+ _file_load_request(files, at_pos);
+ }
}
}
diff --git a/editor/plugins/visual_shader_editor_plugin.cpp b/editor/plugins/visual_shader_editor_plugin.cpp
index 056562a7a7..58ae115b26 100644
--- a/editor/plugins/visual_shader_editor_plugin.cpp
+++ b/editor/plugins/visual_shader_editor_plugin.cpp
@@ -2799,15 +2799,35 @@ void VisualShaderEditor::drop_data_fw(const Point2 &p_point, const Variant &p_da
void VisualShaderEditor::_show_preview_text() {
preview_showed = !preview_showed;
- preview_vbox->set_visible(preview_showed);
if (preview_showed) {
+ if (preview_first) {
+ preview_window->set_size(Size2(400 * EDSCALE, 600 * EDSCALE));
+ preview_window->popup_centered();
+ preview_first = false;
+ } else {
+ preview_window->popup();
+ }
+ _preview_size_changed();
+
if (pending_update_preview) {
_update_preview();
pending_update_preview = false;
}
+ } else {
+ preview_window->hide();
}
}
+void VisualShaderEditor::_preview_close_requested() {
+ preview_showed = false;
+ preview_window->hide();
+ preview_shader->set_pressed(false);
+}
+
+void VisualShaderEditor::_preview_size_changed() {
+ preview_vbox->set_custom_minimum_size(preview_window->get_size());
+}
+
static ShaderLanguage::DataType _get_global_variable_type(const StringName &p_variable) {
RS::GlobalVariableType gvt = RS::get_singleton()->global_variable_get_type(p_variable);
return RS::global_variable_type_get_shader_datatype(gvt);
@@ -2843,6 +2863,16 @@ void VisualShaderEditor::_update_preview() {
}
}
+void VisualShaderEditor::_visibility_changed() {
+ if (!is_visible()) {
+ if (preview_window->is_visible()) {
+ preview_shader->set_pressed(false);
+ preview_window->hide();
+ preview_showed = false;
+ }
+ }
+}
+
void VisualShaderEditor::_bind_methods() {
ClassDB::bind_method("_update_graph", &VisualShaderEditor::_update_graph);
ClassDB::bind_method("_update_options_menu", &VisualShaderEditor::_update_options_menu);
@@ -2873,7 +2903,6 @@ VisualShaderEditor::VisualShaderEditor() {
saved_node_pos = Point2(0, 0);
ShaderLanguage::get_keyword_list(&keyword_list);
- preview_showed = false;
pending_update_preview = false;
shader_error = false;
@@ -2882,16 +2911,11 @@ VisualShaderEditor::VisualShaderEditor() {
from_node = -1;
from_slot = -1;
- main_box = memnew(HSplitContainer);
- main_box->set_v_size_flags(SIZE_EXPAND_FILL);
- main_box->set_h_size_flags(SIZE_EXPAND_FILL);
- add_child(main_box);
-
graph = memnew(GraphEdit);
graph->get_zoom_hbox()->set_h_size_flags(SIZE_EXPAND_FILL);
graph->set_v_size_flags(SIZE_EXPAND_FILL);
graph->set_h_size_flags(SIZE_EXPAND_FILL);
- main_box->add_child(graph);
+ add_child(graph);
graph->set_drag_forwarding(this);
graph->add_valid_right_disconnect_type(VisualShaderNode::PORT_TYPE_SCALAR);
graph->add_valid_right_disconnect_type(VisualShaderNode::PORT_TYPE_SCALAR_INT);
@@ -2912,6 +2936,7 @@ VisualShaderEditor::VisualShaderEditor() {
graph->connect("gui_input", callable_mp(this, &VisualShaderEditor::_graph_gui_input));
graph->connect("connection_to_empty", callable_mp(this, &VisualShaderEditor::_connection_to_empty));
graph->connect("connection_from_empty", callable_mp(this, &VisualShaderEditor::_connection_from_empty));
+ graph->connect("visibility_changed", callable_mp(this, &VisualShaderEditor::_visibility_changed));
graph->add_valid_connection_type(VisualShaderNode::PORT_TYPE_SCALAR, VisualShaderNode::PORT_TYPE_SCALAR);
graph->add_valid_connection_type(VisualShaderNode::PORT_TYPE_SCALAR, VisualShaderNode::PORT_TYPE_SCALAR_INT);
graph->add_valid_connection_type(VisualShaderNode::PORT_TYPE_SCALAR, VisualShaderNode::PORT_TYPE_VECTOR);
@@ -2966,29 +2991,35 @@ VisualShaderEditor::VisualShaderEditor() {
preview_shader = memnew(Button);
preview_shader->set_flat(true);
preview_shader->set_toggle_mode(true);
- preview_shader->set_tooltip(TTR("Show resulted shader code."));
+ preview_shader->set_tooltip(TTR("Show generated shader code."));
graph->get_zoom_hbox()->add_child(preview_shader);
preview_shader->connect("pressed", callable_mp(this, &VisualShaderEditor::_show_preview_text));
///////////////////////////////////////
- // PREVIEW PANEL
+ // PREVIEW WINDOW
///////////////////////////////////////
+ preview_window = memnew(Window);
+ preview_window->set_title(TTR("Generated shader code"));
+ preview_window->set_visible(preview_showed);
+ preview_window->connect("close_requested", callable_mp(this, &VisualShaderEditor::_preview_close_requested));
+ preview_window->connect("size_changed", callable_mp(this, &VisualShaderEditor::_preview_size_changed));
+ add_child(preview_window);
+
preview_vbox = memnew(VBoxContainer);
- preview_vbox->set_visible(preview_showed);
- main_box->add_child(preview_vbox);
+ preview_window->add_child(preview_vbox);
+
preview_text = memnew(CodeEdit);
syntax_highlighter.instance();
preview_vbox->add_child(preview_text);
- preview_text->set_h_size_flags(SIZE_EXPAND_FILL);
- preview_text->set_v_size_flags(SIZE_EXPAND_FILL);
- preview_text->set_custom_minimum_size(Size2(400 * EDSCALE, 0));
+ preview_text->set_v_size_flags(Control::SIZE_EXPAND_FILL);
preview_text->set_syntax_highlighter(syntax_highlighter);
preview_text->set_draw_line_numbers(true);
preview_text->set_readonly(true);
error_text = memnew(Label);
preview_vbox->add_child(error_text);
+ error_text->set_autowrap(true);
error_text->set_visible(false);
///////////////////////////////////////
diff --git a/editor/plugins/visual_shader_editor_plugin.h b/editor/plugins/visual_shader_editor_plugin.h
index 6e8ac92dc2..1c3296a10b 100644
--- a/editor/plugins/visual_shader_editor_plugin.h
+++ b/editor/plugins/visual_shader_editor_plugin.h
@@ -134,7 +134,6 @@ class VisualShaderEditor : public VBoxContainer {
int editing_port;
Ref<VisualShader> visual_shader;
- HSplitContainer *main_box;
GraphEdit *graph;
Button *add_node;
Button *preview_shader;
@@ -148,6 +147,7 @@ class VisualShaderEditor : public VBoxContainer {
bool pending_update_preview;
bool shader_error;
+ Window *preview_window;
VBoxContainer *preview_vbox;
CodeEdit *preview_text;
Ref<CodeHighlighter> syntax_highlighter;
@@ -161,7 +161,8 @@ class VisualShaderEditor : public VBoxContainer {
PopupMenu *popup_menu;
MenuButton *tools;
- bool preview_showed;
+ bool preview_first = true;
+ bool preview_showed = false;
bool particles_mode;
enum TypeFlags {
@@ -277,6 +278,8 @@ class VisualShaderEditor : public VBoxContainer {
void _set_mode(int p_which);
void _show_preview_text();
+ void _preview_close_requested();
+ void _preview_size_changed();
void _update_preview();
String _get_description(int p_idx);
@@ -388,6 +391,8 @@ class VisualShaderEditor : public VBoxContainer {
void _update_uniforms(bool p_update_refs);
void _update_uniform_refs(Set<String> &p_names);
+ void _visibility_changed();
+
protected:
void _notification(int p_what);
static void _bind_methods();
diff --git a/editor/project_manager.cpp b/editor/project_manager.cpp
index dacd0162ba..1007a6c689 100644
--- a/editor/project_manager.cpp
+++ b/editor/project_manager.cpp
@@ -1297,9 +1297,7 @@ void ProjectList::_global_menu_new_window(const Variant &p_tag) {
List<String> args;
args.push_back("-p");
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- OS::get_singleton()->execute(exec, args, false, &pid);
+ OS::get_singleton()->create_process(exec, args);
}
void ProjectList::_global_menu_open_project(const Variant &p_tag) {
@@ -1310,9 +1308,7 @@ void ProjectList::_global_menu_open_project(const Variant &p_tag) {
List<String> args;
args.push_back(conf);
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- OS::get_singleton()->execute(exec, args, false, &pid);
+ OS::get_singleton()->create_process(exec, args);
}
}
@@ -2055,9 +2051,7 @@ void ProjectManager::_open_selected_projects() {
}
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- Error err = OS::get_singleton()->execute(exec, args, false, &pid);
+ Error err = OS::get_singleton()->create_process(exec, args);
ERR_FAIL_COND(err);
}
@@ -2143,9 +2137,7 @@ void ProjectManager::_run_project_confirm() {
}
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- Error err = OS::get_singleton()->execute(exec, args, false, &pid);
+ Error err = OS::get_singleton()->create_process(exec, args);
ERR_FAIL_COND(err);
}
}
@@ -2270,8 +2262,7 @@ void ProjectManager::_language_selected(int p_id) {
void ProjectManager::_restart_confirm() {
List<String> args = OS::get_singleton()->get_cmdline_args();
String exec = OS::get_singleton()->get_executable_path();
- OS::ProcessID pid = 0;
- Error err = OS::get_singleton()->execute(exec, args, false, &pid);
+ Error err = OS::get_singleton()->create_process(exec, args);
ERR_FAIL_COND(err);
_dim_window();
diff --git a/editor/project_settings_editor.cpp b/editor/project_settings_editor.cpp
index 98cdab0b70..4516180fa5 100644
--- a/editor/project_settings_editor.cpp
+++ b/editor/project_settings_editor.cpp
@@ -381,9 +381,12 @@ ProjectSettingsEditor::ProjectSettingsEditor(EditorData *p_data) {
type->set_custom_minimum_size(Size2(100, 0) * EDSCALE);
hbc->add_child(type);
- // Start at 1 to avoid adding "Nil" as an option
- for (int i = 1; i < Variant::VARIANT_MAX; i++) {
- type->add_item(Variant::get_type_name(Variant::Type(i)));
+ for (int i = 0; i < Variant::VARIANT_MAX; i++) {
+ // There's no point in adding Nil types, and Object types
+ // can't be serialized correctly in the project settings.
+ if (i != Variant::NIL && i != Variant::OBJECT) {
+ type->add_item(Variant::get_type_name(Variant::Type(i)));
+ }
}
l = memnew(Label);
diff --git a/main/main.cpp b/main/main.cpp
index 25c559dac1..58782fa9c1 100644
--- a/main/main.cpp
+++ b/main/main.cpp
@@ -2686,8 +2686,7 @@ void Main::cleanup() {
//attempt to restart with arguments
String exec = OS::get_singleton()->get_executable_path();
List<String> args = OS::get_singleton()->get_restart_on_exit_arguments();
- OS::ProcessID pid = 0;
- OS::get_singleton()->execute(exec, args, false, &pid);
+ OS::get_singleton()->create_process(exec, args);
OS::get_singleton()->set_restart_on_exit(false, List<String>()); //clear list (uses memory)
}
diff --git a/modules/bullet/rigid_body_bullet.cpp b/modules/bullet/rigid_body_bullet.cpp
index 7a53f91b33..4763098584 100644
--- a/modules/bullet/rigid_body_bullet.cpp
+++ b/modules/bullet/rigid_body_bullet.cpp
@@ -322,7 +322,8 @@ void RigidBodyBullet::set_space(SpaceBullet *p_space) {
if (space) {
can_integrate_forces = false;
isScratchedSpaceOverrideModificator = false;
-
+ // Remove any constraints
+ space->remove_rigid_body_constraints(this);
// Remove this object form the physics world
space->remove_rigid_body(this);
}
diff --git a/modules/bullet/space_bullet.cpp b/modules/bullet/space_bullet.cpp
index a8d55b59b3..d7dd11d2a5 100644
--- a/modules/bullet/space_bullet.cpp
+++ b/modules/bullet/space_bullet.cpp
@@ -177,8 +177,10 @@ bool BulletPhysicsDirectSpaceState::cast_motion(const RID &p_shape, const Transf
bt_xform_to.getOrigin() += bt_motion;
if ((bt_xform_to.getOrigin() - bt_xform_from.getOrigin()).fuzzyZero()) {
+ r_closest_safe = 1.0f;
+ r_closest_unsafe = 1.0f;
bulletdelete(btShape);
- return false;
+ return true;
}
GodotClosestConvexResultCallback btResult(bt_xform_from.getOrigin(), bt_xform_to.getOrigin(), &p_exclude, p_collide_with_bodies, p_collide_with_areas);
@@ -477,7 +479,7 @@ void SpaceBullet::add_rigid_body(RigidBodyBullet *p_body) {
}
}
-void SpaceBullet::remove_rigid_body(RigidBodyBullet *p_body) {
+void SpaceBullet::remove_rigid_body_constraints(RigidBodyBullet *p_body) {
btRigidBody *btBody = p_body->get_bt_rigid_body();
int constraints = btBody->getNumConstraintRefs();
@@ -487,6 +489,10 @@ void SpaceBullet::remove_rigid_body(RigidBodyBullet *p_body) {
dynamicsWorld->removeConstraint(btBody->getConstraintRef(i));
}
}
+}
+
+void SpaceBullet::remove_rigid_body(RigidBodyBullet *p_body) {
+ btRigidBody *btBody = p_body->get_bt_rigid_body();
if (p_body->is_static()) {
dynamicsWorld->removeCollisionObject(btBody);
diff --git a/modules/bullet/space_bullet.h b/modules/bullet/space_bullet.h
index 42f982d5f0..0f2482e551 100644
--- a/modules/bullet/space_bullet.h
+++ b/modules/bullet/space_bullet.h
@@ -151,6 +151,7 @@ public:
void reload_collision_filters(AreaBullet *p_area);
void add_rigid_body(RigidBodyBullet *p_body);
+ void remove_rigid_body_constraints(RigidBodyBullet *p_body);
void remove_rigid_body(RigidBodyBullet *p_body);
void reload_collision_filters(RigidBodyBullet *p_body);
diff --git a/modules/fbx/data/fbx_mesh_data.cpp b/modules/fbx/data/fbx_mesh_data.cpp
index 963a815896..883651943e 100644
--- a/modules/fbx/data/fbx_mesh_data.cpp
+++ b/modules/fbx/data/fbx_mesh_data.cpp
@@ -34,7 +34,7 @@
#include "scene/resources/mesh.h"
#include "scene/resources/surface_tool.h"
-#include "thirdparty/misc/triangulator.h"
+#include "thirdparty/misc/polypartition.h"
template <class T>
T collect_first(const Vector<VertexData<T>> *p_data, T p_fall_back) {
@@ -930,30 +930,30 @@ void FBXMeshData::triangulate_polygon(Ref<SurfaceTool> st, Vector<int> p_polygon
}
}
- TriangulatorPoly triangulator_poly;
- triangulator_poly.Init(polygon_vertex_count);
+ TPPLPoly tppl_poly;
+ tppl_poly.Init(polygon_vertex_count);
std::vector<Vector2> projected_vertices(polygon_vertex_count);
for (int i = 0; i < polygon_vertex_count; i += 1) {
const Vector2 pv(poly_vertices[i][axis_1_coord], poly_vertices[i][axis_2_coord]);
projected_vertices[i] = pv;
- triangulator_poly.GetPoint(i) = pv;
+ tppl_poly.GetPoint(i) = pv;
}
- triangulator_poly.SetOrientation(TRIANGULATOR_CCW);
+ tppl_poly.SetOrientation(TPPL_ORIENTATION_CCW);
- List<TriangulatorPoly> out_poly;
+ List<TPPLPoly> out_poly;
- TriangulatorPartition triangulator_partition;
- if (triangulator_partition.Triangulate_OPT(&triangulator_poly, &out_poly) == 0) { // Good result.
- if (triangulator_partition.Triangulate_EC(&triangulator_poly, &out_poly) == 0) { // Medium result.
- if (triangulator_partition.Triangulate_MONO(&triangulator_poly, &out_poly) == 0) { // Really poor result.
+ TPPLPartition tppl_partition;
+ if (tppl_partition.Triangulate_OPT(&tppl_poly, &out_poly) == 0) { // Good result.
+ if (tppl_partition.Triangulate_EC(&tppl_poly, &out_poly) == 0) { // Medium result.
+ if (tppl_partition.Triangulate_MONO(&tppl_poly, &out_poly) == 0) { // Really poor result.
ERR_FAIL_MSG("The triangulation of this polygon failed, please try to triangulate your mesh or check if it has broken polygons.");
}
}
}
std::vector<Vector2> tris(out_poly.size());
- for (List<TriangulatorPoly>::Element *I = out_poly.front(); I; I = I->next()) {
- TriangulatorPoly &tp = I->get();
+ for (List<TPPLPoly>::Element *I = out_poly.front(); I; I = I->next()) {
+ TPPLPoly &tp = I->get();
ERR_FAIL_COND_MSG(tp.GetNumPoints() != 3, "The triangulator retuned more points, how this is possible?");
// Find Index
diff --git a/modules/gdscript/gdscript_analyzer.cpp b/modules/gdscript/gdscript_analyzer.cpp
index 5fc5b88ef8..a6138cc564 100644
--- a/modules/gdscript/gdscript_analyzer.cpp
+++ b/modules/gdscript/gdscript_analyzer.cpp
@@ -1163,24 +1163,26 @@ void GDScriptAnalyzer::resolve_variable(GDScriptParser::VariableNode *p_variable
void GDScriptAnalyzer::resolve_constant(GDScriptParser::ConstantNode *p_constant) {
GDScriptParser::DataType type;
- reduce_expression(p_constant->initializer);
- if (p_constant->initializer->type == GDScriptParser::Node::ARRAY) {
- const_fold_array(static_cast<GDScriptParser::ArrayNode *>(p_constant->initializer));
- } else if (p_constant->initializer->type == GDScriptParser::Node::DICTIONARY) {
- const_fold_dictionary(static_cast<GDScriptParser::DictionaryNode *>(p_constant->initializer));
- }
+ if (p_constant->initializer != nullptr) {
+ reduce_expression(p_constant->initializer);
+ if (p_constant->initializer->type == GDScriptParser::Node::ARRAY) {
+ const_fold_array(static_cast<GDScriptParser::ArrayNode *>(p_constant->initializer));
+ } else if (p_constant->initializer->type == GDScriptParser::Node::DICTIONARY) {
+ const_fold_dictionary(static_cast<GDScriptParser::DictionaryNode *>(p_constant->initializer));
+ }
- if (!p_constant->initializer->is_constant) {
- push_error(vformat(R"(Assigned value for constant "%s" isn't a constant expression.)", p_constant->identifier->name), p_constant->initializer);
- }
+ if (!p_constant->initializer->is_constant) {
+ push_error(vformat(R"(Assigned value for constant "%s" isn't a constant expression.)", p_constant->identifier->name), p_constant->initializer);
+ }
- type = p_constant->initializer->get_datatype();
+ type = p_constant->initializer->get_datatype();
#ifdef DEBUG_ENABLED
- if (p_constant->initializer->type == GDScriptParser::Node::CALL && type.kind == GDScriptParser::DataType::BUILTIN && type.builtin_type == Variant::NIL) {
- parser->push_warning(p_constant->initializer, GDScriptWarning::VOID_ASSIGNMENT, static_cast<GDScriptParser::CallNode *>(p_constant->initializer)->function_name);
- }
+ if (p_constant->initializer->type == GDScriptParser::Node::CALL && type.kind == GDScriptParser::DataType::BUILTIN && type.builtin_type == Variant::NIL) {
+ parser->push_warning(p_constant->initializer, GDScriptWarning::VOID_ASSIGNMENT, static_cast<GDScriptParser::CallNode *>(p_constant->initializer)->function_name);
+ }
#endif
+ }
if (p_constant->datatype_specifier != nullptr) {
GDScriptParser::DataType explicit_type = resolve_datatype(p_constant->datatype_specifier);
@@ -1215,7 +1217,10 @@ void GDScriptAnalyzer::resolve_constant(GDScriptParser::ConstantNode *p_constant
void GDScriptAnalyzer::resolve_assert(GDScriptParser::AssertNode *p_assert) {
reduce_expression(p_assert->condition);
if (p_assert->message != nullptr) {
- reduce_literal(p_assert->message);
+ reduce_expression(p_assert->message);
+ if (!p_assert->message->is_constant || p_assert->message->reduced_value.get_type() != Variant::STRING) {
+ push_error(R"(Expected constant string for assert error message.)", p_assert->message);
+ }
}
p_assert->set_datatype(p_assert->condition->get_datatype());
@@ -1752,6 +1757,8 @@ void GDScriptAnalyzer::reduce_call(GDScriptParser::CallNode *p_call, bool is_awa
// Those are stored by reference so not suited for compile-time construction.
// Because in this case they would be the same reference in all constructed values.
case Variant::OBJECT:
+ case Variant::DICTIONARY:
+ case Variant::ARRAY:
case Variant::PACKED_BYTE_ARRAY:
case Variant::PACKED_INT32_ARRAY:
case Variant::PACKED_INT64_ARRAY:
@@ -2029,14 +2036,14 @@ void GDScriptAnalyzer::reduce_call(GDScriptParser::CallNode *p_call, bool is_awa
push_error(vformat(R"*(Name "%s" called as a function but is a "%s".)*", p_call->function_name, callee_datatype.to_string()), p_call->callee);
}
#ifdef DEBUG_ENABLED
- } else if (!is_self) {
+ } else if (!is_self && !(base_type.is_hard_type() && base_type.kind == GDScriptParser::DataType::BUILTIN)) {
parser->push_warning(p_call, GDScriptWarning::UNSAFE_METHOD_ACCESS, p_call->function_name, base_type.to_string());
mark_node_unsafe(p_call);
#endif
}
}
}
- if (!found && is_self) {
+ if (!found && (is_self || (base_type.is_hard_type() && base_type.kind == GDScriptParser::DataType::BUILTIN))) {
String base_name = is_self && !p_call->is_super ? "self" : base_type.to_string();
push_error(vformat(R"*(Function "%s()" not found in base %s.)*", p_call->function_name, base_name), p_call->is_super ? p_call : p_call->callee);
}
diff --git a/modules/gdscript/gdscript_byte_codegen.cpp b/modules/gdscript/gdscript_byte_codegen.cpp
index 873d2b0183..58c6b31a77 100644
--- a/modules/gdscript/gdscript_byte_codegen.cpp
+++ b/modules/gdscript/gdscript_byte_codegen.cpp
@@ -899,6 +899,17 @@ void GDScriptByteCodeGenerator::write_call_self(const Address &p_target, const S
append(p_function_name);
}
+void GDScriptByteCodeGenerator::write_call_self_async(const Address &p_target, const StringName &p_function_name, const Vector<Address> &p_arguments) {
+ append(GDScriptFunction::OPCODE_CALL_ASYNC, 2 + p_arguments.size());
+ for (int i = 0; i < p_arguments.size(); i++) {
+ append(p_arguments[i]);
+ }
+ append(GDScriptFunction::ADDR_TYPE_SELF << GDScriptFunction::ADDR_BITS);
+ append(p_target);
+ append(p_arguments.size());
+ append(p_function_name);
+}
+
void GDScriptByteCodeGenerator::write_call_script_function(const Address &p_target, const Address &p_base, const StringName &p_function_name, const Vector<Address> &p_arguments) {
append(p_target.mode == Address::NIL ? GDScriptFunction::OPCODE_CALL : GDScriptFunction::OPCODE_CALL_RETURN, 2 + p_arguments.size());
for (int i = 0; i < p_arguments.size(); i++) {
diff --git a/modules/gdscript/gdscript_byte_codegen.h b/modules/gdscript/gdscript_byte_codegen.h
index df1ecfff6d..1e66af269a 100644
--- a/modules/gdscript/gdscript_byte_codegen.h
+++ b/modules/gdscript/gdscript_byte_codegen.h
@@ -441,6 +441,7 @@ public:
virtual void write_call_method_bind(const Address &p_target, const Address &p_base, MethodBind *p_method, const Vector<Address> &p_arguments) override;
virtual void write_call_ptrcall(const Address &p_target, const Address &p_base, MethodBind *p_method, const Vector<Address> &p_arguments) override;
virtual void write_call_self(const Address &p_target, const StringName &p_function_name, const Vector<Address> &p_arguments) override;
+ virtual void write_call_self_async(const Address &p_target, const StringName &p_function_name, const Vector<Address> &p_arguments) override;
virtual void write_call_script_function(const Address &p_target, const Address &p_base, const StringName &p_function_name, const Vector<Address> &p_arguments) override;
virtual void write_construct(const Address &p_target, Variant::Type p_type, const Vector<Address> &p_arguments) override;
virtual void write_construct_array(const Address &p_target, const Vector<Address> &p_arguments) override;
diff --git a/modules/gdscript/gdscript_codegen.h b/modules/gdscript/gdscript_codegen.h
index d9ad7e058e..d72bd12033 100644
--- a/modules/gdscript/gdscript_codegen.h
+++ b/modules/gdscript/gdscript_codegen.h
@@ -133,6 +133,7 @@ public:
virtual void write_call_method_bind(const Address &p_target, const Address &p_base, MethodBind *p_method, const Vector<Address> &p_arguments) = 0;
virtual void write_call_ptrcall(const Address &p_target, const Address &p_base, MethodBind *p_method, const Vector<Address> &p_arguments) = 0;
virtual void write_call_self(const Address &p_target, const StringName &p_function_name, const Vector<Address> &p_arguments) = 0;
+ virtual void write_call_self_async(const Address &p_target, const StringName &p_function_name, const Vector<Address> &p_arguments) = 0;
virtual void write_call_script_function(const Address &p_target, const Address &p_base, const StringName &p_function_name, const Vector<Address> &p_arguments) = 0;
virtual void write_construct(const Address &p_target, Variant::Type p_type, const Vector<Address> &p_arguments) = 0;
virtual void write_construct_array(const Address &p_target, const Vector<Address> &p_arguments) = 0;
diff --git a/modules/gdscript/gdscript_compiler.cpp b/modules/gdscript/gdscript_compiler.cpp
index e8be310375..b491440d4c 100644
--- a/modules/gdscript/gdscript_compiler.cpp
+++ b/modules/gdscript/gdscript_compiler.cpp
@@ -494,9 +494,17 @@ GDScriptCodeGenerator::Address GDScriptCompiler::_parse_expression(CodeGen &code
} else if ((codegen.function_node && codegen.function_node->is_static) || call->function_name == "new") {
GDScriptCodeGenerator::Address self;
self.mode = GDScriptCodeGenerator::Address::CLASS;
- gen->write_call(result, self, call->function_name, arguments);
+ if (within_await) {
+ gen->write_call_async(result, self, call->function_name, arguments);
+ } else {
+ gen->write_call(result, self, call->function_name, arguments);
+ }
} else {
- gen->write_call_self(result, call->function_name, arguments);
+ if (within_await) {
+ gen->write_call_self_async(result, call->function_name, arguments);
+ } else {
+ gen->write_call_self(result, call->function_name, arguments);
+ }
}
} else if (callee->type == GDScriptParser::Node::SUBSCRIPT) {
const GDScriptParser::SubscriptNode *subscript = static_cast<const GDScriptParser::SubscriptNode *>(call->callee);
diff --git a/modules/gdscript/gdscript_editor.cpp b/modules/gdscript/gdscript_editor.cpp
index 8ea51c61fb..b17971cf93 100644
--- a/modules/gdscript/gdscript_editor.cpp
+++ b/modules/gdscript/gdscript_editor.cpp
@@ -2345,7 +2345,7 @@ static void _find_call_arguments(GDScriptParser::CompletionContext &p_context, c
GDScriptParser::DataType base_type;
bool _static = false;
const GDScriptParser::CallNode *call = static_cast<const GDScriptParser::CallNode *>(p_call);
- GDScriptParser::Node::Type callee_type = GDScriptParser::Node::NONE;
+ GDScriptParser::Node::Type callee_type = call->get_callee_type();
GDScriptCompletionIdentifier connect_base;
diff --git a/modules/gdscript/gdscript_parser.cpp b/modules/gdscript/gdscript_parser.cpp
index 0a017e6730..a77fb14064 100644
--- a/modules/gdscript/gdscript_parser.cpp
+++ b/modules/gdscript/gdscript_parser.cpp
@@ -976,6 +976,8 @@ GDScriptParser::ConstantNode *GDScriptParser::parse_constant() {
push_error(R"(Expected initializer expression for constant.)");
return nullptr;
}
+ } else {
+ return nullptr;
}
end_statement("constant declaration");
@@ -1501,12 +1503,9 @@ GDScriptParser::AssertNode *GDScriptParser::parse_assert() {
if (match(GDScriptTokenizer::Token::COMMA)) {
// Error message.
- if (consume(GDScriptTokenizer::Token::LITERAL, R"(Expected error message for assert after ",".)")) {
- assert->message = parse_literal();
- if (assert->message->value.get_type() != Variant::STRING) {
- push_error(R"(Expected string for assert error message.)");
- }
- } else {
+ assert->message = parse_expression(false);
+ if (assert->message == nullptr) {
+ push_error(R"(Expected error message for assert after ",".)");
return nullptr;
}
}
@@ -2919,8 +2918,8 @@ GDScriptParser::ParseRule *GDScriptParser::get_rule(GDScriptTokenizer::Token::Ty
{ nullptr, &GDScriptParser::parse_binary_operator, PREC_BIT_SHIFT }, // LESS_LESS,
{ nullptr, &GDScriptParser::parse_binary_operator, PREC_BIT_SHIFT }, // GREATER_GREATER,
// Math
- { &GDScriptParser::parse_unary_operator, &GDScriptParser::parse_binary_operator, PREC_ADDITION }, // PLUS,
- { &GDScriptParser::parse_unary_operator, &GDScriptParser::parse_binary_operator, PREC_SUBTRACTION }, // MINUS,
+ { &GDScriptParser::parse_unary_operator, &GDScriptParser::parse_binary_operator, PREC_ADDITION_SUBTRACTION }, // PLUS,
+ { &GDScriptParser::parse_unary_operator, &GDScriptParser::parse_binary_operator, PREC_ADDITION_SUBTRACTION }, // MINUS,
{ nullptr, &GDScriptParser::parse_binary_operator, PREC_FACTOR }, // STAR,
{ nullptr, &GDScriptParser::parse_binary_operator, PREC_FACTOR }, // SLASH,
{ nullptr, &GDScriptParser::parse_binary_operator, PREC_FACTOR }, // PERCENT,
diff --git a/modules/gdscript/gdscript_parser.h b/modules/gdscript/gdscript_parser.h
index cf1ff5eefc..f43708b81f 100644
--- a/modules/gdscript/gdscript_parser.h
+++ b/modules/gdscript/gdscript_parser.h
@@ -286,7 +286,7 @@ public:
struct AssertNode : public Node {
ExpressionNode *condition = nullptr;
- LiteralNode *message = nullptr;
+ ExpressionNode *message = nullptr;
AssertNode() {
type = ASSERT;
@@ -1172,8 +1172,7 @@ private:
PREC_BIT_XOR,
PREC_BIT_AND,
PREC_BIT_SHIFT,
- PREC_SUBTRACTION,
- PREC_ADDITION,
+ PREC_ADDITION_SUBTRACTION,
PREC_FACTOR,
PREC_SIGN,
PREC_BIT_NOT,
diff --git a/modules/gdscript/gdscript_vm.cpp b/modules/gdscript/gdscript_vm.cpp
index 4abd2e00f4..4e098d7a6d 100644
--- a/modules/gdscript/gdscript_vm.cpp
+++ b/modules/gdscript/gdscript_vm.cpp
@@ -476,11 +476,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
}
if (p_instance) {
- if (p_instance->base_ref && static_cast<Reference *>(p_instance->owner)->is_referenced()) {
- self = REF(static_cast<Reference *>(p_instance->owner));
- } else {
- self = p_instance->owner;
- }
+ self = p_instance->owner;
script = p_instance->script.ptr();
} else {
script = _script;
@@ -2306,10 +2302,10 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
Dictionary *dict = VariantInternal::get_dictionary(container);
const Variant *next = dict->next(nullptr);
- *counter = *next;
if (!dict->is_empty()) {
GET_INSTRUCTION_ARG(iterator, 2);
+ *counter = *next;
*iterator = *next;
// Skip regular iterate.
diff --git a/modules/gltf/gltf_document.cpp b/modules/gltf/gltf_document.cpp
index 580bc006f5..ebf30b13f2 100644
--- a/modules/gltf/gltf_document.cpp
+++ b/modules/gltf/gltf_document.cpp
@@ -805,7 +805,9 @@ Error GLTFDocument::_encode_buffer_views(Ref<GLTFState> state) {
}
Error GLTFDocument::_parse_buffer_views(Ref<GLTFState> state) {
- ERR_FAIL_COND_V(!state->json.has("bufferViews"), ERR_FILE_CORRUPT);
+ if (!state->json.has("bufferViews")) {
+ return OK;
+ }
const Array &buffers = state->json["bufferViews"];
for (GLTFBufferViewIndex i = 0; i < buffers.size(); i++) {
const Dictionary &d = buffers[i];
@@ -942,7 +944,9 @@ GLTFDocument::GLTFType GLTFDocument::_get_type_from_str(const String &p_string)
}
Error GLTFDocument::_parse_accessors(Ref<GLTFState> state) {
- ERR_FAIL_COND_V(!state->json.has("accessors"), ERR_FILE_CORRUPT);
+ if (!state->json.has("accessors")) {
+ return OK;
+ }
const Array &accessors = state->json["accessors"];
for (GLTFAccessorIndex i = 0; i < accessors.size(); i++) {
const Dictionary &d = accessors[i];
diff --git a/modules/meshoptimizer/register_types.cpp b/modules/meshoptimizer/register_types.cpp
index 71cd9f4dcb..a03310f518 100644
--- a/modules/meshoptimizer/register_types.cpp
+++ b/modules/meshoptimizer/register_types.cpp
@@ -35,9 +35,13 @@
void register_meshoptimizer_types() {
SurfaceTool::optimize_vertex_cache_func = meshopt_optimizeVertexCache;
SurfaceTool::simplify_func = meshopt_simplify;
+ SurfaceTool::simplify_scale_func = meshopt_simplifyScale;
+ SurfaceTool::simplify_sloppy_func = meshopt_simplifySloppy;
}
void unregister_meshoptimizer_types() {
SurfaceTool::optimize_vertex_cache_func = nullptr;
SurfaceTool::simplify_func = nullptr;
+ SurfaceTool::simplify_scale_func = nullptr;
+ SurfaceTool::simplify_sloppy_func = nullptr;
}
diff --git a/modules/mono/csharp_script.cpp b/modules/mono/csharp_script.cpp
index da4ece8c5c..18fe44108f 100644
--- a/modules/mono/csharp_script.cpp
+++ b/modules/mono/csharp_script.cpp
@@ -3584,9 +3584,9 @@ Error CSharpScript::load_source_code(const String &p_path) {
ERR_FAIL_COND_V_MSG(ferr != OK, ferr,
ferr == ERR_INVALID_DATA ?
