diff options
701 files changed, 15203 insertions, 9034 deletions
diff --git a/.github/CODEOWNERS b/.github/CODEOWNERS index 33ec541bc7..e08c8bf9de 100644 --- a/.github/CODEOWNERS +++ b/.github/CODEOWNERS @@ -31,7 +31,7 @@ doc_classes/* @godotengine/documentation /modules/csg/ @BastiaanOlij /modules/enet/ @godotengine/network /modules/gdnative/*arvr/ @BastiaanOlij -/modules/gdscript/ @vnen @bojidar-bg +/modules/gdscript/ @vnen /modules/mbedtls/ @godotengine/network /modules/mobile_vr/ @BastiaanOlij /modules/mono/ @neikeq diff --git a/.github/workflows/android_builds.yml b/.github/workflows/android_builds.yml index 1c9a8f7f03..3ce3765efc 100644 --- a/.github/workflows/android_builds.yml +++ b/.github/workflows/android_builds.yml @@ -1,9 +1,10 @@ name: 🤖 Android Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=android verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_LIMIT: 4096 jobs: @@ -22,20 +23,10 @@ jobs: sudo cp -f misc/ci/sources.list /etc/apt/sources.list sudo apt-get update - # Install all packages (except scons) - - name: Configure dependencies - run: | - sudo apt-get install openjdk-8-jdk - echo "::set-env name=JAVA_HOME::usr/lib/jvm/java-8-openjdk-amd64" - - - name: Install Android SDK and NDK - run: | - echo "::set-env name=PATH::/usr/lib/jvm/java-8-openjdk-amd64/jre/bin:${PATH}" - java -version - echo "::set-env name=ANDROID_HOME::$(pwd)/godot-dev/build-tools/android-sdk" - echo "::set-env name=ANDROID_NDK_ROOT::$(pwd)/godot-dev/build-tools/android-ndk" - misc/ci/android-tools-linux.sh - source ~/.bashrc + - name: Set up Java 8 + uses: actions/setup-java@v1 + with: + java-version: 8 # Upload cache on completion and check it out now - name: Load .scons_cache directory @@ -58,7 +49,6 @@ jobs: # Optional - x64 or x86 architecture, defaults to x64 architecture: 'x64' - # You can test your matrix by printing the current Python version - name: Configuring Python packages run: | python -c "import sys; print(sys.version)" @@ -69,5 +59,17 @@ jobs: - name: Compilation env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ + ANDROID_NDK_ROOT: /usr/local/lib/android/sdk/ndk-bundle run: | - scons -j2 verbose=yes warnings=all werror=yes platform=android target=release tools=no + scons target=release tools=no android_arch=armv7 + scons target=release tools=no android_arch=arm64v8 + cd platform/android/java + ./gradlew generateGodotTemplates + cd ../../.. + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/.github/workflows/ios_builds.yml b/.github/workflows/ios_builds.yml index e6770d384a..80db5d68ce 100644 --- a/.github/workflows/ios_builds.yml +++ b/.github/workflows/ios_builds.yml @@ -1,9 +1,10 @@ name: 🍏 iOS Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=iphone verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_LIMIT: 4096 jobs: @@ -47,4 +48,11 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=iphone target=release tools=no + scons target=release tools=no + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/.github/workflows/javascript_builds.disabled b/.github/workflows/javascript_builds.disabled index c3c51209bd..8ed77726cc 100644 --- a/.github/workflows/javascript_builds.disabled +++ b/.github/workflows/javascript_builds.disabled @@ -1,9 +1,10 @@ name: 🌐 JavaScript Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=javascript verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_LIMIT: 4096 EM_VERSION: 1.39.20 EM_CACHE_FOLDER: 'emsdk-cache' @@ -74,4 +75,11 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=javascript target=release tools=no use_closure_compiler=yes + scons target=release tools=no use_closure_compiler=yes + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/.github/workflows/linux_builds.yml b/.github/workflows/linux_builds.yml index 436671dd95..b81c06e54d 100644 --- a/.github/workflows/linux_builds.yml +++ b/.github/workflows/linux_builds.yml @@ -1,13 +1,14 @@ name: 🐧 Linux Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=linuxbsd verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_LIMIT: 4096 jobs: - linux-editor: + linux-editor-mono: runs-on: "ubuntu-20.04" name: Editor w/ Mono (target=release_debug, tools=yes, tests=yes) @@ -61,13 +62,20 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd tools=yes tests=yes target=release_debug module_mono_enabled=yes mono_glue=no + scons tools=yes tests=yes target=release_debug module_mono_enabled=yes mono_glue=no + ls -l bin/ # Execute unit tests for the editor - name: Unit Tests run: | ./bin/godot.linuxbsd.opt.tools.64.mono --test + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 + linux-editor-sanitizers: runs-on: "ubuntu-20.04" name: Editor with sanitizers (target=debug, tools=yes, tests=yes, use_asan=yes, use_ubsan=yes) @@ -90,7 +98,7 @@ jobs: # Upload cache on completion and check it out now - name: Load .scons_cache directory - id: linux-editor-cache + id: linux-sanitizers-cache uses: actions/cache@v2 with: path: ${{github.workspace}}/.scons_cache/ @@ -122,14 +130,15 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd tools=yes tests=yes target=debug use_asan=yes use_ubsan=yes + scons tools=yes tests=yes target=debug use_asan=yes use_ubsan=yes + ls -l bin/ # Execute unit tests for the editor - name: Unit Tests run: | ./bin/godot.linuxbsd.tools.64s --test - linux-template: + linux-template-mono: runs-on: "ubuntu-20.04" name: Template w/ Mono (target=release, tools=no) @@ -182,4 +191,11 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd target=release tools=no module_mono_enabled=yes mono_glue=no + scons target=release tools=no module_mono_enabled=yes mono_glue=no debug_symbols=no + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/.github/workflows/macos_builds.yml b/.github/workflows/macos_builds.yml index 74b57adaeb..5f9ad24ac7 100644 --- a/.github/workflows/macos_builds.yml +++ b/.github/workflows/macos_builds.yml @@ -1,9 +1,10 @@ name: 🍎 macOS Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=osx verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_LIMIT: 4096 jobs: @@ -49,13 +50,20 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=osx tools=yes tests=yes target=release_debug + scons tools=yes tests=yes target=release_debug + ls -l bin/ # Execute unit tests for the editor - name: Unit Tests run: | ./bin/godot.osx.opt.tools.64 --test + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 + macos-template: runs-on: "macos-latest" name: Template (target=release, tools=no) @@ -96,4 +104,11 @@ jobs: env: SCONS_CACHE: ${{github.workspace}}/.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=osx target=release tools=no + scons target=release tools=no debug_symbols=no + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/.github/workflows/windows_builds.yml b/.github/workflows/windows_builds.yml index a2fa4cc7c8..71a1b580b1 100644 --- a/.github/workflows/windows_builds.yml +++ b/.github/workflows/windows_builds.yml @@ -1,10 +1,11 @@ name: 🏁 Windows Builds on: [push, pull_request] -# Global Cache Settings +# Global Settings # SCONS_CACHE for windows must be set in the build environment env: GODOT_BASE_BRANCH: master + SCONSFLAGS: platform=windows verbose=yes warnings=all werror=yes --jobs=2 SCONS_CACHE_MSVC_CONFIG: true SCONS_CACHE_LIMIT: 4096 @@ -54,21 +55,19 @@ jobs: env: SCONS_CACHE: /.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=windows tools=yes tests=yes target=release_debug + scons tools=yes tests=yes target=release_debug + ls -l bin/ # Execute unit tests for the editor - name: Unit Tests run: | ./bin/godot.windows.opt.tools.64.exe --test -# Build Product Upload (tested and working) -# sorry this is disabled until github can give us some more space as we would hit our limit very quickly -# tested this code and it works fine so just enable it to get them back -# - name: publishing godot windows-editor -# uses: actions/upload-artifact@v1 -# with: -# name: windows-editor (x64) -# path: bin/godot.windows.opt.tools.64.exe + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 windows-template: runs-on: "windows-latest" @@ -111,13 +110,11 @@ jobs: env: SCONS_CACHE: /.scons_cache/ run: | - scons -j2 verbose=yes warnings=all werror=yes platform=windows target=release tools=no - -# Build Product Upload (tested and working) -# sorry this is disabled until github can give us some more space as we would hit our limit very quickly -# tested this code and it works fine so just enable it to get them back -# - name: publishing godot windows-template -# uses: actions/upload-artifact@v1 -# with: -# name: windows-template (x64) -# path: bin/godot.windows.opt.64.exe + scons target=release tools=no debug_symbols=no + ls -l bin/ + + - uses: actions/upload-artifact@v2 + with: + name: ${{ github.job }} + path: bin/* + retention-days: 14 diff --git a/core/SCsub b/core/SCsub index 59fe63b4b3..b9f06d12ae 100644 --- a/core/SCsub +++ b/core/SCsub @@ -3,7 +3,6 @@ Import("env") import core_builders -import make_binders env.core_sources = [] @@ -87,11 +86,7 @@ if env["builtin_zlib"]: # Minizip library, could be unbundled in theory # However, our version has some custom modifications, so it won't compile with the system one thirdparty_minizip_dir = "#thirdparty/minizip/" -thirdparty_minizip_sources = [ - "ioapi.c", - "unzip.c", - "zip.c", -] +thirdparty_minizip_sources = ["ioapi.c", "unzip.c", "zip.c"] thirdparty_minizip_sources = [thirdparty_minizip_dir + file for file in thirdparty_minizip_sources] env_thirdparty.add_source_files(env.core_sources, thirdparty_minizip_sources) @@ -152,27 +147,16 @@ env.CommandNoCache( env.Run(core_builders.make_certs_header, "Building ca-certificates header."), ) -# Make binders -env.CommandNoCache( - ["method_bind.gen.inc", "method_bind_ext.gen.inc", "method_bind_free_func.gen.inc"], - "make_binders.py", - env.Run(make_binders.run, "Generating method binders."), -) - # Authors env.Depends("#core/authors.gen.h", "../AUTHORS.md") env.CommandNoCache( - "#core/authors.gen.h", - "../AUTHORS.md", - env.Run(core_builders.make_authors_header, "Generating authors header."), + "#core/authors.gen.h", "../AUTHORS.md", env.Run(core_builders.make_authors_header, "Generating authors header.") ) # Donors env.Depends("#core/donors.gen.h", "../DONORS.md") env.CommandNoCache( - "#core/donors.gen.h", - "../DONORS.md", - env.Run(core_builders.make_donors_header, "Generating donors header."), + "#core/donors.gen.h", "../DONORS.md", env.Run(core_builders.make_donors_header, "Generating donors header.") ) # License diff --git a/core/array.cpp b/core/array.cpp index d1c0688e63..c6e90d71ec 100644 --- a/core/array.cpp +++ b/core/array.cpp @@ -31,8 +31,8 @@ #include "array.h" #include "container_type_validate.h" +#include "core/class_db.h" #include "core/hashfuncs.h" -#include "core/object.h" #include "core/script_language.h" #include "core/variant.h" #include "core/vector.h" @@ -330,9 +330,8 @@ struct _ArrayVariantSort { } }; -Array &Array::sort() { +void Array::sort() { _p->array.sort_custom<_ArrayVariantSort>(); - return *this; } struct _ArrayVariantSortCustom { @@ -349,14 +348,13 @@ struct _ArrayVariantSortCustom { return res; } }; -Array &Array::sort_custom(Object *p_obj, const StringName &p_function) { - ERR_FAIL_NULL_V(p_obj, *this); +void Array::sort_custom(Object *p_obj, const StringName &p_function) { + ERR_FAIL_NULL(p_obj); SortArray<Variant, _ArrayVariantSortCustom, true> avs; avs.compare.obj = p_obj; avs.compare.func = p_function; avs.sort(_p->array.ptrw(), _p->array.size()); - return *this; } void Array::shuffle() { @@ -415,9 +413,8 @@ int Array::bsearch_custom(const Variant &p_value, Object *p_obj, const StringNam return bisect(_p->array, p_value, p_before, less); } -Array &Array::invert() { +void Array::invert() { _p->array.invert(); - return *this; } void Array::push_front(const Variant &p_value) { diff --git a/core/array.h b/core/array.h index d2e0537ad5..34367088e4 100644 --- a/core/array.h +++ b/core/array.h @@ -75,12 +75,12 @@ public: Variant front() const; Variant back() const; - Array &sort(); - Array &sort_custom(Object *p_obj, const StringName &p_function); + void sort(); + void sort_custom(Object *p_obj, const StringName &p_function); void shuffle(); int bsearch(const Variant &p_value, bool p_before = true); int bsearch_custom(const Variant &p_value, Object *p_obj, const StringName &p_function, bool p_before = true); - Array &invert(); + void invert(); int find(const Variant &p_value, int p_from = 0) const; int rfind(const Variant &p_value, int p_from = -1) const; diff --git a/core/bind/core_bind.cpp b/core/bind/core_bind.cpp index 88e31c56fe..baf5d4b928 100644 --- a/core/bind/core_bind.cpp +++ b/core/bind/core_bind.cpp @@ -1156,10 +1156,6 @@ Vector<Vector3> _Geometry3D::clip_polygon(const Vector<Vector3> &p_points, const return Geometry3D::clip_polygon(p_points, p_plane); } -int _Geometry3D::get_uv84_normal_bit(const Vector3 &p_vector) { - return Geometry3D::get_uv84_normal_bit(p_vector); -} - void _Geometry3D::_bind_methods() { ClassDB::bind_method(D_METHOD("build_box_planes", "extents"), &_Geometry3D::build_box_planes); ClassDB::bind_method(D_METHOD("build_cylinder_planes", "radius", "height", "sides", "axis"), &_Geometry3D::build_cylinder_planes, DEFVAL(Vector3::AXIS_Z)); @@ -1171,8 +1167,6 @@ void _Geometry3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_closest_point_to_segment_uncapped", "point", "s1", "s2"), &_Geometry3D::get_closest_point_to_segment_uncapped); - ClassDB::bind_method(D_METHOD("get_uv84_normal_bit", "normal"), &_Geometry3D::get_uv84_normal_bit); - ClassDB::bind_method(D_METHOD("ray_intersects_triangle", "from", "dir", "a", "b", "c"), &_Geometry3D::ray_intersects_triangle); ClassDB::bind_method(D_METHOD("segment_intersects_triangle", "from", "to", "a", "b", "c"), &_Geometry3D::segment_intersects_triangle); ClassDB::bind_method(D_METHOD("segment_intersects_sphere", "from", "to", "sphere_position", "sphere_radius"), &_Geometry3D::segment_intersects_sphere); diff --git a/core/bind/core_bind.h b/core/bind/core_bind.h index 5c9520d7fe..e75e740cd5 100644 --- a/core/bind/core_bind.h +++ b/core/bind/core_bind.h @@ -344,7 +344,6 @@ public: Vector<Vector3> segment_intersects_sphere(const Vector3 &p_from, const Vector3 &p_to, const Vector3 &p_sphere_pos, real_t p_sphere_radius); Vector<Vector3> segment_intersects_cylinder(const Vector3 &p_from, const Vector3 &p_to, float p_height, float p_radius); Vector<Vector3> segment_intersects_convex(const Vector3 &p_from, const Vector3 &p_to, const Vector<Plane> &p_planes); - int get_uv84_normal_bit(const Vector3 &p_vector); Vector<Vector3> clip_polygon(const Vector<Vector3> &p_points, const Plane &p_plane); diff --git a/core/binder_common.h b/core/binder_common.h new file mode 100644 index 0000000000..0fbfa56230 --- /dev/null +++ b/core/binder_common.h @@ -0,0 +1,657 @@ +/*************************************************************************/ +/* binder_common.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef BINDER_COMMON_H +#define BINDER_COMMON_H + +#include "core/list.h" +#include "core/method_ptrcall.h" +#include "core/object.h" +#include "core/simple_type.h" +#include "core/type_info.h" +#include "core/typedefs.h" +#include "core/variant.h" +#include "core/variant_internal.h" + +#include <stdio.h> + +template <class T> +struct VariantCaster { + static _FORCE_INLINE_ T cast(const Variant &p_variant) { + return p_variant; + } +}; + +template <class T> +struct VariantCaster<T &> { + static _FORCE_INLINE_ T cast(const Variant &p_variant) { + return p_variant; + } +}; + +template <class T> +struct VariantCaster<const T &> { + static _FORCE_INLINE_ T cast(const Variant &p_variant) { + return p_variant; + } +}; + +#ifdef PTRCALL_ENABLED + +#define VARIANT_ENUM_CAST(m_enum) \ + MAKE_ENUM_TYPE_INFO(m_enum) \ + template <> \ + struct VariantCaster<m_enum> { \ + static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \ + return (m_enum)p_variant.operator int(); \ + } \ + }; \ + template <> \ + struct PtrToArg<m_enum> { \ + _FORCE_INLINE_ static m_enum convert(const void *p_ptr) { \ + return m_enum(*reinterpret_cast<const int *>(p_ptr)); \ + } \ + _FORCE_INLINE_ static void encode(m_enum p_val, const void *p_ptr) { \ + *(int *)p_ptr = p_val; \ + } \ + }; + +#else + +#define VARIANT_ENUM_CAST(m_enum) \ + MAKE_ENUM_TYPE_INFO(m_enum) \ + template <> \ + struct VariantCaster<m_enum> { \ + static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \ + return (m_enum)p_variant.operator int(); \ + } \ + }; + +#endif + +// Object enum casts must go here +VARIANT_ENUM_CAST(Object::ConnectFlags); + +VARIANT_ENUM_CAST(Vector3::Axis); + +VARIANT_ENUM_CAST(Error); +VARIANT_ENUM_CAST(Margin); +VARIANT_ENUM_CAST(Corner); +VARIANT_ENUM_CAST(Orientation); +VARIANT_ENUM_CAST(HAlign); +VARIANT_ENUM_CAST(VAlign); +VARIANT_ENUM_CAST(PropertyHint); +VARIANT_ENUM_CAST(PropertyUsageFlags); +VARIANT_ENUM_CAST(Variant::Type); +VARIANT_ENUM_CAST(Variant::Operator); + +template <> +struct VariantCaster<char32_t> { + static _FORCE_INLINE_ char32_t cast(const Variant &p_variant) { + return (char32_t)p_variant.operator int(); + } +}; +#ifdef PTRCALL_ENABLED +template <> +struct PtrToArg<char32_t> { + _FORCE_INLINE_ static char32_t convert(const void *p_ptr) { + return char32_t(*reinterpret_cast<const int *>(p_ptr)); + } + _FORCE_INLINE_ static void encode(char32_t p_val, const void *p_ptr) { + *(int *)p_ptr = p_val; + } +}; +#endif + +template <typename T> +struct VariantObjectClassChecker { + static _FORCE_INLINE_ bool check(const Variant &p_variant) { + return true; + } +}; + +template <> +struct VariantObjectClassChecker<Node *> { + static _FORCE_INLINE_ bool check(const Variant &p_variant) { + Object *obj = p_variant; + Node *node = p_variant; + return node || !obj; + } +}; + +template <> +struct VariantObjectClassChecker<Control *> { + static _FORCE_INLINE_ bool check(const Variant &p_variant) { + Object *obj = p_variant; + Control *control = p_variant; + return control || !obj; + } +}; + +#ifdef DEBUG_METHODS_ENABLED + +template <class T> +struct VariantCasterAndValidate { + static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { + Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; + if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) || + !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) { + r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; + r_error.argument = p_arg_idx; + r_error.expected = argtype; + } + + return VariantCaster<T>::cast(*p_args[p_arg_idx]); + } +}; + +template <class T> +struct VariantCasterAndValidate<T &> { + static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { + Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; + if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) || + !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) { + r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; + r_error.argument = p_arg_idx; + r_error.expected = argtype; + } + + return VariantCaster<T>::cast(*p_args[p_arg_idx]); + } +}; + +template <class T> +struct VariantCasterAndValidate<const T &> { + static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { + Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; + if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) || + !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) { + r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; + r_error.argument = p_arg_idx; + r_error.expected = argtype; + } + + return VariantCaster<T>::cast(*p_args[p_arg_idx]); + } +}; + +#endif // DEBUG_METHODS_ENABLED + +template <class T, class... P, size_t... Is> +void call_with_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) { + r_error.error = Callable::CallError::CALL_OK; + +#ifdef DEBUG_METHODS_ENABLED + (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); +#else + (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); +#endif + (void)(p_args); //avoid warning +} + +template <class T, class... P, size_t... Is> +void call_with_variant_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) { + r_error.error = Callable::CallError::CALL_OK; + +#ifdef DEBUG_METHODS_ENABLED + (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); +#else + (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); +#endif + (void)(p_args); //avoid warning +} + +#ifdef PTRCALL_ENABLED + +template <class T, class... P, size_t... Is> +void call_with_ptr_args_helper(T *p_instance, void (T::*p_method)(P...), const void **p_args, IndexSequence<Is...>) { + (p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...); +} + +template <class T, class... P, size_t... Is> +void call_with_ptr_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const void **p_args, IndexSequence<Is...>) { + (p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_ptr_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const void **p_args, void *r_ret, IndexSequence<Is...>) { + PtrToArg<R>::encode((p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...), r_ret); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_ptr_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const void **p_args, void *r_ret, IndexSequence<Is...>) { + PtrToArg<R>::encode((p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...), r_ret); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_ptr_args_static_retc_helper(T *p_instance, R (*p_method)(T *, P...), const void **p_args, void *r_ret, IndexSequence<Is...>) { + PtrToArg<R>::encode(p_method(p_instance, PtrToArg<P>::convert(p_args[Is])...), r_ret); +} + +#endif // PTRCALL_ENABLED + +template <class T, class... P, size_t... Is> +void call_with_validated_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, IndexSequence<Is...>) { + (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...); +} + +template <class T, class... P, size_t... Is> +void call_with_validated_variant_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, IndexSequence<Is...>) { + (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_validated_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) { + VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...)); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_validated_variant_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) { + VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...)); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_validated_variant_args_static_retc_helper(T *p_instance, R (*p_method)(T *, P...), const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) { + VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, p_method(p_instance, (VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...)); +} + +template <class T, class... P> +void call_with_variant_args(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error) { +#ifdef DEBUG_METHODS_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } + + if ((size_t)p_argcount < sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class... P> +void call_with_variant_args_dv(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error, const Vector<Variant> &default_values) { +#ifdef DEBUG_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount; + + int32_t dvs = default_values.size(); +#ifdef DEBUG_ENABLED + if (missing > dvs) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array + for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) { + if (i < p_argcount) { + args[i] = p_args[i]; + } else { + args[i] = &default_values[i - p_argcount + (dvs - missing)]; + } + } + + call_with_variant_args_helper(p_instance, p_method, args, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class... P> +void call_with_variant_argsc(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Callable::CallError &r_error) { +#ifdef DEBUG_METHODS_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } + + if ((size_t)p_argcount < sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class... P> +void call_with_variant_argsc_dv(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Callable::CallError &r_error, const Vector<Variant> &default_values) { +#ifdef DEBUG_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount; + + int32_t dvs = default_values.size(); +#ifdef DEBUG_ENABLED + if (missing > dvs) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array + for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) { + if (i < p_argcount) { + args[i] = p_args[i]; + } else { + args[i] = &default_values[i - p_argcount + (dvs - missing)]; + } + } + + call_with_variant_argsc_helper(p_instance, p_method, args, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_variant_args_ret_dv(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error, const Vector<Variant> &default_values) { +#ifdef DEBUG_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount; + + int32_t dvs = default_values.size(); +#ifdef DEBUG_ENABLED + if (missing > dvs) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array + for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) { + if (i < p_argcount) { + args[i] = p_args[i]; + } else { + args[i] = &default_values[i - p_argcount + (dvs - missing)]; + } + } + + call_with_variant_args_ret_helper(p_instance, p_method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_variant_args_retc_dv(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error, const Vector<Variant> &default_values) { +#ifdef DEBUG_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount; + + int32_t dvs = default_values.size(); +#ifdef DEBUG_ENABLED + if (missing > dvs) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + + const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array + for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) { + if (i < p_argcount) { + args[i] = p_args[i]; + } else { + args[i] = &default_values[i - p_argcount + (dvs - missing)]; + } + } + + call_with_variant_args_retc_helper(p_instance, p_method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +#ifdef PTRCALL_ENABLED + +template <class T, class... P> +void call_with_ptr_args(T *p_instance, void (T::*p_method)(P...), const void **p_args) { + call_with_ptr_args_helper<T, P...>(p_instance, p_method, p_args, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class... P> +void call_with_ptr_argsc(T *p_instance, void (T::*p_method)(P...) const, const void **p_args) { + call_with_ptr_argsc_helper<T, P...>(p_instance, p_method, p_args, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_ptr_args_ret(T *p_instance, R (T::*p_method)(P...), const void **p_args, void *r_ret) { + call_with_ptr_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_ptr_args_retc(T *p_instance, R (T::*p_method)(P...) const, const void **p_args, void *r_ret) { + call_with_ptr_args_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_ptr_args_static_retc(T *p_instance, R (*p_method)(T *, P...), const void **p_args, void *r_ret) { + call_with_ptr_args_static_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +#endif // PTRCALL_ENABLED + +template <class T, class... P> +void call_with_validated_variant_args(Variant *base, void (T::*p_method)(P...), const Variant **p_args) { + call_with_validated_variant_args_helper<T, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_validated_variant_args_ret(Variant *base, R (T::*p_method)(P...), const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_ret_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_validated_variant_args_retc(Variant *base, R (T::*p_method)(P...) const, const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_retc_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P> +void call_with_validated_variant_args_static_retc(Variant *base, R (*p_method)(T *, P...), const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_static_retc_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{}); +} + +// GCC raises "parameter 'p_args' set but not used" when P = {}, +// it's not clever enough to treat other P values as making this branch valid. +#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wunused-but-set-parameter" +#endif + +#ifdef DEBUG_METHODS_ENABLED + +template <class Q> +void call_get_argument_type_helper(int p_arg, int &index, Variant::Type &type) { + if (p_arg == index) { + type = GetTypeInfo<Q>::VARIANT_TYPE; + } + index++; +} + +template <class... P> +Variant::Type call_get_argument_type(int p_arg) { + Variant::Type type = Variant::NIL; + int index = 0; + // I think rocket science is simpler than modern C++. + using expand_type = int[]; + expand_type a{ 0, (call_get_argument_type_helper<P>(p_arg, index, type), 0)... }; + (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning. + (void)index; // Suppress GCC warning. + return type; +} + +template <class Q> +void call_get_argument_type_info_helper(int p_arg, int &index, PropertyInfo &info) { + if (p_arg == index) { + info = GetTypeInfo<Q>::get_class_info(); + } + index++; +} + +template <class... P> +void call_get_argument_type_info(int p_arg, PropertyInfo &info) { + int index = 0; + // I think rocket science is simpler than modern C++. + using expand_type = int[]; + expand_type a{ 0, (call_get_argument_type_info_helper<P>(p_arg, index, info), 0)... }; + (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning. + (void)index; // Suppress GCC warning. +} + +template <class Q> +void call_get_argument_metadata_helper(int p_arg, int &index, GodotTypeInfo::Metadata &md) { + if (p_arg == index) { + md = GetTypeInfo<Q>::METADATA; + } + index++; +} + +template <class... P> +GodotTypeInfo::Metadata call_get_argument_metadata(int p_arg) { + GodotTypeInfo::Metadata md = GodotTypeInfo::METADATA_NONE; + + int index = 0; + // I think rocket science is simpler than modern C++. + using expand_type = int[]; + expand_type a{ 0, (call_get_argument_metadata_helper<P>(p_arg, index, md), 0)... }; + (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning. + (void)index; + return md; +} + +#else + +template <class... P> +Variant::Type call_get_argument_type(int p_arg) { + return Variant::NIL; +} + +#endif // DEBUG_METHODS_ENABLED + +////////////////////// + +template <class T, class R, class... P, size_t... Is> +void call_with_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) { + r_error.error = Callable::CallError::CALL_OK; + +#ifdef DEBUG_METHODS_ENABLED + r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); +#else + r_ret = (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); +#endif +} + +template <class T, class R, class... P> +void call_with_variant_args_ret(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { +#ifdef DEBUG_METHODS_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } + + if ((size_t)p_argcount < sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + call_with_variant_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_variant_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) { + r_error.error = Callable::CallError::CALL_OK; + +#ifdef DEBUG_METHODS_ENABLED + r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); +#else + r_ret = (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); +#endif + (void)p_args; +} + +template <class T, class R, class... P> +void call_with_variant_args_retc(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { +#ifdef DEBUG_METHODS_ENABLED + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } + + if ((size_t)p_argcount < sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } +#endif + call_with_variant_args_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); +} + +template <class T, class R, class... P, size_t... Is> +void call_with_variant_args_retc_static_helper(T *p_instance, R (*p_method)(T *, P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) { + r_error.error = Callable::CallError::CALL_OK; + +#ifdef DEBUG_METHODS_ENABLED + r_ret = (p_method)(p_instance, VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); +#else + r_ret = (p_method)(p_instance, VariantCaster<P>::cast(*p_args[Is])...); +#endif + + (void)p_args; +} + +#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif + +#endif // BINDER_COMMON_H diff --git a/core/callable.cpp b/core/callable.cpp index b7bdc715f8..c368565687 100644 --- a/core/callable.cpp +++ b/core/callable.cpp @@ -30,6 +30,7 @@ #include "callable.h" +#include "callable_bind.h" #include "core/script_language.h" #include "message_queue.h" #include "object.h" @@ -53,6 +54,18 @@ void Callable::call(const Variant **p_arguments, int p_argcount, Variant &r_retu } } +Callable Callable::bind(const Variant **p_arguments, int p_argcount) const { + Vector<Variant> args; + args.resize(p_argcount); + for (int i = 0; i < p_argcount; i++) { + args.write[i] = *p_arguments[i]; + } + return Callable(memnew(CallableCustomBind(*this, args))); +} +Callable Callable::unbind(int p_argcount) const { + return Callable(memnew(CallableCustomUnbind(*this, p_argcount))); +} + Object *Callable::get_object() const { if (is_null()) { return nullptr; @@ -85,6 +98,18 @@ CallableCustom *Callable::get_custom() const { return custom; } +const Callable *Callable::get_base_comparator() const { + const Callable *comparator = nullptr; + if (is_custom()) { + comparator = custom->get_base_comparator(); + } + if (comparator) { + return comparator; + } else { + return this; + } +} + uint32_t Callable::hash() const { if (is_custom()) { return custom->hash(); @@ -258,6 +283,10 @@ Callable::~Callable() { } } +const Callable *CallableCustom::get_base_comparator() const { + return nullptr; +} + CallableCustom::CallableCustom() { ref_count.init(); } diff --git a/core/callable.h b/core/callable.h index 7fd6b54cf7..936272a681 100644 --- a/core/callable.h +++ b/core/callable.h @@ -80,6 +80,9 @@ public: return method != StringName(); } + Callable bind(const Variant **p_arguments, int p_argcount) const; + Callable unbind(int p_argcount) const; + Object *get_object() const; ObjectID get_object_id() const; StringName get_method() const; @@ -87,6 +90,8 @@ public: uint32_t hash() const; + const Callable *get_base_comparator() const; //used for bind/unbind to do less precise comparisons (ignoring binds) in signal connect/disconnect + bool operator==(const Callable &p_callable) const; bool operator!=(const Callable &p_callable) const; bool operator<(const Callable &p_callable) const; @@ -119,6 +124,7 @@ public: virtual CompareLessFunc get_compare_less_func() const = 0; virtual ObjectID get_object() const = 0; //must always be able to provide an object virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const = 0; + virtual const Callable *get_base_comparator() const; CallableCustom(); virtual ~CallableCustom() {} diff --git a/core/callable_bind.cpp b/core/callable_bind.cpp new file mode 100644 index 0000000000..da08d3ccbd --- /dev/null +++ b/core/callable_bind.cpp @@ -0,0 +1,193 @@ +/*************************************************************************/ +/* callable_bind.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "callable_bind.h" + +////////////////////////////////// + +uint32_t CallableCustomBind::hash() const { + return callable.hash(); +} +String CallableCustomBind::get_as_text() const { + return callable.operator String(); +} + +bool CallableCustomBind::_equal_func(const CallableCustom *p_a, const CallableCustom *p_b) { + const CallableCustomBind *a = (const CallableCustomBind *)p_a; + const CallableCustomBind *b = (const CallableCustomBind *)p_b; + + if (!(a->callable != b->callable)) { + return false; + } + + if (a->binds.size() != b->binds.size()) { + return false; + } + + return true; +} + +bool CallableCustomBind::_less_func(const CallableCustom *p_a, const CallableCustom *p_b) { + const CallableCustomBind *a = (const CallableCustomBind *)p_a; + const CallableCustomBind *b = (const CallableCustomBind *)p_b; + + if (a->callable < b->callable) { + return true; + } else if (b->callable < a->callable) { + return false; + } + + return a->binds.size() < b->binds.size(); +} + +CallableCustom::CompareEqualFunc CallableCustomBind::get_compare_equal_func() const { + return _equal_func; +} +CallableCustom::CompareLessFunc CallableCustomBind::get_compare_less_func() const { + return _less_func; +} +ObjectID CallableCustomBind::get_object() const { + return callable.get_object_id(); +} +const Callable *CallableCustomBind::get_base_comparator() const { + return &callable; +} + +void CallableCustomBind::call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const { + const Variant **args = (const Variant **)alloca(sizeof(const Variant **) * (binds.size() + p_argcount)); + for (int i = 0; i < p_argcount; i++) { + args[i] = (const Variant *)p_arguments[i]; + } + for (int i = 0; i < binds.size(); i++) { + args[i + p_argcount] = (const Variant *)&binds[i]; + } + + callable.call(args, p_argcount + binds.size(), r_return_value, r_call_error); +} + +CallableCustomBind::CallableCustomBind(const Callable &p_callable, const Vector<Variant> &p_binds) { + callable = p_callable; + binds = p_binds; +} + +CallableCustomBind::~CallableCustomBind() { +} + +////////////////////////////////// + +uint32_t CallableCustomUnbind::hash() const { + return callable.hash(); +} +String CallableCustomUnbind::get_as_text() const { + return callable.operator String(); +} + +bool CallableCustomUnbind::_equal_func(const CallableCustom *p_a, const CallableCustom *p_b) { + const CallableCustomUnbind *a = (const CallableCustomUnbind *)p_a; + const CallableCustomUnbind *b = (const CallableCustomUnbind *)p_b; + + if (!(a->callable != b->callable)) { + return false; + } + + if (a->argcount != b->argcount) { + return false; + } + + return true; +} + +bool CallableCustomUnbind::_less_func(const CallableCustom *p_a, const CallableCustom *p_b) { + const CallableCustomUnbind *a = (const CallableCustomUnbind *)p_a; + const CallableCustomUnbind *b = (const CallableCustomUnbind *)p_b; + + if (a->callable < b->callable) { + return true; + } else if (b->callable < a->callable) { + return false; + } + + return a->argcount < b->argcount; +} + +CallableCustom::CompareEqualFunc CallableCustomUnbind::get_compare_equal_func() const { + return _equal_func; +} +CallableCustom::CompareLessFunc CallableCustomUnbind::get_compare_less_func() const { + return _less_func; +} +ObjectID CallableCustomUnbind::get_object() const { + return callable.get_object_id(); +} +const Callable *CallableCustomUnbind::get_base_comparator() const { + return &callable; +} + +void CallableCustomUnbind::call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const { + if (argcount > p_argcount) { + r_call_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_call_error.argument = 0; + r_call_error.expected = argcount; + return; + } + callable.call(p_arguments, p_argcount - argcount, r_return_value, r_call_error); +} + +CallableCustomUnbind::CallableCustomUnbind(const Callable &p_callable, int p_argcount) { + callable = p_callable; + argcount = p_argcount; +} + +CallableCustomUnbind::~CallableCustomUnbind() { +} + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1) { + return p_callable.bind((const Variant **)&p_arg1, 1); +} + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2) { + const Variant *args[2] = { &p_arg1, &p_arg2 }; + return p_callable.bind(args, 2); +} + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3) { + const Variant *args[3] = { &p_arg1, &p_arg2, &p_arg3 }; + return p_callable.bind(args, 3); +} + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4) { + const Variant *args[4] = { &p_arg1, &p_arg2, &p_arg3, &p_arg4 }; + return p_callable.bind(args, 4); +} + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5) { + const Variant *args[5] = { &p_arg1, &p_arg2, &p_arg3, &p_arg4, &p_arg5 }; + return p_callable.bind(args, 5); +} diff --git a/core/callable_bind.h b/core/callable_bind.h new file mode 100644 index 0000000000..21b9228be3 --- /dev/null +++ b/core/callable_bind.h @@ -0,0 +1,85 @@ +/*************************************************************************/ +/* callable_bind.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef CALLABLE_BIND_H +#define CALLABLE_BIND_H + +#include "core/callable.h" +#include "core/variant.h" + +class CallableCustomBind : public CallableCustom { + Callable callable; + Vector<Variant> binds; + + static bool _equal_func(const CallableCustom *p_a, const CallableCustom *p_b); + static bool _less_func(const CallableCustom *p_a, const CallableCustom *p_b); + +public: + //for every type that inherits, these must always be the same for this type + virtual uint32_t hash() const; + virtual String get_as_text() const; + virtual CompareEqualFunc get_compare_equal_func() const; + virtual CompareLessFunc get_compare_less_func() const; + virtual ObjectID get_object() const; //must always be able to provide an object + virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const; + virtual const Callable *get_base_comparator() const; + + CallableCustomBind(const Callable &p_callable, const Vector<Variant> &p_binds); + virtual ~CallableCustomBind(); +}; + +class CallableCustomUnbind : public CallableCustom { + Callable callable; + int argcount; + + static bool _equal_func(const CallableCustom *p_a, const CallableCustom *p_b); + static bool _less_func(const CallableCustom *p_a, const CallableCustom *p_b); + +public: + //for every type that inherits, these must always be the same for this type + virtual uint32_t hash() const; + virtual String get_as_text() const; + virtual CompareEqualFunc get_compare_equal_func() const; + virtual CompareLessFunc get_compare_less_func() const; + virtual ObjectID get_object() const; //must always be able to provide an object + virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const; + virtual const Callable *get_base_comparator() const; + + CallableCustomUnbind(const Callable &p_callable, int p_argcount); + virtual ~CallableCustomUnbind(); +}; + +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1); +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2); +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3); +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4); +Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5); + +#endif // CALLABLE_BIND_H diff --git a/core/callable_method_pointer.h b/core/callable_method_pointer.h index 1bb89e53e1..2007b9f338 100644 --- a/core/callable_method_pointer.h +++ b/core/callable_method_pointer.h @@ -31,6 +31,7 @@ #ifndef CALLABLE_METHOD_POINTER_H #define CALLABLE_METHOD_POINTER_H +#include "core/binder_common.h" #include "core/callable.h" #include "core/hashfuncs.h" #include "core/object.h" @@ -69,94 +70,6 @@ public: virtual uint32_t hash() const; }; -#ifdef DEBUG_METHODS_ENABLED - -template <class T> -struct VariantCasterAndValidate { - static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { - Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; - if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) { - r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; - r_error.argument = p_arg_idx; - r_error.expected = argtype; - } - - return VariantCaster<T>::cast(*p_args[p_arg_idx]); - } -}; - -template <class T> -struct VariantCasterAndValidate<T &> { - static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { - Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; - if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) { - r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; - r_error.argument = p_arg_idx; - r_error.expected = argtype; - } - - return VariantCaster<T>::cast(*p_args[p_arg_idx]); - } -}; - -template <class T> -struct VariantCasterAndValidate<const T &> { - static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) { - Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE; - if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) { - r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; - r_error.argument = p_arg_idx; - r_error.expected = argtype; - } - - return VariantCaster<T>::cast(*p_args[p_arg_idx]); - } -}; - -#endif // DEBUG_METHODS_ENABLED - -// GCC 8 raises "parameter 'p_args' set but not used" here, probably using a -// template version that does not have arguments and thus sees it unused, but -// obviously the template can be used for functions with and without them, and -// the optimizer will get rid of it anyway. -#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) -#pragma GCC diagnostic push -#pragma GCC diagnostic ignored "-Wunused-but-set-parameter" -#endif - -template <class T, class... P, size_t... Is> -void call_with_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) { - r_error.error = Callable::CallError::CALL_OK; - -#ifdef DEBUG_METHODS_ENABLED - (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); -#else - (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); -#endif -} - -#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) -#pragma GCC diagnostic pop -#endif - -template <class T, class... P> -void call_with_variant_args(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error) { -#ifdef DEBUG_METHODS_ENABLED - if ((size_t)p_argcount > sizeof...(P)) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument = sizeof...(P); - return; - } - - if ((size_t)p_argcount < sizeof...(P)) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument = sizeof...(P); - return; - } -#endif - call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{}); -} - template <class T, class... P> class CallableCustomMethodPointer : public CallableCustomMethodPointerBase { struct Data { @@ -212,57 +125,71 @@ Callable create_custom_callable_function_pointer(T *p_instance, // VERSION WITH RETURN -// GCC 8 raises "parameter 'p_args' set but not used" here, probably using a -// template version that does not have arguments and thus sees it unused, but -// obviously the template can be used for functions with and without them, and -// the optimizer will get rid of it anyway. -#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) -#pragma GCC diagnostic push -#pragma GCC diagnostic ignored "-Wunused-but-set-parameter" +template <class T, class R, class... P> +class CallableCustomMethodPointerRet : public CallableCustomMethodPointerBase { + struct Data { + T *instance; +#ifdef DEBUG_ENABLED + uint64_t object_id; #endif + R(T::*method) + (P...); + } data; -template <class T, class R, class... P, size_t... Is> -void call_with_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) { - r_error.error = Callable::CallError::CALL_OK; +public: + virtual ObjectID get_object() const { +#ifdef DEBUG_ENABLED + if (ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr) { + return ObjectID(); + } +#endif + return data.instance->get_instance_id(); + } -#ifdef DEBUG_METHODS_ENABLED - r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...); -#else - (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...); + virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const { +#ifdef DEBUG_ENABLED + ERR_FAIL_COND_MSG(ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr, "Invalid Object id '" + uitos(data.object_id) + "', can't call method."); #endif -} + call_with_variant_args_ret(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error); + } -#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__) -#pragma GCC diagnostic pop + CallableCustomMethodPointerRet(T *p_instance, R (T::*p_method)(P...)) { + zeromem(&data, sizeof(Data)); // Clear beforehand, may have padding bytes. + data.instance = p_instance; +#ifdef DEBUG_ENABLED + data.object_id = p_instance->get_instance_id(); #endif + data.method = p_method; + _setup((uint32_t *)&data, sizeof(Data)); + } +}; template <class T, class R, class... P> -void call_with_variant_args_ret(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { +Callable create_custom_callable_function_pointer(T *p_instance, #ifdef DEBUG_METHODS_ENABLED - if ((size_t)p_argcount > sizeof...(P)) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument = sizeof...(P); - return; - } + const char *p_func_text, +#endif + R (T::*p_method)(P...)) { - if ((size_t)p_argcount < sizeof...(P)) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument = sizeof...(P); - return; - } + typedef CallableCustomMethodPointerRet<T, R, P...> CCMP; // Messes with memnew otherwise. + CCMP *ccmp = memnew(CCMP(p_instance, p_method)); +#ifdef DEBUG_METHODS_ENABLED + ccmp->set_text(p_func_text + 1); // Try to get rid of the ampersand. #endif - call_with_variant_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); + return Callable(ccmp); } +// CONST VERSION WITH RETURN + template <class T, class R, class... P> -class CallableCustomMethodPointerRet : public CallableCustomMethodPointerBase { +class CallableCustomMethodPointerRetC : public CallableCustomMethodPointerBase { struct Data { T *instance; #ifdef DEBUG_ENABLED uint64_t object_id; #endif R(T::*method) - (P...); + (P...) const; } data; public: @@ -279,10 +206,10 @@ public: #ifdef DEBUG_ENABLED ERR_FAIL_COND_MSG(ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr, "Invalid Object id '" + uitos(data.object_id) + "', can't call method."); #endif - call_with_variant_args_ret(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error); + call_with_variant_args_retc(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error); } - CallableCustomMethodPointerRet(T *p_instance, R (T::*p_method)(P...)) { + CallableCustomMethodPointerRetC(T *p_instance, R (T::*p_method)(P...) const) { zeromem(&data, sizeof(Data)); // Clear beforehand, may have padding bytes. data.instance = p_instance; #ifdef DEBUG_ENABLED @@ -298,9 +225,9 @@ Callable create_custom_callable_function_pointer(T *p_instance, #ifdef DEBUG_METHODS_ENABLED const char *p_func_text, #endif - R (T::*p_method)(P...)) { + R (T::*p_method)(P...) const) { - typedef CallableCustomMethodPointerRet<T, R, P...> CCMP; // Messes with memnew otherwise. + typedef CallableCustomMethodPointerRetC<T, R, P...> CCMP; // Messes with memnew otherwise. CCMP *ccmp = memnew(CCMP(p_instance, p_method)); #ifdef DEBUG_METHODS_ENABLED ccmp->set_text(p_func_text + 1); // Try to get rid of the ampersand. diff --git a/core/class_db.cpp b/core/class_db.cpp index 88f1df3457..ad85cd0d62 100644 --- a/core/class_db.cpp +++ b/core/class_db.cpp @@ -1343,7 +1343,7 @@ MethodBind *ClassDB::bind_methodfi(uint32_t p_flags, MethodBind *p_bind, const c defvals.resize(p_defcount); for (int i = 0; i < p_defcount; i++) { - defvals.write[i] = *p_defs[p_defcount - i - 1]; + defvals.write[i] = *p_defs[i]; } p_bind->set_default_arguments(defvals); diff --git a/core/class_db.h b/core/class_db.h index 86ac2aa001..4734b06c7a 100644 --- a/core/class_db.h +++ b/core/class_db.h @@ -36,7 +36,7 @@ #include "core/print_string.h" /** To bind more then 6 parameters include this: - * #include "core/method_bind_ext.gen.inc" + * */ // Makes callable_mp readily available in all classes connecting signals. diff --git a/core/command_queue_mt.cpp b/core/command_queue_mt.cpp index ace210ca2c..a55eed5d3c 100644 --- a/core/command_queue_mt.cpp +++ b/core/command_queue_mt.cpp @@ -31,6 +31,7 @@ #include "command_queue_mt.h" #include "core/os/os.h" +#include "core/project_settings.h" void CommandQueueMT::lock() { mutex.lock(); @@ -71,7 +72,7 @@ CommandQueueMT::SyncSemaphore *CommandQueueMT::_alloc_sync_sem() { bool CommandQueueMT::dealloc_one() { tryagain: - if (dealloc_ptr == write_ptr) { + if (dealloc_ptr == (write_ptr_and_epoch >> 1)) { // The queue is empty return false; } @@ -94,6 +95,10 @@ tryagain: } CommandQueueMT::CommandQueueMT(bool p_sync) { + command_mem_size = GLOBAL_DEF_RST("memory/limits/command_queue/multithreading_queue_size_kb", DEFAULT_COMMAND_MEM_SIZE_KB); + ProjectSettings::get_singleton()->set_custom_property_info("memory/limits/command_queue/multithreading_queue_size_kb", PropertyInfo(Variant::INT, "memory/limits/command_queue/multithreading_queue_size_kb", PROPERTY_HINT_RANGE, "1,4096,1,or_greater")); + command_mem_size *= 1024; + command_mem = (uint8_t *)memalloc(command_mem_size); if (p_sync) { sync = memnew(Semaphore); } diff --git a/core/command_queue_mt.h b/core/command_queue_mt.h index d7a6a5bc43..0e5bc7f369 100644 --- a/core/command_queue_mt.h +++ b/core/command_queue_mt.h @@ -330,15 +330,15 @@ class CommandQueueMT { /***** BASE *******/ enum { - COMMAND_MEM_SIZE_KB = 256, - COMMAND_MEM_SIZE = COMMAND_MEM_SIZE_KB * 1024, + DEFAULT_COMMAND_MEM_SIZE_KB = 256, SYNC_SEMAPHORES = 8 }; - uint8_t *command_mem = (uint8_t *)memalloc(COMMAND_MEM_SIZE); - uint32_t read_ptr = 0; - uint32_t write_ptr = 0; + uint8_t *command_mem = nullptr; + uint32_t read_ptr_and_epoch = 0; + uint32_t write_ptr_and_epoch = 0; uint32_t dealloc_ptr = 0; + uint32_t command_mem_size = 0; SyncSemaphore sync_sems[SYNC_SEMAPHORES]; Mutex mutex; Semaphore *sync = nullptr; @@ -348,7 +348,11 @@ class CommandQueueMT { // alloc size is size+T+safeguard uint32_t alloc_size = ((sizeof(T) + 8 - 1) & ~(8 - 1)) + 8; + // Assert that the buffer is big enough to hold at least two messages. + ERR_FAIL_COND_V(alloc_size * 2 + sizeof(uint32_t) > command_mem_size, nullptr); + tryagain: + uint32_t write_ptr = write_ptr_and_epoch >> 1; if (write_ptr < dealloc_ptr) { // behind dealloc_ptr, check that there is room @@ -362,7 +366,7 @@ class CommandQueueMT { } else { // ahead of dealloc_ptr, check that there is room - if ((COMMAND_MEM_SIZE - write_ptr) < alloc_size + sizeof(uint32_t)) { + if ((command_mem_size - write_ptr) < alloc_size + sizeof(uint32_t)) { // no room at the end, wrap down; if (dealloc_ptr == 0) { // don't want write_ptr to become dealloc_ptr @@ -375,12 +379,17 @@ class CommandQueueMT { } // if this happens, it's a bug - ERR_FAIL_COND_V((COMMAND_MEM_SIZE - write_ptr) < 8, nullptr); + ERR_FAIL_COND_V((command_mem_size - write_ptr) < 8, nullptr); // zero means, wrap to beginning uint32_t *p = (uint32_t *)&command_mem[write_ptr]; - *p = 0; - write_ptr = 0; + *p = 1; + write_ptr_and_epoch = 0 | (1 & ~write_ptr_and_epoch); // Invert epoch. + // See if we can get the thread to run and clear up some more space while we wait. + // This is required if alloc_size * 2 + 4 > COMMAND_MEM_SIZE + if (sync) { + sync->post(); + } goto tryagain; } } @@ -394,6 +403,7 @@ class CommandQueueMT { // allocate the command T *cmd = memnew_placement(&command_mem[write_ptr], T); write_ptr += size; + write_ptr_and_epoch = (write_ptr << 1) | (write_ptr_and_epoch & 1); return cmd; } @@ -419,19 +429,21 @@ class CommandQueueMT { tryagain: // tried to read an empty queue - if (read_ptr == write_ptr) { + if (read_ptr_and_epoch == write_ptr_and_epoch) { if (p_lock) { unlock(); } return false; } + uint32_t read_ptr = read_ptr_and_epoch >> 1; uint32_t size_ptr = read_ptr; uint32_t size = *(uint32_t *)&command_mem[read_ptr] >> 1; if (size == 0) { + *(uint32_t *)&command_mem[read_ptr] = 0; // clear in-use bit. //end of ringbuffer, wrap - read_ptr = 0; + read_ptr_and_epoch = 0 | (1 & ~read_ptr_and_epoch); // Invert epoch. goto tryagain; } @@ -441,6 +453,8 @@ class CommandQueueMT { read_ptr += size; + read_ptr_and_epoch = (read_ptr << 1) | (read_ptr_and_epoch & 1); + if (p_lock) { unlock(); } diff --git a/core/core_string_names.cpp b/core/core_string_names.cpp index 1d3b333efc..6f86f107e6 100644 --- a/core/core_string_names.cpp +++ b/core/core_string_names.cpp @@ -73,6 +73,8 @@ CoreStringNames::CoreStringNames() : a8(StaticCString::create("a8")), call(StaticCString::create("call")), call_deferred(StaticCString::create("call_deferred")), + bind(StaticCString::create("bind")), + unbind(StaticCString::create("unbind")), emit(StaticCString::create("emit")), notification(StaticCString::create("notification")) { } diff --git a/core/core_string_names.h b/core/core_string_names.h index 1a18c84572..43597ef301 100644 --- a/core/core_string_names.h +++ b/core/core_string_names.h @@ -92,6 +92,8 @@ public: StringName call; StringName call_deferred; + StringName bind; + StringName unbind; StringName emit; StringName notification; }; diff --git a/core/debugger/remote_debugger.h b/core/debugger/remote_debugger.h index dc7e4436e1..320ee15996 100644 --- a/core/debugger/remote_debugger.h +++ b/core/debugger/remote_debugger.h @@ -32,10 +32,10 @@ #define REMOTE_DEBUGGER_H #include "core/array.h" +#include "core/class_db.h" #include "core/debugger/debugger_marshalls.h" #include "core/debugger/engine_debugger.h" #include "core/debugger/remote_debugger_peer.h" -#include "core/object.h" #include "core/string_name.h" #include "core/ustring.h" diff --git a/core/global_constants.cpp b/core/global_constants.cpp index b30685539a..064c302341 100644 --- a/core/global_constants.cpp +++ b/core/global_constants.cpp @@ -30,8 +30,8 @@ #include "global_constants.h" +#include "core/class_db.h" #include "core/input/input_event.h" -#include "core/object.h" #include "core/os/keyboard.h" #include "core/variant.h" diff --git a/core/input/input_map.h b/core/input/input_map.h index 548553ed31..755df26984 100644 --- a/core/input/input_map.h +++ b/core/input/input_map.h @@ -31,8 +31,8 @@ #ifndef INPUT_MAP_H #define INPUT_MAP_H +#include "core/class_db.h" #include "core/input/input_event.h" -#include "core/object.h" class InputMap : public Object { GDCLASS(InputMap, Object); diff --git a/core/io/http_client.cpp b/core/io/http_client.cpp index 46e45500bf..a25413b21b 100644 --- a/core/io/http_client.cpp +++ b/core/io/http_client.cpp @@ -96,6 +96,10 @@ Error HTTPClient::connect_to_host(const String &p_host, int p_port, bool p_ssl, void HTTPClient::set_connection(const Ref<StreamPeer> &p_connection) { ERR_FAIL_COND_MSG(p_connection.is_null(), "Connection is not a reference to a valid StreamPeer object."); + if (connection == p_connection) { + return; + } + close(); connection = p_connection; status = STATUS_CONNECTED; diff --git a/core/io/packet_peer.h b/core/io/packet_peer.h index 92cdbc4151..fb4dc181db 100644 --- a/core/io/packet_peer.h +++ b/core/io/packet_peer.h @@ -31,8 +31,8 @@ #ifndef PACKET_PEER_H #define PACKET_PEER_H +#include "core/class_db.h" #include "core/io/stream_peer.h" -#include "core/object.h" #include "core/ring_buffer.h" class PacketPeer : public Reference { diff --git a/core/make_binders.py b/core/make_binders.py deleted file mode 100644 index 7d0d08cde6..0000000000 --- a/core/make_binders.py +++ /dev/null @@ -1,390 +0,0 @@ -# -*- coding: ibm850 -*- - -template_typed = """ -#ifdef TYPED_METHOD_BIND -template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$> -class MethodBind$argc$$ifret R$$ifconst C$ : public MethodBind { -public: - - $ifret R$ $ifnoret void$ (T::*method)($arg, P@$) $ifconst const$; -#ifdef DEBUG_METHODS_ENABLED - virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); } - virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { - $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$ - $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA; - $ - return GodotTypeInfo::METADATA_NONE; - } - Variant::Type _get_argument_type(int p_argument) const { - $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$ - $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE; - $ - return Variant::NIL; - } - virtual PropertyInfo _gen_argument_type_info(int p_argument) const { - $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$ - $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info(); - $ - return PropertyInfo(); - } -#endif - virtual String get_instance_class() const { - return T::get_class_static(); - } - - virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) { - - T *instance=Object::cast_to<T>(p_object); - r_error.error=Callable::CallError::CALL_OK; -#ifdef DEBUG_METHODS_ENABLED - - ERR_FAIL_COND_V(!instance,Variant()); - if (p_arg_count>get_argument_count()) { - r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument=get_argument_count(); - return Variant(); - - } - if (p_arg_count<(get_argument_count()-get_default_argument_count())) { - - r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument=get_argument_count()-get_default_argument_count(); - return Variant(); - } - $arg CHECK_ARG(@); - $ -#endif - $ifret Variant ret = $(instance->*method)($arg, _VC(@)$); - $ifret return Variant(ret);$ - $ifnoret return Variant();$ - } - -#ifdef PTRCALL_ENABLED - virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) { - - T *instance=Object::cast_to<T>(p_object); - $ifret PtrToArg<R>::encode( $ (instance->*method)($arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret)$ ; - } -#endif - MethodBind$argc$$ifret R$$ifconst C$ () { -#ifdef DEBUG_METHODS_ENABLED - _set_const($ifconst true$$ifnoconst false$); - _generate_argument_types($argc$); -#else - set_argument_count($argc$); -#endif - - $ifret _set_returns(true); $ - } -}; - -template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$> -MethodBind* create_method_bind($ifret R$ $ifnoret void$ (T::*p_method)($arg, P@$) $ifconst const$ ) { - - MethodBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$> * a = memnew( (MethodBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$>) ); - a->method=p_method; - return a; -} -#endif -""" - -template = """ -#ifndef TYPED_METHOD_BIND -$iftempl template<$ $ifret class R$ $ifretargs ,$ $arg, class P@$ $iftempl >$ -class MethodBind$argc$$ifret R$$ifconst C$ : public MethodBind { - -public: - - StringName type_name; - $ifret R$ $ifnoret void$ (__UnexistingClass::*method)($arg, P@$) $ifconst const$; - -#ifdef DEBUG_METHODS_ENABLED - virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); } - virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { - $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$ - $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA; - $ - return GodotTypeInfo::METADATA_NONE; - } - - Variant::Type _get_argument_type(int p_argument) const { - $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$ - $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE; - $ - return Variant::NIL; - } - - virtual PropertyInfo _gen_argument_type_info(int p_argument) const { - $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$ - $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info(); - $ - return PropertyInfo(); - } - -#endif - virtual String get_instance_class() const { - return type_name; - } - - virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) { - - __UnexistingClass *instance = (__UnexistingClass*)p_object; - - r_error.error=Callable::CallError::CALL_OK; -#ifdef DEBUG_METHODS_ENABLED - - ERR_FAIL_COND_V(!instance,Variant()); - if (p_arg_count>get_argument_count()) { - r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument=get_argument_count(); - return Variant(); - } - - if (p_arg_count<(get_argument_count()-get_default_argument_count())) { - - r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument=get_argument_count()-get_default_argument_count(); - return Variant(); - } - - $arg CHECK_ARG(@); - $ -#endif - $ifret Variant ret = $(instance->*method)($arg, _VC(@)$); - $ifret return Variant(ret);$ - $ifnoret return Variant();$ - } -#ifdef PTRCALL_ENABLED - virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) { - __UnexistingClass *instance = (__UnexistingClass*)p_object; - $ifret PtrToArg<R>::encode( $ (instance->*method)($arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret) $ ; - } -#endif - MethodBind$argc$$ifret R$$ifconst C$ () { -#ifdef DEBUG_METHODS_ENABLED - _set_const($ifconst true$$ifnoconst false$); - _generate_argument_types($argc$); -#else - set_argument_count($argc$); -#endif - $ifret _set_returns(true); $ - - - } -}; - -template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$> -MethodBind* create_method_bind($ifret R$ $ifnoret void$ (T::*p_method)($arg, P@$) $ifconst const$ ) { - - MethodBind$argc$$ifret R$$ifconst C$ $iftempl <$ $ifret R$ $ifretargs ,$ $arg, P@$ $iftempl >$ * a = memnew( (MethodBind$argc$$ifret R$$ifconst C$ $iftempl <$ $ifret R$ $ifretargs ,$ $arg, P@$ $iftempl >$) ); - union { - - $ifret R$ $ifnoret void$ (T::*sm)($arg, P@$) $ifconst const$; - $ifret R$ $ifnoret void$ (__UnexistingClass::*dm)($arg, P@$) $ifconst const$; - } u; - u.sm=p_method; - a->method=u.dm; - a->type_name=T::get_class_static(); - return a; -} -#endif -""" - - -template_typed_free_func = """ -#ifdef TYPED_METHOD_BIND -template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$> -class FunctionBind$argc$$ifret R$$ifconst C$ : public MethodBind { -public: - - $ifret R$ $ifnoret void$ (*method) ($ifconst const$ T *$ifargs , $$arg, P@$); -#ifdef DEBUG_METHODS_ENABLED - virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); } - virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { - $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$ - $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA; - $ - return GodotTypeInfo::METADATA_NONE; - } - Variant::Type _get_argument_type(int p_argument) const { - $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$ - $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE; - $ - return Variant::NIL; - } - virtual PropertyInfo _gen_argument_type_info(int p_argument) const { - $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$ - $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info(); - $ - return PropertyInfo(); - } -#endif - virtual String get_instance_class() const { - return T::get_class_static(); - } - - virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) { - - T *instance=Object::cast_to<T>(p_object); - r_error.error=Callable::CallError::CALL_OK; -#ifdef DEBUG_METHODS_ENABLED - - ERR_FAIL_COND_V(!instance,Variant()); - if (p_arg_count>get_argument_count()) { - r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument=get_argument_count(); - return Variant(); - - } - if (p_arg_count<(get_argument_count()-get_default_argument_count())) { - - r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument=get_argument_count()-get_default_argument_count(); - return Variant(); - } - $arg CHECK_ARG(@); - $ -#endif - $ifret Variant ret = $(method)(instance$ifargs , $$arg, _VC(@)$); - $ifret return Variant(ret);$ - $ifnoret return Variant();$ - } - -#ifdef PTRCALL_ENABLED - virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) { - - T *instance=Object::cast_to<T>(p_object); - $ifret PtrToArg<R>::encode( $ (method)(instance$ifargs , $$arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret)$ ; - } -#endif - FunctionBind$argc$$ifret R$$ifconst C$ () { -#ifdef DEBUG_METHODS_ENABLED - _set_const($ifconst true$$ifnoconst false$); - _generate_argument_types($argc$); -#else - set_argument_count($argc$); -#endif - - $ifret _set_returns(true); $ - } -}; - -template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$> -MethodBind* create_method_bind($ifret R$ $ifnoret void$ (*p_method)($ifconst const$ T *$ifargs , $$arg, P@$) ) { - - FunctionBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$> * a = memnew( (FunctionBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$>) ); - a->method=p_method; - return a; -} -#endif -""" - - -def make_version(template, nargs, argmax, const, ret): - - intext = template - from_pos = 0 - outtext = "" - - while True: - to_pos = intext.find("$", from_pos) - if to_pos == -1: - outtext += intext[from_pos:] - break - else: - outtext += intext[from_pos:to_pos] - end = intext.find("$", to_pos + 1) - if end == -1: - break # ignore - macro = intext[to_pos + 1 : end] - cmd = "" - data = "" - - if macro.find(" ") != -1: - cmd = macro[0 : macro.find(" ")] - data = macro[macro.find(" ") + 1 :] - else: - cmd = macro - - if cmd == "argc": - outtext += str(nargs) - if cmd == "ifret" and ret: - outtext += data - if cmd == "ifargs" and nargs: - outtext += data - if cmd == "ifretargs" and nargs and ret: - outtext += data - if cmd == "ifconst" and const: - outtext += data - elif cmd == "ifnoconst" and not const: - outtext += data - elif cmd == "ifnoret" and not ret: - outtext += data - elif cmd == "iftempl" and (nargs > 0 or ret): - outtext += data - elif cmd == "arg,": - for i in range(1, nargs + 1): - if i > 1: - outtext += ", " - outtext += data.replace("@", str(i)) - elif cmd == "arg": - for i in range(1, nargs + 1): - outtext += data.replace("@", str(i)) - elif cmd == "noarg": - for i in range(nargs + 1, argmax + 1): - outtext += data.replace("@", str(i)) - - from_pos = end + 1 - - return outtext - - -def run(target, source, env): - - versions = 15 - versions_ext = 6 - text = "" - text_ext = "" - text_free_func = "#ifndef METHOD_BIND_FREE_FUNC_H\n#define METHOD_BIND_FREE_FUNC_H\n" - text_free_func += "\n//including this header file allows method binding to use free functions\n" - text_free_func += ( - "//note that the free function must have a pointer to an instance of the class as its first parameter\n" - ) - - for i in range(0, versions + 1): - - t = "" - t += make_version(template, i, versions, False, False) - t += make_version(template_typed, i, versions, False, False) - t += make_version(template, i, versions, False, True) - t += make_version(template_typed, i, versions, False, True) - t += make_version(template, i, versions, True, False) - t += make_version(template_typed, i, versions, True, False) - t += make_version(template, i, versions, True, True) - t += make_version(template_typed, i, versions, True, True) - if i >= versions_ext: - text_ext += t - else: - text += t - - text_free_func += make_version(template_typed_free_func, i, versions, False, False) - text_free_func += make_version(template_typed_free_func, i, versions, False, True) - text_free_func += make_version(template_typed_free_func, i, versions, True, False) - text_free_func += make_version(template_typed_free_func, i, versions, True, True) - - text_free_func += "#endif" - - with open(target[0], "w") as f: - f.write(text) - - with open(target[1], "w") as f: - f.write(text_ext) - - with open(target[2], "w") as f: - f.write(text_free_func) - - -if __name__ == "__main__": - from platform_methods import subprocess_main - - subprocess_main(globals()) diff --git a/core/math/aabb.cpp b/core/math/aabb.cpp index f5c667dab0..e868ebc7c8 100644 --- a/core/math/aabb.cpp +++ b/core/math/aabb.cpp @@ -31,6 +31,7 @@ #include "aabb.h" #include "core/print_string.h" +#include "core/variant.h" real_t AABB::get_area() const { return size.x * size.y * size.z; @@ -375,6 +376,21 @@ void AABB::get_edge(int p_edge, Vector3 &r_from, Vector3 &r_to) const { } } +Variant AABB::intersects_segment_bind(const Vector3 &p_from, const Vector3 &p_to) const { + Vector3 inters; + if (intersects_segment(p_from, p_to, &inters)) { + return inters; + } + return Variant(); +} +Variant AABB::intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const { + Vector3 inters; + if (intersects_ray(p_from, p_dir, &inters)) { + return inters; + } + return Variant(); +} + AABB::operator String() const { return String() + position + " - " + size; } diff --git a/core/math/aabb.h b/core/math/aabb.h index bd1f3a1a36..8c08754e1c 100644 --- a/core/math/aabb.h +++ b/core/math/aabb.h @@ -39,6 +39,7 @@ * AABB / AABB (Axis Aligned Bounding Box) * This is implemented by a point (position) and the box size */ +class Variant; class AABB { public: @@ -103,6 +104,9 @@ public: return AABB(Vector3(position.x + MIN(size.x, 0), position.y + MIN(size.y, 0), position.z + MIN(size.z, 0)), size.abs()); } + Variant intersects_segment_bind(const Vector3 &p_from, const Vector3 &p_to) const; + Variant intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const; + operator String() const; _FORCE_INLINE_ AABB() {} diff --git a/core/math/geometry_3d.h b/core/math/geometry_3d.h index 6bbf518141..11cac8f108 100644 --- a/core/math/geometry_3d.h +++ b/core/math/geometry_3d.h @@ -636,54 +636,6 @@ public: void optimize_vertices(); }; - _FORCE_INLINE_ static int get_uv84_normal_bit(const Vector3 &p_vector) { - int lat = Math::fast_ftoi(Math::floor(Math::acos(p_vector.dot(Vector3(0, 1, 0))) * 4.0 / Math_PI + 0.5)); - - if (lat == 0) { - return 24; - } else if (lat == 4) { - return 25; - } - - int lon = Math::fast_ftoi(Math::floor((Math_PI + Math::atan2(p_vector.x, p_vector.z)) * 8.0 / (Math_PI * 2.0) + 0.5)) % 8; - - return lon + (lat - 1) * 8; - } - - _FORCE_INLINE_ static int get_uv84_normal_bit_neighbors(int p_idx) { - if (p_idx == 24) { - return 1 | 2 | 4 | 8; - } else if (p_idx == 25) { - return (1 << 23) | (1 << 22) | (1 << 21) | (1 << 20); - } else { - int ret = 0; - if ((p_idx % 8) == 0) { - ret |= (1 << (p_idx + 7)); - } else { - ret |= (1 << (p_idx - 1)); - } - if ((p_idx % 8) == 7) { - ret |= (1 << (p_idx - 7)); - } else { - ret |= (1 << (p_idx + 1)); - } - - int mask = ret | (1 << p_idx); - if (p_idx < 8) { - ret |= 24; - } else { - ret |= mask >> 8; - } - - if (p_idx >= 16) { - ret |= 25; - } else { - ret |= mask << 8; - } - - return ret; - } - } static MeshData build_convex_mesh(const Vector<Plane> &p_planes); static Vector<Plane> build_sphere_planes(real_t p_radius, int p_lats, int p_lons, Vector3::Axis p_axis = Vector3::AXIS_Z); static Vector<Plane> build_box_planes(const Vector3 &p_extents); diff --git a/core/math/plane.cpp b/core/math/plane.cpp index 4200484c59..ae2021d2f6 100644 --- a/core/math/plane.cpp +++ b/core/math/plane.cpp @@ -31,6 +31,7 @@ #include "plane.h" #include "core/math/math_funcs.h" +#include "core/variant.h" void Plane::set_normal(const Vector3 &p_normal) { normal = p_normal; @@ -138,6 +139,31 @@ bool Plane::intersects_segment(const Vector3 &p_begin, const Vector3 &p_end, Vec return true; } +Variant Plane::intersect_3_bind(const Plane &p_plane1, const Plane &p_plane2) const { + Vector3 inters; + if (intersect_3(p_plane1, p_plane2, &inters)) { + return inters; + } else { + return Variant(); + } +} +Variant Plane::intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const { + Vector3 inters; + if (intersects_ray(p_from, p_dir, &inters)) { + return inters; + } else { + return Variant(); + } +} +Variant Plane::intersects_segment_bind(const Vector3 &p_begin, const Vector3 &p_end) const { + Vector3 inters; + if (intersects_segment(p_begin, p_end, &inters)) { + return inters; + } else { + return Variant(); + } +} + /* misc */ bool Plane::is_equal_approx_any_side(const Plane &p_plane) const { diff --git a/core/math/plane.h b/core/math/plane.h index 70a6111edd..1386b0a2cb 100644 --- a/core/math/plane.h +++ b/core/math/plane.h @@ -33,6 +33,8 @@ #include "core/math/vector3.h" +class Variant; + class Plane { public: Vector3 normal; @@ -59,6 +61,11 @@ public: bool intersects_ray(const Vector3 &p_from, const Vector3 &p_dir, Vector3 *p_intersection) const; bool intersects_segment(const Vector3 &p_begin, const Vector3 &p_end, Vector3 *p_intersection) const; + // For Variant bindings. + Variant intersect_3_bind(const Plane &p_plane1, const Plane &p_plane2) const; + Variant intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const; + Variant intersects_segment_bind(const Vector3 &p_begin, const Vector3 &p_end) const; + _FORCE_INLINE_ Vector3 project(const Vector3 &p_point) const { return p_point - normal * distance_to(p_point); } diff --git a/core/math/rect2.h b/core/math/rect2.h index 14393325ec..7660db71eb 100644 --- a/core/math/rect2.h +++ b/core/math/rect2.h @@ -197,6 +197,10 @@ struct Rect2 { return g; } + inline Rect2 grow_margin_bind(uint32_t p_margin, real_t p_amount) const { + return grow_margin(Margin(p_margin), p_amount); + } + inline Rect2 grow_individual(real_t p_left, real_t p_top, real_t p_right, real_t p_bottom) const { Rect2 g = *this; g.position.x -= p_left; @@ -363,6 +367,10 @@ struct Rect2i { return g; } + inline Rect2i grow_margin_bind(uint32_t p_margin, int p_amount) const { + return grow_margin(Margin(p_margin), p_amount); + } + inline Rect2i grow_individual(int p_left, int p_top, int p_right, int p_bottom) const { Rect2i g = *this; g.position.x -= p_left; diff --git a/core/math/vector2.h b/core/math/vector2.h index f41bcc15bc..c2a2656e72 100644 --- a/core/math/vector2.h +++ b/core/math/vector2.h @@ -65,6 +65,14 @@ struct Vector2 { real_t length() const; real_t length_squared() const; + Vector2 min(const Vector2 &p_vector2) const { + return Vector2(MIN(x, p_vector2.x), MIN(y, p_vector2.y)); + } + + Vector2 max(const Vector2 &p_vector2) const { + return Vector2(MAX(x, p_vector2.x), MAX(y, p_vector2.y)); + } + real_t distance_to(const Vector2 &p_vector2) const; real_t distance_squared_to(const Vector2 &p_vector2) const; real_t angle_to(const Vector2 &p_vector2) const; diff --git a/core/message_queue.h b/core/message_queue.h index 710a605371..5d39ceee03 100644 --- a/core/message_queue.h +++ b/core/message_queue.h @@ -31,7 +31,7 @@ #ifndef MESSAGE_QUEUE_H #define MESSAGE_QUEUE_H -#include "core/object.h" +#include "core/class_db.h" #include "core/os/thread_safe.h" class MessageQueue { diff --git a/core/method_bind.h b/core/method_bind.h index 942e2e0036..d43186257b 100644 --- a/core/method_bind.h +++ b/core/method_bind.h @@ -31,18 +31,7 @@ #ifndef METHOD_BIND_H #define METHOD_BIND_H -#ifdef DEBUG_ENABLED -#define DEBUG_METHODS_ENABLED -#endif - -#include "core/list.h" -#include "core/method_ptrcall.h" -#include "core/object.h" -#include "core/type_info.h" -#include "core/typedefs.h" -#include "core/variant.h" - -#include <stdio.h> +#include "core/binder_common.h" enum MethodFlags { @@ -57,151 +46,15 @@ enum MethodFlags { METHOD_FLAGS_DEFAULT = METHOD_FLAG_NORMAL, }; -template <class T> -struct VariantCaster { - static _FORCE_INLINE_ T cast(const Variant &p_variant) { - return p_variant; - } -}; - -template <class T> -struct VariantCaster<T &> { - static _FORCE_INLINE_ T cast(const Variant &p_variant) { - return p_variant; - } -}; - -template <class T> -struct VariantCaster<const T &> { - static _FORCE_INLINE_ T cast(const Variant &p_variant) { - return p_variant; - } -}; - -#define _VC(m_idx) \ - (VariantCaster<P##m_idx>::cast((m_idx - 1) >= p_arg_count ? get_default_argument(m_idx - 1) : *p_args[m_idx - 1])) - -#ifdef PTRCALL_ENABLED - -#define VARIANT_ENUM_CAST(m_enum) \ - MAKE_ENUM_TYPE_INFO(m_enum) \ - template <> \ - struct VariantCaster<m_enum> { \ - static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \ - return (m_enum)p_variant.operator int(); \ - } \ - }; \ - template <> \ - struct PtrToArg<m_enum> { \ - _FORCE_INLINE_ static m_enum convert(const void *p_ptr) { \ - return m_enum(*reinterpret_cast<const int *>(p_ptr)); \ - } \ - _FORCE_INLINE_ static void encode(m_enum p_val, const void *p_ptr) { \ - *(int *)p_ptr = p_val; \ - } \ - }; - -#else - -#define VARIANT_ENUM_CAST(m_enum) \ - MAKE_ENUM_TYPE_INFO(m_enum) \ - template <> \ - struct VariantCaster<m_enum> { \ - static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \ - return (m_enum)p_variant.operator int(); \ - } \ - }; - -#endif - -// Object enum casts must go here -VARIANT_ENUM_CAST(Object::ConnectFlags); - -template <typename T> -struct VariantObjectClassChecker { - static _FORCE_INLINE_ bool check(const Variant &p_variant) { - return true; - } -}; - -template <> -struct VariantObjectClassChecker<Node *> { - static _FORCE_INLINE_ bool check(const Variant &p_variant) { - Object *obj = p_variant; - Node *node = p_variant; - return node || !obj; - } -}; - -template <> -struct VariantObjectClassChecker<Control *> { - static _FORCE_INLINE_ bool check(const Variant &p_variant) { - Object *obj = p_variant; - Control *control = p_variant; - return control || !obj; - } -}; - -#define CHECK_ARG(m_arg) \ - if ((m_arg - 1) < p_arg_count) { \ - Variant::Type argtype = get_argument_type(m_arg - 1); \ - if (!Variant::can_convert_strict(p_args[m_arg - 1]->get_type(), argtype) || \ - !VariantObjectClassChecker<P##m_arg>::check(*p_args[m_arg - 1])) { \ - r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; \ - r_error.argument = m_arg - 1; \ - r_error.expected = argtype; \ - return Variant(); \ - } \ - } - -#define CHECK_NOARG(m_arg) \ - { \ - if (p_arg##m_arg.get_type() != Variant::NIL) { \ - if (r_argerror) { \ - *r_argerror = (m_arg - 1); \ - } \ - return CALL_ERROR_EXTRA_ARGUMENT; \ - } \ - } +VARIANT_ENUM_CAST(MethodFlags) // some helpers -VARIANT_ENUM_CAST(Vector3::Axis); - -VARIANT_ENUM_CAST(Error); -VARIANT_ENUM_CAST(Margin); -VARIANT_ENUM_CAST(Corner); -VARIANT_ENUM_CAST(Orientation); -VARIANT_ENUM_CAST(HAlign); -VARIANT_ENUM_CAST(VAlign); -VARIANT_ENUM_CAST(PropertyHint); -VARIANT_ENUM_CAST(PropertyUsageFlags); -VARIANT_ENUM_CAST(MethodFlags); -VARIANT_ENUM_CAST(Variant::Type); -VARIANT_ENUM_CAST(Variant::Operator); - -template <> -struct VariantCaster<char32_t> { - static _FORCE_INLINE_ char32_t cast(const Variant &p_variant) { - return (char32_t)p_variant.operator int(); - } -}; -#ifdef PTRCALL_ENABLED -template <> -struct PtrToArg<char32_t> { - _FORCE_INLINE_ static char32_t convert(const void *p_ptr) { - return char32_t(*reinterpret_cast<const int *>(p_ptr)); - } - _FORCE_INLINE_ static void encode(char32_t p_val, const void *p_ptr) { - *(int *)p_ptr = p_val; - } -}; -#endif - class MethodBind { int method_id; uint32_t hint_flags = METHOD_FLAGS_DEFAULT; StringName name; + StringName instance_class; Vector<Variant> default_arguments; int default_argument_count = 0; int argument_count = 0; @@ -225,11 +78,11 @@ protected: void set_argument_count(int p_count) { argument_count = p_count; } public: - Vector<Variant> get_default_arguments() const { return default_arguments; } + _FORCE_INLINE_ const Vector<Variant> &get_default_arguments() const { return default_arguments; } _FORCE_INLINE_ int get_default_argument_count() const { return default_argument_count; } _FORCE_INLINE_ Variant has_default_argument(int p_arg) const { - int idx = argument_count - p_arg - 1; + int idx = p_arg - (argument_count - default_arguments.size()); if (idx < 0 || idx >= default_arguments.size()) { return false; @@ -239,7 +92,7 @@ public: } _FORCE_INLINE_ Variant get_default_argument(int p_arg) const { - int idx = argument_count - p_arg - 1; + int idx = p_arg - (argument_count - default_arguments.size()); if (idx < 0 || idx >= default_arguments.size()) { return Variant(); @@ -249,7 +102,6 @@ public: } #ifdef DEBUG_METHODS_ENABLED - _FORCE_INLINE_ Variant::Type get_argument_type(int p_argument) const { ERR_FAIL_COND_V(p_argument < -1 || p_argument > argument_count, Variant::NIL); return argument_types[p_argument + 1]; @@ -258,15 +110,16 @@ public: PropertyInfo get_argument_info(int p_argument) const; PropertyInfo get_return_info() const; - void set_argument_names(const Vector<StringName> &p_names); //set by class, db, can't be inferred otherwise + void set_argument_names(const Vector<StringName> &p_names); // Set by ClassDB, can't be inferred otherwise. Vector<StringName> get_argument_names() const; virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const = 0; - #endif + void set_hint_flags(uint32_t p_hint) { hint_flags = p_hint; } uint32_t get_hint_flags() const { return hint_flags | (is_const() ? METHOD_FLAG_CONST : 0) | (is_vararg() ? METHOD_FLAG_VARARG : 0); } - virtual String get_instance_class() const = 0; + _FORCE_INLINE_ StringName get_instance_class() const { return instance_class; } + _FORCE_INLINE_ void set_instance_class(const StringName &p_class) { instance_class = p_class; } _FORCE_INLINE_ int get_argument_count() const { return argument_count; }; @@ -302,7 +155,6 @@ protected: public: #ifdef DEBUG_METHODS_ENABLED - virtual PropertyInfo _gen_argument_type_info(int p_arg) const { if (p_arg < 0) { return arguments.return_val; @@ -320,14 +172,12 @@ public: virtual GodotTypeInfo::Metadata get_argument_meta(int) const { return GodotTypeInfo::METADATA_NONE; } - #else - virtual Variant::Type _gen_argument_type(int p_arg) const { return Variant::NIL; } - #endif + virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) { T *instance = static_cast<T *>(p_object); return (instance->*call_method)(p_args, p_arg_count, r_error); @@ -364,7 +214,6 @@ public: void set_method(NativeCall p_method) { call_method = p_method; } virtual bool is_const() const { return false; } - virtual String get_instance_class() const { return T::get_class_static(); } virtual bool is_vararg() const { return true; } @@ -378,16 +227,365 @@ MethodBind *create_vararg_method_bind(Variant (T::*p_method)(const Variant **, i MethodBindVarArg<T> *a = memnew((MethodBindVarArg<T>)); a->set_method(p_method); a->set_method_info(p_info, p_return_nil_is_variant); + a->set_instance_class(T::get_class_static()); return a; } -/** This amazing hack is based on the FastDelegates theory */ - -// tale of an amazing hack.. // +/**** VARIADIC TEMPLATES ****/ -// if you declare a nonexistent class.. +#ifndef TYPED_METHOD_BIND class __UnexistingClass; +#define MB_T __UnexistingClass +#else +#define MB_T T +#endif -#include "method_bind.gen.inc" +// no return, not const +#ifdef TYPED_METHOD_BIND +template <class T, class... P> +#else +template <class... P> +#endif +class MethodBindT : public MethodBind { + void (MB_T::*method)(P...); + +protected: +#ifdef DEBUG_METHODS_ENABLED +// GCC raises warnings in the case P = {} as the comparison is always false... +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wlogical-op" +#endif + virtual Variant::Type _gen_argument_type(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + return call_get_argument_type<P...>(p_arg); + } else { + return Variant::NIL; + } + } +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif + + virtual PropertyInfo _gen_argument_type_info(int p_arg) const { + PropertyInfo pi; + call_get_argument_type_info<P...>(p_arg, pi); + return pi; + } +#endif + +public: +#ifdef DEBUG_METHODS_ENABLED + virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { + return call_get_argument_metadata<P...>(p_arg); + } + +#endif + virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) { +#ifdef TYPED_METHOD_BIND + call_with_variant_args_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, r_error, get_default_arguments()); +#else + call_with_variant_args_dv((MB_T *)(p_object), method, p_args, p_arg_count, r_error, get_default_arguments()); +#endif + return Variant(); + } + +#ifdef PTRCALL_ENABLED + virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) { +#ifdef TYPED_METHOD_BIND + call_with_ptr_args<T, P...>(static_cast<T *>(p_object), method, p_args); +#else + call_with_ptr_args<MB_T, P...>((MB_T *)(p_object), method, p_args); +#endif + } +#endif + + MethodBindT(void (MB_T::*p_method)(P...)) { + method = p_method; +#ifdef DEBUG_METHODS_ENABLED + _generate_argument_types(sizeof...(P)); +#endif + set_argument_count(sizeof...(P)); + } +}; + +template <class T, class... P> +MethodBind *create_method_bind(void (T::*p_method)(P...)) { +#ifdef TYPED_METHOD_BIND + MethodBind *a = memnew((MethodBindT<T, P...>)(p_method)); +#else + MethodBind *a = memnew((MethodBindT<P...>)(reinterpret_cast<void (MB_T::*)(P...)>(p_method))); +#endif + a->set_instance_class(T::get_class_static()); + return a; +} + +// no return, not const + +#ifdef TYPED_METHOD_BIND +template <class T, class... P> +#else +template <class... P> +#endif +class MethodBindTC : public MethodBind { + void (MB_T::*method)(P...) const; + +protected: +#ifdef DEBUG_METHODS_ENABLED +// GCC raises warnings in the case P = {} as the comparison is always false... +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wlogical-op" +#endif + virtual Variant::Type _gen_argument_type(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + return call_get_argument_type<P...>(p_arg); + } else { + return Variant::NIL; + } + } +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif + + virtual PropertyInfo _gen_argument_type_info(int p_arg) const { + PropertyInfo pi; + call_get_argument_type_info<P...>(p_arg, pi); + return pi; + } +#endif + +public: +#ifdef DEBUG_METHODS_ENABLED + virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { + return call_get_argument_metadata<P...>(p_arg); + } + +#endif + virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) { +#ifdef TYPED_METHOD_BIND + call_with_variant_argsc_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, r_error, get_default_arguments()); +#else + call_with_variant_argsc_dv((MB_T *)(p_object), method, p_args, p_arg_count, r_error, get_default_arguments()); +#endif + return Variant(); + } + +#ifdef PTRCALL_ENABLED + virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) { +#ifdef TYPED_METHOD_BIND + call_with_ptr_argsc<T, P...>(static_cast<T *>(p_object), method, p_args); +#else + call_with_ptr_argsc<MB_T, P...>((MB_T *)(p_object), method, p_args); +#endif + } +#endif + + MethodBindTC(void (MB_T::*p_method)(P...) const) { + method = p_method; + _set_const(true); +#ifdef DEBUG_METHODS_ENABLED + _generate_argument_types(sizeof...(P)); +#endif + set_argument_count(sizeof...(P)); + } +}; + +template <class T, class... P> +MethodBind *create_method_bind(void (T::*p_method)(P...) const) { +#ifdef TYPED_METHOD_BIND + MethodBind *a = memnew((MethodBindTC<T, P...>)(p_method)); +#else + MethodBind *a = memnew((MethodBindTC<P...>)(reinterpret_cast<void (MB_T::*)(P...) const>(p_method))); +#endif + a->set_instance_class(T::get_class_static()); + return a; +} + +// return, not const + +#ifdef TYPED_METHOD_BIND +template <class T, class R, class... P> +#else +template <class R, class... P> +#endif +class MethodBindTR : public MethodBind { + R(MB_T::*method) + (P...); + +protected: +#ifdef DEBUG_METHODS_ENABLED +// GCC raises warnings in the case P = {} as the comparison is always false... +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wlogical-op" +#endif + virtual Variant::Type _gen_argument_type(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + return call_get_argument_type<P...>(p_arg); + } else { + return GetTypeInfo<R>::VARIANT_TYPE; + } + } + + virtual PropertyInfo _gen_argument_type_info(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + PropertyInfo pi; + call_get_argument_type_info<P...>(p_arg, pi); + return pi; + } else { + return GetTypeInfo<R>::get_class_info(); + } + } +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif +#endif + +public: +#ifdef DEBUG_METHODS_ENABLED + virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { + if (p_arg >= 0) { + return call_get_argument_metadata<P...>(p_arg); + } else { + return GetTypeInfo<R>::METADATA; + } + } +#endif + + virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) { + Variant ret; +#ifdef TYPED_METHOD_BIND + call_with_variant_args_ret_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments()); +#else + call_with_variant_args_ret_dv((MB_T *)p_object, method, p_args, p_arg_count, ret, r_error, get_default_arguments()); +#endif + return ret; + } + +#ifdef PTRCALL_ENABLED + virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) { +#ifdef TYPED_METHOD_BIND + call_with_ptr_args_ret<T, R, P...>(static_cast<T *>(p_object), method, p_args, r_ret); +#else + call_with_ptr_args_ret<MB_T, R, P...>((MB_T *)(p_object), method, p_args, r_ret); +#endif + } +#endif + + MethodBindTR(R (MB_T::*p_method)(P...)) { + method = p_method; + _set_returns(true); +#ifdef DEBUG_METHODS_ENABLED + _generate_argument_types(sizeof...(P)); +#endif + set_argument_count(sizeof...(P)); + } +}; + +template <class T, class R, class... P> +MethodBind *create_method_bind(R (T::*p_method)(P...)) { +#ifdef TYPED_METHOD_BIND + MethodBind *a = memnew((MethodBindTR<T, R, P...>)(p_method)); +#else + MethodBind *a = memnew((MethodBindTR<R, P...>)(reinterpret_cast<R (MB_T::*)(P...)>(p_method))); +#endif + + a->set_instance_class(T::get_class_static()); + return a; +} + +// return, const + +#ifdef TYPED_METHOD_BIND +template <class T, class R, class... P> +#else +template <class R, class... P> +#endif +class MethodBindTRC : public MethodBind { + R(MB_T::*method) + (P...) const; + +protected: +#ifdef DEBUG_METHODS_ENABLED +// GCC raises warnings in the case P = {} as the comparison is always false... +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wlogical-op" +#endif + virtual Variant::Type _gen_argument_type(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + return call_get_argument_type<P...>(p_arg); + } else { + return GetTypeInfo<R>::VARIANT_TYPE; + } + } + + virtual PropertyInfo _gen_argument_type_info(int p_arg) const { + if (p_arg >= 0 && p_arg < (int)sizeof...(P)) { + PropertyInfo pi; + call_get_argument_type_info<P...>(p_arg, pi); + return pi; + } else { + return GetTypeInfo<R>::get_class_info(); + } + } +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif +#endif + +public: +#ifdef DEBUG_METHODS_ENABLED + virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const { + if (p_arg >= 0) { + return call_get_argument_metadata<P...>(p_arg); + } else { + return GetTypeInfo<R>::METADATA; + } + } +#endif + + virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) { + Variant ret; +#ifdef TYPED_METHOD_BIND + call_with_variant_args_retc_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments()); +#else + call_with_variant_args_retc_dv((MB_T *)(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments()); +#endif + return ret; + } + +#ifdef PTRCALL_ENABLED + virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) { +#ifdef TYPED_METHOD_BIND + call_with_ptr_args_retc<T, R, P...>(static_cast<T *>(p_object), method, p_args, r_ret); +#else + call_with_ptr_args_retc<MB_T, R, P...>((MB_T *)(p_object), method, p_args, r_ret); +#endif + } +#endif + + MethodBindTRC(R (MB_T::*p_method)(P...) const) { + method = p_method; + _set_returns(true); + _set_const(true); +#ifdef DEBUG_METHODS_ENABLED + _generate_argument_types(sizeof...(P)); +#endif + set_argument_count(sizeof...(P)); + } +}; + +template <class T, class R, class... P> +MethodBind *create_method_bind(R (T::*p_method)(P...) const) { +#ifdef TYPED_METHOD_BIND + MethodBind *a = memnew((MethodBindTRC<T, R, P...>)(p_method)); +#else + MethodBind *a = memnew((MethodBindTRC<R, P...>)(reinterpret_cast<R (MB_T::*)(P...) const>(p_method))); +#endif + a->set_instance_class(T::get_class_static()); + return a; +} #endif // METHOD_BIND_H diff --git a/core/object.cpp b/core/object.cpp index 67c605c39b..0d9e5c5116 100644 --- a/core/object.cpp +++ b/core/object.cpp @@ -1315,9 +1315,10 @@ Error Object::connect(const StringName &p_signal, const Callable &p_callable, co Callable target = p_callable; - if (s->slot_map.has(target)) { + //compare with the base callable, so binds can be ignored + if (s->slot_map.has(*target.get_base_comparator())) { if (p_flags & CONNECT_REFERENCE_COUNTED) { - s->slot_map[target].reference_count++; + s->slot_map[*target.get_base_comparator()].reference_count++; return OK; } else { ERR_FAIL_V_MSG(ERR_INVALID_PARAMETER, "Signal '" + p_signal + "' is already connected to given callable '" + p_callable + "' in that object."); @@ -1337,7 +1338,8 @@ Error Object::connect(const StringName &p_signal, const Callable &p_callable, co slot.reference_count = 1; } - s->slot_map[target] = slot; + //use callable version as key, so binds can be ignored + s->slot_map[*target.get_base_comparator()] = slot; return OK; } @@ -1364,7 +1366,7 @@ bool Object::is_connected(const StringName &p_signal, const Callable &p_callable Callable target = p_callable; - return s->slot_map.has(target); + return s->slot_map.has(*target.get_base_comparator()); //const Map<Signal::Target,Signal::Slot>::Element *E = s->slot_map.find(target); //return (E!=nullptr ); } @@ -1386,7 +1388,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable, SignalData *s = signal_map.getptr(p_signal); ERR_FAIL_COND_MSG(!s, vformat("Nonexistent signal '%s' in %s.", p_signal, to_string())); - ERR_FAIL_COND_MSG(!s->slot_map.has(p_callable), "Disconnecting nonexistent signal '" + p_signal + "', callable: " + p_callable + "."); + ERR_FAIL_COND_MSG(!s->slot_map.has(*p_callable.get_base_comparator()), "Disconnecting nonexistent signal '" + p_signal + "', callable: " + p_callable + "."); SignalData::Slot *slot = &s->slot_map[p_callable]; @@ -1398,7 +1400,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable, } target_object->connections.erase(slot->cE); - s->slot_map.erase(p_callable); + s->slot_map.erase(*p_callable.get_base_comparator()); if (s->slot_map.empty() && ClassDB::has_signal(get_class_name(), p_signal)) { //not user signal, delete diff --git a/core/object.h b/core/object.h index 12ef600dfc..765fb63c6e 100644 --- a/core/object.h +++ b/core/object.h @@ -31,6 +31,7 @@ #ifndef OBJECT_H #define OBJECT_H +#include "core/callable_bind.h" #include "core/hash_map.h" #include "core/list.h" #include "core/map.h" @@ -811,7 +812,4 @@ public: static int get_object_count(); }; -//needed by macros -#include "core/class_db.h" - #endif // OBJECT_H diff --git a/core/project_settings.cpp b/core/project_settings.cpp index 90f56694c2..3829474626 100644 --- a/core/project_settings.cpp +++ b/core/project_settings.cpp @@ -629,19 +629,26 @@ Error ProjectSettings::_load_settings_text(const String &p_path) { } Error ProjectSettings::_load_settings_text_or_binary(const String &p_text_path, const String &p_bin_path) { - // Attempt first to load the text-based project.godot file - Error err_text = _load_settings_text(p_text_path); - if (err_text == OK) { + // Attempt first to load the binary project.godot file. + Error err = _load_settings_binary(p_bin_path); + if (err == OK) { + return OK; + } else if (err != ERR_FILE_NOT_FOUND) { + // If the file exists but can't be loaded, we want to know it. + ERR_PRINT("Couldn't load file '" + p_bin_path + "', error code " + itos(err) + "."); + return err; + } + + // Fallback to text-based project.godot file if binary was not found. + err = _load_settings_text(p_text_path); + if (err == OK) { return OK; - } else if (err_text != ERR_FILE_NOT_FOUND) { - // If the text-based file exists but can't be loaded, we want to know it - ERR_PRINT("Couldn't load file '" + p_text_path + "', error code " + itos(err_text) + "."); - return err_text; + } else if (err != ERR_FILE_NOT_FOUND) { + ERR_PRINT("Couldn't load file '" + p_text_path + "', error code " + itos(err) + "."); + return err; } - // Fallback to binary project.binary file if text-based was not found - Error err_bin = _load_settings_binary(p_bin_path); - return err_bin; + return err; } int ProjectSettings::get_order(const String &p_name) const { diff --git a/core/project_settings.h b/core/project_settings.h index 6cbb02d30e..9a1d9cee97 100644 --- a/core/project_settings.h +++ b/core/project_settings.h @@ -31,7 +31,7 @@ #ifndef PROJECT_SETTINGS_H #define PROJECT_SETTINGS_H -#include "core/object.h" +#include "core/class_db.h" #include "core/os/thread_safe.h" #include "core/set.h" diff --git a/core/reference.h b/core/reference.h index f5794b0b67..868894aad4 100644 --- a/core/reference.h +++ b/core/reference.h @@ -32,7 +32,6 @@ #define REFERENCE_H #include "core/class_db.h" -#include "core/object.h" #include "core/safe_refcount.h" class Reference : public Object { diff --git a/core/resource.h b/core/resource.h index 7699d48735..41707f216d 100644 --- a/core/resource.h +++ b/core/resource.h @@ -32,7 +32,6 @@ #define RESOURCE_H #include "core/class_db.h" -#include "core/object.h" #include "core/reference.h" #include "core/safe_refcount.h" #include "core/self_list.h" diff --git a/core/script_language.h b/core/script_language.h index aa7014ed3e..a94c128932 100644 --- a/core/script_language.h +++ b/core/script_language.h @@ -255,6 +255,7 @@ struct ScriptCodeCompletionOption { String insert_text; Color font_color; RES icon; + Variant default_value; ScriptCodeCompletionOption() {} diff --git a/core/simple_type.h b/core/simple_type.h index 10dc36cbd4..841ab9f384 100644 --- a/core/simple_type.h +++ b/core/simple_type.h @@ -48,4 +48,9 @@ struct GetSimpleTypeT<T const> { typedef T type_t; }; +template <class T> +struct GetSimpleTypeT<T const &> { + typedef T type_t; +}; + #endif // SIMPLE_TYPE_H diff --git a/core/thread_work_pool.h b/core/thread_work_pool.h index e21d3974ee..661060aa3f 100644 --- a/core/thread_work_pool.h +++ b/core/thread_work_pool.h @@ -73,13 +73,15 @@ class ThreadWorkPool { ThreadData *threads = nullptr; uint32_t thread_count = 0; + BaseWork *current_work = nullptr; static void _thread_function(ThreadData *p_thread); public: template <class C, class M, class U> - void do_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) { + void begin_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) { ERR_FAIL_COND(!threads); //never initialized + ERR_FAIL_COND(current_work != nullptr); index.store(0); @@ -90,16 +92,37 @@ public: w->index = &index; w->max_elements = p_elements; + current_work = w; + for (uint32_t i = 0; i < thread_count; i++) { threads[i].work = w; threads[i].start.post(); } + } + + bool is_working() const { + return current_work != nullptr; + } + + uint32_t get_work_index() const { + return index; + } + + void end_work() { + ERR_FAIL_COND(current_work == nullptr); for (uint32_t i = 0; i < thread_count; i++) { threads[i].completed.wait(); threads[i].work = nullptr; } - memdelete(w); + memdelete(current_work); + current_work = nullptr; + } + + template <class C, class M, class U> + void do_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) { + begin_work(p_elements, p_instance, p_method, p_userdata); + end_work(); } void init(int p_thread_count = -1); diff --git a/core/type_info.h b/core/type_info.h index 3c7f59bb84..b9ae88d97c 100644 --- a/core/type_info.h +++ b/core/type_info.h @@ -31,7 +31,7 @@ #ifndef TYPE_INFO_H #define TYPE_INFO_H -#ifdef DEBUG_METHODS_ENABLED +#include "core/typedefs.h" template <bool C, typename T = void> struct EnableIf { @@ -267,11 +267,4 @@ inline StringName __constant_get_enum_name(T param, const String &p_constant) { #define CLASS_INFO(m_type) (GetTypeInfo<m_type *>::get_class_info()) -#else - -#define MAKE_ENUM_TYPE_INFO(m_enum) -#define CLASS_INFO(m_type) - -#endif // DEBUG_METHODS_ENABLED - #endif // TYPE_INFO_H diff --git a/core/typedefs.h b/core/typedefs.h index 4bfa5debac..2472e5fcd9 100644 --- a/core/typedefs.h +++ b/core/typedefs.h @@ -263,4 +263,8 @@ struct BuildIndexSequence : BuildIndexSequence<N - 1, N - 1, Is...> {}; template <size_t... Is> struct BuildIndexSequence<0, Is...> : IndexSequence<Is...> {}; +#ifdef DEBUG_ENABLED +#define DEBUG_METHODS_ENABLED +#endif + #endif // TYPEDEFS_H diff --git a/core/undo_redo.h b/core/undo_redo.h index b46f7ff867..68a553efd4 100644 --- a/core/undo_redo.h +++ b/core/undo_redo.h @@ -31,7 +31,7 @@ #ifndef UNDO_REDO_H #define UNDO_REDO_H -#include "core/object.h" +#include "core/class_db.h" #include "core/resource.h" class UndoRedo : public Object { diff --git a/core/ustring.cpp b/core/ustring.cpp index e382ef3746..27dab8db6e 100644 --- a/core/ustring.cpp +++ b/core/ustring.cpp @@ -4732,6 +4732,69 @@ String String::unquote() const { return substr(1, length() - 2); } +Vector<uint8_t> String::to_ascii_buffer() const { + const String *s = this; + if (s->empty()) { + return Vector<uint8_t>(); + } + CharString charstr = s->ascii(); + + Vector<uint8_t> retval; + size_t len = charstr.length(); + retval.resize(len); + uint8_t *w = retval.ptrw(); + copymem(w, charstr.ptr(), len); + + return retval; +} + +Vector<uint8_t> String::to_utf8_buffer() const { + const String *s = this; + if (s->empty()) { + return Vector<uint8_t>(); + } + CharString charstr = s->utf8(); + + Vector<uint8_t> retval; + size_t len = charstr.length(); + retval.resize(len); + uint8_t *w = retval.ptrw(); + copymem(w, charstr.ptr(), len); + + return retval; +} + +Vector<uint8_t> String::to_utf16_buffer() const { + const String *s = this; + if (s->empty()) { + return Vector<uint8_t>(); + } + Char16String charstr = s->utf16(); + + Vector<uint8_t> retval; + size_t len = charstr.length() * 2; + retval.resize(len); + uint8_t *w = retval.ptrw(); + copymem(w, (const void *)charstr.ptr(), len); + + return retval; +} + +Vector<uint8_t> String::to_utf32_buffer() const { + const String *s = this; + if (s->empty()) { + return Vector<uint8_t>(); + } + + Vector<uint8_t> retval; + size_t len = s->length() * 4; + retval.resize(len); + uint8_t *w = retval.ptrw(); + copymem(w, (const void *)s->ptr(), len); + + return retval; +} + #ifdef TOOLS_ENABLED String TTR(const String &p_text, const String &p_context) { if (TranslationServer::get_singleton()) { diff --git a/core/ustring.h b/core/ustring.h index 1f8a5d7e7d..bf9c06b9ca 100644 --- a/core/ustring.h +++ b/core/ustring.h @@ -440,6 +440,11 @@ public: return *this; } + Vector<uint8_t> to_ascii_buffer() const; + Vector<uint8_t> to_utf8_buffer() const; + Vector<uint8_t> to_utf16_buffer() const; + Vector<uint8_t> to_utf32_buffer() const; + String(const char *p_str); String(const wchar_t *p_str); String(const char32_t *p_str); diff --git a/core/variant.h b/core/variant.h index 112003a7ae..84e5427b21 100644 --- a/core/variant.h +++ b/core/variant.h @@ -414,6 +414,45 @@ public: static void blend(const Variant &a, const Variant &b, float c, Variant &r_dst); static void interpolate(const Variant &a, const Variant &b, float c, Variant &r_dst); + class InternalMethod { +#ifdef DEBUG_ENABLED + protected: + StringName method_name; + Variant::Type base_type; +#endif + public: + enum Flags { + FLAG_IS_CONST = 1, + FLAG_RETURNS_VARIANT = 2, + FLAG_NO_PTRCALL = 4, + FLAG_VARARGS = 8 + }; + + virtual int get_argument_count() const = 0; + virtual Type get_argument_type(int p_arg) const = 0; + virtual Type get_return_type() const = 0; + virtual uint32_t get_flags() const = 0; + +#ifdef DEBUG_ENABLED + virtual String get_argument_name(int p_arg) const = 0; + StringName get_name() const { + return method_name; + } + Variant::Type get_base_type() const { + return base_type; + } +#endif + virtual Vector<Variant> get_default_arguments() const = 0; + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) = 0; + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) = 0; +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) = 0; +#endif + virtual ~InternalMethod() {} + }; + + static InternalMethod *get_internal_method(Type p_type, const StringName &p_method_name); + void call_ptr(const StringName &p_method, const Variant **p_args, int p_argcount, Variant *r_ret, Callable::CallError &r_error); Variant call(const StringName &p_method, const Variant **p_args, int p_argcount, Callable::CallError &r_error); Variant call(const StringName &p_method, const Variant &p_arg1 = Variant(), const Variant &p_arg2 = Variant(), const Variant &p_arg3 = Variant(), const Variant &p_arg4 = Variant(), const Variant &p_arg5 = Variant()); diff --git a/core/variant_call.cpp b/core/variant_call.cpp index 5fd970c8e1..6ffefccb67 100644 --- a/core/variant_call.cpp +++ b/core/variant_call.cpp @@ -30,1062 +30,645 @@ #include "variant.h" +#include "core/class_db.h" #include "core/color_names.inc" #include "core/core_string_names.h" #include "core/crypto/crypto_core.h" #include "core/debugger/engine_debugger.h" #include "core/io/compression.h" -#include "core/object.h" +#include "core/oa_hash_map.h" #include "core/os/os.h" +_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr) { +} + +_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr, const String &p_str) { + arr.push_back(p_str); +} + +template <class... P> +_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr, const String &p_str, P... p_args) { + arr.push_back(p_str); + sarray_add_str(arr, p_args...); +} + +template <class... P> +_FORCE_INLINE_ Vector<String> sarray(P... p_args) { + Vector<String> arr; + sarray_add_str(arr, p_args...); + return arr; +} + typedef void (*VariantFunc)(Variant &r_ret, Variant &p_self, const Variant **p_args); typedef void (*VariantConstructFunc)(Variant &r_ret, const Variant **p_args); struct _VariantCall { - static void Vector3_dot(Variant &r_ret, Variant &p_self, const Variant **p_args) { - r_ret = reinterpret_cast<Vector3 *>(p_self._data._mem)->dot(*reinterpret_cast<const Vector3 *>(p_args[0]->_data._mem)); - } - - struct FuncData { - int arg_count; - Vector<Variant> default_args; - Vector<Variant::Type> arg_types; - Vector<StringName> arg_names; - Variant::Type return_type; + template <class T, class... P> + class InternalMethod : public Variant::InternalMethod { + public: + void (T::*method)(P...); + Vector<Variant> default_values; +#ifdef DEBUG_ENABLED + Vector<String> argument_names; +#endif - bool _const; - bool returns; + virtual int get_argument_count() const { + return sizeof...(P); + } + virtual Variant::Type get_argument_type(int p_arg) const { + return call_get_argument_type<P...>(p_arg); + } +#ifdef DEBUG_ENABLED + virtual String get_argument_name(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String()); + return argument_names[p_arg]; + } +#endif + virtual Vector<Variant> get_default_arguments() const { + return default_values; + } - VariantFunc func; + virtual Variant::Type get_return_type() const { + return Variant::NIL; + } + virtual uint32_t get_flags() const { + return 0; + } - _FORCE_INLINE_ bool verify_arguments(const Variant **p_args, Callable::CallError &r_error) { - if (arg_count == 0) { - return true; - } + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + call_with_variant_args_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_error, default_values); + } - const Variant::Type *tptr = &arg_types[0]; + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args(base, method, p_args); + } - for (int i = 0; i < arg_count; i++) { - if (tptr[i] == Variant::NIL || tptr[i] == p_args[i]->type) { - continue; // all good - } - if (!Variant::can_convert(p_args[i]->type, tptr[i])) { - r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; - r_error.argument = i; - r_error.expected = tptr[i]; - return false; - } - } - return true; +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) { + call_with_ptr_args<T, P...>(reinterpret_cast<T *>(p_base), method, p_args); } +#endif + InternalMethod(void (T::*p_method)(P...), const Vector<Variant> &p_default_args +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_arg_names, const StringName &p_method_name, Variant::Type p_base_type +#endif + ) { + method = p_method; + default_values = p_default_args; +#ifdef DEBUG_ENABLED + argument_names = p_arg_names; + method_name = p_method_name; + base_type = p_base_type; +#endif + } + }; - _FORCE_INLINE_ void call(Variant &r_ret, Variant &p_self, const Variant **p_args, int p_argcount, Callable::CallError &r_error) { + template <class T, class R, class... P> + class InternalMethodR : public Variant::InternalMethod { + public: + R(T::*method) + (P...); + Vector<Variant> default_values; #ifdef DEBUG_ENABLED - if (p_argcount > arg_count) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; - r_error.argument = arg_count; - return; - } else + Vector<String> argument_names; #endif - if (p_argcount < arg_count) { - int def_argcount = default_args.size(); + + virtual int get_argument_count() const { + return sizeof...(P); + } + virtual Variant::Type get_argument_type(int p_arg) const { + return call_get_argument_type<P...>(p_arg); + return Variant::NIL; + } #ifdef DEBUG_ENABLED - if (p_argcount < (arg_count - def_argcount)) { - r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; - r_error.argument = arg_count - def_argcount; - return; - } + virtual String get_argument_name(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String()); + return argument_names[p_arg]; + } +#endif + virtual Vector<Variant> get_default_arguments() const { + return default_values; + } + virtual Variant::Type get_return_type() const { + return GetTypeInfo<R>::VARIANT_TYPE; + } + virtual uint32_t get_flags() const { + uint32_t f = 0; + if (get_return_type() == Variant::NIL) { + f |= FLAG_RETURNS_VARIANT; + } + return f; + } + + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + call_with_variant_args_ret_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_ret, r_error, default_values); + } + + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_ret(base, method, p_args, r_ret); + } +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) { + call_with_ptr_args_ret<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret); + } #endif - ERR_FAIL_COND(p_argcount > VARIANT_ARG_MAX); - const Variant *newargs[VARIANT_ARG_MAX]; - for (int i = 0; i < p_argcount; i++) { - newargs[i] = p_args[i]; - } - // fill in any remaining parameters with defaults - int first_default_arg = arg_count - def_argcount; - for (int i = p_argcount; i < arg_count; i++) { - newargs[i] = &default_args[i - first_default_arg]; - } + InternalMethodR(R (T::*p_method)(P...), const Vector<Variant> &p_default_args #ifdef DEBUG_ENABLED - if (!verify_arguments(newargs, r_error)) { - return; - } + , + const Vector<String> &p_arg_names, const StringName &p_method_name, Variant::Type p_base_type #endif - func(r_ret, p_self, newargs); - } else { + ) { + method = p_method; + default_values = p_default_args; #ifdef DEBUG_ENABLED - if (!verify_arguments(p_args, r_error)) { - return; - } + argument_names = p_arg_names; + method_name = p_method_name; + base_type = p_base_type; #endif - func(r_ret, p_self, p_args); - } } }; - struct TypeFunc { - Map<StringName, FuncData> functions; - }; + template <class T, class R, class... P> + class InternalMethodRC : public Variant::InternalMethod { + public: + R(T::*method) + (P...) const; + Vector<Variant> default_values; +#ifdef DEBUG_ENABLED + Vector<String> argument_names; +#endif - static TypeFunc *type_funcs; + virtual int get_argument_count() const { + return sizeof...(P); + } + virtual Variant::Type get_argument_type(int p_arg) const { + return call_get_argument_type<P...>(p_arg); + } +#ifdef DEBUG_ENABLED + virtual String get_argument_name(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String()); + return argument_names[p_arg]; + } +#endif + virtual Vector<Variant> get_default_arguments() const { + return default_values; + } - struct Arg { - StringName name; - Variant::Type type; - Arg() { type = Variant::NIL; } - Arg(Variant::Type p_type, const StringName &p_name) : - name(p_name), - type(p_type) { + virtual Variant::Type get_return_type() const { + return GetTypeInfo<R>::VARIANT_TYPE; + } + virtual uint32_t get_flags() const { + uint32_t f = FLAG_IS_CONST; + if (get_return_type() == Variant::NIL) { + f |= FLAG_RETURNS_VARIANT; + } + return f; } - }; - //void addfunc(Variant::Type p_type, const StringName& p_name,VariantFunc p_func); + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + call_with_variant_args_retc_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_ret, r_error, default_values); + } - static void make_func_return_variant(Variant::Type p_type, const StringName &p_name) { + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_retc(base, method, p_args, r_ret); + } +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) { + call_with_ptr_args_retc<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret); + } +#endif + InternalMethodRC(R (T::*p_method)(P...) const, const Vector<Variant> &p_default_args #ifdef DEBUG_ENABLED - type_funcs[p_type].functions[p_name].returns = true; + , + const Vector<String> &p_arg_names, const StringName &p_method_name, Variant::Type p_base_type #endif - } - - static void addfunc(bool p_const, Variant::Type p_type, Variant::Type p_return, bool p_has_return, const StringName &p_name, VariantFunc p_func, const Vector<Variant> &p_defaultarg, const Arg &p_argtype1 = Arg(), const Arg &p_argtype2 = Arg(), const Arg &p_argtype3 = Arg(), const Arg &p_argtype4 = Arg(), const Arg &p_argtype5 = Arg()) { - FuncData funcdata; - funcdata.func = p_func; - funcdata.default_args = p_defaultarg; - funcdata._const = p_const; - funcdata.returns = p_has_return; - funcdata.return_type = p_return; + ) { + method = p_method; + default_values = p_default_args; +#ifdef DEBUG_ENABLED + argument_names = p_arg_names; + method_name = p_method_name; + base_type = p_base_type; +#endif + } + }; - if (p_argtype1.name) { - funcdata.arg_types.push_back(p_argtype1.type); + template <class T, class R, class... P> + class InternalMethodRS : public Variant::InternalMethod { + public: + R(*method) + (T *, P...); + Vector<Variant> default_values; #ifdef DEBUG_ENABLED - funcdata.arg_names.push_back(p_argtype1.name); + Vector<String> argument_names; #endif - } else { - goto end; + virtual int get_argument_count() const { + return sizeof...(P); + } + virtual Variant::Type get_argument_type(int p_arg) const { + return call_get_argument_type<P...>(p_arg); } - - if (p_argtype2.name) { - funcdata.arg_types.push_back(p_argtype2.type); #ifdef DEBUG_ENABLED - funcdata.arg_names.push_back(p_argtype2.name); + virtual String get_argument_name(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String()); + return argument_names[p_arg]; + } #endif + virtual Vector<Variant> get_default_arguments() const { + return default_values; + } - } else { - goto end; + virtual Variant::Type get_return_type() const { + return GetTypeInfo<R>::VARIANT_TYPE; + } + virtual uint32_t get_flags() const { + uint32_t f = 0; + if (get_return_type() == Variant::NIL) { + f |= FLAG_RETURNS_VARIANT; + } + return f; } - if (p_argtype3.name) { - funcdata.arg_types.push_back(p_argtype3.type); + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + const Variant **args = p_args; #ifdef DEBUG_ENABLED - funcdata.arg_names.push_back(p_argtype3.name); + if ((size_t)p_argcount > sizeof...(P)) { + r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS; + r_error.argument = sizeof...(P); + return; + } #endif - - } else { - goto end; + if ((size_t)p_argcount < sizeof...(P)) { + size_t missing = sizeof...(P) - (size_t)p_argcount; + if (missing <= (size_t)default_values.size()) { + args = (const Variant **)alloca(sizeof...(P) * sizeof(const Variant *)); + // GCC fails to see that `sizeof...(P)` cannot be 0 here given the previous + // conditions, so it raises a warning on the potential use of `i < 0` as the + // execution condition. +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wtype-limits" +#endif + for (size_t i = 0; i < sizeof...(P); i++) { + if (i < (size_t)p_argcount) { + args[i] = p_args[i]; + } else { + args[i] = &default_values[i - p_argcount + (default_values.size() - missing)]; + } + } +#if defined(__GNUC__) && !defined(__clang__) +#pragma GCC diagnostic pop +#endif + } else { +#ifdef DEBUG_ENABLED + r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS; + r_error.argument = sizeof...(P); +#endif + return; + } + } + call_with_variant_args_retc_static_helper(VariantGetInternalPtr<T>::get_ptr(base), method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{}); } - if (p_argtype4.name) { - funcdata.arg_types.push_back(p_argtype4.type); + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) { + call_with_validated_variant_args_static_retc(base, method, p_args, r_ret); + } +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) { + call_with_ptr_args_static_retc<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret); + } +#endif + InternalMethodRS(R (*p_method)(T *, P...), const Vector<Variant> &p_default_args #ifdef DEBUG_ENABLED - funcdata.arg_names.push_back(p_argtype4.name); + , + const Vector<String> &p_arg_names, const StringName &p_method_name, Variant::Type p_base_type +#endif + ) { + method = p_method; + default_values = p_default_args; +#ifdef DEBUG_ENABLED + argument_names = p_arg_names; + method_name = p_method_name; + base_type = p_base_type; #endif - } else { - goto end; } + }; - if (p_argtype5.name) { - funcdata.arg_types.push_back(p_argtype5.type); + class InternalMethodVC : public Variant::InternalMethod { + public: + typedef void (*MethodVC)(Variant *, const Variant **, int, Variant &r_ret, Callable::CallError &); + MethodVC methodvc = nullptr; + uint32_t base_flags = 0; + Vector<String> argument_names; + Vector<Variant::Type> argument_types; + Variant::Type return_type = Variant::NIL; + + virtual int get_argument_count() const { + return argument_names.size(); + } + virtual Variant::Type get_argument_type(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_types.size(), Variant::NIL); + return argument_types[p_arg]; + } #ifdef DEBUG_ENABLED - funcdata.arg_names.push_back(p_argtype5.name); + virtual String get_argument_name(int p_arg) const { + ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String()); + return argument_names[p_arg]; + } #endif - } else { - goto end; + virtual Vector<Variant> get_default_arguments() const { + return Vector<Variant>(); } - end: + virtual Variant::Type get_return_type() const { + return return_type; + } + virtual uint32_t get_flags() const { + return base_flags | FLAG_NO_PTRCALL; + } - funcdata.arg_count = funcdata.arg_types.size(); - type_funcs[p_type].functions[p_name] = funcdata; - } - -#define VCALL_LOCALMEM0(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(); } -#define VCALL_LOCALMEM0R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(); } -#define VCALL_LOCALMEM1(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0]); } -#define VCALL_LOCALMEM1R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0]); } -#define VCALL_LOCALMEM2(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_LOCALMEM2R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_LOCALMEM3(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_LOCALMEM3R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_LOCALMEM4(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_LOCALMEM4R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_LOCALMEM5(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } -#define VCALL_LOCALMEM5R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } - - // built-in functions of localmem based types - - VCALL_LOCALMEM1R(String, casecmp_to); - VCALL_LOCALMEM1R(String, nocasecmp_to); - VCALL_LOCALMEM1R(String, naturalnocasecmp_to); - VCALL_LOCALMEM0R(String, length); - VCALL_LOCALMEM3R(String, count); - VCALL_LOCALMEM3R(String, countn); - VCALL_LOCALMEM2R(String, substr); - VCALL_LOCALMEM2R(String, find); - VCALL_LOCALMEM2R(String, findn); - VCALL_LOCALMEM2R(String, rfind); - VCALL_LOCALMEM2R(String, rfindn); - VCALL_LOCALMEM1R(String, match); - VCALL_LOCALMEM1R(String, matchn); - VCALL_LOCALMEM1R(String, begins_with); - VCALL_LOCALMEM1R(String, ends_with); - VCALL_LOCALMEM1R(String, is_subsequence_of); - VCALL_LOCALMEM1R(String, is_subsequence_ofi); - VCALL_LOCALMEM0R(String, bigrams); - VCALL_LOCALMEM1R(String, similarity); - VCALL_LOCALMEM2R(String, format); - VCALL_LOCALMEM2R(String, replace); - VCALL_LOCALMEM2R(String, replacen); - VCALL_LOCALMEM1R(String, repeat); - VCALL_LOCALMEM2R(String, insert); - VCALL_LOCALMEM0R(String, capitalize); - VCALL_LOCALMEM3R(String, split); - VCALL_LOCALMEM3R(String, rsplit); - VCALL_LOCALMEM2R(String, split_floats); - VCALL_LOCALMEM1R(String, join); - VCALL_LOCALMEM0R(String, to_upper); - VCALL_LOCALMEM0R(String, to_lower); - VCALL_LOCALMEM1R(String, left); - VCALL_LOCALMEM1R(String, right); - VCALL_LOCALMEM0R(String, dedent); - VCALL_LOCALMEM2R(String, strip_edges); - VCALL_LOCALMEM0R(String, strip_escapes); - VCALL_LOCALMEM1R(String, lstrip); - VCALL_LOCALMEM1R(String, rstrip); - VCALL_LOCALMEM0R(String, get_extension); - VCALL_LOCALMEM0R(String, get_basename); - VCALL_LOCALMEM1R(String, plus_file); - VCALL_LOCALMEM1R(String, ord_at); - VCALL_LOCALMEM2(String, erase); - VCALL_LOCALMEM0R(String, hash); - VCALL_LOCALMEM0R(String, md5_text); - VCALL_LOCALMEM0R(String, sha1_text); - VCALL_LOCALMEM0R(String, sha256_text); - VCALL_LOCALMEM0R(String, md5_buffer); - VCALL_LOCALMEM0R(String, sha1_buffer); - VCALL_LOCALMEM0R(String, sha256_buffer); - VCALL_LOCALMEM0R(String, empty); - VCALL_LOCALMEM1R(String, humanize_size); - VCALL_LOCALMEM0R(String, is_abs_path); - VCALL_LOCALMEM0R(String, is_rel_path); - VCALL_LOCALMEM0R(String, get_base_dir); - VCALL_LOCALMEM0R(String, get_file); - VCALL_LOCALMEM0R(String, xml_escape); - VCALL_LOCALMEM0R(String, xml_unescape); - VCALL_LOCALMEM0R(String, http_escape); - VCALL_LOCALMEM0R(String, http_unescape); - VCALL_LOCALMEM0R(String, c_escape); - VCALL_LOCALMEM0R(String, c_unescape); - VCALL_LOCALMEM0R(String, json_escape); - VCALL_LOCALMEM0R(String, percent_encode); - VCALL_LOCALMEM0R(String, percent_decode); - VCALL_LOCALMEM0R(String, is_valid_identifier); - VCALL_LOCALMEM0R(String, is_valid_integer); - VCALL_LOCALMEM0R(String, is_valid_float); - VCALL_LOCALMEM1R(String, is_valid_hex_number); - VCALL_LOCALMEM0R(String, is_valid_html_color); - VCALL_LOCALMEM0R(String, is_valid_ip_address); - VCALL_LOCALMEM0R(String, is_valid_filename); - VCALL_LOCALMEM0R(String, to_int); - VCALL_LOCALMEM0R(String, to_float); - VCALL_LOCALMEM0R(String, hex_to_int); - VCALL_LOCALMEM2R(String, lpad); - VCALL_LOCALMEM2R(String, rpad); - VCALL_LOCALMEM1R(String, pad_decimals); - VCALL_LOCALMEM1R(String, pad_zeros); - VCALL_LOCALMEM1R(String, trim_prefix); - VCALL_LOCALMEM1R(String, trim_suffix); - - static void _call_String_to_ascii(Variant &r_ret, Variant &p_self, const Variant **p_args) { - String *s = reinterpret_cast<String *>(p_self._data._mem); - if (s->empty()) { - r_ret = PackedByteArray(); - return; + virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + methodvc(base, p_args, p_argcount, r_ret, r_error); } - CharString charstr = s->ascii(); - PackedByteArray retval; - size_t len = charstr.length(); - retval.resize(len); - uint8_t *w = retval.ptrw(); - copymem(w, charstr.ptr(), len); + virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) { + ERR_FAIL_MSG("No support for validated call"); + } +#ifdef PTRCALL_ENABLED + virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) { + ERR_FAIL_MSG("No support for ptrcall call"); + } +#endif + InternalMethodVC(MethodVC p_method, uint32_t p_flags, const Vector<Variant::Type> &p_argument_types, const Variant::Type &p_return_type +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_arg_names, const StringName &p_method_name, Variant::Type p_base_type +#endif + ) { + methodvc = p_method; + argument_types = p_argument_types; + return_type = p_return_type; + base_flags = p_flags; +#ifdef DEBUG_ENABLED + argument_names = p_arg_names; + method_name = p_method_name; + base_type = p_base_type; +#endif + } + }; - r_ret = retval; - } + typedef OAHashMap<StringName, Variant::InternalMethod *> MethodMap; + static MethodMap *type_internal_methods; + static List<StringName> *type_internal_method_names; - static void _call_String_to_utf8(Variant &r_ret, Variant &p_self, const Variant **p_args) { - String *s = reinterpret_cast<String *>(p_self._data._mem); - if (s->empty()) { - r_ret = PackedByteArray(); - return; - } - CharString charstr = s->utf8(); + template <class T, class... P> + static void _bind_method(const StringName &p_name, void (T::*p_method)(P...), const Vector<Variant> &p_default_args = Vector<Variant>() +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_argument_names = Vector<String>() +#endif + ) { - PackedByteArray retval; - size_t len = charstr.length(); - retval.resize(len); - uint8_t *w = retval.ptrw(); - copymem(w, charstr.ptr(), len); +#ifdef DEBUG_ENABLED + ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); + ERR_FAIL_COND(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name)); +#endif +#ifdef DEBUG_ENABLED + Variant::InternalMethod *m = memnew((InternalMethod<T, P...>)(p_method, p_default_args, p_argument_names, p_name, GetTypeInfo<T>::VARIANT_TYPE)); +#else + Variant::InternalMethod *m = memnew((InternalMethod<T, P...>)(p_method, p_default_args)); +#endif - r_ret = retval; + type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m); + type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name); } - static void _call_String_to_utf16(Variant &r_ret, Variant &p_self, const Variant **p_args) { - String *s = reinterpret_cast<String *>(p_self._data._mem); - if (s->empty()) { - r_ret = PackedByteArray(); - return; - } - Char16String charstr = s->utf16(); + template <class T, class R, class... P> + static void _bind_method(const StringName &p_name, R (T::*p_method)(P...) const, const Vector<Variant> &p_default_args = Vector<Variant>() +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_argument_names = Vector<String>() +#endif + ) { +#ifdef DEBUG_ENABLED + ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); + ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); - PackedByteArray retval; - size_t len = charstr.length() * 2; - retval.resize(len); - uint8_t *w = retval.ptrw(); - copymem(w, (const void *)charstr.ptr(), len); +#endif +#ifdef DEBUG_ENABLED + Variant::InternalMethod *m = memnew((InternalMethodRC<T, R, P...>)(p_method, p_default_args, p_argument_names, p_name, GetTypeInfo<T>::VARIANT_TYPE)); +#else + Variant::InternalMethod *m = memnew((InternalMethodRC<T, R, P...>)(p_method, p_default_args)); +#endif - r_ret = retval; + type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m); + type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name); } - static void _call_String_to_utf32(Variant &r_ret, Variant &p_self, const Variant **p_args) { - String *s = reinterpret_cast<String *>(p_self._data._mem); - if (s->empty()) { - r_ret = PackedByteArray(); - return; - } + template <class T, class R, class... P> + static void _bind_method(const StringName &p_name, R (T::*p_method)(P...), const Vector<Variant> &p_default_args = Vector<Variant>() +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_argument_names = Vector<String>() +#endif + ) { +#ifdef DEBUG_ENABLED + ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); + ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); +#endif - PackedByteArray retval; - size_t len = s->length() * 4; - retval.resize(len); - uint8_t *w = retval.ptrw(); - copymem(w, (const void *)s->ptr(), len); - - r_ret = retval; - } - - VCALL_LOCALMEM1R(Vector2, distance_to); - VCALL_LOCALMEM1R(Vector2, distance_squared_to); - VCALL_LOCALMEM0R(Vector2, length); - VCALL_LOCALMEM0R(Vector2, length_squared); - VCALL_LOCALMEM0R(Vector2, normalized); - VCALL_LOCALMEM0R(Vector2, is_normalized); - VCALL_LOCALMEM1R(Vector2, is_equal_approx); - VCALL_LOCALMEM1R(Vector2, posmod); - VCALL_LOCALMEM1R(Vector2, posmodv); - VCALL_LOCALMEM1R(Vector2, project); - VCALL_LOCALMEM1R(Vector2, angle_to); - VCALL_LOCALMEM1R(Vector2, angle_to_point); - VCALL_LOCALMEM1R(Vector2, direction_to); - VCALL_LOCALMEM2R(Vector2, lerp); - VCALL_LOCALMEM2R(Vector2, slerp); - VCALL_LOCALMEM4R(Vector2, cubic_interpolate); - VCALL_LOCALMEM2R(Vector2, move_toward); - VCALL_LOCALMEM1R(Vector2, rotated); - VCALL_LOCALMEM0R(Vector2, tangent); - VCALL_LOCALMEM0R(Vector2, floor); - VCALL_LOCALMEM0R(Vector2, ceil); - VCALL_LOCALMEM0R(Vector2, round); - VCALL_LOCALMEM1R(Vector2, snapped); - VCALL_LOCALMEM0R(Vector2, aspect); - VCALL_LOCALMEM1R(Vector2, dot); - VCALL_LOCALMEM1R(Vector2, slide); - VCALL_LOCALMEM1R(Vector2, bounce); - VCALL_LOCALMEM1R(Vector2, reflect); - VCALL_LOCALMEM0R(Vector2, angle); - VCALL_LOCALMEM1R(Vector2, cross); - VCALL_LOCALMEM0R(Vector2, abs); - VCALL_LOCALMEM1R(Vector2, clamped); - VCALL_LOCALMEM0R(Vector2, sign); - - VCALL_LOCALMEM0R(Vector2i, aspect); - VCALL_LOCALMEM0R(Vector2i, sign); - VCALL_LOCALMEM0R(Vector2i, abs); - - VCALL_LOCALMEM0R(Rect2, get_area); - VCALL_LOCALMEM0R(Rect2, has_no_area); - VCALL_LOCALMEM1R(Rect2, has_point); - VCALL_LOCALMEM1R(Rect2, is_equal_approx); - VCALL_LOCALMEM2R(Rect2, intersects); - VCALL_LOCALMEM1R(Rect2, encloses); - VCALL_LOCALMEM1R(Rect2, clip); - VCALL_LOCALMEM1R(Rect2, merge); - VCALL_LOCALMEM1R(Rect2, expand); - VCALL_LOCALMEM1R(Rect2, grow); - VCALL_LOCALMEM2R(Rect2, grow_margin); - VCALL_LOCALMEM4R(Rect2, grow_individual); - VCALL_LOCALMEM0R(Rect2, abs); - - VCALL_LOCALMEM0R(Rect2i, get_area); - VCALL_LOCALMEM0R(Rect2i, has_no_area); - VCALL_LOCALMEM1R(Rect2i, has_point); - VCALL_LOCALMEM1R(Rect2i, intersects); - VCALL_LOCALMEM1R(Rect2i, encloses); - VCALL_LOCALMEM1R(Rect2i, clip); - VCALL_LOCALMEM1R(Rect2i, merge); - VCALL_LOCALMEM1R(Rect2i, expand); - VCALL_LOCALMEM1R(Rect2i, grow); - VCALL_LOCALMEM2R(Rect2i, grow_margin); - VCALL_LOCALMEM4R(Rect2i, grow_individual); - VCALL_LOCALMEM0R(Rect2i, abs); - - VCALL_LOCALMEM0R(Vector3, min_axis); - VCALL_LOCALMEM0R(Vector3, max_axis); - VCALL_LOCALMEM1R(Vector3, distance_to); - VCALL_LOCALMEM1R(Vector3, distance_squared_to); - VCALL_LOCALMEM0R(Vector3, length); - VCALL_LOCALMEM0R(Vector3, length_squared); - VCALL_LOCALMEM0R(Vector3, normalized); - VCALL_LOCALMEM0R(Vector3, is_normalized); - VCALL_LOCALMEM1R(Vector3, is_equal_approx); - VCALL_LOCALMEM0R(Vector3, inverse); - VCALL_LOCALMEM1R(Vector3, snapped); - VCALL_LOCALMEM2R(Vector3, rotated); - VCALL_LOCALMEM2R(Vector3, lerp); - VCALL_LOCALMEM2R(Vector3, slerp); - VCALL_LOCALMEM4R(Vector3, cubic_interpolate); - VCALL_LOCALMEM2R(Vector3, move_toward); - VCALL_LOCALMEM1R(Vector3, dot); - VCALL_LOCALMEM1R(Vector3, cross); - VCALL_LOCALMEM1R(Vector3, outer); - VCALL_LOCALMEM0R(Vector3, to_diagonal_matrix); - VCALL_LOCALMEM0R(Vector3, abs); - VCALL_LOCALMEM0R(Vector3, floor); - VCALL_LOCALMEM0R(Vector3, ceil); - VCALL_LOCALMEM0R(Vector3, round); - VCALL_LOCALMEM1R(Vector3, posmod); - VCALL_LOCALMEM1R(Vector3, posmodv); - VCALL_LOCALMEM1R(Vector3, project); - VCALL_LOCALMEM1R(Vector3, angle_to); - VCALL_LOCALMEM1R(Vector3, direction_to); - VCALL_LOCALMEM1R(Vector3, slide); - VCALL_LOCALMEM1R(Vector3, bounce); - VCALL_LOCALMEM1R(Vector3, reflect); - VCALL_LOCALMEM0R(Vector3, sign); - - VCALL_LOCALMEM0R(Vector3i, min_axis); - VCALL_LOCALMEM0R(Vector3i, max_axis); - VCALL_LOCALMEM0R(Vector3i, sign); - - VCALL_LOCALMEM0R(Plane, normalized); - VCALL_LOCALMEM0R(Plane, center); - VCALL_LOCALMEM1R(Plane, is_equal_approx); - VCALL_LOCALMEM1R(Plane, is_point_over); - VCALL_LOCALMEM1R(Plane, distance_to); - VCALL_LOCALMEM2R(Plane, has_point); - VCALL_LOCALMEM1R(Plane, project); - - //return vector3 if intersected, nil if not - static void _call_Plane_intersect_3(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Vector3 result; - if (reinterpret_cast<Plane *>(p_self._data._mem)->intersect_3(*p_args[0], *p_args[1], &result)) { - r_ret = result; - } else { - r_ret = Variant(); - } +#ifdef DEBUG_ENABLED + Variant::InternalMethod *m = memnew((InternalMethodR<T, R, P...>)(p_method, p_default_args, p_argument_names, p_name, GetTypeInfo<T>::VARIANT_TYPE)); +#else + Variant::InternalMethod *m = memnew((InternalMethodR<T, R, P...>)(p_method, p_default_args)); +#endif + type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m); + type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name); } - static void _call_Plane_intersects_ray(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Vector3 result; - if (reinterpret_cast<Plane *>(p_self._data._mem)->intersects_ray(*p_args[0], *p_args[1], &result)) { - r_ret = result; - } else { - r_ret = Variant(); - } +#ifdef DEBUG_ENABLED +#define bind_method(m_type, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_method, &m_type ::m_method, m_default_args, m_arg_names) +#else +#define bind_method(m_type, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_method, &m_type ::m_method, m_default_args) +#endif + +#ifdef DEBUG_ENABLED +#define bind_methodv(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_name, m_method, m_default_args, m_arg_names) +#else +#define bind_methodv(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_name, m_method, m_default_args) +#endif + + template <class T, class R, class... P> + static void _bind_function(const StringName &p_name, R (*p_method)(T *, P...), const Vector<Variant> &p_default_args = Vector<Variant>() +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_argument_names = Vector<String>() +#endif + ) { +#ifdef DEBUG_ENABLED + ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); + ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name)); +#endif + +#ifdef DEBUG_ENABLED + Variant::InternalMethod *m = memnew((InternalMethodRS<T, R, P...>)(p_method, p_default_args, p_argument_names, p_name, GetTypeInfo<T>::VARIANT_TYPE)); +#else + Variant::InternalMethod *m = memnew((InternalMethodRS<T, R, P...>)(p_method, p_default_args)); +#endif + + type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m); + type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name); } - static void _call_Plane_intersects_segment(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Vector3 result; - if (reinterpret_cast<Plane *>(p_self._data._mem)->intersects_segment(*p_args[0], *p_args[1], &result)) { - r_ret = result; - } else { - r_ret = Variant(); - } - } - - VCALL_LOCALMEM0R(Quat, length); - VCALL_LOCALMEM0R(Quat, length_squared); - VCALL_LOCALMEM0R(Quat, normalized); - VCALL_LOCALMEM0R(Quat, is_normalized); - VCALL_LOCALMEM1R(Quat, is_equal_approx); - VCALL_LOCALMEM0R(Quat, inverse); - VCALL_LOCALMEM1R(Quat, dot); - VCALL_LOCALMEM1R(Quat, xform); - VCALL_LOCALMEM2R(Quat, slerp); - VCALL_LOCALMEM2R(Quat, slerpni); - VCALL_LOCALMEM4R(Quat, cubic_slerp); - VCALL_LOCALMEM0R(Quat, get_euler); - VCALL_LOCALMEM1(Quat, set_euler); - VCALL_LOCALMEM2(Quat, set_axis_angle); - - VCALL_LOCALMEM0R(Color, to_argb32); - VCALL_LOCALMEM0R(Color, to_abgr32); - VCALL_LOCALMEM0R(Color, to_rgba32); - VCALL_LOCALMEM0R(Color, to_argb64); - VCALL_LOCALMEM0R(Color, to_abgr64); - VCALL_LOCALMEM0R(Color, to_rgba64); - VCALL_LOCALMEM0R(Color, inverted); - VCALL_LOCALMEM0R(Color, contrasted); - VCALL_LOCALMEM2R(Color, lerp); - VCALL_LOCALMEM1R(Color, blend); - VCALL_LOCALMEM1R(Color, lightened); - VCALL_LOCALMEM1R(Color, darkened); - VCALL_LOCALMEM1R(Color, to_html); - VCALL_LOCALMEM4R(Color, from_hsv); - VCALL_LOCALMEM1R(Color, is_equal_approx); - - VCALL_LOCALMEM0R(RID, get_id); - - VCALL_LOCALMEM0R(NodePath, is_absolute); - VCALL_LOCALMEM0R(NodePath, get_name_count); - VCALL_LOCALMEM1R(NodePath, get_name); - VCALL_LOCALMEM0R(NodePath, get_subname_count); - VCALL_LOCALMEM1R(NodePath, get_subname); - VCALL_LOCALMEM0R(NodePath, get_concatenated_subnames); - VCALL_LOCALMEM0R(NodePath, get_as_property_path); - VCALL_LOCALMEM0R(NodePath, is_empty); - - VCALL_LOCALMEM0R(Dictionary, size); - VCALL_LOCALMEM0R(Dictionary, empty); - VCALL_LOCALMEM0(Dictionary, clear); - VCALL_LOCALMEM1R(Dictionary, has); - VCALL_LOCALMEM1R(Dictionary, has_all); - VCALL_LOCALMEM1R(Dictionary, erase); - VCALL_LOCALMEM0R(Dictionary, hash); - VCALL_LOCALMEM0R(Dictionary, keys); - VCALL_LOCALMEM0R(Dictionary, values); - VCALL_LOCALMEM1R(Dictionary, duplicate); - VCALL_LOCALMEM2R(Dictionary, get); - - VCALL_LOCALMEM0R(Callable, is_null); - VCALL_LOCALMEM0R(Callable, is_custom); - VCALL_LOCALMEM0(Callable, is_standard); - VCALL_LOCALMEM0(Callable, get_object); - VCALL_LOCALMEM0(Callable, get_object_id); - VCALL_LOCALMEM0(Callable, get_method); - VCALL_LOCALMEM0(Callable, hash); - - VCALL_LOCALMEM0R(Signal, is_null); - VCALL_LOCALMEM0R(Signal, get_object); - VCALL_LOCALMEM0R(Signal, get_object_id); - VCALL_LOCALMEM0R(Signal, get_name); - VCALL_LOCALMEM3R(Signal, connect); - VCALL_LOCALMEM1(Signal, disconnect); - VCALL_LOCALMEM1R(Signal, is_connected); - VCALL_LOCALMEM0R(Signal, get_connections); - - VCALL_LOCALMEM2(Array, set); - VCALL_LOCALMEM1R(Array, get); - VCALL_LOCALMEM0R(Array, size); - VCALL_LOCALMEM0R(Array, empty); - VCALL_LOCALMEM0(Array, clear); - VCALL_LOCALMEM0R(Array, hash); - VCALL_LOCALMEM1(Array, push_back); - VCALL_LOCALMEM1(Array, push_front); - VCALL_LOCALMEM0R(Array, pop_back); - VCALL_LOCALMEM0R(Array, pop_front); - VCALL_LOCALMEM1(Array, append); - VCALL_LOCALMEM1(Array, resize); - VCALL_LOCALMEM2(Array, insert); - VCALL_LOCALMEM1(Array, remove); - VCALL_LOCALMEM0R(Array, front); - VCALL_LOCALMEM0R(Array, back); - VCALL_LOCALMEM2R(Array, find); - VCALL_LOCALMEM2R(Array, rfind); - VCALL_LOCALMEM1R(Array, find_last); - VCALL_LOCALMEM1R(Array, count); - VCALL_LOCALMEM1R(Array, has); - VCALL_LOCALMEM1(Array, erase); - VCALL_LOCALMEM0(Array, sort); - VCALL_LOCALMEM2(Array, sort_custom); - VCALL_LOCALMEM0(Array, shuffle); - VCALL_LOCALMEM2R(Array, bsearch); - VCALL_LOCALMEM4R(Array, bsearch_custom); - VCALL_LOCALMEM1R(Array, duplicate); - VCALL_LOCALMEM4R(Array, slice); - VCALL_LOCALMEM0(Array, invert); - VCALL_LOCALMEM0R(Array, max); - VCALL_LOCALMEM0R(Array, min); - - static void _call_PackedByteArray_get_string_from_ascii(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); +#ifdef DEBUG_ENABLED +#define bind_function(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_function(m_name, m_method, m_default_args, m_arg_names) +#else +#define bind_function(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_function(m_name, m_method, m_default_args) +#endif + + static void _bind_custom(Variant::Type p_type, const StringName &p_name, InternalMethodVC::MethodVC p_method, uint32_t p_flags, const Vector<Variant::Type> &p_argument_types, const Variant::Type &p_return_type +#ifdef DEBUG_ENABLED + , + const Vector<String> &p_argument_names = Vector<String>() +#endif + ) { + +#ifdef DEBUG_ENABLED + Variant::InternalMethod *m = memnew(InternalMethodVC(p_method, p_flags, p_argument_types, p_return_type, p_argument_names, p_name, p_type)); +#else + Variant::InternalMethod *m = memnew(InternalMethodVC(p_method, p_flags, p_argument_types, p_return_type)); +#endif + + type_internal_methods[p_type].insert(p_name, m); + type_internal_method_names[p_type].push_back(p_name); + } + +#ifdef DEBUG_ENABLED +#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) +#else +#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type) +#endif + + static String func_PackedByteArray_get_string_from_ascii(PackedByteArray *p_instance) { String s; - if (ba->array.size() > 0) { - const uint8_t *r = ba->array.ptr(); + if (p_instance->size() > 0) { + const uint8_t *r = p_instance->ptr(); CharString cs; - cs.resize(ba->array.size() + 1); - copymem(cs.ptrw(), r, ba->array.size()); - cs[ba->array.size()] = 0; + cs.resize(p_instance->size() + 1); + copymem(cs.ptrw(), r, p_instance->size()); + cs[p_instance->size()] = 0; s = cs.get_data(); } - r_ret = s; + return s; } - static void _call_PackedByteArray_get_string_from_utf8(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); - + static String func_PackedByteArray_get_string_from_utf8(PackedByteArray *p_instance) { String s; - if (ba->array.size() > 0) { - const uint8_t *r = ba->array.ptr(); - s.parse_utf8((const char *)r, ba->array.size()); + if (p_instance->size() > 0) { + const uint8_t *r = p_instance->ptr(); + s.parse_utf8((const char *)r, p_instance->size()); } - r_ret = s; + return s; } - static void _call_PackedByteArray_get_string_from_utf16(Variant &r_ret, Variant &p_self, const Variant **p_args) { - PackedByteArray *ba = reinterpret_cast<PackedByteArray *>(p_self._data._mem); + static String func_PackedByteArray_get_string_from_utf16(PackedByteArray *p_instance) { String s; - if (ba->size() > 0) { - const uint8_t *r = ba->ptr(); - s.parse_utf16((const char16_t *)r, ba->size() / 2); + if (p_instance->size() > 0) { + const uint8_t *r = p_instance->ptr(); + s.parse_utf16((const char16_t *)r, p_instance->size() / 2); } - r_ret = s; + return s; } - static void _call_PackedByteArray_get_string_from_utf32(Variant &r_ret, Variant &p_self, const Variant **p_args) { - PackedByteArray *ba = reinterpret_cast<PackedByteArray *>(p_self._data._mem); + static String func_PackedByteArray_get_string_from_utf32(PackedByteArray *p_instance) { String s; - if (ba->size() > 0) { - const uint8_t *r = ba->ptr(); - s = String((const char32_t *)r, ba->size() / 4); + if (p_instance->size() > 0) { + const uint8_t *r = p_instance->ptr(); + s = String((const char32_t *)r, p_instance->size() / 4); } - r_ret = s; + return s; } - static void _call_PackedByteArray_compress(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); + static PackedByteArray func_PackedByteArray_compress(PackedByteArray *p_instance, int p_mode) { PackedByteArray compressed; - if (ba->array.size() > 0) { - Compression::Mode mode = (Compression::Mode)(int)(*p_args[0]); - compressed.resize(Compression::get_max_compressed_buffer_size(ba->array.size(), mode)); - int result = Compression::compress(compressed.ptrw(), ba->array.ptr(), ba->array.size(), mode); + if (p_instance->size() > 0) { + Compression::Mode mode = (Compression::Mode)(p_mode); + compressed.resize(Compression::get_max_compressed_buffer_size(p_instance->size(), mode)); + int result = Compression::compress(compressed.ptrw(), p_instance->ptr(), p_instance->size(), mode); result = result >= 0 ? result : 0; compressed.resize(result); } - r_ret = compressed; + return compressed; } - static void _call_PackedByteArray_decompress(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); + static PackedByteArray func_PackedByteArray_decompress(PackedByteArray *p_instance, int64_t p_buffer_size, int p_mode) { PackedByteArray decompressed; - Compression::Mode mode = (Compression::Mode)(int)(*p_args[1]); + Compression::Mode mode = (Compression::Mode)(p_mode); - int buffer_size = (int)(*p_args[0]); + int64_t buffer_size = p_buffer_size; if (buffer_size <= 0) { - r_ret = decompressed; - ERR_FAIL_MSG("Decompression buffer size must be greater than zero."); + ERR_FAIL_V_MSG(decompressed, "Decompression buffer size must be greater than zero."); } decompressed.resize(buffer_size); - int result = Compression::decompress(decompressed.ptrw(), buffer_size, ba->array.ptr(), ba->array.size(), mode); + int result = Compression::decompress(decompressed.ptrw(), buffer_size, p_instance->ptr(), p_instance->size(), mode); result = result >= 0 ? result : 0; decompressed.resize(result); - r_ret = decompressed; + return decompressed; } - static void _call_PackedByteArray_decompress_dynamic(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); + static PackedByteArray func_PackedByteArray_decompress_dynamic(PackedByteArray *p_instance, int64_t p_buffer_size, int p_mode) { PackedByteArray decompressed; - int max_output_size = (int)(*p_args[0]); - Compression::Mode mode = (Compression::Mode)(int)(*p_args[1]); + int64_t max_output_size = p_buffer_size; + Compression::Mode mode = (Compression::Mode)(p_mode); - int result = Compression::decompress_dynamic(&decompressed, max_output_size, ba->array.ptr(), ba->array.size(), mode); + int result = Compression::decompress_dynamic(&decompressed, max_output_size, p_instance->ptr(), p_instance->size(), mode); if (result == OK) { - r_ret = decompressed; + return decompressed; } else { decompressed.clear(); - r_ret = decompressed; - ERR_FAIL_MSG("Decompression failed."); + ERR_FAIL_V_MSG(decompressed, "Decompression failed."); } } - static void _call_PackedByteArray_hex_encode(Variant &r_ret, Variant &p_self, const Variant **p_args) { - Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array); - if (ba->array.size() == 0) { - r_ret = String(); - return; - } - const uint8_t *r = ba->array.ptr(); - String s = String::hex_encode_buffer(&r[0], ba->array.size()); - r_ret = s; - } - -#define VCALL_PARRMEM0(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(); } -#define VCALL_PARRMEM0R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(); } -#define VCALL_PARRMEM1(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0]); } -#define VCALL_PARRMEM1R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0]); } -#define VCALL_PARRMEM2(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_PARRMEM2R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_PARRMEM3(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_PARRMEM3R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_PARRMEM4(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_PARRMEM4R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_PARRMEM5(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } -#define VCALL_PARRMEM5R(m_type, m_elemtype, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } - - VCALL_PARRMEM0R(PackedByteArray, uint8_t, size); - VCALL_PARRMEM0R(PackedByteArray, uint8_t, empty); - VCALL_PARRMEM2(PackedByteArray, uint8_t, set); - VCALL_PARRMEM1R(PackedByteArray, uint8_t, get); - VCALL_PARRMEM1(PackedByteArray, uint8_t, push_back); - VCALL_PARRMEM1(PackedByteArray, uint8_t, resize); - VCALL_PARRMEM2R(PackedByteArray, uint8_t, insert); - VCALL_PARRMEM1(PackedByteArray, uint8_t, remove); - VCALL_PARRMEM1(PackedByteArray, uint8_t, append); - VCALL_PARRMEM1(PackedByteArray, uint8_t, append_array); - VCALL_PARRMEM1R(PackedByteArray, uint8_t, has); - VCALL_PARRMEM0(PackedByteArray, uint8_t, sort); - VCALL_PARRMEM0(PackedByteArray, uint8_t, invert); - VCALL_PARRMEM2R(PackedByteArray, uint8_t, subarray); - - VCALL_PARRMEM0R(PackedInt32Array, int32_t, size); - VCALL_PARRMEM0R(PackedInt32Array, int32_t, empty); - VCALL_PARRMEM2(PackedInt32Array, int32_t, set); - VCALL_PARRMEM1R(PackedInt32Array, int32_t, get); - VCALL_PARRMEM1(PackedInt32Array, int32_t, push_back); - VCALL_PARRMEM1(PackedInt32Array, int32_t, resize); - VCALL_PARRMEM2R(PackedInt32Array, int32_t, insert); - VCALL_PARRMEM1(PackedInt32Array, int32_t, remove); - VCALL_PARRMEM1(PackedInt32Array, int32_t, append); - VCALL_PARRMEM1(PackedInt32Array, int32_t, append_array); - VCALL_PARRMEM1R(PackedInt32Array, int32_t, has); - VCALL_PARRMEM0(PackedInt32Array, int32_t, sort); - VCALL_PARRMEM0(PackedInt32Array, int32_t, invert); - - VCALL_PARRMEM0R(PackedInt64Array, int64_t, size); - VCALL_PARRMEM0R(PackedInt64Array, int64_t, empty); - VCALL_PARRMEM2(PackedInt64Array, int64_t, set); - VCALL_PARRMEM1R(PackedInt64Array, int64_t, get); - VCALL_PARRMEM1(PackedInt64Array, int64_t, push_back); - VCALL_PARRMEM1(PackedInt64Array, int64_t, resize); - VCALL_PARRMEM2R(PackedInt64Array, int64_t, insert); - VCALL_PARRMEM1(PackedInt64Array, int64_t, remove); - VCALL_PARRMEM1(PackedInt64Array, int64_t, append); - VCALL_PARRMEM1(PackedInt64Array, int64_t, append_array); - VCALL_PARRMEM1R(PackedInt64Array, int64_t, has); - VCALL_PARRMEM0(PackedInt64Array, int64_t, sort); - VCALL_PARRMEM0(PackedInt64Array, int64_t, invert); - - VCALL_PARRMEM0R(PackedFloat32Array, float, size); - VCALL_PARRMEM0R(PackedFloat32Array, float, empty); - VCALL_PARRMEM2(PackedFloat32Array, float, set); - VCALL_PARRMEM1R(PackedFloat32Array, float, get); - VCALL_PARRMEM1(PackedFloat32Array, float, push_back); - VCALL_PARRMEM1(PackedFloat32Array, float, resize); - VCALL_PARRMEM2R(PackedFloat32Array, float, insert); - VCALL_PARRMEM1(PackedFloat32Array, float, remove); - VCALL_PARRMEM1(PackedFloat32Array, float, append); - VCALL_PARRMEM1(PackedFloat32Array, float, append_array); - VCALL_PARRMEM1R(PackedFloat32Array, float, has); - VCALL_PARRMEM0(PackedFloat32Array, float, sort); - VCALL_PARRMEM0(PackedFloat32Array, float, invert); - - VCALL_PARRMEM0R(PackedFloat64Array, double, size); - VCALL_PARRMEM0R(PackedFloat64Array, double, empty); - VCALL_PARRMEM2(PackedFloat64Array, double, set); - VCALL_PARRMEM1R(PackedFloat64Array, double, get); - VCALL_PARRMEM1(PackedFloat64Array, double, push_back); - VCALL_PARRMEM1(PackedFloat64Array, double, resize); - VCALL_PARRMEM2R(PackedFloat64Array, double, insert); - VCALL_PARRMEM1(PackedFloat64Array, double, remove); - VCALL_PARRMEM1(PackedFloat64Array, double, append); - VCALL_PARRMEM1(PackedFloat64Array, double, append_array); - VCALL_PARRMEM1R(PackedFloat64Array, double, has); - VCALL_PARRMEM0(PackedFloat64Array, double, sort); - VCALL_PARRMEM0(PackedFloat64Array, double, invert); - - VCALL_PARRMEM0R(PackedStringArray, String, size); - VCALL_PARRMEM0R(PackedStringArray, String, empty); - VCALL_PARRMEM2(PackedStringArray, String, set); - VCALL_PARRMEM1R(PackedStringArray, String, get); - VCALL_PARRMEM1(PackedStringArray, String, push_back); - VCALL_PARRMEM1(PackedStringArray, String, resize); - VCALL_PARRMEM2R(PackedStringArray, String, insert); - VCALL_PARRMEM1(PackedStringArray, String, remove); - VCALL_PARRMEM1(PackedStringArray, String, append); - VCALL_PARRMEM1(PackedStringArray, String, append_array); - VCALL_PARRMEM1R(PackedStringArray, String, has); - VCALL_PARRMEM0(PackedStringArray, String, sort); - VCALL_PARRMEM0(PackedStringArray, String, invert); - - VCALL_PARRMEM0R(PackedVector2Array, Vector2, size); - VCALL_PARRMEM0R(PackedVector2Array, Vector2, empty); - VCALL_PARRMEM2(PackedVector2Array, Vector2, set); - VCALL_PARRMEM1R(PackedVector2Array, Vector2, get); - VCALL_PARRMEM1(PackedVector2Array, Vector2, push_back); - VCALL_PARRMEM1(PackedVector2Array, Vector2, resize); - VCALL_PARRMEM2R(PackedVector2Array, Vector2, insert); - VCALL_PARRMEM1(PackedVector2Array, Vector2, remove); - VCALL_PARRMEM1(PackedVector2Array, Vector2, append); - VCALL_PARRMEM1(PackedVector2Array, Vector2, append_array); - VCALL_PARRMEM1R(PackedVector2Array, Vector2, has); - VCALL_PARRMEM0(PackedVector2Array, Vector2, sort); - VCALL_PARRMEM0(PackedVector2Array, Vector2, invert); - - VCALL_PARRMEM0R(PackedVector3Array, Vector3, size); - VCALL_PARRMEM0R(PackedVector3Array, Vector3, empty); - VCALL_PARRMEM2(PackedVector3Array, Vector3, set); - VCALL_PARRMEM1R(PackedVector3Array, Vector3, get); - VCALL_PARRMEM1(PackedVector3Array, Vector3, push_back); - VCALL_PARRMEM1(PackedVector3Array, Vector3, resize); - VCALL_PARRMEM2R(PackedVector3Array, Vector3, insert); - VCALL_PARRMEM1(PackedVector3Array, Vector3, remove); - VCALL_PARRMEM1(PackedVector3Array, Vector3, append); - VCALL_PARRMEM1(PackedVector3Array, Vector3, append_array); - VCALL_PARRMEM1R(PackedVector3Array, Vector3, has); - VCALL_PARRMEM0(PackedVector3Array, Vector3, sort); - VCALL_PARRMEM0(PackedVector3Array, Vector3, invert); - - VCALL_PARRMEM0R(PackedColorArray, Color, size); - VCALL_PARRMEM0R(PackedColorArray, Color, empty); - VCALL_PARRMEM2(PackedColorArray, Color, set); - VCALL_PARRMEM1R(PackedColorArray, Color, get); - VCALL_PARRMEM1(PackedColorArray, Color, push_back); - VCALL_PARRMEM1(PackedColorArray, Color, resize); - VCALL_PARRMEM2R(PackedColorArray, Color, insert); - VCALL_PARRMEM1(PackedColorArray, Color, remove); - VCALL_PARRMEM1(PackedColorArray, Color, append); - VCALL_PARRMEM1(PackedColorArray, Color, append_array); - VCALL_PARRMEM1R(PackedColorArray, Color, has); - VCALL_PARRMEM0(PackedColorArray, Color, sort); - VCALL_PARRMEM0(PackedColorArray, Color, invert); - -#define VCALL_PTR0(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(); } -#define VCALL_PTR0R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(); } -#define VCALL_PTR1(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0]); } -#define VCALL_PTR1R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0]); } -#define VCALL_PTR2(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_PTR2R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1]); } -#define VCALL_PTR3(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_PTR3R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2]); } -#define VCALL_PTR4(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_PTR4R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); } -#define VCALL_PTR5(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } -#define VCALL_PTR5R(m_type, m_method) \ - static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); } - - VCALL_PTR0R(AABB, abs); - VCALL_PTR0R(AABB, get_area); - VCALL_PTR0R(AABB, has_no_area); - VCALL_PTR0R(AABB, has_no_surface); - VCALL_PTR1R(AABB, has_point); - VCALL_PTR1R(AABB, is_equal_approx); - VCALL_PTR1R(AABB, intersects); - VCALL_PTR1R(AABB, encloses); - VCALL_PTR1R(AABB, intersects_plane); - VCALL_PTR2R(AABB, intersects_segment); - VCALL_PTR1R(AABB, intersection); - VCALL_PTR1R(AABB, merge); - VCALL_PTR1R(AABB, expand); - VCALL_PTR1R(AABB, grow); - VCALL_PTR1R(AABB, get_support); - VCALL_PTR0R(AABB, get_longest_axis); - VCALL_PTR0R(AABB, get_longest_axis_index); - VCALL_PTR0R(AABB, get_longest_axis_size); - VCALL_PTR0R(AABB, get_shortest_axis); - VCALL_PTR0R(AABB, get_shortest_axis_index); - VCALL_PTR0R(AABB, get_shortest_axis_size); - VCALL_PTR1R(AABB, get_endpoint); - - VCALL_PTR0R(Transform2D, inverse); - VCALL_PTR0R(Transform2D, affine_inverse); - VCALL_PTR0R(Transform2D, get_rotation); - VCALL_PTR0R(Transform2D, get_origin); - VCALL_PTR0R(Transform2D, get_scale); - VCALL_PTR0R(Transform2D, orthonormalized); - VCALL_PTR1R(Transform2D, rotated); - VCALL_PTR1R(Transform2D, scaled); - VCALL_PTR1R(Transform2D, translated); - VCALL_PTR2R(Transform2D, interpolate_with); - VCALL_PTR1R(Transform2D, is_equal_approx); - - static void _call_Transform2D_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator Vector2()); - return; - case Variant::RECT2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator Rect2()); - return; - case Variant::PACKED_VECTOR2_ARRAY: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator PackedVector2Array()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'xform' in base 'Transform2D'. Valid types are Vector2, Rect2, and PackedVector2Array."); + static String func_PackedByteArray_hex_encode(PackedByteArray *p_instance) { + if (p_instance->size() == 0) { + return String(); } + const uint8_t *r = p_instance->ptr(); + String s = String::hex_encode_buffer(&r[0], p_instance->size()); + return s; } - static void _call_Transform2D_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Vector2()); - return; - case Variant::RECT2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Rect2()); - return; - case Variant::PACKED_VECTOR2_ARRAY: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator PackedVector2Array()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'xform_inv' in base 'Transform2D'. Valid types are Vector2, Rect2, and PackedVector2Array."); - } + static void func_Callable_call(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v); + callable->call(p_args, p_argcount, r_ret, r_error); } - static void _call_Transform2D_basis_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->basis_xform(p_args[0]->operator Vector2()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'basis_xform' in base 'Transform2D'. Only Vector2 is valid."); - } + static void func_Callable_call_deferred(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v); + callable->call_deferred(p_args, p_argcount); } - static void _call_Transform2D_basis_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR2: - r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->basis_xform_inv(p_args[0]->operator Vector2()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'basis_xform_inv' in base 'Transform2D'. Only Vector2 is valid."); - } - } - - VCALL_PTR0R(Basis, inverse); - VCALL_PTR0R(Basis, transposed); - VCALL_PTR0R(Basis, determinant); - VCALL_PTR2R(Basis, rotated); - VCALL_PTR1R(Basis, scaled); - VCALL_PTR0R(Basis, get_scale); - VCALL_PTR0R(Basis, get_euler); - VCALL_PTR0R(Basis, get_euler_xyz); - VCALL_PTR1(Basis, set_euler_xyz); - VCALL_PTR0R(Basis, get_euler_xzy); - VCALL_PTR1(Basis, set_euler_xzy); - VCALL_PTR0R(Basis, get_euler_yzx); - VCALL_PTR1(Basis, set_euler_yzx); - VCALL_PTR0R(Basis, get_euler_yxz); - VCALL_PTR1(Basis, set_euler_yxz); - VCALL_PTR0R(Basis, get_euler_zxy); - VCALL_PTR1(Basis, set_euler_zxy); - VCALL_PTR0R(Basis, get_euler_zyx); - VCALL_PTR1(Basis, set_euler_zyx); - VCALL_PTR1R(Basis, tdotx); - VCALL_PTR1R(Basis, tdoty); - VCALL_PTR1R(Basis, tdotz); - VCALL_PTR1R(Basis, xform); - VCALL_PTR1R(Basis, xform_inv); - VCALL_PTR0R(Basis, get_orthogonal_index); - VCALL_PTR0R(Basis, orthonormalized); - VCALL_PTR2R(Basis, slerp); - VCALL_PTR1R(Basis, is_equal_approx); - VCALL_PTR0R(Basis, get_rotation_quat); - - VCALL_PTR0R(Transform, inverse); - VCALL_PTR0R(Transform, affine_inverse); - VCALL_PTR2R(Transform, rotated); - VCALL_PTR1R(Transform, scaled); - VCALL_PTR1R(Transform, translated); - VCALL_PTR0R(Transform, orthonormalized); - VCALL_PTR2R(Transform, looking_at); - VCALL_PTR2R(Transform, interpolate_with); - VCALL_PTR1R(Transform, is_equal_approx); - - static void _call_Transform_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR3: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator Vector3()); - return; - case Variant::PLANE: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator Plane()); - return; - case Variant::AABB: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator ::AABB()); - return; - case Variant::PACKED_VECTOR3_ARRAY: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator ::PackedVector3Array()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'xform' in base 'Transform'. Valid types are Vector3, Plane, AABB, and PackedVector3Array."); - } + static void func_Callable_bind(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v); + r_ret = callable->bind(p_args, p_argcount); } - static void _call_Transform_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) { - switch (p_args[0]->type) { - case Variant::VECTOR3: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Vector3()); - return; - case Variant::PLANE: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Plane()); - return; - case Variant::AABB: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator ::AABB()); - return; - case Variant::PACKED_VECTOR3_ARRAY: - r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator ::PackedVector3Array()); - return; - default: - r_ret = Variant(); - ERR_PRINT("Invalid type in function 'xform_inv' in base 'Transform'. Valid types are Vector3, Plane, AABB, and PackedVector3Array."); - } + static void func_Signal_emit(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) { + Signal *signal = VariantGetInternalPtr<Signal>::get_ptr(v); + signal->emit(p_args, p_argcount); } struct ConstructData { @@ -1300,9 +883,10 @@ struct _VariantCall { } }; -_VariantCall::TypeFunc *_VariantCall::type_funcs = nullptr; _VariantCall::ConstructFunc *_VariantCall::construct_funcs = nullptr; _VariantCall::ConstantData *_VariantCall::constant_data = nullptr; +_VariantCall::MethodMap *_VariantCall::type_internal_methods = nullptr; +List<StringName> *_VariantCall::type_internal_method_names = nullptr; Variant Variant::call(const StringName &p_method, const Variant **p_args, int p_argcount, Callable::CallError &r_error) { Variant ret; @@ -1334,38 +918,14 @@ void Variant::call_ptr(const StringName &p_method, const Variant **p_args, int p } else { r_error.error = Callable::CallError::CALL_OK; - Map<StringName, _VariantCall::FuncData>::Element *E = _VariantCall::type_funcs[type].functions.find(p_method); - - if (E) { - _VariantCall::FuncData &funcdata = E->get(); - funcdata.call(ret, *this, p_args, p_argcount, r_error); + Variant::InternalMethod **m = _VariantCall::type_internal_methods[type].lookup_ptr(p_method); + if (m) { + (*m)->call((Variant *)this, p_args, p_argcount, ret, r_error); } else { - //handle vararg functions manually - bool valid = false; - if (type == CALLABLE) { - if (p_method == CoreStringNames::get_singleton()->call) { - reinterpret_cast<const Callable *>(_data._mem)->call(p_args, p_argcount, ret, r_error); - valid = true; - } - if (p_method == CoreStringNames::get_singleton()->call_deferred) { - reinterpret_cast<const Callable *>(_data._mem)->call_deferred(p_args, p_argcount); - valid = true; - } - } else if (type == SIGNAL) { - if (p_method == CoreStringNames::get_singleton()->emit) { - if (r_ret) { - *r_ret = Variant(); - } - reinterpret_cast<const Signal *>(_data._mem)->emit(p_args, p_argcount); - valid = true; - } - } - if (!valid) { - //ok fail because not found - r_error.error = Callable::CallError::CALL_ERROR_INVALID_METHOD; - return; - } + //ok fail because not found + r_error.error = Callable::CallError::CALL_ERROR_INVALID_METHOD; + return; } } @@ -1593,126 +1153,96 @@ bool Variant::has_method(const StringName &p_method) const { return obj->has_method(p_method); } - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[type]; - return tf.functions.has(p_method); + return _VariantCall::type_internal_methods[type].has(p_method); } Vector<Variant::Type> Variant::get_method_argument_types(Variant::Type p_type, const StringName &p_method) { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type]; + Vector<Variant::Type> types; - const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method); - if (!E) { - return Vector<Variant::Type>(); + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method); + if (*m) { + types.resize((*m)->get_argument_count()); + for (int i = 0; i < (*m)->get_argument_count(); i++) { + types.write[i] = (*m)->get_argument_type(i); + } } - return E->get().arg_types; + return types; } bool Variant::is_method_const(Variant::Type p_type, const StringName &p_method) { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type]; - - const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method); - if (!E) { - return false; + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method); + if (*m) { + return (*m)->get_flags() & Variant::InternalMethod::FLAG_IS_CONST; } - - return E->get()._const; + return false; } Vector<StringName> Variant::get_method_argument_names(Variant::Type p_type, const StringName &p_method) { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type]; + Vector<StringName> argnames; - const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method); - if (!E) { - return Vector<StringName>(); +#ifdef DEBUG_ENABLED + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method); + if (*m) { + argnames.resize((*m)->get_argument_count()); + for (int i = 0; i < (*m)->get_argument_count(); i++) { + argnames.write[i] = (*m)->get_argument_name(i); + } } - - return E->get().arg_names; +#endif + return argnames; } Variant::Type Variant::get_method_return_type(Variant::Type p_type, const StringName &p_method, bool *r_has_return) { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type]; - - const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method); - if (!E) { - return Variant::NIL; - } - - if (r_has_return) { - *r_has_return = E->get().returns; + Variant::Type rt = Variant::NIL; + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method); + if (*m) { + rt = (*m)->get_return_type(); + if (r_has_return) { + *r_has_return = ((*m)->get_flags() & Variant::InternalMethod::FLAG_RETURNS_VARIANT) || rt != Variant::NIL; + } } - - return E->get().return_type; + return rt; } Vector<Variant> Variant::get_method_default_arguments(Variant::Type p_type, const StringName &p_method) { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type]; - - const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method); - if (!E) { - return Vector<Variant>(); + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method); + if (*m) { + return (*m)->get_default_arguments(); } - - return E->get().default_args; + return Vector<Variant>(); } void Variant::get_method_list(List<MethodInfo> *p_list) const { - const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[type]; - - for (const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.front(); E; E = E->next()) { - const _VariantCall::FuncData &fd = E->get(); + for (List<StringName>::Element *E = _VariantCall::type_internal_method_names[type].front(); E; E = E->next()) { + Variant::InternalMethod **m = _VariantCall::type_internal_methods[type].lookup_ptr(E->get()); + ERR_CONTINUE(!