- "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
+ "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
" Please ensure that scripts are saved in valid UTF-8 unicode." :
- "Failed to read file: '" + p_path + "'.");
+ "Failed to read file: '" + p_path + "'.");
#ifdef TOOLS_ENABLED
source_changed_cache = true;
diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
index e2feb66e35..5ef55fea49 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
@@ -181,7 +181,7 @@ namespace GodotTools.Build
var outputArray = new Godot.Collections.Array<string>();
int exitCode = Godot.OS.Execute(vsWherePath, vsWhereArgs,
- blocking: true, output: (Godot.Collections.Array)outputArray);
+ output: (Godot.Collections.Array)outputArray);
if (exitCode != 0)
return string.Empty;
diff --git a/modules/mono/editor/GodotTools/GodotTools/Export/XcodeHelper.cs b/modules/mono/editor/GodotTools/GodotTools/Export/XcodeHelper.cs
index 219b7a698a..93ef837a83 100755
--- a/modules/mono/editor/GodotTools/GodotTools/Export/XcodeHelper.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Export/XcodeHelper.cs
@@ -27,7 +27,7 @@ namespace GodotTools.Export
{
var outputWrapper = new Godot.Collections.Array();
- int exitCode = Godot.OS.Execute("xcode-select", new string[] { "--print-path" }, blocking: true, output: outputWrapper);
+ int exitCode = Godot.OS.Execute("xcode-select", new string[] { "--print-path" }, output: outputWrapper);
if (exitCode == 0)
{
diff --git a/modules/mono/editor/bindings_generator.cpp b/modules/mono/editor/bindings_generator.cpp
index 59ce617990..38e403b2e1 100644
--- a/modules/mono/editor/bindings_generator.cpp
+++ b/modules/mono/editor/bindings_generator.cpp
@@ -365,7 +365,7 @@ String BindingsGenerator::bbcode_to_xml(const String &p_bbcode, const TypeInterf
xml_output.append("</c>");
} else if (link_tag == "enum") {
StringName search_cname = !target_itype ? target_cname :
- StringName(target_itype->name + "." + (String)target_cname);
+ StringName(target_itype->name + "." + (String)target_cname);
const Map<StringName, TypeInterface>::Element *enum_match = enum_types.find(search_cname);
diff --git a/modules/mono/editor/script_class_parser.cpp b/modules/mono/editor/script_class_parser.cpp
index 8f9a31a5b9..e81cbe4ebd 100644
--- a/modules/mono/editor/script_class_parser.cpp
+++ b/modules/mono/editor/script_class_parser.cpp
@@ -735,9 +735,9 @@ Error ScriptClassParser::parse_file(const String &p_filepath) {
ERR_FAIL_COND_V_MSG(ferr != OK, ferr,
ferr == ERR_INVALID_DATA ?
- "File '" + p_filepath + "' contains invalid unicode (UTF-8), so it was not loaded."
+ "File '" + p_filepath + "' contains invalid unicode (UTF-8), so it was not loaded."
" Please ensure that scripts are saved in valid UTF-8 unicode." :
- "Failed to read file: '" + p_filepath + "'.");
+ "Failed to read file: '" + p_filepath + "'.");
run_dummy_preprocessor(source, p_filepath);
diff --git a/modules/mono/mono_gd/gd_mono.cpp b/modules/mono/mono_gd/gd_mono.cpp
index 875d20ebe4..43a39a4966 100644
--- a/modules/mono/mono_gd/gd_mono.cpp
+++ b/modules/mono/mono_gd/gd_mono.cpp
@@ -593,8 +593,8 @@ ApiAssemblyInfo::Version ApiAssemblyInfo::Version::get_from_loaded_assembly(GDMo
ApiAssemblyInfo::Version api_assembly_version;
const char *nativecalls_name = p_api_type == ApiAssemblyInfo::API_CORE ?
- BINDINGS_CLASS_NATIVECALLS :
- BINDINGS_CLASS_NATIVECALLS_EDITOR;
+ BINDINGS_CLASS_NATIVECALLS :
+ BINDINGS_CLASS_NATIVECALLS_EDITOR;
GDMonoClass *nativecalls_klass = p_api_assembly->get_class(BINDINGS_NAMESPACE, nativecalls_name);
@@ -757,11 +757,11 @@ String GDMono::update_api_assemblies_from_prebuilt(const String &p_config, const
#define FAIL_REASON(m_out_of_sync, m_prebuilt_exists) \
( \
(m_out_of_sync ? \
- String("The assembly is invalidated ") : \
- String("The assembly was not found ")) + \
+ String("The assembly is invalidated ") : \
+ String("The assembly was not found ")) + \
(m_prebuilt_exists ? \
- String("and the prebuilt assemblies are missing.") : \
- String("and we failed to copy the prebuilt assemblies.")))
+ String("and the prebuilt assemblies are missing.") : \
+ String("and we failed to copy the prebuilt assemblies.")))
String dst_assemblies_dir = GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config);
@@ -820,8 +820,8 @@ bool GDMono::_load_core_api_assembly(LoadedApiAssembly &r_loaded_api_assembly, c
// If running the project manager, load it from the prebuilt API directory
String assembly_dir = !Main::is_project_manager() ?
- GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
- GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+ GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
+ GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
String assembly_path = assembly_dir.plus_file(CORE_API_ASSEMBLY_NAME ".dll");
@@ -853,8 +853,8 @@ bool GDMono::_load_editor_api_assembly(LoadedApiAssembly &r_loaded_api_assembly,
// If running the project manager, load it from the prebuilt API directory
String assembly_dir = !Main::is_project_manager() ?
- GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
- GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+ GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
+ GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
String assembly_path = assembly_dir.plus_file(EDITOR_API_ASSEMBLY_NAME ".dll");
diff --git a/modules/mono/mono_gd/gd_mono_marshal.cpp b/modules/mono/mono_gd/gd_mono_marshal.cpp
index 57fbf5b7e1..286858bff1 100644
--- a/modules/mono/mono_gd/gd_mono_marshal.cpp
+++ b/modules/mono/mono_gd/gd_mono_marshal.cpp
@@ -1677,8 +1677,8 @@ Callable managed_to_callable(const M_Callable &p_managed_callable) {
return Callable(managed_callable);
} else {
Object *target = p_managed_callable.target ?
- unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target)) :
- nullptr;
+ unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target)) :
+ nullptr;
StringName *method_ptr = unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_callable.method_string_name));
StringName method = method_ptr ? *method_ptr : StringName();
return Callable(target, method);
@@ -1723,8 +1723,8 @@ M_Callable callable_to_managed(const Callable &p_callable) {
Signal managed_to_signal_info(const M_SignalInfo &p_managed_signal) {
Object *owner = p_managed_signal.owner ?
- unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner)) :
- nullptr;
+ unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner)) :
+ nullptr;
StringName *name_ptr = unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_signal.name_string_name));
StringName name = name_ptr ? *name_ptr : StringName();
return Signal(owner, name);
diff --git a/modules/mono/utils/mono_reg_utils.cpp b/modules/mono/utils/mono_reg_utils.cpp
index 27c2b2c5c1..bb1265e959 100644
--- a/modules/mono/utils/mono_reg_utils.cpp
+++ b/modules/mono/utils/mono_reg_utils.cpp
@@ -173,7 +173,7 @@ String find_msbuild_tools_path() {
String output;
int exit_code;
- OS::get_singleton()->execute(vswhere_path, vswhere_args, true, nullptr, &output, &exit_code);
+ OS::get_singleton()->execute(vswhere_path, vswhere_args, &output, &exit_code);
if (exit_code == 0) {
Vector<String> lines = output.split("\n");
diff --git a/modules/regex/doc_classes/RegEx.xml b/modules/regex/doc_classes/RegEx.xml
index 312275842a..b21f5d1e7a 100644
--- a/modules/regex/doc_classes/RegEx.xml
+++ b/modules/regex/doc_classes/RegEx.xml
@@ -39,8 +39,8 @@
var regex = RegEx.new()
regex.compile("\\S+") # Negated whitespace character class.
var results = []
- for match in regex.search_all("One Two \n\tThree"):
- results.push_back(match.get_string())
+ for result in regex.search_all("One Two \n\tThree"):
+ results.push_back(result.get_string())
# The `results` array now contains "One", "Two", "Three".
[/codeblock]
[b]Note:[/b] Godot's regex implementation is based on the [url=https://www.pcre.org/]PCRE2[/url] library. You can view the full pattern reference [url=https://www.pcre.org/current/doc/html/pcre2pattern.html]here[/url].
diff --git a/modules/webxr/native/library_godot_webxr.js b/modules/webxr/native/library_godot_webxr.js
index 447045ed27..3041c16c79 100644
--- a/modules/webxr/native/library_godot_webxr.js
+++ b/modules/webxr/native/library_godot_webxr.js
@@ -601,7 +601,13 @@ const GodotWebXR = {
const buf = GodotRuntime.malloc((axes_count + 1) * 4);
GodotRuntime.setHeapValue(buf, axes_count, 'i32');
for (let i = 0; i < axes_count; i++) {
- GodotRuntime.setHeapValue(buf + 4 + (i * 4), controller.gamepad.axes[i], 'float');
+ let value = controller.gamepad.axes[i];
+ if (i === 1 || i === 3) {
+ // Invert the Y-axis on thumbsticks and trackpads, in order to
+ // match OpenXR and other XR platform SDKs.
+ value *= -1.0;
+ }
+ GodotRuntime.setHeapValue(buf + 4 + (i * 4), value, 'float');
}
return buf;
},
diff --git a/modules/webxr/webxr_interface_js.cpp b/modules/webxr/webxr_interface_js.cpp
index 72dc4790ac..6594553146 100644
--- a/modules/webxr/webxr_interface_js.cpp
+++ b/modules/webxr/webxr_interface_js.cpp
@@ -375,11 +375,11 @@ void WebXRInterfaceJS::_update_tracker(int p_controller_id) {
if (godot_webxr_is_controller_connected(p_controller_id)) {
if (tracker == nullptr) {
tracker = memnew(XRPositionalTracker);
- tracker->set_type(XRServer::TRACKER_CONTROLLER);
+ tracker->set_tracker_type(XRServer::TRACKER_CONTROLLER);
// Controller id's 0 and 1 are always the left and right hands.
if (p_controller_id < 2) {
- tracker->set_name(p_controller_id == 0 ? "Left" : "Right");
- tracker->set_hand(p_controller_id == 0 ? XRPositionalTracker::TRACKER_LEFT_HAND : XRPositionalTracker::TRACKER_RIGHT_HAND);
+ tracker->set_tracker_name(p_controller_id == 0 ? "Left" : "Right");
+ tracker->set_tracker_hand(p_controller_id == 0 ? XRPositionalTracker::TRACKER_HAND_LEFT : XRPositionalTracker::TRACKER_HAND_RIGHT);
}
// Use the ids we're giving to our "virtual" gamepads.
tracker->set_joy_id(p_controller_id + 100);
diff --git a/platform/android/export/export.cpp b/platform/android/export/export.cpp
index 08ee410a96..cdcc39c6e7 100644
--- a/platform/android/export/export.cpp
+++ b/platform/android/export/export.cpp
@@ -308,7 +308,7 @@ class EditorExportPlatformAndroid : public EditorExportPlatform {
List<String> args;
args.push_back("devices");
int ec;
- OS::get_singleton()->execute(adb, args, true, nullptr, &devices, &ec);
+ OS::get_singleton()->execute(adb, args, &devices, &ec);
Vector<String> ds = devices.split("\n");
Vector<String> ldevices;
@@ -361,7 +361,7 @@ class EditorExportPlatformAndroid : public EditorExportPlatform {
int ec2;
String dp;
- OS::get_singleton()->execute(adb, args, true, nullptr, &dp, &ec2);
+ OS::get_singleton()->execute(adb, args, &dp, &ec2);
Vector<String> props = dp.split("\n");
String vendor;
@@ -432,7 +432,7 @@ class EditorExportPlatformAndroid : public EditorExportPlatform {
List<String> args;
args.push_back("kill-server");
- OS::get_singleton()->execute(adb, args, true);
+ OS::get_singleton()->execute(adb, args);
};
}
@@ -1800,7 +1800,7 @@ public:
args.push_back("uninstall");
args.push_back(get_package_name(package_name));
- err = OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ err = OS::get_singleton()->execute(adb, args, nullptr, &rv);
}
print_line("Installing to device (please wait...): " + devices[p_device].name);
@@ -1815,7 +1815,7 @@ public:
args.push_back("-r");
args.push_back(tmp_export_path);
- err = OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ err = OS::get_singleton()->execute(adb, args, nullptr, &rv);
if (err || rv != 0) {
EditorNode::add_io_error("Could not install to device.");
CLEANUP_AND_RETURN(ERR_CANT_CREATE);
@@ -1832,7 +1832,7 @@ public:
args.push_back(devices[p_device].id);
args.push_back("reverse");
args.push_back("--remove-all");
- OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ OS::get_singleton()->execute(adb, args, nullptr, &rv);
if (p_debug_flags & DEBUG_FLAG_REMOTE_DEBUG) {
int dbg_port = EditorSettings::get_singleton()->get("network/debug/remote_port");
@@ -1843,7 +1843,7 @@ public:
args.push_back("tcp:" + itos(dbg_port));
args.push_back("tcp:" + itos(dbg_port));
- OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ OS::get_singleton()->execute(adb, args, nullptr, &rv);
print_line("Reverse result: " + itos(rv));
}
@@ -1857,7 +1857,7 @@ public:
args.push_back("tcp:" + itos(fs_port));
args.push_back("tcp:" + itos(fs_port));
- err = OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ err = OS::get_singleton()->execute(adb, args, nullptr, &rv);
print_line("Reverse result2: " + itos(rv));
}
} else {
@@ -1885,7 +1885,7 @@ public:
args.push_back("-n");
args.push_back(get_package_name(package_name) + "/com.godot.game.GodotApp");
- err = OS::get_singleton()->execute(adb, args, true, nullptr, nullptr, &rv);
+ err = OS::get_singleton()->execute(adb, args, nullptr, &rv);
if (err || rv != 0) {
EditorNode::add_io_error("Could not execute on device.");
CLEANUP_AND_RETURN(ERR_CANT_CREATE);
@@ -2288,7 +2288,7 @@ public:
args.push_back(user);
args.push_back(export_path);
int retval;
- OS::get_singleton()->execute(apksigner, args, true, NULL, NULL, &retval);
+ OS::get_singleton()->execute(apksigner, args, nullptr, &retval);
if (retval) {
EditorNode::add_io_error("'apksigner' returned with error #" + itos(retval));
return ERR_CANT_CREATE;
@@ -2303,7 +2303,7 @@ public:
args.push_back("--verbose");
args.push_back(export_path);
- OS::get_singleton()->execute(apksigner, args, true, NULL, NULL, &retval);
+ OS::get_singleton()->execute(apksigner, args, nullptr, &retval);
if (retval) {
EditorNode::add_io_error("'apksigner' verification of " + export_label + " failed.");
return ERR_CANT_CREATE;
diff --git a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
index b536733201..63c91561ff 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
@@ -188,15 +188,15 @@ public class GodotGLRenderView extends GLSurfaceView implements GodotRenderView
if (GLUtils.use_32) {
setEGLConfigChooser(translucent ?
- new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+ new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
new RegularConfigChooser(8, 8, 8, 8, 16, stencil)) :
- new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+ new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
new RegularConfigChooser(5, 6, 5, 0, 16, stencil)));
} else {
setEGLConfigChooser(translucent ?
- new RegularConfigChooser(8, 8, 8, 8, 16, stencil) :
- new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
+ new RegularConfigChooser(8, 8, 8, 8, 16, stencil) :
+ new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
}
break;
}
diff --git a/platform/iphone/export/export.cpp b/platform/iphone/export/export.cpp
index 3253112bf3..9dfd8a2c1b 100644
--- a/platform/iphone/export/export.cpp
+++ b/platform/iphone/export/export.cpp
@@ -979,7 +979,7 @@ Error EditorExportPlatformIOS::_codesign(String p_file, void *p_userdata) {
codesign_args.push_back("-s");
codesign_args.push_back(data->preset->get(data->debug ? "application/code_sign_identity_debug" : "application/code_sign_identity_release"));
codesign_args.push_back(p_file);
- return OS::get_singleton()->execute("codesign", codesign_args, true);
+ return OS::get_singleton()->execute("codesign", codesign_args);
}
return OK;
}
@@ -1229,7 +1229,7 @@ Error EditorExportPlatformIOS::_copy_asset(const String &p_out_dir, const String
install_name_args.push_back(String("@rpath").plus_file(framework_name).plus_file(file_name));
install_name_args.push_back(destination);
- OS::get_singleton()->execute("install_name_tool", install_name_args, true);
+ OS::get_singleton()->execute("install_name_tool", install_name_args);
}
// Creating Info.plist
@@ -1848,7 +1848,7 @@ Error EditorExportPlatformIOS::export_project(const Ref<EditorExportPreset> &p_p
archive_args.push_back("archive");
archive_args.push_back("-archivePath");
archive_args.push_back(archive_path);
- err = OS::get_singleton()->execute("xcodebuild", archive_args, true);
+ err = OS::get_singleton()->execute("xcodebuild", archive_args);
ERR_FAIL_COND_V(err, err);
if (ep.step("Making .ipa", 4)) {
@@ -1863,7 +1863,7 @@ Error EditorExportPlatformIOS::export_project(const Ref<EditorExportPreset> &p_p
export_args.push_back("-allowProvisioningUpdates");
export_args.push_back("-exportPath");
export_args.push_back(dest_dir);
- err = OS::get_singleton()->execute("xcodebuild", export_args, true);
+ err = OS::get_singleton()->execute("xcodebuild", export_args);
ERR_FAIL_COND_V(err, err);
#else
print_line(".ipa can only be built on macOS. Leaving Xcode project without building the package.");
diff --git a/platform/javascript/SCsub b/platform/javascript/SCsub
index 1d3f96a6b8..b0302a5f88 100644
--- a/platform/javascript/SCsub
+++ b/platform/javascript/SCsub
@@ -27,8 +27,13 @@ if env["tools"]:
sys_env.AddJSLibraries(["js/libs/library_godot_editor_tools.js"])
if env["javascript_eval"]:
sys_env.AddJSLibraries(["js/libs/library_godot_eval.js"])
+
for lib in sys_env["JS_LIBS"]:
sys_env.Append(LINKFLAGS=["--js-library", lib])
+for js in env["JS_PRE"]:
+ sys_env.Append(LINKFLAGS=["--pre-js", env.File(js).path])
+for ext in env["JS_EXTERNS"]:
+ sys_env["ENV"]["EMCC_CLOSURE_ARGS"] += " --externs " + ext.path
build = []
if env["gdnative_enabled"]:
@@ -66,16 +71,8 @@ else:
build = sys_env.Program(build_targets, javascript_files + ["javascript_runtime.cpp"])
sys_env.Depends(build[0], sys_env["JS_LIBS"])
-
-if "JS_PRE" in env:
- for js in env["JS_PRE"]:
- env.Append(LINKFLAGS=["--pre-js", env.File(js).path])
- env.Depends(build, env["JS_PRE"])
-
-if "JS_EXTERNS" in env:
- for ext in env["JS_EXTERNS"]:
- env["ENV"]["EMCC_CLOSURE_ARGS"] += " --externs " + ext.path
- env.Depends(build, env["JS_EXTERNS"])
+sys_env.Depends(build[0], sys_env["JS_PRE"])
+sys_env.Depends(build[0], sys_env["JS_EXTERNS"])
engine = [
"js/engine/preloader.js",
diff --git a/platform/javascript/detect.py b/platform/javascript/detect.py
index 7d501e94b2..0d57f8aad1 100644
--- a/platform/javascript/detect.py
+++ b/platform/javascript/detect.py
@@ -131,7 +131,10 @@ def configure(env):
jscc = env.Builder(generator=run_closure_compiler, suffix=".cc.js", src_suffix=".js")
env.Append(BUILDERS={"BuildJS": jscc})
- # Add helper method for adding libraries.
+ # Add helper method for adding libraries, externs, pre-js.
+ env["JS_LIBS"] = []
+ env["JS_PRE"] = []
+ env["JS_EXTERNS"] = []
env.AddMethod(add_js_libraries, "AddJSLibraries")
env.AddMethod(add_js_pre, "AddJSPre")
env.AddMethod(add_js_externs, "AddJSExterns")
diff --git a/platform/javascript/emscripten_helpers.py b/platform/javascript/emscripten_helpers.py
index 278186e4c0..8b8c492e22 100644
--- a/platform/javascript/emscripten_helpers.py
+++ b/platform/javascript/emscripten_helpers.py
@@ -22,18 +22,12 @@ def create_engine_file(env, target, source, externs):
def add_js_libraries(env, libraries):
- if "JS_LIBS" not in env:
- env["JS_LIBS"] = []
env.Append(JS_LIBS=env.File(libraries))
def add_js_pre(env, js_pre):
- if "JS_PRE" not in env:
- env["JS_PRE"] = []
env.Append(JS_PRE=env.File(js_pre))
def add_js_externs(env, externs):
- if "JS_EXTERNS" not in env:
- env["JS_EXTERNS"] = []
env.Append(JS_EXTERNS=env.File(externs))
diff --git a/platform/javascript/http_client_javascript.cpp b/platform/javascript/http_client_javascript.cpp
index 44819c495c..c8c48dd582 100644
--- a/platform/javascript/http_client_javascript.cpp
+++ b/platform/javascript/http_client_javascript.cpp
@@ -220,13 +220,13 @@ Error HTTPClient::poll() {
has_polled = true;
} else {
// forcing synchronous requests is not possible on the web
- if (last_polling_frame == Engine::get_singleton()->get_idle_frames()) {
+ if (last_polling_frame == Engine::get_singleton()->get_process_frames()) {
WARN_PRINT("HTTPClient polled multiple times in one frame, "
"but request cannot progress more than once per "
"frame on the HTML5 platform.");
}
}
- last_polling_frame = Engine::get_singleton()->get_idle_frames();
+ last_polling_frame = Engine::get_singleton()->get_process_frames();
#endif
polled_response_code = godot_xhr_get_status(xhr_id);
diff --git a/platform/javascript/javascript_main.cpp b/platform/javascript/javascript_main.cpp
index 5656ecd7dc..0b8af70b13 100644
--- a/platform/javascript/javascript_main.cpp
+++ b/platform/javascript/javascript_main.cpp
@@ -87,7 +87,7 @@ extern EMSCRIPTEN_KEEPALIVE int godot_js_main(int argc, char *argv[]) {
ResourceLoader::set_abort_on_missing_resources(false);
Main::start();
- os->get_main_loop()->init();
+ os->get_main_loop()->initialize();
emscripten_set_main_loop(main_loop_callback, -1, false);
// Immediately run the first iteration.
// We are inside an animation frame, we want to immediately draw on the newly setup canvas.
diff --git a/platform/javascript/os_javascript.cpp b/platform/javascript/os_javascript.cpp
index 3fb5d4ad6a..b922b2ba91 100644
--- a/platform/javascript/os_javascript.cpp
+++ b/platform/javascript/os_javascript.cpp
@@ -106,14 +106,18 @@ void OS_JavaScript::finalize() {
// Miscellaneous
-Error OS_JavaScript::execute(const String &p_path, const List<String> &p_arguments, bool p_blocking, ProcessID *r_child_id, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+Error OS_JavaScript::execute(const String &p_path, const List<String> &p_arguments, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+ return create_process(p_path, p_arguments);
+}
+
+Error OS_JavaScript::create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id) {
Array args;
for (const List<String>::Element *E = p_arguments.front(); E; E = E->next()) {
args.push_back(E->get());
}
String json_args = JSON::print(args);
int failed = godot_js_os_execute(json_args.utf8().get_data());
- ERR_FAIL_COND_V_MSG(failed, ERR_UNAVAILABLE, "OS::execute() must be implemented in JavaScript via 'engine.setOnExecute' if required.");
+ ERR_FAIL_COND_V_MSG(failed, ERR_UNAVAILABLE, "OS::execute() or create_process() must be implemented in JavaScript via 'engine.setOnExecute' if required.");
return OK;
}
diff --git a/platform/javascript/os_javascript.h b/platform/javascript/os_javascript.h
index 9c8da0c898..8db62d9d1c 100644
--- a/platform/javascript/os_javascript.h
+++ b/platform/javascript/os_javascript.h
@@ -70,7 +70,8 @@ public:
MainLoop *get_main_loop() const override;
bool main_loop_iterate();
- Error execute(const String &p_path, const List<String> &p_arguments, bool p_blocking = true, ProcessID *r_child_id = nullptr, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ Error execute(const String &p_path, const List<String> &p_arguments, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ Error create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id = nullptr) override;
Error kill(const ProcessID &p_pid) override;
int get_process_id() const override;
diff --git a/platform/linuxbsd/crash_handler_linuxbsd.cpp b/platform/linuxbsd/crash_handler_linuxbsd.cpp
index 90e34f8e77..ea0222cb19 100644
--- a/platform/linuxbsd/crash_handler_linuxbsd.cpp
+++ b/platform/linuxbsd/crash_handler_linuxbsd.cpp
@@ -104,7 +104,7 @@ static void handle_crash(int sig) {
// Try to get the file/line number using addr2line
int ret;
- Error err = OS::get_singleton()->execute(String("addr2line"), args, true, nullptr, &output, &ret);
+ Error err = OS::get_singleton()->execute(String("addr2line"), args, &output, &ret);
if (err == OK) {
output.erase(output.length() - 1, 1);
}
diff --git a/platform/linuxbsd/display_server_x11.cpp b/platform/linuxbsd/display_server_x11.cpp
index 1ee5cd3923..00b90923de 100644
--- a/platform/linuxbsd/display_server_x11.cpp
+++ b/platform/linuxbsd/display_server_x11.cpp
@@ -191,7 +191,7 @@ void DisplayServerX11::alert(const String &p_alert, const String &p_title) {
}
if (program.length()) {
- OS::get_singleton()->execute(program, args, true);
+ OS::get_singleton()->execute(program, args);
} else {
print_line(p_alert);
}
diff --git a/platform/linuxbsd/os_linuxbsd.cpp b/platform/linuxbsd/os_linuxbsd.cpp
index 68290bb4ec..44b3930d6c 100644
--- a/platform/linuxbsd/os_linuxbsd.cpp
+++ b/platform/linuxbsd/os_linuxbsd.cpp
@@ -128,7 +128,7 @@ Error OS_LinuxBSD::shell_open(String p_uri) {
args.push_back(p_uri);
// Agnostic
- ok = execute("xdg-open", args, true, nullptr, nullptr, &err_code);
+ ok = execute("xdg-open", args, nullptr, &err_code);
if (ok == OK && !err_code) {
return OK;
} else if (err_code == 2) {
@@ -136,25 +136,25 @@ Error OS_LinuxBSD::shell_open(String p_uri) {
}
// GNOME
args.push_front("open"); // The command is `gio open`, so we need to add it to args
- ok = execute("gio", args, true, nullptr, nullptr, &err_code);
+ ok = execute("gio", args, nullptr, &err_code);
if (ok == OK && !err_code) {
return OK;
} else if (err_code == 2) {
return ERR_FILE_NOT_FOUND;
}
args.pop_front();
- ok = execute("gvfs-open", args, true, nullptr, nullptr, &err_code);
+ ok = execute("gvfs-open", args, nullptr, &err_code);
if (ok == OK && !err_code) {
return OK;
} else if (err_code == 2) {
return ERR_FILE_NOT_FOUND;
}
// KDE
- ok = execute("kde-open5", args, true, nullptr, nullptr, &err_code);
+ ok = execute("kde-open5", args, nullptr, &err_code);
if (ok == OK && !err_code) {
return OK;
}
- ok = execute("kde-open", args, true, nullptr, nullptr, &err_code);
+ ok = execute("kde-open", args, nullptr, &err_code);
return !err_code ? ok : FAILED;
}
@@ -232,7 +232,7 @@ String OS_LinuxBSD::get_system_dir(SystemDir p_dir) const {
String pipe;
List<String> arg;
arg.push_back(xdgparam);
- Error err = const_cast<OS_LinuxBSD *>(this)->execute("xdg-user-dir", arg, true, nullptr, &pipe);
+ Error err = const_cast<OS_LinuxBSD *>(this)->execute("xdg-user-dir", arg, &pipe);
if (err != OK) {
return ".";
}
@@ -307,7 +307,7 @@ Error OS_LinuxBSD::move_to_trash(const String &p_path) {
List<String> args;
args.push_back(p_path);
args.push_front("trash"); // The command is `gio trash <file_name>` so we need to add it to args.
- Error result = execute("gio", args, true, nullptr, nullptr, &err_code); // For GNOME based machines.
+ Error result = execute("gio", args, nullptr, &err_code); // For GNOME based machines.
if (result == OK && !err_code) {
return OK;
} else if (err_code == 2) {
@@ -317,7 +317,7 @@ Error OS_LinuxBSD::move_to_trash(const String &p_path) {
args.pop_front();
args.push_front("move");
args.push_back("trash:/"); // The command is `kioclient5 move <file_name> trash:/`.
- result = execute("kioclient5", args, true, nullptr, nullptr, &err_code); // For KDE based machines.
+ result = execute("kioclient5", args, nullptr, &err_code); // For KDE based machines.
if (result == OK && !err_code) {
return OK;
} else if (err_code == 2) {
@@ -326,7 +326,7 @@ Error OS_LinuxBSD::move_to_trash(const String &p_path) {
args.pop_front();
args.pop_back();
- result = execute("gvfs-trash", args, true, nullptr, nullptr, &err_code); // For older Linux machines.
+ result = execute("gvfs-trash", args, nullptr, &err_code); // For older Linux machines.
if (result == OK && !err_code) {
return OK;
} else if (err_code == 2) {
@@ -432,7 +432,7 @@ Error OS_LinuxBSD::move_to_trash(const String &p_path) {
mv_args.push_back(trash_path + "/files");
{
int retval;
- Error err = execute("mv", mv_args, true, nullptr, nullptr, &retval);
+ Error err = execute("mv", mv_args, nullptr, &retval);
// Issue an error if "mv" failed to move the given resource to the trash can.
if (err != OK || retval != 0) {
diff --git a/platform/osx/crash_handler_osx.mm b/platform/osx/crash_handler_osx.mm
index 4d6ed41a73..147ce26779 100644
--- a/platform/osx/crash_handler_osx.mm
+++ b/platform/osx/crash_handler_osx.mm
@@ -135,7 +135,7 @@ static void handle_crash(int sig) {
int ret;
String out = "";
- Error err = OS::get_singleton()->execute(String("atos"), args, true, NULL, &out, &ret);
+ Error err = OS::get_singleton()->execute(String("atos"), args, &out, &ret);
if (err == OK && out.substr(0, 2) != "0x") {
out.erase(out.length() - 1, 1);
output = out;
diff --git a/platform/osx/display_server_osx.mm b/platform/osx/display_server_osx.mm
index bb3c1d47b7..2d43454501 100644
--- a/platform/osx/display_server_osx.mm
+++ b/platform/osx/display_server_osx.mm
@@ -256,9 +256,7 @@ static NSCursor *_cursorFromSelector(SEL selector, SEL fallback = nil) {
List<String> args;
args.push_back(((OS_OSX *)(OS_OSX::get_singleton()))->open_with_filename);
String exec = OS::get_singleton()->get_executable_path();
-
- OS::ProcessID pid = 0;
- OS::get_singleton()->execute(exec, args, false, &pid);
+ OS::get_singleton()->create_process(exec, args);
}
#endif
return YES;
diff --git a/platform/osx/export/export.cpp b/platform/osx/export/export.cpp
index 752b119958..337cfd6808 100644
--- a/platform/osx/export/export.cpp
+++ b/platform/osx/export/export.cpp
@@ -419,7 +419,7 @@ Error EditorExportPlatformOSX::_notarize(const Ref<EditorExportPreset> &p_preset
args.push_back(p_path);
String str;
- Error err = OS::get_singleton()->execute("xcrun", args, true, nullptr, &str, nullptr, true);
+ Error err = OS::get_singleton()->execute("xcrun", args, &str, nullptr, true);
ERR_FAIL_COND_V(err != OK, err);
print_line("altool (" + p_path + "):\n" + str);
@@ -470,7 +470,7 @@ Error EditorExportPlatformOSX::_code_sign(const Ref<EditorExportPreset> &p_prese
args.push_back(p_path);
String str;
- Error err = OS::get_singleton()->execute("codesign", args, true, nullptr, &str, nullptr, true);
+ Error err = OS::get_singleton()->execute("codesign", args, &str, nullptr, true);
ERR_FAIL_COND_V(err != OK, err);
print_line("codesign (" + p_path + "):\n" + str);
@@ -504,7 +504,7 @@ Error EditorExportPlatformOSX::_create_dmg(const String &p_dmg_path, const Strin
args.push_back(p_app_path_name);
String str;
- Error err = OS::get_singleton()->execute("hdiutil", args, true, nullptr, &str, nullptr, true);
+ Error err = OS::get_singleton()->execute("hdiutil", args, &str, nullptr, true);
ERR_FAIL_COND_V(err != OK, err);
print_line("hdiutil returned: " + str);
diff --git a/platform/uwp/export/export.cpp b/platform/uwp/export/export.cpp
index 860448ceac..1aad2bfa1a 100644
--- a/platform/uwp/export/export.cpp
+++ b/platform/uwp/export/export.cpp
@@ -760,7 +760,7 @@ class EditorExportPlatformUWP : public EditorExportPlatform {
result = result.replace("$version_string$", version);
Platform arch = (Platform)(int)p_preset->get("architecture/target");
- String architecture = arch == ARM ? "arm" : arch == X86 ? "x86" : "x64";
+ String architecture = arch == ARM ? "arm" : (arch == X86 ? "x86" : "x64");
result = result.replace("$architecture$", architecture);
result = result.replace("$display_name$", String(p_preset->get("package/display_name")).is_empty() ? (String)ProjectSettings::get_singleton()->get("application/config/name") : String(p_preset->get("package/display_name")));
@@ -1411,7 +1411,7 @@ public:
args.push_back(cert_pass);
args.push_back(p_path);
- OS::get_singleton()->execute(signtool_path, args, true);
+ OS::get_singleton()->execute(signtool_path, args);
#endif // WINDOWS_ENABLED
return OK;
diff --git a/platform/uwp/os_uwp.cpp b/platform/uwp/os_uwp.cpp
index 18d5d7e08d..5760bcc72c 100644
--- a/platform/uwp/os_uwp.cpp
+++ b/platform/uwp/os_uwp.cpp
@@ -638,7 +638,11 @@ void OS_UWP::set_custom_mouse_cursor(const RES &p_cursor, CursorShape p_shape, c
// TODO
}
-Error OS_UWP::execute(const String &p_path, const List<String> &p_arguments, bool p_blocking, ProcessID *r_child_id, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+Error OS_UWP::execute(const String &p_path, const List<String> &p_arguments, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+ return FAILED;
+};
+
+Error OS_UWP::create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id) {
return FAILED;
};
diff --git a/platform/uwp/os_uwp.h b/platform/uwp/os_uwp.h
index edc197ad08..a4d3d6d52a 100644
--- a/platform/uwp/os_uwp.h
+++ b/platform/uwp/os_uwp.h
@@ -199,7 +199,8 @@ public:
virtual void delay_usec(uint32_t p_usec) const;
virtual uint64_t get_ticks_usec() const;
- virtual Error execute(const String &p_path, const List<String> &p_arguments, bool p_blocking = true, ProcessID *r_child_id = nullptr, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr);
+ virtual Error execute(const String &p_path, const List<String> &p_arguments, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr);
+ virtual Error create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id = nullptr);
virtual Error kill(const ProcessID &p_pid);
virtual bool has_environment(const String &p_var) const;
diff --git a/platform/windows/export/export.cpp b/platform/windows/export/export.cpp
index 084a5bee1d..222597b3ff 100644
--- a/platform/windows/export/export.cpp
+++ b/platform/windows/export/export.cpp
@@ -173,11 +173,11 @@ void EditorExportPlatformWindows::_rcedit_add_data(const Ref<EditorExportPreset>
}
#ifdef WINDOWS_ENABLED
- OS::get_singleton()->execute(rcedit_path, args, true);
+ OS::get_singleton()->execute(rcedit_path, args);
#else
// On non-Windows we need WINE to run rcedit
args.push_front(rcedit_path);
- OS::get_singleton()->execute(wine_path, args, true);
+ OS::get_singleton()->execute(wine_path, args);
#endif
}
@@ -314,7 +314,7 @@ Error EditorExportPlatformWindows::_code_sign(const Ref<EditorExportPreset> &p_p
#endif
String str;
- Error err = OS::get_singleton()->execute(signtool_path, args, true, nullptr, &str, nullptr, true);
+ Error err = OS::get_singleton()->execute(signtool_path, args, &str, nullptr, true);
ERR_FAIL_COND_V(err != OK, err);
print_line("codesign (" + p_path + "): " + str);
diff --git a/platform/windows/os_windows.cpp b/platform/windows/os_windows.cpp
index 051b69e8d9..f0848ff880 100644
--- a/platform/windows/os_windows.cpp
+++ b/platform/windows/os_windows.cpp
@@ -410,24 +410,23 @@ String OS_Windows::_quote_command_line_argument(const String &p_text) const {
return p_text;
}
-Error OS_Windows::execute(const String &p_path, const List<String> &p_arguments, bool p_blocking, ProcessID *r_child_id, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
+Error OS_Windows::execute(const String &p_path, const List<String> &p_arguments, String *r_pipe, int *r_exitcode, bool read_stderr, Mutex *p_pipe_mutex) {
String path = p_path.replace("/", "\\");
+ String command = _quote_command_line_argument(path);
+ for (const List<String>::Element *E = p_arguments.front(); E; E = E->next()) {
+ command += " " + _quote_command_line_argument(E->get());
+ }
- if (p_blocking && r_pipe) {
- String argss = _quote_command_line_argument(path);
- for (const List<String>::Element *E = p_arguments.front(); E; E = E->next()) {
- argss += " " + _quote_command_line_argument(E->get());
- }
-
+ if (r_pipe) {
if (read_stderr) {
- argss += " 2>&1"; // Read stderr too
+ command += " 2>&1"; // Include stderr
}
- // Note: _wpopen is calling command as "cmd.exe /c argss", instead of executing it directly, add extra quotes around full command, to prevent it from stripping quotes in the command.
- argss = _quote_command_line_argument(argss);
-
- FILE *f = _wpopen((LPCWSTR)(argss.utf16().get_data()), L"r");
- ERR_FAIL_COND_V(!f, ERR_CANT_OPEN);
+ // Add extra quotes around the full command, to prevent it from stripping quotes in the command,
+ // because _wpopen calls command as "cmd.exe /c command", instead of executing it directly
+ command = _quote_command_line_argument(command);
+ FILE *f = _wpopen((LPCWSTR)(command.utf16().get_data()), L"r");
+ ERR_FAIL_COND_V_MSG(!f, ERR_CANT_OPEN, "Cannot create pipe from command: " + command);
char buf[65535];
while (fgets(buf, 65535, f)) {
if (p_pipe_mutex) {
@@ -438,20 +437,40 @@ Error OS_Windows::execute(const String &p_path, const List<String> &p_arguments,
p_pipe_mutex->unlock();
}
}
-
int rv = _pclose(f);
+
if (r_exitcode) {
*r_exitcode = rv;
}
-
return OK;
}
- String cmdline = _quote_command_line_argument(path);
- const List<String>::Element *I = p_arguments.front();
- while (I) {
- cmdline += " " + _quote_command_line_argument(I->get());
- I = I->next();
+ ProcessInfo pi;
+ ZeroMemory(&pi.si, sizeof(pi.si));
+ pi.si.cb = sizeof(pi.si);
+ ZeroMemory(&pi.pi, sizeof(pi.pi));
+ LPSTARTUPINFOW si_w = (LPSTARTUPINFOW)&pi.si;
+
+ int ret = CreateProcessW(nullptr, (LPWSTR)(command.utf16().ptrw()), nullptr, nullptr, false, NORMAL_PRIORITY_CLASS & CREATE_NO_WINDOW, nullptr, nullptr, si_w, &pi.pi);
+ ERR_FAIL_COND_V_MSG(ret == 0, ERR_CANT_FORK, "Could not create child process: " + command);
+
+ WaitForSingleObject(pi.pi.hProcess, INFINITE);
+ if (r_exitcode) {
+ DWORD ret2;
+ GetExitCodeProcess(pi.pi.hProcess, &ret2);
+ *r_exitcode = ret2;
+ }
+ CloseHandle(pi.pi.hProcess);
+ CloseHandle(pi.pi.hThread);
+
+ return OK;
+};
+
+Error OS_Windows::create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id) {
+ String path = p_path.replace("/", "\\");
+ String command = _quote_command_line_argument(path);
+ for (const List<String>::Element *E = p_arguments.front(); E; E = E->next()) {
+ command += " " + _quote_command_line_argument(E->get());
}
ProcessInfo pi;
@@ -460,27 +479,15 @@ Error OS_Windows::execute(const String &p_path, const List<String> &p_arguments,
ZeroMemory(&pi.pi, sizeof(pi.pi));
LPSTARTUPINFOW si_w = (LPSTARTUPINFOW)&pi.si;
- Char16String modstr = cmdline.utf16(); // Windows wants to change this no idea why.
- int ret = CreateProcessW(nullptr, (LPWSTR)(modstr.ptrw()), nullptr, nullptr, 0, NORMAL_PRIORITY_CLASS & CREATE_NO_WINDOW, nullptr, nullptr, si_w, &pi.pi);
- ERR_FAIL_COND_V(ret == 0, ERR_CANT_FORK);
+ int ret = CreateProcessW(nullptr, (LPWSTR)(command.utf16().ptrw()), nullptr, nullptr, false, NORMAL_PRIORITY_CLASS & CREATE_NO_WINDOW, nullptr, nullptr, si_w, &pi.pi);
+ ERR_FAIL_COND_V_MSG(ret == 0, ERR_CANT_FORK, "Could not create child process: " + command);
- if (p_blocking) {
- WaitForSingleObject(pi.pi.hProcess, INFINITE);
- if (r_exitcode) {
- DWORD ret2;
- GetExitCodeProcess(pi.pi.hProcess, &ret2);
- *r_exitcode = ret2;
- }
-
- CloseHandle(pi.pi.hProcess);
- CloseHandle(pi.pi.hThread);
- } else {
- ProcessID pid = pi.pi.dwProcessId;
- if (r_child_id) {
- *r_child_id = pid;
- }
- process_map->insert(pid, pi);
+ ProcessID pid = pi.pi.dwProcessId;
+ if (r_child_id) {
+ *r_child_id = pid;
}
+ process_map->insert(pid, pi);
+
return OK;
};
diff --git a/platform/windows/os_windows.h b/platform/windows/os_windows.h
index 78258f132b..1a8791196b 100644
--- a/platform/windows/os_windows.h
+++ b/platform/windows/os_windows.h
@@ -136,7 +136,8 @@ public:
virtual void delay_usec(uint32_t p_usec) const override;
virtual uint64_t get_ticks_usec() const override;
- virtual Error execute(const String &p_path, const List<String> &p_arguments, bool p_blocking = true, ProcessID *r_child_id = nullptr, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ virtual Error execute(const String &p_path, const List<String> &p_arguments, String *r_pipe = nullptr, int *r_exitcode = nullptr, bool read_stderr = false, Mutex *p_pipe_mutex = nullptr) override;
+ virtual Error create_process(const String &p_path, const List<String> &p_arguments, ProcessID *r_child_id = nullptr) override;
virtual Error kill(const ProcessID &p_pid) override;
virtual int get_process_id() const override;
diff --git a/scene/2d/collision_polygon_2d.cpp b/scene/2d/collision_polygon_2d.cpp
index 7347b7829a..851e40cda6 100644
--- a/scene/2d/collision_polygon_2d.cpp
+++ b/scene/2d/collision_polygon_2d.cpp
@@ -36,7 +36,7 @@
#include "scene/resources/concave_polygon_shape_2d.h"
#include "scene/resources/convex_polygon_shape_2d.h"
-#include "thirdparty/misc/triangulator.h"
+#include "thirdparty/misc/polypartition.h"
void CollisionPolygon2D::_build_polygon() {
parent->shape_owner_clear_shapes(owner_id);
@@ -194,6 +194,7 @@ void CollisionPolygon2D::set_polygon(const Vector<Point2> &p_polygon) {
if (parent) {
_build_polygon();
+ _update_in_shape_owner();
}
update();
update_configuration_warning();
@@ -208,6 +209,7 @@ void CollisionPolygon2D::set_build_mode(BuildMode p_mode) {
build_mode = p_mode;
if (parent) {
_build_polygon();
+ _update_in_shape_owner();
}
}
diff --git a/scene/2d/collision_shape_2d.cpp b/scene/2d/collision_shape_2d.cpp
index acdde96df0..37bed577ac 100644
--- a/scene/2d/collision_shape_2d.cpp
+++ b/scene/2d/collision_shape_2d.cpp
@@ -141,6 +141,9 @@ void CollisionShape2D::_notification(int p_what) {
}
void CollisionShape2D::set_shape(const Ref<Shape2D> &p_shape) {
+ if (p_shape == shape) {
+ return;
+ }
if (shape.is_valid()) {
shape->disconnect("changed", callable_mp(this, &CollisionShape2D::_shape_changed));
}
@@ -151,6 +154,7 @@ void CollisionShape2D::set_shape(const Ref<Shape2D> &p_shape) {
if (shape.is_valid()) {
parent->shape_owner_add_shape(owner_id, shape);
}
+ _update_in_shape_owner();
}
if (shape.is_valid()) {
diff --git a/scene/2d/navigation_region_2d.cpp b/scene/2d/navigation_region_2d.cpp
index 72dc8bd9ad..7360fce330 100644
--- a/scene/2d/navigation_region_2d.cpp
+++ b/scene/2d/navigation_region_2d.cpp
@@ -37,7 +37,7 @@
#include "navigation_2d.h"
#include "servers/navigation_server_2d.h"
-#include "thirdparty/misc/triangulator.h"
+#include "thirdparty/misc/polypartition.h"
#ifdef TOOLS_ENABLED
Rect2 NavigationPolygon::_edit_get_rect() const {
@@ -228,7 +228,7 @@ void NavigationPolygon::make_polygons_from_outlines() {
MutexLock lock(navmesh_generation);
navmesh.unref();
}
- List<TriangulatorPoly> in_poly, out_poly;
+ List<TPPLPoly> in_poly, out_poly;
Vector2 outside_point(-1e10, -1e10);
@@ -278,23 +278,23 @@ void NavigationPolygon::make_polygons_from_outlines() {
bool outer = (interscount % 2) == 0;
- TriangulatorPoly tp;
+ TPPLPoly tp;
tp.Init(olsize);
for (int j = 0; j < olsize; j++) {
tp[j] = r[j];
}
if (outer) {
- tp.SetOrientation(TRIANGULATOR_CCW);
+ tp.SetOrientation(TPPL_ORIENTATION_CCW);
} else {
- tp.SetOrientation(TRIANGULATOR_CW);
+ tp.SetOrientation(TPPL_ORIENTATION_CW);
tp.SetHole(true);
}
in_poly.push_back(tp);
}
- TriangulatorPartition tpart;
+ TPPLPartition tpart;
if (tpart.ConvexPartition_HM(&in_poly, &out_poly) == 0) { //failed!
ERR_PRINT("NavigationPolygon: Convex partition failed!");
return;
@@ -304,8 +304,8 @@ void NavigationPolygon::make_polygons_from_outlines() {
vertices.resize(0);
Map<Vector2, int> points;
- for (List<TriangulatorPoly>::Element *I = out_poly.front(); I; I = I->next()) {
- TriangulatorPoly &tp = I->get();
+ for (List<TPPLPoly>::Element *I = out_poly.front(); I; I = I->next()) {
+ TPPLPoly &tp = I->get();
struct Polygon p;
diff --git a/scene/3d/collision_shape_3d.cpp b/scene/3d/collision_shape_3d.cpp
index 47966c772b..503d1be104 100644
--- a/scene/3d/collision_shape_3d.cpp
+++ b/scene/3d/collision_shape_3d.cpp
@@ -93,7 +93,6 @@ void CollisionShape3D::_notification(int p_what) {
if (shape.is_valid()) {
parent->shape_owner_add_shape(owner_id, shape);
}
- _update_in_shape_owner();
}
} break;
case NOTIFICATION_ENTER_TREE: {
@@ -170,6 +169,9 @@ void CollisionShape3D::_bind_methods() {
}
void CollisionShape3D::set_shape(const Ref<Shape3D> &p_shape) {
+ if (p_shape == shape) {
+ return;
+ }
if (!shape.is_null()) {
shape->unregister_owner(this);
shape->disconnect("changed", callable_mp(this, &CollisionShape3D::_shape_changed));
diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp
index 145b5afbd0..97241be60f 100644
--- a/scene/3d/gpu_particles_collision_3d.cpp
+++ b/scene/3d/gpu_particles_collision_3d.cpp
@@ -293,11 +293,11 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons
SGN(cb.cross(nor).dot(pb)) +
SGN(ac.cross(nor).dot(pc)) <
2.0) ?
- MIN(MIN(
+ MIN(MIN(
Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) :
- nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
+ nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
closest_distance = MIN(closest_distance, inside_d);
}
diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp
index 503dd5735b..2a49e60669 100644
--- a/scene/3d/node_3d.cpp
+++ b/scene/3d/node_3d.cpp
@@ -239,8 +239,8 @@ void Node3D::set_transform(const Transform &p_transform) {
void Node3D::set_global_transform(const Transform &p_transform) {
Transform xform =
(data.parent && !data.top_level_active) ?
- data.parent->get_global_transform().affine_inverse() * p_transform :
- p_transform;
+ data.parent->get_global_transform().affine_inverse() * p_transform :
+ p_transform;
set_transform(xform);
}
diff --git a/scene/3d/physics_joint_3d.cpp b/scene/3d/physics_joint_3d.cpp
index 0a2af6b0cd..326b91b6ed 100644
--- a/scene/3d/physics_joint_3d.cpp
+++ b/scene/3d/physics_joint_3d.cpp
@@ -114,21 +114,23 @@ void Joint3D::_update_joint(bool p_only_free) {
return;
}
- if (!body_a) {
- SWAP(body_a, body_b);
- }
-
warning = String();
update_configuration_warning();
- joint = _configure_joint(body_a, body_b);
+ if (body_a) {
+ joint = _configure_joint(body_a, body_b);
+ } else if (body_b) {
+ joint = _configure_joint(body_b, nullptr);
+ }
ERR_FAIL_COND_MSG(!joint.is_valid(), "Failed to configure the joint.");
PhysicsServer3D::get_singleton()->joint_set_solver_priority(joint, solver_priority);
- ba = body_a->get_rid();
- body_a->connect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Joint3D::_body_exit_tree), make_binds(body_a->get_instance_id()));
+ if (body_a) {
+ ba = body_a->get_rid();
+ body_a->connect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Joint3D::_body_exit_tree), make_binds(body_a->get_instance_id()));
+ }
if (body_b) {
bb = body_b->get_rid();
diff --git a/scene/gui/graph_edit.cpp b/scene/gui/graph_edit.cpp
index d5b12b6bb6..6662992d46 100644
--- a/scene/gui/graph_edit.cpp
+++ b/scene/gui/graph_edit.cpp
@@ -401,7 +401,14 @@ void GraphEdit::add_child_notify(Node *p_child) {
void GraphEdit::remove_child_notify(Node *p_child) {
Control::remove_child_notify(p_child);
- if (is_inside_tree()) {
+ if (p_child == top_layer) {
+ top_layer = nullptr;
+ minimap = nullptr;
+ } else if (p_child == connections_layer) {
+ connections_layer = nullptr;
+ }
+
+ if (top_layer != nullptr && is_inside_tree()) {
top_layer->call_deferred("raise"); // Top layer always on top!
}
@@ -409,8 +416,14 @@ void GraphEdit::remove_child_notify(Node *p_child) {
if (gn) {
gn->disconnect("position_offset_changed", callable_mp(this, &GraphEdit::_graph_node_moved));
gn->disconnect("raise_request", callable_mp(this, &GraphEdit::_graph_node_raised));
- gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)connections_layer, &CanvasItem::update));
- gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)minimap, &GraphEditMinimap::update));
+
+ // In case of the whole GraphEdit being destroyed these references can already be freed.
+ if (connections_layer != nullptr && connections_layer->is_inside_tree()) {
+ gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)connections_layer, &CanvasItem::update));
+ }
+ if (minimap != nullptr && minimap->is_inside_tree()) {
+ gn->disconnect("item_rect_changed", callable_mp((CanvasItem *)minimap, &GraphEditMinimap::update));
+ }
}
}
diff --git a/scene/gui/rich_text_label.cpp b/scene/gui/rich_text_label.cpp
index a1aa72b29a..05ca97491b 100644
--- a/scene/gui/rich_text_label.cpp
+++ b/scene/gui/rich_text_label.cpp
@@ -3677,6 +3677,7 @@ void RichTextLabel::set_percent_visible(float p_percent) {
}
main->first_invalid_line = 0; //invalidate ALL
_validate_line_caches(main);
+ _change_notify("visible_characters");
update();
}
}
@@ -3890,6 +3891,15 @@ void RichTextLabel::_bind_methods() {
void RichTextLabel::set_visible_characters(int p_visible) {
visible_characters = p_visible;
+ if (p_visible == -1) {
+ percent_visible = 1;
+ } else {
+ int total_char_count = get_total_character_count();
+ if (total_char_count > 0) {
+ percent_visible = (float)p_visible / (float)total_char_count;
+ }
+ }
+ _change_notify("percent_visible");
update();
}
diff --git a/scene/gui/tab_container.cpp b/scene/gui/tab_container.cpp
index 7f0d7b6e7b..64a2a1843d 100644
--- a/scene/gui/tab_container.cpp
+++ b/scene/gui/tab_container.cpp
@@ -789,6 +789,10 @@ Control *TabContainer::get_current_tab_control() const {
void TabContainer::remove_child_notify(Node *p_child) {
Container::remove_child_notify(p_child);
+ if (!Object::cast_to<Control>(p_child)) {
+ return;
+ }
+
call_deferred("_update_current_tab");
p_child->disconnect("renamed", callable_mp(this, &TabContainer::_child_renamed_callback));
diff --git a/scene/resources/particles_material.cpp b/scene/resources/particles_material.cpp
index 73b7a5cfe9..3aa9f9b3bc 100644
--- a/scene/resources/particles_material.cpp
+++ b/scene/resources/particles_material.cpp
@@ -646,7 +646,7 @@ void ParticlesMaterial::_update_shader() {
code += " for(int i=0;i<emit_count;i++) {\n";
code += " uint flags = FLAG_EMIT_POSITION|FLAG_EMIT_ROT_SCALE;\n";
code += " if (sub_emitter_keep_velocity) flags|=FLAG_EMIT_VELOCITY;\n";
- code += " emit_particle(TRANSFORM,VELOCITY,vec4(0.0),vec4(0.0),flags);\n";
+ code += " emit_subparticle(TRANSFORM,VELOCITY,vec4(0.0),vec4(0.0),flags);\n";
code += " }";
}
diff --git a/scene/resources/surface_tool.cpp b/scene/resources/surface_tool.cpp
index c1c87be42d..dbf5268762 100644
--- a/scene/resources/surface_tool.cpp
+++ b/scene/resources/surface_tool.cpp
@@ -35,6 +35,8 @@
SurfaceTool::OptimizeVertexCacheFunc SurfaceTool::optimize_vertex_cache_func = nullptr;
SurfaceTool::SimplifyFunc SurfaceTool::simplify_func = nullptr;
+SurfaceTool::SimplifyScaleFunc SurfaceTool::simplify_scale_func = nullptr;
+SurfaceTool::SimplifySloppyFunc SurfaceTool::simplify_sloppy_func = nullptr;
bool SurfaceTool::Vertex::operator==(const Vertex &p_vertex) const {
if (vertex != p_vertex.vertex) {
diff --git a/scene/resources/surface_tool.h b/scene/resources/surface_tool.h
index dcb689bfc0..ea6069e7c1 100644
--- a/scene/resources/surface_tool.h
+++ b/scene/resources/surface_tool.h
@@ -78,6 +78,10 @@ public:
static OptimizeVertexCacheFunc optimize_vertex_cache_func;
typedef size_t (*SimplifyFunc)(unsigned int *destination, const unsigned int *indices, size_t index_count, const float *vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float *r_error);
static SimplifyFunc simplify_func;
+ typedef float (*SimplifyScaleFunc)(const float *vertex_positions, size_t vertex_count, size_t vertex_positions_stride);
+ static SimplifyScaleFunc simplify_scale_func;
+ typedef size_t (*SimplifySloppyFunc)(unsigned int *destination, const unsigned int *indices, size_t index_count, const float *vertex_positions_data, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float *out_result_error);
+ static SimplifySloppyFunc simplify_sloppy_func;
private:
struct VertexHasher {
diff --git a/servers/physics_2d/space_2d_sw.cpp b/servers/physics_2d/space_2d_sw.cpp
index ad5dca37e4..068bc7fc0a 100644
--- a/servers/physics_2d/space_2d_sw.cpp
+++ b/servers/physics_2d/space_2d_sw.cpp
@@ -278,9 +278,9 @@ bool PhysicsDirectSpaceState2DSW::cast_motion(const RID &p_shape, const Transfor
continue;
}
- //test initial overlap
+ //test initial overlap, ignore objects it's inside of.
if (CollisionSolver2DSW::solve(shape, p_xform, Vector2(), col_obj->get_shape(shape_idx), col_obj_xform, Vector2(), nullptr, nullptr, nullptr, p_margin)) {
- return false;
+ continue;
}
//just do kinematic solving
diff --git a/servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp b/servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp
index 7eb49e657b..13b389251f 100644
--- a/servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp
+++ b/servers/physics_3d/joints/generic_6dof_joint_3d_sw.cpp
@@ -132,7 +132,7 @@ real_t G6DOFRotationalLimitMotor3DSW::solveAngularLimits(
real_t oldaccumImpulse = m_accumulatedImpulse;
real_t sum = oldaccumImpulse + clippedMotorImpulse;
- m_accumulatedImpulse = sum > hi ? real_t(0.) : sum < lo ? real_t(0.) : sum;
+ m_accumulatedImpulse = sum > hi ? real_t(0.) : (sum < lo ? real_t(0.) : sum);
clippedMotorImpulse = m_accumulatedImpulse - oldaccumImpulse;
@@ -201,7 +201,7 @@ real_t G6DOFTranslationalLimitMotor3DSW::solveLinearAxis(
real_t oldNormalImpulse = m_accumulatedImpulse[limit_index];
real_t sum = oldNormalImpulse + normalImpulse;
- m_accumulatedImpulse[limit_index] = sum > hi ? real_t(0.) : sum < lo ? real_t(0.) : sum;
+ m_accumulatedImpulse[limit_index] = sum > hi ? real_t(0.) : (sum < lo ? real_t(0.) : sum);
normalImpulse = m_accumulatedImpulse[limit_index] - oldNormalImpulse;
Vector3 impulse_vector = axis_normal_on_a * normalImpulse;
diff --git a/servers/physics_3d/space_3d_sw.cpp b/servers/physics_3d/space_3d_sw.cpp
index 0395a3339c..6cc7ad2676 100644
--- a/servers/physics_3d/space_3d_sw.cpp
+++ b/servers/physics_3d/space_3d_sw.cpp
@@ -274,11 +274,11 @@ bool PhysicsDirectSpaceState3DSW::cast_motion(const RID &p_shape, const Transfor
continue;
}
- //test initial overlap
+ //test initial overlap, ignore objects it's inside of.
sep_axis = p_motion.normalized();
if (!CollisionSolver3DSW::solve_distance(shape, p_xform, col_obj->get_shape(shape_idx), col_obj_xform, point_A, point_B, aabb, &sep_axis)) {
- return false;
+ continue;
}
//just do kinematic solving
diff --git a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
index 5b3c3c703f..792fcb0b59 100644
--- a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
+++ b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
@@ -2506,7 +2506,7 @@ RendererCanvasRenderRD::RendererCanvasRenderRD(RendererStorageRD *p_storage) {
actions.renames["FRAGCOORD"] = "gl_FragCoord";
actions.renames["POINT_COORD"] = "gl_PointCoord";
- actions.renames["LIGHT_POSITION"] = "light_pos";
+ actions.renames["LIGHT_POSITION"] = "light_position";
actions.renames["LIGHT_COLOR"] = "light_color";
actions.renames["LIGHT_ENERGY"] = "light_energy";
actions.renames["LIGHT"] = "light";
diff --git a/servers/rendering/renderer_rd/renderer_scene_render_forward.cpp b/servers/rendering/renderer_rd/renderer_scene_render_forward.cpp
index 1d07741296..74556f8105 100644
--- a/servers/rendering/renderer_rd/renderer_scene_render_forward.cpp
+++ b/servers/rendering/renderer_rd/renderer_scene_render_forward.cpp
@@ -3355,7 +3355,7 @@ RendererSceneRenderForward::RendererSceneRenderForward(RendererStorageRD *p_stor
actions.default_filter = ShaderLanguage::FILTER_LINEAR_MIPMAP;
actions.default_repeat = ShaderLanguage::REPEAT_ENABLE;
actions.global_buffer_array_variable = "global_variables.data";
- actions.instance_uniform_index_variable = "instances.data[instance_index].instance_uniforms_ofs";
+ actions.instance_uniform_index_variable = "draw_call.instance_uniforms_ofs";
shader.compiler.initialize(actions);
}
diff --git a/servers/rendering/renderer_rd/renderer_scene_render_rd.cpp b/servers/rendering/renderer_rd/renderer_scene_render_rd.cpp
index 188bcde8d7..a655edcfa7 100644
--- a/servers/rendering/renderer_rd/renderer_scene_render_rd.cpp
+++ b/servers/rendering/renderer_rd/renderer_scene_render_rd.cpp
@@ -4416,7 +4416,10 @@ void RendererSceneRenderRD::gi_probe_update(RID p_probe, bool p_update_light_ins
}
}
- dmap.uniform_set = RD::get_singleton()->uniform_set_create(uniforms, giprobe_lighting_shader_version_shaders[(write && plot) ? GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_WRITE_PLOT : write ? GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_WRITE : GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_PLOT], 0);
+ dmap.uniform_set = RD::get_singleton()->uniform_set_create(
+ uniforms,
+ giprobe_lighting_shader_version_shaders[(write && plot) ? GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_WRITE_PLOT : (write ? GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_WRITE : GI_PROBE_SHADER_VERSION_DYNAMIC_SHRINK_PLOT)],
+ 0);
}
gi_probe->dynamic_maps.push_back(dmap);
@@ -4850,7 +4853,16 @@ void RendererSceneRenderRD::_debug_giprobe(RID p_gi_probe, RD::DrawListID p_draw
}
giprobe_debug_uniform_set = RD::get_singleton()->uniform_set_create(uniforms, giprobe_debug_shader_version_shaders[0], 0);
- RD::get_singleton()->draw_list_bind_render_pipeline(p_draw_list, giprobe_debug_shader_version_pipelines[p_emission ? GI_PROBE_DEBUG_EMISSION : p_lighting ? (gi_probe->has_dynamic_object_data ? GI_PROBE_DEBUG_LIGHT_FULL : GI_PROBE_DEBUG_LIGHT) : GI_PROBE_DEBUG_COLOR].get_render_pipeline(RD::INVALID_ID, RD::get_singleton()->framebuffer_get_format(p_framebuffer)));
+
+ int giprobe_debug_pipeline = GI_PROBE_DEBUG_COLOR;
+ if (p_emission) {
+ giprobe_debug_pipeline = GI_PROBE_DEBUG_EMISSION;
+ } else if (p_lighting) {
+ giprobe_debug_pipeline = gi_probe->has_dynamic_object_data ? GI_PROBE_DEBUG_LIGHT_FULL : GI_PROBE_DEBUG_LIGHT;
+ }
+ RD::get_singleton()->draw_list_bind_render_pipeline(
+ p_draw_list,
+ giprobe_debug_shader_version_pipelines[giprobe_debug_pipeline].get_render_pipeline(RD::INVALID_ID, RD::get_singleton()->framebuffer_get_format(p_framebuffer)));
RD::get_singleton()->draw_list_bind_uniform_set(p_draw_list, giprobe_debug_uniform_set, 0);
RD::get_singleton()->draw_list_set_push_constant(p_draw_list, &push_constant, sizeof(GIProbeDebugPushConstant));
RD::get_singleton()->draw_list_draw(p_draw_list, false, cell_count, 36);
diff --git a/servers/rendering/renderer_rd/renderer_storage_rd.cpp b/servers/rendering/renderer_rd/renderer_storage_rd.cpp
index 1ffc024d42..b74a1083e7 100644
--- a/servers/rendering/renderer_rd/renderer_storage_rd.cpp
+++ b/servers/rendering/renderer_rd/renderer_storage_rd.cpp
@@ -8780,7 +8780,7 @@ RendererStorageRD::RendererStorageRD() {
actions.renames["RESTART_VELOCITY"] = "restart_velocity";
actions.renames["RESTART_COLOR"] = "restart_color";
actions.renames["RESTART_CUSTOM"] = "restart_custom";
- actions.renames["emit_particle"] = "emit_particle";
+ actions.renames["emit_subparticle"] = "emit_subparticle";
actions.renames["COLLIDED"] = "collided";
actions.renames["COLLISION_NORMAL"] = "collision_normal";
actions.renames["COLLISION_DEPTH"] = "collision_depth";
diff --git a/servers/rendering/renderer_rd/shaders/canvas.glsl b/servers/rendering/renderer_rd/shaders/canvas.glsl
index 9c4e95a7c2..3b39edc70e 100644
--- a/servers/rendering/renderer_rd/shaders/canvas.glsl
+++ b/servers/rendering/renderer_rd/shaders/canvas.glsl
@@ -396,7 +396,7 @@ vec4 light_shadow_compute(uint light_base, vec4 light_color, vec4 shadow_uv
vec4 shadow_color = unpackUnorm4x8(light_array.data[light_base].shadow_color);
#ifdef LIGHT_SHADER_CODE_USED
- shadow_color *= shadow_modulate;
+ shadow_color.rgb *= shadow_modulate;
#endif
shadow_color.a *= light_color.a; //respect light alpha
@@ -546,7 +546,7 @@ FRAGMENT_SHADER_CODE
#ifdef LIGHT_SHADER_CODE_USED
vec4 shadow_modulate = vec4(1.0);
- light_color = light_compute(light_vertex, direction, normal, light_color, light_color.a, specular_shininess, shadow_modulate, screen_uv, color, uv, true);
+ light_color = light_compute(light_vertex, vec3(direction, light_array.data[light_base].height), normal, light_color, light_color.a, specular_shininess, shadow_modulate, screen_uv, uv, color, true);
#else
if (normal_used) {
@@ -563,7 +563,7 @@ FRAGMENT_SHADER_CODE
light_color = light_shadow_compute(light_base, light_color, shadow_uv
#ifdef LIGHT_SHADER_CODE_USED
,
- shadow_modulate
+ shadow_modulate.rgb
#endif
);
}
@@ -605,7 +605,7 @@ FRAGMENT_SHADER_CODE
vec3 light_position = vec3(light_array.data[light_base].position, light_array.data[light_base].height);
light_color.rgb *= light_base_color.rgb;
- light_color = light_compute(light_vertex, light_position, normal, light_color, light_base_color.a, specular_shininess, shadow_modulate, screen_uv, color, uv, false);
+ light_color = light_compute(light_vertex, light_position, normal, light_color, light_base_color.a, specular_shininess, shadow_modulate, screen_uv, uv, color, false);
#else
light_color.rgb *= light_base_color.rgb * light_base_color.a;
@@ -659,7 +659,7 @@ FRAGMENT_SHADER_CODE
light_color = light_shadow_compute(light_base, light_color, shadow_uv
#ifdef LIGHT_SHADER_CODE_USED
,
- shadow_modulate
+ shadow_modulate.rgb
#endif
);
}
diff --git a/servers/rendering/renderer_rd/shaders/particles.glsl b/servers/rendering/renderer_rd/shaders/particles.glsl
index 926c7ef9fc..cb6d8dc7f6 100644
--- a/servers/rendering/renderer_rd/shaders/particles.glsl
+++ b/servers/rendering/renderer_rd/shaders/particles.glsl
@@ -173,7 +173,7 @@ uint hash(uint x) {
return x;
}
-bool emit_particle(mat4 p_xform, vec3 p_velocity, vec4 p_color, vec4 p_custom, uint p_flags) {
+bool emit_subparticle(mat4 p_xform, vec3 p_velocity, vec4 p_color, vec4 p_custom, uint p_flags) {
if (!params.can_emit) {
return false;
}
diff --git a/servers/rendering/shader_language.cpp b/servers/rendering/shader_language.cpp
index 0cb9220bb3..2fa3355d2f 100644
--- a/servers/rendering/shader_language.cpp
+++ b/servers/rendering/shader_language.cpp
@@ -6305,7 +6305,9 @@ Error ShaderLanguage::_parse_shader(const Map<StringName, FunctionInfo> &p_funct
}
uniform2.texture_order = -1;
- uniform2.order = uniforms++;
+ if (uniform_scope != ShaderNode::Uniform::SCOPE_INSTANCE) {
+ uniform2.order = uniforms++;
+ }
}
uniform2.type = type;
uniform2.scope = uniform_scope;
diff --git a/servers/rendering/shader_types.cpp b/servers/rendering/shader_types.cpp
index c1fa4a8ca7..e99b8504bb 100644
--- a/servers/rendering/shader_types.cpp
+++ b/servers/rendering/shader_types.cpp
@@ -347,7 +347,7 @@ ShaderTypes::ShaderTypes() {
emit_vertex_func.arguments.push_back(ShaderLanguage::StageFunctionInfo::Argument("custom", ShaderLanguage::TYPE_VEC4));
emit_vertex_func.arguments.push_back(ShaderLanguage::StageFunctionInfo::Argument("flags", ShaderLanguage::TYPE_UINT));
emit_vertex_func.return_type = ShaderLanguage::TYPE_BOOL; //whether it could emit
- shader_modes[RS::SHADER_PARTICLES].functions["compute"].stage_functions["emit_particle"] = emit_vertex_func;
+ shader_modes[RS::SHADER_PARTICLES].functions["compute"].stage_functions["emit_subparticle"] = emit_vertex_func;
}
shader_modes[RS::SHADER_PARTICLES].modes.push_back("collision_use_scale");
diff --git a/tests/test_local_vector.h b/tests/test_local_vector.h
new file mode 100644
index 0000000000..eff2a16abc
--- /dev/null
+++ b/tests/test_local_vector.h
@@ -0,0 +1,229 @@
+/*************************************************************************/
+/* test_local_vector.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2021 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2021 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef TEST_LOCAL_VECTOR_H
+#define TEST_LOCAL_VECTOR_H
+
+#include "core/templates/local_vector.h"
+
+#include "tests/test_macros.h"
+
+namespace TestLocalVector {
+
+TEST_CASE("[LocalVector] Push Back.") {
+ LocalVector<int> vector;
+ vector.push_back(0);
+ vector.push_back(1);
+ vector.push_back(2);
+ vector.push_back(3);
+ vector.push_back(4);
+
+ CHECK(vector[0] == 0);
+ CHECK(vector[1] == 1);
+ CHECK(vector[2] == 2);
+ CHECK(vector[3] == 3);
+ CHECK(vector[4] == 4);
+}
+
+TEST_CASE("[LocalVector] Find.") {
+ LocalVector<int> vector;
+ vector.push_back(3);
+ vector.push_back(1);
+ vector.push_back(4);
+ vector.push_back(0);
+ vector.push_back(2);
+
+ CHECK(vector[0] == 3);
+ CHECK(vector[1] == 1);
+ CHECK(vector[2] == 4);
+ CHECK(vector[3] == 0);
+ CHECK(vector[4] == 2);
+
+ CHECK(vector.find(0) == 3);
+ CHECK(vector.find(1) == 1);
+ CHECK(vector.find(2) == 4);
+ CHECK(vector.find(3) == 0);
+ CHECK(vector.find(4) == 2);
+
+ CHECK(vector.find(-1) == -1);
+ CHECK(vector.find(5) == -1);
+}
+
+TEST_CASE("[LocalVector] Remove.") {
+ LocalVector<int> vector;
+ vector.push_back(0);
+ vector.push_back(1);
+ vector.push_back(2);
+ vector.push_back(3);
+ vector.push_back(4);
+
+ vector.remove(0);
+
+ CHECK(vector[0] == 1);
+ CHECK(vector[1] == 2);
+ CHECK(vector[2] == 3);
+ CHECK(vector[3] == 4);
+
+ vector.remove(2);
+
+ CHECK(vector[0] == 1);
+ CHECK(vector[1] == 2);
+ CHECK(vector[2] == 4);
+
+ vector.remove(1);
+
+ CHECK(vector[0] == 1);
+ CHECK(vector[1] == 4);
+
+ vector.remove(0);
+
+ CHECK(vector[0] == 4);
+}
+
+TEST_CASE("[LocalVector] Remove Unordered.") {
+ LocalVector<int> vector;
+ vector.push_back(0);
+ vector.push_back(1);
+ vector.push_back(2);
+ vector.push_back(3);
+ vector.push_back(4);
+
+ CHECK(vector.size() == 5);
+
+ vector.remove_unordered(0);
+
+ CHECK(vector.size() == 4);
+
+ CHECK(vector.find(0) == -1);
+ CHECK(vector.find(1) != -1);
+ CHECK(vector.find(2) != -1);
+ CHECK(vector.find(3) != -1);
+ CHECK(vector.find(4) != -1);
+
+ // Now the vector is no more ordered.