*m); MethodInfo mi; - mi.name = E->key(); - - if (fd._const) { + mi.name = E->get(); + mi.return_val.type = (*m)->get_return_type(); + if ((*m)->get_flags() & Variant::InternalMethod::FLAG_RETURNS_VARIANT) { + mi.return_val.usage |= PROPERTY_USAGE_NIL_IS_VARIANT; + } + if ((*m)->get_flags() & Variant::InternalMethod::FLAG_IS_CONST) { mi.flags |= METHOD_FLAG_CONST; } - - for (int i = 0; i < fd.arg_types.size(); i++) { - PropertyInfo pi; - pi.type = fd.arg_types[i]; -#ifdef DEBUG_ENABLED - pi.name = fd.arg_names[i]; -#endif - mi.arguments.push_back(pi); + if ((*m)->get_flags() & Variant::InternalMethod::FLAG_VARARGS) { + mi.flags |= METHOD_FLAG_VARARG; } - mi.default_arguments = fd.default_args; - PropertyInfo ret; + for (int i = 0; i < (*m)->get_argument_count(); i++) { + PropertyInfo arg; #ifdef DEBUG_ENABLED - ret.type = fd.return_type; - if (fd.returns) { - ret.name = "ret"; - if (fd.return_type == Variant::NIL) { - ret.usage = PROPERTY_USAGE_NIL_IS_VARIANT; - } - } - mi.return_val = ret; + arg.name = (*m)->get_argument_name(i); +#else + arg.name = "arg" + itos(i + 1); #endif + arg.type = (*m)->get_argument_type(i); + mi.arguments.push_back(arg); + } - p_list->push_back(mi); - } - - if (type == CALLABLE) { - MethodInfo mi; - mi.name = "call"; - mi.return_val.usage = PROPERTY_USAGE_NIL_IS_VARIANT; - mi.flags |= METHOD_FLAG_VARARG; - - p_list->push_back(mi); - - mi.name = "call_deferred"; - mi.return_val.usage = 0; - - p_list->push_back(mi); - } - - if (type == SIGNAL) { - MethodInfo mi; - mi.name = "emit"; - mi.flags |= METHOD_FLAG_VARARG; - + mi.default_arguments = (*m)->get_default_arguments(); p_list->push_back(mi); } } @@ -1811,565 +1341,620 @@ Variant Variant::get_constant_value(Variant::Type p_type, const StringName &p_va return E->get(); } -void register_variant_methods() { - _VariantCall::type_funcs = memnew_arr(_VariantCall::TypeFunc, Variant::VARIANT_MAX); +Variant::InternalMethod *Variant::get_internal_method(Type p_type, const StringName &p_method_name) { + ERR_FAIL_INDEX_V(p_type, VARIANT_MAX, nullptr); + + Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method_name); + if (*m) { + return *m; + } + return nullptr; +} +void register_variant_methods() { + _VariantCall::type_internal_methods = memnew_arr(_VariantCall::MethodMap, Variant::VARIANT_MAX); + _VariantCall::type_internal_method_names = memnew_arr(List<StringName>, Variant::VARIANT_MAX); _VariantCall::construct_funcs = memnew_arr(_VariantCall::ConstructFunc, Variant::VARIANT_MAX); _VariantCall::constant_data = memnew_arr(_VariantCall::ConstantData, Variant::VARIANT_MAX); -#define ADDFUNC0R(m_vtype, m_ret, m_class, m_method, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg); -#define ADDFUNC1R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1))); -#define ADDFUNC2R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2))); -#define ADDFUNC3R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3))); -#define ADDFUNC4R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4))); - -#define ADDFUNC0RNC(m_vtype, m_ret, m_class, m_method, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg); -#define ADDFUNC1RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1))); -#define ADDFUNC2RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2))); -#define ADDFUNC3RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3))); -#define ADDFUNC4RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4))); - -#define ADDFUNC0(m_vtype, m_ret, m_class, m_method, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg); -#define ADDFUNC1(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1))); -#define ADDFUNC2(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2))); -#define ADDFUNC3(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3))); -#define ADDFUNC4(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \ - _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4))); - -#define ADDFUNC0NC(m_vtype, m_ret, m_class, m_method, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg); -#define ADDFUNC1NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1))); -#define ADDFUNC2NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2))); -#define ADDFUNC3NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3))); -#define ADDFUNC4NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \ - _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4))); - /* STRING */ - ADDFUNC1R(STRING, INT, String, casecmp_to, STRING, "to", varray()); - ADDFUNC1R(STRING, INT, String, nocasecmp_to, STRING, "to", varray()); - ADDFUNC1R(STRING, INT, String, naturalnocasecmp_to, STRING, "to", varray()); - ADDFUNC0R(STRING, INT, String, length, varray()); - ADDFUNC2R(STRING, STRING, String, substr, INT, "from", INT, "len", varray(-1)); - - ADDFUNC2R(STRING, INT, String, find, STRING, "what", INT, "from", varray(0)); - - ADDFUNC3R(STRING, INT, String, count, STRING, "what", INT, "from", INT, "to", varray(0, 0)); - ADDFUNC3R(STRING, INT, String, countn, STRING, "what", INT, "from", INT, "to", varray(0, 0)); - - ADDFUNC2R(STRING, INT, String, findn, STRING, "what", INT, "from", varray(0)); - ADDFUNC2R(STRING, INT, String, rfind, STRING, "what", INT, "from", varray(-1)); - ADDFUNC2R(STRING, INT, String, rfindn, STRING, "what", INT, "from", varray(-1)); - ADDFUNC1R(STRING, BOOL, String, match, STRING, "expr", varray()); - ADDFUNC1R(STRING, BOOL, String, matchn, STRING, "expr", varray()); - ADDFUNC1R(STRING, BOOL, String, begins_with, STRING, "text", varray()); - ADDFUNC1R(STRING, BOOL, String, ends_with, STRING, "text", varray()); - ADDFUNC1R(STRING, BOOL, String, is_subsequence_of, STRING, "text", varray()); - ADDFUNC1R(STRING, BOOL, String, is_subsequence_ofi, STRING, "text", varray()); - ADDFUNC0R(STRING, PACKED_STRING_ARRAY, String, bigrams, varray()); - ADDFUNC1R(STRING, FLOAT, String, similarity, STRING, "text", varray()); - - ADDFUNC2R(STRING, STRING, String, format, NIL, "values", STRING, "placeholder", varray("{_}")); - ADDFUNC2R(STRING, STRING, String, replace, STRING, "what", STRING, "forwhat", varray()); - ADDFUNC2R(STRING, STRING, String, replacen, STRING, "what", STRING, "forwhat", varray()); - ADDFUNC1R(STRING, STRING, String, repeat, INT, "count", varray()); - ADDFUNC2R(STRING, STRING, String, insert, INT, "position", STRING, "what", varray()); - ADDFUNC0R(STRING, STRING, String, capitalize, varray()); - ADDFUNC3R(STRING, PACKED_STRING_ARRAY, String, split, STRING, "delimiter", BOOL, "allow_empty", INT, "maxsplit", varray(true, 0)); - ADDFUNC3R(STRING, PACKED_STRING_ARRAY, String, rsplit, STRING, "delimiter", BOOL, "allow_empty", INT, "maxsplit", varray(true, 0)); - ADDFUNC2R(STRING, PACKED_FLOAT32_ARRAY, String, split_floats, STRING, "delimiter", BOOL, "allow_empty", varray(true)); - ADDFUNC1R(STRING, STRING, String, join, PACKED_STRING_ARRAY, "parts", varray()); - - ADDFUNC0R(STRING, STRING, String, to_upper, varray()); - ADDFUNC0R(STRING, STRING, String, to_lower, varray()); - - ADDFUNC1R(STRING, STRING, String, left, INT, "position", varray()); - ADDFUNC1R(STRING, STRING, String, right, INT, "position", varray()); - ADDFUNC2R(STRING, STRING, String, strip_edges, BOOL, "left", BOOL, "right", varray(true, true)); - ADDFUNC0R(STRING, STRING, String, strip_escapes, varray()); - ADDFUNC1R(STRING, STRING, String, lstrip, STRING, "chars", varray()); - ADDFUNC1R(STRING, STRING, String, rstrip, STRING, "chars", varray()); - ADDFUNC0R(STRING, STRING, String, get_extension, varray()); - ADDFUNC0R(STRING, STRING, String, get_basename, varray()); - ADDFUNC1R(STRING, STRING, String, plus_file, STRING, "file", varray()); - ADDFUNC1R(STRING, INT, String, ord_at, INT, "at", varray()); - ADDFUNC0R(STRING, STRING, String, dedent, varray()); - ADDFUNC2(STRING, NIL, String, erase, INT, "position", INT, "chars", varray()); - ADDFUNC0R(STRING, INT, String, hash, varray()); - ADDFUNC0R(STRING, STRING, String, md5_text, varray()); - ADDFUNC0R(STRING, STRING, String, sha1_text, varray()); - ADDFUNC0R(STRING, STRING, String, sha256_text, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, md5_buffer, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, sha1_buffer, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, sha256_buffer, varray()); - ADDFUNC0R(STRING, BOOL, String, empty, varray()); - ADDFUNC1R(STRING, STRING, String, humanize_size, INT, "size", varray()); - ADDFUNC0R(STRING, BOOL, String, is_abs_path, varray()); - ADDFUNC0R(STRING, BOOL, String, is_rel_path, varray()); - ADDFUNC0R(STRING, STRING, String, get_base_dir, varray()); - ADDFUNC0R(STRING, STRING, String, get_file, varray()); - ADDFUNC0R(STRING, STRING, String, xml_escape, varray()); - ADDFUNC0R(STRING, STRING, String, xml_unescape, varray()); - ADDFUNC0R(STRING, STRING, String, http_escape, varray()); - ADDFUNC0R(STRING, STRING, String, http_unescape, varray()); - ADDFUNC0R(STRING, STRING, String, c_escape, varray()); - ADDFUNC0R(STRING, STRING, String, c_unescape, varray()); - ADDFUNC0R(STRING, STRING, String, json_escape, varray()); - ADDFUNC0R(STRING, STRING, String, percent_encode, varray()); - ADDFUNC0R(STRING, STRING, String, percent_decode, varray()); - ADDFUNC0R(STRING, BOOL, String, is_valid_identifier, varray()); - ADDFUNC0R(STRING, BOOL, String, is_valid_integer, varray()); - ADDFUNC0R(STRING, BOOL, String, is_valid_float, varray()); - ADDFUNC1R(STRING, BOOL, String, is_valid_hex_number, BOOL, "with_prefix", varray(false)); - ADDFUNC0R(STRING, BOOL, String, is_valid_html_color, varray()); - ADDFUNC0R(STRING, BOOL, String, is_valid_ip_address, varray()); - ADDFUNC0R(STRING, BOOL, String, is_valid_filename, varray()); - ADDFUNC0R(STRING, INT, String, to_int, varray()); - ADDFUNC0R(STRING, FLOAT, String, to_float, varray()); - ADDFUNC0R(STRING, INT, String, hex_to_int, varray()); - ADDFUNC2R(STRING, STRING, String, lpad, INT, "min_length", STRING, "character", varray(" ")); - ADDFUNC2R(STRING, STRING, String, rpad, INT, "min_length", STRING, "character", varray(" ")); - ADDFUNC1R(STRING, STRING, String, pad_decimals, INT, "digits", varray()); - ADDFUNC1R(STRING, STRING, String, pad_zeros, INT, "digits", varray()); - ADDFUNC1R(STRING, STRING, String, trim_prefix, STRING, "prefix", varray()); - ADDFUNC1R(STRING, STRING, String, trim_suffix, STRING, "suffix", varray()); - - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_ascii, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf8, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf16, varray()); - ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf32, varray()); - - ADDFUNC0R(VECTOR2, FLOAT, Vector2, angle, varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, angle_to, VECTOR2, "to", varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, angle_to_point, VECTOR2, "to", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, direction_to, VECTOR2, "b", varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, distance_to, VECTOR2, "to", varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, distance_squared_to, VECTOR2, "to", varray()); - ADDFUNC0R(VECTOR2, FLOAT, Vector2, length, varray()); - ADDFUNC0R(VECTOR2, FLOAT, Vector2, length_squared, varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, normalized, varray()); - ADDFUNC0R(VECTOR2, BOOL, Vector2, is_normalized, varray()); - ADDFUNC1R(VECTOR2, BOOL, Vector2, is_equal_approx, VECTOR2, "v", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, posmod, FLOAT, "mod", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, posmodv, VECTOR2, "modv", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, project, VECTOR2, "b", varray()); - ADDFUNC2R(VECTOR2, VECTOR2, Vector2, lerp, VECTOR2, "b", FLOAT, "t", varray()); - ADDFUNC2R(VECTOR2, VECTOR2, Vector2, slerp, VECTOR2, "b", FLOAT, "t", varray()); - ADDFUNC4R(VECTOR2, VECTOR2, Vector2, cubic_interpolate, VECTOR2, "b", VECTOR2, "pre_a", VECTOR2, "post_b", FLOAT, "t", varray()); - ADDFUNC2R(VECTOR2, VECTOR2, Vector2, move_toward, VECTOR2, "to", FLOAT, "delta", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, rotated, FLOAT, "phi", varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, tangent, varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, floor, varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, ceil, varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, round, varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, snapped, VECTOR2, "by", varray()); - ADDFUNC0R(VECTOR2, FLOAT, Vector2, aspect, varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, dot, VECTOR2, "with", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, slide, VECTOR2, "n", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, bounce, VECTOR2, "n", varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, reflect, VECTOR2, "n", varray()); - ADDFUNC1R(VECTOR2, FLOAT, Vector2, cross, VECTOR2, "with", varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, abs, varray()); - ADDFUNC1R(VECTOR2, VECTOR2, Vector2, clamped, FLOAT, "length", varray()); - ADDFUNC0R(VECTOR2, VECTOR2, Vector2, sign, varray()); - - ADDFUNC0R(VECTOR2I, FLOAT, Vector2i, aspect, varray()); - ADDFUNC0R(VECTOR2I, VECTOR2I, Vector2i, sign, varray()); - ADDFUNC0R(VECTOR2I, VECTOR2I, Vector2i, abs, varray()); - - ADDFUNC0R(RECT2, FLOAT, Rect2, get_area, varray()); - ADDFUNC0R(RECT2, BOOL, Rect2, has_no_area, varray()); - ADDFUNC1R(RECT2, BOOL, Rect2, has_point, VECTOR2, "point", varray()); - ADDFUNC1R(RECT2, BOOL, Rect2, is_equal_approx, RECT2, "rect", varray()); - ADDFUNC2R(RECT2, BOOL, Rect2, intersects, RECT2, "b", BOOL, "include_borders", varray(false)); - ADDFUNC1R(RECT2, BOOL, Rect2, encloses, RECT2, "b", varray()); - ADDFUNC1R(RECT2, RECT2, Rect2, clip, RECT2, "b", varray()); - ADDFUNC1R(RECT2, RECT2, Rect2, merge, RECT2, "b", varray()); - ADDFUNC1R(RECT2, RECT2, Rect2, expand, VECTOR2, "to", varray()); - ADDFUNC1R(RECT2, RECT2, Rect2, grow, FLOAT, "by", varray()); - ADDFUNC2R(RECT2, RECT2, Rect2, grow_margin, INT, "margin", FLOAT, "by", varray()); - ADDFUNC4R(RECT2, RECT2, Rect2, grow_individual, FLOAT, "left", FLOAT, "top", FLOAT, "right", FLOAT, " bottom", varray()); - ADDFUNC0R(RECT2, RECT2, Rect2, abs, varray()); - - ADDFUNC0R(RECT2I, INT, Rect2i, get_area, varray()); - ADDFUNC0R(RECT2I, BOOL, Rect2i, has_no_area, varray()); - ADDFUNC1R(RECT2I, BOOL, Rect2i, has_point, VECTOR2I, "point", varray()); - ADDFUNC1R(RECT2I, BOOL, Rect2i, intersects, RECT2I, "b", varray()); - ADDFUNC1R(RECT2I, BOOL, Rect2i, encloses, RECT2I, "b", varray()); - ADDFUNC1R(RECT2I, RECT2I, Rect2i, clip, RECT2I, "b", varray()); - ADDFUNC1R(RECT2I, RECT2I, Rect2i, merge, RECT2I, "b", varray()); - ADDFUNC1R(RECT2I, RECT2I, Rect2i, expand, VECTOR2I, "to", varray()); - ADDFUNC1R(RECT2I, RECT2I, Rect2i, grow, INT, "by", varray()); - ADDFUNC2R(RECT2I, RECT2I, Rect2i, grow_margin, INT, "margin", INT, "by", varray()); - ADDFUNC4R(RECT2I, RECT2I, Rect2i, grow_individual, INT, "left", INT, "top", INT, "right", INT, " bottom", varray()); - ADDFUNC0R(RECT2I, RECT2I, Rect2i, abs, varray()); - - ADDFUNC0R(VECTOR3, INT, Vector3, min_axis, varray()); - ADDFUNC0R(VECTOR3, INT, Vector3, max_axis, varray()); - ADDFUNC1R(VECTOR3, FLOAT, Vector3, angle_to, VECTOR3, "to", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, direction_to, VECTOR3, "b", varray()); - ADDFUNC1R(VECTOR3, FLOAT, Vector3, distance_to, VECTOR3, "b", varray()); - ADDFUNC1R(VECTOR3, FLOAT, Vector3, distance_squared_to, VECTOR3, "b", varray()); - ADDFUNC0R(VECTOR3, FLOAT, Vector3, length, varray()); - ADDFUNC0R(VECTOR3, FLOAT, Vector3, length_squared, varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, normalized, varray()); - ADDFUNC0R(VECTOR3, BOOL, Vector3, is_normalized, varray()); - ADDFUNC1R(VECTOR3, BOOL, Vector3, is_equal_approx, VECTOR3, "v", varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, inverse, varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, snapped, VECTOR3, "by", varray()); - ADDFUNC2R(VECTOR3, VECTOR3, Vector3, rotated, VECTOR3, "axis", FLOAT, "phi", varray()); - ADDFUNC2R(VECTOR3, VECTOR3, Vector3, lerp, VECTOR3, "b", FLOAT, "t", varray()); - ADDFUNC2R(VECTOR3, VECTOR3, Vector3, slerp, VECTOR3, "b", FLOAT, "t", varray()); - ADDFUNC4R(VECTOR3, VECTOR3, Vector3, cubic_interpolate, VECTOR3, "b", VECTOR3, "pre_a", VECTOR3, "post_b", FLOAT, "t", varray()); - ADDFUNC2R(VECTOR3, VECTOR3, Vector3, move_toward, VECTOR3, "to", FLOAT, "delta", varray()); - ADDFUNC1R(VECTOR3, FLOAT, Vector3, dot, VECTOR3, "b", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, cross, VECTOR3, "b", varray()); - ADDFUNC1R(VECTOR3, BASIS, Vector3, outer, VECTOR3, "b", varray()); - ADDFUNC0R(VECTOR3, BASIS, Vector3, to_diagonal_matrix, varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, abs, varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, floor, varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, ceil, varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, round, varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, posmod, FLOAT, "mod", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, posmodv, VECTOR3, "modv", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, project, VECTOR3, "b", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, slide, VECTOR3, "n", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, bounce, VECTOR3, "n", varray()); - ADDFUNC1R(VECTOR3, VECTOR3, Vector3, reflect, VECTOR3, "n", varray()); - ADDFUNC0R(VECTOR3, VECTOR3, Vector3, sign, varray()); - - ADDFUNC0R(VECTOR3I, INT, Vector3i, min_axis, varray()); - ADDFUNC0R(VECTOR3I, INT, Vector3i, max_axis, varray()); - ADDFUNC0R(VECTOR3I, VECTOR3I, Vector3i, sign, varray()); - - ADDFUNC0R(PLANE, PLANE, Plane, normalized, varray()); - ADDFUNC0R(PLANE, VECTOR3, Plane, center, varray()); - ADDFUNC1R(PLANE, BOOL, Plane, is_equal_approx, PLANE, "plane", varray()); - ADDFUNC1R(PLANE, BOOL, Plane, is_point_over, VECTOR3, "point", varray()); - ADDFUNC1R(PLANE, FLOAT, Plane, distance_to, VECTOR3, "point", varray()); - ADDFUNC2R(PLANE, BOOL, Plane, has_point, VECTOR3, "point", FLOAT, "epsilon", varray(CMP_EPSILON)); - ADDFUNC1R(PLANE, VECTOR3, Plane, project, VECTOR3, "point", varray()); - ADDFUNC2R(PLANE, VECTOR3, Plane, intersect_3, PLANE, "b", PLANE, "c", varray()); - ADDFUNC2R(PLANE, VECTOR3, Plane, intersects_ray, VECTOR3, "from", VECTOR3, "dir", varray()); - ADDFUNC2R(PLANE, VECTOR3, Plane, intersects_segment, VECTOR3, "begin", VECTOR3, "end", varray()); - - ADDFUNC0R(QUAT, FLOAT, Quat, length, varray()); - ADDFUNC0R(QUAT, FLOAT, Quat, length_squared, varray()); - ADDFUNC0R(QUAT, QUAT, Quat, normalized, varray()); - ADDFUNC0R(QUAT, BOOL, Quat, is_normalized, varray()); - ADDFUNC1R(QUAT, BOOL, Quat, is_equal_approx, QUAT, "quat", varray()); - ADDFUNC0R(QUAT, QUAT, Quat, inverse, varray()); - ADDFUNC1R(QUAT, FLOAT, Quat, dot, QUAT, "b", varray()); - ADDFUNC1R(QUAT, VECTOR3, Quat, xform, VECTOR3, "v", varray()); - ADDFUNC2R(QUAT, QUAT, Quat, slerp, QUAT, "b", FLOAT, "t", varray()); - ADDFUNC2R(QUAT, QUAT, Quat, slerpni, QUAT, "b", FLOAT, "t", varray()); - ADDFUNC4R(QUAT, QUAT, Quat, cubic_slerp, QUAT, "b", QUAT, "pre_a", QUAT, "post_b", FLOAT, "t", varray()); - ADDFUNC0R(QUAT, VECTOR3, Quat, get_euler, varray()); - ADDFUNC1(QUAT, NIL, Quat, set_euler, VECTOR3, "euler", varray()); - ADDFUNC2(QUAT, NIL, Quat, set_axis_angle, VECTOR3, "axis", FLOAT, "angle", varray()); - - ADDFUNC0R(COLOR, INT, Color, to_argb32, varray()); - ADDFUNC0R(COLOR, INT, Color, to_abgr32, varray()); - ADDFUNC0R(COLOR, INT, Color, to_rgba32, varray()); - ADDFUNC0R(COLOR, INT, Color, to_argb64, varray()); - ADDFUNC0R(COLOR, INT, Color, to_abgr64, varray()); - ADDFUNC0R(COLOR, INT, Color, to_rgba64, varray()); - ADDFUNC0R(COLOR, COLOR, Color, inverted, varray()); - ADDFUNC0R(COLOR, COLOR, Color, contrasted, varray()); - ADDFUNC2R(COLOR, COLOR, Color, lerp, COLOR, "b", FLOAT, "t", varray()); - ADDFUNC1R(COLOR, COLOR, Color, blend, COLOR, "over", varray()); - ADDFUNC1R(COLOR, COLOR, Color, lightened, FLOAT, "amount", varray()); - ADDFUNC1R(COLOR, COLOR, Color, darkened, FLOAT, "amount", varray()); - ADDFUNC1R(COLOR, STRING, Color, to_html, BOOL, "with_alpha", varray(true)); - ADDFUNC4R(COLOR, COLOR, Color, from_hsv, FLOAT, "h", FLOAT, "s", FLOAT, "v", FLOAT, "a", varray(1.0)); - ADDFUNC1R(COLOR, BOOL, Color, is_equal_approx, COLOR, "color", varray()); - - ADDFUNC0R(_RID, INT, RID, get_id, varray()); - - ADDFUNC0R(NODE_PATH, BOOL, NodePath, is_absolute, varray()); - ADDFUNC0R(NODE_PATH, INT, NodePath, get_name_count, varray()); - ADDFUNC1R(NODE_PATH, STRING, NodePath, get_name, INT, "idx", varray()); - ADDFUNC0R(NODE_PATH, INT, NodePath, get_subname_count, varray()); - ADDFUNC1R(NODE_PATH, STRING, NodePath, get_subname, INT, "idx", varray()); - ADDFUNC0R(NODE_PATH, STRING, NodePath, get_concatenated_subnames, varray()); - ADDFUNC0R(NODE_PATH, NODE_PATH, NodePath, get_as_property_path, varray()); - ADDFUNC0R(NODE_PATH, BOOL, NodePath, is_empty, varray()); - - ADDFUNC0R(DICTIONARY, INT, Dictionary, size, varray()); - ADDFUNC0R(DICTIONARY, BOOL, Dictionary, empty, varray()); - ADDFUNC0NC(DICTIONARY, NIL, Dictionary, clear, varray()); - ADDFUNC1R(DICTIONARY, BOOL, Dictionary, has, NIL, "key", varray()); - ADDFUNC1R(DICTIONARY, BOOL, Dictionary, has_all, ARRAY, "keys", varray()); - ADDFUNC1RNC(DICTIONARY, BOOL, Dictionary, erase, NIL, "key", varray()); - ADDFUNC0R(DICTIONARY, INT, Dictionary, hash, varray()); - ADDFUNC0R(DICTIONARY, ARRAY, Dictionary, keys, varray()); - ADDFUNC0R(DICTIONARY, ARRAY, Dictionary, values, varray()); - ADDFUNC1R(DICTIONARY, DICTIONARY, Dictionary, duplicate, BOOL, "deep", varray(false)); - ADDFUNC2R(DICTIONARY, NIL, Dictionary, get, NIL, "key", NIL, "default", varray(Variant())); - - ADDFUNC0R(CALLABLE, BOOL, Callable, is_null, varray()); - ADDFUNC0R(CALLABLE, BOOL, Callable, is_custom, varray()); - ADDFUNC0R(CALLABLE, BOOL, Callable, is_standard, varray()); - ADDFUNC0R(CALLABLE, OBJECT, Callable, get_object, varray()); - ADDFUNC0R(CALLABLE, INT, Callable, get_object_id, varray()); - ADDFUNC0R(CALLABLE, STRING_NAME, Callable, get_method, varray()); - ADDFUNC0R(CALLABLE, INT, Callable, hash, varray()); - - ADDFUNC0R(SIGNAL, BOOL, Signal, is_null, varray()); - ADDFUNC0R(SIGNAL, OBJECT, Signal, get_object, varray()); - ADDFUNC0R(SIGNAL, INT, Signal, get_object_id, varray()); - ADDFUNC0R(SIGNAL, STRING_NAME, Signal, get_name, varray()); - - ADDFUNC3R(SIGNAL, INT, Signal, connect, CALLABLE, "callable", ARRAY, "binds", INT, "flags", varray(Array(), 0)); - - ADDFUNC1R(SIGNAL, NIL, Signal, disconnect, CALLABLE, "callable", varray()); - ADDFUNC1R(SIGNAL, BOOL, Signal, is_connected, CALLABLE, "callable", varray()); - ADDFUNC0R(SIGNAL, ARRAY, Signal, get_connections, varray()); - - ADDFUNC0R(ARRAY, INT, Array, size, varray()); - ADDFUNC0R(ARRAY, BOOL, Array, empty, varray()); - ADDFUNC0NC(ARRAY, NIL, Array, clear, varray()); - ADDFUNC0R(ARRAY, INT, Array, hash, varray()); - ADDFUNC1NC(ARRAY, NIL, Array, push_back, NIL, "value", varray()); - ADDFUNC1NC(ARRAY, NIL, Array, push_front, NIL, "value", varray()); - ADDFUNC1NC(ARRAY, NIL, Array, append, NIL, "value", varray()); - ADDFUNC1NC(ARRAY, NIL, Array, resize, INT, "size", varray()); - ADDFUNC2NC(ARRAY, NIL, Array, insert, INT, "position", NIL, "value", varray()); - ADDFUNC1NC(ARRAY, NIL, Array, remove, INT, "position", varray()); - ADDFUNC1NC(ARRAY, NIL, Array, erase, NIL, "value", varray()); - ADDFUNC0R(ARRAY, NIL, Array, front, varray()); - ADDFUNC0R(ARRAY, NIL, Array, back, varray()); - ADDFUNC2R(ARRAY, INT, Array, find, NIL, "what", INT, "from", varray(0)); - ADDFUNC2R(ARRAY, INT, Array, rfind, NIL, "what", INT, "from", varray(-1)); - ADDFUNC1R(ARRAY, INT, Array, find_last, NIL, "value", varray()); - ADDFUNC1R(ARRAY, INT, Array, count, NIL, "value", varray()); - ADDFUNC1R(ARRAY, BOOL, Array, has, NIL, "value", varray()); - ADDFUNC0RNC(ARRAY, NIL, Array, pop_back, varray()); - ADDFUNC0RNC(ARRAY, NIL, Array, pop_front, varray()); - ADDFUNC0NC(ARRAY, NIL, Array, sort, varray()); - ADDFUNC2NC(ARRAY, NIL, Array, sort_custom, OBJECT, "obj", STRING, "func", varray()); - ADDFUNC0NC(ARRAY, NIL, Array, shuffle, varray()); - ADDFUNC2R(ARRAY, INT, Array, bsearch, NIL, "value", BOOL, "before", varray(true)); - ADDFUNC4R(ARRAY, INT, Array, bsearch_custom, NIL, "value", OBJECT, "obj", STRING, "func", BOOL, "before", varray(true)); - ADDFUNC0NC(ARRAY, NIL, Array, invert, varray()); - ADDFUNC1R(ARRAY, ARRAY, Array, duplicate, BOOL, "deep", varray(false)); - ADDFUNC4R(ARRAY, ARRAY, Array, slice, INT, "begin", INT, "end", INT, "step", BOOL, "deep", varray(1, false)); - ADDFUNC0R(ARRAY, NIL, Array, max, varray()); - ADDFUNC0R(ARRAY, NIL, Array, min, varray()); - - ADDFUNC0R(PACKED_BYTE_ARRAY, INT, PackedByteArray, size, varray()); - ADDFUNC0R(PACKED_BYTE_ARRAY, BOOL, PackedByteArray, empty, varray()); - ADDFUNC2(PACKED_BYTE_ARRAY, NIL, PackedByteArray, set, INT, "idx", INT, "byte", varray()); - ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, push_back, INT, "byte", varray()); - ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, append, INT, "byte", varray()); - ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, append_array, PACKED_BYTE_ARRAY, "array", varray()); - ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_BYTE_ARRAY, INT, PackedByteArray, insert, INT, "idx", INT, "byte", varray()); - ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_BYTE_ARRAY, BOOL, PackedByteArray, has, INT, "value", varray()); - ADDFUNC0(PACKED_BYTE_ARRAY, NIL, PackedByteArray, sort, varray()); - ADDFUNC0(PACKED_BYTE_ARRAY, NIL, PackedByteArray, invert, varray()); - ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, subarray, INT, "from", INT, "to", varray()); - - ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_ascii, varray()); - ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf8, varray()); - ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf16, varray()); - ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf32, varray()); - ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, hex_encode, varray()); - ADDFUNC1R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, compress, INT, "compression_mode", varray(0)); - ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, decompress, INT, "buffer_size", INT, "compression_mode", varray(0)); - ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, decompress_dynamic, INT, "max_output_size", INT, "compression_mode", varray(0)); - - ADDFUNC0R(PACKED_INT32_ARRAY, INT, PackedInt32Array, size, varray()); - ADDFUNC0R(PACKED_INT32_ARRAY, BOOL, PackedInt32Array, empty, varray()); - ADDFUNC2(PACKED_INT32_ARRAY, NIL, PackedInt32Array, set, INT, "idx", INT, "integer", varray()); - ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, push_back, INT, "integer", varray()); - ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, append, INT, "integer", varray()); - ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, append_array, PACKED_INT32_ARRAY, "array", varray()); - ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_INT32_ARRAY, INT, PackedInt32Array, insert, INT, "idx", INT, "integer", varray()); - ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_INT32_ARRAY, BOOL, PackedInt32Array, has, INT, "value", varray()); - ADDFUNC0(PACKED_INT32_ARRAY, NIL, PackedInt32Array, sort, varray()); - ADDFUNC0(PACKED_INT32_ARRAY, NIL, PackedInt32Array, invert, varray()); - - ADDFUNC0R(PACKED_INT64_ARRAY, INT, PackedInt64Array, size, varray()); - ADDFUNC0R(PACKED_INT64_ARRAY, BOOL, PackedInt64Array, empty, varray()); - ADDFUNC2(PACKED_INT64_ARRAY, NIL, PackedInt64Array, set, INT, "idx", INT, "integer", varray()); - ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, push_back, INT, "integer", varray()); - ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, append, INT, "integer", varray()); - ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, append_array, PACKED_INT64_ARRAY, "array", varray()); - ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_INT64_ARRAY, INT, PackedInt64Array, insert, INT, "idx", INT, "integer", varray()); - ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_INT64_ARRAY, BOOL, PackedInt64Array, has, INT, "value", varray()); - ADDFUNC0(PACKED_INT64_ARRAY, NIL, PackedInt64Array, sort, varray()); - ADDFUNC0(PACKED_INT64_ARRAY, NIL, PackedInt64Array, invert, varray()); - - ADDFUNC0R(PACKED_FLOAT32_ARRAY, INT, PackedFloat32Array, size, varray()); - ADDFUNC0R(PACKED_FLOAT32_ARRAY, BOOL, PackedFloat32Array, empty, varray()); - ADDFUNC2(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, set, INT, "idx", FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, push_back, FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, append, FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, append_array, PACKED_FLOAT32_ARRAY, "array", varray()); - ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_FLOAT32_ARRAY, INT, PackedFloat32Array, insert, INT, "idx", FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_FLOAT32_ARRAY, BOOL, PackedFloat32Array, has, FLOAT, "value", varray()); - ADDFUNC0(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, sort, varray()); - ADDFUNC0(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, invert, varray()); - - ADDFUNC0R(PACKED_FLOAT64_ARRAY, INT, PackedFloat64Array, size, varray()); - ADDFUNC0R(PACKED_FLOAT64_ARRAY, BOOL, PackedFloat64Array, empty, varray()); - ADDFUNC2(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, set, INT, "idx", FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, push_back, FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, append, FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, append_array, PACKED_FLOAT64_ARRAY, "array", varray()); - ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_FLOAT64_ARRAY, INT, PackedFloat64Array, insert, INT, "idx", FLOAT, "value", varray()); - ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_FLOAT64_ARRAY, BOOL, PackedFloat64Array, has, FLOAT, "value", varray()); - ADDFUNC0(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, sort, varray()); - ADDFUNC0(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, invert, varray()); - - ADDFUNC0R(PACKED_STRING_ARRAY, INT, PackedStringArray, size, varray()); - ADDFUNC0R(PACKED_STRING_ARRAY, BOOL, PackedStringArray, empty, varray()); - ADDFUNC2(PACKED_STRING_ARRAY, NIL, PackedStringArray, set, INT, "idx", STRING, "string", varray()); - ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, push_back, STRING, "string", varray()); - ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, append, STRING, "string", varray()); - ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, append_array, PACKED_STRING_ARRAY, "array", varray()); - ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_STRING_ARRAY, INT, PackedStringArray, insert, INT, "idx", STRING, "string", varray()); - ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_STRING_ARRAY, BOOL, PackedStringArray, has, STRING, "value", varray()); - ADDFUNC0(PACKED_STRING_ARRAY, NIL, PackedStringArray, sort, varray()); - ADDFUNC0(PACKED_STRING_ARRAY, NIL, PackedStringArray, invert, varray()); - - ADDFUNC0R(PACKED_VECTOR2_ARRAY, INT, PackedVector2Array, size, varray()); - ADDFUNC0R(PACKED_VECTOR2_ARRAY, BOOL, PackedVector2Array, empty, varray()); - ADDFUNC2(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, set, INT, "idx", VECTOR2, "vector2", varray()); - ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, push_back, VECTOR2, "vector2", varray()); - ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, append, VECTOR2, "vector2", varray()); - ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, append_array, PACKED_VECTOR2_ARRAY, "array", varray()); - ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_VECTOR2_ARRAY, INT, PackedVector2Array, insert, INT, "idx", VECTOR2, "vector2", varray()); - ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_VECTOR2_ARRAY, BOOL, PackedVector2Array, has, VECTOR2, "value", varray()); - ADDFUNC0(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, sort, varray()); - ADDFUNC0(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, invert, varray()); - - ADDFUNC0R(PACKED_VECTOR3_ARRAY, INT, PackedVector3Array, size, varray()); - ADDFUNC0R(PACKED_VECTOR3_ARRAY, BOOL, PackedVector3Array, empty, varray()); - ADDFUNC2(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, set, INT, "idx", VECTOR3, "vector3", varray()); - ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, push_back, VECTOR3, "vector3", varray()); - ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, append, VECTOR3, "vector3", varray()); - ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, append_array, PACKED_VECTOR3_ARRAY, "array", varray()); - ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_VECTOR3_ARRAY, INT, PackedVector3Array, insert, INT, "idx", VECTOR3, "vector3", varray()); - ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_VECTOR3_ARRAY, BOOL, PackedVector3Array, has, VECTOR3, "value", varray()); - ADDFUNC0(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, sort, varray()); - ADDFUNC0(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, invert, varray()); - - ADDFUNC0R(PACKED_COLOR_ARRAY, INT, PackedColorArray, size, varray()); - ADDFUNC0R(PACKED_COLOR_ARRAY, BOOL, PackedColorArray, empty, varray()); - ADDFUNC2(PACKED_COLOR_ARRAY, NIL, PackedColorArray, set, INT, "idx", COLOR, "color", varray()); - ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, push_back, COLOR, "color", varray()); - ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, append, COLOR, "color", varray()); - ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, append_array, PACKED_COLOR_ARRAY, "array", varray()); - ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, remove, INT, "idx", varray()); - ADDFUNC2R(PACKED_COLOR_ARRAY, INT, PackedColorArray, insert, INT, "idx", COLOR, "color", varray()); - ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, resize, INT, "idx", varray()); - ADDFUNC1R(PACKED_COLOR_ARRAY, BOOL, PackedColorArray, has, COLOR, "value", varray()); - ADDFUNC0(PACKED_COLOR_ARRAY, NIL, PackedColorArray, sort, varray()); - ADDFUNC0(PACKED_COLOR_ARRAY, NIL, PackedColorArray, invert, varray()); - - //pointerbased - - ADDFUNC0R(AABB, AABB, AABB, abs, varray()); - ADDFUNC0R(AABB, FLOAT, AABB, get_area, varray()); - ADDFUNC0R(AABB, BOOL, AABB, has_no_area, varray()); - ADDFUNC0R(AABB, BOOL, AABB, has_no_surface, varray()); - ADDFUNC1R(AABB, BOOL, AABB, has_point, VECTOR3, "point", varray()); - ADDFUNC1R(AABB, BOOL, AABB, is_equal_approx, AABB, "aabb", varray()); - ADDFUNC1R(AABB, BOOL, AABB, intersects, AABB, "with", varray()); - ADDFUNC1R(AABB, BOOL, AABB, encloses, AABB, "with", varray()); - ADDFUNC1R(AABB, BOOL, AABB, intersects_plane, PLANE, "plane", varray()); - ADDFUNC2R(AABB, BOOL, AABB, intersects_segment, VECTOR3, "from", VECTOR3, "to", varray()); - ADDFUNC1R(AABB, AABB, AABB, intersection, AABB, "with", varray()); - ADDFUNC1R(AABB, AABB, AABB, merge, AABB, "with", varray()); - ADDFUNC1R(AABB, AABB, AABB, expand, VECTOR3, "to_point", varray()); - ADDFUNC1R(AABB, AABB, AABB, grow, FLOAT, "by", varray()); - ADDFUNC1R(AABB, VECTOR3, AABB, get_support, VECTOR3, "dir", varray()); - ADDFUNC0R(AABB, VECTOR3, AABB, get_longest_axis, varray()); - ADDFUNC0R(AABB, INT, AABB, get_longest_axis_index, varray()); - ADDFUNC0R(AABB, FLOAT, AABB, get_longest_axis_size, varray()); - ADDFUNC0R(AABB, VECTOR3, AABB, get_shortest_axis, varray()); - ADDFUNC0R(AABB, INT, AABB, get_shortest_axis_index, varray()); - ADDFUNC0R(AABB, FLOAT, AABB, get_shortest_axis_size, varray()); - ADDFUNC1R(AABB, VECTOR3, AABB, get_endpoint, INT, "idx", varray()); - - ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, inverse, varray()); - ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, affine_inverse, varray()); - ADDFUNC0R(TRANSFORM2D, FLOAT, Transform2D, get_rotation, varray()); - ADDFUNC0R(TRANSFORM2D, VECTOR2, Transform2D, get_origin, varray()); - ADDFUNC0R(TRANSFORM2D, VECTOR2, Transform2D, get_scale, varray()); - ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, orthonormalized, varray()); - ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, rotated, FLOAT, "phi", varray()); - ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, scaled, VECTOR2, "scale", varray()); - ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, translated, VECTOR2, "offset", varray()); - ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform, NIL, "v", varray()); - ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform_inv, NIL, "v", varray()); - ADDFUNC1R(TRANSFORM2D, VECTOR2, Transform2D, basis_xform, VECTOR2, "v", varray()); - ADDFUNC1R(TRANSFORM2D, VECTOR2, Transform2D, basis_xform_inv, VECTOR2, "v", varray()); - ADDFUNC2R(TRANSFORM2D, TRANSFORM2D, Transform2D, interpolate_with, TRANSFORM2D, "transform", FLOAT, "weight", varray()); - ADDFUNC1R(TRANSFORM2D, BOOL, Transform2D, is_equal_approx, TRANSFORM2D, "transform", varray()); - - ADDFUNC0R(BASIS, BASIS, Basis, inverse, varray()); - ADDFUNC0R(BASIS, BASIS, Basis, transposed, varray()); - ADDFUNC0R(BASIS, BASIS, Basis, orthonormalized, varray()); - ADDFUNC0R(BASIS, FLOAT, Basis, determinant, varray()); - ADDFUNC2R(BASIS, BASIS, Basis, rotated, VECTOR3, "axis", FLOAT, "phi", varray()); - ADDFUNC1R(BASIS, BASIS, Basis, scaled, VECTOR3, "scale", varray()); - ADDFUNC0R(BASIS, VECTOR3, Basis, get_scale, varray()); - ADDFUNC0R(BASIS, VECTOR3, Basis, get_euler, varray()); - ADDFUNC1R(BASIS, FLOAT, Basis, tdotx, VECTOR3, "with", varray()); - ADDFUNC1R(BASIS, FLOAT, Basis, tdoty, VECTOR3, "with", varray()); - ADDFUNC1R(BASIS, FLOAT, Basis, tdotz, VECTOR3, "with", varray()); - ADDFUNC1R(BASIS, VECTOR3, Basis, xform, VECTOR3, "v", varray()); - ADDFUNC1R(BASIS, VECTOR3, Basis, xform_inv, VECTOR3, "v", varray()); - ADDFUNC0R(BASIS, INT, Basis, get_orthogonal_index, varray()); - ADDFUNC2R(BASIS, BASIS, Basis, slerp, BASIS, "b", FLOAT, "t", varray()); - ADDFUNC1R(BASIS, BOOL, Basis, is_equal_approx, BASIS, "b", varray()); - ADDFUNC0R(BASIS, QUAT, Basis, get_rotation_quat, varray()); - - ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, inverse, varray()); - ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, affine_inverse, varray()); - ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, orthonormalized, varray()); - ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, rotated, VECTOR3, "axis", FLOAT, "phi", varray()); - ADDFUNC1R(TRANSFORM, TRANSFORM, Transform, scaled, VECTOR3, "scale", varray()); - ADDFUNC1R(TRANSFORM, TRANSFORM, Transform, translated, VECTOR3, "offset", varray()); - ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, looking_at, VECTOR3, "target", VECTOR3, "up", varray()); - ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, interpolate_with, TRANSFORM, "transform", FLOAT, "weight", varray()); - ADDFUNC1R(TRANSFORM, BOOL, Transform, is_equal_approx, TRANSFORM, "transform", varray()); - ADDFUNC1R(TRANSFORM, NIL, Transform, xform, NIL, "v", varray()); - ADDFUNC1R(TRANSFORM, NIL, Transform, xform_inv, NIL, "v", varray()); + + bind_method(String, casecmp_to, sarray("to"), varray()); + bind_method(String, nocasecmp_to, sarray("to"), varray()); + bind_method(String, naturalnocasecmp_to, sarray("to"), varray()); + bind_method(String, length, sarray(), varray()); + bind_method(String, substr, sarray("from", "len"), varray(-1)); + bind_methodv(find, static_cast<int (String::*)(const String &, int) const>(&String::find), sarray("what", "from"), varray(0)); + bind_method(String, count, sarray("what", "from", "to"), varray(0, 0)); + bind_method(String, countn, sarray("what", "from", "to"), varray(0, 0)); + bind_method(String, findn, sarray("what", "from"), varray(0)); + bind_method(String, rfind, sarray("what", "from"), varray(-1)); + bind_method(String, rfindn, sarray("what", "from"), varray(-1)); + bind_method(String, match, sarray("expr"), varray()); + bind_method(String, matchn, sarray("expr"), varray()); + bind_methodv(begins_with, static_cast<bool (String::*)(const String &) const>(&String::begins_with), sarray("text"), varray()); + bind_method(String, ends_with, sarray("text"), varray()); + bind_method(String, is_subsequence_of, sarray("text"), varray()); + bind_method(String, is_subsequence_ofi, sarray("text"), varray()); + bind_method(String, bigrams, sarray(), varray()); + bind_method(String, similarity, sarray("text"), varray()); + + bind_method(String, format, sarray("values", "placeholder"), varray("{_}")); + bind_methodv(replace, static_cast<String (String::*)(const String &, const String &) const>(&String::replace), sarray("what", "forwhat"), varray()); + bind_method(String, replacen, sarray("what", "forwhat"), varray()); + bind_method(String, repeat, sarray("count"), varray()); + bind_method(String, insert, sarray("position", "what"), varray()); + bind_method(String, capitalize, sarray(), varray()); + bind_method(String, split, sarray("delimiter", "allow_empty", "maxsplit"), varray(true, 0)); + bind_method(String, rsplit, sarray("delimiter", "allow_empty", "maxsplit"), varray(true, 0)); + bind_method(String, split_floats, sarray("delimiter", "allow_empty"), varray(true)); + bind_method(String, join, sarray("parts"), varray()); + + bind_method(String, to_upper, sarray(), varray()); + bind_method(String, to_lower, sarray(), varray()); + + bind_method(String, left, sarray("position"), varray()); + bind_method(String, right, sarray("position"), varray()); + + bind_method(String, strip_edges, sarray("left", "right"), varray(true, true)); + bind_method(String, strip_escapes, sarray(), varray()); + bind_method(String, lstrip, sarray("chars"), varray()); + bind_method(String, rstrip, sarray("chars"), varray()); + bind_method(String, get_extension, sarray(), varray()); + bind_method(String, get_basename, sarray(), varray()); + bind_method(String, plus_file, sarray("file"), varray()); + bind_method(String, ord_at, sarray("at"), varray()); + bind_method(String, dedent, sarray(), varray()); + //string needs to be immutable when binding + //bind_method(String, erase, sarray("position", "chars"), varray()); + bind_method(String, hash, sarray(), varray()); + bind_method(String, md5_text, sarray(), varray()); + bind_method(String, sha1_text, sarray(), varray()); + bind_method(String, sha256_text, sarray(), varray()); + bind_method(String, md5_buffer, sarray(), varray()); + bind_method(String, sha1_buffer, sarray(), varray()); + bind_method(String, sha256_buffer, sarray(), varray()); + bind_method(String, empty, sarray(), varray()); + //static function, not sure how to bind + //bind_method(String, humanize_size, sarray("size"), varray()); + + bind_method(String, is_abs_path, sarray(), varray()); + bind_method(String, is_rel_path, sarray(), varray()); + bind_method(String, get_base_dir, sarray(), varray()); + bind_method(String, get_file, sarray(), varray()); + bind_method(String, xml_escape, sarray("escape_quotes"), varray(false)); + bind_method(String, xml_unescape, sarray(), varray()); + bind_method(String, http_escape, sarray(), varray()); + bind_method(String, http_unescape, sarray(), varray()); + bind_method(String, c_escape, sarray(), varray()); + bind_method(String, c_unescape, sarray(), varray()); + bind_method(String, json_escape, sarray(), varray()); + bind_method(String, percent_encode, sarray(), varray()); + bind_method(String, percent_decode, sarray(), varray()); + + bind_method(String, is_valid_identifier, sarray(), varray()); + bind_method(String, is_valid_integer, sarray(), varray()); + bind_method(String, is_valid_float, sarray(), varray()); + bind_method(String, is_valid_hex_number, sarray("with_prefix"), varray(false)); + bind_method(String, is_valid_html_color, sarray(), varray()); + bind_method(String, is_valid_ip_address, sarray(), varray()); + bind_method(String, is_valid_filename, sarray(), varray()); + + bind_method(String, to_int, sarray(), varray()); + bind_method(String, to_float, sarray(), varray()); + bind_method(String, hex_to_int, sarray("with_prefix"), varray(true)); + bind_method(String, bin_to_int, sarray("with_prefix"), varray(true)); + + bind_method(String, lpad, sarray("min_length", "character"), varray(" ")); + bind_method(String, rpad, sarray("min_length", "character"), varray(" ")); + bind_method(String, pad_decimals, sarray("digits"), varray()); + bind_method(String, pad_zeros, sarray("digits"), varray()); + bind_method(String, trim_prefix, sarray("prefix"), varray()); + bind_method(String, trim_suffix, sarray("suffix"), varray()); + + bind_method(String, to_ascii_buffer, sarray(), varray()); + bind_method(String, to_utf8_buffer, sarray(), varray()); + bind_method(String, to_utf16_buffer, sarray(), varray()); + bind_method(String, to_utf32_buffer, sarray(), varray()); + + /* VECTOR2 */ + + bind_method(Vector2, angle, sarray(), varray()); + bind_method(Vector2, angle_to, sarray("to"), varray()); + bind_method(Vector2, angle_to_point, sarray("to"), varray()); + bind_method(Vector2, direction_to, sarray("b"), varray()); + bind_method(Vector2, distance_to, sarray("to"), varray()); + bind_method(Vector2, distance_squared_to, sarray("to"), varray()); + bind_method(Vector2, length, sarray(), varray()); + bind_method(Vector2, length_squared, sarray(), varray()); + bind_method(Vector2, normalized, sarray(), varray()); + bind_method(Vector2, is_normalized, sarray(), varray()); + bind_method(Vector2, is_equal_approx, sarray("to"), varray()); + bind_method(Vector2, posmod, sarray("mod"), varray()); + bind_method(Vector2, posmodv, sarray("modv"), varray()); + bind_method(Vector2, project, sarray("b"), varray()); + bind_method(Vector2, lerp, sarray("with", "t"), varray()); + bind_method(Vector2, slerp, sarray("with", "t"), varray()); + bind_method(Vector2, cubic_interpolate, sarray("b", "pre_a", "post_b", "t"), varray()); + bind_method(Vector2, move_toward, sarray("to", "delta"), varray()); + bind_method(Vector2, rotated, sarray("phi"), varray()); + bind_method(Vector2, tangent, sarray(), varray()); + bind_method(Vector2, floor, sarray(), varray()); + bind_method(Vector2, ceil, sarray(), varray()); + bind_method(Vector2, round, sarray(), varray()); + bind_method(Vector2, aspect, sarray(), varray()); + bind_method(Vector2, dot, sarray("with"), varray()); + bind_method(Vector2, slide, sarray("n"), varray()); + bind_method(Vector2, bounce, sarray("n"), varray()); + bind_method(Vector2, reflect, sarray("n"), varray()); + bind_method(Vector2, cross, sarray("with"), varray()); + bind_method(Vector2, abs, sarray(), varray()); + bind_method(Vector2, sign, sarray(), varray()); + bind_method(Vector2, clamped, sarray("length"), varray()); + + /* VECTOR2I */ + + bind_method(Vector2i, aspect, sarray(), varray()); + bind_method(Vector2i, sign, sarray(), varray()); + bind_method(Vector2i, abs, sarray(), varray()); + + /* RECT2 */ + + bind_method(Rect2, get_area, sarray(), varray()); + bind_method(Rect2, has_no_area, sarray(), varray()); + bind_method(Rect2, has_point, sarray("point"), varray()); + bind_method(Rect2, is_equal_approx, sarray("rect"), varray()); + bind_method(Rect2, intersects, sarray("b", "include_borders"), varray(false)); + bind_method(Rect2, encloses, sarray("b"), varray()); + bind_method(Rect2, clip, sarray("b"), varray()); + bind_method(Rect2, merge, sarray("b"), varray()); + bind_method(Rect2, expand, sarray("to"), varray()); + bind_method(Rect2, grow, sarray("by"), varray()); + bind_methodv(grow_margin, &Rect2::grow_margin_bind, sarray("margin", "by"), varray()); + bind_method(Rect2, grow_individual, sarray("left", "top", "right", "bottom"), varray()); + bind_method(Rect2, abs, sarray(), varray()); + + /* Rect2i */ + + bind_method(Rect2i, get_area, sarray(), varray()); + bind_method(Rect2i, has_no_area, sarray(), varray()); + bind_method(Rect2i, has_point, sarray("point"), varray()); + bind_method(Rect2i, intersects, sarray("b"), varray()); + bind_method(Rect2i, encloses, sarray("b"), varray()); + bind_method(Rect2i, clip, sarray("b"), varray()); + bind_method(Rect2i, merge, sarray("b"), varray()); + bind_method(Rect2i, expand, sarray("to"), varray()); + bind_method(Rect2i, grow, sarray("by"), varray()); + bind_methodv(grow_margin, &Rect2i::grow_margin_bind, sarray("margin", "by"), varray()); + bind_method(Rect2i, grow_individual, sarray("left", "top", "right", "bottom"), varray()); + bind_method(Rect2i, abs, sarray(), varray()); + + /* Vector3 */ + + bind_method(Vector3, min_axis, sarray(), varray()); + bind_method(Vector3, max_axis, sarray(), varray()); + bind_method(Vector3, angle_to, sarray("to"), varray()); + bind_method(Vector3, direction_to, sarray("b"), varray()); + bind_method(Vector3, distance_to, sarray("b"), varray()); + bind_method(Vector3, distance_squared_to, sarray("b"), varray()); + bind_method(Vector3, length, sarray(), varray()); + bind_method(Vector3, length_squared, sarray(), varray()); + bind_method(Vector3, normalized, sarray(), varray()); + bind_method(Vector3, is_normalized, sarray(), varray()); + bind_method(Vector3, is_equal_approx, sarray("to"), varray()); + bind_method(Vector3, inverse, sarray(), varray()); + bind_method(Vector3, snapped, sarray("by"), varray()); + bind_method(Vector3, rotated, sarray("by_axis", "phi"), varray()); + bind_method(Vector3, lerp, sarray("b", "t"), varray()); + bind_method(Vector3, slerp, sarray("b", "t"), varray()); + bind_method(Vector3, cubic_interpolate, sarray("b", "pre_a", "post_b", "t"), varray()); + bind_method(Vector3, move_toward, sarray("to", "delta"), varray()); + bind_method(Vector3, dot, sarray("with"), varray()); + bind_method(Vector3, cross, sarray("with"), varray()); + bind_method(Vector3, outer, sarray("with"), varray()); + bind_method(Vector3, to_diagonal_matrix, sarray(), varray()); + bind_method(Vector3, abs, sarray(), varray()); + bind_method(Vector3, floor, sarray(), varray()); + bind_method(Vector3, ceil, sarray(), varray()); + bind_method(Vector3, round, sarray(), varray()); + bind_method(Vector3, posmod, sarray("mod"), varray()); + bind_method(Vector3, posmodv, sarray("modv"), varray()); + bind_method(Vector3, project, sarray("b"), varray()); + bind_method(Vector3, slide, sarray("n"), varray()); + bind_method(Vector3, bounce, sarray("n"), varray()); + bind_method(Vector3, reflect, sarray("n"), varray()); + bind_method(Vector3, sign, sarray(), varray()); + + /* Vector3i */ + + bind_method(Vector3i, min_axis, sarray(), varray()); + bind_method(Vector3i, max_axis, sarray(), varray()); + bind_method(Vector3i, sign, sarray(), varray()); + bind_method(Vector3i, abs, sarray(), varray()); + + /* Plane */ + + bind_method(Plane, normalized, sarray(), varray()); + bind_method(Plane, center, sarray(), varray()); + bind_method(Plane, is_equal_approx, sarray("to_plane"), varray()); + bind_method(Plane, is_point_over, sarray("plane"), varray()); + bind_method(Plane, distance_to, sarray("point"), varray()); + bind_method(Plane, has_point, sarray("point", "epsilon"), varray(CMP_EPSILON)); + bind_method(Plane, project, sarray("point"), varray()); + bind_methodv(intersect_3, &Plane::intersect_3_bind, sarray("b", "c"), varray()); + bind_methodv(intersects_ray, &Plane::intersects_ray_bind, sarray("from", "dir"), varray()); + bind_methodv(intersects_segment, &Plane::intersects_segment_bind, sarray("from", "to"), varray()); + + /* Quaternion */ + + bind_method(Quat, length, sarray(), varray()); + bind_method(Quat, length_squared, sarray(), varray()); + bind_method(Quat, normalized, sarray(), varray()); + bind_method(Quat, is_normalized, sarray(), varray()); + bind_method(Quat, is_equal_approx, sarray("to"), varray()); + bind_method(Quat, inverse, sarray(), varray()); + bind_method(Quat, dot, sarray("with"), varray()); + bind_method(Quat, xform, sarray("v3"), varray()); + bind_method(Quat, slerp, sarray("b", "t"), varray()); + bind_method(Quat, slerpni, sarray("b", "t"), varray()); + bind_method(Quat, cubic_slerp, sarray("b", "pre_a", "post_b", "t"), varray()); + bind_method(Quat, get_euler, sarray(), varray()); + + //Quat is atomic, this should be done via construcror + //ADDFUNC1(QUAT, NIL, Quat, set_euler, VECTOR3, "euler", varray()); + //ADDFUNC2(QUAT, NIL, Quat, set_axis_angle, VECTOR3, "axis", FLOAT, "angle", varray()); + + /* Color */ + + bind_method(Color, to_argb32, sarray(), varray()); + bind_method(Color, to_abgr32, sarray(), varray()); + bind_method(Color, to_rgba32, sarray(), varray()); + bind_method(Color, to_argb64, sarray(), varray()); + bind_method(Color, to_abgr64, sarray(), varray()); + bind_method(Color, to_rgba64, sarray(), varray()); + + bind_method(Color, inverted, sarray(), varray()); + bind_method(Color, contrasted, sarray(), varray()); + bind_method(Color, lerp, sarray("b", "t"), varray()); + bind_method(Color, lightened, sarray("amount"), varray()); + bind_method(Color, darkened, sarray("amount"), varray()); + bind_method(Color, to_html, sarray("with_alpha"), varray(true)); + bind_method(Color, blend, sarray("over"), varray()); + + //Color is immutable, need to probably find a way to do this via constructor + //ADDFUNC4R(COLOR, COLOR, Color, from_hsv, FLOAT, "h", FLOAT, "s", FLOAT, "v", FLOAT, "a", varray(1.0)); + bind_method(Color, is_equal_approx, sarray("to"), varray()); + + /* RID */ + + bind_method(RID, get_id, sarray(), varray()); + + /* NodePath */ + + bind_method(NodePath, is_absolute, sarray(), varray()); + bind_method(NodePath, get_name_count, sarray(), varray()); + bind_method(NodePath, get_name, sarray("idx"), varray()); + bind_method(NodePath, get_subname_count, sarray(), varray()); + bind_method(NodePath, get_subname, sarray("idx"), varray()); + bind_method(NodePath, get_concatenated_subnames, sarray(), varray()); + bind_method(NodePath, get_as_property_path, sarray(), varray()); + bind_method(NodePath, is_empty, sarray(), varray()); + + /* Callable */ + + bind_method(Callable, is_null, sarray(), varray()); + bind_method(Callable, is_custom, sarray(), varray()); + bind_method(Callable, is_standard, sarray(), varray()); + bind_method(Callable, get_object, sarray(), varray()); + bind_method(Callable, get_object_id, sarray(), varray()); + bind_method(Callable, get_method, sarray(), varray()); + bind_method(Callable, hash, sarray(), varray()); + bind_method(Callable, unbind, sarray("argcount"), varray()); + + //#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type) + + bind_custom(Variant::CALLABLE, "call", _VariantCall::func_Callable_call, Variant::InternalMethod::FLAG_VARARGS | Variant::InternalMethod::FLAG_RETURNS_VARIANT, Vector<Variant::Type>(), Variant::NIL, sarray()); + bind_custom(Variant::CALLABLE, "call_deferred", _VariantCall::func_Callable_call_deferred, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::NIL, sarray()); + bind_custom(Variant::CALLABLE, "bind", _VariantCall::func_Callable_bind, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::CALLABLE, sarray()); + + /* Signal */ + + bind_method(Signal, is_null, sarray(), varray()); + bind_method(Signal, get_object, sarray(), varray()); + bind_method(Signal, get_object_id, sarray(), varray()); + bind_method(Signal, get_name, sarray(), varray()); + + bind_method(Signal, connect, sarray("callable", "binds", "flags"), varray(Array(), 0)); + bind_method(Signal, disconnect, sarray("callable"), varray()); + bind_method(Signal, is_connected, sarray("callable"), varray()); + bind_method(Signal, get_connections, sarray(), varray()); + + bind_custom(Variant::SIGNAL, "emit", _VariantCall::func_Signal_emit, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::NIL, sarray()); + + /* Transform2D */ + + bind_method(Transform2D, inverse, sarray(), varray()); + bind_method(Transform2D, affine_inverse, sarray(), varray()); + bind_method(Transform2D, get_rotation, sarray(), varray()); + bind_method(Transform2D, get_origin, sarray(), varray()); + bind_method(Transform2D, get_scale, sarray(), varray()); + bind_method(Transform2D, orthonormalized, sarray(), varray()); + bind_method(Transform2D, rotated, sarray("phi"), varray()); + bind_method(Transform2D, scaled, sarray("scale"), varray()); + bind_method(Transform2D, translated, sarray("offset"), varray()); + //too complex to bind this, operator * should be used instead + //ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform, NIL, "v", varray()); + //ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform_inv, NIL, "v", varray()); + bind_method(Transform2D, basis_xform, sarray("v"), varray()); + bind_method(Transform2D, basis_xform_inv, sarray("v"), varray()); + bind_method(Transform2D, interpolate_with, sarray("xform", "t"), varray()); + bind_method(Transform2D, is_equal_approx, sarray("xform"), varray()); + + /* Basis */ + + bind_method(Basis, inverse, sarray(), varray()); + bind_method(Basis, transposed, sarray(), varray()); + bind_method(Basis, orthonormalized, sarray(), varray()); + bind_method(Basis, determinant, sarray(), varray()); + bind_methodv(rotated, static_cast<Basis (Basis::*)(const Vector3 &, float) const>(&Basis::rotated), sarray("axis", "phi"), varray()); + bind_method(Basis, scaled, sarray("scale"), varray()); + bind_method(Basis, get_scale, sarray(), varray()); + bind_method(Basis, get_euler, sarray(), varray()); + bind_method(Basis, tdotx, sarray("with"), varray()); + bind_method(Basis, tdoty, sarray("with"), varray()); + bind_method(Basis, tdotz, sarray("with"), varray()); + //use the operators instead + //ADDFUNC1R(BASIS, VECTOR3, Basis, xform, VECTOR3, "v", varray()); + //ADDFUNC1R(BASIS, VECTOR3, Basis, xform_inv, VECTOR3, "v", varray()); + bind_method(Basis, get_orthogonal_index, sarray(), varray()); + bind_method(Basis, slerp, sarray("b", "t"), varray()); + bind_method(Basis, is_equal_approx, sarray("b"), varray()); + bind_method(Basis, get_rotation_quat, sarray(), varray()); + + /* AABB */ + + bind_method(::AABB, abs, sarray(), varray()); + bind_method(::AABB, get_area, sarray(), varray()); + bind_method(::AABB, has_no_area, sarray(), varray()); + bind_method(::AABB, has_no_surface, sarray(), varray()); + bind_method(::AABB, has_point, sarray("point"), varray()); + bind_method(::AABB, is_equal_approx, sarray("aabb"), varray()); + bind_method(::AABB, intersects, sarray("with"), varray()); + bind_method(::AABB, encloses, sarray("with"), varray()); + bind_method(::AABB, intersects_plane, sarray("plane"), varray()); + bind_method(::AABB, intersection, sarray("with"), varray()); + bind_method(::AABB, merge, sarray("with"), varray()); + bind_method(::AABB, expand, sarray("to_point"), varray()); + bind_method(::AABB, grow, sarray("by"), varray()); + bind_method(::AABB, get_support, sarray("dir"), varray()); + bind_method(::AABB, get_longest_axis, sarray(), varray()); + bind_method(::AABB, get_longest_axis_index, sarray(), varray()); + bind_method(::AABB, get_longest_axis_size, sarray(), varray()); + bind_method(::AABB, get_shortest_axis, sarray(), varray()); + bind_method(::AABB, get_shortest_axis_index, sarray(), varray()); + bind_method(::AABB, get_shortest_axis_size, sarray(), varray()); + bind_method(::AABB, get_endpoint, sarray("idx"), varray()); + bind_methodv(intersects_segment, &AABB::intersects_segment_bind, sarray("from", "to"), varray()); + bind_methodv(intersects_ray, &AABB::intersects_ray_bind, sarray("from", "dir"), varray()); + + /* Transform */ + + bind_method(Transform, inverse, sarray(), varray()); + bind_method(Transform, affine_inverse, sarray(), varray()); + bind_method(Transform, orthonormalized, sarray(), varray()); + bind_method(Transform, rotated, sarray("axis", "phi"), varray()); + bind_method(Transform, scaled, sarray("scale"), varray()); + bind_method(Transform, translated, sarray("offset"), varray()); + bind_method(Transform, looking_at, sarray("target", "up"), varray()); + bind_method(Transform, interpolate_with, sarray("xform", "weight"), varray()); + bind_method(Transform, is_equal_approx, sarray("xform"), varray()); + //use the operators instead + //ADDFUNC1R(TRANSFORM, NIL, Transform, xform, NIL, "v", varray()); + //ADDFUNC1R(TRANSFORM, NIL, Transform, xform_inv, NIL, "v", varray()); + + /* Dictionary */ + + bind_method(Dictionary, size, sarray(), varray()); + bind_method(Dictionary, empty, sarray(), varray()); + bind_method(Dictionary, clear, sarray(), varray()); + bind_method(Dictionary, has, sarray("key"), varray()); + bind_method(Dictionary, has_all, sarray("keys"), varray()); + bind_method(Dictionary, erase, sarray("key"), varray()); + bind_method(Dictionary, hash, sarray(), varray()); + bind_method(Dictionary, keys, sarray(), varray()); + bind_method(Dictionary, values, sarray(), varray()); + bind_method(Dictionary, duplicate, sarray("deep"), varray(false)); + bind_method(Dictionary, get, sarray("key", "default"), varray(Variant())); + + /* Array */ + + bind_method(Array, size, sarray(), varray()); + bind_method(Array, empty, sarray(), varray()); + bind_method(Array, clear, sarray(), varray()); + bind_method(Array, hash, sarray(), varray()); + bind_method(Array, push_back, sarray("value"), varray()); + bind_method(Array, push_front, sarray("value"), varray()); + bind_method(Array, append, sarray("value"), varray()); + bind_method(Array, resize, sarray("size"), varray()); + bind_method(Array, insert, sarray("position", "value"), varray()); + bind_method(Array, remove, sarray("position"), varray()); + bind_method(Array, erase, sarray("value"), varray()); + bind_method(Array, front, sarray(), varray()); + bind_method(Array, back, sarray(), varray()); + bind_method(Array, find, sarray("what", "from"), varray(0)); + bind_method(Array, rfind, sarray("what", "from"), varray(-1)); + bind_method(Array, find_last, sarray("value"), varray()); + bind_method(Array, count, sarray("value"), varray()); + bind_method(Array, has, sarray("value"), varray()); + bind_method(Array, pop_back, sarray(), varray()); + bind_method(Array, pop_front, sarray(), varray()); + bind_method(Array, sort, sarray(), varray()); + bind_method(Array, sort_custom, sarray("obj", "func"), varray()); + bind_method(Array, shuffle, sarray(), varray()); + bind_method(Array, bsearch, sarray("value", "before"), varray(true)); + bind_method(Array, bsearch_custom, sarray("value", "obj", "func", "before"), varray(true)); + bind_method(Array, invert, sarray(), varray()); + bind_method(Array, duplicate, sarray("deep"), varray(false)); + bind_method(Array, slice, sarray("begin", "end", "step", "deep"), varray(1, false)); + bind_method(Array, max, sarray(), varray()); + bind_method(Array, min, sarray(), varray()); + + /* Byte Array */ + bind_method(PackedByteArray, size, sarray(), varray()); + bind_method(PackedByteArray, empty, sarray(), varray()); + bind_method(PackedByteArray, set, sarray("index", "value"), varray()); + bind_method(PackedByteArray, push_back, sarray("value"), varray()); + bind_method(PackedByteArray, append, sarray("value"), varray()); + bind_method(PackedByteArray, append_array, sarray("array"), varray()); + bind_method(PackedByteArray, remove, sarray("index"), varray()); + bind_method(PackedByteArray, insert, sarray("at_index", "value"), varray()); + bind_method(PackedByteArray, resize, sarray("new_size"), varray()); + bind_method(PackedByteArray, has, sarray("value"), varray()); + bind_method(PackedByteArray, invert, sarray(), varray()); + bind_method(PackedByteArray, subarray, sarray("from", "to"), varray()); + bind_method(PackedByteArray, sort, sarray(), varray()); + + bind_function("get_string_from_ascii", _VariantCall::func_PackedByteArray_get_string_from_ascii, sarray(), varray()); + bind_function("get_string_from_utf8", _VariantCall::func_PackedByteArray_get_string_from_utf8, sarray(), varray()); + bind_function("get_string_from_utf16", _VariantCall::func_PackedByteArray_get_string_from_utf16, sarray(), varray()); + bind_function("get_string_from_utf32", _VariantCall::func_PackedByteArray_get_string_from_utf32, sarray(), varray()); + bind_function("hex_encode", _VariantCall::func_PackedByteArray_hex_encode, sarray(), varray()); + bind_function("compress", _VariantCall::func_PackedByteArray_compress, sarray("compression_mode"), varray(0)); + bind_function("decompress", _VariantCall::func_PackedByteArray_decompress, sarray("buffer_size", "compression_mode"), varray(0)); + bind_function("decompress_dynamic", _VariantCall::func_PackedByteArray_decompress_dynamic, sarray("max_output_size", "compression_mode"), varray(0)); + + /* Int32 Array */ + + bind_method(PackedInt32Array, size, sarray(), varray()); + bind_method(PackedInt32Array, empty, sarray(), varray()); + bind_method(PackedInt32Array, set, sarray("index", "value"), varray()); + bind_method(PackedInt32Array, push_back, sarray("value"), varray()); + bind_method(PackedInt32Array, append, sarray("value"), varray()); + bind_method(PackedInt32Array, append_array, sarray("array"), varray()); + bind_method(PackedInt32Array, remove, sarray("index"), varray()); + bind_method(PackedInt32Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedInt32Array, resize, sarray("new_size"), varray()); + bind_method(PackedInt32Array, has, sarray("value"), varray()); + bind_method(PackedInt32Array, invert, sarray(), varray()); + bind_method(PackedInt32Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedInt32Array, to_byte_array, sarray(), varray()); + bind_method(PackedInt32Array, sort, sarray(), varray()); + + /* Int64 Array */ + + bind_method(PackedInt64Array, size, sarray(), varray()); + bind_method(PackedInt64Array, empty, sarray(), varray()); + bind_method(PackedInt64Array, set, sarray("index", "value"), varray()); + bind_method(PackedInt64Array, push_back, sarray("value"), varray()); + bind_method(PackedInt64Array, append, sarray("value"), varray()); + bind_method(PackedInt64Array, append_array, sarray("array"), varray()); + bind_method(PackedInt64Array, remove, sarray("index"), varray()); + bind_method(PackedInt64Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedInt64Array, resize, sarray("new_size"), varray()); + bind_method(PackedInt64Array, has, sarray("value"), varray()); + bind_method(PackedInt64Array, invert, sarray(), varray()); + bind_method(PackedInt64Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedInt64Array, to_byte_array, sarray(), varray()); + bind_method(PackedInt64Array, sort, sarray(), varray()); + + /* Float32 Array */ + + bind_method(PackedFloat32Array, size, sarray(), varray()); + bind_method(PackedFloat32Array, empty, sarray(), varray()); + bind_method(PackedFloat32Array, set, sarray("index", "value"), varray()); + bind_method(PackedFloat32Array, push_back, sarray("value"), varray()); + bind_method(PackedFloat32Array, append, sarray("value"), varray()); + bind_method(PackedFloat32Array, append_array, sarray("array"), varray()); + bind_method(PackedFloat32Array, remove, sarray("index"), varray()); + bind_method(PackedFloat32Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedFloat32Array, resize, sarray("new_size"), varray()); + bind_method(PackedFloat32Array, has, sarray("value"), varray()); + bind_method(PackedFloat32Array, invert, sarray(), varray()); + bind_method(PackedFloat32Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedFloat32Array, to_byte_array, sarray(), varray()); + bind_method(PackedFloat32Array, sort, sarray(), varray()); + + /* Float64 Array */ + + bind_method(PackedFloat64Array, size, sarray(), varray()); + bind_method(PackedFloat64Array, empty, sarray(), varray()); + bind_method(PackedFloat64Array, set, sarray("index", "value"), varray()); + bind_method(PackedFloat64Array, push_back, sarray("value"), varray()); + bind_method(PackedFloat64Array, append, sarray("value"), varray()); + bind_method(PackedFloat64Array, append_array, sarray("array"), varray()); + bind_method(PackedFloat64Array, remove, sarray("index"), varray()); + bind_method(PackedFloat64Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedFloat64Array, resize, sarray("new_size"), varray()); + bind_method(PackedFloat64Array, has, sarray("value"), varray()); + bind_method(PackedFloat64Array, invert, sarray(), varray()); + bind_method(PackedFloat64Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedFloat64Array, to_byte_array, sarray(), varray()); + bind_method(PackedFloat64Array, sort, sarray(), varray()); + + /* String Array */ + + bind_method(PackedStringArray, size, sarray(), varray()); + bind_method(PackedStringArray, empty, sarray(), varray()); + bind_method(PackedStringArray, set, sarray("index", "value"), varray()); + bind_method(PackedStringArray, push_back, sarray("value"), varray()); + bind_method(PackedStringArray, append, sarray("value"), varray()); + bind_method(PackedStringArray, append_array, sarray("array"), varray()); + bind_method(PackedStringArray, remove, sarray("index"), varray()); + bind_method(PackedStringArray, insert, sarray("at_index", "value"), varray()); + bind_method(PackedStringArray, resize, sarray("new_size"), varray()); + bind_method(PackedStringArray, has, sarray("value"), varray()); + bind_method(PackedStringArray, invert, sarray(), varray()); + bind_method(PackedStringArray, subarray, sarray("from", "to"), varray()); + bind_method(PackedStringArray, to_byte_array, sarray(), varray()); + bind_method(PackedStringArray, sort, sarray(), varray()); + + /* Vector2 Array */ + + bind_method(PackedVector2Array, size, sarray(), varray()); + bind_method(PackedVector2Array, empty, sarray(), varray()); + bind_method(PackedVector2Array, set, sarray("index", "value"), varray()); + bind_method(PackedVector2Array, push_back, sarray("value"), varray()); + bind_method(PackedVector2Array, append, sarray("value"), varray()); + bind_method(PackedVector2Array, append_array, sarray("array"), varray()); + bind_method(PackedVector2Array, remove, sarray("index"), varray()); + bind_method(PackedVector2Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedVector2Array, resize, sarray("new_size"), varray()); + bind_method(PackedVector2Array, has, sarray("value"), varray()); + bind_method(PackedVector2Array, invert, sarray(), varray()); + bind_method(PackedVector2Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedVector2Array, to_byte_array, sarray(), varray()); + + /* Vector3 Array */ + + bind_method(PackedVector3Array, size, sarray(), varray()); + bind_method(PackedVector3Array, empty, sarray(), varray()); + bind_method(PackedVector3Array, set, sarray("index", "value"), varray()); + bind_method(PackedVector3Array, push_back, sarray("value"), varray()); + bind_method(PackedVector3Array, append, sarray("value"), varray()); + bind_method(PackedVector3Array, append_array, sarray("array"), varray()); + bind_method(PackedVector3Array, remove, sarray("index"), varray()); + bind_method(PackedVector3Array, insert, sarray("at_index", "value"), varray()); + bind_method(PackedVector3Array, resize, sarray("new_size"), varray()); + bind_method(PackedVector3Array, has, sarray("value"), varray()); + bind_method(PackedVector3Array, invert, sarray(), varray()); + bind_method(PackedVector3Array, subarray, sarray("from", "to"), varray()); + bind_method(PackedVector3Array, to_byte_array, sarray(), varray()); + + /* Color Array */ + + bind_method(PackedColorArray, size, sarray(), varray()); + bind_method(PackedColorArray, empty, sarray(), varray()); + bind_method(PackedColorArray, set, sarray("index", "value"), varray()); + bind_method(PackedColorArray, push_back, sarray("value"), varray()); + bind_method(PackedColorArray, append, sarray("value"), varray()); + bind_method(PackedColorArray, append_array, sarray("array"), varray()); + bind_method(PackedColorArray, remove, sarray("index"), varray()); + bind_method(PackedColorArray, insert, sarray("at_index", "value"), varray()); + bind_method(PackedColorArray, resize, sarray("new_size"), varray()); + bind_method(PackedColorArray, has, sarray("value"), varray()); + bind_method(PackedColorArray, invert, sarray(), varray()); + bind_method(PackedColorArray, subarray, sarray("from", "to"), varray()); + bind_method(PackedColorArray, to_byte_array, sarray(), varray()); /* REGISTER CONSTRUCTORS */ @@ -2497,7 +2082,18 @@ void register_variant_methods() { } void unregister_variant_methods() { - memdelete_arr(_VariantCall::type_funcs); + //clear methods + for (int i = 0; i < Variant::VARIANT_MAX; i++) { + for (List<StringName>::Element *E = _VariantCall::type_internal_method_names[i].front(); E; E = E->next()) { + Variant::InternalMethod **m = _VariantCall::type_internal_methods[i].lookup_ptr(E->get()); + if (*m) { + memdelete(*m); + } + } + } + + memdelete_arr(_VariantCall::type_internal_methods); + memdelete_arr(_VariantCall::type_internal_method_names); memdelete_arr(_VariantCall::construct_funcs); memdelete_arr(_VariantCall::constant_data); } diff --git a/core/variant_internal.h b/core/variant_internal.h index 0e0a1e398f..7893c6d382 100644 --- a/core/variant_internal.h +++ b/core/variant_internal.h @@ -113,6 +113,540 @@ public: _FORCE_INLINE_ static const PackedVector3Array *get_vector3_array(const Variant *v) { return &static_cast<const Variant::PackedArrayRef<Vector3> *>(v->_data.packed_array)->array; } _FORCE_INLINE_ static PackedColorArray *get_color_array(Variant *v) { return &static_cast<Variant::PackedArrayRef<Color> *>(v->_data.packed_array)->array; } _FORCE_INLINE_ static const PackedColorArray *get_color_array(const Variant *v) { return &static_cast<const Variant::PackedArrayRef<Color> *>(v->_data.packed_array)->array; } + + _FORCE_INLINE_ static Object **get_object(Variant *v) { return (Object **)&v->_get_obj().obj; } + _FORCE_INLINE_ static const Object **get_object(const Variant *v) { return (const Object **)&v->_get_obj().obj; } +}; + +template <class T> +struct VariantGetInternalPtr { +}; + +template <> +struct VariantGetInternalPtr<bool> { + static bool *get_ptr(Variant *v) { return VariantInternal::get_bool(v); } + static const bool *get_ptr(const Variant *v) { return VariantInternal::get_bool(v); } +}; + +template <> +struct VariantGetInternalPtr<int8_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<uint8_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<int16_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<uint16_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<int32_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<uint32_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<int64_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<uint64_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<char32_t> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<ObjectID> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<Error> { + static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); } + static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); } +}; + +template <> +struct VariantGetInternalPtr<float> { + static double *get_ptr(Variant *v) { return VariantInternal::get_float(v); } + static const double *get_ptr(const Variant *v) { return VariantInternal::get_float(v); } +}; + +template <> +struct VariantGetInternalPtr<double> { + static double *get_ptr(Variant *v) { return VariantInternal::get_float(v); } + static const double *get_ptr(const Variant *v) { return VariantInternal::get_float(v); } +}; + +template <> +struct VariantGetInternalPtr<String> { + static String *get_ptr(Variant *v) { return VariantInternal::get_string(v); } + static const String *get_ptr(const Variant *v) { return VariantInternal::get_string(v); } +}; + +template <> +struct VariantGetInternalPtr<Vector2> { + static Vector2 *get_ptr(Variant *v) { return VariantInternal::get_vector2(v); } + static const Vector2 *get_ptr(const Variant *v) { return VariantInternal::get_vector2(v); } +}; + +template <> +struct VariantGetInternalPtr<Vector2i> { + static Vector2i *get_ptr(Variant *v) { return VariantInternal::get_vector2i(v); } + static const Vector2i *get_ptr(const Variant *v) { return VariantInternal::get_vector2i(v); } +}; + +template <> +struct VariantGetInternalPtr<Rect2> { + static Rect2 *get_ptr(Variant *v) { return VariantInternal::get_rect2(v); } + static const Rect2 *get_ptr(const Variant *v) { return VariantInternal::get_rect2(v); } +}; + +template <> +struct VariantGetInternalPtr<Rect2i> { + static Rect2i *get_ptr(Variant *v) { return VariantInternal::get_rect2i(v); } + static const Rect2i *get_ptr(const Variant *v) { return VariantInternal::get_rect2i(v); } +}; + +template <> +struct VariantGetInternalPtr<Vector3> { + static Vector3 *get_ptr(Variant *v) { return VariantInternal::get_vector3(v); } + static const Vector3 *get_ptr(const Variant *v) { return VariantInternal::get_vector3(v); } +}; + +template <> +struct VariantGetInternalPtr<Vector3i> { + static Vector3i *get_ptr(Variant *v) { return VariantInternal::get_vector3i(v); } + static const Vector3i *get_ptr(const Variant *v) { return VariantInternal::get_vector3i(v); } +}; + +template <> +struct VariantGetInternalPtr<Transform2D> { + static Transform2D *get_ptr(Variant *v) { return VariantInternal::get_transform2d(v); } + static const Transform2D *get_ptr(const Variant *v) { return VariantInternal::get_transform2d(v); } +}; + +template <> +struct VariantGetInternalPtr<Transform> { + static Transform *get_ptr(Variant *v) { return VariantInternal::get_transform(v); } + static const Transform *get_ptr(const Variant *v) { return VariantInternal::get_transform(v); } +}; + +template <> +struct VariantGetInternalPtr<Plane> { + static Plane *get_ptr(Variant *v) { return VariantInternal::get_plane(v); } + static const Plane *get_ptr(const Variant *v) { return VariantInternal::get_plane(v); } +}; + +template <> +struct VariantGetInternalPtr<Quat> { + static Quat *get_ptr(Variant *v) { return VariantInternal::get_quat(v); } + static const Quat *get_ptr(const Variant *v) { return VariantInternal::get_quat(v); } +}; + +template <> +struct VariantGetInternalPtr<::AABB> { + static ::AABB *get_ptr(Variant *v) { return VariantInternal::get_aabb(v); } + static const ::AABB *get_ptr(const Variant *v) { return VariantInternal::get_aabb(v); } +}; + +template <> +struct VariantGetInternalPtr<Basis> { + static Basis *get_ptr(Variant *v) { return VariantInternal::get_basis(v); } + static const Basis *get_ptr(const Variant *v) { return VariantInternal::get_basis(v); } +}; + +// + +template <> +struct VariantGetInternalPtr<Color> { + static Color *get_ptr(Variant *v) { return VariantInternal::get_color(v); } + static const Color *get_ptr(const Variant *v) { return VariantInternal::get_color(v); } +}; + +template <> +struct VariantGetInternalPtr<StringName> { + static StringName *get_ptr(Variant *v) { return VariantInternal::get_string_name(v); } + static const StringName *get_ptr(const Variant *v) { return VariantInternal::get_string_name(v); } +}; + +template <> +struct VariantGetInternalPtr<NodePath> { + static NodePath *get_ptr(Variant *v) { return VariantInternal::get_node_path(v); } + static const NodePath *get_ptr(const Variant *v) { return VariantInternal::get_node_path(v); } +}; + +template <> +struct VariantGetInternalPtr<RID> { + static RID *get_ptr(Variant *v) { return VariantInternal::get_rid(v); } + static const RID *get_ptr(const Variant *v) { return VariantInternal::get_rid(v); } +}; + +template <> +struct VariantGetInternalPtr<Callable> { + static Callable *get_ptr(Variant *v) { return VariantInternal::get_callable(v); } + static const Callable *get_ptr(const Variant *v) { return VariantInternal::get_callable(v); } +}; + +template <> +struct VariantGetInternalPtr<Signal> { + static Signal *get_ptr(Variant *v) { return VariantInternal::get_signal(v); } + static const Signal *get_ptr(const Variant *v) { return VariantInternal::get_signal(v); } +}; + +template <> +struct VariantGetInternalPtr<Dictionary> { + static Dictionary *get_ptr(Variant *v) { return VariantInternal::get_dictionary(v); } + static const Dictionary *get_ptr(const Variant *v) { return VariantInternal::get_dictionary(v); } +}; + +template <> +struct VariantGetInternalPtr<Array> { + static Array *get_ptr(Variant *v) { return VariantInternal::get_array(v); } + static const Array *get_ptr(const Variant *v) { return VariantInternal::get_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedByteArray> { + static PackedByteArray *get_ptr(Variant *v) { return VariantInternal::get_byte_array(v); } + static const PackedByteArray *get_ptr(const Variant *v) { return VariantInternal::get_byte_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedInt32Array> { + static PackedInt32Array *get_ptr(Variant *v) { return VariantInternal::get_int32_array(v); } + static const PackedInt32Array *get_ptr(const Variant *v) { return VariantInternal::get_int32_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedInt64Array> { + static PackedInt64Array *get_ptr(Variant *v) { return VariantInternal::get_int64_array(v); } + static const PackedInt64Array *get_ptr(const Variant *v) { return VariantInternal::get_int64_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedFloat32Array> { + static PackedFloat32Array *get_ptr(Variant *v) { return VariantInternal::get_float32_array(v); } + static const PackedFloat32Array *get_ptr(const Variant *v) { return VariantInternal::get_float32_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedFloat64Array> { + static PackedFloat64Array *get_ptr(Variant *v) { return VariantInternal::get_float64_array(v); } + static const PackedFloat64Array *get_ptr(const Variant *v) { return VariantInternal::get_float64_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedStringArray> { + static PackedStringArray *get_ptr(Variant *v) { return VariantInternal::get_string_array(v); } + static const PackedStringArray *get_ptr(const Variant *v) { return VariantInternal::get_string_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedVector2Array> { + static PackedVector2Array *get_ptr(Variant *v) { return VariantInternal::get_vector2_array(v); } + static const PackedVector2Array *get_ptr(const Variant *v) { return VariantInternal::get_vector2_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedVector3Array> { + static PackedVector3Array *get_ptr(Variant *v) { return VariantInternal::get_vector3_array(v); } + static const PackedVector3Array *get_ptr(const Variant *v) { return VariantInternal::get_vector3_array(v); } +}; + +template <> +struct VariantGetInternalPtr<PackedColorArray> { + static PackedColorArray *get_ptr(Variant *v) { return VariantInternal::get_color_array(v); } + static const PackedColorArray *get_ptr(const Variant *v) { return VariantInternal::get_color_array(v); } +}; + +template <class T> +struct VariantInternalAccessor { +}; + +template <> +struct VariantInternalAccessor<bool> { + static _FORCE_INLINE_ bool get(const Variant *v) { return *VariantInternal::get_bool(v); } + static _FORCE_INLINE_ void set(Variant *v, bool p_value) { *VariantInternal::get_bool(v) = p_value; } +}; + +#define VARIANT_ACCESSOR_NUMBER(m_type) \ + template <> \ + struct VariantInternalAccessor<m_type> { \ + static _FORCE_INLINE_ m_type get(const Variant *v) { return (m_type)*VariantInternal::get_int(v); } \ + static _FORCE_INLINE_ void set(Variant *v, m_type p_value) { *VariantInternal::get_int(v) = p_value; } \ + }; + +VARIANT_ACCESSOR_NUMBER(int8_t) +VARIANT_ACCESSOR_NUMBER(uint8_t) +VARIANT_ACCESSOR_NUMBER(int16_t) +VARIANT_ACCESSOR_NUMBER(uint16_t) +VARIANT_ACCESSOR_NUMBER(int32_t) +VARIANT_ACCESSOR_NUMBER(uint32_t) +VARIANT_ACCESSOR_NUMBER(int64_t) +VARIANT_ACCESSOR_NUMBER(uint64_t) +VARIANT_ACCESSOR_NUMBER(char32_t) +VARIANT_ACCESSOR_NUMBER(Error) +VARIANT_ACCESSOR_NUMBER(Margin) + +template <> +struct VariantInternalAccessor<ObjectID> { + static _FORCE_INLINE_ ObjectID get(const Variant *v) { return ObjectID(*VariantInternal::get_int(v)); } + static _FORCE_INLINE_ void set(Variant *v, ObjectID p_value) { *VariantInternal::get_int(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<float> { + static _FORCE_INLINE_ float get(const Variant *v) { return *VariantInternal::get_float(v); } + static _FORCE_INLINE_ void set(Variant *v, float p_value) { *VariantInternal::get_float(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<double> { + static _FORCE_INLINE_ double get(const Variant *v) { return *VariantInternal::get_float(v); } + static _FORCE_INLINE_ void set(Variant *v, double p_value) { *VariantInternal::get_float(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<String> { + static _FORCE_INLINE_ const String &get(const Variant *v) { return *VariantInternal::get_string(v); } + static _FORCE_INLINE_ void set(Variant *v, const String &p_value) { *VariantInternal::get_string(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Vector2> { + static _FORCE_INLINE_ const Vector2 &get(const Variant *v) { return *VariantInternal::get_vector2(v); } + static _FORCE_INLINE_ void set(Variant *v, const Vector2 &p_value) { *VariantInternal::get_vector2(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Vector2i> { + static _FORCE_INLINE_ const Vector2i &get(const Variant *v) { return *VariantInternal::get_vector2i(v); } + static _FORCE_INLINE_ void set(Variant *v, const Vector2i &p_value) { *VariantInternal::get_vector2i(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Rect2> { + static _FORCE_INLINE_ const Rect2 &get(const Variant *v) { return *VariantInternal::get_rect2(v); } + static _FORCE_INLINE_ void set(Variant *v, const Rect2 &p_value) { *VariantInternal::get_rect2(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Rect2i> { + static _FORCE_INLINE_ const Rect2i &get(const Variant *v) { return *VariantInternal::get_rect2i(v); } + static _FORCE_INLINE_ void set(Variant *v, const Rect2i &p_value) { *VariantInternal::get_rect2i(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Vector3> { + static _FORCE_INLINE_ const Vector3 &get(const Variant *v) { return *VariantInternal::get_vector3(v); } + static _FORCE_INLINE_ void set(Variant *v, const Vector3 &p_value) { *VariantInternal::get_vector3(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Vector3i> { + static _FORCE_INLINE_ const Vector3i &get(const Variant *v) { return *VariantInternal::get_vector3i(v); } + static _FORCE_INLINE_ void set(Variant *v, const Vector3i &p_value) { *VariantInternal::get_vector3i(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Transform2D> { + static _FORCE_INLINE_ const Transform2D &get(const Variant *v) { return *VariantInternal::get_transform2d(v); } + static _FORCE_INLINE_ void set(Variant *v, const Transform2D &p_value) { *VariantInternal::get_transform2d(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Transform> { + static _FORCE_INLINE_ const Transform &get(const Variant *v) { return *VariantInternal::get_transform(v); } + static _FORCE_INLINE_ void set(Variant *v, const Transform &p_value) { *VariantInternal::get_transform(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Plane> { + static _FORCE_INLINE_ const Plane &get(const Variant *v) { return *VariantInternal::get_plane(v); } + static _FORCE_INLINE_ void set(Variant *v, const Plane &p_value) { *VariantInternal::get_plane(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Quat> { + static _FORCE_INLINE_ const Quat &get(const Variant *v) { return *VariantInternal::get_quat(v); } + static _FORCE_INLINE_ void set(Variant *v, const Quat &p_value) { *VariantInternal::get_quat(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<AABB> { + static _FORCE_INLINE_ const AABB &get(const Variant *v) { return *VariantInternal::get_aabb(v); } + static _FORCE_INLINE_ void set(Variant *v, const AABB &p_value) { *VariantInternal::get_aabb(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Basis> { + static _FORCE_INLINE_ const Basis &get(const Variant *v) { return *VariantInternal::get_basis(v); } + static _FORCE_INLINE_ void set(Variant *v, const Basis &p_value) { *VariantInternal::get_basis(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Color> { + static _FORCE_INLINE_ const Color &get(const Variant *v) { return *VariantInternal::get_color(v); } + static _FORCE_INLINE_ void set(Variant *v, const Color &p_value) { *VariantInternal::get_color(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<StringName> { + static _FORCE_INLINE_ const StringName &get(const Variant *v) { return *VariantInternal::get_string_name(v); } + static _FORCE_INLINE_ void set(Variant *v, const StringName &p_value) { *VariantInternal::get_string_name(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<NodePath> { + static _FORCE_INLINE_ const NodePath &get(const Variant *v) { return *VariantInternal::get_node_path(v); } + static _FORCE_INLINE_ void set(Variant *v, const NodePath &p_value) { *VariantInternal::get_node_path(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<RID> { + static _FORCE_INLINE_ const RID &get(const Variant *v) { return *VariantInternal::get_rid(v); } + static _FORCE_INLINE_ void set(Variant *v, const RID &p_value) { *VariantInternal::get_rid(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Callable> { + static _FORCE_INLINE_ const Callable &get(const Variant *v) { return *VariantInternal::get_callable(v); } + static _FORCE_INLINE_ void set(Variant *v, const Callable &p_value) { *VariantInternal::get_callable(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Signal> { + static _FORCE_INLINE_ const Signal &get(const Variant *v) { return *VariantInternal::get_signal(v); } + static _FORCE_INLINE_ void set(Variant *v, const Signal &p_value) { *VariantInternal::get_signal(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Dictionary> { + static _FORCE_INLINE_ const Dictionary &get(const Variant *v) { return *VariantInternal::get_dictionary(v); } + static _FORCE_INLINE_ void set(Variant *v, const Dictionary &p_value) { *VariantInternal::get_dictionary(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Array> { + static _FORCE_INLINE_ const Array &get(const Variant *v) { return *VariantInternal::get_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const Array &p_value) { *VariantInternal::get_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedByteArray> { + static _FORCE_INLINE_ const PackedByteArray &get(const Variant *v) { return *VariantInternal::get_byte_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedByteArray &p_value) { *VariantInternal::get_byte_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedInt32Array> { + static _FORCE_INLINE_ const PackedInt32Array &get(const Variant *v) { return *VariantInternal::get_int32_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedInt32Array &p_value) { *VariantInternal::get_int32_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedInt64Array> { + static _FORCE_INLINE_ const PackedInt64Array &get(const Variant *v) { return *VariantInternal::get_int64_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedInt64Array &p_value) { *VariantInternal::get_int64_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedFloat32Array> { + static _FORCE_INLINE_ const PackedFloat32Array &get(const Variant *v) { return *VariantInternal::get_float32_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedFloat32Array &p_value) { *VariantInternal::get_float32_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedFloat64Array> { + static _FORCE_INLINE_ const PackedFloat64Array &get(const Variant *v) { return *VariantInternal::get_float64_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedFloat64Array &p_value) { *VariantInternal::get_float64_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedStringArray> { + static _FORCE_INLINE_ const PackedStringArray &get(const Variant *v) { return *VariantInternal::get_string_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedStringArray &p_value) { *VariantInternal::get_string_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedVector2Array> { + static _FORCE_INLINE_ const PackedVector2Array &get(const Variant *v) { return *VariantInternal::get_vector2_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedVector2Array &p_value) { *VariantInternal::get_vector2_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedVector3Array> { + static _FORCE_INLINE_ const PackedVector3Array &get(const Variant *v) { return *VariantInternal::get_vector3_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedVector3Array &p_value) { *VariantInternal::get_vector3_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<PackedColorArray> { + static _FORCE_INLINE_ const PackedColorArray &get(const Variant *v) { return *VariantInternal::get_color_array(v); } + static _FORCE_INLINE_ void set(Variant *v, const PackedColorArray &p_value) { *VariantInternal::get_color_array(v) = p_value; } +}; + +template <> +struct VariantInternalAccessor<Object *> { + static _FORCE_INLINE_ Object *get(const Variant *v) { return const_cast<Object *>(*VariantInternal::get_object(v)); } + static _FORCE_INLINE_ void set(Variant *v, const Object *p_value) { *VariantInternal::get_object(v) = const_cast<Object *>(p_value); } +}; + +template <> +struct VariantInternalAccessor<Variant> { + static _FORCE_INLINE_ Variant &get(Variant *v) { return *v; } + static _FORCE_INLINE_ const Variant &get(const Variant *v) { return *v; } + static _FORCE_INLINE_ void set(Variant *v, const Variant &p_value) { *v = p_value; } +}; + +template <> +struct VariantInternalAccessor<Vector<Variant>> { + static _FORCE_INLINE_ Vector<Variant> get(const Variant *v) { + Vector<Variant> ret; + int s = VariantInternal::get_array(v)->size(); + ret.resize(s); + for (int i = 0; i < s; i++) { + ret.write[i] = VariantInternal::get_array(v)->get(i); + } + + return ret; + } + static _FORCE_INLINE_ void set(Variant *v, const Vector<Variant> &p_value) { + int s = p_value.size(); + VariantInternal::get_array(v)->resize(s); + for (int i = 0; i < s; i++) { + VariantInternal::get_array(v)->set(i, p_value[i]); + } + } }; #endif // VARIANT_INTERNAL_H diff --git a/core/variant_op.cpp b/core/variant_op.cpp index 533b056f91..47539df856 100644 --- a/core/variant_op.cpp +++ b/core/variant_op.cpp @@ -30,9 +30,9 @@ #include "variant.h" +#include "core/class_db.h" #include "core/core_string_names.h" #include "core/debugger/engine_debugger.h" -#include "core/object.h" #define CASE_TYPE_ALL(PREFIX, OP) \ CASE_TYPE(PREFIX, OP, INT) \ diff --git a/doc/classes/Animation.xml b/doc/classes/Animation.xml index ceef16f158..d34308501c 100644 --- a/doc/classes/Animation.xml +++ b/doc/classes/Animation.xml @@ -681,26 +681,26 @@ Returns the update mode of a value track. </description> </method> - <method name="value_track_set_update_mode"> - <return type="void"> + <method name="value_track_interpolate" qualifiers="const"> + <return type="Variant"> </return> <argument index="0" name="track_idx" type="int"> </argument> - <argument index="1" name="mode" type="int" enum="Animation.UpdateMode"> + <argument index="1" name="time_sec" type="float"> </argument> <description> - Sets the update mode (see [enum UpdateMode]) of a value track. + Returns the interpolated value at the given time (in seconds). The [code]track_idx[/code] must be the index of a value track. </description> </method> - <method name="value_track_interpolate" qualifiers="const"> - <return type="float"> + <method name="value_track_set_update_mode"> + <return type="void"> </return> <argument index="0" name="track_idx" type="int"> </argument> - <argument index="1" name="time_sec" type="float"> + <argument index="1" name="mode" type="int" enum="Animation.UpdateMode"> </argument> <description> - Returns the interpolated value at the given time (in seconds). The [code]track_idx[/code] must be the index of a value track. + Sets the update mode (see [enum UpdateMode]) of a value track. </description> </method> </methods> diff --git a/doc/classes/Area2D.xml b/doc/classes/Area2D.xml index 4f8d102393..72c40478bb 100644 --- a/doc/classes/Area2D.xml +++ b/doc/classes/Area2D.xml @@ -91,7 +91,8 @@ </methods> <members> <member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="1.0"> - The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping). + The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. + See [member ProjectSettings.physics/2d/default_angular_damp] for more details about damping. </member> <member name="audio_bus_name" type="StringName" setter="set_audio_bus_name" getter="get_audio_bus_name" default="@"Master""> The name of the area's audio bus. @@ -118,7 +119,8 @@ The area's gravity vector (not normalized). If gravity is a point (see [member gravity_point]), this will be the point of attraction. </member> <member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="0.1"> - The rate at which objects stop moving in this area. Represents the linear velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping). + The rate at which objects stop moving in this area. Represents the linear velocity lost per second. + See [member ProjectSettings.physics/2d/default_linear_damp] for more details about damping. </member> <member name="monitorable" type="bool" setter="set_monitorable" getter="is_monitorable" default="true"> If [code]true[/code], other monitoring areas can detect this area. diff --git a/doc/classes/Area3D.xml b/doc/classes/Area3D.xml index db1c96c8cb..92a8465762 100644 --- a/doc/classes/Area3D.xml +++ b/doc/classes/Area3D.xml @@ -89,7 +89,8 @@ </methods> <members> <member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="0.1"> - The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping). + The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. + See [member ProjectSettings.physics/3d/default_angular_damp] for more details about damping. </member> <member name="audio_bus_name" type="StringName" setter="set_audio_bus" getter="get_audio_bus" default="@"Master""> The name of the area's audio bus. @@ -116,7 +117,8 @@ The area's gravity vector (not normalized). If gravity is a point (see [member gravity_point]), this will be the point of attraction. </member> <member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="0.1"> - The rate at which objects stop moving in this area. Represents the linear velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping). + The rate at which objects stop moving in this area. Represents the linear velocity lost per second. + See [member ProjectSettings.physics/3d/default_linear_damp] for more details about damping. </member> <member name="monitorable" type="bool" setter="set_monitorable" getter="is_monitorable" default="true"> If [code]true[/code], other monitoring areas can detect this area. diff --git a/doc/classes/ArrayMesh.xml b/doc/classes/ArrayMesh.xml index 4edf69ccb2..dc834474ad 100644 --- a/doc/classes/ArrayMesh.xml +++ b/doc/classes/ArrayMesh.xml @@ -69,7 +69,6 @@ <argument index="2" name="blend_shapes" type="Array" default="[ ]"> </argument> <argument index="3" name="lods" type="Dictionary" default="{ - }"> </argument> <argument index="4" name="compress_flags" type="int" default="31744"> diff --git a/doc/classes/BaseButton.xml b/doc/classes/BaseButton.xml index bf4d9383ac..378df1ce65 100644 --- a/doc/classes/BaseButton.xml +++ b/doc/classes/BaseButton.xml @@ -44,6 +44,9 @@ <member name="action_mode" type="int" setter="set_action_mode" getter="get_action_mode" enum="BaseButton.ActionMode" default="1"> Determines when the button is considered clicked, one of the [enum ActionMode] constants. </member> + <member name="button_group" type="ButtonGroup" setter="set_button_group" getter="get_button_group"> + The [ButtonGroup] associated with the button. Not to be confused with node groups. + </member> <member name="button_mask" type="int" setter="set_button_mask" getter="get_button_mask" default="1"> Binary mask to choose which mouse buttons this button will respond to. To allow both left-click and right-click, use [code]BUTTON_MASK_LEFT | BUTTON_MASK_RIGHT[/code]. @@ -51,13 +54,7 @@ <member name="disabled" type="bool" setter="set_disabled" getter="is_disabled" default="false"> If [code]true[/code], the button is in disabled state and can't be clicked or toggled. </member> - <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" enum="Control.FocusMode" default="2"> - Focus access mode to use when switching between enabled/disabled (see [member Control.focus_mode] and [member disabled]). - </member> <member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="2" /> - <member name="group" type="ButtonGroup" setter="set_button_group" getter="get_button_group"> - [ButtonGroup] associated to the button. - </member> <member name="keep_pressed_outside" type="bool" setter="set_keep_pressed_outside" getter="is_keep_pressed_outside" default="false"> If [code]true[/code], the button stays pressed when moving the cursor outside the button while pressing it. [b]Note:[/b] This property only affects the button's visual appearance. Signals will be emitted at the same moment regardless of this property's value. diff --git a/doc/classes/Basis.xml b/doc/classes/Basis.xml index faea2f78b8..42ca3ad24b 100644 --- a/doc/classes/Basis.xml +++ b/doc/classes/Basis.xml @@ -111,8 +111,6 @@ </return> <argument index="0" name="b" type="Basis"> </argument> - <argument index="1" name="epsilon" type="float" default="1e-05"> - </argument> <description> Returns [code]true[/code] if this basis and [code]b[/code] are approximately equal, by calling [code]is_equal_approx[/code] on each component. </description> diff --git a/doc/classes/ButtonGroup.xml b/doc/classes/ButtonGroup.xml index b7f3234b36..5aa2d699a8 100644 --- a/doc/classes/ButtonGroup.xml +++ b/doc/classes/ButtonGroup.xml @@ -14,7 +14,7 @@ <return type="Array"> </return> <description> - Returns an [Array] of [Button]s who have this as their [ButtonGroup] (see [member BaseButton.group]). + Returns an [Array] of [Button]s who have this as their [ButtonGroup] (see [member BaseButton.button_group]). </description> </method> <method name="get_pressed_button"> diff --git a/doc/classes/Callable.xml b/doc/classes/Callable.xml index 3bbee993ac..ad5c549fee 100644 --- a/doc/classes/Callable.xml +++ b/doc/classes/Callable.xml @@ -47,6 +47,12 @@ Creates a new [Callable] for the method called [code]method_name[/code] in the specified [code]object[/code]. </description> </method> + <method name="bind" qualifiers="vararg"> + <return type="void"> + </return> + <description> + </description> + </method> <method name="call" qualifiers="vararg"> <return type="Variant"> </return> @@ -106,6 +112,14 @@ <description> </description> </method> + <method name="unbind"> + <return type="Callable"> + </return> + <argument index="0" name="argcount" type="int"> + </argument> + <description> + </description> + </method> </methods> <constants> </constants> diff --git a/doc/classes/CanvasItem.xml b/doc/classes/CanvasItem.xml index d36a997330..11000ce8d5 100644 --- a/doc/classes/CanvasItem.xml +++ b/doc/classes/CanvasItem.xml @@ -607,9 +607,6 @@ <member name="show_behind_parent" type="bool" setter="set_draw_behind_parent" getter="is_draw_behind_parent_enabled" default="false"> If [code]true[/code], the object draws behind its parent. </member> - <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level"> - If [code]true[/code], the node will not inherit its transform from parent [CanvasItem]s. - </member> <member name="show_on_top" type="bool" setter="_set_on_top" getter="_is_on_top"> If [code]true[/code], the object draws on top of its parent. </member> @@ -619,6 +616,9 @@ <member name="texture_repeat" type="int" setter="set_texture_repeat" getter="get_texture_repeat" enum="CanvasItem.TextureRepeat" default="0"> The texture repeating mode to use on this [CanvasItem]. </member> + <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level" default="false"> + If [code]true[/code], the node will not inherit its transform from parent [CanvasItem]s. + </member> <member name="use_parent_material" type="bool" setter="set_use_parent_material" getter="get_use_parent_material" default="false"> If [code]true[/code], the parent [CanvasItem]'s [member material] property is used as this one's material. </member> diff --git a/doc/classes/ColorRect.xml b/doc/classes/ColorRect.xml index 072759e383..7c0cd981e4 100644 --- a/doc/classes/ColorRect.xml +++ b/doc/classes/ColorRect.xml @@ -4,7 +4,7 @@ Colored rectangle. </brief_description> <description> - Displays a colored rectangle. + Displays a rectangle filled with a solid [member color]. If you need to display the border alone, consider using [ReferenceRect] instead. </description> <tutorials> <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link> diff --git a/doc/classes/Environment.xml b/doc/classes/Environment.xml index 8afc18f91b..104c149784 100644 --- a/doc/classes/Environment.xml +++ b/doc/classes/Environment.xml @@ -18,24 +18,24 @@ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link> </tutorials> <methods> - <method name="is_glow_level_enabled" qualifiers="const"> - <return type="bool"> + <method name="get_glow_level" qualifiers="const"> + <return type="float"> </return> <argument index="0" name="idx" type="int"> </argument> <description> - Returns [code]true[/code] if the glow level [code]idx[/code] is specified, [code]false[/code] otherwise. + Returns the intensity of the glow level [code]idx[/code]. </description> </method> - <method name="set_glow_level_enabled"> + <method name="set_glow_level"> <return type="void"> </return> <argument index="0" name="idx" type="int"> </argument> - <argument index="1" name="enabled" type="bool"> + <argument index="1" name="intensity" type="float"> </argument> <description> - Enables or disables the glow level at index [code]idx[/code]. Each level relies on the previous level. This means that enabling higher glow levels will slow down the glow effect rendering, even if previous levels aren't enabled. + Sets the intensity of the glow level [code]idx[/code]. A value above [code]0.0[/code] enables the level. Each level relies on the previous level. This means that enabling higher glow levels will slow down the glow effect rendering, even if previous levels aren't enabled. </description> </method> </methods> @@ -98,6 +98,10 @@ <member name="background_mode" type="int" setter="set_background" getter="get_background" enum="Environment.BGMode" default="0"> The background mode. See [enum BGMode] for possible values. </member> + <member name="fog_aerial_perspective" type="float" setter="set_fog_aerial_perspective" getter="get_fog_aerial_perspective" default="0.0"> + Blend factor between the fog's color and the color of the background [Sky]. Must have [member background_mode] set to [constant BG_SKY]. + This is useful to simulate [url=https://en.wikipedia.org/wiki/Aerial_perspective]aerial perspective[/url] in large scenes with low density fog. However, it is not very useful for high-density fog, as the sky will shine through. When set to [code]1.0[/code], the fog color comes completely from the [Sky]. If set to [code]0.0[/code], aerial perspective is disabled. + </member> <member name="fog_density" type="float" setter="set_fog_density" getter="get_fog_density" default="0.001"> </member> <member name="fog_enabled" type="bool" setter="set_fog_enabled" getter="is_fog_enabled" default="false"> @@ -132,33 +136,36 @@ The lower threshold of the HDR glow. When using the GLES2 renderer (which doesn't support HDR), this needs to be below [code]1.0[/code] for glow to be visible. A value of [code]0.9[/code] works well in this case. </member> <member name="glow_intensity" type="float" setter="set_glow_intensity" getter="get_glow_intensity" default="0.8"> - The glow intensity. When using the GLES2 renderer, this should be increased to 1.5 to compensate for the lack of HDR rendering. + The overall brightness multiplier of the glow effect. When using the GLES2 renderer, this should be increased to 1.5 to compensate for the lack of HDR rendering. </member> - <member name="glow_levels/1" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false"> - If [code]true[/code], the 1st level of glow is enabled. This is the most "local" level (least blurry). + <member name="glow_levels/1" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0"> + The intensity of the 1st level of glow. This is the most "local" level (least blurry). </member> - <member name="glow_levels/2" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false"> - If [code]true[/code], the 2th level of glow is enabled. + <member name="glow_levels/2" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0"> + The intensity of the 2nd level of glow. </member> - <member name="glow_levels/3" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="true"> - If [code]true[/code], the 3th level of glow is enabled. + <member name="glow_levels/3" type="float" setter="set_glow_level" getter="get_glow_level" default="1.0"> + The intensity of the 3rd level of glow. </member> - <member name="glow_levels/4" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false"> - If [code]true[/code], the 4th level of glow is enabled. + <member name="glow_levels/4" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0"> + The intensity of the 4th level of glow. </member> - <member name="glow_levels/5" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="true"> - If [code]true[/code], the 5th level of glow is enabled. + <member name="glow_levels/5" type="float" setter="set_glow_level" getter="get_glow_level" default="1.0"> + The intensity of the 5th level of glow. </member> - <member name="glow_levels/6" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false"> - If [code]true[/code], the 6th level of glow is enabled. + <member name="glow_levels/6" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0"> + The intensity of the 6th level of glow. </member> - <member name="glow_levels/7" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false"> - If [code]true[/code], the 7th level of glow is enabled. This is the most "global" level (blurriest). + <member name="glow_levels/7" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0"> + The intensity of the 7th level of glow. This is the most "global" level (blurriest). </member> <member name="glow_mix" type="float" setter="set_glow_mix" getter="get_glow_mix" default="0.05"> </member> + <member name="glow_normalized" type="bool" setter="set_glow_normalized" getter="is_glow_normalized" default="false"> + If [code]true[/code], glow levels will be normalized so that summed together their intensities equal [code]1.0[/code]. + </member> <member name="glow_strength" type="float" setter="set_glow_strength" getter="get_glow_strength" default="1.0"> - The glow strength. When using the GLES2 renderer, this should be increased to 1.3 to compensate for the lack of HDR rendering. + The strength of the glow effect. This applies as the glow is blurred across the screen and increases the distance and intensity of the blur. When using the GLES2 renderer, this should be increased to 1.3 to compensate for the lack of HDR rendering. </member> <member name="reflected_light_source" type="int" setter="set_reflection_source" getter="get_reflection_source" enum="Environment.ReflectionSource" default="0"> </member> diff --git a/doc/classes/FuncRef.xml b/doc/classes/FuncRef.xml index 7c01397c24..dc9246ad35 100644 --- a/doc/classes/FuncRef.xml +++ b/doc/classes/FuncRef.xml @@ -26,6 +26,13 @@ Calls the referenced function previously set in [member function] or [method @GDScript.funcref]. Contrarily to [method call_func], this method does not support a variable number of arguments but expects all parameters to be passed via a single [Array]. </description> </method> + <method name="is_valid" qualifiers="const"> + <return type="bool"> + </return> + <description> + Returns whether the object still exists and has the function assigned. + </description> + </method> <method name="set_instance"> <return type="void"> </return> @@ -35,16 +42,9 @@ The object containing the referenced function. This object must be of a type actually inheriting from [Object], not a built-in type such as [int], [Vector2] or [Dictionary]. </description> </method> - <method name="is_valid" qualifiers="const"> - <return type="bool"> - </return> - <description> - Returns whether the object still exists and has the function assigned. - </description> - </method> </methods> <members> - <member name="function" type="StringName" setter="set_function" getter="get_function"> + <member name="function" type="StringName" setter="set_function" getter="get_function" default="@"""> The name of the referenced function. </member> </members> diff --git a/doc/classes/GPUParticles3D.xml b/doc/classes/GPUParticles3D.xml index e840e457bf..d1296c3418 100644 --- a/doc/classes/GPUParticles3D.xml +++ b/doc/classes/GPUParticles3D.xml @@ -67,6 +67,8 @@ <member name="amount" type="int" setter="set_amount" getter="get_amount" default="8"> Number of particles to emit. </member> + <member name="collision_base_size" type="float" setter="set_collision_base_size" getter="get_collision_base_size" default="0.01"> + </member> <member name="draw_order" type="int" setter="set_draw_order" getter="get_draw_order" enum="GPUParticles3D.DrawOrder" default="0"> Particle draw order. Uses [enum DrawOrder] values. </member> diff --git a/doc/classes/GPUParticlesAttractor3D.xml b/doc/classes/GPUParticlesAttractor3D.xml new file mode 100644 index 0000000000..111827d294 --- /dev/null +++ b/doc/classes/GPUParticlesAttractor3D.xml @@ -0,0 +1,23 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesAttractor3D" inherits="VisualInstance3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="attenuation" type="float" setter="set_attenuation" getter="get_attenuation" default="1.0"> + </member> + <member name="cull_mask" type="int" setter="set_cull_mask" getter="get_cull_mask" default="4294967295"> + </member> + <member name="directionality" type="float" setter="set_directionality" getter="get_directionality" default="0.0"> + </member> + <member name="strength" type="float" setter="set_strength" getter="get_strength" default="1.0"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesAttractorBox.xml b/doc/classes/GPUParticlesAttractorBox.xml new file mode 100644 index 0000000000..68616f9bbd --- /dev/null +++ b/doc/classes/GPUParticlesAttractorBox.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesAttractorBox" inherits="GPUParticlesAttractor3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesAttractorSphere.xml b/doc/classes/GPUParticlesAttractorSphere.xml new file mode 100644 index 0000000000..6984427a96 --- /dev/null +++ b/doc/classes/GPUParticlesAttractorSphere.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesAttractorSphere" inherits="GPUParticlesAttractor3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="radius" type="float" setter="set_radius" getter="get_radius" default="1.0"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesAttractorVectorField.xml b/doc/classes/GPUParticlesAttractorVectorField.xml new file mode 100644 index 0000000000..cf5e375ea3 --- /dev/null +++ b/doc/classes/GPUParticlesAttractorVectorField.xml @@ -0,0 +1,19 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesAttractorVectorField" inherits="GPUParticlesAttractor3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )"> + </member> + <member name="texture" type="Texture3D" setter="set_texture" getter="get_texture"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesCollision3D.xml b/doc/classes/GPUParticlesCollision3D.xml new file mode 100644 index 0000000000..dce9a32fc4 --- /dev/null +++ b/doc/classes/GPUParticlesCollision3D.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesCollision3D" inherits="VisualInstance3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="cull_mask" type="int" setter="set_cull_mask" getter="get_cull_mask" default="4294967295"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesCollisionBox.xml b/doc/classes/GPUParticlesCollisionBox.xml new file mode 100644 index 0000000000..17fc124c41 --- /dev/null +++ b/doc/classes/GPUParticlesCollisionBox.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesCollisionBox" inherits="GPUParticlesCollision3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/GPUParticlesCollisionHeightField.xml b/doc/classes/GPUParticlesCollisionHeightField.xml new file mode 100644 index 0000000000..c6987515a9 --- /dev/null +++ b/doc/classes/GPUParticlesCollisionHeightField.xml @@ -0,0 +1,43 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesCollisionHeightField" inherits="GPUParticlesCollision3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )"> + </member> + <member name="follow_camera_enabled" type="bool" setter="set_follow_camera_mode" getter="is_follow_camera_mode_enabled" default="false"> + </member> + <member name="follow_camera_push_ratio" type="float" setter="set_follow_camera_push_ratio" getter="get_follow_camera_push_ratio" default="0.1"> + </member> + <member name="resolution" type="int" setter="set_resolution" getter="get_resolution" enum="GPUParticlesCollisionHeightField.Resolution" default="2"> + </member> + <member name="update_mode" type="int" setter="set_update_mode" getter="get_update_mode" enum="GPUParticlesCollisionHeightField.UpdateMode" default="0"> + </member> + </members> + <constants> + <constant name="RESOLUTION_256" value="0" enum="Resolution"> + </constant> + <constant name="RESOLUTION_512" value="1" enum="Resolution"> + </constant> + <constant name="RESOLUTION_1024" value="2" enum="Resolution"> + </constant> + <constant name="RESOLUTION_2048" value="3" enum="Resolution"> + </constant> + <constant name="RESOLUTION_4096" value="4" enum="Resolution"> + </constant> + <constant name="RESOLUTION_8192" value="5" enum="Resolution"> + </constant> + <constant name="RESOLUTION_MAX" value="6" enum="Resolution"> + </constant> + <constant name="UPDATE_MODE_WHEN_MOVED" value="0" enum="UpdateMode"> + </constant> + <constant name="UPDATE_MODE_ALWAYS" value="1" enum="UpdateMode"> + </constant> + </constants> +</class> diff --git a/doc/classes/GPUParticlesCollisionSDF.xml b/doc/classes/GPUParticlesCollisionSDF.xml new file mode 100644 index 0000000000..c3cbe4b1c6 --- /dev/null +++ b/doc/classes/GPUParticlesCollisionSDF.xml @@ -0,0 +1,37 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesCollisionSDF" inherits="GPUParticlesCollision3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )"> + </member> + <member name="resolution" type="int" setter="set_resolution" getter="get_resolution" enum="GPUParticlesCollisionSDF.Resolution" default="2"> + </member> + <member name="texture" type="Texture3D" setter="set_texture" getter="get_texture"> + </member> + <member name="thickness" type="float" setter="set_thickness" getter="get_thickness" default="1.0"> + </member> + </members> + <constants> + <constant name="RESOLUTION_16" value="0" enum="Resolution"> + </constant> + <constant name="RESOLUTION_32" value="1" enum="Resolution"> + </constant> + <constant name="RESOLUTION_64" value="2" enum="Resolution"> + </constant> + <constant name="RESOLUTION_128" value="3" enum="Resolution"> + </constant> + <constant name="RESOLUTION_256" value="4" enum="Resolution"> + </constant> + <constant name="RESOLUTION_512" value="5" enum="Resolution"> + </constant> + <constant name="RESOLUTION_MAX" value="6" enum="Resolution"> + </constant> + </constants> +</class> diff --git a/doc/classes/GPUParticlesCollisionSphere.xml b/doc/classes/GPUParticlesCollisionSphere.xml new file mode 100644 index 0000000000..41150960d2 --- /dev/null +++ b/doc/classes/GPUParticlesCollisionSphere.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="GPUParticlesCollisionSphere" inherits="GPUParticlesCollision3D" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="radius" type="float" setter="set_radius" getter="get_radius" default="1.0"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/Geometry3D.xml b/doc/classes/Geometry3D.xml index ec685a5ce7..d0b930defb 100644 --- a/doc/classes/Geometry3D.xml +++ b/doc/classes/Geometry3D.xml @@ -102,15 +102,6 @@ Given the two 3D segments ([code]p1[/code], [code]p2[/code]) and ([code]q1[/code], [code]q2[/code]), finds those two points on the two segments that are closest to each other. Returns a [PackedVector3Array] that contains this point on ([code]p1[/code], [code]p2[/code]) as well the accompanying point on ([code]q1[/code], [code]q2[/code]). </description> </method> - <method name="get_uv84_normal_bit"> - <return type="int"> - </return> - <argument index="0" name="normal" type="Vector3"> - </argument> - <description> - Used internally by the engine. - </description> - </method> <method name="ray_intersects_triangle"> <return type="Variant"> </return> diff --git a/doc/classes/GraphEdit.xml b/doc/classes/GraphEdit.xml index 9d00ffe233..77bd2c60cc 100644 --- a/doc/classes/GraphEdit.xml +++ b/doc/classes/GraphEdit.xml @@ -193,16 +193,11 @@ </member> </members> <signals> - <signal name="_begin_node_move"> + <signal name="begin_node_move"> <description> Emitted at the beginning of a GraphNode movement. </description> </signal> - <signal name="_end_node_move"> - <description> - Emitted at the end of a GraphNode movement. - </description> - </signal> <signal name="connection_from_empty"> <argument index="0" name="to" type="StringName"> </argument> @@ -266,6 +261,11 @@ Emitted when a GraphNode is attempted to be duplicated in the GraphEdit. </description> </signal> + <signal name="end_node_move"> + <description> + Emitted at the end of a GraphNode movement. + </description> + </signal> <signal name="node_selected"> <argument index="0" name="node" type="Node"> </argument> diff --git a/doc/classes/KinematicBody2D.xml b/doc/classes/KinematicBody2D.xml index 17c4b85346..425df00b6f 100644 --- a/doc/classes/KinematicBody2D.xml +++ b/doc/classes/KinematicBody2D.xml @@ -55,21 +55,21 @@ <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on the ceiling. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with the ceiling on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="is_on_floor" qualifiers="const"> <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on the floor. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with the floor on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="is_on_wall" qualifiers="const"> <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on a wall. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with a wall on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="move_and_collide"> diff --git a/doc/classes/KinematicBody3D.xml b/doc/classes/KinematicBody3D.xml index 17a6034e9a..a21496de54 100644 --- a/doc/classes/KinematicBody3D.xml +++ b/doc/classes/KinematicBody3D.xml @@ -59,21 +59,21 @@ <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on the ceiling. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with the ceiling on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="is_on_floor" qualifiers="const"> <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on the floor. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with the floor on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="is_on_wall" qualifiers="const"> <return type="bool"> </return> <description> - Returns [code]true[/code] if the body is on a wall. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap]. + Returns [code]true[/code] if the body collided with a wall on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code]. </description> </method> <method name="move_and_collide"> diff --git a/doc/classes/LinkButton.xml b/doc/classes/LinkButton.xml index fed936cc2f..2d475fc449 100644 --- a/doc/classes/LinkButton.xml +++ b/doc/classes/LinkButton.xml @@ -12,7 +12,6 @@ <methods> </methods> <members> - <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" override="true" enum="Control.FocusMode" default="0" /> <member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="0" /> <member name="mouse_default_cursor_shape" type="int" setter="set_default_cursor_shape" getter="get_default_cursor_shape" override="true" enum="Control.CursorShape" default="2" /> <member name="text" type="String" setter="set_text" getter="get_text" default=""""> diff --git a/doc/classes/MenuButton.xml b/doc/classes/MenuButton.xml index cf1fdb5ba6..d97e0f0f21 100644 --- a/doc/classes/MenuButton.xml +++ b/doc/classes/MenuButton.xml @@ -30,7 +30,6 @@ </methods> <members> <member name="action_mode" type="int" setter="set_action_mode" getter="get_action_mode" override="true" enum="BaseButton.ActionMode" default="0" /> - <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" override="true" enum="Control.FocusMode" default="0" /> <member name="flat" type="bool" setter="set_flat" getter="is_flat" override="true" default="true" /> <member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="0" /> <member name="switch_on_hover" type="bool" setter="set_switch_on_hover" getter="is_switch_on_hover" default="false"> diff --git a/doc/classes/MultiMesh.xml b/doc/classes/MultiMesh.xml index e1b3ffa2e4..6ebfc946dc 100644 --- a/doc/classes/MultiMesh.xml +++ b/doc/classes/MultiMesh.xml @@ -65,7 +65,7 @@ <argument index="1" name="color" type="Color"> </argument> <description> - Sets the color of a specific instance. + Sets the color of a specific instance by [i]multiplying[/i] the mesh's existing vertex colors. For the color to take effect, ensure that [member use_colors] is [code]true[/code] on the [MultiMesh] and [member BaseMaterial3D.vertex_color_use_as_albedo] is [code]true[/code] on the material. </description> </method> diff --git a/doc/classes/Node.xml b/doc/classes/Node.xml index 623e4b099b..2e8b76865d 100644 --- a/doc/classes/Node.xml +++ b/doc/classes/Node.xml @@ -834,6 +834,7 @@ </member> <member name="name" type="StringName" setter="set_name" getter="get_name"> The name of the node. This name is unique among the siblings (other child nodes from the same parent). When set to an existing name, the node will be automatically renamed. + [b]Note:[/b] Auto-generated names might include the [code]@[/code] character, which is reserved for unique names when using [method add_child]. When setting the name manually, any [code]@[/code] will be removed. </member> <member name="owner" type="Node" setter="set_owner" getter="get_owner"> The node owner. A node can have any other node as owner (as long as it is a valid parent, grandparent, etc. ascending in the tree). When saving a node (using [PackedScene]), all the nodes it owns will be saved with it. This allows for the creation of complex [SceneTree]s, with instancing and subinstancing. diff --git a/doc/classes/Node3D.xml b/doc/classes/Node3D.xml index af4f18c5f7..f6ff514474 100644 --- a/doc/classes/Node3D.xml +++ b/doc/classes/Node3D.xml @@ -301,7 +301,7 @@ <member name="scale" type="Vector3" setter="set_scale" getter="get_scale" default="Vector3( 1, 1, 1 )"> Scale part of the local transformation. </member> - <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level"> + <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level" default="false"> If [code]true[/code], the node will not inherit its transformations from its parent. Node transformations are only in global space. </member> <member name="transform" type="Transform" setter="set_transform" getter="get_transform" default="Transform( 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0 )"> diff --git a/doc/classes/ParticlesMaterial.xml b/doc/classes/ParticlesMaterial.xml index f6fa3cf38b..77df6245e9 100644 --- a/doc/classes/ParticlesMaterial.xml +++ b/doc/classes/ParticlesMaterial.xml @@ -131,6 +131,16 @@ <member name="anim_speed_random" type="float" setter="set_param_randomness" getter="get_param_randomness" default="0.0"> Animation speed randomness ratio. </member> + <member name="attractor_interaction_enabled" type="bool" setter="set_attractor_interaction_enabled" getter="is_attractor_interaction_enabled" default="true"> + </member> + <member name="collision_bounce" type="float" setter="set_collision_bounce" getter="get_collision_bounce" default="0.0"> + </member> + <member name="collision_enabled" type="bool" setter="set_collision_enabled" getter="is_collision_enabled" default="true"> + </member> + <member name="collision_friction" type="float" setter="set_collision_friction" getter="get_collision_friction" default="0.0"> + </member> + <member name="collision_use_scale" type="bool" setter="set_collision_use_scale" getter="is_collision_using_scale" default="false"> + </member> <member name="color" type="Color" setter="set_color" getter="get_color" default="Color( 1, 1, 1, 1 )"> Each particle's initial color. If the [GPUParticles2D]'s [code]texture[/code] is defined, it will be multiplied by this color. To have particle display color in a [BaseMaterial3D] make sure to set [member BaseMaterial3D.vertex_color_use_as_albedo] to [code]true[/code]. </member> diff --git a/doc/classes/PhysicsBody2D.xml b/doc/classes/PhysicsBody2D.xml index ca42f5801a..9c3c47afba 100644 --- a/doc/classes/PhysicsBody2D.xml +++ b/doc/classes/PhysicsBody2D.xml @@ -86,9 +86,6 @@ The physics layers this area scans for collisions. See [url=https://docs.godotengine.org/en/latest/tutorials/physics/physics_introduction.html#collision-layers-and-masks]Collision layers and masks[/url] in the documentation for more information. </member> <member name="input_pickable" type="bool" setter="set_pickable" getter="is_pickable" override="true" default="false" /> - <member name="layers" type="int" setter="_set_layers" getter="_get_layers"> - Both [member collision_layer] and [member collision_mask]. Returns [member collision_layer] when accessed. Updates [member collision_layer] and [member collision_mask] when modified. - </member> </members> <constants> </constants> diff --git a/doc/classes/PhysicsDirectSpaceState2D.xml b/doc/classes/PhysicsDirectSpaceState2D.xml index 676e33601a..c26cf0514c 100644 --- a/doc/classes/PhysicsDirectSpaceState2D.xml +++ b/doc/classes/PhysicsDirectSpaceState2D.xml @@ -64,13 +64,14 @@ <argument index="5" name="collide_with_areas" type="bool" default="false"> </argument> <description> - Checks whether a point is inside any shape. The shapes the point is inside of are returned in an array containing dictionaries with the following fields: + Checks whether a point is inside any solid shape. The shapes the point is inside of are returned in an array containing dictionaries with the following fields: [code]collider[/code]: The colliding object. [code]collider_id[/code]: The colliding object's ID. [code]metadata[/code]: The intersecting shape's metadata. This metadata is different from [method Object.get_meta], and is set with [method PhysicsServer2D.shape_set_data]. [code]rid[/code]: The intersecting object's [RID]. [code]shape[/code]: The shape index of the colliding shape. Additionally, the method can take an [code]exclude[/code] array of objects or [RID]s that are to be excluded from collisions, a [code]collision_mask[/code] bitmask representing the physics layers to check in, or booleans to determine if the ray should collide with [PhysicsBody2D]s or [Area2D]s, respectively. + [b]Note:[/b] [ConcavePolygonShape2D]s and [CollisionPolygon2D]s in [code]Segments[/code] build mode are not solid shapes. Therefore, they will not be detected. </description> </method> <method name="intersect_point_on_canvas"> diff --git a/doc/classes/ProjectSettings.xml b/doc/classes/ProjectSettings.xml index 54c337faf9..91998ead34 100644 --- a/doc/classes/ProjectSettings.xml +++ b/doc/classes/ProjectSettings.xml @@ -469,7 +469,7 @@ [b]Note:[/b] This option is experimental and meant to alleviate stutter experienced by some users. However, some users have experienced a Vsync framerate halving (e.g. from 60 FPS to 30 FPS) when using it. </member> <member name="editor/script_templates_search_path" type="String" setter="" getter="" default=""res://script_templates""> - Search path for project-specific script templates. Script templates will be search both in the editor-specific path and in this project-specific path. + Search path for project-specific script templates. Godot will search for script templates both in the editor-specific path and in this project-specific path. </member> <member name="editor/search_in_file_extensions" type="PackedStringArray" setter="" getter="" default="PackedStringArray( "gd", "shader" )"> Text-based file extensions to include in the script editor's "Find in Files" feature. You can add e.g. [code]tscn[/code] if you wish to also parse your scene files, especially if you use built-in scripts which are serialized in the scene files. @@ -558,7 +558,7 @@ <member name="input_devices/pointing/emulate_touch_from_mouse" type="bool" setter="" getter="" default="false"> If [code]true[/code], sends touch input events when clicking or dragging the mouse. </member> - <member name="input_devices/pointing/ios/touch_delay" type="float" setter="" getter="" default="0.150"> + <member name="input_devices/pointing/ios/touch_delay" type="float" setter="" getter="" default="0.15"> Default delay for touch events. This only affects iOS devices. </member> <member name="layer_names/2d_physics/layer_1" type="String" setter="" getter="" default=""""> @@ -818,7 +818,7 @@ <member name="logging/file_logging/max_log_files" type="int" setter="" getter="" default="5"> Specifies the maximum amount of log files allowed (used for rotation). </member> - <member name="memory/limits/message_queue/max_size_kb" type="int" setter="" getter="" default="1024"> + <member name="memory/limits/message_queue/max_size_kb" type="int" setter="" getter="" default="4096"> Godot uses a message queue to defer some function calls. If you run out of space on it (you will see an error), you can increase the size here. </member> <member name="memory/limits/multithreaded_server/rid_pool_prealloc" type="int" setter="" getter="" default="60"> @@ -883,6 +883,7 @@ </member> <member name="physics/2d/default_angular_damp" type="float" setter="" getter="" default="1.0"> The default angular damp in 2D. + [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration. </member> <member name="physics/2d/default_gravity" type="int" setter="" getter="" default="98"> The default gravity strength in 2D. @@ -902,6 +903,7 @@ </member> <member name="physics/2d/default_linear_damp" type="float" setter="" getter="" default="0.1"> The default linear damp in 2D. + [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration. </member> <member name="physics/2d/large_object_surface_threshold_in_cells" type="int" setter="" getter="" default="512"> Threshold defining the surface size that constitutes a large object with regard to cells in the broad-phase 2D hash grid algorithm. @@ -928,6 +930,7 @@ </member> <member name="physics/3d/default_angular_damp" type="float" setter="" getter="" default="0.1"> The default angular damp in 3D. + [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration. </member> <member name="physics/3d/default_gravity" type="float" setter="" getter="" default="9.8"> The default gravity strength in 3D. @@ -947,6 +950,7 @@ </member> <member name="physics/3d/default_linear_damp" type="float" setter="" getter="" default="0.1"> The default linear damp in 3D. + [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration. </member> <member name="physics/3d/physics_engine" type="String" setter="" getter="" default=""DEFAULT""> Sets which physics engine to use for 3D physics. diff --git a/doc/classes/RandomNumberGenerator.xml b/doc/classes/RandomNumberGenerator.xml index ec0f1a96b2..d4f9517dd1 100644 --- a/doc/classes/RandomNumberGenerator.xml +++ b/doc/classes/RandomNumberGenerator.xml @@ -15,6 +15,7 @@ [/codeblock] </description> <tutorials> + <link title="Random number generation">https://docs.godotengine.org/en/latest/tutorials/math/random_number_generation.html</link> </tutorials> <methods> <method name="randf"> diff --git a/doc/classes/ReferenceRect.xml b/doc/classes/ReferenceRect.xml index 4f8f71b3db..1a3fbbdfc5 100644 --- a/doc/classes/ReferenceRect.xml +++ b/doc/classes/ReferenceRect.xml @@ -4,7 +4,7 @@ Reference frame for GUI. </brief_description> <description> - A rectangle box that displays only a [member border_color] border color around its rectangle. [ReferenceRect] has no fill [Color]. + A rectangle box that displays only a [member border_color] border color around its rectangle. [ReferenceRect] has no fill [Color]. If you need to display a rectangle filled with a solid color, consider using [ColorRect] instead. </description> <tutorials> </tutorials> @@ -14,6 +14,9 @@ <member name="border_color" type="Color" setter="set_border_color" getter="get_border_color" default="Color( 1, 0, 0, 1 )"> Sets the border [Color] of the [ReferenceRect]. </member> + <member name="border_width" type="float" setter="set_border_width" getter="get_border_width" default="1.0"> + Sets the border width of the [ReferenceRect]. The border grows both inwards and outwards with respect to the rectangle box. + </member> <member name="editor_only" type="bool" setter="set_editor_only" getter="get_editor_only" default="true"> If set to [code]true[/code], the [ReferenceRect] will only be visible while in editor. Otherwise, [ReferenceRect] will be visible in game. </member> diff --git a/doc/classes/RenderingServer.xml b/doc/classes/RenderingServer.xml index 9c8c964967..857c13deb5 100644 --- a/doc/classes/RenderingServer.xml +++ b/doc/classes/RenderingServer.xml @@ -583,6 +583,12 @@ Modulates all colors in the given canvas. </description> </method> + <method name="create_local_rendering_device" qualifiers="const"> + <return type="RenderingDevice"> + </return> + <description> + </description> + </method> <method name="directional_light_create"> <return type="RID"> </return> @@ -712,7 +718,7 @@ </argument> <argument index="1" name="enable" type="bool"> </argument> - <argument index="2" name="level_flags" type="int"> + <argument index="2" name="levels" type="PackedFloat32Array"> </argument> <argument index="3" name="intensity" type="float"> </argument> @@ -1627,7 +1633,6 @@ <argument index="3" name="blend_shapes" type="Array" default="[ ]"> </argument> <argument index="4" name="lods" type="Dictionary" default="{ - }"> </argument> <argument index="5" name="compress_format" type="int" default="31744"> @@ -3574,22 +3579,24 @@ <constant name="INSTANCE_PARTICLES" value="4" enum="InstanceType"> The instance is a particle emitter. </constant> - <constant name="INSTANCE_LIGHT" value="5" enum="InstanceType"> + <constant name="INSTANCE_PARTICLES_COLLISION" value="5" enum="InstanceType"> + </constant> + <constant name="INSTANCE_LIGHT" value="6" enum="InstanceType"> The instance is a light. </constant> - <constant name="INSTANCE_REFLECTION_PROBE" value="6" enum="InstanceType"> + <constant name="INSTANCE_REFLECTION_PROBE" value="7" enum="InstanceType"> The instance is a reflection probe. </constant> - <constant name="INSTANCE_DECAL" value="7" enum="InstanceType"> + <constant name="INSTANCE_DECAL" value="8" enum="InstanceType"> The instance is a decal. </constant> - <constant name="INSTANCE_GI_PROBE" value="8" enum="InstanceType"> + <constant name="INSTANCE_GI_PROBE" value="9" enum="InstanceType"> The instance is a GI probe. </constant> - <constant name="INSTANCE_LIGHTMAP" value="9" enum="InstanceType"> + <constant name="INSTANCE_LIGHTMAP" value="10" enum="InstanceType"> The instance is a lightmap. </constant> - <constant name="INSTANCE_MAX" value="10" enum="InstanceType"> + <constant name="INSTANCE_MAX" value="11" enum="InstanceType"> Represents the size of the [enum InstanceType] enum. </constant> <constant name="INSTANCE_GEOMETRY_MASK" value="30" enum="InstanceType"> diff --git a/doc/classes/RigidBody2D.xml b/doc/classes/RigidBody2D.xml index eca5b8054d..6f41d5ba27 100644 --- a/doc/classes/RigidBody2D.xml +++ b/doc/classes/RigidBody2D.xml @@ -119,6 +119,7 @@ <members> <member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="-1.0"> Damps the body's [member angular_velocity]. If [code]-1[/code], the body will use the [b]Default Angular Damp[/b] defined in [b]Project > Project Settings > Physics > 2d[/b]. + See [member ProjectSettings.physics/2d/default_angular_damp] for more details about damping. </member> <member name="angular_velocity" type="float" setter="set_angular_velocity" getter="get_angular_velocity" default="0.0"> The body's rotational velocity. @@ -155,6 +156,7 @@ </member> <member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="-1.0"> Damps the body's [member linear_velocity]. If [code]-1[/code], the body will use the [b]Default Linear Damp[/b] in [b]Project > Project Settings > Physics > 2d[/b]. + See [member ProjectSettings.physics/2d/default_linear_damp] for more details about damping. </member> <member name="linear_velocity" type="Vector2" setter="set_linear_velocity" getter="get_linear_velocity" default="Vector2( 0, 0 )"> The body's linear velocity. diff --git a/doc/classes/RigidBody3D.xml b/doc/classes/RigidBody3D.xml index 8d92c8b066..f8dc9887a9 100644 --- a/doc/classes/RigidBody3D.xml +++ b/doc/classes/RigidBody3D.xml @@ -134,6 +134,7 @@ <members> <member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="-1.0"> Damps RigidBody3D's rotational forces. + See [member ProjectSettings.physics/3d/default_angular_damp] for more details about damping. </member> <member name="angular_velocity" type="Vector3" setter="set_angular_velocity" getter="get_angular_velocity" default="Vector3( 0, 0, 0 )"> RigidBody3D's rotational velocity. @@ -179,6 +180,7 @@ </member> <member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="-1.0"> The body's linear damp. Cannot be less than -1.0. If this value is different from -1.0, any linear damp derived from the world or areas will be overridden. + See [member ProjectSettings.physics/3d/default_linear_damp] for more details about damping. </member> <member name="linear_velocity" type="Vector3" setter="set_linear_velocity" getter="get_linear_velocity" default="Vector3( 0, 0, 0 )"> The body's linear velocity. Can be used sporadically, but [b]don't set this every frame[/b], because physics may run in another thread and runs at a different granularity. Use [method _integrate_forces] as your process loop for precise control of the body state. diff --git a/doc/classes/StyleBox.xml b/doc/classes/StyleBox.xml index 0e848a1bf6..04f8eb9d13 100644 --- a/doc/classes/StyleBox.xml +++ b/doc/classes/StyleBox.xml @@ -5,6 +5,7 @@ </brief_description> <description> StyleBox is [Resource] that provides an abstract base class for drawing stylized boxes for the UI. StyleBoxes are used for drawing the styles of buttons, line edit backgrounds, tree backgrounds, etc. and also for testing a transparency mask for pointer signals. If mask test fails on a StyleBox assigned as mask to a control, clicks and motion signals will go through it to the one below. + [b]Note:[/b] For children of [Control] that have [i]Theme Properties[/i], the [code]focus[/code] [StyleBox] is displayed over the [code]normal[/code], [code]hover[/code] or [code]pressed[/code] [StyleBox]. This makes the [code]focus[/code] [StyleBox] more reusable across different nodes. </description> <tutorials> </tutorials> diff --git a/doc/classes/SurfaceTool.xml b/doc/classes/SurfaceTool.xml index 385e31ccc7..4f02cd00dd 100644 --- a/doc/classes/SurfaceTool.xml +++ b/doc/classes/SurfaceTool.xml @@ -38,6 +38,7 @@ </argument> <description> Specifies a [Color] for the next vertex to use. + [b]Note:[/b] The material must have [member BaseMaterial3D.vertex_color_use_as_albedo] enabled for the vertex color to be visible. </description> </method> <method name="add_index"> diff --git a/doc/classes/VisualShaderNode.xml b/doc/classes/VisualShaderNode.xml index 3bb527f3d4..6327ab534f 100644 --- a/doc/classes/VisualShaderNode.xml +++ b/doc/classes/VisualShaderNode.xml @@ -57,12 +57,6 @@ Emitted when the node requests an editor refresh. Currently called only in setter of [member VisualShaderNodeTexture.source], [VisualShaderNodeTexture], and [VisualShaderNodeCubemap] (and their derivatives). </description> </signal> - <signal name="show_port_preview"> - <argument index="0" name="port_id" type="int"> - </argument> - <description> - </description> - </signal> </signals> <constants> <constant name="PORT_TYPE_SCALAR" value="0" enum="PortType"> diff --git a/doc/classes/VisualShaderNodeCurveTexture.xml b/doc/classes/VisualShaderNodeCurveTexture.xml new file mode 100644 index 0000000000..26b7b07df2 --- /dev/null +++ b/doc/classes/VisualShaderNodeCurveTexture.xml @@ -0,0 +1,17 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="VisualShaderNodeCurveTexture" inherits="VisualShaderNodeResizableBase" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="texture" type="CurveTexture" setter="set_texture" getter="get_texture"> + </member> + </members> + <constants> + </constants> +</class> diff --git a/doc/classes/VisualShaderNodeGroupBase.xml b/doc/classes/VisualShaderNodeGroupBase.xml index 13018d52f3..afa14c776e 100644 --- a/doc/classes/VisualShaderNodeGroupBase.xml +++ b/doc/classes/VisualShaderNodeGroupBase.xml @@ -1,5 +1,5 @@ <?xml version="1.0" encoding="UTF-8" ?