+ vector.remove_unordered(vector.find(3));
+
+ CHECK(vector.size() == 3);
+
+ CHECK(vector.find(3) == -1);
+ CHECK(vector.find(1) != -1);
+ CHECK(vector.find(2) != -1);
+ CHECK(vector.find(4) != -1);
+
+ vector.remove_unordered(vector.find(2));
+
+ CHECK(vector.size() == 2);
+
+ CHECK(vector.find(2) == -1);
+ CHECK(vector.find(1) != -1);
+ CHECK(vector.find(4) != -1);
+
+ vector.remove_unordered(vector.find(4));
+
+ CHECK(vector.size() == 1);
+
+ CHECK(vector.find(4) == -1);
+ CHECK(vector.find(1) != -1);
+
+ // Remove the last one.
+ vector.remove_unordered(0);
+
+ CHECK(vector.is_empty());
+ CHECK(vector.size() == 0);
+}
+
+TEST_CASE("[LocalVector] Erase.") {
+ LocalVector<int> vector;
+ vector.push_back(1);
+ vector.push_back(3);
+ vector.push_back(0);
+ vector.push_back(2);
+ vector.push_back(4);
+
+ CHECK(vector.find(2) == 3);
+
+ vector.erase(2);
+
+ CHECK(vector.find(2) == -1);
+ CHECK(vector.size() == 4);
+}
+
+TEST_CASE("[LocalVector] Size / Resize / Reserve.") {
+ LocalVector<int> vector;
+
+ CHECK(vector.is_empty());
+ CHECK(vector.size() == 0);
+ CHECK(vector.get_capacity() == 0);
+
+ vector.resize(10);
+
+ CHECK(vector.size() == 10);
+ CHECK(vector.get_capacity() >= 10);
+
+ vector.resize(5);
+
+ CHECK(vector.size() == 5);
+ // Capacity is supposed to change only when the size increase.
+ CHECK(vector.get_capacity() >= 10);
+
+ vector.remove(0);
+ vector.remove(0);
+ vector.remove(0);
+
+ CHECK(vector.size() == 2);
+ // Capacity is supposed to change only when the size increase.
+ CHECK(vector.get_capacity() >= 10);
+
+ vector.reset();
+
+ CHECK(vector.size() == 0);
+ CHECK(vector.get_capacity() == 0);
+
+ vector.reserve(3);
+
+ CHECK(vector.is_empty());
+ CHECK(vector.size() == 0);
+ CHECK(vector.get_capacity() >= 3);
+
+ vector.push_back(0);
+ vector.push_back(0);
+ vector.push_back(0);
+
+ CHECK(vector.size() == 3);
+ CHECK(vector.get_capacity() >= 3);
+
+ vector.push_back(0);
+
+ CHECK(vector.size() == 4);
+ CHECK(vector.get_capacity() >= 4);
+}
+} // namespace TestLocalVector
+
+#endif // TEST_LOCAL_VECTOR_H
diff --git a/tests/test_main.cpp b/tests/test_main.cpp
index ca1fe234c0..e07a0a7d7b 100644
--- a/tests/test_main.cpp
+++ b/tests/test_main.cpp
@@ -48,6 +48,7 @@
#include "test_gui.h"
#include "test_json.h"
#include "test_list.h"
+#include "test_local_vector.h"
#include "test_lru.h"
#include "test_math.h"
#include "test_method_bind.h"
diff --git a/tests/test_math.cpp b/tests/test_math.cpp
index cda0cffda3..26c2aa2088 100644
--- a/tests/test_math.cpp
+++ b/tests/test_math.cpp
@@ -617,7 +617,7 @@ MainLoop *test() {
List<String> args;
args.push_back("-l");
- Error err = OS::get_singleton()->execute("/bin/ls", args, true, nullptr, &ret);
+ Error err = OS::get_singleton()->execute("/bin/ls", args, &ret);
print_line("error: " + itos(err));
print_line(ret);
diff --git a/thirdparty/README.md b/thirdparty/README.md
index 5d03458b69..3803e87fea 100644
--- a/thirdparty/README.md
+++ b/thirdparty/README.md
@@ -344,7 +344,7 @@ File extracted from upstream release tarball:
## meshoptimizer
- Upstream: https://github.com/zeux/meshoptimizer
-- Version: git (e4e43fe36e7a8705e602e7ca2f9fb795ded1d0b9, 2020)
+- Version: git (e3f53f66e7a35b9b8764bee478589d79e34fa698, 2021)
- License: MIT
Files extracted from upstream repository:
@@ -424,6 +424,11 @@ Collection of single-file libraries used in Godot components.
* Upstream: http://www.pcg-random.org
* Version: minimal C implementation, http://www.pcg-random.org/download.html
* License: Apache 2.0
+- `polypartition.{cpp,h}`
+ * Upstream: https://github.com/ivanfratric/polypartition (`src/polypartition.{cpp,h}`)
+ * Version: git (7bdffb428b2b19ad1c43aa44c714dcc104177e84, 2021)
+ * Modifications: Change from STL to Godot types (see provided patch).
+ * License: MIT
- `r128.h`
* Upstream: https://github.com/fahickman/r128
* Version: 1.4.4 (cf2e88fc3e7d7dfe99189686f914874cd0bda15e, 2020)
@@ -441,10 +446,6 @@ Collection of single-file libraries used in Godot components.
* Upstream: https://github.com/nothings/stb
* Version: 1.20 (314d0a6f9af5af27e585336eecea333e95c5a2d8, 2020)
* License: Public Domain or Unlicense or MIT
-- `triangulator.{cpp,h}`
- * Upstream: https://github.com/ivanfratric/polypartition (`src/polypartition.cpp`)
- * Version: TBD, class was renamed
- * License: MIT
- `yuv2rgb.h`
* Upstream: http://wss.co.uk/pinknoise/yuv2rgb/ (to check)
* Version: ?
diff --git a/thirdparty/meshoptimizer/indexcodec.cpp b/thirdparty/meshoptimizer/indexcodec.cpp
index 5c35eb43ae..e4495b8586 100644
--- a/thirdparty/meshoptimizer/indexcodec.cpp
+++ b/thirdparty/meshoptimizer/indexcodec.cpp
@@ -108,7 +108,7 @@ static unsigned int decodeVByte(const unsigned char*& data)
for (int i = 0; i < 4; ++i)
{
unsigned char group = *data++;
- result |= (group & 127) << shift;
+ result |= unsigned(group & 127) << shift;
shift += 7;
if (group < 128)
diff --git a/thirdparty/meshoptimizer/meshoptimizer.h b/thirdparty/meshoptimizer/meshoptimizer.h
index 4071f0a371..1714000384 100644
--- a/thirdparty/meshoptimizer/meshoptimizer.h
+++ b/thirdparty/meshoptimizer/meshoptimizer.h
@@ -262,7 +262,7 @@ MESHOPTIMIZER_EXPERIMENTAL void meshopt_decodeFilterExp(void* buffer, size_t ver
* The resulting index buffer references vertices from the original vertex buffer.
* If the original vertex data isn't required, creating a compact vertex buffer using meshopt_optimizeVertexFetch is recommended.
*
- * destination must contain enough space for the *source* index buffer (since optimization is iterative, this means index_count elements - *not* target_index_count!)
+ * destination must contain enough space for the target index buffer, worst case is index_count elements (*not* target_index_count)!
* vertex_positions should have float3 position in the first 12 bytes of each vertex - similar to glVertexPointer
* target_error represents the error relative to mesh extents that can be tolerated, e.g. 0.01 = 1% deformation
* result_error can be NULL; when it's not NULL, it will contain the resulting (relative) error after simplification
@@ -272,15 +272,17 @@ MESHOPTIMIZER_EXPERIMENTAL size_t meshopt_simplify(unsigned int* destination, co
/**
* Experimental: Mesh simplifier (sloppy)
* Reduces the number of triangles in the mesh, sacrificing mesh apperance for simplification performance
- * The algorithm doesn't preserve mesh topology but is always able to reach target triangle count.
+ * The algorithm doesn't preserve mesh topology but can stop short of the target goal based on target error.
* Returns the number of indices after simplification, with destination containing new index data
* The resulting index buffer references vertices from the original vertex buffer.
* If the original vertex data isn't required, creating a compact vertex buffer using meshopt_optimizeVertexFetch is recommended.
*
- * destination must contain enough space for the target index buffer
+ * destination must contain enough space for the target index buffer, worst case is index_count elements (*not* target_index_count)!
* vertex_positions should have float3 position in the first 12 bytes of each vertex - similar to glVertexPointer
+ * target_error represents the error relative to mesh extents that can be tolerated, e.g. 0.01 = 1% deformation
+ * result_error can be NULL; when it's not NULL, it will contain the resulting (relative) error after simplification
*/
-MESHOPTIMIZER_EXPERIMENTAL size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count);
+MESHOPTIMIZER_EXPERIMENTAL size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float* result_error);
/**
* Experimental: Point cloud simplifier
@@ -289,7 +291,7 @@ MESHOPTIMIZER_EXPERIMENTAL size_t meshopt_simplifySloppy(unsigned int* destinati
* The resulting index buffer references vertices from the original vertex buffer.
* If the original vertex data isn't required, creating a compact vertex buffer using meshopt_optimizeVertexFetch is recommended.
*
- * destination must contain enough space for the target index buffer
+ * destination must contain enough space for the target index buffer (target_vertex_count elements)
* vertex_positions should have float3 position in the first 12 bytes of each vertex - similar to glVertexPointer
*/
MESHOPTIMIZER_EXPERIMENTAL size_t meshopt_simplifyPoints(unsigned int* destination, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_vertex_count);
@@ -533,7 +535,7 @@ inline int meshopt_decodeIndexSequence(T* destination, size_t index_count, const
template <typename T>
inline size_t meshopt_simplify(T* destination, const T* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float* result_error = 0);
template <typename T>
-inline size_t meshopt_simplifySloppy(T* destination, const T* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count);
+inline size_t meshopt_simplifySloppy(T* destination, const T* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float* result_error = 0);
template <typename T>
inline size_t meshopt_stripify(T* destination, const T* indices, size_t index_count, size_t vertex_count, T restart_index);
template <typename T>
@@ -855,12 +857,12 @@ inline size_t meshopt_simplify(T* destination, const T* indices, size_t index_co
}
template <typename T>
-inline size_t meshopt_simplifySloppy(T* destination, const T* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count)
+inline size_t meshopt_simplifySloppy(T* destination, const T* indices, size_t index_count, const float* vertex_positions, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float* result_error)
{
meshopt_IndexAdapter<T> in(0, indices, index_count);
- meshopt_IndexAdapter<T> out(destination, 0, target_index_count);
+ meshopt_IndexAdapter<T> out(destination, 0, index_count);
- return meshopt_simplifySloppy(out.data, in.data, index_count, vertex_positions, vertex_count, vertex_positions_stride, target_index_count);
+ return meshopt_simplifySloppy(out.data, in.data, index_count, vertex_positions, vertex_count, vertex_positions_stride, target_index_count, target_error, result_error);
}
template <typename T>
diff --git a/thirdparty/meshoptimizer/simplifier.cpp b/thirdparty/meshoptimizer/simplifier.cpp
index 5205b01172..942db14461 100644
--- a/thirdparty/meshoptimizer/simplifier.cpp
+++ b/thirdparty/meshoptimizer/simplifier.cpp
@@ -1400,7 +1400,7 @@ size_t meshopt_simplify(unsigned int* destination, const unsigned int* indices,
return result_count;
}
-size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* indices, size_t index_count, const float* vertex_positions_data, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count)
+size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* indices, size_t index_count, const float* vertex_positions_data, size_t vertex_count, size_t vertex_positions_stride, size_t target_index_count, float target_error, float* out_result_error)
{
using namespace meshopt;
@@ -1412,9 +1412,6 @@ size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* ind
// we expect to get ~2 triangles/vertex in the output
size_t target_cell_count = target_index_count / 6;
- if (target_cell_count == 0)
- return 0;
-
meshopt_Allocator allocator;
Vector3* vertex_positions = allocator.allocate<Vector3>(vertex_count);
@@ -1431,18 +1428,25 @@ size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* ind
const int kInterpolationPasses = 5;
// invariant: # of triangles in min_grid <= target_count
- int min_grid = 0;
+ int min_grid = int(1.f / (target_error < 1e-3f ? 1e-3f : target_error));
int max_grid = 1025;
size_t min_triangles = 0;
size_t max_triangles = index_count / 3;
+ // when we're error-limited, we compute the triangle count for the min. size; this accelerates convergence and provides the correct answer when we can't use a larger grid
+ if (min_grid > 1)
+ {
+ computeVertexIds(vertex_ids, vertex_positions, vertex_count, min_grid);
+ min_triangles = countTriangles(vertex_ids, indices, index_count);
+ }
+
// instead of starting in the middle, let's guess as to what the answer might be! triangle count usually grows as a square of grid size...
int next_grid_size = int(sqrtf(float(target_cell_count)) + 0.5f);
for (int pass = 0; pass < 10 + kInterpolationPasses; ++pass)
{
- assert(min_triangles < target_index_count / 3);
- assert(max_grid - min_grid > 1);
+ if (min_triangles >= target_index_count / 3 || max_grid - min_grid <= 1)
+ break;
// we clamp the prediction of the grid size to make sure that the search converges
int grid_size = next_grid_size;
@@ -1471,16 +1475,18 @@ size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* ind
max_triangles = triangles;
}
- if (triangles == target_index_count / 3 || max_grid - min_grid <= 1)
- break;
-
// we start by using interpolation search - it usually converges faster
// however, interpolation search has a worst case of O(N) so we switch to binary search after a few iterations which converges in O(logN)
next_grid_size = (pass < kInterpolationPasses) ? int(tip + 0.5f) : (min_grid + max_grid) / 2;
}
if (min_triangles == 0)
+ {
+ if (out_result_error)
+ *out_result_error = 1.f;
+
return 0;
+ }
// build vertex->cell association by mapping all vertices with the same quantized position to the same cell
size_t table_size = hashBuckets2(vertex_count);
@@ -1503,18 +1509,26 @@ size_t meshopt_simplifySloppy(unsigned int* destination, const unsigned int* ind
fillCellRemap(cell_remap, cell_errors, cell_count, vertex_cells, cell_quadrics, vertex_positions, vertex_count);
+ // compute error
+ float result_error = 0.f;
+
+ for (size_t i = 0; i < cell_count; ++i)
+ result_error = result_error < cell_errors[i] ? cell_errors[i] : result_error;
+
// collapse triangles!
// note that we need to filter out triangles that we've already output because we very frequently generate redundant triangles between cells :(
size_t tritable_size = hashBuckets2(min_triangles);
unsigned int* tritable = allocator.allocate<unsigned int>(tritable_size);
size_t write = filterTriangles(destination, tritable, tritable_size, indices, index_count, vertex_cells, cell_remap);
- assert(write <= target_index_count);
#if TRACE
- printf("result: %d cells, %d triangles (%d unfiltered)\n", int(cell_count), int(write / 3), int(min_triangles));
+ printf("result: %d cells, %d triangles (%d unfiltered), error %e\n", int(cell_count), int(write / 3), int(min_triangles), sqrtf(result_error));
#endif
+ if (out_result_error)
+ *out_result_error = sqrtf(result_error);
+
return write;
}
diff --git a/thirdparty/misc/patches/polypartition-godot-types.patch b/thirdparty/misc/patches/polypartition-godot-types.patch
new file mode 100644
index 0000000000..59fdb2707c
--- /dev/null
+++ b/thirdparty/misc/patches/polypartition-godot-types.patch
@@ -0,0 +1,819 @@
+diff --git a/thirdparty/misc/polypartition.cpp b/thirdparty/misc/polypartition.cpp
+index 3a8a6efa8319..4f1b6dcb21d8 100644
+--- a/thirdparty/misc/polypartition.cpp
++++ b/thirdparty/misc/polypartition.cpp
+@@ -23,10 +23,7 @@
+
+ #include "polypartition.h"
+
+-#include <math.h>
+-#include <string.h>
+ #include <algorithm>
+-#include <vector>
+
+ TPPLPoly::TPPLPoly() {
+ hole = false;
+@@ -186,7 +183,7 @@ int TPPLPartition::Intersects(TPPLPoint &p11, TPPLPoint &p12, TPPLPoint &p21, TP
+ // Removes holes from inpolys by merging them with non-holes.
+ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ TPPLPolyList polys;
+- TPPLPolyList::iterator holeiter, polyiter, iter, iter2;
++ TPPLPolyList::Element *holeiter, *polyiter, *iter, *iter2;
+ long i, i2, holepointindex, polypointindex;
+ TPPLPoint holepoint, polypoint, bestpolypoint;
+ TPPLPoint linep1, linep2;
+@@ -198,15 +195,15 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+
+ // Check for the trivial case of no holes.
+ hasholes = false;
+- for (iter = inpolys->begin(); iter != inpolys->end(); iter++) {
+- if (iter->IsHole()) {
++ for (iter = inpolys->front(); iter; iter = iter->next()) {
++ if (iter->get().IsHole()) {
+ hasholes = true;
+ break;
+ }
+ }
+ if (!hasholes) {
+- for (iter = inpolys->begin(); iter != inpolys->end(); iter++) {
+- outpolys->push_back(*iter);
++ for (iter = inpolys->front(); iter; iter = iter->next()) {
++ outpolys->push_back(iter->get());
+ }
+ return 1;
+ }
+@@ -216,8 +213,8 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ while (1) {
+ // Find the hole point with the largest x.
+ hasholes = false;
+- for (iter = polys.begin(); iter != polys.end(); iter++) {
+- if (!iter->IsHole()) {
++ for (iter = polys.front(); iter; iter = iter->next()) {
++ if (!iter->get().IsHole()) {
+ continue;
+ }
+
+@@ -227,8 +224,8 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ holepointindex = 0;
+ }
+
+- for (i = 0; i < iter->GetNumPoints(); i++) {
+- if (iter->GetPoint(i).x > holeiter->GetPoint(holepointindex).x) {
++ for (i = 0; i < iter->get().GetNumPoints(); i++) {
++ if (iter->get().GetPoint(i).x > holeiter->get().GetPoint(holepointindex).x) {
+ holeiter = iter;
+ holepointindex = i;
+ }
+@@ -237,24 +234,24 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ if (!hasholes) {
+ break;
+ }
+- holepoint = holeiter->GetPoint(holepointindex);
++ holepoint = holeiter->get().GetPoint(holepointindex);
+
+ pointfound = false;
+- for (iter = polys.begin(); iter != polys.end(); iter++) {
+- if (iter->IsHole()) {
++ for (iter = polys.front(); iter; iter = iter->next()) {
++ if (iter->get().IsHole()) {
+ continue;
+ }
+- for (i = 0; i < iter->GetNumPoints(); i++) {
+- if (iter->GetPoint(i).x <= holepoint.x) {
++ for (i = 0; i < iter->get().GetNumPoints(); i++) {
++ if (iter->get().GetPoint(i).x <= holepoint.x) {
+ continue;
+ }
+- if (!InCone(iter->GetPoint((i + iter->GetNumPoints() - 1) % (iter->GetNumPoints())),
+- iter->GetPoint(i),
+- iter->GetPoint((i + 1) % (iter->GetNumPoints())),
++ if (!InCone(iter->get().GetPoint((i + iter->get().GetNumPoints() - 1) % (iter->get().GetNumPoints())),
++ iter->get().GetPoint(i),
++ iter->get().GetPoint((i + 1) % (iter->get().GetNumPoints())),
+ holepoint)) {
+ continue;
+ }
+- polypoint = iter->GetPoint(i);
++ polypoint = iter->get().GetPoint(i);
+ if (pointfound) {
+ v1 = Normalize(polypoint - holepoint);
+ v2 = Normalize(bestpolypoint - holepoint);
+@@ -263,13 +260,13 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ }
+ }
+ pointvisible = true;
+- for (iter2 = polys.begin(); iter2 != polys.end(); iter2++) {
+- if (iter2->IsHole()) {
++ for (iter2 = polys.front(); iter2; iter2->next()) {
++ if (iter2->get().IsHole()) {
+ continue;
+ }
+- for (i2 = 0; i2 < iter2->GetNumPoints(); i2++) {
+- linep1 = iter2->GetPoint(i2);
+- linep2 = iter2->GetPoint((i2 + 1) % (iter2->GetNumPoints()));
++ for (i2 = 0; i2 < iter2->get().GetNumPoints(); i2++) {
++ linep1 = iter2->get().GetPoint(i2);
++ linep2 = iter2->get().GetPoint((i2 + 1) % (iter2->get().GetNumPoints()));
+ if (Intersects(holepoint, polypoint, linep1, linep2)) {
+ pointvisible = false;
+ break;
+@@ -292,18 +289,18 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ return 0;
+ }
+
+- newpoly.Init(holeiter->GetNumPoints() + polyiter->GetNumPoints() + 2);
++ newpoly.Init(holeiter->get().GetNumPoints() + polyiter->get().GetNumPoints() + 2);
+ i2 = 0;
+ for (i = 0; i <= polypointindex; i++) {
+- newpoly[i2] = polyiter->GetPoint(i);
++ newpoly[i2] = polyiter->get().GetPoint(i);
+ i2++;
+ }
+- for (i = 0; i <= holeiter->GetNumPoints(); i++) {
+- newpoly[i2] = holeiter->GetPoint((i + holepointindex) % holeiter->GetNumPoints());
++ for (i = 0; i <= holeiter->get().GetNumPoints(); i++) {
++ newpoly[i2] = holeiter->get().GetPoint((i + holepointindex) % holeiter->get().GetNumPoints());
+ i2++;
+ }
+- for (i = polypointindex; i < polyiter->GetNumPoints(); i++) {
+- newpoly[i2] = polyiter->GetPoint(i);
++ for (i = polypointindex; i < polyiter->get().GetNumPoints(); i++) {
++ newpoly[i2] = polyiter->get().GetPoint(i);
+ i2++;
+ }
+
+@@ -312,8 +309,8 @@ int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ polys.push_back(newpoly);
+ }
+
+- for (iter = polys.begin(); iter != polys.end(); iter++) {
+- outpolys->push_back(*iter);
++ for (iter = polys.front(); iter; iter = iter->next()) {
++ outpolys->push_back(iter->get());
+ }
+
+ return 1;
+@@ -524,13 +521,13 @@ int TPPLPartition::Triangulate_EC(TPPLPoly *poly, TPPLPolyList *triangles) {
+
+ int TPPLPartition::Triangulate_EC(TPPLPolyList *inpolys, TPPLPolyList *triangles) {
+ TPPLPolyList outpolys;
+- TPPLPolyList::iterator iter;
++ TPPLPolyList::Element *iter;
+
+ if (!RemoveHoles(inpolys, &outpolys)) {
+ return 0;
+ }
+- for (iter = outpolys.begin(); iter != outpolys.end(); iter++) {
+- if (!Triangulate_EC(&(*iter), triangles)) {
++ for (iter = outpolys.front(); iter; iter = iter->next()) {
++ if (!Triangulate_EC(&(iter->get()), triangles)) {
+ return 0;
+ }
+ }
+@@ -543,7 +540,7 @@ int TPPLPartition::ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts) {
+ }
+
+ TPPLPolyList triangles;
+- TPPLPolyList::iterator iter1, iter2;
++ TPPLPolyList::Element *iter1, *iter2;
+ TPPLPoly *poly1 = NULL, *poly2 = NULL;
+ TPPLPoly newpoly;
+ TPPLPoint d1, d2, p1, p2, p3;
+@@ -578,19 +575,19 @@ int TPPLPartition::ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts) {
+ return 0;
+ }
+
+- for (iter1 = triangles.begin(); iter1 != triangles.end(); iter1++) {
+- poly1 = &(*iter1);
++ for (iter1 = triangles.front(); iter1; iter1 = iter1->next()) {
++ poly1 = &(iter1->get());
+ for (i11 = 0; i11 < poly1->GetNumPoints(); i11++) {
+ d1 = poly1->GetPoint(i11);
+ i12 = (i11 + 1) % (poly1->GetNumPoints());
+ d2 = poly1->GetPoint(i12);
+
+ isdiagonal = false;
+- for (iter2 = iter1; iter2 != triangles.end(); iter2++) {
++ for (iter2 = iter1; iter2; iter2 = iter2->next()) {
+ if (iter1 == iter2) {
+ continue;
+ }
+- poly2 = &(*iter2);
++ poly2 = &(iter2->get());
+
+ for (i21 = 0; i21 < poly2->GetNumPoints(); i21++) {
+ if ((d2.x != poly2->GetPoint(i21).x) || (d2.y != poly2->GetPoint(i21).y)) {
+@@ -660,16 +657,16 @@ int TPPLPartition::ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts) {
+ }
+
+ triangles.erase(iter2);
+- *iter1 = newpoly;
+- poly1 = &(*iter1);
++ iter1->get() = newpoly;
++ poly1 = &(iter1->get());
+ i11 = -1;
+
+ continue;
+ }
+ }
+
+- for (iter1 = triangles.begin(); iter1 != triangles.end(); iter1++) {
+- parts->push_back(*iter1);
++ for (iter1 = triangles.front(); iter1; iter1 = iter1->next()) {
++ parts->push_back(iter1->get());
+ }
+
+ return 1;
+@@ -677,13 +674,13 @@ int TPPLPartition::ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts) {
+
+ int TPPLPartition::ConvexPartition_HM(TPPLPolyList *inpolys, TPPLPolyList *parts) {
+ TPPLPolyList outpolys;
+- TPPLPolyList::iterator iter;
++ TPPLPolyList::Element *iter;
+
+ if (!RemoveHoles(inpolys, &outpolys)) {
+ return 0;
+ }
+- for (iter = outpolys.begin(); iter != outpolys.end(); iter++) {
+- if (!ConvexPartition_HM(&(*iter), parts)) {
++ for (iter = outpolys.front(); iter; iter = iter->next()) {
++ if (!ConvexPartition_HM(&(iter->get()), parts)) {
+ return 0;
+ }
+ }
+@@ -824,8 +821,8 @@ int TPPLPartition::Triangulate_OPT(TPPLPoly *poly, TPPLPolyList *triangles) {
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_back(newdiagonal);
+- while (!diagonals.empty()) {
+- diagonal = *(diagonals.begin());
++ while (!diagonals.is_empty()) {
++ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ bestvertex = dpstates[diagonal.index2][diagonal.index1].bestvertex;
+ if (bestvertex == -1) {
+@@ -873,10 +870,10 @@ void TPPLPartition::UpdateState(long a, long b, long w, long i, long j, DPState2
+ pairs->push_front(newdiagonal);
+ dpstates[a][b].weight = w;
+ } else {
+- if ((!pairs->empty()) && (i <= pairs->begin()->index1)) {
++ if ((!pairs->is_empty()) && (i <= pairs->front()->get().index1)) {
+ return;
+ }
+- while ((!pairs->empty()) && (pairs->begin()->index2 >= j)) {
++ while ((!pairs->is_empty()) && (pairs->front()->get().index2 >= j)) {
+ pairs->pop_front();
+ }
+ pairs->push_front(newdiagonal);
+@@ -885,7 +882,7 @@ void TPPLPartition::UpdateState(long a, long b, long w, long i, long j, DPState2
+
+ void TPPLPartition::TypeA(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
+ DiagonalList *pairs = NULL;
+- DiagonalList::iterator iter, lastiter;
++ DiagonalList::Element *iter, *lastiter;
+ long top;
+ long w;
+
+@@ -902,23 +899,23 @@ void TPPLPartition::TypeA(long i, long j, long k, PartitionVertex *vertices, DPS
+ }
+ if (j - i > 1) {
+ pairs = &(dpstates[i][j].pairs);
+- iter = pairs->end();
+- lastiter = pairs->end();
+- while (iter != pairs->begin()) {
++ iter = pairs->back();
++ lastiter = pairs->back();
++ while (iter != pairs->front()) {
+ iter--;
+- if (!IsReflex(vertices[iter->index2].p, vertices[j].p, vertices[k].p)) {
++ if (!IsReflex(vertices[iter->get().index2].p, vertices[j].p, vertices[k].p)) {
+ lastiter = iter;
+ } else {
+ break;
+ }
+ }
+- if (lastiter == pairs->end()) {
++ if (lastiter == pairs->back()) {
+ w++;
+ } else {
+- if (IsReflex(vertices[k].p, vertices[i].p, vertices[lastiter->index1].p)) {
++ if (IsReflex(vertices[k].p, vertices[i].p, vertices[lastiter->get().index1].p)) {
+ w++;
+ } else {
+- top = lastiter->index1;
++ top = lastiter->get().index1;
+ }
+ }
+ }
+@@ -927,7 +924,7 @@ void TPPLPartition::TypeA(long i, long j, long k, PartitionVertex *vertices, DPS
+
+ void TPPLPartition::TypeB(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
+ DiagonalList *pairs = NULL;
+- DiagonalList::iterator iter, lastiter;
++ DiagonalList::Element *iter, *lastiter;
+ long top;
+ long w;
+
+@@ -946,21 +943,21 @@ void TPPLPartition::TypeB(long i, long j, long k, PartitionVertex *vertices, DPS
+ if (k - j > 1) {
+ pairs = &(dpstates[j][k].pairs);
+
+- iter = pairs->begin();
+- if ((!pairs->empty()) && (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->index1].p))) {
++ iter = pairs->front();
++ if ((!pairs->is_empty()) && (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->get().index1].p))) {
+ lastiter = iter;
+- while (iter != pairs->end()) {
+- if (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->index1].p)) {
++ while (iter) {
++ if (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->get().index1].p)) {
+ lastiter = iter;
+- iter++;
++ iter = iter->next();
+ } else {
+ break;
+ }
+ }
+- if (IsReflex(vertices[lastiter->index2].p, vertices[k].p, vertices[i].p)) {
++ if (IsReflex(vertices[lastiter->get().index2].p, vertices[k].p, vertices[i].p)) {
+ w++;
+ } else {
+- top = lastiter->index2;
++ top = lastiter->get().index2;
+ }
+ } else {
+ w++;
+@@ -981,11 +978,11 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ DiagonalList diagonals, diagonals2;
+ Diagonal diagonal, newdiagonal;
+ DiagonalList *pairs = NULL, *pairs2 = NULL;
+- DiagonalList::iterator iter, iter2;
++ DiagonalList::Element *iter, *iter2;
+ int ret;
+ TPPLPoly newpoly;
+- std::vector<long> indices;
+- std::vector<long>::iterator iiter;
++ List<long> indices;
++ List<long>::Element *iiter;
+ bool ijreal, jkreal;
+
+ n = poly->GetNumPoints();
+@@ -1110,35 +1107,35 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_front(newdiagonal);
+- while (!diagonals.empty()) {
+- diagonal = *(diagonals.begin());
++ while (!diagonals.is_empty()) {
++ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+ }
+ pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
+- if (pairs->empty()) {
++ if (pairs->is_empty()) {
+ ret = 0;
+ break;
+ }
+ if (!vertices[diagonal.index1].isConvex) {
+- iter = pairs->end();
++ iter = pairs->back();
+ iter--;
+- j = iter->index2;
++ j = iter->get().index2;
+ newdiagonal.index1 = j;
+ newdiagonal.index2 = diagonal.index2;
+ diagonals.push_front(newdiagonal);
+ if ((j - diagonal.index1) > 1) {
+- if (iter->index1 != iter->index2) {
++ if (iter->get().index1 != iter->get().index2) {
+ pairs2 = &(dpstates[diagonal.index1][j].pairs);
+ while (1) {
+- if (pairs2->empty()) {
++ if (pairs2->is_empty()) {
+ ret = 0;
+ break;
+ }
+- iter2 = pairs2->end();
++ iter2 = pairs2->back();
+ iter2--;
+- if (iter->index1 != iter2->index1) {
++ if (iter->get().index1 != iter2->get().index1) {
+ pairs2->pop_back();
+ } else {
+ break;
+@@ -1153,21 +1150,21 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ diagonals.push_front(newdiagonal);
+ }
+ } else {
+- iter = pairs->begin();
+- j = iter->index1;
++ iter = pairs->front();
++ j = iter->get().index1;
+ newdiagonal.index1 = diagonal.index1;
+ newdiagonal.index2 = j;
+ diagonals.push_front(newdiagonal);
+ if ((diagonal.index2 - j) > 1) {
+- if (iter->index1 != iter->index2) {
++ if (iter->get().index1 != iter->get().index2) {
+ pairs2 = &(dpstates[j][diagonal.index2].pairs);
+ while (1) {
+- if (pairs2->empty()) {
++ if (pairs2->is_empty()) {
+ ret = 0;
+ break;
+ }
+- iter2 = pairs2->begin();
+- if (iter->index2 != iter2->index2) {
++ iter2 = pairs2->front();
++ if (iter->get().index2 != iter2->get().index2) {
+ pairs2->pop_front();
+ } else {
+ break;
+@@ -1197,8 +1194,8 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_front(newdiagonal);
+- while (!diagonals.empty()) {
+- diagonal = *(diagonals.begin());
++ while (!diagonals.is_empty()) {
++ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+@@ -1210,8 +1207,8 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ indices.push_back(diagonal.index2);
+ diagonals2.push_front(diagonal);
+
+- while (!diagonals2.empty()) {
+- diagonal = *(diagonals2.begin());
++ while (!diagonals2.is_empty()) {
++ diagonal = diagonals2.front()->get();
+ diagonals2.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+@@ -1220,16 +1217,16 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ jkreal = true;
+ pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
+ if (!vertices[diagonal.index1].isConvex) {
+- iter = pairs->end();
++ iter = pairs->back();
+ iter--;
+- j = iter->index2;
+- if (iter->index1 != iter->index2) {
++ j = iter->get().index2;
++ if (iter->get().index1 != iter->get().index2) {
+ ijreal = false;
+ }
+ } else {
+- iter = pairs->begin();
+- j = iter->index1;
+- if (iter->index1 != iter->index2) {
++ iter = pairs->front();
++ j = iter->get().index1;
++ if (iter->get().index1 != iter->get().index2) {
+ jkreal = false;
+ }
+ }
+@@ -1253,11 +1250,12 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ indices.push_back(j);
+ }
+
+- std::sort(indices.begin(), indices.end());
++ //std::sort(indices.begin(), indices.end());
++ indices.sort();
+ newpoly.Init((long)indices.size());
+ k = 0;
+- for (iiter = indices.begin(); iiter != indices.end(); iiter++) {
+- newpoly[k] = vertices[*iiter].p;
++ for (iiter = indices.front(); iiter != indices.back(); iiter = iiter->next()) {
++ newpoly[k] = vertices[iiter->get()].p;
+ k++;
+ }
+ parts->push_back(newpoly);
+@@ -1281,7 +1279,7 @@ int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ // "Computational Geometry: Algorithms and Applications"
+ // by Mark de Berg, Otfried Cheong, Marc van Kreveld, and Mark Overmars.
+ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monotonePolys) {
+- TPPLPolyList::iterator iter;
++ TPPLPolyList::Element *iter;
+ MonotoneVertex *vertices = NULL;
+ long i, numvertices, vindex, vindex2, newnumvertices, maxnumvertices;
+ long polystartindex, polyendindex;
+@@ -1291,11 +1289,8 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ bool error = false;
+
+ numvertices = 0;
+- for (iter = inpolys->begin(); iter != inpolys->end(); iter++) {
+- if (!iter->Valid()) {
+- return 0;
+- }
+- numvertices += iter->GetNumPoints();
++ for (iter = inpolys->front(); iter; iter++) {
++ numvertices += iter->get().GetNumPoints();
+ }
+
+ maxnumvertices = numvertices * 3;
+@@ -1303,8 +1298,8 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ newnumvertices = numvertices;
+
+ polystartindex = 0;
+- for (iter = inpolys->begin(); iter != inpolys->end(); iter++) {
+- poly = &(*iter);
++ for (iter = inpolys->front(); iter; iter++) {
++ poly = &(iter->get());
+ polyendindex = polystartindex + poly->GetNumPoints() - 1;
+ for (i = 0; i < poly->GetNumPoints(); i++) {
+ vertices[i + polystartindex].p = poly->GetPoint(i);
+@@ -1360,14 +1355,14 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ // Note that while set doesn't actually have to be implemented as
+ // a tree, complexity requirements for operations are the same as
+ // for the balanced binary search tree.
+- std::set<ScanLineEdge> edgeTree;
++ Set<ScanLineEdge> edgeTree;
+ // Store iterators to the edge tree elements.
+ // This makes deleting existing edges much faster.
+- std::set<ScanLineEdge>::iterator *edgeTreeIterators, edgeIter;
+- edgeTreeIterators = new std::set<ScanLineEdge>::iterator[maxnumvertices];
+- std::pair<std::set<ScanLineEdge>::iterator, bool> edgeTreeRet;
++ Set<ScanLineEdge>::Element **edgeTreeIterators, *edgeIter;
++ edgeTreeIterators = new Set<ScanLineEdge>::Element *[maxnumvertices];
++ //Pair<Set<ScanLineEdge>::iterator, bool> edgeTreeRet;
+ for (i = 0; i < numvertices; i++) {
+- edgeTreeIterators[i] = edgeTree.end();
++ edgeTreeIterators[i] = nullptr;
+ }
+
+ // For each vertex.
+@@ -1387,13 +1382,14 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ newedge.p1 = v->p;
+ newedge.p2 = vertices[v->next].p;
+ newedge.index = vindex;
+- edgeTreeRet = edgeTree.insert(newedge);
+- edgeTreeIterators[vindex] = edgeTreeRet.first;
++ //edgeTreeRet = edgeTree.insert(newedge);
++ //edgeTreeIterators[vindex] = edgeTreeRet.first;
++ edgeTreeIterators[vindex] = edgeTree.insert(newedge);
+ helpers[vindex] = vindex;
+ break;
+
+ case TPPL_VERTEXTYPE_END:
+- if (edgeTreeIterators[v->previous] == edgeTree.end()) {
++ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+@@ -1412,29 +1408,30 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+- if (edgeIter == edgeTree.begin()) {
++ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+ edgeIter--;
+ // Insert the diagonal connecting vi to helper(e_j) in D.
+- AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->index],
++ AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ vindex2 = newnumvertices - 2;
+ v2 = &(vertices[vindex2]);
+ // helper(e_j) in v_i.
+- helpers[edgeIter->index] = vindex;
++ helpers[edgeIter->get().index] = vindex;
+ // Insert e_i in T and set helper(e_i) to v_i.
+ newedge.p1 = v2->p;
+ newedge.p2 = vertices[v2->next].p;
+ newedge.index = vindex2;
+- edgeTreeRet = edgeTree.insert(newedge);
+- edgeTreeIterators[vindex2] = edgeTreeRet.first;
++ //edgeTreeRet = edgeTree.insert(newedge);
++ //edgeTreeIterators[vindex2] = edgeTreeRet.first;
++ edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
+ helpers[vindex2] = vindex2;
+ break;
+
+ case TPPL_VERTEXTYPE_MERGE:
+- if (edgeTreeIterators[v->previous] == edgeTree.end()) {
++ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+@@ -1452,25 +1449,25 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+- if (edgeIter == edgeTree.begin()) {
++ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+ edgeIter--;
+ // If helper(e_j) is a merge vertex.
+- if (vertextypes[helpers[edgeIter->index]] == TPPL_VERTEXTYPE_MERGE) {
++ if (vertextypes[helpers[edgeIter->get().index]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting v_i to helper(e_j) in D.
+- AddDiagonal(vertices, &newnumvertices, vindex2, helpers[edgeIter->index],
++ AddDiagonal(vertices, &newnumvertices, vindex2, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ }
+ // helper(e_j) <- v_i
+- helpers[edgeIter->index] = vindex2;
++ helpers[edgeIter->get().index] = vindex2;
+ break;
+
+ case TPPL_VERTEXTYPE_REGULAR:
+ // If the interior of P lies to the right of v_i.
+ if (Below(v->p, vertices[v->previous].p)) {
+- if (edgeTreeIterators[v->previous] == edgeTree.end()) {
++ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+@@ -1488,27 +1485,28 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+ newedge.p1 = v2->p;
+ newedge.p2 = vertices[v2->next].p;
+ newedge.index = vindex2;
+- edgeTreeRet = edgeTree.insert(newedge);
+- edgeTreeIterators[vindex2] = edgeTreeRet.first;
++ //edgeTreeRet = edgeTree.insert(newedge);
++ //edgeTreeIterators[vindex2] = edgeTreeRet.first;
++ edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
+ helpers[vindex2] = vindex;
+ } else {
+ // Search in T to find the edge e_j directly left of v_i.
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+- if (edgeIter == edgeTree.begin()) {
++ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+- edgeIter--;
++ edgeIter = edgeIter->prev();
+ // If helper(e_j) is a merge vertex.
+- if (vertextypes[helpers[edgeIter->index]] == TPPL_VERTEXTYPE_MERGE) {
++ if (vertextypes[helpers[edgeIter->get().index]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting v_i to helper(e_j) in D.
+- AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->index],
++ AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ }
+ // helper(e_j) <- v_i.
+- helpers[edgeIter->index] = vindex;
++ helpers[edgeIter->get().index] = vindex;
+ }
+ break;
+ }
+@@ -1569,8 +1567,8 @@ int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monoto
+
+ // Adds a diagonal to the doubly-connected list of vertices.
+ void TPPLPartition::AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
+- TPPLVertexType *vertextypes, std::set<ScanLineEdge>::iterator *edgeTreeIterators,
+- std::set<ScanLineEdge> *edgeTree, long *helpers) {
++ TPPLVertexType *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
++ Set<ScanLineEdge> *edgeTree, long *helpers) {
+ long newindex1, newindex2;
+
+ newindex1 = *numvertices;
+@@ -1597,14 +1595,14 @@ void TPPLPartition::AddDiagonal(MonotoneVertex *vertices, long *numvertices, lon
+ vertextypes[newindex1] = vertextypes[index1];
+ edgeTreeIterators[newindex1] = edgeTreeIterators[index1];
+ helpers[newindex1] = helpers[index1];
+- if (edgeTreeIterators[newindex1] != edgeTree->end()) {
+- edgeTreeIterators[newindex1]->index = newindex1;
++ if (edgeTreeIterators[newindex1] != edgeTree->back()) {
++ edgeTreeIterators[newindex1]->get().index = newindex1;
+ }
+ vertextypes[newindex2] = vertextypes[index2];
+ edgeTreeIterators[newindex2] = edgeTreeIterators[index2];
+ helpers[newindex2] = helpers[index2];
+- if (edgeTreeIterators[newindex2] != edgeTree->end()) {
+- edgeTreeIterators[newindex2]->index = newindex2;
++ if (edgeTreeIterators[newindex2] != edgeTree->back()) {
++ edgeTreeIterators[newindex2]->get().index = newindex2;
+ }
+ }
+
+@@ -1830,13 +1828,13 @@ int TPPLPartition::TriangulateMonotone(TPPLPoly *inPoly, TPPLPolyList *triangles
+
+ int TPPLPartition::Triangulate_MONO(TPPLPolyList *inpolys, TPPLPolyList *triangles) {
+ TPPLPolyList monotone;
+- TPPLPolyList::iterator iter;
++ TPPLPolyList::Element *iter;
+
+ if (!MonotonePartition(inpolys, &monotone)) {
+ return 0;
+ }
+- for (iter = monotone.begin(); iter != monotone.end(); iter++) {
+- if (!TriangulateMonotone(&(*iter), triangles)) {
++ for (iter = monotone.front(); iter; iter = iter->next()) {
++ if (!TriangulateMonotone(&(iter->get()), triangles)) {
+ return 0;
+ }
+ }
+diff --git a/thirdparty/misc/polypartition.h b/thirdparty/misc/polypartition.h
+index f163f5d2173f..b2d905a3ef76 100644
+--- a/thirdparty/misc/polypartition.h
++++ b/thirdparty/misc/polypartition.h
+@@ -24,8 +24,9 @@
+ #ifndef POLYPARTITION_H
+ #define POLYPARTITION_H
+
+-#include <list>
+-#include <set>
++#include "core/math/vector2.h"
++#include "core/templates/list.h"
++#include "core/templates/set.h"
+
+ typedef double tppl_float;
+
+@@ -44,49 +45,7 @@ enum TPPLVertexType {
+ };
+
+ // 2D point structure.
+-struct TPPLPoint {
+- tppl_float x;
+- tppl_float y;
+- // User-specified vertex identifier. Note that this isn't used internally
+- // by the library, but will be faithfully copied around.
+- int id;
+-
+- TPPLPoint operator+(const TPPLPoint &p) const {
+- TPPLPoint r;
+- r.x = x + p.x;
+- r.y = y + p.y;
+- return r;
+- }
+-
+- TPPLPoint operator-(const TPPLPoint &p) const {
+- TPPLPoint r;
+- r.x = x - p.x;
+- r.y = y - p.y;
+- return r;
+- }
+-
+- TPPLPoint operator*(const tppl_float f) const {
+- TPPLPoint r;
+- r.x = x * f;
+- r.y = y * f;
+- return r;
+- }
+-
+- TPPLPoint operator/(const tppl_float f) const {
+- TPPLPoint r;
+- r.x = x / f;
+- r.y = y / f;
+- return r;
+- }
+-
+- bool operator==(const TPPLPoint &p) const {
+- return ((x == p.x) && (y == p.y));
+- }
+-
+- bool operator!=(const TPPLPoint &p) const {
+- return !((x == p.x) && (y == p.y));
+- }
+-};
++typedef Vector2 TPPLPoint;
+
+ // Polygon implemented as an array of points with a "hole" flag.
+ class TPPLPoly {
+@@ -168,9 +127,9 @@ class TPPLPoly {
+ };
+
+ #ifdef TPPL_ALLOCATOR
+-typedef std::list<TPPLPoly, TPPL_ALLOCATOR(TPPLPoly)> TPPLPolyList;
++typedef List<TPPLPoly, TPPL_ALLOCATOR(TPPLPoly)> TPPLPolyList;
+ #else
+-typedef std::list<TPPLPoly> TPPLPolyList;
++typedef List<TPPLPoly> TPPLPolyList;
+ #endif
+
+ class TPPLPartition {
+@@ -209,9 +168,9 @@ public:
+ };
+
+ #ifdef TPPL_ALLOCATOR
+- typedef std::list<Diagonal, TPPL_ALLOCATOR(Diagonal)> DiagonalList;
++ typedef List<Diagonal, TPPL_ALLOCATOR(Diagonal)> DiagonalList;
+ #else
+- typedef std::list<Diagonal> DiagonalList;
++ typedef List<Diagonal> DiagonalList;
+ #endif
+
+ // Dynamic programming state for minimum-weight triangulation.
+@@ -265,8 +224,8 @@ public:
+ // Helper functions for MonotonePartition.
+ bool Below(TPPLPoint &p1, TPPLPoint &p2);
+ void AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
+- TPPLVertexType *vertextypes, std::set<ScanLineEdge>::iterator *edgeTreeIterators,
+- std::set<ScanLineEdge> *edgeTree, long *helpers);
++ TPPLVertexType *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
++ Set<ScanLineEdge> *edgeTree, long *helpers);
+
+ // Triangulates a monotone polygon, used in Triangulate_MONO.
+ int TriangulateMonotone(TPPLPoly *inPoly, TPPLPolyList *triangles);
diff --git a/thirdparty/misc/polypartition.cpp b/thirdparty/misc/polypartition.cpp
new file mode 100644
index 0000000000..4f1b6dcb21
--- /dev/null
+++ b/thirdparty/misc/polypartition.cpp
@@ -0,0 +1,1849 @@
+/*************************************************************************/
+/* Copyright (c) 2011-2021 Ivan Fratric and contributors. */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#include "polypartition.h"
+
+#include <algorithm>
+
+TPPLPoly::TPPLPoly() {
+ hole = false;
+ numpoints = 0;
+ points = NULL;
+}
+
+TPPLPoly::~TPPLPoly() {
+ if (points) {
+ delete[] points;
+ }
+}
+
+void TPPLPoly::Clear() {
+ if (points) {
+ delete[] points;
+ }
+ hole = false;
+ numpoints = 0;
+ points = NULL;
+}
+
+void TPPLPoly::Init(long numpoints) {
+ Clear();
+ this->numpoints = numpoints;
+ points = new TPPLPoint[numpoints];
+}
+
+void TPPLPoly::Triangle(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3) {
+ Init(3);
+ points[0] = p1;
+ points[1] = p2;
+ points[2] = p3;
+}
+
+TPPLPoly::TPPLPoly(const TPPLPoly &src) :
+ TPPLPoly() {
+ hole = src.hole;
+ numpoints = src.numpoints;
+
+ if (numpoints > 0) {
+ points = new TPPLPoint[numpoints];
+ memcpy(points, src.points, numpoints * sizeof(TPPLPoint));
+ }
+}
+
+TPPLPoly &TPPLPoly::operator=(const TPPLPoly &src) {
+ Clear();
+ hole = src.hole;
+ numpoints = src.numpoints;
+
+ if (numpoints > 0) {
+ points = new TPPLPoint[numpoints];
+ memcpy(points, src.points, numpoints * sizeof(TPPLPoint));
+ }
+
+ return *this;
+}
+
+TPPLOrientation TPPLPoly::GetOrientation() const {
+ long i1, i2;
+ tppl_float area = 0;
+ for (i1 = 0; i1 < numpoints; i1++) {
+ i2 = i1 + 1;
+ if (i2 == numpoints) {
+ i2 = 0;
+ }
+ area += points[i1].x * points[i2].y - points[i1].y * points[i2].x;
+ }
+ if (area > 0) {
+ return TPPL_ORIENTATION_CCW;
+ }
+ if (area < 0) {
+ return TPPL_ORIENTATION_CW;
+ }
+ return TPPL_ORIENTATION_NONE;
+}
+
+void TPPLPoly::SetOrientation(TPPLOrientation orientation) {
+ TPPLOrientation polyorientation = GetOrientation();
+ if (polyorientation != TPPL_ORIENTATION_NONE && polyorientation != orientation) {
+ Invert();
+ }
+}
+
+void TPPLPoly::Invert() {
+ std::reverse(points, points + numpoints);
+}
+
+TPPLPartition::PartitionVertex::PartitionVertex() :
+ previous(NULL), next(NULL) {
+}
+
+TPPLPoint TPPLPartition::Normalize(const TPPLPoint &p) {
+ TPPLPoint r;
+ tppl_float n = sqrt(p.x * p.x + p.y * p.y);
+ if (n != 0) {
+ r = p / n;
+ } else {
+ r.x = 0;
+ r.y = 0;
+ }
+ return r;
+}
+
+tppl_float TPPLPartition::Distance(const TPPLPoint &p1, const TPPLPoint &p2) {
+ tppl_float dx, dy;
+ dx = p2.x - p1.x;
+ dy = p2.y - p1.y;
+ return (sqrt(dx * dx + dy * dy));
+}
+
+// Checks if two lines intersect.
+int TPPLPartition::Intersects(TPPLPoint &p11, TPPLPoint &p12, TPPLPoint &p21, TPPLPoint &p22) {
+ if ((p11.x == p21.x) && (p11.y == p21.y)) {
+ return 0;
+ }
+ if ((p11.x == p22.x) && (p11.y == p22.y)) {
+ return 0;
+ }
+ if ((p12.x == p21.x) && (p12.y == p21.y)) {
+ return 0;
+ }
+ if ((p12.x == p22.x) && (p12.y == p22.y)) {
+ return 0;
+ }
+
+ TPPLPoint v1ort, v2ort, v;
+ tppl_float dot11, dot12, dot21, dot22;
+
+ v1ort.x = p12.y - p11.y;
+ v1ort.y = p11.x - p12.x;
+
+ v2ort.x = p22.y - p21.y;
+ v2ort.y = p21.x - p22.x;
+
+ v = p21 - p11;
+ dot21 = v.x * v1ort.x + v.y * v1ort.y;
+ v = p22 - p11;
+ dot22 = v.x * v1ort.x + v.y * v1ort.y;
+
+ v = p11 - p21;
+ dot11 = v.x * v2ort.x + v.y * v2ort.y;
+ v = p12 - p21;
+ dot12 = v.x * v2ort.x + v.y * v2ort.y;
+
+ if (dot11 * dot12 > 0) {
+ return 0;
+ }
+ if (dot21 * dot22 > 0) {
+ return 0;
+ }
+
+ return 1;
+}
+
+// Removes holes from inpolys by merging them with non-holes.
+int TPPLPartition::RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys) {
+ TPPLPolyList polys;
+ TPPLPolyList::Element *holeiter, *polyiter, *iter, *iter2;
+ long i, i2, holepointindex, polypointindex;
+ TPPLPoint holepoint, polypoint, bestpolypoint;
+ TPPLPoint linep1, linep2;
+ TPPLPoint v1, v2;
+ TPPLPoly newpoly;
+ bool hasholes;
+ bool pointvisible;
+ bool pointfound;
+
+ // Check for the trivial case of no holes.
+ hasholes = false;
+ for (iter = inpolys->front(); iter; iter = iter->next()) {
+ if (iter->get().IsHole()) {
+ hasholes = true;
+ break;
+ }
+ }
+ if (!hasholes) {
+ for (iter = inpolys->front(); iter; iter = iter->next()) {
+ outpolys->push_back(iter->get());
+ }
+ return 1;
+ }
+
+ polys = *inpolys;
+
+ while (1) {
+ // Find the hole point with the largest x.
+ hasholes = false;
+ for (iter = polys.front(); iter; iter = iter->next()) {
+ if (!iter->get().IsHole()) {
+ continue;
+ }
+
+ if (!hasholes) {
+ hasholes = true;
+ holeiter = iter;
+ holepointindex = 0;
+ }
+
+ for (i = 0; i < iter->get().GetNumPoints(); i++) {
+ if (iter->get().GetPoint(i).x > holeiter->get().GetPoint(holepointindex).x) {
+ holeiter = iter;
+ holepointindex = i;
+ }
+ }
+ }
+ if (!hasholes) {
+ break;
+ }
+ holepoint = holeiter->get().GetPoint(holepointindex);
+
+ pointfound = false;
+ for (iter = polys.front(); iter; iter = iter->next()) {
+ if (iter->get().IsHole()) {
+ continue;
+ }
+ for (i = 0; i < iter->get().GetNumPoints(); i++) {
+ if (iter->get().GetPoint(i).x <= holepoint.x) {
+ continue;
+ }
+ if (!InCone(iter->get().GetPoint((i + iter->get().GetNumPoints() - 1) % (iter->get().GetNumPoints())),
+ iter->get().GetPoint(i),
+ iter->get().GetPoint((i + 1) % (iter->get().GetNumPoints())),
+ holepoint)) {
+ continue;
+ }
+ polypoint = iter->get().GetPoint(i);
+ if (pointfound) {
+ v1 = Normalize(polypoint - holepoint);
+ v2 = Normalize(bestpolypoint - holepoint);
+ if (v2.x > v1.x) {
+ continue;
+ }
+ }
+ pointvisible = true;
+ for (iter2 = polys.front(); iter2; iter2->next()) {
+ if (iter2->get().IsHole()) {
+ continue;
+ }
+ for (i2 = 0; i2 < iter2->get().GetNumPoints(); i2++) {
+ linep1 = iter2->get().GetPoint(i2);
+ linep2 = iter2->get().GetPoint((i2 + 1) % (iter2->get().GetNumPoints()));
+ if (Intersects(holepoint, polypoint, linep1, linep2)) {
+ pointvisible = false;
+ break;
+ }
+ }
+ if (!pointvisible) {
+ break;
+ }
+ }
+ if (pointvisible) {
+ pointfound = true;
+ bestpolypoint = polypoint;
+ polyiter = iter;
+ polypointindex = i;
+ }
+ }
+ }
+
+ if (!pointfound) {
+ return 0;
+ }
+
+ newpoly.Init(holeiter->get().GetNumPoints() + polyiter->get().GetNumPoints() + 2);
+ i2 = 0;
+ for (i = 0; i <= polypointindex; i++) {
+ newpoly[i2] = polyiter->get().GetPoint(i);
+ i2++;
+ }
+ for (i = 0; i <= holeiter->get().GetNumPoints(); i++) {
+ newpoly[i2] = holeiter->get().GetPoint((i + holepointindex) % holeiter->get().GetNumPoints());
+ i2++;
+ }
+ for (i = polypointindex; i < polyiter->get().GetNumPoints(); i++) {
+ newpoly[i2] = polyiter->get().GetPoint(i);
+ i2++;
+ }
+
+ polys.erase(holeiter);
+ polys.erase(polyiter);
+ polys.push_back(newpoly);
+ }
+
+ for (iter = polys.front(); iter; iter = iter->next()) {
+ outpolys->push_back(iter->get());
+ }
+
+ return 1;
+}
+
+bool TPPLPartition::IsConvex(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3) {
+ tppl_float tmp;
+ tmp = (p3.y - p1.y) * (p2.x - p1.x) - (p3.x - p1.x) * (p2.y - p1.y);
+ if (tmp > 0) {
+ return 1;
+ } else {
+ return 0;
+ }
+}
+
+bool TPPLPartition::IsReflex(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3) {
+ tppl_float tmp;
+ tmp = (p3.y - p1.y) * (p2.x - p1.x) - (p3.x - p1.x) * (p2.y - p1.y);
+ if (tmp < 0) {
+ return 1;
+ } else {
+ return 0;
+ }
+}
+
+bool TPPLPartition::IsInside(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3, TPPLPoint &p) {
+ if (IsConvex(p1, p, p2)) {
+ return false;
+ }
+ if (IsConvex(p2, p, p3)) {
+ return false;
+ }
+ if (IsConvex(p3, p, p1)) {
+ return false;
+ }
+ return true;
+}
+
+bool TPPLPartition::InCone(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3, TPPLPoint &p) {
+ bool convex;
+
+ convex = IsConvex(p1, p2, p3);
+
+ if (convex) {
+ if (!IsConvex(p1, p2, p)) {
+ return false;
+ }
+ if (!IsConvex(p2, p3, p)) {
+ return false;
+ }
+ return true;
+ } else {
+ if (IsConvex(p1, p2, p)) {
+ return true;
+ }
+ if (IsConvex(p2, p3, p)) {
+ return true;
+ }
+ return false;
+ }
+}
+
+bool TPPLPartition::InCone(PartitionVertex *v, TPPLPoint &p) {
+ TPPLPoint p1, p2, p3;
+
+ p1 = v->previous->p;
+ p2 = v->p;
+ p3 = v->next->p;
+
+ return InCone(p1, p2, p3, p);
+}
+
+void TPPLPartition::UpdateVertexReflexity(PartitionVertex *v) {
+ PartitionVertex *v1 = NULL, *v3 = NULL;
+ v1 = v->previous;
+ v3 = v->next;
+ v->isConvex = !IsReflex(v1->p, v->p, v3->p);
+}
+
+void TPPLPartition::UpdateVertex(PartitionVertex *v, PartitionVertex *vertices, long numvertices) {
+ long i;
+ PartitionVertex *v1 = NULL, *v3 = NULL;
+ TPPLPoint vec1, vec3;
+
+ v1 = v->previous;
+ v3 = v->next;
+
+ v->isConvex = IsConvex(v1->p, v->p, v3->p);
+
+ vec1 = Normalize(v1->p - v->p);
+ vec3 = Normalize(v3->p - v->p);
+ v->angle = vec1.x * vec3.x + vec1.y * vec3.y;
+
+ if (v->isConvex) {
+ v->isEar = true;
+ for (i = 0; i < numvertices; i++) {
+ if ((vertices[i].p.x == v->p.x) && (vertices[i].p.y == v->p.y)) {
+ continue;
+ }
+ if ((vertices[i].p.x == v1->p.x) && (vertices[i].p.y == v1->p.y)) {
+ continue;
+ }
+ if ((vertices[i].p.x == v3->p.x) && (vertices[i].p.y == v3->p.y)) {
+ continue;
+ }
+ if (IsInside(v1->p, v->p, v3->p, vertices[i].p)) {
+ v->isEar = false;
+ break;
+ }
+ }
+ } else {
+ v->isEar = false;
+ }
+}
+
+// Triangulation by ear removal.
+int TPPLPartition::Triangulate_EC(TPPLPoly *poly, TPPLPolyList *triangles) {
+ if (!poly->Valid()) {
+ return 0;
+ }
+
+ long numvertices;
+ PartitionVertex *vertices = NULL;
+ PartitionVertex *ear = NULL;
+ TPPLPoly triangle;
+ long i, j;
+ bool earfound;
+
+ if (poly->GetNumPoints() < 3) {
+ return 0;
+ }
+ if (poly->GetNumPoints() == 3) {
+ triangles->push_back(*poly);
+ return 1;
+ }
+
+ numvertices = poly->GetNumPoints();
+
+ vertices = new PartitionVertex[numvertices];
+ for (i = 0; i < numvertices; i++) {
+ vertices[i].isActive = true;
+ vertices[i].p = poly->GetPoint(i);
+ if (i == (numvertices - 1)) {
+ vertices[i].next = &(vertices[0]);
+ } else {
+ vertices[i].next = &(vertices[i + 1]);
+ }
+ if (i == 0) {
+ vertices[i].previous = &(vertices[numvertices - 1]);
+ } else {
+ vertices[i].previous = &(vertices[i - 1]);
+ }
+ }
+ for (i = 0; i < numvertices; i++) {
+ UpdateVertex(&vertices[i], vertices, numvertices);
+ }
+
+ for (i = 0; i < numvertices - 3; i++) {
+ earfound = false;
+ // Find the most extruded ear.
+ for (j = 0; j < numvertices; j++) {
+ if (!vertices[j].isActive) {
+ continue;
+ }
+ if (!vertices[j].isEar) {
+ continue;
+ }
+ if (!earfound) {
+ earfound = true;
+ ear = &(vertices[j]);
+ } else {
+ if (vertices[j].angle > ear->angle) {
+ ear = &(vertices[j]);
+ }
+ }
+ }
+ if (!earfound) {
+ delete[] vertices;
+ return 0;
+ }
+
+ triangle.Triangle(ear->previous->p, ear->p, ear->next->p);
+ triangles->push_back(triangle);
+
+ ear->isActive = false;
+ ear->previous->next = ear->next;
+ ear->next->previous = ear->previous;
+
+ if (i == numvertices - 4) {
+ break;
+ }
+
+ UpdateVertex(ear->previous, vertices, numvertices);
+ UpdateVertex(ear->next, vertices, numvertices);
+ }
+ for (i = 0; i < numvertices; i++) {
+ if (vertices[i].isActive) {
+ triangle.Triangle(vertices[i].previous->p, vertices[i].p, vertices[i].next->p);
+ triangles->push_back(triangle);
+ break;
+ }
+ }
+
+ delete[] vertices;
+
+ return 1;
+}
+
+int TPPLPartition::Triangulate_EC(TPPLPolyList *inpolys, TPPLPolyList *triangles) {
+ TPPLPolyList outpolys;
+ TPPLPolyList::Element *iter;
+
+ if (!RemoveHoles(inpolys, &outpolys)) {
+ return 0;
+ }
+ for (iter = outpolys.front(); iter; iter = iter->next()) {
+ if (!Triangulate_EC(&(iter->get()), triangles)) {
+ return 0;
+ }
+ }
+ return 1;
+}
+
+int TPPLPartition::ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts) {
+ if (!poly->Valid()) {
+ return 0;
+ }
+
+ TPPLPolyList triangles;
+ TPPLPolyList::Element *iter1, *iter2;
+ TPPLPoly *poly1 = NULL, *poly2 = NULL;
+ TPPLPoly newpoly;
+ TPPLPoint d1, d2, p1, p2, p3;
+ long i11, i12, i21, i22, i13, i23, j, k;
+ bool isdiagonal;
+ long numreflex;
+
+ // Check if the poly is already convex.
+ numreflex = 0;
+ for (i11 = 0; i11 < poly->GetNumPoints(); i11++) {
+ if (i11 == 0) {
+ i12 = poly->GetNumPoints() - 1;
+ } else {
+ i12 = i11 - 1;
+ }
+ if (i11 == (poly->GetNumPoints() - 1)) {
+ i13 = 0;
+ } else {
+ i13 = i11 + 1;
+ }
+ if (IsReflex(poly->GetPoint(i12), poly->GetPoint(i11), poly->GetPoint(i13))) {
+ numreflex = 1;
+ break;
+ }
+ }
+ if (numreflex == 0) {
+ parts->push_back(*poly);
+ return 1;
+ }
+
+ if (!Triangulate_EC(poly, &triangles)) {
+ return 0;
+ }
+
+ for (iter1 = triangles.front(); iter1; iter1 = iter1->next()) {
+ poly1 = &(iter1->get());
+ for (i11 = 0; i11 < poly1->GetNumPoints(); i11++) {
+ d1 = poly1->GetPoint(i11);
+ i12 = (i11 + 1) % (poly1->GetNumPoints());
+ d2 = poly1->GetPoint(i12);
+
+ isdiagonal = false;
+ for (iter2 = iter1; iter2; iter2 = iter2->next()) {
+ if (iter1 == iter2) {
+ continue;
+ }
+ poly2 = &(iter2->get());
+
+ for (i21 = 0; i21 < poly2->GetNumPoints(); i21++) {
+ if ((d2.x != poly2->GetPoint(i21).x) || (d2.y != poly2->GetPoint(i21).y)) {
+ continue;
+ }
+ i22 = (i21 + 1) % (poly2->GetNumPoints());
+ if ((d1.x != poly2->GetPoint(i22).x) || (d1.y != poly2->GetPoint(i22).y)) {
+ continue;
+ }
+ isdiagonal = true;
+ break;
+ }
+ if (isdiagonal) {
+ break;
+ }
+ }
+
+ if (!isdiagonal) {
+ continue;
+ }
+
+ p2 = poly1->GetPoint(i11);
+ if (i11 == 0) {
+ i13 = poly1->GetNumPoints() - 1;
+ } else {
+ i13 = i11 - 1;
+ }
+ p1 = poly1->GetPoint(i13);
+ if (i22 == (poly2->GetNumPoints() - 1)) {
+ i23 = 0;
+ } else {
+ i23 = i22 + 1;
+ }
+ p3 = poly2->GetPoint(i23);
+
+ if (!IsConvex(p1, p2, p3)) {
+ continue;
+ }
+
+ p2 = poly1->GetPoint(i12);
+ if (i12 == (poly1->GetNumPoints() - 1)) {
+ i13 = 0;
+ } else {
+ i13 = i12 + 1;
+ }
+ p3 = poly1->GetPoint(i13);
+ if (i21 == 0) {
+ i23 = poly2->GetNumPoints() - 1;
+ } else {
+ i23 = i21 - 1;
+ }
+ p1 = poly2->GetPoint(i23);
+
+ if (!IsConvex(p1, p2, p3)) {
+ continue;
+ }
+
+ newpoly.Init(poly1->GetNumPoints() + poly2->GetNumPoints() - 2);
+ k = 0;
+ for (j = i12; j != i11; j = (j + 1) % (poly1->GetNumPoints())) {
+ newpoly[k] = poly1->GetPoint(j);
+ k++;
+ }
+ for (j = i22; j != i21; j = (j + 1) % (poly2->GetNumPoints())) {
+ newpoly[k] = poly2->GetPoint(j);
+ k++;
+ }
+
+ triangles.erase(iter2);
+ iter1->get() = newpoly;
+ poly1 = &(iter1->get());
+ i11 = -1;
+
+ continue;
+ }
+ }
+
+ for (iter1 = triangles.front(); iter1; iter1 = iter1->next()) {
+ parts->push_back(iter1->get());
+ }
+
+ return 1;
+}
+
+int TPPLPartition::ConvexPartition_HM(TPPLPolyList *inpolys, TPPLPolyList *parts) {
+ TPPLPolyList outpolys;
+ TPPLPolyList::Element *iter;
+
+ if (!RemoveHoles(inpolys, &outpolys)) {
+ return 0;
+ }
+ for (iter = outpolys.front(); iter; iter = iter->next()) {
+ if (!ConvexPartition_HM(&(iter->get()), parts)) {
+ return 0;
+ }
+ }
+ return 1;
+}
+
+// Minimum-weight polygon triangulation by dynamic programming.
+// Time complexity: O(n^3)
+// Space complexity: O(n^2)
+int TPPLPartition::Triangulate_OPT(TPPLPoly *poly, TPPLPolyList *triangles) {
+ if (!poly->Valid()) {
+ return 0;
+ }
+
+ long i, j, k, gap, n;
+ DPState **dpstates = NULL;
+ TPPLPoint p1, p2, p3, p4;
+ long bestvertex;
+ tppl_float weight, minweight, d1, d2;
+ Diagonal diagonal, newdiagonal;
+ DiagonalList diagonals;
+ TPPLPoly triangle;
+ int ret = 1;
+
+ n = poly->GetNumPoints();
+ dpstates = new DPState *[n];
+ for (i = 1; i < n; i++) {
+ dpstates[i] = new DPState[i];
+ }
+
+ // Initialize states and visibility.
+ for (i = 0; i < (n - 1); i++) {
+ p1 = poly->GetPoint(i);
+ for (j = i + 1; j < n; j++) {
+ dpstates[j][i].visible = true;
+ dpstates[j][i].weight = 0;
+ dpstates[j][i].bestvertex = -1;
+ if (j != (i + 1)) {
+ p2 = poly->GetPoint(j);
+
+ // Visibility check.