> -<class name="VisualShaderNodeGroupBase" inherits="VisualShaderNode" version="4.0"> +<class name="VisualShaderNodeGroupBase" inherits="VisualShaderNodeResizableBase" version="4.0"> <brief_description> Base class for a family of nodes with variable amount of input and output ports within the visual shader graph. </brief_description> @@ -199,11 +199,6 @@ </description> </method> </methods> - <members> - <member name="size" type="Vector2" setter="set_size" getter="get_size" default="Vector2( 0, 0 )"> - The size of the node in the visual shader graph. - </member> - </members> <constants> </constants> </class> diff --git a/doc/classes/VisualShaderNodeResizableBase.xml b/doc/classes/VisualShaderNodeResizableBase.xml new file mode 100644 index 0000000000..9f827a96cc --- /dev/null +++ b/doc/classes/VisualShaderNodeResizableBase.xml @@ -0,0 +1,18 @@ +<?xml version="1.0" encoding="UTF-8" ?> +<class name="VisualShaderNodeResizableBase" inherits="VisualShaderNode" version="4.0"> + <brief_description> + </brief_description> + <description> + </description> + <tutorials> + </tutorials> + <methods> + </methods> + <members> + <member name="size" type="Vector2" setter="set_size" getter="get_size" default="Vector2( 0, 0 )"> + The size of the node in the visual shader graph. + </member> + </members> + <constants> + </constants> +</class> diff --git a/drivers/dummy/rasterizer_dummy.h b/drivers/dummy/rasterizer_dummy.h index bdb51b1573..bef4d999af 100644 --- a/drivers/dummy/rasterizer_dummy.h +++ b/drivers/dummy/rasterizer_dummy.h @@ -80,7 +80,7 @@ public: void environment_set_canvas_max_layer(RID p_env, int p_max_layer) override {} void environment_set_ambient_light(RID p_env, const Color &p_color, RS::EnvironmentAmbientSource p_ambient = RS::ENV_AMBIENT_SOURCE_BG, float p_energy = 1.0, float p_sky_contribution = 0.0, RS::EnvironmentReflectionSource p_reflection_source = RS::ENV_REFLECTION_SOURCE_BG, const Color &p_ao_color = Color()) override {} - void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) override {} + void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) override {} void environment_glow_set_use_bicubic_upscale(bool p_enable) override {} void environment_glow_set_use_high_quality(bool p_enable) override {} @@ -154,6 +154,7 @@ public: void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) override {} void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count) override {} void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) override {} + void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) override {} void set_scene_pass(uint64_t p_pass) override {} void set_time(double p_time, double p_step) override {} @@ -802,6 +803,7 @@ public: void particles_set_fractional_delta(RID p_particles, bool p_enable) override {} void particles_set_subemitter(RID p_particles, RID p_subemitter_particles) override {} void particles_set_view_axis(RID p_particles, const Vector3 &p_axis) override {} + void particles_set_collision_base_size(RID p_particles, float p_size) override {} void particles_restart(RID p_particles) override {} void particles_set_draw_order(RID p_particles, RS::ParticlesDrawOrder p_order) override {} @@ -819,6 +821,28 @@ public: int particles_get_draw_passes(RID p_particles) const override { return 0; } RID particles_get_draw_pass_mesh(RID p_particles, int p_pass) const override { return RID(); } + void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) override {} + void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) override {} + + void update_particles() override {} + + /* PARTICLES COLLISION */ + + RID particles_collision_create() override { return RID(); } + void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) override {} + void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) override {} + void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) override {} + void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) override {} + void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) override {} + void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) override {} + void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) override {} + void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) override {} + void particles_collision_height_field_update(RID p_particles_collision) override {} + void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) override {} + AABB particles_collision_get_aabb(RID p_particles_collision) const override { return AABB(); } + bool particles_collision_is_heightfield(RID p_particles_collision) const override { return false; } + RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const override { return RID(); } + /* GLOBAL VARIABLES */ void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value) override {} diff --git a/drivers/vulkan/rendering_device_vulkan.cpp b/drivers/vulkan/rendering_device_vulkan.cpp index 9fe3f7e6c0..41b9c33d7f 100644 --- a/drivers/vulkan/rendering_device_vulkan.cpp +++ b/drivers/vulkan/rendering_device_vulkan.cpp @@ -38,7 +38,58 @@ #include "thirdparty/spirv-reflect/spirv_reflect.h" -#define FORCE_FULL_BARRIER +//#define FORCE_FULL_BARRIER + +// Get the Vulkan object information and possible stage access types (bitwise OR'd with incoming values) +RenderingDeviceVulkan::Buffer *RenderingDeviceVulkan::_get_buffer_from_owner(RID p_buffer, VkPipelineStageFlags &stage_mask, VkAccessFlags &access_mask) { + Buffer *buffer = nullptr; + if (vertex_buffer_owner.owns(p_buffer)) { + stage_mask |= VK_PIPELINE_STAGE_VERTEX_INPUT_BIT; + access_mask |= VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT; + buffer = vertex_buffer_owner.getornull(p_buffer); + } else if (index_buffer_owner.owns(p_buffer)) { + stage_mask |= VK_PIPELINE_STAGE_VERTEX_INPUT_BIT; + access_mask |= VK_ACCESS_INDEX_READ_BIT; + buffer = index_buffer_owner.getornull(p_buffer); + } else if (uniform_buffer_owner.owns(p_buffer)) { + stage_mask |= VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + access_mask |= VK_ACCESS_UNIFORM_READ_BIT; + buffer = uniform_buffer_owner.getornull(p_buffer); + } else if (texture_buffer_owner.owns(p_buffer)) { + stage_mask |= VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + access_mask |= VK_ACCESS_SHADER_READ_BIT; + buffer = &texture_buffer_owner.getornull(p_buffer)->buffer; + } else if (storage_buffer_owner.owns(p_buffer)) { + stage_mask |= VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + access_mask |= VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_SHADER_WRITE_BIT; + buffer = storage_buffer_owner.getornull(p_buffer); + } + return buffer; +} + +static void update_external_dependency_for_store(VkSubpassDependency &dependency, bool is_sampled, bool is_storage, bool is_depth) { + // Transitioning from write to read, protect the shaders that may use this next + // Allow for copies/image layout transitions + dependency.dstStageMask |= VK_PIPELINE_STAGE_TRANSFER_BIT; + dependency.dstAccessMask |= VK_ACCESS_TRANSFER_READ_BIT; + + if (is_sampled) { + dependency.dstStageMask |= VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + dependency.dstAccessMask |= VK_ACCESS_SHADER_READ_BIT; + } else if (is_storage) { + dependency.dstStageMask |= VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + dependency.dstAccessMask |= VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_SHADER_WRITE_BIT; + } else { + dependency.dstStageMask |= VK_PIPELINE_STAGE_COLOR_ATTACHMENT_OUTPUT_BIT; + dependency.dstAccessMask |= VK_ACCESS_COLOR_ATTACHMENT_READ_BIT | VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT; + } + + if (is_depth) { + // Depth resources have addtional stages that may be interested in them + dependency.dstStageMask |= VK_PIPELINE_STAGE_EARLY_FRAGMENT_TESTS_BIT | VK_PIPELINE_STAGE_LATE_FRAGMENT_TESTS_BIT; + dependency.dstAccessMask |= VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT | VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; + } +} void RenderingDeviceVulkan::_add_dependency(RID p_id, RID p_depends_on) { if (!dependency_map.has(p_depends_on)) { @@ -1932,7 +1983,7 @@ RID RenderingDeviceVulkan::texture_create(const TextureFormat &p_format, const T image_memory_barrier.subresourceRange.baseArrayLayer = 0; image_memory_barrier.subresourceRange.layerCount = image_create_info.arrayLayers; - vkCmdPipelineBarrier(frames[frame].setup_command_buffer, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(frames[frame].setup_command_buffer, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } RID id = texture_owner.make_rid(texture); @@ -2189,7 +2240,7 @@ Error RenderingDeviceVulkan::texture_update(RID p_texture, uint32_t p_layer, con image_memory_barrier.subresourceRange.baseArrayLayer = p_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_BOTTOM_OF_PIPE_BIT, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } uint32_t mipmap_offset = 0; @@ -2322,7 +2373,7 @@ Error RenderingDeviceVulkan::texture_update(RID p_texture, uint32_t p_layer, con image_memory_barrier.subresourceRange.baseArrayLayer = p_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } return OK; @@ -2485,6 +2536,9 @@ Vector<uint8_t> RenderingDeviceVulkan::texture_get_data(RID p_texture, uint32_t image_memory_barrier.pNext = nullptr; image_memory_barrier.srcAccessMask = VK_ACCESS_TRANSFER_READ_BIT; image_memory_barrier.dstAccessMask = VK_ACCESS_SHADER_READ_BIT; + if (tex->usage_flags & TEXTURE_USAGE_STORAGE_BIT) { + image_memory_barrier.dstAccessMask |= VK_ACCESS_SHADER_WRITE_BIT; + } image_memory_barrier.oldLayout = VK_IMAGE_LAYOUT_TRANSFER_SRC_OPTIMAL; image_memory_barrier.newLayout = tex->layout; image_memory_barrier.srcQueueFamilyIndex = VK_QUEUE_FAMILY_IGNORED; @@ -2496,7 +2550,7 @@ Vector<uint8_t> RenderingDeviceVulkan::texture_get_data(RID p_texture, uint32_t image_memory_barrier.subresourceRange.baseArrayLayer = p_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } _flush(true); @@ -2672,7 +2726,7 @@ Error RenderingDeviceVulkan::texture_copy(RID p_from_texture, RID p_to_texture, image_memory_barrier.subresourceRange.baseArrayLayer = p_src_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } { //make dst readable @@ -2694,7 +2748,7 @@ Error RenderingDeviceVulkan::texture_copy(RID p_from_texture, RID p_to_texture, image_memory_barrier.subresourceRange.baseArrayLayer = p_src_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } } @@ -2755,7 +2809,7 @@ Error RenderingDeviceVulkan::texture_resolve_multisample(RID p_from_texture, RID image_memory_barrier.subresourceRange.baseArrayLayer = src_tex->base_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_BOTTOM_OF_PIPE_BIT, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } { //Dest VkImageMemoryBarrier image_memory_barrier; @@ -2824,7 +2878,7 @@ Error RenderingDeviceVulkan::texture_resolve_multisample(RID p_from_texture, RID image_memory_barrier.subresourceRange.baseArrayLayer = src_tex->base_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_ACCESS_TRANSFER_WRITE_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } { //make dst readable @@ -2846,7 +2900,7 @@ Error RenderingDeviceVulkan::texture_resolve_multisample(RID p_from_texture, RID image_memory_barrier.subresourceRange.baseArrayLayer = dst_tex->base_layer; image_memory_barrier.subresourceRange.layerCount = 1; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } } @@ -2878,16 +2932,22 @@ Error RenderingDeviceVulkan::texture_clear(RID p_texture, const Color &p_color, VkCommandBuffer command_buffer = p_sync_with_draw ? frames[frame].draw_command_buffer : frames[frame].setup_command_buffer; - VkImageLayout layout = src_tex->layout; + VkImageLayout clear_layout = (src_tex->layout == VK_IMAGE_LAYOUT_GENERAL) ? VK_IMAGE_LAYOUT_GENERAL : VK_IMAGE_LAYOUT_TRANSFER_DST_OPTIMAL; - if (src_tex->layout != VK_IMAGE_LAYOUT_GENERAL) { //storage may be in general state + // NOTE: Perhaps the valid stages/accesses for a given onwner should be a property of the owner. (Here and places like _get_buffer_from_owner) + const VkPipelineStageFlags valid_texture_stages = VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; + constexpr VkAccessFlags read_access = VK_ACCESS_SHADER_READ_BIT; + constexpr VkAccessFlags read_write_access = VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_SHADER_WRITE_BIT; + const VkAccessFlags valid_texture_access = (src_tex->usage_flags & TEXTURE_USAGE_STORAGE_BIT) ? read_write_access : read_access; + + { // Barrier from previous access with optional layout change (see clear_layout logic above) VkImageMemoryBarrier image_memory_barrier; image_memory_barrier.sType = VK_STRUCTURE_TYPE_IMAGE_MEMORY_BARRIER; image_memory_barrier.pNext = nullptr; - image_memory_barrier.srcAccessMask = 0; + image_memory_barrier.srcAccessMask = valid_texture_access; image_memory_barrier.dstAccessMask = VK_ACCESS_TRANSFER_WRITE_BIT; image_memory_barrier.oldLayout = src_tex->layout; - image_memory_barrier.newLayout = VK_IMAGE_LAYOUT_TRANSFER_DST_OPTIMAL; + image_memory_barrier.oldLayout = clear_layout; image_memory_barrier.srcQueueFamilyIndex = VK_QUEUE_FAMILY_IGNORED; image_memory_barrier.dstQueueFamilyIndex = VK_QUEUE_FAMILY_IGNORED; @@ -2898,8 +2958,7 @@ Error RenderingDeviceVulkan::texture_clear(RID p_texture, const Color &p_color, image_memory_barrier.subresourceRange.baseArrayLayer = src_tex->base_layer + p_base_layer; image_memory_barrier.subresourceRange.layerCount = p_layers; - layout = VK_IMAGE_LAYOUT_TRANSFER_DST_OPTIMAL; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, valid_texture_stages, VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } VkClearColorValue clear_color; @@ -2915,16 +2974,15 @@ Error RenderingDeviceVulkan::texture_clear(RID p_texture, const Color &p_color, range.baseMipLevel = src_tex->base_mipmap + p_base_mipmap; range.levelCount = p_mipmaps; - vkCmdClearColorImage(command_buffer, src_tex->image, layout, &clear_color, 1, &range); - - if (src_tex->layout != VK_IMAGE_LAYOUT_GENERAL) { //storage may be in general state + vkCmdClearColorImage(command_buffer, src_tex->image, clear_layout, &clear_color, 1, &range); + { // Barrier to post clear accesses (changing back the layout if needed) VkImageMemoryBarrier image_memory_barrier; image_memory_barrier.sType = VK_STRUCTURE_TYPE_IMAGE_MEMORY_BARRIER; image_memory_barrier.pNext = nullptr; image_memory_barrier.srcAccessMask = VK_ACCESS_TRANSFER_WRITE_BIT; - image_memory_barrier.dstAccessMask = VK_ACCESS_SHADER_READ_BIT; - image_memory_barrier.oldLayout = VK_IMAGE_LAYOUT_TRANSFER_DST_OPTIMAL; + image_memory_barrier.dstAccessMask = valid_texture_access; + image_memory_barrier.oldLayout = clear_layout; image_memory_barrier.newLayout = src_tex->layout; image_memory_barrier.srcQueueFamilyIndex = VK_QUEUE_FAMILY_IGNORED; @@ -2936,7 +2994,7 @@ Error RenderingDeviceVulkan::texture_clear(RID p_texture, const Color &p_color, image_memory_barrier.subresourceRange.baseArrayLayer = src_tex->base_layer + p_base_layer; image_memory_barrier.subresourceRange.layerCount = p_layers; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_TRANSFER_BIT, valid_texture_stages, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); } return OK; @@ -2991,6 +3049,19 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF Vector<VkAttachmentReference> depth_stencil_references; Vector<VkAttachmentReference> resolve_references; + // Set up a dependencies from/to external equivalent to the default (implicit) one, and then amend them + const VkPipelineStageFlags default_access_mask = VK_ACCESS_INPUT_ATTACHMENT_READ_BIT | + VK_ACCESS_COLOR_ATTACHMENT_READ_BIT | + VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT | + VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT | + VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; // From Section 7.1 of Vulkan API Spec v1.1.148 + + VkPipelineStageFlags reading_stages = VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT; + VkSubpassDependency dependencies[2] = { { VK_SUBPASS_EXTERNAL, 0, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_ALL_GRAPHICS_BIT, 0, default_access_mask, 0 }, + { 0, VK_SUBPASS_EXTERNAL, VK_PIPELINE_STAGE_ALL_GRAPHICS_BIT, VK_PIPELINE_STAGE_BOTTOM_OF_PIPE_BIT, default_access_mask, 0, 0 } }; + VkSubpassDependency &dependency_from_external = dependencies[0]; + VkSubpassDependency &dependency_to_external = dependencies[1]; + for (int i = 0; i < p_format.size(); i++) { ERR_FAIL_INDEX_V(p_format[i].format, DATA_FORMAT_MAX, VK_NULL_HANDLE); ERR_FAIL_INDEX_V(p_format[i].samples, TEXTURE_SAMPLES_MAX, VK_NULL_HANDLE); @@ -3006,11 +3077,16 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF bool is_sampled = p_format[i].usage_flags & TEXTURE_USAGE_SAMPLING_BIT; bool is_storage = p_format[i].usage_flags & TEXTURE_USAGE_STORAGE_BIT; + // For each UNDEFINED, assume the prior use was a *read*, as we'd be discarding the output of a write + // Also, each UNDEFINED will do an immediate layout transition (write), s.t. we must ensure execution syncronization vs. + // the read. If this is a performance issue, one could track the actual last accessor of each resource, adding only that + // stage switch (is_depth_stencil ? p_initial_depth_action : p_initial_color_action) { case INITIAL_ACTION_CLEAR: { description.loadOp = VK_ATTACHMENT_LOAD_OP_CLEAR; description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_CLEAR; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there + dependency_from_external.srcStageMask |= reading_stages; } break; case INITIAL_ACTION_KEEP: { if (p_format[i].usage_flags & TEXTURE_USAGE_COLOR_ATTACHMENT_BIT) { @@ -3021,10 +3097,12 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF description.loadOp = VK_ATTACHMENT_LOAD_OP_CLEAR; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_CLEAR; + dependency_from_external.srcStageMask |= reading_stages; } else { description.loadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there + dependency_from_external.srcStageMask |= reading_stages; } } break; case INITIAL_ACTION_DROP: { @@ -3036,10 +3114,12 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF description.loadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; + dependency_from_external.srcStageMask |= reading_stages; } else { description.loadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there + dependency_from_external.srcStageMask |= reading_stages; } } break; case INITIAL_ACTION_CONTINUE: { @@ -3055,6 +3135,7 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF description.loadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there + dependency_from_external.srcStageMask |= reading_stages; } } break; default: { @@ -3068,14 +3149,17 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF description.storeOp = VK_ATTACHMENT_STORE_OP_STORE; description.stencilStoreOp = VK_ATTACHMENT_STORE_OP_DONT_CARE; description.finalLayout = is_sampled ? VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL : (is_storage ? VK_IMAGE_LAYOUT_GENERAL : VK_IMAGE_LAYOUT_COLOR_ATTACHMENT_OPTIMAL); + update_external_dependency_for_store(dependency_to_external, is_sampled, is_storage, false); } else if (p_format[i].usage_flags & TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT) { description.storeOp = VK_ATTACHMENT_STORE_OP_STORE; description.stencilStoreOp = VK_ATTACHMENT_STORE_OP_STORE; description.finalLayout = is_sampled ? VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL : (is_storage ? VK_IMAGE_LAYOUT_GENERAL : VK_IMAGE_LAYOUT_DEPTH_STENCIL_ATTACHMENT_OPTIMAL); + update_external_dependency_for_store(dependency_to_external, is_sampled, is_storage, true); } else { description.loadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.stencilLoadOp = VK_ATTACHMENT_LOAD_OP_DONT_CARE; description.initialLayout = VK_IMAGE_LAYOUT_UNDEFINED; //don't care what is there + // TODO: What does this mean about the next usage (and thus appropriate dependency masks } } break; case FINAL_ACTION_DISCARD: { @@ -3128,9 +3212,24 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF } else if (p_format[i].usage_flags & TEXTURE_USAGE_RESOLVE_ATTACHMENT_BIT) { reference.layout = VK_IMAGE_LAYOUT_COLOR_ATTACHMENT_OPTIMAL; resolve_references.push_back(reference); + // if resolves are done, we need to ensure the copy is safe + dependency_to_external.dstStageMask |= VK_PIPELINE_STAGE_TRANSFER_BIT; + dependency_to_external.dstAccessMask |= VK_ACCESS_TRANSFER_READ_BIT; } else { ERR_FAIL_V_MSG(VK_NULL_HANDLE, "Texture index " + itos(i) + " is neither color, depth stencil or resolve so it can't be used as attachment."); } + + // NOTE: Big Mallet Approach -- any layout transition causes a full barrier + if (reference.layout != description.initialLayout) { + // NOTE: this should be smarter based on the textures knowledge of it's previous role + dependency_from_external.srcStageMask |= VK_PIPELINE_STAGE_ALL_COMMANDS_BIT; + dependency_from_external.srcAccessMask |= VK_ACCESS_MEMORY_READ_BIT | VK_ACCESS_MEMORY_WRITE_BIT; + } + if (reference.layout != description.finalLayout) { + // NOTE: this should be smarter based on the textures knowledge of it's subsequent role + dependency_from_external.dstStageMask |= VK_PIPELINE_STAGE_ALL_COMMANDS_BIT; + dependency_from_external.dstAccessMask |= VK_ACCESS_MEMORY_READ_BIT | VK_ACCESS_MEMORY_WRITE_BIT; + } } ERR_FAIL_COND_V_MSG(depth_stencil_references.size() > 1, VK_NULL_HANDLE, @@ -3159,8 +3258,8 @@ VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentF render_pass_create_info.pAttachments = attachments.ptr(); render_pass_create_info.subpassCount = 1; render_pass_create_info.pSubpasses = &subpass; - render_pass_create_info.dependencyCount = 0; - render_pass_create_info.pDependencies = nullptr; + render_pass_create_info.dependencyCount = 0; //2 - throws validation layer error + render_pass_create_info.pDependencies = dependencies; VkRenderPass render_pass; VkResult res = vkCreateRenderPass(device, &render_pass_create_info, nullptr, &render_pass); @@ -3185,7 +3284,7 @@ RenderingDevice::FramebufferFormatID RenderingDeviceVulkan::framebuffer_format_c } int color_references; - VkRenderPass render_pass = _render_pass_create(p_format, INITIAL_ACTION_CLEAR, FINAL_ACTION_DISCARD, INITIAL_ACTION_CLEAR, FINAL_ACTION_DISCARD, &color_references); //actions don't matter for this use case + VkRenderPass render_pass = _render_pass_create(p_format, INITIAL_ACTION_CLEAR, FINAL_ACTION_READ, INITIAL_ACTION_CLEAR, FINAL_ACTION_READ, &color_references); //actions don't matter for this use case if (render_pass == VK_NULL_HANDLE) { //was likely invalid return INVALID_ID; @@ -3389,6 +3488,10 @@ RID RenderingDeviceVulkan::vertex_buffer_create(uint32_t p_size_bytes, const Vec _THREAD_SAFE_METHOD_ ERR_FAIL_COND_V(p_data.size() && (uint32_t)p_data.size() != p_size_bytes, RID()); + ERR_FAIL_COND_V_MSG(draw_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); Buffer buffer; _buffer_allocate(&buffer, p_size_bytes, VK_BUFFER_USAGE_TRANSFER_SRC_BIT | VK_BUFFER_USAGE_TRANSFER_DST_BIT | VK_BUFFER_USAGE_VERTEX_BUFFER_BIT, VMA_MEMORY_USAGE_GPU_ONLY); @@ -3512,6 +3615,10 @@ RID RenderingDeviceVulkan::vertex_array_create(uint32_t p_vertex_count, VertexFo RID RenderingDeviceVulkan::index_buffer_create(uint32_t p_index_count, IndexBufferFormat p_format, const Vector<uint8_t> &p_data, bool p_use_restart_indices) { _THREAD_SAFE_METHOD_ + ERR_FAIL_COND_V_MSG(draw_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); ERR_FAIL_COND_V(p_index_count == 0, RID()); @@ -4258,6 +4365,10 @@ RID RenderingDeviceVulkan::uniform_buffer_create(uint32_t p_size_bytes, const Ve _THREAD_SAFE_METHOD_ ERR_FAIL_COND_V(p_data.size() && (uint32_t)p_data.size() != p_size_bytes, RID()); + ERR_FAIL_COND_V_MSG(draw_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); Buffer buffer; Error err = _buffer_allocate(&buffer, p_size_bytes, VK_BUFFER_USAGE_TRANSFER_DST_BIT | VK_BUFFER_USAGE_UNIFORM_BUFFER_BIT, VMA_MEMORY_USAGE_GPU_ONLY); @@ -4273,6 +4384,10 @@ RID RenderingDeviceVulkan::uniform_buffer_create(uint32_t p_size_bytes, const Ve RID RenderingDeviceVulkan::storage_buffer_create(uint32_t p_size_bytes, const Vector<uint8_t> &p_data, uint32_t p_usage) { _THREAD_SAFE_METHOD_ + ERR_FAIL_COND_V_MSG(draw_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); ERR_FAIL_COND_V(p_data.size() && (uint32_t)p_data.size() != p_size_bytes, RID()); @@ -4296,6 +4411,10 @@ RID RenderingDeviceVulkan::storage_buffer_create(uint32_t p_size_bytes, const Ve RID RenderingDeviceVulkan::texture_buffer_create(uint32_t p_size_elements, DataFormat p_format, const Vector<uint8_t> &p_data) { _THREAD_SAFE_METHOD_ + ERR_FAIL_COND_V_MSG(draw_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list != nullptr && p_data.size(), RID(), + "Creating buffers with data is forbidden during creation of a draw list"); uint32_t element_size = get_format_vertex_size(p_format); ERR_FAIL_COND_V_MSG(element_size == 0, RID(), "Format requested is not supported for texture buffers"); @@ -4491,12 +4610,12 @@ RID RenderingDeviceVulkan::uniform_set_create(const Vector<Uniform> &p_uniforms, } } ERR_FAIL_COND_V_MSG(uniform_idx == -1, RID(), - "All the shader bindings for the given set must be covered by the uniforms provided. Binding (" + itos(set_uniform.binding) + ") was not provided."); + "All the shader bindings for the given set must be covered by the uniforms provided. Binding (" + itos(set_uniform.binding) + "), set (" + itos(p_shader_set) + ") was not provided."); const Uniform &uniform = uniforms[uniform_idx]; ERR_FAIL_COND_V_MSG(uniform.type != set_uniform.type, RID(), - "Mismatch uniform type for binding (" + itos(set_uniform.binding) + "). Expected '" + shader_uniform_names[set_uniform.type] + "', supplied: '" + shader_uniform_names[uniform.type] + "'."); + "Mismatch uniform type for binding (" + itos(set_uniform.binding) + "), set (" + itos(p_shader_set) + "). Expected '" + shader_uniform_names[set_uniform.type] + "', supplied: '" + shader_uniform_names[uniform.type] + "'."); VkWriteDescriptorSet write; //common header write.sType = VK_STRUCTURE_TYPE_WRITE_DESCRIPTOR_SET; @@ -4885,44 +5004,27 @@ Error RenderingDeviceVulkan::buffer_update(RID p_buffer, uint32_t p_offset, uint ERR_FAIL_COND_V_MSG(draw_list && p_sync_with_draw, ERR_INVALID_PARAMETER, "Updating buffers in 'sync to draw' mode is forbidden during creation of a draw list"); + ERR_FAIL_COND_V_MSG(compute_list && p_sync_with_draw, ERR_INVALID_PARAMETER, + "Updating buffers in 'sync to draw' mode is forbidden during creation of a compute list"); - VkPipelineStageFlags dst_stage_mask; - VkAccessFlags dst_access; + // Protect subsequent updates... + VkPipelineStageFlags dst_stage_mask = VK_PIPELINE_STAGE_TRANSFER_BIT; + VkAccessFlags dst_access = VK_ACCESS_TRANSFER_WRITE_BIT; - Buffer *buffer = nullptr; - if (vertex_buffer_owner.owns(p_buffer)) { - dst_stage_mask = VK_PIPELINE_STAGE_VERTEX_INPUT_BIT; - dst_access = VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT; - buffer = vertex_buffer_owner.getornull(p_buffer); - } else if (index_buffer_owner.owns(p_buffer)) { - dst_stage_mask = VK_PIPELINE_STAGE_VERTEX_INPUT_BIT; - dst_access = VK_ACCESS_INDEX_READ_BIT; - buffer = index_buffer_owner.getornull(p_buffer); - } else if (uniform_buffer_owner.owns(p_buffer)) { - dst_stage_mask = VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; - dst_access = VK_ACCESS_UNIFORM_READ_BIT; - buffer = uniform_buffer_owner.getornull(p_buffer); - } else if (texture_buffer_owner.owns(p_buffer)) { - dst_stage_mask = VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; - dst_access = VK_ACCESS_SHADER_READ_BIT; - buffer = &texture_buffer_owner.getornull(p_buffer)->buffer; - } else if (storage_buffer_owner.owns(p_buffer)) { - dst_stage_mask = VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT; - dst_access = VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_SHADER_WRITE_BIT; - buffer = storage_buffer_owner.getornull(p_buffer); - } else { + Buffer *buffer = _get_buffer_from_owner(p_buffer, dst_stage_mask, dst_access); + if (!buffer) { ERR_FAIL_V_MSG(ERR_INVALID_PARAMETER, "Buffer argument is not a valid buffer of any type."); } ERR_FAIL_COND_V_MSG(p_offset + p_size > buffer->size, ERR_INVALID_PARAMETER, "Attempted to write buffer (" + itos((p_offset + p_size) - buffer->size) + " bytes) past the end."); + _buffer_memory_barrier(buffer->buffer, p_offset, p_size, dst_stage_mask, VK_PIPELINE_STAGE_TRANSFER_BIT, dst_access, VK_ACCESS_TRANSFER_WRITE_BIT, p_sync_with_draw); Error err = _buffer_update(buffer, p_offset, (uint8_t *)p_data, p_size, p_sync_with_draw); if (err) { return err; } - _buffer_memory_barrier(buffer->buffer, p_offset, p_size, VK_PIPELINE_STAGE_TRANSFER_BIT, dst_stage_mask, VK_ACCESS_TRANSFER_WRITE_BIT, dst_access, p_sync_with_draw); #ifdef FORCE_FULL_BARRIER _full_barrier(p_sync_with_draw); #else @@ -4934,20 +5036,20 @@ Error RenderingDeviceVulkan::buffer_update(RID p_buffer, uint32_t p_offset, uint Vector<uint8_t> RenderingDeviceVulkan::buffer_get_data(RID p_buffer) { _THREAD_SAFE_METHOD_ - Buffer *buffer = nullptr; - if (vertex_buffer_owner.owns(p_buffer)) { - buffer = vertex_buffer_owner.getornull(p_buffer); - } else if (index_buffer_owner.owns(p_buffer)) { - buffer = index_buffer_owner.getornull(p_buffer); - } else if (texture_buffer_owner.owns(p_buffer)) { - buffer = &texture_buffer_owner.getornull(p_buffer)->buffer; - } else if (storage_buffer_owner.owns(p_buffer)) { - buffer = storage_buffer_owner.getornull(p_buffer); - } else { + // It could be this buffer was just created + VkPipelineShaderStageCreateFlags src_stage_mask = VK_PIPELINE_STAGE_TRANSFER_BIT; + VkAccessFlags src_access_mask = VK_ACCESS_TRANSFER_WRITE_BIT; + // Get the vulkan buffer and the potential stage/access possible + Buffer *buffer = _get_buffer_from_owner(p_buffer, src_stage_mask, src_access_mask); + if (!buffer) { ERR_FAIL_V_MSG(Vector<uint8_t>(), "Buffer is either invalid or this type of buffer can't be retrieved. Only Index and Vertex buffers allow retrieving."); } + // Make sure no one is using the buffer -- the "false" gets us to the same command buffer as below. + _buffer_memory_barrier(buffer->buffer, 0, buffer->size, src_stage_mask, src_access_mask, VK_PIPELINE_STAGE_TRANSFER_BIT, VK_ACCESS_TRANSFER_READ_BIT, false); + VkCommandBuffer command_buffer = frames[frame].setup_command_buffer; + Buffer tmp_buffer; _buffer_allocate(&tmp_buffer, buffer->size, VK_BUFFER_USAGE_TRANSFER_DST_BIT, VMA_MEMORY_USAGE_CPU_ONLY); VkBufferCopy region; @@ -5614,7 +5716,7 @@ Error RenderingDeviceVulkan::_draw_list_render_pass_begin(Framebuffer *framebuff image_memory_barrier.subresourceRange.baseArrayLayer = texture->base_layer; image_memory_barrier.subresourceRange.layerCount = texture->layers; - vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT, VK_PIPELINE_STAGE_VERTEX_INPUT_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(command_buffer, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT, VK_PIPELINE_STAGE_VERTEX_INPUT_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); texture->layout = VK_IMAGE_LAYOUT_GENERAL; @@ -6352,7 +6454,7 @@ void RenderingDeviceVulkan::draw_list_end() { image_memory_barrier.subresourceRange.baseArrayLayer = texture->base_layer; image_memory_barrier.subresourceRange.layerCount = texture->layers; - vkCmdPipelineBarrier(frames[frame].draw_command_buffer, VK_PIPELINE_STAGE_COLOR_ATTACHMENT_OUTPUT_BIT | VK_PIPELINE_STAGE_LATE_FRAGMENT_TESTS_BIT, VK_PIPELINE_STAGE_VERTEX_INPUT_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(frames[frame].draw_command_buffer, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); texture->layout = VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL; } @@ -6494,7 +6596,7 @@ void RenderingDeviceVulkan::compute_list_bind_uniform_set(ComputeListID p_list, image_memory_barrier.subresourceRange.baseArrayLayer = textures_to_sampled[i]->base_layer; image_memory_barrier.subresourceRange.layerCount = textures_to_sampled[i]->layers; - vkCmdPipelineBarrier(cl->command_buffer, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + vkCmdPipelineBarrier(cl->command_buffer, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); textures_to_sampled[i]->layout = VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL; @@ -6691,13 +6793,13 @@ void RenderingDeviceVulkan::compute_list_add_barrier(ComputeListID p_list) { void RenderingDeviceVulkan::compute_list_end() { ERR_FAIL_COND(!compute_list); - + const VkPipelineStageFlags dest_stage_mask = VK_PIPELINE_STAGE_DRAW_INDIRECT_BIT | VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT; for (Set<Texture *>::Element *E = compute_list->state.textures_to_sampled_layout.front(); E; E = E->next()) { VkImageMemoryBarrier image_memory_barrier; image_memory_barrier.sType = VK_STRUCTURE_TYPE_IMAGE_MEMORY_BARRIER; image_memory_barrier.pNext = nullptr; image_memory_barrier.srcAccessMask = VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_SHADER_WRITE_BIT; - image_memory_barrier.dstAccessMask = VK_ACCESS_SHADER_READ_BIT; + image_memory_barrier.dstAccessMask = VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_INDIRECT_COMMAND_READ_BIT; image_memory_barrier.oldLayout = E->get()->layout; image_memory_barrier.newLayout = VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL; @@ -6710,7 +6812,8 @@ void RenderingDeviceVulkan::compute_list_end() { image_memory_barrier.subresourceRange.baseArrayLayer = E->get()->base_layer; image_memory_barrier.subresourceRange.layerCount = E->get()->layers; - vkCmdPipelineBarrier(compute_list->command_buffer, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); + // TODO: Look at the usages in the compute list and determine tighter dst stage and access masks based on some "final" usage equivalent + vkCmdPipelineBarrier(compute_list->command_buffer, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, dest_stage_mask, 0, 0, nullptr, 0, nullptr, 1, &image_memory_barrier); E->get()->layout = VK_IMAGE_LAYOUT_SHADER_READ_ONLY_OPTIMAL; } @@ -6720,7 +6823,7 @@ void RenderingDeviceVulkan::compute_list_end() { #ifdef FORCE_FULL_BARRIER _full_barrier(true); #else - _memory_barrier(VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_VERTEX_INPUT_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT, VK_ACCESS_SHADER_WRITE_BIT, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_ACCESS_INDEX_READ_BIT | VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT | VK_ACCESS_TRANSFER_READ_BIT | VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_INDIRECT_COMMAND_READ_BIT, true); + _memory_barrier(VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT, dest_stage_mask, VK_ACCESS_SHADER_WRITE_BIT, VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_ACCESS_INDEX_READ_BIT | VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT | VK_ACCESS_TRANSFER_READ_BIT | VK_ACCESS_TRANSFER_WRITE_BIT | VK_ACCESS_SHADER_READ_BIT | VK_ACCESS_INDIRECT_COMMAND_READ_BIT, true); #endif } diff --git a/drivers/vulkan/rendering_device_vulkan.h b/drivers/vulkan/rendering_device_vulkan.h index 6f8bbc9c64..e6cbf2e01d 100644 --- a/drivers/vulkan/rendering_device_vulkan.h +++ b/drivers/vulkan/rendering_device_vulkan.h @@ -793,6 +793,7 @@ class RenderingDeviceVulkan : public RenderingDevice { Error _draw_list_setup_framebuffer(Framebuffer *p_framebuffer, InitialAction p_initial_color_action, FinalAction p_final_color_action, InitialAction p_initial_depth_action, FinalAction p_final_depth_action, VkFramebuffer *r_framebuffer, VkRenderPass *r_render_pass); Error _draw_list_render_pass_begin(Framebuffer *framebuffer, InitialAction p_initial_color_action, FinalAction p_final_color_action, InitialAction p_initial_depth_action, FinalAction p_final_depth_action, const Vector<Color> &p_clear_colors, float p_clear_depth, uint32_t p_clear_stencil, Point2i viewport_offset, Point2i viewport_size, VkFramebuffer vkframebuffer, VkRenderPass render_pass, VkCommandBuffer command_buffer, VkSubpassContents subpass_contents, const Vector<RID> &p_storage_textures); _FORCE_INLINE_ DrawList *_get_draw_list_ptr(DrawListID p_id); + Buffer *_get_buffer_from_owner(RID p_buffer, VkPipelineStageFlags &dst_stage_mask, VkAccessFlags &dst_access); /**********************/ /**** COMPUTE LIST ****/ diff --git a/editor/editor_export.cpp b/editor/editor_export.cpp index d3a4dbb6e7..0f86385031 100644 --- a/editor/editor_export.cpp +++ b/editor/editor_export.cpp @@ -185,35 +185,6 @@ bool EditorExportPreset::has_export_file(const String &p_path) { return selected_files.has(p_path); } -void EditorExportPreset::add_patch(const String &p_path, int p_at_pos) { - if (p_at_pos < 0) { - patches.push_back(p_path); - } else { - patches.insert(p_at_pos, p_path); - } - EditorExport::singleton->save_presets(); -} - -void EditorExportPreset::remove_patch(int p_idx) { - patches.remove(p_idx); - EditorExport::singleton->save_presets(); -} - -void EditorExportPreset::set_patch(int p_index, const String &p_path) { - ERR_FAIL_INDEX(p_index, patches.size()); - patches.write[p_index] = p_path; - EditorExport::singleton->save_presets(); -} - -String EditorExportPreset::get_patch(int p_index) { - ERR_FAIL_INDEX_V(p_index, patches.size(), String()); - return patches[p_index]; -} - -Vector<String> EditorExportPreset::get_patches() const { - return patches; -} - void EditorExportPreset::set_custom_features(const String &p_custom_features) { custom_features = p_custom_features; EditorExport::singleton->save_presets(); @@ -1341,7 +1312,6 @@ void EditorExport::_save() { config->set_value(section, "include_filter", preset->get_include_filter()); config->set_value(section, "exclude_filter", preset->get_exclude_filter()); config->set_value(section, "export_path", preset->get_export_path()); - config->set_value(section, "patch_list", preset->get_patches()); config->set_value(section, "encryption_include_filters", preset->get_enc_in_filter()); config->set_value(section, "encryption_exclude_filters", preset->get_enc_ex_filter()); config->set_value(section, "encrypt_pck", preset->get_enc_pck()); @@ -1529,12 +1499,6 @@ void EditorExport::load_config() { preset->set_exclude_filter(config->get_value(section, "exclude_filter")); preset->set_export_path(config->get_value(section, "export_path", "")); - Vector<String> patch_list = config->get_value(section, "patch_list"); - - for (int i = 0; i < patch_list.size(); i++) { - preset->add_patch(patch_list[i]); - } - if (config->has_section_key(section, "encrypt_pck")) { preset->set_enc_pck(config->get_value(section, "encrypt_pck")); } diff --git a/editor/editor_export.h b/editor/editor_export.h index fa6be88302..55728f0c94 100644 --- a/editor/editor_export.h +++ b/editor/editor_export.h @@ -68,8 +68,6 @@ private: Set<String> selected_files; bool runnable = false; - Vector<String> patches; - friend class EditorExport; friend class EditorExportPlatform; @@ -121,12 +119,6 @@ public: void set_exclude_filter(const String &p_exclude); String get_exclude_filter() const; - void add_patch(const String &p_path, int p_at_pos = -1); - void set_patch(int p_index, const String &p_path); - String get_patch(int p_index); - void remove_patch(int p_idx); - Vector<String> get_patches() const; - void set_custom_features(const String &p_custom_features); String get_custom_features() const; diff --git a/editor/editor_node.cpp b/editor/editor_node.cpp index 8edda3123b..668cce5b67 100644 --- a/editor/editor_node.cpp +++ b/editor/editor_node.cpp @@ -128,6 +128,7 @@ #include "editor/plugins/gi_probe_editor_plugin.h" #include "editor/plugins/gpu_particles_2d_editor_plugin.h" #include "editor/plugins/gpu_particles_3d_editor_plugin.h" +#include "editor/plugins/gpu_particles_collision_sdf_editor_plugin.h" #include "editor/plugins/gradient_editor_plugin.h" #include "editor/plugins/item_list_editor_plugin.h" #include "editor/plugins/light_occluder_2d_editor_plugin.h" @@ -504,6 +505,7 @@ void EditorNode::_notification(int p_what) { RS::get_singleton()->environment_set_volumetric_fog_filter_active(bool(GLOBAL_GET("rendering/volumetric_fog/use_filter"))); RS::get_singleton()->environment_set_volumetric_fog_directional_shadow_shrink_size(GLOBAL_GET("rendering/volumetric_fog/directional_shadow_shrink")); RS::get_singleton()->environment_set_volumetric_fog_positional_shadow_shrink_size(GLOBAL_GET("rendering/volumetric_fog/positional_shadow_shrink")); + RS::get_singleton()->canvas_set_shadow_texture_size(GLOBAL_GET("rendering/quality/2d_shadow_atlas/size")); } ResourceImporterTexture::get_singleton()->update_imports(); @@ -4224,6 +4226,7 @@ void EditorNode::_save_docks_to_config(Ref<ConfigFile> p_layout, const String &p p_layout->set_value(p_section, "dock_filesystem_split", filesystem_dock->get_split_offset()); p_layout->set_value(p_section, "dock_filesystem_display_mode", filesystem_dock->get_display_mode()); + p_layout->set_value(p_section, "dock_filesystem_file_sort", filesystem_dock->get_file_sort()); p_layout->set_value(p_section, "dock_filesystem_file_list_display_mode", filesystem_dock->get_file_list_display_mode()); for (int i = 0; i < vsplits.size(); i++) { @@ -4418,6 +4421,11 @@ void EditorNode::_load_docks_from_config(Ref<ConfigFile> p_layout, const String filesystem_dock->set_display_mode(dock_filesystem_display_mode); } + if (p_layout->has_section_key(p_section, "dock_filesystem_file_sort")) { + FileSystemDock::FileSortOption dock_filesystem_file_sort = FileSystemDock::FileSortOption(int(p_layout->get_value(p_section, "dock_filesystem_file_sort"))); + filesystem_dock->set_file_sort(dock_filesystem_file_sort); + } + if (p_layout->has_section_key(p_section, "dock_filesystem_file_list_display_mode")) { FileSystemDock::FileListDisplayMode dock_filesystem_file_list_display_mode = FileSystemDock::FileListDisplayMode(int(p_layout->get_value(p_section, "dock_filesystem_file_list_display_mode"))); filesystem_dock->set_file_list_display_mode(dock_filesystem_file_list_display_mode); @@ -5121,7 +5129,6 @@ void EditorNode::_dropped_files(const Vector<String> &p_files, int p_screen) { void EditorNode::_add_dropped_files_recursive(const Vector<String> &p_files, String to_path) { DirAccessRef dir = DirAccess::create(DirAccess::ACCESS_FILESYSTEM); - Vector<String> just_copy = String("ttf,otf").split(","); for (int i = 0; i < p_files.size(); i++) { String from = p_files[i]; @@ -5152,9 +5159,6 @@ void EditorNode::_add_dropped_files_recursive(const Vector<String> &p_files, Str continue; } - if (!ResourceFormatImporter::get_singleton()->can_be_imported(from) && (just_copy.find(from.get_extension().to_lower()) == -1)) { - continue; - } dir->copy(from, to); } } @@ -6635,6 +6639,7 @@ EditorNode::EditorNode() { add_editor_plugin(memnew(PhysicalBone3DEditorPlugin(this))); add_editor_plugin(memnew(MeshEditorPlugin(this))); add_editor_plugin(memnew(MaterialEditorPlugin(this))); + add_editor_plugin(memnew(GPUParticlesCollisionSDFEditorPlugin(this))); for (int i = 0; i < EditorPlugins::get_plugin_count(); i++) { add_editor_plugin(EditorPlugins::create(i, this)); diff --git a/editor/editor_plugin.cpp b/editor/editor_plugin.cpp index 082c317655..e330713cfb 100644 --- a/editor/editor_plugin.cpp +++ b/editor/editor_plugin.cpp @@ -791,7 +791,7 @@ bool EditorPlugin::build() { return true; } -void EditorPlugin::queue_save_layout() const { +void EditorPlugin::queue_save_layout() { EditorNode::get_singleton()->save_layout(); } diff --git a/editor/editor_plugin.h b/editor/editor_plugin.h index 40a91cbfb9..dd3bf08678 100644 --- a/editor/editor_plugin.h +++ b/editor/editor_plugin.h @@ -221,7 +221,7 @@ public: int update_overlays() const; - void queue_save_layout() const; + void queue_save_layout(); void make_bottom_panel_item_visible(Control *p_item); void hide_bottom_panel(); diff --git a/editor/editor_properties.cpp b/editor/editor_properties.cpp index 4c8af615b4..48a9ca90c4 100644 --- a/editor/editor_properties.cpp +++ b/editor/editor_properties.cpp @@ -614,7 +614,7 @@ public: const Ref<InputEventMouseButton> mb = p_ev; - if (mb.is_valid() && mb->get_button_index() == BUTTON_LEFT && mb->is_pressed()) { + if (mb.is_valid() && mb->get_button_index() == BUTTON_LEFT && mb->is_pressed() && hovered_index > 0) { // Toggle the flag. // We base our choice on the hovered flag, so that it always matches the hovered flag. if (value & (1 << hovered_index)) { @@ -1172,7 +1172,7 @@ void EditorPropertyVector2::setup(double p_min, double p_max, double p_step, boo } EditorPropertyVector2::EditorPropertyVector2(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector2_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector2_editing")); BoxContainer *bc; @@ -1258,7 +1258,7 @@ void EditorPropertyRect2::setup(double p_min, double p_max, double p_step, bool } EditorPropertyRect2::EditorPropertyRect2(bool p_force_wide) { - bool horizontal = !p_force_wide && bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); BoxContainer *bc; @@ -1353,7 +1353,7 @@ void EditorPropertyVector3::setup(double p_min, double p_max, double p_step, boo } EditorPropertyVector3::EditorPropertyVector3(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector_types_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); BoxContainer *bc; @@ -1435,7 +1435,7 @@ void EditorPropertyVector2i::setup(int p_min, int p_max, bool p_no_slider) { } EditorPropertyVector2i::EditorPropertyVector2i(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector2_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector2_editing")); BoxContainer *bc; @@ -1521,7 +1521,7 @@ void EditorPropertyRect2i::setup(int p_min, int p_max, bool p_no_slider) { } EditorPropertyRect2i::EditorPropertyRect2i(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector_types_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); BoxContainer *bc; @@ -1605,7 +1605,7 @@ void EditorPropertyVector3i::setup(int p_min, int p_max, bool p_no_slider) { } EditorPropertyVector3i::EditorPropertyVector3i(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector_types_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); BoxContainer *bc; if (p_force_wide) { @@ -1690,7 +1690,7 @@ void EditorPropertyPlane::setup(double p_min, double p_max, double p_step, bool } EditorPropertyPlane::EditorPropertyPlane(bool p_force_wide) { - bool horizontal = EDITOR_GET("interface/inspector/horizontal_vector_types_editing"); + bool horizontal = p_force_wide || bool(EDITOR_GET("interface/inspector/horizontal_vector_types_editing")); BoxContainer *bc; diff --git a/editor/editor_resource_preview.cpp b/editor/editor_resource_preview.cpp index 3170ea5ff8..9723ae188b 100644 --- a/editor/editor_resource_preview.cpp +++ b/editor/editor_resource_preview.cpp @@ -30,8 +30,6 @@ #include "editor_resource_preview.h" -#include "core/method_bind_ext.gen.inc" - #include "core/io/resource_loader.h" #include "core/io/resource_saver.h" #include "core/message_queue.h" diff --git a/editor/editor_run_native.cpp b/editor/editor_run_native.cpp index 422534a2e1..639da371bd 100644 --- a/editor/editor_run_native.cpp +++ b/editor/editor_run_native.cpp @@ -76,8 +76,10 @@ void EditorRunNative::_notification(int p_what) { } else { mb->get_popup()->clear(); mb->show(); - mb->set_tooltip(eep->get_options_tooltip()); - if (dc > 1) { + if (dc == 1) { + mb->set_tooltip(eep->get_option_tooltip(0)); + } else { + mb->set_tooltip(eep->get_options_tooltip()); for (int i = 0; i < dc; i++) { mb->get_popup()->add_icon_item(eep->get_option_icon(i), eep->get_option_label(i)); mb->get_popup()->set_item_tooltip(mb->get_popup()->get_item_count() - 1, eep->get_option_tooltip(i)); diff --git a/editor/editor_settings.h b/editor/editor_settings.h index 04bb49bb51..c1bb7951fa 100644 --- a/editor/editor_settings.h +++ b/editor/editor_settings.h @@ -31,8 +31,7 @@ #ifndef EDITOR_SETTINGS_H #define EDITOR_SETTINGS_H -#include "core/object.h" - +#include "core/class_db.h" #include "core/io/config_file.h" #include "core/os/thread_safe.h" #include "core/resource.h" diff --git a/editor/editor_vcs_interface.h b/editor/editor_vcs_interface.h index ee9e51441d..6ef55f0a46 100644 --- a/editor/editor_vcs_interface.h +++ b/editor/editor_vcs_interface.h @@ -31,7 +31,7 @@ #ifndef EDITOR_VCS_INTERFACE_H #define EDITOR_VCS_INTERFACE_H -#include "core/object.h" +#include "core/class_db.h" #include "core/ustring.h" #include "scene/gui/panel_container.h" diff --git a/editor/fileserver/editor_file_server.h b/editor/fileserver/editor_file_server.h index 9645fbf39e..eefaa503c1 100644 --- a/editor/fileserver/editor_file_server.h +++ b/editor/fileserver/editor_file_server.h @@ -31,10 +31,10 @@ #ifndef EDITOR_FILE_SERVER_H #define EDITOR_FILE_SERVER_H +#include "core/class_db.h" #include "core/io/file_access_network.h" #include "core/io/packet_peer.h" #include "core/io/tcp_server.h" -#include "core/object.h" #include "core/os/thread.h" class EditorFileServer : public Object { diff --git a/editor/filesystem_dock.cpp b/editor/filesystem_dock.cpp index 0071f169ac..f675f60b7a 100644 --- a/editor/filesystem_dock.cpp +++ b/editor/filesystem_dock.cpp @@ -31,6 +31,7 @@ #include "filesystem_dock.h" #include "core/io/resource_loader.h" +#include "core/list.h" #include "core/os/dir_access.h" #include "core/os/file_access.h" #include "core/os/keyboard.h" @@ -46,13 +47,12 @@ #include "scene/resources/packed_scene.h" #include "servers/display_server.h" -Ref<Texture2D> FileSystemDock::_get_tree_item_icon(EditorFileSystemDirectory *p_dir, int p_idx) { +Ref<Texture2D> FileSystemDock::_get_tree_item_icon(bool p_is_valid, String p_file_type) { Ref<Texture2D> file_icon; - if (!p_dir->get_file_import_is_valid(p_idx)) { + if (!p_is_valid) { file_icon = get_theme_icon("ImportFail", "EditorIcons"); } else { - String file_type = p_dir->get_file_type(p_idx); - file_icon = (has_theme_icon(file_type, "EditorIcons")) ? get_theme_icon(file_type, "EditorIcons") : get_theme_icon("File", "EditorIcons"); + file_icon = (has_theme_icon(p_file_type, "EditorIcons")) ? get_theme_icon(p_file_type, "EditorIcons") : get_theme_icon("File", "EditorIcons"); } return file_icon; } @@ -94,15 +94,17 @@ bool FileSystemDock::_create_tree(TreeItem *p_parent, EditorFileSystemDirectory // Create all items for the files in the subdirectory. if (display_mode == DISPLAY_MODE_TREE_ONLY) { String main_scene = ProjectSettings::get_singleton()->get("application/run/main_scene"); + + // Build the list of the files to display. + List<FileInfo> file_list; for (int i = 0; i < p_dir->get_file_count(); i++) { String file_type = p_dir->get_file_type(i); - if (_is_file_type_disabled_by_feature_profile(file_type)) { // If type is disabled, file won't be displayed. continue; } - String file_name = p_dir->get_file(i); + String file_name = p_dir->get_file(i); if (searched_string.length() > 0) { if (file_name.to_lower().find(searched_string) < 0) { // The searched string is not in the file name, we skip it. @@ -113,10 +115,27 @@ bool FileSystemDock::_create_tree(TreeItem *p_parent, EditorFileSystemDirectory } } + FileInfo fi; + fi.name = p_dir->get_file(i); + fi.type = p_dir->get_file_type(i); + fi.import_broken = !p_dir->get_file_import_is_valid(i); + + file_list.push_back(fi); + } + + // Sort the file list if needed. + if (file_sort == FILE_SORT_TYPE) { + file_list.sort_custom<FileInfoExtensionComparator>(); + } + + // Build the tree. + for (List<FileInfo>::Element *E = file_list.front(); E; E = E->next()) { + FileInfo fi = E->get(); + TreeItem *file_item = tree->create_item(subdirectory_item); - file_item->set_text(0, file_name); - file_item->set_icon(0, _get_tree_item_icon(p_dir, i)); - String file_metadata = lpath.plus_file(file_name); + file_item->set_text(0, fi.name); + file_item->set_icon(0, _get_tree_item_icon(!fi.import_broken, fi.type)); + String file_metadata = lpath.plus_file(fi.name); file_item->set_metadata(0, file_metadata); if (!p_select_in_favorites && path == file_metadata) { file_item->select(0); @@ -220,7 +239,7 @@ void FileSystemDock::_update_tree(const Vector<String> &p_uncollapsed_paths, boo int index; EditorFileSystemDirectory *dir = EditorFileSystem::get_singleton()->find_file(fave, &index); if (dir) { - icon = _get_tree_item_icon(dir, index); + icon = _get_tree_item_icon(dir->get_file_import_is_valid(index), dir->get_file_type(index)); } else { icon = get_theme_icon("File", "EditorIcons"); } @@ -273,9 +292,9 @@ void FileSystemDock::_update_display_mode(bool p_force) { tree->show(); tree->set_v_size_flags(SIZE_EXPAND_FILL); if (display_mode == DISPLAY_MODE_TREE_ONLY) { - tree_search_box->show(); + toolbar2_hbc->show(); } else { - tree_search_box->hide(); + toolbar2_hbc->hide(); } _update_tree(_compute_uncollapsed_paths()); @@ -286,7 +305,7 @@ void FileSystemDock::_update_display_mode(bool p_force) { tree->show(); tree->set_v_size_flags(SIZE_EXPAND_FILL); tree->ensure_cursor_is_visible(); - tree_search_box->hide(); + toolbar2_hbc->hide(); _update_tree(_compute_uncollapsed_paths()); file_list_vb->show(); @@ -318,10 +337,14 @@ void FileSystemDock::_notification(int p_what) { files->connect("item_activated", callable_mp(this, &FileSystemDock::_file_list_activate_file)); button_hist_next->connect("pressed", callable_mp(this, &FileSystemDock::_fw_history)); button_hist_prev->connect("pressed", callable_mp(this, &FileSystemDock::_bw_history)); + tree_search_box->set_right_icon(get_theme_icon("Search", ei)); tree_search_box->set_clear_button_enabled(true); + tree_button_sort->set_icon(get_theme_icon("Sort", ei)); + file_list_search_box->set_right_icon(get_theme_icon("Search", ei)); file_list_search_box->set_clear_button_enabled(true); + file_list_button_sort->set_icon(get_theme_icon("Sort", ei)); button_hist_next->set_icon(get_theme_icon("Forward", ei)); button_hist_prev->set_icon(get_theme_icon("Back", ei)); @@ -387,8 +410,11 @@ void FileSystemDock::_notification(int p_what) { tree_search_box->set_right_icon(get_theme_icon("Search", ei)); tree_search_box->set_clear_button_enabled(true); + tree_button_sort->set_icon(get_theme_icon("Sort", ei)); + file_list_search_box->set_right_icon(get_theme_icon("Search", ei)); file_list_search_box->set_clear_button_enabled(true); + file_list_button_sort->set_icon(get_theme_icon("Sort", ei)); // Update always show folders. bool new_always_show_folders = bool(EditorSettings::get_singleton()->get("docks/filesystem/always_show_folders")); @@ -660,7 +686,7 @@ void FileSystemDock::_update_file_list(bool p_keep_selection) { const Color folder_color = get_theme_color("folder_icon_modulate", "FileDialog"); // Build the FileInfo list. - List<FileInfo> filelist; + List<FileInfo> file_list; if (path == "Favorites") { // Display the favorites. Vector<String> favorites = EditorSettings::get_singleton()->get_favorites(); @@ -698,7 +724,7 @@ void FileSystemDock::_update_file_list(bool p_keep_selection) { } if (searched_string.length() == 0 || fi.name.to_lower().find(searched_string) >= 0) { - filelist.push_back(fi); + file_list.push_back(fi); } } } @@ -719,7 +745,7 @@ void FileSystemDock::_update_file_list(bool p_keep_selection) { if (searched_string.length() > 0) { // Display the search results. - _search(EditorFileSystem::get_singleton()->get_filesystem(), &filelist, 128); + _search(EditorFileSystem::get_singleton()->get_filesystem(), &file_list, 128); } else { if (display_mode == DISPLAY_MODE_TREE_ONLY || always_show_folders) { // Display folders in the list. @@ -757,16 +783,21 @@ void FileSystemDock::_update_file_list(bool p_keep_selection) { fi.type = efd->get_file_type(i); fi.import_broken = !efd->get_file_import_is_valid(i); - filelist.push_back(fi); + file_list.push_back(fi); } } - filelist.sort(); + file_list.sort(); + } + + // Sort the file list if needed. + if (file_sort == FILE_SORT_TYPE) { + file_list.sort_custom<FileInfoExtensionComparator>(); } // Fills the ItemList control node from the FileInfos. String main_scene = ProjectSettings::get_singleton()->get("application/run/main_scene"); String oi = "Object"; - for (List<FileInfo>::Element *E = filelist.front(); E; E = E->next()) { + for (List<FileInfo>::Element *E = file_list.front(); E; E = E->next()) { FileInfo *finfo = &(E->get()); String fname = finfo->name; String fpath = finfo->path; @@ -2516,6 +2547,35 @@ void FileSystemDock::_feature_profile_changed() { _update_display_mode(true); } +void FileSystemDock::set_file_sort(FileSortOption p_file_sort) { + for (int i = 0; i != FILE_SORT_MAX; i++) { + tree_button_sort->get_popup()->set_item_checked(i, (i == (int)p_file_sort)); + file_list_button_sort->get_popup()->set_item_checked(i, (i == (int)p_file_sort)); + } + file_sort = p_file_sort; + + // Update everything needed. + _update_tree(_compute_uncollapsed_paths()); + _update_file_list(true); +} + +void FileSystemDock::_file_sort_popup(int p_id) { + set_file_sort((FileSortOption)p_id); +} + +MenuButton *FileSystemDock::_create_file_menu_button() { + MenuButton *button = memnew(MenuButton); + button->set_flat(true); + button->set_tooltip(TTR("Sort files")); + + PopupMenu *p = button->get_popup(); + p->connect("id_pressed", callable_mp(this, &FileSystemDock::_file_sort_popup)); + p->add_radio_check_item("Sort by Name", FILE_SORT_NAME); + p->add_radio_check_item("Sort by Type", FILE_SORT_TYPE); + p->set_item_checked(file_sort, true); + return button; +} + void FileSystemDock::_bind_methods() { ClassDB::bind_method(D_METHOD("_update_tree"), &FileSystemDock::_update_tree); @@ -2593,7 +2653,7 @@ FileSystemDock::FileSystemDock(EditorNode *p_editor) { button_toggle_display_mode->set_tooltip(TTR("Toggle Split Mode")); toolbar_hbc->add_child(button_toggle_display_mode); - HBoxContainer *toolbar2_hbc = memnew(HBoxContainer); + toolbar2_hbc = memnew(HBoxContainer); toolbar2_hbc->add_theme_constant_override("separation", 0); top_vbc->add_child(toolbar2_hbc); @@ -2603,6 +2663,9 @@ FileSystemDock::FileSystemDock(EditorNode *p_editor) { tree_search_box->connect("text_changed", callable_mp(this, &FileSystemDock::_search_changed), varray(tree_search_box)); toolbar2_hbc->add_child(tree_search_box); + tree_button_sort = _create_file_menu_button(); + toolbar2_hbc->add_child(tree_button_sort); + file_list_popup = memnew(PopupMenu); add_child(file_list_popup); @@ -2644,6 +2707,9 @@ FileSystemDock::FileSystemDock(EditorNode *p_editor) { file_list_search_box->connect("text_changed", callable_mp(this, &FileSystemDock::_search_changed), varray(file_list_search_box)); path_hb->add_child(file_list_search_box); + file_list_button_sort = _create_file_menu_button(); + path_hb->add_child(file_list_button_sort); + button_file_list_display_mode = memnew(Button); button_file_list_display_mode->set_flat(true); path_hb->add_child(button_file_list_display_mode); diff --git a/editor/filesystem_dock.h b/editor/filesystem_dock.h index ec2a075834..f74e04ac2e 100644 --- a/editor/filesystem_dock.h +++ b/editor/filesystem_dock.h @@ -69,6 +69,12 @@ public: DISPLAY_MODE_SPLIT, }; + enum FileSortOption { + FILE_SORT_NAME = 0, + FILE_SORT_TYPE, + FILE_SORT_MAX, + }; + private: enum FileMenu { FILE_OPEN, @@ -95,6 +101,8 @@ private: FOLDER_COLLAPSE_ALL, }; + FileSortOption file_sort = FILE_SORT_NAME; + VBoxContainer *scanning_vb; ProgressBar *scanning_progress; VSplitContainer *split_box; @@ -109,8 +117,13 @@ private: Button *button_hist_next; Button *button_hist_prev; LineEdit *current_path; + + HBoxContainer *toolbar2_hbc; LineEdit *tree_search_box; + MenuButton *tree_button_sort; + LineEdit *file_list_search_box; + MenuButton *file_list_button_sort; String searched_string; Vector<String> uncollapsed_paths_before_search; @@ -173,7 +186,7 @@ private: ItemList *files; bool import_dock_needs_update; - Ref<Texture2D> _get_tree_item_icon(EditorFileSystemDirectory *p_dir, int p_idx); + Ref<Texture2D> _get_tree_item_icon(bool p_is_valid, String p_file_type); bool _create_tree(TreeItem *p_parent, EditorFileSystemDirectory *p_dir, Vector<String> &uncollapsed_paths, bool p_select_in_favorites, bool p_unfold_path = false); Vector<String> _compute_uncollapsed_paths(); void _update_tree(const Vector<String> &p_uncollapsed_paths = Vector<String>(), bool p_uncollapse_root = false, bool p_select_in_favorites = false, bool p_unfold_path = false); @@ -238,6 +251,9 @@ private: void _search_changed(const String &p_text, const Control *p_from); + MenuButton *_create_file_menu_button(); + void _file_sort_popup(int p_id); + void _file_and_folders_fill_popup(PopupMenu *p_popup, Vector<String> p_paths, bool p_display_path_dependent_options = true); void _tree_rmb_select(const Vector2 &p_pos); void _tree_rmb_empty(const Vector2 &p_pos); @@ -256,6 +272,11 @@ private: return NaturalNoCaseComparator()(name, fi.name); } }; + struct FileInfoExtensionComparator { + bool operator()(const FileInfo &p_a, const FileInfo &p_b) const { + return NaturalNoCaseComparator()(p_a.name.get_extension() + p_a.name.get_basename(), p_b.name.get_extension() + p_b.name.get_basename()); + } + }; void _search(EditorFileSystemDirectory *p_path, List<FileInfo> *matches, int p_max_items); @@ -299,6 +320,9 @@ public: void set_display_mode(DisplayMode p_display_mode); DisplayMode get_display_mode() { return display_mode; } + void set_file_sort(FileSortOption p_file_sort); + FileSortOption get_file_sort() { return file_sort; } + void set_file_list_display_mode(FileListDisplayMode p_mode); FileListDisplayMode get_file_list_display_mode() { return file_list_display_mode; }; diff --git a/editor/icons/PaintVertex.svg b/editor/icons/PaintVertex.svg deleted file mode 100644 index 5a13e4b7d0..0000000000 --- a/editor/icons/PaintVertex.svg +++ /dev/null @@ -1 +0,0 @@ -<svg height="16" viewBox="0 0 16 16" width="16" xmlns="http://www.w3.org/2000/svg"><ellipse cx="8.372881" cy="8.169492" fill="#fff" rx="6.677966" ry="6.067797"/></svg> diff --git a/editor/icons/Rectangle.svg b/editor/icons/Rectangle.svg new file mode 100644 index 0000000000..415940e68f --- /dev/null +++ b/editor/icons/Rectangle.svg @@ -0,0 +1 @@ +<svg height="16" viewBox="0 0 16 16" width="16" xmlns="http://www.w3.org/2000/svg"><rect fill="none" height="8" rx=".000017" stroke="#e0e0e0" stroke-linejoin="round" stroke-miterlimit="10" stroke-width="2" width="12" x="2" y="4"/></svg> diff --git a/editor/icons/UnpaintVertex.svg b/editor/icons/UnpaintVertex.svg deleted file mode 100644 index 059fcf6e25..0000000000 --- a/editor/icons/UnpaintVertex.svg +++ /dev/null @@ -1 +0,0 @@ -<svg height="16" viewBox="0 0 16 16" width="16" xmlns="http://www.w3.org/2000/svg"><ellipse cx="8.372881" cy="8.169492" rx="6.677966" ry="6.067797"/></svg> diff --git a/editor/import/resource_importer_layered_texture.cpp b/editor/import/resource_importer_layered_texture.cpp index bbf62596d0..ac068c05cf 100644 --- a/editor/import/resource_importer_layered_texture.cpp +++ b/editor/import/resource_importer_layered_texture.cpp @@ -51,7 +51,7 @@ String ResourceImporterLayeredTexture::get_importer_name() const { return "cubemap_array_texture"; } break; case MODE_3D: { - return "cubemap_3d_texture"; + return "3d_texture"; } break; } diff --git a/editor/inspector_dock.cpp b/editor/inspector_dock.cpp index 8f1b8838d8..c88cd8ea5f 100644 --- a/editor/inspector_dock.cpp +++ b/editor/inspector_dock.cpp @@ -164,7 +164,7 @@ void InspectorDock::_resource_file_selected(String p_file) { editor->push_item(res.operator->()); } -void InspectorDock::_save_resource(bool save_as) const { +void InspectorDock::_save_resource(bool save_as) { ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current(); Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr; @@ -179,7 +179,7 @@ void InspectorDock::_save_resource(bool save_as) const { } } -void InspectorDock::_unref_resource() const { +void InspectorDock::_unref_resource() { ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current(); Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr; @@ -190,7 +190,7 @@ void InspectorDock::_unref_resource() const { editor->edit_current(); } -void InspectorDock::_copy_resource() const { +void InspectorDock::_copy_resource() { ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current(); Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr; @@ -201,7 +201,7 @@ void InspectorDock::_copy_resource() const { EditorSettings::get_singleton()->set_resource_clipboard(current_res); } -void InspectorDock::_paste_resource() const { +void InspectorDock::_paste_resource() { RES r = EditorSettings::get_singleton()->get_resource_clipboard(); if (r.is_valid()) { editor->push_item(EditorSettings::get_singleton()->get_resource_clipboard().ptr(), String()); diff --git a/editor/inspector_dock.h b/editor/inspector_dock.h index 551d3d1643..b2dabf19c5 100644 --- a/editor/inspector_dock.h +++ b/editor/inspector_dock.h @@ -96,10 +96,10 @@ class InspectorDock : public VBoxContainer { void _load_resource(const String &p_type = ""); void _open_resource_selector() { _load_resource(); }; // just used to call from arg-less signal void _resource_file_selected(String p_file); - void _save_resource(bool save_as) const; - void _unref_resource() const; - void _copy_resource() const; - void _paste_resource() const; + void _save_resource(bool save_as); + void _unref_resource(); + void _copy_resource(); + void _paste_resource(); void _warning_pressed(); void _resource_created(); diff --git a/editor/localization_editor.cpp b/editor/localization_editor.cpp index 6764f70d9b..e4562c57af 100644 --- a/editor/localization_editor.cpp +++ b/editor/localization_editor.cpp @@ -319,7 +319,7 @@ void LocalizationEditor::_translation_filter_option_changed() { } } - f_locales = f_locales.sort(); + f_locales.sort(); undo_redo->create_action(TTR("Changed Locale Filter")); undo_redo->add_do_property(ProjectSettings::get_singleton(), "locale/locale_filter", f_locales_all); diff --git a/editor/node_3d_editor_gizmos.cpp b/editor/node_3d_editor_gizmos.cpp index 6e5fb6389d..397a958d8f 100644 --- a/editor/node_3d_editor_gizmos.cpp +++ b/editor/node_3d_editor_gizmos.cpp @@ -41,6 +41,7 @@ #include "scene/3d/decal.h" #include "scene/3d/gi_probe.h" #include "scene/3d/gpu_particles_3d.h" +#include "scene/3d/gpu_particles_collision_3d.h" #include "scene/3d/light_3d.h" #include "scene/3d/lightmap_probe.h" #include "scene/3d/listener_3d.h" @@ -2455,6 +2456,266 @@ void GPUParticles3DGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) { //// +//// + +GPUParticlesCollision3DGizmoPlugin::GPUParticlesCollision3DGizmoPlugin() { + Color gizmo_color = EDITOR_DEF("editors/3d_gizmos/gizmo_colors/particle_collision", Color(0.5, 0.7, 1)); + create_material("shape_material", gizmo_color); + gizmo_color.a = 0.15; + create_material("shape_material_internal", gizmo_color); + + create_handle_material("handles"); +} + +bool GPUParticlesCollision3DGizmoPlugin::has_gizmo(Node3D *p_spatial) { + return (Object::cast_to<GPUParticlesCollision3D>(p_spatial) != nullptr) || (Object::cast_to<GPUParticlesAttractor3D>(p_spatial) != nullptr); +} + +String GPUParticlesCollision3DGizmoPlugin::get_name() const { + return "GPUParticlesCollision3D"; +} + +int GPUParticlesCollision3DGizmoPlugin::get_priority() const { + return -1; +} + +String GPUParticlesCollision3DGizmoPlugin::get_handle_name(const EditorNode3DGizmo *p_gizmo, int p_idx) const { + const Node3D *cs = p_gizmo->get_spatial_node(); + + if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) { + return "Radius"; + } + + if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) { + return "Extents"; + } + + return ""; +} + +Variant GPUParticlesCollision3DGizmoPlugin::get_handle_value(EditorNode3DGizmo *p_gizmo, int p_idx) const { + const Node3D *cs = p_gizmo->get_spatial_node(); + + if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) { + return p_gizmo->get_spatial_node()->call("get_radius"); + } + + if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) { + return Vector3(p_gizmo->get_spatial_node()->call("get_extents")); + } + + return Variant(); +} + +void GPUParticlesCollision3DGizmoPlugin::set_handle(EditorNode3DGizmo *p_gizmo, int p_idx, Camera3D *p_camera, const Point2 &p_point) { + Node3D *sn = p_gizmo->get_spatial_node(); + + Transform gt = sn->get_global_transform(); + Transform gi = gt.affine_inverse(); + + Vector3 ray_from = p_camera->project_ray_origin(p_point); + Vector3 ray_dir = p_camera->project_ray_normal(p_point); + + Vector3 sg[2] = { gi.xform(ray_from), gi.xform(ray_from + ray_dir * 4096) }; + + if (Object::cast_to<GPUParticlesCollisionSphere>(sn) || Object::cast_to<GPUParticlesAttractorSphere>(sn)) { + Vector3 ra, rb; + Geometry3D::get_closest_points_between_segments(Vector3(), Vector3(4096, 0, 0), sg[0], sg[1], ra, rb); + float d = ra.x; + if (Node3DEditor::get_singleton()->is_snap_enabled()) { + d = Math::stepify(d, Node3DEditor::get_singleton()->get_translate_snap()); + } + + if (d < 0.001) { + d = 0.001; + } + + sn->call("set_radius", d); + } + + if (Object::cast_to<GPUParticlesCollisionBox>(sn) || Object::cast_to<GPUParticlesAttractorBox>(sn) || Object::cast_to<GPUParticlesAttractorVectorField>(sn) || Object::cast_to<GPUParticlesCollisionSDF>(sn) || Object::cast_to<GPUParticlesCollisionHeightField>(sn)) { + Vector3 axis; + axis[p_idx] = 1.0; + Vector3 ra, rb; + Geometry3D::get_closest_points_between_segments(Vector3(), axis * 4096, sg[0], sg[1], ra, rb); + float d = ra[p_idx]; + if (Node3DEditor::get_singleton()->is_snap_enabled()) { + d = Math::stepify(d, Node3DEditor::get_singleton()->get_translate_snap()); + } + + if (d < 0.001) { + d = 0.001; + } + + Vector3 he = sn->call("get_extents"); + he[p_idx] = d; + sn->call("set_extents", he); + } +} + +void GPUParticlesCollision3DGizmoPlugin::commit_handle(EditorNode3DGizmo *p_gizmo, int p_idx, const Variant &p_restore, bool p_cancel) { + Node3D *sn = p_gizmo->get_spatial_node(); + + if (Object::cast_to<GPUParticlesCollisionSphere>(sn) || Object::cast_to<GPUParticlesAttractorSphere>(sn)) { + if (p_cancel) { + sn->call("set_radius", p_restore); + return; + } + + UndoRedo *ur = Node3DEditor::get_singleton()->get_undo_redo(); + ur->create_action(TTR("Change Radius")); + ur->add_do_method(sn, "set_radius", sn->call("get_radius")); + ur->add_undo_method(sn, "set_radius", p_restore); + ur->commit_action(); + } + + if (Object::cast_to<GPUParticlesCollisionBox>(sn) || Object::cast_to<GPUParticlesAttractorBox>(sn) || Object::cast_to<GPUParticlesAttractorVectorField>(sn) || Object::cast_to<GPUParticlesCollisionSDF>(sn) || Object::cast_to<GPUParticlesCollisionHeightField>(sn)) { + if (p_cancel) { + sn->call("set_extents", p_restore); + return; + } + + UndoRedo *ur = Node3DEditor::get_singleton()->get_undo_redo(); + ur->create_action(TTR("Change Box Shape Extents")); + ur->add_do_method(sn, "set_extents", sn->call("get_extents")); + ur->add_undo_method(sn, "set_extents", p_restore); + ur->commit_action(); + } +} + +void GPUParticlesCollision3DGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) { + Node3D *cs = p_gizmo->get_spatial_node(); + + print_line("redraw request " + itos(cs != nullptr)); + p_gizmo->clear(); + + const Ref<Material> material = + get_material("shape_material", p_gizmo); + const Ref<Material> material_internal = + get_material("shape_material_internal", p_gizmo); + + Ref<Material> handles_material = get_material("handles"); + + if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) { + float r = cs->call("get_radius"); + + Vector<Vector3> points; + + for (int i = 0; i <= 360; i++) { + float ra = Math::deg2rad((float)i); + float rb = Math::deg2rad((float)i + 1); + Point2 a = Vector2(Math::sin(ra), Math::cos(ra)) * r; + Point2 b = Vector2(Math::sin(rb), Math::cos(rb)) * r; + + points.push_back(Vector3(a.x, 0, a.y)); + points.push_back(Vector3(b.x, 0, b.y)); + points.push_back(Vector3(0, a.x, a.y)); + points.push_back(Vector3(0, b.x, b.y)); + points.push_back(Vector3(a.x, a.y, 0)); + points.push_back(Vector3(b.x, b.y, 0)); + } + + Vector<Vector3> collision_segments; + + for (int i = 0; i < 64; i++) { + float ra = i * Math_PI * 2.0 / 64.0; + float rb = (i + 1) * Math_PI * 2.0 / 64.0; + Point2 a = Vector2(Math::sin(ra), Math::cos(ra)) * r; + Point2 b = Vector2(Math::sin(rb), Math::cos(rb)) * r; + + collision_segments.push_back(Vector3(a.x, 0, a.y)); + collision_segments.push_back(Vector3(b.x, 0, b.y)); + collision_segments.push_back(Vector3(0, a.x, a.y)); + collision_segments.push_back(Vector3(0, b.x, b.y)); + collision_segments.push_back(Vector3(a.x, a.y, 0)); + collision_segments.push_back(Vector3(b.x, b.y, 0)); + } + + p_gizmo->add_lines(points, material); + p_gizmo->add_collision_segments(collision_segments); + Vector<Vector3> handles; + handles.push_back(Vector3(r, 0, 0)); + p_gizmo->add_handles(handles, handles_material); + } + + if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) { + Vector<Vector3> lines; + AABB aabb; + aabb.position = -cs->call("get_extents").operator Vector3(); + aabb.size = aabb.position * -2; + + for (int i = 0; i < 12; i++) { + Vector3 a, b; + aabb.get_edge(i, a, b); + lines.push_back(a); + lines.push_back(b); + } + + Vector<Vector3> handles; + + for (int i = 0; i < 3; i++) { + Vector3 ax; + ax[i] = cs->call("get_extents").operator Vector3()[i]; + handles.push_back(ax); + } + + p_gizmo->add_lines(lines, material); + p_gizmo->add_collision_segments(lines); + p_gizmo->add_handles(handles, handles_material); + + GPUParticlesCollisionSDF *col_sdf = Object::cast_to<GPUParticlesCollisionSDF>(cs); + if (col_sdf) { + static const int subdivs[GPUParticlesCollisionSDF::RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; + int subdiv = subdivs[col_sdf->get_resolution()]; + float cell_size = aabb.get_longest_axis_size() / subdiv; + + lines.clear(); + + for (int i = 1; i < subdiv; i++) { + for (int j = 0; j < 3; j++) { + if (cell_size * i > aabb.size[j]) { + continue; + } + + Vector2 dir; + dir[j] = 1.0; + Vector2 ta, tb; + int j_n1 = (j + 1) % 3; + int j_n2 = (j + 2) % 3; + ta[j_n1] = 1.0; + tb[j_n2] = 1.0; + + for (int k = 0; k < 4; k++) { + Vector3 from = aabb.position, to = aabb.position; + from[j] += cell_size * i; + to[j] += cell_size * i; + + if (k & 1) { + to[j_n1] += aabb.size[j_n1]; + } else { + to[j_n2] += aabb.size[j_n2]; + } + + if (k & 2) { + from[j_n1] += aabb.size[j_n1]; + from[j_n2] += aabb.size[j_n2]; + } + + lines.push_back(from); + lines.push_back(to); + } + } + } + + p_gizmo->add_lines(lines, material_internal); + } + } +} + +///// + +//// + ReflectionProbeGizmoPlugin::ReflectionProbeGizmoPlugin() { Color gizmo_color = EDITOR_DEF("editors/3d_gizmos/gizmo_colors/reflection_probe", Color(0.6, 1, 0.5)); diff --git a/editor/node_3d_editor_gizmos.h b/editor/node_3d_editor_gizmos.h index c7aae39a45..4826054643 100644 --- a/editor/node_3d_editor_gizmos.h +++ b/editor/node_3d_editor_gizmos.h @@ -253,6 +253,23 @@ public: GPUParticles3DGizmoPlugin(); }; +class GPUParticlesCollision3DGizmoPlugin : public EditorNode3DGizmoPlugin { + GDCLASS(GPUParticlesCollision3DGizmoPlugin, EditorNode3DGizmoPlugin); + +public: + bool has_gizmo(Node3D *p_spatial) override; + String get_name() const override; + int get_priority() const override; + void redraw(EditorNode3DGizmo *p_gizmo) override; + + String get_handle_name(const EditorNode3DGizmo *p_gizmo, int p_idx) const override; + Variant get_handle_value(EditorNode3DGizmo *p_gizmo, int p_idx) const override; + void set_handle(EditorNode3DGizmo *p_gizmo, int p_idx, Camera3D *p_camera, const Point2 &p_point) override; + void commit_handle(EditorNode3DGizmo *p_gizmo, int p_idx, const Variant &p_restore, bool p_cancel = false) override; + + GPUParticlesCollision3DGizmoPlugin(); +}; + class ReflectionProbeGizmoPlugin : public EditorNode3DGizmoPlugin { GDCLASS(ReflectionProbeGizmoPlugin, EditorNode3DGizmoPlugin); diff --git a/editor/plugins/animation_state_machine_editor.cpp b/editor/plugins/animation_state_machine_editor.cpp index 26006d85c9..885ec17cb3 100644 --- a/editor/plugins/animation_state_machine_editor.cpp +++ b/editor/plugins/animation_state_machine_editor.cpp @@ -386,6 +386,12 @@ void AnimationNodeStateMachineEditor::_state_machine_gui_input(const Ref<InputEv over_text = over_text_now; } } + + Ref<InputEventPanGesture> pan_gesture = p_event; + if (pan_gesture.is_valid()) { + h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * pan_gesture->get_delta().x / 8); + v_scroll->set_value(v_scroll->get_value() + v_scroll->get_page() * pan_gesture->get_delta().y / 8); + } } void AnimationNodeStateMachineEditor::_file_opened(const String &p_file) { diff --git a/editor/plugins/audio_stream_editor_plugin.cpp b/editor/plugins/audio_stream_editor_plugin.cpp index b0f65af245..231f5588a4 100644 --- a/editor/plugins/audio_stream_editor_plugin.cpp +++ b/editor/plugins/audio_stream_editor_plugin.cpp @@ -44,8 +44,8 @@ void AudioStreamEditor::_notification(int p_what) { if (p_what == NOTIFICATION_THEME_CHANGED || p_what == NOTIFICATION_ENTER_TREE) { _play_button->set_icon(get_theme_icon("MainPlay", "EditorIcons")); _stop_button->set_icon(get_theme_icon("Stop", "EditorIcons")); - _preview->set_frame_color(get_theme_color("dark_color_2", "Editor")); - set_frame_color(get_theme_color("dark_color_1", "Editor")); + _preview->set_color(get_theme_color("dark_color_2", "Editor")); + set_color(get_theme_color("dark_color_1", "Editor")); _indicator->update(); _preview->update(); diff --git a/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp new file mode 100644 index 0000000000..0288645f91 --- /dev/null +++ b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp @@ -0,0 +1,201 @@ +/*************************************************************************/ +/* gpu_particles_collision_sdf_editor_plugin.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "gpu_particles_collision_sdf_editor_plugin.h" + +void GPUParticlesCollisionSDFEditorPlugin::_bake() { + if (col_sdf) { + if (col_sdf->get_texture().is_null() || !col_sdf->get_texture()->get_path().is_resource_file()) { + String path = get_tree()->get_edited_scene_root()->get_filename(); + if (path == String()) { + path = "res://" + col_sdf->get_name() + "_data.exr"; + } else { + String ext = path.get_extension(); + path = path.get_basename() + "." + col_sdf->get_name() + "_data.exr"; + } + probe_file->set_current_path(path); + probe_file->popup_file_dialog(); + return; + } + + _sdf_save_path_and_bake(col_sdf->get_texture()->get_path()); + } +} + +void GPUParticlesCollisionSDFEditorPlugin::edit(Object *p_object) { + GPUParticlesCollisionSDF *s = Object::cast_to<GPUParticlesCollisionSDF>(p_object); + if (!s) { + return; + } + + col_sdf = s; +} + +bool GPUParticlesCollisionSDFEditorPlugin::handles(Object *p_object) const { + return p_object->is_class("GPUParticlesCollisionSDF"); +} + +void GPUParticlesCollisionSDFEditorPlugin::_notification(int p_what) { + if (p_what == NOTIFICATION_PROCESS) { + if (!col_sdf) { + return; + } + + const Vector3i size = col_sdf->get_estimated_cell_size(); + String text = vformat(String::utf8("%d × %d × %d"), size.x, size.y, size.z); + int data_size = 2; + + const double size_mb = size.x * size.y * size.z * data_size / (1024.0 * 1024.0); + text += " - " + vformat(TTR("VRAM Size: %s MB"), String::num(size_mb, 2)); + + if (bake_info->get_text() == text) { + return; + } + + // Color the label depending on the estimated performance level. + Color color; + if (size_mb <= 16.0 + CMP_EPSILON) { + // Fast. + color = bake_info->get_theme_color("success_color", "Editor"); + } else if (size_mb <= 64.0 + CMP_EPSILON) { + // Medium. + color = bake_info->get_theme_color("warning_color", "Editor"); + } else { + // Slow. + color = bake_info->get_theme_color("error_color", "Editor"); + } + bake_info->add_theme_color_override("font_color", color); + + bake_info->set_text(text); + } +} + +void GPUParticlesCollisionSDFEditorPlugin::make_visible(bool p_visible) { + if (p_visible) { + bake_hb->show(); + set_process(true); + } else { + bake_hb->hide(); + set_process(false); + } +} + +EditorProgress *GPUParticlesCollisionSDFEditorPlugin::tmp_progress = nullptr; + +void GPUParticlesCollisionSDFEditorPlugin::bake_func_begin(int p_steps) { + ERR_FAIL_COND(tmp_progress != nullptr); + + tmp_progress = memnew(EditorProgress("bake_sdf", TTR("Bake SDF"), p_steps)); +} + +void GPUParticlesCollisionSDFEditorPlugin::bake_func_step(int p_step, const String &p_description) { + ERR_FAIL_COND(tmp_progress == nullptr); + tmp_progress->step(p_description, p_step, false); +} + +void GPUParticlesCollisionSDFEditorPlugin::bake_func_end() { + ERR_FAIL_COND(tmp_progress == nullptr); + memdelete(tmp_progress); + tmp_progress = nullptr; +} + +void GPUParticlesCollisionSDFEditorPlugin::_sdf_save_path_and_bake(const String &p_path) { + probe_file->hide(); + if (col_sdf) { + Ref<Image> bake_img = col_sdf->bake(); + if (bake_img.is_null()) { + EditorNode::get_singleton()->show_warning("Bake Error."); + return; + } + + Ref<ConfigFile> config; + + config.instance(); + if (FileAccess::exists(p_path + ".import")) { + config->load(p_path + ".import"); + } + + config->set_value("remap", "importer", "3d_texture"); + config->set_value("remap", "type", "StreamTexture3D"); + if (!config->has_section_key("params", "compress/mode")) { + config->set_value("params", "compress/mode", 3); //user may want another compression, so leave it be + } + config->set_value("params", "compress/channel_pack", 1); + config->set_value("params", "mipmaps/generate", false); + config->set_value("params", "slices/horizontal", 1); + config->set_value("params", "slices/vertical", bake_img->get_meta("depth")); + + config->save(p_path + ".import"); + + Error err = bake_img->save_exr(p_path, false); + ERR_FAIL_COND(err); + ResourceLoader::import(p_path); + Ref<Texture> t = ResourceLoader::load(p_path); //if already loaded, it will be updated on refocus? + ERR_FAIL_COND(t.is_null()); + + col_sdf->set_texture(t); + } +} + +void GPUParticlesCollisionSDFEditorPlugin::_bind_methods() { +} + +GPUParticlesCollisionSDFEditorPlugin::GPUParticlesCollisionSDFEditorPlugin(EditorNode *p_node) { + editor = p_node; + bake_hb = memnew(HBoxContainer); + bake_hb->set_h_size_flags(Control::SIZE_EXPAND_FILL); + bake_hb->hide(); + bake = memnew(Button); + bake->set_flat(true); + bake->set_icon(editor->get_gui_base()->get_theme_icon("Bake", "EditorIcons")); + bake->set_text(TTR("Bake SDF")); + bake->connect("pressed", callable_mp(this, &GPUParticlesCollisionSDFEditorPlugin::_bake)); + bake_hb->add_child(bake); + bake_info = memnew(Label); + bake_info->set_h_size_flags(Control::SIZE_EXPAND_FILL); + bake_info->set_clip_text(true); + bake_hb->add_child(bake_info); + + add_control_to_container(CONTAINER_SPATIAL_EDITOR_MENU, bake_hb); + col_sdf = nullptr; + probe_file = memnew(EditorFileDialog); + probe_file->set_file_mode(EditorFileDialog::FILE_MODE_SAVE_FILE); + probe_file->add_filter("*.exr"); + probe_file->connect("file_selected", callable_mp(this, &GPUParticlesCollisionSDFEditorPlugin::_sdf_save_path_and_bake)); + get_editor_interface()->get_base_control()->add_child(probe_file); + probe_file->set_title(TTR("Select path for SDF Texture")); + + GPUParticlesCollisionSDF::bake_begin_function = bake_func_begin; + GPUParticlesCollisionSDF::bake_step_function = bake_func_step; + GPUParticlesCollisionSDF::bake_end_function = bake_func_end; +} + +GPUParticlesCollisionSDFEditorPlugin::~GPUParticlesCollisionSDFEditorPlugin() { +} diff --git a/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h new file mode 100644 index 0000000000..0cdc70a62b --- /dev/null +++ b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h @@ -0,0 +1,74 @@ +/*************************************************************************/ +/* gpu_particles_collision_sdf_editor_plugin.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H +#define GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H + +#include "editor/editor_node.h" +#include "editor/editor_plugin.h" +#include "scene/3d/gpu_particles_collision_3d.h" +#include "scene/resources/material.h" + +class GPUParticlesCollisionSDFEditorPlugin : public EditorPlugin { + GDCLASS(GPUParticlesCollisionSDFEditorPlugin, EditorPlugin); + + GPUParticlesCollisionSDF *col_sdf; + + HBoxContainer *bake_hb; + Label *bake_info; + Button *bake; + EditorNode *editor; + + EditorFileDialog *probe_file; + + static EditorProgress *tmp_progress; + static void bake_func_begin(int p_steps); + static void bake_func_step(int p_step, const String &p_description); + static void bake_func_end(); + + void _bake(); + void _sdf_save_path_and_bake(const String &p_path); + +protected: + static void _bind_methods(); + void _notification(int p_what); + +public: + virtual String get_name() const override { return "GPUParticlesCollisionSDF"; } + bool has_main_screen() const override { return false; } + virtual void edit(Object *p_object) override; + virtual bool handles(Object *p_object) const override; + virtual void make_visible(bool p_visible) override; + + GPUParticlesCollisionSDFEditorPlugin(EditorNode *p_node); + ~GPUParticlesCollisionSDFEditorPlugin(); +}; + +#endif // GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H diff --git a/editor/plugins/node_3d_editor_plugin.cpp b/editor/plugins/node_3d_editor_plugin.cpp index b2fd855834..a4eab6ab4a 100644 --- a/editor/plugins/node_3d_editor_plugin.cpp +++ b/editor/plugins/node_3d_editor_plugin.cpp @@ -2405,18 +2405,18 @@ void Node3DEditorViewport::_notification(int p_what) { } Transform t = sp->get_global_gizmo_transform(); + VisualInstance3D *vi = Object::cast_to<VisualInstance3D>(sp); + AABB new_aabb = vi ? vi->get_aabb() : _calculate_spatial_bounds(sp); exist = true; - if (se->last_xform == t && !se->last_xform_dirty) { + if (se->last_xform == t && se->aabb == new_aabb && !se->last_xform_dirty) { continue; } changed = true; se->last_xform_dirty = false; se->last_xform = t; - VisualInstance3D *vi = Object::cast_to<VisualInstance3D>(sp); - - se->aabb = vi ? vi->get_aabb() : _calculate_spatial_bounds(sp); + se->aabb = new_aabb; t.translate(se->aabb.position); @@ -2464,12 +2464,14 @@ void Node3DEditorViewport::_notification(int p_what) { subviewport_container->set_stretch_shrink(shrink ? 2 : 1); } - //update msaa if changed + // Update MSAA, screen-space AA and debanding if changed - int msaa_mode = ProjectSettings::get_singleton()->get("rendering/quality/screen_filters/msaa"); + const int msaa_mode = ProjectSettings::get_singleton()->get("rendering/quality/screen_filters/msaa"); viewport->set_msaa(Viewport::MSAA(msaa_mode)); - int ssaa_mode = GLOBAL_GET("rendering/quality/screen_filters/screen_space_aa"); + const int ssaa_mode = GLOBAL_GET("rendering/quality/screen_filters/screen_space_aa"); viewport->set_screen_space_aa(Viewport::ScreenSpaceAA(ssaa_mode)); + const bool use_debanding = GLOBAL_GET("rendering/quality/screen_filters/use_debanding"); + viewport->set_use_debanding(use_debanding); bool show_info = view_menu->get_popup()->is_item_checked(view_menu->get_popup()->get_item_index(VIEW_INFORMATION)); if (show_info != info_label->is_visible()) { @@ -6092,6 +6094,7 @@ void Node3DEditor::_register_all_gizmos() { add_gizmo_plugin(Ref<VehicleWheel3DGizmoPlugin>(memnew(VehicleWheel3DGizmoPlugin))); add_gizmo_plugin(Ref<VisibilityNotifier3DGizmoPlugin>(memnew(VisibilityNotifier3DGizmoPlugin))); add_gizmo_plugin(Ref<GPUParticles3DGizmoPlugin>(memnew(GPUParticles3DGizmoPlugin))); + add_gizmo_plugin(Ref<GPUParticlesCollision3DGizmoPlugin>(memnew(GPUParticlesCollision3DGizmoPlugin))); add_gizmo_plugin(Ref<CPUParticles3DGizmoPlugin>(memnew(CPUParticles3DGizmoPlugin))); add_gizmo_plugin(Ref<ReflectionProbeGizmoPlugin>(memnew(ReflectionProbeGizmoPlugin))); add_gizmo_plugin(Ref<DecalGizmoPlugin>(memnew(DecalGizmoPlugin))); diff --git a/editor/plugins/node_3d_editor_plugin.h b/editor/plugins/node_3d_editor_plugin.h index 4f627b1d0c..e4a384449b 100644 --- a/editor/plugins/node_3d_editor_plugin.h +++ b/editor/plugins/node_3d_editor_plugin.h @@ -28,8 +28,8 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef SPATIAL_EDITOR_PLUGIN_H -#define SPATIAL_EDITOR_PLUGIN_H +#ifndef NODE_3D_EDITOR_PLUGIN_H +#define NODE_3D_EDITOR_PLUGIN_H #include "editor/editor_node.h" #include "editor/editor_plugin.h" @@ -890,4 +890,4 @@ public: virtual ~EditorNode3DGizmoPlugin(); }; -#endif +#endif // NODE_3D_EDITOR_PLUGIN_H diff --git a/editor/plugins/polygon_2d_editor_plugin.cpp b/editor/plugins/polygon_2d_editor_plugin.cpp index dd1194d020..ac90ee9570 100644 --- a/editor/plugins/polygon_2d_editor_plugin.cpp +++ b/editor/plugins/polygon_2d_editor_plugin.cpp @@ -79,8 +79,8 @@ void Polygon2DEditor::_notification(int p_what) { uv_button[UV_MODE_SCALE]->set_icon(get_theme_icon("ToolScale", "EditorIcons")); uv_button[UV_MODE_ADD_POLYGON]->set_icon(get_theme_icon("Edit", "EditorIcons")); uv_button[UV_MODE_REMOVE_POLYGON]->set_icon(get_theme_icon("Close", "EditorIcons")); - uv_button[UV_MODE_PAINT_WEIGHT]->set_icon(get_theme_icon("PaintVertex", "EditorIcons")); - uv_button[UV_MODE_CLEAR_WEIGHT]->set_icon(get_theme_icon("UnpaintVertex", "EditorIcons")); + uv_button[UV_MODE_PAINT_WEIGHT]->set_icon(get_theme_icon("Bucket", "EditorIcons")); + uv_button[UV_MODE_CLEAR_WEIGHT]->set_icon(get_theme_icon("Clear", "EditorIcons")); b_snap_grid->set_icon(get_theme_icon("Grid", "EditorIcons")); b_snap_enable->set_icon(get_theme_icon("SnapGrid", "EditorIcons")); @@ -1325,11 +1325,16 @@ Polygon2DEditor::Polygon2DEditor(EditorNode *p_editor) : uv_main_hsc->add_child(uv_edit_draw); uv_edit_draw->set_h_size_flags(SIZE_EXPAND_FILL); uv_edit_draw->set_custom_minimum_size(Size2(200, 200) * EDSCALE); + + Control *space = memnew(Control); + uv_mode_hb->add_child(space); + space->set_h_size_flags(SIZE_EXPAND_FILL); + uv_menu = memnew(MenuButton); uv_mode_hb->add_child(uv_menu); uv_menu->set_text(TTR("Edit")); - uv_menu->get_popup()->add_item(TTR("Polygon->UV"), UVEDIT_POLYGON_TO_UV); - uv_menu->get_popup()->add_item(TTR("UV->Polygon"), UVEDIT_UV_TO_POLYGON); + uv_menu->get_popup()->add_item(TTR("Copy Polygon to UV"), UVEDIT_POLYGON_TO_UV); + uv_menu->get_popup()->add_item(TTR("Copy UV to Polygon"), UVEDIT_UV_TO_POLYGON); uv_menu->get_popup()->add_separator(); uv_menu->get_popup()->add_item(TTR("Clear UV"), UVEDIT_UV_CLEAR); uv_menu->get_popup()->add_separator(); diff --git a/editor/plugins/tile_map_editor_plugin.cpp b/editor/plugins/tile_map_editor_plugin.cpp index 8cd8aaf277..cb3c0c8be0 100644 --- a/editor/plugins/tile_map_editor_plugin.cpp +++ b/editor/plugins/tile_map_editor_plugin.cpp @@ -65,7 +65,7 @@ void TileMapEditor::_notification(int p_what) { paint_button->set_icon(get_theme_icon("Edit", "EditorIcons")); line_button->set_icon(get_theme_icon("CurveLinear", "EditorIcons")); - rectangle_button->set_icon(get_theme_icon("RectangleShape2D", "EditorIcons")); + rectangle_button->set_icon(get_theme_icon("Rectangle", "EditorIcons")); bucket_fill_button->set_icon(get_theme_icon("Bucket", "EditorIcons")); picker_button->set_icon(get_theme_icon("ColorPick", "EditorIcons")); select_button->set_icon(get_theme_icon("ActionCopy", "EditorIcons")); @@ -89,6 +89,25 @@ void TileMapEditor::_notification(int p_what) { case NOTIFICATION_EXIT_TREE: { get_tree()->disconnect("node_removed", callable_mp(this, &TileMapEditor::_node_removed)); } break; + + case NOTIFICATION_APPLICATION_FOCUS_OUT: { + if (tool == TOOL_PAINTING) { + Vector<int> ids = get_selected_tiles(); + + if (ids.size() > 0 && ids[0] != TileMap::INVALID_CELL) { + _set_cell(over_tile, ids, flip_h, flip_v, transpose); + _finish_undo(); + + paint_undo.clear(); + } + + tool = TOOL_NONE; + _update_button_tool(); + } + + // set flag to ignore over_tile on refocus + refocus_over_tile = true; + } break; } } @@ -1299,6 +1318,12 @@ bool TileMapEditor::forward_gui_input(const Ref<InputEvent> &p_event) { CanvasItemEditor::get_singleton()->update_viewport(); } + if (refocus_over_tile) { + // editor lost focus; forget last tile position + old_over_tile = new_over_tile; + refocus_over_tile = false; + } + int tile_under = node->get_cell(over_tile.x, over_tile.y); String tile_name = "none"; diff --git a/editor/plugins/tile_map_editor_plugin.h b/editor/plugins/tile_map_editor_plugin.h index 996e904853..f57616db1f 100644 --- a/editor/plugins/tile_map_editor_plugin.h +++ b/editor/plugins/tile_map_editor_plugin.h @@ -119,6 +119,7 @@ class TileMapEditor : public VBoxContainer { Rect2i rectangle; Point2i over_tile; + bool refocus_over_tile = false; bool *bucket_cache_visited; Rect2i bucket_cache_rect; diff --git a/editor/plugins/tile_set_editor_plugin.cpp b/editor/plugins/tile_set_editor_plugin.cpp index 684d8f0f10..9c589267fc 100644 --- a/editor/plugins/tile_set_editor_plugin.cpp +++ b/editor/plugins/tile_set_editor_plugin.cpp @@ -60,7 +60,6 @@ void TileSetEditor::_import_node(Node *p_node, Ref<TileSet> p_library) { Sprite2D *mi = Object::cast_to<Sprite2D>(child); Ref<Texture2D> texture = mi->get_texture(); - Ref<Texture2D> normal_map = mi->get_normal_map(); Ref<ShaderMaterial> material = mi->get_material(); if (texture.is_null()) { @@ -75,7 +74,6 @@ void TileSetEditor::_import_node(Node *p_node, Ref<TileSet> p_library) { } p_library->tile_set_texture(id, texture); - p_library->tile_set_normal_map(id, normal_map); p_library->tile_set_material(id, material); p_library->tile_set_modulate(id, mi->get_modulate()); @@ -2368,7 +2366,6 @@ void TileSetEditor::_select_edited_shape_coord() { void TileSetEditor::_undo_tile_removal(int p_id) { undo_redo->add_undo_method(tileset.ptr(), "create_tile", p_id); undo_redo->add_undo_method(tileset.ptr(), "tile_set_name", p_id, tileset->tile_get_name(p_id)); - undo_redo->add_undo_method(tileset.ptr(), "tile_set_normal_map", p_id, tileset->tile_get_normal_map(p_id)); undo_redo->add_undo_method(tileset.ptr(), "tile_set_texture_offset", p_id, tileset->tile_get_texture_offset(p_id)); undo_redo->add_undo_method(tileset.ptr(), "tile_set_material", p_id, tileset->tile_get_material(p_id)); undo_redo->add_undo_method(tileset.ptr(), "tile_set_modulate", p_id, tileset->tile_get_modulate(p_id)); @@ -3541,7 +3538,6 @@ void TilesetEditorContext::_get_property_list(List<PropertyInfo> *p_list) const int id = tileset_editor->get_current_tile(); p_list->push_back(PropertyInfo(Variant::NIL, "Selected Tile", PROPERTY_HINT_NONE, "tile_", PROPERTY_USAGE_GROUP)); p_list->push_back(PropertyInfo(Variant::STRING, "tile_name")); - p_list->push_back(PropertyInfo(Variant::OBJECT, "tile_normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D")); p_list->push_back(PropertyInfo(Variant::VECTOR2, "tile_tex_offset")); p_list->push_back(PropertyInfo(Variant::OBJECT, "tile_material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial")); p_list->push_back(PropertyInfo(Variant::COLOR, "tile_modulate")); diff --git a/editor/plugins/visual_shader_editor_plugin.cpp b/editor/plugins/visual_shader_editor_plugin.cpp index 1651de4048..ddcba18a78 100644 --- a/editor/plugins/visual_shader_editor_plugin.cpp +++ b/editor/plugins/visual_shader_editor_plugin.cpp @@ -107,6 +107,8 @@ void VisualShaderGraphPlugin::_bind_methods() { ClassDB::bind_method("update_node_deferred", &VisualShaderGraphPlugin::update_node_deferred); ClassDB::bind_method("set_input_port_default_value", &VisualShaderGraphPlugin::set_input_port_default_value); ClassDB::bind_method("set_uniform_name", &VisualShaderGraphPlugin::set_uniform_name); + ClassDB::bind_method("set_expression", &VisualShaderGraphPlugin::set_expression); + ClassDB::bind_method("update_curve", &VisualShaderGraphPlugin::update_curve); ClassDB::bind_method("update_constant", &VisualShaderGraphPlugin::update_constant); } @@ -205,6 +207,14 @@ void VisualShaderGraphPlugin::set_uniform_name(VisualShader::Type p_type, int p_ } } +void VisualShaderGraphPlugin::update_curve(int p_node_id) { + if (links.has(p_node_id) && links[p_node_id].curve_editor) { + if (((VisualShaderNodeCurveTexture *)links[p_node_id].visual_node)->get_texture().is_valid()) { + links[p_node_id].curve_editor->set_curve(((VisualShaderNodeCurveTexture *)links[p_node_id].visual_node)->get_texture()->get_curve()); + } + } +} + int VisualShaderGraphPlugin::get_constant_index(float p_constant) const { for (int i = 0; i < MAX_FLOAT_CONST_DEFS; i++) { if (Math::is_equal_approx(p_constant, float_constant_defs[i].value)) { @@ -226,6 +236,13 @@ void VisualShaderGraphPlugin::update_constant(VisualShader::Type p_type, int p_n links[p_node_id].graph_node->set_size(Size2(-1, -1)); } +void VisualShaderGraphPlugin::set_expression(VisualShader::Type p_type, int p_node_id, const String &p_expression) { + if (p_type != visual_shader->get_shader_type() || !links.has(p_node_id) || !links[p_node_id].expression_edit) { + return; + } + links[p_node_id].expression_edit->set_text(p_expression); +} + void VisualShaderGraphPlugin::update_node_size(int p_node_id) { if (!links.has(p_node_id)) { return; @@ -241,6 +258,14 @@ void VisualShaderGraphPlugin::register_constant_option_btn(int p_node_id, Option links[p_node_id].const_op = p_button; } +void VisualShaderGraphPlugin::register_expression_edit(int p_node_id, CodeEdit *p_expression_edit) { + links[p_node_id].expression_edit = p_expression_edit; +} + +void VisualShaderGraphPlugin::register_curve_editor(int p_node_id, CurveEditor *p_curve_editor) { + links[p_node_id].curve_editor = p_curve_editor; +} + void VisualShaderGraphPlugin::update_uniform_refs() { for (Map<int, Link>::Element *E = links.front(); E; E = E->next()) { VisualShaderNodeUniformRef *ref = Object::cast_to<VisualShaderNodeUniformRef>(E->get().visual_node); @@ -284,7 +309,7 @@ void VisualShaderGraphPlugin::make_dirty(bool p_enabled) { } void VisualShaderGraphPlugin::register_link(VisualShader::Type p_type, int p_id, VisualShaderNode *p_visual_node, GraphNode *p_graph_node) { - links.insert(p_id, { p_type, p_visual_node, p_graph_node, p_visual_node->get_output_port_for_preview() != -1, -1, Map<int, InputPort>(), Map<int, Port>(), nullptr, nullptr, nullptr }); + links.insert(p_id, { p_type, p_visual_node, p_graph_node, p_visual_node->get_output_port_for_preview() != -1, -1, Map<int, InputPort>(), Map<int, Port>(), nullptr, nullptr, nullptr, nullptr, nullptr }); } void VisualShaderGraphPlugin::register_output_port(int p_node_id, int p_port, TextureButton *p_button) { @@ -315,9 +340,12 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { Ref<VisualShaderNode> vsnode = visual_shader->get_node(p_type, p_id); + Ref<VisualShaderNodeResizableBase> resizable_node = Object::cast_to<VisualShaderNodeResizableBase>(vsnode.ptr()); + bool is_resizable = !resizable_node.is_null(); + Size2 size = Size2(0, 0); + Ref<VisualShaderNodeGroupBase> group_node = Object::cast_to<VisualShaderNodeGroupBase>(vsnode.ptr()); bool is_group = !group_node.is_null(); - Size2 size = Size2(0, 0); Ref<VisualShaderNodeExpression> expression_node = Object::cast_to<VisualShaderNodeExpression>(group_node.ptr()); bool is_expression = !expression_node.is_null(); @@ -326,8 +354,8 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { GraphNode *node = memnew(GraphNode); register_link(p_type, p_id, vsnode.ptr(), node); - if (is_group) { - size = group_node->get_size(); + if (is_resizable) { + size = resizable_node->get_size(); node->set_resizable(true); node->connect("resize_request", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_node_resized), varray((int)p_type, p_id)); @@ -342,7 +370,7 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { if (p_id >= 2) { node->set_show_close_button(true); - node->connect("close_request", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_delete_request), varray(p_id), CONNECT_DEFERRED); + node->connect("close_request", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_delete_node_request), varray(p_type, p_id), CONNECT_DEFERRED); } node->connect("dragged", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_node_dragged), varray(p_id)); @@ -391,6 +419,18 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { } } + Ref<VisualShaderNodeCurveTexture> curve = vsnode; + if (curve.is_valid()) { + if (curve->get_texture().is_valid() && !curve->get_texture()->is_connected("changed", callable_mp(VisualShaderEditor::get_singleton()->get_graph_plugin(), &VisualShaderGraphPlugin::update_curve))) { + curve->get_texture()->connect("changed", callable_mp(VisualShaderEditor::get_singleton()->get_graph_plugin(), &VisualShaderGraphPlugin::update_curve), varray(p_id)); + } + + HBoxContainer *hbox = memnew(HBoxContainer); + custom_editor->set_h_size_flags(Control::SIZE_EXPAND_FILL); + hbox->add_child(custom_editor); + custom_editor = hbox; + } + Ref<VisualShaderNodeFloatConstant> float_const = vsnode; if (float_const.is_valid()) { HBoxContainer *hbox = memnew(HBoxContainer); @@ -413,6 +453,37 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { } else if (custom_editor) { port_offset++; node->add_child(custom_editor); + + if (curve.is_valid()) { + VisualShaderEditor::get_singleton()->graph->add_child(node); + VisualShaderEditor::get_singleton()->_update_created_node(node); + + CurveEditor *curve_editor = memnew(CurveEditor); + node->add_child(curve_editor); + register_curve_editor(p_id, curve_editor); + curve_editor->set_custom_minimum_size(Size2(300, 0)); + curve_editor->set_h_size_flags(Control::SIZE_EXPAND_FILL); + if (curve->get_texture().is_valid()) { + curve_editor->set_curve(curve->get_texture()->get_curve()); + } + + TextureButton *preview = memnew(TextureButton); + preview->set_toggle_mode(true); + preview->set_normal_texture(VisualShaderEditor::get_singleton()->get_theme_icon("GuiVisibilityHidden", "EditorIcons")); + preview->set_pressed_texture(VisualShaderEditor::get_singleton()->get_theme_icon("GuiVisibilityVisible", "EditorIcons")); + preview->set_v_size_flags(Control::SIZE_SHRINK_CENTER); + + register_output_port(p_id, 0, preview); + + preview->connect("pressed", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_preview_select_port), varray(p_id, 0), CONNECT_DEFERRED); + custom_editor->add_child(preview); + + VisualShaderNode::PortType port_left = vsnode->get_input_port_type(0); + VisualShaderNode::PortType port_right = vsnode->get_output_port_type(0); + node->set_slot(0, true, port_left, type_color[port_left], true, port_right, type_color[port_right]); + + VisualShaderEditor::get_singleton()->call_deferred("_set_node_size", (int)p_type, p_id, size); + } if (vsnode->is_use_prop_slots()) { return; } @@ -623,6 +694,7 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { expression_syntax_highlighter.instance(); expression_node->set_control(expression_box, 0); node->add_child(expression_box); + register_expression_edit(p_id, expression_box); Color background_color = EDITOR_GET("text_editor/highlighting/background_color"); Color text_color = EDITOR_GET("text_editor/highlighting/text_color"); @@ -659,7 +731,7 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) { if (!uniform.is_valid()) { VisualShaderEditor::get_singleton()->graph->add_child(node); VisualShaderEditor::get_singleton()->_update_created_node(node); - if (is_group) { + if (is_resizable) { VisualShaderEditor::get_singleton()->call_deferred("_set_node_size", (int)p_type, p_id, size); } } @@ -1210,7 +1282,7 @@ void VisualShaderEditor::_add_input_port(int p_node, int p_port, int p_port_type return; } - undo_redo->create_action(TTR("Add input port")); + undo_redo->create_action(TTR("Add Input Port")); undo_redo->add_do_method(node.ptr(), "add_input_port", p_port, p_port_type, p_name); undo_redo->add_undo_method(node.ptr(), "remove_input_port", p_port); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node); @@ -1225,7 +1297,7 @@ void VisualShaderEditor::_add_output_port(int p_node, int p_port, int p_port_typ return; } - undo_redo->create_action(TTR("Add output port")); + undo_redo->create_action(TTR("Add Output Port")); undo_redo->add_do_method(node.ptr(), "add_output_port", p_port, p_port_type, p_name); undo_redo->add_undo_method(node.ptr(), "remove_output_port", p_port); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node); @@ -1240,7 +1312,7 @@ void VisualShaderEditor::_change_input_port_type(int p_type, int p_node, int p_p return; } - undo_redo->create_action(TTR("Change input port type")); + undo_redo->create_action(TTR("Change Input Port Type")); undo_redo->add_do_method(node.ptr(), "set_input_port_type", p_port, p_type); undo_redo->add_undo_method(node.ptr(), "set_input_port_type", p_port, node->get_input_port_type(p_port)); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node); @@ -1255,7 +1327,7 @@ void VisualShaderEditor::_change_output_port_type(int p_type, int p_node, int p_ return; } - undo_redo->create_action(TTR("Change output port type")); + undo_redo->create_action(TTR("Change Output Port Type")); undo_redo->add_do_method(node.ptr(), "set_output_port_type", p_port, p_type); undo_redo->add_undo_method(node.ptr(), "set_output_port_type", p_port, node->get_output_port_type(p_port)); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node); @@ -1269,7 +1341,7 @@ void VisualShaderEditor::_change_input_port_name(const String &p_text, Object *l Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node_id); ERR_FAIL_COND(!node.is_valid()); - undo_redo->create_action(TTR("Change input port name")); + undo_redo->create_action(TTR("Change Input Port Name")); undo_redo->add_do_method(node.ptr(), "set_input_port_name", p_port_id, p_text); undo_redo->add_undo_method(node.ptr(), "set_input_port_name", p_port_id, node->get_input_port_name(p_port_id)); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node_id); @@ -1283,7 +1355,7 @@ void VisualShaderEditor::_change_output_port_name(const String &p_text, Object * Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node_id); ERR_FAIL_COND(!node.is_valid()); - undo_redo->create_action(TTR("Change output port name")); + undo_redo->create_action(TTR("Change Output Port Name")); undo_redo->add_do_method(node.ptr(), "set_output_port_name", p_port_id, p_text); undo_redo->add_undo_method(node.ptr(), "set_output_port_name", p_port_id, node->get_output_port_name(p_port_id)); undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node_id); @@ -1298,7 +1370,7 @@ void VisualShaderEditor::_remove_input_port(int p_node, int p_port) { return; } - undo_redo->create_action(TTR("Remove input port")); + undo_redo->create_action(TTR("Remove Input Port")); List<VisualShader::Connection> conns; visual_shader->get_node_connections(type, &conns); @@ -1347,7 +1419,7 @@ void VisualShaderEditor::_remove_output_port(int p_node, int p_port) { return; } - undo_redo->create_action(TTR("Remove output port")); + undo_redo->create_action(TTR("Remove Output Port")); List<VisualShader::Connection> conns; visual_shader->get_node_connections(type, &conns); @@ -1402,31 +1474,39 @@ void VisualShaderEditor::_expression_focus_out(Object *code_edit, int p_node) { return; } - undo_redo->create_action(TTR("Set expression")); + undo_redo->create_action(TTR("Set VisualShader Expression")); undo_redo->add_do_method(node.ptr(), "set_expression", expression_box->get_text()); undo_redo->add_undo_method(node.ptr(), "set_expression", node->get_expression()); + undo_redo->add_do_method(graph_plugin.ptr(), "set_expression", type, p_node, expression_box->get_text()); + undo_redo->add_undo_method(graph_plugin.ptr(), "set_expression", type, p_node, node->get_expression()); undo_redo->commit_action(); } void VisualShaderEditor::_set_node_size(int p_type, int p_node, const Vector2 &p_size) { - VisualShader::Type type = get_current_shader_type(); - Ref<VisualShaderNode> node = visual_shader->get_node(type, p_node); + VisualShader::Type type = VisualShader::Type(p_type); + Ref<VisualShaderNodeResizableBase> node = visual_shader->get_node(type, p_node); if (node.is_null()) { return; } - Ref<VisualShaderNodeGroupBase> group_node = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr()); - - if (group_node.is_null()) { - return; + Size2 size = p_size; + if (!node->is_allow_v_resize()) { + size.y = 0; } - Vector2 size = p_size; + node->set_size(size); - group_node->set_size(size); + if (get_current_shader_type() == type) { + Ref<VisualShaderNodeExpression> expression_node = Object::cast_to<VisualShaderNodeExpression>(node.ptr()); + Control *text_box = nullptr; + if (!expression_node.is_null()) { + text_box = expression_node->get_control(0); + if (text_box) { + text_box->set_custom_minimum_size(Size2(0, 0)); + } + } - GraphNode *gn = nullptr; - if (edit_type->get_selected() == p_type) { // check - otherwise the error will be emitted + GraphNode *gn = nullptr; Node *node2 = graph->get_node(itos(p_node)); gn = Object::cast_to<GraphNode>(node2); if (!gn) { @@ -1435,34 +1515,31 @@ void VisualShaderEditor::_set_node_size(int p_type, int p_node, const Vector2 &p gn->set_custom_minimum_size(size); gn->set_size(Size2(1, 1)); - } - Ref<VisualShaderNodeExpression> expression_node = Object::cast_to<VisualShaderNodeExpression>(node.ptr()); - if (!expression_node.is_null()) { - Control *text_box = expression_node->get_control(0); - Size2 box_size = size; - if (gn != nullptr) { - if (box_size.x < 150 * EDSCALE || box_size.y < 0) { - box_size.x = gn->get_size().x; + if (!expression_node.is_null() && text_box) { + Size2 box_size = size; + if (gn != nullptr) { + if (box_size.x < 150 * EDSCALE || box_size.y < 0) { + box_size.x = gn->get_size().x; + } } + box_size.x -= text_box->get_margin(MARGIN_LEFT); + box_size.x -= 28 * EDSCALE; + box_size.y -= text_box->get_margin(MARGIN_TOP); + box_size.y -= 28 * EDSCALE; + text_box->set_custom_minimum_size(Size2(box_size.x, box_size.y)); + text_box->set_size(Size2(1, 1)); } - box_size.x -= text_box->get_margin(MARGIN_LEFT); - box_size.x -= 28 * EDSCALE; - box_size.y -= text_box->get_margin(MARGIN_TOP); - box_size.y -= 28 * EDSCALE; - text_box->set_custom_minimum_size(Size2(box_size.x, box_size.y)); - text_box->set_size(Size2(1, 1)); } } void VisualShaderEditor::_node_resized(const Vector2 &p_new_size, int p_type, int p_node) { - VisualShader::Type type = get_current_shader_type(); - Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node); + Ref<VisualShaderNodeResizableBase> node = visual_shader->get_node(VisualShader::Type(p_type), p_node); if (node.is_null()) { return; } - undo_redo->create_action(TTR("Resize VisualShader node"), UndoRedo::MERGE_ENDS); + undo_redo->create_action(TTR("Resize VisualShader Node"), UndoRedo::MERGE_ENDS); undo_redo->add_do_method(this, "_set_node_size", p_type, p_node, p_new_size); undo_redo->add_undo_method(this, "_set_node_size", p_type, p_node, node->get_size()); undo_redo->commit_action(); @@ -1637,6 +1714,11 @@ void VisualShaderEditor::_add_texture3d_node(const String &p_path) { texture3d->set_texture(ResourceLoader::load(p_path)); } +void VisualShaderEditor::_add_curve_node(const String &p_path) { + VisualShaderNodeCurveTexture *curve = (VisualShaderNodeCurveTexture *)_add_node(curve_node_option_idx, -1); + curve->set_texture(ResourceLoader::load(p_path)); +} + VisualShaderNode *VisualShaderEditor::_add_node(int p_idx, int p_op_idx) { ERR_FAIL_INDEX_V(p_idx, add_options.size(), nullptr); @@ -1815,6 +1897,11 @@ VisualShaderNode *VisualShaderEditor::_add_node(int p_idx, int p_op_idx) { undo_redo->add_undo_method(this, "_update_uniforms", true); } + VisualShaderNodeCurveTexture *curve = Object::cast_to<VisualShaderNodeCurveTexture>(vsnode.ptr()); + if (curve) { + graph_plugin->call_deferred("update_curve", id_to_use); + } + undo_redo->commit_action(); return vsnode.ptr(); } @@ -1903,61 +1990,112 @@ void VisualShaderEditor::_connection_from_empty(const String &p_to, int p_to_slo _show_members_dialog(true); } -void VisualShaderEditor::_delete_request(int which) { - VisualShader::Type type = get_current_shader_type(); - Ref<VisualShaderNode> node = Ref<VisualShaderNode>(visual_shader->get_node(type, which)); - - undo_redo->create_action(TTR("Delete Node")); - +void VisualShaderEditor::_delete_nodes(int p_type, const List<int> &p_nodes) { + VisualShader::Type type = VisualShader::Type(p_type); List<VisualShader::Connection> conns; visual_shader->get_node_connections(type, &conns); - for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { - if (E->get().from_node == which || E->get().to_node == which) { - undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); + + for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) { + for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { + if (E->get().from_node == F->get() || E->get().to_node == F->get()) { + undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); + } } } - undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, which); - undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, which), which); - undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, which); + Set<String> uniform_names; - undo_redo->add_do_method(this, "_clear_buffer"); - undo_redo->add_undo_method(this, "_clear_buffer"); + for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) { + Ref<VisualShaderNode> node = visual_shader->get_node(type, F->get()); - // restore size, inputs and outputs if node is group - VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr()); - if (group) { - undo_redo->add_undo_method(group, "set_size", group->get_size()); - undo_redo->add_undo_method(group, "set_inputs", group->get_inputs()); - undo_redo->add_undo_method(group, "set_outputs", group->get_outputs()); - } + undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, F->get()); + undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, F->get()), F->get()); + undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, F->get()); + + undo_redo->add_do_method(this, "_clear_buffer"); + undo_redo->add_undo_method(this, "_clear_buffer"); + + // restore size, inputs and outputs if node is group + VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr()); + if (group) { + undo_redo->add_undo_method(group, "set_size", group->get_size()); + undo_redo->add_undo_method(group, "set_inputs", group->get_inputs()); + undo_redo->add_undo_method(group, "set_outputs", group->get_outputs()); + } - // restore expression text if node is expression - VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr()); - if (expression) { - undo_redo->add_undo_method(expression, "set_expression", expression->get_expression()); + // restore expression text if node is expression + VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr()); + if (expression) { + undo_redo->add_undo_method(expression, "set_expression", expression->get_expression()); + } + + VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr()); + if (uniform) { + uniform_names.insert(uniform->get_uniform_name()); + } } - for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { - if (E->get().from_node == which || E->get().to_node == which) { - undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); - undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); + List<VisualShader::Connection> used_conns; + for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) { + for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { + if (E->get().from_node == F->get() || E->get().to_node == F->get()) { + bool cancel = false; + for (List<VisualShader::Connection>::Element *R = used_conns.front(); R; R = R->next()) { + if (R->get().from_node == E->get().from_node && R->get().from_port == E->get().from_port && R->get().to_node == E->get().to_node && R->get().to_port == E->get().to_port) { + cancel = true; // to avoid ERR_ALREADY_EXISTS warning + break; + } + } + if (!cancel) { + undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); + undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); + used_conns.push_back(E->get()); + } + } } } - // delete a node from the graph - undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, which); - VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr()); - if (uniform) { + // delete nodes from the graph + for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) { + undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, F->get()); + } + + // update uniform refs if any uniform has been deleted + if (uniform_names.size() > 0) { undo_redo->add_do_method(this, "_update_uniforms", true); undo_redo->add_undo_method(this, "_update_uniforms", true); - Set<String> uniform_names; - uniform_names.insert(uniform->get_uniform_name()); - _update_uniform_refs(uniform_names); } +} + +void VisualShaderEditor::_delete_node_request(int p_type, int p_node) { + List<int> to_erase; + to_erase.push_back(p_node); + + undo_redo->create_action(TTR("Delete VisualShader Node")); + _delete_nodes(p_type, to_erase); + undo_redo->commit_action(); +} + +void VisualShaderEditor::_delete_nodes_request() { + List<int> to_erase; + + for (int i = 0; i < graph->get_child_count(); i++) { + GraphNode *gn = Object::cast_to<GraphNode>(graph->get_child(i)); + if (gn) { + if (gn->is_selected() && gn->is_close_button_visible()) { + to_erase.push_back(gn->get_name().operator String().to_int()); + } + } + } + + if (to_erase.empty()) { + return; + } + undo_redo->create_action(TTR("Delete VisualShader Node(s)")); + _delete_nodes(get_current_shader_type(), to_erase); undo_redo->commit_action(); } @@ -2280,7 +2418,7 @@ void VisualShaderEditor::_clear_buffer() { } void VisualShaderEditor::_duplicate_nodes() { - int type = edit_type->get_selected(); + int type = get_current_shader_type(); List<int> nodes; Set<int> excluded; @@ -2291,13 +2429,13 @@ void VisualShaderEditor::_duplicate_nodes() { return; } - undo_redo->create_action(TTR("Duplicate Nodes")); + undo_redo->create_action(TTR("Duplicate VisualShader Node(s)")); _dup_paste_nodes(type, type, nodes, excluded, Vector2(10, 10) * EDSCALE, true); } void VisualShaderEditor::_copy_nodes() { - copy_type = edit_type->get_selected(); + copy_type = get_current_shader_type(); _clear_buffer(); @@ -2309,9 +2447,7 @@ void VisualShaderEditor::_paste_nodes(bool p_use_custom_position, const Vector2 return; } - int type = edit_type->get_selected(); - - undo_redo->create_action(TTR("Paste Nodes")); + int type = get_current_shader_type(); float scale = graph->get_zoom(); @@ -2322,109 +2458,13 @@ void VisualShaderEditor::_paste_nodes(bool p_use_custom_position, const Vector2 mpos = graph->get_local_mouse_position(); } + undo_redo->create_action(TTR("Paste VisualShader Node(s)")); + _dup_paste_nodes(type, copy_type, copy_nodes_buffer, copy_nodes_excluded_buffer, (graph->get_scroll_ofs() / scale + mpos / scale - selection_center), false); _dup_update_excluded(type, copy_nodes_excluded_buffer); // to prevent selection of previous copies at new paste } -void VisualShaderEditor::_delete_nodes() { - VisualShader::Type type = get_current_shader_type(); - List<int> to_erase; - - for (int i = 0; i < graph->get_child_count(); i++) { - GraphNode *gn = Object::cast_to<GraphNode>(graph->get_child(i)); - if (gn) { - if (gn->is_selected() && gn->is_close_button_visible()) { - to_erase.push_back(gn->get_name().operator String().to_int()); - } - } - } - - if (to_erase.empty()) { - return; - } - - undo_redo->create_action(TTR("Delete Nodes")); - - List<VisualShader::Connection> conns; - visual_shader->get_node_connections(type, &conns); - - for (List<int>::Element *F = to_erase.front(); F; F = F->next()) { - for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { - if (E->get().from_node == F->get() || E->get().to_node == F->get()) { - undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); - } - } - } - - Set<String> uniform_names; - - for (List<int>::Element *F = to_erase.front(); F; F = F->next()) { - Ref<VisualShaderNode> node = visual_shader->get_node(type, F->get()); - - undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, F->get()); - undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, F->get()), F->get()); - undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, F->get()); - - undo_redo->add_do_method(this, "_clear_buffer"); - undo_redo->add_undo_method(this, "_clear_buffer"); - - // restore size, inputs and outputs if node is group - VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr()); - if (group) { - undo_redo->add_undo_method(group, "set_size", group->get_size()); - undo_redo->add_undo_method(group, "set_inputs", group->get_inputs()); - undo_redo->add_undo_method(group, "set_outputs", group->get_outputs()); - } - - // restore expression text if node is expression - VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr()); - if (expression) { - undo_redo->add_undo_method(expression, "set_expression", expression->get_expression()); - } - - VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr()); - if (uniform) { - uniform_names.insert(uniform->get_uniform_name()); - } - } - - List<VisualShader::Connection> used_conns; - for (List<int>::Element *F = to_erase.front(); F; F = F->next()) { - for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) { - if (E->get().from_node == F->get() || E->get().to_node == F->get()) { - bool cancel = false; - for (List<VisualShader::Connection>::Element *R = used_conns.front(); R; R = R->next()) { - if (R->get().from_node == E->get().from_node && R->get().from_port == E->get().from_port && R->get().to_node == E->get().to_node && R->get().to_port == E->get().to_port) { - cancel = true; // to avoid ERR_ALREADY_EXISTS warning - break; - } - } - if (!cancel) { - undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); - undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port); - used_conns.push_back(E->get()); - } - } - } - } - - // delete nodes from the graph - for (List<int>::Element *F = to_erase.front(); F; F = F->next()) { - undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, F->get()); - } - - // update uniform refs if any uniform has been deleted - if (uniform_names.size() > 0) { - undo_redo->add_do_method(this, "_update_uniforms", true); - undo_redo->add_undo_method(this, "_update_uniforms", true); - - _update_uniform_refs(uniform_names); - } - - undo_redo->commit_action(); -} - void VisualShaderEditor::_mode_selected(int p_id) { visual_shader->set_shader_type(particles_mode ? VisualShader::Type(p_id + 3) : VisualShader::Type(p_id)); _update_options_menu(); @@ -2630,7 +2670,7 @@ void VisualShaderEditor::_node_menu_id_pressed(int p_idx) { _paste_nodes(true, menu_point); break; case NodeMenuOptions::DELETE: - _delete_nodes(); + _delete_nodes_request(); break; case NodeMenuOptions::DUPLICATE: _duplicate_nodes(); @@ -2705,6 +2745,11 @@ void VisualShaderEditor::drop_data_fw(const Point2 &p_point, const Variant &p_da _add_custom_node(arr[i]); j++; } + } else if (type == "CurveTexture") { + saved_node_pos = p_point + Vector2(0, j * 210 * EDSCALE); + saved_node_pos_dirty = true; + _add_curve_node(arr[i]); + j++; } else if (ClassDB::get_parent_class(type) == "Texture2D") { saved_node_pos = p_point + Vector2(0, j * 210 * EDSCALE); saved_node_pos_dirty = true; @@ -2842,8 +2887,8 @@ VisualShaderEditor::VisualShaderEditor() { graph->connect("scroll_offset_changed", callable_mp(this, &VisualShaderEditor::_scroll_changed)); graph->connect("duplicate_nodes_request", callable_mp(this, &VisualShaderEditor::_duplicate_nodes)); graph->connect("copy_nodes_request", callable_mp(this, &VisualShaderEditor::_copy_nodes)); - graph->connect("paste_nodes_request", callable_mp(this, &VisualShaderEditor::_paste_nodes)); - graph->connect("delete_nodes_request", callable_mp(this, &VisualShaderEditor::_delete_nodes)); + graph->connect("paste_nodes_request", callable_mp(this, &VisualShaderEditor::_paste_nodes), varray(false, Point2())); + graph->connect("delete_nodes_request", callable_mp(this, &VisualShaderEditor::_delete_nodes_request)); graph->connect("gui_input", callable_mp(this, &VisualShaderEditor::_graph_gui_input)); graph->connect("connection_to_empty", callable_mp(this, &VisualShaderEditor::_connection_to_empty)); graph->connect("connection_from_empty", callable_mp(this, &VisualShaderEditor::_connection_from_empty)); @@ -3127,6 +3172,7 @@ VisualShaderEditor::VisualShaderEditor() { add_options.push_back(AddOption("FragCoord", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_fragment_and_light_shader_modes, "fragcoord"), "fragcoord", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); add_options.push_back(AddOption("Light", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "light"), "light", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); add_options.push_back(AddOption("LightColor", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "light_color"), "light_color", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); + add_options.push_back(AddOption("Metallic", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "metallic"), "metallic", VisualShaderNode::PORT_TYPE_SCALAR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); add_options.push_back(AddOption("Roughness", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "roughness"), "roughness", VisualShaderNode::PORT_TYPE_SCALAR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); add_options.push_back(AddOption("Specular", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "specular"), "specular", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); add_options.push_back(AddOption("Transmission", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "transmission"), "transmission", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL)); @@ -3329,6 +3375,8 @@ VisualShaderEditor::VisualShaderEditor() { // TEXTURES cubemap_node_option_idx = add_options.size(); add_options.push_back(AddOption("CubeMap", "Textures", "Functions", "VisualShaderNodeCubemap", TTR("Perform the cubic texture lookup."), -1, -1)); + curve_node_option_idx = add_options.size(); + add_options.push_back(AddOption("CurveTexture", "Textures", "Functions", "VisualShaderNodeCurveTexture", TTR("Perform the curve texture lookup."), -1, -1)); texture2d_node_option_idx = add_options.size(); add_options.push_back(AddOption("Texture2D", "Textures", "Functions", "VisualShaderNodeTexture", TTR("Perform the 2D texture lookup."), -1, -1)); texture2d_array_node_option_idx = add_options.size(); diff --git a/editor/plugins/visual_shader_editor_plugin.h b/editor/plugins/visual_shader_editor_plugin.h index d43af82238..73bebcd192 100644 --- a/editor/plugins/visual_shader_editor_plugin.h +++ b/editor/plugins/visual_shader_editor_plugin.h @@ -33,6 +33,7 @@ #include "editor/editor_node.h" #include "editor/editor_plugin.h" +#include "editor/plugins/curve_editor_plugin.h" #include "editor/property_editor.h" #include "scene/gui/button.h" #include "scene/gui/graph_edit.h" @@ -73,6 +74,8 @@ private: VBoxContainer *preview_box; LineEdit *uniform_name; OptionButton *const_op; + CodeEdit *expression_edit; + CurveEditor *curve_editor; }; Ref<VisualShader> visual_shader; @@ -91,6 +94,8 @@ public: void register_uniform_name(int p_id, LineEdit *p_uniform_name); void register_default_input_button(int p_node_id, int p_port_id, Button *p_button); void register_constant_option_btn(int p_node_id, OptionButton *p_button); + void register_expression_edit(int p_node_id, CodeEdit *p_expression_edit); + void register_curve_editor(int p_node_id, CurveEditor *p_curve_editor); void clear_links(); void set_shader_type(VisualShader::Type p_type); bool is_preview_visible(int p_id) const; @@ -109,7 +114,9 @@ public: void set_input_port_default_value(VisualShader::Type p_type, int p_node_id, int p_port_id, Variant p_value); void update_uniform_refs(); void set_uniform_name(VisualShader::Type p_type, int p_node_id, const String &p_name); + void update_curve(int p_node_id); void update_constant(VisualShader::Type p_type, int p_node_id); + void set_expression(VisualShader::Type p_type, int p_node_id, const String &p_expression); int get_constant_index(float p_constant) const; void update_node_size(int p_node_id); VisualShader::Type get_shader_type() const; @@ -251,6 +258,7 @@ class VisualShaderEditor : public VBoxContainer { int texture2d_array_node_option_idx; int texture3d_node_option_idx; int custom_node_option_idx; + int curve_node_option_idx; List<String> keyword_list; List<VisualShaderNodeUniformRef> uniform_refs; @@ -262,6 +270,8 @@ class VisualShaderEditor : public VBoxContainer { void _add_texture2d_node(const String &p_path); void _add_texture2d_array_node(const String &p_path); void _add_texture3d_node(const String &p_path); + void _add_curve_node(const String &p_path); + VisualShaderNode *_add_node(int p_idx, int p_op_idx = -1); void _update_options_menu(); void _set_mode(int p_which); @@ -290,8 +300,9 @@ class VisualShaderEditor : public VBoxContainer { void _scroll_changed(const Vector2 &p_scroll); void _node_selected(Object *p_node); - void _delete_request(int); - void _delete_nodes(); + void _delete_nodes(int p_type, const List<int> &p_nodes); + void _delete_node_request(int p_type, int p_node); + void _delete_nodes_request(); void _removed_from_graph(); diff --git a/editor/project_export.cpp b/editor/project_export.cpp index 1f553ba0de..71522bb253 100644 --- a/editor/project_export.cpp +++ b/editor/project_export.cpp @@ -51,10 +51,6 @@ void ProjectExportDialog::_theme_changed() { duplicate_preset->set_icon(presets->get_theme_icon("Duplicate", "EditorIcons")); delete_preset->set_icon(presets->get_theme_icon("Remove", "EditorIcons")); - Control *panel = custom_feature_display->get_parent_control(); - if (panel) { - panel->add_theme_style_override("panel", patches->get_theme_stylebox("bg", "Tree")); - } } void ProjectExportDialog::_notification(int p_what) { @@ -68,7 +64,6 @@ void ProjectExportDialog::_notification(int p_what) { duplicate_preset->set_icon(presets->get_theme_icon("Duplicate", "EditorIcons")); delete_preset->set_icon(presets->get_theme_icon("Remove", "EditorIcons")); connect("confirmed", callable_mp(this, &ProjectExportDialog::_export_pck_zip)); - custom_feature_display->get_parent_control()->add_theme_style_override("panel", patches->get_theme_stylebox("bg", "Tree")); } break; } } @@ -205,7 +200,6 @@ void ProjectExportDialog::_edit_preset(int p_index) { duplicate_preset->set_disabled(true); delete_preset->set_disabled(true); sections->hide(); - patches->clear(); export_error->hide(); export_templates_error->hide(); return; @@ -241,34 +235,6 @@ void ProjectExportDialog::_edit_preset(int p_index) { include_filters->set_text(current->get_include_filter()); exclude_filters->set_text(current->get_exclude_filter()); - patches->clear(); - TreeItem *patch_root = patches->create_item(); - Vector<String> patchlist = current->get_patches(); - for (int i = 0; i < patchlist.size(); i++) { - TreeItem *patch = patches->create_item(patch_root); - patch->set_cell_mode(0, TreeItem::CELL_MODE_CHECK); - String file = patchlist[i].get_file(); - patch->set_editable(0, true); - patch->set_text(0, file.get_file().replace("*", "")); - if (file.ends_with("*")) { - patch->set_checked(0, true); - } - patch->set_tooltip(0, patchlist[i]); - patch->set_metadata(0, i); - patch->add_button(0, presets->get_theme_icon("Remove", "EditorIcons"), 0); - patch->add_button(0, presets->get_theme_icon("folder", "FileDialog"), 1); - } - - TreeItem *patch_add = patches->create_item(patch_root); - patch_add->set_metadata(0, patchlist.size()); - if (patchlist.size() == 0) { - patch_add->set_text(0, TTR("Add initial export...")); - } else { - patch_add->set_text(0, TTR("Add previous patches...")); - } - - patch_add->add_button(0, presets->get_theme_icon("folder", "FileDialog"), 1); - _fill_resource_tree(); bool needs_templates; @@ -401,74 +367,6 @@ void ProjectExportDialog::_tab_changed(int) { _update_feature_list(); } -void ProjectExportDialog::_patch_button_pressed(Object *p_item, int p_column, int p_id) { - TreeItem *ti = (TreeItem *)p_item; - - patch_index = ti->get_metadata(0); - - Ref<EditorExportPreset> current = get_current_preset(); - ERR_FAIL_COND(current.is_null()); - - if (p_id == 0) { - Vector<String> patches = current->get_patches(); - ERR_FAIL_INDEX(patch_index, patches.size()); - patch_erase->set_text(vformat(TTR("Delete patch '%s' from list?"), patches[patch_index].get_file())); - patch_erase->popup_centered(); - } else { - patch_dialog->popup_file_dialog(); - } -} - -void ProjectExportDialog::_patch_edited() { - TreeItem *item = patches->get_edited(); - if (!item) { - return; - } - int index = item->get_metadata(0); - - Ref<EditorExportPreset> current = get_current_preset(); - ERR_FAIL_COND(current.is_null()); - - Vector<String> patches = current->get_patches(); - - ERR_FAIL_INDEX(index, patches.size()); - - String patch = patches[index].replace("*", ""); - - if (item->is_checked(0)) { - patch += "*"; - } - - current->set_patch(index, patch); -} - -void ProjectExportDialog::_patch_selected(const String &p_path) { - Ref<EditorExportPreset> current = get_current_preset(); - ERR_FAIL_COND(current.is_null()); - - Vector<String> patches = current->get_patches(); - - if (patch_index >= patches.size()) { - current->add_patch(ProjectSettings::get_singleton()->get_resource_path().path_to(p_path) + "*"); - } else { - String enabled = patches[patch_index].ends_with("*") ? String("*") : String(); - current->set_patch(patch_index, ProjectSettings::get_singleton()->get_resource_path().path_to(p_path) + enabled); - } - - _update_current_preset(); -} - -void ProjectExportDialog::_patch_deleted() { - Ref<EditorExportPreset> current = get_current_preset(); - ERR_FAIL_COND(current.is_null()); - - Vector<String> patches = current->get_patches(); - if (patch_index < patches.size()) { - current->remove_patch(patch_index); - _update_current_preset(); - } -} - void ProjectExportDialog::_update_parameters(const String &p_edited_property) { _update_current_preset(); } @@ -663,10 +561,6 @@ void ProjectExportDialog::_duplicate_preset() { preset->set_export_filter(current->get_export_filter()); preset->set_include_filter(current->get_include_filter()); preset->set_exclude_filter(current->get_exclude_filter()); - Vector<String> list = current->get_patches(); - for (int i = 0; i < list.size(); i++) { - preset->add_patch(list[i]); - } preset->set_custom_features(current->get_custom_features()); for (const List<PropertyInfo>::Element *E = current->get_properties().front(); E; E = E->next()) { @@ -718,21 +612,6 @@ Variant ProjectExportDialog::get_drag_data_fw(const Point2 &p_point, Control *p_ return d; } - } else if (p_from == patches) { - TreeItem *item = patches->get_item_at_position(p_point); - - if (item && item->get_cell_mode(0) == TreeItem::CELL_MODE_CHECK) { - int metadata = item->get_metadata(0); - Dictionary d; - d["type"] = "export_patch"; - d["patch"] = metadata; - - Label *label = memnew(Label); - label->set_text(item->get_text(0)); - patches->set_drag_preview(label); - - return d; - } } return Variant(); @@ -748,19 +627,6 @@ bool ProjectExportDialog::can_drop_data_fw(const Point2 &p_point, const Variant if (presets->get_item_at_position(p_point, true) < 0 && !presets->is_pos_at_end_of_items(p_point)) { return false; } - } else if (p_from == patches) { - Dictionary d = p_data; - if (!d.has("type") || String(d["type"]) != "export_patch") { - return false; - } - - patches->set_drop_mode_flags(Tree::DROP_MODE_ON_ITEM); - - TreeItem *item = patches->get_item_at_position(p_point); - - if (!item) { - return false; - } } return true; @@ -797,33 +663,6 @@ void ProjectExportDialog::drop_data_fw(const Point2 &p_point, const Variant &p_d } else { _edit_preset(presets->get_item_count() - 1); } - } else if (p_from == patches) { - Dictionary d = p_data; - if (!d.has("type") || String(d["type"]) != "export_patch") { - return; - } - - int from_pos = d["patch"]; - - TreeItem *item = patches->get_item_at_position(p_point); - if (!item) { - return; - } - - int to_pos = item->get_cell_mode(0) == TreeItem::CELL_MODE_CHECK ? int(item->get_metadata(0)) : -1; - - if (to_pos == from_pos) { - return; - } else if (to_pos > from_pos) { - to_pos--; - } - - Ref<EditorExportPreset> preset = get_current_preset(); - String patch = preset->get_patch(from_pos); - preset->remove_patch(from_pos); - preset->add_patch(patch, to_pos); - - _update_current_preset(); } } @@ -1222,48 +1061,6 @@ ProjectExportDialog::ProjectExportDialog() { script_mode->add_item(TTR("Compiled"), (int)EditorExportPreset::MODE_SCRIPT_COMPILED); script_mode->connect("item_selected", callable_mp(this, &ProjectExportDialog::_script_export_mode_changed)); - // Patch packages. - - VBoxContainer *patch_vb = memnew(VBoxContainer); - sections->add_child(patch_vb); - patch_vb->set_name(TTR("Patches")); - - // FIXME: Patching support doesn't seem properly implemented yet, so we hide it. - // The rest of the code is still kept for now, in the hope that it will be made - // functional and reactivated. - patch_vb->hide(); - - patches = memnew(Tree); - patch_vb->add_child(patches); - patches->set_v_size_flags(Control::SIZE_EXPAND_FILL); - patches->set_hide_root(true); - patches->connect("button_pressed", callable_mp(this, &ProjectExportDialog::_patch_button_pressed)); - patches->connect("item_edited", callable_mp(this, &ProjectExportDialog::_patch_edited)); -#ifndef _MSC_VER -#warning must reimplement drag forward -#endif - //patches->set_drag_forwarding(this); - patches->set_edit_checkbox_cell_only_when_checkbox_is_pressed(true); - - HBoxContainer *patches_hb = memnew(HBoxContainer); - patch_vb->add_child(patches_hb); - patches_hb->add_spacer(); - patch_export = memnew(Button); - patch_export->set_text(TTR("Make Patch")); - patches_hb->add_child(patch_export); - patches_hb->add_spacer(); - - patch_dialog = memnew(EditorFileDialog); - patch_dialog->add_filter("*.pck ; " + TTR("Pack File")); - patch_dialog->set_file_mode(EditorFileDialog::FILE_MODE_OPEN_FILE); - patch_dialog->connect("file_selected", callable_mp(this, &ProjectExportDialog::_patch_selected)); - add_child(patch_dialog); - - patch_erase = memnew(ConfirmationDialog); - patch_erase->get_ok()->set_text(TTR("Delete")); - patch_erase->connect("confirmed", callable_mp(this, &ProjectExportDialog::_patch_deleted)); - add_child(patch_erase); - // Feature tags. VBoxContainer *feature_vb = memnew(VBoxContainer); diff --git a/editor/project_export.h b/editor/project_export.h index 75402dc334..026daac2ad 100644 --- a/editor/project_export.h +++ b/editor/project_export.h @@ -87,12 +87,6 @@ private: StringName editor_icons; - Tree *patches; - Button *patch_export; - int patch_index; - EditorFileDialog *patch_dialog; - ConfirmationDialog *patch_erase; - Button *export_button; Button *export_all_button; AcceptDialog *export_all_dialog; @@ -109,9 +103,6 @@ private: String default_filename; - void _patch_selected(const String &p_path); - void _patch_deleted(); - void _runnable_pressed(); void _update_parameters(const String &p_edited_property); void _name_changed(const String &p_string); @@ -133,9 +124,6 @@ private: bool _fill_tree(EditorFileSystemDirectory *p_dir, TreeItem *p_item, Ref<EditorExportPreset> ¤t, bool p_only_scenes); void _tree_changed(); - void _patch_button_pressed(Object *p_item, int p_column, int p_id); - void _patch_edited(); - Variant get_drag_data_fw(const Point2 &p_point, Control *p_from); bool can_drop_data_fw(const Point2 &p_point, const Variant &p_data, Control *p_from) const; void drop_data_fw(const Point2 &p_point, const Variant &p_data, Control *p_from); diff --git a/editor/property_editor.cpp b/editor/property_editor.cpp index cb56358ae6..7f1b5347cf 100644 --- a/editor/property_editor.cpp +++ b/editor/property_editor.cpp @@ -1697,13 +1697,18 @@ void CustomPropertyEditor::config_value_editors(int p_amount, int p_columns, int int cell_width = 95; int cell_height = 25; int cell_margin = 5; - int hor_spacing = 5; // Spacing between labels and their values - int rows = ((p_amount - 1) / p_columns) + 1; set_size(Size2(cell_margin + p_label_w + (cell_width + cell_margin + p_label_w) * p_columns, cell_margin + (cell_height + cell_margin) * rows) * EDSCALE); for (int i = 0; i < MAX_VALUE_EDITORS; i++) { + value_label[i]->get_parent()->remove_child(value_label[i]); + value_editor[i]->get_parent()->remove_child(value_editor[i]); + + int box_id = i / p_columns; + value_hboxes[box_id]->add_child(value_label[i]); + value_hboxes[box_id]->add_child(value_editor[i]); + if (i < MAX_VALUE_EDITORS / 4) { if (i <= p_amount / 4) { value_hboxes[i]->show(); @@ -1712,16 +1717,10 @@ void CustomPropertyEditor::config_value_editors(int p_amount, int p_columns, int } } - int c = i % p_columns; - int r = i / p_columns; - if (i < p_amount) { value_editor[i]->show(); value_label[i]->show(); value_label[i]->set_text(i < p_strings.size() ? p_strings[i] : String("")); - value_editor[i]->set_position(Point2(cell_margin + p_label_w + hor_spacing + (cell_width + cell_margin + p_label_w + hor_spacing) * c, cell_margin + (cell_height + cell_margin) * r) * EDSCALE); - value_editor[i]->set_size(Size2(cell_width, cell_height)); - value_label[i]->set_position(Point2(cell_margin + (cell_width + cell_margin + p_label_w + hor_spacing) * c, cell_margin + (cell_height + cell_margin) * r) * EDSCALE); value_editor[i]->set_editable(!read_only); } else { value_editor[i]->hide(); diff --git a/editor/scene_tree_dock.cpp b/editor/scene_tree_dock.cpp index 75dc840738..c4e90ca3ff 100644 --- a/editor/scene_tree_dock.cpp +++ b/editor/scene_tree_dock.cpp @@ -1141,7 +1141,7 @@ void SceneTreeDock::_notification(int p_what) { node_shortcuts->add_child(button_custom); button_custom->set_text(TTR("Other Node")); button_custom->set_icon(get_theme_icon("Add", "EditorIcons")); - button_custom->connect("pressed", callable_mp(this, &SceneTreeDock::_tool_selected), make_binds(TOOL_NEW, false)); + button_custom->connect("pressed", callable_bind(callable_mp(this, &SceneTreeDock::_tool_selected), TOOL_NEW, false)); node_shortcuts->add_spacer(); create_root_dialog->add_child(node_shortcuts); @@ -2107,8 +2107,12 @@ void SceneTreeDock::replace_node(Node *p_node, Node *p_by_node, bool p_keep_prop } if (E->get().name == "__meta__") { - if (Object::cast_to<CanvasItem>(newnode)) { - Dictionary metadata = n->get(E->get().name); + Dictionary metadata = n->get(E->get().name); + if (metadata.has("_editor_description_")) { + newnode->set_meta("_editor_description_", metadata["_editor_description_"]); + } + + if (Object::cast_to<CanvasItem>(newnode) || Object::cast_to<Node3D>(newnode)) { if (metadata.has("_edit_group_") && metadata["_edit_group_"]) { newnode->set_meta("_edit_group_", true); } diff --git a/editor/shader_globals_editor.cpp b/editor/shader_globals_editor.cpp index aa88b0ef39..915aec6d9a 100644 --- a/editor/shader_globals_editor.cpp +++ b/editor/shader_globals_editor.cpp @@ -284,7 +284,13 @@ static Variant create_var(RS::GlobalVariableType p_type) { return Vector3i(); } case RS::GLOBAL_VAR_TYPE_UVEC4: { - return Rect2i(); + Vector<int> v4; + v4.resize(4); + v4.write[0] = 0; + v4.write[1] = 0; + v4.write[2] = 0; + v4.write[3] = 0; + return v4; } case RS::GLOBAL_VAR_TYPE_FLOAT: { return 0.0; @@ -324,7 +330,7 @@ static Variant create_var(RS::GlobalVariableType p_type) { } case RS::GLOBAL_VAR_TYPE_MAT4: { Vector<real_t> xform; - xform.resize(4); + xform.resize(16); xform.write[0] = 1; xform.write[1] = 0; xform.write[2] = 0; @@ -437,6 +443,9 @@ void ShaderGlobalsEditor::_notification(int p_what) { inspector->edit(interface); } } + if (p_what == NOTIFICATION_PREDELETE) { + inspector->edit(nullptr); + } } ShaderGlobalsEditor::ShaderGlobalsEditor() { @@ -474,6 +483,5 @@ ShaderGlobalsEditor::ShaderGlobalsEditor() { } ShaderGlobalsEditor::~ShaderGlobalsEditor() { - inspector->edit(nullptr); memdelete(interface); } diff --git a/main/performance.h b/main/performance.h index 5f88a24c0f..f406433cf2 100644 --- a/main/performance.h +++ b/main/performance.h @@ -31,7 +31,7 @@ #ifndef PERFORMANCE_H #define PERFORMANCE_H -#include "core/object.h" +#include "core/class_db.h" #include "core/ordered_hash_map.h" #define PERF_WARN_OFFLINE_FUNCTION diff --git a/misc/ci/android-tools-linux.sh b/misc/ci/android-tools-linux.sh deleted file mode 100755 index 6114551861..0000000000 --- a/misc/ci/android-tools-linux.sh +++ /dev/null @@ -1,108 +0,0 @@ -#!/bin/bash - -# SDK -# https://dl.google.com/android/repository/sdk-tools-linux-3859397.zip -# SHA-256 444e22ce8ca0f67353bda4b85175ed3731cae3ffa695ca18119cbacef1c1bea0 -# latest version available here: https://developer.android.com/studio/index.html - -# NDK -# https://dl.google.com/android/repository/android-ndk-r15c-linux-x86_64.zip -# SHA-1 0bf02d4e8b85fd770fd7b9b2cdec57f9441f27a2 -# latest version available here: https://developer.android.com/ndk/downloads/index.html - -BASH_RC=~/.bashrc -GODOT_BUILD_TOOLS_PATH=./godot-dev/build-tools -mkdir -p $GODOT_BUILD_TOOLS_PATH -cd $GODOT_BUILD_TOOLS_PATH - -ANDROID_BASE_URL=http://dl.google.com/android/repository - -ANDROID_SDK_RELEASE=4333796 -ANDROID_SDK_DIR=android-sdk -ANDROID_SDK_FILENAME=sdk-tools-linux-$ANDROID_SDK_RELEASE.zip -ANDROID_SDK_URL=$ANDROID_BASE_URL/$ANDROID_SDK_FILENAME -ANDROID_SDK_PATH=$GODOT_BUILD_TOOLS_PATH/$ANDROID_SDK_DIR -ANDROID_SDK_SHA256=92ffee5a1d98d856634e8b71132e8a95d96c83a63fde1099be3d86df3106def9 - -ANDROID_NDK_RELEASE=r21 -ANDROID_NDK_DIR=android-ndk -ANDROID_NDK_FILENAME=android-ndk-$ANDROID_NDK_RELEASE-linux-x86_64.zip -ANDROID_NDK_URL=$ANDROID_BASE_URL/$ANDROID_NDK_FILENAME -ANDROID_NDK_PATH=$GODOT_BUILD_TOOLS_PATH/$ANDROID_NDK_DIR -ANDROID_NDK_SHA1=afc9c0b9faad222898ac8168c78ad4ccac8a1b5c - -echo -echo "Download and install Android development tools ..." -echo - -if [ ! -e $ANDROID_SDK_FILENAME ]; then - echo "Downloading: Android SDK ..." - curl -L -O $ANDROID_SDK_URL -else - echo $ANDROID_SDK_SHA1 $ANDROID_SDK_FILENAME > $ANDROID_SDK_FILENAME.sha1 - if [ $(shasum -a 256 < $ANDROID_SDK_FILENAME | awk '{print $1;}') != $ANDROID_SDK_SHA1 ]; then - echo "Downloading: Android SDK ..." - curl -L -O $ANDROID_SDK_URL - fi -fi - -if [ ! -d $ANDROID_SDK_DIR ]; then - echo "Extracting: Android SDK ..." - unzip -qq $ANDROID_SDK_FILENAME -d $ANDROID_SDK_DIR - echo -fi - -if [ ! -e $ANDROID_NDK_FILENAME ]; then - echo "Downloading: Android NDK ..." - curl -L -O $ANDROID_NDK_URL -else - echo $ANDROID_NDK_MD5 $ANDROID_NDK_FILENAME > $ANDROID_NDK_FILENAME.md5 - if [ $(shasum -a 1 < $ANDROID_NDK_FILENAME | awk '{print $1;}') != $ANDROID_NDK_SHA1 ]; then - echo "Downloading: Android NDK ..." - curl -L -O $ANDROID_NDK_URL - fi -fi - -if [ ! -d $ANDROID_NDK_DIR ]; then - echo "Extracting: Android NDK ..." - unzip -qq $ANDROID_NDK_FILENAME - mv android-ndk-$ANDROID_NDK_RELEASE $ANDROID_NDK_DIR - echo -fi - -mkdir -p ~/.android && echo "count=0" > ~/.android/repositories.cfg -echo "Installing: Accepting Licenses ..." -yes | $ANDROID_SDK_DIR/tools/bin/sdkmanager --licenses > /dev/null -echo "Installing: Android Build and Platform Tools ..." -yes | $ANDROID_SDK_DIR/tools/bin/sdkmanager 'tools' > /dev/null -yes | $ANDROID_SDK_DIR/tools/bin/sdkmanager 'platform-tools' > /dev/null -yes | $ANDROID_SDK_DIR/tools/bin/sdkmanager 'build-tools;29.0.3' > /dev/null -echo - -EXPORT_VAL="export ANDROID_HOME=$ANDROID_SDK_PATH" -if ! grep -q "^$EXPORT_VAL" $BASH_RC; then - echo $EXPORT_VAL >> $BASH_RC -fi -#eval $EXPORT_VAL - -EXPORT_VAL="export ANDROID_NDK_ROOT=$ANDROID_NDK_PATH" -if ! grep -q "^$EXPORT_VAL" $BASH_RC; then - echo $EXPORT_VAL >> $BASH_RC -fi -#eval $EXPORT_VAL - -EXPORT_VAL="export PATH=$PATH:$ANDROID_SDK_PATH/tools" -if ! grep -q "^export PATH=.*$ANDROID_SDK_PATH/tools.*" $BASH_RC; then - echo $EXPORT_VAL >> $BASH_RC -fi -#eval $EXPORT_VAL - -EXPORT_VAL="export PATH=$PATH:$ANDROID_SDK_PATH/tools/bin" -if ! grep -q "^export PATH=.*$ANDROID_SDK_PATH/tools/bin.*" $BASH_RC; then - echo $EXPORT_VAL >> $BASH_RC -fi -#eval $EXPORT_VAL - -echo -echo "Done!" -echo diff --git a/misc/dist/html/editor.html b/misc/dist/html/editor.html new file mode 100644 index 0000000000..5b6ad2df65 --- /dev/null +++ b/misc/dist/html/editor.html @@ -0,0 +1,475 @@ +<!DOCTYPE html> +<html xmlns='http://www.w3.org/1999/xhtml' lang='' xml:lang=''> +<head> + <meta charset='utf-8' /> + <meta name='viewport' content='width=device-width, user-scalable=no' /> + <link id='-gd-engine-icon' rel='icon' type='image/png' href='favicon.png' /> + <title></title> + <style type='text/css'> + + body { + touch-action: none; + margin: 0; + border: 0 none; + padding: 0; + text-align: center; + background-color: black; + overflow: hidden; + } + + #canvas, #gameCanvas { + display: block; + margin: 0; + color: white; + } + + #canvas:focus, #gameCanvas:focus { + outline: none; + } + + .godot { + font-family: 'Noto Sans', 'Droid Sans', Arial, sans-serif; + color: #e0e0e0; + background-color: #3b3943; + background-image: linear-gradient(to bottom, #403e48, #35333c); + border: 1px solid #45434e; + box-shadow: 0 0 1px 1px #2f2d35; + } + + + /* Status display + * ============== */ + + #status { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; + display: flex; + justify-content: center; + align-items: center; + /* don't consume click events - make children visible explicitly */ + visibility: hidden; + } + + #status-progress { + width: 366px; + height: 7px; + background-color: #38363A; + border: 1px solid #444246; + padding: 1px; + box-shadow: 0 0 2px 1px #1B1C22; + border-radius: 2px; + visibility: visible; + } + + @media only screen and (orientation:portrait) { + #status-progress { + width: 61.8%; + } + } + + #status-progress-inner { + height: 100%; + width: 0; + box-sizing: border-box; + transition: width 0.5s linear; + background-color: #202020; + border: 1px solid #222223; + box-shadow: 0 0 1px 1px #27282E; + border-radius: 3px; + } + + #status-indeterminate { + visibility: visible; + position: relative; + } + + #status-indeterminate > div { + width: 4.5px; + height: 0; + border-style: solid; + border-width: 9px 3px 0 3px; + border-color: #2b2b2b transparent transparent transparent; + transform-origin: center 21px; + position: absolute; + } + + #status-indeterminate > div:nth-child(1) { transform: rotate( 22.5deg); } + #status-indeterminate > div:nth-child(2) { transform: rotate( 67.5deg); } + #status-indeterminate > div:nth-child(3) { transform: rotate(112.5deg); } + #status-indeterminate > div:nth-child(4) { transform: rotate(157.5deg); } + #status-indeterminate > div:nth-child(5) { transform: rotate(202.5deg); } + #status-indeterminate > div:nth-child(6) { transform: rotate(247.5deg); } + #status-indeterminate > div:nth-child(7) { transform: rotate(292.5deg); } + #status-indeterminate > div:nth-child(8) { transform: rotate(337.5deg); } + + #status-notice { + margin: 0 100px; + line-height: 1.3; + visibility: visible; + padding: 4px 6px; + visibility: visible; + } + </style> +</head> +<body> + <div id="tabs-buttons"> + <button id="btn-tab-loader" class="tab-btn" onclick="showTab('loader')">Loader</button> + <button id="btn-tab-editor" class="tab-btn" disabled="disabled" onclick="showTab('editor')">Editor</button> + <button id="btn-close-editor" class="close-btn" disabled="disabled" onclick="closeEditor()">X</button> + <button id="btn-tab-game" class="tab-btn" disabled="disabled" onclick="showTab('game')">Game</button> + <button id="btn-close-game" class="close-btn" disabled="disabled" onclick="closeGame()">X</button> + </div> + <div id='tabs'> + <div id='tab-loader'> + <div style="color: white;" id="persistence"> + <label for="videoMode" style="display: none;">Select video driver:</label><br /> + <select id="videoMode" style="display: none;"> + <option value="GLES2" selected="selected">WebGL</option> + <option value="GLES3">WebGL 2</option> + </select> + <br /> + <label for="zip-file">Preload project zip: </label><input id="zip-file" type="file" id="files" name="files"/> + <br /> + <button id="startButton">Start Godot Editor</button> + <br /> + <br /> + <button onclick="clearPersistence()">Clear persistent data</button> + </div> + </div> + <div id='tab-editor' style="display: none;"> + <canvas id='editor-canvas' tabindex="1"> + HTML5 canvas appears to be unsupported in the current browser.<br /> + Please try updating or use a different browser. + </canvas> + </div> + <div id='tab-game' style="display: none;"> + <canvas id='game-canvas' tabindex="2"> + HTML5 canvas appears to be unsupported in the current browser.