+ if (i == 0) {
+ p3 = poly->GetPoint(n - 1);
+ } else {
+ p3 = poly->GetPoint(i - 1);
+ }
+ if (i == (n - 1)) {
+ p4 = poly->GetPoint(0);
+ } else {
+ p4 = poly->GetPoint(i + 1);
+ }
+ if (!InCone(p3, p1, p4, p2)) {
+ dpstates[j][i].visible = false;
+ continue;
+ }
+
+ if (j == 0) {
+ p3 = poly->GetPoint(n - 1);
+ } else {
+ p3 = poly->GetPoint(j - 1);
+ }
+ if (j == (n - 1)) {
+ p4 = poly->GetPoint(0);
+ } else {
+ p4 = poly->GetPoint(j + 1);
+ }
+ if (!InCone(p3, p2, p4, p1)) {
+ dpstates[j][i].visible = false;
+ continue;
+ }
+
+ for (k = 0; k < n; k++) {
+ p3 = poly->GetPoint(k);
+ if (k == (n - 1)) {
+ p4 = poly->GetPoint(0);
+ } else {
+ p4 = poly->GetPoint(k + 1);
+ }
+ if (Intersects(p1, p2, p3, p4)) {
+ dpstates[j][i].visible = false;
+ break;
+ }
+ }
+ }
+ }
+ }
+ dpstates[n - 1][0].visible = true;
+ dpstates[n - 1][0].weight = 0;
+ dpstates[n - 1][0].bestvertex = -1;
+
+ for (gap = 2; gap < n; gap++) {
+ for (i = 0; i < (n - gap); i++) {
+ j = i + gap;
+ if (!dpstates[j][i].visible) {
+ continue;
+ }
+ bestvertex = -1;
+ for (k = (i + 1); k < j; k++) {
+ if (!dpstates[k][i].visible) {
+ continue;
+ }
+ if (!dpstates[j][k].visible) {
+ continue;
+ }
+
+ if (k <= (i + 1)) {
+ d1 = 0;
+ } else {
+ d1 = Distance(poly->GetPoint(i), poly->GetPoint(k));
+ }
+ if (j <= (k + 1)) {
+ d2 = 0;
+ } else {
+ d2 = Distance(poly->GetPoint(k), poly->GetPoint(j));
+ }
+
+ weight = dpstates[k][i].weight + dpstates[j][k].weight + d1 + d2;
+
+ if ((bestvertex == -1) || (weight < minweight)) {
+ bestvertex = k;
+ minweight = weight;
+ }
+ }
+ if (bestvertex == -1) {
+ for (i = 1; i < n; i++) {
+ delete[] dpstates[i];
+ }
+ delete[] dpstates;
+
+ return 0;
+ }
+
+ dpstates[j][i].bestvertex = bestvertex;
+ dpstates[j][i].weight = minweight;
+ }
+ }
+
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_back(newdiagonal);
+ while (!diagonals.is_empty()) {
+ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ bestvertex = dpstates[diagonal.index2][diagonal.index1].bestvertex;
+ if (bestvertex == -1) {
+ ret = 0;
+ break;
+ }
+ triangle.Triangle(poly->GetPoint(diagonal.index1), poly->GetPoint(bestvertex), poly->GetPoint(diagonal.index2));
+ triangles->push_back(triangle);
+ if (bestvertex > (diagonal.index1 + 1)) {
+ newdiagonal.index1 = diagonal.index1;
+ newdiagonal.index2 = bestvertex;
+ diagonals.push_back(newdiagonal);
+ }
+ if (diagonal.index2 > (bestvertex + 1)) {
+ newdiagonal.index1 = bestvertex;
+ newdiagonal.index2 = diagonal.index2;
+ diagonals.push_back(newdiagonal);
+ }
+ }
+
+ for (i = 1; i < n; i++) {
+ delete[] dpstates[i];
+ }
+ delete[] dpstates;
+
+ return ret;
+}
+
+void TPPLPartition::UpdateState(long a, long b, long w, long i, long j, DPState2 **dpstates) {
+ Diagonal newdiagonal;
+ DiagonalList *pairs = NULL;
+ long w2;
+
+ w2 = dpstates[a][b].weight;
+ if (w > w2) {
+ return;
+ }
+
+ pairs = &(dpstates[a][b].pairs);
+ newdiagonal.index1 = i;
+ newdiagonal.index2 = j;
+
+ if (w < w2) {
+ pairs->clear();
+ pairs->push_front(newdiagonal);
+ dpstates[a][b].weight = w;
+ } else {
+ if ((!pairs->is_empty()) && (i <= pairs->front()->get().index1)) {
+ return;
+ }
+ while ((!pairs->is_empty()) && (pairs->front()->get().index2 >= j)) {
+ pairs->pop_front();
+ }
+ pairs->push_front(newdiagonal);
+ }
+}
+
+void TPPLPartition::TypeA(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
+ DiagonalList *pairs = NULL;
+ DiagonalList::Element *iter, *lastiter;
+ long top;
+ long w;
+
+ if (!dpstates[i][j].visible) {
+ return;
+ }
+ top = j;
+ w = dpstates[i][j].weight;
+ if (k - j > 1) {
+ if (!dpstates[j][k].visible) {
+ return;
+ }
+ w += dpstates[j][k].weight + 1;
+ }
+ if (j - i > 1) {
+ pairs = &(dpstates[i][j].pairs);
+ iter = pairs->back();
+ lastiter = pairs->back();
+ while (iter != pairs->front()) {
+ iter--;
+ if (!IsReflex(vertices[iter->get().index2].p, vertices[j].p, vertices[k].p)) {
+ lastiter = iter;
+ } else {
+ break;
+ }
+ }
+ if (lastiter == pairs->back()) {
+ w++;
+ } else {
+ if (IsReflex(vertices[k].p, vertices[i].p, vertices[lastiter->get().index1].p)) {
+ w++;
+ } else {
+ top = lastiter->get().index1;
+ }
+ }
+ }
+ UpdateState(i, k, w, top, j, dpstates);
+}
+
+void TPPLPartition::TypeB(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
+ DiagonalList *pairs = NULL;
+ DiagonalList::Element *iter, *lastiter;
+ long top;
+ long w;
+
+ if (!dpstates[j][k].visible) {
+ return;
+ }
+ top = j;
+ w = dpstates[j][k].weight;
+
+ if (j - i > 1) {
+ if (!dpstates[i][j].visible) {
+ return;
+ }
+ w += dpstates[i][j].weight + 1;
+ }
+ if (k - j > 1) {
+ pairs = &(dpstates[j][k].pairs);
+
+ iter = pairs->front();
+ if ((!pairs->is_empty()) && (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->get().index1].p))) {
+ lastiter = iter;
+ while (iter) {
+ if (!IsReflex(vertices[i].p, vertices[j].p, vertices[iter->get().index1].p)) {
+ lastiter = iter;
+ iter = iter->next();
+ } else {
+ break;
+ }
+ }
+ if (IsReflex(vertices[lastiter->get().index2].p, vertices[k].p, vertices[i].p)) {
+ w++;
+ } else {
+ top = lastiter->get().index2;
+ }
+ } else {
+ w++;
+ }
+ }
+ UpdateState(i, k, w, j, top, dpstates);
+}
+
+int TPPLPartition::ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts) {
+ if (!poly->Valid()) {
+ return 0;
+ }
+
+ TPPLPoint p1, p2, p3, p4;
+ PartitionVertex *vertices = NULL;
+ DPState2 **dpstates = NULL;
+ long i, j, k, n, gap;
+ DiagonalList diagonals, diagonals2;
+ Diagonal diagonal, newdiagonal;
+ DiagonalList *pairs = NULL, *pairs2 = NULL;
+ DiagonalList::Element *iter, *iter2;
+ int ret;
+ TPPLPoly newpoly;
+ List<long> indices;
+ List<long>::Element *iiter;
+ bool ijreal, jkreal;
+
+ n = poly->GetNumPoints();
+ vertices = new PartitionVertex[n];
+
+ dpstates = new DPState2 *[n];
+ for (i = 0; i < n; i++) {
+ dpstates[i] = new DPState2[n];
+ }
+
+ // Initialize vertex information.
+ for (i = 0; i < n; i++) {
+ vertices[i].p = poly->GetPoint(i);
+ vertices[i].isActive = true;
+ if (i == 0) {
+ vertices[i].previous = &(vertices[n - 1]);
+ } else {
+ vertices[i].previous = &(vertices[i - 1]);
+ }
+ if (i == (poly->GetNumPoints() - 1)) {
+ vertices[i].next = &(vertices[0]);
+ } else {
+ vertices[i].next = &(vertices[i + 1]);
+ }
+ }
+ for (i = 1; i < n; i++) {
+ UpdateVertexReflexity(&(vertices[i]));
+ }
+
+ // Initialize states and visibility.
+ for (i = 0; i < (n - 1); i++) {
+ p1 = poly->GetPoint(i);
+ for (j = i + 1; j < n; j++) {
+ dpstates[i][j].visible = true;
+ if (j == i + 1) {
+ dpstates[i][j].weight = 0;
+ } else {
+ dpstates[i][j].weight = 2147483647;
+ }
+ if (j != (i + 1)) {
+ p2 = poly->GetPoint(j);
+
+ // Visibility check.
+ if (!InCone(&vertices[i], p2)) {
+ dpstates[i][j].visible = false;
+ continue;
+ }
+ if (!InCone(&vertices[j], p1)) {
+ dpstates[i][j].visible = false;
+ continue;
+ }
+
+ for (k = 0; k < n; k++) {
+ p3 = poly->GetPoint(k);
+ if (k == (n - 1)) {
+ p4 = poly->GetPoint(0);
+ } else {
+ p4 = poly->GetPoint(k + 1);
+ }
+ if (Intersects(p1, p2, p3, p4)) {
+ dpstates[i][j].visible = false;
+ break;
+ }
+ }
+ }
+ }
+ }
+ for (i = 0; i < (n - 2); i++) {
+ j = i + 2;
+ if (dpstates[i][j].visible) {
+ dpstates[i][j].weight = 0;
+ newdiagonal.index1 = i + 1;
+ newdiagonal.index2 = i + 1;
+ dpstates[i][j].pairs.push_back(newdiagonal);
+ }
+ }
+
+ dpstates[0][n - 1].visible = true;
+ vertices[0].isConvex = false; // By convention.
+
+ for (gap = 3; gap < n; gap++) {
+ for (i = 0; i < n - gap; i++) {
+ if (vertices[i].isConvex) {
+ continue;
+ }
+ k = i + gap;
+ if (dpstates[i][k].visible) {
+ if (!vertices[k].isConvex) {
+ for (j = i + 1; j < k; j++) {
+ TypeA(i, j, k, vertices, dpstates);
+ }
+ } else {
+ for (j = i + 1; j < (k - 1); j++) {
+ if (vertices[j].isConvex) {
+ continue;
+ }
+ TypeA(i, j, k, vertices, dpstates);
+ }
+ TypeA(i, k - 1, k, vertices, dpstates);
+ }
+ }
+ }
+ for (k = gap; k < n; k++) {
+ if (vertices[k].isConvex) {
+ continue;
+ }
+ i = k - gap;
+ if ((vertices[i].isConvex) && (dpstates[i][k].visible)) {
+ TypeB(i, i + 1, k, vertices, dpstates);
+ for (j = i + 2; j < k; j++) {
+ if (vertices[j].isConvex) {
+ continue;
+ }
+ TypeB(i, j, k, vertices, dpstates);
+ }
+ }
+ }
+ }
+
+ // Recover solution.
+ ret = 1;
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_front(newdiagonal);
+ while (!diagonals.is_empty()) {
+ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+ }
+ pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
+ if (pairs->is_empty()) {
+ ret = 0;
+ break;
+ }
+ if (!vertices[diagonal.index1].isConvex) {
+ iter = pairs->back();
+ iter--;
+ j = iter->get().index2;
+ newdiagonal.index1 = j;
+ newdiagonal.index2 = diagonal.index2;
+ diagonals.push_front(newdiagonal);
+ if ((j - diagonal.index1) > 1) {
+ if (iter->get().index1 != iter->get().index2) {
+ pairs2 = &(dpstates[diagonal.index1][j].pairs);
+ while (1) {
+ if (pairs2->is_empty()) {
+ ret = 0;
+ break;
+ }
+ iter2 = pairs2->back();
+ iter2--;
+ if (iter->get().index1 != iter2->get().index1) {
+ pairs2->pop_back();
+ } else {
+ break;
+ }
+ }
+ if (ret == 0) {
+ break;
+ }
+ }
+ newdiagonal.index1 = diagonal.index1;
+ newdiagonal.index2 = j;
+ diagonals.push_front(newdiagonal);
+ }
+ } else {
+ iter = pairs->front();
+ j = iter->get().index1;
+ newdiagonal.index1 = diagonal.index1;
+ newdiagonal.index2 = j;
+ diagonals.push_front(newdiagonal);
+ if ((diagonal.index2 - j) > 1) {
+ if (iter->get().index1 != iter->get().index2) {
+ pairs2 = &(dpstates[j][diagonal.index2].pairs);
+ while (1) {
+ if (pairs2->is_empty()) {
+ ret = 0;
+ break;
+ }
+ iter2 = pairs2->front();
+ if (iter->get().index2 != iter2->get().index2) {
+ pairs2->pop_front();
+ } else {
+ break;
+ }
+ }
+ if (ret == 0) {
+ break;
+ }
+ }
+ newdiagonal.index1 = j;
+ newdiagonal.index2 = diagonal.index2;
+ diagonals.push_front(newdiagonal);
+ }
+ }
+ }
+
+ if (ret == 0) {
+ for (i = 0; i < n; i++) {
+ delete[] dpstates[i];
+ }
+ delete[] dpstates;
+ delete[] vertices;
+
+ return ret;
+ }
+
+ newdiagonal.index1 = 0;
+ newdiagonal.index2 = n - 1;
+ diagonals.push_front(newdiagonal);
+ while (!diagonals.is_empty()) {
+ diagonal = diagonals.front()->get();
+ diagonals.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+ }
+
+ indices.clear();
+ diagonals2.clear();
+ indices.push_back(diagonal.index1);
+ indices.push_back(diagonal.index2);
+ diagonals2.push_front(diagonal);
+
+ while (!diagonals2.is_empty()) {
+ diagonal = diagonals2.front()->get();
+ diagonals2.pop_front();
+ if ((diagonal.index2 - diagonal.index1) <= 1) {
+ continue;
+ }
+ ijreal = true;
+ jkreal = true;
+ pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
+ if (!vertices[diagonal.index1].isConvex) {
+ iter = pairs->back();
+ iter--;
+ j = iter->get().index2;
+ if (iter->get().index1 != iter->get().index2) {
+ ijreal = false;
+ }
+ } else {
+ iter = pairs->front();
+ j = iter->get().index1;
+ if (iter->get().index1 != iter->get().index2) {
+ jkreal = false;
+ }
+ }
+
+ newdiagonal.index1 = diagonal.index1;
+ newdiagonal.index2 = j;
+ if (ijreal) {
+ diagonals.push_back(newdiagonal);
+ } else {
+ diagonals2.push_back(newdiagonal);
+ }
+
+ newdiagonal.index1 = j;
+ newdiagonal.index2 = diagonal.index2;
+ if (jkreal) {
+ diagonals.push_back(newdiagonal);
+ } else {
+ diagonals2.push_back(newdiagonal);
+ }
+
+ indices.push_back(j);
+ }
+
+ //std::sort(indices.begin(), indices.end());
+ indices.sort();
+ newpoly.Init((long)indices.size());
+ k = 0;
+ for (iiter = indices.front(); iiter != indices.back(); iiter = iiter->next()) {
+ newpoly[k] = vertices[iiter->get()].p;
+ k++;
+ }
+ parts->push_back(newpoly);
+ }
+
+ for (i = 0; i < n; i++) {
+ delete[] dpstates[i];
+ }
+ delete[] dpstates;
+ delete[] vertices;
+
+ return ret;
+}
+
+// Creates a monotone partition of a list of polygons that
+// can contain holes. Triangulates a set of polygons by
+// first partitioning them into monotone polygons.
+// Time complexity: O(n*log(n)), n is the number of vertices.
+// Space complexity: O(n)
+// The algorithm used here is outlined in the book
+// "Computational Geometry: Algorithms and Applications"
+// by Mark de Berg, Otfried Cheong, Marc van Kreveld, and Mark Overmars.
+int TPPLPartition::MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monotonePolys) {
+ TPPLPolyList::Element *iter;
+ MonotoneVertex *vertices = NULL;
+ long i, numvertices, vindex, vindex2, newnumvertices, maxnumvertices;
+ long polystartindex, polyendindex;
+ TPPLPoly *poly = NULL;
+ MonotoneVertex *v = NULL, *v2 = NULL, *vprev = NULL, *vnext = NULL;
+ ScanLineEdge newedge;
+ bool error = false;
+
+ numvertices = 0;
+ for (iter = inpolys->front(); iter; iter++) {
+ numvertices += iter->get().GetNumPoints();
+ }
+
+ maxnumvertices = numvertices * 3;
+ vertices = new MonotoneVertex[maxnumvertices];
+ newnumvertices = numvertices;
+
+ polystartindex = 0;
+ for (iter = inpolys->front(); iter; iter++) {
+ poly = &(iter->get());
+ polyendindex = polystartindex + poly->GetNumPoints() - 1;
+ for (i = 0; i < poly->GetNumPoints(); i++) {
+ vertices[i + polystartindex].p = poly->GetPoint(i);
+ if (i == 0) {
+ vertices[i + polystartindex].previous = polyendindex;
+ } else {
+ vertices[i + polystartindex].previous = i + polystartindex - 1;
+ }
+ if (i == (poly->GetNumPoints() - 1)) {
+ vertices[i + polystartindex].next = polystartindex;
+ } else {
+ vertices[i + polystartindex].next = i + polystartindex + 1;
+ }
+ }
+ polystartindex = polyendindex + 1;
+ }
+
+ // Construct the priority queue.
+ long *priority = new long[numvertices];
+ for (i = 0; i < numvertices; i++) {
+ priority[i] = i;
+ }
+ std::sort(priority, &(priority[numvertices]), VertexSorter(vertices));
+
+ // Determine vertex types.
+ TPPLVertexType *vertextypes = new TPPLVertexType[maxnumvertices];
+ for (i = 0; i < numvertices; i++) {
+ v = &(vertices[i]);
+ vprev = &(vertices[v->previous]);
+ vnext = &(vertices[v->next]);
+
+ if (Below(vprev->p, v->p) && Below(vnext->p, v->p)) {
+ if (IsConvex(vnext->p, vprev->p, v->p)) {
+ vertextypes[i] = TPPL_VERTEXTYPE_START;
+ } else {
+ vertextypes[i] = TPPL_VERTEXTYPE_SPLIT;
+ }
+ } else if (Below(v->p, vprev->p) && Below(v->p, vnext->p)) {
+ if (IsConvex(vnext->p, vprev->p, v->p)) {
+ vertextypes[i] = TPPL_VERTEXTYPE_END;
+ } else {
+ vertextypes[i] = TPPL_VERTEXTYPE_MERGE;
+ }
+ } else {
+ vertextypes[i] = TPPL_VERTEXTYPE_REGULAR;
+ }
+ }
+
+ // Helpers.
+ long *helpers = new long[maxnumvertices];
+
+ // Binary search tree that holds edges intersecting the scanline.
+ // Note that while set doesn't actually have to be implemented as
+ // a tree, complexity requirements for operations are the same as
+ // for the balanced binary search tree.
+ Set<ScanLineEdge> edgeTree;
+ // Store iterators to the edge tree elements.
+ // This makes deleting existing edges much faster.
+ Set<ScanLineEdge>::Element **edgeTreeIterators, *edgeIter;
+ edgeTreeIterators = new Set<ScanLineEdge>::Element *[maxnumvertices];
+ //Pair<Set<ScanLineEdge>::iterator, bool> edgeTreeRet;
+ for (i = 0; i < numvertices; i++) {
+ edgeTreeIterators[i] = nullptr;
+ }
+
+ // For each vertex.
+ for (i = 0; i < numvertices; i++) {
+ vindex = priority[i];
+ v = &(vertices[vindex]);
+ vindex2 = vindex;
+ v2 = v;
+
+ // Depending on the vertex type, do the appropriate action.
+ // Comments in the following sections are copied from
+ // "Computational Geometry: Algorithms and Applications".
+ // Notation: e_i = e subscript i, v_i = v subscript i, etc.
+ switch (vertextypes[vindex]) {
+ case TPPL_VERTEXTYPE_START:
+ // Insert e_i in T and set helper(e_i) to v_i.
+ newedge.p1 = v->p;
+ newedge.p2 = vertices[v->next].p;
+ newedge.index = vindex;
+ //edgeTreeRet = edgeTree.insert(newedge);
+ //edgeTreeIterators[vindex] = edgeTreeRet.first;
+ edgeTreeIterators[vindex] = edgeTree.insert(newedge);
+ helpers[vindex] = vindex;
+ break;
+
+ case TPPL_VERTEXTYPE_END:
+ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+ // If helper(e_i - 1) is a merge vertex
+ if (vertextypes[helpers[v->previous]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting vi to helper(e_i - 1) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex, helpers[v->previous],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ }
+ // Delete e_i - 1 from T
+ edgeTree.erase(edgeTreeIterators[v->previous]);
+ break;
+
+ case TPPL_VERTEXTYPE_SPLIT:
+ // Search in T to find the edge e_j directly left of v_i.
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+ edgeIter--;
+ // Insert the diagonal connecting vi to helper(e_j) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ vindex2 = newnumvertices - 2;
+ v2 = &(vertices[vindex2]);
+ // helper(e_j) in v_i.
+ helpers[edgeIter->get().index] = vindex;
+ // Insert e_i in T and set helper(e_i) to v_i.
+ newedge.p1 = v2->p;
+ newedge.p2 = vertices[v2->next].p;
+ newedge.index = vindex2;
+ //edgeTreeRet = edgeTree.insert(newedge);
+ //edgeTreeIterators[vindex2] = edgeTreeRet.first;
+ edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
+ helpers[vindex2] = vindex2;
+ break;
+
+ case TPPL_VERTEXTYPE_MERGE:
+ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+ // if helper(e_i - 1) is a merge vertex
+ if (vertextypes[helpers[v->previous]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting vi to helper(e_i - 1) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex, helpers[v->previous],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ vindex2 = newnumvertices - 2;
+ v2 = &(vertices[vindex2]);
+ }
+ // Delete e_i - 1 from T.
+ edgeTree.erase(edgeTreeIterators[v->previous]);
+ // Search in T to find the edge e_j directly left of v_i.
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+ edgeIter--;
+ // If helper(e_j) is a merge vertex.
+ if (vertextypes[helpers[edgeIter->get().index]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting v_i to helper(e_j) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex2, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ }
+ // helper(e_j) <- v_i
+ helpers[edgeIter->get().index] = vindex2;
+ break;
+
+ case TPPL_VERTEXTYPE_REGULAR:
+ // If the interior of P lies to the right of v_i.
+ if (Below(v->p, vertices[v->previous].p)) {
+ if (edgeTreeIterators[v->previous] == edgeTree.back()) {
+ error = true;
+ break;
+ }
+ // If helper(e_i - 1) is a merge vertex.
+ if (vertextypes[helpers[v->previous]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting v_i to helper(e_i - 1) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex, helpers[v->previous],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ vindex2 = newnumvertices - 2;
+ v2 = &(vertices[vindex2]);
+ }
+ // Delete e_i - 1 from T.
+ edgeTree.erase(edgeTreeIterators[v->previous]);
+ // Insert e_i in T and set helper(e_i) to v_i.
+ newedge.p1 = v2->p;
+ newedge.p2 = vertices[v2->next].p;
+ newedge.index = vindex2;
+ //edgeTreeRet = edgeTree.insert(newedge);
+ //edgeTreeIterators[vindex2] = edgeTreeRet.first;
+ edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
+ helpers[vindex2] = vindex;
+ } else {
+ // Search in T to find the edge e_j directly left of v_i.
+ newedge.p1 = v->p;
+ newedge.p2 = v->p;
+ edgeIter = edgeTree.lower_bound(newedge);
+ if (edgeIter == edgeTree.front()) {
+ error = true;
+ break;
+ }
+ edgeIter = edgeIter->prev();
+ // If helper(e_j) is a merge vertex.
+ if (vertextypes[helpers[edgeIter->get().index]] == TPPL_VERTEXTYPE_MERGE) {
+ // Insert the diagonal connecting v_i to helper(e_j) in D.
+ AddDiagonal(vertices, &newnumvertices, vindex, helpers[edgeIter->get().index],
+ vertextypes, edgeTreeIterators, &edgeTree, helpers);
+ }
+ // helper(e_j) <- v_i.
+ helpers[edgeIter->get().index] = vindex;
+ }
+ break;
+ }
+
+ if (error)
+ break;
+ }
+
+ char *used = new char[newnumvertices];
+ memset(used, 0, newnumvertices * sizeof(char));
+
+ if (!error) {
+ // Return result.
+ long size;
+ TPPLPoly mpoly;
+ for (i = 0; i < newnumvertices; i++) {
+ if (used[i]) {
+ continue;
+ }
+ v = &(vertices[i]);
+ vnext = &(vertices[v->next]);
+ size = 1;
+ while (vnext != v) {
+ vnext = &(vertices[vnext->next]);
+ size++;
+ }
+ mpoly.Init(size);
+ v = &(vertices[i]);
+ mpoly[0] = v->p;
+ vnext = &(vertices[v->next]);
+ size = 1;
+ used[i] = 1;
+ used[v->next] = 1;
+ while (vnext != v) {
+ mpoly[size] = vnext->p;
+ used[vnext->next] = 1;
+ vnext = &(vertices[vnext->next]);
+ size++;
+ }
+ monotonePolys->push_back(mpoly);
+ }
+ }
+
+ // Cleanup.
+ delete[] vertices;
+ delete[] priority;
+ delete[] vertextypes;
+ delete[] edgeTreeIterators;
+ delete[] helpers;
+ delete[] used;
+
+ if (error) {
+ return 0;
+ } else {
+ return 1;
+ }
+}
+
+// Adds a diagonal to the doubly-connected list of vertices.
+void TPPLPartition::AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
+ TPPLVertexType *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
+ Set<ScanLineEdge> *edgeTree, long *helpers) {
+ long newindex1, newindex2;
+
+ newindex1 = *numvertices;
+ (*numvertices)++;
+ newindex2 = *numvertices;
+ (*numvertices)++;
+
+ vertices[newindex1].p = vertices[index1].p;
+ vertices[newindex2].p = vertices[index2].p;
+
+ vertices[newindex2].next = vertices[index2].next;
+ vertices[newindex1].next = vertices[index1].next;
+
+ vertices[vertices[index2].next].previous = newindex2;
+ vertices[vertices[index1].next].previous = newindex1;
+
+ vertices[index1].next = newindex2;
+ vertices[newindex2].previous = index1;
+
+ vertices[index2].next = newindex1;
+ vertices[newindex1].previous = index2;
+
+ // Update all relevant structures.
+ vertextypes[newindex1] = vertextypes[index1];
+ edgeTreeIterators[newindex1] = edgeTreeIterators[index1];
+ helpers[newindex1] = helpers[index1];
+ if (edgeTreeIterators[newindex1] != edgeTree->back()) {
+ edgeTreeIterators[newindex1]->get().index = newindex1;
+ }
+ vertextypes[newindex2] = vertextypes[index2];
+ edgeTreeIterators[newindex2] = edgeTreeIterators[index2];
+ helpers[newindex2] = helpers[index2];
+ if (edgeTreeIterators[newindex2] != edgeTree->back()) {
+ edgeTreeIterators[newindex2]->get().index = newindex2;
+ }
+}
+
+bool TPPLPartition::Below(TPPLPoint &p1, TPPLPoint &p2) {
+ if (p1.y < p2.y) {
+ return true;
+ } else if (p1.y == p2.y) {
+ if (p1.x < p2.x) {
+ return true;
+ }
+ }
+ return false;
+}
+
+// Sorts in the falling order of y values, if y is equal, x is used instead.
+bool TPPLPartition::VertexSorter::operator()(long index1, long index2) {
+ if (vertices[index1].p.y > vertices[index2].p.y) {
+ return true;
+ } else if (vertices[index1].p.y == vertices[index2].p.y) {
+ if (vertices[index1].p.x > vertices[index2].p.x) {
+ return true;
+ }
+ }
+ return false;
+}
+
+bool TPPLPartition::ScanLineEdge::IsConvex(const TPPLPoint &p1, const TPPLPoint &p2, const TPPLPoint &p3) const {
+ tppl_float tmp;
+ tmp = (p3.y - p1.y) * (p2.x - p1.x) - (p3.x - p1.x) * (p2.y - p1.y);
+ if (tmp > 0) {
+ return 1;
+ }
+
+ return 0;
+}
+
+bool TPPLPartition::ScanLineEdge::operator<(const ScanLineEdge &other) const {
+ if (other.p1.y == other.p2.y) {
+ if (p1.y == p2.y) {
+ return (p1.y < other.p1.y);
+ }
+ return IsConvex(p1, p2, other.p1);
+ } else if (p1.y == p2.y) {
+ return !IsConvex(other.p1, other.p2, p1);
+ } else if (p1.y < other.p1.y) {
+ return !IsConvex(other.p1, other.p2, p1);
+ } else {
+ return IsConvex(p1, p2, other.p1);
+ }
+}
+
+// Triangulates monotone polygon.
+// Time complexity: O(n)
+// Space complexity: O(n)
+int TPPLPartition::TriangulateMonotone(TPPLPoly *inPoly, TPPLPolyList *triangles) {
+ if (!inPoly->Valid()) {
+ return 0;
+ }
+
+ long i, i2, j, topindex, bottomindex, leftindex, rightindex, vindex;
+ TPPLPoint *points = NULL;
+ long numpoints;
+ TPPLPoly triangle;
+
+ numpoints = inPoly->GetNumPoints();
+ points = inPoly->GetPoints();
+
+ // Trivial case.
+ if (numpoints == 3) {
+ triangles->push_back(*inPoly);
+ return 1;
+ }
+
+ topindex = 0;
+ bottomindex = 0;
+ for (i = 1; i < numpoints; i++) {
+ if (Below(points[i], points[bottomindex])) {
+ bottomindex = i;
+ }
+ if (Below(points[topindex], points[i])) {
+ topindex = i;
+ }
+ }
+
+ // Check if the poly is really monotone.
+ i = topindex;
+ while (i != bottomindex) {
+ i2 = i + 1;
+ if (i2 >= numpoints) {
+ i2 = 0;
+ }
+ if (!Below(points[i2], points[i])) {
+ return 0;
+ }
+ i = i2;
+ }
+ i = bottomindex;
+ while (i != topindex) {
+ i2 = i + 1;
+ if (i2 >= numpoints) {
+ i2 = 0;
+ }
+ if (!Below(points[i], points[i2])) {
+ return 0;
+ }
+ i = i2;
+ }
+
+ char *vertextypes = new char[numpoints];
+ long *priority = new long[numpoints];
+
+ // Merge left and right vertex chains.
+ priority[0] = topindex;
+ vertextypes[topindex] = 0;
+ leftindex = topindex + 1;
+ if (leftindex >= numpoints) {
+ leftindex = 0;
+ }
+ rightindex = topindex - 1;
+ if (rightindex < 0) {
+ rightindex = numpoints - 1;
+ }
+ for (i = 1; i < (numpoints - 1); i++) {
+ if (leftindex == bottomindex) {
+ priority[i] = rightindex;
+ rightindex--;
+ if (rightindex < 0) {
+ rightindex = numpoints - 1;
+ }
+ vertextypes[priority[i]] = -1;
+ } else if (rightindex == bottomindex) {
+ priority[i] = leftindex;
+ leftindex++;
+ if (leftindex >= numpoints) {
+ leftindex = 0;
+ }
+ vertextypes[priority[i]] = 1;
+ } else {
+ if (Below(points[leftindex], points[rightindex])) {
+ priority[i] = rightindex;
+ rightindex--;
+ if (rightindex < 0) {
+ rightindex = numpoints - 1;
+ }
+ vertextypes[priority[i]] = -1;
+ } else {
+ priority[i] = leftindex;
+ leftindex++;
+ if (leftindex >= numpoints) {
+ leftindex = 0;
+ }
+ vertextypes[priority[i]] = 1;
+ }
+ }
+ }
+ priority[i] = bottomindex;
+ vertextypes[bottomindex] = 0;
+
+ long *stack = new long[numpoints];
+ long stackptr = 0;
+
+ stack[0] = priority[0];
+ stack[1] = priority[1];
+ stackptr = 2;
+
+ // For each vertex from top to bottom trim as many triangles as possible.
+ for (i = 2; i < (numpoints - 1); i++) {
+ vindex = priority[i];
+ if (vertextypes[vindex] != vertextypes[stack[stackptr - 1]]) {
+ for (j = 0; j < (stackptr - 1); j++) {
+ if (vertextypes[vindex] == 1) {
+ triangle.Triangle(points[stack[j + 1]], points[stack[j]], points[vindex]);
+ } else {
+ triangle.Triangle(points[stack[j]], points[stack[j + 1]], points[vindex]);
+ }
+ triangles->push_back(triangle);
+ }
+ stack[0] = priority[i - 1];
+ stack[1] = priority[i];
+ stackptr = 2;
+ } else {
+ stackptr--;
+ while (stackptr > 0) {
+ if (vertextypes[vindex] == 1) {
+ if (IsConvex(points[vindex], points[stack[stackptr - 1]], points[stack[stackptr]])) {
+ triangle.Triangle(points[vindex], points[stack[stackptr - 1]], points[stack[stackptr]]);
+ triangles->push_back(triangle);
+ stackptr--;
+ } else {
+ break;
+ }
+ } else {
+ if (IsConvex(points[vindex], points[stack[stackptr]], points[stack[stackptr - 1]])) {
+ triangle.Triangle(points[vindex], points[stack[stackptr]], points[stack[stackptr - 1]]);
+ triangles->push_back(triangle);
+ stackptr--;
+ } else {
+ break;
+ }
+ }
+ }
+ stackptr++;
+ stack[stackptr] = vindex;
+ stackptr++;
+ }
+ }
+ vindex = priority[i];
+ for (j = 0; j < (stackptr - 1); j++) {
+ if (vertextypes[stack[j + 1]] == 1) {
+ triangle.Triangle(points[stack[j]], points[stack[j + 1]], points[vindex]);
+ } else {
+ triangle.Triangle(points[stack[j + 1]], points[stack[j]], points[vindex]);
+ }
+ triangles->push_back(triangle);
+ }
+
+ delete[] priority;
+ delete[] vertextypes;
+ delete[] stack;
+
+ return 1;
+}
+
+int TPPLPartition::Triangulate_MONO(TPPLPolyList *inpolys, TPPLPolyList *triangles) {
+ TPPLPolyList monotone;
+ TPPLPolyList::Element *iter;
+
+ if (!MonotonePartition(inpolys, &monotone)) {
+ return 0;
+ }
+ for (iter = monotone.front(); iter; iter = iter->next()) {
+ if (!TriangulateMonotone(&(iter->get()), triangles)) {
+ return 0;
+ }
+ }
+ return 1;
+}
+
+int TPPLPartition::Triangulate_MONO(TPPLPoly *poly, TPPLPolyList *triangles) {
+ TPPLPolyList polys;
+ polys.push_back(*poly);
+
+ return Triangulate_MONO(&polys, triangles);
+}
diff --git a/thirdparty/misc/polypartition.h b/thirdparty/misc/polypartition.h
new file mode 100644
index 0000000000..b2d905a3ef
--- /dev/null
+++ b/thirdparty/misc/polypartition.h
@@ -0,0 +1,378 @@
+/*************************************************************************/
+/* Copyright (c) 2011-2021 Ivan Fratric and contributors. */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef POLYPARTITION_H
+#define POLYPARTITION_H
+
+#include "core/math/vector2.h"
+#include "core/templates/list.h"
+#include "core/templates/set.h"
+
+typedef double tppl_float;
+
+enum TPPLOrientation {
+ TPPL_ORIENTATION_CW = -1,
+ TPPL_ORIENTATION_NONE = 0,
+ TPPL_ORIENTATION_CCW = 1,
+};
+
+enum TPPLVertexType {
+ TPPL_VERTEXTYPE_REGULAR = 0,
+ TPPL_VERTEXTYPE_START = 1,
+ TPPL_VERTEXTYPE_END = 2,
+ TPPL_VERTEXTYPE_SPLIT = 3,
+ TPPL_VERTEXTYPE_MERGE = 4,
+};
+
+// 2D point structure.
+typedef Vector2 TPPLPoint;
+
+// Polygon implemented as an array of points with a "hole" flag.
+class TPPLPoly {
+ protected:
+ TPPLPoint *points;
+ long numpoints;
+ bool hole;
+
+ public:
+ // Constructors and destructors.
+ TPPLPoly();
+ ~TPPLPoly();
+
+ TPPLPoly(const TPPLPoly &src);
+ TPPLPoly &operator=(const TPPLPoly &src);
+
+ // Getters and setters.
+ long GetNumPoints() const {
+ return numpoints;
+ }
+
+ bool IsHole() const {
+ return hole;
+ }
+
+ void SetHole(bool hole) {
+ this->hole = hole;
+ }
+
+ TPPLPoint &GetPoint(long i) {
+ return points[i];
+ }
+
+ const TPPLPoint &GetPoint(long i) const {
+ return points[i];
+ }
+
+ TPPLPoint *GetPoints() {
+ return points;
+ }
+
+ TPPLPoint &operator[](int i) {
+ return points[i];
+ }
+
+ const TPPLPoint &operator[](int i) const {
+ return points[i];
+ }
+
+ // Clears the polygon points.
+ void Clear();
+
+ // Inits the polygon with numpoints vertices.
+ void Init(long numpoints);
+
+ // Creates a triangle with points p1, p2, and p3.
+ void Triangle(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3);
+
+ // Inverts the orfer of vertices.
+ void Invert();
+
+ // Returns the orientation of the polygon.
+ // Possible values:
+ // TPPL_ORIENTATION_CCW: Polygon vertices are in counter-clockwise order.
+ // TPPL_ORIENTATION_CW: Polygon vertices are in clockwise order.
+ // TPPL_ORIENTATION_NONE: The polygon has no (measurable) area.
+ TPPLOrientation GetOrientation() const;
+
+ // Sets the polygon orientation.
+ // Possible values:
+ // TPPL_ORIENTATION_CCW: Sets vertices in counter-clockwise order.
+ // TPPL_ORIENTATION_CW: Sets vertices in clockwise order.
+ // TPPL_ORIENTATION_NONE: Reverses the orientation of the vertices if there
+ // is one, otherwise does nothing (if orientation is already NONE).
+ void SetOrientation(TPPLOrientation orientation);
+
+ // Checks whether a polygon is valid or not.
+ inline bool Valid() const { return this->numpoints >= 3; }
+};
+
+#ifdef TPPL_ALLOCATOR
+typedef List<TPPLPoly, TPPL_ALLOCATOR(TPPLPoly)> TPPLPolyList;
+#else
+typedef List<TPPLPoly> TPPLPolyList;
+#endif
+
+class TPPLPartition {
+ protected:
+ struct PartitionVertex {
+ bool isActive;
+ bool isConvex;
+ bool isEar;
+
+ TPPLPoint p;
+ tppl_float angle;
+ PartitionVertex *previous;
+ PartitionVertex *next;
+
+ PartitionVertex();
+ };
+
+ struct MonotoneVertex {
+ TPPLPoint p;
+ long previous;
+ long next;
+ };
+
+ class VertexSorter {
+ MonotoneVertex *vertices;
+
+public:
+ VertexSorter(MonotoneVertex *v) :
+ vertices(v) {}
+ bool operator()(long index1, long index2);
+ };
+
+ struct Diagonal {
+ long index1;
+ long index2;
+ };
+
+#ifdef TPPL_ALLOCATOR
+ typedef List<Diagonal, TPPL_ALLOCATOR(Diagonal)> DiagonalList;
+#else
+ typedef List<Diagonal> DiagonalList;
+#endif
+
+ // Dynamic programming state for minimum-weight triangulation.
+ struct DPState {
+ bool visible;
+ tppl_float weight;
+ long bestvertex;
+ };
+
+ // Dynamic programming state for convex partitioning.
+ struct DPState2 {
+ bool visible;
+ long weight;
+ DiagonalList pairs;
+ };
+
+ // Edge that intersects the scanline.
+ struct ScanLineEdge {
+ mutable long index;
+ TPPLPoint p1;
+ TPPLPoint p2;
+
+ // Determines if the edge is to the left of another edge.
+ bool operator<(const ScanLineEdge &other) const;
+
+ bool IsConvex(const TPPLPoint &p1, const TPPLPoint &p2, const TPPLPoint &p3) const;
+ };
+
+ // Standard helper functions.
+ bool IsConvex(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3);
+ bool IsReflex(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3);
+ bool IsInside(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3, TPPLPoint &p);
+
+ bool InCone(TPPLPoint &p1, TPPLPoint &p2, TPPLPoint &p3, TPPLPoint &p);
+ bool InCone(PartitionVertex *v, TPPLPoint &p);
+
+ int Intersects(TPPLPoint &p11, TPPLPoint &p12, TPPLPoint &p21, TPPLPoint &p22);
+
+ TPPLPoint Normalize(const TPPLPoint &p);
+ tppl_float Distance(const TPPLPoint &p1, const TPPLPoint &p2);
+
+ // Helper functions for Triangulate_EC.
+ void UpdateVertexReflexity(PartitionVertex *v);
+ void UpdateVertex(PartitionVertex *v, PartitionVertex *vertices, long numvertices);
+
+ // Helper functions for ConvexPartition_OPT.
+ void UpdateState(long a, long b, long w, long i, long j, DPState2 **dpstates);
+ void TypeA(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates);
+ void TypeB(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates);
+
+ // Helper functions for MonotonePartition.
+ bool Below(TPPLPoint &p1, TPPLPoint &p2);
+ void AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
+ TPPLVertexType *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
+ Set<ScanLineEdge> *edgeTree, long *helpers);
+
+ // Triangulates a monotone polygon, used in Triangulate_MONO.
+ int TriangulateMonotone(TPPLPoly *inPoly, TPPLPolyList *triangles);
+
+ public:
+ // Simple heuristic procedure for removing holes from a list of polygons.
+ // It works by creating a diagonal from the right-most hole vertex
+ // to some other visible vertex.
+ // Time complexity: O(h*(n^2)), h is the # of holes, n is the # of vertices.
+ // Space complexity: O(n)
+ // params:
+ // inpolys:
+ // A list of polygons that can contain holes.
+ // Vertices of all non-hole polys have to be in counter-clockwise order.
+ // Vertices of all hole polys have to be in clockwise order.
+ // outpolys:
+ // A list of polygons without holes.
+ // Returns 1 on success, 0 on failure.
+ int RemoveHoles(TPPLPolyList *inpolys, TPPLPolyList *outpolys);
+
+ // Triangulates a polygon by ear clipping.
+ // Time complexity: O(n^2), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // poly:
+ // An input polygon to be triangulated.
+ // Vertices have to be in counter-clockwise order.
+ // triangles:
+ // A list of triangles (result).
+ // Returns 1 on success, 0 on failure.
+ int Triangulate_EC(TPPLPoly *poly, TPPLPolyList *triangles);
+
+ // Triangulates a list of polygons that may contain holes by ear clipping
+ // algorithm. It first calls RemoveHoles to get rid of the holes, and then
+ // calls Triangulate_EC for each resulting polygon.
+ // Time complexity: O(h*(n^2)), h is the # of holes, n is the # of vertices.
+ // Space complexity: O(n)
+ // params:
+ // inpolys:
+ // A list of polygons to be triangulated (can contain holes).
+ // Vertices of all non-hole polys have to be in counter-clockwise order.
+ // Vertices of all hole polys have to be in clockwise order.
+ // triangles:
+ // A list of triangles (result).
+ // Returns 1 on success, 0 on failure.
+ int Triangulate_EC(TPPLPolyList *inpolys, TPPLPolyList *triangles);
+
+ // Creates an optimal polygon triangulation in terms of minimal edge length.
+ // Time complexity: O(n^3), n is the number of vertices
+ // Space complexity: O(n^2)
+ // params:
+ // poly:
+ // An input polygon to be triangulated.
+ // Vertices have to be in counter-clockwise order.
+ // triangles:
+ // A list of triangles (result).
+ // Returns 1 on success, 0 on failure.
+ int Triangulate_OPT(TPPLPoly *poly, TPPLPolyList *triangles);
+
+ // Triangulates a polygon by first partitioning it into monotone polygons.
+ // Time complexity: O(n*log(n)), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // poly:
+ // An input polygon to be triangulated.
+ // Vertices have to be in counter-clockwise order.
+ // triangles:
+ // A list of triangles (result).
+ // Returns 1 on success, 0 on failure.
+ int Triangulate_MONO(TPPLPoly *poly, TPPLPolyList *triangles);
+
+ // Triangulates a list of polygons by first
+ // partitioning them into monotone polygons.
+ // Time complexity: O(n*log(n)), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // inpolys:
+ // A list of polygons to be triangulated (can contain holes).
+ // Vertices of all non-hole polys have to be in counter-clockwise order.
+ // Vertices of all hole polys have to be in clockwise order.
+ // triangles:
+ // A list of triangles (result).
+ // Returns 1 on success, 0 on failure.
+ int Triangulate_MONO(TPPLPolyList *inpolys, TPPLPolyList *triangles);
+
+ // Creates a monotone partition of a list of polygons that
+ // can contain holes. Triangulates a set of polygons by
+ // first partitioning them into monotone polygons.
+ // Time complexity: O(n*log(n)), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // inpolys:
+ // A list of polygons to be triangulated (can contain holes).
+ // Vertices of all non-hole polys have to be in counter-clockwise order.
+ // Vertices of all hole polys have to be in clockwise order.
+ // monotonePolys:
+ // A list of monotone polygons (result).
+ // Returns 1 on success, 0 on failure.
+ int MonotonePartition(TPPLPolyList *inpolys, TPPLPolyList *monotonePolys);
+
+ // Partitions a polygon into convex polygons by using the
+ // Hertel-Mehlhorn algorithm. The algorithm gives at most four times
+ // the number of parts as the optimal algorithm, however, in practice
+ // it works much better than that and often gives optimal partition.
+ // It uses triangulation obtained by ear clipping as intermediate result.
+ // Time complexity O(n^2), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // poly:
+ // An input polygon to be partitioned.
+ // Vertices have to be in counter-clockwise order.
+ // parts:
+ // Resulting list of convex polygons.
+ // Returns 1 on success, 0 on failure.
+ int ConvexPartition_HM(TPPLPoly *poly, TPPLPolyList *parts);
+
+ // Partitions a list of polygons into convex parts by using the
+ // Hertel-Mehlhorn algorithm. The algorithm gives at most four times
+ // the number of parts as the optimal algorithm, however, in practice
+ // it works much better than that and often gives optimal partition.
+ // It uses triangulation obtained by ear clipping as intermediate result.
+ // Time complexity O(n^2), n is the number of vertices.
+ // Space complexity: O(n)
+ // params:
+ // inpolys:
+ // An input list of polygons to be partitioned. Vertices of
+ // all non-hole polys have to be in counter-clockwise order.
+ // Vertices of all hole polys have to be in clockwise order.
+ // parts:
+ // Resulting list of convex polygons.
+ // Returns 1 on success, 0 on failure.
+ int ConvexPartition_HM(TPPLPolyList *inpolys, TPPLPolyList *parts);
+
+ // Optimal convex partitioning (in terms of number of resulting
+ // convex polygons) using the Keil-Snoeyink algorithm.
+ // For reference, see M. Keil, J. Snoeyink, "On the time bound for
+ // convex decomposition of simple polygons", 1998.
+ // Time complexity O(n^3), n is the number of vertices.
+ // Space complexity: O(n^3)
+ // params:
+ // poly:
+ // An input polygon to be partitioned.
+ // Vertices have to be in counter-clockwise order.
+ // parts:
+ // Resulting list of convex polygons.
+ // Returns 1 on success, 0 on failure.
+ int ConvexPartition_OPT(TPPLPoly *poly, TPPLPolyList *parts);
+};
+
+#endif
diff --git a/thirdparty/misc/triangulator.cpp b/thirdparty/misc/triangulator.cpp
deleted file mode 100644
index d6b63c6638..0000000000
--- a/thirdparty/misc/triangulator.cpp
+++ /dev/null
@@ -1,1550 +0,0 @@
-//Copyright (C) 2011 by Ivan Fratric
-//
-//Permission is hereby granted, free of charge, to any person obtaining a copy
-//of this software and associated documentation files (the "Software"), to deal
-//in the Software without restriction, including without limitation the rights
-//to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
-//copies of the Software, and to permit persons to whom the Software is
-//furnished to do so, subject to the following conditions:
-//
-//The above copyright notice and this permission notice shall be included in
-//all copies or substantial portions of the Software.
-//
-//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-//IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-//FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-//AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-//LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
-//OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
-//THE SOFTWARE.
-
-
-#include <stdio.h>
-#include <string.h>
-#include <math.h>
-
-#include "triangulator.h"
-
-
-#define TRIANGULATOR_VERTEXTYPE_REGULAR 0
-#define TRIANGULATOR_VERTEXTYPE_START 1
-#define TRIANGULATOR_VERTEXTYPE_END 2
-#define TRIANGULATOR_VERTEXTYPE_SPLIT 3
-#define TRIANGULATOR_VERTEXTYPE_MERGE 4
-
-TriangulatorPoly::TriangulatorPoly() {
- hole = false;
- numpoints = 0;
- points = NULL;
-}
-
-TriangulatorPoly::~TriangulatorPoly() {
- if(points) delete [] points;
-}
-
-void TriangulatorPoly::Clear() {
- if(points) delete [] points;
- hole = false;
- numpoints = 0;
- points = NULL;
-}
-
-void TriangulatorPoly::Init(long numpoints) {
- Clear();
- this->numpoints = numpoints;
- points = new Vector2[numpoints];
-}
-
-void TriangulatorPoly::Triangle(Vector2 &p1, Vector2 &p2, Vector2 &p3) {
- Init(3);
- points[0] = p1;
- points[1] = p2;
- points[2] = p3;
-}
-
-TriangulatorPoly::TriangulatorPoly(const TriangulatorPoly &src) {
- hole = src.hole;
- numpoints = src.numpoints;
- points = new Vector2[numpoints];
- memcpy(points, src.points, numpoints*sizeof(Vector2));
-}
-
-TriangulatorPoly& TriangulatorPoly::operator=(const TriangulatorPoly &src) {
- Clear();
- hole = src.hole;
- numpoints = src.numpoints;
- points = new Vector2[numpoints];
- memcpy(points, src.points, numpoints*sizeof(Vector2));
- return *this;
-}
-
-int TriangulatorPoly::GetOrientation() {
- long i1,i2;
- real_t area = 0;
- for(i1=0; i1<numpoints; i1++) {
- i2 = i1+1;
- if(i2 == numpoints) i2 = 0;
- area += points[i1].x * points[i2].y - points[i1].y * points[i2].x;
- }
- if(area>0) return TRIANGULATOR_CCW;
- if(area<0) return TRIANGULATOR_CW;
- return 0;
-}
-
-void TriangulatorPoly::SetOrientation(int orientation) {
- int polyorientation = GetOrientation();
- if(polyorientation&&(polyorientation!=orientation)) {
- Invert();
- }
-}
-
-void TriangulatorPoly::Invert() {
- long i;
- Vector2 *invpoints;
-
- invpoints = new Vector2[numpoints];
- for(i=0;i<numpoints;i++) {
- invpoints[i] = points[numpoints-i-1];
- }
-
- delete [] points;
- points = invpoints;
-}
-
-Vector2 TriangulatorPartition::Normalize(const Vector2 &p) {
- Vector2 r;
- real_t n = sqrt(p.x*p.x + p.y*p.y);
- if(n!=0) {
- r = p/n;
- } else {
- r.x = 0;
- r.y = 0;
- }
- return r;
-}
-
-real_t TriangulatorPartition::Distance(const Vector2 &p1, const Vector2 &p2) {
- real_t dx,dy;
- dx = p2.x - p1.x;
- dy = p2.y - p1.y;
- return(sqrt(dx*dx + dy*dy));
-}
-
-//checks if two lines intersect
-int TriangulatorPartition::Intersects(Vector2 &p11, Vector2 &p12, Vector2 &p21, Vector2 &p22) {
- if((p11.x == p21.x)&&(p11.y == p21.y)) return 0;
- if((p11.x == p22.x)&&(p11.y == p22.y)) return 0;
- if((p12.x == p21.x)&&(p12.y == p21.y)) return 0;
- if((p12.x == p22.x)&&(p12.y == p22.y)) return 0;
-
- Vector2 v1ort,v2ort,v;
- real_t dot11,dot12,dot21,dot22;
-
- v1ort.x = p12.y-p11.y;
- v1ort.y = p11.x-p12.x;
-
- v2ort.x = p22.y-p21.y;
- v2ort.y = p21.x-p22.x;
-
- v = p21-p11;
- dot21 = v.x*v1ort.x + v.y*v1ort.y;
- v = p22-p11;
- dot22 = v.x*v1ort.x + v.y*v1ort.y;
-
- v = p11-p21;
- dot11 = v.x*v2ort.x + v.y*v2ort.y;
- v = p12-p21;
- dot12 = v.x*v2ort.x + v.y*v2ort.y;
-
- if(dot11*dot12>0) return 0;
- if(dot21*dot22>0) return 0;
-
- return 1;
-}
-
-//removes holes from inpolys by merging them with non-holes
-int TriangulatorPartition::RemoveHoles(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *outpolys) {
- List<TriangulatorPoly> polys;
- List<TriangulatorPoly>::Element *holeiter,*polyiter,*iter,*iter2;
- long i,i2,holepointindex,polypointindex;
- Vector2 holepoint,polypoint,bestpolypoint;
- Vector2 linep1,linep2;
- Vector2 v1,v2;
- TriangulatorPoly newpoly;
- bool hasholes;
- bool pointvisible;
- bool pointfound;
-
- //check for trivial case (no holes)
- hasholes = false;
- for(iter = inpolys->front(); iter; iter=iter->next()) {
- if(iter->get().IsHole()) {
- hasholes = true;
- break;
- }
- }
- if(!hasholes) {
- for(iter = inpolys->front(); iter; iter=iter->next()) {
- outpolys->push_back(iter->get());
- }
- return 1;
- }
-
- polys = *inpolys;
-
- while(1) {
- //find the hole point with the largest x
- hasholes = false;
- for(iter = polys.front(); iter; iter=iter->next()) {
- if(!iter->get().IsHole()) continue;
-
- if(!hasholes) {
- hasholes = true;
- holeiter = iter;
- holepointindex = 0;
- }
-
- for(i=0; i < iter->get().GetNumPoints(); i++) {
- if(iter->get().GetPoint(i).x > holeiter->get().GetPoint(holepointindex).x) {
- holeiter = iter;
- holepointindex = i;
- }
- }
- }
- if(!hasholes) break;
- holepoint = holeiter->get().GetPoint(holepointindex);
-
- pointfound = false;
- for(iter = polys.front(); iter; iter=iter->next()) {
- if(iter->get().IsHole()) continue;
- for(i=0; i < iter->get().GetNumPoints(); i++) {
- if(iter->get().GetPoint(i).x <= holepoint.x) continue;
- if(!InCone(iter->get().GetPoint((i+iter->get().GetNumPoints()-1)%(iter->get().GetNumPoints())),
- iter->get().GetPoint(i),
- iter->get().GetPoint((i+1)%(iter->get().GetNumPoints())),
- holepoint))
- continue;
- polypoint = iter->get().GetPoint(i);
- if(pointfound) {
- v1 = Normalize(polypoint-holepoint);
- v2 = Normalize(bestpolypoint-holepoint);
- if(v2.x > v1.x) continue;
- }
- pointvisible = true;
- for(iter2 = polys.front(); iter2; iter2=iter2->next()) {
- if(iter2->get().IsHole()) continue;
- for(i2=0; i2 < iter2->get().GetNumPoints(); i2++) {
- linep1 = iter2->get().GetPoint(i2);
- linep2 = iter2->get().GetPoint((i2+1)%(iter2->get().GetNumPoints()));
- if(Intersects(holepoint,polypoint,linep1,linep2)) {
- pointvisible = false;
- break;
- }
- }
- if(!pointvisible) break;
- }
- if(pointvisible) {
- pointfound = true;
- bestpolypoint = polypoint;
- polyiter = iter;
- polypointindex = i;
- }
- }
- }
-
- if(!pointfound) return 0;
-
- newpoly.Init(holeiter->get().GetNumPoints() + polyiter->get().GetNumPoints() + 2);
- i2 = 0;
- for(i=0;i<=polypointindex;i++) {
- newpoly[i2] = polyiter->get().GetPoint(i);
- i2++;
- }
- for(i=0;i<=holeiter->get().GetNumPoints();i++) {
- newpoly[i2] = holeiter->get().GetPoint((i+holepointindex)%holeiter->get().GetNumPoints());
- i2++;
- }
- for(i=polypointindex;i<polyiter->get().GetNumPoints();i++) {
- newpoly[i2] = polyiter->get().GetPoint(i);
- i2++;
- }
-
- polys.erase(holeiter);
- polys.erase(polyiter);
- polys.push_back(newpoly);
- }
-
- for(iter = polys.front(); iter; iter=iter->next()) {
- outpolys->push_back(iter->get());
- }
-
- return 1;
-}
-
-bool TriangulatorPartition::IsConvex(Vector2& p1, Vector2& p2, Vector2& p3) {
- real_t tmp;
- tmp = (p3.y-p1.y)*(p2.x-p1.x)-(p3.x-p1.x)*(p2.y-p1.y);
- if(tmp>0) return 1;
- else return 0;
-}
-
-bool TriangulatorPartition::IsReflex(Vector2& p1, Vector2& p2, Vector2& p3) {
- real_t tmp;
- tmp = (p3.y-p1.y)*(p2.x-p1.x)-(p3.x-p1.x)*(p2.y-p1.y);
- if(tmp<0) return 1;
- else return 0;
-}
-
-bool TriangulatorPartition::IsInside(Vector2& p1, Vector2& p2, Vector2& p3, Vector2 &p) {
- if(IsConvex(p1,p,p2)) return false;
- if(IsConvex(p2,p,p3)) return false;
- if(IsConvex(p3,p,p1)) return false;
- return true;
-}
-
-bool TriangulatorPartition::InCone(Vector2 &p1, Vector2 &p2, Vector2 &p3, Vector2 &p) {
- bool convex;
-
- convex = IsConvex(p1,p2,p3);
-
- if(convex) {
- if(!IsConvex(p1,p2,p)) return false;
- if(!IsConvex(p2,p3,p)) return false;
- return true;
- } else {
- if(IsConvex(p1,p2,p)) return true;
- if(IsConvex(p2,p3,p)) return true;
- return false;
- }
-}
-
-bool TriangulatorPartition::InCone(PartitionVertex *v, Vector2 &p) {
- Vector2 p1,p2,p3;
-
- p1 = v->previous->p;
- p2 = v->p;
- p3 = v->next->p;
-
- return InCone(p1,p2,p3,p);
-}
-
-void TriangulatorPartition::UpdateVertexReflexity(PartitionVertex *v) {
- PartitionVertex *v1,*v3;
- v1 = v->previous;
- v3 = v->next;
- v->isConvex = !IsReflex(v1->p,v->p,v3->p);
-}
-
-void TriangulatorPartition::UpdateVertex(PartitionVertex *v, PartitionVertex *vertices, long numvertices) {
- long i;
- PartitionVertex *v1,*v3;
- Vector2 vec1,vec3;
-
- v1 = v->previous;
- v3 = v->next;
-
- v->isConvex = IsConvex(v1->p,v->p,v3->p);
-
- vec1 = Normalize(v1->p - v->p);
- vec3 = Normalize(v3->p - v->p);
- v->angle = vec1.x*vec3.x + vec1.y*vec3.y;
-
- if(v->isConvex) {
- v->isEar = true;
- for(i=0;i<numvertices;i++) {
- if((vertices[i].p.x==v->p.x)&&(vertices[i].p.y==v->p.y)) continue;
- if((vertices[i].p.x==v1->p.x)&&(vertices[i].p.y==v1->p.y)) continue;
- if((vertices[i].p.x==v3->p.x)&&(vertices[i].p.y==v3->p.y)) continue;
- if(IsInside(v1->p,v->p,v3->p,vertices[i].p)) {
- v->isEar = false;
- break;
- }
- }
- } else {
- v->isEar = false;
- }
-}
-
-//triangulation by ear removal
-int TriangulatorPartition::Triangulate_EC(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles) {
- long numvertices;
- PartitionVertex *vertices;
- PartitionVertex *ear;
- TriangulatorPoly triangle;
- long i,j;
- bool earfound;
-
- if(poly->GetNumPoints() < 3) return 0;
- if(poly->GetNumPoints() == 3) {
- triangles->push_back(*poly);
- return 1;
- }
-
- numvertices = poly->GetNumPoints();
-
- vertices = new PartitionVertex[numvertices];
- for(i=0;i<numvertices;i++) {
- vertices[i].isActive = true;
- vertices[i].p = poly->GetPoint(i);
- if(i==(numvertices-1)) vertices[i].next=&(vertices[0]);
- else vertices[i].next=&(vertices[i+1]);
- if(i==0) vertices[i].previous = &(vertices[numvertices-1]);
- else vertices[i].previous = &(vertices[i-1]);
- }
- for(i=0;i<numvertices;i++) {
- UpdateVertex(&vertices[i],vertices,numvertices);
- }
-
- for(i=0;i<numvertices-3;i++) {
- earfound = false;
- //find the most extruded ear
- for(j=0;j<numvertices;j++) {
- if(!vertices[j].isActive) continue;
- if(!vertices[j].isEar) continue;
- if(!earfound) {
- earfound = true;
- ear = &(vertices[j]);
- } else {
- if(vertices[j].angle > ear->angle) {
- ear = &(vertices[j]);
- }
- }
- }
- if(!earfound) {
- delete [] vertices;
- return 0;
- }
-
- triangle.Triangle(ear->previous->p,ear->p,ear->next->p);
- triangles->push_back(triangle);
-
- ear->isActive = false;
- ear->previous->next = ear->next;
- ear->next->previous = ear->previous;
-
- if(i==numvertices-4) break;
-
- UpdateVertex(ear->previous,vertices,numvertices);
- UpdateVertex(ear->next,vertices,numvertices);
- }
- for(i=0;i<numvertices;i++) {
- if(vertices[i].isActive) {
- triangle.Triangle(vertices[i].previous->p,vertices[i].p,vertices[i].next->p);
- triangles->push_back(triangle);
- break;
- }
- }
-
- delete [] vertices;
-
- return 1;
-}
-
-int TriangulatorPartition::Triangulate_EC(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *triangles) {
- List<TriangulatorPoly> outpolys;
- List<TriangulatorPoly>::Element*iter;
-
- if(!RemoveHoles(inpolys,&outpolys)) return 0;
- for(iter=outpolys.front();iter;iter=iter->next()) {
- if(!Triangulate_EC(&(iter->get()),triangles)) return 0;
- }
- return 1;
-}
-
-int TriangulatorPartition::ConvexPartition_HM(TriangulatorPoly *poly, List<TriangulatorPoly> *parts) {
- List<TriangulatorPoly> triangles;
- List<TriangulatorPoly>::Element *iter1,*iter2;
- TriangulatorPoly *poly1,*poly2;
- TriangulatorPoly newpoly;
- Vector2 d1,d2,p1,p2,p3;
- long i11,i12,i21,i22,i13,i23,j,k;
- bool isdiagonal;
- long numreflex;
-
- //check if the poly is already convex
- numreflex = 0;
- for(i11=0;i11<poly->GetNumPoints();i11++) {
- if(i11==0) i12 = poly->GetNumPoints()-1;
- else i12=i11-1;
- if(i11==(poly->GetNumPoints()-1)) i13=0;
- else i13=i11+1;
- if(IsReflex(poly->GetPoint(i12),poly->GetPoint(i11),poly->GetPoint(i13))) {
- numreflex = 1;
- break;
- }
- }
- if(numreflex == 0) {
- parts->push_back(*poly);
- return 1;
- }
-
- if(!Triangulate_EC(poly,&triangles)) return 0;
-
- for(iter1 = triangles.front(); iter1 ; iter1=iter1->next()) {
- poly1 = &(iter1->get());
- for(i11=0;i11<poly1->GetNumPoints();i11++) {
- d1 = poly1->GetPoint(i11);
- i12 = (i11+1)%(poly1->GetNumPoints());
- d2 = poly1->GetPoint(i12);
-
- isdiagonal = false;
- for(iter2 = iter1; iter2 ; iter2=iter2->next()) {
- if(iter1 == iter2) continue;
- poly2 = &(iter2->get());
-
- for(i21=0;i21<poly2->GetNumPoints();i21++) {
- if((d2.x != poly2->GetPoint(i21).x)||(d2.y != poly2->GetPoint(i21).y)) continue;
- i22 = (i21+1)%(poly2->GetNumPoints());
- if((d1.x != poly2->GetPoint(i22).x)||(d1.y != poly2->GetPoint(i22).y)) continue;
- isdiagonal = true;
- break;
- }
- if(isdiagonal) break;
- }
-
- if(!isdiagonal) continue;
-
- p2 = poly1->GetPoint(i11);
- if(i11 == 0) i13 = poly1->GetNumPoints()-1;
- else i13 = i11-1;
- p1 = poly1->GetPoint(i13);
- if(i22 == (poly2->GetNumPoints()-1)) i23 = 0;
- else i23 = i22+1;
- p3 = poly2->GetPoint(i23);
-
- if(!IsConvex(p1,p2,p3)) continue;
-
- p2 = poly1->GetPoint(i12);
- if(i12 == (poly1->GetNumPoints()-1)) i13 = 0;
- else i13 = i12+1;
- p3 = poly1->GetPoint(i13);
- if(i21 == 0) i23 = poly2->GetNumPoints()-1;
- else i23 = i21-1;
- p1 = poly2->GetPoint(i23);
-
- if(!IsConvex(p1,p2,p3)) continue;
-
- newpoly.Init(poly1->GetNumPoints()+poly2->GetNumPoints()-2);
- k = 0;
- for(j=i12;j!=i11;j=(j+1)%(poly1->GetNumPoints())) {
- newpoly[k] = poly1->GetPoint(j);
- k++;
- }
- for(j=i22;j!=i21;j=(j+1)%(poly2->GetNumPoints())) {
- newpoly[k] = poly2->GetPoint(j);
- k++;
- }
-
- triangles.erase(iter2);
- iter1->get() = newpoly;
- poly1 = &(iter1->get());
- i11 = -1;
-
- continue;
- }
- }
-
- for(iter1 = triangles.front(); iter1 ; iter1=iter1->next()) {
- parts->push_back(iter1->get());
- }
-
- return 1;
-}
-
-int TriangulatorPartition::ConvexPartition_HM(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *parts) {
- List<TriangulatorPoly> outpolys;
- List<TriangulatorPoly>::Element* iter;
-
- if(!RemoveHoles(inpolys,&outpolys)) return 0;
- for(iter=outpolys.front();iter;iter=iter->next()) {
- if(!ConvexPartition_HM(&(iter->get()),parts)) return 0;
- }
- return 1;
-}
-
-//minimum-weight polygon triangulation by dynamic programming
-//O(n^3) time complexity
-//O(n^2) space complexity
-int TriangulatorPartition::Triangulate_OPT(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles) {
- long i,j,k,gap,n;
- DPState **dpstates;
- Vector2 p1,p2,p3,p4;
- long bestvertex;
- real_t weight,minweight,d1,d2;
- Diagonal diagonal,newdiagonal;
- List<Diagonal> diagonals;
- TriangulatorPoly triangle;
- int ret = 1;
-
- n = poly->GetNumPoints();
- dpstates = new DPState *[n];
- for(i=1;i<n;i++) {
- dpstates[i] = new DPState[i];
- }
-
- //init states and visibility
- for(i=0;i<(n-1);i++) {
- p1 = poly->GetPoint(i);
- for(j=i+1;j<n;j++) {
- dpstates[j][i].visible = true;
- dpstates[j][i].weight = 0;
- dpstates[j][i].bestvertex = -1;
- if(j!=(i+1)) {
- p2 = poly->GetPoint(j);
-
- //visibility check
- if(i==0) p3 = poly->GetPoint(n-1);
- else p3 = poly->GetPoint(i-1);
- if(i==(n-1)) p4 = poly->GetPoint(0);
- else p4 = poly->GetPoint(i+1);
- if(!InCone(p3,p1,p4,p2)) {
- dpstates[j][i].visible = false;
- continue;
- }
-
- if(j==0) p3 = poly->GetPoint(n-1);
- else p3 = poly->GetPoint(j-1);
- if(j==(n-1)) p4 = poly->GetPoint(0);
- else p4 = poly->GetPoint(j+1);
- if(!InCone(p3,p2,p4,p1)) {
- dpstates[j][i].visible = false;
- continue;
- }
-
- for(k=0;k<n;k++) {
- p3 = poly->GetPoint(k);
- if(k==(n-1)) p4 = poly->GetPoint(0);
- else p4 = poly->GetPoint(k+1);
- if(Intersects(p1,p2,p3,p4)) {
- dpstates[j][i].visible = false;
- break;
- }
- }
- }
- }
- }
- dpstates[n-1][0].visible = true;
- dpstates[n-1][0].weight = 0;
- dpstates[n-1][0].bestvertex = -1;
-
- for(gap = 2; gap<n; gap++) {
- for(i=0; i<(n-gap); i++) {
- j = i+gap;
- if(!dpstates[j][i].visible) continue;
- bestvertex = -1;
- for(k=(i+1);k<j;k++) {
- if(!dpstates[k][i].visible) continue;
- if(!dpstates[j][k].visible) continue;
-
- if(k<=(i+1)) d1=0;
- else d1 = Distance(poly->GetPoint(i),poly->GetPoint(k));
- if(j<=(k+1)) d2=0;
- else d2 = Distance(poly->GetPoint(k),poly->GetPoint(j));
-
- weight = dpstates[k][i].weight + dpstates[j][k].weight + d1 + d2;
-
- if((bestvertex == -1)||(weight<minweight)) {
- bestvertex = k;
- minweight = weight;
- }
- }
- if(bestvertex == -1) {
- for(i=1;i<n;i++) {
- delete [] dpstates[i];
- }
- delete [] dpstates;
-
- return 0;
- }
-
- dpstates[j][i].bestvertex = bestvertex;
- dpstates[j][i].weight = minweight;
- }
- }
-
- newdiagonal.index1 = 0;
- newdiagonal.index2 = n-1;
- diagonals.push_back(newdiagonal);
- while(!diagonals.is_empty()) {
- diagonal = (diagonals.front()->get());
- diagonals.pop_front();
- bestvertex = dpstates[diagonal.index2][diagonal.index1].bestvertex;
- if(bestvertex == -1) {
- ret = 0;
- break;
- }
- triangle.Triangle(poly->GetPoint(diagonal.index1),poly->GetPoint(bestvertex),poly->GetPoint(diagonal.index2));
- triangles->push_back(triangle);
- if(bestvertex > (diagonal.index1+1)) {
- newdiagonal.index1 = diagonal.index1;
- newdiagonal.index2 = bestvertex;
- diagonals.push_back(newdiagonal);
- }
- if(diagonal.index2 > (bestvertex+1)) {
- newdiagonal.index1 = bestvertex;
- newdiagonal.index2 = diagonal.index2;
- diagonals.push_back(newdiagonal);
- }
- }
-
- for(i=1;i<n;i++) {
- delete [] dpstates[i];
- }
- delete [] dpstates;
-
- return ret;
-}
-
-void TriangulatorPartition::UpdateState(long a, long b, long w, long i, long j, DPState2 **dpstates) {
- Diagonal newdiagonal;
- List<Diagonal> *pairs;
- long w2;
-
- w2 = dpstates[a][b].weight;
- if(w>w2) return;
-
- pairs = &(dpstates[a][b].pairs);
- newdiagonal.index1 = i;
- newdiagonal.index2 = j;
-
- if(w<w2) {
- pairs->clear();
- pairs->push_front(newdiagonal);
- dpstates[a][b].weight = w;
- } else {
- if((!pairs->is_empty())&&(i <= pairs->front()->get().index1)) return;
- while((!pairs->is_empty())&&(pairs->front()->get().index2 >= j)) pairs->pop_front();
- pairs->push_front(newdiagonal);
- }
-}
-
-void TriangulatorPartition::TypeA(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
- List<Diagonal> *pairs;
- List<Diagonal>::Element *iter,*lastiter;
- long top;
- long w;
-
- if(!dpstates[i][j].visible) return;
- top = j;
- w = dpstates[i][j].weight;
- if(k-j > 1) {
- if (!dpstates[j][k].visible) return;
- w += dpstates[j][k].weight + 1;
- }
- if(j-i > 1) {
- pairs = &(dpstates[i][j].pairs);
- iter = NULL;
- lastiter = NULL;
- while(iter!=pairs->front()) {
- if (!iter)
- iter=pairs->back();
- else
- iter=iter->prev();
-
- if(!IsReflex(vertices[iter->get().index2].p,vertices[j].p,vertices[k].p)) lastiter = iter;
- else break;
- }
- if(lastiter == NULL) w++;
- else {
- if(IsReflex(vertices[k].p,vertices[i].p,vertices[lastiter->get().index1].p)) w++;
- else top = lastiter->get().index1;
- }
- }
- UpdateState(i,k,w,top,j,dpstates);
-}
-
-void TriangulatorPartition::TypeB(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates) {
- List<Diagonal> *pairs;
- List<Diagonal>::Element* iter,*lastiter;
- long top;
- long w;
-
- if(!dpstates[j][k].visible) return;
- top = j;
- w = dpstates[j][k].weight;
-
- if (j-i > 1) {
- if (!dpstates[i][j].visible) return;
- w += dpstates[i][j].weight + 1;
- }
- if (k-j > 1) {
- pairs = &(dpstates[j][k].pairs);
-
- iter = pairs->front();
- if((!pairs->is_empty())&&(!IsReflex(vertices[i].p,vertices[j].p,vertices[iter->get().index1].p))) {
- lastiter = iter;
- while(iter!=NULL) {
- if(!IsReflex(vertices[i].p,vertices[j].p,vertices[iter->get().index1].p)) {
- lastiter = iter;
- iter=iter->next();
- }
- else break;
- }
- if(IsReflex(vertices[lastiter->get().index2].p,vertices[k].p,vertices[i].p)) w++;
- else top = lastiter->get().index2;
- } else w++;
- }
- UpdateState(i,k,w,j,top,dpstates);
-}
-
-int TriangulatorPartition::ConvexPartition_OPT(TriangulatorPoly *poly, List<TriangulatorPoly> *parts) {
- Vector2 p1,p2,p3,p4;
- PartitionVertex *vertices;
- DPState2 **dpstates;
- long i,j,k,n,gap;
- List<Diagonal> diagonals,diagonals2;
- Diagonal diagonal,newdiagonal;
- List<Diagonal> *pairs,*pairs2;
- List<Diagonal>::Element* iter,*iter2;
- int ret;
- TriangulatorPoly newpoly;
- List<long> indices;
- List<long>::Element* iiter;
- bool ijreal,jkreal;
-
- n = poly->GetNumPoints();
- vertices = new PartitionVertex[n];
-
- dpstates = new DPState2 *[n];
- for(i=0;i<n;i++) {
- dpstates[i] = new DPState2[n];
- }
-
- //init vertex information
- for(i=0;i<n;i++) {
- vertices[i].p = poly->GetPoint(i);
- vertices[i].isActive = true;
- if(i==0) vertices[i].previous = &(vertices[n-1]);
- else vertices[i].previous = &(vertices[i-1]);
- if(i==(poly->GetNumPoints()-1)) vertices[i].next = &(vertices[0]);
- else vertices[i].next = &(vertices[i+1]);
- }
- for(i=1;i<n;i++) {
- UpdateVertexReflexity(&(vertices[i]));
- }
-
- //init states and visibility
- for(i=0;i<(n-1);i++) {
- p1 = poly->GetPoint(i);
- for(j=i+1;j<n;j++) {
- dpstates[i][j].visible = true;
- if(j==i+1) {
- dpstates[i][j].weight = 0;
- } else {
- dpstates[i][j].weight = 2147483647;
- }
- if(j!=(i+1)) {
- p2 = poly->GetPoint(j);
-
- //visibility check
- if(!InCone(&vertices[i],p2)) {
- dpstates[i][j].visible = false;
- continue;
- }
- if(!InCone(&vertices[j],p1)) {
- dpstates[i][j].visible = false;
- continue;
- }
-
- for(k=0;k<n;k++) {
- p3 = poly->GetPoint(k);
- if(k==(n-1)) p4 = poly->GetPoint(0);
- else p4 = poly->GetPoint(k+1);
- if(Intersects(p1,p2,p3,p4)) {
- dpstates[i][j].visible = false;
- break;
- }