<br /> + Please try updating or use a different browser. + </canvas> + </div> + <div id='tab-status' style="display: none;"> + <div id='status-progress' style='display: none;' oncontextmenu='event.preventDefault();'><div id ='status-progress-inner'></div></div> + <div id='status-indeterminate' style='display: none;' oncontextmenu='event.preventDefault();'> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + <div></div> + </div> + <div id='status-notice' class='godot' style='display: none;'></div> + </div> + </div> + + <script type='text/javascript' src='godot.tools.js'></script> + <script type='text/javascript'>//<![CDATA[ + + var engine = new Engine; + var game = null; + var setStatusMode; + var setStatusNotice; + var video_driver = "GLES2"; + + function clearPersistence() { + function deleteDB(path) { + return new Promise(function(resolve, reject) { + var req = indexedDB.deleteDatabase(path); + req.onsuccess = function() { + resolve(); + }; + req.onerror = function(err) { + reject(err); + }; + req.onblocked = function(err) { + reject(err); + } + + }); + } + if (!window.confirm("Are you sure you want to delete all the locally stored files?")) { + return; + } + Promise.all([ + deleteDB("/home/web_user/projects"), + deleteDB("/home/web_user/.config") + ]).then(function(results) { + alert("Done."); + }).catch(function (err) { + alert("Error deleting local files. Please retry after reloading the page."); + }); + } + + function selectVideoMode() { + var select = document.getElementById('videoMode'); + video_driver = select.selectedOptions[0].value; + } + + var tabs = [ + document.getElementById('tab-loader'), + document.getElementById('tab-editor'), + document.getElementById('tab-game') + ] + function showTab(name) { + tabs.forEach(function (elem) { + if (elem.id == 'tab-' + name) { + elem.style.display = 'block'; + } else { + elem.style.display = 'none'; + } + }); + } + + function setButtonEnabled(id, enabled) { + if (enabled) { + document.getElementById(id).disabled = ""; + } else { + document.getElementById(id).disabled = "disabled"; + } + } + + function setLoaderEnabled(enabled) { + setButtonEnabled('btn-tab-loader', enabled); + setButtonEnabled('btn-tab-editor', !enabled); + setButtonEnabled('btn-close-editor', !enabled); + } + + function setGameTabEnabled(enabled) { + setButtonEnabled('btn-tab-game', enabled); + setButtonEnabled('btn-close-game', enabled); + } + + function closeGame() { + if (game) { + game.requestQuit(); + } + } + + function closeEditor() { + closeGame(); + if (engine) { + engine.requestQuit(); + } + } + + function startEditor(zip) { + + const INDETERMINATE_STATUS_STEP_MS = 100; + const persistentPaths = ['/home/web_user/.config', '/home/web_user/projects']; + + var editorCanvas = document.getElementById('editor-canvas'); + var gameCanvas = document.getElementById('game-canvas'); + var statusProgress = document.getElementById('status-progress'); + var statusProgressInner = document.getElementById('status-progress-inner'); + var statusIndeterminate = document.getElementById('status-indeterminate'); + var statusNotice = document.getElementById('status-notice'); + + var initializing = true; + var statusMode = 'hidden'; + + showTab('status'); + + var animationCallbacks = []; + function animate(time) { + animationCallbacks.forEach(callback => callback(time)); + requestAnimationFrame(animate); + } + requestAnimationFrame(animate); + + function adjustCanvasDimensions() { + var scale = window.devicePixelRatio || 1; + var header = document.getElementById('tabs-buttons'); + var headerHeight = header.offsetHeight + 1; + var width = window.innerWidth; + var height = window.innerHeight - headerHeight; + editorCanvas.width = width * scale; + editorCanvas.height = height * scale; + editorCanvas.style.width = width + "px"; + editorCanvas.style.height = height + "px"; + } + animationCallbacks.push(adjustCanvasDimensions); + adjustCanvasDimensions(); + + setStatusMode = function setStatusMode(mode) { + + if (statusMode === mode || !initializing) + return; + [statusProgress, statusIndeterminate, statusNotice].forEach(elem => { + elem.style.display = 'none'; + }); + animationCallbacks = animationCallbacks.filter(function(value) { + return (value != animateStatusIndeterminate); + }); + switch (mode) { + case 'progress': + statusProgress.style.display = 'block'; + break; + case 'indeterminate': + statusIndeterminate.style.display = 'block'; + animationCallbacks.push(animateStatusIndeterminate); + break; + case 'notice': + statusNotice.style.display = 'block'; + break; + case 'hidden': + break; + default: + throw new Error('Invalid status mode'); + } + statusMode = mode; + } + + function animateStatusIndeterminate(ms) { + + var i = Math.floor(ms / INDETERMINATE_STATUS_STEP_MS % 8); + if (statusIndeterminate.children[i].style.borderTopColor == '') { + Array.prototype.slice.call(statusIndeterminate.children).forEach(child => { + child.style.borderTopColor = ''; + }); + statusIndeterminate.children[i].style.borderTopColor = '#dfdfdf'; + } + } + + setStatusNotice = function setStatusNotice(text) { + + while (statusNotice.lastChild) { + statusNotice.removeChild(statusNotice.lastChild); + } + var lines = text.split('\n'); + lines.forEach((line) => { + statusNotice.appendChild(document.createTextNode(line)); + statusNotice.appendChild(document.createElement('br')); + }); + }; + + engine.setProgressFunc((current, total) => { + + if (total > 0) { + statusProgressInner.style.width = current/total * 100 + '%'; + setStatusMode('progress'); + if (current === total) { + // wait for progress bar animation + setTimeout(() => { + setStatusMode('indeterminate'); + }, 100); + } + } else { + setStatusMode('indeterminate'); + } + }); + + engine.setPersistentPaths(persistentPaths); + + engine.setOnExecute(function(args) { + const is_editor = args.filter(function(v) { return v == '--editor' || v == '-e' }).length != 0; + const is_project_manager = args.filter(function(v) { return v == '--project-manager' }).length != 0; + const is_game = !is_editor && !is_project_manager; + if (is_project_manager) { + args.push('--video-driver', video_driver); + } + if (is_game) { + if (game) { + console.error("A game is already running. Close it first"); + return; + } + setGameTabEnabled(true); + game = new Engine(); + game.setPersistentPaths(persistentPaths); + game.setUnloadAfterInit(false); + game.setOnExecute(engine.onExecute); + game.setCanvas(gameCanvas); + game.setCanvasResizedOnStart(true); + game.setOnExit(function() { + setGameTabEnabled(false); + showTab('editor'); + game = null; + }); + showTab('game'); + game.init().then(function() { + requestAnimationFrame(function() { + game.start.apply(game, args).then(function() { + gameCanvas.focus(); + }); + }); + }); + } else { // New editor instances will be run in the same canvas. We want to wait for it to exit. + engine.setOnExit(function(code) { + setLoaderEnabled(true); + setTimeout(function() { + engine.init().then(function() { + setLoaderEnabled(false); + engine.setOnExit(function() { + showTab('loader'); + setLoaderEnabled(true); + }); + engine.start.apply(engine, args); + }); + }, 0); + engine.setOnExit(null); + }); + } + }); + + function displayFailureNotice(err) { + var msg = err.message || err; + console.error(msg); + setStatusNotice(msg); + setStatusMode('notice'); + initializing = false; + }; + + if (!Engine.isWebGLAvailable()) { + displayFailureNotice('WebGL not available'); + } else { + setStatusMode('indeterminate'); + engine.setCanvas(editorCanvas); + engine.setUnloadAfterInit(false); // Don't want to reload when starting game. + engine.init('godot.tools').then(function() { + if (zip) { + engine.copyToFS("/home/web_user/preload.zip", zip); + } + try { + // Avoid user creating project in the persistent root folder. + engine.copyToFS("/home/web_user/projects/keep", new Uint8Array()); + } catch(e) { + // File exists + } + //selectVideoMode(); + showTab('editor'); + setLoaderEnabled(false); + engine.setOnExit(function() { + showTab('loader'); + setLoaderEnabled(true); + }); + engine.start('--video-driver', video_driver).then(function() { + setStatusMode('hidden'); + initializing = false; + }); + }).catch(displayFailureNotice); + } + }; + document.getElementById("startButton").onclick = function() { + preloadZip(document.getElementById('zip-file')).then(function(zip) { + startEditor(zip); + }); + } + + function preloadZip(target) { + return new Promise(function(resolve, reject) { + if (target.files.length > 0) { + target.files[0].arrayBuffer().then(function(data) { + resolve(data); + }); + } else { + resolve(); + } + }); + } + //]]></script> +</body> +</html> diff --git a/modules/bullet/collision_object_bullet.h b/modules/bullet/collision_object_bullet.h index f1423a69e4..36b3a9550c 100644 --- a/modules/bullet/collision_object_bullet.h +++ b/modules/bullet/collision_object_bullet.h @@ -31,9 +31,9 @@ #ifndef COLLISION_OBJECT_BULLET_H #define COLLISION_OBJECT_BULLET_H +#include "core/class_db.h" #include "core/math/transform.h" #include "core/math/vector3.h" -#include "core/object.h" #include "core/vset.h" #include "shape_owner_bullet.h" diff --git a/modules/bullet/rigid_body_bullet.cpp b/modules/bullet/rigid_body_bullet.cpp index 76c0e0e607..eb599df74c 100644 --- a/modules/bullet/rigid_body_bullet.cpp +++ b/modules/bullet/rigid_body_bullet.cpp @@ -264,6 +264,7 @@ RigidBodyBullet::RigidBodyBullet() : btRigidBody::btRigidBodyConstructionInfo cInfo(mass, godotMotionState, nullptr, localInertia); btBody = bulletnew(btRigidBody(cInfo)); + btBody->setFriction(1.0); reload_shapes(); setupBulletCollisionObject(btBody); diff --git a/modules/bullet/shape_bullet.cpp b/modules/bullet/shape_bullet.cpp index 340680c8d9..fdc2944dad 100644 --- a/modules/bullet/shape_bullet.cpp +++ b/modules/bullet/shape_bullet.cpp @@ -275,7 +275,7 @@ void CapsuleShapeBullet::setup(real_t p_height, real_t p_radius) { } btCollisionShape *CapsuleShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) { - return prepare(ShapeBullet::create_shape_capsule(radius * p_implicit_scale[0] + p_extra_edge, height * p_implicit_scale[1] + p_extra_edge)); + return prepare(ShapeBullet::create_shape_capsule(radius * p_implicit_scale[0] + p_extra_edge, height * p_implicit_scale[1])); } /* Cylinder */ diff --git a/modules/denoise/lightmap_denoiser.h b/modules/denoise/lightmap_denoiser.h index d01bbd10a5..74a9d8af86 100644 --- a/modules/denoise/lightmap_denoiser.h +++ b/modules/denoise/lightmap_denoiser.h @@ -31,7 +31,7 @@ #ifndef LIGHTMAP_DENOISER_H #define LIGHTMAP_DENOISER_H -#include "core/object.h" +#include "core/class_db.h" #include "scene/3d/lightmapper.h" struct OIDNDeviceImpl; diff --git a/modules/gdnative/xr/config.py b/modules/gdnative/xr/config.py deleted file mode 100644 index d22f9454ed..0000000000 --- a/modules/gdnative/xr/config.py +++ /dev/null @@ -1,6 +0,0 @@ -def can_build(env, platform): - return True - - -def configure(env): - pass diff --git a/modules/gdnavigation/rvo_agent.h b/modules/gdnavigation/rvo_agent.h index f5c579ba84..1ad9d3ed76 100644 --- a/modules/gdnavigation/rvo_agent.h +++ b/modules/gdnavigation/rvo_agent.h @@ -31,8 +31,9 @@ #ifndef RVO_AGENT_H #define RVO_AGENT_H -#include "core/object.h" +#include "core/class_db.h" #include "nav_rid.h" + #include <Agent.h> /** diff --git a/modules/gdscript/doc_classes/@GDScript.xml b/modules/gdscript/doc_classes/@GDScript.xml index fc27892099..e170667a30 100644 --- a/modules/gdscript/doc_classes/@GDScript.xml +++ b/modules/gdscript/doc_classes/@GDScript.xml @@ -7,6 +7,7 @@ List of core built-in GDScript functions. Math functions and other utilities. Everything else is provided by objects. (Keywords: builtin, built in, global functions.) </description> <tutorials> + <link title="Random number generation">https://docs.godotengine.org/en/latest/tutorials/math/random_number_generation.html</link> </tutorials> <methods> <method name="Color8"> diff --git a/modules/gdscript/gdscript_analyzer.cpp b/modules/gdscript/gdscript_analyzer.cpp index 943a49060f..5250115608 100644 --- a/modules/gdscript/gdscript_analyzer.cpp +++ b/modules/gdscript/gdscript_analyzer.cpp @@ -577,6 +577,12 @@ void GDScriptAnalyzer::resolve_class_interface(GDScriptParser::ClassNode *p_clas GDScriptParser::DataType datatype = member.constant->get_datatype(); if (member.constant->initializer) { + if (member.constant->initializer->type == GDScriptParser::Node::ARRAY) { + const_fold_array(static_cast<GDScriptParser::ArrayNode *>(member.constant->initializer)); + } else if (member.constant->initializer->type == GDScriptParser::Node::DICTIONARY) { + const_fold_dictionary(static_cast<GDScriptParser::DictionaryNode *>(member.constant->initializer)); + } + if (!member.constant->initializer->is_constant) { push_error(R"(Initializer for a constant must be a constant expression.)", member.constant->initializer); } @@ -1113,6 +1119,11 @@ void GDScriptAnalyzer::resolve_constant(GDScriptParser::ConstantNode *p_constant GDScriptParser::DataType type; reduce_expression(p_constant->initializer); + if (p_constant->initializer->type == GDScriptParser::Node::ARRAY) { + const_fold_array(static_cast<GDScriptParser::ArrayNode *>(p_constant->initializer)); + } else if (p_constant->initializer->type == GDScriptParser::Node::DICTIONARY) { + const_fold_dictionary(static_cast<GDScriptParser::DictionaryNode *>(p_constant->initializer)); + } if (!p_constant->initializer->is_constant) { push_error(vformat(R"(Assigned value for constant "%s" isn't a constant expression.)", p_constant->identifier->name), p_constant->initializer); @@ -1422,22 +1433,9 @@ void GDScriptAnalyzer::reduce_expression(GDScriptParser::ExpressionNode *p_expre } void GDScriptAnalyzer::reduce_array(GDScriptParser::ArrayNode *p_array) { - bool all_is_constant = true; - for (int i = 0; i < p_array->elements.size(); i++) { GDScriptParser::ExpressionNode *element = p_array->elements[i]; reduce_expression(element); - all_is_constant = all_is_constant && element->is_constant; - } - - if (all_is_constant) { - Array array; - array.resize(p_array->elements.size()); - for (int i = 0; i < p_array->elements.size(); i++) { - array[i] = p_array->elements[i]->reduced_value; - } - p_array->is_constant = true; - p_array->reduced_value = array; } // It's array in any case. @@ -1984,8 +1982,6 @@ void GDScriptAnalyzer::reduce_cast(GDScriptParser::CastNode *p_cast) { } void GDScriptAnalyzer::reduce_dictionary(GDScriptParser::DictionaryNode *p_dictionary) { - bool all_is_constant = true; - HashMap<Variant, GDScriptParser::ExpressionNode *, VariantHasher, VariantComparator> elements; for (int i = 0; i < p_dictionary->elements.size(); i++) { @@ -1994,7 +1990,6 @@ void GDScriptAnalyzer::reduce_dictionary(GDScriptParser::DictionaryNode *p_dicti reduce_expression(element.key); } reduce_expression(element.value); - all_is_constant = all_is_constant && element.key->is_constant && element.value->is_constant; if (element.key->is_constant) { if (elements.has(element.key->reduced_value)) { @@ -2005,16 +2000,6 @@ void GDScriptAnalyzer::reduce_dictionary(GDScriptParser::DictionaryNode *p_dicti } } - if (all_is_constant) { - Dictionary dict; - for (int i = 0; i < p_dictionary->elements.size(); i++) { - const GDScriptParser::DictionaryNode::Pair &element = p_dictionary->elements[i]; - dict[element.key->reduced_value] = element.value->reduced_value; - } - p_dictionary->is_constant = true; - p_dictionary->reduced_value = dict; - } - // It's dictionary in any case. GDScriptParser::DataType dict_type; dict_type.type_source = GDScriptParser::DataType::ANNOTATED_EXPLICIT; @@ -2737,6 +2722,46 @@ void GDScriptAnalyzer::reduce_unary_op(GDScriptParser::UnaryOpNode *p_unary_op) p_unary_op->set_datatype(result); } +void GDScriptAnalyzer::const_fold_array(GDScriptParser::ArrayNode *p_array) { + bool all_is_constant = true; + + for (int i = 0; i < p_array->elements.size(); i++) { + GDScriptParser::ExpressionNode *element = p_array->elements[i]; + all_is_constant = all_is_constant && element->is_constant; + if (!all_is_constant) { + return; + } + } + + Array array; + array.resize(p_array->elements.size()); + for (int i = 0; i < p_array->elements.size(); i++) { + array[i] = p_array->elements[i]->reduced_value; + } + p_array->is_constant = true; + p_array->reduced_value = array; +} + +void GDScriptAnalyzer::const_fold_dictionary(GDScriptParser::DictionaryNode *p_dictionary) { + bool all_is_constant = true; + + for (int i = 0; i < p_dictionary->elements.size(); i++) { + const GDScriptParser::DictionaryNode::Pair &element = p_dictionary->elements[i]; + all_is_constant = all_is_constant && element.key->is_constant && element.value->is_constant; + if (!all_is_constant) { + return; + } + } + + Dictionary dict; + for (int i = 0; i < p_dictionary->elements.size(); i++) { + const GDScriptParser::DictionaryNode::Pair &element = p_dictionary->elements[i]; + dict[element.key->reduced_value] = element.value->reduced_value; + } + p_dictionary->is_constant = true; + p_dictionary->reduced_value = dict; +} + GDScriptParser::DataType GDScriptAnalyzer::type_from_variant(const Variant &p_value, const GDScriptParser::Node *p_source) { GDScriptParser::DataType result; result.is_constant = true; diff --git a/modules/gdscript/gdscript_analyzer.h b/modules/gdscript/gdscript_analyzer.h index c3911cce76..f3cbb320b7 100644 --- a/modules/gdscript/gdscript_analyzer.h +++ b/modules/gdscript/gdscript_analyzer.h @@ -89,6 +89,9 @@ class GDScriptAnalyzer { void reduce_ternary_op(GDScriptParser::TernaryOpNode *p_ternary_op); void reduce_unary_op(GDScriptParser::UnaryOpNode *p_unary_op); + void const_fold_array(GDScriptParser::ArrayNode *p_array); + void const_fold_dictionary(GDScriptParser::DictionaryNode *p_dictionary); + // Helpers. GDScriptParser::DataType type_from_variant(const Variant &p_value, const GDScriptParser::Node *p_source); GDScriptParser::DataType type_from_metatype(const GDScriptParser::DataType &p_meta_type) const; diff --git a/modules/gdscript/gdscript_byte_codegen.cpp b/modules/gdscript/gdscript_byte_codegen.cpp index 8f0ce99de6..cc9e87b882 100644 --- a/modules/gdscript/gdscript_byte_codegen.cpp +++ b/modules/gdscript/gdscript_byte_codegen.cpp @@ -529,6 +529,7 @@ void GDScriptByteCodeGenerator::write_construct(const Address &p_target, Variant append(p_arguments[i]); } append(p_target); + alloc_call(p_arguments.size()); } void GDScriptByteCodeGenerator::write_construct_array(const Address &p_target, const Vector<Address> &p_arguments) { @@ -579,8 +580,8 @@ void GDScriptByteCodeGenerator::write_endif() { } void GDScriptByteCodeGenerator::write_for(const Address &p_variable, const Address &p_list) { - int counter_pos = increase_stack() | (GDScriptFunction::ADDR_TYPE_STACK << GDScriptFunction::ADDR_BITS); - int container_pos = increase_stack() | (GDScriptFunction::ADDR_TYPE_STACK << GDScriptFunction::ADDR_BITS); + int counter_pos = add_temporary() | (GDScriptFunction::ADDR_TYPE_STACK << GDScriptFunction::ADDR_BITS); + int container_pos = add_temporary() | (GDScriptFunction::ADDR_TYPE_STACK << GDScriptFunction::ADDR_BITS); current_breaks_to_patch.push_back(List<int>()); @@ -628,7 +629,9 @@ void GDScriptByteCodeGenerator::write_endfor() { } current_breaks_to_patch.pop_back(); - current_stack_size -= 2; // Remove loop temporaries. + // Remove loop temporaries. + pop_temporary(); + pop_temporary(); } void GDScriptByteCodeGenerator::start_while_condition() { diff --git a/modules/gdscript/gdscript_compiler.h b/modules/gdscript/gdscript_compiler.h index db02079d26..fe34d6cba3 100644 --- a/modules/gdscript/gdscript_compiler.h +++ b/modules/gdscript/gdscript_compiler.h @@ -51,12 +51,11 @@ class GDScriptCompiler { GDScriptCodeGenerator *generator = nullptr; Map<StringName, GDScriptCodeGenerator::Address> parameters; Map<StringName, GDScriptCodeGenerator::Address> locals; - List<Set<StringName>> locals_in_scope; + List<Map<StringName, GDScriptCodeGenerator::Address>> locals_stack; GDScriptCodeGenerator::Address add_local(const StringName &p_name, const GDScriptDataType &p_type) { uint32_t addr = generator->add_local(p_name, p_type); locals[p_name] = GDScriptCodeGenerator::Address(GDScriptCodeGenerator::Address::LOCAL_VARIABLE, addr, p_type); - locals_in_scope.back()->get().insert(p_name); return locals[p_name]; } @@ -102,17 +101,14 @@ class GDScriptCompiler { } void start_block() { - Set<StringName> scope; - locals_in_scope.push_back(scope); + Map<StringName, GDScriptCodeGenerator::Address> old_locals = locals; + locals_stack.push_back(old_locals); generator->start_block(); } void end_block() { - Set<StringName> &scope = locals_in_scope.back()->get(); - for (Set<StringName>::Element *E = scope.front(); E; E = E->next()) { - locals.erase(E->get()); - } - locals_in_scope.pop_back(); + locals = locals_stack.back()->get(); + locals_stack.pop_back(); generator->end_block(); } }; diff --git a/modules/gdscript/gdscript_editor.cpp b/modules/gdscript/gdscript_editor.cpp index 2e372575da..aec05b6771 100644 --- a/modules/gdscript/gdscript_editor.cpp +++ b/modules/gdscript/gdscript_editor.cpp @@ -792,6 +792,9 @@ static void _find_identifiers_in_class(const GDScriptParser::ClassNode *p_class, continue; } option = ScriptCodeCompletionOption(member.constant->identifier->name, ScriptCodeCompletionOption::KIND_CONSTANT); + if (member.constant->initializer) { + option.default_value = member.constant->initializer->reduced_value; + } break; case GDScriptParser::ClassNode::Member::CLASS: if (p_only_functions) { @@ -2404,6 +2407,11 @@ Error GDScriptLanguage::complete_code(const String &p_code, const String &p_path Variant::get_constants_for_type(completion_context.builtin_type, &constants); for (const List<StringName>::Element *E = constants.front(); E != nullptr; E = E->next()) { ScriptCodeCompletionOption option(E->get(), ScriptCodeCompletionOption::KIND_CONSTANT); + bool valid = false; + Variant default_value = Variant::get_constant_value(completion_context.builtin_type, E->get(), &valid); + if (valid) { + option.default_value = default_value; + } options.insert(option.display, option); } } break; diff --git a/modules/gdscript/tests/test_gdscript.cpp b/modules/gdscript/tests/test_gdscript.cpp index 68d9984b43..931b683a44 100644 --- a/modules/gdscript/tests/test_gdscript.cpp +++ b/modules/gdscript/tests/test_gdscript.cpp @@ -30,10 +30,13 @@ #include "test_gdscript.h" +#include "core/io/file_access_pack.h" #include "core/os/file_access.h" #include "core/os/main_loop.h" #include "core/os/os.h" +#include "core/project_settings.h" #include "core/string_builder.h" +#include "scene/resources/packed_scene.h" #include "modules/gdscript/gdscript_analyzer.h" #include "modules/gdscript/gdscript_compiler.h" @@ -179,6 +182,60 @@ static void test_compiler(const String &p_code, const String &p_script_path, con } } +void init_autoloads() { + Map<StringName, ProjectSettings::AutoloadInfo> autoloads = ProjectSettings::get_singleton()->get_autoload_list(); + + // First pass, add the constants so they exist before any script is loaded. + for (Map<StringName, ProjectSettings::AutoloadInfo>::Element *E = autoloads.front(); E; E = E->next()) { + const ProjectSettings::AutoloadInfo &info = E->get(); + + if (info.is_singleton) { + for (int i = 0; i < ScriptServer::get_language_count(); i++) { + ScriptServer::get_language(i)->add_global_constant(info.name, Variant()); + } + } + } + + // Second pass, load into global constants. + for (Map<StringName, ProjectSettings::AutoloadInfo>::Element *E = autoloads.front(); E; E = E->next()) { + const ProjectSettings::AutoloadInfo &info = E->get(); + + if (!info.is_singleton) { + // Skip non-singletons since we don't have a scene tree here anyway. + continue; + } + + RES res = ResourceLoader::load(info.path); + ERR_CONTINUE_MSG(res.is_null(), "Can't autoload: " + info.path); + Node *n = nullptr; + if (res->is_class("PackedScene")) { + Ref<PackedScene> ps = res; + n = ps->instance(); + } else if (res->is_class("Script")) { + Ref<Script> script_res = res; + StringName ibt = script_res->get_instance_base_type(); + bool valid_type = ClassDB::is_parent_class(ibt, "Node"); + ERR_CONTINUE_MSG(!valid_type, "Script does not inherit a Node: " + info.path); + + Object *obj = ClassDB::instance(ibt); + + ERR_CONTINUE_MSG(obj == nullptr, + "Cannot instance script for autoload, expected 'Node' inheritance, got: " + + String(ibt)); + + n = Object::cast_to<Node>(obj); + n->set_script(script_res); + } + + ERR_CONTINUE_MSG(!n, "Path in autoload not a node or script: " + info.path); + n->set_name(info.name); + + for (int i = 0; i < ScriptServer::get_language_count(); i++) { + ScriptServer::get_language(i)->add_global_constant(info.name, n); + } + } +} + void test(TestType p_type) { List<String> cmdlargs = OS::get_singleton()->get_cmdline_args(); @@ -195,6 +252,21 @@ void test(TestType p_type) { FileAccessRef fa = FileAccess::open(test, FileAccess::READ); ERR_FAIL_COND_MSG(!fa, "Could not open file: " + test); + // Init PackedData since it's used by ProjectSettings. + PackedData *packed_data = memnew(PackedData); + + // Setup project settings since it's needed by the languages to get the global scripts. + // This also sets up the base resource path. + Error err = ProjectSettings::get_singleton()->setup(fa->get_path_absolute().get_base_dir(), String(), true); + if (err) { + print_line("Could not load project settings."); + // Keep going since some scripts still work without this. + } + + // Initialize the language for the test routine. + ScriptServer::init_languages(); + init_autoloads(); + Vector<uint8_t> buf; int flen = fa->get_len(); buf.resize(fa->get_len() + 1); @@ -226,6 +298,10 @@ void test(TestType p_type) { case TEST_BYTECODE: print_line("Not implemented."); } + + // Destroy stuff we set up earlier. + ScriptServer::finish_languages(); + memdelete(packed_data); } } // namespace TestGDScript diff --git a/modules/jsonrpc/jsonrpc.h b/modules/jsonrpc/jsonrpc.h index e2b7ab0975..6f3f8003e0 100644 --- a/modules/jsonrpc/jsonrpc.h +++ b/modules/jsonrpc/jsonrpc.h @@ -31,7 +31,7 @@ #ifndef GODOT_JSON_RPC_H #define GODOT_JSON_RPC_H -#include "core/object.h" +#include "core/class_db.h" #include "core/variant.h" class JSONRPC : public Object { diff --git a/modules/mono/csharp_script.cpp b/modules/mono/csharp_script.cpp index a05b38b8bf..70b731d611 100644 --- a/modules/mono/csharp_script.cpp +++ b/modules/mono/csharp_script.cpp @@ -975,7 +975,6 @@ void CSharpLanguage::reload_assemblies(bool p_soft_reload) { script->signals_invalidated = true; script->reload(p_soft_reload); - script->update_exports(); if (!script->valid) { script->pending_reload_instances.clear(); @@ -2955,13 +2954,24 @@ void CSharpScript::initialize_for_managed_type(Ref<CSharpScript> p_script, GDMon CRASH_COND(p_script->native == nullptr); + p_script->valid = true; + + update_script_class_info(p_script); + +#ifdef TOOLS_ENABLED + p_script->_update_member_info_no_exports(); +#endif +} + +// Extract information about the script using the mono class. +void CSharpScript::update_script_class_info(Ref<CSharpScript> p_script) { GDMonoClass *base = p_script->script_class->get_parent_class(); + // `base` should only be set if the script is a user defined type. if (base != p_script->native) { p_script->base = base; } - p_script->valid = true; p_script->tool = p_script->script_class->has_attribute(CACHED_CLASS(ToolAttribute)); if (!p_script->tool) { @@ -2996,17 +3006,74 @@ void CSharpScript::initialize_for_managed_type(Ref<CSharpScript> p_script, GDMon p_script->script_class->fetch_methods_with_godot_api_checks(p_script->native); - // Need to fetch method from base classes as well + p_script->rpc_functions.clear(); + p_script->rpc_variables.clear(); + GDMonoClass *top = p_script->script_class; while (top && top != p_script->native) { + // Fetch methods from base classes as well top->fetch_methods_with_godot_api_checks(p_script->native); + + // Update RPC info + { + Vector<GDMonoMethod *> methods = top->get_all_methods(); + for (int i = 0; i < methods.size(); i++) { + if (!methods[i]->is_static()) { + MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(methods[i]); + if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { + ScriptNetData nd; + nd.name = methods[i]->get_name(); + nd.mode = mode; + if (-1 == p_script->rpc_functions.find(nd)) { + p_script->rpc_functions.push_back(nd); + } + } + } + } + } + + { + Vector<GDMonoField *> fields = top->get_all_fields(); + for (int i = 0; i < fields.size(); i++) { + if (!fields[i]->is_static()) { + MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(fields[i]); + if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { + ScriptNetData nd; + nd.name = fields[i]->get_name(); + nd.mode = mode; + if (-1 == p_script->rpc_variables.find(nd)) { + p_script->rpc_variables.push_back(nd); + } + } + } + } + } + + { + Vector<GDMonoProperty *> properties = top->get_all_properties(); + for (int i = 0; i < properties.size(); i++) { + if (!properties[i]->is_static()) { + MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(properties[i]); + if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { + ScriptNetData nd; + nd.name = properties[i]->get_name(); + nd.mode = mode; + if (-1 == p_script->rpc_variables.find(nd)) { + p_script->rpc_variables.push_back(nd); + } + } + } + } + } + top = top->get_parent_class(); } + // Sort so we are 100% that they are always the same. + p_script->rpc_functions.sort_custom<SortNetData>(); + p_script->rpc_variables.sort_custom<SortNetData>(); + p_script->load_script_signals(p_script->script_class, p_script->native); -#ifdef TOOLS_ENABLED - p_script->_update_member_info_no_exports(); -#endif } bool CSharpScript::can_instance() const { @@ -3305,124 +3372,15 @@ Error CSharpScript::reload(bool p_keep_state) { print_verbose("Found class " + script_class->get_full_name() + " for script " + get_path()); #endif - tool = script_class->has_attribute(CACHED_CLASS(ToolAttribute)); - - if (!tool) { - GDMonoClass *nesting_class = script_class->get_nesting_class(); - tool = nesting_class && nesting_class->has_attribute(CACHED_CLASS(ToolAttribute)); - } - -#if TOOLS_ENABLED - if (!tool) { - tool = script_class->get_assembly() == GDMono::get_singleton()->get_tools_assembly(); - } -#endif - native = GDMonoUtils::get_class_native_base(script_class); CRASH_COND(native == nullptr); - GDMonoClass *base_class = script_class->get_parent_class(); - - if (base_class != native) { - base = base_class; - } - -#ifdef DEBUG_ENABLED - // For debug builds, we must fetch from all native base methods as well. - // Native base methods must be fetched before the current class. - // Not needed if the script class itself is a native class. + update_script_class_info(this); - if (script_class != native) { - GDMonoClass *native_top = native; - while (native_top) { - native_top->fetch_methods_with_godot_api_checks(native); - - if (native_top == CACHED_CLASS(GodotObject)) { - break; - } - - native_top = native_top->get_parent_class(); - } - } -#endif - - script_class->fetch_methods_with_godot_api_checks(native); - - // Need to fetch method from base classes as well - GDMonoClass *top = script_class; - while (top && top != native) { - top->fetch_methods_with_godot_api_checks(native); - top = top->get_parent_class(); - } - - load_script_signals(script_class, native); _update_exports(); } - rpc_functions.clear(); - rpc_variables.clear(); - - GDMonoClass *top = script_class; - while (top && top != native) { - { - Vector<GDMonoMethod *> methods = top->get_all_methods(); - for (int i = 0; i < methods.size(); i++) { - if (!methods[i]->is_static()) { - MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(methods[i]); - if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { - ScriptNetData nd; - nd.name = methods[i]->get_name(); - nd.mode = mode; - if (-1 == rpc_functions.find(nd)) { - rpc_functions.push_back(nd); - } - } - } - } - } - - { - Vector<GDMonoField *> fields = top->get_all_fields(); - for (int i = 0; i < fields.size(); i++) { - if (!fields[i]->is_static()) { - MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(fields[i]); - if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { - ScriptNetData nd; - nd.name = fields[i]->get_name(); - nd.mode = mode; - if (-1 == rpc_variables.find(nd)) { - rpc_variables.push_back(nd); - } - } - } - } - } - - { - Vector<GDMonoProperty *> properties = top->get_all_properties(); - for (int i = 0; i < properties.size(); i++) { - if (!properties[i]->is_static()) { - MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(properties[i]); - if (MultiplayerAPI::RPC_MODE_DISABLED != mode) { - ScriptNetData nd; - nd.name = properties[i]->get_name(); - nd.mode = mode; - if (-1 == rpc_variables.find(nd)) { - rpc_variables.push_back(nd); - } - } - } - } - } - - top = top->get_parent_class(); - } - - // Sort so we are 100% that they are always the same. - rpc_functions.sort_custom<SortNetData>(); - rpc_variables.sort_custom<SortNetData>(); - return OK; } diff --git a/modules/mono/csharp_script.h b/modules/mono/csharp_script.h index f0b43a40f9..cfe070a371 100644 --- a/modules/mono/csharp_script.h +++ b/modules/mono/csharp_script.h @@ -164,6 +164,7 @@ private: // Do not use unless you know what you are doing friend void GDMonoInternals::tie_managed_to_unmanaged(MonoObject *, Object *); static Ref<CSharpScript> create_for_managed_type(GDMonoClass *p_class, GDMonoClass *p_native); + static void update_script_class_info(Ref<CSharpScript> p_script); static void initialize_for_managed_type(Ref<CSharpScript> p_script, GDMonoClass *p_class, GDMonoClass *p_native); MultiplayerAPI::RPCMode _member_get_rpc_mode(IMonoClassMember *p_member) const; diff --git a/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec b/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec index 5b5cefe80e..ba68a4da43 100644 --- a/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec +++ b/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec @@ -17,6 +17,6 @@ <repository url="$projecturl$" /> </metadata> <files> - <file src="Sdk\**" target="Sdk" />\ + <file src="Sdk\**" target="Sdk" /> </files> </package> diff --git a/modules/mono/editor/GodotTools/GodotTools.BuildLogger/GodotBuildLogger.cs b/modules/mono/editor/GodotTools/GodotTools.BuildLogger/GodotBuildLogger.cs index 5edf72d63e..9b7b422276 100644 --- a/modules/mono/editor/GodotTools/GodotTools.BuildLogger/GodotBuildLogger.cs +++ b/modules/mono/editor/GodotTools/GodotTools.BuildLogger/GodotBuildLogger.cs @@ -15,14 +15,14 @@ namespace GodotTools.BuildLogger public void Initialize(IEventSource eventSource) { if (null == Parameters) - throw new LoggerException("Log directory was not set."); + throw new LoggerException("Log directory parameter not specified."); var parameters = Parameters.Split(new[] { ';' }); string logDir = parameters[0]; if (string.IsNullOrEmpty(logDir)) - throw new LoggerException("Log directory was not set."); + throw new LoggerException("Log directory parameter is empty."); if (parameters.Length > 1) throw new LoggerException("Too many parameters passed."); @@ -51,22 +51,31 @@ namespace GodotTools.BuildLogger { throw new LoggerException("Failed to create log file: " + ex.Message); } - else - { - // Unexpected failure - throw; - } + + // Unexpected failure + throw; } eventSource.ProjectStarted += eventSource_ProjectStarted; - eventSource.TaskStarted += eventSource_TaskStarted; + eventSource.ProjectFinished += eventSource_ProjectFinished; eventSource.MessageRaised += eventSource_MessageRaised; eventSource.WarningRaised += eventSource_WarningRaised; eventSource.ErrorRaised += eventSource_ErrorRaised; - eventSource.ProjectFinished += eventSource_ProjectFinished; } - void eventSource_ErrorRaised(object sender, BuildErrorEventArgs e) + private void eventSource_ProjectStarted(object sender, ProjectStartedEventArgs e) + { + WriteLine(e.Message); + indent++; + } + + private void eventSource_ProjectFinished(object sender, ProjectFinishedEventArgs e) + { + indent--; + WriteLine(e.Message); + } + + private void eventSource_ErrorRaised(object sender, BuildErrorEventArgs e) { string line = $"{e.File}({e.LineNumber},{e.ColumnNumber}): error {e.Code}: {e.Message}"; @@ -81,7 +90,7 @@ namespace GodotTools.BuildLogger issuesStreamWriter.WriteLine(errorLine); } - void eventSource_WarningRaised(object sender, BuildWarningEventArgs e) + private void eventSource_WarningRaised(object sender, BuildWarningEventArgs e) { string line = $"{e.File}({e.LineNumber},{e.ColumnNumber}): warning {e.Code}: {e.Message}"; @@ -108,40 +117,6 @@ namespace GodotTools.BuildLogger } } - private void eventSource_TaskStarted(object sender, TaskStartedEventArgs e) - { - // TaskStartedEventArgs adds ProjectFile, TaskFile, TaskName - // To keep this log clean, this logger will ignore these events. - } - - private void eventSource_ProjectStarted(object sender, ProjectStartedEventArgs e) - { - WriteLine(e.Message); - indent++; - } - - private void eventSource_ProjectFinished(object sender, ProjectFinishedEventArgs e) - { - indent--; - WriteLine(e.Message); - } - - /// <summary> - /// Write a line to the log, adding the SenderName - /// </summary> - private void WriteLineWithSender(string line, BuildEventArgs e) - { - if (0 == string.Compare(e.SenderName, "MSBuild", StringComparison.OrdinalIgnoreCase)) - { - // Well, if the sender name is MSBuild, let's leave it out for prettiness - WriteLine(line); - } - else - { - WriteLine(e.SenderName + ": " + line); - } - } - /// <summary> /// Write a line to the log, adding the SenderName and Message /// (these parameters are on all MSBuild event argument objects) diff --git a/modules/mono/editor/GodotTools/GodotTools/BottomPanel.cs b/modules/mono/editor/GodotTools/GodotTools/BottomPanel.cs deleted file mode 100644 index 3ab669a9f3..0000000000 --- a/modules/mono/editor/GodotTools/GodotTools/BottomPanel.cs +++ /dev/null @@ -1,339 +0,0 @@ -using Godot; -using System; -using System.IO; -using Godot.Collections; -using GodotTools.Internals; -using static GodotTools.Internals.Globals; -using File = GodotTools.Utils.File; -using Path = System.IO.Path; - -namespace GodotTools -{ - public class BottomPanel : VBoxContainer - { - private EditorInterface editorInterface; - - private TabContainer panelTabs; - - private VBoxContainer panelBuildsTab; - - private ItemList buildTabsList; - private TabContainer buildTabs; - - private Button warningsBtn; - private Button errorsBtn; - private Button viewLogBtn; - - private void _UpdateBuildTab(int index, int? currentTab) - { - var tab = (BuildTab)buildTabs.GetChild(index); - - string itemName = Path.GetFileNameWithoutExtension(tab.BuildInfo.Solution); - itemName += " [" + tab.BuildInfo.Configuration + "]"; - - buildTabsList.AddItem(itemName, tab.IconTexture); - - string itemTooltip = "Solution: " + tab.BuildInfo.Solution; - itemTooltip += "\nConfiguration: " + tab.BuildInfo.Configuration; - itemTooltip += "\nStatus: "; - - if (tab.BuildExited) - itemTooltip += tab.BuildResult == BuildTab.BuildResults.Success ? "Succeeded" : "Errored"; - else - itemTooltip += "Running"; - - if (!tab.BuildExited || tab.BuildResult == BuildTab.BuildResults.Error) - itemTooltip += $"\nErrors: {tab.ErrorCount}"; - - itemTooltip += $"\nWarnings: {tab.WarningCount}"; - - buildTabsList.SetItemTooltip(index, itemTooltip); - - // If this tab was already selected before the changes or if no tab was selected - if (currentTab == null || currentTab == index) - { - buildTabsList.Select(index); - _BuildTabsItemSelected(index); - } - } - - private void _UpdateBuildTabsList() - { - buildTabsList.Clear(); - - int? currentTab = buildTabs.CurrentTab; - - if (currentTab < 0 || currentTab >= buildTabs.GetTabCount()) - currentTab = null; - - for (int i = 0; i < buildTabs.GetChildCount(); i++) - _UpdateBuildTab(i, currentTab); - } - - public BuildTab GetBuildTabFor(BuildInfo buildInfo) - { - foreach (var buildTab in new Array<BuildTab>(buildTabs.GetChildren())) - { - if (buildTab.BuildInfo.Equals(buildInfo)) - return buildTab; - } - - var newBuildTab = new BuildTab(buildInfo); - AddBuildTab(newBuildTab); - - return newBuildTab; - } - - private void _BuildTabsItemSelected(int idx) - { - if (idx < 0 || idx >= buildTabs.GetTabCount()) - throw new IndexOutOfRangeException(); - - buildTabs.CurrentTab = idx; - if (!buildTabs.Visible) - buildTabs.Visible = true; - - warningsBtn.Visible = true; - errorsBtn.Visible = true; - viewLogBtn.Visible = true; - } - - private void _BuildTabsNothingSelected() - { - if (buildTabs.GetTabCount() != 0) - { - // just in case - buildTabs.Visible = false; - - // This callback is called when clicking on the empty space of the list. - // ItemList won't deselect the items automatically, so we must do it ourselves. - buildTabsList.UnselectAll(); - } - - warningsBtn.Visible = false; - errorsBtn.Visible = false; - viewLogBtn.Visible = false; - } - - private void _WarningsToggled(bool pressed) - { - int currentTab = buildTabs.CurrentTab; - - if (currentTab < 0 || currentTab >= buildTabs.GetTabCount()) - throw new InvalidOperationException("No tab selected"); - - var buildTab = (BuildTab)buildTabs.GetChild(currentTab); - buildTab.WarningsVisible = pressed; - buildTab.UpdateIssuesList(); - } - - private void _ErrorsToggled(bool pressed) - { - int currentTab = buildTabs.CurrentTab; - - if (currentTab < 0 || currentTab >= buildTabs.GetTabCount()) - throw new InvalidOperationException("No tab selected"); - - var buildTab = (BuildTab)buildTabs.GetChild(currentTab); - buildTab.ErrorsVisible = pressed; - buildTab.UpdateIssuesList(); - } - - public void BuildProjectPressed() - { - if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) - return; // No solution to build - - string editorScriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, "scripts_metadata.editor"); - string playerScriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, "scripts_metadata.editor_player"); - - CsProjOperations.GenerateScriptsMetadata(GodotSharpDirs.ProjectCsProjPath, editorScriptsMetadataPath); - - if (File.Exists(editorScriptsMetadataPath)) - { - try - { - File.Copy(editorScriptsMetadataPath, playerScriptsMetadataPath); - } - catch (IOException e) - { - GD.PushError($"Failed to copy scripts metadata file. Exception message: {e.Message}"); - return; - } - } - - bool buildSuccess = BuildManager.BuildProjectBlocking("Debug"); - - if (!buildSuccess) - return; - - // Notify running game for hot-reload - Internal.EditorDebuggerNodeReloadScripts(); - - // Hot-reload in the editor - GodotSharpEditor.Instance.GetNode<HotReloadAssemblyWatcher>("HotReloadAssemblyWatcher").RestartTimer(); - - if (Internal.IsAssembliesReloadingNeeded()) - Internal.ReloadAssemblies(softReload: false); - } - - private void _ViewLogPressed() - { - if (!buildTabsList.IsAnythingSelected()) - return; - - var selectedItems = buildTabsList.GetSelectedItems(); - - if (selectedItems.Length != 1) - throw new InvalidOperationException($"Expected 1 selected item, got {selectedItems.Length}"); - - int selectedItem = selectedItems[0]; - - var buildTab = (BuildTab)buildTabs.GetTabControl(selectedItem); - - OS.ShellOpen(Path.Combine(buildTab.BuildInfo.LogsDirPath, BuildManager.MsBuildLogFileName)); - } - - public override void _Notification(int what) - { - base._Notification(what); - - if (what == EditorSettings.NotificationEditorSettingsChanged) - { - var editorBaseControl = editorInterface.GetBaseControl(); - panelTabs.AddThemeStyleboxOverride("panel", editorBaseControl.GetThemeStylebox("DebuggerPanel", "EditorStyles")); - panelTabs.AddThemeStyleboxOverride("tab_fg", editorBaseControl.GetThemeStylebox("DebuggerTabFG", "EditorStyles")); - panelTabs.AddThemeStyleboxOverride("tab_bg", editorBaseControl.GetThemeStylebox("DebuggerTabBG", "EditorStyles")); - } - } - - public void AddBuildTab(BuildTab buildTab) - { - buildTabs.AddChild(buildTab); - RaiseBuildTab(buildTab); - } - - public void RaiseBuildTab(BuildTab buildTab) - { - if (buildTab.GetParent() != buildTabs) - throw new InvalidOperationException("Build tab is not in the tabs list"); - - buildTabs.MoveChild(buildTab, 0); - _UpdateBuildTabsList(); - } - - public void ShowBuildTab() - { - for (int i = 0; i < panelTabs.GetTabCount(); i++) - { - if (panelTabs.GetTabControl(i) == panelBuildsTab) - { - panelTabs.CurrentTab = i; - GodotSharpEditor.Instance.MakeBottomPanelItemVisible(this); - return; - } - } - - GD.PushError("Builds tab not found"); - } - - public override void _Ready() - { - base._Ready(); - - editorInterface = GodotSharpEditor.Instance.GetEditorInterface(); - - var editorBaseControl = editorInterface.GetBaseControl(); - - SizeFlagsVertical = (int)SizeFlags.ExpandFill; - SetAnchorsAndMarginsPreset(LayoutPreset.Wide); - - panelTabs = new TabContainer - { - TabAlign = TabContainer.TabAlignEnum.Left, - RectMinSize = new Vector2(0, 228) * EditorScale, - SizeFlagsVertical = (int)SizeFlags.ExpandFill - }; - panelTabs.AddThemeStyleboxOverride("panel", editorBaseControl.GetThemeStylebox("DebuggerPanel", "EditorStyles")); - panelTabs.AddThemeStyleboxOverride("tab_fg", editorBaseControl.GetThemeStylebox("DebuggerTabFG", "EditorStyles")); - panelTabs.AddThemeStyleboxOverride("tab_bg", editorBaseControl.GetThemeStylebox("DebuggerTabBG", "EditorStyles")); - AddChild(panelTabs); - - { - // Builds tab - panelBuildsTab = new VBoxContainer - { - Name = "Builds".TTR(), - SizeFlagsHorizontal = (int)SizeFlags.ExpandFill - }; - panelTabs.AddChild(panelBuildsTab); - - var toolBarHBox = new HBoxContainer {SizeFlagsHorizontal = (int)SizeFlags.ExpandFill}; - panelBuildsTab.AddChild(toolBarHBox); - - var buildProjectBtn = new Button - { - Text = "Build Project".TTR(), - FocusMode = FocusModeEnum.None - }; - buildProjectBtn.PressedSignal += BuildProjectPressed; - toolBarHBox.AddChild(buildProjectBtn); - - toolBarHBox.AddSpacer(begin: false); - - warningsBtn = new Button - { - Text = "Warnings".TTR(), - ToggleMode = true, - Pressed = true, - Visible = false, - FocusMode = FocusModeEnum.None - }; - warningsBtn.Toggled += _WarningsToggled; - toolBarHBox.AddChild(warningsBtn); - - errorsBtn = new Button - { - Text = "Errors".TTR(), - ToggleMode = true, - Pressed = true, - Visible = false, - FocusMode = FocusModeEnum.None - }; - errorsBtn.Toggled += _ErrorsToggled; - toolBarHBox.AddChild(errorsBtn); - - toolBarHBox.AddSpacer(begin: false); - - viewLogBtn = new Button - { - Text = "View log".TTR(), - FocusMode = FocusModeEnum.None, - Visible = false - }; - viewLogBtn.PressedSignal += _ViewLogPressed; - toolBarHBox.AddChild(viewLogBtn); - - var hsc = new HSplitContainer - { - SizeFlagsHorizontal = (int)SizeFlags.ExpandFill, - SizeFlagsVertical = (int)SizeFlags.ExpandFill - }; - panelBuildsTab.AddChild(hsc); - - buildTabsList = new ItemList {SizeFlagsHorizontal = (int)SizeFlags.ExpandFill}; - buildTabsList.ItemSelected += _BuildTabsItemSelected; - buildTabsList.NothingSelected += _BuildTabsNothingSelected; - hsc.AddChild(buildTabsList); - - buildTabs = new TabContainer - { - TabAlign = TabContainer.TabAlignEnum.Left, - SizeFlagsHorizontal = (int)SizeFlags.ExpandFill, - TabsVisible = false - }; - hsc.AddChild(buildTabs); - } - } - } -} diff --git a/modules/mono/editor/GodotTools/GodotTools/BuildInfo.cs b/modules/mono/editor/GodotTools/GodotTools/Build/BuildInfo.cs index ab090c46e7..51055dc9b9 100644 --- a/modules/mono/editor/GodotTools/GodotTools/BuildInfo.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Build/BuildInfo.cs @@ -4,7 +4,7 @@ using Godot.Collections; using GodotTools.Internals; using Path = System.IO.Path; -namespace GodotTools +namespace GodotTools.Build { [Serializable] public sealed class BuildInfo : Reference // TODO Remove Reference once we have proper serialization @@ -20,7 +20,9 @@ namespace GodotTools public override bool Equals(object obj) { if (obj is BuildInfo other) - return other.Solution == Solution && other.Configuration == Configuration; + return other.Solution == Solution && other.Targets == Targets && + other.Configuration == Configuration && other.Restore == Restore && + other.CustomProperties == CustomProperties && other.LogsDirPath == LogsDirPath; return false; } @@ -31,7 +33,11 @@ namespace GodotTools { int hash = 17; hash = hash * 29 + Solution.GetHashCode(); + hash = hash * 29 + Targets.GetHashCode(); hash = hash * 29 + Configuration.GetHashCode(); + hash = hash * 29 + Restore.GetHashCode(); + hash = hash * 29 + CustomProperties.GetHashCode(); + hash = hash * 29 + LogsDirPath.GetHashCode(); return hash; } } diff --git a/modules/mono/editor/GodotTools/GodotTools/BuildManager.cs b/modules/mono/editor/GodotTools/GodotTools/Build/BuildManager.cs index ff7ce97c47..9b512d90f5 100644 --- a/modules/mono/editor/GodotTools/GodotTools/BuildManager.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Build/BuildManager.cs @@ -1,20 +1,19 @@ using System; -using System.Collections.Generic; using System.IO; using System.Threading.Tasks; -using GodotTools.Build; using GodotTools.Ides.Rider; using GodotTools.Internals; -using GodotTools.Utils; using JetBrains.Annotations; using static GodotTools.Internals.Globals; using File = GodotTools.Utils.File; +using OS = GodotTools.Utils.OS; +using Path = System.IO.Path; -namespace GodotTools +namespace GodotTools.Build { public static class BuildManager { - private static readonly List<BuildInfo> BuildsInProgress = new List<BuildInfo>(); + private static BuildInfo _buildInProgress; public const string PropNameMSBuildMono = "MSBuild (Mono)"; public const string PropNameMSBuildVs = "MSBuild (VS Build Tools)"; @@ -24,6 +23,14 @@ namespace GodotTools public const string MsBuildIssuesFileName = "msbuild_issues.csv"; public const string MsBuildLogFileName = "msbuild_log.txt"; + public delegate void BuildLaunchFailedEventHandler(BuildInfo buildInfo, string reason); + + public static event BuildLaunchFailedEventHandler BuildLaunchFailed; + public static event Action<BuildInfo> BuildStarted; + public static event Action<BuildResult> BuildFinished; + public static event Action<string> StdOutputReceived; + public static event Action<string> StdErrorReceived; + private static void RemoveOldIssuesFile(BuildInfo buildInfo) { var issuesFile = GetIssuesFilePath(buildInfo); @@ -36,12 +43,13 @@ namespace GodotTools private static void ShowBuildErrorDialog(string message) { - GodotSharpEditor.Instance.ShowErrorDialog(message, "Build error"); - GodotSharpEditor.Instance.BottomPanel.ShowBuildTab(); + var plugin = GodotSharpEditor.Instance; + plugin.ShowErrorDialog(message, "Build error"); + plugin.MakeBottomPanelItemVisible(plugin.MSBuildPanel); } - public static void RestartBuild(BuildTab buildTab) => throw new NotImplementedException(); - public static void StopBuild(BuildTab buildTab) => throw new NotImplementedException(); + public static void RestartBuild(BuildOutputView buildOutputView) => throw new NotImplementedException(); + public static void StopBuild(BuildOutputView buildOutputView) => throw new NotImplementedException(); private static string GetLogFilePath(BuildInfo buildInfo) { @@ -61,15 +69,14 @@ namespace GodotTools public static bool Build(BuildInfo buildInfo) { - if (BuildsInProgress.Contains(buildInfo)) + if (_buildInProgress != null) throw new InvalidOperationException("A build is already in progress"); - BuildsInProgress.Add(buildInfo); + _buildInProgress = buildInfo; try { - BuildTab buildTab = GodotSharpEditor.Instance.BottomPanel.GetBuildTabFor(buildInfo); - buildTab.OnBuildStart(); + BuildStarted?.Invoke(buildInfo); // Required in order to update the build tasks list Internal.GodotMainIteration(); @@ -80,44 +87,44 @@ namespace GodotTools } catch (IOException e) { - buildTab.OnBuildExecFailed($"Cannot remove issues file: {GetIssuesFilePath(buildInfo)}"); + BuildLaunchFailed?.Invoke(buildInfo, $"Cannot remove issues file: {GetIssuesFilePath(buildInfo)}"); Console.Error.WriteLine(e); } try { - int exitCode = BuildSystem.Build(buildInfo); + int exitCode = BuildSystem.Build(buildInfo, StdOutputReceived, StdErrorReceived); if (exitCode != 0) PrintVerbose($"MSBuild exited with code: {exitCode}. Log file: {GetLogFilePath(buildInfo)}"); - buildTab.OnBuildExit(exitCode == 0 ? BuildTab.BuildResults.Success : BuildTab.BuildResults.Error); + BuildFinished?.Invoke(exitCode == 0 ? BuildResult.Success : BuildResult.Error); return exitCode == 0; } catch (Exception e) { - buildTab.OnBuildExecFailed($"The build method threw an exception.\n{e.GetType().FullName}: {e.Message}"); + BuildLaunchFailed?.Invoke(buildInfo, $"The build method threw an exception.\n{e.GetType().FullName}: {e.Message}"); Console.Error.WriteLine(e); return false; } } finally { - BuildsInProgress.Remove(buildInfo); + _buildInProgress = null; } } public static async Task<bool> BuildAsync(BuildInfo buildInfo) { - if (BuildsInProgress.Contains(buildInfo)) + if (_buildInProgress != null) throw new InvalidOperationException("A build is already in progress"); - BuildsInProgress.Add(buildInfo); + _buildInProgress = buildInfo; try { - BuildTab buildTab = GodotSharpEditor.Instance.BottomPanel.GetBuildTabFor(buildInfo); + BuildStarted?.Invoke(buildInfo); try { @@ -125,43 +132,57 @@ namespace GodotTools } catch (IOException e) { - buildTab.OnBuildExecFailed($"Cannot remove issues file: {GetIssuesFilePath(buildInfo)}"); + BuildLaunchFailed?.Invoke(buildInfo, $"Cannot remove issues file: {GetIssuesFilePath(buildInfo)}"); Console.Error.WriteLine(e); } try { - int exitCode = await BuildSystem.BuildAsync(buildInfo); + int exitCode = await BuildSystem.BuildAsync(buildInfo, StdOutputReceived, StdErrorReceived); if (exitCode != 0) PrintVerbose($"MSBuild exited with code: {exitCode}. Log file: {GetLogFilePath(buildInfo)}"); - buildTab.OnBuildExit(exitCode == 0 ? BuildTab.BuildResults.Success : BuildTab.BuildResults.Error); + BuildFinished?.Invoke(exitCode == 0 ? BuildResult.Success : BuildResult.Error); return exitCode == 0; } catch (Exception e) { - buildTab.OnBuildExecFailed($"The build method threw an exception.\n{e.GetType().FullName}: {e.Message}"); + BuildLaunchFailed?.Invoke(buildInfo, $"The build method threw an exception.\n{e.GetType().FullName}: {e.Message}"); Console.Error.WriteLine(e); return false; } } finally { - BuildsInProgress.Remove(buildInfo); + _buildInProgress = null; } } - public static bool BuildProjectBlocking(string config, [CanBeNull] string platform = null) + public static bool BuildProjectBlocking(string config, [CanBeNull] string[] targets = null, [CanBeNull] string platform = null) { - if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) + var buildInfo = new BuildInfo(GodotSharpDirs.ProjectSlnPath, targets ?? new[] {"Build"}, config, restore: true); + + // If a platform was not specified, try determining the current one. If that fails, let MSBuild auto-detect it. + if (platform != null || OS.PlatformNameMap.TryGetValue(Godot.OS.GetName(), out platform)) + buildInfo.CustomProperties.Add($"GodotTargetPlatform={platform}"); + + if (Internal.GodotIsRealTDouble()) + buildInfo.CustomProperties.Add("GodotRealTIsDouble=true"); + + return BuildProjectBlocking(buildInfo); + } + + private static bool BuildProjectBlocking(BuildInfo buildInfo) + { + if (!File.Exists(buildInfo.Solution)) return true; // No solution to build // Make sure the API assemblies are up to date before building the project. // We may not have had the chance to update the release API assemblies, and the debug ones // may have been deleted by the user at some point after they were loaded by the Godot editor. - string apiAssembliesUpdateError = Internal.UpdateApiAssembliesFromPrebuilt(config == "ExportRelease" ? "Release" : "Debug"); + string apiAssembliesUpdateError = Internal.UpdateApiAssembliesFromPrebuilt(buildInfo.Configuration == "ExportRelease" ? "Release" : "Debug"); if (!string.IsNullOrEmpty(apiAssembliesUpdateError)) { @@ -173,15 +194,6 @@ namespace GodotTools { pr.Step("Building project solution", 0); - var buildInfo = new BuildInfo(GodotSharpDirs.ProjectSlnPath, targets: new[] {"Build"}, config, restore: true); - - // If a platform was not specified, try determining the current one. If that fails, let MSBuild auto-detect it. - if (platform != null || OS.PlatformNameMap.TryGetValue(Godot.OS.GetName(), out platform)) - buildInfo.CustomProperties.Add($"GodotTargetPlatform={platform}"); - - if (Internal.GodotIsRealTDouble()) - buildInfo.CustomProperties.Add("GodotRealTIsDouble=true"); - if (!Build(buildInfo)) { ShowBuildErrorDialog("Failed to build project solution"); @@ -197,18 +209,41 @@ namespace GodotTools if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) return true; // No solution to build + GenerateEditorScriptMetadata(); + + if (GodotSharpEditor.Instance.SkipBuildBeforePlaying) + return true; // Requested play from an external editor/IDE which already built the project + + return BuildProjectBlocking("Debug"); + } + + // NOTE: This will be replaced with C# source generators in 4.0 + public static void GenerateEditorScriptMetadata() + { string editorScriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, "scripts_metadata.editor"); string playerScriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, "scripts_metadata.editor_player"); CsProjOperations.GenerateScriptsMetadata(GodotSharpDirs.ProjectCsProjPath, editorScriptsMetadataPath); - if (File.Exists(editorScriptsMetadataPath)) - File.Copy(editorScriptsMetadataPath, playerScriptsMetadataPath); + if (!File.Exists(editorScriptsMetadataPath)) + return; - if (GodotSharpEditor.Instance.SkipBuildBeforePlaying) - return true; // Requested play from an external editor/IDE which already built the project + try + { + File.Copy(editorScriptsMetadataPath, playerScriptsMetadataPath); + } + catch (IOException e) + { + throw new IOException("Failed to copy scripts metadata file.", innerException: e); + } + } - return BuildProjectBlocking("Debug"); + // NOTE: This will be replaced with C# source generators in 4.0 + public static string GenerateExportedGameScriptMetadata(bool isDebug) + { + string scriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, $"scripts_metadata.{(isDebug ? "debug" : "release")}"); + CsProjOperations.GenerateScriptsMetadata(GodotSharpDirs.ProjectCsProjPath, scriptsMetadataPath); + return scriptsMetadataPath; } public static void Initialize() @@ -254,8 +289,6 @@ namespace GodotTools ["hint"] = Godot.PropertyHint.Enum, ["hint_string"] = hintString }); - - EditorDef("mono/builds/print_build_output", false); } } } diff --git a/modules/mono/editor/GodotTools/GodotTools/BuildTab.cs b/modules/mono/editor/GodotTools/GodotTools/Build/BuildOutputView.cs index 8596cd24af..9514cc9622 100644 --- a/modules/mono/editor/GodotTools/GodotTools/BuildTab.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Build/BuildOutputView.cs @@ -5,16 +5,10 @@ using GodotTools.Internals; using File = GodotTools.Utils.File; using Path = System.IO.Path; -namespace GodotTools +namespace GodotTools.Build { - public class BuildTab : VBoxContainer + public class BuildOutputView : VBoxContainer, ISerializationListener { - public enum BuildResults - { - Error, - Success - } - [Serializable] private class BuildIssue : Reference // TODO Remove Reference once we have proper serialization { @@ -29,10 +23,14 @@ namespace GodotTools private readonly Array<BuildIssue> issues = new Array<BuildIssue>(); // TODO Use List once we have proper serialization private ItemList issuesList; + private TextEdit buildLog; + private PopupMenu issuesListContextMenu; - public bool BuildExited { get; private set; } = false; + [Signal] public event Action BuildStateChanged; - public BuildResults? BuildResult { get; private set; } = null; + public bool HasBuildExited { get; private set; } = false; + + public BuildResult? BuildResult { get; private set; } = null; public int ErrorCount { get; private set; } = 0; @@ -41,23 +39,31 @@ namespace GodotTools public bool ErrorsVisible { get; set; } = true; public bool WarningsVisible { get; set; } = true; - public Texture2D IconTexture + public Texture2D BuildStateIcon { get { - if (!BuildExited) + if (!HasBuildExited) return GetThemeIcon("Stop", "EditorIcons"); - if (BuildResult == BuildResults.Error) - return GetThemeIcon("StatusError", "EditorIcons"); + if (BuildResult == Build.BuildResult.Error) + return GetThemeIcon("Error", "EditorIcons"); + + if (WarningCount > 1) + return GetThemeIcon("Warning", "EditorIcons"); - return GetThemeIcon("StatusSuccess", "EditorIcons"); + return null; } } - public BuildInfo BuildInfo { get; private set; } + private BuildInfo BuildInfo { get; set; } - private void _LoadIssuesFromFile(string csvFile) + public bool LogVisible + { + set => buildLog.Visible = value; + } + + private void LoadIssuesFromFile(string csvFile) { using (var file = new Godot.File()) { @@ -107,7 +113,7 @@ namespace GodotTools } } - private void _IssueActivated(int idx) + private void IssueActivated(int idx) { if (idx < 0 || idx >= issuesList.GetItemCount()) throw new IndexOutOfRangeException("Item list index out of range"); @@ -190,49 +196,79 @@ namespace GodotTools } } - public void OnBuildStart() + private void BuildLaunchFailed(BuildInfo buildInfo, string cause) + { + HasBuildExited = true; + BuildResult = Build.BuildResult.Error; + + issuesList.Clear(); + + var issue = new BuildIssue {Message = cause, Warning = false}; + + ErrorCount += 1; + issues.Add(issue); + + UpdateIssuesList(); + + EmitSignal(nameof(BuildStateChanged)); + } + + private void BuildStarted(BuildInfo buildInfo) { - BuildExited = false; + BuildInfo = buildInfo; + HasBuildExited = false; issues.Clear(); WarningCount = 0; ErrorCount = 0; + buildLog.Text = string.Empty; + UpdateIssuesList(); - GodotSharpEditor.Instance.BottomPanel.RaiseBuildTab(this); + EmitSignal(nameof(BuildStateChanged)); } - public void OnBuildExit(BuildResults result) + private void BuildFinished(BuildResult result) { - BuildExited = true; + HasBuildExited = true; BuildResult = result; - _LoadIssuesFromFile(Path.Combine(BuildInfo.LogsDirPath, BuildManager.MsBuildIssuesFileName)); + LoadIssuesFromFile(Path.Combine(BuildInfo.LogsDirPath, BuildManager.MsBuildIssuesFileName)); + UpdateIssuesList(); - GodotSharpEditor.Instance.BottomPanel.RaiseBuildTab(this); + EmitSignal(nameof(BuildStateChanged)); } - public void OnBuildExecFailed(string cause) + private void StdOutputReceived(string text) { - BuildExited = true; - BuildResult = BuildResults.Error; - - issuesList.Clear(); + buildLog.Text += text + "\n"; + ScrollToLastNonEmptyLogLine(); + } - var issue = new BuildIssue { Message = cause, Warning = false }; + private void StdErrorReceived(string text) + { + buildLog.Text += text + "\n"; + ScrollToLastNonEmptyLogLine(); + } - ErrorCount += 1; - issues.Add(issue); + private void ScrollToLastNonEmptyLogLine() + { + int line; + for (line = buildLog.GetLineCount(); line > 0; line--) + { + string lineText = buildLog.GetLine(line); - UpdateIssuesList(); + if (!string.IsNullOrEmpty(lineText) || !string.IsNullOrEmpty(lineText?.Trim())) + break; + } - GodotSharpEditor.Instance.BottomPanel.RaiseBuildTab(this); + buildLog.CursorSetLine(line); } public void RestartBuild() { - if (!BuildExited) + if (!HasBuildExited) throw new InvalidOperationException("Build already started"); BuildManager.RestartBuild(this); @@ -240,28 +276,118 @@ namespace GodotTools public void StopBuild() { - if (!BuildExited) + if (!HasBuildExited) throw new InvalidOperationException("Build is not in progress"); BuildManager.StopBuild(this); } + private enum IssuesContextMenuOption + { + Copy + } + + private void IssuesListContextOptionPressed(int id) + { + switch ((IssuesContextMenuOption)id) + { + case IssuesContextMenuOption.Copy: + { + // We don't allow multi-selection but just in case that changes later... + string text = null; + + foreach (int issueIndex in issuesList.GetSelectedItems()) + { + if (text != null) + text += "\n"; + text += issuesList.GetItemText(issueIndex); + } + + if (text != null) + DisplayServer.ClipboardSet(text); + break; + } + default: + throw new ArgumentOutOfRangeException(nameof(id), id, "Invalid issue context menu option"); + } + } + + private void IssuesListRmbSelected(int index, Vector2 atPosition) + { + _ = index; // Unused + + issuesListContextMenu.Clear(); + issuesListContextMenu.Size = new Vector2i(1, 1); + + if (issuesList.IsAnythingSelected()) + { + // Add menu entries for the selected item + issuesListContextMenu.AddIconItem(GetThemeIcon("ActionCopy", "EditorIcons"), + label: "Copy Error".TTR(), (int)IssuesContextMenuOption.Copy); + } + + if (issuesListContextMenu.GetItemCount() > 0) + { + issuesListContextMenu.Position = (Vector2i)(issuesList.RectGlobalPosition + atPosition); + issuesListContextMenu.Popup(); + } + } + public override void _Ready() { base._Ready(); - issuesList = new ItemList { SizeFlagsVertical = (int)SizeFlags.ExpandFill }; - issuesList.ItemActivated += _IssueActivated; - AddChild(issuesList); + SizeFlagsVertical = (int)SizeFlags.ExpandFill; + + var hsc = new HSplitContainer + { + SizeFlagsHorizontal = (int)SizeFlags.ExpandFill, + SizeFlagsVertical = (int)SizeFlags.ExpandFill + }; + AddChild(hsc); + + issuesList = new ItemList + { + SizeFlagsVertical = (int)SizeFlags.ExpandFill, + SizeFlagsHorizontal = (int)SizeFlags.ExpandFill // Avoid being squashed by the build log + }; + issuesList.ItemActivated += IssueActivated; + issuesList.AllowRmbSelect = true; + issuesList.ItemRmbSelected += IssuesListRmbSelected; + hsc.AddChild(issuesList); + + issuesListContextMenu = new PopupMenu(); + issuesListContextMenu.IdPressed += IssuesListContextOptionPressed; + issuesList.AddChild(issuesListContextMenu); + + buildLog = new TextEdit + { + Readonly = true, + SizeFlagsVertical = (int)SizeFlags.ExpandFill, + SizeFlagsHorizontal = (int)SizeFlags.ExpandFill // Avoid being squashed by the issues list + }; + hsc.AddChild(buildLog); + + AddBuildEventListeners(); } - private BuildTab() + private void AddBuildEventListeners() { + BuildManager.BuildLaunchFailed += BuildLaunchFailed; + BuildManager.BuildStarted += BuildStarted; + BuildManager.BuildFinished += BuildFinished; + // StdOutput/Error can be received from different threads, so we need to use CallDeferred + BuildManager.StdOutputReceived += line => CallDeferred(nameof(StdOutputReceived), line); + BuildManager.StdErrorReceived += line => CallDeferred(nameof(StdErrorReceived), line); } - public BuildTab(BuildInfo buildInfo) + public void OnBeforeSerialize() { - BuildInfo = buildInfo; + } + + public void OnAfterDeserialize() + { + AddBuildEventListeners(); // Re-add them } } } diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/BuildResult.cs b/modules/mono/editor/GodotTools/GodotTools/Build/BuildResult.cs new file mode 100644 index 0000000000..59055b60c3 --- /dev/null +++ b/modules/mono/editor/GodotTools/GodotTools/Build/BuildResult.cs @@ -0,0 +1,8 @@ +namespace GodotTools.Build +{ + public enum BuildResult + { + Error, + Success + } +} diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/BuildSystem.cs b/modules/mono/editor/GodotTools/GodotTools/Build/BuildSystem.cs index d9862ae361..bac7a2e6db 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Build/BuildSystem.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Build/BuildSystem.cs @@ -44,10 +44,7 @@ namespace GodotTools.Build } } - private static bool PrintBuildOutput => - (bool)EditorSettings.GetSetting("mono/builds/print_build_output"); - - private static Process LaunchBuild(BuildInfo buildInfo) + private static Process LaunchBuild(BuildInfo buildInfo, Action<string> stdOutHandler, Action<string> stdErrHandler) { (string msbuildPath, BuildTool buildTool) = MsBuildFinder.FindMsBuild(); @@ -58,13 +55,13 @@ namespace GodotTools.Build var startInfo = new ProcessStartInfo(msbuildPath, compilerArgs); - bool redirectOutput = !IsDebugMsBuildRequested() && !PrintBuildOutput; - - if (!redirectOutput || Godot.OS.IsStdoutVerbose()) - Console.WriteLine($"Running: \"{startInfo.FileName}\" {startInfo.Arguments}"); + string launchMessage = $"Running: \"{startInfo.FileName}\" {startInfo.Arguments}"; + stdOutHandler?.Invoke(launchMessage); + if (Godot.OS.IsStdoutVerbose()) + Console.WriteLine(launchMessage); - startInfo.RedirectStandardOutput = redirectOutput; - startInfo.RedirectStandardError = redirectOutput; + startInfo.RedirectStandardOutput = true; + startInfo.RedirectStandardError = true; startInfo.UseShellExecute = false; if (UsingMonoMsBuildOnWindows) @@ -82,20 +79,22 @@ namespace GodotTools.Build var process = new Process {StartInfo = startInfo}; + if (stdOutHandler != null) + process.OutputDataReceived += (s, e) => stdOutHandler.Invoke(e.Data); + if (stdErrHandler != null) + process.ErrorDataReceived += (s, e) => stdErrHandler.Invoke(e.Data); + process.Start(); - if (redirectOutput) - { - process.BeginOutputReadLine(); - process.BeginErrorReadLine(); - } + process.BeginOutputReadLine(); + process.BeginErrorReadLine(); return process; } - public static int Build(BuildInfo buildInfo) + public static int Build(BuildInfo buildInfo, Action<string> stdOutHandler, Action<string> stdErrHandler) { - using (var process = LaunchBuild(buildInfo)) + using (var process = LaunchBuild(buildInfo, stdOutHandler, stdErrHandler)) { process.WaitForExit(); @@ -103,9 +102,9 @@ namespace GodotTools.Build } } - public static async Task<int> BuildAsync(BuildInfo buildInfo) + public static async Task<int> BuildAsync(BuildInfo buildInfo, Action<string> stdOutHandler, Action<string> stdErrHandler) { - using (var process = LaunchBuild(buildInfo)) + using (var process = LaunchBuild(buildInfo, stdOutHandler, stdErrHandler)) { await process.WaitForExitAsync(); @@ -152,10 +151,5 @@ namespace GodotTools.Build foreach (string env in platformEnvironmentVariables) environmentVariables.Remove(env); } - - private static bool IsDebugMsBuildRequested() - { - return Environment.GetEnvironmentVariable("GODOT_DEBUG_MSBUILD")?.Trim() == "1"; - } } } diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/MSBuildPanel.cs b/modules/mono/editor/GodotTools/GodotTools/Build/MSBuildPanel.cs new file mode 100644 index 0000000000..c22dce005c --- /dev/null +++ b/modules/mono/editor/GodotTools/GodotTools/Build/MSBuildPanel.cs @@ -0,0 +1,165 @@ +using System; +using Godot; +using GodotTools.Internals; +using JetBrains.Annotations; +using static GodotTools.Internals.Globals; +using File = GodotTools.Utils.File; + +namespace GodotTools.Build +{ + public class MSBuildPanel : VBoxContainer + { + public BuildOutputView BuildOutputView { get; private set; } + + private Button errorsBtn; + private Button warningsBtn; + private Button viewLogBtn; + + private void WarningsToggled(bool pressed) + { + BuildOutputView.WarningsVisible = pressed; + BuildOutputView.UpdateIssuesList(); + } + + private void ErrorsToggled(bool pressed) + { + BuildOutputView.ErrorsVisible = pressed; + BuildOutputView.UpdateIssuesList(); + } + + [UsedImplicitly] + public void BuildSolution() + { + if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) + return; // No solution to build + + BuildManager.GenerateEditorScriptMetadata(); + + if (!BuildManager.BuildProjectBlocking("Debug")) + return; // Build failed + + // Notify running game for hot-reload + Internal.EditorDebuggerNodeReloadScripts(); + + // Hot-reload in the editor + GodotSharpEditor.Instance.GetNode<HotReloadAssemblyWatcher>("HotReloadAssemblyWatcher").RestartTimer(); + + if (Internal.IsAssembliesReloadingNeeded()) + Internal.ReloadAssemblies(softReload: false); + } + + [UsedImplicitly] + private void RebuildSolution() + { + if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) + return; // No solution to build + + BuildManager.GenerateEditorScriptMetadata(); + + if (!BuildManager.BuildProjectBlocking("Debug", targets: new[] {"Rebuild"})) + return; // Build failed + + // Notify running game for hot-reload + Internal.EditorDebuggerNodeReloadScripts(); + + // Hot-reload in the editor + GodotSharpEditor.Instance.GetNode<HotReloadAssemblyWatcher>("HotReloadAssemblyWatcher").RestartTimer(); + + if (Internal.IsAssembliesReloadingNeeded()) + Internal.ReloadAssemblies(softReload: false); + } + + [UsedImplicitly] + private void CleanSolution() + { + if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) + return; // No solution to build + + BuildManager.BuildProjectBlocking("Debug", targets: new[] {"Clean"}); + } + + private void ViewLogToggled(bool pressed) => BuildOutputView.LogVisible = pressed; + + private void BuildMenuOptionPressed(int id) + { + switch ((BuildMenuOptions)id) + { + case BuildMenuOptions.BuildSolution: + BuildSolution(); + break; + case BuildMenuOptions.RebuildSolution: + RebuildSolution(); + break; + case BuildMenuOptions.CleanSolution: + CleanSolution(); + break; + default: + throw new ArgumentOutOfRangeException(nameof(id), id, "Invalid build menu option"); + } + } + + private enum BuildMenuOptions + { + BuildSolution, + RebuildSolution, + CleanSolution + } + + public override void _Ready() + { + base._Ready(); + + RectMinSize = new Vector2(0, 228) * EditorScale; + SizeFlagsVertical = (int)SizeFlags.ExpandFill; + + var toolBarHBox = new HBoxContainer {SizeFlagsHorizontal = (int)SizeFlags.ExpandFill}; + AddChild(toolBarHBox); + + var buildMenuBtn = new MenuButton {Text = "Build", Icon = GetThemeIcon("Play", "EditorIcons")}; + toolBarHBox.AddChild(buildMenuBtn); + + var buildMenu = buildMenuBtn.GetPopup(); + buildMenu.AddItem("Build Solution".TTR(), (int)BuildMenuOptions.BuildSolution); + buildMenu.AddItem("Rebuild Solution".TTR(), (int)BuildMenuOptions.RebuildSolution); + buildMenu.AddItem("Clean Solution".TTR(), (int)BuildMenuOptions.CleanSolution); + buildMenu.IdPressed += BuildMenuOptionPressed; + + errorsBtn = new Button + { + HintTooltip = "Show Errors".TTR(), + Icon = GetThemeIcon("StatusError", "EditorIcons"), + ExpandIcon = false, + ToggleMode = true, + Pressed = true, + FocusMode = FocusModeEnum.None + }; + errorsBtn.Toggled += ErrorsToggled; + toolBarHBox.AddChild(errorsBtn); + + warningsBtn = new Button + { + HintTooltip = "Show Warnings".TTR(), + Icon = GetThemeIcon("NodeWarning", "EditorIcons"), + ExpandIcon = false, + ToggleMode = true, + Pressed = true, + FocusMode = FocusModeEnum.None + }; + warningsBtn.Toggled += WarningsToggled; + toolBarHBox.AddChild(warningsBtn); + + viewLogBtn = new Button + { + Text = "Show Output".TTR(), + ToggleMode = true, + Pressed = true, + FocusMode = FocusModeEnum.None + }; + viewLogBtn.Toggled += ViewLogToggled; + toolBarHBox.AddChild(viewLogBtn); + + BuildOutputView = new BuildOutputView(); + AddChild(BuildOutputView); + } + } +} diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs index 7bfba779fb..e2feb66e35 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs @@ -31,7 +31,7 @@ namespace GodotTools.Build string dotnetCliPath = OS.PathWhich("dotnet"); if (!string.IsNullOrEmpty(dotnetCliPath)) return (dotnetCliPath, BuildTool.DotnetCli); - GD.PushError("Cannot find dotnet CLI executable. Fallback to MSBuild from Visual Studio."); + GD.PushError($"Cannot find executable for '{BuildManager.PropNameDotnetCli}'. Fallback to MSBuild from Visual Studio."); goto case BuildTool.MsBuildVs; } case BuildTool.MsBuildVs: @@ -89,7 +89,7 @@ namespace GodotTools.Build string dotnetCliPath = OS.PathWhich("dotnet"); if (!string.IsNullOrEmpty(dotnetCliPath)) return (dotnetCliPath, BuildTool.DotnetCli); - GD.PushError("Cannot find dotnet CLI executable. Fallback to MSBuild from Mono."); + GD.PushError($"Cannot find executable for '{BuildManager.PropNameDotnetCli}'. Fallback to MSBuild from Mono."); goto case BuildTool.MsBuildMono; } case BuildTool.MsBuildMono: @@ -119,7 +119,7 @@ namespace GodotTools.Build { var result = new List<string>(); - if (OS.IsOSX) + if (OS.IsMacOS) { result.Add("/Library/Frameworks/Mono.framework/Versions/Current/bin/"); result.Add("/usr/local/var/homebrew/linked/mono/bin/"); @@ -161,7 +161,7 @@ namespace GodotTools.Build // Try to find 15.0 with vswhere - var envNames = Internal.GodotIs32Bits() ? new[] { "ProgramFiles", "ProgramW6432" } : new[] { "ProgramFiles(x86)", "ProgramFiles" }; + var envNames = Internal.GodotIs32Bits() ? new[] {"ProgramFiles", "ProgramW6432"} : new[] {"ProgramFiles(x86)", "ProgramFiles"}; string vsWherePath = null; foreach (var envName in envNames) diff --git a/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs b/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs index 42ede3f3f3..5bb8d444c2 100755 --- a/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs @@ -120,7 +120,7 @@ namespace GodotTools.Export string assemblyPath = assembly.Value; string outputFileExtension = platform == OS.Platforms.Windows ? ".dll" : - platform == OS.Platforms.OSX ? ".dylib" : + platform == OS.Platforms.MacOS ? ".dylib" : ".so"; string outputFileName = assemblyName + ".dll" + outputFileExtension; @@ -132,7 +132,7 @@ namespace GodotTools.Export ExecuteCompiler(FindCrossCompiler(compilerDirPath), compilerArgs, bclDir); - if (platform == OS.Platforms.OSX) + if (platform == OS.Platforms.MacOS) { exporter.AddSharedObject(tempOutputFilePath, tags: null); } @@ -581,7 +581,7 @@ MONO_AOT_MODE_LAST = 1000, string arch = bits == "64" ? "x86_64" : "i686"; return $"windows-{arch}"; } - case OS.Platforms.OSX: + case OS.Platforms.MacOS: { Debug.Assert(bits == null || bits == "64"); string arch = "x86_64"; diff --git a/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs b/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs index 599ca94699..e18ed7f107 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs @@ -5,6 +5,7 @@ using System.Diagnostics; using System.IO; using System.Linq; using System.Runtime.CompilerServices; +using GodotTools.Build; using GodotTools.Core; using GodotTools.Internals; using JetBrains.Annotations; @@ -143,6 +144,8 @@ namespace GodotTools.Export private void _ExportBeginImpl(string[] features, bool isDebug, string path, int flags) { + _ = flags; // Unused + if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) return; @@ -154,12 +157,10 @@ namespace GodotTools.Export string buildConfig = isDebug ? "ExportDebug" : "ExportRelease"; - string scriptsMetadataPath = Path.Combine(GodotSharpDirs.ResMetadataDir, $"scripts_metadata.{(isDebug ? "debug" : "release")}"); - CsProjOperations.GenerateScriptsMetadata(GodotSharpDirs.ProjectCsProjPath, scriptsMetadataPath); - + string scriptsMetadataPath = BuildManager.GenerateExportedGameScriptMetadata(isDebug); AddFile(scriptsMetadataPath, scriptsMetadataPath); - if (!BuildManager.BuildProjectBlocking(buildConfig, platform)) + if (!BuildManager.BuildProjectBlocking(buildConfig, platform: platform)) throw new Exception("Failed to build project"); // Add dependency assemblies @@ -340,7 +341,7 @@ namespace GodotTools.Export private static bool PlatformHasTemplateDir(string platform) { // OSX export templates are contained in a zip, so we place our custom template inside it and let Godot do the rest. - return !new[] {OS.Platforms.OSX, OS.Platforms.Android, OS.Platforms.iOS, OS.Platforms.HTML5}.Contains(platform); + return !new[] {OS.Platforms.MacOS, OS.Platforms.Android, OS.Platforms.iOS, OS.Platforms.HTML5}.Contains(platform); } private static bool DeterminePlatformFromFeatures(IEnumerable<string> features, out string platform) @@ -411,7 +412,7 @@ namespace GodotTools.Export case OS.Platforms.Windows: case OS.Platforms.UWP: return "net_4_x_win"; - case OS.Platforms.OSX: + case OS.Platforms.MacOS: case OS.Platforms.LinuxBSD: case OS.Platforms.Server: case OS.Platforms.Haiku: diff --git a/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs b/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs index 2a450c5b87..f5c99e87ef 100644 --- a/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs +++ b/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs @@ -4,9 +4,9 @@ using GodotTools.Export; using GodotTools.Utils; using System; using System.Collections.Generic; -using System.Diagnostics.CodeAnalysis; using System.IO; using System.Linq; +using GodotTools.Build; using GodotTools.Ides; using GodotTools.Ides.Rider; using GodotTools.Internals; @@ -19,7 +19,6 @@ using Path = System.IO.Path; namespace GodotTools { - [SuppressMessage("ReSharper", "ClassNeverInstantiated.Global")] public class GodotSharpEditor : EditorPlugin, ISerializationListener { private EditorSettings editorSettings; @@ -37,7 +36,7 @@ namespace GodotTools private WeakRef exportPluginWeak; // TODO Use WeakReference once we have proper serialization - public BottomPanel BottomPanel { get; private set; } + public MSBuildPanel MSBuildPanel { get; private set; } public bool SkipBuildBeforePlaying { get; set; } = false; @@ -153,7 +152,7 @@ namespace GodotTools } } - private void _BuildSolutionPressed() + private void BuildSolutionPressed() { if (!File.Exists(GodotSharpDirs.ProjectSlnPath)) { @@ -161,23 +160,22 @@ namespace GodotTools return; // Failed to create solution } - Instance.BottomPanel.BuildProjectPressed(); + Instance.MSBuildPanel.BuildSolution(); } - public override void _Notification(int what) + public override void _Ready() { - base._Notification(what); + base._Ready(); - if (what == NotificationReady) + MSBuildPanel.BuildOutputView.BuildStateChanged += BuildStateChanged; + + bool showInfoDialog = (bool)editorSettings.GetSetting("mono/editor/show_info_on_start"); + if (showInfoDialog) { - bool showInfoDialog = (bool)editorSettings.GetSetting("mono/editor/show_info_on_start"); - if (showInfoDialog) - { - aboutDialog.Exclusive = true; - _ShowAboutDialog(); - // Once shown a first time, it can be seen again via the Mono menu - it doesn't have to be exclusive from that time on. - aboutDialog.Exclusive = false; - } + aboutDialog.Exclusive = true; + _ShowAboutDialog(); + // Once shown a first time, it can be seen again via the Mono menu - it doesn't have to be exclusive from that time on. + aboutDialog.Exclusive = false; } } @@ -272,7 +270,7 @@ namespace GodotTools bool osxAppBundleInstalled = false; - if (OS.IsOSX) + if (OS.IsMacOS) { // The package path is '/Applications/Visual Studio Code.app' const string vscodeBundleId = "com.microsoft.VSCode"; @@ -312,7 +310,7 @@ namespace GodotTools string command; - if (OS.IsOSX) + if (OS.IsMacOS) { if (!osxAppBundleInstalled && string.IsNullOrEmpty(_vsCodePath)) { @@ -393,6 +391,12 @@ namespace GodotTools } } + private void BuildStateChanged() + { + if (bottomPanelBtn != null) + bottomPanelBtn.Icon = MSBuildPanel.BuildOutputView.BuildStateIcon; + } + public override void EnablePlugin() { base.EnablePlugin(); @@ -409,16 +413,15 @@ namespace GodotTools errorDialog = new AcceptDialog(); editorBaseControl.AddChild(errorDialog); - BottomPanel = new BottomPanel(); - - bottomPanelBtn = AddControlToBottomPanel(BottomPanel, "Mono".TTR()); + MSBuildPanel = new MSBuildPanel(); + bottomPanelBtn = AddControlToBottomPanel(MSBuildPanel, "MSBuild".TTR()); AddChild(new HotReloadAssemblyWatcher {Name = "HotReloadAssemblyWatcher"}); menuPopup = new PopupMenu(); menuPopup.Hide(); - AddToolSubmenuItem("Mono", menuPopup); + AddToolSubmenuItem("C#", menuPopup); // TODO: Remove or edit this info dialog once Mono support is no longer in alpha { @@ -476,7 +479,7 @@ namespace GodotTools HintTooltip = "Build solution", FocusMode = Control.FocusModeEnum.None }; - toolBarBuildButton.PressedSignal += _BuildSolutionPressed; + toolBarBuildButton.PressedSignal += BuildSolutionPressed; AddControlToContainer(CustomControlContainer.Toolbar, toolBarBuildButton); if (File.Exists(GodotSharpDirs.ProjectSlnPath) && File.Exists(GodotSharpDirs.ProjectCsProjPath)) @@ -504,7 +507,7 @@ namespace GodotTools $",Visual Studio Code:{(int)ExternalEditorId.VsCode}" + $",JetBrains Rider:{(int)ExternalEditorId.Rider}"; } - else if (OS.IsOSX) + else if (OS.IsMacOS) { settingsHintStr += $",Visual Studio:{(int)ExternalEditorId.VisualStudioForMac}" + $",MonoDevelop:{(int)ExternalEditorId.MonoDevelop}" + @@ -570,6 +573,7 @@ namespace GodotTools public static GodotSharpEditor Instance { get; private set; } + [UsedImplicitly] private GodotSharpEditor() { } diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs index e4932ca217..451ce39f5c 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs @@ -111,7 +111,7 @@ namespace GodotTools.Ides { MonoDevelop.Instance GetMonoDevelopInstance(string solutionPath) { - if (Utils.OS.IsOSX && editorId == ExternalEditorId.VisualStudioForMac) + if (Utils.OS.IsMacOS && editorId == ExternalEditorId.VisualStudioForMac) { vsForMacInstance = (vsForMacInstance?.IsDisposed ?? true ? null : vsForMacInstance) ?? new MonoDevelop.Instance(solutionPath, MonoDevelop.EditorId.VisualStudioForMac); diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs index d6fa2eeba7..fd7bbd5578 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs @@ -26,7 +26,7 @@ namespace GodotTools.Ides.MonoDevelop string command; - if (OS.IsOSX) + if (OS.IsMacOS) { string bundleId = BundleIds[editorId]; @@ -85,7 +85,7 @@ namespace GodotTools.Ides.MonoDevelop public Instance(string solutionFile, EditorId editorId) { - if (editorId == EditorId.VisualStudioForMac && !OS.IsOSX) + if (editorId == EditorId.VisualStudioForMac && !OS.IsMacOS) throw new InvalidOperationException($"{nameof(EditorId.VisualStudioForMac)} not supported on this platform"); this.solutionFile = solutionFile; @@ -103,7 +103,7 @@ namespace GodotTools.Ides.MonoDevelop static Instance() { - if (OS.IsOSX) + if (OS.IsMacOS) { ExecutableNames = new Dictionary<EditorId, string> { diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs index e22e9af919..94fc5da425 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs @@ -32,7 +32,7 @@ namespace GodotTools.Ides.Rider { return CollectRiderInfosWindows(); } - if (OS.IsOSX) + if (OS.IsMacOS) { return CollectRiderInfosMac(); } @@ -138,7 +138,7 @@ namespace GodotTools.Ides.Rider return GetToolboxRiderRootPath(localAppData); } - if (OS.IsOSX) + if (OS.IsMacOS) { var home = Environment.GetEnvironmentVariable("HOME"); if (string.IsNullOrEmpty(home)) @@ -211,7 +211,7 @@ namespace GodotTools.Ides.Rider { if (OS.IsWindows || OS.IsUnixLike) return "../../build.txt"; - if (OS.IsOSX) + if (OS.IsMacOS) return "Contents/Resources/build.txt"; throw new Exception("Unknown OS."); } diff --git a/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs b/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs index 6c05891f2c..e745966435 100644 --- a/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs +++ b/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs @@ -21,7 +21,7 @@ namespace GodotTools.Utils public static class Names { public const string Windows = "Windows"; - public const string OSX = "OSX"; + public const string MacOS = "macOS"; public const string Linux = "Linux"; public const string FreeBSD = "FreeBSD"; public const string NetBSD = "NetBSD"; @@ -37,7 +37,7 @@ namespace GodotTools.Utils public static class Platforms { public const string Windows = "windows"; - public const string OSX = "osx"; + public const string MacOS = "osx"; public const string LinuxBSD = "linuxbsd"; public const string Server = "server"; public const string UWP = "uwp"; @@ -50,7 +50,7 @@ namespace GodotTools.Utils public static readonly Dictionary<string, string> PlatformNameMap = new Dictionary<string, string> { [Names.Windows] = Platforms.Windows, - [Names.OSX] = Platforms.OSX, + [Names.MacOS] = Platforms.MacOS, [Names.Linux] = Platforms.LinuxBSD, [Names.FreeBSD] = Platforms.LinuxBSD, [Names.NetBSD] = Platforms.LinuxBSD, @@ -77,11 +77,11 @@ namespace GodotTools.Utils new[] {Names.Linux, Names.FreeBSD, Names.NetBSD, Names.BSD}; private static readonly IEnumerable<string> UnixLikePlatforms = - new[] {Names.OSX, Names.Server, Names.Haiku, Names.Android, Names.iOS} + new[] {Names.MacOS, Names.Server, Names.Haiku, Names.Android, Names.iOS} .Concat(LinuxBSDPlatforms).ToArray(); private static readonly Lazy<bool> _isWindows = new Lazy<bool>(() => IsOS(Names.Windows)); - private static readonly Lazy<bool> _isOSX = new Lazy<bool>(() => IsOS(Names.OSX)); + private static readonly Lazy<bool> _isMacOS = new Lazy<bool>(() => IsOS(Names.MacOS)); private static readonly Lazy<bool> _isLinuxBSD = new Lazy<bool>(() => IsAnyOS(LinuxBSDPlatforms)); private static readonly Lazy<bool> _isServer = new Lazy<bool>(() => IsOS(Names.Server)); private static readonly Lazy<bool> _isUWP = new Lazy<bool>(() => IsOS(Names.UWP)); @@ -92,7 +92,7 @@ namespace GodotTools.Utils private static readonly Lazy<bool> _isUnixLike = new Lazy<bool>(() => IsAnyOS(UnixLikePlatforms)); public static bool IsWindows => _isWindows.Value || IsUWP; - public static bool IsOSX => _isOSX.Value; + public static bool IsMacOS => _isMacOS.Value; public static bool IsLinuxBSD => _isLinuxBSD.Value; public static bool IsServer => _isServer.Value; public static bool IsUWP => _isUWP.Value; diff --git a/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs b/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs index bd1dbc1229..d63db0f905 100644 --- a/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs +++ b/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs @@ -393,6 +393,35 @@ namespace Godot return instance.Substring(sep + 1); } + /// <summary> + /// Converts the given byte array of ASCII encoded text to a string. + /// Faster alternative to <see cref="GetStringFromUTF8"/> if the + /// content is ASCII-only. Unlike the UTF-8 function this function + /// maps every byte to a character in the array. Multibyte sequences + /// will not be interpreted correctly. For parsing user input always + /// use <see cref="GetStringFromUTF8"/>. + /// </summary> + /// <param name="bytes">A byte array of ASCII characters (on the range of 0-127).</param> + /// <returns>A string created from the bytes.</returns> + public static string GetStringFromASCII(this byte[] bytes) + { + return Encoding.ASCII.GetString(bytes); + } + + /// <summary> + /// Converts the given byte array of UTF-8 encoded text to a string. + /// Slower than <see cref="GetStringFromASCII"/> but supports UTF-8 + /// encoded data. Use this function if you are unsure about the + /// source of the data. For user input this function + /// should always be preferred. + /// </summary> + /// <param name="bytes">A byte array of UTF-8 characters (a character may take up multiple bytes).</param> + /// <returns>A string created from the bytes.</returns> + public static string GetStringFromUTF8(this byte[] bytes) + { + return Encoding.UTF8.GetString(bytes); + } + // <summary> // Hash the string and return a 32 bits integer. // </summary> diff --git a/modules/mono/glue/base_object_glue.cpp b/modules/mono/glue/base_object_glue.cpp index ebcd6d5e9c..439fb1ab0a 100644 --- a/modules/mono/glue/base_object_glue.cpp +++ b/modules/mono/glue/base_object_glue.cpp @@ -31,7 +31,6 @@ #ifdef MONO_GLUE_ENABLED #include "core/class_db.h" -#include "core/object.h" #include "core/reference.h" #include "core/string_name.h" diff --git a/modules/mono/glue/glue_header.h b/modules/mono/glue/glue_header.h index c1f1936711..dc3bf47838 100644 --- a/modules/mono/glue/glue_header.h +++ b/modules/mono/glue/glue_header.h @@ -64,7 +64,6 @@ void godot_register_glue_header_icalls() { #include "core/engine.h" #include "core/method_bind.h" #include "core/node_path.h" -#include "core/object.h" #include "core/reference.h" #include "core/typedefs.h" #include "core/ustring.h" diff --git a/modules/mono/glue/rid_glue.cpp b/modules/mono/glue/rid_glue.cpp index 6d2e6b559f..a7b18c36dd 100644 --- a/modules/mono/glue/rid_glue.cpp +++ b/modules/mono/glue/rid_glue.cpp @@ -30,7 +30,7 @@ #ifdef MONO_GLUE_ENABLED -#include "core/object.h" +#include "core/class_db.h" #include "core/resource.h" #include "core/rid.h" diff --git a/modules/mono/mono_gd/gd_mono_internals.h b/modules/mono/mono_gd/gd_mono_internals.h index 038d17f782..cf7efdecd6 100644 --- a/modules/mono/mono_gd/gd_mono_internals.h +++ b/modules/mono/mono_gd/gd_mono_internals.h @@ -35,7 +35,7 @@ #include "../utils/macros.h" -#include "core/object.h" +#include "core/class_db.h" namespace GDMonoInternals { diff --git a/modules/mono/mono_gd/gd_mono_utils.h b/modules/mono/mono_gd/gd_mono_utils.h index 5958bf3cc1..80569cb1c7 100644 --- a/modules/mono/mono_gd/gd_mono_utils.h +++ b/modules/mono/mono_gd/gd_mono_utils.h @@ -37,7 +37,7 @@ #include "../utils/macros.h" #include "gd_mono_header.h" -#include "core/object.h" +#include "core/class_db.h" #include "core/reference.h" #define UNHANDLED_EXCEPTION(m_exc) \ diff --git a/modules/visual_script/visual_script_editor.cpp b/modules/visual_script/visual_script_editor.cpp index b1d8c05d87..01c674d086 100644 --- a/modules/visual_script/visual_script_editor.cpp +++ b/modules/visual_script/visual_script_editor.cpp @@ -30,8 +30,8 @@ #include "visual_script_editor.h" +#include "core/class_db.h" #include "core/input/input.h" -#include "core/object.h" #include "core/os/keyboard.h" #include "core/script_language.h" #include "core/variant.h" @@ -4783,8 +4783,8 @@ VisualScriptEditor::VisualScriptEditor() { graph->set_v_size_flags(Control::SIZE_EXPAND_FILL); graph->set_anchors_and_margins_preset(Control::PRESET_WIDE); graph->connect("node_selected", callable_mp(this, &VisualScriptEditor::_node_selected)); - graph->connect("_begin_node_move", callable_mp(this, &VisualScriptEditor::_begin_node_move)); - graph->connect("_end_node_move", callable_mp(this, &VisualScriptEditor::_end_node_move)); + graph->connect("begin_node_move", callable_mp(this, &VisualScriptEditor::_begin_node_move)); + graph->connect("end_node_move", callable_mp(this, &VisualScriptEditor::_end_node_move)); graph->connect("delete_nodes_request", callable_mp(this, &VisualScriptEditor::_on_nodes_delete)); graph->connect("duplicate_nodes_request", callable_mp(this, &VisualScriptEditor::_on_nodes_duplicate)); graph->connect("gui_input", callable_mp(this, &VisualScriptEditor::_graph_gui_input)); diff --git a/modules/visual_script/visual_script_func_nodes.cpp b/modules/visual_script/visual_script_func_nodes.cpp index f13377f3c8..68de686272 100644 --- a/modules/visual_script/visual_script_func_nodes.cpp +++ b/modules/visual_script/visual_script_func_nodes.cpp @@ -2088,6 +2088,7 @@ void VisualScriptPropertyGet::_bind_methods() { BIND_ENUM_CONSTANT(CALL_MODE_SELF); BIND_ENUM_CONSTANT(CALL_MODE_NODE_PATH); BIND_ENUM_CONSTANT(CALL_MODE_INSTANCE); + BIND_ENUM_CONSTANT(CALL_MODE_BASIC_TYPE); } class VisualScriptNodeInstancePropertyGet : public VisualScriptNodeInstance { diff --git a/modules/webrtc/doc_classes/WebRTCPeerConnection.xml b/modules/webrtc/doc_classes/WebRTCPeerConnection.xml index c80b903e39..e21dee8eff 100644 --- a/modules/webrtc/doc_classes/WebRTCPeerConnection.xml +++ b/modules/webrtc/doc_classes/WebRTCPeerConnection.xml @@ -40,7 +40,6 @@ <argument index="0" name="label" type="String"> </argument> <argument index="1" name="options" type="Dictionary" default="{ - }"> </argument> <description> @@ -82,7 +81,6 @@ <return type="int" enum="Error"> </return> <argument index="0" name="configuration" type="Dictionary" default="{ - }"> </argument> <description> diff --git a/platform/android/export/export.cpp b/platform/android/export/export.cpp index 5e6cc3e4e2..37da1dbd4d 100644 --- a/platform/android/export/export.cpp +++ b/platform/android/export/export.cpp @@ -592,7 +592,7 @@ class EditorExportPlatformAndroid : public EditorExportPlatform { zipfi.tmz_date.tm_hour = time.hour; zipfi.tmz_date.tm_mday = date.day; zipfi.tmz_date.tm_min = time.min; - zipfi.tmz_date.tm_mon = date.month; + zipfi.tmz_date.tm_mon = date.month - 1; // tm_mon is zero indexed zipfi.tmz_date.tm_sec = time.sec; zipfi.tmz_date.tm_year = date.year; zipfi.dosDate = 0; diff --git a/platform/iphone/game_center.h b/platform/iphone/game_center.h index 6705674ac6..10c8ef52fb 100644 --- a/platform/iphone/game_center.h +++ b/platform/iphone/game_center.h @@ -33,7 +33,7 @@ #ifndef GAME_CENTER_H #define GAME_CENTER_H -#include "core/object.h" +#include "core/class_db.h" class GameCenter : public Object { GDCLASS(GameCenter, Object); diff --git a/platform/iphone/icloud.h b/platform/iphone/icloud.h index 381edfa718..6ca1e6594a 100644 --- a/platform/iphone/icloud.h +++ b/platform/iphone/icloud.h @@ -33,7 +33,7 @@ #ifndef ICLOUD_H #define ICLOUD_H -#include "core/object.h" +#include "core/class_db.h" class ICloud : public Object { GDCLASS(ICloud, Object); diff --git a/platform/iphone/in_app_store.h b/platform/iphone/in_app_store.h index beb58af2c7..1b8f84ec7b 100644 --- a/platform/iphone/in_app_store.h +++ b/platform/iphone/in_app_store.h @@ -33,7 +33,18 @@ #ifndef IN_APP_STORE_H #define IN_APP_STORE_H -#include "core/object.h" +#include "core/class_db.h" + +#ifdef __OBJC__ +@class GodotProductsDelegate; +@class GodotTransactionsObserver; + +typedef GodotProductsDelegate InAppStoreProductDelegate; +typedef GodotTransactionsObserver InAppStoreTransactionObserver; +#else +typedef void InAppStoreProductDelegate; +typedef void InAppStoreTransactionObserver; +#endif class InAppStore : public Object { GDCLASS(InAppStore, Object); @@ -43,6 +54,9 @@ class InAppStore : public Object { List<Variant> pending_events; + InAppStoreProductDelegate *products_request_delegate; + InAppStoreTransactionObserver *transactions_observer; + public: Error request_product_info(Dictionary p_params); Error restore_purchases(); diff --git a/platform/iphone/in_app_store.mm b/platform/iphone/in_app_store.mm index 2b973dfbcf..3eec9dae69 100644 --- a/platform/iphone/in_app_store.mm +++ b/platform/iphone/in_app_store.mm @@ -32,24 +32,22 @@ #include "in_app_store.h" -extern "C" { #import <Foundation/Foundation.h> #import <StoreKit/StoreKit.h> -}; -bool auto_finish_transactions = true; -NSMutableDictionary *pending_transactions = [NSMutableDictionary dictionary]; -static NSArray *latestProducts; +InAppStore *InAppStore::instance = NULL; @interface SKProduct (LocalizedPrice) @property(nonatomic, readonly) NSString *localizedPrice; + @end //----------------------------------// // SKProduct extension //----------------------------------// @implementation SKProduct (LocalizedPrice) + - (NSString *)localizedPrice { NSNumberFormatter *numberFormatter = [[NSNumberFormatter alloc] init]; [numberFormatter setFormatterBehavior:NSNumberFormatterBehavior10_4]; @@ -61,29 +59,91 @@ static NSArray *latestProducts; @end -InAppStore *InAppStore::instance = NULL; - -void InAppStore::_bind_methods() { - ClassDB::bind_method(D_METHOD("request_product_info"), &InAppStore::request_product_info); - ClassDB::bind_method(D_METHOD("restore_purchases"), &InAppStore::restore_purchases); - ClassDB::bind_method(D_METHOD("purchase"), &InAppStore::purchase); +@interface GodotProductsDelegate : NSObject <SKProductsRequestDelegate> - ClassDB::bind_method(D_METHOD("get_pending_event_count"), &InAppStore::get_pending_event_count); - ClassDB::bind_method(D_METHOD("pop_pending_event"), &InAppStore::pop_pending_event); - ClassDB::bind_method(D_METHOD("finish_transaction"), &InAppStore::finish_transaction); - ClassDB::bind_method(D_METHOD("set_auto_finish_transaction"), &InAppStore::set_auto_finish_transaction); -}; +@property(nonatomic, strong) NSMutableArray *loadedProducts; +@property(nonatomic, strong) NSMutableArray *pendingRequests; -@interface ProductsDelegate : NSObject <SKProductsRequestDelegate> { -}; +- (void)performRequestWithProductIDs:(NSSet *)productIDs; +- (Error)purchaseProductWithProductID:(NSString *)productID; +- (void)reset; @end -@implementation ProductsDelegate +@implementation GodotProductsDelegate + +- (instancetype)init { + self = [super init]; + + if (self) { + [self godot_commonInit]; + } + + return self; +} + +- (void)godot_commonInit { + self.loadedProducts = [NSMutableArray new]; + self.pendingRequests = [NSMutableArray new]; +} + +- (void)performRequestWithProductIDs:(NSSet *)productIDs { + SKProductsRequest *request = [[SKProductsRequest alloc] initWithProductIdentifiers:productIDs]; + + request.delegate = self; + [self.pendingRequests addObject:request]; + [request start]; +} + +- (Error)purchaseProductWithProductID:(NSString *)productID { + SKProduct *product = nil; + + NSLog(@"searching for product!"); + + if (self.loadedProducts) { + for (SKProduct *storedProduct in self.loadedProducts) { + if ([storedProduct.productIdentifier isEqualToString:productID]) { + product = storedProduct; + break; + } + } + } + + if (!product) { + return ERR_INVALID_PARAMETER; + } + + NSLog(@"product found!"); + + SKPayment *payment = [SKPayment paymentWithProduct:product]; + [[SKPaymentQueue defaultQueue] addPayment:payment]; + + NSLog(@"purchase sent!"); + + return OK; +} + +- (void)reset { + [self.loadedProducts removeAllObjects]; + [self.pendingRequests removeAllObjects]; +} + +- (void)request:(SKRequest *)request didFailWithError:(NSError *)error { + [self.pendingRequests removeObject:request]; + + Dictionary ret; + ret["type"] = "product_info"; + ret["result"] = "error"; + ret["error"] = String::utf8([error.localizedDescription UTF8String]); + + InAppStore::get_singleton()->_post_event(ret); +} - (void)productsRequest:(SKProductsRequest *)request didReceiveResponse:(SKProductsResponse *)response { + [self.pendingRequests removeObject:request]; + NSArray *products = response.products; - latestProducts = products; + [self.loadedProducts addObjectsFromArray:products]; Dictionary ret; ret["type"] = "product_info"; @@ -107,7 +167,8 @@ void InAppStore::_bind_methods() { ids.push_back(String::utf8([product.productIdentifier UTF8String])); localized_prices.push_back(String::utf8([product.localizedPrice UTF8String])); currency_codes.push_back(String::utf8([[[product priceLocale] objectForKey:NSLocaleCurrencyCode] UTF8String])); - }; + } + ret["titles"] = titles; ret["descriptions"] = descriptions; ret["prices"] = prices; @@ -119,50 +180,54 @@ void InAppStore::_bind_methods() { for (NSString *ipid in response.invalidProductIdentifiers) { invalid_ids.push_back(String::utf8([ipid UTF8String])); - }; + } + ret["invalid_ids"] = invalid_ids; InAppStore::get_singleton()->_post_event(ret); -}; +} @end -Error InAppStore::request_product_info(Dictionary p_params) { - ERR_FAIL_COND_V(!p_params.has("product_ids"), ERR_INVALID_PARAMETER); +@interface GodotTransactionsObserver : NSObject <SKPaymentTransactionObserver> - PackedStringArray pids = p_params["product_ids"]; - printf("************ request product info! %i\n", pids.size()); +@property(nonatomic, assign) BOOL shouldAutoFinishTransactions; +@property(nonatomic, strong) NSMutableDictionary *pendingTransactions; - NSMutableArray *array = [[NSMutableArray alloc] initWithCapacity:pids.size()]; - for (int i = 0; i < pids.size(); i++) { - printf("******** adding %s to product list\n", pids[i].utf8().get_data()); - NSString *pid = [[NSString alloc] initWithUTF8String:pids[i].utf8().get_data()]; - [array addObject:pid]; - }; +- (void)finishTransactionWithProductID:(NSString *)productID; +- (void)reset; - NSSet *products = [[NSSet alloc] initWithArray:array]; - SKProductsRequest *request = [[SKProductsRequest alloc] initWithProductIdentifiers:products]; +@end - ProductsDelegate *delegate = [[ProductsDelegate alloc] init]; +@implementation GodotTransactionsObserver - request.delegate = delegate; - [request start]; +- (instancetype)init { + self = [super init]; - return OK; -}; + if (self) { + [self godot_commonInit]; + } -Error InAppStore::restore_purchases() { - printf("restoring purchases!\n"); - [[SKPaymentQueue defaultQueue] restoreCompletedTransactions]; + return self; +} - return OK; -}; +- (void)godot_commonInit { + self.pendingTransactions = [NSMutableDictionary new]; +} -@interface TransObserver : NSObject <SKPaymentTransactionObserver> { -}; -@end +- (void)finishTransactionWithProductID:(NSString *)productID { + SKPaymentTransaction *transaction = self.pendingTransactions[productID]; + + if (transaction) { + [[SKPaymentQueue defaultQueue] finishTransaction:transaction]; + } -@implementation TransObserver + self.pendingTransactions[productID] = nil; +} + +- (void)reset { + [self.pendingTransactions removeAllObjects]; +} - (void)paymentQueue:(SKPaymentQueue *)queue updatedTransactions:(NSArray *)transactions { printf("transactions updated!\n"); @@ -190,6 +255,7 @@ Error InAppStore::restore_purchases() { receipt = [NSData dataWithContentsOfURL:receiptFileURL]; NSString *receipt_to_send = nil; + if (receipt != nil) { receipt_to_send = [receipt base64EncodedStringWithOptions:0]; } @@ -200,13 +266,13 @@ Error InAppStore::restore_purchases() { InAppStore::get_singleton()->_post_event(ret); - if (auto_finish_transactions) { + if (self.shouldAutoFinishTransactions) { [[SKPaymentQueue defaultQueue] finishTransaction:transaction]; } else { - [pending_transactions setObject:transaction forKey:transaction.payment.productIdentifier]; + self.pendingTransactions[transaction.payment.productIdentifier] = transaction; } - }; break; + } break; case SKPaymentTransactionStateFailed: { printf("status transaction failed!\n"); String pid = String::utf8([transaction.payment.productIdentifier UTF8String]); @@ -231,95 +297,119 @@ Error InAppStore::restore_purchases() { } break; default: { printf("status default %i!\n", (int)transaction.transactionState); - }; break; - }; - }; -}; + } break; + } + } +} @end -Error InAppStore::purchase(Dictionary p_params) { - ERR_FAIL_COND_V(![SKPaymentQueue canMakePayments], ERR_UNAVAILABLE); - if (![SKPaymentQueue canMakePayments]) - return ERR_UNAVAILABLE; +void InAppStore::_bind_methods() { + ClassDB::bind_method(D_METHOD("request_product_info"), &InAppStore::request_product_info); + ClassDB::bind_method(D_METHOD("restore_purchases"), &InAppStore::restore_purchases); + ClassDB::bind_method(D_METHOD("purchase"), &InAppStore::purchase); - printf("purchasing!\n"); - ERR_FAIL_COND_V(!p_params.has("product_id"), ERR_INVALID_PARAMETER); + ClassDB::bind_method(D_METHOD("get_pending_event_count"), &InAppStore::get_pending_event_count); + ClassDB::bind_method(D_METHOD("pop_pending_event"), &InAppStore::pop_pending_event); + ClassDB::bind_method(D_METHOD("finish_transaction"), &InAppStore::finish_transaction); + ClassDB::bind_method(D_METHOD("set_auto_finish_transaction"), &InAppStore::set_auto_finish_transaction); +} - NSString *pid = [[NSString alloc] initWithUTF8String:String(p_params["product_id"]).utf8().get_data()]; +Error InAppStore::request_product_info(Dictionary p_params) { + ERR_FAIL_COND_V(!p_params.has("product_ids"), ERR_INVALID_PARAMETER); - SKProduct *product = nil; + PackedStringArray pids = p_params["product_ids"]; + printf("************ request product info! %i\n", pids.size()); - if (latestProducts) { - for (SKProduct *storedProduct in latestProducts) { - if ([storedProduct.productIdentifier isEqualToString:pid]) { - product = storedProduct; - break; - } - } - } + NSMutableArray *array = [[NSMutableArray alloc] initWithCapacity:pids.size()]; + for (int i = 0; i < pids.size(); i++) { + printf("******** adding %s to product list\n", pids[i].utf8().get_data()); + NSString *pid = [[NSString alloc] initWithUTF8String:pids[i].utf8().get_data()]; + [array addObject:pid]; + }; - if (!product) { - return ERR_INVALID_PARAMETER; - } + NSSet *products = [[NSSet alloc] initWithArray:array]; - SKPayment *payment = [SKPayment paymentWithProduct:product]; - SKPaymentQueue *defq = [SKPaymentQueue defaultQueue]; - [defq addPayment:payment]; - printf("purchase sent!\n"); + [products_request_delegate performRequestWithProductIDs:products]; return OK; -}; +} + +Error InAppStore::restore_purchases() { + printf("restoring purchases!\n"); + [[SKPaymentQueue defaultQueue] restoreCompletedTransactions]; + + return OK; +} + +Error InAppStore::purchase(Dictionary p_params) { + ERR_FAIL_COND_V(![SKPaymentQueue canMakePayments], ERR_UNAVAILABLE); + if (![SKPaymentQueue canMakePayments]) { + return ERR_UNAVAILABLE; + } + + printf("purchasing!\n"); + Dictionary params = p_params; + ERR_FAIL_COND_V(!params.has("product_id"), ERR_INVALID_PARAMETER); + + NSString *pid = [[NSString alloc] initWithUTF8String:String(params["product_id"]).utf8().get_data()]; + + return [products_request_delegate purchaseProductWithProductID:pid]; +} int InAppStore::get_pending_event_count() { return pending_events.size(); -}; +} Variant InAppStore::pop_pending_event() { Variant front = pending_events.front()->get(); pending_events.pop_front(); return front; -}; +} void InAppStore::_post_event(Variant p_event) { pending_events.push_back(p_event); -}; +} void InAppStore::_record_purchase(String product_id) { String skey = "purchased/" + product_id; NSString *key = [[NSString alloc] initWithUTF8String:skey.utf8().get_data()]; [[NSUserDefaults standardUserDefaults] setBool:YES forKey:key]; [[NSUserDefaults standardUserDefaults] synchronize]; -}; +} InAppStore *InAppStore::get_singleton() { return instance; -}; +} InAppStore::InAppStore() { ERR_FAIL_COND(instance != NULL); instance = this; - auto_finish_transactions = false; - TransObserver *observer = [[TransObserver alloc] init]; - [[SKPaymentQueue defaultQueue] addTransactionObserver:observer]; - //pending_transactions = [NSMutableDictionary dictionary]; -}; + products_request_delegate = [[GodotProductsDelegate alloc] init]; + transactions_observer = [[GodotTransactionsObserver alloc] init]; + + [[SKPaymentQueue defaultQueue] addTransactionObserver:transactions_observer]; +} void InAppStore::finish_transaction(String product_id) { NSString *prod_id = [NSString stringWithCString:product_id.utf8().get_data() encoding:NSUTF8StringEncoding]; - if ([pending_transactions objectForKey:prod_id]) { - [[SKPaymentQueue defaultQueue] finishTransaction:[pending_transactions objectForKey:prod_id]]; - [pending_transactions removeObjectForKey:prod_id]; - } -}; + [transactions_observer finishTransactionWithProductID:prod_id]; +} void InAppStore::set_auto_finish_transaction(bool b) { - auto_finish_transactions = b; + transactions_observer.shouldAutoFinishTransactions = b; } -InAppStore::~InAppStore() {} +InAppStore::~InAppStore() { + [products_request_delegate reset]; + [transactions_observer reset]; + + products_request_delegate = nil; + [[SKPaymentQueue defaultQueue] removeTransactionObserver:transactions_observer]; + transactions_observer = nil; +} #endif diff --git a/platform/iphone/ios.h b/platform/iphone/ios.h index 2b29e6f268..6a89cd38cb 100644 --- a/platform/iphone/ios.h +++ b/platform/iphone/ios.h @@ -31,7 +31,7 @@ #ifndef IOS_H #define IOS_H -#include "core/object.h" +#include "core/class_db.h" class iOS : public Object { GDCLASS(iOS, Object); diff --git a/platform/javascript/SCsub b/platform/javascript/SCsub index a8861124b9..7381ea13b7 100644 --- a/platform/javascript/SCsub +++ b/platform/javascript/SCsub @@ -9,6 +9,7 @@ javascript_files = [ "javascript_eval.cpp", "javascript_main.cpp", "os_javascript.cpp", + "api/javascript_tools_editor_plugin.cpp", ] build_targets = ["#bin/godot${PROGSUFFIX}.js", "#bin/godot${PROGSUFFIX}.wasm"] @@ -55,7 +56,7 @@ out_files = [ zip_dir.File(binary_name + ".wasm"), zip_dir.File(binary_name + ".html"), ] -html_file = "#misc/dist/html/full-size.html" +html_file = "#misc/dist/html/editor.html" if env["tools"] else "#misc/dist/html/full-size.html" in_files = [js_wrapped, build[1], html_file] if env["threads_enabled"]: in_files.append(build[2]) diff --git a/platform/javascript/api/api.cpp b/platform/javascript/api/api.cpp index 9c73e5c4c4..aa0206d144 100644 --- a/platform/javascript/api/api.cpp +++ b/platform/javascript/api/api.cpp @@ -31,10 +31,12 @@ #include "api.h" #include "core/engine.h" #include "javascript_eval.h" +#include "javascript_tools_editor_plugin.h" static JavaScript *javascript_eval; void register_javascript_api() { + JavaScriptToolsEditorPlugin::initialize(); ClassDB::register_virtual_class<JavaScript>(); javascript_eval = memnew(JavaScript); Engine::get_singleton()->add_singleton(Engine::Singleton("JavaScript", javascript_eval)); diff --git a/platform/javascript/api/javascript_eval.h b/platform/javascript/api/javascript_eval.h index 29229de8e3..26b5b9e484 100644 --- a/platform/javascript/api/javascript_eval.h +++ b/platform/javascript/api/javascript_eval.h @@ -31,7 +31,7 @@ #ifndef JAVASCRIPT_EVAL_H #define JAVASCRIPT_EVAL_H -#include "core/object.h" +#include "core/class_db.h" class JavaScript : public Object { private: diff --git a/platform/javascript/api/javascript_tools_editor_plugin.cpp b/platform/javascript/api/javascript_tools_editor_plugin.cpp new file mode 100644 index 0000000000..e487bf23b7 --- /dev/null +++ b/platform/javascript/api/javascript_tools_editor_plugin.cpp @@ -0,0 +1,153 @@ +/*************************************************************************/ +/* javascript_tools_editor_plugin.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#if defined(TOOLS_ENABLED) && defined(JAVASCRIPT_ENABLED) +#include "javascript_tools_editor_plugin.h" + +#include "core/engine.h" +#include "core/os/dir_access.h" +#include "core/os/file_access.h" +#include "core/project_settings.h" +#include "editor/editor_node.h" + +#include <emscripten/emscripten.h> + +static void _javascript_editor_init_callback() { + EditorNode::get_singleton()->add_editor_plugin(memnew(JavaScriptToolsEditorPlugin(EditorNode::get_singleton()))); +} + +void JavaScriptToolsEditorPlugin::initialize() { + EditorNode::add_init_callback(_javascript_editor_init_callback); +} + +JavaScriptToolsEditorPlugin::JavaScriptToolsEditorPlugin(EditorNode *p_editor) { + Variant v; + add_tool_menu_item("Download Project Source", this, "_download_zip", v); +} + +void JavaScriptToolsEditorPlugin::_download_zip(Variant p_v) { + if (!Engine::get_singleton() || !Engine::get_singleton()->is_editor_hint()) { + WARN_PRINT("Project download is only available in Editor mode"); + return; + } + String resource_path = ProjectSettings::get_singleton()->get_resource_path(); + + FileAccess *src_f; + zlib_filefunc_def io = zipio_create_io_from_file(&src_f); + zipFile zip = zipOpen2("/tmp/project.zip", APPEND_STATUS_CREATE, NULL, &io); + String base_path = resource_path.substr(0, resource_path.rfind("/")) + "/"; + _zip_recursive(resource_path, base_path, zip); + zipClose(zip, NULL); + EM_ASM({ + const path = "/tmp/project.zip"; + const size = FS.stat(path)["size"]; + const buf = new Uint8Array(size); + const fd = FS.open(path, "r"); + FS.read(fd, buf, 0, size); + FS.close(fd); + FS.unlink(path); + const blob = new Blob([buf], { type: "application/zip" }); + const url = window.URL.createObjectURL(blob); + const a = document.createElement("a"); + a.href = url; + a.download = "project.zip"; + a.style.display = "none"; + document.body.appendChild(a); + a.click(); + a.remove(); + window.URL.revokeObjectURL(url); + }); +} + +void JavaScriptToolsEditorPlugin::_bind_methods() { + ClassDB::bind_method("_download_zip", &JavaScriptToolsEditorPlugin::_download_zip); +} + +void JavaScriptToolsEditorPlugin::_zip_file(String p_path, String p_base_path, zipFile p_zip) { + FileAccess *f = FileAccess::open(p_path, FileAccess::READ); + if (!f) { + WARN_PRINT("Unable to open file for zipping: " + p_path); + return; + } + Vector<uint8_t> data; + int len = f->get_len(); + data.resize(len); + f->get_buffer(data.ptrw(), len); + f->close(); + memdelete(f); + + String path = p_path.replace_first(p_base_path, ""); + zipOpenNewFileInZip(p_zip, + path.utf8().get_data(), + NULL, + NULL, + 0, + NULL, + 0, + NULL, + Z_DEFLATED, + Z_DEFAULT_COMPRESSION); + zipWriteInFileInZip(p_zip, data.ptr(), data.size()); + zipCloseFileInZip(p_zip); +} + +void JavaScriptToolsEditorPlugin::_zip_recursive(String p_path, String p_base_path, zipFile p_zip) { + DirAccess *dir = DirAccess::open(p_path); + if (!dir) { + WARN_PRINT("Unable to open dir for zipping: " + p_path); + return; + } + dir->list_dir_begin(); + String cur = dir->get_next(); + while (!cur.empty()) { + String cs = p_path.plus_file(cur); + if (cur == "." || cur == ".." || cur == ".import") { + // Skip + } else if (dir->current_is_dir()) { + String path = cs.replace_first(p_base_path, "") + "/"; + zipOpenNewFileInZip(p_zip, + path.utf8().get_data(), + NULL, + NULL, + 0, + NULL, + 0, + NULL, + Z_DEFLATED, + Z_DEFAULT_COMPRESSION); + zipCloseFileInZip(p_zip); + _zip_recursive(cs, p_base_path, p_zip); + } else { + _zip_file(cs, p_base_path, p_zip); + } + cur = dir->get_next(); + } +} +#endif diff --git a/platform/javascript/api/javascript_tools_editor_plugin.h b/platform/javascript/api/javascript_tools_editor_plugin.h new file mode 100644 index 0000000000..cc09fa4cd3 --- /dev/null +++ b/platform/javascript/api/javascript_tools_editor_plugin.h @@ -0,0 +1,62 @@ +/*************************************************************************/ +/* javascript_tools_editor_plugin.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H +#define JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H + +#if defined(TOOLS_ENABLED) && defined(JAVASCRIPT_ENABLED) +#include "core/io/zip_io.h" +#include "editor/editor_plugin.h" + +class JavaScriptToolsEditorPlugin : public EditorPlugin { + GDCLASS(JavaScriptToolsEditorPlugin, EditorPlugin); + +private: + void _zip_file(String p_path, String p_base_path, zipFile p_zip); + void _zip_recursive(String p_path, String p_base_path, zipFile p_zip); + +protected: + static void _bind_methods(); + + void _download_zip(Variant p_v); + +public: + static void initialize(); + + JavaScriptToolsEditorPlugin(EditorNode *p_editor); +}; +#else +class JavaScriptToolsEditorPlugin { +public: + static void initialize() {} +}; +#endif + +#endif // JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H diff --git a/platform/javascript/detect.py b/platform/javascript/detect.py index 4b5890545f..8f2961b33d 100644 --- a/platform/javascript/detect.py +++ b/platform/javascript/detect.py @@ -135,7 +135,7 @@ def configure(env): env.Append(CPPDEFINES=["PTHREAD_NO_RENAME"]) env.Append(CCFLAGS=["-s", "USE_PTHREADS=1"]) env.Append(LINKFLAGS=["-s", "USE_PTHREADS=1"]) - env.Append(LINKFLAGS=["-s", "PTHREAD_POOL_SIZE=4"]) + env.Append(LINKFLAGS=["-s", "PTHREAD_POOL_SIZE=8"]) env.Append(LINKFLAGS=["-s", "WASM_MEM_MAX=2048MB"]) env.extra_suffix = ".threads" + env.extra_suffix else: diff --git a/platform/javascript/engine/engine.js b/platform/javascript/engine/engine.js index adcd919a6b..05a11701c0 100644 --- a/platform/javascript/engine/engine.js +++ b/platform/javascript/engine/engine.js @@ -121,6 +121,7 @@ Function('return this')()['Engine'] = (function() { me.rtenv['noExitRuntime'] = true; me.rtenv['onExecute'] = me.onExecute; me.rtenv['onExit'] = function(code) { + me.rtenv['deinitFS'](); if (me.onExit) me.onExit(code); me.rtenv = null; @@ -227,6 +228,12 @@ Function('return this')()['Engine'] = (function() { this.persistentPaths = persistentPaths; }; + Engine.prototype.requestQuit = function() { + if (this.rtenv) { + this.rtenv['request_quit'](); + } + }; + // Closure compiler exported engine methods. /** @export */ Engine['isWebGLAvailable'] = Utils.isWebGLAvailable; @@ -249,5 +256,6 @@ Function('return this')()['Engine'] = (function() { Engine.prototype['setOnExit'] = Engine.prototype.setOnExit; Engine.prototype['copyToFS'] = Engine.prototype.copyToFS; Engine.prototype['setPersistentPaths'] = Engine.prototype.setPersistentPaths; + Engine.prototype['requestQuit'] = Engine.prototype.requestQuit; return Engine; })(); diff --git a/platform/javascript/native/utils.js b/platform/javascript/native/utils.js index 0b3698fd86..8d0beba454 100644 --- a/platform/javascript/native/utils.js +++ b/platform/javascript/native/utils.js @@ -29,8 +29,7 @@ /*************************************************************************/ Module['initFS'] = function(persistentPaths) { - FS.mkdir('/userfs'); - FS.mount(IDBFS, {}, '/userfs'); + Module.mount_points = ['/userfs'].concat(persistentPaths); function createRecursive(dir) { try { @@ -43,13 +42,14 @@ Module['initFS'] = function(persistentPaths) { } } - persistentPaths.forEach(function(path) { + Module.mount_points.forEach(function(path) { createRecursive(path); FS.mount(IDBFS, {}, path); }); return new Promise(function(resolve, reject) { FS.syncfs(true, function(err) { if (err) { + Module.mount_points = []; Module.idbfs = false; console.log("IndexedDB not available: " + err.message); } else { @@ -60,6 +60,21 @@ Module['initFS'] = function(persistentPaths) { }); }; +Module['deinitFS'] = function() { + Module.mount_points.forEach(function(path) { + try { + FS.unmount(path); + } catch (e) { + console.log("Already unmounted", e); + } + if (Module.idbfs && IDBFS.dbs[path]) { + IDBFS.dbs[path].close(); + delete IDBFS.dbs[path]; + } + }); + Module.mount_points = []; +}; + Module['copyToFS'] = function(path, buffer) { var p = path.lastIndexOf("/"); var dir = "/"; diff --git a/platform/osx/detect.py b/platform/osx/detect.py index 6fc1dc65af..50e9bd2653 100644 --- a/platform/osx/detect.py +++ b/platform/osx/detect.py @@ -139,7 +139,8 @@ def configure(env): env.Append(CPPDEFINES=["__MACPORTS__"]) # hack to fix libvpx MM256_BROADCASTSI128_SI256 define if env["CXX"] == "clang++": - env.Append(CPPDEFINES=["TYPED_METHOD_BIND"]) + # This should now work with clang++, re-enable if there are issues + # env.Append(CPPDEFINES=["TYPED_METHOD_BIND"]) env["CC"] = "clang" env["LINK"] = "clang++" diff --git a/platform/osx/display_server_osx.mm b/platform/osx/display_server_osx.mm index cd5b71890c..1ad7117b39 100644 --- a/platform/osx/display_server_osx.mm +++ b/platform/osx/display_server_osx.mm @@ -63,6 +63,8 @@ #define DS_OSX ((DisplayServerOSX *)(DisplayServerOSX::get_singleton())) +static bool ignore_momentum_scroll = false; + static void _get_key_modifier_state(unsigned int p_osx_state, Ref<InputEventWithModifiers> r_state) { r_state->set_shift((p_osx_state & NSEventModifierFlagShift)); r_state->set_control((p_osx_state & NSEventModifierFlagControl)); @@ -1304,6 +1306,8 @@ static int remapKey(unsigned int key, unsigned int state) { ERR_FAIL_COND(!DS_OSX->windows.has(window_id)); DisplayServerOSX::WindowData &wd = DS_OSX->windows[window_id]; + ignore_momentum_scroll = true; + // Ignore all input if IME input is in progress if (!imeInputEventInProgress) { NSString *characters = [event characters]; @@ -1348,6 +1352,8 @@ static int remapKey(unsigned int key, unsigned int state) { } - (void)flagsChanged:(NSEvent *)event { + ignore_momentum_scroll = true; + // Ignore all input if IME input is in progress if (!imeInputEventInProgress) { DisplayServerOSX::KeyEvent ke; @@ -1507,6 +1513,14 @@ inline void sendPanEvent(DisplayServer::WindowID window_id, double dx, double dy deltaY *= 0.03; } + if ([event momentumPhase] != NSEventPhaseNone) { + if (ignore_momentum_scroll) { + return; + } + } else { + ignore_momentum_scroll = false; + } + if ([event phase] != NSEventPhaseNone || [event momentumPhase] != NSEventPhaseNone) { sendPanEvent(window_id, deltaX, deltaY, [event modifierFlags]); } else { diff --git a/platform/uwp/detect.py b/platform/uwp/detect.py index 6e57dbbf64..2af7803749 100644 --- a/platform/uwp/detect.py +++ b/platform/uwp/detect.py @@ -81,7 +81,7 @@ def configure(env): vc_base_path = os.environ["VCTOOLSINSTALLDIR"] if "VCTOOLSINSTALLDIR" in os.environ else os.environ["VCINSTALLDIR"] # Force to use Unicode encoding - env.Append(MSVC_FLAGS=["/utf-8"]) + env.AppendUnique(CCFLAGS=["/utf-8"]) # ANGLE angle_root = os.getenv("ANGLE_SRC_PATH") diff --git a/platform/uwp/export/export.cpp b/platform/uwp/export/export.cpp index 219174b509..e9e536837f 100644 --- a/platform/uwp/export/export.cpp +++ b/platform/uwp/export/export.cpp @@ -29,11 +29,12 @@ /*************************************************************************/ #include "export.h" + #include "core/bind/core_bind.h" +#include "core/class_db.h" #include "core/crypto/crypto_core.h" #include "core/io/marshalls.h" #include "core/io/zip_io.h" -#include "core/object.h" #include "core/os/dir_access.h" #include "core/os/file_access.h" #include "core/project_settings.h" diff --git a/platform/windows/detect.py b/platform/windows/detect.py index d5474ace9c..489e45404f 100644 --- a/platform/windows/detect.py +++ b/platform/windows/detect.py @@ -223,7 +223,7 @@ def configure_msvc(env, manual_msvc_config): env.AppendUnique(CCFLAGS=["/MT", "/Gd", "/GR", "/nologo"]) # Force to use Unicode encoding - env.Append(MSVC_FLAGS=["/utf-8"]) + env.AppendUnique(CCFLAGS=["/utf-8"]) env.AppendUnique(CXXFLAGS=["/TP"]) # assume all sources are C++ if manual_msvc_config: # should be automatic if SCons found it if os.getenv("WindowsSdkDir") is not None: diff --git a/scene/2d/animated_sprite_2d.cpp b/scene/2d/animated_sprite_2d.cpp index b3370863e1..127748cdd5 100644 --- a/scene/2d/animated_sprite_2d.cpp +++ b/scene/2d/animated_sprite_2d.cpp @@ -33,9 +33,6 @@ #include "core/os/os.h" #include "scene/scene_string_names.h" -#define NORMAL_SUFFIX "_normal" -#define SPECULAR_SUFFIX "_specular" - #ifdef TOOLS_ENABLED Dictionary AnimatedSprite2D::_edit_get_state() const { Dictionary state = Node2D::_edit_get_state(); @@ -152,8 +149,6 @@ void SpriteFrames::add_animation(const StringName &p_anim) { ERR_FAIL_COND_MSG(animations.has(p_anim), "SpriteFrames already has animation '" + p_anim + "'."); animations[p_anim] = Anim(); - animations[p_anim].normal_name = String(p_anim) + NORMAL_SUFFIX; - animations[p_anim].specular_name = String(p_anim) + SPECULAR_SUFFIX; } bool SpriteFrames::has_animation(const StringName &p_anim) const { @@ -171,8 +166,6 @@ void SpriteFrames::rename_animation(const StringName &p_prev, const StringName & Anim anim = animations[p_prev]; animations.erase(p_prev); animations[p_next] = anim; - animations[p_next].normal_name = String(p_next) + NORMAL_SUFFIX; - animations[p_next].specular_name = String(p_next) + SPECULAR_SUFFIX; } Vector<String> SpriteFrames::_get_animation_list() const { @@ -441,9 +434,6 @@ void AnimatedSprite2D::_notification(int p_what) { return; } - Ref<Texture2D> normal = frames->get_normal_frame(animation, frame); - Ref<Texture2D> specular = frames->get_specular_frame(animation, frame); - RID ci = get_canvas_item(); Size2i s; @@ -465,7 +455,7 @@ void AnimatedSprite2D::_notification(int p_what) { dst_rect.size.y = -dst_rect.size.y; } - texture->draw_rect_region(ci, dst_rect, Rect2(Vector2(), texture->get_size()), Color(1, 1, 1), false, normal, specular, Color(specular_color.r, specular_color.g, specular_color.b, shininess)); + texture->draw_rect_region(ci, dst_rect, Rect2(Vector2(), texture->get_size()), Color(1, 1, 1), false); } break; } @@ -672,24 +662,6 @@ String AnimatedSprite2D::get_configuration_warning() const { return warning; } -void AnimatedSprite2D::set_specular_color(const Color &p_color) { - specular_color = p_color; - update(); -} - -Color AnimatedSprite2D::get_specular_color() const { - return specular_color; -} - -void AnimatedSprite2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float AnimatedSprite2D::get_shininess() const { - return shininess; -} - void AnimatedSprite2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_sprite_frames", "sprite_frames"), &AnimatedSprite2D::set_sprite_frames); ClassDB::bind_method(D_METHOD("get_sprite_frames"), &AnimatedSprite2D::get_sprite_frames); @@ -722,12 +694,6 @@ void AnimatedSprite2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_speed_scale", "speed_scale"), &AnimatedSprite2D::set_speed_scale); ClassDB::bind_method(D_METHOD("get_speed_scale"), &AnimatedSprite2D::get_speed_scale); - ClassDB::bind_method(D_METHOD("set_specular_color", "color"), &AnimatedSprite2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &AnimatedSprite2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &AnimatedSprite2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &AnimatedSprite2D::get_shininess); - ADD_SIGNAL(MethodInfo("frame_changed")); ADD_SIGNAL(MethodInfo("animation_finished")); @@ -737,9 +703,6 @@ void AnimatedSprite2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "frame"), "set_frame", "get_frame"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "speed_scale"), "set_speed_scale", "get_speed_scale"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "playing"), "_set_playing", "_is_playing"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Offset", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "centered"), "set_centered", "is_centered"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); @@ -759,6 +722,4 @@ AnimatedSprite2D::AnimatedSprite2D() { animation = "default"; timeout = 0; is_over = false; - specular_color = Color(1, 1, 1, 1); - shininess = 1.0; } diff --git a/scene/2d/animated_sprite_2d.h b/scene/2d/animated_sprite_2d.h index cefed56620..fddbf39be2 100644 --- a/scene/2d/animated_sprite_2d.h +++ b/scene/2d/animated_sprite_2d.h @@ -46,14 +46,8 @@ class SpriteFrames : public Resource { loop = true; speed = 5; } - - StringName normal_name; - StringName specular_name; }; - Color specular_color; - float shininess; - Map<StringName, Anim> animations; Array _get_frames() const; @@ -95,34 +89,6 @@ public: return E->get().frames[p_idx]; } - _FORCE_INLINE_ Ref<Texture2D> get_normal_frame(const StringName &p_anim, int p_idx) const { - const Map<StringName, Anim>::Element *E = animations.find(p_anim); - ERR_FAIL_COND_V_MSG(!E, Ref<Texture2D>(), "Animation '" + String(p_anim) + "' doesn't exist."); - ERR_FAIL_COND_V(p_idx < 0, Ref<Texture2D>()); - - const Map<StringName, Anim>::Element *EN = animations.find(E->get().normal_name); - - if (!EN || p_idx >= EN->get().frames.size()) { - return Ref<Texture2D>(); - } - - return EN->get().frames[p_idx]; - } - - _FORCE_INLINE_ Ref<Texture2D> get_specular_frame(const StringName &p_anim, int p_idx) const { - const Map<StringName, Anim>::Element *E = animations.find(p_anim); - ERR_FAIL_COND_V(!E, Ref<Texture2D>()); - ERR_FAIL_COND_V(p_idx < 0, Ref<Texture2D>()); - - const Map<StringName, Anim>::Element *EN = animations.find(E->get().specular_name); - - if (!EN || p_idx >= EN->get().frames.size()) { - return Ref<Texture2D>(); - } - - return EN->get().frames[p_idx]; - } - void set_frame(const StringName &p_anim, int p_idx, const Ref<Texture2D> &p_frame) { Map<StringName, Anim>::Element *E = animations.find(p_anim); ERR_FAIL_COND_MSG(!E, "Animation '" + String(p_anim) + "' doesn't exist."); @@ -166,9 +132,6 @@ class AnimatedSprite2D : public Node2D { bool _is_playing() const; Rect2 _get_rect() const; - Color specular_color; - float shininess; - protected: static void _bind_methods(); void _notification(int p_what); @@ -216,12 +179,6 @@ public: void set_flip_v(bool p_flip); bool is_flipped_v() const; - void set_specular_color(const Color &p_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - virtual String get_configuration_warning() const override; AnimatedSprite2D(); }; diff --git a/scene/2d/cpu_particles_2d.cpp b/scene/2d/cpu_particles_2d.cpp index 8d1162b7e3..ef2a9a4911 100644 --- a/scene/2d/cpu_particles_2d.cpp +++ b/scene/2d/cpu_particles_2d.cpp @@ -228,15 +228,6 @@ Ref<Texture2D> CPUParticles2D::get_texture() const { return texture; } -void CPUParticles2D::set_normalmap(const Ref<Texture2D> &p_normalmap) { - normalmap = p_normalmap; - update(); -} - -Ref<Texture2D> CPUParticles2D::get_normalmap() const { - return normalmap; -} - void CPUParticles2D::set_fixed_fps(int p_count) { fixed_fps = p_count; } @@ -1060,12 +1051,7 @@ void CPUParticles2D::_notification(int p_what) { texrid = texture->get_rid(); } - RID normrid; - if (normalmap.is_valid()) { - normrid = normalmap->get_rid(); - } - - RS::get_singleton()->canvas_item_add_multimesh(get_canvas_item(), multimesh, texrid, normrid); + RS::get_singleton()->canvas_item_add_multimesh(get_canvas_item(), multimesh, texrid); } if (p_what == NOTIFICATION_INTERNAL_PROCESS) { @@ -1214,9 +1200,6 @@ void CPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &CPUParticles2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &CPUParticles2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normalmap", "normalmap"), &CPUParticles2D::set_normalmap); - ClassDB::bind_method(D_METHOD("get_normalmap"), &CPUParticles2D::get_normalmap); - ClassDB::bind_method(D_METHOD("restart"), &CPUParticles2D::restart); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "emitting"), "set_emitting", "is_emitting"); @@ -1236,7 +1219,6 @@ void CPUParticles2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "local_coords"), "set_use_local_coordinates", "get_use_local_coordinates"); ADD_PROPERTY(PropertyInfo(Variant::INT, "draw_order", PROPERTY_HINT_ENUM, "Index,Lifetime"), "set_draw_order", "get_draw_order"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normalmap", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normalmap", "get_normalmap"); BIND_ENUM_CONSTANT(DRAW_ORDER_INDEX); BIND_ENUM_CONSTANT(DRAW_ORDER_LIFETIME); diff --git a/scene/2d/cpu_particles_2d.h b/scene/2d/cpu_particles_2d.h index dfc875ceb0..5b405246e2 100644 --- a/scene/2d/cpu_particles_2d.h +++ b/scene/2d/cpu_particles_2d.h @@ -147,7 +147,6 @@ private: DrawOrder draw_order; Ref<Texture2D> texture; - Ref<Texture2D> normalmap; //////// @@ -232,9 +231,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normalmap(const Ref<Texture2D> &p_normalmap); - Ref<Texture2D> get_normalmap() const; - /////////////////// void set_direction(Vector2 p_direction); diff --git a/scene/2d/gpu_particles_2d.cpp b/scene/2d/gpu_particles_2d.cpp index 01da36ec34..a9fdb103b2 100644 --- a/scene/2d/gpu_particles_2d.cpp +++ b/scene/2d/gpu_particles_2d.cpp @@ -267,15 +267,6 @@ Ref<Texture2D> GPUParticles2D::get_texture() const { return texture; } -void GPUParticles2D::set_normal_map(const Ref<Texture2D> &p_normal_map) { - normal_map = p_normal_map; - update(); -} - -Ref<Texture2D> GPUParticles2D::get_normal_map() const { - return normal_map; -} - void GPUParticles2D::_validate_property(PropertyInfo &property) const { } @@ -290,12 +281,8 @@ void GPUParticles2D::_notification(int p_what) { if (texture.is_valid()) { texture_rid = texture->get_rid(); } - RID normal_rid; - if (normal_map.is_valid()) { - normal_rid = normal_map->get_rid(); - } - RS::get_singleton()->canvas_item_add_particles(get_canvas_item(), particles, texture_rid, normal_rid); + RS::get_singleton()->canvas_item_add_particles(get_canvas_item(), particles, texture_rid); #ifdef TOOLS_ENABLED if (Engine::get_singleton()->is_editor_hint() && (this == get_tree()->get_edited_scene_root() || get_tree()->get_edited_scene_root()->is_a_parent_of(this))) { @@ -359,9 +346,6 @@ void GPUParticles2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticles2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticles2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "texture"), &GPUParticles2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &GPUParticles2D::get_normal_map); - ClassDB::bind_method(D_METHOD("capture_rect"), &GPUParticles2D::capture_rect); ClassDB::bind_method(D_METHOD("restart"), &GPUParticles2D::restart); @@ -385,7 +369,6 @@ void GPUParticles2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "process_material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial,ParticlesMaterial"), "set_process_material", "get_process_material"); ADD_GROUP("Textures", ""); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); BIND_ENUM_CONSTANT(DRAW_ORDER_INDEX); BIND_ENUM_CONSTANT(DRAW_ORDER_LIFETIME); diff --git a/scene/2d/gpu_particles_2d.h b/scene/2d/gpu_particles_2d.h index 3258237f92..f1001a39fe 100644 --- a/scene/2d/gpu_particles_2d.h +++ b/scene/2d/gpu_particles_2d.h @@ -65,7 +65,6 @@ private: DrawOrder draw_order; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; void _update_particle_emission_transform(); @@ -111,9 +110,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> get_normal_map() const; - virtual String get_configuration_warning() const override; void restart(); diff --git a/scene/2d/light_2d.cpp b/scene/2d/light_2d.cpp index 217a210342..4fc0882fdd 100644 --- a/scene/2d/light_2d.cpp +++ b/scene/2d/light_2d.cpp @@ -262,15 +262,6 @@ bool Light2D::is_shadow_enabled() const { return shadow; } -void Light2D::set_shadow_buffer_size(int p_size) { - shadow_buffer_size = p_size; - RS::get_singleton()->canvas_light_set_shadow_buffer_size(canvas_light, shadow_buffer_size); -} - -int Light2D::get_shadow_buffer_size() const { - return shadow_buffer_size; -} - void Light2D::set_shadow_filter(ShadowFilter p_filter) { ERR_FAIL_INDEX(p_filter, SHADOW_FILTER_MAX); shadow_filter = p_filter; @@ -380,9 +371,6 @@ void Light2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_shadow_enabled", "enabled"), &Light2D::set_shadow_enabled); ClassDB::bind_method(D_METHOD("is_shadow_enabled"), &Light2D::is_shadow_enabled); - ClassDB::bind_method(D_METHOD("set_shadow_buffer_size", "size"), &Light2D::set_shadow_buffer_size); - ClassDB::bind_method(D_METHOD("get_shadow_buffer_size"), &Light2D::get_shadow_buffer_size); - ClassDB::bind_method(D_METHOD("set_shadow_smooth", "smooth"), &Light2D::set_shadow_smooth); ClassDB::bind_method(D_METHOD("get_shadow_smooth"), &Light2D::get_shadow_smooth); @@ -411,7 +399,6 @@ void Light2D::_bind_methods() { ADD_GROUP("Shadow", "shadow_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "shadow_enabled"), "set_shadow_enabled", "is_shadow_enabled"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "shadow_color"), "set_shadow_color", "get_shadow_color"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_buffer_size", PROPERTY_HINT_RANGE, "32,16384,1"), "set_shadow_buffer_size", "get_shadow_buffer_size"); ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_filter", PROPERTY_HINT_ENUM, "None,PCF5,PCF13"), "set_shadow_filter", "get_shadow_filter"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shadow_filter_smooth", PROPERTY_HINT_RANGE, "0,64,0.1"), "set_shadow_smooth", "get_shadow_smooth"); ADD_PROPERTY(PropertyInfo(Variant::INT, "shadow_item_cull_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_item_shadow_cull_mask", "get_item_shadow_cull_mask"); @@ -441,7 +428,6 @@ Light2D::Light2D() { item_mask = 1; item_shadow_mask = 1; mode = MODE_ADD; - shadow_buffer_size = 2048; energy = 1.0; shadow_color = Color(0, 0, 0, 0); shadow_filter = SHADOW_FILTER_NONE; diff --git a/scene/2d/light_2d.h b/scene/2d/light_2d.h index 45444800fe..095cb05635 100644 --- a/scene/2d/light_2d.h +++ b/scene/2d/light_2d.h @@ -67,7 +67,6 @@ private: int layer_max; int item_mask; int item_shadow_mask; - int shadow_buffer_size; float shadow_smooth; Mode mode; Ref<Texture2D> texture; @@ -142,9 +141,6 @@ public: void set_shadow_enabled(bool p_enabled); bool is_shadow_enabled() const; - void set_shadow_buffer_size(int p_size); - int get_shadow_buffer_size() const; - void set_shadow_filter(ShadowFilter p_filter); ShadowFilter get_shadow_filter() const; diff --git a/scene/2d/mesh_instance_2d.cpp b/scene/2d/mesh_instance_2d.cpp index 897595ad1f..037e423ce9 100644 --- a/scene/2d/mesh_instance_2d.cpp +++ b/scene/2d/mesh_instance_2d.cpp @@ -33,7 +33,7 @@ void MeshInstance2D::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { if (mesh.is_valid()) { - draw_mesh(mesh, texture, normal_map); + draw_mesh(mesh, texture); } } } diff --git a/scene/2d/multimesh_instance_2d.cpp b/scene/2d/multimesh_instance_2d.cpp index b99c0a3fa9..c258e30eab 100644 --- a/scene/2d/multimesh_instance_2d.cpp +++ b/scene/2d/multimesh_instance_2d.cpp @@ -33,7 +33,7 @@ void MultiMeshInstance2D::_notification(int p_what) { if (p_what == NOTIFICATION_DRAW) { if (multimesh.is_valid()) { - draw_multimesh(multimesh, texture, normal_map); + draw_multimesh(multimesh, texture); } } } diff --git a/scene/2d/physics_body_2d.cpp b/scene/2d/physics_body_2d.cpp index 22d426bdb4..402eac644f 100644 --- a/scene/2d/physics_body_2d.cpp +++ b/scene/2d/physics_body_2d.cpp @@ -30,27 +30,17 @@ #include "physics_body_2d.h" +#include "core/class_db.h" #include "core/core_string_names.h" #include "core/engine.h" #include "core/list.h" #include "core/math/math_funcs.h" -#include "core/method_bind_ext.gen.inc" -#include "core/object.h" #include "core/rid.h" #include "scene/scene_string_names.h" void PhysicsBody2D::_notification(int p_what) { } -void PhysicsBody2D::_set_layers(uint32_t p_mask) { - set_collision_layer(p_mask); - set_collision_mask(p_mask); -} - -uint32_t PhysicsBody2D::_get_layers() const { - return get_collision_layer(); -} - void PhysicsBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody2D::set_collision_layer); ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody2D::get_collision_layer); @@ -63,13 +53,9 @@ void PhysicsBody2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody2D::set_collision_layer_bit); ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody2D::get_collision_layer_bit); - ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody2D::_set_layers); - ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody2D::_get_layers); - ClassDB::bind_method(D_METHOD("get_collision_exceptions"), &PhysicsBody2D::get_collision_exceptions); ClassDB::bind_method(D_METHOD("add_collision_exception_with", "body"), &PhysicsBody2D::add_collision_exception_with); ClassDB::bind_method(D_METHOD("remove_collision_exception_with", "body"), &PhysicsBody2D::remove_collision_exception_with); - ADD_PROPERTY(PropertyInfo(Variant::INT, "layers", PROPERTY_HINT_LAYERS_2D_PHYSICS, "", 0), "_set_layers", "_get_layers"); //for backwards compat ADD_GROUP("Collision", "collision_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_2D_PHYSICS), "set_collision_layer", "get_collision_layer"); diff --git a/scene/2d/physics_body_2d.h b/scene/2d/physics_body_2d.h index e83ab6557d..aefea56fa3 100644 --- a/scene/2d/physics_body_2d.h +++ b/scene/2d/physics_body_2d.h @@ -44,9 +44,6 @@ class PhysicsBody2D : public CollisionObject2D { uint32_t collision_layer; uint32_t collision_mask; - void _set_layers(uint32_t p_mask); - uint32_t _get_layers() const; - protected: void _notification(int p_what); PhysicsBody2D(PhysicsServer2D::BodyMode p_mode); diff --git a/scene/2d/polygon_2d.cpp b/scene/2d/polygon_2d.cpp index 13b62816a4..26340bb861 100644 --- a/scene/2d/polygon_2d.cpp +++ b/scene/2d/polygon_2d.cpp @@ -302,7 +302,7 @@ void Polygon2D::_notification(int p_what) { if (invert || polygons.size() == 0) { Vector<int> indices = Geometry2D::triangulate_polygon(points); if (indices.size()) { - RS::get_singleton()->canvas_item_add_triangle_array(get_canvas_item(), indices, points, colors, uvs, bones, weights, texture.is_valid() ? texture->get_rid() : RID(), -1, normal_map.is_valid() ? normal_map->get_rid() : RID(), specular_map.is_valid() ? specular_map->get_rid() : RID(), Color(specular_color.r, specular_color.g, specular_color.b, shininess)); + RS::get_singleton()->canvas_item_add_triangle_array(get_canvas_item(), indices, points, colors, uvs, bones, weights, texture.is_valid() ? texture->get_rid() : RID(), -1); } } else { //draw individual polygons @@ -417,42 +417,6 @@ Ref<Texture2D> Polygon2D::get_texture() const { return texture; } -void Polygon2D::set_normal_map(const Ref<Texture2D> &p_normal_map) { - normal_map = p_normal_map; - update(); -} - -Ref<Texture2D> Polygon2D::get_normal_map() const { - return normal_map; -} - -void Polygon2D::set_specular_map(const Ref<Texture2D> &p_specular_map) { - specular_map = p_specular_map; - update(); -} - -Ref<Texture2D> Polygon2D::get_specular_map() const { - return specular_map; -} - -void Polygon2D::set_specular_color(const Color &p_specular_color) { - specular_color = p_specular_color; - update(); -} - -Color Polygon2D::get_specular_color() const { - return specular_color; -} - -void Polygon2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float Polygon2D::get_shininess() const { - return shininess; -} - void Polygon2D::set_texture_offset(const Vector2 &p_offset) { tex_ofs = p_offset; update(); @@ -616,18 +580,6 @@ void Polygon2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &Polygon2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &Polygon2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &Polygon2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &Polygon2D::get_normal_map); - - ClassDB::bind_method(D_METHOD("set_specular_map", "specular_map"), &Polygon2D::set_specular_map); - ClassDB::bind_method(D_METHOD("get_specular_map"), &Polygon2D::get_specular_map); - - ClassDB::bind_method(D_METHOD("set_specular_color", "specular_color"), &Polygon2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &Polygon2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &Polygon2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &Polygon2D::get_shininess); - ClassDB::bind_method(D_METHOD("set_texture_offset", "texture_offset"), &Polygon2D::set_texture_offset); ClassDB::bind_method(D_METHOD("get_texture_offset"), &Polygon2D::get_texture_offset); @@ -680,11 +632,6 @@ void Polygon2D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "texture_scale"), "set_texture_scale", "get_texture_scale"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_rotation_degrees", PROPERTY_HINT_RANGE, "-360,360,0.1,or_lesser,or_greater"), "set_texture_rotation_degrees", "get_texture_rotation_degrees"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "texture_rotation", PROPERTY_HINT_NONE, "", 0), "set_texture_rotation", "get_texture_rotation"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_map", "get_specular_map"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Skeleton", ""); ADD_PROPERTY(PropertyInfo(Variant::NODE_PATH, "skeleton", PROPERTY_HINT_NODE_PATH_VALID_TYPES, "Skeleton2D"), "set_skeleton", "get_skeleton"); @@ -711,7 +658,4 @@ Polygon2D::Polygon2D() { color = Color(1, 1, 1); rect_cache_dirty = true; internal_vertices = 0; - - specular_color = Color(1, 1, 1, 1); - shininess = 1.0; } diff --git a/scene/2d/polygon_2d.h b/scene/2d/polygon_2d.h index c5ff05aace..e2a8db414a 100644 --- a/scene/2d/polygon_2d.h +++ b/scene/2d/polygon_2d.h @@ -51,10 +51,6 @@ class Polygon2D : public Node2D { Color color; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; - Ref<Texture2D> specular_map; - Color specular_color; - float shininess; Size2 tex_scale; Vector2 tex_ofs; @@ -115,18 +111,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> get_normal_map() const; - - void set_specular_map(const Ref<Texture2D> &p_specular_map); - Ref<Texture2D> get_specular_map() const; - - void set_specular_color(const Color &p_specular_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - void set_texture_offset(const Vector2 &p_offset); Vector2 get_texture_offset() const; diff --git a/scene/2d/sprite_2d.cpp b/scene/2d/sprite_2d.cpp index d1be93e55d..5178d2f850 100644 --- a/scene/2d/sprite_2d.cpp +++ b/scene/2d/sprite_2d.cpp @@ -130,8 +130,8 @@ void Sprite2D::_notification(int p_what) { Rect2 src_rect, dst_rect; bool filter_clip; _get_rects(src_rect, dst_rect, filter_clip); - texture->draw_rect_region(ci, dst_rect, src_rect, Color(1, 1, 1), false, normal_map, specular, Color(specular_color.r, specular_color.g, specular_color.b, shininess), RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, filter_clip); + texture->draw_rect_region(ci, dst_rect, src_rect, Color(1, 1, 1), false, filter_clip); } break; } } @@ -157,42 +157,6 @@ void Sprite2D::set_texture(const Ref<Texture2D> &p_texture) { _change_notify("texture"); } -void Sprite2D::set_normal_map(const Ref<Texture2D> &p_texture) { - normal_map = p_texture; - update(); -} - -Ref<Texture2D> Sprite2D::get_normal_map() const { - return normal_map; -} - -void Sprite2D::set_specular_map(const Ref<Texture2D> &p_texture) { - specular = p_texture; - update(); -} - -Ref<Texture2D> Sprite2D::get_specular_map() const { - return specular; -} - -void Sprite2D::set_specular_color(const Color &p_color) { - specular_color = p_color; - update(); -} - -Color Sprite2D::get_specular_color() const { - return specular_color; -} - -void Sprite2D::set_shininess(float p_shininess) { - shininess = CLAMP(p_shininess, 0.0, 1.0); - update(); -} - -float Sprite2D::get_shininess() const { - return shininess; -} - Ref<Texture2D> Sprite2D::get_texture() const { return texture; } @@ -434,18 +398,6 @@ void Sprite2D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &Sprite2D::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &Sprite2D::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &Sprite2D::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &Sprite2D::get_normal_map); - - ClassDB::bind_method(D_METHOD("set_specular_map", "specular_map"), &Sprite2D::set_specular_map); - ClassDB::bind_method(D_METHOD("get_specular_map"), &Sprite2D::get_specular_map); - - ClassDB::bind_method(D_METHOD("set_specular_color", "specular_color"), &Sprite2D::set_specular_color); - ClassDB::bind_method(D_METHOD("get_specular_color"), &Sprite2D::get_specular_color); - - ClassDB::bind_method(D_METHOD("set_shininess", "shininess"), &Sprite2D::set_shininess); - ClassDB::bind_method(D_METHOD("get_shininess"), &Sprite2D::get_shininess); - ClassDB::bind_method(D_METHOD("set_centered", "centered"), &Sprite2D::set_centered); ClassDB::bind_method(D_METHOD("is_centered"), &Sprite2D::is_centered); @@ -487,11 +439,6 @@ void Sprite2D::_bind_methods() { ADD_SIGNAL(MethodInfo("texture_changed")); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_GROUP("Lighting", ""); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_map", "get_specular_map"); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); - ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_shininess", "get_shininess"); ADD_GROUP("Offset", ""); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "centered"), "set_centered", "is_centered"); ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "offset"), "set_offset", "get_offset"); @@ -515,8 +462,6 @@ Sprite2D::Sprite2D() { vflip = false; region = false; region_filter_clip = false; - shininess = 1.0; - specular_color = Color(1, 1, 1, 1); frame = 0; diff --git a/scene/2d/sprite_2d.h b/scene/2d/sprite_2d.h index f6b752575f..2875d333bb 100644 --- a/scene/2d/sprite_2d.h +++ b/scene/2d/sprite_2d.h @@ -38,8 +38,6 @@ class Sprite2D : public Node2D { GDCLASS(Sprite2D, Node2D); Ref<Texture2D> texture; - Ref<Texture2D> normal_map; - Ref<Texture2D> specular; Color specular_color; float shininess; @@ -87,18 +85,6 @@ public: void set_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_normal_map() const; - - void set_specular_map(const Ref<Texture2D> &p_texture); - Ref<Texture2D> get_specular_map() const; - - void set_specular_color(const Color &p_color); - Color get_specular_color() const; - - void set_shininess(float p_shininess); - float get_shininess() const; - void set_centered(bool p_center); bool is_centered() const; diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp index c2951559a4..bff191a2bf 100644 --- a/scene/2d/tile_map.cpp +++ b/scene/2d/tile_map.cpp @@ -32,7 +32,6 @@ #include "collision_object_2d.h" #include "core/io/marshalls.h" -#include "core/method_bind_ext.gen.inc" #include "core/os/os.h" #include "scene/2d/area_2d.h" #include "servers/navigation_server_2d.h" @@ -529,15 +528,14 @@ void TileMap::update_dirty_quadrants() { rect.position += tile_ofs; } - Ref<Texture2D> normal_map = tile_set->tile_get_normal_map(c.id); Color modulate = tile_set->tile_get_modulate(c.id); Color self_modulate = get_self_modulate(); modulate = Color(modulate.r * self_modulate.r, modulate.g * self_modulate.g, modulate.b * self_modulate.b, modulate.a * self_modulate.a); if (r == Rect2()) { - tex->draw_rect(canvas_item, rect, false, modulate, c.transpose, normal_map); + tex->draw_rect(canvas_item, rect, false, modulate, c.transpose); } else { - tex->draw_rect_region(canvas_item, rect, r, modulate, c.transpose, normal_map, Ref<Texture2D>(), Color(1, 1, 1, 1), RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, clip_uv); + tex->draw_rect_region(canvas_item, rect, r, modulate, c.transpose, clip_uv); } Vector<TileSet::ShapeData> shapes = tile_set->tile_get_shapes(c.id); diff --git a/scene/3d/gi_probe.cpp b/scene/3d/gi_probe.cpp index ab30d2fec5..fd592012f8 100644 --- a/scene/3d/gi_probe.cpp +++ b/scene/3d/gi_probe.cpp @@ -32,7 +32,6 @@ #include "core/os/os.h" -#include "core/method_bind_ext.gen.inc" #include "mesh_instance_3d.h" #include "voxelizer.h" diff --git a/scene/3d/gpu_particles_3d.cpp b/scene/3d/gpu_particles_3d.cpp index da5c99a873..ec33d7bcab 100644 --- a/scene/3d/gpu_particles_3d.cpp +++ b/scene/3d/gpu_particles_3d.cpp @@ -124,6 +124,11 @@ void GPUParticles3D::set_speed_scale(float p_scale) { RS::get_singleton()->particles_set_speed_scale(particles, p_scale); } +void GPUParticles3D::set_collision_base_size(float p_size) { + collision_base_size = p_size; + RS::get_singleton()->particles_set_collision_base_size(particles, p_size); +} + bool GPUParticles3D::is_emitting() const { return RS::get_singleton()->particles_get_emitting(particles); } @@ -168,6 +173,10 @@ float GPUParticles3D::get_speed_scale() const { return speed_scale; } +float GPUParticles3D::get_collision_base_size() const { + return collision_base_size; +} + void GPUParticles3D::set_draw_order(DrawOrder p_order) { draw_order = p_order; RS::get_singleton()->particles_set_draw_order(particles, RS::ParticlesDrawOrder(p_order)); @@ -381,6 +390,7 @@ void GPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_fractional_delta", "enable"), &GPUParticles3D::set_fractional_delta); ClassDB::bind_method(D_METHOD("set_process_material", "material"), &GPUParticles3D::set_process_material); ClassDB::bind_method(D_METHOD("set_speed_scale", "scale"), &GPUParticles3D::set_speed_scale); + ClassDB::bind_method(D_METHOD("set_collision_base_size", "size"), &GPUParticles3D::set_collision_base_size); ClassDB::bind_method(D_METHOD("is_emitting"), &GPUParticles3D::is_emitting); ClassDB::bind_method(D_METHOD("get_amount"), &GPUParticles3D::get_amount); @@ -395,6 +405,7 @@ void GPUParticles3D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_fractional_delta"), &GPUParticles3D::get_fractional_delta); ClassDB::bind_method(D_METHOD("get_process_material"), &GPUParticles3D::get_process_material); ClassDB::bind_method(D_METHOD("get_speed_scale"), &GPUParticles3D::get_speed_scale); + ClassDB::bind_method(D_METHOD("get_collision_base_size"), &GPUParticles3D::get_collision_base_size); ClassDB::bind_method(D_METHOD("set_draw_order", "order"), &GPUParticles3D::set_draw_order); @@ -426,6 +437,8 @@ void GPUParticles3D::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_randomness_ratio", "get_randomness_ratio"); ADD_PROPERTY(PropertyInfo(Variant::INT, "fixed_fps", PROPERTY_HINT_RANGE, "0,1000,1"), "set_fixed_fps", "get_fixed_fps"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fract_delta"), "set_fractional_delta", "get_fractional_delta"); + ADD_GROUP("Collision", "collision_"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_base_size", PROPERTY_HINT_RANGE, "0,128,0.01,or_greater"), "set_collision_base_size", "get_collision_base_size"); ADD_GROUP("Drawing", ""); ADD_PROPERTY(PropertyInfo(Variant::AABB, "visibility_aabb"), "set_visibility_aabb", "get_visibility_aabb"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "local_coords"), "set_use_local_coordinates", "get_use_local_coordinates"); @@ -469,6 +482,7 @@ GPUParticles3D::GPUParticles3D() { set_draw_passes(1); set_draw_order(DRAW_ORDER_INDEX); set_speed_scale(1); + set_collision_base_size(0.01); } GPUParticles3D::~GPUParticles3D() { diff --git a/scene/3d/gpu_particles_3d.h b/scene/3d/gpu_particles_3d.h index 0d8dadd31d..b68acef21c 100644 --- a/scene/3d/gpu_particles_3d.h +++ b/scene/3d/gpu_particles_3d.h @@ -65,6 +65,7 @@ private: int fixed_fps; bool fractional_delta; NodePath sub_emitter; + float collision_base_size; Ref<Material> process_material; @@ -94,6 +95,7 @@ public: void set_use_local_coordinates(bool p_enable); void set_process_material(const Ref<Material> &p_material); void set_speed_scale(float p_scale); + void set_collision_base_size(float p_ratio); bool is_emitting() const; int get_amount() const; @@ -106,6 +108,7 @@ public: bool get_use_local_coordinates() const; Ref<Material> get_process_material() const; float get_speed_scale() const; + float get_collision_base_size() const; void set_fixed_fps(int p_count); int get_fixed_fps() const; diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp new file mode 100644 index 0000000000..baaaa23185 --- /dev/null +++ b/scene/3d/gpu_particles_collision_3d.cpp @@ -0,0 +1,901 @@ +/*************************************************************************/ +/* gpu_particles_collision_3d.cpp */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#include "gpu_particles_collision_3d.h" + +#include "core/thread_work_pool.h" +#include "mesh_instance_3d.h" +#include "scene/3d/camera_3d.h" +#include "scene/main/viewport.h" + +void GPUParticlesCollision3D::set_cull_mask(uint32_t p_cull_mask) { + cull_mask = p_cull_mask; + RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask); +} + +uint32_t GPUParticlesCollision3D::get_cull_mask() const { + return cull_mask; +} + +void GPUParticlesCollision3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesCollision3D::set_cull_mask); + ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesCollision3D::get_cull_mask); + + ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask"); +} + +GPUParticlesCollision3D::GPUParticlesCollision3D(RS::ParticlesCollisionType p_type) { + collision = RS::get_singleton()->particles_collision_create(); + RS::get_singleton()->particles_collision_set_collision_type(collision, p_type); + set_base(collision); +} + +GPUParticlesCollision3D::~GPUParticlesCollision3D() { + RS::get_singleton()->free(collision); +} + +///////////////////////////////// + +void GPUParticlesCollisionSphere::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesCollisionSphere::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesCollisionSphere::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); +} + +void GPUParticlesCollisionSphere::set_radius(float p_radius) { + radius = p_radius; + RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); + update_gizmo(); +} + +float GPUParticlesCollisionSphere::get_radius() const { + return radius; +} + +AABB GPUParticlesCollisionSphere::get_aabb() const { + return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); +} + +GPUParticlesCollisionSphere::GPUParticlesCollisionSphere() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE) { +} + +GPUParticlesCollisionSphere::~GPUParticlesCollisionSphere() { +} + +/////////////////////////// + +void GPUParticlesCollisionBox::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionBox::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionBox::get_extents); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); +} + +void GPUParticlesCollisionBox::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesCollisionBox::get_extents() const { + return extents; +} + +AABB GPUParticlesCollisionBox::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionBox::GPUParticlesCollisionBox() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE) { +} + +GPUParticlesCollisionBox::~GPUParticlesCollisionBox() { +} + +/////////////////////////////// +/////////////////////////// + +void GPUParticlesCollisionSDF::_find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes) { + MeshInstance3D *mi = Object::cast_to<MeshInstance3D>(p_at_node); + if (mi && mi->is_visible_in_tree()) { + Ref<Mesh> mesh = mi->get_mesh(); + if (mesh.is_valid()) { + AABB aabb = mesh->get_aabb(); + + Transform xf = get_global_transform().affine_inverse() * mi->get_global_transform(); + + if (p_aabb.intersects(xf.xform(aabb))) { + PlotMesh pm; + pm.local_xform = xf; + pm.mesh = mesh; + plot_meshes.push_back(pm); + } + } + } + + Node3D *s = Object::cast_to<Node3D>(p_at_node); + if (s) { + if (s->is_visible_in_tree()) { + Array meshes = p_at_node->call("get_meshes"); + for (int i = 0; i < meshes.size(); i += 2) { + Transform mxf = meshes[i]; + Ref<Mesh> mesh = meshes[i + 1]; + if (!mesh.is_valid()) { + continue; + } + + AABB aabb = mesh->get_aabb(); + + Transform xf = get_global_transform().affine_inverse() * (s->get_global_transform() * mxf); + + if (p_aabb.intersects(xf.xform(aabb))) { + PlotMesh pm; + pm.local_xform = xf; + pm.mesh = mesh; + plot_meshes.push_back(pm); + } + } + } + } + + for (int i = 0; i < p_at_node->get_child_count(); i++) { + Node *child = p_at_node->get_child(i); + _find_meshes(p_aabb, child, plot_meshes); + } +} + +uint32_t GPUParticlesCollisionSDF::_create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness) { + if (p_face_count == 1) { + return BVH::LEAF_BIT | p_faces[0].index; + } + + uint32_t index = bvh_tree.size(); + { + BVH bvh; + + for (uint32_t i = 0; i < p_face_count; i++) { + const Face3 &f = p_triangles[p_faces[i].index]; + AABB aabb(f.vertex[0], Vector3()); + aabb.expand_to(f.vertex[1]); + aabb.expand_to(f.vertex[2]); + if (p_thickness > 0.0) { + Vector3 normal = p_triangles[p_faces[i].index].get_plane().normal; + aabb.expand_to(f.vertex[0] - normal * p_thickness); + aabb.expand_to(f.vertex[1] - normal * p_thickness); + aabb.expand_to(f.vertex[2] - normal * p_thickness); + } + if (i == 0) { + bvh.bounds = aabb; + } else { + bvh.bounds.merge_with(aabb); + } + } + bvh_tree.push_back(bvh); + } + + uint32_t middle = p_face_count / 2; + + SortArray<FacePos, FaceSort> s; + s.compare.axis = bvh_tree[index].bounds.get_longest_axis_index(); + s.sort(p_faces, p_face_count); + + uint32_t left = _create_bvh(bvh_tree, p_faces, middle, p_triangles, p_thickness); + uint32_t right = _create_bvh(bvh_tree, p_faces + middle, p_face_count - middle, p_triangles, p_thickness); + + bvh_tree[index].children[0] = left; + bvh_tree[index].children[1] = right; + + return index; +} + +static _FORCE_INLINE_ float Vector3_dot2(const Vector3 &p_vec3) { + return p_vec3.dot(p_vec3); +} + +void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance) { + if (p_bvh_cell & BVH::LEAF_BIT) { + p_bvh_cell &= BVH::LEAF_MASK; //remove bit + + Vector3 point = p_pos; + Plane p = triangles[p_bvh_cell].get_plane(); + float d = p.distance_to(point); + float inside_d = 1e20; + if (d < 0 && d > -thickness) { + //inside planes, do this in 2D + + Vector3 x_axis = (triangles[p_bvh_cell].vertex[0] - triangles[p_bvh_cell].vertex[1]).normalized(); + Vector3 y_axis = p.normal.cross(x_axis).normalized(); + + Vector2 points[3]; + for (int i = 0; i < 3; i++) { + points[i] = Vector2(x_axis.dot(triangles[p_bvh_cell].vertex[i]), y_axis.dot(triangles[p_bvh_cell].vertex[i])); + } + + Vector2 p2d = Vector2(x_axis.dot(point), y_axis.dot(point)); + + { + // https://www.shadertoy.com/view/XsXSz4 + + Vector2 e0 = points[1] - points[0]; + Vector2 e1 = points[2] - points[1]; + Vector2 e2 = points[0] - points[2]; + + Vector2 v0 = p2d - points[0]; + Vector2 v1 = p2d - points[1]; + Vector2 v2 = p2d - points[2]; + + Vector2 pq0 = v0 - e0 * CLAMP(v0.dot(e0) / e0.dot(e0), 0.0, 1.0); + Vector2 pq1 = v1 - e1 * CLAMP(v1.dot(e1) / e1.dot(e1), 0.0, 1.0); + Vector2 pq2 = v2 - e2 * CLAMP(v2.dot(e2) / e2.dot(e2), 0.0, 1.0); + + float s = SGN(e0.x * e2.y - e0.y * e2.x); + Vector2 d2 = Vector2(pq0.dot(pq0), s * (v0.x * e0.y - v0.y * e0.x)).min(Vector2(pq1.dot(pq1), s * (v1.x * e1.y - v1.y * e1.x))).min(Vector2(pq2.dot(pq2), s * (v2.x * e2.y - v2.y * e2.x))); + + inside_d = -Math::sqrt(d2.x) * SGN(d2.y); + } + + //make sure distance to planes is not shorter if inside + if (inside_d < 0) { + inside_d = MAX(inside_d, d); + inside_d = MAX(inside_d, -(thickness + d)); + } + + closest_distance = MIN(closest_distance, inside_d); + } else { + if (d < 0) { + point -= p.normal * thickness; //flatten + } + + // https://iquilezles.org/www/articles/distfunctions/distfunctions.htm + Vector3 a = triangles[p_bvh_cell].vertex[0]; + Vector3 b = triangles[p_bvh_cell].vertex[1]; + Vector3 c = triangles[p_bvh_cell].vertex[2]; + + Vector3 ba = b - a; + Vector3 pa = point - a; + Vector3 cb = c - b; + Vector3 pb = point - b; + Vector3 ac = a - c; + Vector3 pc = point - c; + Vector3 nor = ba.cross(ac); + + inside_d = Math::sqrt( + (SGN(ba.cross(nor).dot(pa)) + + SGN(cb.cross(nor).dot(pb)) + + SGN(ac.cross(nor).dot(pc)) < + 2.0) ? + MIN(MIN( + Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa), + Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)), + Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) : + nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor)); + + closest_distance = MIN(closest_distance, inside_d); + } + + } else { + bool pass = true; + if (!bvh[p_bvh_cell].bounds.has_point(p_pos)) { + //outside, find closest point + Vector3 he = bvh[p_bvh_cell].bounds.size * 0.5; + Vector3 center = bvh[p_bvh_cell].bounds.position + he; + + Vector3 rel = (p_pos - center).abs(); + Vector3 closest(MIN(rel.x, he.x), MIN(rel.y, he.y), MIN(rel.z, he.z)); + float d = rel.distance_to(closest); + + if (d >= closest_distance) { + pass = false; //already closer than this aabb, discard + } + } + + if (pass) { + _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[0], triangles, thickness, closest_distance); + _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[1], triangles, thickness, closest_distance); + } + } +} + +void GPUParticlesCollisionSDF::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *params) { + int32_t z_ofs = p_z * params->size.y * params->size.x; + for (int32_t y = 0; y < params->size.y; y++) { + int32_t y_ofs = z_ofs + y * params->size.x; + for (int32_t x = 0; x < params->size.x; x++) { + int32_t x_ofs = y_ofs + x; + float &cell = params->cells[x_ofs]; + + Vector3 pos = params->cell_offset + Vector3(x, y, p_z) * params->cell_size; + + cell = 1e20; + + _find_closest_distance(pos, params->bvh, 0, params->triangles, params->thickness, cell); + } + } +} + +void GPUParticlesCollisionSDF::_compute_sdf(ComputeSDFParams *params) { + ThreadWorkPool work_pool; + work_pool.init(); + work_pool.begin_work(params->size.z, this, &GPUParticlesCollisionSDF::_compute_sdf_z, params); + while (work_pool.get_work_index() < (uint32_t)params->size.z) { + OS::get_singleton()->delay_usec(10000); + bake_step_function(work_pool.get_work_index() * 100 / params->size.z, "Baking SDF"); + } + work_pool.end_work(); + work_pool.finish(); +} + +Vector3i GPUParticlesCollisionSDF::get_estimated_cell_size() const { + static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; + int subdiv = subdivs[get_resolution()]; + + AABB aabb(-extents, extents * 2); + + float cell_size = aabb.get_longest_axis_size() / float(subdiv); + + Vector3i sdf_size = Vector3i(aabb.size / cell_size); + sdf_size.x = MAX(1, sdf_size.x); + sdf_size.y = MAX(1, sdf_size.y); + sdf_size.z = MAX(1, sdf_size.z); + return sdf_size; +} + +Ref<Image> GPUParticlesCollisionSDF::bake() { + static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 }; + int subdiv = subdivs[get_resolution()]; + + AABB aabb(-extents, extents * 2); + + float cell_size = aabb.get_longest_axis_size() / float(subdiv); + + Vector3i sdf_size = Vector3i(aabb.size / cell_size); + sdf_size.x = MAX(1, sdf_size.x); + sdf_size.y = MAX(1, sdf_size.y); + sdf_size.z = MAX(1, sdf_size.z); + + if (bake_begin_function) { + bake_begin_function(100); + } + + aabb.size = Vector3(sdf_size) * cell_size; + + List<PlotMesh> plot_meshes; + _find_meshes(aabb, get_parent(), plot_meshes); + + LocalVector<Face3> faces; + + if (bake_step_function) { + bake_step_function(0, "Finding Meshes"); + } + + for (List<PlotMesh>::Element *E = plot_meshes.front(); E; E = E->next()) { + const PlotMesh &pm = E->get(); + + for (int i = 0; i < pm.mesh->get_surface_count(); i++) { + if (pm.mesh->surface_get_primitive_type(i) != Mesh::PRIMITIVE_TRIANGLES) { + continue; //only triangles + } + + Array a = pm.mesh->surface_get_arrays(i); + + Vector<Vector3> vertices = a[Mesh::ARRAY_VERTEX]; + const Vector3 *vr = vertices.ptr(); + Vector<int> index = a[Mesh::ARRAY_INDEX]; + + if (index.size()) { + int facecount = index.size() / 3; + const int *ir = index.ptr(); + + for (int j = 0; j < facecount; j++) { + Face3 face; + + for (int k = 0; k < 3; k++) { + face.vertex[k] = pm.local_xform.xform(vr[ir[j * 3 + k]]); + } + + //test against original bounds + if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) { + continue; + } + + faces.push_back(face); + } + + } else { + int facecount = vertices.size() / 3; + + for (int j = 0; j < facecount; j++) { + Face3 face; + + for (int k = 0; k < 3; k++) { + face.vertex[k] = pm.local_xform.xform(vr[j * 3 + k]); + } + + //test against original bounds + if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) { + continue; + } + + faces.push_back(face); + } + } + } + } + + //compute bvh + + ERR_FAIL_COND_V(faces.size() <= 1, Ref<Image>()); + + LocalVector<FacePos> face_pos; + + face_pos.resize(faces.size()); + + float th = cell_size * thickness; + + for (uint32_t i = 0; i < faces.size(); i++) { + face_pos[i].index = i; + face_pos[i].center = (faces[i].vertex[0] + faces[i].vertex[1] + faces[i].vertex[2]) / 2; + if (th > 0.0) { + face_pos[i].center -= faces[i].get_plane().normal * th * 0.5; + } + } + + if (bake_step_function) { + bake_step_function(0, "Creating BVH"); + } + + LocalVector<BVH> bvh; + + _create_bvh(bvh, face_pos.ptr(), face_pos.size(), faces.ptr(), th); + + Vector<uint8_t> data; + data.resize(sdf_size.z * sdf_size.y * sdf_size.x * sizeof(float)); + + if (bake_step_function) { + bake_step_function(0, "Baking SDF"); + } + + ComputeSDFParams params; + params.cells = (float *)data.ptrw(); + params.size = sdf_size; + params.cell_size = cell_size; + params.cell_offset = aabb.position + Vector3(cell_size * 0.5, cell_size * 0.5, cell_size * 0.5); + params.bvh = bvh.ptr(); + params.triangles = faces.ptr(); + params.thickness = th; + _compute_sdf(¶ms); + + Ref<Image> ret; + ret.instance(); + ret->create(sdf_size.x, sdf_size.y * sdf_size.z, false, Image::FORMAT_RF, data); + ret->convert(Image::FORMAT_RH); //convert to half, save space + ret->set_meta("depth", sdf_size.z); //hack, make sure to add to the docs of this function + + if (bake_end_function) { + bake_end_function(); + } + + return ret; +} + +void GPUParticlesCollisionSDF::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionSDF::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionSDF::get_extents); + + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionSDF::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionSDF::get_resolution); + + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesCollisionSDF::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesCollisionSDF::get_texture); + + ClassDB::bind_method(D_METHOD("set_thickness", "thickness"), &GPUParticlesCollisionSDF::set_thickness); + ClassDB::bind_method(D_METHOD("get_thickness"), &GPUParticlesCollisionSDF::get_thickness); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "16,32,64,128,256,512"), "set_resolution", "get_resolution"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "thickness", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_thickness", "get_thickness"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture"); + + BIND_ENUM_CONSTANT(RESOLUTION_16); + BIND_ENUM_CONSTANT(RESOLUTION_32); + BIND_ENUM_CONSTANT(RESOLUTION_64); + BIND_ENUM_CONSTANT(RESOLUTION_128); + BIND_ENUM_CONSTANT(RESOLUTION_256); + BIND_ENUM_CONSTANT(RESOLUTION_512); + BIND_ENUM_CONSTANT(RESOLUTION_MAX); +} + +void GPUParticlesCollisionSDF::set_thickness(float p_thickness) { + thickness = p_thickness; +} + +float GPUParticlesCollisionSDF::get_thickness() const { + return thickness; +} + +void GPUParticlesCollisionSDF::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesCollisionSDF::get_extents() const { + return extents; +} + +void GPUParticlesCollisionSDF::set_resolution(Resolution p_resolution) { + resolution = p_resolution; + update_gizmo(); +} + +GPUParticlesCollisionSDF::Resolution GPUParticlesCollisionSDF::get_resolution() const { + return resolution; +} + +void GPUParticlesCollisionSDF::set_texture(const Ref<Texture3D> &p_texture) { + texture = p_texture; + RID tex = texture.is_valid() ? texture->get_rid() : RID(); + RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); +} + +Ref<Texture3D> GPUParticlesCollisionSDF::get_texture() const { + return texture; +} + +AABB GPUParticlesCollisionSDF::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionSDF::BakeBeginFunc GPUParticlesCollisionSDF::bake_begin_function = nullptr; +GPUParticlesCollisionSDF::BakeStepFunc GPUParticlesCollisionSDF::bake_step_function = nullptr; +GPUParticlesCollisionSDF::BakeEndFunc GPUParticlesCollisionSDF::bake_end_function = nullptr; + +GPUParticlesCollisionSDF::GPUParticlesCollisionSDF() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE) { +} + +GPUParticlesCollisionSDF::~GPUParticlesCollisionSDF() { +} + +//////////////////////////// +//////////////////////////// + +void GPUParticlesCollisionHeightField::_notification(int p_what) { + if (p_what == NOTIFICATION_INTERNAL_PROCESS) { + if (update_mode == UPDATE_MODE_ALWAYS) { + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } + + if (follow_camera_mode && get_viewport()) { + Camera3D *cam = get_viewport()->get_camera(); + if (cam) { + Transform xform = get_global_transform(); + Vector3 x_axis = xform.basis.get_axis(Vector3::AXIS_X).normalized(); + Vector3 z_axis = xform.basis.get_axis(Vector3::AXIS_Z).normalized(); + float x_len = xform.basis.get_scale().x; + float z_len = xform.basis.get_scale().z; + + Vector3 cam_pos = cam->get_global_transform().origin; + Transform new_xform = xform; + + while (x_axis.dot(cam_pos - new_xform.origin) > x_len) { + new_xform.origin += x_axis * x_len; + } + while (x_axis.dot(cam_pos - new_xform.origin) < -x_len) { + new_xform.origin -= x_axis * x_len; + } + + while (z_axis.dot(cam_pos - new_xform.origin) > z_len) { + new_xform.origin += z_axis * z_len; + } + while (z_axis.dot(cam_pos - new_xform.origin) < -z_len) { + new_xform.origin -= z_axis * z_len; + } + + if (new_xform != xform) { + set_global_transform(new_xform); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } + } + } + } + + if (p_what == NOTIFICATION_TRANSFORM_CHANGED) { + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); + } +} + +void GPUParticlesCollisionHeightField::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionHeightField::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionHeightField::get_extents); + + ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionHeightField::set_resolution); + ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionHeightField::get_resolution); + + ClassDB::bind_method(D_METHOD("set_update_mode", "update_mode"), &GPUParticlesCollisionHeightField::set_update_mode); + ClassDB::bind_method(D_METHOD("get_update_mode"), &GPUParticlesCollisionHeightField::get_update_mode); + + ClassDB::bind_method(D_METHOD("set_follow_camera_mode", "enabled"), &GPUParticlesCollisionHeightField::set_follow_camera_mode); + ClassDB::bind_method(D_METHOD("is_follow_camera_mode_enabled"), &GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled); + + ClassDB::bind_method(D_METHOD("set_follow_camera_push_ratio", "ratio"), &GPUParticlesCollisionHeightField::set_follow_camera_push_ratio); + ClassDB::bind_method(D_METHOD("get_follow_camera_push_ratio"), &GPUParticlesCollisionHeightField::get_follow_camera_push_ratio); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "256,512,1024,2048,4096,8192"), "set_resolution", "get_resolution"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "update_mode", PROPERTY_HINT_ENUM, "WhenMoved,Always"), "set_update_mode", "get_update_mode"); + ADD_GROUP("Folow Camera", "follow_camera_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "follow_camera_enabled"), "set_follow_camera_mode", "is_follow_camera_mode_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "follow_camera_push_ratio", PROPERTY_HINT_RANGE, "0.01,1,0.01"), "set_follow_camera_push_ratio", "get_follow_camera_push_ratio"); + + BIND_ENUM_CONSTANT(RESOLUTION_256); + BIND_ENUM_CONSTANT(RESOLUTION_512); + BIND_ENUM_CONSTANT(RESOLUTION_1024); + BIND_ENUM_CONSTANT(RESOLUTION_2048); + BIND_ENUM_CONSTANT(RESOLUTION_4096); + BIND_ENUM_CONSTANT(RESOLUTION_8192); + BIND_ENUM_CONSTANT(RESOLUTION_MAX); + + BIND_ENUM_CONSTANT(UPDATE_MODE_WHEN_MOVED); + BIND_ENUM_CONSTANT(UPDATE_MODE_ALWAYS); +} + +void GPUParticlesCollisionHeightField::set_follow_camera_push_ratio(float p_follow_camera_push_ratio) { + follow_camera_push_ratio = p_follow_camera_push_ratio; +} + +float GPUParticlesCollisionHeightField::get_follow_camera_push_ratio() const { + return follow_camera_push_ratio; +} + +void GPUParticlesCollisionHeightField::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); +} + +Vector3 GPUParticlesCollisionHeightField::get_extents() const { + return extents; +} + +void GPUParticlesCollisionHeightField::set_resolution(Resolution p_resolution) { + resolution = p_resolution; + RS::get_singleton()->particles_collision_set_height_field_resolution(_get_collision(), RS::ParticlesCollisionHeightfieldResolution(resolution)); + update_gizmo(); + RS::get_singleton()->particles_collision_height_field_update(_get_collision()); +} + +GPUParticlesCollisionHeightField::Resolution GPUParticlesCollisionHeightField::get_resolution() const { + return resolution; +} + +void GPUParticlesCollisionHeightField::set_update_mode(UpdateMode p_update_mode) { + update_mode = p_update_mode; + set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); +} + +GPUParticlesCollisionHeightField::UpdateMode GPUParticlesCollisionHeightField::get_update_mode() const { + return update_mode; +} + +void GPUParticlesCollisionHeightField::set_follow_camera_mode(bool p_enabled) { + follow_camera_mode = p_enabled; + set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS); +} + +bool GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled() const { + return follow_camera_mode; +} + +AABB GPUParticlesCollisionHeightField::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesCollisionHeightField::GPUParticlesCollisionHeightField() : + GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE) { +} + +GPUParticlesCollisionHeightField::~GPUParticlesCollisionHeightField() { +} + +//////////////////////////// +//////////////////////////// + +void GPUParticlesAttractor3D::set_cull_mask(uint32_t p_cull_mask) { + cull_mask = p_cull_mask; + RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask); +} + +uint32_t GPUParticlesAttractor3D::get_cull_mask() const { + return cull_mask; +} + +void GPUParticlesAttractor3D::set_strength(float p_strength) { + strength = p_strength; + RS::get_singleton()->particles_collision_set_attractor_strength(collision, p_strength); +} + +float GPUParticlesAttractor3D::get_strength() const { + return strength; +} + +void GPUParticlesAttractor3D::set_attenuation(float p_attenuation) { + attenuation = p_attenuation; + RS::get_singleton()->particles_collision_set_attractor_attenuation(collision, p_attenuation); +} + +float GPUParticlesAttractor3D::get_attenuation() const { + return attenuation; +} + +void GPUParticlesAttractor3D::set_directionality(float p_directionality) { + directionality = p_directionality; + RS::get_singleton()->particles_collision_set_attractor_directionality(collision, p_directionality); + update_gizmo(); +} + +float GPUParticlesAttractor3D::get_directionality() const { + return directionality; +} + +void GPUParticlesAttractor3D::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesAttractor3D::set_cull_mask); + ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesAttractor3D::get_cull_mask); + + ClassDB::bind_method(D_METHOD("set_strength", "strength"), &GPUParticlesAttractor3D::set_strength); + ClassDB::bind_method(D_METHOD("get_strength"), &GPUParticlesAttractor3D::get_strength); + + ClassDB::bind_method(D_METHOD("set_attenuation", "attenuation"), &GPUParticlesAttractor3D::set_attenuation); + ClassDB::bind_method(D_METHOD("get_attenuation"), &GPUParticlesAttractor3D::get_attenuation); + + ClassDB::bind_method(D_METHOD("set_directionality", "amount"), &GPUParticlesAttractor3D::set_directionality); + ClassDB::bind_method(D_METHOD("get_directionality"), &GPUParticlesAttractor3D::get_directionality); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "strength", PROPERTY_HINT_RANGE, "-128,128,0.01,or_greater,or_lesser"), "set_strength", "get_strength"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "attenuation", PROPERTY_HINT_EXP_EASING, "0,8,0.01"), "set_attenuation", "get_attenuation"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "directionality", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_directionality", "get_directionality"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask"); +} + +GPUParticlesAttractor3D::GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type) { + collision = RS::get_singleton()->particles_collision_create(); + RS::get_singleton()->particles_collision_set_collision_type(collision, p_type); + set_base(collision); +} +GPUParticlesAttractor3D::~GPUParticlesAttractor3D() { + RS::get_singleton()->free(collision); +} + +///////////////////////////////// + +void GPUParticlesAttractorSphere::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesAttractorSphere::set_radius); + ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesAttractorSphere::get_radius); + + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius"); +} + +void GPUParticlesAttractorSphere::set_radius(float p_radius) { + radius = p_radius; + RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius); + update_gizmo(); +} + +float GPUParticlesAttractorSphere::get_radius() const { + return radius; +} + +AABB GPUParticlesAttractorSphere::get_aabb() const { + return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2)); +} + +GPUParticlesAttractorSphere::GPUParticlesAttractorSphere() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT) { +} + +GPUParticlesAttractorSphere::~GPUParticlesAttractorSphere() { +} + +/////////////////////////// + +void GPUParticlesAttractorBox::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorBox::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorBox::get_extents); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); +} + +void GPUParticlesAttractorBox::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesAttractorBox::get_extents() const { + return extents; +} + +AABB GPUParticlesAttractorBox::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesAttractorBox::GPUParticlesAttractorBox() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT) { +} + +GPUParticlesAttractorBox::~GPUParticlesAttractorBox() { +} + +/////////////////////////// + +void GPUParticlesAttractorVectorField::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorVectorField::set_extents); + ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorVectorField::get_extents); + + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesAttractorVectorField::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesAttractorVectorField::get_texture); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture"); +} + +void GPUParticlesAttractorVectorField::set_extents(const Vector3 &p_extents) { + extents = p_extents; + RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents); + update_gizmo(); +} + +Vector3 GPUParticlesAttractorVectorField::get_extents() const { + return extents; +} + +void GPUParticlesAttractorVectorField::set_texture(const Ref<Texture3D> &p_texture) { + texture = p_texture; + RID tex = texture.is_valid() ? texture->get_rid() : RID(); + RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex); +} + +Ref<Texture3D> GPUParticlesAttractorVectorField::get_texture() const { + return texture; +} + +AABB GPUParticlesAttractorVectorField::get_aabb() const { + return AABB(-extents, extents * 2); +} + +GPUParticlesAttractorVectorField::GPUParticlesAttractorVectorField() : + GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) { +} + +GPUParticlesAttractorVectorField::~GPUParticlesAttractorVectorField() { +} diff --git a/scene/3d/gpu_particles_collision_3d.h b/scene/3d/gpu_particles_collision_3d.h new file mode 100644 index 0000000000..4c73c7bcb2 --- /dev/null +++ b/scene/3d/gpu_particles_collision_3d.h @@ -0,0 +1,342 @@ +/*************************************************************************/ +/* gpu_particles_collision_3d.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef GPU_PARTICLES_COLLISION_3D_H +#define GPU_PARTICLES_COLLISION_3D_H + +#include "core/local_vector.h" +#include "core/rid.h" +#include "scene/3d/visual_instance_3d.h" +#include "scene/resources/material.h" + +class GPUParticlesCollision3D : public VisualInstance3D { + GDCLASS(GPUParticlesCollision3D, VisualInstance3D); + + uint32_t cull_mask = 0xFFFFFFFF; + RID collision; + +protected: + _FORCE_INLINE_ RID _get_collision() { return collision; } + static void _bind_methods(); + + GPUParticlesCollision3D(RS::ParticlesCollisionType p_type); + +public: + void set_cull_mask(uint32_t p_cull_mask); + uint32_t get_cull_mask() const; + + virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); } + + ~GPUParticlesCollision3D(); +}; + +class GPUParticlesCollisionSphere : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSphere, GPUParticlesCollision3D); + + float radius = 1.0; + +protected: + static void _bind_methods(); + +public: + void set_radius(float p_radius); + float get_radius() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionSphere(); + ~GPUParticlesCollisionSphere(); +}; + +class GPUParticlesCollisionBox : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionBox, GPUParticlesCollision3D); + + Vector3 extents = Vector3(1, 1, 1); + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionBox(); + ~GPUParticlesCollisionBox(); +}; + +class GPUParticlesCollisionSDF : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionSDF, GPUParticlesCollision3D); + +public: + enum Resolution { + RESOLUTION_16, + RESOLUTION_32, + RESOLUTION_64, + RESOLUTION_128, + RESOLUTION_256, + RESOLUTION_512, + RESOLUTION_MAX, + }; + + typedef void (*BakeBeginFunc)(int); + typedef void (*BakeStepFunc)(int, const String &); + typedef void (*BakeEndFunc)(); + +private: + Vector3 extents = Vector3(1, 1, 1); + Resolution resolution = RESOLUTION_64; + Ref<Texture3D> texture; + float thickness = 1.0; + + struct PlotMesh { + Ref<Mesh> mesh; + Transform local_xform; + }; + + void _find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes); + + struct BVH { + enum { + LEAF_BIT = 1 << 30, + LEAF_MASK = LEAF_BIT - 1 + }; + AABB bounds; + uint32_t children[2]; + }; + + struct FacePos { + Vector3 center; + uint32_t index; + }; + + struct FaceSort { + uint32_t axis; + bool operator()(const FacePos &p_left, const FacePos &p_right) const { + return p_left.center[axis] < p_right.center[axis]; + } + }; + + uint32_t _create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness); + + struct ComputeSDFParams { + float *cells; + Vector3i size; + float cell_size; + Vector3 cell_offset; + const BVH *bvh; + const Face3 *triangles; + float thickness; + }; + + void _find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance); + void _compute_sdf_z(uint32_t p_z, ComputeSDFParams *params); + void _compute_sdf(ComputeSDFParams *params); + +protected: + static void _bind_methods(); + +public: + void set_thickness(float p_thickness); + float get_thickness() const; + + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_resolution(Resolution p_resolution); + Resolution get_resolution() const; + + void set_texture(const Ref<Texture3D> &p_texture); + Ref<Texture3D> get_texture() const; + + Vector3i get_estimated_cell_size() const; + Ref<Image> bake(); + + virtual AABB get_aabb() const override; + + static BakeBeginFunc bake_begin_function; + static BakeStepFunc bake_step_function; + static BakeEndFunc bake_end_function; + + GPUParticlesCollisionSDF(); + ~GPUParticlesCollisionSDF(); +}; + +VARIANT_ENUM_CAST(GPUParticlesCollisionSDF::Resolution) + +class GPUParticlesCollisionHeightField : public GPUParticlesCollision3D { + GDCLASS(GPUParticlesCollisionHeightField, GPUParticlesCollision3D); + +public: + enum Resolution { + RESOLUTION_256, + RESOLUTION_512, + RESOLUTION_1024, + RESOLUTION_2048, + RESOLUTION_4096, + RESOLUTION_8192, + RESOLUTION_MAX, + }; + + enum UpdateMode { + UPDATE_MODE_WHEN_MOVED, + UPDATE_MODE_ALWAYS, + }; + +private: + Vector3 extents = Vector3(1, 1, 1); + Resolution resolution = RESOLUTION_1024; + bool follow_camera_mode = false; + float follow_camera_push_ratio = 0.1; + + UpdateMode update_mode = UPDATE_MODE_WHEN_MOVED; + +protected: + void _notification(int p_what); + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_resolution(Resolution p_resolution); + Resolution get_resolution() const; + + void set_update_mode(UpdateMode p_update_mode); + UpdateMode get_update_mode() const; + + void set_follow_camera_mode(bool p_enabled); + bool is_follow_camera_mode_enabled() const; + + void set_follow_camera_push_ratio(float p_ratio); + float get_follow_camera_push_ratio() const; + + virtual AABB get_aabb() const override; + + GPUParticlesCollisionHeightField(); + ~GPUParticlesCollisionHeightField(); +}; + +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::Resolution) +VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::UpdateMode) + +class GPUParticlesAttractor3D : public VisualInstance3D { + GDCLASS(GPUParticlesAttractor3D, VisualInstance3D); + + uint32_t cull_mask = 0xFFFFFFFF; + RID collision; + float strength = 1.0; + float attenuation = 1.0; + float directionality = 0.0; + +protected: + _FORCE_INLINE_ RID _get_collision() { return collision; } + static void _bind_methods(); + + GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type); + +public: + void set_cull_mask(uint32_t p_cull_mask); + uint32_t get_cull_mask() const; + + void set_strength(float p_strength); + float get_strength() const; + + void set_attenuation(float p_attenuation); + float get_attenuation() const; + + void set_directionality(float p_directionality); + float get_directionality() const; + + virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); } + + ~GPUParticlesAttractor3D(); +}; + +class GPUParticlesAttractorSphere : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorSphere, GPUParticlesAttractor3D); + + float radius = 1.0; + +protected: + static void _bind_methods(); + +public: + void set_radius(float p_radius); + float get_radius() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorSphere(); + ~GPUParticlesAttractorSphere(); +}; + +class GPUParticlesAttractorBox : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorBox, GPUParticlesAttractor3D); + + Vector3 extents = Vector3(1, 1, 1); + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorBox(); + ~GPUParticlesAttractorBox(); +}; + +class GPUParticlesAttractorVectorField : public GPUParticlesAttractor3D { + GDCLASS(GPUParticlesAttractorVectorField, GPUParticlesAttractor3D); + + Vector3 extents = Vector3(1, 1, 1); + Ref<Texture3D> texture; + +protected: + static void _bind_methods(); + +public: + void set_extents(const Vector3 &p_extents); + Vector3 get_extents() const; + + void set_texture(const Ref<Texture3D> &p_texture); + Ref<Texture3D> get_texture() const; + + virtual AABB get_aabb() const override; + + GPUParticlesAttractorVectorField(); + ~GPUParticlesAttractorVectorField(); +}; + +#endif // GPU_PARTICLES_COLLISION_3D_H diff --git a/scene/3d/physics_body_3d.cpp b/scene/3d/physics_body_3d.cpp index 193d016010..579088b835 100644 --- a/scene/3d/physics_body_3d.cpp +++ b/scene/3d/physics_body_3d.cpp @@ -30,11 +30,10 @@ #include "physics_body_3d.h" +#include "core/class_db.h" #include "core/core_string_names.h" #include "core/engine.h" #include "core/list.h" -#include "core/method_bind_ext.gen.inc" -#include "core/object.h" #include "core/rid.h" #include "scene/3d/collision_shape_3d.h" #include "scene/scene_string_names.h" @@ -130,15 +129,6 @@ void PhysicsBody3D::remove_collision_exception_with(Node *p_node) { PhysicsServer3D::get_singleton()->body_remove_collision_exception(get_rid(), collision_object->get_rid()); } -void PhysicsBody3D::_set_layers(uint32_t p_mask) { - set_collision_layer(p_mask); - set_collision_mask(p_mask); -} - -uint32_t PhysicsBody3D::_get_layers() const { - return get_collision_layer(); -} - void PhysicsBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody3D::set_collision_layer); ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody3D::get_collision_layer); @@ -152,9 +142,6 @@ void PhysicsBody3D::_bind_methods() { ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody3D::set_collision_layer_bit); ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody3D::get_collision_layer_bit); - ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody3D::_set_layers); - ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody3D::_get_layers); - ADD_GROUP("Collision", "collision_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_layer", "get_collision_layer"); ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_mask", "get_collision_mask"); diff --git a/scene/3d/physics_body_3d.h b/scene/3d/physics_body_3d.h index 9830a55183..d3dddeae55 100644 --- a/scene/3d/physics_body_3d.h +++ b/scene/3d/physics_body_3d.h @@ -43,9 +43,6 @@ class PhysicsBody3D : public CollisionObject3D { uint32_t collision_layer; uint32_t collision_mask; - void _set_layers(uint32_t p_mask); - uint32_t _get_layers() const; - protected: static void _bind_methods(); PhysicsBody3D(PhysicsServer3D::BodyMode p_mode); diff --git a/scene/3d/soft_body_3d.cpp b/scene/3d/soft_body_3d.cpp index 018a2a7a39..3b5c328e43 100644 --- a/scene/3d/soft_body_3d.cpp +++ b/scene/3d/soft_body_3d.cpp @@ -30,8 +30,8 @@ #include "soft_body_3d.h" +#include "core/class_db.h" #include "core/list.h" -#include "core/object.h" #include "core/os/os.h" #include "core/rid.h" #include "scene/3d/collision_object_3d.h" diff --git a/scene/animation/animation_tree.cpp b/scene/animation/animation_tree.cpp index d7d55b468e..bb5d536600 100644 --- a/scene/animation/animation_tree.cpp +++ b/scene/animation/animation_tree.cpp @@ -32,7 +32,6 @@ #include "animation_blend_tree.h" #include "core/engine.h" -#include "core/method_bind_ext.gen.inc" #include "scene/scene_string_names.h" #include "servers/audio/audio_stream.h" diff --git a/scene/animation/tween.cpp b/scene/animation/tween.cpp index bd4396d680..1a2a97ada8 100644 --- a/scene/animation/tween.cpp +++ b/scene/animation/tween.cpp @@ -30,8 +30,6 @@ #include "tween.h" -#include "core/method_bind_ext.gen.inc" - void Tween::_add_pending_command(StringName p_key, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5, const Variant &p_arg6, const Variant &p_arg7, const Variant &p_arg8, const Variant &p_arg9, const Variant &p_arg10) { // Add a new pending command and reference it pending_commands.push_back(PendingCommand()); diff --git a/scene/debugger/scene_debugger.h b/scene/debugger/scene_debugger.h index a2bafde039..80e329f1f2 100644 --- a/scene/debugger/scene_debugger.h +++ b/scene/debugger/scene_debugger.h @@ -32,7 +32,7 @@ #define SCENE_DEBUGGER_H #include "core/array.h" -#include "core/object.h" +#include "core/class_db.h" #include "core/pair.h" #include "core/ustring.h" diff --git a/scene/gui/base_button.cpp b/scene/gui/base_button.cpp index 2e77d20d4e..1a19c75d27 100644 --- a/scene/gui/base_button.cpp +++ b/scene/gui/base_button.cpp @@ -307,17 +307,6 @@ int BaseButton::get_button_mask() const { return button_mask; } -void BaseButton::set_enabled_focus_mode(FocusMode p_mode) { - enabled_focus_mode = p_mode; - if (!status.disabled) { - set_focus_mode(p_mode); - } -} - -Control::FocusMode BaseButton::get_enabled_focus_mode() const { - return enabled_focus_mode; -} - void BaseButton::set_keep_pressed_outside(bool p_on) { keep_pressed_outside = p_on; } @@ -388,8 +377,6 @@ void BaseButton::_bind_methods() { ClassDB::bind_method(D_METHOD("set_button_mask", "mask"), &BaseButton::set_button_mask); ClassDB::bind_method(D_METHOD("get_button_mask"), &BaseButton::get_button_mask); ClassDB::bind_method(D_METHOD("get_draw_mode"), &BaseButton::get_draw_mode); - ClassDB::bind_method(D_METHOD("set_enabled_focus_mode", "mode"), &BaseButton::set_enabled_focus_mode); - ClassDB::bind_method(D_METHOD("get_enabled_focus_mode"), &BaseButton::get_enabled_focus_mode); ClassDB::bind_method(D_METHOD("set_keep_pressed_outside", "enabled"), &BaseButton::set_keep_pressed_outside); ClassDB::bind_method(D_METHOD("is_keep_pressed_outside"), &BaseButton::is_keep_pressed_outside); @@ -412,10 +399,9 @@ void BaseButton::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "pressed"), "set_pressed", "is_pressed"); ADD_PROPERTY(PropertyInfo(Variant::INT, "action_mode", PROPERTY_HINT_ENUM, "Button Press,Button Release"), "set_action_mode", "get_action_mode"); ADD_PROPERTY(PropertyInfo(Variant::INT, "button_mask", PROPERTY_HINT_FLAGS, "Mouse Left, Mouse Right, Mouse Middle"), "set_button_mask", "get_button_mask"); - ADD_PROPERTY(PropertyInfo(Variant::INT, "enabled_focus_mode", PROPERTY_HINT_ENUM, "None,Click,All"), "set_enabled_focus_mode", "get_enabled_focus_mode"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "keep_pressed_outside"), "set_keep_pressed_outside", "is_keep_pressed_outside"); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shortcut", PROPERTY_HINT_RESOURCE_TYPE, "Shortcut"), "set_shortcut", "get_shortcut"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "group", PROPERTY_HINT_RESOURCE_TYPE, "ButtonGroup"), "set_button_group", "get_button_group"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "button_group", PROPERTY_HINT_RESOURCE_TYPE, "ButtonGroup"), "set_button_group", "get_button_group"); BIND_ENUM_CONSTANT(DRAW_NORMAL); BIND_ENUM_CONSTANT(DRAW_PRESSED); @@ -437,7 +423,6 @@ BaseButton::BaseButton() { status.pressing_inside = false; status.disabled = false; set_focus_mode(FOCUS_ALL); - enabled_focus_mode = FOCUS_ALL; action_mode = ACTION_MODE_BUTTON_RELEASE; button_mask = BUTTON_MASK_LEFT; } diff --git a/scene/gui/base_button.h b/scene/gui/base_button.h index 8e71931f8b..33f19949cd 100644 --- a/scene/gui/base_button.h +++ b/scene/gui/base_button.h @@ -49,7 +49,6 @@ private: bool toggle_mode; bool shortcut_in_tooltip; bool keep_pressed_outside; - FocusMode enabled_focus_mode; Ref<Shortcut> shortcut; ActionMode action_mode; @@ -115,9 +114,6 @@ public: void set_button_mask(int p_mask); int get_button_mask() const; - void set_enabled_focus_mode(FocusMode p_mode); - FocusMode get_enabled_focus_mode() const; - void set_shortcut(const Ref<Shortcut> &p_shortcut); Ref<Shortcut> get_shortcut() const; diff --git a/scene/gui/code_edit.cpp b/scene/gui/code_edit.cpp index 56cf432b38..1eb45d7fc6 100644 --- a/scene/gui/code_edit.cpp +++ b/scene/gui/code_edit.cpp @@ -132,6 +132,7 @@ void CodeEdit::set_line_as_breakpoint(int p_line, bool p_breakpointed) { breakpointed_lines.erase(p_line); } emit_signal("breakpoint_toggled", p_line); + update(); } bool CodeEdit::is_line_breakpointed(int p_line) const { @@ -160,6 +161,7 @@ Array CodeEdit::get_breakpointed_lines() const { void CodeEdit::set_line_as_bookmarked(int p_line, bool p_bookmarked) { int mask = get_line_gutter_metadata(p_line, main_gutter); set_line_gutter_metadata(p_line, main_gutter, p_bookmarked ? mask | MAIN_GUTTER_BOOKMARK : mask & ~MAIN_GUTTER_BOOKMARK); + update(); } bool CodeEdit::is_line_bookmarked(int p_line) const { @@ -188,6 +190,7 @@ Array CodeEdit::get_bookmarked_lines() const { void CodeEdit::set_line_as_executing(int p_line, bool p_executing) { int mask = get_line_gutter_metadata(p_line, main_gutter); set_line_gutter_metadata(p_line, main_gutter, p_executing ? mask | MAIN_GUTTER_EXECUTING : mask & ~MAIN_GUTTER_EXECUTING); + update(); } bool CodeEdit::is_line_executing(int p_line) const { diff --git a/scene/gui/color_rect.cpp b/scene/gui/color_rect.cpp index 627e589c02..0c38b93c60 100644 --- a/scene/gui/color_rect.cpp +++ b/scene/gui/color_rect.cpp @@ -30,12 +30,12 @@ #include "color_rect.h" -void ColorRect::set_frame_color(const Color &p_color) { +void ColorRect::set_color(const Color &p_color) { color = p_color; update(); } -Color ColorRect::get_frame_color() const { +Color ColorRect::get_color() const { return color; } @@ -46,12 +46,8 @@ void ColorRect::_notification(int p_what) { } void ColorRect::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_frame_color", "color"), &ColorRect::set_frame_color); - ClassDB::bind_method(D_METHOD("get_frame_color"), &ColorRect::get_frame_color); + ClassDB::bind_method(D_METHOD("set_color", "color"), &ColorRect::set_color); + ClassDB::bind_method(D_METHOD("get_color"), &ColorRect::get_color); - ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_frame_color", "get_frame_color"); -} - -ColorRect::ColorRect() { - color = Color(1, 1, 1); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "color"), "set_color", "get_color"); } diff --git a/scene/gui/color_rect.h b/scene/gui/color_rect.h index 3df44b9334..61d57f7cca 100644 --- a/scene/gui/color_rect.h +++ b/scene/gui/color_rect.h @@ -36,17 +36,15 @@ class ColorRect : public Control { GDCLASS(ColorRect, Control); - Color color; + Color color = Color(1, 1, 1); protected: void _notification(int p_what); static void _bind_methods(); public: - void set_frame_color(const Color &p_color); - Color get_frame_color() const; - - ColorRect(); + void set_color(const Color &p_color); + Color get_color() const; }; #endif // COLOR_RECT_H diff --git a/scene/gui/graph_edit.cpp b/scene/gui/graph_edit.cpp index a7c15e7027..ad02aaade5 100644 --- a/scene/gui/graph_edit.cpp +++ b/scene/gui/graph_edit.cpp @@ -775,6 +775,11 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { } if (mm.is_valid() && dragging) { + if (!moving_selection) { + emit_signal("begin_node_move"); + moving_selection = true; + } + just_selected = true; drag_accum += mm->get_relative(); for (int i = get_child_count() - 1; i >= 0; i--) { @@ -881,16 +886,17 @@ void GraphEdit::_gui_input(const Ref<InputEvent> &p_ev) { } if (drag_accum != Vector2()) { - emit_signal("_begin_node_move"); - for (int i = get_child_count() - 1; i >= 0; i--) { GraphNode *gn = Object::cast_to<GraphNode>(get_child(i)); if (gn && gn->is_selected()) { gn->set_drag(false); } } + } - emit_signal("_end_node_move"); + if (moving_selection) { + emit_signal("end_node_move"); + moving_selection = false; } dragging = false; @@ -1281,8 +1287,8 @@ void GraphEdit::_bind_methods() { ADD_SIGNAL(MethodInfo("connection_to_empty", PropertyInfo(Variant::STRING_NAME, "from"), PropertyInfo(Variant::INT, "from_slot"), PropertyInfo(Variant::VECTOR2, "release_position"))); ADD_SIGNAL(MethodInfo("connection_from_empty", PropertyInfo(Variant::STRING_NAME, "to"), PropertyInfo(Variant::INT, "to_slot"), PropertyInfo(Variant::VECTOR2, "release_position"))); ADD_SIGNAL(MethodInfo("delete_nodes_request")); - ADD_SIGNAL(MethodInfo("_begin_node_move")); - ADD_SIGNAL(MethodInfo("_end_node_move")); + ADD_SIGNAL(MethodInfo("begin_node_move")); + ADD_SIGNAL(MethodInfo("end_node_move")); ADD_SIGNAL(MethodInfo("scroll_offset_changed", PropertyInfo(Variant::VECTOR2, "ofs"))); } diff --git a/scene/gui/graph_edit.h b/scene/gui/graph_edit.h index 37cb5989e9..d87bd41f27 100644 --- a/scene/gui/graph_edit.h +++ b/scene/gui/graph_edit.h @@ -98,6 +98,7 @@ private: bool dragging; bool just_selected; + bool moving_selection; Vector2 drag_accum; float zoom; diff --git a/scene/gui/graph_node.cpp b/scene/gui/graph_node.cpp index 38bf31830f..4454e87017 100644 --- a/scene/gui/graph_node.cpp +++ b/scene/gui/graph_node.cpp @@ -30,8 +30,6 @@ #include "graph_node.h" -#include "core/method_bind_ext.gen.inc" - bool GraphNode::_set(const StringName &p_name, const Variant &p_value) { if (!p_name.operator String().begins_with("slot/")) { return false; diff --git a/scene/gui/link_button.cpp b/scene/gui/link_button.cpp index f8c8bd4caf..27a60945c8 100644 --- a/scene/gui/link_button.cpp +++ b/scene/gui/link_button.cpp @@ -127,6 +127,5 @@ void LinkButton::_bind_methods() { LinkButton::LinkButton() { underline_mode = UNDERLINE_MODE_ALWAYS; - set_enabled_focus_mode(FOCUS_NONE); set_default_cursor_shape(CURSOR_POINTING_HAND); } diff --git a/scene/gui/menu_button.cpp b/scene/gui/menu_button.cpp index aa69fb39e7..d65e98ea46 100644 --- a/scene/gui/menu_button.cpp +++ b/scene/gui/menu_button.cpp @@ -53,17 +53,9 @@ void MenuButton::_unhandled_key_input(Ref<InputEvent> p_event) { } void MenuButton::pressed() { - { - Window *w = Object::cast_to<Window>(get_viewport()); - if (w && !w->is_embedding_subwindows()) { - print_line("windowpos: " + w->get_position()); - } - } Size2 size = get_size(); Point2 gp = get_screen_position(); - - print_line("screenpos: " + gp); gp.y += get_size().y; popup->set_position(gp); @@ -130,7 +122,6 @@ MenuButton::MenuButton() { set_flat(true); set_toggle_mode(true); set_disable_shortcuts(false); - set_enabled_focus_mode(FOCUS_NONE); set_process_unhandled_key_input(true); set_action_mode(ACTION_MODE_BUTTON_PRESS); diff --git a/scene/gui/nine_patch_rect.h b/scene/gui/nine_patch_rect.h index 487fe4c860..a539ad43c0 100644 --- a/scene/gui/nine_patch_rect.h +++ b/scene/gui/nine_patch_rect.h @@ -79,4 +79,5 @@ public: }; VARIANT_ENUM_CAST(NinePatchRect::AxisStretchMode) + #endif // NINE_PATCH_RECT_H diff --git a/scene/gui/reference_rect.cpp b/scene/gui/reference_rect.cpp index 27c57c684a..32ec0049f0 100644 --- a/scene/gui/reference_rect.cpp +++ b/scene/gui/reference_rect.cpp @@ -38,7 +38,7 @@ void ReferenceRect::_notification(int p_what) { return; } if (Engine::get_singleton()->is_editor_hint() || !editor_only) { - draw_rect(Rect2(Point2(), get_size()), border_color, false); + draw_rect(Rect2(Point2(), get_size()), border_color, false, border_width); } } } @@ -52,6 +52,15 @@ Color ReferenceRect::get_border_color() const { return border_color; } +void ReferenceRect::set_border_width(float p_width) { + border_width = MAX(0.0, p_width); + update(); +} + +float ReferenceRect::get_border_width() const { + return border_width; +} + void ReferenceRect::set_editor_only(const bool &p_enabled) { editor_only = p_enabled; update(); @@ -65,14 +74,13 @@ void ReferenceRect::_bind_methods() { ClassDB::bind_method(D_METHOD("get_border_color"), &ReferenceRect::get_border_color); ClassDB::bind_method(D_METHOD("set_border_color", "color"), &ReferenceRect::set_border_color); + ClassDB::bind_method(D_METHOD("get_border_width"), &ReferenceRect::get_border_width); + ClassDB::bind_method(D_METHOD("set_border_width", "width"), &ReferenceRect::set_border_width); + ClassDB::bind_method(D_METHOD("get_editor_only"), &ReferenceRect::get_editor_only); ClassDB::bind_method(D_METHOD("set_editor_only", "enabled"), &ReferenceRect::set_editor_only); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "border_color"), "set_border_color", "get_border_color"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "border_width", PROPERTY_HINT_RANGE, "0.0,5.0,0.1,or_greater"), "set_border_width", "get_border_width"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "editor_only"), "set_editor_only", "get_editor_only"); } - -ReferenceRect::ReferenceRect() { - border_color = Color(1, 0, 0); - editor_only = true; -} diff --git a/scene/gui/reference_rect.h b/scene/gui/reference_rect.h index db2f4269f3..becbbf47c5 100644 --- a/scene/gui/reference_rect.h +++ b/scene/gui/reference_rect.h @@ -35,19 +35,22 @@ class ReferenceRect : public Control { GDCLASS(ReferenceRect, Control); - Color border_color; - bool editor_only; + + Color border_color = Color(1, 0, 0); + float border_width = 1.0; + bool editor_only = true; protected: void _notification(int p_what); static void _bind_methods(); public: - ReferenceRect(); - void set_border_color(const Color &p_color); Color get_border_color() const; + void set_border_width(float p_width); + float get_border_width() const; + void set_editor_only(const bool &p_enabled); bool get_editor_only() const; }; diff --git a/scene/gui/text_edit.cpp b/scene/gui/text_edit.cpp index 957e1c11c7..c87f639193 100644 --- a/scene/gui/text_edit.cpp +++ b/scene/gui/text_edit.cpp @@ -1367,6 +1367,10 @@ void TextEdit::_notification(int p_what) { int scrollw = get_theme_constant("completion_scroll_width"); Color scrollc = get_theme_color("completion_scroll_color"); +#ifdef TOOLS_ENABLED + scrollw *= EDSCALE; +#endif + const int completion_options_size = completion_options.size(); int lines = MIN(completion_options_size, maxlines); int w = 0; @@ -1389,6 +1393,17 @@ void TextEdit::_notification(int p_what) { Size2 icon_area_size(get_row_height(), get_row_height()); w += icon_area_size.width + icon_hsep; + int line_from = CLAMP(completion_index - lines / 2, 0, completion_options_size - lines); + + for (int i = 0; i < lines; i++) { + int l = line_from + i; + ERR_CONTINUE(l < 0 || l >= completion_options_size); + if (completion_options[l].default_value.get_type() == Variant::COLOR) { + w += icon_area_size.width; + break; + } + } + int th = h + csb->get_minimum_size().y; if (cursor_pos.y + get_row_height() + th > get_size().height) { @@ -1415,7 +1430,6 @@ void TextEdit::_notification(int p_what) { if (cache.completion_background_color.a > 0.01) { RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(completion_rect.position, completion_rect.size + Size2(scrollw, 0)), cache.completion_background_color); } - int line_from = CLAMP(completion_index - lines / 2, 0, completion_options_size - lines); RenderingServer::get_singleton()->canvas_item_add_rect(ci, Rect2(Point2(completion_rect.position.x, completion_rect.position.y + (completion_index - line_from) * get_row_height()), Size2(completion_rect.size.width, get_row_height())), cache.completion_selected_color); draw_rect(Rect2(completion_rect.position + Vector2(icon_area_size.x + icon_hsep, 0), Size2(MIN(nofs, completion_rect.size.width - (icon_area_size.x + icon_hsep)), completion_rect.size.height)), cache.completion_existing_color); @@ -1437,6 +1451,11 @@ void TextEdit::_notification(int p_what) { } title_pos.x = icon_area.position.x + icon_area.size.width + icon_hsep; + + if (completion_options[l].default_value.get_type() == Variant::COLOR) { + draw_rect(Rect2(Point2(completion_rect.position.x + completion_rect.size.width - icon_area_size.x, icon_area.position.y), icon_area_size), (Color)completion_options[l].default_value); + } + draw_string(cache.font, title_pos, completion_options[l].display, completion_options[l].font_color, completion_rect.size.width - (icon_area_size.x + icon_hsep)); } @@ -6406,7 +6425,7 @@ void TextEdit::set_tooltip_request_func(Object *p_obj, const StringName &p_funct } void TextEdit::set_line(int line, String new_text) { - if (line < 0 || line > text.size()) { + if (line < 0 || line >= text.size()) { return; } _remove_text(line, 0, line, text[line].length()); diff --git a/scene/gui/texture_rect.h b/scene/gui/texture_rect.h index efd3f0698a..e39545f679 100644 --- a/scene/gui/texture_rect.h +++ b/scene/gui/texture_rect.h @@ -28,8 +28,8 @@ /* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ /*************************************************************************/ -#ifndef TEXTURE_FRAME_H -#define TEXTURE_FRAME_H +#ifndef TEXTURE_RECT_H +#define TEXTURE_RECT_H #include "scene/gui/control.h" @@ -83,4 +83,5 @@ public: }; VARIANT_ENUM_CAST(TextureRect::StretchMode); -#endif // TEXTURE_FRAME_H + +#endif // TEXTURE_RECT_H diff --git a/scene/gui/tree.cpp b/scene/gui/tree.cpp index 2f5ee20373..318496df70 100644 --- a/scene/gui/tree.cpp +++ b/scene/gui/tree.cpp @@ -1173,6 +1173,9 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2 if (p_item->cells[i].text.size() > 0) { float icon_width = p_item->cells[i].get_icon_size().width; + if (p_item->get_icon_max_width(i) > 0) { + icon_width = p_item->get_icon_max_width(i); + } r.position.x += icon_width; r.size.x -= icon_width; } diff --git a/scene/main/canvas_item.cpp b/scene/main/canvas_item.cpp index 0d9d9d6356..c9a83f98a0 100644 --- a/scene/main/canvas_item.cpp +++ b/scene/main/canvas_item.cpp @@ -32,7 +32,6 @@ #include "core/input/input.h" #include "core/message_queue.h" -#include "core/method_bind_ext.gen.inc" #include "scene/main/canvas_layer.h" #include "scene/main/viewport.h" #include "scene/main/window.h" @@ -832,25 +831,25 @@ void CanvasItem::draw_circle(const Point2 &p_pos, float p_radius, const Color &p RenderingServer::get_singleton()->canvas_item_add_circle(canvas_item, p_pos, p_radius, p_color); } -void CanvasItem::draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw(canvas_item, p_pos, p_modulate, false, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + p_texture->draw(canvas_item, p_pos, p_modulate, false); } -void CanvasItem::draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw_rect(canvas_item, p_rect, p_tile, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + p_texture->draw_rect(canvas_item, p_rect, p_tile, p_modulate, p_transpose); } -void CanvasItem::draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, bool p_clip_uv, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); ERR_FAIL_COND(p_texture.is_null()); - p_texture->draw_rect_region(canvas_item, p_rect, p_src_rect, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat), p_clip_uv); + p_texture->draw_rect_region(canvas_item, p_rect, p_src_rect, p_modulate, p_transpose, p_clip_uv); } void CanvasItem::draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p_rect) { @@ -861,14 +860,11 @@ void CanvasItem::draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p p_style_box->draw(canvas_item, p_rect); } -void CanvasItem::draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, float p_width, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, float p_width) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_primitive(canvas_item, p_points, p_colors, p_uvs, rid, p_width, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_primitive(canvas_item, p_points, p_colors, p_uvs, rid, p_width); } void CanvasItem::draw_set_transform(const Point2 &p_offset, float p_rot, const Size2 &p_scale) { @@ -885,44 +881,34 @@ void CanvasItem::draw_set_transform_matrix(const Transform2D &p_matrix) { RenderingServer::get_singleton()->canvas_item_add_set_transform(canvas_item, p_matrix); } -void CanvasItem::draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, p_colors, p_uvs, rid, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, p_colors, p_uvs, rid); } -void CanvasItem::draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture) { ERR_FAIL_COND_MSG(!drawing, "Drawing is only allowed inside NOTIFICATION_DRAW, _draw() function or 'draw' signal."); Vector<Color> colors; colors.push_back(p_color); RID rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID rid_normal = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID rid_specular = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, colors, p_uvs, rid, rid_normal, rid_specular, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_polygon(canvas_item, p_points, colors, p_uvs, rid); } -void CanvasItem::draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, const Transform2D &p_transform, const Color &p_modulate, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Transform2D &p_transform, const Color &p_modulate) { ERR_FAIL_COND(p_mesh.is_null()); RID texture_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID normal_map_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_map_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(canvas_item, p_mesh->get_rid(), p_transform, p_modulate, texture_rid, normal_map_rid, specular_map_rid, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_mesh(canvas_item, p_mesh->get_rid(), p_transform, p_modulate, texture_rid); } -void CanvasItem::draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, TextureFilter p_texture_filter, TextureRepeat p_texture_repeat) { +void CanvasItem::draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture) { ERR_FAIL_COND(p_multimesh.is_null()); RID texture_rid = p_texture.is_valid() ? p_texture->get_rid() : RID(); - RID normal_map_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_map_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - - RenderingServer::get_singleton()->canvas_item_add_multimesh(canvas_item, p_multimesh->get_rid(), texture_rid, normal_map_rid, specular_map_rid, p_specular_color_shininess, RS::CanvasItemTextureFilter(p_texture_filter), RS::CanvasItemTextureRepeat(p_texture_repeat)); + RenderingServer::get_singleton()->canvas_item_add_multimesh(canvas_item, p_multimesh->get_rid(), texture_rid); } void CanvasItem::draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, const Color &p_modulate, int p_clip_w) { @@ -1162,17 +1148,17 @@ void CanvasItem::_bind_methods() { ClassDB::bind_method(D_METHOD("draw_multiline_colors", "points", "colors", "width"), &CanvasItem::draw_multiline_colors, DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_rect", "rect", "color", "filled", "width"), &CanvasItem::draw_rect, DEFVAL(true), DEFVAL(1.0)); ClassDB::bind_method(D_METHOD("draw_circle", "position", "radius", "color"), &CanvasItem::draw_circle); - ClassDB::bind_method(D_METHOD("draw_texture", "texture", "position", "modulate", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_texture_rect", "texture", "rect", "tile", "modulate", "transpose", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture_rect, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_texture_rect_region", "texture", "rect", "src_rect", "modulate", "transpose", "normal_map", "specular_map", "specular_shininess", "clip_uv", "texture_filter", "texture_repeat"), &CanvasItem::draw_texture_rect_region, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(true), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); + ClassDB::bind_method(D_METHOD("draw_texture", "texture", "position", "modulate"), &CanvasItem::draw_texture, DEFVAL(Color(1, 1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_texture_rect", "texture", "rect", "tile", "modulate", "transpose"), &CanvasItem::draw_texture_rect, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_texture_rect_region", "texture", "rect", "src_rect", "modulate", "transpose", "clip_uv"), &CanvasItem::draw_texture_rect_region, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(false), DEFVAL(true)); ClassDB::bind_method(D_METHOD("draw_style_box", "style_box", "rect"), &CanvasItem::draw_style_box); - ClassDB::bind_method(D_METHOD("draw_primitive", "points", "colors", "uvs", "texture", "width", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_primitive, DEFVAL(Ref<Texture2D>()), DEFVAL(1.0), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_polygon", "points", "colors", "uvs", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_colored_polygon", "points", "color", "uvs", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_colored_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); + ClassDB::bind_method(D_METHOD("draw_primitive", "points", "colors", "uvs", "texture", "width"), &CanvasItem::draw_primitive, DEFVAL(Ref<Texture2D>()), DEFVAL(1.0)); + ClassDB::bind_method(D_METHOD("draw_polygon", "points", "colors", "uvs", "texture"), &CanvasItem::draw_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); + ClassDB::bind_method(D_METHOD("draw_colored_polygon", "points", "color", "uvs", "texture"), &CanvasItem::draw_colored_polygon, DEFVAL(PackedVector2Array()), DEFVAL(Ref<Texture2D>())); ClassDB::bind_method(D_METHOD("draw_string", "font", "position", "text", "modulate", "clip_w"), &CanvasItem::draw_string, DEFVAL(Color(1, 1, 1, 1)), DEFVAL(-1)); ClassDB::bind_method(D_METHOD("draw_char", "font", "position", "char", "next", "modulate"), &CanvasItem::draw_char, DEFVAL(Color(1, 1, 1, 1))); - ClassDB::bind_method(D_METHOD("draw_mesh", "mesh", "texture", "normal_map", "specular_map", "specular_shininess", "transform", "modulate", "texture_filter", "texture_repeat"), &CanvasItem::draw_mesh, DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(Transform2D()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); - ClassDB::bind_method(D_METHOD("draw_multimesh", "multimesh", "texture", "normal_map", "specular_map", "specular_shininess", "texture_filter", "texture_repeat"), &CanvasItem::draw_multimesh, DEFVAL(Ref<Texture2D>()), DEFVAL(Ref<Texture2D>()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(TEXTURE_FILTER_PARENT_NODE), DEFVAL(TEXTURE_REPEAT_PARENT_NODE)); + ClassDB::bind_method(D_METHOD("draw_mesh", "mesh", "texture", "transform", "modulate"), &CanvasItem::draw_mesh, DEFVAL(Transform2D()), DEFVAL(Color(1, 1, 1, 1))); + ClassDB::bind_method(D_METHOD("draw_multimesh", "multimesh", "texture"), &CanvasItem::draw_multimesh); ClassDB::bind_method(D_METHOD("draw_set_transform", "position", "rotation", "scale"), &CanvasItem::draw_set_transform, DEFVAL(0.0), DEFVAL(Size2(1.0, 1.0))); ClassDB::bind_method(D_METHOD("draw_set_transform_matrix", "xform"), &CanvasItem::draw_set_transform_matrix); @@ -1328,23 +1314,7 @@ void CanvasItem::_update_texture_filter_changed(bool p_propagate) { if (parent_item) { texture_filter_cache = parent_item->texture_filter_cache; } else { - //from viewport - switch (get_viewport()->get_default_canvas_item_texture_filter()) { - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS: - texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS; - break; - default: { - } - } + texture_filter_cache = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT; } } else { texture_filter_cache = RS::CanvasItemTextureFilter(texture_filter); @@ -1385,20 +1355,7 @@ void CanvasItem::_update_texture_repeat_changed(bool p_propagate) { if (parent_item) { texture_repeat_cache = parent_item->texture_repeat_cache; } else { - //from viewport - switch (get_viewport()->get_default_canvas_item_texture_repeat()) { - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_DISABLED: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_ENABLED: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED; - break; - case Viewport::DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MIRROR: - texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_MIRROR; - break; - default: { - } - } + texture_repeat_cache = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT; } } else { texture_repeat_cache = RS::CanvasItemTextureRepeat(texture_repeat); @@ -1458,3 +1415,154 @@ CanvasItem::CanvasItem() : CanvasItem::~CanvasItem() { RenderingServer::get_singleton()->free(canvas_item); } + +/////////////////////////////////////////////////////////////////// + +void CanvasTexture::set_diffuse_texture(const Ref<Texture2D> &p_diffuse) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_diffuse.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + diffuse_texture = p_diffuse; + + RID tex_rid = diffuse_texture.is_valid() ? diffuse_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_DIFFUSE, tex_rid); + emit_changed(); +} +Ref<Texture2D> CanvasTexture::get_diffuse_texture() const { + return diffuse_texture; +} + +void CanvasTexture::set_normal_texture(const Ref<Texture2D> &p_normal) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_normal.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + normal_texture = p_normal; + RID tex_rid = normal_texture.is_valid() ? normal_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_NORMAL, tex_rid); +} +Ref<Texture2D> CanvasTexture::get_normal_texture() const { + return normal_texture; +} + +void CanvasTexture::set_specular_texture(const Ref<Texture2D> &p_specular) { + ERR_FAIL_COND_MSG(Object::cast_to<CanvasTexture>(p_specular.ptr()) != nullptr, "Cant self-assign a CanvasTexture"); + specular_texture = p_specular; + RID tex_rid = specular_texture.is_valid() ? specular_texture->get_rid() : RID(); + RS::get_singleton()->canvas_texture_set_channel(canvas_texture, RS::CANVAS_TEXTURE_CHANNEL_SPECULAR, tex_rid); +} +Ref<Texture2D> CanvasTexture::get_specular_texture() const { + return specular_texture; +} + +void CanvasTexture::set_specular_color(const Color &p_color) { + specular = p_color; + RS::get_singleton()->canvas_texture_set_shading_parameters(canvas_texture, specular, shininess); +} +Color CanvasTexture::get_specular_color() const { + return specular; +} + +void CanvasTexture::set_specular_shininess(float p_shininess) { + shininess = p_shininess; + RS::get_singleton()->canvas_texture_set_shading_parameters(canvas_texture, specular, shininess); +} +float CanvasTexture::get_specular_shininess() const { + return shininess; +} + +void CanvasTexture::set_texture_filter(CanvasItem::TextureFilter p_filter) { + texture_filter = p_filter; + RS::get_singleton()->canvas_texture_set_texture_filter(canvas_texture, RS::CanvasItemTextureFilter(p_filter)); +} +CanvasItem::TextureFilter CanvasTexture::get_texture_filter() const { + return texture_filter; +} + +void CanvasTexture::set_texture_repeat(CanvasItem::TextureRepeat p_repeat) { + texture_repeat = p_repeat; + RS::get_singleton()->canvas_texture_set_texture_repeat(canvas_texture, RS::CanvasItemTextureRepeat(p_repeat)); +} +CanvasItem::TextureRepeat CanvasTexture::get_texture_repeat() const { + return texture_repeat; +} + +int CanvasTexture::get_width() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_width(); + } else { + return 1; + } +} +int CanvasTexture::get_height() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_height(); + } else { + return 1; + } +} + +bool CanvasTexture::is_pixel_opaque(int p_x, int p_y) const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->is_pixel_opaque(p_x, p_y); + } else { + return false; + } +} + +bool CanvasTexture::has_alpha() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->has_alpha(); + } else { + return false; + } +} + +Ref<Image> CanvasTexture::get_data() const { + if (diffuse_texture.is_valid()) { + return diffuse_texture->get_data(); + } else { + return Ref<Image>(); + } +} + +RID CanvasTexture::get_rid() const { + return canvas_texture; +} + +void CanvasTexture::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_diffuse_texture", "texture"), &CanvasTexture::set_diffuse_texture); + ClassDB::bind_method(D_METHOD("get_diffuse_texture"), &CanvasTexture::get_diffuse_texture); + + ClassDB::bind_method(D_METHOD("set_normal_texture", "texture"), &CanvasTexture::set_normal_texture); + ClassDB::bind_method(D_METHOD("get_normal_texture"), &CanvasTexture::get_normal_texture); + + ClassDB::bind_method(D_METHOD("set_specular_texture", "texture"), &CanvasTexture::set_specular_texture); + ClassDB::bind_method(D_METHOD("get_specular_texture"), &CanvasTexture::get_specular_texture); + + ClassDB::bind_method(D_METHOD("set_specular_color", "color"), &CanvasTexture::set_specular_color); + ClassDB::bind_method(D_METHOD("get_specular_color"), &CanvasTexture::get_specular_color); + + ClassDB::bind_method(D_METHOD("set_specular_shininess", "shininess"), &CanvasTexture::set_specular_shininess); + ClassDB::bind_method(D_METHOD("get_specular_shininess"), &CanvasTexture::get_specular_shininess); + + ClassDB::bind_method(D_METHOD("set_texture_filter", "filter"), &CanvasTexture::set_texture_filter); + ClassDB::bind_method(D_METHOD("get_texture_filter"), &CanvasTexture::get_texture_filter); + + ClassDB::bind_method(D_METHOD("set_texture_repeat", "repeat"), &CanvasTexture::set_texture_repeat); + ClassDB::bind_method(D_METHOD("get_texture_repeat"), &CanvasTexture::get_texture_repeat); + + ADD_GROUP("Diffuse", "diffuse_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "diffuse_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_diffuse_texture", "get_diffuse_texture"); + ADD_GROUP("Normalmap", "normal_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_texture", "get_normal_texture"); + ADD_GROUP("Specular", "specular_"); + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "specular_texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_specular_texture", "get_specular_texture"); + ADD_PROPERTY(PropertyInfo(Variant::COLOR, "specular_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_specular_color", "get_specular_color"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "specular_shininess", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_specular_shininess", "get_specular_shininess"); + ADD_GROUP("Texture", "texture_"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "texture_filter", PROPERTY_HINT_ENUM, "Inherit,Nearest,Linear,MipmapNearest,MipmapLinear,MipmapNearestAniso,MipmapLinearAniso"), "set_texture_filter", "get_texture_filter"); + ADD_PROPERTY(PropertyInfo(Variant::INT, "texture_repeat", PROPERTY_HINT_ENUM, "Inherit,Disabled,Enabled,Mirror"), "set_texture_repeat", "get_texture_repeat"); +} + +CanvasTexture::CanvasTexture() { + canvas_texture = RS::get_singleton()->canvas_texture_create(); +} +CanvasTexture::~CanvasTexture() { + RS::get_singleton()->free(canvas_texture); +} diff --git a/scene/main/canvas_item.h b/scene/main/canvas_item.h index a331cb96a9..092fd17df3 100644 --- a/scene/main/canvas_item.h +++ b/scene/main/canvas_item.h @@ -334,16 +334,16 @@ public: void draw_multiline_colors(const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0); void draw_rect(const Rect2 &p_rect, const Color &p_color, bool p_filled = true, float p_width = 1.0); void draw_circle(const Point2 &p_pos, float p_radius, const Color &p_color); - void draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1, 1), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), bool p_clip_uv = false, TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_texture(const Ref<Texture2D> &p_texture, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1, 1)); + void draw_texture_rect(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false); + void draw_texture_rect_region(const Ref<Texture2D> &p_texture, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = false); void draw_style_box(const Ref<StyleBox> &p_style_box, const Rect2 &p_rect); - void draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture = Ref<Texture2D>(), float p_width = 1, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>(), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>(), const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_primitive(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, Ref<Texture2D> p_texture = Ref<Texture2D>(), float p_width = 1); + void draw_polygon(const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>()); + void draw_colored_polygon(const Vector<Point2> &p_points, const Color &p_color, const Vector<Point2> &p_uvs = Vector<Point2>(), Ref<Texture2D> p_texture = Ref<Texture2D>()); - void draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); - void draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), TextureFilter p_texture_filter = TEXTURE_FILTER_PARENT_NODE, TextureRepeat p_texture_repeat = TEXTURE_REPEAT_PARENT_NODE); + void draw_mesh(const Ref<Mesh> &p_mesh, const Ref<Texture2D> &p_texture, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1)); + void draw_multimesh(const Ref<MultiMesh> &p_multimesh, const Ref<Texture2D> &p_texture); void draw_string(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_text, const Color &p_modulate = Color(1, 1, 1), int p_clip_w = -1); float draw_char(const Ref<Font> &p_font, const Point2 &p_pos, const String &p_char, const String &p_next = "", const Color &p_modulate = Color(1, 1, 1)); @@ -423,4 +423,58 @@ public: VARIANT_ENUM_CAST(CanvasItem::TextureFilter) VARIANT_ENUM_CAST(CanvasItem::TextureRepeat) +class CanvasTexture : public Texture2D { + GDCLASS(CanvasTexture, Texture2D); + OBJ_SAVE_TYPE(Texture2D); // Saves derived classes with common type so they can be interchanged. + + Ref<Texture2D> diffuse_texture; + Ref<Texture2D> normal_texture; + Ref<Texture2D> specular_texture; + Color specular = Color(1, 1, 1, 1); + float shininess = 1.0; + + RID canvas_texture; + + CanvasItem::TextureFilter texture_filter = CanvasItem::TEXTURE_FILTER_PARENT_NODE; + CanvasItem::TextureRepeat texture_repeat = CanvasItem::TEXTURE_REPEAT_PARENT_NODE; + +protected: + static void _bind_methods(); + +public: + void set_diffuse_texture(const Ref<Texture2D> &p_diffuse); + Ref<Texture2D> get_diffuse_texture() const; + + void set_normal_texture(const Ref<Texture2D> &p_normal); + Ref<Texture2D> get_normal_texture() const; + + void set_specular_texture(const Ref<Texture2D> &p_specular); + Ref<Texture2D> get_specular_texture() const; + + void set_specular_color(const Color &p_color); + Color get_specular_color() const; + + void set_specular_shininess(float p_shininess); + float get_specular_shininess() const; + + void set_texture_filter(CanvasItem::TextureFilter p_filter); + CanvasItem::TextureFilter get_texture_filter() const; + + void set_texture_repeat(CanvasItem::TextureRepeat p_repeat); + CanvasItem::TextureRepeat get_texture_repeat() const; + + virtual int get_width() const override; + virtual int get_height() const override; + + virtual bool is_pixel_opaque(int p_x, int p_y) const override; + virtual bool has_alpha() const override; + + virtual Ref<Image> get_data() const override; + + virtual RID get_rid() const override; + + CanvasTexture(); + ~CanvasTexture(); +}; + #endif // CANVAS_ITEM_H diff --git a/scene/main/node.h b/scene/main/node.h index 2928466cd0..09943d0626 100644 --- a/scene/main/node.h +++ b/scene/main/node.h @@ -34,7 +34,6 @@ #include "core/class_db.h" #include "core/map.h" #include "core/node_path.h" -#include "core/object.h" #include "core/project_settings.h" #include "core/script_language.h" #include "core/typed_array.h" diff --git a/scene/main/scene_tree.cpp b/scene/main/scene_tree.cpp index adefb53862..ea0fe6fcc2 100644 --- a/scene/main/scene_tree.cpp +++ b/scene/main/scene_tree.cpp @@ -1383,14 +1383,17 @@ SceneTree::SceneTree() { root->set_as_audio_listener_2d(true); current_scene = nullptr; - int msaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/msaa", 0); + const int msaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/msaa", 0); ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/screen_filters/msaa", PropertyInfo(Variant::INT, "rendering/quality/screen_filters/msaa", PROPERTY_HINT_ENUM, "Disabled (Fastest),2x (Fast),4x (Average),8x (Slow),16x (Slower)")); root->set_msaa(Viewport::MSAA(msaa_mode)); - int ssaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/screen_space_aa", 0); + const int ssaa_mode = GLOBAL_DEF("rendering/quality/screen_filters/screen_space_aa", 0); ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/screen_filters/screen_space_aa", PropertyInfo(Variant::INT, "rendering/quality/screen_filters/screen_space_aa", PROPERTY_HINT_ENUM, "Disabled (Fastest),FXAA (Fast)")); root->set_screen_space_aa(Viewport::ScreenSpaceAA(ssaa_mode)); + const bool use_debanding = GLOBAL_DEF("rendering/quality/screen_filters/use_debanding", false); + root->set_use_debanding(use_debanding); + { //load default fallback environment //get possible extensions List<String> exts; diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp index 3c7475a150..ba78f8dc2d 100644 --- a/scene/main/viewport.cpp +++ b/scene/main/viewport.cpp @@ -3138,6 +3138,17 @@ Viewport::ScreenSpaceAA Viewport::get_screen_space_aa() const { return screen_space_aa; } +void Viewport::set_use_debanding(bool p_use_debanding) { + if (use_debanding == p_use_debanding) + return; + use_debanding = p_use_debanding; + RS::get_singleton()->viewport_set_use_debanding(viewport, p_use_debanding); +} + +bool Viewport::is_using_debanding() const { + return use_debanding; +} + void Viewport::set_debug_draw(DebugDraw p_debug_draw) { debug_draw = p_debug_draw; RS::get_singleton()->viewport_set_debug_draw(viewport, RS::ViewportDebugDraw(p_debug_draw)); @@ -3213,11 +3224,28 @@ void Viewport::_validate_property(PropertyInfo &property) const { } void Viewport::set_default_canvas_item_texture_filter(DefaultCanvasItemTextureFilter p_filter) { + ERR_FAIL_INDEX(p_filter, DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_MAX); + if (default_canvas_item_texture_filter == p_filter) { return; } default_canvas_item_texture_filter = p_filter; - _propagate_update_default_filter(this); + switch (default_canvas_item_texture_filter) { + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS: + RS::get_singleton()->viewport_set_default_canvas_item_texture_filter(viewport, RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS); + break; + default: { + } + } } Viewport::DefaultCanvasItemTextureFilter Viewport::get_default_canvas_item_texture_filter() const { @@ -3225,37 +3253,31 @@ Viewport::DefaultCanvasItemTextureFilter Viewport::get_default_canvas_item_textu } void Viewport::set_default_canvas_item_texture_repeat(DefaultCanvasItemTextureRepeat p_repeat) { + ERR_FAIL_INDEX(p_repeat, DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MAX); + if (default_canvas_item_texture_repeat == p_repeat) { return; } - default_canvas_item_texture_repeat = p_repeat; - _propagate_update_default_repeat(this); -} -Viewport::DefaultCanvasItemTextureRepeat Viewport::get_default_canvas_item_texture_repeat() const { - return default_canvas_item_texture_repeat; -} - -void Viewport::_propagate_update_default_filter(Node *p_node) { - CanvasItem *ci = Object::cast_to<CanvasItem>(p_node); - if (ci) { - ci->_update_texture_filter_changed(false); - } + default_canvas_item_texture_repeat = p_repeat; - for (int i = 0; i < p_node->get_child_count(); i++) { - _propagate_update_default_filter(p_node->get_child(i)); + switch (default_canvas_item_texture_repeat) { + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_DISABLED: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_ENABLED: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + break; + case DEFAULT_CANVAS_ITEM_TEXTURE_REPEAT_MIRROR: + RS::get_singleton()->viewport_set_default_canvas_item_texture_repeat(viewport, RS::CANVAS_ITEM_TEXTURE_REPEAT_MIRROR); + break; + default: { + } } } -void Viewport::_propagate_update_default_repeat(Node *p_node) { - CanvasItem *ci = Object::cast_to<CanvasItem>(p_node); - if (ci) { - ci->_update_texture_repeat_changed(false); - } - - for (int i = 0; i < p_node->get_child_count(); i++) { - _propagate_update_default_repeat(p_node->get_child(i)); - } +Viewport::DefaultCanvasItemTextureRepeat Viewport::get_default_canvas_item_texture_repeat() const { + return default_canvas_item_texture_repeat; } DisplayServer::WindowID Viewport::get_window_id() const { @@ -3324,6 +3346,9 @@ void Viewport::_bind_methods() { ClassDB::bind_method(D_METHOD("set_screen_space_aa", "screen_space_aa"), &Viewport::set_screen_space_aa); ClassDB::bind_method(D_METHOD("get_screen_space_aa"), &Viewport::get_screen_space_aa); + ClassDB::bind_method(D_METHOD("set_use_debanding", "enable"), &Viewport::set_use_debanding); + ClassDB::bind_method(D_METHOD("is_using_debanding"), &Viewport::is_using_debanding); + ClassDB::bind_method(D_METHOD("set_debug_draw", "debug_draw"), &Viewport::set_debug_draw); ClassDB::bind_method(D_METHOD("get_debug_draw"), &Viewport::get_debug_draw); @@ -3397,6 +3422,7 @@ void Viewport::_bind_methods() { ADD_GROUP("Rendering", ""); ADD_PROPERTY(PropertyInfo(Variant::INT, "msaa", PROPERTY_HINT_ENUM, "Disabled,2x,4x,8x,16x,AndroidVR 2x,AndroidVR 4x"), "set_msaa", "get_msaa"); ADD_PROPERTY(PropertyInfo(Variant::INT, "screen_space_aa", PROPERTY_HINT_ENUM, "Disabled,FXAA"), "set_screen_space_aa", "get_screen_space_aa"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "use_debanding"), "set_use_debanding", "is_using_debanding"); ADD_PROPERTY(PropertyInfo(Variant::INT, "debug_draw", PROPERTY_HINT_ENUM, "Disabled,Unshaded,Overdraw,Wireframe"), "set_debug_draw", "get_debug_draw"); ADD_GROUP("Canvas Items", "canvas_item_"); ADD_PROPERTY(PropertyInfo(Variant::INT, "canvas_item_default_texture_filter", PROPERTY_HINT_ENUM, "Nearest,Linear,MipmapLinear,MipmapNearest"), "set_default_canvas_item_texture_filter", "get_default_canvas_item_texture_filter"); diff --git a/scene/main/viewport.h b/scene/main/viewport.h index 878ac47bca..9238f7637c 100644 --- a/scene/main/viewport.h +++ b/scene/main/viewport.h @@ -279,6 +279,7 @@ private: MSAA msaa; ScreenSpaceAA screen_space_aa; + bool use_debanding; Ref<ViewportTexture> default_texture; Set<ViewportTexture *> viewport_textures; @@ -356,9 +357,6 @@ private: DefaultCanvasItemTextureFilter default_canvas_item_texture_filter; DefaultCanvasItemTextureRepeat default_canvas_item_texture_repeat; - void _propagate_update_default_filter(Node *p_node); - void _propagate_update_default_repeat(Node *p_node); - bool disable_input; void _gui_call_input(Control *p_control, const Ref<InputEvent> &p_input); @@ -521,6 +519,9 @@ public: void set_screen_space_aa(ScreenSpaceAA p_screen_space_aa); ScreenSpaceAA get_screen_space_aa() const; + void set_use_debanding(bool p_use_debanding); + bool is_using_debanding() const; + Vector2 get_camera_coords(const Vector2 &p_viewport_coords) const; Vector2 get_camera_rect_size() const; diff --git a/scene/main/window.cpp b/scene/main/window.cpp index 7c2350d1c0..9f014e8175 100644 --- a/scene/main/window.cpp +++ b/scene/main/window.cpp @@ -895,11 +895,11 @@ void Window::_window_input(const Ref<InputEvent> &p_ev) { if (exclusive_child != nullptr) { Window *focus_target = exclusive_child; + focus_target->grab_focus(); while (focus_target->exclusive_child != nullptr) { - focus_target->grab_focus(); focus_target = focus_target->exclusive_child; + focus_target->grab_focus(); } - focus_target->grab_focus(); if (!is_embedding_subwindows()) { //not embedding, no need for event return; diff --git a/scene/register_scene_types.cpp b/scene/register_scene_types.cpp index 820513c53d..76b68c8da8 100644 --- a/scene/register_scene_types.cpp +++ b/scene/register_scene_types.cpp @@ -194,6 +194,7 @@ #include "scene/3d/decal.h" #include "scene/3d/gi_probe.h" #include "scene/3d/gpu_particles_3d.h" +#include "scene/3d/gpu_particles_collision_3d.h" #include "scene/3d/immediate_geometry_3d.h" #include "scene/3d/light_3d.h" #include "scene/3d/lightmap_probe.h" @@ -450,6 +451,15 @@ void register_scene_types() { ClassDB::register_class<LightmapProbe>(); ClassDB::register_virtual_class<Lightmapper>(); ClassDB::register_class<GPUParticles3D>(); + ClassDB::register_virtual_class<GPUParticlesCollision3D>(); + ClassDB::register_class<GPUParticlesCollisionBox>(); + ClassDB::register_class<GPUParticlesCollisionSphere>(); + ClassDB::register_class<GPUParticlesCollisionSDF>(); + ClassDB::register_class<GPUParticlesCollisionHeightField>(); + ClassDB::register_virtual_class<GPUParticlesAttractor3D>(); + ClassDB::register_class<GPUParticlesAttractorBox>(); + ClassDB::register_class<GPUParticlesAttractorSphere>(); + ClassDB::register_class<GPUParticlesAttractorVectorField>(); ClassDB::register_class<CPUParticles3D>(); ClassDB::register_class<Position3D>(); @@ -512,7 +522,8 @@ void register_scene_types() { ClassDB::register_class<VisualShaderNodeCustom>(); ClassDB::register_class<VisualShaderNodeInput>(); ClassDB::register_virtual_class<VisualShaderNodeOutput>(); - ClassDB::register_class<VisualShaderNodeGroupBase>(); + ClassDB::register_virtual_class<VisualShaderNodeResizableBase>(); + ClassDB::register_virtual_class<VisualShaderNodeGroupBase>(); ClassDB::register_class<VisualShaderNodeFloatConstant>(); ClassDB::register_class<VisualShaderNodeIntConstant>(); ClassDB::register_class<VisualShaderNodeBooleanConstant>(); @@ -553,6 +564,7 @@ void register_scene_types() { ClassDB::register_class<VisualShaderNodeVectorDecompose>(); ClassDB::register_class<VisualShaderNodeTransformDecompose>(); ClassDB::register_class<VisualShaderNodeTexture>(); + ClassDB::register_class<VisualShaderNodeCurveTexture>(); ClassDB::register_virtual_class<VisualShaderNodeSample3D>(); ClassDB::register_class<VisualShaderNodeTexture2DArray>(); ClassDB::register_class<VisualShaderNodeTexture3D>(); @@ -582,6 +594,7 @@ void register_scene_types() { ClassDB::register_class<ShaderMaterial>(); ClassDB::register_virtual_class<CanvasItem>(); + ClassDB::register_class<CanvasTexture>(); ClassDB::register_class<CanvasItemMaterial>(); SceneTree::add_idle_callback(CanvasItemMaterial::flush_changes); CanvasItemMaterial::init_shaders(); diff --git a/scene/resources/dynamic_font.cpp b/scene/resources/dynamic_font.cpp index bc983c1d7e..ad9d888480 100644 --- a/scene/resources/dynamic_font.cpp +++ b/scene/resources/dynamic_font.cpp @@ -347,7 +347,7 @@ float DynamicFontAtSize::draw_char(RID p_canvas_item, const Point2 &p_pos, char3 modulate.r = modulate.g = modulate.b = 1.0; } RID texture = font->textures[ch->texture_idx].texture->get_rid(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, ch->rect.size), texture, ch->rect_uv, modulate, false, RID(), RID(), Color(1, 1, 1, 1), false); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, ch->rect.size), texture, ch->rect_uv, modulate, false, false); } advance = ch->advance; diff --git a/scene/resources/environment.cpp b/scene/resources/environment.cpp index ee8e63266d..f4edab07b5 100644 --- a/scene/resources/environment.cpp +++ b/scene/resources/environment.cpp @@ -44,6 +44,9 @@ void Environment::set_background(BGMode p_bg) { bg_mode = p_bg; RS::get_singleton()->environment_set_background(environment, RS::EnvironmentBG(p_bg)); _change_notify(); + if (bg_mode != BG_SKY) { + set_fog_aerial_perspective(0.0); + } } Environment::BGMode Environment::get_background() const { @@ -578,22 +581,28 @@ bool Environment::is_glow_enabled() const { return glow_enabled; } -void Environment::set_glow_level_enabled(int p_level, bool p_enabled) { +void Environment::set_glow_level(int p_level, float p_intensity) { ERR_FAIL_INDEX(p_level, RS::MAX_GLOW_LEVELS); - if (p_enabled) { - glow_levels |= (1 << p_level); - } else { - glow_levels &= ~(1 << p_level); - } + glow_levels.write[p_level] = p_intensity; _update_glow(); } -bool Environment::is_glow_level_enabled(int p_level) const { +float Environment::get_glow_level(int p_level) const { ERR_FAIL_INDEX_V(p_level, RS::MAX_GLOW_LEVELS, false); - return glow_levels & (1 << p_level); + return glow_levels[p_level]; +} + +void Environment::set_glow_normalized(bool p_normalized) { + glow_normalize_levels = p_normalized; + + _update_glow(); +} + +bool Environment::is_glow_normalized() const { + return glow_normalize_levels; } void Environment::set_glow_intensity(float p_intensity) { @@ -670,10 +679,24 @@ float Environment::get_glow_hdr_luminance_cap() const { } void Environment::_update_glow() { + Vector<float> normalized_levels; + if (glow_normalize_levels) { + normalized_levels.resize(7); + float size = 0.0; + for (int i = 0; i < glow_levels.size(); i++) { + size += glow_levels[i]; + } + for (int i = 0; i < glow_levels.size(); i++) { + normalized_levels.write[i] = glow_levels[i] / size; + } + } else { + normalized_levels = glow_levels; + } + RS::get_singleton()->environment_set_glow( environment, glow_enabled, - glow_levels, + normalized_levels, glow_intensity, glow_strength, glow_mix, @@ -739,6 +762,14 @@ float Environment::get_fog_height_density() const { return fog_height_density; } +void Environment::set_fog_aerial_perspective(float p_aerial_perspective) { + fog_aerial_perspective = p_aerial_perspective; + _update_fog(); +} +float Environment::get_fog_aerial_perspective() const { + return fog_aerial_perspective; +} + void Environment::_update_fog() { RS::get_singleton()->environment_set_fog( environment, @@ -748,7 +779,8 @@ void Environment::_update_fog() { fog_sun_scatter, fog_density, fog_height, - fog_height_density); + fog_height_density, + fog_aerial_perspective); } // Volumetric Fog @@ -887,6 +919,12 @@ void Environment::_validate_property(PropertyInfo &property) const { } } + if (property.name == "fog_aerial_perspective") { + if (bg_mode != BG_SKY) { + property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; + } + } + if (property.name == "glow_intensity" && glow_blend_mode == GLOW_BLEND_MODE_MIX) { property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL; } @@ -1162,8 +1200,10 @@ void Environment::_bind_methods() { ClassDB::bind_method(D_METHOD("set_glow_enabled", "enabled"), &Environment::set_glow_enabled); ClassDB::bind_method(D_METHOD("is_glow_enabled"), &Environment::is_glow_enabled); - ClassDB::bind_method(D_METHOD("set_glow_level_enabled", "idx", "enabled"), &Environment::set_glow_level_enabled); - ClassDB::bind_method(D_METHOD("is_glow_level_enabled", "idx"), &Environment::is_glow_level_enabled); + ClassDB::bind_method(D_METHOD("set_glow_level", "idx", "intensity"), &Environment::set_glow_level); + ClassDB::bind_method(D_METHOD("get_glow_level", "idx"), &Environment::get_glow_level); + ClassDB::bind_method(D_METHOD("set_glow_normalized", "normalize"), &Environment::set_glow_normalized); + ClassDB::bind_method(D_METHOD("is_glow_normalized"), &Environment::is_glow_normalized); ClassDB::bind_method(D_METHOD("set_glow_intensity", "intensity"), &Environment::set_glow_intensity); ClassDB::bind_method(D_METHOD("get_glow_intensity"), &Environment::get_glow_intensity); ClassDB::bind_method(D_METHOD("set_glow_strength", "strength"), &Environment::set_glow_strength); @@ -1183,13 +1223,14 @@ void Environment::_bind_methods() { ADD_GROUP("Glow", "glow_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_enabled"), "set_glow_enabled", "is_glow_enabled"); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/1"), "set_glow_level_enabled", "is_glow_level_enabled", 0); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/2"), "set_glow_level_enabled", "is_glow_level_enabled", 1); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/3"), "set_glow_level_enabled", "is_glow_level_enabled", 2); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/4"), "set_glow_level_enabled", "is_glow_level_enabled", 3); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/5"), "set_glow_level_enabled", "is_glow_level_enabled", 4); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/6"), "set_glow_level_enabled", "is_glow_level_enabled", 5); - ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/7"), "set_glow_level_enabled", "is_glow_level_enabled", 6); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/1", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 0); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/2", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 1); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/3", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 2); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/4", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 3); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/5", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 4); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/6", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 5); + ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/7", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 6); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_normalized"), "set_glow_normalized", "is_glow_normalized"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_intensity", PROPERTY_HINT_RANGE, "0.0,8.0,0.01"), "set_glow_intensity", "get_glow_intensity"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_strength", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_glow_strength", "get_glow_strength"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_mix", PROPERTY_HINT_RANGE, "0.0,1.0,0.001"), "set_glow_mix", "get_glow_mix"); @@ -1219,6 +1260,9 @@ void Environment::_bind_methods() { ClassDB::bind_method(D_METHOD("set_fog_height_density", "height_density"), &Environment::set_fog_height_density); ClassDB::bind_method(D_METHOD("get_fog_height_density"), &Environment::get_fog_height_density); + ClassDB::bind_method(D_METHOD("set_fog_aerial_perspective", "aerial_perspective"), &Environment::set_fog_aerial_perspective); + ClassDB::bind_method(D_METHOD("get_fog_aerial_perspective"), &Environment::get_fog_aerial_perspective); + ADD_GROUP("Fog", "fog_"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fog_enabled"), "set_fog_enabled", "is_fog_enabled"); ADD_PROPERTY(PropertyInfo(Variant::COLOR, "fog_light_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_fog_light_color", "get_fog_light_color"); @@ -1226,6 +1270,7 @@ void Environment::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_sun_scatter", PROPERTY_HINT_RANGE, "0,1,0.01,or_greater"), "set_fog_sun_scatter", "get_fog_sun_scatter"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_density", PROPERTY_HINT_RANGE, "0,16,0.0001"), "set_fog_density", "get_fog_density"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_aerial_perspective", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_fog_aerial_perspective", "get_fog_aerial_perspective"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height", PROPERTY_HINT_RANGE, "-1024,1024,0.01,or_lesser,or_greater"), "set_fog_height", "get_fog_height"); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height_density", PROPERTY_HINT_RANGE, "0,128,0.001,or_greater"), "set_fog_height_density", "get_fog_height_density"); @@ -1329,6 +1374,16 @@ Environment::Environment() { environment = RS::get_singleton()->environment_create(); set_camera_feed_id(bg_camera_feed_id); + + glow_levels.resize(7); + glow_levels.write[0] = 0.0; + glow_levels.write[1] = 0.0; + glow_levels.write[2] = 1.0; + glow_levels.write[3] = 0.0; + glow_levels.write[4] = 1.0; + glow_levels.write[5] = 0.0; + glow_levels.write[6] = 0.0; + _update_ambient_light(); _update_tonemap(); _update_ssr(); diff --git a/scene/resources/environment.h b/scene/resources/environment.h index d4d84f31aa..9b7247b58d 100644 --- a/scene/resources/environment.h +++ b/scene/resources/environment.h @@ -171,7 +171,8 @@ private: // Glow bool glow_enabled = false; - int glow_levels = (1 << 2) | (1 << 4); + Vector<float> glow_levels; + bool glow_normalize_levels = false; float glow_intensity = 0.8; float glow_strength = 1.0; float glow_mix = 0.05; @@ -190,6 +191,7 @@ private: float fog_density = 0.001; float fog_height = 0.0; float fog_height_density = 0.0; //can be negative to invert effect + float fog_aerial_perspective = 0.0; void _update_fog(); @@ -332,8 +334,10 @@ public: // Glow void set_glow_enabled(bool p_enabled); bool is_glow_enabled() const; - void set_glow_level_enabled(int p_level, bool p_enabled); - bool is_glow_level_enabled(int p_level) const; + void set_glow_level(int p_level, float p_intensity); + float get_glow_level(int p_level) const; + void set_glow_normalized(bool p_normalized); + bool is_glow_normalized() const; void set_glow_intensity(float p_intensity); float get_glow_intensity() const; void set_glow_strength(float p_strength); @@ -368,6 +372,8 @@ public: float get_fog_height() const; void set_fog_height_density(float p_amount); float get_fog_height_density() const; + void set_fog_aerial_perspective(float p_aerial_perspective); + float get_fog_aerial_perspective() const; // Volumetric Fog void set_volumetric_fog_enabled(bool p_enable); diff --git a/scene/resources/font.cpp b/scene/resources/font.cpp index 7cc39f661d..7bda889e46 100644 --- a/scene/resources/font.cpp +++ b/scene/resources/font.cpp @@ -31,7 +31,6 @@ #include "font.h" #include "core/io/resource_loader.h" -#include "core/method_bind_ext.gen.inc" #include "core/os/file_access.h" void Font::draw_halign(RID p_canvas_item, const Point2 &p_pos, HAlign p_align, float p_width, const String &p_text, const Color &p_modulate, const Color &p_outline_modulate) const { @@ -550,7 +549,7 @@ float BitmapFont::draw_char(RID p_canvas_item, const Point2 &p_pos, char32_t p_c cpos.x += c->h_align; cpos.y -= ascent; cpos.y += c->v_align; - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, c->rect.size), textures[c->texture_idx]->get_rid(), c->rect, p_modulate, false, RID(), RID(), Color(1, 1, 1, 1), false); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(cpos, c->rect.size), textures[c->texture_idx]->get_rid(), c->rect, p_modulate, false, false); } return get_char_size(p_char, p_next).width; diff --git a/scene/resources/particles_material.cpp b/scene/resources/particles_material.cpp index 4bbfa8965a..a286184aee 100644 --- a/scene/resources/particles_material.cpp +++ b/scene/resources/particles_material.cpp @@ -98,6 +98,9 @@ void ParticlesMaterial::init_shaders() { shader_names->sub_emitter_frequency = "sub_emitter_frequency"; shader_names->sub_emitter_amount_at_end = "sub_emitter_amount_at_end"; shader_names->sub_emitter_keep_velocity = "sub_emitter_keep_velocity"; + + shader_names->collision_friction = "collision_friction"; + shader_names->collision_bounce = "collision_bounce"; } void ParticlesMaterial::finish_shaders() { @@ -136,6 +139,10 @@ void ParticlesMaterial::_update_shader() { String code = "shader_type particles;\n"; + if (collision_scale) { + code += "render_mode collision_use_scale;\n"; + } + code += "uniform vec3 direction;\n"; code += "uniform float spread;\n"; code += "uniform float flatness;\n"; @@ -247,6 +254,11 @@ void ParticlesMaterial::_update_shader() { code += "uniform sampler2D anim_offset_texture;\n"; } + if (collision_enabled) { + code += "uniform float collision_friction;\n"; + code += "uniform float collision_bounce;\n"; + } + //need a random function code += "\n\n"; code += "float rand_from_seed(inout uint seed) {\n"; @@ -476,6 +488,10 @@ void ParticlesMaterial::_update_shader() { code += " vec3 crossDiff = cross(normalize(diff), normalize(gravity));\n"; code += " force += length(crossDiff) > 0.0 ? normalize(crossDiff) * ((tangent_accel + tex_tangent_accel) * mix(1.0, rand_from_seed(alt_seed), tangent_accel_random)) : vec3(0.0);\n"; } + if (attractor_interaction_enabled) { + code += " force += ATTRACTOR_FORCE;\n\n"; + } + code += " // apply attractor forces\n"; code += " VELOCITY += force * DELTA;\n"; code += " // orbit velocity\n"; @@ -599,6 +615,13 @@ void ParticlesMaterial::_update_shader() { code += " VELOCITY.z = 0.0;\n"; code += " TRANSFORM[3].z = 0.0;\n"; } + if (collision_enabled) { + code += " if (COLLIDED) {\n"; + code += " TRANSFORM[3].xyz+=COLLISION_NORMAL * COLLISION_DEPTH;\n"; + code += " VELOCITY -= COLLISION_NORMAL * dot(COLLISION_NORMAL, VELOCITY) * (1.0 + collision_bounce);\n"; + code += " VELOCITY = mix(VELOCITY,vec3(0.0),collision_friction * DELTA * 100.0);\n"; + code += " }\n"; + } if (sub_emitter_mode != SUB_EMITTER_DISABLED) { code += " int emit_count = 0;\n"; switch (sub_emitter_mode) { @@ -609,6 +632,7 @@ void ParticlesMaterial::_update_shader() { } break; case SUB_EMITTER_AT_COLLISION: { //not implemented yet + code += " if (COLLIDED) emit_count = 1;\n"; } break; case SUB_EMITTER_AT_END: { //not implemented yet @@ -1072,6 +1096,51 @@ bool ParticlesMaterial::get_sub_emitter_keep_velocity() const { return sub_emitter_keep_velocity; } +void ParticlesMaterial::set_attractor_interaction_enabled(bool p_enable) { + attractor_interaction_enabled = p_enable; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_attractor_interaction_enabled() const { + return attractor_interaction_enabled; +} + +void ParticlesMaterial::set_collision_enabled(bool p_enabled) { + collision_enabled = p_enabled; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_collision_enabled() const { + return collision_enabled; +} + +void ParticlesMaterial::set_collision_use_scale(bool p_scale) { + collision_scale = p_scale; + _queue_shader_change(); +} + +bool ParticlesMaterial::is_collision_using_scale() const { + return collision_scale; +} + +void ParticlesMaterial::set_collision_friction(float p_friction) { + collision_friction = p_friction; + RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_friction, p_friction); +} + +float ParticlesMaterial::get_collision_friction() const { + return collision_friction; +} + +void ParticlesMaterial::set_collision_bounce(float p_bounce) { + collision_bounce = p_bounce; + RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_bounce, p_bounce); +} + +float ParticlesMaterial::get_collision_bounce() const { + return collision_bounce; +} + Shader::Mode ParticlesMaterial::get_shader_mode() const { return Shader::MODE_PARTICLES; } @@ -1143,6 +1212,21 @@ void ParticlesMaterial::_bind_methods() { ClassDB::bind_method(D_METHOD("get_sub_emitter_keep_velocity"), &ParticlesMaterial::get_sub_emitter_keep_velocity); ClassDB::bind_method(D_METHOD("set_sub_emitter_keep_velocity", "enable"), &ParticlesMaterial::set_sub_emitter_keep_velocity); + ClassDB::bind_method(D_METHOD("set_attractor_interaction_enabled", "enabled"), &ParticlesMaterial::set_attractor_interaction_enabled); + ClassDB::bind_method(D_METHOD("is_attractor_interaction_enabled"), &ParticlesMaterial::is_attractor_interaction_enabled); + + ClassDB::bind_method(D_METHOD("set_collision_enabled", "enabled"), &ParticlesMaterial::set_collision_enabled); + ClassDB::bind_method(D_METHOD("is_collision_enabled"), &ParticlesMaterial::is_collision_enabled); + + ClassDB::bind_method(D_METHOD("set_collision_use_scale", "radius"), &ParticlesMaterial::set_collision_use_scale); + ClassDB::bind_method(D_METHOD("is_collision_using_scale"), &ParticlesMaterial::is_collision_using_scale); + + ClassDB::bind_method(D_METHOD("set_collision_friction", "friction"), &ParticlesMaterial::set_collision_friction); + ClassDB::bind_method(D_METHOD("get_collision_friction"), &ParticlesMaterial::get_collision_friction); + + ClassDB::bind_method(D_METHOD("set_collision_bounce", "bounce"), &ParticlesMaterial::set_collision_bounce); + ClassDB::bind_method(D_METHOD("get_collision_bounce"), &ParticlesMaterial::get_collision_bounce); + ADD_GROUP("Time", ""); ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lifetime_randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_lifetime_randomness", "get_lifetime_randomness"); @@ -1221,6 +1305,14 @@ void ParticlesMaterial::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::INT, "sub_emitter_amount_at_end", PROPERTY_HINT_RANGE, "1,32,1"), "set_sub_emitter_amount_at_end", "get_sub_emitter_amount_at_end"); ADD_PROPERTY(PropertyInfo(Variant::BOOL, "sub_emitter_keep_velocity"), "set_sub_emitter_keep_velocity", "get_sub_emitter_keep_velocity"); + ADD_GROUP("Attractor Interaction", "attractor_interaction_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "attractor_interaction_enabled"), "set_attractor_interaction_enabled", "is_attractor_interaction_enabled"); + ADD_GROUP("Collision", "collision_"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_enabled"), "set_collision_enabled", "is_collision_enabled"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_friction", "get_collision_friction"); + ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_bounce", "get_collision_bounce"); + ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_use_scale"), "set_collision_use_scale", "is_collision_using_scale"); + BIND_ENUM_CONSTANT(PARAM_INITIAL_LINEAR_VELOCITY); BIND_ENUM_CONSTANT(PARAM_ANGULAR_VELOCITY); BIND_ENUM_CONSTANT(PARAM_ORBIT_VELOCITY); @@ -1283,6 +1375,12 @@ ParticlesMaterial::ParticlesMaterial() : set_sub_emitter_amount_at_end(1); set_sub_emitter_keep_velocity(false); + set_attractor_interaction_enabled(true); + set_collision_enabled(true); + set_collision_bounce(0.0); + set_collision_friction(0.0); + set_collision_use_scale(false); + for (int i = 0; i < PARAM_MAX; i++) { set_param_randomness(Parameter(i), 0); } diff --git a/scene/resources/particles_material.h b/scene/resources/particles_material.h index fa8858f67f..7aca708889 100644 --- a/scene/resources/particles_material.h +++ b/scene/resources/particles_material.h @@ -37,11 +37,7 @@ /* TODO: -Path following -*Manual emission --Sub Emitters --Attractors -Emitter positions deformable by bones --Collision -Proper trails */ @@ -99,6 +95,9 @@ private: uint32_t invalid_key : 1; uint32_t has_emission_color : 1; uint32_t sub_emitter : 2; + uint32_t attractor_enabled : 1; + uint32_t collision_enabled : 1; + uint32_t collision_scale : 1; }; uint32_t key; @@ -135,6 +134,9 @@ private: mk.emission_shape = emission_shape; mk.has_emission_color = emission_shape >= EMISSION_SHAPE_POINTS && emission_color_texture.is_valid(); mk.sub_emitter = sub_emitter_mode; + mk.collision_enabled = collision_enabled; + mk.attractor_enabled = attractor_interaction_enabled; + mk.collision_scale = collision_scale; return mk; } @@ -201,6 +203,9 @@ private: StringName sub_emitter_frequency; StringName sub_emitter_amount_at_end; StringName sub_emitter_keep_velocity; + + StringName collision_friction; + StringName collision_bounce; }; static ShaderNames *shader_names; @@ -244,6 +249,12 @@ private: bool sub_emitter_keep_velocity; //do not save emission points here + bool attractor_interaction_enabled; + bool collision_enabled; + bool collision_scale; + float collision_friction; + float collision_bounce; + protected: static void _bind_methods(); virtual void _validate_property(PropertyInfo &property) const override; @@ -298,6 +309,21 @@ public: void set_lifetime_randomness(float p_lifetime); float get_lifetime_randomness() const; + void set_attractor_interaction_enabled(bool p_enable); + bool is_attractor_interaction_enabled() const; + + void set_collision_enabled(bool p_enabled); + bool is_collision_enabled() const; + + void set_collision_use_scale(bool p_scale); + bool is_collision_using_scale() const; + + void set_collision_friction(float p_friction); + float get_collision_friction() const; + + void set_collision_bounce(float p_bounce); + float get_collision_bounce() const; + static void init_shaders(); static void finish_shaders(); static void flush_changes(); diff --git a/scene/resources/style_box.cpp b/scene/resources/style_box.cpp index cdb0ec5111..a8bf44c5c0 100644 --- a/scene/resources/style_box.cpp +++ b/scene/resources/style_box.cpp @@ -130,18 +130,6 @@ Ref<Texture2D> StyleBoxTexture::get_texture() const { return texture; } -void StyleBoxTexture::set_normal_map(Ref<Texture2D> p_normal_map) { - if (normal_map == p_normal_map) { - return; - } - normal_map = p_normal_map; - emit_changed(); -} - -Ref<Texture2D> StyleBoxTexture::get_normal_map() const { - return normal_map; -} - void StyleBoxTexture::set_margin_size(Margin p_margin, float p_size) { ERR_FAIL_INDEX((int)p_margin, 4); @@ -187,12 +175,7 @@ void StyleBoxTexture::draw(RID p_canvas_item, const Rect2 &p_rect) const { rect.size.x += expand_margin[MARGIN_LEFT] + expand_margin[MARGIN_RIGHT]; rect.size.y += expand_margin[MARGIN_TOP] + expand_margin[MARGIN_BOTTOM]; - RID normal_rid; - if (normal_map.is_valid()) { - normal_rid = normal_map->get_rid(); - } - - RenderingServer::get_singleton()->canvas_item_add_nine_patch(p_canvas_item, rect, src_rect, texture->get_rid(), Vector2(margin[MARGIN_LEFT], margin[MARGIN_TOP]), Vector2(margin[MARGIN_RIGHT], margin[MARGIN_BOTTOM]), RS::NinePatchAxisMode(axis_h), RS::NinePatchAxisMode(axis_v), draw_center, modulate, normal_rid); + RenderingServer::get_singleton()->canvas_item_add_nine_patch(p_canvas_item, rect, src_rect, texture->get_rid(), Vector2(margin[MARGIN_LEFT], margin[MARGIN_TOP]), Vector2(margin[MARGIN_RIGHT], margin[MARGIN_BOTTOM]), RS::NinePatchAxisMode(axis_h), RS::NinePatchAxisMode(axis_v), draw_center, modulate); } void StyleBoxTexture::set_draw_center(bool p_enabled) { @@ -288,9 +271,6 @@ void StyleBoxTexture::_bind_methods() { ClassDB::bind_method(D_METHOD("set_texture", "texture"), &StyleBoxTexture::set_texture); ClassDB::bind_method(D_METHOD("get_texture"), &StyleBoxTexture::get_texture); - ClassDB::bind_method(D_METHOD("set_normal_map", "normal_map"), &StyleBoxTexture::set_normal_map); - ClassDB::bind_method(D_METHOD("get_normal_map"), &StyleBoxTexture::get_normal_map); - ClassDB::bind_method(D_METHOD("set_margin_size", "margin", "size"), &StyleBoxTexture::set_margin_size); ClassDB::bind_method(D_METHOD("get_margin_size", "margin"), &StyleBoxTexture::get_margin_size); @@ -317,7 +297,6 @@ void StyleBoxTexture::_bind_methods() { ADD_SIGNAL(MethodInfo("texture_changed")); ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_texture", "get_texture"); - ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D"), "set_normal_map", "get_normal_map"); ADD_PROPERTY(PropertyInfo(Variant::RECT2, "region_rect"), "set_region_rect", "get_region_rect"); ADD_GROUP("Margin", "margin_"); ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "margin_left", PROPERTY_HINT_RANGE, "0,2048,1"), "set_margin_size", "get_margin_size", MARGIN_LEFT); diff --git a/scene/resources/style_box.h b/scene/resources/style_box.h index 3d29e3bd0f..c5caab1b5a 100644 --- a/scene/resources/style_box.h +++ b/scene/resources/style_box.h @@ -90,7 +90,6 @@ private: float margin[4]; Rect2 region_rect; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; bool draw_center; Color modulate; AxisStretchMode axis_h; @@ -115,9 +114,6 @@ public: void set_texture(Ref<Texture2D> p_texture); Ref<Texture2D> get_texture() const; - void set_normal_map(Ref<Texture2D> p_normal_map); - Ref<Texture2D> get_normal_map() const; - void set_draw_center(bool p_enabled); bool is_draw_center_enabled() const; virtual Size2 get_center_size() const override; diff --git a/scene/resources/surface_tool.cpp b/scene/resources/surface_tool.cpp index 1a2dcc84bb..ff14a5a292 100644 --- a/scene/resources/surface_tool.cpp +++ b/scene/resources/surface_tool.cpp @@ -30,8 +30,6 @@ #include "surface_tool.h" -#include "core/method_bind_ext.gen.inc" - #define _VERTEX_SNAP 0.0001 #define EQ_VERTEX_DIST 0.00001 diff --git a/scene/resources/texture.cpp b/scene/resources/texture.cpp index 39237e1a33..255cf3df3a 100644 --- a/scene/resources/texture.cpp +++ b/scene/resources/texture.cpp @@ -32,7 +32,6 @@ #include "core/core_string_names.h" #include "core/io/image_loader.h" -#include "core/method_bind_ext.gen.inc" #include "core/os/os.h" #include "mesh.h" #include "scene/resources/bit_map.h" @@ -46,28 +45,21 @@ bool Texture2D::is_pixel_opaque(int p_x, int p_y) const { return true; } -void Texture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, get_size()), get_rid(), false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); +void Texture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, get_size()), get_rid(), false, p_modulate, p_transpose); } -void Texture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, get_rid(), p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); +void Texture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, get_rid(), p_tile, p_modulate, p_transpose); } -void Texture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, get_rid(), p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); +void Texture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, get_rid(), p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool Texture2D::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { r_rect = p_rect; r_src_rect = p_src_rect; - return true; } @@ -76,9 +68,9 @@ void Texture2D::_bind_methods() { ClassDB::bind_method(D_METHOD("get_height"), &Texture2D::get_height); ClassDB::bind_method(D_METHOD("get_size"), &Texture2D::get_size); ClassDB::bind_method(D_METHOD("has_alpha"), &Texture2D::has_alpha); - ClassDB::bind_method(D_METHOD("draw", "canvas_item", "position", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat"), &Texture2D::draw, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT)); - ClassDB::bind_method(D_METHOD("draw_rect", "canvas_item", "rect", "tile", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat"), &Texture2D::draw_rect, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT)); - ClassDB::bind_method(D_METHOD("draw_rect_region", "canvas_item", "rect", "src_rect", "modulate", "transpose", "normal_map", "specular_map", "specular_color_shininess", "texture_filter", "texture_repeat", "clip_uv"), &Texture2D::draw_rect_region, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(Variant()), DEFVAL(Variant()), DEFVAL(Color(1, 1, 1, 1)), DEFVAL(RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT), DEFVAL(RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT), DEFVAL(true)); + ClassDB::bind_method(D_METHOD("draw", "canvas_item", "position", "modulate", "transpose"), &Texture2D::draw, DEFVAL(Color(1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_rect", "canvas_item", "rect", "tile", "modulate", "transpose"), &Texture2D::draw_rect, DEFVAL(Color(1, 1, 1)), DEFVAL(false)); + ClassDB::bind_method(D_METHOD("draw_rect_region", "canvas_item", "rect", "src_rect", "modulate", "transpose", "clip_uv"), &Texture2D::draw_rect_region, DEFVAL(Color(1, 1, 1)), DEFVAL(false), DEFVAL(true)); ClassDB::bind_method(D_METHOD("get_data"), &Texture2D::get_data); ADD_GROUP("", ""); @@ -233,31 +225,25 @@ bool ImageTexture::has_alpha() const { return (format == Image::FORMAT_LA8 || format == Image::FORMAT_RGBA8); } -void ImageTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void ImageTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose); } -void ImageTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void ImageTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose); } -void ImageTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void ImageTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool ImageTexture::is_pixel_opaque(int p_x, int p_y) const { @@ -652,31 +638,25 @@ RID StreamTexture2D::get_rid() const { return texture; } -void StreamTexture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void StreamTexture2D::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, Rect2(p_pos, Size2(w, h)), texture, false, p_modulate, p_transpose); } -void StreamTexture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void StreamTexture2D::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect(p_canvas_item, p_rect, texture, p_tile, p_modulate, p_transpose); } -void StreamTexture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void StreamTexture2D::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if ((w | h) == 0) { return; } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, p_clip_uv, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, p_rect, texture, p_src_rect, p_modulate, p_transpose, p_clip_uv); } bool StreamTexture2D::has_alpha() const { @@ -1204,7 +1184,7 @@ void AtlasTexture::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::BOOL, "filter_clip"), "set_filter_clip", "has_filter_clip"); } -void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if (!atlas.is_valid()) { return; } @@ -1219,12 +1199,10 @@ void AtlasTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_m rc.size.height = atlas->get_height(); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(p_pos + margin.position, rc.size), atlas->get_rid(), rc, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, Rect2(p_pos + margin.position, rc.size), atlas->get_rid(), rc, p_modulate, p_transpose, filter_clip); } -void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if (!atlas.is_valid()) { return; } @@ -1242,12 +1220,10 @@ void AtlasTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile Vector2 scale = p_rect.size / (region.size + margin.size); Rect2 dr(p_rect.position + margin.position * scale, rc.size * scale); - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), rc, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), rc, p_modulate, p_transpose, filter_clip); } -void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { //this might not necessarily work well if using a rect, needs to be fixed properly if (!atlas.is_valid()) { return; @@ -1257,9 +1233,7 @@ void AtlasTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, cons Rect2 src_c; get_rect_region(p_rect, p_src_rect, dr, src_c); - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), src_c, p_modulate, p_transpose, normal_rid, specular_rid, p_specular_color_shininess, filter_clip, p_texture_filter, p_texture_repeat); + RS::get_singleton()->canvas_item_add_texture_rect_region(p_canvas_item, dr, atlas->get_rid(), src_c, p_modulate, p_transpose, filter_clip); } bool AtlasTexture::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { @@ -1364,7 +1338,7 @@ Ref<Texture2D> MeshTexture::get_base_texture() const { return base_texture; } -void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1374,12 +1348,10 @@ void MeshTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_mo SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } -void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1398,12 +1370,10 @@ void MeshTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } -void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { if (mesh.is_null() || base_texture.is_null()) { return; } @@ -1422,9 +1392,7 @@ void MeshTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const SWAP(xform.elements[0][1], xform.elements[1][0]); SWAP(xform.elements[0][0], xform.elements[1][1]); } - RID normal_rid = p_normal_map.is_valid() ? p_normal_map->get_rid() : RID(); - RID specular_rid = p_specular_map.is_valid() ? p_specular_map->get_rid() : RID(); - RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid(), normal_rid, specular_rid, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + RenderingServer::get_singleton()->canvas_item_add_mesh(p_canvas_item, mesh->get_rid(), xform, p_modulate, base_texture->get_rid()); } bool MeshTexture::get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const { @@ -1569,14 +1537,14 @@ void LargeTexture::_bind_methods() { ADD_PROPERTY(PropertyInfo(Variant::ARRAY, "_data", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL), "_set_data", "_get_data"); } -void LargeTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void LargeTexture::draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate, bool p_transpose) const { for (int i = 0; i < pieces.size(); i++) { // TODO - pieces[i].texture->draw(p_canvas_item, pieces[i].offset + p_pos, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + pieces[i].texture->draw(p_canvas_item, pieces[i].offset + p_pos, p_modulate, p_transpose); } } -void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat) const { +void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile, const Color &p_modulate, bool p_transpose) const { //tiling not supported for this if (size.x == 0 || size.y == 0) { return; @@ -1586,11 +1554,11 @@ void LargeTexture::draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile for (int i = 0; i < pieces.size(); i++) { // TODO - pieces[i].texture->draw_rect(p_canvas_item, Rect2(pieces[i].offset * scale + p_rect.position, pieces[i].texture->get_size() * scale), false, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat); + pieces[i].texture->draw_rect(p_canvas_item, Rect2(pieces[i].offset * scale + p_rect.position, pieces[i].texture->get_size() * scale), false, p_modulate, p_transpose); } } -void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, const Ref<Texture2D> &p_normal_map, const Ref<Texture2D> &p_specular_map, const Color &p_specular_color_shininess, RS::CanvasItemTextureFilter p_texture_filter, RS::CanvasItemTextureRepeat p_texture_repeat, bool p_clip_uv) const { +void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) const { //tiling not supported for this if (p_src_rect.size.x == 0 || p_src_rect.size.y == 0) { return; @@ -1609,7 +1577,7 @@ void LargeTexture::draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, cons target.size *= scale; target.position = p_rect.position + (p_src_rect.position + rect.position) * scale; local.position -= rect.position; - pieces[i].texture->draw_rect_region(p_canvas_item, target, local, p_modulate, p_transpose, p_normal_map, p_specular_map, p_specular_color_shininess, p_texture_filter, p_texture_repeat, false); + pieces[i].texture->draw_rect_region(p_canvas_item, target, local, p_modulate, p_transpose, false); } } diff --git a/scene/resources/texture.h b/scene/resources/texture.h index eebbf4f233..fd48afccda 100644 --- a/scene/resources/texture.h +++ b/scene/resources/texture.h @@ -66,9 +66,9 @@ public: virtual bool has_alpha() const = 0; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const; virtual Ref<Image> get_data() const { return Ref<Image>(); } @@ -115,9 +115,9 @@ public: virtual RID get_rid() const override; bool has_alpha() const override; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -194,9 +194,9 @@ public: virtual void set_path(const String &p_path, bool p_take_over) override; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool has_alpha() const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -246,9 +246,9 @@ public: void set_filter_clip(const bool p_enable); bool has_filter_clip() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -285,9 +285,9 @@ public: void set_base_texture(const Ref<Texture2D> &p_texture); Ref<Texture2D> get_base_texture() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; virtual bool get_rect_region(const Rect2 &p_rect, const Rect2 &p_src_rect, Rect2 &r_rect, Rect2 &r_src_rect) const override; bool is_pixel_opaque(int p_x, int p_y) const override; @@ -331,9 +331,9 @@ public: Ref<Texture2D> get_piece_texture(int p_idx) const; Ref<Image> to_image() const; - virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) const override; - virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, const Ref<Texture2D> &p_normal_map = Ref<Texture2D>(), const Ref<Texture2D> &p_specular_map = Ref<Texture2D>(), const Color &p_specular_color_shininess = Color(1, 1, 1, 1), RS::CanvasItemTextureFilter p_texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, bool p_clip_uv = true) const override; + virtual void draw(RID p_canvas_item, const Point2 &p_pos, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect(RID p_canvas_item, const Rect2 &p_rect, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) const override; + virtual void draw_rect_region(RID p_canvas_item, const Rect2 &p_rect, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = true) const override; bool is_pixel_opaque(int p_x, int p_y) const override; diff --git a/scene/resources/tile_set.cpp b/scene/resources/tile_set.cpp index 84b067d1e2..dcd8f11400 100644 --- a/scene/resources/tile_set.cpp +++ b/scene/resources/tile_set.cpp @@ -51,8 +51,6 @@ bool TileSet::_set(const StringName &p_name, const Variant &p_value) { tile_set_name(id, p_value); } else if (what == "texture") { tile_set_texture(id, p_value); - } else if (what == "normal_map") { - tile_set_normal_map(id, p_value); } else if (what == "tex_offset") { tile_set_texture_offset(id, p_value); } else if (what == "material") { @@ -226,8 +224,6 @@ bool TileSet::_get(const StringName &p_name, Variant &r_ret) const { r_ret = tile_get_name(id); } else if (what == "texture") { r_ret = tile_get_texture(id); - } else if (what == "normal_map") { - r_ret = tile_get_normal_map(id); } else if (what == "tex_offset") { r_ret = tile_get_texture_offset(id); } else if (what == "material") { @@ -331,7 +327,6 @@ void TileSet::_get_property_list(List<PropertyInfo> *p_list) const { String pre = itos(id) + "/"; p_list->push_back(PropertyInfo(Variant::STRING, pre + "name", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NOEDITOR)); - p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "normal_map", PROPERTY_HINT_RESOURCE_TYPE, "Texture2D", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::VECTOR2, pre + "tex_offset", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::OBJECT, pre + "material", PROPERTY_HINT_RESOURCE_TYPE, "ShaderMaterial", PROPERTY_USAGE_NOEDITOR)); p_list->push_back(PropertyInfo(Variant::COLOR, pre + "modulate", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_NOEDITOR)); @@ -402,17 +397,6 @@ Ref<Texture2D> TileSet::tile_get_texture(int p_id) const { return tile_map[p_id].texture; } -void TileSet::tile_set_normal_map(int p_id, const Ref<Texture2D> &p_normal_map) { - ERR_FAIL_COND(!tile_map.has(p_id)); - tile_map[p_id].normal_map = p_normal_map; - emit_changed(); -} - -Ref<Texture2D> TileSet::tile_get_normal_map(int p_id) const { - ERR_FAIL_COND_V(!tile_map.has(p_id), Ref<Texture2D>()); - return tile_map[p_id].normal_map; -} - void TileSet::tile_set_material(int p_id, const Ref<ShaderMaterial> &p_material) { ERR_FAIL_COND(!tile_map.has(p_id)); tile_map[p_id].material = p_material; @@ -1128,8 +1112,6 @@ void TileSet::_bind_methods() { ClassDB::bind_method(D_METHOD("tile_get_name", "id"), &TileSet::tile_get_name); ClassDB::bind_method(D_METHOD("tile_set_texture", "id", "texture"), &TileSet::tile_set_texture); ClassDB::bind_method(D_METHOD("tile_get_texture", "id"), &TileSet::tile_get_texture); - ClassDB::bind_method(D_METHOD("tile_set_normal_map", "id", "normal_map"), &TileSet::tile_set_normal_map); - ClassDB::bind_method(D_METHOD("tile_get_normal_map", "id"), &TileSet::tile_get_normal_map); ClassDB::bind_method(D_METHOD("tile_set_material", "id", "material"), &TileSet::tile_set_material); ClassDB::bind_method(D_METHOD("tile_get_material", "id"), &TileSet::tile_get_material); ClassDB::bind_method(D_METHOD("tile_set_modulate", "id", "color"), &TileSet::tile_set_modulate); diff --git a/scene/resources/tile_set.h b/scene/resources/tile_set.h index 78f34e46ce..aab428aa21 100644 --- a/scene/resources/tile_set.h +++ b/scene/resources/tile_set.h @@ -106,7 +106,6 @@ private: struct TileData { String name; Ref<Texture2D> texture; - Ref<Texture2D> normal_map; Vector2 offset; Rect2i region; Vector<ShapeData> shapes_data; @@ -149,9 +148,6 @@ public: void tile_set_texture(int p_id, const Ref<Texture2D> &p_texture); Ref<Texture2D> tile_get_texture(int p_id) const; - void tile_set_normal_map(int p_id, const Ref<Texture2D> &p_normal_map); - Ref<Texture2D> tile_get_normal_map(int p_id) const; - void tile_set_texture_offset(int p_id, const Vector2 &p_offset); Vector2 tile_get_texture_offset(int p_id) const; diff --git a/scene/resources/visual_shader.cpp b/scene/resources/visual_shader.cpp index 84437faca0..81851a9127 100644 --- a/scene/resources/visual_shader.cpp +++ b/scene/resources/visual_shader.cpp @@ -992,7 +992,7 @@ bool VisualShader::_set(const StringName &p_name, const Variant &p_value) { set_node_position(type, id, p_value); return true; } else if (what == "size") { - ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->set_size(p_value); + ((VisualShaderNodeResizableBase *)get_node(type, id).ptr())->set_size(p_value); return true; } else if (what == "input_ports") { ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->set_inputs(p_value); @@ -1059,7 +1059,7 @@ bool VisualShader::_get(const StringName &p_name, Variant &r_ret) const { r_ret = get_node_position(type, id); return true; } else if (what == "size") { - r_ret = ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->get_size(); + r_ret = ((VisualShaderNodeResizableBase *)get_node(type, id).ptr())->get_size(); return true; } else if (what == "input_ports") { r_ret = ((VisualShaderNodeGroupBase *)get_node(type, id).ptr())->get_inputs(); @@ -1712,6 +1712,7 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = { { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "diffuse", "DIFFUSE_LIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "specular", "SPECULAR_LIGHT" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "roughness", "ROUGHNESS" }, + { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "metallic", "METALLIC" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "world", "WORLD_MATRIX" }, { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "inv_camera", "INV_CAMERA_MATRIX" }, @@ -2596,20 +2597,37 @@ Vector<StringName> VisualShaderNodeUniform::get_editable_properties() const { VisualShaderNodeUniform::VisualShaderNodeUniform() { } -////////////// GroupBase - -String VisualShaderNodeGroupBase::get_caption() const { - return "Group"; -} +////////////// ResizeableBase -void VisualShaderNodeGroupBase::set_size(const Vector2 &p_size) { +void VisualShaderNodeResizableBase::set_size(const Vector2 &p_size) { size = p_size; } -Vector2 VisualShaderNodeGroupBase::get_size() const { +Vector2 VisualShaderNodeResizableBase::get_size() const { return size; } +void VisualShaderNodeResizableBase::set_allow_v_resize(bool p_enabled) { + allow_v_resize = p_enabled; +} + +bool VisualShaderNodeResizableBase::is_allow_v_resize() const { + return allow_v_resize; +} + +void VisualShaderNodeResizableBase::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_size", "size"), &VisualShaderNodeResizableBase::set_size); + ClassDB::bind_method(D_METHOD("get_size"), &VisualShaderNodeResizableBase::get_size); + + ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "size"), "set_size", "get_size"); +} + +VisualShaderNodeResizableBase::VisualShaderNodeResizableBase() { + set_allow_v_resize(true); +} + +////////////// GroupBase + void VisualShaderNodeGroupBase::set_inputs(const String &p_inputs) { if (inputs == p_inputs) { return; @@ -3036,9 +3054,6 @@ bool VisualShaderNodeGroupBase::is_editable() const { } void VisualShaderNodeGroupBase::_bind_methods() { - ClassDB::bind_method(D_METHOD("set_size", "size"), &VisualShaderNodeGroupBase::set_size); - ClassDB::bind_method(D_METHOD("get_size"), &VisualShaderNodeGroupBase::get_size); - ClassDB::bind_method(D_METHOD("set_inputs", "inputs"), &VisualShaderNodeGroupBase::set_inputs); ClassDB::bind_method(D_METHOD("get_inputs"), &VisualShaderNodeGroupBase::get_inputs); @@ -3066,8 +3081,6 @@ void VisualShaderNodeGroupBase::_bind_methods() { ClassDB::bind_method(D_METHOD("get_free_input_port_id"), &VisualShaderNodeGroupBase::get_free_input_port_id); ClassDB::bind_method(D_METHOD("get_free_output_port_id"), &VisualShaderNodeGroupBase::get_free_output_port_id); - - ADD_PROPERTY(PropertyInfo(Variant::VECTOR2, "size"), "set_size", "get_size"); } String VisualShaderNodeGroupBase::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { diff --git a/scene/resources/visual_shader.h b/scene/resources/visual_shader.h index e3d5200e6b..e3d8dae032 100644 --- a/scene/resources/visual_shader.h +++ b/scene/resources/visual_shader.h @@ -486,14 +486,33 @@ public: VisualShaderNodeUniformRef(); }; -class VisualShaderNodeGroupBase : public VisualShaderNode { - GDCLASS(VisualShaderNodeGroupBase, VisualShaderNode); +class VisualShaderNodeResizableBase : public VisualShaderNode { + GDCLASS(VisualShaderNodeResizableBase, VisualShaderNode); + +protected: + Vector2 size = Size2(0, 0); + bool allow_v_resize = true; + +protected: + static void _bind_methods(); + +public: + void set_size(const Vector2 &p_size); + Vector2 get_size() const; + + bool is_allow_v_resize() const; + void set_allow_v_resize(bool p_enabled); + + VisualShaderNodeResizableBase(); +}; + +class VisualShaderNodeGroupBase : public VisualShaderNodeResizableBase { + GDCLASS(VisualShaderNodeGroupBase, VisualShaderNodeResizableBase); private: void _apply_port_changes(); protected: - Vector2 size = Size2(0, 0); String inputs = ""; String outputs = ""; bool editable = false; @@ -511,11 +530,6 @@ protected: static void _bind_methods(); public: - virtual String get_caption() const override; - - void set_size(const Vector2 &p_size); - Vector2 get_size() const; - void set_inputs(const String &p_inputs); String get_inputs() const; diff --git a/scene/resources/visual_shader_nodes.cpp b/scene/resources/visual_shader_nodes.cpp index 085c0d0112..704d1b2ea8 100644 --- a/scene/resources/visual_shader_nodes.cpp +++ b/scene/resources/visual_shader_nodes.cpp @@ -782,6 +782,90 @@ void VisualShaderNodeTexture::_bind_methods() { VisualShaderNodeTexture::VisualShaderNodeTexture() { } +////////////// Curve + +String VisualShaderNodeCurveTexture::get_caption() const { + return "CurveTexture"; +} + +int VisualShaderNodeCurveTexture::get_input_port_count() const { + return 1; +} + +VisualShaderNodeCurveTexture::PortType VisualShaderNodeCurveTexture::get_input_port_type(int p_port) const { + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeCurveTexture::get_input_port_name(int p_port) const { + return String(); +} + +int VisualShaderNodeCurveTexture::get_output_port_count() const { + return 1; +} + +VisualShaderNodeCurveTexture::PortType VisualShaderNodeCurveTexture::get_output_port_type(int p_port) const { + return PORT_TYPE_SCALAR; +} + +String VisualShaderNodeCurveTexture::get_output_port_name(int p_port) const { + return String(); +} + +void VisualShaderNodeCurveTexture::set_texture(Ref<CurveTexture> p_texture) { + texture = p_texture; + emit_changed(); +} + +Ref<CurveTexture> VisualShaderNodeCurveTexture::get_texture() const { + return texture; +} + +Vector<StringName> VisualShaderNodeCurveTexture::get_editable_properties() const { + Vector<StringName> props; + props.push_back("texture"); + return props; +} + +String VisualShaderNodeCurveTexture::generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const { + return "uniform sampler2D " + make_unique_id(p_type, p_id, "curve") + ";\n"; +} + +String VisualShaderNodeCurveTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const { + if (p_input_vars[0] == String()) { + return "\t" + p_output_vars[0] + " = 0.0;\n"; + } + String id = make_unique_id(p_type, p_id, "curve"); + String code; + code += "\t" + p_output_vars[0] + " = texture(" + id + ", vec2(" + p_input_vars[0] + ", 0.0)).r;\n"; + return code; +} + +Vector<VisualShader::DefaultTextureParam> VisualShaderNodeCurveTexture::get_default_texture_parameters(VisualShader::Type p_type, int p_id) const { + VisualShader::DefaultTextureParam dtp; + dtp.name = make_unique_id(p_type, p_id, "curve"); + dtp.param = texture; + Vector<VisualShader::DefaultTextureParam> ret; + ret.push_back(dtp); + return ret; +} + +void VisualShaderNodeCurveTexture::_bind_methods() { + ClassDB::bind_method(D_METHOD("set_texture", "texture"), &VisualShaderNodeCurveTexture::set_texture); + ClassDB::bind_method(D_METHOD("get_texture"), &VisualShaderNodeCurveTexture::get_texture); + + ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "CurveTexture"), "set_texture", "get_texture"); +} + +bool VisualShaderNodeCurveTexture::is_use_prop_slots() const { + return true; +} + +VisualShaderNodeCurveTexture::VisualShaderNodeCurveTexture() { + simple_decl = true; + allow_v_resize = false; +} + ////////////// Sample3D int VisualShaderNodeSample3D::get_input_port_count() const { diff --git a/scene/resources/visual_shader_nodes.h b/scene/resources/visual_shader_nodes.h index 95042f8e56..d4d6540baf 100644 --- a/scene/resources/visual_shader_nodes.h +++ b/scene/resources/visual_shader_nodes.h @@ -284,6 +284,39 @@ VARIANT_ENUM_CAST(VisualShaderNodeTexture::Source) /////////////////////////////////////// +class VisualShaderNodeCurveTexture : public VisualShaderNodeResizableBase { + GDCLASS(VisualShaderNodeCurveTexture, VisualShaderNodeResizableBase); + Ref<CurveTexture> texture; + +protected: + static void _bind_methods(); + +public: + virtual String get_caption() const override; + + virtual int get_input_port_count() const override; + virtual PortType get_input_port_type(int p_port) const override; + virtual String get_input_port_name(int p_port) const override; + + virtual int get_output_port_count() const override; + virtual PortType get_output_port_type(int p_port) const override; + virtual String get_output_port_name(int p_port) const override; + + virtual Vector<VisualShader::DefaultTextureParam> get_default_texture_parameters(VisualShader::Type p_type, int p_id) const override; + virtual String generate_global(Shader::Mode p_mode, VisualShader::Type p_type, int p_id) const override; + virtual String generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview = false) const override; //if no output is connected, the output var passed will be empty. if no input is connected and input is NIL, the input var passed will be empty + + void set_texture(Ref<CurveTexture> p_value); + Ref<CurveTexture> get_texture() const; + + virtual Vector<StringName> get_editable_properties() const override; + virtual bool is_use_prop_slots() const override; + + VisualShaderNodeCurveTexture(); +}; + +/////////////////////////////////////// + class VisualShaderNodeSample3D : public VisualShaderNode { GDCLASS(VisualShaderNodeSample3D, VisualShaderNode); diff --git a/servers/audio/effects/audio_effect_spectrum_analyzer.cpp b/servers/audio/effects/audio_effect_spectrum_analyzer.cpp index e744dbf9b0..3f4f11ee8d 100644 --- a/servers/audio/effects/audio_effect_spectrum_analyzer.cpp +++ b/servers/audio/effects/audio_effect_spectrum_analyzer.cpp @@ -113,15 +113,15 @@ void AudioEffectSpectrumAnalyzerInstance::process(const AudioFrame *p_src_frames float *fftw = temporal_fft.ptrw(); for (int i = 0; i < to_fill; i++) { //left and right buffers - float window = -0.5 * Math::cos(2.0 * Math_PI * (double)i / (double)to_fill) + 0.5; - fftw[(i + temporal_fft_pos) * 2] = window * p_src_frames[i].l; - fftw[(i + temporal_fft_pos) * 2 + 1] = 0; - fftw[(i + temporal_fft_pos + fft_size * 2) * 2] = window * p_src_frames[i].r; - fftw[(i + temporal_fft_pos + fft_size * 2) * 2 + 1] = 0; + float window = -0.5 * Math::cos(2.0 * Math_PI * (double)temporal_fft_pos / (double)fft_size) + 0.5; + fftw[temporal_fft_pos * 2] = window * p_src_frames->l; + fftw[temporal_fft_pos * 2 + 1] = 0; + fftw[(temporal_fft_pos + fft_size * 2) * 2] = window * p_src_frames->r; + fftw[(temporal_fft_pos + fft_size * 2) * 2 + 1] = 0; + ++p_src_frames; + ++temporal_fft_pos; } - p_src_frames += to_fill; - temporal_fft_pos += to_fill; p_frame_count -= to_fill; if (temporal_fft_pos == fft_size * 2) { @@ -134,9 +134,8 @@ void AudioEffectSpectrumAnalyzerInstance::process(const AudioFrame *p_src_frames for (int i = 0; i < fft_size; i++) { //abs(vec)/fft_size normalizes each frequency - float window = 1.0; //-.5 * Math::cos(2. * Math_PI * (double)i / (double)fft_size) + .5; - hw[i].l = window * Vector2(fftw[i * 2], fftw[i * 2 + 1]).length() / float(fft_size); - hw[i].r = window * Vector2(fftw[fft_size * 4 + i * 2], fftw[fft_size * 4 + i * 2 + 1]).length() / float(fft_size); + hw[i].l = Vector2(fftw[i * 2], fftw[i * 2 + 1]).length() / float(fft_size); + hw[i].r = Vector2(fftw[fft_size * 4 + i * 2], fftw[fft_size * 4 + i * 2 + 1]).length() / float(fft_size); } fft_pos = next; //swap diff --git a/servers/audio_server.h b/servers/audio_server.h index 80e244aacd..31537e8326 100644 --- a/servers/audio_server.h +++ b/servers/audio_server.h @@ -31,8 +31,8 @@ #ifndef AUDIO_SERVER_H #define AUDIO_SERVER_H +#include "core/class_db.h" #include "core/math/audio_frame.h" -#include "core/object.h" #include "core/os/os.h" #include "core/variant.h" #include "servers/audio/audio_effect.h" diff --git a/servers/camera_server.h b/servers/camera_server.h index b268553fe5..7723e30974 100644 --- a/servers/camera_server.h +++ b/servers/camera_server.h @@ -31,7 +31,7 @@ #ifndef CAMERA_SERVER_H #define CAMERA_SERVER_H -#include "core/object.h" +#include "core/class_db.h" #include "core/os/thread_safe.h" #include "core/reference.h" #include "core/rid.h" diff --git a/servers/display_server.cpp b/servers/display_server.cpp index 356f4b884a..e678c6919b 100644 --- a/servers/display_server.cpp +++ b/servers/display_server.cpp @@ -31,7 +31,6 @@ #include "display_server.h" #include "core/input/input.h" -#include "core/method_bind_ext.gen.inc" #include "scene/resources/texture.h" DisplayServer *DisplayServer::singleton = nullptr; diff --git a/servers/navigation_server_2d.h b/servers/navigation_server_2d.h index d7384bae74..6575426e73 100644 --- a/servers/navigation_server_2d.h +++ b/servers/navigation_server_2d.h @@ -35,7 +35,7 @@ #ifndef NAVIGATION_2D_SERVER_H #define NAVIGATION_2D_SERVER_H -#include "core/object.h" +#include "core/class_db.h" #include "core/rid.h" #include "scene/2d/navigation_region_2d.h" diff --git a/servers/navigation_server_3d.h b/servers/navigation_server_3d.h index c34bd2391b..7a3e4f5f8f 100644 --- a/servers/navigation_server_3d.h +++ b/servers/navigation_server_3d.h @@ -35,7 +35,7 @@ #ifndef NAVIGATION_SERVER_H #define NAVIGATION_SERVER_H -#include "core/object.h" +#include "core/class_db.h" #include "core/rid.h" #include "scene/3d/navigation_region_3d.h" diff --git a/servers/physics_server_2d.cpp b/servers/physics_server_2d.cpp index 0dac08015f..4338a6938a 100644 --- a/servers/physics_server_2d.cpp +++ b/servers/physics_server_2d.cpp @@ -30,7 +30,6 @@ #include "physics_server_2d.h" -#include "core/method_bind_ext.gen.inc" #include "core/print_string.h" #include "core/project_settings.h" diff --git a/servers/physics_server_2d.h b/servers/physics_server_2d.h index f609adccf9..40773e4ced 100644 --- a/servers/physics_server_2d.h +++ b/servers/physics_server_2d.h @@ -31,7 +31,7 @@ #ifndef PHYSICS_2D_SERVER_H #define PHYSICS_2D_SERVER_H -#include "core/object.h" +#include "core/class_db.h" #include "core/reference.h" #include "core/resource.h" diff --git a/servers/physics_server_3d.cpp b/servers/physics_server_3d.cpp index 33a2b91902..d0266f95b5 100644 --- a/servers/physics_server_3d.cpp +++ b/servers/physics_server_3d.cpp @@ -30,7 +30,6 @@ #include "physics_server_3d.h" -#include "core/method_bind_ext.gen.inc" #include "core/print_string.h" #include "core/project_settings.h" diff --git a/servers/physics_server_3d.h b/servers/physics_server_3d.h index b779942460..d79dc6fec0 100644 --- a/servers/physics_server_3d.h +++ b/servers/physics_server_3d.h @@ -31,7 +31,7 @@ #ifndef PHYSICS_SERVER_H #define PHYSICS_SERVER_H -#include "core/object.h" +#include "core/class_db.h" #include "core/resource.h" class PhysicsDirectSpaceState3D; diff --git a/servers/rendering/rasterizer.h b/servers/rendering/rasterizer.h index a24189bdd7..4ece811a1e 100644 --- a/servers/rendering/rasterizer.h +++ b/servers/rendering/rasterizer.h @@ -84,7 +84,7 @@ public: virtual void environment_set_camera_feed_id(RID p_env, int p_camera_feed_id) = 0; #endif - virtual void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0; + virtual void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0; virtual void environment_glow_set_use_bicubic_upscale(bool p_enable) = 0; virtual void environment_glow_set_use_high_quality(bool p_enable) = 0; @@ -111,7 +111,7 @@ public: virtual void environment_set_adjustment(RID p_env, bool p_enable, float p_brightness, float p_contrast, float p_saturation, RID p_ramp) = 0; - virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) = 0; + virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective) = 0; virtual Ref<Image> environment_bake_panorama(RID p_env, bool p_bake_irradiance, const Size2i &p_size) = 0; @@ -299,13 +299,14 @@ public: virtual void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0; virtual void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count) = 0; virtual void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) = 0; + virtual void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) = 0; virtual void set_scene_pass(uint64_t p_pass) = 0; virtual void set_time(double p_time, double p_step) = 0; virtual void set_debug_draw_mode(RS::ViewportDebugDraw p_debug_draw) = 0; virtual RID render_buffers_create() = 0; - virtual void render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RS::ViewportScreenSpaceAA p_screen_space_aa) = 0; + virtual void render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RS::ViewportScreenSpaceAA p_screen_space_aa, bool p_use_debanding) = 0; virtual void screen_space_roughness_limiter_set_active(bool p_enable, float p_amount, float p_limit) = 0; virtual bool screen_space_roughness_limiter_is_active() const = 0; @@ -350,10 +351,6 @@ public: virtual void texture_replace(RID p_texture, RID p_by_texture) = 0; virtual void texture_set_size_override(RID p_texture, int p_width, int p_height) = 0; -// FIXME: Disabled during Vulkan refactoring, should be ported. -#if 0 - virtual void texture_bind(RID p_texture, uint32_t p_texture_no) = 0; -#endif virtual void texture_set_path(RID p_texture, const String &p_path) = 0; virtual String texture_get_path(RID p_texture) const = 0; @@ -371,6 +368,15 @@ public: virtual void texture_add_to_decal_atlas(RID p_texture, bool p_panorama_to_dp = false) = 0; virtual void texture_remove_from_decal_atlas(RID p_texture, bool p_panorama_to_dp = false) = 0; + /* CANVAS TEXTURE API */ + + virtual RID canvas_texture_create() = 0; + virtual void canvas_texture_set_channel(RID p_canvas_texture, RS::CanvasTextureChannel p_channel, RID p_texture) = 0; + virtual void canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_base_color, float p_shininess) = 0; + + virtual void canvas_texture_set_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter) = 0; + virtual void canvas_texture_set_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat) = 0; + /* SHADER API */ virtual RID shader_create() = 0; @@ -660,6 +666,7 @@ public: virtual void particles_set_process_material(RID p_particles, RID p_material) = 0; virtual void particles_set_fixed_fps(RID p_particles, int p_fps) = 0; virtual void particles_set_fractional_delta(RID p_particles, bool p_enable) = 0; + virtual void particles_set_collision_base_size(RID p_particles, float p_size) = 0; virtual void particles_restart(RID p_particles) = 0; virtual void particles_emit(RID p_particles, const Transform &p_transform, const Vector3 &p_velocity, const Color &p_color, const Color &p_custom, uint32_t p_emit_flags) = 0; virtual void particles_set_subemitter(RID p_particles, RID p_subemitter_particles) = 0; @@ -682,6 +689,28 @@ public: virtual void particles_set_view_axis(RID p_particles, const Vector3 &p_axis) = 0; + virtual void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) = 0; + virtual void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) = 0; + + virtual void update_particles() = 0; + + /* PARTICLES COLLISION */ + + virtual RID particles_collision_create() = 0; + virtual void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) = 0; + virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) = 0; + virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) = 0; //for spheres + virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) = 0; //for non-spheres + virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) = 0; + virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) = 0; + virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) = 0; + virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) = 0; //for SDF and vector field, heightfield is dynamic + virtual void particles_collision_height_field_update(RID p_particles_collision) = 0; //for SDF and vector field + virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) = 0; //for SDF and vector field + virtual AABB particles_collision_get_aabb(RID p_particles_collision) const = 0; + virtual bool particles_collision_is_heightfield(RID p_particles_collision) const = 0; + virtual RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const = 0; + /* GLOBAL VARIABLES */ virtual void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value) = 0; @@ -858,39 +887,10 @@ public: } }; - typedef uint64_t TextureBindingID; - - virtual TextureBindingID request_texture_binding(RID p_texture, RID p_normalmap, RID p_specular, RS::CanvasItemTextureFilter p_filter, RS::CanvasItemTextureRepeat p_repeat, RID p_multimesh) = 0; - virtual void free_texture_binding(TextureBindingID p_binding) = 0; - //easier wrap to avoid mistakes struct Item; - struct TextureBinding { - TextureBindingID binding_id; - - _FORCE_INLINE_ void create(RS::CanvasItemTextureFilter p_item_filter, RS::CanvasItemTextureRepeat p_item_repeat, RID p_texture, RID p_normalmap, RID p_specular, RS::CanvasItemTextureFilter p_filter, RS::CanvasItemTextureRepeat p_repeat, RID p_multimesh) { - if (p_filter == RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT) { - p_filter = p_item_filter; - } - if (p_repeat == RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) { - p_repeat = p_item_repeat; - } - if (p_texture != RID() || p_normalmap != RID() || p_specular != RID() || p_filter != RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT || p_repeat != RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT || p_multimesh.is_valid()) { - ERR_FAIL_COND(binding_id != 0); - binding_id = singleton->request_texture_binding(p_texture, p_normalmap, p_specular, p_filter, p_repeat, p_multimesh); - } - } - - _FORCE_INLINE_ TextureBinding() { binding_id = 0; } - _FORCE_INLINE_ ~TextureBinding() { - if (binding_id) { - singleton->free_texture_binding(binding_id); - } - } - }; - typedef uint64_t PolygonID; virtual PolygonID request_polygon(const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>()) = 0; virtual void free_polygon(PolygonID p_polygon) = 0; @@ -960,9 +960,8 @@ public: Color modulate; Rect2 source; uint8_t flags; - Color specular_shininess; - TextureBinding texture_binding; + RID texture; CommandRect() { flags = 0; @@ -978,8 +977,9 @@ public: Color color; RS::NinePatchAxisMode axis_x; RS::NinePatchAxisMode axis_y; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandNinePatch() { draw_center = true; type = TYPE_NINEPATCH; @@ -989,8 +989,9 @@ public: struct CommandPolygon : public Command { RS::PrimitiveType primitive; Polygon polygon; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandPolygon() { type = TYPE_POLYGON; } @@ -1001,8 +1002,9 @@ public: Vector2 points[4]; Vector2 uvs[4]; Color colors[4]; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandPrimitive() { type = TYPE_PRIMITIVE; } @@ -1012,22 +1014,25 @@ public: RID mesh; Transform2D transform; Color modulate; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandMesh() { type = TYPE_MESH; } }; struct CommandMultiMesh : public Command { RID multimesh; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandMultiMesh() { type = TYPE_MULTIMESH; } }; struct CommandParticles : public Command { RID particles; - Color specular_shininess; - TextureBinding texture_binding; + + RID texture; + CommandParticles() { type = TYPE_PARTICLES; } }; @@ -1236,12 +1241,6 @@ public: return command; } - struct CustomData { - virtual ~CustomData() {} - }; - - mutable CustomData *custom_data; //implementation dependent - void clear() { Command *c = commands; while (c) { @@ -1271,6 +1270,10 @@ public: material_owner = nullptr; light_masked = false; } + + RS::CanvasItemTextureFilter texture_filter; + RS::CanvasItemTextureRepeat texture_repeat; + Item() { commands = nullptr; last_command = nullptr; @@ -1291,7 +1294,8 @@ public: light_masked = false; update_when_visible = false; z_final = 0; - custom_data = nullptr; + texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT; + texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT; } virtual ~Item() { clear(); @@ -1301,13 +1305,10 @@ public: if (copy_back_buffer) { memdelete(copy_back_buffer); } - if (custom_data) { - memdelete(custom_data); - } } }; - virtual void canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform) = 0; + virtual void canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform, RS::CanvasItemTextureFilter p_default_filter, RS::CanvasItemTextureRepeat p_default_repeat) = 0; virtual void canvas_debug_viewport_shadows(Light *p_lights_with_shadow) = 0; struct LightOccluderInstance { @@ -1333,12 +1334,13 @@ public: virtual RID light_create() = 0; virtual void light_set_texture(RID p_rid, RID p_texture) = 0; - virtual void light_set_use_shadow(RID p_rid, bool p_enable, int p_resolution) = 0; - virtual void light_update_shadow(RID p_rid, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders) = 0; + virtual void light_set_use_shadow(RID p_rid, bool p_enable) = 0; + virtual void light_update_shadow(RID p_rid, int p_shadow_index, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders) = 0; virtual RID occluder_polygon_create() = 0; virtual void occluder_polygon_set_shape_as_lines(RID p_occluder, const Vector<Vector2> &p_lines) = 0; virtual void occluder_polygon_set_cull_mode(RID p_occluder, RS::CanvasOccluderPolygonCullMode p_mode) = 0; + virtual void set_shadow_texture_size(int p_size) = 0; virtual void draw_window_margins(int *p_margins, RID *p_margin_textures) = 0; diff --git a/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.cpp index aad2be45c6..28674b118c 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.cpp +++ b/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.cpp @@ -92,152 +92,6 @@ void RasterizerCanvasRD::_update_transform_to_mat4(const Transform &p_transform, p_mat4[15] = 1; } -void RasterizerCanvasRD::_update_specular_shininess(const Color &p_transform, uint32_t *r_ss) { - *r_ss = uint32_t(CLAMP(p_transform.a * 255.0, 0, 255)) << 24; - *r_ss |= uint32_t(CLAMP(p_transform.b * 255.0, 0, 255)) << 16; - *r_ss |= uint32_t(CLAMP(p_transform.g * 255.0, 0, 255)) << 8; - *r_ss |= uint32_t(CLAMP(p_transform.r * 255.0, 0, 255)); -} - -RID RasterizerCanvasRD::_create_texture_binding(RID p_texture, RID p_normalmap, RID p_specular, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat, RID p_multimesh) { - Vector<RD::Uniform> uniform_set; - - { // COLOR TEXTURE - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE; - u.binding = 1; - RID texture = storage->texture_get_rd_texture(p_texture); - if (!texture.is_valid()) { - //use default white texture - texture = storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_WHITE); - } - u.ids.push_back(texture); - uniform_set.push_back(u); - } - - { // NORMAL TEXTURE - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE; - u.binding = 2; - RID texture = storage->texture_get_rd_texture(p_normalmap); - if (!texture.is_valid()) { - //use default normal texture - texture = storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_NORMAL); - } - u.ids.push_back(texture); - uniform_set.push_back(u); - } - - { // SPECULAR TEXTURE - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE; - u.binding = 3; - RID texture = storage->texture_get_rd_texture(p_specular); - if (!texture.is_valid()) { - //use default white texture - texture = storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_WHITE); - } - u.ids.push_back(texture); - uniform_set.push_back(u); - } - - { // SAMPLER - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_SAMPLER; - u.binding = 4; - RID sampler = storage->sampler_rd_get_default(p_filter, p_repeat); - ERR_FAIL_COND_V(sampler.is_null(), RID()); - u.ids.push_back(sampler); - uniform_set.push_back(u); - } - - { // MULTIMESH TEXTURE BUFFER - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE_BUFFER; - u.binding = 5; - u.ids.push_back(storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_MULTIMESH_BUFFER)); - uniform_set.push_back(u); - } - - return RD::get_singleton()->uniform_set_create(uniform_set, shader.default_version_rd_shader, 0); -} - -RasterizerCanvas::TextureBindingID RasterizerCanvasRD::request_texture_binding(RID p_texture, RID p_normalmap, RID p_specular, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat, RID p_multimesh) { - if (p_filter == RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT) { - p_filter = default_samplers.default_filter; - } - - if (p_repeat == RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) { - p_repeat = default_samplers.default_repeat; - } - - TextureBindingKey key; - key.texture = p_texture; - key.normalmap = p_normalmap; - key.specular = p_specular; - key.multimesh = p_multimesh; - key.texture_filter = p_filter; - key.texture_repeat = p_repeat; - - TextureBinding *binding; - TextureBindingID id; - { - TextureBindingID *idptr = bindings.texture_key_bindings.getptr(key); - - if (!idptr) { - id = bindings.id_generator++; - bindings.texture_key_bindings[key] = id; - binding = memnew(TextureBinding); - binding->key = key; - binding->id = id; - - bindings.texture_bindings[id] = binding; - - } else { - id = *idptr; - binding = bindings.texture_bindings[id]; - } - } - - binding->reference_count++; - - if (binding->to_dispose.in_list()) { - //was queued for disposal previously, but ended up reused. - bindings.to_dispose_list.remove(&binding->to_dispose); - } - - if (binding->uniform_set.is_null() || !RD::get_singleton()->uniform_set_is_valid(binding->uniform_set)) { - binding->uniform_set = _create_texture_binding(p_texture, p_normalmap, p_specular, p_filter, p_repeat, p_multimesh); - } - - return id; -} - -void RasterizerCanvasRD::free_texture_binding(TextureBindingID p_binding) { - TextureBinding **binding_ptr = bindings.texture_bindings.getptr(p_binding); - ERR_FAIL_COND(!binding_ptr); - TextureBinding *binding = *binding_ptr; - ERR_FAIL_COND(binding->reference_count == 0); - binding->reference_count--; - if (binding->reference_count == 0) { - bindings.to_dispose_list.add(&binding->to_dispose); - } -} - -void RasterizerCanvasRD::_dispose_bindings() { - while (bindings.to_dispose_list.first()) { - TextureBinding *binding = bindings.to_dispose_list.first()->self(); - if (binding->uniform_set.is_valid() && RD::get_singleton()->uniform_set_is_valid(binding->uniform_set)) { - RD::get_singleton()->free(binding->uniform_set); - } - - bindings.texture_key_bindings.erase(binding->key); - bindings.texture_bindings.erase(binding->id); - bindings.to_dispose_list.remove(&binding->to_dispose); - memdelete(binding); - } -} - RasterizerCanvas::PolygonID RasterizerCanvasRD::request_polygon(const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, const Vector<int> &p_bones, const Vector<float> &p_weights) { // Care must be taken to generate array formats // in ways where they could be reused, so we will @@ -457,36 +311,72 @@ void RasterizerCanvasRD::free_polygon(PolygonID p_polygon) { polygon_buffers.polygons.erase(p_polygon); } -Size2i RasterizerCanvasRD::_bind_texture_binding(TextureBindingID p_binding, RD::DrawListID p_draw_list, uint32_t &flags) { - TextureBinding **texture_binding_ptr = bindings.texture_bindings.getptr(p_binding); - ERR_FAIL_COND_V(!texture_binding_ptr, Size2i()); - TextureBinding *texture_binding = *texture_binding_ptr; +//////////////////// + +void RasterizerCanvasRD::_bind_canvas_texture(RD::DrawListID p_draw_list, RID p_texture, RS::CanvasItemTextureFilter p_base_filter, RS::CanvasItemTextureRepeat p_base_repeat, RID &r_last_texture, PushConstant &push_constant, Size2 &r_texpixel_size) { + if (p_texture == RID()) { + p_texture = default_canvas_texture; + } - if (texture_binding->key.normalmap.is_valid()) { - flags |= FLAGS_DEFAULT_NORMAL_MAP_USED; + if (r_last_texture == p_texture) { + return; //nothing to do, its the same } - if (texture_binding->key.specular.is_valid()) { - flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; + + RID uniform_set; + Color specular_shininess; + Size2i size; + bool use_normal; + bool use_specular; + + bool success = storage->canvas_texture_get_unifom_set(p_texture, p_base_filter, p_base_repeat, shader.default_version_rd_shader, CANVAS_TEXTURE_UNIFORM_SET, uniform_set, size, specular_shininess, use_normal, use_specular); + //something odd happened + if (!success) { + _bind_canvas_texture(p_draw_list, default_canvas_texture, p_base_filter, p_base_repeat, r_last_texture, push_constant, r_texpixel_size); + return; } - if (!RD::get_singleton()->uniform_set_is_valid(texture_binding->uniform_set)) { - //texture may have changed (erased or replaced, see if we can fix) - texture_binding->uniform_set = _create_texture_binding(texture_binding->key.texture, texture_binding->key.normalmap, texture_binding->key.specular, texture_binding->key.texture_filter, texture_binding->key.texture_repeat, texture_binding->key.multimesh); - ERR_FAIL_COND_V(!texture_binding->uniform_set.is_valid(), Size2i(1, 1)); + RD::get_singleton()->draw_list_bind_uniform_set(p_draw_list, uniform_set, CANVAS_TEXTURE_UNIFORM_SET); + + if (specular_shininess.a < 0.999) { + push_constant.flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; + } else { + push_constant.flags &= ~FLAGS_DEFAULT_SPECULAR_MAP_USED; } - RD::get_singleton()->draw_list_bind_uniform_set(p_draw_list, texture_binding->uniform_set, 0); - if (texture_binding->key.texture.is_valid()) { - return storage->texture_2d_get_size(texture_binding->key.texture); + if (use_normal) { + push_constant.flags |= FLAGS_DEFAULT_NORMAL_MAP_USED; } else { - return Size2i(1, 1); + push_constant.flags &= ~FLAGS_DEFAULT_NORMAL_MAP_USED; } + + push_constant.specular_shininess = uint32_t(CLAMP(specular_shininess.a * 255.0, 0, 255)) << 24; + push_constant.specular_shininess |= uint32_t(CLAMP(specular_shininess.b * 255.0, 0, 255)) << 16; + push_constant.specular_shininess |= uint32_t(CLAMP(specular_shininess.g * 255.0, 0, 255)) << 8; + push_constant.specular_shininess |= uint32_t(CLAMP(specular_shininess.r * 255.0, 0, 255)); + + r_texpixel_size.x = 1.0 / float(size.x); + r_texpixel_size.y = 1.0 / float(size.y); + + push_constant.color_texture_pixel_size[0] = r_texpixel_size.x; + push_constant.color_texture_pixel_size[1] = r_texpixel_size.y; + + r_last_texture = p_texture; } -//////////////////// void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_item, RD::FramebufferFormatID p_framebuffer_format, const Transform2D &p_canvas_transform_inverse, Item *¤t_clip, Light *p_lights, PipelineVariants *p_pipeline_variants) { //create an empty push constant + RS::CanvasItemTextureFilter current_filter = default_filter; + RS::CanvasItemTextureRepeat current_repeat = default_repeat; + + if (p_item->texture_filter != RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT) { + current_filter = p_item->texture_filter; + } + + if (p_item->texture_repeat != RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) { + current_repeat = p_item->texture_repeat; + } + PushConstant push_constant; Transform2D base_transform = p_canvas_transform_inverse * p_item->final_transform; _update_transform_2d_to_mat2x3(base_transform, push_constant.world); @@ -513,16 +403,6 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ uint32_t base_flags = 0; - bool light_uniform_set_dirty = false; - - if (!p_item->custom_data) { - p_item->custom_data = memnew(ItemStateData); - light_uniform_set_dirty = true; - } - - ItemStateData *state_data = (ItemStateData *)p_item->custom_data; - - Light *light_cache[DEFAULT_MAX_LIGHTS_PER_ITEM]; uint16_t light_count = 0; PipelineLightMode light_mode; @@ -534,160 +414,34 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ uint32_t light_index = light->render_index_cache; push_constant.lights[light_count >> 2] |= light_index << ((light_count & 3) * 8); - if (!light_uniform_set_dirty && (state_data->light_cache[light_count].light != light || state_data->light_cache[light_count].light_version != light->version)) { - light_uniform_set_dirty = true; - } - - light_cache[light_count] = light; - light_count++; + if (light->mode == RS::CANVAS_LIGHT_MODE_MASK) { base_flags |= FLAGS_USING_LIGHT_MASK; } - if (light_count == state.max_lights_per_item) { + + if (light_count == MAX_LIGHTS_PER_ITEM) { break; } } light = light->next_ptr; } - if (light_count != state_data->light_cache_count) { - light_uniform_set_dirty = true; - } base_flags |= light_count << FLAGS_LIGHT_COUNT_SHIFT; } - { - RID &canvas_item_state = light_count ? state_data->state_uniform_set_with_light : state_data->state_uniform_set; - - bool invalid_uniform = canvas_item_state.is_valid() && !RD::get_singleton()->uniform_set_is_valid(canvas_item_state); - - if (canvas_item_state.is_null() || invalid_uniform || (light_count > 0 && light_uniform_set_dirty)) { - //re create canvas state - Vector<RD::Uniform> uniforms; - - if (state_data->state_uniform_set_with_light.is_valid() && !invalid_uniform) { - RD::get_singleton()->free(canvas_item_state); - } - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; - u.binding = 0; - u.ids.push_back(state.canvas_state_buffer); - uniforms.push_back(u); - } - - if (false && p_item->skeleton.is_valid()) { - //bind skeleton stuff - } else { - //bind default - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE_BUFFER; - u.binding = 1; - u.ids.push_back(shader.default_skeleton_texture_buffer); - uniforms.push_back(u); - } - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; - u.binding = 2; - u.ids.push_back(shader.default_skeleton_uniform_buffer); - uniforms.push_back(u); - } - } - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_STORAGE_BUFFER; - u.binding = 7; - u.ids.push_back(storage->global_variables_get_storage_buffer()); - uniforms.push_back(u); - } - - //validate and update lighs if they are being used - - if (light_count > 0) { - //recreate uniform set - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; - u.binding = 3; - u.ids.push_back(state.lights_uniform_buffer); - uniforms.push_back(u); - } - - { - RD::Uniform u_lights; - u_lights.type = RD::UNIFORM_TYPE_TEXTURE; - u_lights.binding = 4; - - RD::Uniform u_shadows; - u_shadows.type = RD::UNIFORM_TYPE_TEXTURE; - u_shadows.binding = 5; - - //lights - for (uint32_t i = 0; i < state.max_lights_per_item; i++) { - if (i < light_count) { - CanvasLight *cl = canvas_light_owner.getornull(light_cache[i]->light_internal); - ERR_CONTINUE(!cl); - - RID rd_texture; - - if (cl->texture.is_valid()) { - rd_texture = storage->texture_get_rd_texture(cl->texture); - } - if (rd_texture.is_valid()) { - u_lights.ids.push_back(rd_texture); - } else { - u_lights.ids.push_back(storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_WHITE)); - } - if (cl->shadow.texture.is_valid()) { - u_shadows.ids.push_back(cl->shadow.texture); - } else { - u_shadows.ids.push_back(storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_BLACK)); - } - } else { - u_lights.ids.push_back(storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_WHITE)); - u_shadows.ids.push_back(storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_BLACK)); - } - } - - uniforms.push_back(u_lights); - uniforms.push_back(u_shadows); - } - - { - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_SAMPLER; - u.binding = 6; - u.ids.push_back(state.shadow_sampler); - uniforms.push_back(u); - } - - canvas_item_state = RD::get_singleton()->uniform_set_create(uniforms, shader.default_version_rd_shader_light, 2); - } else { - canvas_item_state = RD::get_singleton()->uniform_set_create(uniforms, shader.default_version_rd_shader, 2); - } - } - - RD::get_singleton()->draw_list_bind_uniform_set(p_draw_list, canvas_item_state, 2); - } - light_mode = light_count > 0 ? PIPELINE_LIGHT_MODE_ENABLED : PIPELINE_LIGHT_MODE_DISABLED; PipelineVariants *pipeline_variants = p_pipeline_variants; bool reclip = false; + RID last_texture; + Size2 texpixel_size; + const Item::Command *c = p_item->commands; while (c) { - push_constant.flags = base_flags; //reset on each command for sanity - push_constant.specular_shininess = 0xFFFFFFFF; + push_constant.flags = base_flags | (push_constant.flags & (FLAGS_DEFAULT_NORMAL_MAP_USED | FLAGS_DEFAULT_SPECULAR_MAP_USED)); //reset on each command for sanity, keep canvastexture binding config switch (c->type) { case Item::Command::TYPE_RECT: { @@ -701,26 +455,12 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ //bind textures - Size2 texpixel_size; - { - texpixel_size = _bind_texture_binding(rect->texture_binding.binding_id, p_draw_list, push_constant.flags); - texpixel_size.x = 1.0 / texpixel_size.x; - texpixel_size.y = 1.0 / texpixel_size.y; - } - - if (rect->specular_shininess.a < 0.999) { - push_constant.flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; - } - - _update_specular_shininess(rect->specular_shininess, &push_constant.specular_shininess); + _bind_canvas_texture(p_draw_list, rect->texture, current_filter, current_repeat, last_texture, push_constant, texpixel_size); Rect2 src_rect; Rect2 dst_rect; - if (texpixel_size != Vector2()) { - push_constant.color_texture_pixel_size[0] = texpixel_size.x; - push_constant.color_texture_pixel_size[1] = texpixel_size.y; - + if (rect->texture != RID()) { src_rect = (rect->flags & CANVAS_RECT_REGION) ? Rect2(rect->source.position * texpixel_size, rect->source.size * texpixel_size) : Rect2(0, 0, 1, 1); dst_rect = Rect2(rect->rect.position, rect->rect.size); @@ -762,7 +502,6 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ } src_rect = Rect2(0, 0, 1, 1); - texpixel_size = Vector2(1, 1); } push_constant.modulation[0] = rect->modulate.r * base_color.r; @@ -780,9 +519,6 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ push_constant.dst_rect[2] = dst_rect.size.width; push_constant.dst_rect[3] = dst_rect.size.height; - push_constant.color_texture_pixel_size[0] = texpixel_size.x; - push_constant.color_texture_pixel_size[1] = texpixel_size.y; - RD::get_singleton()->draw_list_set_push_constant(p_draw_list, &push_constant, sizeof(PushConstant)); RD::get_singleton()->draw_list_bind_index_array(p_draw_list, shader.quad_index_array); RD::get_singleton()->draw_list_draw(p_draw_list, true); @@ -800,30 +536,21 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ //bind textures - Size2 texpixel_size; - { - texpixel_size = _bind_texture_binding(np->texture_binding.binding_id, p_draw_list, push_constant.flags); - texpixel_size.x = 1.0 / texpixel_size.x; - texpixel_size.y = 1.0 / texpixel_size.y; - } - - if (np->specular_shininess.a < 0.999) { - push_constant.flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; - } - - _update_specular_shininess(np->specular_shininess, &push_constant.specular_shininess); + _bind_canvas_texture(p_draw_list, np->texture, current_filter, current_repeat, last_texture, push_constant, texpixel_size); Rect2 src_rect; Rect2 dst_rect(np->rect.position.x, np->rect.position.y, np->rect.size.x, np->rect.size.y); - if (texpixel_size == Size2()) { + if (np->texture == RID()) { texpixel_size = Size2(1, 1); src_rect = Rect2(0, 0, 1, 1); } else { if (np->source != Rect2()) { src_rect = Rect2(np->source.position.x * texpixel_size.width, np->source.position.y * texpixel_size.height, np->source.size.x * texpixel_size.width, np->source.size.y * texpixel_size.height); - texpixel_size = Size2(1.0 / np->source.size.width, 1.0 / np->source.size.height); + push_constant.color_texture_pixel_size[0] = 1.0 / np->source.size.width; + push_constant.color_texture_pixel_size[1] = 1.0 / np->source.size.height; + } else { src_rect = Rect2(0, 0, 1, 1); } @@ -844,9 +571,6 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ push_constant.dst_rect[2] = dst_rect.size.width; push_constant.dst_rect[3] = dst_rect.size.height; - push_constant.color_texture_pixel_size[0] = texpixel_size.x; - push_constant.color_texture_pixel_size[1] = texpixel_size.y; - push_constant.flags |= int(np->axis_x) << FLAGS_NINEPATCH_H_MODE_SHIFT; push_constant.flags |= int(np->axis_y) << FLAGS_NINEPATCH_V_MODE_SHIFT; @@ -863,6 +587,10 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ RD::get_singleton()->draw_list_bind_index_array(p_draw_list, shader.quad_index_array); RD::get_singleton()->draw_list_draw(p_draw_list, true); + //restore if overrided + push_constant.color_texture_pixel_size[0] = texpixel_size.x; + push_constant.color_texture_pixel_size[1] = texpixel_size.y; + } break; case Item::Command::TYPE_POLYGON: { const Item::CommandPolygon *polygon = static_cast<const Item::CommandPolygon *>(c); @@ -884,18 +612,7 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ //bind textures - Size2 texpixel_size; - { - texpixel_size = _bind_texture_binding(polygon->texture_binding.binding_id, p_draw_list, push_constant.flags); - texpixel_size.x = 1.0 / texpixel_size.x; - texpixel_size.y = 1.0 / texpixel_size.y; - } - - if (polygon->specular_shininess.a < 0.999) { - push_constant.flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; - } - - _update_specular_shininess(polygon->specular_shininess, &push_constant.specular_shininess); + _bind_canvas_texture(p_draw_list, polygon->texture, current_filter, current_repeat, last_texture, push_constant, texpixel_size); push_constant.modulation[0] = base_color.r; push_constant.modulation[1] = base_color.g; @@ -908,9 +625,6 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ push_constant.ninepatch_margins[j] = 0; } - push_constant.color_texture_pixel_size[0] = texpixel_size.x; - push_constant.color_texture_pixel_size[1] = texpixel_size.y; - RD::get_singleton()->draw_list_set_push_constant(p_draw_list, &push_constant, sizeof(PushConstant)); RD::get_singleton()->draw_list_bind_vertex_array(p_draw_list, pb->vertex_array); if (pb->indices.is_valid()) { @@ -932,15 +646,7 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ //bind textures - { - _bind_texture_binding(primitive->texture_binding.binding_id, p_draw_list, push_constant.flags); - } - - if (primitive->specular_shininess.a < 0.999) { - push_constant.flags |= FLAGS_DEFAULT_SPECULAR_MAP_USED; - } - - _update_specular_shininess(primitive->specular_shininess, &push_constant.specular_shininess); + _bind_canvas_texture(p_draw_list, RID(), current_filter, current_repeat, last_texture, push_constant, texpixel_size); RD::get_singleton()->draw_list_bind_index_array(p_draw_list, primitive_arrays.index_array[MIN(3, primitive->point_count) - 1]); @@ -1295,7 +1001,108 @@ void RasterizerCanvasRD::_render_item(RD::DrawListID p_draw_list, const Item *p_ } } -void RasterizerCanvasRD::_render_items(RID p_to_render_target, int p_item_count, const Transform2D &p_canvas_transform_inverse, Light *p_lights, RID p_screen_uniform_set) { +RID RasterizerCanvasRD::_create_base_uniform_set(RID p_to_render_target, bool p_backbuffer) { + //re create canvas state + Vector<RD::Uniform> uniforms; + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; + u.binding = 1; + u.ids.push_back(state.canvas_state_buffer); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; + u.binding = 2; + u.ids.push_back(state.lights_uniform_buffer); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 3; + u.ids.push_back(storage->decal_atlas_get_texture()); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 4; + u.ids.push_back(state.shadow_texture); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_SAMPLER; + u.binding = 5; + u.ids.push_back(state.shadow_sampler); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 6; + RID screen; + if (p_backbuffer) { + screen = storage->render_target_get_rd_texture(p_to_render_target); + } else { + screen = storage->render_target_get_rd_backbuffer(p_to_render_target); + if (screen.is_null()) { //unallocated backbuffer + screen = storage->texture_rd_get_default(RasterizerStorageRD::DEFAULT_RD_TEXTURE_WHITE); + } + } + u.ids.push_back(screen); + uniforms.push_back(u); + } + + { + //needs samplers for the material (uses custom textures) create them + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_SAMPLER; + u.binding = 7; + u.ids.resize(12); + RID *ids_ptr = u.ids.ptrw(); + ids_ptr[0] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[1] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[2] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[3] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[4] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[5] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); + ids_ptr[6] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + ids_ptr[7] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + ids_ptr[8] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + ids_ptr[9] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + ids_ptr[10] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + ids_ptr[11] = storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); + uniforms.push_back(u); + } + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_STORAGE_BUFFER; + u.binding = 8; + u.ids.push_back(storage->global_variables_get_storage_buffer()); + uniforms.push_back(u); + } + + RID uniform_set = RD::get_singleton()->uniform_set_create(uniforms, shader.default_version_rd_shader, BASE_UNIFORM_SET); + if (p_backbuffer) { + storage->render_target_set_backbuffer_uniform_set(p_to_render_target, uniform_set); + } else { + storage->render_target_set_framebuffer_uniform_set(p_to_render_target, uniform_set); + } + + return uniform_set; +} + +void RasterizerCanvasRD::_render_items(RID p_to_render_target, int p_item_count, const Transform2D &p_canvas_transform_inverse, Light *p_lights) { Item *current_clip = nullptr; Transform2D canvas_transform_inverse = p_canvas_transform_inverse; @@ -1313,13 +1120,19 @@ void RasterizerCanvasRD::_render_items(RID p_to_render_target, int p_item_count, #warning TODO obtain from framebuffer format eventually when this is implemented #endif + RID fb_uniform_set = storage->render_target_get_framebuffer_uniform_set(p_to_render_target); + + if (fb_uniform_set.is_null() || !RD::get_singleton()->uniform_set_is_valid(fb_uniform_set)) { + fb_uniform_set = _create_base_uniform_set(p_to_render_target, false); + } + RD::FramebufferFormatID fb_format = RD::get_singleton()->framebuffer_get_format(framebuffer); RD::DrawListID draw_list = RD::get_singleton()->draw_list_begin(framebuffer, clear ? RD::INITIAL_ACTION_CLEAR : RD::INITIAL_ACTION_KEEP, RD::FINAL_ACTION_READ, RD::INITIAL_ACTION_KEEP, RD::FINAL_ACTION_DISCARD, clear_colors); - if (p_screen_uniform_set.is_valid()) { - RD::get_singleton()->draw_list_bind_uniform_set(draw_list, p_screen_uniform_set, 3); - } + RD::get_singleton()->draw_list_bind_uniform_set(draw_list, fb_uniform_set, BASE_UNIFORM_SET); + RD::get_singleton()->draw_list_bind_uniform_set(draw_list, state.default_transforms_uniform_set, TRANSFORMS_UNIFORM_SET); + RID prev_material; PipelineVariants *pipeline_variants = &shader.pipeline_variants; @@ -1349,7 +1162,7 @@ void RasterizerCanvasRD::_render_items(RID p_to_render_target, int p_item_count, if (material_data->shader_data->version.is_valid() && material_data->shader_data->valid) { pipeline_variants = &material_data->shader_data->pipeline_variants; if (material_data->uniform_set.is_valid()) { - RD::get_singleton()->draw_list_bind_uniform_set(draw_list, material_data->uniform_set, 1); + RD::get_singleton()->draw_list_bind_uniform_set(draw_list, material_data->uniform_set, MATERIAL_UNIFORM_SET); } } else { pipeline_variants = &shader.pipeline_variants; @@ -1367,7 +1180,7 @@ void RasterizerCanvasRD::_render_items(RID p_to_render_target, int p_item_count, RD::get_singleton()->draw_list_end(); } -void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform) { +void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform, RenderingServer::CanvasItemTextureFilter p_default_filter, RenderingServer::CanvasItemTextureRepeat p_default_repeat) { int item_count = 0; //setup canvas state uniforms if needed @@ -1435,24 +1248,42 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite state.light_uniforms[index].height = l->height * (p_canvas_transform.elements[0].length() + p_canvas_transform.elements[1].length()) * 0.5; //approximate height conversion to the canvas size, since all calculations are done in canvas coords to avoid precision loss for (int i = 0; i < 4; i++) { - state.light_uniforms[index].shadow_color[i] = l->shadow_color[i]; + state.light_uniforms[index].shadow_color[i] = uint8_t(CLAMP(int32_t(l->shadow_color[i] * 255.0), 0, 255)); state.light_uniforms[index].color[i] = l->color[i]; } state.light_uniforms[index].color[3] = l->energy; //use alpha for energy, so base color can go separate - if (clight->shadow.texture.is_valid()) { - state.light_uniforms[index].shadow_pixel_size = (1.0 / clight->shadow.size) * (1.0 + l->shadow_smooth); + if (state.shadow_fb.is_valid()) { + state.light_uniforms[index].shadow_pixel_size = (1.0 / state.shadow_texture_size) * (1.0 + l->shadow_smooth); + state.light_uniforms[index].shadow_z_far_inv = 1.0 / clight->shadow.z_far; + state.light_uniforms[index].shadow_y_ofs = clight->shadow.y_offset; } else { state.light_uniforms[index].shadow_pixel_size = 1.0; + state.light_uniforms[index].shadow_z_far_inv = 1.0; + state.light_uniforms[index].shadow_y_ofs = 0; } state.light_uniforms[index].flags |= l->mode << LIGHT_FLAGS_BLEND_SHIFT; state.light_uniforms[index].flags |= l->shadow_filter << LIGHT_FLAGS_FILTER_SHIFT; - if (clight->shadow.texture.is_valid()) { + if (clight->shadow.enabled) { state.light_uniforms[index].flags |= LIGHT_FLAGS_HAS_SHADOW; } + if (clight->texture.is_valid()) { + Rect2 atlas_rect = storage->decal_atlas_get_texture_rect(clight->texture); + state.light_uniforms[index].atlas_rect[0] = atlas_rect.position.x; + state.light_uniforms[index].atlas_rect[1] = atlas_rect.position.y; + state.light_uniforms[index].atlas_rect[2] = atlas_rect.size.width; + state.light_uniforms[index].atlas_rect[3] = atlas_rect.size.height; + + } else { + state.light_uniforms[index].atlas_rect[0] = 0; + state.light_uniforms[index].atlas_rect[1] = 0; + state.light_uniforms[index].atlas_rect[2] = 0; + state.light_uniforms[index].atlas_rect[3] = 0; + } + l->render_index_cache = index; index++; @@ -1464,12 +1295,16 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite } } + { //default filter/repeat + default_filter = p_default_filter; + default_repeat = p_default_repeat; + } + //fill the list until rendering is possible. bool material_screen_texture_found = false; Item *ci = p_item_list; Rect2 back_buffer_rect; bool backbuffer_copy = false; - RID screen_uniform_set; while (ci) { if (ci->copy_back_buffer) { @@ -1490,10 +1325,6 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite backbuffer_copy = true; back_buffer_rect = Rect2(); } - if (screen_uniform_set.is_null()) { - RID backbuffer_shader = shader.canvas_shader.version_get_shader(md->shader_data->version, 0); //any version is fine - screen_uniform_set = storage->render_target_get_back_buffer_uniform_set(p_to_render_target, backbuffer_shader); - } } if (md->last_frame != RasterizerRD::singleton->get_frame_number()) { @@ -1509,7 +1340,7 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite if (backbuffer_copy) { //render anything pending, including clearing if no items - _render_items(p_to_render_target, item_count, canvas_transform_inverse, p_light_list, screen_uniform_set); + _render_items(p_to_render_target, item_count, canvas_transform_inverse, p_light_list); item_count = 0; storage->render_target_copy_to_back_buffer(p_to_render_target, back_buffer_rect); @@ -1521,7 +1352,7 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite items[item_count++] = ci; if (!ci->next || item_count == MAX_RENDER_ITEMS - 1) { - _render_items(p_to_render_target, item_count, canvas_transform_inverse, p_light_list, screen_uniform_set); + _render_items(p_to_render_target, item_count, canvas_transform_inverse, p_light_list); //then reset item_count = 0; } @@ -1532,7 +1363,6 @@ void RasterizerCanvasRD::canvas_render_items(RID p_to_render_target, Item *p_ite RID RasterizerCanvasRD::light_create() { CanvasLight canvas_light; - canvas_light.shadow.size = 0; return canvas_light_owner.make_rid(canvas_light); } @@ -1542,71 +1372,71 @@ void RasterizerCanvasRD::light_set_texture(RID p_rid, RID p_texture) { if (cl->texture == p_texture) { return; } - + if (cl->texture.is_valid()) { + storage->texture_remove_from_decal_atlas(cl->texture); + } cl->texture = p_texture; + + if (cl->texture.is_valid()) { + storage->texture_add_to_decal_atlas(cl->texture); + } } -void RasterizerCanvasRD::light_set_use_shadow(RID p_rid, bool p_enable, int p_resolution) { +void RasterizerCanvasRD::light_set_use_shadow(RID p_rid, bool p_enable) { CanvasLight *cl = canvas_light_owner.getornull(p_rid); ERR_FAIL_COND(!cl); - ERR_FAIL_COND(p_resolution < 64); - if (cl->shadow.texture.is_valid() == p_enable && p_resolution == cl->shadow.size) { - return; - } - if (cl->shadow.texture.is_valid()) { - RD::get_singleton()->free(cl->shadow.fb); - RD::get_singleton()->free(cl->shadow.depth); - RD::get_singleton()->free(cl->shadow.texture); - cl->shadow.fb = RID(); - cl->shadow.texture = RID(); - cl->shadow.depth = RID(); - } + cl->shadow.enabled = p_enable; +} + +void RasterizerCanvasRD::light_update_shadow(RID p_rid, int p_shadow_index, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders) { + CanvasLight *cl = canvas_light_owner.getornull(p_rid); + ERR_FAIL_COND(!cl->shadow.enabled); + + if (state.shadow_fb == RID()) { + //ah, we lack the shadow texture.. + RD::get_singleton()->free(state.shadow_texture); //erase placeholder - if (p_enable) { Vector<RID> fb_textures; { //texture RD::TextureFormat tf; tf.type = RD::TEXTURE_TYPE_2D; - tf.width = p_resolution; - tf.height = 1; + tf.width = state.shadow_texture_size; + tf.height = state.max_lights_per_render * 2; tf.usage_bits = RD::TEXTURE_USAGE_COLOR_ATTACHMENT_BIT | RD::TEXTURE_USAGE_SAMPLING_BIT; tf.format = RD::DATA_FORMAT_R32_SFLOAT; - cl->shadow.texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); - fb_textures.push_back(cl->shadow.texture); + state.shadow_texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); + fb_textures.push_back(state.shadow_texture); } { RD::TextureFormat tf; tf.type = RD::TEXTURE_TYPE_2D; - tf.width = p_resolution; - tf.height = 1; + tf.width = state.shadow_texture_size; + tf.height = state.max_lights_per_render * 2; tf.usage_bits = RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT; - tf.format = RD::get_singleton()->texture_is_format_supported_for_usage(RD::DATA_FORMAT_X8_D24_UNORM_PACK32, RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT) ? RD::DATA_FORMAT_X8_D24_UNORM_PACK32 : RD::DATA_FORMAT_D32_SFLOAT; + tf.format = RD::DATA_FORMAT_D32_SFLOAT; //chunks to write - cl->shadow.depth = RD::get_singleton()->texture_create(tf, RD::TextureView()); - fb_textures.push_back(cl->shadow.depth); + state.shadow_depth_texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); + fb_textures.push_back(state.shadow_depth_texture); } - cl->shadow.fb = RD::get_singleton()->framebuffer_create(fb_textures); + state.shadow_fb = RD::get_singleton()->framebuffer_create(fb_textures); } - cl->shadow.size = p_resolution; -} - -void RasterizerCanvasRD::light_update_shadow(RID p_rid, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders) { - CanvasLight *cl = canvas_light_owner.getornull(p_rid); - ERR_FAIL_COND(cl->shadow.texture.is_null()); + cl->shadow.z_far = p_far; + cl->shadow.y_offset = float(p_shadow_index * 2 + 1) / float(state.max_lights_per_render * 2); + Vector<Color> cc; + cc.push_back(Color(p_far, p_far, p_far, 1.0)); for (int i = 0; i < 4; i++) { //make sure it remains orthogonal, makes easy to read angle later //light.basis.scale(Vector3(to_light.elements[0].length(),to_light.elements[1].length(),1)); - Vector<Color> cc; - cc.push_back(Color(p_far, p_far, p_far, 1.0)); - RD::DrawListID draw_list = RD::get_singleton()->draw_list_begin(cl->shadow.fb, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_DISCARD, cc, 1.0, 0, Rect2i((cl->shadow.size / 4) * i, 0, (cl->shadow.size / 4), 1)); + Rect2i rect((state.shadow_texture_size / 4) * i, p_shadow_index * 2, (state.shadow_texture_size / 4), 2); + RD::DrawListID draw_list = RD::get_singleton()->draw_list_begin(state.shadow_fb, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_DISCARD, cc, 1.0, 0, rect); CameraMatrix projection; { @@ -1635,8 +1465,8 @@ void RasterizerCanvasRD::light_update_shadow(RID p_rid, const Transform2D &p_lig static const Vector2 directions[4] = { Vector2(1, 0), Vector2(0, 1), Vector2(-1, 0), Vector2(0, -1) }; push_constant.direction[0] = directions[i].x; push_constant.direction[1] = directions[i].y; - push_constant.pad[0] = 0; - push_constant.pad[1] = 0; + push_constant.z_far = p_far; + push_constant.pad = 0; /*if (i == 0) *p_xform_cache = projection;*/ @@ -1774,7 +1604,6 @@ void RasterizerCanvasRD::ShaderData::set_code(const String &p_code) { ubo_size = 0; uniforms.clear(); uses_screen_texture = false; - uses_material_samplers = false; if (code == String()) { return; //just invalid, but no error @@ -1812,10 +1641,6 @@ void RasterizerCanvasRD::ShaderData::set_code(const String &p_code) { version = canvas_singleton->shader.canvas_shader.version_create(); } - if (gen_code.texture_uniforms.size() || uses_screen_texture) { //requires the samplers - gen_code.defines.push_back("\n#define USE_MATERIAL_SAMPLERS\n"); - uses_material_samplers = true; - } #if 0 print_line("**compiling shader:"); print_line("**defines:\n"); @@ -2022,7 +1847,6 @@ Variant RasterizerCanvasRD::ShaderData::get_default_parameter(const StringName & RasterizerCanvasRD::ShaderData::ShaderData() { valid = false; uses_screen_texture = false; - uses_material_samplers = false; } RasterizerCanvasRD::ShaderData::~ShaderData() { @@ -2085,7 +1909,7 @@ void RasterizerCanvasRD::MaterialData::update_parameters(const Map<StringName, V update_textures(p_parameters, shader_data->default_texture_params, shader_data->texture_uniforms, texture_cache.ptrw(), false); } - if (shader_data->ubo_size == 0 && !shader_data->uses_material_samplers) { + if (shader_data->ubo_size == 0) { // This material does not require an uniform set, so don't create it. return; } @@ -2098,32 +1922,10 @@ void RasterizerCanvasRD::MaterialData::update_parameters(const Map<StringName, V Vector<RD::Uniform> uniforms; { - if (shader_data->uses_material_samplers) { - //needs samplers for the material (uses custom textures) create them - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_SAMPLER; - u.binding = 0; - u.ids.resize(12); - RID *ids_ptr = u.ids.ptrw(); - ids_ptr[0] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[1] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[2] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[3] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[4] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[5] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED); - ids_ptr[6] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - ids_ptr[7] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - ids_ptr[8] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - ids_ptr[9] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - ids_ptr[10] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - ids_ptr[11] = canvas_singleton->storage->sampler_rd_get_default(RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, RS::CANVAS_ITEM_TEXTURE_REPEAT_ENABLED); - uniforms.push_back(u); - } - if (shader_data->ubo_size) { RD::Uniform u; u.type = RD::UNIFORM_TYPE_UNIFORM_BUFFER; - u.binding = 1; + u.binding = 0; u.ids.push_back(uniform_buffer); uniforms.push_back(u); } @@ -2132,13 +1934,13 @@ void RasterizerCanvasRD::MaterialData::update_parameters(const Map<StringName, V for (uint32_t i = 0; i < tex_uniform_count; i++) { RD::Uniform u; u.type = RD::UNIFORM_TYPE_TEXTURE; - u.binding = 2 + i; + u.binding = 1 + i; u.ids.push_back(textures[i]); uniforms.push_back(u); } } - uniform_set = RD::get_singleton()->uniform_set_create(uniforms, canvas_singleton->shader.canvas_shader.version_get_shader(shader_data->version, 0), 1); + uniform_set = RD::get_singleton()->uniform_set_create(uniforms, canvas_singleton->shader.canvas_shader.version_get_shader(shader_data->version, 0), MATERIAL_UNIFORM_SET); } RasterizerCanvasRD::MaterialData::~MaterialData() { @@ -2164,7 +1966,6 @@ void RasterizerCanvasRD::set_time(double p_time) { } void RasterizerCanvasRD::update() { - _dispose_bindings(); } RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { @@ -2178,22 +1979,7 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { { //shader variants - uint32_t textures_per_stage = RD::get_singleton()->limit_get(RD::LIMIT_MAX_TEXTURES_PER_SHADER_STAGE); - String global_defines; - if (textures_per_stage <= 16) { - //ARM pretty much, and very old Intel GPUs under Linux - state.max_lights_per_item = 4; //sad - global_defines += "#define MAX_LIGHT_TEXTURES 4\n"; - } else if (textures_per_stage <= 32) { - //Apple (Metal) - state.max_lights_per_item = 8; //sad - global_defines += "#define MAX_LIGHT_TEXTURES 8\n"; - } else { - //Anything else (16 lights per item) - state.max_lights_per_item = DEFAULT_MAX_LIGHTS_PER_ITEM; - global_defines += "#define MAX_LIGHT_TEXTURES " + itos(DEFAULT_MAX_LIGHTS_PER_ITEM) + "\n"; - } uint32_t uniform_max_size = RD::get_singleton()->limit_get(RD::LIMIT_MAX_UNIFORM_BUFFER_SIZE); if (uniform_max_size < 65536) { @@ -2226,7 +2012,6 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { shader.default_version = shader.canvas_shader.version_create(); shader.default_version_rd_shader = shader.canvas_shader.version_get_shader(shader.default_version, SHADER_VARIANT_QUAD); - shader.default_version_rd_shader_light = shader.canvas_shader.version_get_shader(shader.default_version, SHADER_VARIANT_QUAD_LIGHT); for (int i = 0; i < PIPELINE_LIGHT_MODE_MAX; i++) { for (int j = 0; j < PIPELINE_VARIANT_MAX; j++) { @@ -2327,8 +2112,8 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { actions.custom_samplers["SPECULAR_SHININESS_TEXTURE"] = "texture_sampler"; actions.custom_samplers["SCREEN_TEXTURE"] = "material_samplers[3]"; //mipmap and filter for screen texture actions.sampler_array_name = "material_samplers"; - actions.base_texture_binding_index = 2; - actions.texture_layout_set = 1; + actions.base_texture_binding_index = 1; + actions.texture_layout_set = MATERIAL_UNIFORM_SET; actions.base_uniform_string = "material."; actions.default_filter = ShaderLanguage::FILTER_LINEAR; actions.default_repeat = ShaderLanguage::REPEAT_DISABLE; @@ -2354,7 +2139,7 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { attachments.push_back(af_color); RD::AttachmentFormat af_depth; - af_depth.format = RD::get_singleton()->texture_is_format_supported_for_usage(RD::DATA_FORMAT_D32_SFLOAT, RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT) ? RD::DATA_FORMAT_D32_SFLOAT : RD::DATA_FORMAT_X8_D24_UNORM_PACK32; + af_depth.format = RD::DATA_FORMAT_D32_SFLOAT; af_depth.usage_flags = RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT; attachments.push_back(af_depth); @@ -2386,21 +2171,17 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { } { //bindings - bindings.id_generator = 0; - //generate for 0 - bindings.default_empty = request_texture_binding(RID(), RID(), RID(), RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, RID()); - - { //state allocate - state.canvas_state_buffer = RD::get_singleton()->uniform_buffer_create(sizeof(State::Buffer)); - state.lights_uniform_buffer = RD::get_singleton()->uniform_buffer_create(sizeof(LightUniform) * state.max_lights_per_render); - - RD::SamplerState shadow_sampler_state; - shadow_sampler_state.mag_filter = RD::SAMPLER_FILTER_LINEAR; - shadow_sampler_state.min_filter = RD::SAMPLER_FILTER_LINEAR; - shadow_sampler_state.repeat_u = RD::SAMPLER_REPEAT_MODE_REPEAT; //shadow wrap around - shadow_sampler_state.compare_op = RD::COMPARE_OP_GREATER; - state.shadow_sampler = RD::get_singleton()->sampler_create(shadow_sampler_state); - } + + state.canvas_state_buffer = RD::get_singleton()->uniform_buffer_create(sizeof(State::Buffer)); + state.lights_uniform_buffer = RD::get_singleton()->uniform_buffer_create(sizeof(LightUniform) * state.max_lights_per_render); + + RD::SamplerState shadow_sampler_state; + shadow_sampler_state.mag_filter = RD::SAMPLER_FILTER_LINEAR; + shadow_sampler_state.min_filter = RD::SAMPLER_FILTER_LINEAR; + shadow_sampler_state.repeat_u = RD::SAMPLER_REPEAT_MODE_REPEAT; //shadow wrap around + shadow_sampler_state.compare_op = RD::COMPARE_OP_GREATER; + shadow_sampler_state.enable_compare = true; + state.shadow_sampler = RD::get_singleton()->sampler_create(shadow_sampler_state); } { @@ -2443,6 +2224,35 @@ RasterizerCanvasRD::RasterizerCanvasRD(RasterizerStorageRD *p_storage) { shader.default_skeleton_texture_buffer = RD::get_singleton()->texture_buffer_create(32, RD::DATA_FORMAT_R32G32B32A32_SFLOAT); } + { + //default shadow texture to keep uniform set happy + RD::TextureFormat tf; + tf.type = RD::TEXTURE_TYPE_2D; + tf.width = 4; + tf.height = 4; + tf.usage_bits = RD::TEXTURE_USAGE_SAMPLING_BIT; + tf.format = RD::DATA_FORMAT_R32_SFLOAT; + + state.shadow_texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); + } + + { + Vector<RD::Uniform> uniforms; + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_STORAGE_BUFFER; + u.binding = 0; + u.ids.push_back(storage->get_default_rd_storage_buffer()); + uniforms.push_back(u); + } + + state.default_transforms_uniform_set = RD::get_singleton()->uniform_set_create(uniforms, shader.default_version_rd_shader, TRANSFORMS_UNIFORM_SET); + } + + default_canvas_texture = storage->canvas_texture_create(); + + state.shadow_texture_size = GLOBAL_GET("rendering/quality/2d_shadow_atlas/size"); //create functions for shader and material storage->shader_set_data_request_function(RasterizerStorageRD::SHADER_TYPE_2D, _create_shader_funcs); @@ -2457,7 +2267,7 @@ bool RasterizerCanvasRD::free(RID p_rid) { if (canvas_light_owner.owns(p_rid)) { CanvasLight *cl = canvas_light_owner.getornull(p_rid); ERR_FAIL_COND_V(!cl, false); - light_set_use_shadow(p_rid, false, 64); + light_set_use_shadow(p_rid, false); canvas_light_owner.free(p_rid); } else if (occluder_polygon_owner.owns(p_rid)) { occluder_polygon_set_shape_as_lines(p_rid, Vector<Vector2>()); @@ -2469,6 +2279,31 @@ bool RasterizerCanvasRD::free(RID p_rid) { return true; } +void RasterizerCanvasRD::set_shadow_texture_size(int p_size) { + p_size = nearest_power_of_2_templated(p_size); + if (p_size == state.shadow_texture_size) { + return; + } + state.shadow_texture_size = p_size; + if (state.shadow_fb.is_valid()) { + RD::get_singleton()->free(state.shadow_texture); + RD::get_singleton()->free(state.shadow_depth_texture); + state.shadow_fb = RID(); + + { + //create a default shadow texture to keep uniform set happy (and that it gets erased when a new one is created) + RD::TextureFormat tf; + tf.type = RD::TEXTURE_TYPE_2D; + tf.width = 4; + tf.height = 4; + tf.usage_bits = RD::TEXTURE_USAGE_SAMPLING_BIT; + tf.format = RD::DATA_FORMAT_R32_SFLOAT; + + state.shadow_texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); + } + } +} + RasterizerCanvasRD::~RasterizerCanvasRD() { //canvas state @@ -2490,24 +2325,6 @@ RasterizerCanvasRD::~RasterizerCanvasRD() { RD::get_singleton()->free(state.shadow_sampler); } //bindings - { - free_texture_binding(bindings.default_empty); - - //dispose pending - _dispose_bindings(); - //anything remains? - if (bindings.texture_bindings.size()) { - ERR_PRINT("Some texture bindings were not properly freed (leaked CanvasItems?)"); - const TextureBindingID *key = nullptr; - while ((key = bindings.texture_bindings.next(key))) { - TextureBinding *tb = bindings.texture_bindings[*key]; - tb->reference_count = 1; - free_texture_binding(*key); - } - //dispose pending - _dispose_bindings(); - } - } //shaders @@ -2520,5 +2337,13 @@ RasterizerCanvasRD::~RasterizerCanvasRD() { //primitives are erase by dependency } + if (state.shadow_fb.is_valid()) { + RD::get_singleton()->free(state.shadow_depth_texture); + } + RD::get_singleton()->free(state.shadow_texture); + + storage->free(default_canvas_texture); //pipelines don't need freeing, they are all gone after shaders are gone + + RD::get_singleton()->free(state.default_transforms_uniform_set); } diff --git a/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.h b/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.h index bfe4e61f47..5791efa4e5 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.h +++ b/servers/rendering/rasterizer_rd/rasterizer_canvas_rd.h @@ -42,6 +42,13 @@ class RasterizerCanvasRD : public RasterizerCanvas { RasterizerStorageRD *storage; + enum { + BASE_UNIFORM_SET = 0, + MATERIAL_UNIFORM_SET = 1, + TRANSFORMS_UNIFORM_SET = 2, + CANVAS_TEXTURE_UNIFORM_SET = 3, + }; + enum ShaderVariant { SHADER_VARIANT_QUAD, SHADER_VARIANT_NINEPATCH, @@ -100,7 +107,7 @@ class RasterizerCanvasRD : public RasterizerCanvas { enum { MAX_RENDER_ITEMS = 256 * 1024, MAX_LIGHT_TEXTURES = 1024, - DEFAULT_MAX_LIGHTS_PER_ITEM = 16, + MAX_LIGHTS_PER_ITEM = 16, DEFAULT_MAX_LIGHTS_PER_RENDER = 256 }; @@ -135,7 +142,6 @@ class RasterizerCanvasRD : public RasterizerCanvas { CanvasShaderRD canvas_shader; RID default_version; RID default_version_rd_shader; - RID default_version_rd_shader_light; RID quad_index_buffer; RID quad_index_array; PipelineVariants pipeline_variants; @@ -178,7 +184,6 @@ class RasterizerCanvasRD : public RasterizerCanvas { Map<StringName, RID> default_texture_params; bool uses_screen_texture; - bool uses_material_samplers; virtual void set_code(const String &p_Code); virtual void set_default_texture_param(const StringName &p_name, RID p_texture); @@ -218,60 +223,9 @@ class RasterizerCanvasRD : public RasterizerCanvas { } /**************************/ - /**** TEXTURE BINDINGS ****/ + /**** CANVAS TEXTURES *****/ /**************************/ - // bindings used to render commands, - // cached for performance. - - struct TextureBindingKey { - RID texture; - RID normalmap; - RID specular; - RID multimesh; - RS::CanvasItemTextureFilter texture_filter; - RS::CanvasItemTextureRepeat texture_repeat; - bool operator==(const TextureBindingKey &p_key) const { - return texture == p_key.texture && normalmap == p_key.normalmap && specular == p_key.specular && multimesh == p_key.specular && texture_filter == p_key.texture_filter && texture_repeat == p_key.texture_repeat; - } - }; - - struct TextureBindingKeyHasher { - static _FORCE_INLINE_ uint32_t hash(const TextureBindingKey &p_key) { - uint32_t hash = hash_djb2_one_64(p_key.texture.get_id()); - hash = hash_djb2_one_64(p_key.normalmap.get_id(), hash); - hash = hash_djb2_one_64(p_key.specular.get_id(), hash); - hash = hash_djb2_one_64(p_key.multimesh.get_id(), hash); - hash = hash_djb2_one_32(uint32_t(p_key.texture_filter) << 16 | uint32_t(p_key.texture_repeat), hash); - return hash; - } - }; - - struct TextureBinding { - TextureBindingID id; - TextureBindingKey key; - SelfList<TextureBinding> to_dispose; - uint32_t reference_count; - RID uniform_set; - TextureBinding() : - to_dispose(this) { - reference_count = 0; - } - }; - - struct { - SelfList<TextureBinding>::List to_dispose_list; - - TextureBindingID id_generator; - HashMap<TextureBindingKey, TextureBindingID, TextureBindingKeyHasher> texture_key_bindings; - HashMap<TextureBindingID, TextureBinding *> texture_bindings; - - TextureBindingID default_empty; - } bindings; - - RID _create_texture_binding(RID p_texture, RID p_normalmap, RID p_specular, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat, RID p_multimesh); - void _dispose_bindings(); - struct { RS::CanvasItemTextureFilter default_filter; RS::CanvasItemTextureRepeat default_repeat; @@ -313,10 +267,9 @@ class RasterizerCanvasRD : public RasterizerCanvas { struct CanvasLight { RID texture; struct { - int size; - RID texture; - RID depth; - RID fb; + bool enabled = false; + float z_far; + float y_offset; } shadow; }; @@ -326,7 +279,8 @@ class RasterizerCanvasRD : public RasterizerCanvas { float projection[16]; float modelview[8]; float direction[2]; - float pad[2]; + float z_far; + float pad; }; struct OccluderPolygon { @@ -342,12 +296,17 @@ class RasterizerCanvasRD : public RasterizerCanvas { float matrix[8]; //light to texture coordinate matrix float shadow_matrix[8]; //light to shadow coordinate matrix float color[4]; - float shadow_color[4]; - float position[2]; + + uint8_t shadow_color[4]; uint32_t flags; //index to light texture - float height; float shadow_pixel_size; - float pad[3]; + float height; + + float position[2]; + float shadow_z_far_inv; + float shadow_y_ofs; + + float atlas_rect[4]; }; RID_Owner<OccluderPolygon> occluder_polygon_owner; @@ -366,34 +325,6 @@ class RasterizerCanvasRD : public RasterizerCanvas { //state that does not vary across rendering all items - struct ItemStateData : public Item::CustomData { - struct LightCache { - uint64_t light_version; - Light *light; - }; - - LightCache light_cache[DEFAULT_MAX_LIGHTS_PER_ITEM]; - uint32_t light_cache_count; - RID state_uniform_set_with_light; - RID state_uniform_set; - ItemStateData() { - for (int i = 0; i < DEFAULT_MAX_LIGHTS_PER_ITEM; i++) { - light_cache[i].light_version = 0; - light_cache[i].light = nullptr; - } - light_cache_count = 0xFFFFFFFF; - } - - ~ItemStateData() { - if (state_uniform_set_with_light.is_valid() && RD::get_singleton()->uniform_set_is_valid(state_uniform_set_with_light)) { - RD::get_singleton()->free(state_uniform_set_with_light); - } - if (state_uniform_set.is_valid() && RD::get_singleton()->uniform_set_is_valid(state_uniform_set)) { - RD::get_singleton()->free(state_uniform_set); - } - } - }; - struct State { //state buffer struct Buffer { @@ -414,6 +345,12 @@ class RasterizerCanvasRD : public RasterizerCanvas { RID lights_uniform_buffer; RID canvas_state_buffer; RID shadow_sampler; + RID shadow_texture; + RID shadow_depth_texture; + RID shadow_fb; + int shadow_texture_size = 2048; + + RID default_transforms_uniform_set; uint32_t max_lights_per_render; uint32_t max_lights_per_item; @@ -452,9 +389,16 @@ class RasterizerCanvasRD : public RasterizerCanvas { Item *items[MAX_RENDER_ITEMS]; - Size2i _bind_texture_binding(TextureBindingID p_binding, RenderingDevice::DrawListID p_draw_list, uint32_t &flags); + RID default_canvas_texture; + + RS::CanvasItemTextureFilter default_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR; + RS::CanvasItemTextureRepeat default_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED; + + RID _create_base_uniform_set(RID p_to_render_target, bool p_backbuffer); + + inline void _bind_canvas_texture(RD::DrawListID p_draw_list, RID p_texture, RS::CanvasItemTextureFilter p_base_filter, RS::CanvasItemTextureRepeat p_base_repeat, RID &r_last_texture, PushConstant &push_constant, Size2 &r_texpixel_size); //recursive, so regular inline used instead. void _render_item(RenderingDevice::DrawListID p_draw_list, const Item *p_item, RenderingDevice::FramebufferFormatID p_framebuffer_format, const Transform2D &p_canvas_transform_inverse, Item *¤t_clip, Light *p_lights, PipelineVariants *p_pipeline_variants); - void _render_items(RID p_to_render_target, int p_item_count, const Transform2D &p_canvas_transform_inverse, Light *p_lights, RID p_screen_uniform_set); + void _render_items(RID p_to_render_target, int p_item_count, const Transform2D &p_canvas_transform_inverse, Light *p_lights); _FORCE_INLINE_ void _update_transform_2d_to_mat2x4(const Transform2D &p_transform, float *p_mat2x4); _FORCE_INLINE_ void _update_transform_2d_to_mat2x3(const Transform2D &p_transform, float *p_mat2x3); @@ -462,30 +406,27 @@ class RasterizerCanvasRD : public RasterizerCanvas { _FORCE_INLINE_ void _update_transform_2d_to_mat4(const Transform2D &p_transform, float *p_mat4); _FORCE_INLINE_ void _update_transform_to_mat4(const Transform &p_transform, float *p_mat4); - _FORCE_INLINE_ void _update_specular_shininess(const Color &p_transform, uint32_t *r_ss); - public: - TextureBindingID request_texture_binding(RID p_texture, RID p_normalmap, RID p_specular, RS::CanvasItemTextureFilter p_filter, RS::CanvasItemTextureRepeat p_repeat, RID p_multimesh); - void free_texture_binding(TextureBindingID p_binding); - PolygonID request_polygon(const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>()); void free_polygon(PolygonID p_polygon); RID light_create(); void light_set_texture(RID p_rid, RID p_texture); - void light_set_use_shadow(RID p_rid, bool p_enable, int p_resolution); - void light_update_shadow(RID p_rid, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders); + void light_set_use_shadow(RID p_rid, bool p_enable); + void light_update_shadow(RID p_rid, int p_shadow_index, const Transform2D &p_light_xform, int p_light_mask, float p_near, float p_far, LightOccluderInstance *p_occluders); RID occluder_polygon_create(); void occluder_polygon_set_shape_as_lines(RID p_occluder, const Vector<Vector2> &p_lines); void occluder_polygon_set_cull_mode(RID p_occluder, RS::CanvasOccluderPolygonCullMode p_mode); - void canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform); + void canvas_render_items(RID p_to_render_target, Item *p_item_list, const Color &p_modulate, Light *p_light_list, const Transform2D &p_canvas_transform, RS::CanvasItemTextureFilter p_default_filter, RS::CanvasItemTextureRepeat p_default_repeat); void canvas_debug_viewport_shadows(Light *p_lights_with_shadow) {} void draw_window_margins(int *p_margins, RID *p_margin_textures) {} + virtual void set_shadow_texture_size(int p_size); + void set_time(double p_time); void update(); bool free(RID p_rid); diff --git a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp index 527ed09584..409cfdfecf 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp +++ b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp @@ -389,14 +389,14 @@ void RasterizerEffectsRD::gaussian_blur(RID p_source_rd_texture, RID p_texture, RD::get_singleton()->compute_list_end(); } -void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Size2i &p_size, float p_strength, bool p_high_quality, bool p_first_pass, float p_luminance_cap, float p_exposure, float p_bloom, float p_hdr_bleed_treshold, float p_hdr_bleed_scale, RID p_auto_exposure, float p_auto_exposure_grey) { +void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_back_texture, const Size2i &p_size, float p_strength, bool p_high_quality, bool p_first_pass, float p_luminance_cap, float p_exposure, float p_bloom, float p_hdr_bleed_treshold, float p_hdr_bleed_scale, RID p_auto_exposure, float p_auto_exposure_grey) { zeromem(©.push_constant, sizeof(CopyPushConstant)); CopyMode copy_mode = p_first_pass && p_auto_exposure.is_valid() ? COPY_MODE_GAUSSIAN_GLOW_AUTO_EXPOSURE : COPY_MODE_GAUSSIAN_GLOW; uint32_t base_flags = 0; - int32_t x_groups = (p_size.width - 1) / 8 + 1; - int32_t y_groups = (p_size.height - 1) / 8 + 1; + int32_t x_groups = (p_size.width + 7) / 8; + int32_t y_groups = (p_size.height + 7) / 8; copy.push_constant.section[2] = p_size.x; copy.push_constant.section[3] = p_size.y; @@ -411,29 +411,15 @@ void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_texture, copy.push_constant.glow_auto_exposure_grey = p_auto_exposure_grey; //unused also - //HORIZONTAL RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin(); RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, copy.pipelines[copy_mode]); RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_source_rd_texture), 0); - RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_texture), 3); + RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_back_texture), 3); if (p_auto_exposure.is_valid() && p_first_pass) { RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_auto_exposure), 1); } - copy.push_constant.flags = base_flags | COPY_FLAG_HORIZONTAL | (p_first_pass ? COPY_FLAG_GLOW_FIRST_PASS : 0) | (p_high_quality ? COPY_FLAG_HIGH_QUALITY_GLOW : 0); - RD::get_singleton()->compute_list_set_push_constant(compute_list, ©.push_constant, sizeof(CopyPushConstant)); - - RD::get_singleton()->compute_list_dispatch(compute_list, x_groups, y_groups, 1); - RD::get_singleton()->compute_list_add_barrier(compute_list); - - copy_mode = COPY_MODE_GAUSSIAN_GLOW; - - //VERTICAL - RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, copy.pipelines[copy_mode]); - RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_texture), 0); - RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_back_texture), 3); - - copy.push_constant.flags = base_flags; + copy.push_constant.flags = base_flags | (p_first_pass ? COPY_FLAG_GLOW_FIRST_PASS : 0) | (p_high_quality ? COPY_FLAG_HIGH_QUALITY_GLOW : 0); RD::get_singleton()->compute_list_set_push_constant(compute_list, ©.push_constant, sizeof(CopyPushConstant)); RD::get_singleton()->compute_list_dispatch(compute_list, x_groups, y_groups, 1); @@ -692,7 +678,13 @@ void RasterizerEffectsRD::tonemapper(RID p_source_color, RID p_dst_framebuffer, tonemap.push_constant.use_glow = p_settings.use_glow; tonemap.push_constant.glow_intensity = p_settings.glow_intensity; - tonemap.push_constant.glow_level_flags = p_settings.glow_level_flags; + tonemap.push_constant.glow_levels[0] = p_settings.glow_levels[0]; // clean this up to just pass by pointer or something + tonemap.push_constant.glow_levels[1] = p_settings.glow_levels[1]; + tonemap.push_constant.glow_levels[2] = p_settings.glow_levels[2]; + tonemap.push_constant.glow_levels[3] = p_settings.glow_levels[3]; + tonemap.push_constant.glow_levels[4] = p_settings.glow_levels[4]; + tonemap.push_constant.glow_levels[5] = p_settings.glow_levels[5]; + tonemap.push_constant.glow_levels[6] = p_settings.glow_levels[6]; tonemap.push_constant.glow_texture_size[0] = p_settings.glow_texture_size.x; tonemap.push_constant.glow_texture_size[1] = p_settings.glow_texture_size.y; tonemap.push_constant.glow_mode = p_settings.glow_mode; @@ -708,6 +700,7 @@ void RasterizerEffectsRD::tonemapper(RID p_source_color, RID p_dst_framebuffer, tonemap.push_constant.use_color_correction = p_settings.use_color_correction; tonemap.push_constant.use_fxaa = p_settings.use_fxaa; + tonemap.push_constant.use_debanding = p_settings.use_debanding; tonemap.push_constant.pixel_size[0] = 1.0 / p_settings.texture_size.x; tonemap.push_constant.pixel_size[1] = 1.0 / p_settings.texture_size.y; @@ -1758,6 +1751,7 @@ RasterizerEffectsRD::~RasterizerEffectsRD() { resolve.shader.version_free(resolve.shader_version); roughness.shader.version_free(roughness.shader_version); roughness_limiter.shader.version_free(roughness_limiter.shader_version); + sort.shader.version_free(sort.shader_version); specular_merge.shader.version_free(specular_merge.shader_version); ssao.blur_shader.version_free(ssao.blur_shader_version); ssao.gather_shader.version_free(ssao.gather_shader_version); diff --git a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h index e434bbc372..679263fbf6 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h +++ b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h @@ -175,18 +175,20 @@ class RasterizerEffectsRD { uint32_t tonemapper; uint32_t glow_texture_size[2]; - float glow_intensity; - uint32_t glow_level_flags; + uint32_t pad3; + uint32_t glow_mode; + float glow_levels[7]; float exposure; float white; float auto_exposure_grey; + uint32_t pad2; float pixel_size[2]; uint32_t use_fxaa; - uint32_t pad; + uint32_t use_debanding; }; /* tonemap actually writes to a framebuffer, which is @@ -607,7 +609,7 @@ public: void copy_depth_to_rect_and_linearize(RID p_source_rd_texture, RID p_dest_texture, const Rect2i &p_rect, bool p_flip_y, float p_z_near, float p_z_far); void copy_to_atlas_fb(RID p_source_rd_texture, RID p_dest_framebuffer, const Rect2 &p_uv_rect, RD::DrawListID p_draw_list, bool p_flip_y = false, bool p_panorama = false); void gaussian_blur(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Rect2i &p_region, bool p_8bit_dst = false); - void gaussian_glow(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Size2i &p_size, float p_strength = 1.0, bool p_high_quality = false, bool p_first_pass = false, float p_luminance_cap = 16.0, float p_exposure = 1.0, float p_bloom = 0.0, float p_hdr_bleed_treshold = 1.0, float p_hdr_bleed_scale = 1.0, RID p_auto_exposure = RID(), float p_auto_exposure_grey = 1.0); + void gaussian_glow(RID p_source_rd_texture, RID p_back_texture, const Size2i &p_size, float p_strength = 1.0, bool p_high_quality = false, bool p_first_pass = false, float p_luminance_cap = 16.0, float p_exposure = 1.0, float p_bloom = 0.0, float p_hdr_bleed_treshold = 1.0, float p_hdr_bleed_scale = 1.0, RID p_auto_exposure = RID(), float p_auto_exposure_grey = 1.0); void cubemap_roughness(RID p_source_rd_texture, RID p_dest_framebuffer, uint32_t p_face_id, uint32_t p_sample_count, float p_roughness, float p_size); void make_mipmap(RID p_source_rd_texture, RID p_dest_texture, const Size2i &p_size); @@ -627,7 +629,7 @@ public: GlowMode glow_mode = GLOW_MODE_ADD; float glow_intensity = 1.0; - uint32_t glow_level_flags = 0; + float glow_levels[7] = { 0.0, 0.0, 1.0, 0.0, 1.0, 0.0, 0.0 }; Vector2i glow_texture_size; bool glow_use_bicubic_upscale = false; RID glow_texture; @@ -649,6 +651,7 @@ public: RID color_correction_texture; bool use_fxaa = false; + bool use_debanding = false; Vector2i texture_size; }; diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp index c56c208098..35b0591289 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp +++ b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp @@ -1335,6 +1335,7 @@ void RasterizerSceneHighEndRD::_setup_environment(RID p_environment, RID p_rende if (scene_state.ubo.fog_height_density >= 0.0001) { scene_state.ubo.fog_height_density = 1.0 / scene_state.ubo.fog_height_density; } + scene_state.ubo.fog_aerial_perspective = environment_get_fog_aerial_perspective(p_environment); Color fog_color = environment_get_fog_light_color(p_environment).to_linear(); float fog_energy = environment_get_fog_light_energy(p_environment); @@ -2018,6 +2019,39 @@ void RasterizerSceneHighEndRD::_render_shadow(RID p_framebuffer, InstanceBase ** } } +void RasterizerSceneHighEndRD::_render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count) { + RENDER_TIMESTAMP("Setup Render Collider Heightfield"); + + _update_render_base_uniform_set(); + + render_pass++; + + scene_state.ubo.dual_paraboloid_side = 0; + + _setup_environment(RID(), RID(), p_cam_projection, p_cam_transform, RID(), true, Vector2(1, 1), RID(), true, Color(), 0, p_cam_projection.get_z_far(), false, false); + + render_list.clear(); + + PassMode pass_mode = PASS_MODE_SHADOW; + + _fill_render_list(p_cull_result, p_cull_count, pass_mode); + + _setup_view_dependant_uniform_set(RID(), RID(), nullptr, 0); + + RENDER_TIMESTAMP("Render Collider Heightield"); + + render_list.sort_by_key(false); + + _fill_instances(render_list.elements, render_list.element_count, true); + + { + //regular forward for now + RD::DrawListID draw_list = RD::get_singleton()->draw_list_begin(p_fb, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ); + _render_list(draw_list, RD::get_singleton()->framebuffer_get_format(p_fb), render_list.elements, render_list.element_count, false, pass_mode, true, RID(), RID()); + RD::get_singleton()->draw_list_end(); + } +} + void RasterizerSceneHighEndRD::_render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) { RENDER_TIMESTAMP("Setup Rendering Material"); @@ -2728,6 +2762,9 @@ RasterizerSceneHighEndRD::RasterizerSceneHighEndRD(RasterizerStorageRD *p_storag actions.renames["NORMAL_ROUGHNESS_TEXTURE"] = "normal_roughness_buffer"; actions.renames["DEPTH"] = "gl_FragDepth"; actions.renames["OUTPUT_IS_SRGB"] = "true"; + actions.renames["FOG"] = "custom_fog"; + actions.renames["RADIANCE"] = "custom_radiance"; + actions.renames["IRRADIANCE"] = "custom_irradiance"; //for light actions.renames["VIEW"] = "view"; @@ -2765,6 +2802,10 @@ RasterizerSceneHighEndRD::RasterizerSceneHighEndRD(RasterizerStorageRD *p_storag actions.usage_defines["DIFFUSE_LIGHT"] = "#define USE_LIGHT_SHADER_CODE\n"; actions.usage_defines["SPECULAR_LIGHT"] = "#define USE_LIGHT_SHADER_CODE\n"; + actions.usage_defines["FOG"] = "#define CUSTOM_FOG_USED\n"; + actions.usage_defines["RADIANCE"] = "#define CUSTOM_RADIANCE_USED\n"; + actions.usage_defines["IRRADIANCE"] = "#define CUSTOM_IRRADIANCE_USED\n"; + actions.render_mode_defines["skip_vertex_transform"] = "#define SKIP_TRANSFORM_USED\n"; actions.render_mode_defines["world_vertex_coords"] = "#define VERTEX_WORLD_COORDS_USED\n"; actions.render_mode_defines["ensure_correct_normals"] = "#define ENSURE_CORRECT_NORMALS\n"; diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h index 1aad9039ff..566022ae5b 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h +++ b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h @@ -308,12 +308,6 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD { float viewport_size[2]; float screen_pixel_size[2]; - float time; - float reflection_multiplier; - - uint32_t pancake_shadows; - uint32_t pad; - float directional_penumbra_shadow_kernel[128]; //32 vec4s float directional_soft_shadow_kernel[128]; float penumbra_shadow_kernel[128]; @@ -366,7 +360,6 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD { uint32_t volumetric_fog_pad; // Fog - uint32_t fog_enabled; float fog_density; float fog_height; @@ -374,6 +367,13 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD { float fog_light_color[3]; float fog_sun_scatter; + + float fog_aerial_perspective; + + float time; + float reflection_multiplier; + + uint32_t pancake_shadows; }; UBO ubo; @@ -581,6 +581,7 @@ protected: virtual void _render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region); virtual void _render_uv2(InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region); virtual void _render_sdfgi(RID p_render_buffers, const Vector3i &p_from, const Vector3i &p_size, const AABB &p_bounds, InstanceBase **p_cull_result, int p_cull_count, const RID &p_albedo_texture, const RID &p_emission_texture, const RID &p_emission_aniso_texture, const RID &p_geom_facing_texture); + virtual void _render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count); public: virtual void set_time(double p_time, double p_step); diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp index 958d8eac1f..0cae141138 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp +++ b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp @@ -1173,6 +1173,94 @@ void RasterizerSceneRD::sdfgi_update_probes(RID p_render_buffers, RID p_environm /* Update dynamic lights */ { + int32_t cascade_light_count[SDFGI::MAX_CASCADES]; + + for (uint32_t i = 0; i < rb->sdfgi->cascades.size(); i++) { + SDFGI::Cascade &cascade = rb->sdfgi->cascades[i]; + + SDGIShader::Light lights[SDFGI::MAX_DYNAMIC_LIGHTS]; + uint32_t idx = 0; + for (uint32_t j = 0; j < p_directional_light_count; j++) { + if (idx == SDFGI::MAX_DYNAMIC_LIGHTS) { + break; + } + + LightInstance *li = light_instance_owner.getornull(p_directional_light_instances[j]); + ERR_CONTINUE(!li); + Vector3 dir = -li->transform.basis.get_axis(Vector3::AXIS_Z); + dir.y *= rb->sdfgi->y_mult; + dir.normalize(); + lights[idx].direction[0] = dir.x; + lights[idx].direction[1] = dir.y; + lights[idx].direction[2] = dir.z; + Color color = storage->light_get_color(li->light); + color = color.to_linear(); + lights[idx].color[0] = color.r; + lights[idx].color[1] = color.g; + lights[idx].color[2] = color.b; + lights[idx].type = RS::LIGHT_DIRECTIONAL; + lights[idx].energy = storage->light_get_param(li->light, RS::LIGHT_PARAM_ENERGY); + lights[idx].has_shadow = storage->light_has_shadow(li->light); + + idx++; + } + + AABB cascade_aabb; + cascade_aabb.position = Vector3((Vector3i(1, 1, 1) * -int32_t(rb->sdfgi->cascade_size >> 1) + cascade.position)) * cascade.cell_size; + cascade_aabb.size = Vector3(1, 1, 1) * rb->sdfgi->cascade_size * cascade.cell_size; + + for (uint32_t j = 0; j < p_positional_light_count; j++) { + if (idx == SDFGI::MAX_DYNAMIC_LIGHTS) { + break; + } + + LightInstance *li = light_instance_owner.getornull(p_positional_light_instances[j]); + ERR_CONTINUE(!li); + + uint32_t max_sdfgi_cascade = storage->light_get_max_sdfgi_cascade(li->light); + if (i > max_sdfgi_cascade) { + continue; + } + + if (!cascade_aabb.intersects(li->aabb)) { + continue; + } + + Vector3 dir = -li->transform.basis.get_axis(Vector3::AXIS_Z); + //faster to not do this here + //dir.y *= rb->sdfgi->y_mult; + //dir.normalize(); + lights[idx].direction[0] = dir.x; + lights[idx].direction[1] = dir.y; + lights[idx].direction[2] = dir.z; + Vector3 pos = li->transform.origin; + pos.y *= rb->sdfgi->y_mult; + lights[idx].position[0] = pos.x; + lights[idx].position[1] = pos.y; + lights[idx].position[2] = pos.z; + Color color = storage->light_get_color(li->light); + color = color.to_linear(); + lights[idx].color[0] = color.r; + lights[idx].color[1] = color.g; + lights[idx].color[2] = color.b; + lights[idx].type = storage->light_get_type(li->light); + lights[idx].energy = storage->light_get_param(li->light, RS::LIGHT_PARAM_ENERGY); + lights[idx].has_shadow = storage->light_has_shadow(li->light); + lights[idx].attenuation = storage->light_get_param(li->light, RS::LIGHT_PARAM_ATTENUATION); + lights[idx].radius = storage->light_get_param(li->light, RS::LIGHT_PARAM_RANGE); + lights[idx].spot_angle = Math::deg2rad(storage->light_get_param(li->light, RS::LIGHT_PARAM_SPOT_ANGLE)); + lights[idx].spot_attenuation = storage->light_get_param(li->light, RS::LIGHT_PARAM_SPOT_ATTENUATION); + + idx++; + } + + if (idx > 0) { + RD::get_singleton()->buffer_update(cascade.lights_buffer, 0, idx * sizeof(SDGIShader::Light), lights, true); + } + + cascade_light_count[i] = idx; + } + RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin(); RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, sdfgi_shader.direct_light_pipeline[SDGIShader::DIRECT_LIGHT_MODE_DYNAMIC]); @@ -1191,91 +1279,7 @@ void RasterizerSceneRD::sdfgi_update_probes(RID p_render_buffers, RID p_environm for (uint32_t i = 0; i < rb->sdfgi->cascades.size(); i++) { SDFGI::Cascade &cascade = rb->sdfgi->cascades[i]; - - { //fill light buffer - - SDGIShader::Light lights[SDFGI::MAX_DYNAMIC_LIGHTS]; - uint32_t idx = 0; - for (uint32_t j = 0; j < p_directional_light_count; j++) { - if (idx == SDFGI::MAX_DYNAMIC_LIGHTS) { - break; - } - - LightInstance *li = light_instance_owner.getornull(p_directional_light_instances[j]); - ERR_CONTINUE(!li); - Vector3 dir = -li->transform.basis.get_axis(Vector3::AXIS_Z); - dir.y *= rb->sdfgi->y_mult; - dir.normalize(); - lights[idx].direction[0] = dir.x; - lights[idx].direction[1] = dir.y; - lights[idx].direction[2] = dir.z; - Color color = storage->light_get_color(li->light); - color = color.to_linear(); - lights[idx].color[0] = color.r; - lights[idx].color[1] = color.g; - lights[idx].color[2] = color.b; - lights[idx].type = RS::LIGHT_DIRECTIONAL; - lights[idx].energy = storage->light_get_param(li->light, RS::LIGHT_PARAM_ENERGY); - lights[idx].has_shadow = storage->light_has_shadow(li->light); - - idx++; - } - - AABB cascade_aabb; - cascade_aabb.position = Vector3((Vector3i(1, 1, 1) * -int32_t(rb->sdfgi->cascade_size >> 1) + cascade.position)) * cascade.cell_size; - cascade_aabb.size = Vector3(1, 1, 1) * rb->sdfgi->cascade_size * cascade.cell_size; - - for (uint32_t j = 0; j < p_positional_light_count; j++) { - if (idx == SDFGI::MAX_DYNAMIC_LIGHTS) { - break; - } - - LightInstance *li = light_instance_owner.getornull(p_positional_light_instances[j]); - ERR_CONTINUE(!li); - - uint32_t max_sdfgi_cascade = storage->light_get_max_sdfgi_cascade(li->light); - if (i > max_sdfgi_cascade) { - continue; - } - - if (!cascade_aabb.intersects(li->aabb)) { - continue; - } - - Vector3 dir = -li->transform.basis.get_axis(Vector3::AXIS_Z); - //faster to not do this here - //dir.y *= rb->sdfgi->y_mult; - //dir.normalize(); - lights[idx].direction[0] = dir.x; - lights[idx].direction[1] = dir.y; - lights[idx].direction[2] = dir.z; - Vector3 pos = li->transform.origin; - pos.y *= rb->sdfgi->y_mult; - lights[idx].position[0] = pos.x; - lights[idx].position[1] = pos.y; - lights[idx].position[2] = pos.z; - Color color = storage->light_get_color(li->light); - color = color.to_linear(); - lights[idx].color[0] = color.r; - lights[idx].color[1] = color.g; - lights[idx].color[2] = color.b; - lights[idx].type = storage->light_get_type(li->light); - lights[idx].energy = storage->light_get_param(li->light, RS::LIGHT_PARAM_ENERGY); - lights[idx].has_shadow = storage->light_has_shadow(li->light); - lights[idx].attenuation = storage->light_get_param(li->light, RS::LIGHT_PARAM_ATTENUATION); - lights[idx].radius = storage->light_get_param(li->light, RS::LIGHT_PARAM_RANGE); - lights[idx].spot_angle = Math::deg2rad(storage->light_get_param(li->light, RS::LIGHT_PARAM_SPOT_ANGLE)); - lights[idx].spot_attenuation = storage->light_get_param(li->light, RS::LIGHT_PARAM_SPOT_ATTENUATION); - - idx++; - } - - if (idx > 0) { - RD::get_singleton()->buffer_update(cascade.lights_buffer, 0, idx * sizeof(SDGIShader::Light), lights, true); - } - push_constant.light_count = idx; - } - + push_constant.light_count = cascade_light_count[i]; push_constant.cascade = i; RD::get_singleton()->compute_list_bind_uniform_set(compute_list, cascade.sdf_direct_light_uniform_set, 0); @@ -2322,6 +2326,7 @@ void RasterizerSceneRD::_setup_sky(RID p_environment, RID p_render_buffers, cons sky_scene_state.ubo.z_far = p_projection.get_z_far(); sky_scene_state.ubo.fog_enabled = environment_is_fog_enabled(p_environment); sky_scene_state.ubo.fog_density = environment_get_fog_density(p_environment); + sky_scene_state.ubo.fog_aerial_perspective = environment_get_fog_aerial_perspective(p_environment); Color fog_color = environment_get_fog_light_color(p_environment).to_linear(); float fog_energy = environment_get_fog_light_energy(p_environment); sky_scene_state.ubo.fog_light_color[0] = fog_color.r * fog_energy; @@ -2932,11 +2937,12 @@ void RasterizerSceneRD::environment_set_tonemap(RID p_env, RS::EnvironmentToneMa env->auto_exp_scale = p_auto_exp_scale; } -void RasterizerSceneRD::environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) { +void RasterizerSceneRD::environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) { Environment *env = environment_owner.getornull(p_env); ERR_FAIL_COND(!env); + ERR_FAIL_COND_MSG(p_levels.size() != 7, "Size of array of glow levels must be 7"); env->glow_enabled = p_enable; - env->glow_levels = p_level_flags; + env->glow_levels = p_levels; env->glow_intensity = p_intensity; env->glow_strength = p_strength; env->glow_mix = p_mix; @@ -2971,7 +2977,7 @@ void RasterizerSceneRD::environment_set_sdfgi(RID p_env, bool p_enable, RS::Envi env->sdfgi_y_scale = p_y_scale; } -void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) { +void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_fog_aerial_perspective) { Environment *env = environment_owner.getornull(p_env); ERR_FAIL_COND(!env); @@ -2982,6 +2988,7 @@ void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Colo env->fog_density = p_density; env->fog_height = p_height; env->fog_height_density = p_height_density; + env->fog_aerial_perspective = p_fog_aerial_perspective; } bool RasterizerSceneRD::environment_is_fog_enabled(RID p_env) const { @@ -3022,6 +3029,12 @@ float RasterizerSceneRD::environment_get_fog_height_density(RID p_env) const { return env->fog_height_density; } +float RasterizerSceneRD::environment_get_fog_aerial_perspective(RID p_env) const { + const Environment *env = environment_owner.getornull(p_env); + ERR_FAIL_COND_V(!env, 0); + return env->fog_aerial_perspective; +} + void RasterizerSceneRD::environment_set_volumetric_fog(RID p_env, bool p_enable, float p_density, const Color &p_light, float p_light_energy, float p_length, float p_detail_spread, float p_gi_inject, RenderingServer::EnvVolumetricFogShadowFilter p_shadow_filter) { Environment *env = environment_owner.getornull(p_env); ERR_FAIL_COND(!env); @@ -5237,25 +5250,21 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu } int max_glow_level = -1; - int glow_mask = 0; if (can_use_effects && env && env->glow_enabled) { /* see that blur textures are allocated */ - if (rb->blur[0].texture.is_null()) { + if (rb->blur[1].texture.is_null()) { _allocate_blur_textures(rb); _render_buffers_uniform_set_changed(p_render_buffers); } for (int i = 0; i < RS::MAX_GLOW_LEVELS; i++) { - if (env->glow_levels & (1 << i)) { + if (env->glow_levels[i] > 0.0) { if (i >= rb->blur[1].mipmaps.size()) { max_glow_level = rb->blur[1].mipmaps.size() - 1; - glow_mask |= 1 << max_glow_level; - } else { max_glow_level = i; - glow_mask |= (1 << i); } } } @@ -5269,9 +5278,9 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu if (env->auto_exposure && rb->luminance.current.is_valid()) { luminance_texture = rb->luminance.current; } - storage->get_effects()->gaussian_glow(rb->texture, rb->blur[0].mipmaps[i + 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality, true, env->glow_hdr_luminance_cap, env->exposure, env->glow_bloom, env->glow_hdr_bleed_threshold, env->glow_hdr_bleed_scale, luminance_texture, env->auto_exp_scale); + storage->get_effects()->gaussian_glow(rb->texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality, true, env->glow_hdr_luminance_cap, env->exposure, env->glow_bloom, env->glow_hdr_bleed_threshold, env->glow_hdr_bleed_scale, luminance_texture, env->auto_exp_scale); } else { - storage->get_effects()->gaussian_glow(rb->blur[1].mipmaps[i - 1].texture, rb->blur[0].mipmaps[i + 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality); + storage->get_effects()->gaussian_glow(rb->blur[1].mipmaps[i - 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality); } } } @@ -5294,7 +5303,9 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu tonemap.use_glow = true; tonemap.glow_mode = RasterizerEffectsRD::TonemapSettings::GlowMode(env->glow_blend_mode); tonemap.glow_intensity = env->glow_blend_mode == RS::ENV_GLOW_BLEND_MODE_MIX ? env->glow_mix : env->glow_intensity; - tonemap.glow_level_flags = glow_mask; + for (int i = 0; i < RS::MAX_GLOW_LEVELS; i++) { + tonemap.glow_levels[i] = env->glow_levels[i]; + } tonemap.glow_texture_size.x = rb->blur[1].mipmaps[0].width; tonemap.glow_texture_size.y = rb->blur[1].mipmaps[0].height; tonemap.glow_use_bicubic_upscale = glow_bicubic_upscale; @@ -5307,6 +5318,7 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu tonemap.use_fxaa = true; } + tonemap.use_debanding = rb->use_debanding; tonemap.texture_size = Vector2i(rb->width, rb->height); if (env) { @@ -5686,13 +5698,14 @@ float RasterizerSceneRD::render_buffers_get_volumetric_fog_detail_spread(RID p_r return rb->volumetric_fog->spread; } -void RasterizerSceneRD::render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RenderingServer::ViewportScreenSpaceAA p_screen_space_aa) { +void RasterizerSceneRD::render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RenderingServer::ViewportScreenSpaceAA p_screen_space_aa, bool p_use_debanding) { RenderBuffers *rb = render_buffers_owner.getornull(p_render_buffers); rb->width = p_width; rb->height = p_height; rb->render_target = p_render_target; rb->msaa = p_msaa; rb->screen_space_aa = p_screen_space_aa; + rb->use_debanding = p_use_debanding; _free_render_buffer_data(rb); { @@ -7227,8 +7240,9 @@ void RasterizerSceneRD::render_sdfgi(RID p_render_buffers, int p_region, Instanc push_constant.grid_size = rb->sdfgi->cascade_size; push_constant.cascade = cascade; - RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin(); if (rb->sdfgi->cascades[cascade].dirty_regions != SDFGI::Cascade::DIRTY_ALL) { + RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin(); + //must pre scroll existing data because not all is dirty RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, sdfgi_shader.preprocess_pipeline[SDGIShader::PRE_PROCESS_SCROLL]); RD::get_singleton()->compute_list_bind_uniform_set(compute_list, rb->sdfgi->cascades[cascade].scroll_uniform_set, 0); @@ -7302,13 +7316,15 @@ void RasterizerSceneRD::render_sdfgi(RID p_render_buffers, int p_region, Instanc } //ok finally barrier - RD::get_singleton()->compute_list_add_barrier(compute_list); + RD::get_singleton()->compute_list_end(); } //clear dispatch indirect data uint32_t dispatch_indirct_data[4] = { 0, 0, 0, 0 }; RD::get_singleton()->buffer_update(rb->sdfgi->cascades[cascade].solid_cell_dispatch_buffer, 0, sizeof(uint32_t) * 4, dispatch_indirct_data, true); + RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin(); + bool half_size = true; //much faster, very little difference static const int optimized_jf_group_size = 8; @@ -7511,6 +7527,23 @@ void RasterizerSceneRD::render_sdfgi(RID p_render_buffers, int p_region, Instanc } } +void RasterizerSceneRD::render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) { + ERR_FAIL_COND(!storage->particles_collision_is_heightfield(p_collider)); + Vector3 extents = storage->particles_collision_get_extents(p_collider) * p_transform.basis.get_scale(); + CameraMatrix cm; + cm.set_orthogonal(-extents.x, extents.x, -extents.z, extents.z, 0, extents.y * 2.0); + + Vector3 cam_pos = p_transform.origin; + cam_pos.y += extents.y; + + Transform cam_xform; + cam_xform.set_look_at(cam_pos, cam_pos - p_transform.basis.get_axis(Vector3::AXIS_Y), -p_transform.basis.get_axis(Vector3::AXIS_Z).normalized()); + + RID fb = storage->particles_collision_get_heightfield_framebuffer(p_collider); + + _render_particle_collider_heightfield(fb, cam_xform, cm, p_cull_result, p_cull_count); +} + void RasterizerSceneRD::render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) { RenderBuffers *rb = render_buffers_owner.getornull(p_render_buffers); ERR_FAIL_COND(!rb); @@ -7975,6 +8008,7 @@ RasterizerSceneRD::RasterizerSceneRD(RasterizerStorageRD *p_storage) { actions.renames["HALF_RES_COLOR"] = "half_res_color"; actions.renames["QUARTER_RES_COLOR"] = "quarter_res_color"; actions.renames["RADIANCE"] = "radiance"; + actions.renames["FOG"] = "custom_fog"; actions.renames["LIGHT0_ENABLED"] = "directional_lights.data[0].enabled"; actions.renames["LIGHT0_DIRECTION"] = "directional_lights.data[0].direction_energy.xyz"; actions.renames["LIGHT0_ENERGY"] = "directional_lights.data[0].direction_energy.w"; @@ -8300,8 +8334,8 @@ RasterizerSceneRD::RasterizerSceneRD(RasterizerStorageRD *p_storage) { { RD::SamplerState sampler; - sampler.mag_filter = RD::SAMPLER_FILTER_LINEAR; - sampler.min_filter = RD::SAMPLER_FILTER_LINEAR; + sampler.mag_filter = RD::SAMPLER_FILTER_NEAREST; + sampler.min_filter = RD::SAMPLER_FILTER_NEAREST; sampler.enable_compare = true; sampler.compare_op = RD::COMPARE_OP_LESS; shadow_sampler = RD::get_singleton()->sampler_create(sampler); diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h index fe31d2f76b..2ad712a9d3 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h +++ b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h @@ -67,7 +67,8 @@ protected: uint32_t volumetric_fog_enabled; float volumetric_fog_inv_length; float volumetric_fog_detail_spread; - uint32_t volumetric_fog_pad; + + float fog_aerial_perspective; float fog_light_color[3]; float fog_sun_scatter; @@ -112,6 +113,7 @@ protected: virtual void _render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0; virtual void _render_uv2(InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0; virtual void _render_sdfgi(RID p_render_buffers, const Vector3i &p_from, const Vector3i &p_size, const AABB &p_bounds, InstanceBase **p_cull_result, int p_cull_count, const RID &p_albedo_texture, const RID &p_emission_texture, const RID &p_emission_aniso_texture, const RID &p_geom_facing_texture) = 0; + virtual void _render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count) = 0; virtual void _debug_giprobe(RID p_gi_probe, RenderingDevice::DrawListID p_draw_list, RID p_framebuffer, const CameraMatrix &p_camera_with_transform, bool p_lighting, bool p_emission, float p_alpha); void _debug_sdfgi_probes(RID p_render_buffers, RD::DrawListID p_draw_list, RID p_framebuffer, const CameraMatrix &p_camera_with_transform); @@ -705,6 +707,7 @@ private: float fog_density = 0.001; float fog_height = 0.0; float fog_height_density = 0.0; //can be negative to invert effect + float fog_aerial_perspective = 0.0; /// Volumetric Fog /// @@ -720,7 +723,7 @@ private: /// Glow bool glow_enabled = false; - int glow_levels = (1 << 2) | (1 << 4); + Vector<float> glow_levels; float glow_intensity = 0.8; float glow_strength = 1.0; float glow_bloom = 0.0; @@ -812,6 +815,7 @@ private: int width = 0, height = 0; RS::ViewportMSAA msaa = RS::VIEWPORT_MSAA_DISABLED; RS::ViewportScreenSpaceAA screen_space_aa = RS::VIEWPORT_SCREEN_SPACE_AA_DISABLED; + bool use_debanding = false; RID render_target; @@ -1529,11 +1533,11 @@ public: bool is_environment(RID p_env) const; - void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap); + void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap); void environment_glow_set_use_bicubic_upscale(bool p_enable); void environment_glow_set_use_high_quality(bool p_enable); - void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density); + void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective); bool environment_is_fog_enabled(RID p_env) const; Color environment_get_fog_light_color(RID p_env) const; float environment_get_fog_light_energy(RID p_env) const; @@ -1541,6 +1545,7 @@ public: float environment_get_fog_density(RID p_env) const; float environment_get_fog_height(RID p_env) const; float environment_get_fog_height_density(RID p_env) const; + float environment_get_fog_aerial_perspective(RID p_env) const; void environment_set_volumetric_fog(RID p_env, bool p_enable, float p_density, const Color &p_light, float p_light_energy, float p_length, float p_detail_spread, float p_gi_inject, RS::EnvVolumetricFogShadowFilter p_shadow_filter); @@ -1841,7 +1846,7 @@ public: } */ RID render_buffers_create(); - void render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RS::ViewportScreenSpaceAA p_screen_space_aa); + void render_buffers_configure(RID p_render_buffers, RID p_render_target, int p_width, int p_height, RS::ViewportMSAA p_msaa, RS::ViewportScreenSpaceAA p_screen_space_aa, bool p_use_debanding); RID render_buffers_get_ao_texture(RID p_render_buffers); RID render_buffers_get_back_buffer_texture(RID p_render_buffers); @@ -1876,6 +1881,8 @@ public: void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count); void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count); + void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count); + virtual void set_scene_pass(uint64_t p_pass) { scene_pass = p_pass; } diff --git a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp index db2c707984..b47d724147 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp +++ b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp @@ -1118,6 +1118,11 @@ void RasterizerStorageRD::texture_replace(RID p_texture, RID p_by_texture) { } RD::get_singleton()->free(tex->rd_texture); + if (tex->canvas_texture) { + memdelete(tex->canvas_texture); + tex->canvas_texture = nullptr; + } + Vector<RID> proxies_to_update = tex->proxies; Vector<RID> proxies_to_redirect = by_tex->proxies; @@ -1125,6 +1130,10 @@ void RasterizerStorageRD::texture_replace(RID p_texture, RID p_by_texture) { tex->proxies = proxies_to_update; //restore proxies, so they can be updated + if (tex->canvas_texture) { + tex->canvas_texture->diffuse = p_texture; //update + } + for (int i = 0; i < proxies_to_update.size(); i++) { texture_proxy_update(proxies_to_update[i], p_texture); } @@ -1193,6 +1202,167 @@ Size2 RasterizerStorageRD::texture_size_with_proxy(RID p_proxy) { return texture_2d_get_size(p_proxy); } +/* CANVAS TEXTURE */ + +void RasterizerStorageRD::CanvasTexture::clear_sets() { + if (cleared_cache) { + return; + } + for (int i = 1; i < RS::CANVAS_ITEM_TEXTURE_FILTER_MAX; i++) { + for (int j = 1; j < RS::CANVAS_ITEM_TEXTURE_REPEAT_MAX; j++) { + if (RD::get_singleton()->uniform_set_is_valid(uniform_sets[i][j])) { + RD::get_singleton()->free(uniform_sets[i][j]); + uniform_sets[i][j] = RID(); + } + } + } + cleared_cache = true; +} + +RasterizerStorageRD::CanvasTexture::~CanvasTexture() { + clear_sets(); +} + +RID RasterizerStorageRD::canvas_texture_create() { + return canvas_texture_owner.make_rid(memnew(CanvasTexture)); +} + +void RasterizerStorageRD::canvas_texture_set_channel(RID p_canvas_texture, RS::CanvasTextureChannel p_channel, RID p_texture) { + CanvasTexture *ct = canvas_texture_owner.getornull(p_canvas_texture); + switch (p_channel) { + case RS::CANVAS_TEXTURE_CHANNEL_DIFFUSE: { + ct->diffuse = p_texture; + } break; + case RS::CANVAS_TEXTURE_CHANNEL_NORMAL: { + ct->normalmap = p_texture; + } break; + case RS::CANVAS_TEXTURE_CHANNEL_SPECULAR: { + ct->specular = p_texture; + } break; + } + + ct->clear_sets(); +} + +void RasterizerStorageRD::canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_specular_color, float p_shininess) { + CanvasTexture *ct = canvas_texture_owner.getornull(p_canvas_texture); + ct->specular_color.r = p_specular_color.r; + ct->specular_color.g = p_specular_color.g; + ct->specular_color.b = p_specular_color.b; + ct->specular_color.a = p_shininess; + ct->clear_sets(); +} + +void RasterizerStorageRD::canvas_texture_set_texture_filter(RID p_canvas_texture, RS::CanvasItemTextureFilter p_filter) { + CanvasTexture *ct = canvas_texture_owner.getornull(p_canvas_texture); + ct->texture_filter = p_filter; + ct->clear_sets(); +} + +void RasterizerStorageRD::canvas_texture_set_texture_repeat(RID p_canvas_texture, RS::CanvasItemTextureRepeat p_repeat) { + CanvasTexture *ct = canvas_texture_owner.getornull(p_canvas_texture); + ct->texture_repeat = p_repeat; + ct->clear_sets(); +} + +bool RasterizerStorageRD::canvas_texture_get_unifom_set(RID p_texture, RS::CanvasItemTextureFilter p_base_filter, RS::CanvasItemTextureRepeat p_base_repeat, RID p_base_shader, int p_base_set, RID &r_uniform_set, Size2i &r_size, Color &r_specular_shininess, bool &r_use_normal, bool &r_use_specular) { + CanvasTexture *ct = nullptr; + + Texture *t = texture_owner.getornull(p_texture); + + if (t) { + //regular texture + if (!t->canvas_texture) { + t->canvas_texture = memnew(CanvasTexture); + t->canvas_texture->diffuse = p_texture; + } + + ct = t->canvas_texture; + } else { + ct = canvas_texture_owner.getornull(p_texture); + } + + if (!ct) { + return false; //invalid texture RID + } + + RS::CanvasItemTextureFilter filter = ct->texture_filter != RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT ? ct->texture_filter : p_base_filter; + ERR_FAIL_COND_V(filter == RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, false); + + RS::CanvasItemTextureRepeat repeat = ct->texture_repeat != RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT ? ct->texture_repeat : p_base_repeat; + ERR_FAIL_COND_V(repeat == RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, false); + + RID uniform_set = ct->uniform_sets[filter][repeat]; + if (!RD::get_singleton()->uniform_set_is_valid(uniform_set)) { + //create and update + Vector<RD::Uniform> uniforms; + { //diffuse + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 0; + + t = texture_owner.getornull(ct->diffuse); + if (!t) { + u.ids.push_back(texture_rd_get_default(DEFAULT_RD_TEXTURE_WHITE)); + ct->size_cache = Size2i(1, 1); + } else { + u.ids.push_back(t->rd_texture); + ct->size_cache = Size2i(t->width_2d, t->height_2d); + } + uniforms.push_back(u); + } + { //normal + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 1; + + t = texture_owner.getornull(ct->normalmap); + if (!t) { + u.ids.push_back(texture_rd_get_default(DEFAULT_RD_TEXTURE_NORMAL)); + ct->use_normal_cache = false; + } else { + u.ids.push_back(t->rd_texture); + ct->use_normal_cache = true; + } + uniforms.push_back(u); + } + { //specular + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 2; + + t = texture_owner.getornull(ct->specular); + if (!t) { + u.ids.push_back(texture_rd_get_default(DEFAULT_RD_TEXTURE_WHITE)); + ct->use_specular_cache = false; + } else { + u.ids.push_back(t->rd_texture); + ct->use_specular_cache = true; + } + uniforms.push_back(u); + } + { //sampler + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_SAMPLER; + u.binding = 3; + u.ids.push_back(sampler_rd_get_default(filter, repeat)); + uniforms.push_back(u); + } + + uniform_set = RD::get_singleton()->uniform_set_create(uniforms, p_base_shader, p_base_set); + ct->uniform_sets[filter][repeat] = uniform_set; + ct->cleared_cache = false; + } + + r_uniform_set = uniform_set; + r_size = ct->size_cache; + r_specular_shininess = ct->specular_color; + r_use_normal = ct->use_normal_cache; + r_use_specular = ct->use_specular_cache; + + return true; +} + /* SHADER API */ RID RasterizerStorageRD::shader_create() { @@ -1256,6 +1426,10 @@ void RasterizerStorageRD::shader_set_code(RID p_shader, const String &p_code) { } material->shader_type = new_type; } + + for (Map<StringName, RID>::Element *E = shader->default_texture_parameter.front(); E; E = E->next()) { + shader->data->set_default_texture_param(E->key(), E->get()); + } } if (shader->data) { @@ -1292,7 +1466,9 @@ void RasterizerStorageRD::shader_set_default_texture_param(RID p_shader, const S } else { shader->default_texture_parameter.erase(p_name); } - + if (shader->data) { + shader->data->set_default_texture_param(p_name, p_texture); + } for (Set<Material *>::Element *E = shader->owners.front(); E; E = E->next()) { Material *material = E->get(); _material_queue_update(material, false, true); @@ -3333,6 +3509,10 @@ void RasterizerStorageRD::_particles_free_data(Particles *particles) { particles->particles_transforms_buffer_uniform_set = RID(); particles->particle_buffer = RID(); + if (RD::get_singleton()->uniform_set_is_valid(particles->collision_textures_uniform_set)) { + RD::get_singleton()->free(particles->collision_textures_uniform_set); + } + if (particles->particles_sort_buffer.is_valid()) { RD::get_singleton()->free(particles->particles_sort_buffer); particles->particles_sort_buffer = RID(); @@ -3454,6 +3634,13 @@ void RasterizerStorageRD::particles_set_fractional_delta(RID p_particles, bool p particles->fractional_delta = p_enable; } +void RasterizerStorageRD::particles_set_collision_base_size(RID p_particles, float p_size) { + Particles *particles = particles_owner.getornull(p_particles); + ERR_FAIL_COND(!particles); + + particles->collision_base_size = p_size; +} + void RasterizerStorageRD::particles_set_process_material(RID p_particles, RID p_material) { Particles *particles = particles_owner.getornull(p_particles); ERR_FAIL_COND(!particles); @@ -3646,6 +3833,22 @@ RID RasterizerStorageRD::particles_get_draw_pass_mesh(RID p_particles, int p_pas return particles->draw_passes[p_pass]; } +void RasterizerStorageRD::particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) { + Particles *particles = particles_owner.getornull(p_particles); + ERR_FAIL_COND(!particles); + + ERR_FAIL_COND(p_instance->base_type != RS::INSTANCE_PARTICLES_COLLISION); + + particles->collisions.insert(p_instance); +} + +void RasterizerStorageRD::particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) { + Particles *particles = particles_owner.getornull(p_particles); + ERR_FAIL_COND(!particles); + + particles->collisions.erase(p_instance); +} + void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_delta) { if (p_particles->particles_material_uniform_set.is_null() || !RD::get_singleton()->uniform_set_is_valid(p_particles->particles_material_uniform_set)) { Vector<RD::Uniform> uniforms; @@ -3729,6 +3932,195 @@ void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_del frame_params.cycle = p_particles->cycle_number; + { //collision and attractors + + frame_params.collider_count = 0; + frame_params.attractor_count = 0; + frame_params.particle_size = p_particles->collision_base_size; + + RID collision_3d_textures[ParticlesFrameParams::MAX_3D_TEXTURES]; + RID collision_heightmap_texture; + + Transform to_particles; + if (p_particles->use_local_coords) { + to_particles = p_particles->emission_transform.affine_inverse(); + } + uint32_t collision_3d_textures_used = 0; + for (const Set<RasterizerScene::InstanceBase *>::Element *E = p_particles->collisions.front(); E; E = E->next()) { + ParticlesCollision *pc = particles_collision_owner.getornull(E->get()->base); + Transform to_collider = E->get()->transform; + if (p_particles->use_local_coords) { + to_collider = to_particles * to_collider; + } + Vector3 scale = to_collider.basis.get_scale(); + to_collider.basis.orthonormalize(); + + if (pc->type <= RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) { + //attractor + if (frame_params.attractor_count >= ParticlesFrameParams::MAX_ATTRACTORS) { + continue; + } + + ParticlesFrameParams::Attractor &attr = frame_params.attractors[frame_params.attractor_count]; + + store_transform(to_collider, attr.transform); + attr.strength = pc->attractor_strength; + attr.attenuation = pc->attractor_attenuation; + attr.directionality = pc->attractor_directionality; + + switch (pc->type) { + case RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT: { + attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_SPHERE; + float radius = pc->radius; + radius *= (scale.x + scale.y + scale.z) / 3.0; + attr.extents[0] = radius; + attr.extents[1] = radius; + attr.extents[2] = radius; + } break; + case RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT: { + attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_BOX; + Vector3 extents = pc->extents * scale; + attr.extents[0] = extents.x; + attr.extents[1] = extents.y; + attr.extents[2] = extents.z; + } break; + case RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT: { + if (collision_3d_textures_used >= ParticlesFrameParams::MAX_3D_TEXTURES) { + continue; + } + attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_VECTOR_FIELD; + Vector3 extents = pc->extents * scale; + attr.extents[0] = extents.x; + attr.extents[1] = extents.y; + attr.extents[2] = extents.z; + attr.texture_index = collision_3d_textures_used; + + collision_3d_textures[collision_3d_textures_used] = pc->field_texture; + collision_3d_textures_used++; + } break; + default: { + } + } + + frame_params.attractor_count++; + } else { + //collider + if (frame_params.collider_count >= ParticlesFrameParams::MAX_COLLIDERS) { + continue; + } + + ParticlesFrameParams::Collider &col = frame_params.colliders[frame_params.collider_count]; + + store_transform(to_collider, col.transform); + switch (pc->type) { + case RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE: { + col.type = ParticlesFrameParams::COLLISION_TYPE_SPHERE; + float radius = pc->radius; + radius *= (scale.x + scale.y + scale.z) / 3.0; + col.extents[0] = radius; + col.extents[1] = radius; + col.extents[2] = radius; + } break; + case RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE: { + col.type = ParticlesFrameParams::COLLISION_TYPE_BOX; + Vector3 extents = pc->extents * scale; + col.extents[0] = extents.x; + col.extents[1] = extents.y; + col.extents[2] = extents.z; + } break; + case RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE: { + if (collision_3d_textures_used >= ParticlesFrameParams::MAX_3D_TEXTURES) { + continue; + } + col.type = ParticlesFrameParams::COLLISION_TYPE_SDF; + Vector3 extents = pc->extents * scale; + col.extents[0] = extents.x; + col.extents[1] = extents.y; + col.extents[2] = extents.z; + col.texture_index = collision_3d_textures_used; + col.scale = (scale.x + scale.y + scale.z) * 0.333333333333; //non uniform scale non supported + + collision_3d_textures[collision_3d_textures_used] = pc->field_texture; + collision_3d_textures_used++; + } break; + case RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE: { + if (collision_heightmap_texture != RID()) { //already taken + continue; + } + + col.type = ParticlesFrameParams::COLLISION_TYPE_HEIGHT_FIELD; + Vector3 extents = pc->extents * scale; + col.extents[0] = extents.x; + col.extents[1] = extents.y; + col.extents[2] = extents.z; + collision_heightmap_texture = pc->heightfield_texture; + } break; + default: { + } + } + + frame_params.collider_count++; + } + } + + bool different = false; + if (collision_3d_textures_used == p_particles->collision_3d_textures_used) { + for (int i = 0; i < ParticlesFrameParams::MAX_3D_TEXTURES; i++) { + if (p_particles->collision_3d_textures[i] != collision_3d_textures[i]) { + different = true; + break; + } + } + } + + if (collision_heightmap_texture != p_particles->collision_heightmap_texture) { + different = true; + } + + bool uniform_set_valid = RD::get_singleton()->uniform_set_is_valid(p_particles->collision_textures_uniform_set); + + if (different || !uniform_set_valid) { + if (uniform_set_valid) { + RD::get_singleton()->free(p_particles->collision_textures_uniform_set); + } + + Vector<RD::Uniform> uniforms; + + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 0; + for (uint32_t i = 0; i < ParticlesFrameParams::MAX_3D_TEXTURES; i++) { + RID rd_tex; + if (i < collision_3d_textures_used) { + Texture *t = texture_owner.getornull(collision_3d_textures[i]); + if (t && t->type == Texture::TYPE_3D) { + rd_tex = t->rd_texture; + } + } + + if (rd_tex == RID()) { + rd_tex = default_rd_textures[DEFAULT_RD_TEXTURE_3D_WHITE]; + } + u.ids.push_back(rd_tex); + } + uniforms.push_back(u); + } + { + RD::Uniform u; + u.type = RD::UNIFORM_TYPE_TEXTURE; + u.binding = 1; + if (collision_heightmap_texture.is_valid()) { + u.ids.push_back(collision_heightmap_texture); + } else { + u.ids.push_back(default_rd_textures[DEFAULT_RD_TEXTURE_BLACK]); + } + uniforms.push_back(u); + } + p_particles->collision_textures_uniform_set = RD::get_singleton()->uniform_set_create(uniforms, particles_shader.default_shader_rd, 2); + } + } + ParticlesShader::PushConstant push_constant; push_constant.clear = p_particles->clear; @@ -3783,8 +4175,10 @@ void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_del RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, m->shader_data->pipeline); RD::get_singleton()->compute_list_bind_uniform_set(compute_list, particles_shader.base_uniform_set, 0); RD::get_singleton()->compute_list_bind_uniform_set(compute_list, p_particles->particles_material_uniform_set, 1); + RD::get_singleton()->compute_list_bind_uniform_set(compute_list, p_particles->collision_textures_uniform_set, 2); + if (m->uniform_set.is_valid()) { - RD::get_singleton()->compute_list_bind_uniform_set(compute_list, m->uniform_set, 2); + RD::get_singleton()->compute_list_bind_uniform_set(compute_list, m->uniform_set, 3); } RD::get_singleton()->compute_list_set_push_constant(compute_list, &push_constant, sizeof(ParticlesShader::PushConstant)); @@ -4190,7 +4584,7 @@ void RasterizerStorageRD::ParticlesMaterialData::update_parameters(const Map<Str } } - uniform_set = RD::get_singleton()->uniform_set_create(uniforms, base_singleton->particles_shader.shader.version_get_shader(shader_data->version, 0), 2); + uniform_set = RD::get_singleton()->uniform_set_create(uniforms, base_singleton->particles_shader.shader.version_get_shader(shader_data->version, 0), 3); } RasterizerStorageRD::ParticlesMaterialData::~ParticlesMaterialData() { @@ -4211,6 +4605,171 @@ RasterizerStorageRD::MaterialData *RasterizerStorageRD::_create_particles_materi return material_data; } //////// + +/* PARTICLES COLLISION API */ + +RID RasterizerStorageRD::particles_collision_create() { + return particles_collision_owner.make_rid(ParticlesCollision()); +} + +RID RasterizerStorageRD::particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND_V(!particles_collision, RID()); + ERR_FAIL_COND_V(particles_collision->type != RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE, RID()); + + if (particles_collision->heightfield_texture == RID()) { + //create + int resolutions[RS::PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_MAX] = { 256, 512, 1024, 2048, 4096, 8192 }; + Size2i size; + if (particles_collision->extents.x > particles_collision->extents.z) { + size.x = resolutions[particles_collision->heightfield_resolution]; + size.y = int32_t(particles_collision->extents.z / particles_collision->extents.x * size.x); + } else { + size.y = resolutions[particles_collision->heightfield_resolution]; + size.x = int32_t(particles_collision->extents.x / particles_collision->extents.z * size.y); + } + + RD::TextureFormat tf; + tf.format = RD::DATA_FORMAT_D32_SFLOAT; + tf.width = size.x; + tf.height = size.y; + tf.type = RD::TEXTURE_TYPE_2D; + tf.usage_bits = RD::TEXTURE_USAGE_SAMPLING_BIT | RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT; + + particles_collision->heightfield_texture = RD::get_singleton()->texture_create(tf, RD::TextureView()); + + Vector<RID> fb_tex; + fb_tex.push_back(particles_collision->heightfield_texture); + particles_collision->heightfield_fb = RD::get_singleton()->framebuffer_create(fb_tex); + particles_collision->heightfield_fb_size = size; + } + + return particles_collision->heightfield_fb; +} + +void RasterizerStorageRD::particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + if (p_type == particles_collision->type) { + return; + } + + if (particles_collision->heightfield_texture.is_valid()) { + RD::get_singleton()->free(particles_collision->heightfield_texture); + particles_collision->heightfield_texture = RID(); + } + particles_collision->type = p_type; + particles_collision->instance_dependency.instance_notify_changed(true, false); +} + +void RasterizerStorageRD::particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + particles_collision->cull_mask = p_cull_mask; +} + +void RasterizerStorageRD::particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->radius = p_radius; + particles_collision->instance_dependency.instance_notify_changed(true, false); +} + +void RasterizerStorageRD::particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->extents = p_extents; + particles_collision->instance_dependency.instance_notify_changed(true, false); +} + +void RasterizerStorageRD::particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->attractor_strength = p_strength; +} + +void RasterizerStorageRD::particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->attractor_directionality = p_directionality; +} + +void RasterizerStorageRD::particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->attractor_attenuation = p_curve; +} + +void RasterizerStorageRD::particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + particles_collision->field_texture = p_texture; +} + +void RasterizerStorageRD::particles_collision_height_field_update(RID p_particles_collision) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + particles_collision->instance_dependency.instance_notify_changed(true, false); +} + +void RasterizerStorageRD::particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND(!particles_collision); + + if (particles_collision->heightfield_resolution == p_resolution) { + return; + } + + particles_collision->heightfield_resolution = p_resolution; + + if (particles_collision->heightfield_texture.is_valid()) { + RD::get_singleton()->free(particles_collision->heightfield_texture); + particles_collision->heightfield_texture = RID(); + } +} + +AABB RasterizerStorageRD::particles_collision_get_aabb(RID p_particles_collision) const { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND_V(!particles_collision, AABB()); + + switch (particles_collision->type) { + case RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT: + case RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE: { + AABB aabb; + aabb.position = -Vector3(1, 1, 1) * particles_collision->radius; + aabb.size = Vector3(2, 2, 2) * particles_collision->radius; + return aabb; + } + default: { + AABB aabb; + aabb.position = -particles_collision->extents; + aabb.size = particles_collision->extents * 2; + return aabb; + } + } + + return AABB(); +} + +Vector3 RasterizerStorageRD::particles_collision_get_extents(RID p_particles_collision) const { + const ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND_V(!particles_collision, Vector3()); + return particles_collision->extents; +} + +bool RasterizerStorageRD::particles_collision_is_heightfield(RID p_particles_collision) const { + const ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision); + ERR_FAIL_COND_V(!particles_collision, false); + return particles_collision->type == RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE; +} + /* SKELETON API */ RID RasterizerStorageRD::skeleton_create() { @@ -4680,6 +5239,9 @@ void RasterizerStorageRD::reflection_probe_set_extents(RID p_probe, const Vector ReflectionProbe *reflection_probe = reflection_probe_owner.getornull(p_probe); ERR_FAIL_COND(!reflection_probe); + if (reflection_probe->extents == p_extents) { + return; + } reflection_probe->extents = p_extents; reflection_probe->instance_dependency.instance_notify_changed(true, false); } @@ -5450,6 +6012,7 @@ void RasterizerStorageRD::_clear_render_target(RenderTarget *rt) { //free in reverse dependency order if (rt->framebuffer.is_valid()) { RD::get_singleton()->free(rt->framebuffer); + rt->framebuffer_uniform_set = RID(); //chain deleted } if (rt->color.is_valid()) { @@ -5464,10 +6027,7 @@ void RasterizerStorageRD::_clear_render_target(RenderTarget *rt) { RD::get_singleton()->free(rt->backbuffer_mipmaps[i].mipmap_copy); } rt->backbuffer_mipmaps.clear(); - if (rt->backbuffer_uniform_set.is_valid() && RD::get_singleton()->uniform_set_is_valid(rt->backbuffer_uniform_set)) { - RD::get_singleton()->free(rt->backbuffer_uniform_set); - } - rt->backbuffer_uniform_set = RID(); + rt->backbuffer_uniform_set = RID(); //chain deleted } rt->framebuffer = RID(); @@ -5577,6 +6137,11 @@ void RasterizerStorageRD::_create_render_target_backbuffer(RenderTarget *rt) { rt->backbuffer = RD::get_singleton()->texture_create(tf, RD::TextureView()); rt->backbuffer_mipmap0 = RD::get_singleton()->texture_create_shared_from_slice(RD::TextureView(), rt->backbuffer, 0, 0); + if (rt->framebuffer_uniform_set.is_valid() && RD::get_singleton()->uniform_set_is_valid(rt->framebuffer_uniform_set)) { + //the new one will require the backbuffer. + RD::get_singleton()->free(rt->framebuffer_uniform_set); + rt->framebuffer_uniform_set = RID(); + } //create mipmaps for (uint32_t i = 1; i < mipmaps_required; i++) { RenderTarget::BackbufferMipmap mm; @@ -5674,6 +6239,12 @@ RID RasterizerStorageRD::render_target_get_rd_texture(RID p_render_target) { return rt->color; } +RID RasterizerStorageRD::render_target_get_rd_backbuffer(RID p_render_target) { + RenderTarget *rt = render_target_owner.getornull(p_render_target); + ERR_FAIL_COND_V(!rt, RID()); + return rt->backbuffer; +} + void RasterizerStorageRD::render_target_request_clear(RID p_render_target, const Color &p_clear_color) { RenderTarget *rt = render_target_owner.getornull(p_render_target); ERR_FAIL_COND(!rt); @@ -5743,32 +6314,28 @@ void RasterizerStorageRD::render_target_copy_to_back_buffer(RID p_render_target, } } -RID RasterizerStorageRD::render_target_get_back_buffer_uniform_set(RID p_render_target, RID p_base_shader) { +RID RasterizerStorageRD::render_target_get_framebuffer_uniform_set(RID p_render_target) { + RenderTarget *rt = render_target_owner.getornull(p_render_target); + ERR_FAIL_COND_V(!rt, RID()); + return rt->framebuffer_uniform_set; +} +RID RasterizerStorageRD::render_target_get_backbuffer_uniform_set(RID p_render_target) { RenderTarget *rt = render_target_owner.getornull(p_render_target); ERR_FAIL_COND_V(!rt, RID()); - - if (!rt->backbuffer.is_valid()) { - _create_render_target_backbuffer(rt); - } - - if (rt->backbuffer_uniform_set.is_valid() && RD::get_singleton()->uniform_set_is_valid(rt->backbuffer_uniform_set)) { - return rt->backbuffer_uniform_set; //if still valid, return/reuse it. - } - - //create otherwise - Vector<RD::Uniform> uniforms; - RD::Uniform u; - u.type = RD::UNIFORM_TYPE_TEXTURE; - u.binding = 0; - u.ids.push_back(rt->backbuffer); - uniforms.push_back(u); - - rt->backbuffer_uniform_set = RD::get_singleton()->uniform_set_create(uniforms, p_base_shader, 3); - ERR_FAIL_COND_V(!rt->backbuffer_uniform_set.is_valid(), RID()); - return rt->backbuffer_uniform_set; } +void RasterizerStorageRD::render_target_set_framebuffer_uniform_set(RID p_render_target, RID p_uniform_set) { + RenderTarget *rt = render_target_owner.getornull(p_render_target); + ERR_FAIL_COND(!rt); + rt->framebuffer_uniform_set = p_uniform_set; +} +void RasterizerStorageRD::render_target_set_backbuffer_uniform_set(RID p_render_target, RID p_uniform_set) { + RenderTarget *rt = render_target_owner.getornull(p_render_target); + ERR_FAIL_COND(!rt); + rt->backbuffer_uniform_set = p_uniform_set; +} + void RasterizerStorageRD::base_update_dependency(RID p_base, RasterizerScene::InstanceBase *p_instance) { if (mesh_owner.owns(p_base)) { Mesh *mesh = mesh_owner.getornull(p_base); @@ -5797,6 +6364,9 @@ void RasterizerStorageRD::base_update_dependency(RID p_base, RasterizerScene::In } else if (particles_owner.owns(p_base)) { Particles *p = particles_owner.getornull(p_base); p_instance->update_dependency(&p->instance_dependency); + } else if (particles_collision_owner.owns(p_base)) { + ParticlesCollision *pc = particles_collision_owner.getornull(p_base); + p_instance->update_dependency(&pc->instance_dependency); } } @@ -5832,6 +6402,9 @@ RS::InstanceType RasterizerStorageRD::get_base_type(RID p_rid) const { if (particles_owner.owns(p_rid)) { return RS::INSTANCE_PARTICLES; } + if (particles_collision_owner.owns(p_rid)) { + return RS::INSTANCE_PARTICLES_COLLISION; + } return RS::INSTANCE_NONE; } @@ -6735,8 +7308,6 @@ void RasterizerStorageRD::update_dirty_resources() { _update_dirty_multimeshes(); _update_dirty_skeletons(); _update_decal_atlas(); - - update_particles(); } bool RasterizerStorageRD::has_os_feature(const String &p_feature) const { @@ -6796,8 +7367,16 @@ bool RasterizerStorageRD::free(RID p_rid) { p->rd_texture = RID(); p->rd_texture_srgb = RID(); } + + if (t->canvas_texture) { + memdelete(t->canvas_texture); + } texture_owner.free(p_rid); + } else if (canvas_texture_owner.owns(p_rid)) { + CanvasTexture *ct = canvas_texture_owner.getornull(p_rid); + memdelete(ct); + canvas_texture_owner.free(p_rid); } else if (shader_owner.owns(p_rid)) { Shader *shader = shader_owner.getornull(p_rid); //make material unreference this @@ -6871,6 +7450,14 @@ bool RasterizerStorageRD::free(RID p_rid) { _particles_free_data(particles); particles->instance_dependency.instance_notify_deleted(p_rid); particles_owner.free(p_rid); + } else if (particles_collision_owner.owns(p_rid)) { + ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_rid); + + if (particles_collision->heightfield_texture.is_valid()) { + RD::get_singleton()->free(particles_collision->heightfield_texture); + } + particles_collision->instance_dependency.instance_notify_deleted(p_rid); + particles_collision_owner.free(p_rid); } else if (render_target_owner.owns(p_rid)) { RenderTarget *rt = render_target_owner.getornull(p_rid); @@ -7379,14 +7966,19 @@ RasterizerStorageRD::RasterizerStorageRD() { actions.renames["RESTART_COLOR"] = "restart_color"; actions.renames["RESTART_CUSTOM"] = "restart_custom"; actions.renames["emit_particle"] = "emit_particle"; + actions.renames["COLLIDED"] = "collided"; + actions.renames["COLLISION_NORMAL"] = "collision_normal"; + actions.renames["COLLISION_DEPTH"] = "collision_depth"; + actions.renames["ATTRACTOR_FORCE"] = "attractor_force"; actions.render_mode_defines["disable_force"] = "#define DISABLE_FORCE\n"; actions.render_mode_defines["disable_velocity"] = "#define DISABLE_VELOCITY\n"; actions.render_mode_defines["keep_data"] = "#define ENABLE_KEEP_DATA\n"; + actions.render_mode_defines["collision_use_scale"] = "#define USE_COLLISON_SCALE\n"; actions.sampler_array_name = "material_samplers"; actions.base_texture_binding_index = 1; - actions.texture_layout_set = 2; + actions.texture_layout_set = 3; actions.base_uniform_string = "material."; actions.base_varying_index = 10; @@ -7481,7 +8073,12 @@ RasterizerStorageRD::~RasterizerStorageRD() { for (int i = 0; i < DEFAULT_RD_BUFFER_MAX; i++) { RD::get_singleton()->free(mesh_default_rd_buffers[i]); } + giprobe_sdf_shader.version_free(giprobe_sdf_shader_version); + particles_shader.copy_shader.version_free(particles_shader.copy_shader_version); + + RenderingServer::get_singleton()->free(particles_shader.default_material); + RenderingServer::get_singleton()->free(particles_shader.default_shader); RD::get_singleton()->free(default_rd_storage_buffer); diff --git a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h index e14b9528cf..7caafca2e0 100644 --- a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h +++ b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h @@ -174,6 +174,29 @@ public: }; private: + /* CANVAS TEXTURE API (2D) */ + + struct CanvasTexture { + RID diffuse; + RID normalmap; + RID specular; + Color specular_color = Color(1, 1, 1, 1); + float shininess = 1.0; + + RS::CanvasItemTextureFilter texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT; + RS::CanvasItemTextureRepeat texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT; + RID uniform_sets[RS::CANVAS_ITEM_TEXTURE_FILTER_MAX][RS::CANVAS_ITEM_TEXTURE_REPEAT_MAX]; + + Size2i size_cache = Size2i(1, 1); + bool use_normal_cache = false; + bool use_specular_cache = false; + bool cleared_cache = true; + void clear_sets(); + ~CanvasTexture(); + }; + + RID_PtrOwner<CanvasTexture> canvas_texture_owner; + /* TEXTURE API */ struct Texture { enum Type { @@ -231,6 +254,8 @@ private: RS::TextureDetectRoughnessCallback detect_roughness_callback = nullptr; void *detect_roughness_callback_ud = nullptr; + + CanvasTexture *canvas_texture = nullptr; }; struct TextureToRDFormat { @@ -475,6 +500,46 @@ private: }; struct ParticlesFrameParams { + enum { + MAX_ATTRACTORS = 32, + MAX_COLLIDERS = 32, + MAX_3D_TEXTURES = 7 + }; + + enum AttractorType { + ATTRACTOR_TYPE_SPHERE, + ATTRACTOR_TYPE_BOX, + ATTRACTOR_TYPE_VECTOR_FIELD, + }; + + struct Attractor { + float transform[16]; + float extents[3]; //exents or radius + uint32_t type; + + uint32_t texture_index; //texture index for vector field + float strength; + float attenuation; + float directionality; + }; + + enum CollisionType { + COLLISION_TYPE_SPHERE, + COLLISION_TYPE_BOX, + COLLISION_TYPE_SDF, + COLLISION_TYPE_HEIGHT_FIELD + }; + + struct Collider { + float transform[16]; + float extents[3]; //exents or radius + uint32_t type; + + uint32_t texture_index; //texture index for vector field + float scale; + uint32_t pad[2]; + }; + uint32_t emitting; float system_phase; float prev_system_phase; @@ -486,9 +551,14 @@ private: float delta; uint32_t random_seed; - uint32_t pad[3]; + uint32_t attractor_count; + uint32_t collider_count; + float particle_size; float emission_transform[16]; + + Attractor attractors[MAX_ATTRACTORS]; + Collider colliders[MAX_COLLIDERS]; }; struct ParticleEmissionBufferData { @@ -536,6 +606,11 @@ private: RID particles_material_uniform_set; RID particles_copy_uniform_set; RID particles_transforms_buffer_uniform_set; + RID collision_textures_uniform_set; + + RID collision_3d_textures[ParticlesFrameParams::MAX_3D_TEXTURES]; + uint32_t collision_3d_textures_used = 0; + RID collision_heightmap_texture; RID particles_sort_buffer; RID particles_sort_uniform_set; @@ -557,6 +632,7 @@ private: int fixed_fps; bool fractional_delta; float frame_remainder; + float collision_base_size; bool clear; @@ -569,6 +645,8 @@ private: ParticleEmissionBuffer *emission_buffer = nullptr; RID emission_storage_buffer; + Set<RasterizerScene::InstanceBase *> collisions; + Particles() : inactive(true), inactive_time(0.0), @@ -590,6 +668,7 @@ private: fixed_fps(0), fractional_delta(false), frame_remainder(0), + collision_base_size(0.01), clear(true) { } @@ -704,6 +783,28 @@ private: mutable RID_Owner<Particles> particles_owner; + /* Particles Collision */ + + struct ParticlesCollision { + RS::ParticlesCollisionType type = RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT; + uint32_t cull_mask = 0xFFFFFFFF; + float radius = 1.0; + Vector3 extents = Vector3(1, 1, 1); + float attractor_strength = 1.0; + float attractor_attenuation = 1.0; + float attractor_directionality = 0.0; + RID field_texture; + RID heightfield_texture; + RID heightfield_fb; + Size2i heightfield_fb_size; + + RS::ParticlesCollisionHeightfieldResolution heightfield_resolution = RS::PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_1024; + + RasterizerScene::InstanceDependency instance_dependency; + }; + + mutable RID_Owner<ParticlesCollision> particles_collision_owner; + /* Skeleton */ struct Skeleton { @@ -896,6 +997,8 @@ private: }; Vector<BackbufferMipmap> backbuffer_mipmaps; + + RID framebuffer_uniform_set; RID backbuffer_uniform_set; //texture generated for this owner (nor RD). @@ -1071,6 +1174,18 @@ public: return default_rd_samplers[p_filter][p_repeat]; } + /* CANVAS TEXTURE API */ + + virtual RID canvas_texture_create(); + + virtual void canvas_texture_set_channel(RID p_canvas_texture, RS::CanvasTextureChannel p_channel, RID p_texture); + virtual void canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_specular_color, float p_shininess); + + virtual void canvas_texture_set_texture_filter(RID p_canvas_texture, RS::CanvasItemTextureFilter p_filter); + virtual void canvas_texture_set_texture_repeat(RID p_canvas_texture, RS::CanvasItemTextureRepeat p_repeat); + + bool canvas_texture_get_unifom_set(RID p_texture, RS::CanvasItemTextureFilter p_base_filter, RS::CanvasItemTextureRepeat p_base_repeat, RID p_base_shader, int p_base_set, RID &r_uniform_set, Size2i &r_size, Color &r_specular_shininess, bool &r_use_normal, bool &r_use_specular); + /* SHADER API */ RID shader_create(); @@ -1691,6 +1806,7 @@ public: void particles_set_process_material(RID p_particles, RID p_material); void particles_set_fixed_fps(RID p_particles, int p_fps); void particles_set_fractional_delta(RID p_particles, bool p_enable); + void particles_set_collision_base_size(RID p_particles, float p_size); void particles_restart(RID p_particles); void particles_emit(RID p_particles, const Transform &p_transform, const Vector3 &p_velocity, const Color &p_color, const Color &p_custom, uint32_t p_emit_flags); void particles_set_subemitter(RID p_particles, RID p_subemitter_particles); @@ -1748,6 +1864,27 @@ public: return particles->particles_transforms_buffer_uniform_set; } + virtual void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance); + virtual void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance); + + /* PARTICLES COLLISION */ + + virtual RID particles_collision_create(); + virtual void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type); + virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask); + virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius); //for spheres + virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents); //for non-spheres + virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength); + virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality); + virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve); + virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture); //for SDF and vector field, heightfield is dynamic + virtual void particles_collision_height_field_update(RID p_particles_collision); //for SDF and vector field + virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution); //for SDF and vector field + virtual AABB particles_collision_get_aabb(RID p_particles_collision) const; + virtual Vector3 particles_collision_get_extents(RID p_particles_collision) const; + virtual bool particles_collision_is_heightfield(RID p_particles_collision) const; + RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const; + /* GLOBAL VARIABLES API */ virtual void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value); @@ -1780,6 +1917,7 @@ public: bool render_target_was_used(RID p_render_target); void render_target_set_as_unused(RID p_render_target); void render_target_copy_to_back_buffer(RID p_render_target, const Rect2i &p_region); + RID render_target_get_back_buffer_uniform_set(RID p_render_target, RID p_base_shader); virtual void render_target_request_clear(RID p_render_target, const Color &p_clear_color); @@ -1791,6 +1929,13 @@ public: Size2 render_target_get_size(RID p_render_target); RID render_target_get_rd_framebuffer(RID p_render_target); RID render_target_get_rd_texture(RID p_render_target); + RID render_target_get_rd_backbuffer(RID p_render_target); + + RID render_target_get_framebuffer_uniform_set(RID p_render_target); + RID render_target_get_backbuffer_uniform_set(RID p_render_target); + + void render_target_set_framebuffer_uniform_set(RID p_render_target, RID p_uniform_set); + void render_target_set_backbuffer_uniform_set(RID p_render_target, RID p_uniform_set); RS::InstanceType get_base_type(RID p_rid) const; @@ -1818,6 +1963,8 @@ public: virtual uint64_t get_captured_timestamp_cpu_time(uint32_t p_index) const; virtual String get_captured_timestamp_name(uint32_t p_index) const; + RID get_default_rd_storage_buffer() { return default_rd_storage_buffer; } + static RasterizerStorageRD *base_singleton; RasterizerEffectsRD *get_effects(); diff --git a/servers/rendering/rasterizer_rd/shader_compiler_rd.cpp b/servers/rendering/rasterizer_rd/shader_compiler_rd.cpp index f70ddbb75a..0a0c343e57 100644 --- a/servers/rendering/rasterizer_rd/shader_compiler_rd.cpp +++ b/servers/rendering/rasterizer_rd/shader_compiler_rd.cpp @@ -423,13 +423,13 @@ static String _get_global_variable_from_type_and_index(const String &p_buffer, c return "(" + p_buffer + "[" + p_index + "].x != 0.0)"; } case ShaderLanguage::TYPE_BVEC2: { - return "(" + p_buffer + "[" + p_index + "].xy != vec2(0.0))"; + return "(notEqual(" + p_buffer + "[" + p_index + "].xy, vec2(0.0)))"; } case ShaderLanguage::TYPE_BVEC3: { - return "(" + p_buffer + "[" + p_index + "].xyz != vec3(0.0))"; + return "(notEqual(" + p_buffer + "[" + p_index + "].xyz, vec3(0.0)))"; } case ShaderLanguage::TYPE_BVEC4: { - return "(" + p_buffer + "[" + p_index + "].xyzw != vec4(0.0))"; + return "(notEqual(" + p_buffer + "[" + p_index + "].xyzw, vec4(0.0)))"; } case ShaderLanguage::TYPE_INT: { return "floatBitsToInt(" + p_buffer + "[" + p_index + "].x)"; @@ -444,16 +444,16 @@ static String _get_global_variable_from_type_and_index(const String &p_buffer, c return "floatBitsToInt(" + p_buffer + "[" + p_index + "].xyzw)"; } case ShaderLanguage::TYPE_UINT: { - return "floatBitsToUInt(" + p_buffer + "[" + p_index + "].x)"; + return "floatBitsToUint(" + p_buffer + "[" + p_index + "].x)"; } case ShaderLanguage::TYPE_UVEC2: { - return "floatBitsToUInt(" + p_buffer + "[" + p_index + "].xy)"; + return "floatBitsToUint(" + p_buffer + "[" + p_index + "].xy)"; } case ShaderLanguage::TYPE_UVEC3: { - return "floatBitsToUInt(" + p_buffer + "[" + p_index + "].xyz)"; + return "floatBitsToUint(" + p_buffer + "[" + p_index + "].xyz)"; } case ShaderLanguage::TYPE_UVEC4: { - return "floatBitsToUInt(" + p_buffer + "[" + p_index + "].xyzw)"; + return "floatBitsToUint(" + p_buffer + "[" + p_index + "].xyzw)"; } case ShaderLanguage::TYPE_FLOAT: { return "(" + p_buffer + "[" + p_index + "].x)"; @@ -1295,6 +1295,8 @@ void ShaderCompilerRD::initialize(DefaultIdentifierActions p_actions) { texture_functions.insert("textureLod"); texture_functions.insert("textureProjLod"); texture_functions.insert("textureGrad"); + texture_functions.insert("textureSize"); + texture_functions.insert("texelFetch"); } ShaderCompilerRD::ShaderCompilerRD() { diff --git a/servers/rendering/rasterizer_rd/shaders/canvas.glsl b/servers/rendering/rasterizer_rd/shaders/canvas.glsl index 4a40584e16..04a37e501f 100644 --- a/servers/rendering/rasterizer_rd/shaders/canvas.glsl +++ b/servers/rendering/rasterizer_rd/shaders/canvas.glsl @@ -26,7 +26,7 @@ layout(location = 3) out vec2 pixel_size_interp; #endif #ifdef USE_MATERIAL_UNIFORMS -layout(set = 1, binding = 1, std140) uniform MaterialUniforms{ +layout(set = 1, binding = 0, std140) uniform MaterialUniforms{ /* clang-format off */ MATERIAL_UNIFORMS /* clang-format on */ @@ -226,7 +226,7 @@ layout(location = 3) in vec2 pixel_size_interp; layout(location = 0) out vec4 frag_color; #ifdef USE_MATERIAL_UNIFORMS -layout(set = 1, binding = 1, std140) uniform MaterialUniforms{ +layout(set = 1, binding = 0, std140) uniform MaterialUniforms{ /* clang-format off */ MATERIAL_UNIFORMS /* clang-format on */ @@ -408,7 +408,7 @@ FRAGMENT_SHADER_CODE color *= canvas_data.canvas_modulation; #ifdef USE_LIGHTING - for (uint i = 0; i < MAX_LIGHT_TEXTURES; i++) { + for (uint i = 0; i < MAX_LIGHTS_PER_ITEM; i++) { if (i >= light_count) { break; } @@ -430,7 +430,8 @@ FRAGMENT_SHADER_CODE light_base &= 0xFF; vec2 tex_uv = (vec4(vertex, 0.0, 1.0) * mat4(light_array.data[light_base].texture_matrix[0], light_array.data[light_base].texture_matrix[1], vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0))).xy; //multiply inverse given its transposed. Optimizer removes useless operations. - vec4 light_color = texture(sampler2D(light_textures[i], texture_sampler), tex_uv); + vec2 tex_uv_atlas = tex_uv * light_array.data[light_base].atlas_rect.zw + light_array.data[light_base].atlas_rect.xy; + vec4 light_color = textureLod(sampler2D(atlas_texture, texture_sampler), tex_uv_atlas, 0.0); vec4 light_base_color = light_array.data[light_base].color; #ifdef LIGHT_SHADER_CODE_USED @@ -502,47 +503,53 @@ FRAGMENT_SHADER_CODE } } + distance *= light_array.data[light_base].shadow_zfar_inv; + //float distance = length(shadow_pos); float shadow; uint shadow_mode = light_array.data[light_base].flags & LIGHT_FLAGS_FILTER_MASK; - vec4 shadow_uv = vec4(tex_ofs, 0.0, distance, 1.0); + vec4 shadow_uv = vec4(tex_ofs, light_array.data[light_base].shadow_y_ofs, distance, 1.0); if (shadow_mode == LIGHT_FLAGS_SHADOW_NEAREST) { - shadow = textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv).x; + shadow = textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv, 0.0).x; } else if (shadow_mode == LIGHT_FLAGS_SHADOW_PCF5) { vec4 shadow_pixel_size = vec4(light_array.data[light_base].shadow_pixel_size, 0.0, 0.0, 0.0); shadow = 0.0; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 2.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 2.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 2.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 2.0, 0.0).x; shadow /= 5.0; } else { //PCF13 vec4 shadow_pixel_size = vec4(light_array.data[light_base].shadow_pixel_size, 0.0, 0.0, 0.0); shadow = 0.0; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 6.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 5.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 4.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 3.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size * 2.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv - shadow_pixel_size).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 2.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 3.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 4.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 5.0).x; - shadow += textureProj(sampler2DShadow(shadow_textures[i], shadow_sampler), shadow_uv + shadow_pixel_size * 6.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 6.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 5.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 4.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 3.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size * 2.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv - shadow_pixel_size, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 2.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 3.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 4.