- }
- }
- }
- }
- for(i=0;i<(n-2);i++) {
- j = i+2;
- if(dpstates[i][j].visible) {
- dpstates[i][j].weight = 0;
- newdiagonal.index1 = i+1;
- newdiagonal.index2 = i+1;
- dpstates[i][j].pairs.push_back(newdiagonal);
- }
- }
-
- dpstates[0][n-1].visible = true;
- vertices[0].isConvex = false; //by convention
-
- for(gap=3; gap<n; gap++) {
- for(i=0;i<n-gap;i++) {
- if(vertices[i].isConvex) continue;
- k = i+gap;
- if(dpstates[i][k].visible) {
- if(!vertices[k].isConvex) {
- for(j=i+1;j<k;j++) TypeA(i,j,k,vertices,dpstates);
- } else {
- for(j=i+1;j<(k-1);j++) {
- if(vertices[j].isConvex) continue;
- TypeA(i,j,k,vertices,dpstates);
- }
- TypeA(i,k-1,k,vertices,dpstates);
- }
- }
- }
- for(k=gap;k<n;k++) {
- if(vertices[k].isConvex) continue;
- i = k-gap;
- if((vertices[i].isConvex)&&(dpstates[i][k].visible)) {
- TypeB(i,i+1,k,vertices,dpstates);
- for(j=i+2;j<k;j++) {
- if(vertices[j].isConvex) continue;
- TypeB(i,j,k,vertices,dpstates);
- }
- }
- }
- }
-
-
- //recover solution
- ret = 1;
- newdiagonal.index1 = 0;
- newdiagonal.index2 = n-1;
- diagonals.push_front(newdiagonal);
- while(!diagonals.is_empty()) {
- diagonal = (diagonals.front()->get());
- diagonals.pop_front();
- if((diagonal.index2 - diagonal.index1) <=1) continue;
- pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
- if(pairs->is_empty()) {
- ret = 0;
- break;
- }
- if(!vertices[diagonal.index1].isConvex) {
- iter = pairs->back();
-
- j = iter->get().index2;
- newdiagonal.index1 = j;
- newdiagonal.index2 = diagonal.index2;
- diagonals.push_front(newdiagonal);
- if((j - diagonal.index1)>1) {
- if(iter->get().index1 != iter->get().index2) {
- pairs2 = &(dpstates[diagonal.index1][j].pairs);
- while(1) {
- if(pairs2->is_empty()) {
- ret = 0;
- break;
- }
- iter2 = pairs2->back();
-
- if(iter->get().index1 != iter2->get().index1) pairs2->pop_back();
- else break;
- }
- if(ret == 0) break;
- }
- newdiagonal.index1 = diagonal.index1;
- newdiagonal.index2 = j;
- diagonals.push_front(newdiagonal);
- }
- } else {
- iter = pairs->front();
- j = iter->get().index1;
- newdiagonal.index1 = diagonal.index1;
- newdiagonal.index2 = j;
- diagonals.push_front(newdiagonal);
- if((diagonal.index2 - j) > 1) {
- if(iter->get().index1 != iter->get().index2) {
- pairs2 = &(dpstates[j][diagonal.index2].pairs);
- while(1) {
- if(pairs2->is_empty()) {
- ret = 0;
- break;
- }
- iter2 = pairs2->front();
- if(iter->get().index2 != iter2->get().index2) pairs2->pop_front();
- else break;
- }
- if(ret == 0) break;
- }
- newdiagonal.index1 = j;
- newdiagonal.index2 = diagonal.index2;
- diagonals.push_front(newdiagonal);
- }
- }
- }
-
- if(ret == 0) {
- for(i=0;i<n;i++) {
- delete [] dpstates[i];
- }
- delete [] dpstates;
- delete [] vertices;
-
- return ret;
- }
-
- newdiagonal.index1 = 0;
- newdiagonal.index2 = n-1;
- diagonals.push_front(newdiagonal);
- while(!diagonals.is_empty()) {
- diagonal = (diagonals.front())->get();
- diagonals.pop_front();
- if((diagonal.index2 - diagonal.index1) <= 1) continue;
-
- indices.clear();
- diagonals2.clear();
- indices.push_back(diagonal.index1);
- indices.push_back(diagonal.index2);
- diagonals2.push_front(diagonal);
-
- while(!diagonals2.is_empty()) {
- diagonal = (diagonals2.front()->get());
- diagonals2.pop_front();
- if((diagonal.index2 - diagonal.index1) <= 1) continue;
- ijreal = true;
- jkreal = true;
- pairs = &(dpstates[diagonal.index1][diagonal.index2].pairs);
- if(!vertices[diagonal.index1].isConvex) {
- iter = pairs->back();
- j = iter->get().index2;
- if(iter->get().index1 != iter->get().index2) ijreal = false;
- } else {
- iter = pairs->front();
- j = iter->get().index1;
- if(iter->get().index1 != iter->get().index2) jkreal = false;
- }
-
- newdiagonal.index1 = diagonal.index1;
- newdiagonal.index2 = j;
- if(ijreal) {
- diagonals.push_back(newdiagonal);
- } else {
- diagonals2.push_back(newdiagonal);
- }
-
- newdiagonal.index1 = j;
- newdiagonal.index2 = diagonal.index2;
- if(jkreal) {
- diagonals.push_back(newdiagonal);
- } else {
- diagonals2.push_back(newdiagonal);
- }
-
- indices.push_back(j);
- }
-
- indices.sort();
- newpoly.Init((long)indices.size());
- k=0;
- for(iiter = indices.front();iiter;iiter=iiter->next()) {
- newpoly[k] = vertices[iiter->get()].p;
- k++;
- }
- parts->push_back(newpoly);
- }
-
- for(i=0;i<n;i++) {
- delete [] dpstates[i];
- }
- delete [] dpstates;
- delete [] vertices;
-
- return ret;
-}
-
-//triangulates a set of polygons by first partitioning them into monotone polygons
-//O(n*log(n)) time complexity, O(n) space complexity
-//the algorithm used here is outlined in the book
-//"Computational Geometry: Algorithms and Applications"
-//by Mark de Berg, Otfried Cheong, Marc van Kreveld and Mark Overmars
-int TriangulatorPartition::MonotonePartition(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *monotonePolys) {
- List<TriangulatorPoly>::Element *iter;
- MonotoneVertex *vertices;
- long i,numvertices,vindex,vindex2,newnumvertices,maxnumvertices;
- long polystartindex, polyendindex;
- TriangulatorPoly *poly;
- MonotoneVertex *v,*v2,*vprev,*vnext;
- ScanLineEdge newedge;
- bool error = false;
-
- numvertices = 0;
- for(iter = inpolys->front(); iter ; iter=iter->next()) {
- numvertices += iter->get().GetNumPoints();
- }
-
- maxnumvertices = numvertices*3;
- vertices = new MonotoneVertex[maxnumvertices];
- newnumvertices = numvertices;
-
- polystartindex = 0;
- for(iter = inpolys->front(); iter ; iter=iter->next()) {
- poly = &(iter->get());
- polyendindex = polystartindex + poly->GetNumPoints()-1;
- for(i=0;i<poly->GetNumPoints();i++) {
- vertices[i+polystartindex].p = poly->GetPoint(i);
- if(i==0) vertices[i+polystartindex].previous = polyendindex;
- else vertices[i+polystartindex].previous = i+polystartindex-1;
- if(i==(poly->GetNumPoints()-1)) vertices[i+polystartindex].next = polystartindex;
- else vertices[i+polystartindex].next = i+polystartindex+1;
- }
- polystartindex = polyendindex+1;
- }
-
- //construct the priority queue
- long *priority = new long [numvertices];
- for(i=0;i<numvertices;i++) priority[i] = i;
- SortArray<long,VertexSorter> sorter;
- sorter.compare.vertices=vertices;
- sorter.sort(priority,numvertices);
-
- //determine vertex types
- char *vertextypes = new char[maxnumvertices];
- for(i=0;i<numvertices;i++) {
- v = &(vertices[i]);
- vprev = &(vertices[v->previous]);
- vnext = &(vertices[v->next]);
-
- if(Below(vprev->p,v->p)&&Below(vnext->p,v->p)) {
- if(IsConvex(vnext->p,vprev->p,v->p)) {
- vertextypes[i] = TRIANGULATOR_VERTEXTYPE_START;
- } else {
- vertextypes[i] = TRIANGULATOR_VERTEXTYPE_SPLIT;
- }
- } else if(Below(v->p,vprev->p)&&Below(v->p,vnext->p)) {
- if(IsConvex(vnext->p,vprev->p,v->p))
- {
- vertextypes[i] = TRIANGULATOR_VERTEXTYPE_END;
- } else {
- vertextypes[i] = TRIANGULATOR_VERTEXTYPE_MERGE;
- }
- } else {
- vertextypes[i] = TRIANGULATOR_VERTEXTYPE_REGULAR;
- }
- }
-
- //helpers
- long *helpers = new long[maxnumvertices];
-
- //binary search tree that holds edges intersecting the scanline
- //note that while set doesn't actually have to be implemented as a tree
- //complexity requirements for operations are the same as for the balanced binary search tree
- Set<ScanLineEdge> edgeTree;
- //store iterators to the edge tree elements
- //this makes deleting existing edges much faster
- Set<ScanLineEdge>::Element **edgeTreeIterators,*edgeIter;
- edgeTreeIterators = new Set<ScanLineEdge>::Element*[maxnumvertices];
- //Pair<Set<ScanLineEdge>::Element*,bool> edgeTreeRet;
- for(i = 0; i<numvertices; i++) edgeTreeIterators[i] = NULL;
-
- //for each vertex
- for(i=0;i<numvertices;i++) {
- vindex = priority[i];
- v = &(vertices[vindex]);
- vindex2 = vindex;
- v2 = v;
-
- //depending on the vertex type, do the appropriate action
- //comments in the following sections are copied from "Computational Geometry: Algorithms and Applications"
- switch(vertextypes[vindex]) {
- case TRIANGULATOR_VERTEXTYPE_START:
- //Insert ei in T and set helper(ei) to vi.
- newedge.p1 = v->p;
- newedge.p2 = vertices[v->next].p;
- newedge.index = vindex;
- edgeTreeIterators[vindex] = edgeTree.insert(newedge);
- helpers[vindex] = vindex;
- break;
-
- case TRIANGULATOR_VERTEXTYPE_END:
- //if helper(ei-1) is a merge vertex
- if(vertextypes[helpers[v->previous]]==TRIANGULATOR_VERTEXTYPE_MERGE) {
- //Insert the diagonal connecting vi to helper(ei-1) in D.
- AddDiagonal(vertices,&newnumvertices,vindex,helpers[v->previous],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- }
- //Delete ei-1 from T
- edgeTree.erase(edgeTreeIterators[v->previous]);
- break;
-
- case TRIANGULATOR_VERTEXTYPE_SPLIT:
- //Search in T to find the edge e j directly left of vi.
- newedge.p1 = v->p;
- newedge.p2 = v->p;
- edgeIter = edgeTree.lower_bound(newedge);
- if(edgeIter == edgeTree.front()) {
- error = true;
- break;
- }
- edgeIter=edgeIter->prev();
- //Insert the diagonal connecting vi to helper(ej) in D.
- AddDiagonal(vertices,&newnumvertices,vindex,helpers[edgeIter->get().index],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- vindex2 = newnumvertices-2;
- v2 = &(vertices[vindex2]);
- //helper(e j)�vi
- helpers[edgeIter->get().index] = vindex;
- //Insert ei in T and set helper(ei) to vi.
- newedge.p1 = v2->p;
- newedge.p2 = vertices[v2->next].p;
- newedge.index = vindex2;
-
- edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
- helpers[vindex2] = vindex2;
- break;
-
- case TRIANGULATOR_VERTEXTYPE_MERGE:
- //if helper(ei-1) is a merge vertex
- if(vertextypes[helpers[v->previous]]==TRIANGULATOR_VERTEXTYPE_MERGE) {
- //Insert the diagonal connecting vi to helper(ei-1) in D.
- AddDiagonal(vertices,&newnumvertices,vindex,helpers[v->previous],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- vindex2 = newnumvertices-2;
- v2 = &(vertices[vindex2]);
- }
- //Delete ei-1 from T.
- edgeTree.erase(edgeTreeIterators[v->previous]);
- //Search in T to find the edge e j directly left of vi.
- newedge.p1 = v->p;
- newedge.p2 = v->p;
- edgeIter = edgeTree.lower_bound(newedge);
- if(edgeIter == edgeTree.front()) {
- error = true;
- break;
- }
- edgeIter=edgeIter->prev();
- //if helper(ej) is a merge vertex
- if(vertextypes[helpers[edgeIter->get().index]]==TRIANGULATOR_VERTEXTYPE_MERGE) {
- //Insert the diagonal connecting vi to helper(e j) in D.
- AddDiagonal(vertices,&newnumvertices,vindex2,helpers[edgeIter->get().index],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- }
- //helper(e j)�vi
- helpers[edgeIter->get().index] = vindex2;
- break;
-
- case TRIANGULATOR_VERTEXTYPE_REGULAR:
- //if the interior of P lies to the right of vi
- if(Below(v->p,vertices[v->previous].p)) {
- //if helper(ei-1) is a merge vertex
- if(vertextypes[helpers[v->previous]]==TRIANGULATOR_VERTEXTYPE_MERGE) {
- //Insert the diagonal connecting vi to helper(ei-1) in D.
- AddDiagonal(vertices,&newnumvertices,vindex,helpers[v->previous],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- vindex2 = newnumvertices-2;
- v2 = &(vertices[vindex2]);
- }
- //Delete ei-1 from T.
- edgeTree.erase(edgeTreeIterators[v->previous]);
- //Insert ei in T and set helper(ei) to vi.
- newedge.p1 = v2->p;
- newedge.p2 = vertices[v2->next].p;
- newedge.index = vindex2;
- edgeTreeIterators[vindex2] = edgeTree.insert(newedge);
- helpers[vindex2] = vindex;
- } else {
- //Search in T to find the edge ej directly left of vi.
- newedge.p1 = v->p;
- newedge.p2 = v->p;
- edgeIter = edgeTree.lower_bound(newedge);
- if(edgeIter == edgeTree.front()) {
- error = true;
- break;
- }
- edgeIter=edgeIter->prev();
- //if helper(ej) is a merge vertex
- if(vertextypes[helpers[edgeIter->get().index]]==TRIANGULATOR_VERTEXTYPE_MERGE) {
- //Insert the diagonal connecting vi to helper(e j) in D.
- AddDiagonal(vertices,&newnumvertices,vindex,helpers[edgeIter->get().index],
- vertextypes, edgeTreeIterators, &edgeTree, helpers);
- }
- //helper(e j)�vi
- helpers[edgeIter->get().index] = vindex;
- }
- break;
- }
-
- if(error) break;
- }
-
- char *used = new char[newnumvertices];
- memset(used,0,newnumvertices*sizeof(char));
-
- if(!error) {
- //return result
- long size;
- TriangulatorPoly mpoly;
- for(i=0;i<newnumvertices;i++) {
- if(used[i]) continue;
- v = &(vertices[i]);
- vnext = &(vertices[v->next]);
- size = 1;
- while(vnext!=v) {
- vnext = &(vertices[vnext->next]);
- size++;
- }
- mpoly.Init(size);
- v = &(vertices[i]);
- mpoly[0] = v->p;
- vnext = &(vertices[v->next]);
- size = 1;
- used[i] = 1;
- used[v->next] = 1;
- while(vnext!=v) {
- mpoly[size] = vnext->p;
- used[vnext->next] = 1;
- vnext = &(vertices[vnext->next]);
- size++;
- }
- monotonePolys->push_back(mpoly);
- }
- }
-
- //cleanup
- delete [] vertices;
- delete [] priority;
- delete [] vertextypes;
- delete [] edgeTreeIterators;
- delete [] helpers;
- delete [] used;
-
- if(error) {
- return 0;
- } else {
- return 1;
- }
-}
-
-//adds a diagonal to the doubly-connected list of vertices
-void TriangulatorPartition::AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
- char *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
- Set<ScanLineEdge> *edgeTree, long *helpers)
-{
- long newindex1,newindex2;
-
- newindex1 = *numvertices;
- (*numvertices)++;
- newindex2 = *numvertices;
- (*numvertices)++;
-
- vertices[newindex1].p = vertices[index1].p;
- vertices[newindex2].p = vertices[index2].p;
-
- vertices[newindex2].next = vertices[index2].next;
- vertices[newindex1].next = vertices[index1].next;
-
- vertices[vertices[index2].next].previous = newindex2;
- vertices[vertices[index1].next].previous = newindex1;
-
- vertices[index1].next = newindex2;
- vertices[newindex2].previous = index1;
-
- vertices[index2].next = newindex1;
- vertices[newindex1].previous = index2;
-
- //update all relevant structures
- vertextypes[newindex1] = vertextypes[index1];
- edgeTreeIterators[newindex1] = edgeTreeIterators[index1];
- helpers[newindex1] = helpers[index1];
- if(edgeTreeIterators[newindex1] != NULL)
- edgeTreeIterators[newindex1]->get().index = newindex1;
- vertextypes[newindex2] = vertextypes[index2];
- edgeTreeIterators[newindex2] = edgeTreeIterators[index2];
- helpers[newindex2] = helpers[index2];
- if(edgeTreeIterators[newindex2] != NULL)
- edgeTreeIterators[newindex2]->get().index = newindex2;
-}
-
-bool TriangulatorPartition::Below(Vector2 &p1, Vector2 &p2) {
- if(p1.y < p2.y) return true;
- else if(p1.y == p2.y) {
- if(p1.x < p2.x) return true;
- }
- return false;
-}
-
-
-
-
-
-//sorts in the falling order of y values, if y is equal, x is used instead
-bool TriangulatorPartition::VertexSorter::operator() (long index1, long index2) const {
- if(vertices[index1].p.y > vertices[index2].p.y) return true;
- else if(vertices[index1].p.y == vertices[index2].p.y) {
- if(vertices[index1].p.x > vertices[index2].p.x) return true;
- }
- return false;
-}
-
-bool TriangulatorPartition::ScanLineEdge::IsConvex(const Vector2& p1, const Vector2& p2, const Vector2& p3) const {
- real_t tmp;
- tmp = (p3.y-p1.y)*(p2.x-p1.x)-(p3.x-p1.x)*(p2.y-p1.y);
- if(tmp>0) return 1;
- else return 0;
-}
-
-bool TriangulatorPartition::ScanLineEdge::operator < (const ScanLineEdge & other) const {
- if(other.p1.y == other.p2.y) {
- if(p1.y == p2.y) {
- if(p1.y < other.p1.y) return true;
- else return false;
- }
- if(IsConvex(p1,p2,other.p1)) return true;
- else return false;
- } else if(p1.y == p2.y) {
- if(IsConvex(other.p1,other.p2,p1)) return false;
- else return true;
- } else if(p1.y < other.p1.y) {
- if(IsConvex(other.p1,other.p2,p1)) return false;
- else return true;
- } else {
- if(IsConvex(p1,p2,other.p1)) return true;
- else return false;
- }
-}
-
-//triangulates monotone polygon
-//O(n) time, O(n) space complexity
-int TriangulatorPartition::TriangulateMonotone(TriangulatorPoly *inPoly, List<TriangulatorPoly> *triangles) {
- long i,i2,j,topindex,bottomindex,leftindex,rightindex,vindex;
- Vector2 *points;
- long numpoints;
- TriangulatorPoly triangle;
-
- numpoints = inPoly->GetNumPoints();
- points = inPoly->GetPoints();
-
- //trivial calses
- if(numpoints < 3) return 0;
- if(numpoints == 3) {
- triangles->push_back(*inPoly);
- }
-
- topindex = 0; bottomindex=0;
- for(i=1;i<numpoints;i++) {
- if(Below(points[i],points[bottomindex])) bottomindex = i;
- if(Below(points[topindex],points[i])) topindex = i;
- }
-
- //check if the poly is really monotone
- i = topindex;
- while(i!=bottomindex) {
- i2 = i+1; if(i2>=numpoints) i2 = 0;
- if(!Below(points[i2],points[i])) return 0;
- i = i2;
- }
- i = bottomindex;
- while(i!=topindex) {
- i2 = i+1; if(i2>=numpoints) i2 = 0;
- if(!Below(points[i],points[i2])) return 0;
- i = i2;
- }
-
- char *vertextypes = new char[numpoints];
- long *priority = new long[numpoints];
-
- //merge left and right vertex chains
- priority[0] = topindex;
- vertextypes[topindex] = 0;
- leftindex = topindex+1; if(leftindex>=numpoints) leftindex = 0;
- rightindex = topindex-1; if(rightindex<0) rightindex = numpoints-1;
- for(i=1;i<(numpoints-1);i++) {
- if(leftindex==bottomindex) {
- priority[i] = rightindex;
- rightindex--; if(rightindex<0) rightindex = numpoints-1;
- vertextypes[priority[i]] = -1;
- } else if(rightindex==bottomindex) {
- priority[i] = leftindex;
- leftindex++; if(leftindex>=numpoints) leftindex = 0;
- vertextypes[priority[i]] = 1;
- } else {
- if(Below(points[leftindex],points[rightindex])) {
- priority[i] = rightindex;
- rightindex--; if(rightindex<0) rightindex = numpoints-1;
- vertextypes[priority[i]] = -1;
- } else {
- priority[i] = leftindex;
- leftindex++; if(leftindex>=numpoints) leftindex = 0;
- vertextypes[priority[i]] = 1;
- }
- }
- }
- priority[i] = bottomindex;
- vertextypes[bottomindex] = 0;
-
- long *stack = new long[numpoints];
- long stackptr = 0;
-
- stack[0] = priority[0];
- stack[1] = priority[1];
- stackptr = 2;
-
- //for each vertex from top to bottom trim as many triangles as possible
- for(i=2;i<(numpoints-1);i++) {
- vindex = priority[i];
- if(vertextypes[vindex]!=vertextypes[stack[stackptr-1]]) {
- for(j=0;j<(stackptr-1);j++) {
- if(vertextypes[vindex]==1) {
- triangle.Triangle(points[stack[j+1]],points[stack[j]],points[vindex]);
- } else {
- triangle.Triangle(points[stack[j]],points[stack[j+1]],points[vindex]);
- }
- triangles->push_back(triangle);
- }
- stack[0] = priority[i-1];
- stack[1] = priority[i];
- stackptr = 2;
- } else {
- stackptr--;
- while(stackptr>0) {
- if(vertextypes[vindex]==1) {
- if(IsConvex(points[vindex],points[stack[stackptr-1]],points[stack[stackptr]])) {
- triangle.Triangle(points[vindex],points[stack[stackptr-1]],points[stack[stackptr]]);
- triangles->push_back(triangle);
- stackptr--;
- } else {
- break;
- }
- } else {
- if(IsConvex(points[vindex],points[stack[stackptr]],points[stack[stackptr-1]])) {
- triangle.Triangle(points[vindex],points[stack[stackptr]],points[stack[stackptr-1]]);
- triangles->push_back(triangle);
- stackptr--;
- } else {
- break;
- }
- }
- }
- stackptr++;
- stack[stackptr] = vindex;
- stackptr++;
- }
- }
- vindex = priority[i];
- for(j=0;j<(stackptr-1);j++) {
- if(vertextypes[stack[j+1]]==1) {
- triangle.Triangle(points[stack[j]],points[stack[j+1]],points[vindex]);
- } else {
- triangle.Triangle(points[stack[j+1]],points[stack[j]],points[vindex]);
- }
- triangles->push_back(triangle);
- }
-
- delete [] priority;
- delete [] vertextypes;
- delete [] stack;
-
- return 1;
-}
-
-int TriangulatorPartition::Triangulate_MONO(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *triangles) {
- List<TriangulatorPoly> monotone;
- List<TriangulatorPoly>::Element* iter;
-
- if(!MonotonePartition(inpolys,&monotone)) return 0;
- for(iter = monotone.front(); iter;iter=iter->next()) {
- if(!TriangulateMonotone(&(iter->get()),triangles)) return 0;
- }
- return 1;
-}
-
-int TriangulatorPartition::Triangulate_MONO(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles) {
- List<TriangulatorPoly> polys;
- polys.push_back(*poly);
-
- return Triangulate_MONO(&polys, triangles);
-}
diff --git a/thirdparty/misc/triangulator.h b/thirdparty/misc/triangulator.h
deleted file mode 100644
index 24b79e7d34..0000000000
--- a/thirdparty/misc/triangulator.h
+++ /dev/null
@@ -1,306 +0,0 @@
-//Copyright (C) 2011 by Ivan Fratric
-//
-//Permission is hereby granted, free of charge, to any person obtaining a copy
-//of this software and associated documentation files (the "Software"), to deal
-//in the Software without restriction, including without limitation the rights
-//to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
-//copies of the Software, and to permit persons to whom the Software is
-//furnished to do so, subject to the following conditions:
-//
-//The above copyright notice and this permission notice shall be included in
-//all copies or substantial portions of the Software.
-//
-//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-//IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-//FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-//AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-//LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
-//OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
-//THE SOFTWARE.
-
-#ifndef TRIANGULATOR_H
-#define TRIANGULATOR_H
-
-#include "core/templates/list.h"
-#include "core/math/vector2.h"
-#include "core/templates/set.h"
-
-//2D point structure
-
-#define TRIANGULATOR_CCW 1
-#define TRIANGULATOR_CW -1
-//Polygon implemented as an array of points with a 'hole' flag
-class TriangulatorPoly {
-protected:
-
-
-
- Vector2 *points;
- long numpoints;
- bool hole;
-
-public:
-
- //constructors/destructors
- TriangulatorPoly();
- ~TriangulatorPoly();
-
- TriangulatorPoly(const TriangulatorPoly &src);
- TriangulatorPoly& operator=(const TriangulatorPoly &src);
-
- //getters and setters
- long GetNumPoints() {
- return numpoints;
- }
-
- bool IsHole() {
- return hole;
- }
-
- void SetHole(bool hole) {
- this->hole = hole;
- }
-
- Vector2 &GetPoint(long i) {
- return points[i];
- }
-
- Vector2 *GetPoints() {
- return points;
- }
-
- Vector2& operator[] (int i) {
- return points[i];
- }
-
- //clears the polygon points
- void Clear();
-
- //inits the polygon with numpoints vertices
- void Init(long numpoints);
-
- //creates a triangle with points p1,p2,p3
- void Triangle(Vector2 &p1, Vector2 &p2, Vector2 &p3);
-
- //inverts the orfer of vertices
- void Invert();
-
- //returns the orientation of the polygon
- //possible values:
- // Triangulator_CCW : polygon vertices are in counter-clockwise order
- // Triangulator_CW : polygon vertices are in clockwise order
- // 0 : the polygon has no (measurable) area
- int GetOrientation();
-
- //sets the polygon orientation
- //orientation can be
- // Triangulator_CCW : sets vertices in counter-clockwise order
- // Triangulator_CW : sets vertices in clockwise order
- void SetOrientation(int orientation);
-};
-
-class TriangulatorPartition {
-protected:
- struct PartitionVertex {
- bool isActive;
- bool isConvex;
- bool isEar;
-
- Vector2 p;
- real_t angle;
- PartitionVertex *previous;
- PartitionVertex *next;
- };
-
- struct MonotoneVertex {
- Vector2 p;
- long previous;
- long next;
- };
-
- struct VertexSorter{
- mutable MonotoneVertex *vertices;
- bool operator() (long index1, long index2) const;
- };
-
- struct Diagonal {
- long index1;
- long index2;
- };
-
- //dynamic programming state for minimum-weight triangulation
- struct DPState {
- bool visible;
- real_t weight;
- long bestvertex;
- };
-
- //dynamic programming state for convex partitioning
- struct DPState2 {
- bool visible;
- long weight;
- List<Diagonal> pairs;
- };
-
- //edge that intersects the scanline
- struct ScanLineEdge {
- mutable long index;
- Vector2 p1;
- Vector2 p2;
-
- //determines if the edge is to the left of another edge
- bool operator< (const ScanLineEdge & other) const;
-
- bool IsConvex(const Vector2& p1, const Vector2& p2, const Vector2& p3) const;
- };
-
- //standard helper functions
- bool IsConvex(Vector2& p1, Vector2& p2, Vector2& p3);
- bool IsReflex(Vector2& p1, Vector2& p2, Vector2& p3);
- bool IsInside(Vector2& p1, Vector2& p2, Vector2& p3, Vector2 &p);
-
- bool InCone(Vector2 &p1, Vector2 &p2, Vector2 &p3, Vector2 &p);
- bool InCone(PartitionVertex *v, Vector2 &p);
-
- int Intersects(Vector2 &p11, Vector2 &p12, Vector2 &p21, Vector2 &p22);
-
- Vector2 Normalize(const Vector2 &p);
- real_t Distance(const Vector2 &p1, const Vector2 &p2);
-
- //helper functions for Triangulate_EC
- void UpdateVertexReflexity(PartitionVertex *v);
- void UpdateVertex(PartitionVertex *v,PartitionVertex *vertices, long numvertices);
-
- //helper functions for ConvexPartition_OPT
- void UpdateState(long a, long b, long w, long i, long j, DPState2 **dpstates);
- void TypeA(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates);
- void TypeB(long i, long j, long k, PartitionVertex *vertices, DPState2 **dpstates);
-
- //helper functions for MonotonePartition
- bool Below(Vector2 &p1, Vector2 &p2);
- void AddDiagonal(MonotoneVertex *vertices, long *numvertices, long index1, long index2,
- char *vertextypes, Set<ScanLineEdge>::Element **edgeTreeIterators,
- Set<ScanLineEdge> *edgeTree, long *helpers);
-
- //triangulates a monotone polygon, used in Triangulate_MONO
- int TriangulateMonotone(TriangulatorPoly *inPoly, List<TriangulatorPoly> *triangles);
-
-public:
-
- //simple heuristic procedure for removing holes from a list of polygons
- //works by creating a diagonal from the rightmost hole vertex to some visible vertex
- //time complexity: O(h*(n^2)), h is the number of holes, n is the number of vertices
- //space complexity: O(n)
- //params:
- // inpolys : a list of polygons that can contain holes
- // vertices of all non-hole polys have to be in counter-clockwise order
- // vertices of all hole polys have to be in clockwise order
- // outpolys : a list of polygons without holes
- //returns 1 on success, 0 on failure
- int RemoveHoles(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *outpolys);
-
- //triangulates a polygon by ear clipping
- //time complexity O(n^2), n is the number of vertices
- //space complexity: O(n)
- //params:
- // poly : an input polygon to be triangulated
- // vertices have to be in counter-clockwise order
- // triangles : a list of triangles (result)
- //returns 1 on success, 0 on failure
- int Triangulate_EC(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles);
-
- //triangulates a list of polygons that may contain holes by ear clipping algorithm
- //first calls RemoveHoles to get rid of the holes, and then Triangulate_EC for each resulting polygon
- //time complexity: O(h*(n^2)), h is the number of holes, n is the number of vertices
- //space complexity: O(n)
- //params:
- // inpolys : a list of polygons to be triangulated (can contain holes)
- // vertices of all non-hole polys have to be in counter-clockwise order
- // vertices of all hole polys have to be in clockwise order
- // triangles : a list of triangles (result)
- //returns 1 on success, 0 on failure
- int Triangulate_EC(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *triangles);
-
- //creates an optimal polygon triangulation in terms of minimal edge length
- //time complexity: O(n^3), n is the number of vertices
- //space complexity: O(n^2)
- //params:
- // poly : an input polygon to be triangulated
- // vertices have to be in counter-clockwise order
- // triangles : a list of triangles (result)
- //returns 1 on success, 0 on failure
- int Triangulate_OPT(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles);
-
- //triangulates a polygons by firstly partitioning it into monotone polygons
- //time complexity: O(n*log(n)), n is the number of vertices
- //space complexity: O(n)
- //params:
- // poly : an input polygon to be triangulated
- // vertices have to be in counter-clockwise order
- // triangles : a list of triangles (result)
- //returns 1 on success, 0 on failure
- int Triangulate_MONO(TriangulatorPoly *poly, List<TriangulatorPoly> *triangles);
-
- //triangulates a list of polygons by firstly partitioning them into monotone polygons
- //time complexity: O(n*log(n)), n is the number of vertices
- //space complexity: O(n)
- //params:
- // inpolys : a list of polygons to be triangulated (can contain holes)
- // vertices of all non-hole polys have to be in counter-clockwise order
- // vertices of all hole polys have to be in clockwise order
- // triangles : a list of triangles (result)
- //returns 1 on success, 0 on failure
- int Triangulate_MONO(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *triangles);
-
- //creates a monotone partition of a list of polygons that can contain holes
- //time complexity: O(n*log(n)), n is the number of vertices
- //space complexity: O(n)
- //params:
- // inpolys : a list of polygons to be triangulated (can contain holes)
- // vertices of all non-hole polys have to be in counter-clockwise order
- // vertices of all hole polys have to be in clockwise order
- // monotonePolys : a list of monotone polygons (result)
- //returns 1 on success, 0 on failure
- int MonotonePartition(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *monotonePolys);
-
- //partitions a polygon into convex polygons by using Hertel-Mehlhorn algorithm
- //the algorithm gives at most four times the number of parts as the optimal algorithm
- //however, in practice it works much better than that and often gives optimal partition
- //uses triangulation obtained by ear clipping as intermediate result
- //time complexity O(n^2), n is the number of vertices
- //space complexity: O(n)
- //params:
- // poly : an input polygon to be partitioned
- // vertices have to be in counter-clockwise order
- // parts : resulting list of convex polygons
- //returns 1 on success, 0 on failure
- int ConvexPartition_HM(TriangulatorPoly *poly, List<TriangulatorPoly> *parts);
-
- //partitions a list of polygons into convex parts by using Hertel-Mehlhorn algorithm
- //the algorithm gives at most four times the number of parts as the optimal algorithm
- //however, in practice it works much better than that and often gives optimal partition
- //uses triangulation obtained by ear clipping as intermediate result
- //time complexity O(n^2), n is the number of vertices
- //space complexity: O(n)
- //params:
- // inpolys : an input list of polygons to be partitioned
- // vertices of all non-hole polys have to be in counter-clockwise order
- // vertices of all hole polys have to be in clockwise order
- // parts : resulting list of convex polygons
- //returns 1 on success, 0 on failure
- int ConvexPartition_HM(List<TriangulatorPoly> *inpolys, List<TriangulatorPoly> *parts);
-
- //optimal convex partitioning (in terms of number of resulting convex polygons)
- //using the Keil-Snoeyink algorithm
- //M. Keil, J. Snoeyink, "On the time bound for convex decomposition of simple polygons", 1998
- //time complexity O(n^3), n is the number of vertices
- //space complexity: O(n^3)
- // poly : an input polygon to be partitioned
- // vertices have to be in counter-clockwise order
- // parts : resulting list of convex polygons
- //returns 1 on success, 0 on failure
- int ConvexPartition_OPT(TriangulatorPoly *poly, List<TriangulatorPoly> *parts);
-};
-
-
-#endif