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 5.0, 0.0).x; + shadow += textureProjLod(sampler2DShadow(shadow_atlas_texture, shadow_sampler), shadow_uv + shadow_pixel_size * 6.0, 0.0).x; shadow /= 13.0; } - vec4 shadow_color = light_array.data[light_base].shadow_color; + vec4 shadow_color = unpackUnorm4x8(light_array.data[light_base].shadow_color); #ifdef LIGHT_SHADER_CODE_USED shadow_color *= shadow_modulate; #endif + + shadow_color.a *= light_color.a; //respect light alpha + light_color = mix(light_color, shadow_color, shadow); + //light_color = mix(light_color, shadow_color, shadow); } uint blend_mode = light_array.data[light_base].flags & LIGHT_FLAGS_BLEND_MASK; diff --git a/servers/rendering/rasterizer_rd/shaders/canvas_occlusion.glsl b/servers/rendering/rasterizer_rd/shaders/canvas_occlusion.glsl index 99e70a1976..421282cd4d 100644 --- a/servers/rendering/rasterizer_rd/shaders/canvas_occlusion.glsl +++ b/servers/rendering/rasterizer_rd/shaders/canvas_occlusion.glsl @@ -8,7 +8,8 @@ layout(push_constant, binding = 0, std430) uniform Constants { mat4 projection; mat2x4 modelview; vec2 direction; - vec2 pad; + float z_far; + float pad; } constants; @@ -25,9 +26,18 @@ void main() { #version 450 +layout(push_constant, binding = 0, std430) uniform Constants { + mat4 projection; + mat2x4 modelview; + vec2 direction; + float z_far; + float pad; +} +constants; + layout(location = 0) in highp float depth; layout(location = 0) out highp float distance_buf; void main() { - distance_buf = depth; + distance_buf = depth / constants.z_far; } diff --git a/servers/rendering/rasterizer_rd/shaders/canvas_uniforms_inc.glsl b/servers/rendering/rasterizer_rd/shaders/canvas_uniforms_inc.glsl index a39866004b..e4dc326af6 100644 --- a/servers/rendering/rasterizer_rd/shaders/canvas_uniforms_inc.glsl +++ b/servers/rendering/rasterizer_rd/shaders/canvas_uniforms_inc.glsl @@ -1,3 +1,6 @@ + +#define MAX_LIGHTS_PER_ITEM 16 + #define M_PI 3.14159265359 #define FLAGS_INSTANCING_STRIDE_MASK 0xF @@ -22,13 +25,7 @@ #define FLAGS_DEFAULT_NORMAL_MAP_USED (1 << 26) #define FLAGS_DEFAULT_SPECULAR_MAP_USED (1 << 27) -// In vulkan, sets should always be ordered using the following logic: -// Lower Sets: Sets that change format and layout less often -// Higher sets: Sets that change format and layout very often -// This is because changing a set for another with a different layout or format, -// invalidates all the upper ones. - -/* SET0: Draw Primitive */ +// Push Constant layout(push_constant, binding = 0, std430) uniform DrawData { vec2 world_x; @@ -53,26 +50,17 @@ layout(push_constant, binding = 0, std430) uniform DrawData { } draw_data; -// The values passed per draw primitives are cached within it - -layout(set = 0, binding = 1) uniform texture2D color_texture; -layout(set = 0, binding = 2) uniform texture2D normal_texture; -layout(set = 0, binding = 3) uniform texture2D specular_texture; -layout(set = 0, binding = 4) uniform sampler texture_sampler; - -layout(set = 0, binding = 5) uniform textureBuffer instancing_buffer; - -/* SET1: Is reserved for the material */ - -#ifdef USE_MATERIAL_SAMPLERS - -layout(set = 1, binding = 0) uniform sampler material_samplers[12]; +// In vulkan, sets should always be ordered using the following logic: +// Lower Sets: Sets that change format and layout less often +// Higher sets: Sets that change format and layout very often +// This is because changing a set for another with a different layout or format, +// invalidates all the upper ones (as likely internal base offset changes) -#endif +/* SET0: Globals */ -/* SET2: Canvas Item State (including lighting) */ +// The values passed per draw primitives are cached within it -layout(set = 2, binding = 0, std140) uniform CanvasData { +layout(set = 0, binding = 1, std140) uniform CanvasData { mat4 canvas_transform; mat4 screen_transform; mat4 canvas_normal_transform; @@ -84,16 +72,6 @@ layout(set = 2, binding = 0, std140) uniform CanvasData { } canvas_data; -layout(set = 2, binding = 1) uniform textureBuffer skeleton_buffer; - -layout(set = 2, binding = 2, std140) uniform SkeletonData { - mat4 skeleton_transform; //in world coordinates - mat4 skeleton_transform_inverse; -} -skeleton_data; - -#ifdef USE_LIGHTING - #define LIGHT_FLAGS_BLEND_MASK (3 << 16) #define LIGHT_FLAGS_BLEND_MODE_ADD (0 << 16) #define LIGHT_FLAGS_BLEND_MODE_SUB (1 << 16) @@ -110,37 +88,52 @@ struct Light { mat2x4 texture_matrix; //light to texture coordinate matrix (transposed) mat2x4 shadow_matrix; //light to shadow coordinate matrix (transposed) vec4 color; - vec4 shadow_color; - vec2 position; + + uint shadow_color; // packed uint flags; //index to light texture - float height; float shadow_pixel_size; - float pad0; - float pad1; - float pad2; + float height; + + vec2 position; + float shadow_zfar_inv; + float shadow_y_ofs; + + vec4 atlas_rect; }; -layout(set = 2, binding = 3, std140) uniform LightData { +layout(set = 0, binding = 2, std140) uniform LightData { Light data[MAX_LIGHTS]; } light_array; -layout(set = 2, binding = 4) uniform texture2D light_textures[MAX_LIGHT_TEXTURES]; -layout(set = 2, binding = 5) uniform texture2D shadow_textures[MAX_LIGHT_TEXTURES]; +layout(set = 0, binding = 3) uniform texture2D atlas_texture; +layout(set = 0, binding = 4) uniform texture2D shadow_atlas_texture; -layout(set = 2, binding = 6) uniform sampler shadow_sampler; +layout(set = 0, binding = 5) uniform sampler shadow_sampler; -#endif +layout(set = 0, binding = 6) uniform texture2D screen_texture; + +layout(set = 0, binding = 7) uniform sampler material_samplers[12]; -layout(set = 2, binding = 7, std430) restrict readonly buffer GlobalVariableData { +layout(set = 0, binding = 8, std430) restrict readonly buffer GlobalVariableData { vec4 data[]; } global_variables; -/* SET3: Render Target Data */ +/* SET1: Is reserved for the material */ -#ifdef SCREEN_TEXTURE_USED +// -layout(set = 3, binding = 0) uniform texture2D screen_texture; +/* SET2: Instancing and Skeleton */ -#endif +layout(set = 2, binding = 0, std430) restrict readonly buffer Transforms { + vec4 data[]; +} +transforms; + +/* SET3: Texture */ + +layout(set = 3, binding = 0) uniform texture2D color_texture; +layout(set = 3, binding = 1) uniform texture2D normal_texture; +layout(set = 3, binding = 2) uniform texture2D specular_texture; +layout(set = 3, binding = 3) uniform sampler texture_sampler; diff --git a/servers/rendering/rasterizer_rd/shaders/copy.glsl b/servers/rendering/rasterizer_rd/shaders/copy.glsl index e565bd8e3d..355a2b9d75 100644 --- a/servers/rendering/rasterizer_rd/shaders/copy.glsl +++ b/servers/rendering/rasterizer_rd/shaders/copy.glsl @@ -58,12 +58,20 @@ layout(rgba8, set = 3, binding = 0) uniform restrict writeonly image2D dest_buff layout(rgba32f, set = 3, binding = 0) uniform restrict writeonly image2D dest_buffer; #endif +#ifdef MODE_GAUSSIAN_GLOW +shared vec4 local_cache[256]; +shared vec4 temp_cache[128]; +#endif + void main() { // Pixel being shaded ivec2 pos = ivec2(gl_GlobalInvocationID.xy); + +#ifndef MODE_GAUSSIAN_GLOW // Glow needs the extra threads if (any(greaterThanEqual(pos, params.section.zw))) { //too large, do nothing return; } +#endif #ifdef MODE_MIPMAP @@ -104,70 +112,69 @@ void main() { #ifdef MODE_GAUSSIAN_GLOW - //Glow uses larger sigma 1 for a more rounded blur effect + // First pass copy texture into 16x16 local memory for every 8x8 thread block + vec2 quad_center_uv = clamp(vec2(gl_GlobalInvocationID.xy + gl_LocalInvocationID.xy - 3.5) / params.section.zw, vec2(0.5 / params.section.zw), vec2(1.0 - 1.5 / params.section.zw)); + uint dest_index = gl_LocalInvocationID.x * 2 + gl_LocalInvocationID.y * 2 * 16; + + if (bool(params.flags & FLAG_HIGH_QUALITY_GLOW)) { + vec2 quad_offset_uv = clamp((vec2(gl_GlobalInvocationID.xy + gl_LocalInvocationID.xy - 3.0)) / params.section.zw, vec2(0.5 / params.section.zw), vec2(1.0 - 1.5 / params.section.zw)); -#define GLOW_ADD(m_ofs, m_mult) \ - { \ - ivec2 ofs = base_pos + m_ofs; \ - if (all(greaterThanEqual(ofs, section_begin)) && all(lessThan(ofs, section_end))) { \ - color += texelFetch(source_color, ofs, 0) * m_mult; \ - } \ + local_cache[dest_index] = (textureLod(source_color, quad_center_uv, 0) + textureLod(source_color, quad_offset_uv, 0)) * 0.5; + local_cache[dest_index + 1] = (textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.z, 0.0), 0) + textureLod(source_color, quad_offset_uv + vec2(1.0 / params.section.z, 0.0), 0)) * 0.5; + local_cache[dest_index + 16] = (textureLod(source_color, quad_center_uv + vec2(0.0, 1.0 / params.section.w), 0) + textureLod(source_color, quad_offset_uv + vec2(0.0, 1.0 / params.section.w), 0)) * 0.5; + local_cache[dest_index + 16 + 1] = (textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.zw), 0) + textureLod(source_color, quad_offset_uv + vec2(1.0 / params.section.zw), 0)) * 0.5; + } else { + local_cache[dest_index] = textureLod(source_color, quad_center_uv, 0); + local_cache[dest_index + 1] = textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.z, 0.0), 0); + local_cache[dest_index + 16] = textureLod(source_color, quad_center_uv + vec2(0.0, 1.0 / params.section.w), 0); + local_cache[dest_index + 16 + 1] = textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.zw), 0); } + memoryBarrierShared(); + barrier(); + + // Horizontal pass. Needs to copy into 8x16 chunk of local memory so vertical pass has full resolution + uint read_index = gl_LocalInvocationID.x + gl_LocalInvocationID.y * 32 + 4; + vec4 color_top = vec4(0.0); + color_top += local_cache[read_index] * 0.174938; + color_top += local_cache[read_index + 1] * 0.165569; + color_top += local_cache[read_index + 2] * 0.140367; + color_top += local_cache[read_index + 3] * 0.106595; + color_top += local_cache[read_index - 1] * 0.165569; + color_top += local_cache[read_index - 2] * 0.140367; + color_top += local_cache[read_index - 3] * 0.106595; + + vec4 color_bottom = vec4(0.0); + color_bottom += local_cache[read_index + 16] * 0.174938; + color_bottom += local_cache[read_index + 1 + 16] * 0.165569; + color_bottom += local_cache[read_index + 2 + 16] * 0.140367; + color_bottom += local_cache[read_index + 3 + 16] * 0.106595; + color_bottom += local_cache[read_index - 1 + 16] * 0.165569; + color_bottom += local_cache[read_index - 2 + 16] * 0.140367; + color_bottom += local_cache[read_index - 3 + 16] * 0.106595; + + // rotate samples to take advantage of cache coherency + uint write_index = gl_LocalInvocationID.y * 2 + gl_LocalInvocationID.x * 16; + + temp_cache[write_index] = color_top; + temp_cache[write_index + 1] = color_bottom; + + memoryBarrierShared(); + barrier(); + + // Vertical pass + uint index = gl_LocalInvocationID.y + gl_LocalInvocationID.x * 16 + 4; vec4 color = vec4(0.0); - if (bool(params.flags & FLAG_HORIZONTAL)) { - ivec2 base_pos = ((pos + params.section.xy) << 1) + ivec2(1); - ivec2 section_begin = params.section.xy << 1; - ivec2 section_end = section_begin + (params.section.zw << 1); - - if (bool(params.flags & FLAG_HIGH_QUALITY_GLOW)) { - //Sample from two lines to capture single pixel features - GLOW_ADD(ivec2(0, 0), 0.152781); - GLOW_ADD(ivec2(1, 0), 0.144599); - GLOW_ADD(ivec2(2, 0), 0.122589); - GLOW_ADD(ivec2(3, 0), 0.093095); - GLOW_ADD(ivec2(4, 0), 0.063327); - GLOW_ADD(ivec2(-1, 0), 0.144599); - GLOW_ADD(ivec2(-2, 0), 0.122589); - GLOW_ADD(ivec2(-3, 0), 0.093095); - GLOW_ADD(ivec2(-4, 0), 0.063327); - - GLOW_ADD(ivec2(0, 1), 0.152781); - GLOW_ADD(ivec2(1, 1), 0.144599); - GLOW_ADD(ivec2(2, 1), 0.122589); - GLOW_ADD(ivec2(3, 1), 0.093095); - GLOW_ADD(ivec2(4, 1), 0.063327); - GLOW_ADD(ivec2(-1, 1), 0.144599); - GLOW_ADD(ivec2(-2, 1), 0.122589); - GLOW_ADD(ivec2(-3, 1), 0.093095); - GLOW_ADD(ivec2(-4, 1), 0.063327); - color *= 0.5; - } else { - GLOW_ADD(ivec2(0, 0), 0.174938); - GLOW_ADD(ivec2(1, 0), 0.165569); - GLOW_ADD(ivec2(2, 0), 0.140367); - GLOW_ADD(ivec2(3, 0), 0.106595); - GLOW_ADD(ivec2(-1, 0), 0.165569); - GLOW_ADD(ivec2(-2, 0), 0.140367); - GLOW_ADD(ivec2(-3, 0), 0.106595); - } - - color *= params.glow_strength; - } else { - ivec2 base_pos = pos + params.section.xy; - ivec2 section_begin = params.section.xy; - ivec2 section_end = section_begin + params.section.zw; - - GLOW_ADD(ivec2(0, 0), 0.288713); - GLOW_ADD(ivec2(0, 1), 0.233062); - GLOW_ADD(ivec2(0, 2), 0.122581); - GLOW_ADD(ivec2(0, -1), 0.233062); - GLOW_ADD(ivec2(0, -2), 0.122581); - color *= params.glow_strength; - } + color += temp_cache[index] * 0.174938; + color += temp_cache[index + 1] * 0.165569; + color += temp_cache[index + 2] * 0.140367; + color += temp_cache[index + 3] * 0.106595; + color += temp_cache[index - 1] * 0.165569; + color += temp_cache[index - 2] * 0.140367; + color += temp_cache[index - 3] * 0.106595; -#undef GLOW_ADD + color *= params.glow_strength; if (bool(params.flags & FLAG_GLOW_FIRST_PASS)) { #ifdef GLOW_USE_AUTO_EXPOSURE diff --git a/servers/rendering/rasterizer_rd/shaders/particles.glsl b/servers/rendering/rasterizer_rd/shaders/particles.glsl index a924509771..926c7ef9fc 100644 --- a/servers/rendering/rasterizer_rd/shaders/particles.glsl +++ b/servers/rendering/rasterizer_rd/shaders/particles.glsl @@ -31,6 +31,40 @@ global_variables; /* Set 1: FRAME AND PARTICLE DATA */ // a frame history is kept for trail deterministic behavior + +#define MAX_ATTRACTORS 32 + +#define ATTRACTOR_TYPE_SPHERE 0 +#define ATTRACTOR_TYPE_BOX 1 +#define ATTRACTOR_TYPE_VECTOR_FIELD 2 + +struct Attractor { + mat4 transform; + vec3 extents; //exents or radius + uint type; + uint texture_index; //texture index for vector field + float strength; + float attenuation; + float directionality; +}; + +#define MAX_COLLIDERS 32 + +#define COLLIDER_TYPE_SPHERE 0 +#define COLLIDER_TYPE_BOX 1 +#define COLLIDER_TYPE_SDF 2 +#define COLLIDER_TYPE_HEIGHT_FIELD 3 + +struct Collider { + mat4 transform; + vec3 extents; //exents or radius + uint type; + + uint texture_index; //texture index for vector field + float scale; + uint pad[2]; +}; + struct FrameParams { bool emitting; float system_phase; @@ -43,9 +77,14 @@ struct FrameParams { float delta; uint random_seed; - uint pad[3]; + uint attractor_count; + uint collider_count; + float particle_size; mat4 emission_transform; + + Attractor attractors[MAX_ATTRACTORS]; + Collider colliders[MAX_COLLIDERS]; }; layout(set = 1, binding = 0, std430) restrict buffer FrameHistory { @@ -80,7 +119,7 @@ struct ParticleEmission { vec4 custom; }; -layout(set = 1, binding = 2, std430) restrict volatile coherent buffer SourceEmission { +layout(set = 1, binding = 2, std430) restrict buffer SourceEmission { int particle_count; uint pad0; uint pad1; @@ -89,7 +128,7 @@ layout(set = 1, binding = 2, std430) restrict volatile coherent buffer SourceEmi } src_particles; -layout(set = 1, binding = 3, std430) restrict volatile coherent buffer DestEmission { +layout(set = 1, binding = 3, std430) restrict buffer DestEmission { int particle_count; int particle_max; uint pad1; @@ -98,10 +137,17 @@ layout(set = 1, binding = 3, std430) restrict volatile coherent buffer DestEmiss } dst_particles; -/* SET 2: MATERIAL */ +/* SET 2: COLLIDER/ATTRACTOR TEXTURES */ + +#define MAX_3D_TEXTURES 7 + +layout(set = 2, binding = 0) uniform texture3D sdf_vec_textures[MAX_3D_TEXTURES]; +layout(set = 2, binding = 1) uniform texture2D height_field_texture; + +/* SET 3: MATERIAL */ #ifdef USE_MATERIAL_UNIFORMS -layout(set = 2, binding = 0, std140) uniform MaterialUniforms{ +layout(set = 3, binding = 0, std140) uniform MaterialUniforms{ /* clang-format off */ MATERIAL_UNIFORMS /* clang-format on */ @@ -140,29 +186,7 @@ bool emit_particle(mat4 p_xform, vec3 p_velocity, vec4 p_color, vec4 p_custom, u atomicAdd(dst_particles.particle_count, -1); return false; } - /* - valid = true; - - int attempts = 256; // never trust compute - while(attempts-- > 0) { - dst_index = dst_particles.particle_count; - if (dst_index == dst_particles.particle_max) { - return false; //can't emit anymore - } - - if (atomicCompSwap(dst_particles.particle_count, dst_index, dst_index +1 ) != dst_index) { - continue; - } - valid=true; - break; - } - barrier(); - - if (!valid) { - return false; //gave up (attempts exhausted) - } -*/ dst_particles.data[dst_index].xform = p_xform; dst_particles.data[dst_index].velocity = p_velocity; dst_particles.data[dst_index].color = p_color; @@ -217,6 +241,199 @@ void main() { vec4(0.0, 0.0, 0.0, 1.0)); } + bool collided = false; + vec3 collision_normal = vec3(0.0); + float collision_depth = 0.0; + + vec3 attractor_force = vec3(0.0); + +#if !defined(DISABLE_VELOCITY) + + if (PARTICLE.is_active) { + PARTICLE.xform[3].xyz += PARTICLE.velocity * local_delta; + } +#endif + + /* Process physics if active */ + + if (PARTICLE.is_active) { + for (uint i = 0; i < FRAME.attractor_count; i++) { + vec3 dir; + float amount; + vec3 rel_vec = PARTICLE.xform[3].xyz - FRAME.attractors[i].transform[3].xyz; + vec3 local_pos = rel_vec * mat3(FRAME.attractors[i].transform); + + switch (FRAME.attractors[i].type) { + case ATTRACTOR_TYPE_SPHERE: { + dir = normalize(rel_vec); + float d = length(local_pos) / FRAME.attractors[i].extents.x; + if (d > 1.0) { + continue; + } + amount = max(0.0, 1.0 - d); + } break; + case ATTRACTOR_TYPE_BOX: { + dir = normalize(rel_vec); + + vec3 abs_pos = abs(local_pos / FRAME.attractors[i].extents); + float d = max(abs_pos.x, max(abs_pos.y, abs_pos.z)); + if (d > 1.0) { + continue; + } + amount = max(0.0, 1.0 - d); + + } break; + case ATTRACTOR_TYPE_VECTOR_FIELD: { + vec3 uvw_pos = (local_pos / FRAME.attractors[i].extents) * 2.0 - 1.0; + if (any(lessThan(uvw_pos, vec3(0.0))) || any(greaterThan(uvw_pos, vec3(1.0)))) { + continue; + } + vec3 s = texture(sampler3D(sdf_vec_textures[FRAME.attractors[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos).xyz; + dir = mat3(FRAME.attractors[i].transform) * normalize(s); //revert direction + amount = length(s); + + } break; + } + amount = pow(amount, FRAME.attractors[i].attenuation); + dir = normalize(mix(dir, FRAME.attractors[i].transform[2].xyz, FRAME.attractors[i].directionality)); + attractor_force -= amount * dir * FRAME.attractors[i].strength; + } + + float particle_size = FRAME.particle_size; + +#ifdef USE_COLLISON_SCALE + + particle_size *= dot(vec3(length(PARTICLE.xform[0].xyz), length(PARTICLE.xform[1].xyz), length(PARTICLE.xform[2].xyz)), vec3(0.33333333333)); + +#endif + + for (uint i = 0; i < FRAME.collider_count; i++) { + vec3 normal; + float depth; + bool col = false; + + vec3 rel_vec = PARTICLE.xform[3].xyz - FRAME.colliders[i].transform[3].xyz; + vec3 local_pos = rel_vec * mat3(FRAME.colliders[i].transform); + + switch (FRAME.colliders[i].type) { + case COLLIDER_TYPE_SPHERE: { + float d = length(rel_vec) - (particle_size + FRAME.colliders[i].extents.x); + + if (d < 0.0) { + col = true; + depth = -d; + normal = normalize(rel_vec); + } + + } break; + case COLLIDER_TYPE_BOX: { + vec3 abs_pos = abs(local_pos); + vec3 sgn_pos = sign(local_pos); + + if (any(greaterThan(abs_pos, FRAME.colliders[i].extents))) { + //point outside box + + vec3 closest = min(abs_pos, FRAME.colliders[i].extents); + vec3 rel = abs_pos - closest; + depth = length(rel) - particle_size; + if (depth < 0.0) { + col = true; + normal = mat3(FRAME.colliders[i].transform) * (normalize(rel) * sgn_pos); + depth = -depth; + } + } else { + //point inside box + vec3 axis_len = FRAME.colliders[i].extents - abs_pos; + // there has to be a faster way to do this? + if (all(lessThan(axis_len.xx, axis_len.yz))) { + normal = vec3(1, 0, 0); + } else if (all(lessThan(axis_len.yy, axis_len.xz))) { + normal = vec3(0, 1, 0); + } else { + normal = vec3(0, 0, 1); + } + + col = true; + depth = dot(normal * axis_len, vec3(1)) + particle_size; + normal = mat3(FRAME.colliders[i].transform) * (normal * sgn_pos); + } + + } break; + case COLLIDER_TYPE_SDF: { + vec3 apos = abs(local_pos); + float extra_dist = 0.0; + if (any(greaterThan(apos, FRAME.colliders[i].extents))) { //outside + vec3 mpos = min(apos, FRAME.colliders[i].extents); + extra_dist = distance(mpos, apos); + } + + if (extra_dist > particle_size) { + continue; + } + + vec3 uvw_pos = (local_pos / FRAME.colliders[i].extents) * 0.5 + 0.5; + float s = texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos).r; + s *= FRAME.colliders[i].scale; + s += extra_dist; + if (s < particle_size) { + col = true; + depth = particle_size - s; + const float EPSILON = 0.001; + normal = mat3(FRAME.colliders[i].transform) * + normalize( + vec3( + texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r, + texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r, + texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r)); + } + + } break; + case COLLIDER_TYPE_HEIGHT_FIELD: { + vec3 local_pos_bottom = local_pos; + local_pos_bottom.y -= particle_size; + + if (any(greaterThan(abs(local_pos_bottom), FRAME.colliders[i].extents))) { + continue; + } + + const float DELTA = 1.0 / 8192.0; + + vec3 uvw_pos = vec3(local_pos_bottom / FRAME.colliders[i].extents) * 0.5 + 0.5; + + float y = 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz).r; + + if (y > uvw_pos.y) { + //inside heightfield + + vec3 pos1 = (vec3(uvw_pos.x, y, uvw_pos.z) * 2.0 - 1.0) * FRAME.colliders[i].extents; + vec3 pos2 = (vec3(uvw_pos.x + DELTA, 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz + vec2(DELTA, 0)).r, uvw_pos.z) * 2.0 - 1.0) * FRAME.colliders[i].extents; + vec3 pos3 = (vec3(uvw_pos.x, 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz + vec2(0, DELTA)).r, uvw_pos.z + DELTA) * 2.0 - 1.0) * FRAME.colliders[i].extents; + + normal = normalize(cross(pos1 - pos2, pos1 - pos3)); + float local_y = (vec3(local_pos / FRAME.colliders[i].extents) * 0.5 + 0.5).y; + + col = true; + depth = dot(normal, pos1) - dot(normal, local_pos_bottom); + } + + } break; + } + + if (col) { + if (!collided) { + collided = true; + collision_normal = normal; + collision_depth = depth; + } else { + vec3 c = collision_normal * collision_depth; + c += normal * max(0.0, depth - dot(normal, c)); + collision_normal = normalize(c); + collision_depth = length(c); + } + } + } + } + if (params.sub_emitter_mode) { if (!PARTICLE.is_active) { int src_index = atomicAdd(src_particles.particle_count, -1) - 1; @@ -329,66 +546,4 @@ COMPUTE_SHADER_CODE /* clang-format on */ } - -#if !defined(DISABLE_VELOCITY) - - if (PARTICLE.is_active) { - PARTICLE.xform[3].xyz += PARTICLE.velocity * local_delta; - } -#endif - -#if 0 - if (PARTICLE.is_active) { - //execute shader - - - - - //!defined(DISABLE_FORCE) - - if (false) { - vec3 force = vec3(0.0); - for (int i = 0; i < attractor_count; i++) { - vec3 rel_vec = xform[3].xyz - attractors[i].pos; - float dist = length(rel_vec); - if (attractors[i].radius < dist) - continue; - if (attractors[i].eat_radius > 0.0 && attractors[i].eat_radius > dist) { - out_velocity_active.a = 0.0; - } - - rel_vec = normalize(rel_vec); - - float attenuation = pow(dist / attractors[i].radius, attractors[i].attenuation); - - if (attractors[i].dir == vec3(0.0)) { - //towards center - force += attractors[i].strength * rel_vec * attenuation * mass; - } else { - force += attractors[i].strength * attractors[i].dir * attenuation * mass; - } - } - - out_velocity_active.xyz += force * local_delta; - } - -#if !defined(DISABLE_VELOCITY) - - if (true) { - xform[3].xyz += out_velocity_active.xyz * local_delta; - } -#endif - } else { - xform = mat4(0.0); - } - - - xform = transpose(xform); - - out_velocity_active.a = mix(0.0, 1.0, shader_active); - - out_xform_1 = xform[0]; - out_xform_2 = xform[1]; - out_xform_3 = xform[2]; -#endif } diff --git a/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl b/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl index e11f3983c5..455a3d4a3a 100644 --- a/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl +++ b/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl @@ -1621,6 +1621,22 @@ vec4 volumetric_fog_process(vec2 screen_uv, float z) { vec4 fog_process(vec3 vertex) { vec3 fog_color = scene_data.fog_light_color; + if (scene_data.fog_aerial_perspective > 0.0) { + vec3 sky_fog_color = vec3(0.0); + vec3 cube_view = scene_data.radiance_inverse_xform * vertex; + // mip_level always reads from the second mipmap and higher so the fog is always slightly blurred + float mip_level = mix(1.0 / MAX_ROUGHNESS_LOD, 1.0, 1.0 - (abs(vertex.z) - scene_data.z_near) / (scene_data.z_far - scene_data.z_near)); +#ifdef USE_RADIANCE_CUBEMAP_ARRAY + float lod, blend; + blend = modf(mip_level * MAX_ROUGHNESS_LOD, lod); + sky_fog_color = texture(samplerCubeArray(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), vec4(cube_view, lod)).rgb; + sky_fog_color = mix(sky_fog_color, texture(samplerCubeArray(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), vec4(cube_view, lod + 1)).rgb, blend); +#else + sky_fog_color = textureLod(samplerCube(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), cube_view, mip_level * MAX_ROUGHNESS_LOD).rgb; +#endif //USE_RADIANCE_CUBEMAP_ARRAY + fog_color = mix(fog_color, sky_fog_color, scene_data.fog_aerial_perspective); + } + if (scene_data.fog_sun_scatter > 0.001) { vec4 sun_scatter = vec4(0.0); float sun_total = 0.0; @@ -1676,6 +1692,15 @@ void main() { float clearcoat_gloss = 0.0; float anisotropy = 0.0; vec2 anisotropy_flow = vec2(1.0, 0.0); +#if defined(CUSTOM_FOG_USED) + vec4 custom_fog = vec4(0.0); +#endif +#if defined(CUSTOM_RADIANCE_USED) + vec4 custom_radiance = vec4(0.0); +#endif +#if defined(CUSTOM_IRRADIANCE_USED) + vec4 custom_irradiance = vec4(0.0); +#endif #if defined(AO_USED) float ao = 1.0; @@ -1893,6 +1918,10 @@ FRAGMENT_SHADER_CODE specular_light *= scene_data.ambient_light_color_energy.a; } +#if defined(CUSTOM_RADIANCE_USED) + specular_light = mix(specular_light, custom_radiance.rgb, custom_radiance.a); +#endif + #ifndef USE_LIGHTMAP //lightmap overrides everything if (scene_data.use_ambient_light) { @@ -1910,7 +1939,9 @@ FRAGMENT_SHADER_CODE } } #endif // USE_LIGHTMAP - +#if defined(CUSTOM_IRRADIANCE_USED) + ambient_light = mix(specular_light, custom_irradiance.rgb, custom_irradiance.a); +#endif #endif //!defined(MODE_RENDER_DEPTH) && !defined(MODE_UNSHADED) //radiance @@ -2726,18 +2757,24 @@ FRAGMENT_SHADER_CODE specular_buffer = vec4(specular_light, metallic); #endif - if (scene_data.volumetric_fog_enabled) { - vec4 fog = volumetric_fog_process(screen_uv, -vertex.z); + // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky. + if (scene_data.fog_enabled) { + vec4 fog = fog_process(vertex); diffuse_buffer.rgb = mix(diffuse_buffer.rgb, fog.rgb, fog.a); specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), fog.a); } - if (scene_data.fog_enabled) { - vec4 fog = fog_process(vertex); + if (scene_data.volumetric_fog_enabled) { + vec4 fog = volumetric_fog_process(screen_uv, -vertex.z); diffuse_buffer.rgb = mix(diffuse_buffer.rgb, fog.rgb, fog.a); specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), fog.a); } +#if defined(CUSTOM_FOG_USED) + diffuse_buffer.rgb = mix(diffuse_buffer.rgb, custom_fog.rgb, custom_fog.a); + specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), custom_fog.a); +#endif //CUSTOM_FOG_USED + #else //MODE_MULTIPLE_RENDER_TARGETS #ifdef MODE_UNSHADED @@ -2747,16 +2784,21 @@ FRAGMENT_SHADER_CODE //frag_color = vec4(1.0); #endif //USE_NO_SHADING - if (scene_data.volumetric_fog_enabled) { - vec4 fog = volumetric_fog_process(screen_uv, -vertex.z); + // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky. + if (scene_data.fog_enabled) { + vec4 fog = fog_process(vertex); frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a); } - if (scene_data.fog_enabled) { - vec4 fog = fog_process(vertex); + if (scene_data.volumetric_fog_enabled) { + vec4 fog = volumetric_fog_process(screen_uv, -vertex.z); frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a); } +#if defined(CUSTOM_FOG_USED) + frag_color.rgb = mix(frag_color.rgb, custom_fog.rgb, custom_fog.a); +#endif //CUSTOM_FOG_USED + #endif //MODE_MULTIPLE_RENDER_TARGETS #endif //MODE_RENDER_DEPTH diff --git a/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl b/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl index 0cc2b90c53..e29a490ca1 100644 --- a/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl +++ b/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl @@ -43,12 +43,6 @@ layout(set = 0, binding = 3, std140) uniform SceneData { vec2 viewport_size; vec2 screen_pixel_size; - float time; - float reflection_multiplier; // one normally, zero when rendering reflections - - bool pancake_shadows; - uint pad; - //use vec4s because std140 doesnt play nice with vec2s, z and w are wasted vec4 directional_penumbra_shadow_kernel[32]; vec4 directional_soft_shadow_kernel[32]; @@ -108,6 +102,13 @@ layout(set = 0, binding = 3, std140) uniform SceneData { vec3 fog_light_color; float fog_sun_scatter; + + float fog_aerial_perspective; + + float time; + float reflection_multiplier; // one normally, zero when rendering reflections + + bool pancake_shadows; } scene_data; diff --git a/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl b/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl index a8ee33a664..06dc4b13de 100644 --- a/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl +++ b/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl @@ -155,18 +155,14 @@ void main() { depth = imageLoad(source_depth, ivec2(pos - 0.5)).r; - if (-depth >= params.camera_z_far) { //went beyond camera - break; - } - z_from = z_to; z_to = z / w; if (depth > z_to) { // if depth was surpassed - if (depth <= max(z_to, z_from) + params.depth_tolerance) { - // check the depth tolerance - //check that normal is valid + if (depth <= max(z_to, z_from) + params.depth_tolerance && -depth < params.camera_z_far) { + // check the depth tolerance and far clip + // check that normal is valid found = true; } break; diff --git a/servers/rendering/rasterizer_rd/shaders/sky.glsl b/servers/rendering/rasterizer_rd/shaders/sky.glsl index 7b6de6a555..6c985e1f5c 100644 --- a/servers/rendering/rasterizer_rd/shaders/sky.glsl +++ b/servers/rendering/rasterizer_rd/shaders/sky.glsl @@ -62,7 +62,8 @@ layout(set = 0, binding = 2, std140) uniform SceneData { bool volumetric_fog_enabled; float volumetric_fog_inv_length; float volumetric_fog_detail_spread; - uint volumetric_fog_pad; + + float fog_aerial_perspective; vec3 fog_light_color; float fog_sun_scatter; @@ -140,8 +141,8 @@ vec4 volumetric_fog_process(vec2 screen_uv) { return texture(sampler3D(volumetric_fog_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), fog_pos); } -vec4 fog_process(vec3 view) { - vec3 fog_color = scene_data.fog_light_color; +vec4 fog_process(vec3 view, vec3 sky_color) { + vec3 fog_color = mix(scene_data.fog_light_color, sky_color, scene_data.fog_aerial_perspective); if (scene_data.fog_sun_scatter > 0.001) { vec4 sun_scatter = vec4(0.0); @@ -181,6 +182,7 @@ void main() { float alpha = 1.0; // Only available to subpasses vec4 half_res_color = vec4(1.0); vec4 quarter_res_color = vec4(1.0); + vec4 custom_fog = vec4(0.0); #ifdef USE_CUBEMAP_PASS vec3 inverted_cube_normal = cube_normal; @@ -223,14 +225,19 @@ FRAGMENT_SHADER_CODE #if !defined(DISABLE_FOG) && !defined(USE_CUBEMAP_PASS) + // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky. + if (scene_data.fog_enabled) { + vec4 fog = fog_process(cube_normal, frag_color.rgb); + frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a); + } + if (scene_data.volumetric_fog_enabled) { vec4 fog = volumetric_fog_process(uv); frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a); } - if (scene_data.fog_enabled) { - vec4 fog = fog_process(cube_normal); - frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a); + if (custom_fog.a > 0.0) { + frag_color.rgb = mix(frag_color.rgb, custom_fog.rgb, custom_fog.a); } #endif // DISABLE_FOG diff --git a/servers/rendering/rasterizer_rd/shaders/tonemap.glsl b/servers/rendering/rasterizer_rd/shaders/tonemap.glsl index b7c46a7d0e..341cdab1ef 100644 --- a/servers/rendering/rasterizer_rd/shaders/tonemap.glsl +++ b/servers/rendering/rasterizer_rd/shaders/tonemap.glsl @@ -37,16 +37,18 @@ layout(push_constant, binding = 1, std430) uniform Params { uvec2 glow_texture_size; float glow_intensity; - uint glow_level_flags; + uint pad3; uint glow_mode; + float glow_levels[7]; float exposure; float white; float auto_exposure_grey; + uint pad2; vec2 pixel_size; bool use_fxaa; - uint pad; + bool use_debanding; } params; @@ -155,6 +157,10 @@ vec3 tonemap_aces(vec3 color, float white) { } vec3 tonemap_reinhard(vec3 color, float white) { + // Ensure color values are positive. + // They can be negative in the case of negative lights, which leads to undesired behavior. + color = max(vec3(0.0), color); + return (white * color + color) / (color * white + white); } @@ -186,32 +192,32 @@ vec3 apply_tonemapping(vec3 color, float white) { // inputs are LINEAR, always o vec3 gather_glow(sampler2D tex, vec2 uv) { // sample all selected glow levels vec3 glow = vec3(0.0f); - if (bool(params.glow_level_flags & (1 << 0))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 0).rgb; + if (params.glow_levels[0] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 0).rgb * params.glow_levels[0]; } - if (bool(params.glow_level_flags & (1 << 1))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 1).rgb; + if (params.glow_levels[1] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 1).rgb * params.glow_levels[1]; } - if (bool(params.glow_level_flags & (1 << 2))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 2).rgb; + if (params.glow_levels[2] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 2).rgb * params.glow_levels[2]; } - if (bool(params.glow_level_flags & (1 << 3))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 3).rgb; + if (params.glow_levels[3] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 3).rgb * params.glow_levels[3]; } - if (bool(params.glow_level_flags & (1 << 4))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 4).rgb; + if (params.glow_levels[4] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 4).rgb * params.glow_levels[4]; } - if (bool(params.glow_level_flags & (1 << 5))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 5).rgb; + if (params.glow_levels[5] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 5).rgb * params.glow_levels[5]; } - if (bool(params.glow_level_flags & (1 << 6))) { - glow += GLOW_TEXTURE_SAMPLE(tex, uv, 6).rgb; + if (params.glow_levels[6] > 0.0001) { + glow += GLOW_TEXTURE_SAMPLE(tex, uv, 6).rgb * params.glow_levels[6]; } return glow; @@ -299,6 +305,18 @@ vec3 do_fxaa(vec3 color, float exposure, vec2 uv_interp) { } } +// From http://alex.vlachos.com/graphics/Alex_Vlachos_Advanced_VR_Rendering_GDC2015.pdf +// and https://www.shadertoy.com/view/MslGR8 (5th one starting from the bottom) +// NOTE: `frag_coord` is in pixels (i.e. not normalized UV). +vec3 screen_space_dither(vec2 frag_coord) { + // Iestyn's RGB dither (7 asm instructions) from Portal 2 X360, slightly modified for VR. + vec3 dither = vec3(dot(vec2(171.0, 231.0), frag_coord)); + dither.rgb = fract(dither.rgb / vec3(103.0, 71.0, 97.0)); + + // Subtract 0.5 to avoid slightly brightening the whole viewport. + return (dither.rgb - 0.5) / 255.0; +} + void main() { vec3 color = textureLod(source_color, uv_interp, 0.0f).rgb; @@ -322,6 +340,11 @@ void main() { if (params.use_fxaa) { color = do_fxaa(color, exposure, uv_interp); } + if (params.use_debanding) { + // For best results, debanding should be done before tonemapping. + // Otherwise, we're adding noise to an already-quantized image. + color += screen_space_dither(gl_FragCoord.xy); + } color = apply_tonemapping(color, params.white); color = linear_to_srgb(color); // regular linear -> SRGB conversion diff --git a/servers/rendering/rendering_device.cpp b/servers/rendering/rendering_device.cpp index 83cbfb85bd..1259b161bd 100644 --- a/servers/rendering/rendering_device.cpp +++ b/servers/rendering/rendering_device.cpp @@ -29,7 +29,7 @@ /*************************************************************************/ #include "rendering_device.h" -#include "core/method_bind_ext.gen.inc" + #include "rendering_device_binds.h" RenderingDevice *RenderingDevice::singleton = nullptr; diff --git a/servers/rendering/rendering_device.h b/servers/rendering/rendering_device.h index 72afc7c621..6df66e7b20 100644 --- a/servers/rendering/rendering_device.h +++ b/servers/rendering/rendering_device.h @@ -31,7 +31,7 @@ #ifndef RENDERING_DEVICE_H #define RENDERING_DEVICE_H -#include "core/object.h" +#include "core/class_db.h" #include "core/typed_array.h" #include "servers/display_server.h" diff --git a/servers/rendering/rendering_server_canvas.cpp b/servers/rendering/rendering_server_canvas.cpp index b3d5b0ad83..b0bff8b2c2 100644 --- a/servers/rendering/rendering_server_canvas.cpp +++ b/servers/rendering/rendering_server_canvas.cpp @@ -37,7 +37,7 @@ static const int z_range = RS::CANVAS_ITEM_Z_MAX - RS::CANVAS_ITEM_Z_MIN + 1; -void RenderingServerCanvas::_render_canvas_item_tree(RID p_to_render_target, Canvas::ChildItem *p_child_items, int p_child_item_count, Item *p_canvas_item, const Transform2D &p_transform, const Rect2 &p_clip_rect, const Color &p_modulate, RasterizerCanvas::Light *p_lights) { +void RenderingServerCanvas::_render_canvas_item_tree(RID p_to_render_target, Canvas::ChildItem *p_child_items, int p_child_item_count, Item *p_canvas_item, const Transform2D &p_transform, const Rect2 &p_clip_rect, const Color &p_modulate, RasterizerCanvas::Light *p_lights, RenderingServer::CanvasItemTextureFilter p_default_filter, RenderingServer::CanvasItemTextureRepeat p_default_repeat) { RENDER_TIMESTAMP("Cull CanvasItem Tree"); memset(z_list, 0, z_range * sizeof(RasterizerCanvas::Item *)); @@ -68,7 +68,7 @@ void RenderingServerCanvas::_render_canvas_item_tree(RID p_to_render_target, Can RENDER_TIMESTAMP("Render Canvas Items"); - RSG::canvas_render->canvas_render_items(p_to_render_target, list, p_modulate, p_lights, p_transform); + RSG::canvas_render->canvas_render_items(p_to_render_target, list, p_modulate, p_lights, p_transform, p_default_filter, p_default_repeat); } void _collect_ysort_children(RenderingServerCanvas::Item *p_canvas_item, Transform2D p_transform, RenderingServerCanvas::Item *p_material_owner, RenderingServerCanvas::Item **r_items, int &r_index) { @@ -243,7 +243,7 @@ void RenderingServerCanvas::_light_mask_canvas_items(int p_z, RasterizerCanvas:: } } -void RenderingServerCanvas::render_canvas(RID p_render_target, Canvas *p_canvas, const Transform2D &p_transform, RasterizerCanvas::Light *p_lights, RasterizerCanvas::Light *p_masked_lights, const Rect2 &p_clip_rect) { +void RenderingServerCanvas::render_canvas(RID p_render_target, Canvas *p_canvas, const Transform2D &p_transform, RasterizerCanvas::Light *p_lights, RasterizerCanvas::Light *p_masked_lights, const Rect2 &p_clip_rect, RenderingServer::CanvasItemTextureFilter p_default_filter, RenderingServer::CanvasItemTextureRepeat p_default_repeat) { RENDER_TIMESTAMP(">Render Canvas"); if (p_canvas->children_order_dirty) { @@ -263,26 +263,26 @@ void RenderingServerCanvas::render_canvas(RID p_render_target, Canvas *p_canvas, } if (!has_mirror) { - _render_canvas_item_tree(p_render_target, ci, l, nullptr, p_transform, p_clip_rect, p_canvas->modulate, p_lights); + _render_canvas_item_tree(p_render_target, ci, l, nullptr, p_transform, p_clip_rect, p_canvas->modulate, p_lights, p_default_filter, p_default_repeat); } else { //used for parallaxlayer mirroring for (int i = 0; i < l; i++) { const Canvas::ChildItem &ci2 = p_canvas->child_items[i]; - _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, p_transform, p_clip_rect, p_canvas->modulate, p_lights); + _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, p_transform, p_clip_rect, p_canvas->modulate, p_lights, p_default_filter, p_default_repeat); //mirroring (useful for scrolling backgrounds) if (ci2.mirror.x != 0) { Transform2D xform2 = p_transform * Transform2D(0, Vector2(ci2.mirror.x, 0)); - _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights); + _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights, p_default_filter, p_default_repeat); } if (ci2.mirror.y != 0) { Transform2D xform2 = p_transform * Transform2D(0, Vector2(0, ci2.mirror.y)); - _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights); + _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights, p_default_filter, p_default_repeat); } if (ci2.mirror.y != 0 && ci2.mirror.x != 0) { Transform2D xform2 = p_transform * Transform2D(0, ci2.mirror); - _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights); + _render_canvas_item_tree(p_render_target, nullptr, 0, ci2.item, xform2, p_clip_rect, p_canvas->modulate, p_lights, p_default_filter, p_default_repeat); } } } @@ -451,18 +451,6 @@ void RenderingServerCanvas::canvas_item_set_update_when_visible(RID p_item, bool canvas_item->update_when_visible = p_update; } -void RenderingServerCanvas::canvas_item_set_default_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter) { - Item *canvas_item = canvas_item_owner.getornull(p_item); - ERR_FAIL_COND(!canvas_item); - canvas_item->texture_filter = p_filter; -} - -void RenderingServerCanvas::canvas_item_set_default_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat) { - Item *canvas_item = canvas_item_owner.getornull(p_item); - ERR_FAIL_COND(!canvas_item); - canvas_item->texture_repeat = p_repeat; -} - void RenderingServerCanvas::canvas_item_add_line(RID p_item, const Point2 &p_from, const Point2 &p_to, const Color &p_color, float p_width) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); @@ -484,7 +472,6 @@ void RenderingServerCanvas::canvas_item_add_line(RID p_item, const Point2 &p_fro for (uint32_t i = 0; i < line->point_count; i++) { line->colors[i] = p_color; } - line->specular_shininess = Color(1, 1, 1, 1); } void RenderingServerCanvas::canvas_item_add_polyline(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width) { @@ -495,8 +482,6 @@ void RenderingServerCanvas::canvas_item_add_polyline(RID p_item, const Vector<Po Item::CommandPolygon *pline = canvas_item->alloc_command<Item::CommandPolygon>(); ERR_FAIL_COND(!pline); - pline->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, RID(), RID(), RID(), RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED, RID()); - if (true || p_width <= 1) { #define TODO make thick lines possible Vector<int> indices; @@ -511,7 +496,6 @@ void RenderingServerCanvas::canvas_item_add_polyline(RID p_item, const Vector<Po } pline->primitive = RS::PRIMITIVE_LINES; - pline->specular_shininess = Color(1, 1, 1, 1); pline->polygon.create(indices, p_points, p_colors); } else { #if 0 @@ -586,13 +570,10 @@ void RenderingServerCanvas::canvas_item_add_multiline(RID p_item, const Vector<P Item::CommandPolygon *pline = canvas_item->alloc_command<Item::CommandPolygon>(); ERR_FAIL_COND(!pline); - pline->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, RID(), RID(), RID(), RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED, RID()); - if (true || p_width <= 1) { #define TODO make thick lines possible pline->primitive = RS::PRIMITIVE_LINES; - pline->specular_shininess = Color(1, 1, 1, 1); pline->polygon.create(Vector<int>(), p_points, p_colors); } else { } @@ -615,10 +596,7 @@ void RenderingServerCanvas::canvas_item_add_circle(RID p_item, const Point2 &p_p Item::CommandPolygon *circle = canvas_item->alloc_command<Item::CommandPolygon>(); ERR_FAIL_COND(!circle); - circle->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, RID(), RID(), RID(), RS::CANVAS_ITEM_TEXTURE_FILTER_NEAREST, RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED, RID()); - circle->primitive = RS::PRIMITIVE_TRIANGLES; - circle->specular_shininess = Color(1, 1, 1, 1); Vector<int> indices; Vector<Vector2> points; @@ -645,7 +623,7 @@ void RenderingServerCanvas::canvas_item_add_circle(RID p_item, const Point2 &p_p circle->polygon.create(indices, points, color); } -void RenderingServerCanvas::canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile, const Color &p_modulate, bool p_transpose, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile, const Color &p_modulate, bool p_transpose) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); @@ -672,11 +650,11 @@ void RenderingServerCanvas::canvas_item_add_texture_rect(RID p_item, const Rect2 rect->flags |= RasterizerCanvas::CANVAS_RECT_TRANSPOSE; SWAP(rect->rect.size.x, rect->rect.size.y); } - rect->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - rect->specular_shininess = p_specular_color_shininess; + + rect->texture = p_texture; } -void RenderingServerCanvas::canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, bool p_clip_uv, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate, bool p_transpose, bool p_clip_uv) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); @@ -684,8 +662,9 @@ void RenderingServerCanvas::canvas_item_add_texture_rect_region(RID p_item, cons ERR_FAIL_COND(!rect); rect->modulate = p_modulate; rect->rect = p_rect; - rect->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - rect->specular_shininess = p_specular_color_shininess; + + rect->texture = p_texture; + rect->source = p_src_rect; rect->flags = RasterizerCanvas::CANVAS_RECT_REGION; @@ -716,14 +695,15 @@ void RenderingServerCanvas::canvas_item_add_texture_rect_region(RID p_item, cons } } -void RenderingServerCanvas::canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, RS::NinePatchAxisMode p_x_axis_mode, RS::NinePatchAxisMode p_y_axis_mode, bool p_draw_center, const Color &p_modulate, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, RS::NinePatchAxisMode p_x_axis_mode, RS::NinePatchAxisMode p_y_axis_mode, bool p_draw_center, const Color &p_modulate) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); Item::CommandNinePatch *style = canvas_item->alloc_command<Item::CommandNinePatch>(); ERR_FAIL_COND(!style); - style->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - style->specular_shininess = p_specular_color_shininess; + + style->texture = p_texture; + style->rect = p_rect; style->source = p_source; style->draw_center = p_draw_center; @@ -736,7 +716,7 @@ void RenderingServerCanvas::canvas_item_add_nine_patch(RID p_item, const Rect2 & style->axis_y = p_y_axis_mode; } -void RenderingServerCanvas::canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width) { uint32_t pc = p_points.size(); ERR_FAIL_COND(pc == 0 || pc > 4); @@ -762,11 +742,10 @@ void RenderingServerCanvas::canvas_item_add_primitive(RID p_item, const Vector<P prim->point_count = p_points.size(); - prim->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - prim->specular_shininess = p_specular_color_shininess; + prim->texture = p_texture; } -void RenderingServerCanvas::canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); #ifdef DEBUG_ENABLED @@ -783,12 +762,11 @@ void RenderingServerCanvas::canvas_item_add_polygon(RID p_item, const Vector<Poi Item::CommandPolygon *polygon = canvas_item->alloc_command<Item::CommandPolygon>(); ERR_FAIL_COND(!polygon); polygon->primitive = RS::PRIMITIVE_TRIANGLES; - polygon->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - polygon->specular_shininess = p_specular_color_shininess; + polygon->texture = p_texture; polygon->polygon.create(indices, p_points, p_colors, p_uvs); } -void RenderingServerCanvas::canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, const Vector<int> &p_bones, const Vector<float> &p_weights, RID p_texture, int p_count, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, const Vector<int> &p_bones, const Vector<float> &p_weights, RID p_texture, int p_count) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); @@ -803,8 +781,9 @@ void RenderingServerCanvas::canvas_item_add_triangle_array(RID p_item, const Vec Item::CommandPolygon *polygon = canvas_item->alloc_command<Item::CommandPolygon>(); ERR_FAIL_COND(!polygon); - polygon->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - polygon->specular_shininess = p_specular_color_shininess; + + polygon->texture = p_texture; + polygon->polygon.create(indices, p_points, p_colors, p_uvs, p_bones, p_weights); polygon->primitive = RS::PRIMITIVE_TRIANGLES; @@ -819,42 +798,43 @@ void RenderingServerCanvas::canvas_item_add_set_transform(RID p_item, const Tran tr->xform = p_transform; } -void RenderingServerCanvas::canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform, const Color &p_modulate, RID p_texture, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform, const Color &p_modulate, RID p_texture) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); Item::CommandMesh *m = canvas_item->alloc_command<Item::CommandMesh>(); ERR_FAIL_COND(!m); m->mesh = p_mesh; - m->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - m->specular_shininess = p_specular_color_shininess; + + m->texture = p_texture; + m->transform = p_transform; m->modulate = p_modulate; } -void RenderingServerCanvas::canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); Item::CommandParticles *part = canvas_item->alloc_command<Item::CommandParticles>(); ERR_FAIL_COND(!part); part->particles = p_particles; - part->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, RID()); - part->specular_shininess = p_specular_color_shininess; + + part->texture = p_texture; //take the chance and request processing for them, at least once until they become visible again RSG::storage->particles_request_process(p_particles); } -void RenderingServerCanvas::canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture, RID p_normal_map, RID p_specular_map, const Color &p_specular_color_shininess, RenderingServer::CanvasItemTextureFilter p_filter, RenderingServer::CanvasItemTextureRepeat p_repeat) { +void RenderingServerCanvas::canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture) { Item *canvas_item = canvas_item_owner.getornull(p_item); ERR_FAIL_COND(!canvas_item); Item::CommandMultiMesh *mm = canvas_item->alloc_command<Item::CommandMultiMesh>(); ERR_FAIL_COND(!mm); mm->multimesh = p_mesh; - mm->texture_binding.create(canvas_item->texture_filter, canvas_item->texture_repeat, p_texture, p_normal_map, p_specular_map, p_filter, p_repeat, mm->multimesh); - mm->specular_shininess = p_specular_color_shininess; + + mm->texture = p_texture; } void RenderingServerCanvas::canvas_item_add_clip_ignore(RID p_item, bool p_ignore) { @@ -1007,6 +987,9 @@ void RenderingServerCanvas::canvas_light_set_texture(RID p_light, RID p_texture) RasterizerCanvas::Light *clight = canvas_light_owner.getornull(p_light); ERR_FAIL_COND(!clight); + if (clight->texture == p_texture) { + return; + } clight->texture = p_texture; clight->version++; RSG::canvas_render->light_set_texture(clight->light_internal, p_texture); @@ -1086,24 +1069,7 @@ void RenderingServerCanvas::canvas_light_set_shadow_enabled(RID p_light, bool p_ } clight->use_shadow = p_enabled; clight->version++; - RSG::canvas_render->light_set_use_shadow(clight->light_internal, clight->use_shadow, clight->shadow_buffer_size); -} - -void RenderingServerCanvas::canvas_light_set_shadow_buffer_size(RID p_light, int p_size) { - ERR_FAIL_COND(p_size < 32 || p_size > 16384); - - RasterizerCanvas::Light *clight = canvas_light_owner.getornull(p_light); - ERR_FAIL_COND(!clight); - - int new_size = next_power_of_2(p_size); - if (new_size == clight->shadow_buffer_size) { - return; - } - - clight->shadow_buffer_size = next_power_of_2(p_size); - clight->version++; - - RSG::canvas_render->light_set_use_shadow(clight->light_internal, clight->use_shadow, clight->shadow_buffer_size); + RSG::canvas_render->light_set_use_shadow(clight->light_internal, clight->use_shadow); } void RenderingServerCanvas::canvas_light_set_shadow_filter(RID p_light, RS::CanvasLightShadowFilter p_filter) { @@ -1271,6 +1237,41 @@ void RenderingServerCanvas::canvas_occluder_polygon_set_cull_mode(RID p_occluder } } +void RenderingServerCanvas::canvas_set_shadow_texture_size(int p_size) { + RSG::canvas_render->set_shadow_texture_size(p_size); +} + +RID RenderingServerCanvas::canvas_texture_create() { + return RSG::storage->canvas_texture_create(); +} + +void RenderingServerCanvas::canvas_texture_set_channel(RID p_canvas_texture, RS::CanvasTextureChannel p_channel, RID p_texture) { + RSG::storage->canvas_texture_set_channel(p_canvas_texture, p_channel, p_texture); +} + +void RenderingServerCanvas::canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_base_color, float p_shininess) { + RSG::storage->canvas_texture_set_shading_parameters(p_canvas_texture, p_base_color, p_shininess); +} + +void RenderingServerCanvas::canvas_texture_set_texture_filter(RID p_canvas_texture, RS::CanvasItemTextureFilter p_filter) { + RSG::storage->canvas_texture_set_texture_filter(p_canvas_texture, p_filter); +} + +void RenderingServerCanvas::canvas_texture_set_texture_repeat(RID p_canvas_texture, RS::CanvasItemTextureRepeat p_repeat) { + RSG::storage->canvas_texture_set_texture_repeat(p_canvas_texture, p_repeat); +} + +void RenderingServerCanvas::canvas_item_set_default_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter) { + Item *ci = canvas_item_owner.getornull(p_item); + ERR_FAIL_COND(!ci); + ci->texture_filter = p_filter; +} +void RenderingServerCanvas::canvas_item_set_default_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat) { + Item *ci = canvas_item_owner.getornull(p_item); + ERR_FAIL_COND(!ci); + ci->texture_repeat = p_repeat; +} + bool RenderingServerCanvas::free(RID p_rid) { if (canvas_owner.owns(p_rid)) { Canvas *canvas = canvas_owner.getornull(p_rid); diff --git a/servers/rendering/rendering_server_canvas.h b/servers/rendering/rendering_server_canvas.h index cebe32fba0..16edfd54e1 100644 --- a/servers/rendering/rendering_server_canvas.h +++ b/servers/rendering/rendering_server_canvas.h @@ -52,8 +52,6 @@ public: Transform2D ysort_xform; Vector2 ysort_pos; int ysort_index; - RS::CanvasItemTextureFilter texture_filter; - RS::CanvasItemTextureRepeat texture_repeat; Vector<Item *> child_items; @@ -71,8 +69,6 @@ public: ysort_xform = Transform2D(); ysort_pos = Vector2(); ysort_index = 0; - texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT; - texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT; } }; @@ -158,7 +154,7 @@ public: bool disable_scale; private: - void _render_canvas_item_tree(RID p_to_render_target, Canvas::ChildItem *p_child_items, int p_child_item_count, Item *p_canvas_item, const Transform2D &p_transform, const Rect2 &p_clip_rect, const Color &p_modulate, RasterizerCanvas::Light *p_lights); + void _render_canvas_item_tree(RID p_to_render_target, Canvas::ChildItem *p_child_items, int p_child_item_count, Item *p_canvas_item, const Transform2D &p_transform, const Rect2 &p_clip_rect, const Color &p_modulate, RasterizerCanvas::Light *p_lights, RS::CanvasItemTextureFilter p_default_filter, RS::CanvasItemTextureRepeat p_default_repeat); void _cull_canvas_item(Item *p_canvas_item, const Transform2D &p_transform, const Rect2 &p_clip_rect, const Color &p_modulate, int p_z, RasterizerCanvas::Item **z_list, RasterizerCanvas::Item **z_last_list, Item *p_canvas_clip, Item *p_material_owner); void _light_mask_canvas_items(int p_z, RasterizerCanvas::Item *p_canvas_item, RasterizerCanvas::Light *p_masked_lights); @@ -166,7 +162,7 @@ private: RasterizerCanvas::Item **z_last_list; public: - void render_canvas(RID p_render_target, Canvas *p_canvas, const Transform2D &p_transform, RasterizerCanvas::Light *p_lights, RasterizerCanvas::Light *p_masked_lights, const Rect2 &p_clip_rect); + void render_canvas(RID p_render_target, Canvas *p_canvas, const Transform2D &p_transform, RasterizerCanvas::Light *p_lights, RasterizerCanvas::Light *p_masked_lights, const Rect2 &p_clip_rect, RS::CanvasItemTextureFilter p_default_filter, RS::CanvasItemTextureRepeat p_default_repeat); RID canvas_create(); void canvas_set_item_mirroring(RID p_canvas, RID p_item, const Point2 &p_mirroring); @@ -191,23 +187,20 @@ public: void canvas_item_set_update_when_visible(RID p_item, bool p_update); - void canvas_item_set_default_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter); - void canvas_item_set_default_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat); - void canvas_item_add_line(RID p_item, const Point2 &p_from, const Point2 &p_to, const Color &p_color, float p_width = 1.0); void canvas_item_add_polyline(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0); void canvas_item_add_multiline(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0); void canvas_item_add_rect(RID p_item, const Rect2 &p_rect, const Color &p_color); void canvas_item_add_circle(RID p_item, const Point2 &p_pos, float p_radius, const Color &p_color); - void canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), bool p_clip_uv = false, RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, RS::NinePatchAxisMode p_x_axis_mode = RS::NINE_PATCH_STRETCH, RS::NinePatchAxisMode p_y_axis_mode = RS::NINE_PATCH_STRETCH, bool p_draw_center = true, const Color &p_modulate = Color(1, 1, 1), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width = 1.0, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>(), RID p_texture = RID(), int p_count = -1, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); - void canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture, RID p_normal_map, RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), RS::CanvasItemTextureFilter p_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, RS::CanvasItemTextureRepeat p_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT); + void canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false); + void canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = false); + void canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, RS::NinePatchAxisMode p_x_axis_mode = RS::NINE_PATCH_STRETCH, RS::NinePatchAxisMode p_y_axis_mode = RS::NINE_PATCH_STRETCH, bool p_draw_center = true, const Color &p_modulate = Color(1, 1, 1)); + void canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width = 1.0); + void canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), RID p_texture = RID()); + void canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>(), RID p_texture = RID(), int p_count = -1); + void canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), RID p_texture = RID()); + void canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture = RID()); + void canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture); void canvas_item_add_set_transform(RID p_item, const Transform2D &p_transform); void canvas_item_add_clip_ignore(RID p_item, bool p_ignore); void canvas_item_set_sort_children_by_y(RID p_item, bool p_enable); @@ -241,7 +234,6 @@ public: void canvas_light_set_mode(RID p_light, RS::CanvasLightMode p_mode); void canvas_light_set_shadow_enabled(RID p_light, bool p_enabled); - void canvas_light_set_shadow_buffer_size(RID p_light, int p_size); void canvas_light_set_shadow_filter(RID p_light, RS::CanvasLightShadowFilter p_filter); void canvas_light_set_shadow_color(RID p_light, const Color &p_color); void canvas_light_set_shadow_smooth(RID p_light, float p_smooth); @@ -259,6 +251,18 @@ public: void canvas_occluder_polygon_set_cull_mode(RID p_occluder_polygon, RS::CanvasOccluderPolygonCullMode p_mode); + void canvas_set_shadow_texture_size(int p_size); + + RID canvas_texture_create(); + void canvas_texture_set_channel(RID p_canvas_texture, RS::CanvasTextureChannel p_channel, RID p_texture); + void canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_base_color, float p_shininess); + + void canvas_texture_set_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter); + void canvas_texture_set_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat); + + void canvas_item_set_default_texture_filter(RID p_item, RS::CanvasItemTextureFilter p_filter); + void canvas_item_set_default_texture_repeat(RID p_item, RS::CanvasItemTextureRepeat p_repeat); + bool free(RID p_rid); RenderingServerCanvas(); ~RenderingServerCanvas(); diff --git a/servers/rendering/rendering_server_raster.cpp b/servers/rendering/rendering_server_raster.cpp index b12e2ff3c1..cbc91497ba 100644 --- a/servers/rendering/rendering_server_raster.cpp +++ b/servers/rendering/rendering_server_raster.cpp @@ -108,6 +108,9 @@ void RenderingServerRaster::draw(bool p_swap_buffers, double frame_step) { RSG::scene->update_dirty_instances(); //update scene stuff + RSG::scene->render_particle_colliders(); + RSG::storage->update_particles(); //need to be done after instances are updated (colliders and particle transforms), and colliders are rendered + RSG::scene->render_probes(); RSG::viewport->draw_viewports(); RSG::canvas_render->update(); diff --git a/servers/rendering/rendering_server_raster.h b/servers/rendering/rendering_server_raster.h index b554425bef..5744b40321 100644 --- a/servers/rendering/rendering_server_raster.h +++ b/servers/rendering/rendering_server_raster.h @@ -452,6 +452,7 @@ public: BIND1(particles_restart, RID) BIND6(particles_emit, RID, const Transform &, const Vector3 &, const Color &, const Color &, uint32_t) BIND2(particles_set_subemitter, RID, RID) + BIND2(particles_set_collision_base_size, RID, float) BIND2(particles_set_draw_order, RID, RS::ParticlesDrawOrder) @@ -461,6 +462,21 @@ public: BIND1R(AABB, particles_get_current_aabb, RID) BIND2(particles_set_emission_transform, RID, const Transform &) + /* PARTICLES COLLISION */ + + BIND0R(RID, particles_collision_create) + + BIND2(particles_collision_set_collision_type, RID, ParticlesCollisionType) + BIND2(particles_collision_set_cull_mask, RID, uint32_t) + BIND2(particles_collision_set_sphere_radius, RID, float) + BIND2(particles_collision_set_box_extents, RID, const Vector3 &) + BIND2(particles_collision_set_attractor_strength, RID, float) + BIND2(particles_collision_set_attractor_directionality, RID, float) + BIND2(particles_collision_set_attractor_attenuation, RID, float) + BIND2(particles_collision_set_field_texture, RID, RID) + BIND1(particles_collision_height_field_update, RID) + BIND2(particles_collision_set_height_field_resolution, RID, ParticlesCollisionHeightfieldResolution) + #undef BINDBASE //from now on, calls forwarded to this singleton #define BINDBASE RSG::scene @@ -513,12 +529,16 @@ public: BIND3(viewport_set_canvas_transform, RID, RID, const Transform2D &) BIND2(viewport_set_transparent_background, RID, bool) + BIND2(viewport_set_default_canvas_item_texture_filter, RID, CanvasItemTextureFilter) + BIND2(viewport_set_default_canvas_item_texture_repeat, RID, CanvasItemTextureRepeat) + BIND2(viewport_set_global_canvas_transform, RID, const Transform2D &) BIND4(viewport_set_canvas_stacking, RID, RID, int, int) BIND2(viewport_set_shadow_atlas_size, RID, int) BIND3(viewport_set_shadow_atlas_quadrant_subdivision, RID, int, int) BIND2(viewport_set_msaa, RID, ViewportMSAA) BIND2(viewport_set_screen_space_aa, RID, ViewportScreenSpaceAA) + BIND2(viewport_set_use_debanding, RID, bool) BIND2R(int, viewport_get_render_info, RID, ViewportRenderInfo) BIND2(viewport_set_debug_draw, RID, ViewportDebugDraw) @@ -565,7 +585,7 @@ public: BIND9(environment_set_ssao, RID, bool, float, float, float, float, float, EnvironmentSSAOBlur, float) BIND2(environment_set_ssao_quality, EnvironmentSSAOQuality, bool) - BIND11(environment_set_glow, RID, bool, int, float, float, float, float, EnvironmentGlowBlendMode, float, float, float) + BIND11(environment_set_glow, RID, bool, Vector<float>, float, float, float, float, EnvironmentGlowBlendMode, float, float, float) BIND1(environment_glow_set_use_bicubic_upscale, bool) BIND1(environment_glow_set_use_high_quality, bool) @@ -573,7 +593,7 @@ public: BIND6(environment_set_adjustment, RID, bool, float, float, float, RID) - BIND8(environment_set_fog, RID, bool, const Color &, float, float, float, float, float) + BIND9(environment_set_fog, RID, bool, const Color &, float, float, float, float, float, float) BIND9(environment_set_volumetric_fog, RID, bool, float, const Color &, float, float, float, float, EnvVolumetricFogShadowFilter) BIND2(environment_set_volumetric_fog_volume_size, int, int) @@ -667,9 +687,19 @@ public: BIND3(canvas_set_parent, RID, RID, float) BIND1(canvas_set_disable_scale, bool) + BIND0R(RID, canvas_texture_create) + BIND3(canvas_texture_set_channel, RID, CanvasTextureChannel, RID) + BIND3(canvas_texture_set_shading_parameters, RID, const Color &, float) + + BIND2(canvas_texture_set_texture_filter, RID, CanvasItemTextureFilter) + BIND2(canvas_texture_set_texture_repeat, RID, CanvasItemTextureRepeat) + BIND0R(RID, canvas_item_create) BIND2(canvas_item_set_parent, RID, RID) + BIND2(canvas_item_set_default_texture_filter, RID, CanvasItemTextureFilter) + BIND2(canvas_item_set_default_texture_repeat, RID, CanvasItemTextureRepeat) + BIND2(canvas_item_set_visible, RID, bool) BIND2(canvas_item_set_light_mask, RID, int) @@ -684,23 +714,20 @@ public: BIND2(canvas_item_set_draw_behind_parent, RID, bool) - BIND2(canvas_item_set_default_texture_filter, RID, CanvasItemTextureFilter) - BIND2(canvas_item_set_default_texture_repeat, RID, CanvasItemTextureRepeat) - BIND5(canvas_item_add_line, RID, const Point2 &, const Point2 &, const Color &, float) BIND4(canvas_item_add_polyline, RID, const Vector<Point2> &, const Vector<Color> &, float) BIND4(canvas_item_add_multiline, RID, const Vector<Point2> &, const Vector<Color> &, float) BIND3(canvas_item_add_rect, RID, const Rect2 &, const Color &) BIND4(canvas_item_add_circle, RID, const Point2 &, float, const Color &) - BIND11(canvas_item_add_texture_rect, RID, const Rect2 &, RID, bool, const Color &, bool, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND12(canvas_item_add_texture_rect_region, RID, const Rect2 &, RID, const Rect2 &, const Color &, bool, RID, RID, const Color &, bool, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND15(canvas_item_add_nine_patch, RID, const Rect2 &, const Rect2 &, RID, const Vector2 &, const Vector2 &, NinePatchAxisMode, NinePatchAxisMode, bool, const Color &, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND11(canvas_item_add_primitive, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, float, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND10(canvas_item_add_polygon, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND14(canvas_item_add_triangle_array, RID, const Vector<int> &, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, const Vector<int> &, const Vector<float> &, RID, int, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND10(canvas_item_add_mesh, RID, const RID &, const Transform2D &, const Color &, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND8(canvas_item_add_multimesh, RID, RID, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - BIND8(canvas_item_add_particles, RID, RID, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) + BIND6(canvas_item_add_texture_rect, RID, const Rect2 &, RID, bool, const Color &, bool) + BIND7(canvas_item_add_texture_rect_region, RID, const Rect2 &, RID, const Rect2 &, const Color &, bool, bool) + BIND10(canvas_item_add_nine_patch, RID, const Rect2 &, const Rect2 &, RID, const Vector2 &, const Vector2 &, NinePatchAxisMode, NinePatchAxisMode, bool, const Color &) + BIND6(canvas_item_add_primitive, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, float) + BIND5(canvas_item_add_polygon, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID) + BIND9(canvas_item_add_triangle_array, RID, const Vector<int> &, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, const Vector<int> &, const Vector<float> &, RID, int) + BIND5(canvas_item_add_mesh, RID, const RID &, const Transform2D &, const Color &, RID) + BIND3(canvas_item_add_multimesh, RID, RID, RID) + BIND3(canvas_item_add_particles, RID, RID, RID) BIND2(canvas_item_add_set_transform, RID, const Transform2D &) BIND2(canvas_item_add_clip_ignore, RID, bool) BIND2(canvas_item_set_sort_children_by_y, RID, bool) @@ -734,7 +761,6 @@ public: BIND2(canvas_light_set_mode, RID, CanvasLightMode) BIND2(canvas_light_set_shadow_enabled, RID, bool) - BIND2(canvas_light_set_shadow_buffer_size, RID, int) BIND2(canvas_light_set_shadow_filter, RID, CanvasLightShadowFilter) BIND2(canvas_light_set_shadow_color, RID, const Color &) BIND2(canvas_light_set_shadow_smooth, RID, float) @@ -752,6 +778,8 @@ public: BIND2(canvas_occluder_polygon_set_cull_mode, RID, CanvasOccluderPolygonCullMode) + BIND1(canvas_set_shadow_texture_size, int) + /* GLOBAL VARIABLES */ #undef BINDBASE diff --git a/servers/rendering/rendering_server_scene.cpp b/servers/rendering/rendering_server_scene.cpp index d8e52a5aae..ae6786090a 100644 --- a/servers/rendering/rendering_server_scene.cpp +++ b/servers/rendering/rendering_server_scene.cpp @@ -193,6 +193,8 @@ void *RenderingServerScene::_instance_pair(void *p_self, OctreeElementID, Instan } else if (B->base_type == RS::INSTANCE_GI_PROBE && A->base_type == RS::INSTANCE_LIGHT) { InstanceGIProbeData *gi_probe = static_cast<InstanceGIProbeData *>(B->base_data); return gi_probe->lights.insert(A); + } else if (B->base_type == RS::INSTANCE_PARTICLES_COLLISION && A->base_type == RS::INSTANCE_PARTICLES) { + RSG::storage->particles_add_collision(A->base, B); } return nullptr; @@ -274,6 +276,8 @@ void RenderingServerScene::_instance_unpair(void *p_self, OctreeElementID, Insta Set<Instance *>::Element *E = reinterpret_cast<Set<Instance *>::Element *>(udata); gi_probe->lights.erase(E); + } else if (B->base_type == RS::INSTANCE_PARTICLES_COLLISION && A->base_type == RS::INSTANCE_PARTICLES) { + RSG::storage->particles_remove_collision(A->base, B); } } @@ -539,6 +543,9 @@ void RenderingServerScene::instance_set_scenario(RID p_instance, RID p_scenario) RSG::scene_render->reflection_probe_release_atlas_index(reflection_probe->instance); } break; + case RS::INSTANCE_PARTICLES_COLLISION: { + heightfield_particle_colliders_update_list.erase(instance); + } break; case RS::INSTANCE_GI_PROBE: { InstanceGIProbeData *gi_probe = static_cast<InstanceGIProbeData *>(instance->base_data); @@ -702,6 +709,12 @@ void RenderingServerScene::instance_set_visible(RID p_instance, bool p_visible) } } break; + case RS::INSTANCE_PARTICLES_COLLISION: { + if (instance->octree_id && instance->scenario) { + instance->scenario->octree.set_pairable(instance->octree_id, p_visible, 1 << RS::INSTANCE_PARTICLES_COLLISION, p_visible ? (1 << RS::INSTANCE_PARTICLES) : 0); + } + + } break; default: { } } @@ -1026,6 +1039,13 @@ void RenderingServerScene::_update_instance(Instance *p_instance) { RSG::storage->particles_set_emission_transform(p_instance->base, p_instance->transform); } + if (p_instance->base_type == RS::INSTANCE_PARTICLES_COLLISION) { + //remove materials no longer used and un-own them + if (RSG::storage->particles_collision_is_heightfield(p_instance->base)) { + heightfield_particle_colliders_update_list.insert(p_instance); + } + } + if (p_instance->aabb.has_no_surface()) { return; } @@ -1085,6 +1105,11 @@ void RenderingServerScene::_update_instance(Instance *p_instance) { pairable = true; } + if (p_instance->base_type == RS::INSTANCE_PARTICLES_COLLISION) { + pairable_mask = p_instance->visible ? (1 << RS::INSTANCE_PARTICLES) : 0; + pairable = true; + } + if (p_instance->base_type == RS::INSTANCE_GI_PROBE) { //lights and geometries pairable_mask = p_instance->visible ? RS::INSTANCE_GEOMETRY_MASK | (1 << RS::INSTANCE_LIGHT) : 0; @@ -1146,6 +1171,10 @@ void RenderingServerScene::_update_instance_aabb(Instance *p_instance) { } } break; + case RenderingServer::INSTANCE_PARTICLES_COLLISION: { + new_aabb = RSG::storage->particles_collision_get_aabb(p_instance->base); + + } break; case RenderingServer::INSTANCE_LIGHT: { new_aabb = RSG::storage->light_get_aabb(p_instance->base); @@ -2679,6 +2708,27 @@ void RenderingServerScene::render_probes() { } } +void RenderingServerScene::render_particle_colliders() { + while (heightfield_particle_colliders_update_list.front()) { + Instance *hfpc = heightfield_particle_colliders_update_list.front()->get(); + + if (hfpc->scenario && hfpc->base_type == RS::INSTANCE_PARTICLES_COLLISION && RSG::storage->particles_collision_is_heightfield(hfpc->base)) { + //update heightfield + int cull_count = hfpc->scenario->octree.cull_aabb(hfpc->transformed_aabb, instance_cull_result, MAX_INSTANCE_CULL); //@TODO: cull mask missing + for (int i = 0; i < cull_count; i++) { + Instance *instance = instance_cull_result[i]; + if (!instance->visible || !((1 << instance->base_type) & (RS::INSTANCE_GEOMETRY_MASK & (~(1 << RS::INSTANCE_PARTICLES))))) { //all but particles to avoid self collision + cull_count--; + SWAP(instance_cull_result[i], instance_cull_result[cull_count]); + } + } + + RSG::scene_render->render_particle_collider_heightfield(hfpc->base, hfpc->transform, (RasterizerScene::InstanceBase **)instance_cull_result, cull_count); + } + heightfield_particle_colliders_update_list.erase(heightfield_particle_colliders_update_list.front()); + } +} + void RenderingServerScene::_update_instance_shader_parameters_from_material(Map<StringName, RasterizerScene::InstanceBase::InstanceShaderParameter> &isparams, const Map<StringName, RasterizerScene::InstanceBase::InstanceShaderParameter> &existing_isparams, RID p_material) { List<RasterizerStorage::InstanceShaderParam> plist; RSG::storage->material_get_instance_shader_parameters(p_material, &plist); diff --git a/servers/rendering/rendering_server_scene.h b/servers/rendering/rendering_server_scene.h index 165c3784c1..1b0a617627 100644 --- a/servers/rendering/rendering_server_scene.h +++ b/servers/rendering/rendering_server_scene.h @@ -385,6 +385,8 @@ public: } }; + Set<Instance *> heightfield_particle_colliders_update_list; + int instance_cull_count; Instance *instance_cull_result[MAX_INSTANCE_CULL]; Instance *instance_shadow_cull_result[MAX_INSTANCE_CULL]; //used for generating shadowmaps @@ -461,6 +463,7 @@ public: void render_camera(RID p_render_buffers, Ref<XRInterface> &p_interface, XRInterface::Eyes p_eye, RID p_camera, RID p_scenario, Size2 p_viewport_size, RID p_shadow_atlas); void update_dirty_instances(); + void render_particle_colliders(); void render_probes(); TypedArray<Image> bake_render_uv2(RID p_base, const Vector<RID> &p_material_overrides, const Size2i &p_image_size); diff --git a/servers/rendering/rendering_server_viewport.cpp b/servers/rendering/rendering_server_viewport.cpp index 48be6ca13b..a8dbe1e254 100644 --- a/servers/rendering/rendering_server_viewport.cpp +++ b/servers/rendering/rendering_server_viewport.cpp @@ -115,7 +115,7 @@ void RenderingServerViewport::_draw_viewport(Viewport *p_viewport, XRInterface:: if ((scenario_draw_canvas_bg || can_draw_3d) && !p_viewport->render_buffers.is_valid()) { //wants to draw 3D but there is no render buffer, create p_viewport->render_buffers = RSG::scene_render->render_buffers_create(); - RSG::scene_render->render_buffers_configure(p_viewport->render_buffers, p_viewport->render_target, p_viewport->size.width, p_viewport->size.height, p_viewport->msaa, p_viewport->screen_space_aa); + RSG::scene_render->render_buffers_configure(p_viewport->render_buffers, p_viewport->render_target, p_viewport->size.width, p_viewport->size.height, p_viewport->msaa, p_viewport->screen_space_aa, p_viewport->use_debanding); } RSG::storage->render_target_request_clear(p_viewport->render_target, bgcolor); @@ -136,6 +136,7 @@ void RenderingServerViewport::_draw_viewport(Viewport *p_viewport, XRInterface:: Rect2 shadow_rect; int light_count = 0; + int shadow_count = 0; RENDER_TIMESTAMP("Cull Canvas Lights"); for (Map<RID, Viewport::CanvasData>::Element *E = p_viewport->canvas_map.front(); E; E = E->next()) { @@ -221,7 +222,7 @@ void RenderingServerViewport::_draw_viewport(Viewport *p_viewport, XRInterface:: while (light) { RENDER_TIMESTAMP("Render Shadow"); - RSG::canvas_render->light_update_shadow(light->light_internal, light->xform_cache.affine_inverse(), light->item_shadow_mask, light->radius_cache / 1000.0, light->radius_cache * 1.1, occluders); + RSG::canvas_render->light_update_shadow(light->light_internal, shadow_count++, light->xform_cache.affine_inverse(), light->item_shadow_mask, light->radius_cache / 1000.0, light->radius_cache * 1.1, occluders); light = light->shadows_next_ptr; } @@ -254,7 +255,7 @@ void RenderingServerViewport::_draw_viewport(Viewport *p_viewport, XRInterface:: ptr = ptr->filter_next_ptr; } - RSG::canvas->render_canvas(p_viewport->render_target, canvas, xform, canvas_lights, lights_with_mask, clip_rect); + RSG::canvas->render_canvas(p_viewport->render_target, canvas, xform, canvas_lights, lights_with_mask, clip_rect, p_viewport->texture_filter, p_viewport->texture_repeat); i++; if (scenario_draw_canvas_bg && E->key().get_layer() >= scenario_canvas_max_layer) { @@ -491,7 +492,7 @@ void RenderingServerViewport::viewport_set_size(RID p_viewport, int p_width, int RSG::scene_render->free(viewport->render_buffers); viewport->render_buffers = RID(); } else { - RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, viewport->msaa, viewport->screen_space_aa); + RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, viewport->msaa, viewport->screen_space_aa, viewport->use_debanding); } } } @@ -704,7 +705,7 @@ void RenderingServerViewport::viewport_set_msaa(RID p_viewport, RS::ViewportMSAA } viewport->msaa = p_msaa; if (viewport->render_buffers.is_valid()) { - RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, p_msaa, viewport->screen_space_aa); + RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, p_msaa, viewport->screen_space_aa, viewport->use_debanding); } } @@ -717,7 +718,20 @@ void RenderingServerViewport::viewport_set_screen_space_aa(RID p_viewport, RS::V } viewport->screen_space_aa = p_mode; if (viewport->render_buffers.is_valid()) { - RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, viewport->msaa, p_mode); + RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, viewport->msaa, p_mode, viewport->use_debanding); + } +} + +void RenderingServerViewport::viewport_set_use_debanding(RID p_viewport, bool p_use_debanding) { + Viewport *viewport = viewport_owner.getornull(p_viewport); + ERR_FAIL_COND(!viewport); + + if (viewport->use_debanding == p_use_debanding) { + return; + } + viewport->use_debanding = p_use_debanding; + if (viewport->render_buffers.is_valid()) { + RSG::scene_render->render_buffers_configure(viewport->render_buffers, viewport->render_target, viewport->size.width, viewport->size.height, viewport->msaa, viewport->screen_space_aa, p_use_debanding); } } @@ -760,6 +774,21 @@ float RenderingServerViewport::viewport_get_measured_render_time_gpu(RID p_viewp return double((viewport->time_gpu_end - viewport->time_gpu_begin) / 1000) / 1000.0; } +void RenderingServerViewport::viewport_set_default_canvas_item_texture_filter(RID p_viewport, RS::CanvasItemTextureFilter p_filter) { + ERR_FAIL_COND_MSG(p_filter == RS::CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, "Viewport does not accept DEFAULT as texture filter (it's the topmost choice already).)"); + Viewport *viewport = viewport_owner.getornull(p_viewport); + ERR_FAIL_COND(!viewport); + + viewport->texture_filter = p_filter; +} +void RenderingServerViewport::viewport_set_default_canvas_item_texture_repeat(RID p_viewport, RS::CanvasItemTextureRepeat p_repeat) { + ERR_FAIL_COND_MSG(p_repeat == RS::CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, "Viewport does not accept DEFAULT as texture repeat (it's the topmost choice already).)"); + Viewport *viewport = viewport_owner.getornull(p_viewport); + ERR_FAIL_COND(!viewport); + + viewport->texture_repeat = p_repeat; +} + bool RenderingServerViewport::free(RID p_rid) { if (viewport_owner.owns(p_rid)) { Viewport *viewport = viewport_owner.getornull(p_rid); diff --git a/servers/rendering/rendering_server_viewport.h b/servers/rendering/rendering_server_viewport.h index 0b90646e4f..161ae94fb0 100644 --- a/servers/rendering/rendering_server_viewport.h +++ b/servers/rendering/rendering_server_viewport.h @@ -59,6 +59,7 @@ public: RS::ViewportMSAA msaa; RS::ViewportScreenSpaceAA screen_space_aa; + bool use_debanding; DisplayServer::WindowID viewport_to_screen; Rect2 viewport_to_screen_rect; @@ -85,6 +86,9 @@ public: RS::ViewportClearMode clear_mode; + RS::CanvasItemTextureFilter texture_filter = RS::CANVAS_ITEM_TEXTURE_FILTER_LINEAR; + RS::CanvasItemTextureRepeat texture_repeat = RS::CANVAS_ITEM_TEXTURE_REPEAT_DISABLED; + bool transparent_bg; struct CanvasKey { @@ -130,6 +134,7 @@ public: debug_draw = RS::VIEWPORT_DEBUG_DRAW_DISABLED; msaa = RS::VIEWPORT_MSAA_DISABLED; screen_space_aa = RS::VIEWPORT_SCREEN_SPACE_AA_DISABLED; + use_debanding = false; for (int i = 0; i < RS::VIEWPORT_RENDER_INFO_MAX; i++) { render_info[i] = 0; @@ -206,6 +211,7 @@ public: void viewport_set_msaa(RID p_viewport, RS::ViewportMSAA p_msaa); void viewport_set_screen_space_aa(RID p_viewport, RS::ViewportScreenSpaceAA p_mode); + void viewport_set_use_debanding(RID p_viewport, bool p_use_debanding); virtual int viewport_get_render_info(RID p_viewport, RS::ViewportRenderInfo p_info); virtual void viewport_set_debug_draw(RID p_viewport, RS::ViewportDebugDraw p_draw); @@ -214,6 +220,9 @@ public: float viewport_get_measured_render_time_cpu(RID p_viewport) const; float viewport_get_measured_render_time_gpu(RID p_viewport) const; + void viewport_set_default_canvas_item_texture_filter(RID p_viewport, RS::CanvasItemTextureFilter p_filter); + void viewport_set_default_canvas_item_texture_repeat(RID p_viewport, RS::CanvasItemTextureRepeat p_repeat); + void handle_timestamp(String p_timestamp, uint64_t p_cpu_time, uint64_t p_gpu_time); void set_default_clear_color(const Color &p_color); diff --git a/servers/rendering/rendering_server_wrap_mt.cpp b/servers/rendering/rendering_server_wrap_mt.cpp index 9aa6593cbe..ab9856e06e 100644 --- a/servers/rendering/rendering_server_wrap_mt.cpp +++ b/servers/rendering/rendering_server_wrap_mt.cpp @@ -124,6 +124,7 @@ void RenderingServerWrapMT::finish() { gi_probe_free_cached_ids(); lightmap_free_cached_ids(); particles_free_cached_ids(); + particles_collision_free_cached_ids(); camera_free_cached_ids(); viewport_free_cached_ids(); environment_free_cached_ids(); diff --git a/servers/rendering/rendering_server_wrap_mt.h b/servers/rendering/rendering_server_wrap_mt.h index 372a7269dc..1836f99c99 100644 --- a/servers/rendering/rendering_server_wrap_mt.h +++ b/servers/rendering/rendering_server_wrap_mt.h @@ -356,6 +356,8 @@ public: FUNC2(particles_set_process_material, RID, RID) FUNC2(particles_set_fixed_fps, RID, int) FUNC2(particles_set_fractional_delta, RID, bool) + FUNC2(particles_set_collision_base_size, RID, float) + FUNC1R(bool, particles_is_inactive, RID) FUNC1(particles_request_process, RID) FUNC1(particles_restart, RID) @@ -371,6 +373,21 @@ public: FUNC1R(AABB, particles_get_current_aabb, RID) + /* PARTICLES COLLISION */ + + FUNCRID(particles_collision) + + FUNC2(particles_collision_set_collision_type, RID, ParticlesCollisionType) + FUNC2(particles_collision_set_cull_mask, RID, uint32_t) + FUNC2(particles_collision_set_sphere_radius, RID, float) + FUNC2(particles_collision_set_box_extents, RID, const Vector3 &) + FUNC2(particles_collision_set_attractor_strength, RID, float) + FUNC2(particles_collision_set_attractor_directionality, RID, float) + FUNC2(particles_collision_set_attractor_attenuation, RID, float) + FUNC2(particles_collision_set_field_texture, RID, RID) + FUNC1(particles_collision_height_field_update, RID) + FUNC2(particles_collision_set_height_field_resolution, RID, ParticlesCollisionHeightfieldResolution) + /* CAMERA API */ FUNCRID(camera) @@ -415,12 +432,16 @@ public: FUNC3(viewport_set_canvas_transform, RID, RID, const Transform2D &) FUNC2(viewport_set_transparent_background, RID, bool) + FUNC2(viewport_set_default_canvas_item_texture_filter, RID, CanvasItemTextureFilter) + FUNC2(viewport_set_default_canvas_item_texture_repeat, RID, CanvasItemTextureRepeat) + FUNC2(viewport_set_global_canvas_transform, RID, const Transform2D &) FUNC4(viewport_set_canvas_stacking, RID, RID, int, int) FUNC2(viewport_set_shadow_atlas_size, RID, int) FUNC3(viewport_set_shadow_atlas_quadrant_subdivision, RID, int, int) FUNC2(viewport_set_msaa, RID, ViewportMSAA) FUNC2(viewport_set_screen_space_aa, RID, ViewportScreenSpaceAA) + FUNC2(viewport_set_use_debanding, RID, bool) //this passes directly to avoid stalling, but it's pretty dangerous, so don't call after freeing a viewport virtual int viewport_get_render_info(RID p_viewport, ViewportRenderInfo p_info) { @@ -475,7 +496,7 @@ public: FUNC1(environment_set_sdfgi_ray_count, EnvironmentSDFGIRayCount) FUNC1(environment_set_sdfgi_frames_to_converge, EnvironmentSDFGIFramesToConverge) - FUNC11(environment_set_glow, RID, bool, int, float, float, float, float, EnvironmentGlowBlendMode, float, float, float) + FUNC11(environment_set_glow, RID, bool, Vector<float>, float, float, float, float, EnvironmentGlowBlendMode, float, float, float) FUNC1(environment_glow_set_use_bicubic_upscale, bool) FUNC1(environment_glow_set_use_high_quality, bool) @@ -483,7 +504,7 @@ public: FUNC6(environment_set_adjustment, RID, bool, float, float, float, RID) - FUNC8(environment_set_fog, RID, bool, const Color &, float, float, float, float, float) + FUNC9(environment_set_fog, RID, bool, const Color &, float, float, float, float, float, float) FUNC9(environment_set_volumetric_fog, RID, bool, float, const Color &, float, float, float, float, EnvVolumetricFogShadowFilter) @@ -565,9 +586,19 @@ public: FUNC3(canvas_set_parent, RID, RID, float) FUNC1(canvas_set_disable_scale, bool) + FUNCRID(canvas_texture) + FUNC3(canvas_texture_set_channel, RID, CanvasTextureChannel, RID) + FUNC3(canvas_texture_set_shading_parameters, RID, const Color &, float) + + FUNC2(canvas_texture_set_texture_filter, RID, CanvasItemTextureFilter) + FUNC2(canvas_texture_set_texture_repeat, RID, CanvasItemTextureRepeat) + FUNCRID(canvas_item) FUNC2(canvas_item_set_parent, RID, RID) + FUNC2(canvas_item_set_default_texture_filter, RID, CanvasItemTextureFilter) + FUNC2(canvas_item_set_default_texture_repeat, RID, CanvasItemTextureRepeat) + FUNC2(canvas_item_set_visible, RID, bool) FUNC2(canvas_item_set_light_mask, RID, int) @@ -582,23 +613,20 @@ public: FUNC2(canvas_item_set_draw_behind_parent, RID, bool) - FUNC2(canvas_item_set_default_texture_filter, RID, CanvasItemTextureFilter) - FUNC2(canvas_item_set_default_texture_repeat, RID, CanvasItemTextureRepeat) - FUNC5(canvas_item_add_line, RID, const Point2 &, const Point2 &, const Color &, float) FUNC4(canvas_item_add_polyline, RID, const Vector<Point2> &, const Vector<Color> &, float) FUNC4(canvas_item_add_multiline, RID, const Vector<Point2> &, const Vector<Color> &, float) FUNC3(canvas_item_add_rect, RID, const Rect2 &, const Color &) FUNC4(canvas_item_add_circle, RID, const Point2 &, float, const Color &) - FUNC11(canvas_item_add_texture_rect, RID, const Rect2 &, RID, bool, const Color &, bool, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC12(canvas_item_add_texture_rect_region, RID, const Rect2 &, RID, const Rect2 &, const Color &, bool, RID, RID, const Color &, bool, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC15(canvas_item_add_nine_patch, RID, const Rect2 &, const Rect2 &, RID, const Vector2 &, const Vector2 &, NinePatchAxisMode, NinePatchAxisMode, bool, const Color &, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC11(canvas_item_add_primitive, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, float, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC10(canvas_item_add_polygon, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC14(canvas_item_add_triangle_array, RID, const Vector<int> &, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, const Vector<int> &, const Vector<float> &, RID, int, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC10(canvas_item_add_mesh, RID, const RID &, const Transform2D &, const Color &, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC8(canvas_item_add_multimesh, RID, RID, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) - FUNC8(canvas_item_add_particles, RID, RID, RID, RID, RID, const Color &, CanvasItemTextureFilter, CanvasItemTextureRepeat) + FUNC6(canvas_item_add_texture_rect, RID, const Rect2 &, RID, bool, const Color &, bool) + FUNC7(canvas_item_add_texture_rect_region, RID, const Rect2 &, RID, const Rect2 &, const Color &, bool, bool) + FUNC10(canvas_item_add_nine_patch, RID, const Rect2 &, const Rect2 &, RID, const Vector2 &, const Vector2 &, NinePatchAxisMode, NinePatchAxisMode, bool, const Color &) + FUNC6(canvas_item_add_primitive, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID, float) + FUNC5(canvas_item_add_polygon, RID, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, RID) + FUNC9(canvas_item_add_triangle_array, RID, const Vector<int> &, const Vector<Point2> &, const Vector<Color> &, const Vector<Point2> &, const Vector<int> &, const Vector<float> &, RID, int) + FUNC5(canvas_item_add_mesh, RID, const RID &, const Transform2D &, const Color &, RID) + FUNC3(canvas_item_add_multimesh, RID, RID, RID) + FUNC3(canvas_item_add_particles, RID, RID, RID) FUNC2(canvas_item_add_set_transform, RID, const Transform2D &) FUNC2(canvas_item_add_clip_ignore, RID, bool) FUNC2(canvas_item_set_sort_children_by_y, RID, bool) @@ -632,7 +660,6 @@ public: FUNC2(canvas_light_set_mode, RID, CanvasLightMode) FUNC2(canvas_light_set_shadow_enabled, RID, bool) - FUNC2(canvas_light_set_shadow_buffer_size, RID, int) FUNC2(canvas_light_set_shadow_filter, RID, CanvasLightShadowFilter) FUNC2(canvas_light_set_shadow_color, RID, const Color &) FUNC2(canvas_light_set_shadow_smooth, RID, float) @@ -650,6 +677,8 @@ public: FUNC2(canvas_occluder_polygon_set_cull_mode, RID, CanvasOccluderPolygonCullMode) + FUNC1(canvas_set_shadow_texture_size, int) + /* GLOBAL VARIABLES */ FUNC3(global_variable_add, const StringName &, GlobalVariableType, const Variant &) diff --git a/servers/rendering/shader_language.cpp b/servers/rendering/shader_language.cpp index 6c835fcadf..1883b6b338 100644 --- a/servers/rendering/shader_language.cpp +++ b/servers/rendering/shader_language.cpp @@ -5912,6 +5912,8 @@ Error ShaderLanguage::_parse_shader(const Map<StringName, FunctionInfo> &p_funct int instance_index = 0; ShaderNode::Uniform::Scope uniform_scope = ShaderNode::Uniform::SCOPE_LOCAL; + stages = &p_functions; + while (tk.type != TK_EOF) { switch (tk.type) { case TK_RENDER_MODE: { @@ -7326,6 +7328,12 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct int idx = 0; bool low_end = RenderingServer::get_singleton()->is_low_end(); + if (stages && stages->has(skip_function)) { + for (const Map<StringName, StageFunctionInfo>::Element *E = (*stages)[skip_function].stage_functions.front(); E; E = E->next()) { + matches.insert(String(E->key()), ScriptCodeCompletionOption::KIND_FUNCTION); + } + } + while (builtin_func_defs[idx].name) { if (low_end && builtin_func_defs[idx].high_end) { idx++; @@ -7362,6 +7370,16 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct return OK; } break; case COMPLETION_CALL_ARGUMENTS: { + StringName block_function; + BlockNode *block = completion_block; + + while (block) { + if (block->parent_function) { + block_function = block->parent_function->name; + } + block = block->parent_block; + } + for (int i = 0; i < shader->functions.size(); i++) { if (!shader->functions[i].callable) { continue; @@ -7421,6 +7439,45 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct String calltip; bool low_end = RenderingServer::get_singleton()->is_low_end(); + if (stages && stages->has(block_function)) { + for (const Map<StringName, StageFunctionInfo>::Element *E = (*stages)[block_function].stage_functions.front(); E; E = E->next()) { + if (completion_function == E->key()) { + calltip += get_datatype_name(E->get().return_type); + calltip += " "; + calltip += E->key(); + calltip += "("; + + for (int i = 0; i < E->get().arguments.size(); i++) { + if (i > 0) { + calltip += ", "; + } else { + calltip += " "; + } + + if (i == completion_argument) { + calltip += char32_t(0xFFFF); + } + + calltip += get_datatype_name(E->get().arguments[i].type); + calltip += " "; + calltip += E->get().arguments[i].name; + + if (i == completion_argument) { + calltip += char32_t(0xFFFF); + } + } + + if (E->get().arguments.size()) { + calltip += " "; + } + calltip += ")"; + + r_call_hint = calltip; + return OK; + } + } + } + while (builtin_func_defs[idx].name) { if (low_end && builtin_func_defs[idx].high_end) { idx++; @@ -7453,7 +7510,7 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct calltip += "("; bool found_arg = false; - for (int i = 0; i < 4; i++) { + for (int i = 0; i < BuiltinFuncDef::MAX_ARGS - 1; i++) { if (builtin_func_defs[idx].args[i] == TYPE_VOID) { break; } diff --git a/servers/rendering/shader_language.h b/servers/rendering/shader_language.h index 0d044a21c7..3c0a10809b 100644 --- a/servers/rendering/shader_language.h +++ b/servers/rendering/shader_language.h @@ -846,6 +846,7 @@ private: StringName completion_function; StringName completion_struct; int completion_argument; + const Map<StringName, FunctionInfo> *stages = nullptr; bool _get_completable_identifier(BlockNode *p_block, CompletionType p_type, StringName &identifier); static const BuiltinFuncDef builtin_func_defs[]; diff --git a/servers/rendering/shader_types.cpp b/servers/rendering/shader_types.cpp index ad5cbc9e51..48eaf1dd13 100644 --- a/servers/rendering/shader_types.cpp +++ b/servers/rendering/shader_types.cpp @@ -129,6 +129,9 @@ ShaderTypes::ShaderTypes() { shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["PROJECTION_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4); shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["INV_PROJECTION_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4); shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["VIEWPORT_SIZE"] = constt(ShaderLanguage::TYPE_VEC2); + shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["FOG"] = ShaderLanguage::TYPE_VEC4; // TODO consider adding to light shader + shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["RADIANCE"] = ShaderLanguage::TYPE_VEC4; + shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["IRRADIANCE"] = ShaderLanguage::TYPE_VEC4; shader_modes[RS::SHADER_SPATIAL].functions["fragment"].can_discard = true; shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["WORLD_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4); @@ -149,6 +152,7 @@ ShaderTypes::ShaderTypes() { shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["SHADOW_ATTENUATION"] = constt(ShaderLanguage::TYPE_VEC3); shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["ALBEDO"] = constt(ShaderLanguage::TYPE_VEC3); shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["BACKLIGHT"] = constt(ShaderLanguage::TYPE_VEC3); + shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["METALLIC"] = constt(ShaderLanguage::TYPE_FLOAT); shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["ROUGHNESS"] = constt(ShaderLanguage::TYPE_FLOAT); shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["DIFFUSE_LIGHT"] = ShaderLanguage::TYPE_VEC3; shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["SPECULAR_LIGHT"] = ShaderLanguage::TYPE_VEC3; @@ -294,6 +298,10 @@ ShaderTypes::ShaderTypes() { shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_VELOCITY"] = constt(ShaderLanguage::TYPE_BOOL); shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_COLOR"] = constt(ShaderLanguage::TYPE_BOOL); shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_CUSTOM"] = constt(ShaderLanguage::TYPE_BOOL); + shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLIDED"] = constt(ShaderLanguage::TYPE_BOOL); + shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLISION_NORMAL"] = constt(ShaderLanguage::TYPE_VEC3); + shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLISION_DEPTH"] = constt(ShaderLanguage::TYPE_FLOAT); + shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["ATTRACTOR_FORCE"] = constt(ShaderLanguage::TYPE_VEC3); shader_modes[RS::SHADER_PARTICLES].functions["compute"].can_discard = false; { @@ -307,6 +315,7 @@ ShaderTypes::ShaderTypes() { shader_modes[RS::SHADER_PARTICLES].functions["compute"].stage_functions["emit_particle"] = emit_vertex_func; } + shader_modes[RS::SHADER_PARTICLES].modes.push_back("collision_use_scale"); shader_modes[RS::SHADER_PARTICLES].modes.push_back("disable_force"); shader_modes[RS::SHADER_PARTICLES].modes.push_back("disable_velocity"); shader_modes[RS::SHADER_PARTICLES].modes.push_back("keep_data"); @@ -347,6 +356,7 @@ ShaderTypes::ShaderTypes() { shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["SKY_COORDS"] = constt(ShaderLanguage::TYPE_VEC2); shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["HALF_RES_COLOR"] = constt(ShaderLanguage::TYPE_VEC4); shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["QUARTER_RES_COLOR"] = constt(ShaderLanguage::TYPE_VEC4); + shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["FOG"] = ShaderLanguage::TYPE_VEC4; shader_modes[RS::SHADER_SKY].modes.push_back("use_half_res_pass"); shader_modes[RS::SHADER_SKY].modes.push_back("use_quarter_res_pass"); diff --git a/servers/rendering_server.cpp b/servers/rendering_server.cpp index 9ad19e4b38..42a77101f7 100644 --- a/servers/rendering_server.cpp +++ b/servers/rendering_server.cpp @@ -30,7 +30,6 @@ #include "rendering_server.h" -#include "core/method_bind_ext.gen.inc" #include "core/project_settings.h" RenderingServer *RenderingServer::singleton = nullptr; @@ -1735,6 +1734,8 @@ void RenderingServer::_bind_methods() { ClassDB::bind_method(D_METHOD("viewport_set_shadow_atlas_size", "viewport", "size"), &RenderingServer::viewport_set_shadow_atlas_size); ClassDB::bind_method(D_METHOD("viewport_set_shadow_atlas_quadrant_subdivision", "viewport", "quadrant", "subdivision"), &RenderingServer::viewport_set_shadow_atlas_quadrant_subdivision); ClassDB::bind_method(D_METHOD("viewport_set_msaa", "viewport", "msaa"), &RenderingServer::viewport_set_msaa); + ClassDB::bind_method(D_METHOD("viewport_set_use_debanding", "viewport", "enable"), &RenderingServer::viewport_set_use_debanding); + ClassDB::bind_method(D_METHOD("viewport_get_render_info", "viewport", "info"), &RenderingServer::viewport_get_render_info); ClassDB::bind_method(D_METHOD("viewport_set_debug_draw", "viewport", "draw"), &RenderingServer::viewport_set_debug_draw); @@ -1747,12 +1748,12 @@ void RenderingServer::_bind_methods() { ClassDB::bind_method(D_METHOD("environment_set_bg_energy", "env", "energy"), &RenderingServer::environment_set_bg_energy); ClassDB::bind_method(D_METHOD("environment_set_canvas_max_layer", "env", "max_layer"), &RenderingServer::environment_set_canvas_max_layer); ClassDB::bind_method(D_METHOD("environment_set_ambient_light", "env", "color", "ambient", "energy", "sky_contibution", "reflection_source", "ao_color"), &RenderingServer::environment_set_ambient_light, DEFVAL(RS::ENV_AMBIENT_SOURCE_BG), DEFVAL(1.0), DEFVAL(0.0), DEFVAL(RS::ENV_REFLECTION_SOURCE_BG), DEFVAL(Color())); - ClassDB::bind_method(D_METHOD("environment_set_glow", "env", "enable", "level_flags", "intensity", "strength", "mix", "bloom_threshold", "blend_mode", "hdr_bleed_threshold", "hdr_bleed_scale", "hdr_luminance_cap"), &RenderingServer::environment_set_glow); + ClassDB::bind_method(D_METHOD("environment_set_glow", "env", "enable", "levels", "intensity", "strength", "mix", "bloom_threshold", "blend_mode", "hdr_bleed_threshold", "hdr_bleed_scale", "hdr_luminance_cap"), &RenderingServer::environment_set_glow); ClassDB::bind_method(D_METHOD("environment_set_tonemap", "env", "tone_mapper", "exposure", "white", "auto_exposure", "min_luminance", "max_luminance", "auto_exp_speed", "auto_exp_grey"), &RenderingServer::environment_set_tonemap); ClassDB::bind_method(D_METHOD("environment_set_adjustment", "env", "enable", "brightness", "contrast", "saturation", "ramp"), &RenderingServer::environment_set_adjustment); ClassDB::bind_method(D_METHOD("environment_set_ssr", "env", "enable", "max_steps", "fade_in", "fade_out", "depth_tolerance"), &RenderingServer::environment_set_ssr); ClassDB::bind_method(D_METHOD("environment_set_ssao", "env", "enable", "radius", "intensity", "bias", "light_affect", "ao_channel_affect", "blur", "bilateral_sharpness"), &RenderingServer::environment_set_ssao); - ClassDB::bind_method(D_METHOD("environment_set_fog", "env", "enable", "light_color", "light_energy", "sun_scatter", "density", "height", "height_density"), &RenderingServer::environment_set_fog); + ClassDB::bind_method(D_METHOD("environment_set_fog", "env", "enable", "light_color", "light_energy", "sun_scatter", "density", "height", "height_density", "aerial_perspective"), &RenderingServer::environment_set_fog); ClassDB::bind_method(D_METHOD("scenario_create"), &RenderingServer::scenario_create); ClassDB::bind_method(D_METHOD("scenario_set_debug", "scenario", "debug_mode"), &RenderingServer::scenario_set_debug); @@ -1845,7 +1846,6 @@ void RenderingServer::_bind_methods() { ClassDB::bind_method(D_METHOD("canvas_light_set_item_shadow_cull_mask", "light", "mask"), &RenderingServer::canvas_light_set_item_shadow_cull_mask); ClassDB::bind_method(D_METHOD("canvas_light_set_mode", "light", "mode"), &RenderingServer::canvas_light_set_mode); ClassDB::bind_method(D_METHOD("canvas_light_set_shadow_enabled", "light", "enabled"), &RenderingServer::canvas_light_set_shadow_enabled); - ClassDB::bind_method(D_METHOD("canvas_light_set_shadow_buffer_size", "light", "size"), &RenderingServer::canvas_light_set_shadow_buffer_size); ClassDB::bind_method(D_METHOD("canvas_light_set_shadow_filter", "light", "filter"), &RenderingServer::canvas_light_set_shadow_filter); ClassDB::bind_method(D_METHOD("canvas_light_set_shadow_color", "light", "color"), &RenderingServer::canvas_light_set_shadow_color); ClassDB::bind_method(D_METHOD("canvas_light_set_shadow_smooth", "light", "smooth"), &RenderingServer::canvas_light_set_shadow_smooth); @@ -2152,6 +2152,7 @@ void RenderingServer::_bind_methods() { BIND_ENUM_CONSTANT(INSTANCE_MULTIMESH); BIND_ENUM_CONSTANT(INSTANCE_IMMEDIATE); BIND_ENUM_CONSTANT(INSTANCE_PARTICLES); + BIND_ENUM_CONSTANT(INSTANCE_PARTICLES_COLLISION); BIND_ENUM_CONSTANT(INSTANCE_LIGHT); BIND_ENUM_CONSTANT(INSTANCE_REFLECTION_PROBE); BIND_ENUM_CONSTANT(INSTANCE_DECAL); @@ -2327,11 +2328,13 @@ RenderingServer::RenderingServer() { ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/size", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/size", PROPERTY_HINT_RANGE, "256,16384")); GLOBAL_DEF("rendering/quality/directional_shadow/soft_shadow_quality", 2); GLOBAL_DEF("rendering/quality/directional_shadow/soft_shadow_quality.mobile", 0); - ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard(Fastest), Soft Low (Fast), Soft Medium (Average), Soft High (Slow), Soft Ultra (Slowest)")); + ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard (Fastest),Soft Low (Fast),Soft Medium (Average),Soft High (Slow),Soft Ultra (Slowest)")); GLOBAL_DEF("rendering/quality/shadows/soft_shadow_quality", 2); GLOBAL_DEF("rendering/quality/shadows/soft_shadow_quality.mobile", 0); - ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/shadows/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/shadows/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard(Fastest), Soft Low (Fast), Soft Medium (Average), Soft High (Slow), Soft Ultra (Slowest)")); + ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/shadows/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/shadows/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard (Fastest),Soft Low (Fast),Soft Medium (Average),Soft High (Slow),Soft Ultra (Slowest)")); + + GLOBAL_DEF("rendering/quality/2d_shadow_atlas/size", 2048); GLOBAL_DEF("rendering/quality/shadow_atlas/size", 4096); GLOBAL_DEF("rendering/quality/shadow_atlas/size.mobile", 2048); diff --git a/servers/rendering_server.h b/servers/rendering_server.h index 7dae45f126..61d0fed52f 100644 --- a/servers/rendering_server.h +++ b/servers/rendering_server.h @@ -31,10 +31,10 @@ #ifndef RENDERING_SERVER_H #define RENDERING_SERVER_H +#include "core/class_db.h" #include "core/image.h" #include "core/math/geometry_3d.h" #include "core/math/transform_2d.h" -#include "core/object.h" #include "core/rid.h" #include "core/typed_array.h" #include "core/variant.h" @@ -578,6 +578,7 @@ public: virtual void particles_set_process_material(RID p_particles, RID p_material) = 0; virtual void particles_set_fixed_fps(RID p_particles, int p_fps) = 0; virtual void particles_set_fractional_delta(RID p_particles, bool p_enable) = 0; + virtual void particles_set_collision_base_size(RID p_particles, float p_size) = 0; virtual bool particles_is_inactive(RID p_particles) = 0; virtual void particles_request_process(RID p_particles) = 0; virtual void particles_restart(RID p_particles) = 0; @@ -609,6 +610,43 @@ public: virtual void particles_set_emission_transform(RID p_particles, const Transform &p_transform) = 0; //this is only used for 2D, in 3D it's automatic + /* PARTICLES COLLISION API */ + + virtual RID particles_collision_create() = 0; + + enum ParticlesCollisionType { + PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT, + PARTICLES_COLLISION_TYPE_BOX_ATTRACT, + PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT, + PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE, + PARTICLES_COLLISION_TYPE_BOX_COLLIDE, + PARTICLES_COLLISION_TYPE_SDF_COLLIDE, + PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE, + }; + + virtual void particles_collision_set_collision_type(RID p_particles_collision, ParticlesCollisionType p_type) = 0; + virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) = 0; + virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) = 0; //for spheres + virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) = 0; //for non-spheres + virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) = 0; + virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) = 0; + virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) = 0; + virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) = 0; //for SDF and vector field, heightfield is dynamic + + virtual void particles_collision_height_field_update(RID p_particles_collision) = 0; //for SDF and vector field + + enum ParticlesCollisionHeightfieldResolution { //longest axis resolution + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_256, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_512, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_1024, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_2048, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_4096, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_8192, + PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_MAX, + }; + + virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, ParticlesCollisionHeightfieldResolution p_resolution) = 0; //for SDF and vector field + /* CAMERA API */ virtual RID camera_create() = 0; @@ -623,6 +661,25 @@ public: /* VIEWPORT TARGET API */ + enum CanvasItemTextureFilter { + CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, //uses canvas item setting for draw command, uses global setting for canvas item + CANVAS_ITEM_TEXTURE_FILTER_NEAREST, + CANVAS_ITEM_TEXTURE_FILTER_LINEAR, + CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, + CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, + CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, + CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, + CANVAS_ITEM_TEXTURE_FILTER_MAX + }; + + enum CanvasItemTextureRepeat { + CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, //uses canvas item setting for draw command, uses global setting for canvas item + CANVAS_ITEM_TEXTURE_REPEAT_DISABLED, + CANVAS_ITEM_TEXTURE_REPEAT_ENABLED, + CANVAS_ITEM_TEXTURE_REPEAT_MIRROR, + CANVAS_ITEM_TEXTURE_REPEAT_MAX, + }; + virtual RID viewport_create() = 0; virtual void viewport_set_use_xr(RID p_viewport, bool p_use_xr) = 0; @@ -664,6 +721,9 @@ public: virtual void viewport_set_canvas_transform(RID p_viewport, RID p_canvas, const Transform2D &p_offset) = 0; virtual void viewport_set_transparent_background(RID p_viewport, bool p_enabled) = 0; + virtual void viewport_set_default_canvas_item_texture_filter(RID p_viewport, CanvasItemTextureFilter p_filter) = 0; + virtual void viewport_set_default_canvas_item_texture_repeat(RID p_viewport, CanvasItemTextureRepeat p_repeat) = 0; + virtual void viewport_set_global_canvas_transform(RID p_viewport, const Transform2D &p_transform) = 0; virtual void viewport_set_canvas_stacking(RID p_viewport, RID p_canvas, int p_layer, int p_sublayer) = 0; @@ -689,6 +749,8 @@ public: virtual void viewport_set_screen_space_aa(RID p_viewport, ViewportScreenSpaceAA p_mode) = 0; + virtual void viewport_set_use_debanding(RID p_viewport, bool p_use_debanding) = 0; + enum ViewportRenderInfo { VIEWPORT_RENDER_INFO_OBJECTS_IN_FRAME, VIEWPORT_RENDER_INFO_VERTICES_IN_FRAME, @@ -794,7 +856,7 @@ public: ENV_GLOW_BLEND_MODE_MIX, }; - virtual void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0; + virtual void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0; virtual void environment_glow_set_use_bicubic_upscale(bool p_enable) = 0; virtual void environment_glow_set_use_high_quality(bool p_enable) = 0; @@ -876,7 +938,7 @@ public: virtual void environment_set_sdfgi_frames_to_converge(EnvironmentSDFGIFramesToConverge p_frames) = 0; - virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) = 0; + virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective) = 0; enum EnvVolumetricFogShadowFilter { ENV_VOLUMETRIC_FOG_SHADOW_FILTER_DISABLED, @@ -965,6 +1027,7 @@ public: INSTANCE_MULTIMESH, INSTANCE_IMMEDIATE, INSTANCE_PARTICLES, + INSTANCE_PARTICLES_COLLISION, INSTANCE_LIGHT, INSTANCE_REFLECTION_PROBE, INSTANCE_DECAL, @@ -1051,9 +1114,26 @@ public: virtual void canvas_set_disable_scale(bool p_disable) = 0; + virtual RID canvas_texture_create() = 0; + + enum CanvasTextureChannel { + CANVAS_TEXTURE_CHANNEL_DIFFUSE, + CANVAS_TEXTURE_CHANNEL_NORMAL, + CANVAS_TEXTURE_CHANNEL_SPECULAR, + }; + virtual void canvas_texture_set_channel(RID p_canvas_texture, CanvasTextureChannel p_channel, RID p_texture) = 0; + virtual void canvas_texture_set_shading_parameters(RID p_canvas_texture, const Color &p_base_color, float p_shininess) = 0; + + //takes effect only for new draw commands + virtual void canvas_texture_set_texture_filter(RID p_canvas_texture, CanvasItemTextureFilter p_filter) = 0; + virtual void canvas_texture_set_texture_repeat(RID p_canvas_texture, CanvasItemTextureRepeat p_repeat) = 0; + virtual RID canvas_item_create() = 0; virtual void canvas_item_set_parent(RID p_item, RID p_parent) = 0; + virtual void canvas_item_set_default_texture_filter(RID p_item, CanvasItemTextureFilter p_filter) = 0; + virtual void canvas_item_set_default_texture_repeat(RID p_item, CanvasItemTextureRepeat p_repeat) = 0; + virtual void canvas_item_set_visible(RID p_item, bool p_visible) = 0; virtual void canvas_item_set_light_mask(RID p_item, int p_mask) = 0; @@ -1074,43 +1154,20 @@ public: NINE_PATCH_TILE_FIT, }; - enum CanvasItemTextureFilter { - CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, //uses canvas item setting for draw command, uses global setting for canvas item - CANVAS_ITEM_TEXTURE_FILTER_NEAREST, - CANVAS_ITEM_TEXTURE_FILTER_LINEAR, - CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS, - CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS, - CANVAS_ITEM_TEXTURE_FILTER_NEAREST_WITH_MIPMAPS_ANISOTROPIC, - CANVAS_ITEM_TEXTURE_FILTER_LINEAR_WITH_MIPMAPS_ANISOTROPIC, - CANVAS_ITEM_TEXTURE_FILTER_MAX - }; - - enum CanvasItemTextureRepeat { - CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT, //uses canvas item setting for draw command, uses global setting for canvas item - CANVAS_ITEM_TEXTURE_REPEAT_DISABLED, - CANVAS_ITEM_TEXTURE_REPEAT_ENABLED, - CANVAS_ITEM_TEXTURE_REPEAT_MIRROR, - CANVAS_ITEM_TEXTURE_REPEAT_MAX, - }; - - //takes effect only for new draw commands - virtual void canvas_item_set_default_texture_filter(RID p_item, CanvasItemTextureFilter p_filter) = 0; - virtual void canvas_item_set_default_texture_repeat(RID p_item, CanvasItemTextureRepeat p_repeat) = 0; - virtual void canvas_item_add_line(RID p_item, const Point2 &p_from, const Point2 &p_to, const Color &p_color, float p_width = 1.0) = 0; virtual void canvas_item_add_polyline(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0) = 0; virtual void canvas_item_add_multiline(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, float p_width = 1.0) = 0; virtual void canvas_item_add_rect(RID p_item, const Rect2 &p_rect, const Color &p_color) = 0; virtual void canvas_item_add_circle(RID p_item, const Point2 &p_pos, float p_radius, const Color &p_color) = 0; - virtual void canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), bool p_clip_uv = false, CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, NinePatchAxisMode p_x_axis_mode = NINE_PATCH_STRETCH, NinePatchAxisMode p_y_axis_mode = NINE_PATCH_STRETCH, bool p_draw_center = true, const Color &p_modulate = Color(1, 1, 1), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width = 1.0, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>(), RID p_texture = RID(), int p_count = -1, RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture = RID(), RID p_normal_map = RID(), RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; - virtual void canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture, RID p_normal_map, RID p_specular_map = RID(), const Color &p_specular_color_shininess = Color(), CanvasItemTextureFilter p_texture_filter = CANVAS_ITEM_TEXTURE_FILTER_DEFAULT, CanvasItemTextureRepeat = CANVAS_ITEM_TEXTURE_REPEAT_DEFAULT) = 0; + virtual void canvas_item_add_texture_rect(RID p_item, const Rect2 &p_rect, RID p_texture, bool p_tile = false, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false) = 0; + virtual void canvas_item_add_texture_rect_region(RID p_item, const Rect2 &p_rect, RID p_texture, const Rect2 &p_src_rect, const Color &p_modulate = Color(1, 1, 1), bool p_transpose = false, bool p_clip_uv = false) = 0; + virtual void canvas_item_add_nine_patch(RID p_item, const Rect2 &p_rect, const Rect2 &p_source, RID p_texture, const Vector2 &p_topleft, const Vector2 &p_bottomright, NinePatchAxisMode p_x_axis_mode = NINE_PATCH_STRETCH, NinePatchAxisMode p_y_axis_mode = NINE_PATCH_STRETCH, bool p_draw_center = true, const Color &p_modulate = Color(1, 1, 1)) = 0; + virtual void canvas_item_add_primitive(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs, RID p_texture, float p_width = 1.0) = 0; + virtual void canvas_item_add_polygon(RID p_item, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), RID p_texture = RID()) = 0; + virtual void canvas_item_add_triangle_array(RID p_item, const Vector<int> &p_indices, const Vector<Point2> &p_points, const Vector<Color> &p_colors, const Vector<Point2> &p_uvs = Vector<Point2>(), const Vector<int> &p_bones = Vector<int>(), const Vector<float> &p_weights = Vector<float>(), RID p_texture = RID(), int p_count = -1) = 0; + virtual void canvas_item_add_mesh(RID p_item, const RID &p_mesh, const Transform2D &p_transform = Transform2D(), const Color &p_modulate = Color(1, 1, 1), RID p_texture = RID()) = 0; + virtual void canvas_item_add_multimesh(RID p_item, RID p_mesh, RID p_texture = RID()) = 0; + virtual void canvas_item_add_particles(RID p_item, RID p_particles, RID p_texture) = 0; virtual void canvas_item_add_set_transform(RID p_item, const Transform2D &p_transform) = 0; virtual void canvas_item_add_clip_ignore(RID p_item, bool p_ignore) = 0; virtual void canvas_item_set_sort_children_by_y(RID p_item, bool p_enable) = 0; @@ -1159,7 +1216,6 @@ public: }; virtual void canvas_light_set_shadow_enabled(RID p_light, bool p_enabled) = 0; - virtual void canvas_light_set_shadow_buffer_size(RID p_light, int p_size) = 0; virtual void canvas_light_set_shadow_filter(RID p_light, CanvasLightShadowFilter p_filter) = 0; virtual void canvas_light_set_shadow_color(RID p_light, const Color &p_color) = 0; virtual void canvas_light_set_shadow_smooth(RID p_light, float p_smooth) = 0; @@ -1183,6 +1239,8 @@ public: virtual void canvas_occluder_polygon_set_cull_mode(RID p_occluder_polygon, CanvasOccluderPolygonCullMode p_mode) = 0; + virtual void canvas_set_shadow_texture_size(int p_size) = 0; + /* GLOBAL VARIABLES */ enum GlobalVariableType { diff --git a/tests/test_command_queue.h b/tests/test_command_queue.h new file mode 100644 index 0000000000..a66fd3c86e --- /dev/null +++ b/tests/test_command_queue.h @@ -0,0 +1,482 @@ +/*************************************************************************/ +/* test_command_queue.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef TEST_COMMAND_QUEUE_H +#define TEST_COMMAND_QUEUE_H + +#include "test_command_queue.h" + +#include "core/command_queue_mt.h" +#include "core/os/mutex.h" +#include "core/os/os.h" +#include "core/os/semaphore.h" +#include "core/os/thread.h" +#include "core/project_settings.h" + +#if !defined(NO_THREADS) + +namespace TestCommandQueue { + +class ThreadWork { + Semaphore thread_sem; + Semaphore main_sem; + Mutex mut; + int threading_errors = 0; + enum State { + MAIN_START, + MAIN_DONE, + THREAD_START, + THREAD_DONE, + } state; + +public: + ThreadWork() { + mut.lock(); + state = MAIN_START; + } + ~ThreadWork() { + CHECK_MESSAGE(threading_errors == 0, "threads did not lock/unlock correctly"); + } + void thread_wait_for_work() { + thread_sem.wait(); + mut.lock(); + if (state != MAIN_DONE) { + threading_errors++; + } + state = THREAD_START; + } + void thread_done_work() { + if (state != THREAD_START) { + threading_errors++; + } + state = THREAD_DONE; + mut.unlock(); + main_sem.post(); + } + + void main_wait_for_done() { + main_sem.wait(); + mut.lock(); + if (state != THREAD_DONE) { + threading_errors++; + } + state = MAIN_START; + } + void main_start_work() { + if (state != MAIN_START) { + threading_errors++; + } + state = MAIN_DONE; + mut.unlock(); + thread_sem.post(); + } +}; + +class SharedThreadState { +public: + ThreadWork reader_threadwork; + ThreadWork writer_threadwork; + + CommandQueueMT command_queue = CommandQueueMT(true); + + enum TestMsgType { + TEST_MSG_FUNC1_TRANSFORM, + TEST_MSG_FUNC2_TRANSFORM_FLOAT, + TEST_MSG_FUNC3_TRANSFORMx6, + TEST_MSGSYNC_FUNC1_TRANSFORM, + TEST_MSGSYNC_FUNC2_TRANSFORM_FLOAT, + TEST_MSGRET_FUNC1_TRANSFORM, + TEST_MSGRET_FUNC2_TRANSFORM_FLOAT, + TEST_MSG_MAX + }; + + Vector<TestMsgType> message_types_to_write; + bool during_writing = false; + int message_count_to_read = 0; + bool exit_threads = false; + + Thread *reader_thread = nullptr; + Thread *writer_thread = nullptr; + + int func1_count = 0; + + void func1(Transform t) { + func1_count++; + } + void func2(Transform t, float f) { + func1_count++; + } + void func3(Transform t1, Transform t2, Transform t3, Transform t4, Transform t5, Transform t6) { + func1_count++; + } + Transform func1r(Transform t) { + func1_count++; + return t; + } + Transform func2r(Transform t, float f) { + func1_count++; + return t; + } + + void add_msg_to_write(TestMsgType type) { + message_types_to_write.push_back(type); + } + + void reader_thread_loop() { + reader_threadwork.thread_wait_for_work(); + while (!exit_threads) { + if (message_count_to_read < 0) { + command_queue.flush_all(); + } + for (int i = 0; i < message_count_to_read; i++) { + command_queue.wait_and_flush_one(); + } + message_count_to_read = 0; + + reader_threadwork.thread_done_work(); + reader_threadwork.thread_wait_for_work(); + } + command_queue.flush_all(); + reader_threadwork.thread_done_work(); + } + static void static_reader_thread_loop(void *stsvoid) { + SharedThreadState *sts = static_cast<SharedThreadState *>(stsvoid); + sts->reader_thread_loop(); + } + + void writer_thread_loop() { + during_writing = false; + writer_threadwork.thread_wait_for_work(); + while (!exit_threads) { + Transform tr; + Transform otr; + float f = 1; + during_writing = true; + for (int i = 0; i < message_types_to_write.size(); i++) { + TestMsgType msg_type = message_types_to_write[i]; + switch (msg_type) { + case TEST_MSG_FUNC1_TRANSFORM: + command_queue.push(this, &SharedThreadState::func1, tr); + break; + case TEST_MSG_FUNC2_TRANSFORM_FLOAT: + command_queue.push(this, &SharedThreadState::func2, tr, f); + break; + case TEST_MSG_FUNC3_TRANSFORMx6: + command_queue.push(this, &SharedThreadState::func3, tr, tr, tr, tr, tr, tr); + break; + case TEST_MSGSYNC_FUNC1_TRANSFORM: + command_queue.push_and_sync(this, &SharedThreadState::func1, tr); + break; + case TEST_MSGSYNC_FUNC2_TRANSFORM_FLOAT: + command_queue.push_and_sync(this, &SharedThreadState::func2, tr, f); + break; + case TEST_MSGRET_FUNC1_TRANSFORM: + command_queue.push_and_ret(this, &SharedThreadState::func1r, tr, &otr); + break; + case TEST_MSGRET_FUNC2_TRANSFORM_FLOAT: + command_queue.push_and_ret(this, &SharedThreadState::func2r, tr, f, &otr); + break; + default: + break; + } + } + message_types_to_write.clear(); + during_writing = false; + + writer_threadwork.thread_done_work(); + writer_threadwork.thread_wait_for_work(); + } + writer_threadwork.thread_done_work(); + } + static void static_writer_thread_loop(void *stsvoid) { + SharedThreadState *sts = static_cast<SharedThreadState *>(stsvoid); + sts->writer_thread_loop(); + } + + void init_threads() { + reader_thread = Thread::create(&SharedThreadState::static_reader_thread_loop, this); + writer_thread = Thread::create(&SharedThreadState::static_writer_thread_loop, this); + } + void destroy_threads() { + exit_threads = true; + reader_threadwork.main_start_work(); + writer_threadwork.main_start_work(); + + Thread::wait_to_finish(reader_thread); + memdelete(reader_thread); + reader_thread = nullptr; + Thread::wait_to_finish(writer_thread); + memdelete(writer_thread); + writer_thread = nullptr; + } +}; + +TEST_CASE("[CommandQueue] Test Queue Basics") { + const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb"; + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1); + SharedThreadState sts; + sts.init_threads(); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + sts.writer_threadwork.main_start_work(); + sts.writer_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 0, + "Control: no messages read before reader has run."); + + sts.message_count_to_read = 1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 1, + "Reader should have read one message"); + + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 1, + "Reader should have read no additional messages from flush_all"); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + sts.writer_threadwork.main_start_work(); + sts.writer_threadwork.main_wait_for_done(); + + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 2, + "Reader should have read one additional message from flush_all"); + + sts.destroy_threads(); + + CHECK_MESSAGE(sts.func1_count == 2, + "Reader should have read no additional messages after join"); + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, + ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING)); +} + +TEST_CASE("[CommandQueue] Test Waiting at Queue Full") { + const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb"; + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1); + SharedThreadState sts; + sts.init_threads(); + + int msgs_to_add = 24; // a queue of size 1kB fundamentally cannot fit 24 matrices. + for (int i = 0; i < msgs_to_add; i++) { + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + } + sts.writer_threadwork.main_start_work(); + // If we call main_wait_for_done, we will deadlock. So instead... + sts.message_count_to_read = 1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 1, + "Reader should have read one message"); + CHECK_MESSAGE(sts.during_writing, + "Writer thread should still be blocked on writing."); + sts.message_count_to_read = msgs_to_add - 3; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count >= msgs_to_add - 3, + "Reader should have read most messages"); + sts.writer_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.during_writing == false, + "Writer thread should no longer be blocked on writing."); + sts.message_count_to_read = 2; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == msgs_to_add, + "Reader should have read all messages"); + + sts.destroy_threads(); + + CHECK_MESSAGE(sts.func1_count == msgs_to_add, + "Reader should have read no additional messages after join"); + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, + ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING)); +} + +TEST_CASE("[CommandQueue] Test Queue Wrapping to same spot.") { + const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb"; + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1); + SharedThreadState sts; + sts.init_threads(); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + sts.writer_threadwork.main_start_work(); + sts.writer_threadwork.main_wait_for_done(); + + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 3, + "Reader should have read at least three messages"); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.writer_threadwork.main_start_work(); + sts.writer_threadwork.main_wait_for_done(); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.writer_threadwork.main_start_work(); + OS::get_singleton()->delay_usec(1000); + + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + OS::get_singleton()->delay_usec(1000); + + sts.writer_threadwork.main_wait_for_done(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count >= 3, + "Reader should have read at least three messages"); + + sts.message_count_to_read = 6 - sts.func1_count; + sts.reader_threadwork.main_start_work(); + + // The following will fail immediately. + // The reason it hangs indefinitely in engine, is all subsequent calls to + // CommandQueue.wait_and_flush_one will also fail. + sts.reader_threadwork.main_wait_for_done(); + + // Because looping around uses an extra message, easiest to consume all. + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 6, + "Reader should have read both message sets"); + + sts.destroy_threads(); + + CHECK_MESSAGE(sts.func1_count == 6, + "Reader should have read no additional messages after join"); + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, + ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING)); +} + +TEST_CASE("[CommandQueue] Test Queue Lapping") { + const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb"; + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1); + SharedThreadState sts; + sts.init_threads(); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.writer_threadwork.main_start_work(); + sts.writer_threadwork.main_wait_for_done(); + + // We need to read an extra message so that it triggers the dealloc logic once. + // Otherwise, the queue will be considered full. + sts.message_count_to_read = 3; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + CHECK_MESSAGE(sts.func1_count == 3, + "Reader should have read first set of messages"); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6); + sts.writer_threadwork.main_start_work(); + // Don't wait for these, because the queue isn't big enough. + sts.writer_threadwork.main_wait_for_done(); + + sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC2_TRANSFORM_FLOAT); + sts.writer_threadwork.main_start_work(); + OS::get_singleton()->delay_usec(1000); + + sts.message_count_to_read = 3; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + + sts.writer_threadwork.main_wait_for_done(); + + sts.message_count_to_read = -1; + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + + CHECK_MESSAGE(sts.func1_count == 6, + "Reader should have read rest of the messages after lapping writers."); + + sts.destroy_threads(); + + CHECK_MESSAGE(sts.func1_count == 6, + "Reader should have read no additional messages after join"); + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, + ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING)); +} + +TEST_CASE("[Stress][CommandQueue] Stress test command queue") { + const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb"; + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1); + SharedThreadState sts; + sts.init_threads(); + + RandomNumberGenerator rng; + + rng.set_seed(1837267); + + int msgs_to_add = 2048; + + for (int i = 0; i < msgs_to_add; i++) { + // randi_range is inclusive, so allow any enum value except MAX. + sts.add_msg_to_write((SharedThreadState::TestMsgType)rng.randi_range(0, SharedThreadState::TEST_MSG_MAX - 1)); + } + sts.writer_threadwork.main_start_work(); + + int max_loop_iters = msgs_to_add * 2; + int loop_iters = 0; + while (sts.func1_count < msgs_to_add && loop_iters < max_loop_iters) { + int remaining = (msgs_to_add - sts.func1_count); + sts.message_count_to_read = rng.randi_range(1, remaining < 128 ? remaining : 128); + if (loop_iters % 3 == 0) { + sts.message_count_to_read = -1; + } + sts.reader_threadwork.main_start_work(); + sts.reader_threadwork.main_wait_for_done(); + loop_iters++; + } + CHECK_MESSAGE(loop_iters < max_loop_iters, + "Reader needed too many iterations to read messages!"); + sts.writer_threadwork.main_wait_for_done(); + + sts.destroy_threads(); + + CHECK_MESSAGE(sts.func1_count == msgs_to_add, + "Reader should have read no additional messages after join"); + ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, + ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING)); +} + +} // namespace TestCommandQueue + +#endif // !defined(NO_THREADS) + +#endif // TEST_COMMAND_QUEUE_H diff --git a/tests/test_main.cpp b/tests/test_main.cpp index f0dec22738..871c796513 100644 --- a/tests/test_main.cpp +++ b/tests/test_main.cpp @@ -36,11 +36,13 @@ #include "test_basis.h" #include "test_class_db.h" #include "test_color.h" +#include "test_command_queue.h" #include "test_expression.h" #include "test_gradient.h" #include "test_gui.h" #include "test_list.h" #include "test_math.h" +#include "test_method_bind.h" #include "test_oa_hash_map.h" #include "test_ordered_hash_map.h" #include "test_physics_2d.h" diff --git a/tests/test_method_bind.h b/tests/test_method_bind.h new file mode 100644 index 0000000000..f4004c2090 --- /dev/null +++ b/tests/test_method_bind.h @@ -0,0 +1,165 @@ +/*************************************************************************/ +/* test_method_bind.h */ +/*************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/*************************************************************************/ +/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */ +/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/*************************************************************************/ + +#ifndef TEST_METHOD_BIND_H +#define TEST_METHOD_BIND_H + +#include "core/class_db.h" + +#include "tests/test_macros.h" + +#include <inttypes.h> +#include <stdio.h> +#include <wchar.h> + +namespace TestMethodBind { + +class MethodBindTester : public Object { + GDCLASS(MethodBindTester, Object); + +public: + enum Test { + TEST_METHOD, + TEST_METHOD_ARGS, + TEST_METHODC, + TEST_METHODC_ARGS, + TEST_METHODR, + TEST_METHODR_ARGS, + TEST_METHODRC, + TEST_METHODRC_ARGS, + TEST_METHOD_DEFARGS, + TEST_MAX + }; + + int test_num = 0; + + bool test_valid[TEST_MAX]; + + void test_method() { + test_valid[TEST_METHOD] = true; + } + + void test_method_args(int p_arg) { + test_valid[TEST_METHOD_ARGS] = p_arg == test_num; + } + + void test_methodc() { + test_valid[TEST_METHODC] = true; + } + + void test_methodc_args(int p_arg) { + test_valid[TEST_METHODC_ARGS] = p_arg == test_num; + } + + int test_methodr() { + test_valid[TEST_METHODR] = true; //temporary + return test_num; + } + + int test_methodr_args(int p_arg) { + test_valid[TEST_METHODR_ARGS] = true; //temporary + return p_arg; + } + + int test_methodrc() { + test_valid[TEST_METHODRC] = true; //temporary + return test_num; + } + + int test_methodrc_args(int p_arg) { + test_valid[TEST_METHODRC_ARGS] = true; //temporary + return p_arg; + } + + void test_method_default_args(int p_arg1, int p_arg2, int p_arg3, int p_arg4, int p_arg5) { + test_valid[TEST_METHOD_DEFARGS] = p_arg1 == 1 && p_arg2 == 2 && p_arg3 == 3 && p_arg4 == 4 && p_arg5 == 5; //temporary + } + + static void _bind_methods() { + ClassDB::bind_method(D_METHOD("test_method"), &MethodBindTester::test_method); + ClassDB::bind_method(D_METHOD("test_method_args"), &MethodBindTester::test_method_args); + ClassDB::bind_method(D_METHOD("test_methodc"), &MethodBindTester::test_methodc); + ClassDB::bind_method(D_METHOD("test_methodc_args"), &MethodBindTester::test_methodc_args); + ClassDB::bind_method(D_METHOD("test_methodr"), &MethodBindTester::test_methodr); + ClassDB::bind_method(D_METHOD("test_methodr_args"), &MethodBindTester::test_methodr_args); + ClassDB::bind_method(D_METHOD("test_methodrc"), &MethodBindTester::test_methodrc); + ClassDB::bind_method(D_METHOD("test_methodrc_args"), &MethodBindTester::test_methodrc_args); + ClassDB::bind_method(D_METHOD("test_method_default_args"), &MethodBindTester::test_method_default_args, DEFVAL(9) /* wrong on purpose */, DEFVAL(4), DEFVAL(5)); + } + + virtual void run_tests() { + for (int i = 0; i < TEST_MAX; i++) { + test_valid[i] = false; + } + //regular + test_num = Math::rand(); + call("test_method"); + test_num = Math::rand(); + call("test_method_args", test_num); + test_num = Math::rand(); + call("test_methodc"); + test_num = Math::rand(); + call("test_methodc_args", test_num); + //return + test_num = Math::rand(); + test_valid[TEST_METHODR] = int(call("test_methodr")) == test_num && test_valid[TEST_METHODR]; + test_num = Math::rand(); + test_valid[TEST_METHODR_ARGS] = int(call("test_methodr_args", test_num)) == test_num && test_valid[TEST_METHODR_ARGS]; + test_num = Math::rand(); + test_valid[TEST_METHODRC] = int(call("test_methodrc")) == test_num && test_valid[TEST_METHODRC]; + test_num = Math::rand(); + test_valid[TEST_METHODRC_ARGS] = int(call("test_methodrc_args", test_num)) == test_num && test_valid[TEST_METHODRC_ARGS]; + + call("test_method_default_args", 1, 2, 3, 4); + } +}; + +TEST_CASE("[MethodBind] check all method binds") { + MethodBindTester *mbt = memnew(MethodBindTester); + + print_line("testing method bind"); + mbt->run_tests(); + + CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD_ARGS]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODC]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODC_ARGS]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODR]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODR_ARGS]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODRC]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHODRC_ARGS]); + CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD_DEFARGS]); + + memdelete(mbt); +} + +} // namespace TestMethodBind + +#endif // TEST_METHOD_BIND_H diff --git a/thirdparty/README.md b/thirdparty/README.md index 46a75d94b0..567f78f1b2 100644 --- a/thirdparty/README.md +++ b/thirdparty/README.md @@ -151,7 +151,7 @@ Use UI font variant if available, because it has tight vertical metrics and good ## freetype - Upstream: https://www.freetype.org -- Version: 2.10.2 (2020) +- Version: 2.10.4 (2020) - License: FreeType License (BSD-like) Files extracted from upstream source: diff --git a/thirdparty/freetype/include/freetype/config/ftconfig.h b/thirdparty/freetype/include/freetype/config/ftconfig.h index 14eecefc2a..b464e0b789 100644 --- a/thirdparty/freetype/include/freetype/config/ftconfig.h +++ b/thirdparty/freetype/include/freetype/config/ftconfig.h @@ -41,533 +41,9 @@ #include FT_CONFIG_OPTIONS_H #include FT_CONFIG_STANDARD_LIBRARY_H - -FT_BEGIN_HEADER - - - /************************************************************************** - * - * PLATFORM-SPECIFIC CONFIGURATION MACROS - * - * These macros can be toggled to suit a specific system. The current ones - * are defaults used to compile FreeType in an ANSI C environment (16bit - * compilers are also supported). Copy this file to your own - * `builds/<system>` directory, and edit it to port the engine. - * - */ - - - /* There are systems (like the Texas Instruments 'C54x) where a `char` */ - /* has 16~bits. ANSI~C says that `sizeof(char)` is always~1. Since an */ - /* `int` has 16~bits also for this system, `sizeof(int)` gives~1 which */ - /* is probably unexpected. */ - /* */ - /* `CHAR_BIT` (defined in `limits.h`) gives the number of bits in a */ - /* `char` type. */ - -#ifndef FT_CHAR_BIT -#define FT_CHAR_BIT CHAR_BIT -#endif - - - /* The size of an `int` type. */ -#if FT_UINT_MAX == 0xFFFFUL -#define FT_SIZEOF_INT ( 16 / FT_CHAR_BIT ) -#elif FT_UINT_MAX == 0xFFFFFFFFUL -#define FT_SIZEOF_INT ( 32 / FT_CHAR_BIT ) -#elif FT_UINT_MAX > 0xFFFFFFFFUL && FT_UINT_MAX == 0xFFFFFFFFFFFFFFFFUL -#define FT_SIZEOF_INT ( 64 / FT_CHAR_BIT ) -#else -#error "Unsupported size of `int' type!" -#endif - - /* The size of a `long` type. A five-byte `long` (as used e.g. on the */ - /* DM642) is recognized but avoided. */ -#if FT_ULONG_MAX == 0xFFFFFFFFUL -#define FT_SIZEOF_LONG ( 32 / FT_CHAR_BIT ) -#elif FT_ULONG_MAX > 0xFFFFFFFFUL && FT_ULONG_MAX == 0xFFFFFFFFFFUL -#define FT_SIZEOF_LONG ( 32 / FT_CHAR_BIT ) -#elif FT_ULONG_MAX > 0xFFFFFFFFUL && FT_ULONG_MAX == 0xFFFFFFFFFFFFFFFFUL -#define FT_SIZEOF_LONG ( 64 / FT_CHAR_BIT ) -#else -#error "Unsupported size of `long' type!" -#endif - - - /* `FT_UNUSED` indicates that a given parameter is not used -- */ - /* this is only used to get rid of unpleasant compiler warnings. */ -#ifndef FT_UNUSED -#define FT_UNUSED( arg ) ( (arg) = (arg) ) -#endif - - - /************************************************************************** - * - * AUTOMATIC CONFIGURATION MACROS - * - * These macros are computed from the ones defined above. Don't touch - * their definition, unless you know precisely what you are doing. No - * porter should need to mess with them. - * - */ - - - /************************************************************************** - * - * Mac support - * - * This is the only necessary change, so it is defined here instead - * providing a new configuration file. - */ -#if defined( __APPLE__ ) || ( defined( __MWERKS__ ) && defined( macintosh ) ) - /* No Carbon frameworks for 64bit 10.4.x. */ - /* `AvailabilityMacros.h` is available since Mac OS X 10.2, */ - /* so guess the system version by maximum errno before inclusion. */ -#include <errno.h> -#ifdef ECANCELED /* defined since 10.2 */ -#include "AvailabilityMacros.h" -#endif -#if defined( __LP64__ ) && \ - ( MAC_OS_X_VERSION_MIN_REQUIRED <= MAC_OS_X_VERSION_10_4 ) -#undef FT_MACINTOSH -#endif - -#elif defined( __SC__ ) || defined( __MRC__ ) - /* Classic MacOS compilers */ -#include "ConditionalMacros.h" -#if TARGET_OS_MAC -#define FT_MACINTOSH 1 -#endif - -#endif - - - /* Fix compiler warning with sgi compiler. */ -#if defined( __sgi ) && !defined( __GNUC__ ) -#if defined( _COMPILER_VERSION ) && ( _COMPILER_VERSION >= 730 ) -#pragma set woff 3505 -#endif -#endif - - - /************************************************************************** - * - * @section: - * basic_types - * - */ - - - /************************************************************************** - * - * @type: - * FT_Int16 - * - * @description: - * A typedef for a 16bit signed integer type. - */ - typedef signed short FT_Int16; - - - /************************************************************************** - * - * @type: - * FT_UInt16 - * - * @description: - * A typedef for a 16bit unsigned integer type. - */ - typedef unsigned short FT_UInt16; - - /* */ - - - /* this #if 0 ... #endif clause is for documentation purposes */ -#if 0 - - /************************************************************************** - * - * @type: - * FT_Int32 - * - * @description: - * A typedef for a 32bit signed integer type. The size depends on the - * configuration. - */ - typedef signed XXX FT_Int32; - - - /************************************************************************** - * - * @type: - * FT_UInt32 - * - * A typedef for a 32bit unsigned integer type. The size depends on the - * configuration. - */ - typedef unsigned XXX FT_UInt32; - - - /************************************************************************** - * - * @type: - * FT_Int64 - * - * A typedef for a 64bit signed integer type. The size depends on the - * configuration. Only defined if there is real 64bit support; - * otherwise, it gets emulated with a structure (if necessary). - */ - typedef signed XXX FT_Int64; - - - /************************************************************************** - * - * @type: - * FT_UInt64 - * - * A typedef for a 64bit unsigned integer type. The size depends on the - * configuration. Only defined if there is real 64bit support; - * otherwise, it gets emulated with a structure (if necessary). - */ - typedef unsigned XXX FT_UInt64; - - /* */ - -#endif - -#if FT_SIZEOF_INT == ( 32 / FT_CHAR_BIT ) - - typedef signed int FT_Int32; - typedef unsigned int FT_UInt32; - -#elif FT_SIZEOF_LONG == ( 32 / FT_CHAR_BIT ) - - typedef signed long FT_Int32; - typedef unsigned long FT_UInt32; - -#else -#error "no 32bit type found -- please check your configuration files" -#endif - - - /* look up an integer type that is at least 32~bits */ -#if FT_SIZEOF_INT >= ( 32 / FT_CHAR_BIT ) - - typedef int FT_Fast; - typedef unsigned int FT_UFast; - -#elif FT_SIZEOF_LONG >= ( 32 / FT_CHAR_BIT ) - - typedef long FT_Fast; - typedef unsigned long FT_UFast; - -#endif - - - /* determine whether we have a 64-bit `int` type for platforms without */ - /* Autoconf */ -#if FT_SIZEOF_LONG == ( 64 / FT_CHAR_BIT ) - - /* `FT_LONG64` must be defined if a 64-bit type is available */ -#define FT_LONG64 -#define FT_INT64 long -#define FT_UINT64 unsigned long - - /************************************************************************** - * - * A 64-bit data type may create compilation problems if you compile in - * strict ANSI mode. To avoid them, we disable other 64-bit data types if - * `__STDC__` is defined. You can however ignore this rule by defining the - * `FT_CONFIG_OPTION_FORCE_INT64` configuration macro. - */ -#elif !defined( __STDC__ ) || defined( FT_CONFIG_OPTION_FORCE_INT64 ) - -#if defined( __STDC_VERSION__ ) && __STDC_VERSION__ >= 199901L - -#define FT_LONG64 -#define FT_INT64 long long int -#define FT_UINT64 unsigned long long int - -#elif defined( _MSC_VER ) && _MSC_VER >= 900 /* Visual C++ (and Intel C++) */ - - /* this compiler provides the `__int64` type */ -#define FT_LONG64 -#define FT_INT64 __int64 -#define FT_UINT64 unsigned __int64 - -#elif defined( __BORLANDC__ ) /* Borland C++ */ - - /* XXXX: We should probably check the value of `__BORLANDC__` in order */ - /* to test the compiler version. */ - - /* this compiler provides the `__int64` type */ -#define FT_LONG64 -#define FT_INT64 __int64 -#define FT_UINT64 unsigned __int64 - -#elif defined( __WATCOMC__ ) /* Watcom C++ */ - - /* Watcom doesn't provide 64-bit data types */ - -#elif defined( __MWERKS__ ) /* Metrowerks CodeWarrior */ - -#define FT_LONG64 -#define FT_INT64 long long int -#define FT_UINT64 unsigned long long int - -#elif defined( __GNUC__ ) - - /* GCC provides the `long long` type */ -#define FT_LONG64 -#define FT_INT64 long long int -#define FT_UINT64 unsigned long long int - -#endif /* __STDC_VERSION__ >= 199901L */ - -#endif /* FT_SIZEOF_LONG == (64 / FT_CHAR_BIT) */ - -#ifdef FT_LONG64 - typedef FT_INT64 FT_Int64; - typedef FT_UINT64 FT_UInt64; -#endif - - -#ifdef _WIN64 - /* only 64bit Windows uses the LLP64 data model, i.e., */ - /* 32bit integers, 64bit pointers */ -#define FT_UINT_TO_POINTER( x ) (void*)(unsigned __int64)(x) -#else -#define FT_UINT_TO_POINTER( x ) (void*)(unsigned long)(x) -#endif - - - /************************************************************************** - * - * miscellaneous - * - */ - - -#define FT_BEGIN_STMNT do { -#define FT_END_STMNT } while ( 0 ) -#define FT_DUMMY_STMNT FT_BEGIN_STMNT FT_END_STMNT - - - /* `typeof` condition taken from gnulib's `intprops.h` header file */ -#if ( ( defined( __GNUC__ ) && __GNUC__ >= 2 ) || \ - ( defined( __IBMC__ ) && __IBMC__ >= 1210 && \ - defined( __IBM__TYPEOF__ ) ) || \ - ( defined( __SUNPRO_C ) && __SUNPRO_C >= 0x5110 && !__STDC__ ) ) -#define FT_TYPEOF( type ) ( __typeof__ ( type ) ) -#else -#define FT_TYPEOF( type ) /* empty */ -#endif - - - /* Use `FT_LOCAL` and `FT_LOCAL_DEF` to declare and define, */ - /* respectively, a function that gets used only within the scope of a */ - /* module. Normally, both the header and source code files for such a */ - /* function are within a single module directory. */ - /* */ - /* Intra-module arrays should be tagged with `FT_LOCAL_ARRAY` and */ - /* `FT_LOCAL_ARRAY_DEF`. */ - /* */ -#ifdef FT_MAKE_OPTION_SINGLE_OBJECT - -#define FT_LOCAL( x ) static x -#define FT_LOCAL_DEF( x ) static x - -#else - -#ifdef __cplusplus -#define FT_LOCAL( x ) extern "C" x -#define FT_LOCAL_DEF( x ) extern "C" x -#else -#define FT_LOCAL( x ) extern x -#define FT_LOCAL_DEF( x ) x -#endif - -#endif /* FT_MAKE_OPTION_SINGLE_OBJECT */ - -#define FT_LOCAL_ARRAY( x ) extern const x -#define FT_LOCAL_ARRAY_DEF( x ) const x - - - /* Use `FT_BASE` and `FT_BASE_DEF` to declare and define, respectively, */ - /* functions that are used in more than a single module. In the */ - /* current setup this implies that the declaration is in a header file */ - /* in the `include/freetype/internal` directory, and the function body */ - /* is in a file in `src/base`. */ - /* */ -#ifndef FT_BASE - -#ifdef __cplusplus -#define FT_BASE( x ) extern "C" x -#else -#define FT_BASE( x ) extern x -#endif - -#endif /* !FT_BASE */ - - -#ifndef FT_BASE_DEF - -#ifdef __cplusplus -#define FT_BASE_DEF( x ) x -#else -#define FT_BASE_DEF( x ) x -#endif - -#endif /* !FT_BASE_DEF */ - - - /* When compiling FreeType as a DLL or DSO with hidden visibility */ - /* some systems/compilers need a special attribute in front OR after */ - /* the return type of function declarations. */ - /* */ - /* Two macros are used within the FreeType source code to define */ - /* exported library functions: `FT_EXPORT` and `FT_EXPORT_DEF`. */ - /* */ - /* - `FT_EXPORT( return_type )` */ - /* */ - /* is used in a function declaration, as in */ - /* */ - /* ``` */ - /* FT_EXPORT( FT_Error ) */ - /* FT_Init_FreeType( FT_Library* alibrary ); */ - /* ``` */ - /* */ - /* - `FT_EXPORT_DEF( return_type )` */ - /* */ - /* is used in a function definition, as in */ - /* */ - /* ``` */ - /* FT_EXPORT_DEF( FT_Error ) */ - /* FT_Init_FreeType( FT_Library* alibrary ) */ - /* { */ - /* ... some code ... */ - /* return FT_Err_Ok; */ - /* } */ - /* ``` */ - /* */ - /* You can provide your own implementation of `FT_EXPORT` and */ - /* `FT_EXPORT_DEF` here if you want. */ - /* */ - /* To export a variable, use `FT_EXPORT_VAR`. */ - /* */ -#ifndef FT_EXPORT - -#ifdef FT2_BUILD_LIBRARY - -#if defined( _WIN32 ) && defined( DLL_EXPORT ) -#define FT_EXPORT( x ) __declspec( dllexport ) x -#elif defined( __GNUC__ ) && __GNUC__ >= 4 -#define FT_EXPORT( x ) __attribute__(( visibility( "default" ) )) x -#elif defined( __SUNPRO_C ) && __SUNPRO_C >= 0x550 -#define FT_EXPORT( x ) __global x -#elif defined( __cplusplus ) -#define FT_EXPORT( x ) extern "C" x -#else -#define FT_EXPORT( x ) extern x -#endif - -#else - -#if defined( _WIN32 ) && defined( DLL_IMPORT ) -#define FT_EXPORT( x ) __declspec( dllimport ) x -#elif defined( __cplusplus ) -#define FT_EXPORT( x ) extern "C" x -#else -#define FT_EXPORT( x ) extern x -#endif - -#endif - -#endif /* !FT_EXPORT */ - - -#ifndef FT_EXPORT_DEF - -#ifdef __cplusplus -#define FT_EXPORT_DEF( x ) extern "C" x -#else -#define FT_EXPORT_DEF( x ) extern x -#endif - -#endif /* !FT_EXPORT_DEF */ - - -#ifndef FT_EXPORT_VAR - -#ifdef __cplusplus -#define FT_EXPORT_VAR( x ) extern "C" x -#else -#define FT_EXPORT_VAR( x ) extern x -#endif - -#endif /* !FT_EXPORT_VAR */ - - - /* The following macros are needed to compile the library with a */ - /* C++ compiler and with 16bit compilers. */ - /* */ - - /* This is special. Within C++, you must specify `extern "C"` for */ - /* functions which are used via function pointers, and you also */ - /* must do that for structures which contain function pointers to */ - /* assure C linkage -- it's not possible to have (local) anonymous */ - /* functions which are accessed by (global) function pointers. */ - /* */ - /* */ - /* FT_CALLBACK_DEF is used to _define_ a callback function, */ - /* located in the same source code file as the structure that uses */ - /* it. */ - /* */ - /* FT_BASE_CALLBACK and FT_BASE_CALLBACK_DEF are used to declare */ - /* and define a callback function, respectively, in a similar way */ - /* as FT_BASE and FT_BASE_DEF work. */ - /* */ - /* FT_CALLBACK_TABLE is used to _declare_ a constant variable that */ - /* contains pointers to callback functions. */ - /* */ - /* FT_CALLBACK_TABLE_DEF is used to _define_ a constant variable */ - /* that contains pointers to callback functions. */ - /* */ - /* */ - /* Some 16bit compilers have to redefine these macros to insert */ - /* the infamous `_cdecl` or `__fastcall` declarations. */ - /* */ -#ifndef FT_CALLBACK_DEF -#ifdef __cplusplus -#define FT_CALLBACK_DEF( x ) extern "C" x -#else -#define FT_CALLBACK_DEF( x ) static x -#endif -#endif /* FT_CALLBACK_DEF */ - -#ifndef FT_BASE_CALLBACK -#ifdef __cplusplus -#define FT_BASE_CALLBACK( x ) extern "C" x -#define FT_BASE_CALLBACK_DEF( x ) extern "C" x -#else -#define FT_BASE_CALLBACK( x ) extern x -#define FT_BASE_CALLBACK_DEF( x ) x -#endif -#endif /* FT_BASE_CALLBACK */ - -#ifndef FT_CALLBACK_TABLE -#ifdef __cplusplus -#define FT_CALLBACK_TABLE extern "C" -#define FT_CALLBACK_TABLE_DEF extern "C" -#else -#define FT_CALLBACK_TABLE extern -#define FT_CALLBACK_TABLE_DEF /* nothing */ -#endif -#endif /* FT_CALLBACK_TABLE */ - - -FT_END_HEADER - +#include <freetype/config/integer-types.h> +#include <freetype/config/public-macros.h> +#include <freetype/config/mac-support.h> #endif /* FTCONFIG_H_ */ diff --git a/thirdparty/freetype/include/freetype/config/ftheader.h b/thirdparty/freetype/include/freetype/config/ftheader.h index e91598e207..28b5cc60cf 100644 --- a/thirdparty/freetype/include/freetype/config/ftheader.h +++ b/thirdparty/freetype/include/freetype/config/ftheader.h @@ -30,10 +30,12 @@ /* encapsulated in an `extern "C" { .. }` block when included from a */ /* C++ compiler. */ /* */ -#ifdef __cplusplus -#define FT_BEGIN_HEADER extern "C" { -#else -#define FT_BEGIN_HEADER /* nothing */ +#ifndef FT_BEGIN_HEADER +# ifdef __cplusplus +# define FT_BEGIN_HEADER extern "C" { +# else +# define FT_BEGIN_HEADER /* nothing */ +# endif #endif @@ -48,10 +50,12 @@ /* encapsulated in an `extern "C" { .. }` block when included from a */ /* C++ compiler. */ /* */ -#ifdef __cplusplus -#define FT_END_HEADER } -#else -#define FT_END_HEADER /* nothing */ +#ifndef FT_END_HEADER +# ifdef __cplusplus +# define FT_END_HEADER } +# else +# define FT_END_HEADER /* nothing */ +# endif #endif @@ -73,9 +77,16 @@ * Macro definitions used to `#include` specific header files. * * @description: - * The following macros are defined to the name of specific FreeType~2 - * header files. They can be used directly in `#include` statements as - * in: + * In addition to the normal scheme of including header files like + * + * ``` + * #include <freetype/freetype.h> + * #include <freetype/ftmm.h> + * #include <freetype/ftglyph.h> + * ``` + * + * it is possible to used named macros instead. They can be used + * directly in `#include` statements as in * * ``` * #include FT_FREETYPE_H @@ -83,13 +94,9 @@ * #include FT_GLYPH_H * ``` * - * There are several reasons why we are now using macros to name public - * header files. The first one is that such macros are not limited to - * the infamous 8.3~naming rule required by DOS (and - * `FT_MULTIPLE_MASTERS_H` is a lot more meaningful than `ftmm.h`). - * - * The second reason is that it allows for more flexibility in the way - * FreeType~2 is installed on a given system. + * These macros were introduced to overcome the infamous 8.3~naming rule + * required by DOS (and `FT_MULTIPLE_MASTERS_H` is a lot more meaningful + * than `ftmm.h`). * */ @@ -797,16 +804,19 @@ #define FT_CACHE_INTERNAL_IMAGE_H FT_CACHE_H #define FT_CACHE_INTERNAL_SBITS_H FT_CACHE_H - - /* - * Include internal headers definitions from `<internal/...>` only when - * building the library. - */ +/* TODO(david): Move this section below to a different header */ #ifdef FT2_BUILD_LIBRARY -#define FT_INTERNAL_INTERNAL_H <freetype/internal/internal.h> -#include FT_INTERNAL_INTERNAL_H -#endif /* FT2_BUILD_LIBRARY */ +#if defined( _MSC_VER ) /* Visual C++ (and Intel C++) */ + /* We disable the warning `conditional expression is constant' here */ + /* in order to compile cleanly with the maximum level of warnings. */ + /* In particular, the warning complains about stuff like `while(0)' */ + /* which is very useful in macro definitions. There is no benefit */ + /* in having it enabled. */ +#pragma warning( disable : 4127 ) + +#endif /* _MSC_VER */ +#endif /* FT2_BUILD_LIBRARY */ #endif /* FTHEADER_H_ */ diff --git a/thirdparty/freetype/include/freetype/config/ftmodule.h b/thirdparty/freetype/include/freetype/config/ftmodule.h index 7c603e5327..b5c4b1ee58 100644 --- a/thirdparty/freetype/include/freetype/config/ftmodule.h +++ b/thirdparty/freetype/include/freetype/config/ftmodule.h @@ -25,8 +25,6 @@ FT_USE_MODULE( FT_Module_Class, pshinter_module_class ) FT_USE_MODULE( FT_Renderer_Class, ft_raster1_renderer_class ) FT_USE_MODULE( FT_Module_Class, sfnt_module_class ) FT_USE_MODULE( FT_Renderer_Class, ft_smooth_renderer_class ) -FT_USE_MODULE( FT_Renderer_Class, ft_smooth_lcd_renderer_class ) -FT_USE_MODULE( FT_Renderer_Class, ft_smooth_lcdv_renderer_class ) FT_USE_MODULE( FT_Driver_ClassRec, bdf_driver_class ) /* EOF */ diff --git a/thirdparty/freetype/include/freetype/config/ftoption.h b/thirdparty/freetype/include/freetype/config/ftoption.h index 426806d2e4..097f19b8a5 100644 --- a/thirdparty/freetype/include/freetype/config/ftoption.h +++ b/thirdparty/freetype/include/freetype/config/ftoption.h @@ -42,7 +42,7 @@ FT_BEGIN_HEADER * the name of a directory that is included _before_ the FreeType include * path during compilation. * - * The default FreeType Makefiles and Jamfiles use the build directory + * The default FreeType Makefiles use the build directory * `builds/<system>` by default, but you can easily change that for your * own projects. * @@ -121,10 +121,8 @@ FT_BEGIN_HEADER * mitigate color fringes inherent to this technology, you also need to * explicitly set up LCD filtering. * - * Note that this feature is covered by several Microsoft patents and - * should not be activated in any default build of the library. When this - * macro is not defined, FreeType offers alternative LCD rendering - * technology that produces excellent output without LCD filtering. + * When this macro is not defined, FreeType offers alternative LCD + * rendering technology that produces excellent output. */ /* #define FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ @@ -542,7 +540,7 @@ FT_BEGIN_HEADER /************************************************************************** * - * Define `TT_CONFIG_OPTION_COLOR_LAYERS` if you want to support coloured + * Define `TT_CONFIG_OPTION_COLOR_LAYERS` if you want to support colored * outlines (from the 'COLR'/'CPAL' tables) in all formats using the 'sfnt' * module (namely TrueType~& OpenType). */ diff --git a/thirdparty/freetype/include/freetype/config/integer-types.h b/thirdparty/freetype/include/freetype/config/integer-types.h new file mode 100644 index 0000000000..a0ca0c95e2 --- /dev/null +++ b/thirdparty/freetype/include/freetype/config/integer-types.h @@ -0,0 +1,245 @@ +/**************************************************************************** + * + * config/integer-types.h + * + * FreeType integer types definitions. + * + * Copyright (C) 1996-2020 by + * David Turner, Robert Wilhelm, and Werner Lemberg. + * + * This file is part of the FreeType project, and may only be used, + * modified, and distributed under the terms of the FreeType project + * license, LICENSE.TXT. By continuing to use, modify, or distribute + * this file you indicate that you have read the license and + * understand and accept it fully. + * + */ +#ifndef FREETYPE_CONFIG_INTEGER_TYPES_H_ +#define FREETYPE_CONFIG_INTEGER_TYPES_H_ + + /* There are systems (like the Texas Instruments 'C54x) where a `char` */ + /* has 16~bits. ANSI~C says that `sizeof(char)` is always~1. Since an */ + /* `int` has 16~bits also for this system, `sizeof(int)` gives~1 which */ + /* is probably unexpected. */ + /* */ + /* `CHAR_BIT` (defined in `limits.h`) gives the number of bits in a */ + /* `char` type. */ + +#ifndef FT_CHAR_BIT +#define FT_CHAR_BIT CHAR_BIT +#endif + +#ifndef FT_SIZEOF_INT + + /* The size of an `int` type. */ +#if FT_UINT_MAX == 0xFFFFUL +#define FT_SIZEOF_INT ( 16 / FT_CHAR_BIT ) +#elif FT_UINT_MAX == 0xFFFFFFFFUL +#define FT_SIZEOF_INT ( 32 / FT_CHAR_BIT ) +#elif FT_UINT_MAX > 0xFFFFFFFFUL && FT_UINT_MAX == 0xFFFFFFFFFFFFFFFFUL +#define FT_SIZEOF_INT ( 64 / FT_CHAR_BIT ) +#else +#error "Unsupported size of `int' type!" +#endif + +#endif /* !defined(FT_SIZEOF_INT) */ + +#ifndef FT_SIZEOF_LONG + + /* The size of a `long` type. A five-byte `long` (as used e.g. on the */ + /* DM642) is recognized but avoided. */ +#if FT_ULONG_MAX == 0xFFFFFFFFUL +#define FT_SIZEOF_LONG ( 32 / FT_CHAR_BIT ) +#elif FT_ULONG_MAX > 0xFFFFFFFFUL && FT_ULONG_MAX == 0xFFFFFFFFFFUL +#define FT_SIZEOF_LONG ( 32 / FT_CHAR_BIT ) +#elif FT_ULONG_MAX > 0xFFFFFFFFUL && FT_ULONG_MAX == 0xFFFFFFFFFFFFFFFFUL +#define FT_SIZEOF_LONG ( 64 / FT_CHAR_BIT ) +#else +#error "Unsupported size of `long' type!" +#endif + +#endif /* !defined(FT_SIZEOF_LONG) */ + + /************************************************************************** + * + * @section: + * basic_types + * + */ + + + /************************************************************************** + * + * @type: + * FT_Int16 + * + * @description: + * A typedef for a 16bit signed integer type. + */ + typedef signed short FT_Int16; + + + /************************************************************************** + * + * @type: + * FT_UInt16 + * + * @description: + * A typedef for a 16bit unsigned integer type. + */ + typedef unsigned short FT_UInt16; + + /* */ + + + /* this #if 0 ... #endif clause is for documentation purposes */ +#if 0 + + /************************************************************************** + * + * @type: + * FT_Int32 + * + * @description: + * A typedef for a 32bit signed integer type. The size depends on the + * configuration. + */ + typedef signed XXX FT_Int32; + + + /************************************************************************** + * + * @type: + * FT_UInt32 + * + * A typedef for a 32bit unsigned integer type. The size depends on the + * configuration. + */ + typedef unsigned XXX FT_UInt32; + + + /************************************************************************** + * + * @type: + * FT_Int64 + * + * A typedef for a 64bit signed integer type. The size depends on the + * configuration. Only defined if there is real 64bit support; + * otherwise, it gets emulated with a structure (if necessary). + */ + typedef signed XXX FT_Int64; + + + /************************************************************************** + * + * @type: + * FT_UInt64 + * + * A typedef for a 64bit unsigned integer type. The size depends on the + * configuration. Only defined if there is real 64bit support; + * otherwise, it gets emulated with a structure (if necessary). + */ + typedef unsigned XXX FT_UInt64; + + /* */ + +#endif + +#if FT_SIZEOF_INT == ( 32 / FT_CHAR_BIT ) + + typedef signed int FT_Int32; + typedef unsigned int FT_UInt32; + +#elif FT_SIZEOF_LONG == ( 32 / FT_CHAR_BIT ) + + typedef signed long FT_Int32; + typedef unsigned long FT_UInt32; + +#else +#error "no 32bit type found -- please check your configuration files" +#endif + + + /* look up an integer type that is at least 32~bits */ +#if FT_SIZEOF_INT >= ( 32 / FT_CHAR_BIT ) + + typedef int FT_Fast; + typedef unsigned int FT_UFast; + +#elif FT_SIZEOF_LONG >= ( 32 / FT_CHAR_BIT ) + + typedef long FT_Fast; + typedef unsigned long FT_UFast; + +#endif + + + /* determine whether we have a 64-bit `int` type for platforms without */ + /* Autoconf */ +#if FT_SIZEOF_LONG == ( 64 / FT_CHAR_BIT ) + + /* `FT_LONG64` must be defined if a 64-bit type is available */ +#define FT_LONG64 +#define FT_INT64 long +#define FT_UINT64 unsigned long + + /************************************************************************** + * + * A 64-bit data type may create compilation problems if you compile in + * strict ANSI mode. To avoid them, we disable other 64-bit data types if + * `__STDC__` is defined. You can however ignore this rule by defining the + * `FT_CONFIG_OPTION_FORCE_INT64` configuration macro. + */ +#elif !defined( __STDC__ ) || defined( FT_CONFIG_OPTION_FORCE_INT64 ) + +#if defined( __STDC_VERSION__ ) && __STDC_VERSION__ >= 199901L + +#define FT_LONG64 +#define FT_INT64 long long int +#define FT_UINT64 unsigned long long int + +#elif defined( _MSC_VER ) && _MSC_VER >= 900 /* Visual C++ (and Intel C++) */ + + /* this compiler provides the `__int64` type */ +#define FT_LONG64 +#define FT_INT64 __int64 +#define FT_UINT64 unsigned __int64 + +#elif defined( __BORLANDC__ ) /* Borland C++ */ + + /* XXXX: We should probably check the value of `__BORLANDC__` in order */ + /* to test the compiler version. */ + + /* this compiler provides the `__int64` type */ +#define FT_LONG64 +#define FT_INT64 __int64 +#define FT_UINT64 unsigned __int64 + +#elif defined( __WATCOMC__ ) /* Watcom C++ */ + + /* Watcom doesn't provide 64-bit data types */ + +#elif defined( __MWERKS__ ) /* Metrowerks CodeWarrior */ + +#define FT_LONG64 +#define FT_INT64 long long int +#define FT_UINT64 unsigned long long int + +#elif defined( __GNUC__ ) + + /* GCC provides the `long long` type */ +#define FT_LONG64 +#define FT_INT64 long long int +#define FT_UINT64 unsigned long long int + +#endif /* __STDC_VERSION__ >= 199901L */ + +#endif /* FT_SIZEOF_LONG == (64 / FT_CHAR_BIT) */ + +#ifdef FT_LONG64 + typedef FT_INT64 FT_Int64; + typedef FT_UINT64 FT_UInt64; +#endif + + +#endif /* FREETYPE_CONFIG_INTEGER_TYPES_H_ */ diff --git a/thirdparty/freetype/include/freetype/config/mac-support.h b/thirdparty/freetype/include/freetype/config/mac-support.h new file mode 100644 index 0000000000..94867088e9 --- /dev/null +++ b/thirdparty/freetype/include/freetype/config/mac-support.h @@ -0,0 +1,49 @@ +/**************************************************************************** + * + * config/mac-support.h + * + * Mac/OS X support configuration header. + * + * Copyright (C) 1996-2020 by + * David Turner, Robert Wilhelm, and Werner Lemberg. + * + * This file is part of the FreeType project, and may only be used, + * modified, and distributed under the terms of the FreeType project + * license, LICENSE.TXT. By continuing to use, modify, or distribute + * this file you indicate that you have read the license and + * understand and accept it fully. + * + */ +#ifndef FREETYPE_CONFIG_MAC_SUPPORT_H_ +#define FREETYPE_CONFIG_MAC_SUPPORT_H_ + + /************************************************************************** + * + * Mac support + * + * This is the only necessary change, so it is defined here instead + * providing a new configuration file. + */ +#if defined( __APPLE__ ) || ( defined( __MWERKS__ ) && defined( macintosh ) ) + /* No Carbon frameworks for 64bit 10.4.x. */ + /* `AvailabilityMacros.h` is available since Mac OS X 10.2, */ + /* so guess the system version by maximum errno before inclusion. */ +#include <errno.h> +#ifdef ECANCELED /* defined since 10.2 */ +#include "AvailabilityMacros.h" +#endif +#if defined( __LP64__ ) && \ + ( MAC_OS_X_VERSION_MIN_REQUIRED <= MAC_OS_X_VERSION_10_4 ) +#undef FT_MACINTOSH +#endif + +#elif defined( __SC__ ) || defined( __MRC__ ) + /* Classic MacOS compilers */ +#include "ConditionalMacros.h" +#if TARGET_OS_MAC +#define FT_MACINTOSH 1 +#endif + +#endif /* Mac support */ + +#endif /* FREETYPE_CONFIG_MAC_SUPPORT_H_ */ diff --git a/thirdparty/freetype/include/freetype/config/public-macros.h b/thirdparty/freetype/include/freetype/config/public-macros.h new file mode 100644 index 0000000000..6aa673e807 --- /dev/null +++ b/thirdparty/freetype/include/freetype/config/public-macros.h @@ -0,0 +1,120 @@ +/**************************************************************************** + * + * config/public-macros.h + * + * Define a set of compiler macros used in public FreeType headers. + * + * Copyright (C) 2020 by + * David Turner, Robert Wilhelm, and Werner Lemberg. + * + * This file is part of the FreeType project, and may only be used, + * modified, and distributed under the terms of the FreeType project + * license, LICENSE.TXT. By continuing to use, modify, or distribute + * this file you indicate that you have read the license and + * understand and accept it fully. + * + */ + + /* + * The definitions in this file are used by the public FreeType headers + * and thus should be considered part of the public API. + * + * Other compiler-specific macro definitions that are not exposed by the + * FreeType API should go into + * `include/freetype/internal/compiler-macros.h` instead. + */ +#ifndef FREETYPE_CONFIG_PUBLIC_MACROS_H_ +#define FREETYPE_CONFIG_PUBLIC_MACROS_H_ + + /* + * `FT_BEGIN_HEADER` and `FT_END_HEADER` might have already been defined + * by `freetype/config/ftheader.h`, but we don't want to include this + * header here, so redefine the macros here only when needed. Their + * definition is very stable, so keeping them in sync with the ones in the + * header should not be a maintenance issue. + */ +#ifndef FT_BEGIN_HEADER +#ifdef __cplusplus +#define FT_BEGIN_HEADER extern "C" { +#else +#define FT_BEGIN_HEADER /* empty */ +#endif +#endif /* FT_BEGIN_HEADER */ + +#ifndef FT_END_HEADER +#ifdef __cplusplus +#define FT_END_HEADER } +#else +#define FT_END_HEADER /* empty */ +#endif +#endif /* FT_END_HEADER */ + + +FT_BEGIN_HEADER + + /* + * Mark a function declaration as public. This ensures it will be + * properly exported to client code. Place this before a function + * declaration. + * + * NOTE: This macro should be considered an internal implementation + * detail, and not part of the FreeType API. It is only defined here + * because it is needed by `FT_EXPORT`. + */ + + /* Visual C, mingw */ +#if defined( _WIN32 ) + +#if defined( FT2_BUILD_LIBRARY ) && defined( DLL_EXPORT ) +#define FT_PUBLIC_FUNCTION_ATTRIBUTE __declspec( dllexport ) +#elif defined( DLL_IMPORT ) +#define FT_PUBLIC_FUNCTION_ATTRIBUTE __declspec( dllimport ) +#endif + + /* gcc, clang */ +#elif ( defined( __GNUC__ ) && __GNUC__ >= 4 ) || defined( __clang__ ) +#define FT_PUBLIC_FUNCTION_ATTRIBUTE \ + __attribute__(( visibility( "default" ) )) + + /* Sun */ +#elif defined( __SUNPRO_C ) && __SUNPRO_C >= 0x550 +#define FT_PUBLIC_FUNCTION_ATTRIBUTE __global +#endif + + +#ifndef FT_PUBLIC_FUNCTION_ATTRIBUTE +#define FT_PUBLIC_FUNCTION_ATTRIBUTE /* empty */ +#endif + + + /* + * Define a public FreeType API function. This ensures it is properly + * exported or imported at build time. The macro parameter is the + * function's return type as in: + * + * FT_EXPORT( FT_Bool ) + * FT_Object_Method( FT_Object obj, + * ... ); + * + * NOTE: This requires that all `FT_EXPORT` uses are inside + * `FT_BEGIN_HEADER ... FT_END_HEADER` blocks. This guarantees that the + * functions are exported with C linkage, even when the header is included + * by a C++ source file. + */ +#define FT_EXPORT( x ) FT_PUBLIC_FUNCTION_ATTRIBUTE extern x + + /* + * `FT_UNUSED` indicates that a given parameter is not used -- this is + * only used to get rid of unpleasant compiler warnings. + * + * Technically, this was not meant to be part of the public API, but some + * third-party code depends on it. + */ +#ifndef FT_UNUSED +#define FT_UNUSED( arg ) ( (arg) = (arg) ) +#endif + + +FT_END_HEADER + +#endif /* FREETYPE_CONFIG_PUBLIC_MACROS_H_ */ diff --git a/thirdparty/freetype/include/freetype/freetype.h b/thirdparty/freetype/include/freetype/freetype.h index 973264b125..be191f5aa0 100644 --- a/thirdparty/freetype/include/freetype/freetype.h +++ b/thirdparty/freetype/include/freetype/freetype.h @@ -20,19 +20,10 @@ #define FREETYPE_H_ -#ifndef FT_FREETYPE_H -#error "`ft2build.h' hasn't been included yet!" -#error "Please always use macros to include FreeType header files." -#error "Example:" -#error " #include <ft2build.h>" -#error " #include FT_FREETYPE_H" -#endif - - #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_TYPES_H -#include FT_ERRORS_H +#include <freetype/fttypes.h> +#include <freetype/fterrors.h> FT_BEGIN_HEADER @@ -51,22 +42,15 @@ FT_BEGIN_HEADER * How client applications should include FreeType header files. * * @description: - * To be as flexible as possible (and for historical reasons), FreeType - * uses a very special inclusion scheme to load header files, for example + * To be as flexible as possible (and for historical reasons), you must + * load file `ft2build.h` first before other header files, for example * * ``` * #include <ft2build.h> * - * #include FT_FREETYPE_H - * #include FT_OUTLINE_H + * #include <freetype/freetype.h> + * #include <freetype/ftoutln.h> * ``` - * - * A compiler and its preprocessor only needs an include path to find the - * file `ft2build.h`; the exact locations and names of the other FreeType - * header files are hidden by @header_file_macros, loaded by - * `ft2build.h`. The API documentation always gives the header macro - * name needed for a particular function. - * */ @@ -974,6 +958,9 @@ FT_BEGIN_HEADER * Note that the bounding box might be off by (at least) one pixel for * hinted fonts. See @FT_Size_Metrics for further discussion. * + * Note that the bounding box does not vary in OpenType variable fonts + * and should only be used in relation to the default instance. + * * units_per_EM :: * The number of font units per EM square for this face. This is * typically 2048 for TrueType fonts, and 1000 for Type~1 fonts. Only @@ -3188,6 +3175,12 @@ FT_BEGIN_HEADER * A pointer to the translation vector. Use `NULL` for the null vector. * * @note: + * This function is provided as a convenience, but keep in mind that + * @FT_Matrix coefficients are only 16.16 fixed point values, which can + * limit the accuracy of the results. Using floating-point computations + * to perform the transform directly in client code instead will always + * yield better numbers. + * * The transformation is only applied to scalable image formats after the * glyph has been loaded. It means that hinting is unaltered by the * transformation and is performed on the character size given in the @@ -3246,14 +3239,6 @@ FT_BEGIN_HEADER * pixels and use the @FT_PIXEL_MODE_LCD_V mode. * * @note: - * Should you define `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` in your - * `ftoption.h`, which enables patented ClearType-style rendering, the - * LCD-optimized glyph bitmaps should be filtered to reduce color fringes - * inherent to this technology. You can either set up LCD filtering with - * @FT_Library_SetLcdFilter or @FT_Face_Properties, or do the filtering - * yourself. The default FreeType LCD rendering technology does not - * require filtering. - * * The selected render mode only affects vector glyphs of a font. * Embedded bitmaps often have a different pixel mode like * @FT_PIXEL_MODE_MONO. You can use @FT_Bitmap_Convert to transform them @@ -4089,7 +4074,7 @@ FT_BEGIN_HEADER * https://docs.microsoft.com/en-us/typography/opentype/spec/colr * * The glyph layer data for a given glyph index, if present, provides an - * alternative, multi-colour glyph representation: Instead of rendering + * alternative, multi-color glyph representation: Instead of rendering * the outline or bitmap with the given glyph index, glyphs with the * indices and colors returned by this function are rendered layer by * layer. @@ -4782,7 +4767,7 @@ FT_BEGIN_HEADER */ #define FREETYPE_MAJOR 2 #define FREETYPE_MINOR 10 -#define FREETYPE_PATCH 2 +#define FREETYPE_PATCH 4 /************************************************************************** diff --git a/thirdparty/freetype/include/freetype/ftadvanc.h b/thirdparty/freetype/include/freetype/ftadvanc.h index c30472bfdb..f166bc6f99 100644 --- a/thirdparty/freetype/include/freetype/ftadvanc.h +++ b/thirdparty/freetype/include/freetype/ftadvanc.h @@ -20,8 +20,7 @@ #define FTADVANC_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -96,6 +95,7 @@ FT_BEGIN_HEADER * load_flags :: * A set of bit flags similar to those used when calling * @FT_Load_Glyph, used to determine what kind of advances you need. + * * @output: * padvance :: * The advance value. If scaling is performed (based on the value of diff --git a/thirdparty/freetype/include/freetype/ftbbox.h b/thirdparty/freetype/include/freetype/ftbbox.h index 294f996976..fda1ad94a5 100644 --- a/thirdparty/freetype/include/freetype/ftbbox.h +++ b/thirdparty/freetype/include/freetype/ftbbox.h @@ -31,8 +31,7 @@ #define FTBBOX_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftbdf.h b/thirdparty/freetype/include/freetype/ftbdf.h index 61db27c8f8..2e1daeeaaf 100644 --- a/thirdparty/freetype/include/freetype/ftbdf.h +++ b/thirdparty/freetype/include/freetype/ftbdf.h @@ -19,8 +19,7 @@ #ifndef FTBDF_H_ #define FTBDF_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftbitmap.h b/thirdparty/freetype/include/freetype/ftbitmap.h index 6c55455767..282c22e1cf 100644 --- a/thirdparty/freetype/include/freetype/ftbitmap.h +++ b/thirdparty/freetype/include/freetype/ftbitmap.h @@ -20,9 +20,8 @@ #define FTBITMAP_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_COLOR_H +#include <freetype/freetype.h> +#include <freetype/ftcolor.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftbzip2.h b/thirdparty/freetype/include/freetype/ftbzip2.h index cb8e8458ef..eb6a5a55d1 100644 --- a/thirdparty/freetype/include/freetype/ftbzip2.h +++ b/thirdparty/freetype/include/freetype/ftbzip2.h @@ -19,8 +19,7 @@ #ifndef FTBZIP2_H_ #define FTBZIP2_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -43,6 +42,16 @@ FT_BEGIN_HEADER * Using bzip2-compressed font files. * * @description: + * In certain builds of the library, bzip2 compression recognition is + * automatically handled when calling @FT_New_Face or @FT_Open_Face. + * This means that if no font driver is capable of handling the raw + * compressed file, the library will try to open a bzip2 compressed + * stream from it and re-open the face with it. + * + * The stream implementation is very basic and resets the decompression + * process each time seeking backwards is needed within the stream, + * which significantly undermines the performance. + * * This section contains the declaration of Bzip2-specific functions. * */ @@ -75,15 +84,6 @@ FT_BEGIN_HEADER * **not** call `FT_Stream_Close` on the source stream. None of the * stream objects will be released to the heap. * - * The stream implementation is very basic and resets the decompression - * process each time seeking backwards is needed within the stream. - * - * In certain builds of the library, bzip2 compression recognition is - * automatically handled when calling @FT_New_Face or @FT_Open_Face. - * This means that if no font driver is capable of handling the raw - * compressed file, the library will try to open a bzip2 compressed - * stream from it and re-open the face with it. - * * This function may return `FT_Err_Unimplemented_Feature` if your build * of FreeType was not compiled with bzip2 support. */ diff --git a/thirdparty/freetype/include/freetype/ftcache.h b/thirdparty/freetype/include/freetype/ftcache.h index d82c4815cf..6047275205 100644 --- a/thirdparty/freetype/include/freetype/ftcache.h +++ b/thirdparty/freetype/include/freetype/ftcache.h @@ -20,8 +20,7 @@ #define FTCACHE_H_ -#include <ft2build.h> -#include FT_GLYPH_H +#include <freetype/ftglyph.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/ftcid.h b/thirdparty/freetype/include/freetype/ftcid.h index 85b74e0047..a29fb33306 100644 --- a/thirdparty/freetype/include/freetype/ftcid.h +++ b/thirdparty/freetype/include/freetype/ftcid.h @@ -19,8 +19,7 @@ #ifndef FTCID_H_ #define FTCID_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftcolor.h b/thirdparty/freetype/include/freetype/ftcolor.h index b744939dd8..ecc6485e5a 100644 --- a/thirdparty/freetype/include/freetype/ftcolor.h +++ b/thirdparty/freetype/include/freetype/ftcolor.h @@ -19,8 +19,7 @@ #ifndef FTCOLOR_H_ #define FTCOLOR_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftdriver.h b/thirdparty/freetype/include/freetype/ftdriver.h index 19b666ecb0..804ec34a39 100644 --- a/thirdparty/freetype/include/freetype/ftdriver.h +++ b/thirdparty/freetype/include/freetype/ftdriver.h @@ -19,9 +19,8 @@ #ifndef FTDRIVER_H_ #define FTDRIVER_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_PARAMETER_TAGS_H +#include <freetype/freetype.h> +#include <freetype/ftparams.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -427,10 +426,6 @@ FT_BEGIN_HEADER * counteracts the 'thinning out' of glyphs, making text remain readable * at smaller sizes. * - * By default, the Adobe engines for CFF, Type~1, and CID fonts darken - * stems at smaller sizes, regardless of hinting, to enhance contrast. - * Setting this property, stem darkening gets switched off. - * * For the auto-hinter, stem-darkening is experimental currently and thus * switched off by default (this is, `no-stem-darkening` is set to TRUE * by default). Total consistency with the CFF driver is not achieved diff --git a/thirdparty/freetype/include/freetype/fterrors.h b/thirdparty/freetype/include/freetype/fterrors.h index 771bc5db52..60a637c77c 100644 --- a/thirdparty/freetype/include/freetype/fterrors.h +++ b/thirdparty/freetype/include/freetype/fterrors.h @@ -89,7 +89,7 @@ * const char* err_msg; * } ft_errors[] = * - * #include FT_ERRORS_H + * #include <freetype/fterrors.h> * ``` * * An alternative to using an array is a switch statement. @@ -124,7 +124,7 @@ /* include module base error codes */ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> /*******************************************************************/ @@ -197,7 +197,7 @@ /* now include the error codes */ -#include FT_ERROR_DEFINITIONS_H +#include <freetype/fterrdef.h> #ifdef FT_ERROR_END_LIST @@ -232,11 +232,16 @@ #undef FT_ERR_PREFIX #endif - /* FT_INCLUDE_ERR_PROTOS: Control if function prototypes should be */ - /* included with `#include FT_ERRORS_H'. This is */ - /* only true where `FT_ERRORDEF` is undefined. */ - /* FT_ERR_PROTOS_DEFINED: Actual multiple-inclusion protection of */ - /* `fterrors.h`. */ + /* FT_INCLUDE_ERR_PROTOS: Control whether function prototypes should be */ + /* included with */ + /* */ + /* #include <freetype/fterrors.h> */ + /* */ + /* This is only true where `FT_ERRORDEF` is */ + /* undefined. */ + /* */ + /* FT_ERR_PROTOS_DEFINED: Actual multiple-inclusion protection of */ + /* `fterrors.h`. */ #ifdef FT_INCLUDE_ERR_PROTOS #undef FT_INCLUDE_ERR_PROTOS diff --git a/thirdparty/freetype/include/freetype/ftfntfmt.h b/thirdparty/freetype/include/freetype/ftfntfmt.h index ad5a1d4162..f803349cd7 100644 --- a/thirdparty/freetype/include/freetype/ftfntfmt.h +++ b/thirdparty/freetype/include/freetype/ftfntfmt.h @@ -19,8 +19,7 @@ #ifndef FTFNTFMT_H_ #define FTFNTFMT_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftgasp.h b/thirdparty/freetype/include/freetype/ftgasp.h index aca1a1329d..6b76882c74 100644 --- a/thirdparty/freetype/include/freetype/ftgasp.h +++ b/thirdparty/freetype/include/freetype/ftgasp.h @@ -19,8 +19,7 @@ #ifndef FTGASP_H_ #define FTGASP_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftglyph.h b/thirdparty/freetype/include/freetype/ftglyph.h index ec515a3694..704619e3d0 100644 --- a/thirdparty/freetype/include/freetype/ftglyph.h +++ b/thirdparty/freetype/include/freetype/ftglyph.h @@ -33,8 +33,7 @@ #define FTGLYPH_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftgxval.h b/thirdparty/freetype/include/freetype/ftgxval.h index 691a73b94a..354460a9a7 100644 --- a/thirdparty/freetype/include/freetype/ftgxval.h +++ b/thirdparty/freetype/include/freetype/ftgxval.h @@ -28,8 +28,7 @@ #ifndef FTGXVAL_H_ #define FTGXVAL_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftgzip.h b/thirdparty/freetype/include/freetype/ftgzip.h index f588c8503b..ec5939a191 100644 --- a/thirdparty/freetype/include/freetype/ftgzip.h +++ b/thirdparty/freetype/include/freetype/ftgzip.h @@ -19,8 +19,7 @@ #ifndef FTGZIP_H_ #define FTGZIP_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -43,6 +42,16 @@ FT_BEGIN_HEADER * Using gzip-compressed font files. * * @description: + * In certain builds of the library, gzip compression recognition is + * automatically handled when calling @FT_New_Face or @FT_Open_Face. + * This means that if no font driver is capable of handling the raw + * compressed file, the library will try to open a gzipped stream from it + * and re-open the face with it. + * + * The stream implementation is very basic and resets the decompression + * process each time seeking backwards is needed within the stream, + * which significantly undermines the performance. + * * This section contains the declaration of Gzip-specific functions. * */ @@ -75,15 +84,6 @@ FT_BEGIN_HEADER * **not** call `FT_Stream_Close` on the source stream. None of the * stream objects will be released to the heap. * - * The stream implementation is very basic and resets the decompression - * process each time seeking backwards is needed within the stream. - * - * In certain builds of the library, gzip compression recognition is - * automatically handled when calling @FT_New_Face or @FT_Open_Face. - * This means that if no font driver is capable of handling the raw - * compressed file, the library will try to open a gzipped stream from it - * and re-open the face with it. - * * This function may return `FT_Err_Unimplemented_Feature` if your build * of FreeType was not compiled with zlib support. */ diff --git a/thirdparty/freetype/include/freetype/ftimage.h b/thirdparty/freetype/include/freetype/ftimage.h index 185967c1b8..74911620d2 100644 --- a/thirdparty/freetype/include/freetype/ftimage.h +++ b/thirdparty/freetype/include/freetype/ftimage.h @@ -30,7 +30,6 @@ /* STANDALONE_ is from ftgrays.c */ #ifndef STANDALONE_ -#include <ft2build.h> #endif @@ -401,6 +400,13 @@ FT_BEGIN_HEADER * if @FT_OUTLINE_IGNORE_DROPOUTS is set. See below for more * information. * + * FT_OUTLINE_OVERLAP :: + * This flag indicates that this outline contains overlapping contrours + * and the anti-aliased renderer should perform oversampling to + * mitigate possible artifacts. This flag should _not_ be set for + * well designed glyphs without overlaps because it quadruples the + * rendering time. + * * FT_OUTLINE_HIGH_PRECISION :: * This flag indicates that the scan-line converter should try to * convert this outline to bitmaps with the highest possible quality. @@ -432,6 +438,7 @@ FT_BEGIN_HEADER #define FT_OUTLINE_IGNORE_DROPOUTS 0x8 #define FT_OUTLINE_SMART_DROPOUTS 0x10 #define FT_OUTLINE_INCLUDE_STUBS 0x20 +#define FT_OUTLINE_OVERLAP 0x40 #define FT_OUTLINE_HIGH_PRECISION 0x100 #define FT_OUTLINE_SINGLE_PASS 0x200 @@ -1004,20 +1011,26 @@ FT_BEGIN_HEADER * User-supplied data that is passed to each drawing callback. * * clip_box :: - * An optional clipping box. It is only used in direct rendering mode. - * Note that coordinates here should be expressed in _integer_ pixels - * (and not in 26.6 fixed-point units). + * An optional span clipping box expressed in _integer_ pixels + * (not in 26.6 fixed-point units). * * @note: - * An anti-aliased glyph bitmap is drawn if the @FT_RASTER_FLAG_AA bit - * flag is set in the `flags` field, otherwise a monochrome bitmap is - * generated. - * - * If the @FT_RASTER_FLAG_DIRECT bit flag is set in `flags`, the raster - * will call the `gray_spans` callback to draw gray pixel spans. This - * allows direct composition over a pre-existing bitmap through - * user-provided callbacks to perform the span drawing and composition. - * Not supported by the monochrome rasterizer. + * The @FT_RASTER_FLAG_AA bit flag must be set in the `flags` to + * generate an anti-aliased glyph bitmap, otherwise a monochrome bitmap + * is generated. The `target` should have appropriate pixel mode and its + * dimensions define the clipping region. + * + * If both @FT_RASTER_FLAG_AA and @FT_RASTER_FLAG_DIRECT bit flags + * are set in `flags`, the raster calls an @FT_SpanFunc callback + * `gray_spans` with `user` data as an argument ignoring `target`. This + * allows direct composition over a pre-existing user surface to perform + * the span drawing and composition. To optionally clip the spans, set + * the @FT_RASTER_FLAG_CLIP flag and `clip_box`. The monochrome raster + * does not support the direct mode. + * + * The gray-level rasterizer always uses 256 gray levels. If you want + * fewer gray levels, you have to use @FT_RASTER_FLAG_DIRECT and reduce + * the levels in the callback function. */ typedef struct FT_Raster_Params_ { diff --git a/thirdparty/freetype/include/freetype/ftincrem.h b/thirdparty/freetype/include/freetype/ftincrem.h index 8c00cfe41c..f67655eda0 100644 --- a/thirdparty/freetype/include/freetype/ftincrem.h +++ b/thirdparty/freetype/include/freetype/ftincrem.h @@ -19,9 +19,8 @@ #ifndef FTINCREM_H_ #define FTINCREM_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_PARAMETER_TAGS_H +#include <freetype/freetype.h> +#include <freetype/ftparams.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftlcdfil.h b/thirdparty/freetype/include/freetype/ftlcdfil.h index c5516d0e0d..c6995f2ff7 100644 --- a/thirdparty/freetype/include/freetype/ftlcdfil.h +++ b/thirdparty/freetype/include/freetype/ftlcdfil.h @@ -20,9 +20,8 @@ #ifndef FTLCDFIL_H_ #define FTLCDFIL_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_PARAMETER_TAGS_H +#include <freetype/freetype.h> +#include <freetype/ftparams.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -47,7 +46,7 @@ FT_BEGIN_HEADER * @description: * FreeType provides two alternative subpixel rendering technologies. * Should you define `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` in your - * `ftoption.h` file, this enables patented ClearType-style rendering. + * `ftoption.h` file, this enables ClearType-style rendering. * Otherwise, Harmony LCD rendering is enabled. These technologies are * controlled differently and API described below, although always * available, performs its function when appropriate method is enabled @@ -177,7 +176,7 @@ FT_BEGIN_HEADER * FT_Library_SetLcdFilter * * @description: - * This function is used to apply color filtering to LCD decimated + * This function is used to change filter applied to LCD decimated * bitmaps, like the ones used when calling @FT_Render_Glyph with * @FT_RENDER_MODE_LCD or @FT_RENDER_MODE_LCD_V. * @@ -196,15 +195,14 @@ FT_BEGIN_HEADER * FreeType error code. 0~means success. * * @note: - * This feature is always disabled by default. Clients must make an - * explicit call to this function with a `filter` value other than - * @FT_LCD_FILTER_NONE in order to enable it. + * Since 2.10.3 the LCD filtering is enabled with @FT_LCD_FILTER_DEFAULT. + * It is no longer necessary to call this function explicitly except + * to choose a different filter or disable filtering altogether with + * @FT_LCD_FILTER_NONE. * - * Due to **PATENTS** covering subpixel rendering, this function doesn't - * do anything except returning `FT_Err_Unimplemented_Feature` if the - * configuration macro `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` is not - * defined in your build of the library, which should correspond to all - * default builds of FreeType. + * This function does nothing but returns `FT_Err_Unimplemented_Feature` + * if the configuration macro `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` is + * not defined in your build of the library. * * @since: * 2.3.0 @@ -235,11 +233,9 @@ FT_BEGIN_HEADER * FreeType error code. 0~means success. * * @note: - * Due to **PATENTS** covering subpixel rendering, this function doesn't - * do anything except returning `FT_Err_Unimplemented_Feature` if the - * configuration macro `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` is not - * defined in your build of the library, which should correspond to all - * default builds of FreeType. + * This function does nothing but returns `FT_Err_Unimplemented_Feature` + * if the configuration macro `FT_CONFIG_OPTION_SUBPIXEL_RENDERING` is + * not defined in your build of the library. * * LCD filter weights can also be set per face using @FT_Face_Properties * with @FT_PARAM_TAG_LCD_FILTER_WEIGHTS. diff --git a/thirdparty/freetype/include/freetype/ftlist.h b/thirdparty/freetype/include/freetype/ftlist.h index 3f6079f243..4588922706 100644 --- a/thirdparty/freetype/include/freetype/ftlist.h +++ b/thirdparty/freetype/include/freetype/ftlist.h @@ -28,8 +28,7 @@ #define FTLIST_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftlzw.h b/thirdparty/freetype/include/freetype/ftlzw.h index 37a53c1b3e..ae46ad6021 100644 --- a/thirdparty/freetype/include/freetype/ftlzw.h +++ b/thirdparty/freetype/include/freetype/ftlzw.h @@ -19,8 +19,7 @@ #ifndef FTLZW_H_ #define FTLZW_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -43,6 +42,16 @@ FT_BEGIN_HEADER * Using LZW-compressed font files. * * @description: + * In certain builds of the library, LZW compression recognition is + * automatically handled when calling @FT_New_Face or @FT_Open_Face. + * This means that if no font driver is capable of handling the raw + * compressed file, the library will try to open a LZW stream from it and + * re-open the face with it. + * + * The stream implementation is very basic and resets the decompression + * process each time seeking backwards is needed within the stream, + * which significantly undermines the performance. + * * This section contains the declaration of LZW-specific functions. * */ @@ -73,15 +82,6 @@ FT_BEGIN_HEADER * **not** call `FT_Stream_Close` on the source stream. None of the * stream objects will be released to the heap. * - * The stream implementation is very basic and resets the decompression - * process each time seeking backwards is needed within the stream - * - * In certain builds of the library, LZW compression recognition is - * automatically handled when calling @FT_New_Face or @FT_Open_Face. - * This means that if no font driver is capable of handling the raw - * compressed file, the library will try to open a LZW stream from it and - * re-open the face with it. - * * This function may return `FT_Err_Unimplemented_Feature` if your build * of FreeType was not compiled with LZW support. */ diff --git a/thirdparty/freetype/include/freetype/ftmac.h b/thirdparty/freetype/include/freetype/ftmac.h index c1a0aa373e..c9de981845 100644 --- a/thirdparty/freetype/include/freetype/ftmac.h +++ b/thirdparty/freetype/include/freetype/ftmac.h @@ -29,7 +29,6 @@ #define FTMAC_H_ -#include <ft2build.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/ftmm.h b/thirdparty/freetype/include/freetype/ftmm.h index 0d839942b9..d8781a8296 100644 --- a/thirdparty/freetype/include/freetype/ftmm.h +++ b/thirdparty/freetype/include/freetype/ftmm.h @@ -20,8 +20,7 @@ #define FTMM_H_ -#include <ft2build.h> -#include FT_TYPE1_TABLES_H +#include <freetype/t1tables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/ftmodapi.h b/thirdparty/freetype/include/freetype/ftmodapi.h index 01cb5fba88..3f7ae82bab 100644 --- a/thirdparty/freetype/include/freetype/ftmodapi.h +++ b/thirdparty/freetype/include/freetype/ftmodapi.h @@ -20,8 +20,7 @@ #define FTMODAPI_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -65,7 +64,7 @@ FT_BEGIN_HEADER * psnames * raster1 * sfnt - * smooth, smooth-lcd, smooth-lcdv + * smooth * truetype * type1 * type42 @@ -486,7 +485,7 @@ FT_BEGIN_HEADER * * ``` * FREETYPE_PROPERTIES=truetype:interpreter-version=35 \ - * cff:no-stem-darkening=1 \ + * cff:no-stem-darkening=0 \ * autofitter:warping=1 * ``` * diff --git a/thirdparty/freetype/include/freetype/ftmoderr.h b/thirdparty/freetype/include/freetype/ftmoderr.h index 5e6aeeb43e..f05fc53aa3 100644 --- a/thirdparty/freetype/include/freetype/ftmoderr.h +++ b/thirdparty/freetype/include/freetype/ftmoderr.h @@ -94,7 +94,7 @@ * const char* mod_err_msg * } ft_mod_errors[] = * - * #include FT_MODULE_ERRORS_H + * #include <freetype/ftmoderr.h> * ``` * */ diff --git a/thirdparty/freetype/include/freetype/ftotval.h b/thirdparty/freetype/include/freetype/ftotval.h index 6f46c414bd..9c00ad30b9 100644 --- a/thirdparty/freetype/include/freetype/ftotval.h +++ b/thirdparty/freetype/include/freetype/ftotval.h @@ -30,8 +30,7 @@ #ifndef FTOTVAL_H_ #define FTOTVAL_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftoutln.h b/thirdparty/freetype/include/freetype/ftoutln.h index fa295b0ab6..84e9b144c1 100644 --- a/thirdparty/freetype/include/freetype/ftoutln.h +++ b/thirdparty/freetype/include/freetype/ftoutln.h @@ -21,8 +21,7 @@ #define FTOUTLN_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" @@ -483,19 +482,13 @@ FT_BEGIN_HEADER * FreeType error code. 0~means success. * * @note: - * This advanced function uses @FT_Raster_Params as an argument, - * allowing FreeType rasterizer to be used for direct composition, - * translucency, etc. You should know how to set up @FT_Raster_Params - * for this function to work. - * + * This advanced function uses @FT_Raster_Params as an argument. * The field `params.source` will be set to `outline` before the scan * converter is called, which means that the value you give to it is - * actually ignored. - * - * The gray-level rasterizer always uses 256 gray levels. If you want - * less gray levels, you have to provide your own span callback. See the - * @FT_RASTER_FLAG_DIRECT value of the `flags` field in the - * @FT_Raster_Params structure for more details. + * actually ignored. Either `params.target` must point to preallocated + * bitmap, or @FT_RASTER_FLAG_DIRECT must be set in `params.flags` + * allowing FreeType rasterizer to be used for direct composition, + * translucency, etc. See @FT_Raster_Params for more details. */ FT_EXPORT( FT_Error ) FT_Outline_Render( FT_Library library, diff --git a/thirdparty/freetype/include/freetype/ftparams.h b/thirdparty/freetype/include/freetype/ftparams.h index 255c6bb160..55ea2a3870 100644 --- a/thirdparty/freetype/include/freetype/ftparams.h +++ b/thirdparty/freetype/include/freetype/ftparams.h @@ -19,8 +19,7 @@ #ifndef FTPARAMS_H_ #define FTPARAMS_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftpfr.h b/thirdparty/freetype/include/freetype/ftpfr.h index 58fbbb78d3..9a5383f918 100644 --- a/thirdparty/freetype/include/freetype/ftpfr.h +++ b/thirdparty/freetype/include/freetype/ftpfr.h @@ -19,8 +19,7 @@ #ifndef FTPFR_H_ #define FTPFR_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftrender.h b/thirdparty/freetype/include/freetype/ftrender.h index 6845111901..8007951b37 100644 --- a/thirdparty/freetype/include/freetype/ftrender.h +++ b/thirdparty/freetype/include/freetype/ftrender.h @@ -20,9 +20,8 @@ #define FTRENDER_H_ -#include <ft2build.h> -#include FT_MODULE_H -#include FT_GLYPH_H +#include <freetype/ftmodapi.h> +#include <freetype/ftglyph.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/ftsizes.h b/thirdparty/freetype/include/freetype/ftsizes.h index 7dc9295211..a8682a30fb 100644 --- a/thirdparty/freetype/include/freetype/ftsizes.h +++ b/thirdparty/freetype/include/freetype/ftsizes.h @@ -29,8 +29,7 @@ #define FTSIZES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftsnames.h b/thirdparty/freetype/include/freetype/ftsnames.h index 2982760635..729e6ab069 100644 --- a/thirdparty/freetype/include/freetype/ftsnames.h +++ b/thirdparty/freetype/include/freetype/ftsnames.h @@ -23,9 +23,8 @@ #define FTSNAMES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_PARAMETER_TAGS_H +#include <freetype/freetype.h> +#include <freetype/ftparams.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftstroke.h b/thirdparty/freetype/include/freetype/ftstroke.h index 141af7d0ba..a759c94dde 100644 --- a/thirdparty/freetype/include/freetype/ftstroke.h +++ b/thirdparty/freetype/include/freetype/ftstroke.h @@ -19,9 +19,8 @@ #ifndef FTSTROKE_H_ #define FTSTROKE_H_ -#include <ft2build.h> -#include FT_OUTLINE_H -#include FT_GLYPH_H +#include <freetype/ftoutln.h> +#include <freetype/ftglyph.h> FT_BEGIN_HEADER @@ -44,7 +43,7 @@ FT_BEGIN_HEADER * borders of the stroke. * * This can be useful to generate 'bordered' glyph, i.e., glyphs - * displayed with a coloured (and anti-aliased) border around their + * displayed with a colored (and anti-aliased) border around their * shape. * * @order: diff --git a/thirdparty/freetype/include/freetype/ftsynth.h b/thirdparty/freetype/include/freetype/ftsynth.h index 3882e69e61..bdb4c5753e 100644 --- a/thirdparty/freetype/include/freetype/ftsynth.h +++ b/thirdparty/freetype/include/freetype/ftsynth.h @@ -45,8 +45,7 @@ #define FTSYNTH_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ftsystem.h b/thirdparty/freetype/include/freetype/ftsystem.h index f7fecb53f3..22aead7140 100644 --- a/thirdparty/freetype/include/freetype/ftsystem.h +++ b/thirdparty/freetype/include/freetype/ftsystem.h @@ -20,7 +20,6 @@ #define FTSYSTEM_H_ -#include <ft2build.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/fttrigon.h b/thirdparty/freetype/include/freetype/fttrigon.h index 968df1fbfd..2ce6b324c9 100644 --- a/thirdparty/freetype/include/freetype/fttrigon.h +++ b/thirdparty/freetype/include/freetype/fttrigon.h @@ -19,7 +19,7 @@ #ifndef FTTRIGON_H_ #define FTTRIGON_H_ -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/fttypes.h b/thirdparty/freetype/include/freetype/fttypes.h index cb785d98b2..aaeb9e8785 100644 --- a/thirdparty/freetype/include/freetype/fttypes.h +++ b/thirdparty/freetype/include/freetype/fttypes.h @@ -22,8 +22,8 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_SYSTEM_H -#include FT_IMAGE_H +#include <freetype/ftsystem.h> +#include <freetype/ftimage.h> #include <stddef.h> diff --git a/thirdparty/freetype/include/freetype/ftwinfnt.h b/thirdparty/freetype/include/freetype/ftwinfnt.h index bacb8aa373..786528c6ec 100644 --- a/thirdparty/freetype/include/freetype/ftwinfnt.h +++ b/thirdparty/freetype/include/freetype/ftwinfnt.h @@ -19,8 +19,7 @@ #ifndef FTWINFNT_H_ #define FTWINFNT_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/internal/autohint.h b/thirdparty/freetype/include/freetype/internal/autohint.h index 438f9c175e..2a472e20b9 100644 --- a/thirdparty/freetype/include/freetype/internal/autohint.h +++ b/thirdparty/freetype/include/freetype/internal/autohint.h @@ -70,8 +70,7 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> FT_BEGIN_HEADER @@ -208,6 +207,9 @@ FT_BEGIN_HEADER } FT_AutoHinter_InterfaceRec, *FT_AutoHinter_Interface; +#define FT_DECLARE_AUTOHINTER_INTERFACE( class_ ) \ + FT_CALLBACK_TABLE const FT_AutoHinter_InterfaceRec class_; + #define FT_DEFINE_AUTOHINTER_INTERFACE( \ class_, \ reset_face_, \ diff --git a/thirdparty/freetype/include/freetype/internal/cffotypes.h b/thirdparty/freetype/include/freetype/internal/cffotypes.h index 207eeda5ff..a316fd1f30 100644 --- a/thirdparty/freetype/include/freetype/internal/cffotypes.h +++ b/thirdparty/freetype/include/freetype/internal/cffotypes.h @@ -19,12 +19,11 @@ #ifndef CFFOTYPES_H_ #define CFFOTYPES_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_CFF_TYPES_H -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/cfftypes.h> +#include <freetype/internal/tttypes.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/pshints.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/cfftypes.h b/thirdparty/freetype/include/freetype/internal/cfftypes.h index 40b0fc73c9..f21167b1e5 100644 --- a/thirdparty/freetype/include/freetype/internal/cfftypes.h +++ b/thirdparty/freetype/include/freetype/internal/cfftypes.h @@ -21,13 +21,12 @@ #define CFFTYPES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TYPE1_TABLES_H -#include FT_INTERNAL_SERVICE_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/freetype.h> +#include <freetype/t1tables.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/pshints.h> +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/compiler-macros.h b/thirdparty/freetype/include/freetype/internal/compiler-macros.h new file mode 100644 index 0000000000..97c18d3a21 --- /dev/null +++ b/thirdparty/freetype/include/freetype/internal/compiler-macros.h @@ -0,0 +1,307 @@ +/**************************************************************************** + * + * internal/compiler-macros.h + * + * Compiler-specific macro definitions used internally by FreeType. + * + * Copyright (C) 2020 by + * David Turner, Robert Wilhelm, and Werner Lemberg. + * + * This file is part of the FreeType project, and may only be used, + * modified, and distributed under the terms of the FreeType project + * license, LICENSE.TXT. By continuing to use, modify, or distribute + * this file you indicate that you have read the license and + * understand and accept it fully. + * + */ + +#ifndef INTERNAL_COMPILER_MACROS_H_ +#define INTERNAL_COMPILER_MACROS_H_ + +#include <freetype/config/public-macros.h> + +FT_BEGIN_HEADER + + /* Fix compiler warning with sgi compiler. */ +#if defined( __sgi ) && !defined( __GNUC__ ) +# if defined( _COMPILER_VERSION ) && ( _COMPILER_VERSION >= 730 ) +# pragma set woff 3505 +# endif +#endif + + /* Fix compiler warning with sgi compiler. */ +#if defined( __sgi ) && !defined( __GNUC__ ) +# if defined( _COMPILER_VERSION ) && ( _COMPILER_VERSION >= 730 ) +# pragma set woff 3505 +# endif +#endif + + /* + * When defining a macro that expands to a non-trivial C statement, use + * FT_BEGIN_STMNT and FT_END_STMNT to enclose the macro's body. This + * ensures there are no surprises when the macro is invoked in conditional + * branches. + * + * Example: + * + * #define LOG( ... ) \ + * FT_BEGIN_STMNT \ + * if ( logging_enabled ) \ + * log( __VA_ARGS__ ); \ + * FT_END_STMNT + */ +#define FT_BEGIN_STMNT do { +#define FT_END_STMNT } while ( 0 ) + + /* + * FT_DUMMY_STMNT expands to an empty C statement. Useful for + * conditionally defined statement macros. + * + * Example: + * + * #ifdef BUILD_CONFIG_LOGGING + * #define LOG( ... ) \ + * FT_BEGIN_STMNT \ + * if ( logging_enabled ) \ + * log( __VA_ARGS__ ); \ + * FT_END_STMNT + * #else + * # define LOG( ... ) FT_DUMMY_STMNT + * #endif + */ +#define FT_DUMMY_STMNT FT_BEGIN_STMNT FT_END_STMNT + +#ifdef _WIN64 + /* only 64bit Windows uses the LLP64 data model, i.e., */ + /* 32-bit integers, 64-bit pointers. */ +#define FT_UINT_TO_POINTER( x ) (void *)(unsigned __int64)(x) +#else +#define FT_UINT_TO_POINTER( x ) (void *)(unsigned long)(x) +#endif + + /* + * Use `FT_TYPEOF( type )` to cast a value to `type`. This is useful to + * suppress signedness compilation warnings in macros. + * + * Example: + * + * #define PAD_( x, n ) ( (x) & ~FT_TYPEOF( x )( (n) - 1 ) ) + * + * (The `typeof` condition is taken from gnulib's `intprops.h` header + * file.) + */ +#if ( ( defined( __GNUC__ ) && __GNUC__ >= 2 ) || \ + ( defined( __IBMC__ ) && __IBMC__ >= 1210 && \ + defined( __IBM__TYPEOF__ ) ) || \ + ( defined( __SUNPRO_C ) && __SUNPRO_C >= 0x5110 && !__STDC__ ) ) +#define FT_TYPEOF( type ) ( __typeof__ ( type ) ) +#else +#define FT_TYPEOF( type ) /* empty */ +#endif + + /* + * Mark a function declaration as internal to the library. This ensures + * that it will not be exposed by default to client code, and helps + * generate smaller and faster code on ELF-based platforms. Place this + * before a function declaration. + */ + + /* Visual C, mingw */ +#if defined( _WIN32 ) +#define FT_INTERNAL_FUNCTION_ATTRIBUTE /* empty */ + + /* gcc, clang */ +#elif ( defined( __GNUC__ ) && __GNUC__ >= 4 ) || defined( __clang__ ) +#define FT_INTERNAL_FUNCTION_ATTRIBUTE \ + __attribute__(( visibility( "hidden" ) )) + + /* Sun */ +#elif defined( __SUNPRO_C ) && __SUNPRO_C >= 0x550 +#define FT_INTERNAL_FUNCTION_ATTRIBUTE __hidden + +#else +#define FT_INTERNAL_FUNCTION_ATTRIBUTE /* empty */ +#endif + + /* + * FreeType supports compilation of its C sources with a C++ compiler (in + * C++ mode); this introduces a number of subtle issues. + * + * The main one is that a C++ function declaration and its definition must + * have the same 'linkage'. Because all FreeType headers declare their + * functions with C linkage (i.e., within an `extern "C" { ... }` block + * due to the magic of FT_BEGIN_HEADER and FT_END_HEADER), their + * definition in FreeType sources should also be prefixed with `extern + * "C"` when compiled in C++ mode. + * + * The `FT_FUNCTION_DECLARATION` and `FT_FUNCTION_DEFINITION` macros are + * provided to deal with this case, as well as `FT_CALLBACK_DEF` and its + * siblings below. + */ + + /* + * `FT_FUNCTION_DECLARATION( type )` can be used to write a C function + * declaration to ensure it will have C linkage when the library is built + * with a C++ compiler. The parameter is the function's return type, so a + * declaration would look like + * + * FT_FUNCTION_DECLARATION( int ) + * foo( int x ); + * + * NOTE: This requires that all uses are inside of `FT_BEGIN_HEADER ... + * FT_END_HEADER` blocks, which guarantees that the declarations have C + * linkage when the headers are included by C++ sources. + * + * NOTE: Do not use directly. Use `FT_LOCAL`, `FT_BASE`, and `FT_EXPORT` + * instead. + */ +#define FT_FUNCTION_DECLARATION( x ) extern x + + /* + * Same as `FT_FUNCTION_DECLARATION`, but for function definitions instead. + * + * NOTE: Do not use directly. Use `FT_LOCAL_DEF`, `FT_BASE_DEF`, and + * `FT_EXPORT_DEF` instead. + */ +#ifdef __cplusplus +#define FT_FUNCTION_DEFINITION( x ) extern "C" x +#else +#define FT_FUNCTION_DEFINITION( x ) x +#endif + + /* + * Use `FT_LOCAL` and `FT_LOCAL_DEF` to declare and define, respectively, + * an internal FreeType function that is only used by the sources of a + * single `src/module/` directory. This ensures that the functions are + * turned into static ones at build time, resulting in smaller and faster + * code. + */ +#ifdef FT_MAKE_OPTION_SINGLE_OBJECT + +#define FT_LOCAL( x ) static x +#define FT_LOCAL_DEF( x ) static x + +#else + +#define FT_LOCAL( x ) FT_INTERNAL_FUNCTION_ATTRIBUTE \ + FT_FUNCTION_DECLARATION( x ) +#define FT_LOCAL_DEF( x ) FT_FUNCTION_DEFINITION( x ) + +#endif /* FT_MAKE_OPTION_SINGLE_OBJECT */ + + /* + * Use `FT_LOCAL_ARRAY` and `FT_LOCAL_ARRAY_DEF` to declare and define, + * respectively, a constant array that must be accessed from several + * sources in the same `src/module/` sub-directory, and which are internal + * to the library. + */ +#define FT_LOCAL_ARRAY( x ) FT_INTERNAL_FUNCTION_ATTRIBUTE \ + extern const x +#define FT_LOCAL_ARRAY_DEF( x ) FT_FUNCTION_DEFINITION( const x ) + + /* + * `Use FT_BASE` and `FT_BASE_DEF` to declare and define, respectively, an + * internal library function that is used by more than a single module. + */ +#define FT_BASE( x ) FT_INTERNAL_FUNCTION_ATTRIBUTE \ + FT_FUNCTION_DECLARATION( x ) +#define FT_BASE_DEF( x ) FT_FUNCTION_DEFINITION( x ) + + + /* + * NOTE: Conditionally define `FT_EXPORT_VAR` due to its definition in + * `src/smooth/ftgrays.h` to make the header more portable. + */ +#ifndef FT_EXPORT_VAR +#define FT_EXPORT_VAR( x ) FT_FUNCTION_DECLARATION( x ) +#endif + + /* When compiling FreeType as a DLL or DSO with hidden visibility, */ + /* some systems/compilers need a special attribute in front OR after */ + /* the return type of function declarations. */ + /* */ + /* Two macros are used within the FreeType source code to define */ + /* exported library functions: `FT_EXPORT` and `FT_EXPORT_DEF`. */ + /* */ + /* - `FT_EXPORT( return_type )` */ + /* */ + /* is used in a function declaration, as in */ + /* */ + /* ``` */ + /* FT_EXPORT( FT_Error ) */ + /* FT_Init_FreeType( FT_Library* alibrary ); */ + /* ``` */ + /* */ + /* - `FT_EXPORT_DEF( return_type )` */ + /* */ + /* is used in a function definition, as in */ + /* */ + /* ``` */ + /* FT_EXPORT_DEF( FT_Error ) */ + /* FT_Init_FreeType( FT_Library* alibrary ) */ + /* { */ + /* ... some code ... */ + /* return FT_Err_Ok; */ + /* } */ + /* ``` */ + /* */ + /* You can provide your own implementation of `FT_EXPORT` and */ + /* `FT_EXPORT_DEF` here if you want. */ + /* */ + /* To export a variable, use `FT_EXPORT_VAR`. */ + /* */ + + /* See `freetype/config/compiler_macros.h` for the `FT_EXPORT` definition */ +#define FT_EXPORT_DEF( x ) FT_FUNCTION_DEFINITION( x ) + + /* The following macros are needed to compile the library with a */ + /* C++ compiler and with 16bit compilers. */ + /* */ + + /* This is special. Within C++, you must specify `extern "C"` for */ + /* functions which are used via function pointers, and you also */ + /* must do that for structures which contain function pointers to */ + /* assure C linkage -- it's not possible to have (local) anonymous */ + /* functions which are accessed by (global) function pointers. */ + /* */ + /* */ + /* FT_CALLBACK_DEF is used to _define_ a callback function, */ + /* located in the same source code file as the structure that uses */ + /* it. */ + /* */ + /* FT_BASE_CALLBACK and FT_BASE_CALLBACK_DEF are used to declare */ + /* and define a callback function, respectively, in a similar way */ + /* as FT_BASE and FT_BASE_DEF work. */ + /* */ + /* FT_CALLBACK_TABLE is used to _declare_ a constant variable that */ + /* contains pointers to callback functions. */ + /* */ + /* FT_CALLBACK_TABLE_DEF is used to _define_ a constant variable */ + /* that contains pointers to callback functions. */ + /* */ + /* */ + /* Some 16bit compilers have to redefine these macros to insert */ + /* the infamous `_cdecl` or `__fastcall` declarations. */ + /* */ +#ifdef __cplusplus +#define FT_CALLBACK_DEF( x ) extern "C" x +#else +#define FT_CALLBACK_DEF( x ) static x +#endif + +#define FT_BASE_CALLBACK( x ) FT_FUNCTION_DECLARATION( x ) +#define FT_BASE_CALLBACK_DEF( x ) FT_FUNCTION_DEFINITION( x ) + +#ifndef FT_CALLBACK_TABLE +#ifdef __cplusplus +#define FT_CALLBACK_TABLE extern "C" +#define FT_CALLBACK_TABLE_DEF extern "C" +#else +#define FT_CALLBACK_TABLE extern +#define FT_CALLBACK_TABLE_DEF /* nothing */ +#endif +#endif /* FT_CALLBACK_TABLE */ + +FT_END_HEADER + +#endif /* INTERNAL_COMPILER_MACROS_H_ */ diff --git a/thirdparty/freetype/include/freetype/internal/ftcalc.h b/thirdparty/freetype/include/freetype/internal/ftcalc.h index 3054a4c497..c65307472f 100644 --- a/thirdparty/freetype/include/freetype/internal/ftcalc.h +++ b/thirdparty/freetype/include/freetype/internal/ftcalc.h @@ -20,9 +20,9 @@ #define FTCALC_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> +#include "compiler-macros.h" FT_BEGIN_HEADER @@ -449,8 +449,7 @@ FT_BEGIN_HEADER #define F2DOT14_TO_FIXED( x ) ( (FT_Long)(x) * 4 ) /* << 2 */ #define FIXED_TO_INT( x ) ( FT_RoundFix( x ) >> 16 ) -#define ROUND_F26DOT6( x ) ( x >= 0 ? ( ( (x) + 32 ) & -64 ) \ - : ( -( ( 32 - (x) ) & -64 ) ) ) +#define ROUND_F26DOT6( x ) ( ( (x) + 32 - ( x < 0 ) ) & -64 ) /* * The following macros have two purposes. diff --git a/thirdparty/freetype/include/freetype/internal/ftdebug.h b/thirdparty/freetype/include/freetype/internal/ftdebug.h index 00d258e642..df5357ad55 100644 --- a/thirdparty/freetype/include/freetype/internal/ftdebug.h +++ b/thirdparty/freetype/include/freetype/internal/ftdebug.h @@ -27,7 +27,9 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_FREETYPE_H +#include <freetype/freetype.h> + +#include "compiler-macros.h" FT_BEGIN_HEADER @@ -56,7 +58,7 @@ FT_BEGIN_HEADER /* defining the enumeration */ typedef enum FT_Trace_ { -#include FT_INTERNAL_TRACE_H +#include <freetype/internal/fttrace.h> trace_count } FT_Trace; diff --git a/thirdparty/freetype/include/freetype/internal/ftdrv.h b/thirdparty/freetype/include/freetype/internal/ftdrv.h index 1dd9206c87..7f22710eae 100644 --- a/thirdparty/freetype/include/freetype/internal/ftdrv.h +++ b/thirdparty/freetype/include/freetype/internal/ftdrv.h @@ -20,9 +20,9 @@ #define FTDRV_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> +#include "compiler-macros.h" FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftgloadr.h b/thirdparty/freetype/include/freetype/internal/ftgloadr.h index 6f3793b1c0..27b8659f7c 100644 --- a/thirdparty/freetype/include/freetype/internal/ftgloadr.h +++ b/thirdparty/freetype/include/freetype/internal/ftgloadr.h @@ -20,8 +20,7 @@ #define FTGLOADR_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> FT_BEGIN_HEADER @@ -138,8 +137,6 @@ FT_BEGIN_HEADER FT_BASE( void ) FT_GlyphLoader_Add( FT_GlyphLoader loader ); - /* */ - FT_END_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/fthash.h b/thirdparty/freetype/include/freetype/internal/fthash.h index 249188040b..622ec76bb9 100644 --- a/thirdparty/freetype/include/freetype/internal/fthash.h +++ b/thirdparty/freetype/include/freetype/internal/fthash.h @@ -43,8 +43,7 @@ #define FTHASH_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftmemory.h b/thirdparty/freetype/include/freetype/internal/ftmemory.h index e0758c127a..ddb18b0512 100644 --- a/thirdparty/freetype/include/freetype/internal/ftmemory.h +++ b/thirdparty/freetype/include/freetype/internal/ftmemory.h @@ -22,8 +22,9 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_TYPES_H +#include <freetype/fttypes.h> +#include "compiler-macros.h" FT_BEGIN_HEADER @@ -389,8 +390,6 @@ extern "C++" #define FT_STRCPYN( dst, src, size ) \ ft_mem_strcpyn( (char*)dst, (const char*)(src), (FT_ULong)(size) ) - /* */ - FT_END_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftobjs.h b/thirdparty/freetype/include/freetype/internal/ftobjs.h index 140eebc7c6..25db2c494f 100644 --- a/thirdparty/freetype/include/freetype/internal/ftobjs.h +++ b/thirdparty/freetype/include/freetype/internal/ftobjs.h @@ -26,21 +26,21 @@ #ifndef FTOBJS_H_ #define FTOBJS_H_ -#include <ft2build.h> -#include FT_RENDER_H -#include FT_SIZES_H -#include FT_LCD_FILTER_H -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_GLYPH_LOADER_H -#include FT_INTERNAL_DRIVER_H -#include FT_INTERNAL_AUTOHINT_H -#include FT_INTERNAL_SERVICE_H -#include FT_INTERNAL_CALC_H +#include <freetype/ftrender.h> +#include <freetype/ftsizes.h> +#include <freetype/ftlcdfil.h> +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftgloadr.h> +#include <freetype/internal/ftdrv.h> +#include <freetype/internal/autohint.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/ftcalc.h> #ifdef FT_CONFIG_OPTION_INCREMENTAL -#include FT_INCREMENTAL_H +#include <freetype/ftincrem.h> #endif +#include "compiler-macros.h" FT_BEGIN_HEADER @@ -226,8 +226,8 @@ FT_BEGIN_HEADER } FT_CMap_ClassRec; -#define FT_DECLARE_CMAP_CLASS( class_ ) \ - FT_CALLBACK_TABLE const FT_CMap_ClassRec class_; +#define FT_DECLARE_CMAP_CLASS( class_ ) \ + FT_CALLBACK_TABLE const FT_CMap_ClassRec class_; #define FT_DEFINE_CMAP_CLASS( \ class_, \ @@ -653,7 +653,7 @@ FT_BEGIN_HEADER FT_BASE( void ) FT_Done_GlyphSlot( FT_GlyphSlot slot ); - /* */ + /* */ #define FT_REQUEST_WIDTH( req ) \ ( (req)->horiResolution \ @@ -1057,6 +1057,9 @@ FT_BEGIN_HEADER * The struct will be allocated in the global scope (or the scope where * the macro is used). */ +#define FT_DECLARE_GLYPH( class_ ) \ + FT_CALLBACK_TABLE const FT_Glyph_Class class_; + #define FT_DEFINE_GLYPH( \ class_, \ size_, \ diff --git a/thirdparty/freetype/include/freetype/internal/ftpsprop.h b/thirdparty/freetype/include/freetype/internal/ftpsprop.h index 72907c4c3a..81ec29151c 100644 --- a/thirdparty/freetype/include/freetype/internal/ftpsprop.h +++ b/thirdparty/freetype/include/freetype/internal/ftpsprop.h @@ -20,8 +20,7 @@ #define FTPSPROP_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftrfork.h b/thirdparty/freetype/include/freetype/internal/ftrfork.h index 9a275a5155..1b7b25acbe 100644 --- a/thirdparty/freetype/include/freetype/internal/ftrfork.h +++ b/thirdparty/freetype/include/freetype/internal/ftrfork.h @@ -25,8 +25,7 @@ #define FTRFORK_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftserv.h b/thirdparty/freetype/include/freetype/internal/ftserv.h index bcaf4720d5..6e1a9472da 100644 --- a/thirdparty/freetype/include/freetype/internal/ftserv.h +++ b/thirdparty/freetype/include/freetype/internal/ftserv.h @@ -31,6 +31,7 @@ #ifndef FTSERV_H_ #define FTSERV_H_ +#include "compiler-macros.h" FT_BEGIN_HEADER @@ -486,33 +487,6 @@ FT_BEGIN_HEADER /* */ - /* - * The header files containing the services. - */ - -#define FT_SERVICE_BDF_H <freetype/internal/services/svbdf.h> -#define FT_SERVICE_CFF_TABLE_LOAD_H <freetype/internal/services/svcfftl.h> -#define FT_SERVICE_CID_H <freetype/internal/services/svcid.h> -#define FT_SERVICE_FONT_FORMAT_H <freetype/internal/services/svfntfmt.h> -#define FT_SERVICE_GLYPH_DICT_H <freetype/internal/services/svgldict.h> -#define FT_SERVICE_GX_VALIDATE_H <freetype/internal/services/svgxval.h> -#define FT_SERVICE_KERNING_H <freetype/internal/services/svkern.h> -#define FT_SERVICE_METRICS_VARIATIONS_H <freetype/internal/services/svmetric.h> -#define FT_SERVICE_MULTIPLE_MASTERS_H <freetype/internal/services/svmm.h> -#define FT_SERVICE_OPENTYPE_VALIDATE_H <freetype/internal/services/svotval.h> -#define FT_SERVICE_PFR_H <freetype/internal/services/svpfr.h> -#define FT_SERVICE_POSTSCRIPT_CMAPS_H <freetype/internal/services/svpscmap.h> -#define FT_SERVICE_POSTSCRIPT_INFO_H <freetype/internal/services/svpsinfo.h> -#define FT_SERVICE_POSTSCRIPT_NAME_H <freetype/internal/services/svpostnm.h> -#define FT_SERVICE_PROPERTIES_H <freetype/internal/services/svprop.h> -#define FT_SERVICE_SFNT_H <freetype/internal/services/svsfnt.h> -#define FT_SERVICE_TRUETYPE_ENGINE_H <freetype/internal/services/svtteng.h> -#define FT_SERVICE_TRUETYPE_GLYF_H <freetype/internal/services/svttglyf.h> -#define FT_SERVICE_TT_CMAP_H <freetype/internal/services/svttcmap.h> -#define FT_SERVICE_WINFNT_H <freetype/internal/services/svwinfnt.h> - - /* */ - FT_END_HEADER #endif /* FTSERV_H_ */ diff --git a/thirdparty/freetype/include/freetype/internal/ftstream.h b/thirdparty/freetype/include/freetype/internal/ftstream.h index f3b3ef0d02..e7d922260f 100644 --- a/thirdparty/freetype/include/freetype/internal/ftstream.h +++ b/thirdparty/freetype/include/freetype/internal/ftstream.h @@ -21,8 +21,8 @@ #include <ft2build.h> -#include FT_SYSTEM_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftsystem.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/ftvalid.h b/thirdparty/freetype/include/freetype/internal/ftvalid.h index 62aea4dc68..a5bc6c9b52 100644 --- a/thirdparty/freetype/include/freetype/internal/ftvalid.h +++ b/thirdparty/freetype/include/freetype/internal/ftvalid.h @@ -20,8 +20,9 @@ #define FTVALID_H_ #include <ft2build.h> -#include FT_CONFIG_STANDARD_LIBRARY_H /* for ft_setjmp and ft_longjmp */ +#include FT_CONFIG_STANDARD_LIBRARY_H /* for ft_jmpbuf */ +#include "compiler-macros.h" FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/psaux.h b/thirdparty/freetype/include/freetype/internal/psaux.h index 8248a0ecdb..8e0a262fd5 100644 --- a/thirdparty/freetype/include/freetype/internal/psaux.h +++ b/thirdparty/freetype/include/freetype/internal/psaux.h @@ -21,14 +21,13 @@ #define PSAUX_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_HASH_H -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_CFF_TYPES_H -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/t1types.h> +#include <freetype/internal/fthash.h> +#include <freetype/internal/tttypes.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/cfftypes.h> +#include <freetype/internal/cffotypes.h> diff --git a/thirdparty/freetype/include/freetype/internal/pshints.h b/thirdparty/freetype/include/freetype/internal/pshints.h index cf0c65298c..663e9d3488 100644 --- a/thirdparty/freetype/include/freetype/internal/pshints.h +++ b/thirdparty/freetype/include/freetype/internal/pshints.h @@ -22,9 +22,8 @@ #define PSHINTS_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TYPE1_TABLES_H +#include <freetype/freetype.h> +#include <freetype/t1tables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svbdf.h b/thirdparty/freetype/include/freetype/internal/services/svbdf.h index 0ec9c7ccb0..81f5a06b62 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svbdf.h +++ b/thirdparty/freetype/include/freetype/internal/services/svbdf.h @@ -19,8 +19,8 @@ #ifndef SVBDF_H_ #define SVBDF_H_ -#include FT_BDF_H -#include FT_INTERNAL_SERVICE_H +#include <freetype/ftbdf.h> +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svcfftl.h b/thirdparty/freetype/include/freetype/internal/services/svcfftl.h index c2f42c1d17..1d2dbb6a8e 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svcfftl.h +++ b/thirdparty/freetype/include/freetype/internal/services/svcfftl.h @@ -19,8 +19,8 @@ #ifndef SVCFFTL_H_ #define SVCFFTL_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_INTERNAL_CFF_TYPES_H +#include <freetype/internal/ftserv.h> +#include <freetype/internal/cfftypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svcid.h b/thirdparty/freetype/include/freetype/internal/services/svcid.h index b8efd8147b..bd49f3270a 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svcid.h +++ b/thirdparty/freetype/include/freetype/internal/services/svcid.h @@ -19,7 +19,7 @@ #ifndef SVCID_H_ #define SVCID_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svfntfmt.h b/thirdparty/freetype/include/freetype/internal/services/svfntfmt.h index 5ec84c933c..6114d638af 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svfntfmt.h +++ b/thirdparty/freetype/include/freetype/internal/services/svfntfmt.h @@ -19,7 +19,7 @@ #ifndef SVFNTFMT_H_ #define SVFNTFMT_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svgldict.h b/thirdparty/freetype/include/freetype/internal/services/svgldict.h index 5a63883c90..f9443e40d6 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svgldict.h +++ b/thirdparty/freetype/include/freetype/internal/services/svgldict.h @@ -19,7 +19,7 @@ #ifndef SVGLDICT_H_ #define SVGLDICT_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svgxval.h b/thirdparty/freetype/include/freetype/internal/services/svgxval.h index d0cb10a423..83c2f26cee 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svgxval.h +++ b/thirdparty/freetype/include/freetype/internal/services/svgxval.h @@ -28,8 +28,8 @@ #ifndef SVGXVAL_H_ #define SVGXVAL_H_ -#include FT_GX_VALIDATE_H -#include FT_INTERNAL_VALIDATE_H +#include <freetype/ftgxval.h> +#include <freetype/internal/ftvalid.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svkern.h b/thirdparty/freetype/include/freetype/internal/services/svkern.h index 891c61a755..13cfb32722 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svkern.h +++ b/thirdparty/freetype/include/freetype/internal/services/svkern.h @@ -19,8 +19,8 @@ #ifndef SVKERN_H_ #define SVKERN_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_TRUETYPE_TABLES_H +#include <freetype/internal/ftserv.h> +#include <freetype/tttables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svmetric.h b/thirdparty/freetype/include/freetype/internal/services/svmetric.h index 06faa4b4f8..2b30edaabe 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svmetric.h +++ b/thirdparty/freetype/include/freetype/internal/services/svmetric.h @@ -19,7 +19,7 @@ #ifndef SVMETRIC_H_ #define SVMETRIC_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svmm.h b/thirdparty/freetype/include/freetype/internal/services/svmm.h index fa044c92dd..5a807636a6 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svmm.h +++ b/thirdparty/freetype/include/freetype/internal/services/svmm.h @@ -19,7 +19,7 @@ #ifndef SVMM_H_ #define SVMM_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svotval.h b/thirdparty/freetype/include/freetype/internal/services/svotval.h index 34ad7ca9f1..763fb2efbe 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svotval.h +++ b/thirdparty/freetype/include/freetype/internal/services/svotval.h @@ -19,8 +19,8 @@ #ifndef SVOTVAL_H_ #define SVOTVAL_H_ -#include FT_OPENTYPE_VALIDATE_H -#include FT_INTERNAL_VALIDATE_H +#include <freetype/ftotval.h> +#include <freetype/internal/ftvalid.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svpfr.h b/thirdparty/freetype/include/freetype/internal/services/svpfr.h index 2dd075c5da..bdeba0785c 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svpfr.h +++ b/thirdparty/freetype/include/freetype/internal/services/svpfr.h @@ -19,8 +19,8 @@ #ifndef SVPFR_H_ #define SVPFR_H_ -#include FT_PFR_H -#include FT_INTERNAL_SERVICE_H +#include <freetype/ftpfr.h> +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER @@ -56,7 +56,6 @@ FT_BEGIN_HEADER }; - /* */ FT_END_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svpostnm.h b/thirdparty/freetype/include/freetype/internal/services/svpostnm.h index 86ab611382..8ef62c5f92 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svpostnm.h +++ b/thirdparty/freetype/include/freetype/internal/services/svpostnm.h @@ -19,7 +19,7 @@ #ifndef SVPOSTNM_H_ #define SVPOSTNM_H_ -#include FT_INTERNAL_SERVICE_H +#include <freetype/internal/ftserv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svpscmap.h b/thirdparty/freetype/include/freetype/internal/services/svpscmap.h index 6c2ffe2e2a..b4dcd80759 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svpscmap.h +++ b/thirdparty/freetype/include/freetype/internal/services/svpscmap.h @@ -19,7 +19,7 @@ #ifndef SVPSCMAP_H_ #define SVPSCMAP_H_ -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svpsinfo.h b/thirdparty/freetype/include/freetype/internal/services/svpsinfo.h index ade24dc2ba..1e7276ff43 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svpsinfo.h +++ b/thirdparty/freetype/include/freetype/internal/services/svpsinfo.h @@ -19,8 +19,8 @@ #ifndef SVPSINFO_H_ #define SVPSINFO_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/ftserv.h> +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svsfnt.h b/thirdparty/freetype/include/freetype/internal/services/svsfnt.h index f3e81ca84e..39c8b5e19d 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svsfnt.h +++ b/thirdparty/freetype/include/freetype/internal/services/svsfnt.h @@ -19,8 +19,8 @@ #ifndef SVSFNT_H_ #define SVSFNT_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_TRUETYPE_TABLES_H +#include <freetype/internal/ftserv.h> +#include <freetype/tttables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svttcmap.h b/thirdparty/freetype/include/freetype/internal/services/svttcmap.h index fbb3115ed4..c18bb2336f 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svttcmap.h +++ b/thirdparty/freetype/include/freetype/internal/services/svttcmap.h @@ -22,8 +22,8 @@ #ifndef SVTTCMAP_H_ #define SVTTCMAP_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_TRUETYPE_TABLES_H +#include <freetype/internal/ftserv.h> +#include <freetype/tttables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svtteng.h b/thirdparty/freetype/include/freetype/internal/services/svtteng.h index 6218d9efe0..7a17e4a755 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svtteng.h +++ b/thirdparty/freetype/include/freetype/internal/services/svtteng.h @@ -19,8 +19,8 @@ #ifndef SVTTENG_H_ #define SVTTENG_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_MODULE_H +#include <freetype/internal/ftserv.h> +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svttglyf.h b/thirdparty/freetype/include/freetype/internal/services/svttglyf.h index d9894e362d..90a81dd40e 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svttglyf.h +++ b/thirdparty/freetype/include/freetype/internal/services/svttglyf.h @@ -18,8 +18,8 @@ #ifndef SVTTGLYF_H_ #define SVTTGLYF_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_TRUETYPE_TABLES_H +#include <freetype/internal/ftserv.h> +#include <freetype/tttables.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/services/svwinfnt.h b/thirdparty/freetype/include/freetype/internal/services/svwinfnt.h index 377f73d450..8c915f5257 100644 --- a/thirdparty/freetype/include/freetype/internal/services/svwinfnt.h +++ b/thirdparty/freetype/include/freetype/internal/services/svwinfnt.h @@ -19,8 +19,8 @@ #ifndef SVWINFNT_H_ #define SVWINFNT_H_ -#include FT_INTERNAL_SERVICE_H -#include FT_WINFONTS_H +#include <freetype/internal/ftserv.h> +#include <freetype/ftwinfnt.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/sfnt.h b/thirdparty/freetype/include/freetype/internal/sfnt.h index b9c81a8f37..b4c12dbb26 100644 --- a/thirdparty/freetype/include/freetype/internal/sfnt.h +++ b/thirdparty/freetype/include/freetype/internal/sfnt.h @@ -20,10 +20,9 @@ #define SFNT_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_INTERNAL_WOFF_TYPES_H +#include <freetype/internal/ftdrv.h> +#include <freetype/internal/tttypes.h> +#include <freetype/internal/wofftypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/t1types.h b/thirdparty/freetype/include/freetype/internal/t1types.h index 799c2939fa..6a0fe5e97d 100644 --- a/thirdparty/freetype/include/freetype/internal/t1types.h +++ b/thirdparty/freetype/include/freetype/internal/t1types.h @@ -21,12 +21,11 @@ #define T1TYPES_H_ -#include <ft2build.h> -#include FT_TYPE1_TABLES_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H -#include FT_INTERNAL_SERVICE_H -#include FT_INTERNAL_HASH_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H +#include <freetype/t1tables.h> +#include <freetype/internal/pshints.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/fthash.h> +#include <freetype/internal/services/svpscmap.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/internal/tttypes.h b/thirdparty/freetype/include/freetype/internal/tttypes.h index 1bddf102be..c36342c93a 100644 --- a/thirdparty/freetype/include/freetype/internal/tttypes.h +++ b/thirdparty/freetype/include/freetype/internal/tttypes.h @@ -21,13 +21,12 @@ #define TTTYPES_H_ -#include <ft2build.h> -#include FT_TRUETYPE_TABLES_H -#include FT_INTERNAL_OBJECTS_H -#include FT_COLOR_H +#include <freetype/tttables.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftcolor.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H +#include <freetype/ftmm.h> #endif diff --git a/thirdparty/freetype/include/freetype/internal/wofftypes.h b/thirdparty/freetype/include/freetype/internal/wofftypes.h index 26159b9d3e..1874a138a0 100644 --- a/thirdparty/freetype/include/freetype/internal/wofftypes.h +++ b/thirdparty/freetype/include/freetype/internal/wofftypes.h @@ -21,9 +21,8 @@ #define WOFFTYPES_H_ -#include <ft2build.h> -#include FT_TRUETYPE_TABLES_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/tttables.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/t1tables.h b/thirdparty/freetype/include/freetype/t1tables.h index 522d6ae6aa..426e14024e 100644 --- a/thirdparty/freetype/include/freetype/t1tables.h +++ b/thirdparty/freetype/include/freetype/t1tables.h @@ -21,8 +21,7 @@ #define T1TABLES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/ttnameid.h b/thirdparty/freetype/include/freetype/ttnameid.h index 9a00913ee7..2b2ed4c613 100644 --- a/thirdparty/freetype/include/freetype/ttnameid.h +++ b/thirdparty/freetype/include/freetype/ttnameid.h @@ -20,7 +20,6 @@ #define TTNAMEID_H_ -#include <ft2build.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/include/freetype/tttables.h b/thirdparty/freetype/include/freetype/tttables.h index 8108db7173..c8fa35ef8e 100644 --- a/thirdparty/freetype/include/freetype/tttables.h +++ b/thirdparty/freetype/include/freetype/tttables.h @@ -21,8 +21,7 @@ #define TTTABLES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/freetype/tttags.h b/thirdparty/freetype/include/freetype/tttags.h index f2b2a45266..3c9fbd59d7 100644 --- a/thirdparty/freetype/include/freetype/tttags.h +++ b/thirdparty/freetype/include/freetype/tttags.h @@ -20,8 +20,7 @@ #define TTAGS_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/include/ft2build.h b/thirdparty/freetype/include/ft2build.h index 195e918335..b4fd1f8c3e 100644 --- a/thirdparty/freetype/include/ft2build.h +++ b/thirdparty/freetype/include/ft2build.h @@ -18,16 +18,14 @@ /************************************************************************** * - * This is the 'entry point' for FreeType header file inclusions. It is - * the only header file which should be included directly; all other - * FreeType header files should be accessed with macro names (after - * including `ft2build.h`). + * This is the 'entry point' for FreeType header file inclusions, to be + * loaded before all other header files. * * A typical example is * * ``` * #include <ft2build.h> - * #include FT_FREETYPE_H + * #include <freetype/freetype.h> * ``` * */ diff --git a/thirdparty/freetype/src/autofit/afblue.c b/thirdparty/freetype/src/autofit/afblue.c index 63f9ed4589..9ebffdd099 100644 --- a/thirdparty/freetype/src/autofit/afblue.c +++ b/thirdparty/freetype/src/autofit/afblue.c @@ -134,7 +134,7 @@ '\0', '\xF0', '\x90', '\x90', '\xA8', ' ', '\xF0', '\x90', '\x90', '\xAA', ' ', '\xF0', '\x90', '\x90', '\xAC', ' ', '\xF0', '\x90', '\x90', '\xBF', ' ', '\xF0', '\x90', '\x91', '\x83', /* 𐐨 𐐪 𐐬 𐐿 𐑃 */ '\0', - '\xE0', '\xA4', '\x95', ' ', '\xE0', '\xA4', '\xAE', ' ', '\xE0', '\xA4', '\x85', ' ', '\xE0', '\xA4', '\x86', ' ', '\xE0', '\xA4', '\xA5', ' ', '\xE0', '\xA4', '\xA7', ' ', '\xE0', '\xA4', '\xAD', ' ', '\xE0', '\xA4', '\xB6', /* क म अ आ थ ध भ श */ + '\xE0', '\xA4', '\x95', ' ', '\xE0', '\xA4', '\xA8', ' ', '\xE0', '\xA4', '\xAE', ' ', '\xE0', '\xA4', '\x89', ' ', '\xE0', '\xA4', '\x9B', ' ', '\xE0', '\xA4', '\x9F', ' ', '\xE0', '\xA4', '\xA0', ' ', '\xE0', '\xA4', '\xA1', /* क न म उ छ ट ठ ड */ '\0', '\xE0', '\xA4', '\x88', ' ', '\xE0', '\xA4', '\x90', ' ', '\xE0', '\xA4', '\x93', ' ', '\xE0', '\xA4', '\x94', ' ', '\xE0', '\xA4', '\xBF', ' ', '\xE0', '\xA5', '\x80', ' ', '\xE0', '\xA5', '\x8B', ' ', '\xE0', '\xA5', '\x8C', /* ई ऐ ओ औ ि ी ो ौ */ '\0', @@ -296,6 +296,20 @@ '\0', '\xE0', '\xB4', '\x9F', ' ', '\xE0', '\xB4', '\xA0', ' ', '\xE0', '\xB4', '\xA7', ' ', '\xE0', '\xB4', '\xB6', ' ', '\xE0', '\xB4', '\x98', ' ', '\xE0', '\xB4', '\x9A', ' ', '\xE0', '\xB4', '\xA5', ' ', '\xE0', '\xB4', '\xB2', /* ട ഠ ധ ശ ഘ ച ഥ ല */ '\0', + '\xF0', '\x96', '\xB9', '\x80', ' ', '\xF0', '\x96', '\xB9', '\x81', ' ', '\xF0', '\x96', '\xB9', '\x82', ' ', '\xF0', '\x96', '\xB9', '\x83', ' ', '\xF0', '\x96', '\xB9', '\x8F', ' ', '\xF0', '\x96', '\xB9', '\x9A', ' ', '\xF0', '\x96', '\xB9', '\x9F', /* 𖹀 𖹁 𖹂 𖹃 𖹏 𖹚 𖹟 */ + '\0', + '\xF0', '\x96', '\xB9', '\x80', ' ', '\xF0', '\x96', '\xB9', '\x81', ' ', '\xF0', '\x96', '\xB9', '\x82', ' ', '\xF0', '\x96', '\xB9', '\x83', ' ', '\xF0', '\x96', '\xB9', '\x8F', ' ', '\xF0', '\x96', '\xB9', '\x9A', ' ', '\xF0', '\x96', '\xB9', '\x92', ' ', '\xF0', '\x96', '\xB9', '\x93', /* 𖹀 𖹁 𖹂 𖹃 𖹏 𖹚 𖹒 𖹓 */ + '\0', + '\xF0', '\x96', '\xB9', '\xA4', ' ', '\xF0', '\x96', '\xB9', '\xAC', ' ', '\xF0', '\x96', '\xB9', '\xA7', ' ', '\xF0', '\x96', '\xB9', '\xB4', ' ', '\xF0', '\x96', '\xB9', '\xB6', ' ', '\xF0', '\x96', '\xB9', '\xBE', /* 𖹤 𖹬 𖹧 𖹴 𖹶 𖹾 */ + '\0', + '\xF0', '\x96', '\xB9', '\xA0', ' ', '\xF0', '\x96', '\xB9', '\xA1', ' ', '\xF0', '\x96', '\xB9', '\xA2', ' ', '\xF0', '\x96', '\xB9', '\xB9', ' ', '\xF0', '\x96', '\xB9', '\xB3', ' ', '\xF0', '\x96', '\xB9', '\xAE', /* 𖹠 𖹡 𖹢 𖹹 𖹳 𖹮 */ + '\0', + '\xF0', '\x96', '\xB9', '\xA0', ' ', '\xF0', '\x96', '\xB9', '\xA1', ' ', '\xF0', '\x96', '\xB9', '\xA2', ' ', '\xF0', '\x96', '\xB9', '\xB3', ' ', '\xF0', '\x96', '\xB9', '\xAD', ' ', '\xF0', '\x96', '\xB9', '\xBD', /* 𖹠 𖹡 𖹢 𖹳 𖹭 𖹽 */ + '\0', + '\xF0', '\x96', '\xB9', '\xA5', ' ', '\xF0', '\x96', '\xB9', '\xA8', ' ', '\xF0', '\x96', '\xB9', '\xA9', /* 𖹥 𖹨 𖹩 */ + '\0', + '\xF0', '\x96', '\xBA', '\x80', ' ', '\xF0', '\x96', '\xBA', '\x85', ' ', '\xF0', '\x96', '\xBA', '\x88', ' ', '\xF0', '\x96', '\xBA', '\x84', ' ', '\xF0', '\x96', '\xBA', '\x8D', /* 𖺀 𖺅 𖺈 𖺄 𖺍 */ + '\0', '\xE1', '\xA0', '\xB3', ' ', '\xE1', '\xA0', '\xB4', ' ', '\xE1', '\xA0', '\xB6', ' ', '\xE1', '\xA0', '\xBD', ' ', '\xE1', '\xA1', '\x82', ' ', '\xE1', '\xA1', '\x8A', ' ', '\xE2', '\x80', '\x8D', '\xE1', '\xA1', '\xA1', '\xE2', '\x80', '\x8D', ' ', '\xE2', '\x80', '\x8D', '\xE1', '\xA1', '\xB3', '\xE2', '\x80', '\x8D', /* ᠳ ᠴ ᠶ ᠽ ᡂ ᡊ ᡡ ᡳ */ '\0', '\xE1', '\xA1', '\x83', /* ᡃ */ @@ -494,14 +508,14 @@ { AF_BLUE_STRING_CHAKMA_BOTTOM, 0 }, { AF_BLUE_STRING_CHAKMA_DESCENDER, 0 }, { AF_BLUE_STRING_MAX, 0 }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_BOTTOM, 0 }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | - AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_BOTTOM, 0 }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_BOTTOM, 0 }, - { AF_BLUE_STRING_MAX, 0 }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_BOTTOM, 0 }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | + AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_BOTTOM, 0 }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_BOTTOM, 0 }, + { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_CARIAN_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, { AF_BLUE_STRING_CARIAN_BOTTOM, 0 }, { AF_BLUE_STRING_MAX, 0 }, @@ -601,6 +615,9 @@ { AF_BLUE_STRING_HEBREW_BOTTOM, 0 }, { AF_BLUE_STRING_HEBREW_DESCENDER, 0 }, { AF_BLUE_STRING_MAX, 0 }, + { AF_BLUE_STRING_KANNADA_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_KANNADA_BOTTOM, 0 }, + { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_KAYAH_LI_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, { AF_BLUE_STRING_KAYAH_LI_BOTTOM, 0 }, @@ -619,9 +636,6 @@ AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, { AF_BLUE_STRING_KHMER_SYMBOLS_WANING_BOTTOM, 0 }, { AF_BLUE_STRING_MAX, 0 }, - { AF_BLUE_STRING_KANNADA_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, - { AF_BLUE_STRING_KANNADA_BOTTOM, 0 }, - { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_LAO_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, { AF_BLUE_STRING_LAO_BOTTOM, 0 }, @@ -659,6 +673,15 @@ { AF_BLUE_STRING_MALAYALAM_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, { AF_BLUE_STRING_MALAYALAM_BOTTOM, 0 }, { AF_BLUE_STRING_MAX, 0 }, + { AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_BOTTOM, 0 }, + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_F_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | + AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_BOTTOM, 0 }, + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_DESCENDER, 0 }, + { AF_BLUE_STRING_MEDEFAIDRIN_DIGIT_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_MONGOLIAN_TOP_BASE, AF_BLUE_PROPERTY_LATIN_TOP }, { AF_BLUE_STRING_MONGOLIAN_BOTTOM_BASE, 0 }, { AF_BLUE_STRING_MAX, 0 }, @@ -724,9 +747,6 @@ { AF_BLUE_STRING_TELUGU_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, { AF_BLUE_STRING_TELUGU_BOTTOM, 0 }, { AF_BLUE_STRING_MAX, 0 }, - { AF_BLUE_STRING_TIFINAGH, AF_BLUE_PROPERTY_LATIN_TOP }, - { AF_BLUE_STRING_TIFINAGH, 0 }, - { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_THAI_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT }, { AF_BLUE_STRING_THAI_BOTTOM, 0 }, @@ -736,6 +756,9 @@ { AF_BLUE_STRING_THAI_LARGE_DESCENDER, 0 }, { AF_BLUE_STRING_THAI_DIGIT_TOP, 0 }, { AF_BLUE_STRING_MAX, 0 }, + { AF_BLUE_STRING_TIFINAGH, AF_BLUE_PROPERTY_LATIN_TOP }, + { AF_BLUE_STRING_TIFINAGH, 0 }, + { AF_BLUE_STRING_MAX, 0 }, { AF_BLUE_STRING_VAI_TOP, AF_BLUE_PROPERTY_LATIN_TOP }, { AF_BLUE_STRING_VAI_BOTTOM, 0 }, { AF_BLUE_STRING_MAX, 0 }, diff --git a/thirdparty/freetype/src/autofit/afblue.dat b/thirdparty/freetype/src/autofit/afblue.dat index f8356ba3a1..b19b8df0f4 100644 --- a/thirdparty/freetype/src/autofit/afblue.dat +++ b/thirdparty/freetype/src/autofit/afblue.dat @@ -203,7 +203,7 @@ AF_BLUE_STRING_ENUM AF_BLUE_STRINGS_ARRAY AF_BLUE_STRING_MAX_LEN: "𐐨 𐐪 𐐬 𐐿 𐑃" AF_BLUE_STRING_DEVANAGARI_BASE - "क म अ आ थ ध भ श" + "क न म उ छ ट ठ ड" AF_BLUE_STRING_DEVANAGARI_TOP "ई ऐ ओ औ ि ी ो ौ" // note that some fonts have extreme variation in the height of the @@ -392,6 +392,21 @@ AF_BLUE_STRING_ENUM AF_BLUE_STRINGS_ARRAY AF_BLUE_STRING_MAX_LEN: AF_BLUE_STRING_MALAYALAM_BOTTOM "ട ഠ ധ ശ ഘ ച ഥ ല" + AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_TOP + "𖹀 𖹁 𖹂 𖹃 𖹏 𖹚 𖹟" + AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_BOTTOM + "𖹀 𖹁 𖹂 𖹃 𖹏 𖹚 𖹒 𖹓" + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_F_TOP + "𖹤 𖹬 𖹧 𖹴 𖹶 𖹾" + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_TOP + "𖹠 𖹡 𖹢 𖹹 𖹳 𖹮" + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_BOTTOM + "𖹠 𖹡 𖹢 𖹳 𖹭 𖹽" + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_DESCENDER + "𖹥 𖹨 𖹩" + AF_BLUE_STRING_MEDEFAIDRIN_DIGIT_TOP + "𖺀 𖺅 𖺈 𖺄 𖺍" + AF_BLUE_STRING_MONGOLIAN_TOP_BASE "ᠳ ᠴ ᠶ ᠽ ᡂ ᡊ ᡡ ᡳ" AF_BLUE_STRING_MONGOLIAN_BOTTOM_BASE @@ -741,14 +756,14 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_MAX, 0 } AF_BLUE_STRINGSET_CANS - { AF_BLUE_STRING_CANADIAN_SYLLABICS_TOP, AF_BLUE_PROPERTY_LATIN_TOP } - { AF_BLUE_STRING_CANADIAN_SYLLABICS_BOTTOM, 0 } - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | - AF_BLUE_PROPERTY_LATIN_X_HEIGHT } - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_BOTTOM, 0 } - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_TOP, AF_BLUE_PROPERTY_LATIN_TOP } - { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_BOTTOM, 0 } - { AF_BLUE_STRING_MAX, 0 } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_BOTTOM, 0 } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | + AF_BLUE_PROPERTY_LATIN_X_HEIGHT } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SMALL_BOTTOM, 0 } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_CANADIAN_SYLLABICS_SUPS_BOTTOM, 0 } + { AF_BLUE_STRING_MAX, 0 } AF_BLUE_STRINGSET_CARI { AF_BLUE_STRING_CARIAN_TOP, AF_BLUE_PROPERTY_LATIN_TOP } @@ -881,6 +896,11 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_HEBREW_DESCENDER, 0 } { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_KNDA + { AF_BLUE_STRING_KANNADA_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_KANNADA_BOTTOM, 0 } + { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_KALI { AF_BLUE_STRING_KAYAH_LI_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT } @@ -905,11 +925,6 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_KHMER_SYMBOLS_WANING_BOTTOM, 0 } { AF_BLUE_STRING_MAX, 0 } - AF_BLUE_STRINGSET_KNDA - { AF_BLUE_STRING_KANNADA_TOP, AF_BLUE_PROPERTY_LATIN_TOP } - { AF_BLUE_STRING_KANNADA_BOTTOM, 0 } - { AF_BLUE_STRING_MAX, 0 } - AF_BLUE_STRINGSET_LAO { AF_BLUE_STRING_LAO_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT } @@ -959,6 +974,17 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_MALAYALAM_BOTTOM, 0 } { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_MEDF + { AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_BOTTOM, 0 } + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_F_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_TOP, AF_BLUE_PROPERTY_LATIN_TOP | + AF_BLUE_PROPERTY_LATIN_X_HEIGHT } + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_BOTTOM, 0 } + { AF_BLUE_STRING_MEDEFAIDRIN_SMALL_DESCENDER, 0 } + { AF_BLUE_STRING_MEDEFAIDRIN_DIGIT_TOP, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_MONG { AF_BLUE_STRING_MONGOLIAN_TOP_BASE, AF_BLUE_PROPERTY_LATIN_TOP } { AF_BLUE_STRING_MONGOLIAN_BOTTOM_BASE, 0 } @@ -1056,11 +1082,6 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_TELUGU_BOTTOM, 0 } { AF_BLUE_STRING_MAX, 0 } - AF_BLUE_STRINGSET_TFNG - { AF_BLUE_STRING_TIFINAGH, AF_BLUE_PROPERTY_LATIN_TOP } - { AF_BLUE_STRING_TIFINAGH, 0 } - { AF_BLUE_STRING_MAX, 0 } - AF_BLUE_STRINGSET_THAI { AF_BLUE_STRING_THAI_TOP, AF_BLUE_PROPERTY_LATIN_TOP | AF_BLUE_PROPERTY_LATIN_X_HEIGHT } @@ -1072,6 +1093,11 @@ AF_BLUE_STRINGSET_ENUM AF_BLUE_STRINGSETS_ARRAY AF_BLUE_STRINGSET_MAX_LEN: { AF_BLUE_STRING_THAI_DIGIT_TOP, 0 } { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_TFNG + { AF_BLUE_STRING_TIFINAGH, AF_BLUE_PROPERTY_LATIN_TOP } + { AF_BLUE_STRING_TIFINAGH, 0 } + { AF_BLUE_STRING_MAX, 0 } + AF_BLUE_STRINGSET_VAII { AF_BLUE_STRING_VAI_TOP, AF_BLUE_PROPERTY_LATIN_TOP } { AF_BLUE_STRING_VAI_BOTTOM, 0 } diff --git a/thirdparty/freetype/src/autofit/afblue.h b/thirdparty/freetype/src/autofit/afblue.h index 2b6a5cdda4..486d663b6c 100644 --- a/thirdparty/freetype/src/autofit/afblue.h +++ b/thirdparty/freetype/src/autofit/afblue.h @@ -212,61 +212,68 @@ FT_BEGIN_HEADER AF_BLUE_STRING_LISU_BOTTOM = 3506, AF_BLUE_STRING_MALAYALAM_TOP = 3538, AF_BLUE_STRING_MALAYALAM_BOTTOM = 3582, - AF_BLUE_STRING_MONGOLIAN_TOP_BASE = 3614, - AF_BLUE_STRING_MONGOLIAN_BOTTOM_BASE = 3658, - AF_BLUE_STRING_MYANMAR_TOP = 3662, - AF_BLUE_STRING_MYANMAR_BOTTOM = 3694, - AF_BLUE_STRING_MYANMAR_ASCENDER = 3726, - AF_BLUE_STRING_MYANMAR_DESCENDER = 3754, - AF_BLUE_STRING_NKO_TOP = 3786, - AF_BLUE_STRING_NKO_BOTTOM = 3810, - AF_BLUE_STRING_NKO_SMALL_TOP = 3825, - AF_BLUE_STRING_NKO_SMALL_BOTTOM = 3834, - AF_BLUE_STRING_OL_CHIKI = 3846, - AF_BLUE_STRING_OLD_TURKIC_TOP = 3870, - AF_BLUE_STRING_OLD_TURKIC_BOTTOM = 3885, - AF_BLUE_STRING_OSAGE_CAPITAL_TOP = 3905, - AF_BLUE_STRING_OSAGE_CAPITAL_BOTTOM = 3945, - AF_BLUE_STRING_OSAGE_CAPITAL_DESCENDER = 3975, - AF_BLUE_STRING_OSAGE_SMALL_TOP = 3990, - AF_BLUE_STRING_OSAGE_SMALL_BOTTOM = 4030, - AF_BLUE_STRING_OSAGE_SMALL_ASCENDER = 4070, - AF_BLUE_STRING_OSAGE_SMALL_DESCENDER = 4095, - AF_BLUE_STRING_OSMANYA_TOP = 4110, - AF_BLUE_STRING_OSMANYA_BOTTOM = 4150, - AF_BLUE_STRING_ROHINGYA_TOP = 4190, - AF_BLUE_STRING_ROHINGYA_BOTTOM = 4215, - AF_BLUE_STRING_ROHINGYA_JOIN = 4240, - AF_BLUE_STRING_SAURASHTRA_TOP = 4243, - AF_BLUE_STRING_SAURASHTRA_BOTTOM = 4275, - AF_BLUE_STRING_SHAVIAN_TOP = 4295, - AF_BLUE_STRING_SHAVIAN_BOTTOM = 4305, - AF_BLUE_STRING_SHAVIAN_DESCENDER = 4330, - AF_BLUE_STRING_SHAVIAN_SMALL_TOP = 4340, - AF_BLUE_STRING_SHAVIAN_SMALL_BOTTOM = 4375, - AF_BLUE_STRING_SINHALA_TOP = 4390, - AF_BLUE_STRING_SINHALA_BOTTOM = 4422, - AF_BLUE_STRING_SINHALA_DESCENDER = 4454, - AF_BLUE_STRING_SUNDANESE_TOP = 4498, - AF_BLUE_STRING_SUNDANESE_BOTTOM = 4522, - AF_BLUE_STRING_SUNDANESE_DESCENDER = 4554, - AF_BLUE_STRING_TAI_VIET_TOP = 4562, - AF_BLUE_STRING_TAI_VIET_BOTTOM = 4582, - AF_BLUE_STRING_TAMIL_TOP = 4594, - AF_BLUE_STRING_TAMIL_BOTTOM = 4626, - AF_BLUE_STRING_TELUGU_TOP = 4658, - AF_BLUE_STRING_TELUGU_BOTTOM = 4686, - AF_BLUE_STRING_THAI_TOP = 4714, - AF_BLUE_STRING_THAI_BOTTOM = 4738, - AF_BLUE_STRING_THAI_ASCENDER = 4766, - AF_BLUE_STRING_THAI_LARGE_ASCENDER = 4778, - AF_BLUE_STRING_THAI_DESCENDER = 4790, - AF_BLUE_STRING_THAI_LARGE_DESCENDER = 4806, - AF_BLUE_STRING_THAI_DIGIT_TOP = 4814, - AF_BLUE_STRING_TIFINAGH = 4826, - AF_BLUE_STRING_VAI_TOP = 4858, - AF_BLUE_STRING_VAI_BOTTOM = 4890, - af_blue_1_1 = 4921, + AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_TOP = 3614, + AF_BLUE_STRING_MEDEFAIDRIN_CAPITAL_BOTTOM = 3649, + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_F_TOP = 3689, + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_TOP = 3719, + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_BOTTOM = 3749, + AF_BLUE_STRING_MEDEFAIDRIN_SMALL_DESCENDER = 3779, + AF_BLUE_STRING_MEDEFAIDRIN_DIGIT_TOP = 3794, + AF_BLUE_STRING_MONGOLIAN_TOP_BASE = 3819, + AF_BLUE_STRING_MONGOLIAN_BOTTOM_BASE = 3863, + AF_BLUE_STRING_MYANMAR_TOP = 3867, + AF_BLUE_STRING_MYANMAR_BOTTOM = 3899, + AF_BLUE_STRING_MYANMAR_ASCENDER = 3931, + AF_BLUE_STRING_MYANMAR_DESCENDER = 3959, + AF_BLUE_STRING_NKO_TOP = 3991, + AF_BLUE_STRING_NKO_BOTTOM = 4015, + AF_BLUE_STRING_NKO_SMALL_TOP = 4030, + AF_BLUE_STRING_NKO_SMALL_BOTTOM = 4039, + AF_BLUE_STRING_OL_CHIKI = 4051, + AF_BLUE_STRING_OLD_TURKIC_TOP = 4075, + AF_BLUE_STRING_OLD_TURKIC_BOTTOM = 4090, + AF_BLUE_STRING_OSAGE_CAPITAL_TOP = 4110, + AF_BLUE_STRING_OSAGE_CAPITAL_BOTTOM = 4150, + AF_BLUE_STRING_OSAGE_CAPITAL_DESCENDER = 4180, + AF_BLUE_STRING_OSAGE_SMALL_TOP = 4195, + AF_BLUE_STRING_OSAGE_SMALL_BOTTOM = 4235, + AF_BLUE_STRING_OSAGE_SMALL_ASCENDER = 4275, + AF_BLUE_STRING_OSAGE_SMALL_DESCENDER = 4300, + AF_BLUE_STRING_OSMANYA_TOP = 4315, + AF_BLUE_STRING_OSMANYA_BOTTOM = 4355, + AF_BLUE_STRING_ROHINGYA_TOP = 4395, + AF_BLUE_STRING_ROHINGYA_BOTTOM = 4420, + AF_BLUE_STRING_ROHINGYA_JOIN = 4445, + AF_BLUE_STRING_SAURASHTRA_TOP = 4448, + AF_BLUE_STRING_SAURASHTRA_BOTTOM = 4480, + AF_BLUE_STRING_SHAVIAN_TOP = 4500, + AF_BLUE_STRING_SHAVIAN_BOTTOM = 4510, + AF_BLUE_STRING_SHAVIAN_DESCENDER = 4535, + AF_BLUE_STRING_SHAVIAN_SMALL_TOP = 4545, + AF_BLUE_STRING_SHAVIAN_SMALL_BOTTOM = 4580, + AF_BLUE_STRING_SINHALA_TOP = 4595, + AF_BLUE_STRING_SINHALA_BOTTOM = 4627, + AF_BLUE_STRING_SINHALA_DESCENDER = 4659, + AF_BLUE_STRING_SUNDANESE_TOP = 4703, + AF_BLUE_STRING_SUNDANESE_BOTTOM = 4727, + AF_BLUE_STRING_SUNDANESE_DESCENDER = 4759, + AF_BLUE_STRING_TAI_VIET_TOP = 4767, + AF_BLUE_STRING_TAI_VIET_BOTTOM = 4787, + AF_BLUE_STRING_TAMIL_TOP = 4799, + AF_BLUE_STRING_TAMIL_BOTTOM = 4831, + AF_BLUE_STRING_TELUGU_TOP = 4863, + AF_BLUE_STRING_TELUGU_BOTTOM = 4891, + AF_BLUE_STRING_THAI_TOP = 4919, + AF_BLUE_STRING_THAI_BOTTOM = 4943, + AF_BLUE_STRING_THAI_ASCENDER = 4971, + AF_BLUE_STRING_THAI_LARGE_ASCENDER = 4983, + AF_BLUE_STRING_THAI_DESCENDER = 4995, + AF_BLUE_STRING_THAI_LARGE_DESCENDER = 5011, + AF_BLUE_STRING_THAI_DIGIT_TOP = 5019, + AF_BLUE_STRING_TIFINAGH = 5031, + AF_BLUE_STRING_VAI_TOP = 5063, + AF_BLUE_STRING_VAI_BOTTOM = 5095, + af_blue_1_1 = 5126, #ifdef AF_CONFIG_OPTION_CJK AF_BLUE_STRING_CJK_TOP = af_blue_1_1 + 1, AF_BLUE_STRING_CJK_BOTTOM = af_blue_1_1 + 203, @@ -350,36 +357,37 @@ FT_BEGIN_HEADER AF_BLUE_STRINGSET_GUJR = 112, AF_BLUE_STRINGSET_GURU = 118, AF_BLUE_STRINGSET_HEBR = 124, - AF_BLUE_STRINGSET_KALI = 128, - AF_BLUE_STRINGSET_KHMR = 134, - AF_BLUE_STRINGSET_KHMS = 140, - AF_BLUE_STRINGSET_KNDA = 143, + AF_BLUE_STRINGSET_KNDA = 128, + AF_BLUE_STRINGSET_KALI = 131, + AF_BLUE_STRINGSET_KHMR = 137, + AF_BLUE_STRINGSET_KHMS = 143, AF_BLUE_STRINGSET_LAO = 146, AF_BLUE_STRINGSET_LATN = 152, AF_BLUE_STRINGSET_LATB = 159, AF_BLUE_STRINGSET_LATP = 166, AF_BLUE_STRINGSET_LISU = 173, AF_BLUE_STRINGSET_MLYM = 176, - AF_BLUE_STRINGSET_MONG = 179, - AF_BLUE_STRINGSET_MYMR = 182, - AF_BLUE_STRINGSET_NKOO = 187, - AF_BLUE_STRINGSET_NONE = 192, - AF_BLUE_STRINGSET_OLCK = 193, - AF_BLUE_STRINGSET_ORKH = 196, - AF_BLUE_STRINGSET_OSGE = 199, - AF_BLUE_STRINGSET_OSMA = 207, - AF_BLUE_STRINGSET_ROHG = 210, - AF_BLUE_STRINGSET_SAUR = 214, - AF_BLUE_STRINGSET_SHAW = 217, - AF_BLUE_STRINGSET_SINH = 223, - AF_BLUE_STRINGSET_SUND = 227, - AF_BLUE_STRINGSET_TAML = 231, - AF_BLUE_STRINGSET_TAVT = 234, - AF_BLUE_STRINGSET_TELU = 237, - AF_BLUE_STRINGSET_TFNG = 240, - AF_BLUE_STRINGSET_THAI = 243, - AF_BLUE_STRINGSET_VAII = 251, - af_blue_2_1 = 254, + AF_BLUE_STRINGSET_MEDF = 179, + AF_BLUE_STRINGSET_MONG = 187, + AF_BLUE_STRINGSET_MYMR = 190, + AF_BLUE_STRINGSET_NKOO = 195, + AF_BLUE_STRINGSET_NONE = 200, + AF_BLUE_STRINGSET_OLCK = 201, + AF_BLUE_STRINGSET_ORKH = 204, + AF_BLUE_STRINGSET_OSGE = 207, + AF_BLUE_STRINGSET_OSMA = 215, + AF_BLUE_STRINGSET_ROHG = 218, + AF_BLUE_STRINGSET_SAUR = 222, + AF_BLUE_STRINGSET_SHAW = 225, + AF_BLUE_STRINGSET_SINH = 231, + AF_BLUE_STRINGSET_SUND = 235, + AF_BLUE_STRINGSET_TAML = 239, + AF_BLUE_STRINGSET_TAVT = 242, + AF_BLUE_STRINGSET_TELU = 245, + AF_BLUE_STRINGSET_THAI = 248, + AF_BLUE_STRINGSET_TFNG = 256, + AF_BLUE_STRINGSET_VAII = 259, + af_blue_2_1 = 262, #ifdef AF_CONFIG_OPTION_CJK AF_BLUE_STRINGSET_HANI = af_blue_2_1 + 0, af_blue_2_1_1 = af_blue_2_1 + 2, diff --git a/thirdparty/freetype/src/autofit/afcjk.c b/thirdparty/freetype/src/autofit/afcjk.c index ca6ce0c60c..3b340cd5ed 100644 --- a/thirdparty/freetype/src/autofit/afcjk.c +++ b/thirdparty/freetype/src/autofit/afcjk.c @@ -22,9 +22,8 @@ * */ -#include <ft2build.h> -#include FT_ADVANCES_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/ftadvanc.h> +#include <freetype/internal/ftdebug.h> #include "afglobal.h" #include "aflatin.h" @@ -158,7 +157,7 @@ if ( !glyph_index ) goto Exit; - FT_TRACE5(( "standard character: U+%04lX (glyph index %d)\n", + FT_TRACE5(( "standard character: U+%04lX (glyph index %ld)\n", ch, glyph_index )); error = FT_Load_Glyph( face, glyph_index, FT_LOAD_NO_SCALE ); @@ -261,9 +260,9 @@ dim == AF_DIMENSION_VERT ? "horizontal" : "vertical" )); - FT_TRACE5(( " %d (standard)", axis->standard_width )); + FT_TRACE5(( " %ld (standard)", axis->standard_width )); for ( i = 1; i < axis->width_count; i++ ) - FT_TRACE5(( " %d", axis->widths[i].org )); + FT_TRACE5(( " %ld", axis->widths[i].org )); FT_TRACE5(( "\n" )); } @@ -728,7 +727,7 @@ delta2 = FT_MulFix( delta2, scale ); - FT_TRACE5(( "delta: %d", delta1 )); + FT_TRACE5(( "delta: %ld", delta1 )); if ( delta2 < 32 ) delta2 = 0; #if 0 @@ -737,7 +736,7 @@ #endif else delta2 = FT_PIX_ROUND( delta2 ); - FT_TRACE5(( "/%d\n", delta2 )); + FT_TRACE5(( "/%ld\n", delta2 )); if ( delta1 < 0 ) delta2 = -delta2; @@ -1644,7 +1643,7 @@ stem_edge->pos = base_edge->pos + fitted_width; - FT_TRACE5(( " CJKLINK: edge %d @%d (opos=%.2f) linked to %.2f," + FT_TRACE5(( " CJKLINK: edge %ld @%d (opos=%.2f) linked to %.2f," " dist was %.2f, now %.2f\n", stem_edge - hints->axis[dim].edges, stem_edge->fpos, stem_edge->opos / 64.0, stem_edge->pos / 64.0, @@ -1866,7 +1865,7 @@ continue; #ifdef FT_DEBUG_LEVEL_TRACE - FT_TRACE5(( " CJKBLUE: edge %d @%d (opos=%.2f) snapped to %.2f," + FT_TRACE5(( " CJKBLUE: edge %ld @%d (opos=%.2f) snapped to %.2f," " was %.2f\n", edge1 - edges, edge1->fpos, edge1->opos / 64.0, blue->fit / 64.0, edge1->pos / 64.0 )); @@ -1930,7 +1929,7 @@ /* this should not happen, but it's better to be safe */ if ( edge2->blue_edge ) { - FT_TRACE5(( "ASSERTION FAILED for edge %d\n", edge2-edges )); + FT_TRACE5(( "ASSERTION FAILED for edge %ld\n", edge2-edges )); af_cjk_align_linked_edge( hints, dim, edge2, edge ); edge->flags |= AF_EDGE_DONE; diff --git a/thirdparty/freetype/src/autofit/aferrors.h b/thirdparty/freetype/src/autofit/aferrors.h index 6c7d0e1d70..f90899944b 100644 --- a/thirdparty/freetype/src/autofit/aferrors.h +++ b/thirdparty/freetype/src/autofit/aferrors.h @@ -26,7 +26,7 @@ #ifndef AFERRORS_H_ #define AFERRORS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX AF_Err_ #define FT_ERR_BASE FT_Mod_Err_Autofit -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* AFERRORS_H_ */ diff --git a/thirdparty/freetype/src/autofit/afglobal.c b/thirdparty/freetype/src/autofit/afglobal.c index 5ad4ea9211..d5129423d5 100644 --- a/thirdparty/freetype/src/autofit/afglobal.c +++ b/thirdparty/freetype/src/autofit/afglobal.c @@ -19,7 +19,7 @@ #include "afglobal.h" #include "afranges.h" #include "afshaper.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> /************************************************************************** @@ -306,7 +306,7 @@ if ( !( count % 10 ) ) FT_TRACE4(( " " )); - FT_TRACE4(( " %d", idx )); + FT_TRACE4(( " %ld", idx )); count++; if ( !( count % 10 ) ) diff --git a/thirdparty/freetype/src/autofit/afhints.c b/thirdparty/freetype/src/autofit/afhints.c index 5a123b2ba3..a8e00890ef 100644 --- a/thirdparty/freetype/src/autofit/afhints.c +++ b/thirdparty/freetype/src/autofit/afhints.c @@ -18,8 +18,8 @@ #include "afhints.h" #include "aferrors.h" -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> /************************************************************************** diff --git a/thirdparty/freetype/src/autofit/aflatin.c b/thirdparty/freetype/src/autofit/aflatin.c index b453fcdf69..21ec02ebd2 100644 --- a/thirdparty/freetype/src/autofit/aflatin.c +++ b/thirdparty/freetype/src/autofit/aflatin.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_ADVANCES_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/ftadvanc.h> +#include <freetype/internal/ftdebug.h> #include "afglobal.h" #include "aflatin.h" @@ -155,7 +154,7 @@ goto Exit; } - FT_TRACE5(( "standard character: U+%04lX (glyph index %d)\n", + FT_TRACE5(( "standard character: U+%04lX (glyph index %ld)\n", ch, glyph_index )); error = FT_Load_Glyph( face, glyph_index, FT_LOAD_NO_SCALE ); @@ -258,9 +257,9 @@ dim == AF_DIMENSION_VERT ? "horizontal" : "vertical" )); - FT_TRACE5(( " %d (standard)", axis->standard_width )); + FT_TRACE5(( " %ld (standard)", axis->standard_width )); for ( i = 1; i < axis->width_count; i++ ) - FT_TRACE5(( " %d", axis->widths[i].org )); + FT_TRACE5(( " %ld", axis->widths[i].org )); FT_TRACE5(( "\n" )); } @@ -1032,7 +1031,7 @@ { *a = *b; FT_TRACE5(( "blue zone overlap:" - " adjusting %s %d to %ld\n", + " adjusting %s %ld to %ld\n", a_is_top ? "overshoot" : "reference", blue_sorted[i] - axis->blues, *a )); @@ -1280,7 +1279,7 @@ "af_latin_metrics_scale_dim:" " x height alignment (style `%s'):\n" " " - " vertical scaling changed from %.5f to %.5f (by %d%%)\n" + " vertical scaling changed from %.5f to %.5f (by %ld%%)\n" "\n", af_style_names[metrics->root.style_class->style], scale / 65536.0, @@ -1333,7 +1332,7 @@ width->cur = FT_MulFix( width->org, scale ); width->fit = width->cur; - FT_TRACE5(( " %d scaled to %.2f\n", + FT_TRACE5(( " %ld scaled to %.2f\n", width->org, width->cur / 64.0 )); } @@ -1474,8 +1473,8 @@ AF_LatinBlue blue = &axis->blues[nn]; - FT_TRACE5(( " reference %d: %d scaled to %.2f%s\n" - " overshoot %d: %d scaled to %.2f%s\n", + FT_TRACE5(( " reference %d: %ld scaled to %.2f%s\n" + " overshoot %d: %ld scaled to %.2f%s\n", nn, blue->ref.org, blue->ref.fit / 64.0, @@ -2945,7 +2944,7 @@ stem_edge->pos = base_edge->pos + fitted_width; - FT_TRACE5(( " LINK: edge %d (opos=%.2f) linked to %.2f," + FT_TRACE5(( " LINK: edge %ld (opos=%.2f) linked to %.2f," " dist was %.2f, now %.2f\n", stem_edge - hints->axis[dim].edges, stem_edge->opos / 64.0, stem_edge->pos / 64.0, dist / 64.0, fitted_width / 64.0 )); @@ -3069,12 +3068,12 @@ #ifdef FT_DEBUG_LEVEL_TRACE if ( !anchor ) - FT_TRACE5(( " BLUE_ANCHOR: edge %d (opos=%.2f) snapped to %.2f," - " was %.2f (anchor=edge %d)\n", + FT_TRACE5(( " BLUE_ANCHOR: edge %ld (opos=%.2f) snapped to %.2f," + " was %.2f (anchor=edge %ld)\n", edge1 - edges, edge1->opos / 64.0, blue->fit / 64.0, edge1->pos / 64.0, edge - edges )); else - FT_TRACE5(( " BLUE: edge %d (opos=%.2f) snapped to %.2f," + FT_TRACE5(( " BLUE: edge %ld (opos=%.2f) snapped to %.2f," " was %.2f\n", edge1 - edges, edge1->opos / 64.0, blue->fit / 64.0, edge1->pos / 64.0 )); @@ -3123,7 +3122,7 @@ /* this should not happen, but it's better to be safe */ if ( edge2->blue_edge ) { - FT_TRACE5(( " ASSERTION FAILED for edge %d\n", edge2 - edges )); + FT_TRACE5(( " ASSERTION FAILED for edge %ld\n", edge2 - edges )); af_latin_align_linked_edge( hints, dim, edge2, edge ); edge->flags |= AF_EDGE_DONE; @@ -3191,7 +3190,7 @@ anchor = edge; edge->flags |= AF_EDGE_DONE; - FT_TRACE5(( " ANCHOR: edge %d (opos=%.2f) and %d (opos=%.2f)" + FT_TRACE5(( " ANCHOR: edge %ld (opos=%.2f) and %ld (opos=%.2f)" " snapped to %.2f and %.2f\n", edge - edges, edge->opos / 64.0, edge2 - edges, edge2->opos / 64.0, @@ -3220,7 +3219,7 @@ if ( edge2->flags & AF_EDGE_DONE ) { - FT_TRACE5(( " ADJUST: edge %d (pos=%.2f) moved to %.2f\n", + FT_TRACE5(( " ADJUST: edge %ld (pos=%.2f) moved to %.2f\n", edge - edges, edge->pos / 64.0, ( edge2->pos - cur_len ) / 64.0 )); @@ -3261,7 +3260,7 @@ edge->pos = cur_pos1 - cur_len / 2; edge2->pos = cur_pos1 + cur_len / 2; - FT_TRACE5(( " STEM: edge %d (opos=%.2f) linked to %d (opos=%.2f)" + FT_TRACE5(( " STEM: edge %ld (opos=%.2f) linked to %ld (opos=%.2f)" " snapped to %.2f and %.2f\n", edge - edges, edge->opos / 64.0, edge2 - edges, edge2->opos / 64.0, @@ -3292,7 +3291,7 @@ edge->pos = ( delta1 < delta2 ) ? cur_pos1 : cur_pos2; edge2->pos = edge->pos + cur_len; - FT_TRACE5(( " STEM: edge %d (opos=%.2f) linked to %d (opos=%.2f)" + FT_TRACE5(( " STEM: edge %ld (opos=%.2f) linked to %ld (opos=%.2f)" " snapped to %.2f and %.2f\n", edge - edges, edge->opos / 64.0, edge2 - edges, edge2->opos / 64.0, @@ -3315,7 +3314,7 @@ if ( edge->link && FT_ABS( edge->link->pos - edge[-1].pos ) > 16 ) { #ifdef FT_DEBUG_LEVEL_TRACE - FT_TRACE5(( " BOUND: edge %d (pos=%.2f) moved to %.2f\n", + FT_TRACE5(( " BOUND: edge %ld (pos=%.2f) moved to %.2f\n", edge - edges, edge->pos / 64.0, edge[-1].pos / 64.0 )); @@ -3417,7 +3416,7 @@ if ( delta < 64 + 16 ) { af_latin_align_serif_edge( hints, edge->serif, edge ); - FT_TRACE5(( " SERIF: edge %d (opos=%.2f) serif to %d (opos=%.2f)" + FT_TRACE5(( " SERIF: edge %ld (opos=%.2f) serif to %ld (opos=%.2f)" " aligned to %.2f\n", edge - edges, edge->opos / 64.0, edge->serif - edges, edge->serif->opos / 64.0, @@ -3427,7 +3426,7 @@ { edge->pos = FT_PIX_ROUND( edge->opos ); anchor = edge; - FT_TRACE5(( " SERIF_ANCHOR: edge %d (opos=%.2f)" + FT_TRACE5(( " SERIF_ANCHOR: edge %ld (opos=%.2f)" " snapped to %.2f\n", edge-edges, edge->opos / 64.0, edge->pos / 64.0 )); } @@ -3455,8 +3454,8 @@ after->pos - before->pos, after->opos - before->opos ); - FT_TRACE5(( " SERIF_LINK1: edge %d (opos=%.2f) snapped to %.2f" - " from %d (opos=%.2f)\n", + FT_TRACE5(( " SERIF_LINK1: edge %ld (opos=%.2f) snapped to %.2f" + " from %ld (opos=%.2f)\n", edge - edges, edge->opos / 64.0, edge->pos / 64.0, before - edges, before->opos / 64.0 )); @@ -3465,7 +3464,7 @@ { edge->pos = anchor->pos + ( ( edge->opos - anchor->opos + 16 ) & ~31 ); - FT_TRACE5(( " SERIF_LINK2: edge %d (opos=%.2f)" + FT_TRACE5(( " SERIF_LINK2: edge %ld (opos=%.2f)" " snapped to %.2f\n", edge - edges, edge->opos / 64.0, edge->pos / 64.0 )); } @@ -3485,7 +3484,7 @@ if ( edge->link && FT_ABS( edge->link->pos - edge[-1].pos ) > 16 ) { #ifdef FT_DEBUG_LEVEL_TRACE - FT_TRACE5(( " BOUND: edge %d (pos=%.2f) moved to %.2f\n", + FT_TRACE5(( " BOUND: edge %ld (pos=%.2f) moved to %.2f\n", edge - edges, edge->pos / 64.0, edge[-1].pos / 64.0 )); @@ -3506,7 +3505,7 @@ if ( edge->link && FT_ABS( edge->link->pos - edge[-1].pos ) > 16 ) { #ifdef FT_DEBUG_LEVEL_TRACE - FT_TRACE5(( " BOUND: edge %d (pos=%.2f) moved to %.2f\n", + FT_TRACE5(( " BOUND: edge %ld (pos=%.2f) moved to %.2f\n", edge - edges, edge->pos / 64.0, edge[1].pos / 64.0 )); diff --git a/thirdparty/freetype/src/autofit/aflatin2.c b/thirdparty/freetype/src/autofit/aflatin2.c index 7bd4156a0f..902f3982e0 100644 --- a/thirdparty/freetype/src/autofit/aflatin2.c +++ b/thirdparty/freetype/src/autofit/aflatin2.c @@ -21,8 +21,7 @@ */ -#include <ft2build.h> -#include FT_ADVANCES_H +#include <freetype/ftadvanc.h> #ifdef FT_OPTION_AUTOFIT2 diff --git a/thirdparty/freetype/src/autofit/afloader.c b/thirdparty/freetype/src/autofit/afloader.c index a53fbf2d21..c35d85c4cf 100644 --- a/thirdparty/freetype/src/autofit/afloader.c +++ b/thirdparty/freetype/src/autofit/afloader.c @@ -22,7 +22,7 @@ #include "aferrors.h" #include "afmodule.h" -#include FT_INTERNAL_CALC_H +#include <freetype/internal/ftcalc.h> /* Initialize glyph loader. */ diff --git a/thirdparty/freetype/src/autofit/afmodule.c b/thirdparty/freetype/src/autofit/afmodule.c index 0bcae4cc25..e16494460e 100644 --- a/thirdparty/freetype/src/autofit/afmodule.c +++ b/thirdparty/freetype/src/autofit/afmodule.c @@ -53,10 +53,10 @@ void* _af_debug_hints = _af_debug_hints_rec; #endif -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_DRIVER_H -#include FT_SERVICE_PROPERTIES_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftdriver.h> +#include <freetype/internal/services/svprop.h> /************************************************************************** @@ -149,7 +149,7 @@ if ( !af_style_classes[ss] ) { FT_TRACE0(( "af_property_set: Invalid value %d for property `%s'\n", - fallback_script, property_name )); + *fallback_script, property_name )); return FT_THROW( Invalid_Argument ); } @@ -550,8 +550,8 @@ NULL, /* reset_face */ NULL, /* get_global_hints */ NULL, /* done_global_hints */ - (FT_AutoHinter_GlyphLoadFunc)af_autofitter_load_glyph ) /* load_glyph */ - + (FT_AutoHinter_GlyphLoadFunc)af_autofitter_load_glyph /* load_glyph */ + ) FT_DEFINE_MODULE( autofit_module_class, diff --git a/thirdparty/freetype/src/autofit/afmodule.h b/thirdparty/freetype/src/autofit/afmodule.h index efa0240b4b..e8fe4a93aa 100644 --- a/thirdparty/freetype/src/autofit/afmodule.h +++ b/thirdparty/freetype/src/autofit/afmodule.h @@ -19,9 +19,8 @@ #ifndef AFMODULE_H_ #define AFMODULE_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_MODULE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER @@ -47,6 +46,7 @@ FT_BEGIN_HEADER } AF_ModuleRec, *AF_Module; +FT_DECLARE_AUTOHINTER_INTERFACE( af_autofitter_interface ) FT_DECLARE_MODULE( autofit_module_class ) diff --git a/thirdparty/freetype/src/autofit/afranges.c b/thirdparty/freetype/src/autofit/afranges.c index d6ecf88910..c8ebf5e784 100644 --- a/thirdparty/freetype/src/autofit/afranges.c +++ b/thirdparty/freetype/src/autofit/afranges.c @@ -664,6 +664,18 @@ }; + const AF_Script_UniRangeRec af_medf_uniranges[] = + { + AF_UNIRANGE_REC( 0x16E40, 0x16E9F ), /* Medefaidrin */ + AF_UNIRANGE_REC( 0, 0 ) + }; + + const AF_Script_UniRangeRec af_medf_nonbase_uniranges[] = + { + AF_UNIRANGE_REC( 0, 0 ) + }; + + const AF_Script_UniRangeRec af_mong_uniranges[] = { AF_UNIRANGE_REC( 0x1800, 0x18AF ), /* Mongolian */ diff --git a/thirdparty/freetype/src/autofit/afscript.h b/thirdparty/freetype/src/autofit/afscript.h index 36caaddc56..4cf9cc19f5 100644 --- a/thirdparty/freetype/src/autofit/afscript.h +++ b/thirdparty/freetype/src/autofit/afscript.h @@ -243,6 +243,12 @@ HINTING_BOTTOM_TO_TOP, "\xE0\xB4\xA0 \xE0\xB4\xB1" ) /* ഠ റ */ + SCRIPT( medf, MEDF, + "Medefaidrin", + HB_SCRIPT_MEDEFAIDRIN, + HINTING_BOTTOM_TO_TOP, + "\xF0\x96\xB9\xA1 \xF0\x96\xB9\x9B \xF0\x96\xB9\xAF" ) /* 𖹡 𖹛 𖹯 */ + SCRIPT( mong, MONG, "Mongolian", HB_SCRIPT_MONGOLIAN, diff --git a/thirdparty/freetype/src/autofit/afshaper.c b/thirdparty/freetype/src/autofit/afshaper.c index d3902db2ed..bbf7b6b1f9 100644 --- a/thirdparty/freetype/src/autofit/afshaper.c +++ b/thirdparty/freetype/src/autofit/afshaper.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_ADVANCES_H +#include <freetype/freetype.h> +#include <freetype/ftadvanc.h> #include "afglobal.h" #include "aftypes.h" #include "afshaper.h" diff --git a/thirdparty/freetype/src/autofit/afshaper.h b/thirdparty/freetype/src/autofit/afshaper.h index a7dbf34f1a..138c27b32b 100644 --- a/thirdparty/freetype/src/autofit/afshaper.h +++ b/thirdparty/freetype/src/autofit/afshaper.h @@ -20,8 +20,7 @@ #define AFSHAPER_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> #ifdef FT_CONFIG_OPTION_USE_HARFBUZZ diff --git a/thirdparty/freetype/src/autofit/afstyles.h b/thirdparty/freetype/src/autofit/afstyles.h index 8d411ab0d7..9113ec451e 100644 --- a/thirdparty/freetype/src/autofit/afstyles.h +++ b/thirdparty/freetype/src/autofit/afstyles.h @@ -322,6 +322,13 @@ AF_BLUE_STRINGSET_MLYM, AF_COVERAGE_DEFAULT ) + STYLE( medf_dflt, MEDF_DFLT, + "Medefaidrin default style", + AF_WRITING_SYSTEM_LATIN, + AF_SCRIPT_MEDF, + AF_BLUE_STRINGSET_MEDF, + AF_COVERAGE_DEFAULT ) + STYLE( mong_dflt, MONG_DFLT, "Mongolian default style", AF_WRITING_SYSTEM_LATIN, diff --git a/thirdparty/freetype/src/autofit/aftypes.h b/thirdparty/freetype/src/autofit/aftypes.h index 7ca0b59e32..5f040c6b4b 100644 --- a/thirdparty/freetype/src/autofit/aftypes.h +++ b/thirdparty/freetype/src/autofit/aftypes.h @@ -32,12 +32,11 @@ #ifndef AFTYPES_H_ #define AFTYPES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_OUTLINE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/freetype.h> +#include <freetype/ftoutln.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> #include "afblue.h" diff --git a/thirdparty/freetype/src/autofit/autofit.c b/thirdparty/freetype/src/autofit/autofit.c index 88be8bf2bc..ef5e7f1452 100644 --- a/thirdparty/freetype/src/autofit/autofit.c +++ b/thirdparty/freetype/src/autofit/autofit.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "afangles.c" #include "afblue.c" diff --git a/thirdparty/freetype/src/base/ftadvanc.c b/thirdparty/freetype/src/base/ftadvanc.c index 310bbba41e..c689e6a15b 100644 --- a/thirdparty/freetype/src/base/ftadvanc.c +++ b/thirdparty/freetype/src/base/ftadvanc.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_ADVANCES_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftadvanc.h> +#include <freetype/internal/ftobjs.h> static FT_Error diff --git a/thirdparty/freetype/src/base/ftbase.c b/thirdparty/freetype/src/base/ftbase.c index b8242bb960..bfbaffd64e 100644 --- a/thirdparty/freetype/src/base/ftbase.c +++ b/thirdparty/freetype/src/base/ftbase.c @@ -16,7 +16,6 @@ */ -#include <ft2build.h> #define FT_MAKE_OPTION_SINGLE_OBJECT #include "ftadvanc.c" diff --git a/thirdparty/freetype/src/base/ftbase.h b/thirdparty/freetype/src/base/ftbase.h index 472713addf..25afa9bc31 100644 --- a/thirdparty/freetype/src/base/ftbase.h +++ b/thirdparty/freetype/src/base/ftbase.h @@ -20,13 +20,16 @@ #define FTBASE_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER + FT_DECLARE_GLYPH( ft_bitmap_glyph_class ) + FT_DECLARE_GLYPH( ft_outline_glyph_class ) + + #ifdef FT_CONFIG_OPTION_MAC_FONTS /* MacOS resource fork cannot exceed 16MB at least for Carbon code; */ diff --git a/thirdparty/freetype/src/base/ftbbox.c b/thirdparty/freetype/src/base/ftbbox.c index 9d9f9c4015..30a4eba0b3 100644 --- a/thirdparty/freetype/src/base/ftbbox.c +++ b/thirdparty/freetype/src/base/ftbbox.c @@ -24,14 +24,13 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H - -#include FT_BBOX_H -#include FT_IMAGE_H -#include FT_OUTLINE_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftdebug.h> + +#include <freetype/ftbbox.h> +#include <freetype/ftimage.h> +#include <freetype/ftoutln.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftobjs.h> typedef struct TBBox_Rec_ diff --git a/thirdparty/freetype/src/base/ftbdf.c b/thirdparty/freetype/src/base/ftbdf.c index a239e5f873..fc374c6675 100644 --- a/thirdparty/freetype/src/base/ftbdf.c +++ b/thirdparty/freetype/src/base/ftbdf.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_BDF_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svbdf.h> /* documentation is in ftbdf.h */ diff --git a/thirdparty/freetype/src/base/ftbitmap.c b/thirdparty/freetype/src/base/ftbitmap.c index 18ac4c5f34..584213ddcf 100644 --- a/thirdparty/freetype/src/base/ftbitmap.c +++ b/thirdparty/freetype/src/base/ftbitmap.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_BITMAP_H -#include FT_IMAGE_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftbitmap.h> +#include <freetype/ftimage.h> +#include <freetype/internal/ftobjs.h> /************************************************************************** @@ -909,13 +908,13 @@ #ifdef FT_DEBUG_LEVEL_TRACE FT_TRACE5(( "FT_Bitmap_Blend:\n" - " source bitmap: (%d, %d) -- (%d, %d); %d x %d\n", + " source bitmap: (%ld, %ld) -- (%ld, %ld); %d x %d\n", source_llx / 64, source_lly / 64, source_urx / 64, source_ury / 64, source_->width, source_->rows )); if ( target->width && target->rows ) - FT_TRACE5(( " target bitmap: (%d, %d) -- (%d, %d); %d x %d\n", + FT_TRACE5(( " target bitmap: (%ld, %ld) -- (%ld, %ld); %d x %d\n", target_llx / 64, target_lly / 64, target_urx / 64, target_ury / 64, target->width, target->rows )); @@ -923,7 +922,7 @@ FT_TRACE5(( " target bitmap: empty\n" )); if ( final_width && final_rows ) - FT_TRACE5(( " final bitmap: (%d, %d) -- (%d, %d); %d x %d\n", + FT_TRACE5(( " final bitmap: (%ld, %ld) -- (%ld, %ld); %d x %d\n", final_llx / 64, final_lly / 64, final_urx / 64, final_ury / 64, final_width, final_rows )); diff --git a/thirdparty/freetype/src/base/ftcalc.c b/thirdparty/freetype/src/base/ftcalc.c index 53550057b1..b5258c85a1 100644 --- a/thirdparty/freetype/src/base/ftcalc.c +++ b/thirdparty/freetype/src/base/ftcalc.c @@ -32,12 +32,11 @@ */ -#include <ft2build.h> -#include FT_GLYPH_H -#include FT_TRIGONOMETRY_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftglyph.h> +#include <freetype/fttrigon.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> #ifdef FT_MULFIX_ASSEMBLER diff --git a/thirdparty/freetype/src/base/ftcid.c b/thirdparty/freetype/src/base/ftcid.c index 17c25730e7..ce8a876adc 100644 --- a/thirdparty/freetype/src/base/ftcid.c +++ b/thirdparty/freetype/src/base/ftcid.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_CID_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_CID_H +#include <freetype/ftcid.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svcid.h> /* documentation is in ftcid.h */ diff --git a/thirdparty/freetype/src/base/ftcolor.c b/thirdparty/freetype/src/base/ftcolor.c index 986e9924a6..a50d680096 100644 --- a/thirdparty/freetype/src/base/ftcolor.c +++ b/thirdparty/freetype/src/base/ftcolor.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_COLOR_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/sfnt.h> +#include <freetype/internal/tttypes.h> +#include <freetype/ftcolor.h> #ifdef TT_CONFIG_OPTION_COLOR_LAYERS diff --git a/thirdparty/freetype/src/base/ftdbgmem.c b/thirdparty/freetype/src/base/ftdbgmem.c index 7f06c86006..eb0d651607 100644 --- a/thirdparty/freetype/src/base/ftdbgmem.c +++ b/thirdparty/freetype/src/base/ftdbgmem.c @@ -18,11 +18,11 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_MEMORY_H -#include FT_SYSTEM_H -#include FT_ERRORS_H -#include FT_TYPES_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftmemory.h> +#include <freetype/ftsystem.h> +#include <freetype/fterrors.h> +#include <freetype/fttypes.h> #ifdef FT_DEBUG_MEMORY diff --git a/thirdparty/freetype/src/base/ftdebug.c b/thirdparty/freetype/src/base/ftdebug.c index da1c1265e3..62cf680b01 100644 --- a/thirdparty/freetype/src/base/ftdebug.c +++ b/thirdparty/freetype/src/base/ftdebug.c @@ -41,9 +41,8 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/freetype.h> +#include <freetype/internal/ftdebug.h> #ifdef FT_DEBUG_LEVEL_ERROR @@ -126,7 +125,7 @@ static const char* ft_trace_toggles[trace_count + 1] = { -#include FT_INTERNAL_TRACE_H +#include <freetype/internal/fttrace.h> NULL }; diff --git a/thirdparty/freetype/src/base/fterrors.c b/thirdparty/freetype/src/base/fterrors.c index 8aa688fbe2..eba9e76563 100644 --- a/thirdparty/freetype/src/base/fterrors.c +++ b/thirdparty/freetype/src/base/fterrors.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_ERRORS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/fterrors.h> /* documentation is in fterrors.h */ @@ -38,7 +37,7 @@ #define FT_ERRORDEF( e, v, s ) case v: return s; #define FT_ERROR_END_LIST } -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* defined( FT_CONFIG_OPTION_ERROR_STRINGS ) || ... */ diff --git a/thirdparty/freetype/src/base/ftfntfmt.c b/thirdparty/freetype/src/base/ftfntfmt.c index 95e9b6e4c1..a45317e797 100644 --- a/thirdparty/freetype/src/base/ftfntfmt.c +++ b/thirdparty/freetype/src/base/ftfntfmt.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_FONT_FORMATS_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_FONT_FORMAT_H +#include <freetype/ftfntfmt.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svfntfmt.h> /* documentation is in ftfntfmt.h */ diff --git a/thirdparty/freetype/src/base/ftfstype.c b/thirdparty/freetype/src/base/ftfstype.c index 461d857077..bca548fc56 100644 --- a/thirdparty/freetype/src/base/ftfstype.c +++ b/thirdparty/freetype/src/base/ftfstype.c @@ -15,11 +15,10 @@ * */ -#include <ft2build.h> -#include FT_TYPE1_TABLES_H -#include FT_TRUETYPE_TABLES_H -#include FT_INTERNAL_SERVICE_H -#include FT_SERVICE_POSTSCRIPT_INFO_H +#include <freetype/t1tables.h> +#include <freetype/tttables.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/services/svpsinfo.h> /* documentation is in freetype.h */ diff --git a/thirdparty/freetype/src/base/ftgasp.c b/thirdparty/freetype/src/base/ftgasp.c index 0fd80b9cd6..eed05a3265 100644 --- a/thirdparty/freetype/src/base/ftgasp.c +++ b/thirdparty/freetype/src/base/ftgasp.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_GASP_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/ftgasp.h> +#include <freetype/internal/tttypes.h> FT_EXPORT_DEF( FT_Int ) diff --git a/thirdparty/freetype/src/base/ftgloadr.c b/thirdparty/freetype/src/base/ftgloadr.c index 6032885c6b..05fc7692bb 100644 --- a/thirdparty/freetype/src/base/ftgloadr.c +++ b/thirdparty/freetype/src/base/ftgloadr.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_GLYPH_LOADER_H -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftgloadr.h> +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftobjs.h> #undef FT_COMPONENT #define FT_COMPONENT gloader @@ -93,6 +92,7 @@ base->outline.n_points = 0; base->outline.n_contours = 0; + base->outline.flags = 0; base->num_subglyphs = 0; *current = *base; diff --git a/thirdparty/freetype/src/base/ftglyph.c b/thirdparty/freetype/src/base/ftglyph.c index 44654be780..825eba2c4d 100644 --- a/thirdparty/freetype/src/base/ftglyph.c +++ b/thirdparty/freetype/src/base/ftglyph.c @@ -28,13 +28,14 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_GLYPH_H -#include FT_OUTLINE_H -#include FT_BITMAP_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftglyph.h> +#include <freetype/ftoutln.h> +#include <freetype/ftbitmap.h> +#include <freetype/internal/ftobjs.h> + +#include "ftbase.h" /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftgxval.c b/thirdparty/freetype/src/base/ftgxval.c index fa32c5f6ca..f04df14526 100644 --- a/thirdparty/freetype/src/base/ftgxval.c +++ b/thirdparty/freetype/src/base/ftgxval.c @@ -25,11 +25,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_GX_VALIDATE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svgxval.h> /* documentation is in ftgxval.h */ diff --git a/thirdparty/freetype/src/base/fthash.c b/thirdparty/freetype/src/base/fthash.c index 387e6d26db..449b03a5c1 100644 --- a/thirdparty/freetype/src/base/fthash.c +++ b/thirdparty/freetype/src/base/fthash.c @@ -39,9 +39,8 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_HASH_H -#include FT_INTERNAL_MEMORY_H +#include <freetype/internal/fthash.h> +#include <freetype/internal/ftmemory.h> #define INITIAL_HT_SIZE 241 diff --git a/thirdparty/freetype/src/base/ftinit.c b/thirdparty/freetype/src/base/ftinit.c index 1aab09a771..0acc75e460 100644 --- a/thirdparty/freetype/src/base/ftinit.c +++ b/thirdparty/freetype/src/base/ftinit.c @@ -39,9 +39,9 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_MODULE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftmodapi.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftlcdfil.c b/thirdparty/freetype/src/base/ftlcdfil.c index d4ef93a518..1e84dbc894 100644 --- a/thirdparty/freetype/src/base/ftlcdfil.c +++ b/thirdparty/freetype/src/base/ftlcdfil.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_LCD_FILTER_H -#include FT_IMAGE_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftlcdfil.h> +#include <freetype/ftimage.h> +#include <freetype/internal/ftobjs.h> #ifdef FT_CONFIG_OPTION_SUBPIXEL_RENDERING diff --git a/thirdparty/freetype/src/base/ftmac.c b/thirdparty/freetype/src/base/ftmac.c index 2de43a0146..55a631fd74 100644 --- a/thirdparty/freetype/src/base/ftmac.c +++ b/thirdparty/freetype/src/base/ftmac.c @@ -65,10 +65,9 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_STREAM_H +#include <freetype/freetype.h> +#include <freetype/tttags.h> +#include <freetype/internal/ftstream.h> #include "ftbase.h" diff --git a/thirdparty/freetype/src/base/ftmm.c b/thirdparty/freetype/src/base/ftmm.c index ef2e3d9588..9a702b9933 100644 --- a/thirdparty/freetype/src/base/ftmm.c +++ b/thirdparty/freetype/src/base/ftmm.c @@ -16,13 +16,12 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_MULTIPLE_MASTERS_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/ftmm.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svmetric.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftobjs.c b/thirdparty/freetype/src/base/ftobjs.c index 1b042614d2..c060bbbc87 100644 --- a/thirdparty/freetype/src/base/ftobjs.c +++ b/thirdparty/freetype/src/base/ftobjs.c @@ -16,32 +16,31 @@ */ -#include <ft2build.h> -#include FT_LIST_H -#include FT_OUTLINE_H -#include FT_FONT_FORMATS_H - -#include FT_INTERNAL_VALIDATE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_RFORK_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H /* for SFNT_Load_Table_Func */ -#include FT_INTERNAL_POSTSCRIPT_AUX_H /* for PS_Driver */ - -#include FT_TRUETYPE_TABLES_H -#include FT_TRUETYPE_TAGS_H -#include FT_TRUETYPE_IDS_H - -#include FT_SERVICE_PROPERTIES_H -#include FT_SERVICE_SFNT_H -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_GLYPH_DICT_H -#include FT_SERVICE_TT_CMAP_H -#include FT_SERVICE_KERNING_H -#include FT_SERVICE_TRUETYPE_ENGINE_H - -#include FT_DRIVER_H +#include <freetype/ftlist.h> +#include <freetype/ftoutln.h> +#include <freetype/ftfntfmt.h> + +#include <freetype/internal/ftvalid.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftrfork.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> /* for SFNT_Load_Table_Func */ +#include <freetype/internal/psaux.h> /* for PS_Driver */ + +#include <freetype/tttables.h> +#include <freetype/tttags.h> +#include <freetype/ttnameid.h> + +#include <freetype/internal/services/svprop.h> +#include <freetype/internal/services/svsfnt.h> +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svgldict.h> +#include <freetype/internal/services/svttcmap.h> +#include <freetype/internal/services/svkern.h> +#include <freetype/internal/services/svtteng.h> + +#include <freetype/ftdriver.h> #ifdef FT_CONFIG_OPTION_MAC_FONTS #include "ftbase.h" @@ -50,7 +49,7 @@ #ifdef FT_DEBUG_LEVEL_TRACE -#include FT_BITMAP_H +#include <freetype/ftbitmap.h> #if defined( _MSC_VER ) /* Visual C++ (and Intel C++) */ /* We disable the warning `conversion from XXX to YYY, */ @@ -1063,11 +1062,30 @@ slot->linearHoriAdvance / 65536.0 )); FT_TRACE5(( " linear y advance: %f\n", slot->linearVertAdvance / 65536.0 )); + FT_TRACE5(( "\n" )); FT_TRACE5(( " bitmap %dx%d, %s (mode %d)\n", slot->bitmap.width, slot->bitmap.rows, pixel_modes[slot->bitmap.pixel_mode], slot->bitmap.pixel_mode )); + FT_TRACE5(( "\n" )); + + { + FT_Glyph_Metrics* metrics = &slot->metrics; + + + FT_TRACE5(( " metrics:\n" )); + FT_TRACE5(( " width: %f\n", metrics->width / 64.0 )); + FT_TRACE5(( " height: %f\n", metrics->height / 64.0 )); + FT_TRACE5(( "\n" )); + FT_TRACE5(( " horiBearingX: %f\n", metrics->horiBearingX / 64.0 )); + FT_TRACE5(( " horiBearingY: %f\n", metrics->horiBearingY / 64.0 )); + FT_TRACE5(( " horiAdvance: %f\n", metrics->horiAdvance / 64.0 )); + FT_TRACE5(( "\n" )); + FT_TRACE5(( " vertBearingX: %f\n", metrics->vertBearingX / 64.0 )); + FT_TRACE5(( " vertBearingY: %f\n", metrics->vertBearingY / 64.0 )); + FT_TRACE5(( " vertAdvance: %f\n", metrics->vertAdvance / 64.0 )); + } #endif Exit: @@ -1842,15 +1860,15 @@ /* FT2 allocator takes signed long buffer length, * too large value causing overflow should be checked */ - FT_TRACE4(( " POST fragment #%d: length=0x%08x" - " total pfb_len=0x%08x\n", + FT_TRACE4(( " POST fragment #%d: length=0x%08lx" + " total pfb_len=0x%08lx\n", i, temp, pfb_len + temp + 6 )); if ( FT_MAC_RFORK_MAX_LEN < temp || FT_MAC_RFORK_MAX_LEN - temp < pfb_len + 6 ) { FT_TRACE2(( " MacOS resource length cannot exceed" - " 0x%08x\n", + " 0x%08lx\n", FT_MAC_RFORK_MAX_LEN )); error = FT_THROW( Invalid_Offset ); @@ -1861,13 +1879,13 @@ } FT_TRACE2(( " total buffer size to concatenate" - " %d POST fragments: 0x%08x\n", + " %ld POST fragments: 0x%08lx\n", resource_cnt, pfb_len + 2 )); if ( pfb_len + 2 < 6 ) { FT_TRACE2(( " too long fragment length makes" - " pfb_len confused: pfb_len=0x%08x\n", + " pfb_len confused: pfb_len=0x%08lx\n", pfb_len )); error = FT_THROW( Array_Too_Large ); @@ -1910,7 +1928,7 @@ goto Exit2; FT_TRACE3(( "POST fragment[%d]:" - " offsets=0x%08x, rlen=0x%08x, flags=0x%04x\n", + " offsets=0x%08lx, rlen=0x%08lx, flags=0x%04x\n", i, offsets[i], rlen, flags )); error = FT_ERR( Array_Too_Large ); @@ -1937,7 +1955,7 @@ else { FT_TRACE3(( " Write POST fragment #%d header (4-byte) to buffer" - " %p + 0x%08x\n", + " %p + 0x%08lx\n", i, pfb_data, pfb_lenpos )); if ( pfb_lenpos + 3 > pfb_len + 2 ) @@ -1952,7 +1970,7 @@ break; FT_TRACE3(( " Write POST fragment #%d header (6-byte) to buffer" - " %p + 0x%08x\n", + " %p + 0x%08lx\n", i, pfb_data, pfb_pos )); if ( pfb_pos + 6 > pfb_len + 2 ) @@ -1974,8 +1992,8 @@ if ( pfb_pos > pfb_len || pfb_pos + rlen > pfb_len ) goto Exit2; - FT_TRACE3(( " Load POST fragment #%d (%d byte) to buffer" - " %p + 0x%08x\n", + FT_TRACE3(( " Load POST fragment #%d (%ld byte) to buffer" + " %p + 0x%08lx\n", i, rlen, pfb_data, pfb_pos )); error = FT_Stream_Read( stream, (FT_Byte *)pfb_data + pfb_pos, rlen ); @@ -2260,7 +2278,7 @@ args2.flags = FT_OPEN_PATHNAME; args2.pathname = file_names[i] ? file_names[i] : args->pathname; - FT_TRACE3(( "Try rule %d: %s (offset=%d) ...", + FT_TRACE3(( "Try rule %d: %s (offset=%ld) ...", i, args2.pathname, offsets[i] )); error = FT_Stream_New( library, &args2, &stream2 ); @@ -2858,6 +2876,8 @@ if ( error ) { FT_FREE( node ); + if ( size ) + FT_FREE( size->internal ); FT_FREE( size ); } @@ -3213,9 +3233,9 @@ FT_Size_Metrics* metrics = &face->size->metrics; - FT_TRACE5(( " x scale: %d (%f)\n", + FT_TRACE5(( " x scale: %ld (%f)\n", metrics->x_scale, metrics->x_scale / 65536.0 )); - FT_TRACE5(( " y scale: %d (%f)\n", + FT_TRACE5(( " y scale: %ld (%f)\n", metrics->y_scale, metrics->y_scale / 65536.0 )); FT_TRACE5(( " ascender: %f\n", metrics->ascender / 64.0 )); FT_TRACE5(( " descender: %f\n", metrics->descender / 64.0 )); @@ -3288,9 +3308,9 @@ FT_Size_Metrics* metrics = &face->size->metrics; - FT_TRACE5(( " x scale: %d (%f)\n", + FT_TRACE5(( " x scale: %ld (%f)\n", metrics->x_scale, metrics->x_scale / 65536.0 )); - FT_TRACE5(( " y scale: %d (%f)\n", + FT_TRACE5(( " y scale: %ld (%f)\n", metrics->y_scale, metrics->y_scale / 65536.0 )); FT_TRACE5(( " ascender: %f\n", metrics->ascender / 64.0 )); FT_TRACE5(( " descender: %f\n", metrics->descender / 64.0 )); @@ -3450,7 +3470,7 @@ if ( akerning->x != orig_x_rounded || akerning->y != orig_y_rounded ) FT_TRACE5(( "FT_Get_Kerning: horizontal kerning" - " (%d, %d) scaled down to (%d, %d) pixels\n", + " (%ld, %ld) scaled down to (%ld, %ld) pixels\n", orig_x_rounded / 64, orig_y_rounded / 64, akerning->x / 64, akerning->y / 64 )); } @@ -3722,7 +3742,7 @@ if ( charcode > 0xFFFFFFFFUL ) { FT_TRACE1(( "FT_Get_Char_Index: too large charcode" )); - FT_TRACE1(( " 0x%x is truncated\n", charcode )); + FT_TRACE1(( " 0x%lx is truncated\n", charcode )); } result = cmap->clazz->char_index( cmap, (FT_UInt32)charcode ); @@ -3898,13 +3918,13 @@ { FT_TRACE1(( "FT_Face_GetCharVariantIndex:" " too large charcode" )); - FT_TRACE1(( " 0x%x is truncated\n", charcode )); + FT_TRACE1(( " 0x%lx is truncated\n", charcode )); } if ( variantSelector > 0xFFFFFFFFUL ) { FT_TRACE1(( "FT_Face_GetCharVariantIndex:" " too large variantSelector" )); - FT_TRACE1(( " 0x%x is truncated\n", variantSelector )); + FT_TRACE1(( " 0x%lx is truncated\n", variantSelector )); } result = vcmap->clazz->char_var_index( vcmap, ucmap, @@ -3941,13 +3961,13 @@ { FT_TRACE1(( "FT_Face_GetCharVariantIsDefault:" " too large charcode" )); - FT_TRACE1(( " 0x%x is truncated\n", charcode )); + FT_TRACE1(( " 0x%lx is truncated\n", charcode )); } if ( variantSelector > 0xFFFFFFFFUL ) { FT_TRACE1(( "FT_Face_GetCharVariantIsDefault:" " too large variantSelector" )); - FT_TRACE1(( " 0x%x is truncated\n", variantSelector )); + FT_TRACE1(( " 0x%lx is truncated\n", variantSelector )); } result = vcmap->clazz->char_var_default( vcmap, @@ -4010,7 +4030,7 @@ if ( charcode > 0xFFFFFFFFUL ) { FT_TRACE1(( "FT_Face_GetVariantsOfChar: too large charcode" )); - FT_TRACE1(( " 0x%x is truncated\n", charcode )); + FT_TRACE1(( " 0x%lx is truncated\n", charcode )); } result = vcmap->clazz->charvariant_list( vcmap, memory, @@ -4044,7 +4064,7 @@ if ( variantSelector > 0xFFFFFFFFUL ) { FT_TRACE1(( "FT_Get_Char_Index: too large variantSelector" )); - FT_TRACE1(( " 0x%x is truncated\n", variantSelector )); + FT_TRACE1(( " 0x%lx is truncated\n", variantSelector )); } result = vcmap->clazz->variantchar_list( vcmap, memory, diff --git a/thirdparty/freetype/src/base/ftotval.c b/thirdparty/freetype/src/base/ftotval.c index 9f69e0c1fd..90a5dd617c 100644 --- a/thirdparty/freetype/src/base/ftotval.c +++ b/thirdparty/freetype/src/base/ftotval.c @@ -15,12 +15,11 @@ * */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_OPENTYPE_VALIDATE_H -#include FT_OPENTYPE_VALIDATE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svotval.h> +#include <freetype/ftotval.h> /* documentation is in ftotval.h */ diff --git a/thirdparty/freetype/src/base/ftoutln.c b/thirdparty/freetype/src/base/ftoutln.c index faaae83294..311f098e3a 100644 --- a/thirdparty/freetype/src/base/ftoutln.c +++ b/thirdparty/freetype/src/base/ftoutln.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_OUTLINE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H -#include FT_TRIGONOMETRY_H +#include <freetype/ftoutln.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/fttrigon.h> /************************************************************************** @@ -275,7 +274,7 @@ first = (FT_UInt)last + 1; } - FT_TRACE5(( "FT_Outline_Decompose: Done\n", n )); + FT_TRACE5(( "FT_Outline_Decompose: Done\n" )); return FT_Err_Ok; Invalid_Outline: @@ -1061,6 +1060,11 @@ if ( cbox.xMin == cbox.xMax || cbox.yMin == cbox.yMax ) return FT_ORIENTATION_NONE; + /* Reject values large outlines. */ + if ( cbox.xMin < -0x1000000L || cbox.yMin < -0x1000000L || + cbox.xMax > 0x1000000L || cbox.yMax > 0x1000000L ) + return FT_ORIENTATION_NONE; + xshift = FT_MSB( (FT_UInt32)( FT_ABS( cbox.xMax ) | FT_ABS( cbox.xMin ) ) ) - 14; xshift = FT_MAX( xshift, 0 ); diff --git a/thirdparty/freetype/src/base/ftpatent.c b/thirdparty/freetype/src/base/ftpatent.c index 077a9b03fa..a02c636a65 100644 --- a/thirdparty/freetype/src/base/ftpatent.c +++ b/thirdparty/freetype/src/base/ftpatent.c @@ -16,13 +16,12 @@ * */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_STREAM_H -#include FT_SERVICE_SFNT_H -#include FT_SERVICE_TRUETYPE_GLYF_H +#include <freetype/freetype.h> +#include <freetype/tttags.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/services/svsfnt.h> +#include <freetype/internal/services/svttglyf.h> /* documentation is in freetype.h */ diff --git a/thirdparty/freetype/src/base/ftpfr.c b/thirdparty/freetype/src/base/ftpfr.c index 57e65665ff..c656fcd9b9 100644 --- a/thirdparty/freetype/src/base/ftpfr.c +++ b/thirdparty/freetype/src/base/ftpfr.c @@ -15,11 +15,10 @@ * */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_PFR_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svpfr.h> /* check the format */ diff --git a/thirdparty/freetype/src/base/ftpsprop.c b/thirdparty/freetype/src/base/ftpsprop.c index c63f864c1a..8c29f50f6b 100644 --- a/thirdparty/freetype/src/base/ftpsprop.c +++ b/thirdparty/freetype/src/base/ftpsprop.c @@ -17,12 +17,11 @@ */ -#include <ft2build.h> -#include FT_DRIVER_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_POSTSCRIPT_PROPS_H +#include <freetype/ftdriver.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/psaux.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftpsprop.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftrfork.c b/thirdparty/freetype/src/base/ftrfork.c index 1bf7800f17..f989be47f4 100644 --- a/thirdparty/freetype/src/base/ftrfork.c +++ b/thirdparty/freetype/src/base/ftrfork.c @@ -24,10 +24,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_RFORK_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftrfork.h> #include "ftbase.h" @@ -240,7 +239,7 @@ (char)( 0xFF & ( tag_internal >> 16 ) ), (char)( 0xFF & ( tag_internal >> 8 ) ), (char)( 0xFF & ( tag_internal >> 0 ) ) )); - FT_TRACE3(( " : subcount=%d, suboffset=0x%04x\n", + FT_TRACE3(( " : subcount=%d, suboffset=0x%04lx\n", subcnt, rpos )); if ( tag_internal == tag ) @@ -286,7 +285,7 @@ ref[j].offset = temp & 0xFFFFFFL; FT_TRACE3(( " [%d]:" - " resource_id=0x%04x, offset=0x%08x\n", + " resource_id=0x%04x, offset=0x%08lx\n", j, (FT_UShort)ref[j].res_id, ref[j].offset )); } @@ -302,7 +301,7 @@ for ( j = 0; j < *count; j++ ) FT_TRACE3(( " [%d]:" - " resource_id=0x%04x, offset=0x%08x\n", + " resource_id=0x%04x, offset=0x%08lx\n", j, ref[j].res_id, ref[j].offset )); } diff --git a/thirdparty/freetype/src/base/ftsnames.c b/thirdparty/freetype/src/base/ftsnames.c index 25f5d45be5..8507f28d36 100644 --- a/thirdparty/freetype/src/base/ftsnames.c +++ b/thirdparty/freetype/src/base/ftsnames.c @@ -19,12 +19,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_SFNT_NAMES_H -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_INTERNAL_STREAM_H +#include <freetype/ftsnames.h> +#include <freetype/internal/tttypes.h> +#include <freetype/internal/ftstream.h> #ifdef TT_CONFIG_OPTION_SFNT_NAMES diff --git a/thirdparty/freetype/src/base/ftstream.c b/thirdparty/freetype/src/base/ftstream.c index 7dbf9b55fc..d940254d8b 100644 --- a/thirdparty/freetype/src/base/ftstream.c +++ b/thirdparty/freetype/src/base/ftstream.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftstroke.c b/thirdparty/freetype/src/base/ftstroke.c index 3369dc24b1..56f98e1d92 100644 --- a/thirdparty/freetype/src/base/ftstroke.c +++ b/thirdparty/freetype/src/base/ftstroke.c @@ -16,13 +16,12 @@ */ -#include <ft2build.h> -#include FT_STROKER_H -#include FT_TRIGONOMETRY_H -#include FT_OUTLINE_H -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/ftstroke.h> +#include <freetype/fttrigon.h> +#include <freetype/ftoutln.h> +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> /* declare an extern to access `ft_outline_glyph_class' globally */ diff --git a/thirdparty/freetype/src/base/ftsynth.c b/thirdparty/freetype/src/base/ftsynth.c index eee6b952b4..a9119e2b24 100644 --- a/thirdparty/freetype/src/base/ftsynth.c +++ b/thirdparty/freetype/src/base/ftsynth.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_SYNTHESIS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_OUTLINE_H -#include FT_BITMAP_H +#include <freetype/ftsynth.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftoutln.h> +#include <freetype/ftbitmap.h> /************************************************************************** @@ -130,7 +129,7 @@ if ( ( ystr >> 6 ) > FT_INT_MAX || ( ystr >> 6 ) < FT_INT_MIN ) { FT_TRACE1(( "FT_GlyphSlot_Embolden:" )); - FT_TRACE1(( "too strong emboldening parameter ystr=%d\n", ystr )); + FT_TRACE1(( "too strong emboldening parameter ystr=%ld\n", ystr )); return; } error = FT_GlyphSlot_Own_Bitmap( slot ); diff --git a/thirdparty/freetype/src/base/ftsystem.c b/thirdparty/freetype/src/base/ftsystem.c index 290100613f..3013cbda9d 100644 --- a/thirdparty/freetype/src/base/ftsystem.c +++ b/thirdparty/freetype/src/base/ftsystem.c @@ -27,11 +27,11 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_SYSTEM_H -#include FT_ERRORS_H -#include FT_TYPES_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/ftsystem.h> +#include <freetype/fterrors.h> +#include <freetype/fttypes.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/fttrigon.c b/thirdparty/freetype/src/base/fttrigon.c index dbe11107bd..c6f027cf61 100644 --- a/thirdparty/freetype/src/base/fttrigon.c +++ b/thirdparty/freetype/src/base/fttrigon.c @@ -29,10 +29,9 @@ * */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_CALC_H -#include FT_TRIGONOMETRY_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/fttrigon.h> /* the Cordic shrink factor 0.858785336480436 * 2^32 */ diff --git a/thirdparty/freetype/src/base/fttype1.c b/thirdparty/freetype/src/base/fttype1.c index 61778faa70..be60ed6ec5 100644 --- a/thirdparty/freetype/src/base/fttype1.c +++ b/thirdparty/freetype/src/base/fttype1.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_SERVICE_H -#include FT_SERVICE_POSTSCRIPT_INFO_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/services/svpsinfo.h> /* documentation is in t1tables.h */ diff --git a/thirdparty/freetype/src/base/ftutil.c b/thirdparty/freetype/src/base/ftutil.c index 629af174b1..d90cfbcd26 100644 --- a/thirdparty/freetype/src/base/ftutil.c +++ b/thirdparty/freetype/src/base/ftutil.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_OBJECTS_H -#include FT_LIST_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftlist.h> /************************************************************************** diff --git a/thirdparty/freetype/src/base/ftver.rc b/thirdparty/freetype/src/base/ftver.rc index fcbd9eff5f..0b92e9b899 100644 --- a/thirdparty/freetype/src/base/ftver.rc +++ b/thirdparty/freetype/src/base/ftver.rc @@ -18,8 +18,8 @@ #include<windows.h> -#define FT_VERSION 2,10,2,0 -#define FT_VERSION_STR "2.10.2" +#define FT_VERSION 2,10,4,0 +#define FT_VERSION_STR "2.10.4" VS_VERSION_INFO VERSIONINFO FILEVERSION FT_VERSION diff --git a/thirdparty/freetype/src/base/ftwinfnt.c b/thirdparty/freetype/src/base/ftwinfnt.c index 77527277c2..699dc3d700 100644 --- a/thirdparty/freetype/src/base/ftwinfnt.c +++ b/thirdparty/freetype/src/base/ftwinfnt.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_WINFONTS_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_WINFNT_H +#include <freetype/internal/ftdebug.h> +#include <freetype/ftwinfnt.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svwinfnt.h> /* documentation is in ftwinfnt.h */ diff --git a/thirdparty/freetype/src/bdf/bdf.c b/thirdparty/freetype/src/bdf/bdf.c index e54df6649b..249012e590 100644 --- a/thirdparty/freetype/src/bdf/bdf.c +++ b/thirdparty/freetype/src/bdf/bdf.c @@ -26,7 +26,6 @@ THE SOFTWARE. #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "bdflib.c" #include "bdfdrivr.c" diff --git a/thirdparty/freetype/src/bdf/bdf.h b/thirdparty/freetype/src/bdf/bdf.h index d9abd2378f..5acbd5f2f9 100644 --- a/thirdparty/freetype/src/bdf/bdf.h +++ b/thirdparty/freetype/src/bdf/bdf.h @@ -30,10 +30,9 @@ * Based on bdf.h,v 1.16 2000/03/16 20:08:51 mleisher */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_HASH_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/fthash.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/bdf/bdfdrivr.c b/thirdparty/freetype/src/bdf/bdfdrivr.c index 60eb93305e..d29188b97b 100644 --- a/thirdparty/freetype/src/bdf/bdfdrivr.c +++ b/thirdparty/freetype/src/bdf/bdfdrivr.c @@ -24,16 +24,15 @@ OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_OBJECTS_H -#include FT_BDF_H -#include FT_TRUETYPE_IDS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftbdf.h> +#include <freetype/ttnameid.h> -#include FT_SERVICE_BDF_H -#include FT_SERVICE_FONT_FORMAT_H +#include <freetype/internal/services/svbdf.h> +#include <freetype/internal/services/svfntfmt.h> #include "bdf.h" #include "bdfdrivr.h" @@ -184,7 +183,8 @@ THE SOFTWARE. Exit: if ( charcode > 0xFFFFFFFFUL ) { - FT_TRACE1(( "bdf_cmap_char_next: charcode 0x%x > 32bit API" )); + FT_TRACE1(( "bdf_cmap_char_next: charcode 0x%lx > 32bit API", + charcode )); *acharcode = 0; /* XXX: result should be changed to indicate an overflow error */ } @@ -402,10 +402,10 @@ THE SOFTWARE. bdf_property_t* prop = NULL; - FT_TRACE4(( " number of glyphs: allocated %d (used %d)\n", + FT_TRACE4(( " number of glyphs: allocated %ld (used %ld)\n", font->glyphs_size, font->glyphs_used )); - FT_TRACE4(( " number of unencoded glyphs: allocated %d (used %d)\n", + FT_TRACE4(( " number of unencoded glyphs: allocated %ld (used %ld)\n", font->unencoded_size, font->unencoded_used )); @@ -457,13 +457,13 @@ THE SOFTWARE. if ( font->font_ascent > 0x7FFF || font->font_ascent < -0x7FFF ) { font->font_ascent = font->font_ascent < 0 ? -0x7FFF : 0x7FFF; - FT_TRACE0(( "BDF_Face_Init: clamping font ascent to value %d\n", + FT_TRACE0(( "BDF_Face_Init: clamping font ascent to value %ld\n", font->font_ascent )); } if ( font->font_descent > 0x7FFF || font->font_descent < -0x7FFF ) { font->font_descent = font->font_descent < 0 ? -0x7FFF : 0x7FFF; - FT_TRACE0(( "BDF_Face_Init: clamping font descent to value %d\n", + FT_TRACE0(( "BDF_Face_Init: clamping font descent to value %ld\n", font->font_descent )); } @@ -504,7 +504,7 @@ THE SOFTWARE. prop->value.l < -0x504C2L ) { bsize->size = 0x7FFF; - FT_TRACE0(( "BDF_Face_Init: clamping point size to value %d\n", + FT_TRACE0(( "BDF_Face_Init: clamping point size to value %ld\n", bsize->size )); } else @@ -517,7 +517,7 @@ THE SOFTWARE. if ( font->point_size > 0x7FFF ) { bsize->size = 0x7FFF; - FT_TRACE0(( "BDF_Face_Init: clamping point size to value %d\n", + FT_TRACE0(( "BDF_Face_Init: clamping point size to value %ld\n", bsize->size )); } else @@ -539,7 +539,7 @@ THE SOFTWARE. if ( prop->value.l > 0x7FFF || prop->value.l < -0x7FFF ) { bsize->y_ppem = 0x7FFF << 6; - FT_TRACE0(( "BDF_Face_Init: clamping pixel size to value %d\n", + FT_TRACE0(( "BDF_Face_Init: clamping pixel size to value %ld\n", bsize->y_ppem )); } else @@ -615,7 +615,7 @@ THE SOFTWARE. for ( n = 0; n < font->glyphs_size; n++ ) { (face->en_table[n]).enc = cur[n].encoding; - FT_TRACE4(( " idx %d, val 0x%lX\n", n, cur[n].encoding )); + FT_TRACE4(( " idx %ld, val 0x%lX\n", n, cur[n].encoding )); (face->en_table[n]).glyph = (FT_UShort)n; if ( cur[n].encoding == font->default_char ) @@ -624,7 +624,7 @@ THE SOFTWARE. face->default_glyph = (FT_UInt)n; else FT_TRACE1(( "BDF_Face_Init:" - " idx %d is too large for this system\n", n )); + " idx %ld is too large for this system\n", n )); } } } @@ -825,7 +825,7 @@ THE SOFTWARE. bitmap->rows = glyph.bbx.height; bitmap->width = glyph.bbx.width; if ( glyph.bpr > FT_INT_MAX ) - FT_TRACE1(( "BDF_Glyph_Load: too large pitch %d is truncated\n", + FT_TRACE1(( "BDF_Glyph_Load: too large pitch %ld is truncated\n", glyph.bpr )); bitmap->pitch = (int)glyph.bpr; /* same as FT_Bitmap.pitch */ @@ -902,7 +902,8 @@ THE SOFTWARE. if ( prop->value.l > 0x7FFFFFFFL || prop->value.l < ( -1 - 0x7FFFFFFFL ) ) { FT_TRACE1(( "bdf_get_bdf_property:" - " too large integer 0x%x is truncated\n" )); + " too large integer 0x%lx is truncated\n", + prop->value.l )); } aproperty->type = BDF_PROPERTY_TYPE_INTEGER; aproperty->u.integer = (FT_Int32)prop->value.l; @@ -912,7 +913,8 @@ THE SOFTWARE. if ( prop->value.ul > 0xFFFFFFFFUL ) { FT_TRACE1(( "bdf_get_bdf_property:" - " too large cardinal 0x%x is truncated\n" )); + " too large cardinal 0x%lx is truncated\n", + prop->value.ul )); } aproperty->type = BDF_PROPERTY_TYPE_CARDINAL; aproperty->u.cardinal = (FT_UInt32)prop->value.ul; diff --git a/thirdparty/freetype/src/bdf/bdfdrivr.h b/thirdparty/freetype/src/bdf/bdfdrivr.h index b37b84ea31..54aaa3353c 100644 --- a/thirdparty/freetype/src/bdf/bdfdrivr.h +++ b/thirdparty/freetype/src/bdf/bdfdrivr.h @@ -28,8 +28,7 @@ THE SOFTWARE. #ifndef BDFDRIVR_H_ #define BDFDRIVR_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> #include "bdf.h" diff --git a/thirdparty/freetype/src/bdf/bdferror.h b/thirdparty/freetype/src/bdf/bdferror.h index dbe41c02ab..c1b5444871 100644 --- a/thirdparty/freetype/src/bdf/bdferror.h +++ b/thirdparty/freetype/src/bdf/bdferror.h @@ -29,7 +29,7 @@ #ifndef BDFERROR_H_ #define BDFERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -37,7 +37,7 @@ #define FT_ERR_PREFIX BDF_Err_ #define FT_ERR_BASE FT_Mod_Err_BDF -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* BDFERROR_H_ */ diff --git a/thirdparty/freetype/src/bdf/bdflib.c b/thirdparty/freetype/src/bdf/bdflib.c index 63813f7edc..a4ddb9a1d9 100644 --- a/thirdparty/freetype/src/bdf/bdflib.c +++ b/thirdparty/freetype/src/bdf/bdflib.c @@ -31,12 +31,11 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/freetype.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftobjs.h> #include "bdf.h" #include "bdferror.h" diff --git a/thirdparty/freetype/src/bzip2/ftbzip2.c b/thirdparty/freetype/src/bzip2/ftbzip2.c index e4d7a4901a..411c5d263b 100644 --- a/thirdparty/freetype/src/bzip2/ftbzip2.c +++ b/thirdparty/freetype/src/bzip2/ftbzip2.c @@ -22,15 +22,14 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H -#include FT_BZIP2_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftbzip2.h> #include FT_CONFIG_STANDARD_LIBRARY_H -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -38,7 +37,7 @@ #define FT_ERR_PREFIX Bzip2_Err_ #define FT_ERR_BASE FT_Mod_Err_Bzip2 -#include FT_ERRORS_H +#include <freetype/fterrors.h> #ifdef FT_CONFIG_OPTION_USE_BZIP2 diff --git a/thirdparty/freetype/src/cache/ftcache.c b/thirdparty/freetype/src/cache/ftcache.c index 4137f68690..e90f4639cb 100644 --- a/thirdparty/freetype/src/cache/ftcache.c +++ b/thirdparty/freetype/src/cache/ftcache.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "ftcbasic.c" #include "ftccache.c" diff --git a/thirdparty/freetype/src/cache/ftcbasic.c b/thirdparty/freetype/src/cache/ftcbasic.c index a65a90e867..43ea314d4a 100644 --- a/thirdparty/freetype/src/cache/ftcbasic.c +++ b/thirdparty/freetype/src/cache/ftcbasic.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_CACHE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftcache.h> #include "ftcglyph.h" #include "ftcimage.h" #include "ftcsbits.h" @@ -111,7 +110,9 @@ if ( (FT_ULong)face->num_glyphs > FT_UINT_MAX || 0 > face->num_glyphs ) FT_TRACE1(( "ftc_basic_family_get_count:" - " too large number of glyphs in this face, truncated\n", + " the number of glyphs in this face is %ld,\n" + " " + " which is too much and thus truncated\n", face->num_glyphs )); if ( !error ) @@ -394,7 +395,7 @@ #if FT_ULONG_MAX > FT_UINT_MAX if ( load_flags > FT_UINT_MAX ) FT_TRACE1(( "FTC_ImageCache_LookupScaler:" - " higher bits in load_flags 0x%x are dropped\n", + " higher bits in load_flags 0x%lx are dropped\n", load_flags & ~((FT_ULong)FT_UINT_MAX) )); #endif @@ -594,7 +595,7 @@ #if FT_ULONG_MAX > FT_UINT_MAX if ( load_flags > FT_UINT_MAX ) FT_TRACE1(( "FTC_ImageCache_LookupScaler:" - " higher bits in load_flags 0x%x are dropped\n", + " higher bits in load_flags 0x%lx are dropped\n", load_flags & ~((FT_ULong)FT_UINT_MAX) )); #endif diff --git a/thirdparty/freetype/src/cache/ftccache.c b/thirdparty/freetype/src/cache/ftccache.c index 1d406c4200..1c8e0f3221 100644 --- a/thirdparty/freetype/src/cache/ftccache.c +++ b/thirdparty/freetype/src/cache/ftccache.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> #include "ftcmanag.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftccache.h b/thirdparty/freetype/src/cache/ftccache.h index 2996ee8080..11698bb0e9 100644 --- a/thirdparty/freetype/src/cache/ftccache.h +++ b/thirdparty/freetype/src/cache/ftccache.h @@ -19,7 +19,7 @@ #ifndef FTCCACHE_H_ #define FTCCACHE_H_ - +#include <freetype/internal/compiler-macros.h> #include "ftcmru.h" FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cache/ftccback.h b/thirdparty/freetype/src/cache/ftccback.h index 252be7c2b5..542acb1565 100644 --- a/thirdparty/freetype/src/cache/ftccback.h +++ b/thirdparty/freetype/src/cache/ftccback.h @@ -18,14 +18,14 @@ #ifndef FTCCBACK_H_ #define FTCCBACK_H_ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcmru.h" #include "ftcimage.h" #include "ftcmanag.h" #include "ftcglyph.h" #include "ftcsbits.h" +FT_BEGIN_HEADER FT_LOCAL( void ) ftc_inode_free( FTC_Node inode, @@ -85,6 +85,7 @@ ftc_node_destroy( FTC_Node node, FTC_Manager manager ); +FT_END_HEADER #endif /* FTCCBACK_H_ */ diff --git a/thirdparty/freetype/src/cache/ftccmap.c b/thirdparty/freetype/src/cache/ftccmap.c index a5da694d56..468c008cf6 100644 --- a/thirdparty/freetype/src/cache/ftccmap.c +++ b/thirdparty/freetype/src/cache/ftccmap.c @@ -16,13 +16,12 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_CACHE_H +#include <freetype/freetype.h> +#include <freetype/ftcache.h> #include "ftcmanag.h" -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcerror.h b/thirdparty/freetype/src/cache/ftcerror.h index 15e416ed21..bedfd28371 100644 --- a/thirdparty/freetype/src/cache/ftcerror.h +++ b/thirdparty/freetype/src/cache/ftcerror.h @@ -26,7 +26,7 @@ #ifndef FTCERROR_H_ #define FTCERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX FTC_Err_ #define FT_ERR_BASE FT_Mod_Err_Cache -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* FTCERROR_H_ */ diff --git a/thirdparty/freetype/src/cache/ftcglyph.c b/thirdparty/freetype/src/cache/ftcglyph.c index 559a2fb4c8..7f5438aad5 100644 --- a/thirdparty/freetype/src/cache/ftcglyph.c +++ b/thirdparty/freetype/src/cache/ftcglyph.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_CACHE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/ftcache.h> #include "ftcglyph.h" -#include FT_ERRORS_H +#include <freetype/fterrors.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcglyph.h b/thirdparty/freetype/src/cache/ftcglyph.h index ef689f9947..5629545f3c 100644 --- a/thirdparty/freetype/src/cache/ftcglyph.h +++ b/thirdparty/freetype/src/cache/ftcglyph.h @@ -117,7 +117,6 @@ #define FTCGLYPH_H_ -#include <ft2build.h> #include "ftcmanag.h" diff --git a/thirdparty/freetype/src/cache/ftcimage.c b/thirdparty/freetype/src/cache/ftcimage.c index 7696b2e52d..58ebad8c93 100644 --- a/thirdparty/freetype/src/cache/ftcimage.c +++ b/thirdparty/freetype/src/cache/ftcimage.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcimage.h" -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftobjs.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcimage.h b/thirdparty/freetype/src/cache/ftcimage.h index f99c5074cf..a400788b3c 100644 --- a/thirdparty/freetype/src/cache/ftcimage.h +++ b/thirdparty/freetype/src/cache/ftcimage.h @@ -36,8 +36,7 @@ #define FTCIMAGE_H_ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcglyph.h" FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cache/ftcmanag.c b/thirdparty/freetype/src/cache/ftcmanag.c index a6f1733f64..436d41f374 100644 --- a/thirdparty/freetype/src/cache/ftcmanag.c +++ b/thirdparty/freetype/src/cache/ftcmanag.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcmanag.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_SIZES_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftsizes.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcmanag.h b/thirdparty/freetype/src/cache/ftcmanag.h index 17ade7175f..6c6ec68545 100644 --- a/thirdparty/freetype/src/cache/ftcmanag.h +++ b/thirdparty/freetype/src/cache/ftcmanag.h @@ -63,8 +63,7 @@ #define FTCMANAG_H_ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcmru.h" #include "ftccache.h" diff --git a/thirdparty/freetype/src/cache/ftcmru.c b/thirdparty/freetype/src/cache/ftcmru.c index 370ae3be04..8feed45f6b 100644 --- a/thirdparty/freetype/src/cache/ftcmru.c +++ b/thirdparty/freetype/src/cache/ftcmru.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcmru.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcmru.h b/thirdparty/freetype/src/cache/ftcmru.h index 1591c20807..ac4f9b126d 100644 --- a/thirdparty/freetype/src/cache/ftcmru.h +++ b/thirdparty/freetype/src/cache/ftcmru.h @@ -44,8 +44,8 @@ #define FTCMRU_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> +#include <freetype/internal/compiler-macros.h> #ifdef FREETYPE_H #error "freetype.h of FreeType 1 has been loaded!" diff --git a/thirdparty/freetype/src/cache/ftcsbits.c b/thirdparty/freetype/src/cache/ftcsbits.c index 24e4aa1316..e0db930af8 100644 --- a/thirdparty/freetype/src/cache/ftcsbits.c +++ b/thirdparty/freetype/src/cache/ftcsbits.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcsbits.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_ERRORS_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/fterrors.h> #include "ftccback.h" #include "ftcerror.h" diff --git a/thirdparty/freetype/src/cache/ftcsbits.h b/thirdparty/freetype/src/cache/ftcsbits.h index 2517d15552..46f797e724 100644 --- a/thirdparty/freetype/src/cache/ftcsbits.h +++ b/thirdparty/freetype/src/cache/ftcsbits.h @@ -20,8 +20,7 @@ #define FTCSBITS_H_ -#include <ft2build.h> -#include FT_CACHE_H +#include <freetype/ftcache.h> #include "ftcglyph.h" diff --git a/thirdparty/freetype/src/cff/cff.c b/thirdparty/freetype/src/cff/cff.c index 755228bb6c..0fa6c87870 100644 --- a/thirdparty/freetype/src/cff/cff.c +++ b/thirdparty/freetype/src/cff/cff.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "cffcmap.c" #include "cffdrivr.c" diff --git a/thirdparty/freetype/src/cff/cffcmap.c b/thirdparty/freetype/src/cff/cffcmap.c index 1a045765de..6d16ed4226 100644 --- a/thirdparty/freetype/src/cff/cffcmap.c +++ b/thirdparty/freetype/src/cff/cffcmap.c @@ -16,8 +16,7 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "cffcmap.h" #include "cffload.h" diff --git a/thirdparty/freetype/src/cff/cffcmap.h b/thirdparty/freetype/src/cff/cffcmap.h index 319be88241..69fab8dc6c 100644 --- a/thirdparty/freetype/src/cff/cffcmap.h +++ b/thirdparty/freetype/src/cff/cffcmap.h @@ -19,7 +19,7 @@ #ifndef CFFCMAP_H_ #define CFFCMAP_H_ -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H +#include <freetype/internal/cffotypes.h> FT_BEGIN_HEADER @@ -43,7 +43,7 @@ FT_BEGIN_HEADER } CFF_CMapStdRec; - FT_DECLARE_CMAP_CLASS(cff_cmap_encoding_class_rec) + FT_DECLARE_CMAP_CLASS( cff_cmap_encoding_class_rec ) /*************************************************************************/ @@ -56,7 +56,7 @@ FT_BEGIN_HEADER /* unicode (synthetic) cmaps */ - FT_DECLARE_CMAP_CLASS(cff_cmap_unicode_class_rec) + FT_DECLARE_CMAP_CLASS( cff_cmap_unicode_class_rec ) FT_END_HEADER diff --git a/thirdparty/freetype/src/cff/cffdrivr.c b/thirdparty/freetype/src/cff/cffdrivr.c index 6d0dcd09d2..486ab24235 100644 --- a/thirdparty/freetype/src/cff/cffdrivr.c +++ b/thirdparty/freetype/src/cff/cffdrivr.c @@ -16,18 +16,17 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_POSTSCRIPT_PROPS_H -#include FT_SERVICE_CID_H -#include FT_SERVICE_POSTSCRIPT_INFO_H -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_TT_CMAP_H -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/freetype.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/internal/psaux.h> +#include <freetype/internal/ftpsprop.h> +#include <freetype/internal/services/svcid.h> +#include <freetype/internal/services/svpsinfo.h> +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svttcmap.h> +#include <freetype/internal/services/svcfftl.h> #include "cffdrivr.h" #include "cffgload.h" @@ -37,16 +36,16 @@ #include "cffobjs.h" #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svmetric.h> #endif #include "cfferrs.h" -#include FT_SERVICE_FONT_FORMAT_H -#include FT_SERVICE_GLYPH_DICT_H -#include FT_SERVICE_PROPERTIES_H -#include FT_DRIVER_H +#include <freetype/internal/services/svfntfmt.h> +#include <freetype/internal/services/svgldict.h> +#include <freetype/internal/services/svprop.h> +#include <freetype/ftdriver.h> /************************************************************************** @@ -738,7 +737,7 @@ { if ( dict->cid_supplement < FT_INT_MIN || dict->cid_supplement > FT_INT_MAX ) - FT_TRACE1(( "cff_get_ros: too large supplement %d is truncated\n", + FT_TRACE1(( "cff_get_ros: too large supplement %ld is truncated\n", dict->cid_supplement )); *supplement = (FT_Int)dict->cid_supplement; } diff --git a/thirdparty/freetype/src/cff/cffdrivr.h b/thirdparty/freetype/src/cff/cffdrivr.h index 25471d511b..d198dd35cb 100644 --- a/thirdparty/freetype/src/cff/cffdrivr.h +++ b/thirdparty/freetype/src/cff/cffdrivr.h @@ -20,8 +20,7 @@ #define CFFDRIVER_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cff/cfferrs.h b/thirdparty/freetype/src/cff/cfferrs.h index 32be8a7637..5b00a3f0a2 100644 --- a/thirdparty/freetype/src/cff/cfferrs.h +++ b/thirdparty/freetype/src/cff/cfferrs.h @@ -25,7 +25,7 @@ #ifndef CFFERRS_H_ #define CFFERRS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_BASE FT_Mod_Err_CFF -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* CFFERRS_H_ */ diff --git a/thirdparty/freetype/src/cff/cffgload.c b/thirdparty/freetype/src/cff/cffgload.c index 1c4e1979c4..feee38a413 100644 --- a/thirdparty/freetype/src/cff/cffgload.c +++ b/thirdparty/freetype/src/cff/cffgload.c @@ -16,14 +16,13 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_OUTLINE_H -#include FT_DRIVER_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/psaux.h> +#include <freetype/ftoutln.h> +#include <freetype/ftdriver.h> #include "cffload.h" #include "cffgload.h" @@ -207,8 +206,8 @@ PSAux_Service psaux = (PSAux_Service)face->psaux; const CFF_Decoder_Funcs decoder_funcs = psaux->cff_decoder_funcs; - FT_Matrix font_matrix; - FT_Vector font_offset; + FT_Matrix font_matrix; + FT_Vector font_offset; force_scaling = FALSE; @@ -364,7 +363,6 @@ top_upm = (FT_Long)cff->top_font.font_dict.units_per_em; sub_upm = (FT_Long)cff->subfonts[fd_index]->font_dict.units_per_em; - font_matrix = cff->subfonts[fd_index]->font_dict.font_matrix; font_offset = cff->subfonts[fd_index]->font_dict.font_offset; @@ -399,7 +397,6 @@ PS_Driver driver = (PS_Driver)FT_FACE_DRIVER( face ); #endif - FT_Byte* charstring; FT_ULong charstring_len; @@ -665,8 +662,12 @@ metrics->horiBearingY = cbox.yMax; if ( has_vertical_info ) + { metrics->vertBearingX = metrics->horiBearingX - metrics->horiAdvance / 2; + metrics->vertBearingY = FT_MulFix( metrics->vertBearingY, + glyph->y_scale ); + } else { if ( load_flags & FT_LOAD_VERTICAL_LAYOUT ) diff --git a/thirdparty/freetype/src/cff/cffgload.h b/thirdparty/freetype/src/cff/cffgload.h index b4ad61a564..3b312f452e 100644 --- a/thirdparty/freetype/src/cff/cffgload.h +++ b/thirdparty/freetype/src/cff/cffgload.h @@ -20,9 +20,8 @@ #define CFFGLOAD_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H +#include <freetype/freetype.h> +#include <freetype/internal/cffotypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cff/cffload.c b/thirdparty/freetype/src/cff/cffload.c index 9f1d0e2e64..73d3eecd31 100644 --- a/thirdparty/freetype/src/cff/cffload.c +++ b/thirdparty/freetype/src/cff/cffload.c @@ -16,17 +16,16 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H -#include FT_TYPE1_TABLES_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> +#include <freetype/t1tables.h> +#include <freetype/internal/psaux.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H +#include <freetype/ftmm.h> +#include <freetype/internal/services/svmm.h> #endif #include "cffload.h" @@ -411,7 +410,7 @@ FT_Error error = FT_Err_Ok; FT_Memory memory = idx->stream->memory; - FT_Byte** t = NULL; + FT_Byte** tbl = NULL; FT_Byte* new_bytes = NULL; FT_ULong new_size; @@ -428,11 +427,11 @@ new_size = idx->data_size + idx->count; if ( idx->count > 0 && - !FT_NEW_ARRAY( t, idx->count + 1 ) && + !FT_NEW_ARRAY( tbl, idx->count + 1 ) && ( !pool || !FT_ALLOC( new_bytes, new_size ) ) ) { FT_ULong n, cur_offset; - FT_ULong extra = 0; + FT_ULong extra = 0; FT_Byte* org_bytes = idx->bytes; @@ -443,15 +442,15 @@ if ( cur_offset != 0 ) { FT_TRACE0(( "cff_index_get_pointers:" - " invalid first offset value %d set to zero\n", + " invalid first offset value %ld set to zero\n", cur_offset )); cur_offset = 0; } if ( !pool ) - t[0] = org_bytes + cur_offset; + tbl[0] = org_bytes + cur_offset; else - t[0] = new_bytes + cur_offset; + tbl[0] = new_bytes + cur_offset; for ( n = 1; n <= idx->count; n++ ) { @@ -465,23 +464,25 @@ next_offset = idx->data_size; if ( !pool ) - t[n] = org_bytes + next_offset; + tbl[n] = org_bytes + next_offset; else { - t[n] = new_bytes + next_offset + extra; + tbl[n] = new_bytes + next_offset + extra; if ( next_offset != cur_offset ) { - FT_MEM_COPY( t[n - 1], org_bytes + cur_offset, t[n] - t[n - 1] ); - t[n][0] = '\0'; - t[n] += 1; + FT_MEM_COPY( tbl[n - 1], + org_bytes + cur_offset, + tbl[n] - tbl[n - 1] ); + tbl[n][0] = '\0'; + tbl[n] += 1; extra++; } } cur_offset = next_offset; } - *table = t; + *table = tbl; if ( pool ) *pool = new_bytes; @@ -490,6 +491,11 @@ } Exit: + if ( error && new_bytes ) + FT_FREE( new_bytes ); + if ( error && tbl ) + FT_FREE( tbl ); + return error; } @@ -553,8 +559,8 @@ idx->data_offset > stream->size - off2 + 1 ) { FT_ERROR(( "cff_index_access_element:" - " offset to next entry (%d)" - " exceeds the end of stream (%d)\n", + " offset to next entry (%ld)" + " exceeds the end of stream (%ld)\n", off2, stream->size - idx->data_offset + 1 )); off2 = stream->size - idx->data_offset + 1; } @@ -978,7 +984,7 @@ if ( glyph_sid > 0xFFFFL - nleft ) { FT_ERROR(( "cff_charset_load: invalid SID range trimmed" - " nleft=%d -> %d\n", nleft, 0xFFFFL - glyph_sid )); + " nleft=%d -> %ld\n", nleft, 0xFFFFL - glyph_sid )); nleft = ( FT_UInt )( 0xFFFFL - glyph_sid ); } @@ -1945,7 +1951,7 @@ if ( priv->blue_shift > 1000 || priv->blue_shift < 0 ) { FT_TRACE2(( "cff_load_private_dict:" - " setting unlikely BlueShift value %d to default (7)\n", + " setting unlikely BlueShift value %ld to default (7)\n", priv->blue_shift )); priv->blue_shift = 7; } @@ -1953,7 +1959,7 @@ if ( priv->blue_fuzz > 1000 || priv->blue_fuzz < 0 ) { FT_TRACE2(( "cff_load_private_dict:" - " setting unlikely BlueFuzz value %d to default (1)\n", + " setting unlikely BlueFuzz value %ld to default (1)\n", priv->blue_fuzz )); priv->blue_fuzz = 1; } diff --git a/thirdparty/freetype/src/cff/cffload.h b/thirdparty/freetype/src/cff/cffload.h index 1b7971293b..fc998db2db 100644 --- a/thirdparty/freetype/src/cff/cffload.h +++ b/thirdparty/freetype/src/cff/cffload.h @@ -20,10 +20,9 @@ #define CFFLOAD_H_ -#include <ft2build.h> -#include FT_INTERNAL_CFF_TYPES_H +#include <freetype/internal/cfftypes.h> #include "cffparse.h" -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H /* for CFF_Face */ +#include <freetype/internal/cffotypes.h> /* for CFF_Face */ FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cff/cffobjs.c b/thirdparty/freetype/src/cff/cffobjs.c index 78c3cb3c2d..d555d52358 100644 --- a/thirdparty/freetype/src/cff/cffobjs.c +++ b/thirdparty/freetype/src/cff/cffobjs.c @@ -16,32 +16,31 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_STREAM_H -#include FT_ERRORS_H -#include FT_TRUETYPE_IDS_H -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_SFNT_H -#include FT_DRIVER_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftstream.h> +#include <freetype/fterrors.h> +#include <freetype/ttnameid.h> +#include <freetype/tttags.h> +#include <freetype/internal/sfnt.h> +#include <freetype/ftdriver.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/ftmm.h> +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svmetric.h> #endif -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H +#include <freetype/internal/cffotypes.h> #include "cffobjs.h" #include "cffload.h" #include "cffcmap.h" #include "cfferrs.h" -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/internal/psaux.h> +#include <freetype/internal/services/svcfftl.h> /************************************************************************** @@ -167,46 +166,56 @@ FT_Error error = FT_Err_Ok; PSH_Globals_Funcs funcs = cff_size_get_globals_funcs( size ); + FT_Memory memory = cffsize->face->memory; + CFF_Internal internal = NULL; + CFF_Face face = (CFF_Face)cffsize->face; + CFF_Font font = (CFF_Font)face->extra.data; - if ( funcs ) - { - CFF_Face face = (CFF_Face)cffsize->face; - CFF_Font font = (CFF_Font)face->extra.data; - CFF_Internal internal = NULL; + PS_PrivateRec priv; - PS_PrivateRec priv; - FT_Memory memory = cffsize->face->memory; + FT_UInt i; - FT_UInt i; + if ( !funcs ) + goto Exit; + + if ( FT_NEW( internal ) ) + goto Exit; + cff_make_private_dict( &font->top_font, &priv ); + error = funcs->create( cffsize->face->memory, &priv, + &internal->topfont ); + if ( error ) + goto Exit; + + for ( i = font->num_subfonts; i > 0; i-- ) + { + CFF_SubFont sub = font->subfonts[i - 1]; - if ( FT_NEW( internal ) ) - goto Exit; - cff_make_private_dict( &font->top_font, &priv ); + cff_make_private_dict( sub, &priv ); error = funcs->create( cffsize->face->memory, &priv, - &internal->topfont ); + &internal->subfonts[i - 1] ); if ( error ) goto Exit; + } - for ( i = font->num_subfonts; i > 0; i-- ) - { - CFF_SubFont sub = font->subfonts[i - 1]; + cffsize->internal->module_data = internal; + size->strike_index = 0xFFFFFFFFUL; - cff_make_private_dict( sub, &priv ); - error = funcs->create( cffsize->face->memory, &priv, - &internal->subfonts[i - 1] ); - if ( error ) - goto Exit; + Exit: + if ( error ) + { + if ( internal ) + { + for ( i = font->num_subfonts; i > 0; i-- ) + FT_FREE( internal->subfonts[i - 1] ); + FT_FREE( internal->topfont ); } - cffsize->internal->module_data = internal; + FT_FREE( internal ); } - size->strike_index = 0xFFFFFFFFUL; - - Exit: return error; } @@ -349,7 +358,8 @@ FT_LOCAL_DEF( void ) cff_slot_done( FT_GlyphSlot slot ) { - slot->internal->glyph_hints = NULL; + if ( slot->internal ) + slot->internal->glyph_hints = NULL; } @@ -940,7 +950,8 @@ style_name = cff_strcpy( memory, fullp ); /* remove the style part from the family name (if present) */ - remove_style( cffface->family_name, style_name ); + if ( style_name ) + remove_style( cffface->family_name, style_name ); } break; } diff --git a/thirdparty/freetype/src/cff/cffobjs.h b/thirdparty/freetype/src/cff/cffobjs.h index 6f12b95db6..845bd90941 100644 --- a/thirdparty/freetype/src/cff/cffobjs.h +++ b/thirdparty/freetype/src/cff/cffobjs.h @@ -20,7 +20,6 @@ #define CFFOBJS_H_ -#include <ft2build.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cff/cffparse.c b/thirdparty/freetype/src/cff/cffparse.c index 0d3bf34592..69bcd5d957 100644 --- a/thirdparty/freetype/src/cff/cffparse.c +++ b/thirdparty/freetype/src/cff/cffparse.c @@ -16,13 +16,12 @@ */ -#include <ft2build.h> #include "cffparse.h" -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_LIST_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/psaux.h> +#include <freetype/ftlist.h> #include "cfferrs.h" #include "cffload.h" @@ -714,7 +713,7 @@ ( max_scaling - min_scaling ) > 9 ) { FT_TRACE1(( "cff_parse_font_matrix:" - " strange scaling values (minimum %d, maximum %d),\n" + " strange scaling values (minimum %ld, maximum %ld),\n" " " " using default matrix\n", min_scaling, max_scaling )); goto Unlikely; @@ -811,7 +810,7 @@ bbox->yMax = FT_RoundFix( cff_parse_fixed( parser, data ) ); error = FT_Err_Ok; - FT_TRACE4(( " [%d %d %d %d]\n", + FT_TRACE4(( " [%ld %ld %ld %ld]\n", bbox->xMin / 65536, bbox->yMin / 65536, bbox->xMax / 65536, @@ -934,11 +933,11 @@ FT_TRACE1(( "cff_parse_cid_ros: real supplement is rounded\n" )); dict->cid_supplement = cff_parse_num( parser, data ); if ( dict->cid_supplement < 0 ) - FT_TRACE1(( "cff_parse_cid_ros: negative supplement %d is found\n", + FT_TRACE1(( "cff_parse_cid_ros: negative supplement %ld is found\n", dict->cid_supplement )); error = FT_Err_Ok; - FT_TRACE4(( " %d %d %d\n", + FT_TRACE4(( " %d %d %ld\n", dict->cid_registry, dict->cid_ordering, dict->cid_supplement )); @@ -1264,11 +1263,11 @@ FT_Byte* charstring_base; FT_ULong charstring_len; - FT_Fixed* stack; - FT_ListNode node; - CFF_T2_String t2; - size_t t2_size; - FT_Byte* q; + FT_Fixed* stack; + FT_ListNode node; + CFF_T2_String t2; + FT_Fixed t2_size; + FT_Byte* q; charstring_base = ++p; diff --git a/thirdparty/freetype/src/cff/cffparse.h b/thirdparty/freetype/src/cff/cffparse.h index 887110a748..6f3fbb37d6 100644 --- a/thirdparty/freetype/src/cff/cffparse.h +++ b/thirdparty/freetype/src/cff/cffparse.h @@ -20,9 +20,8 @@ #define CFFPARSE_H_ -#include <ft2build.h> -#include FT_INTERNAL_CFF_TYPES_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/cfftypes.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cid/ciderrs.h b/thirdparty/freetype/src/cid/ciderrs.h index 52ab55d684..f698bb2293 100644 --- a/thirdparty/freetype/src/cid/ciderrs.h +++ b/thirdparty/freetype/src/cid/ciderrs.h @@ -25,7 +25,7 @@ #ifndef CIDERRS_H_ #define CIDERRS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX CID_Err_ #define FT_ERR_BASE FT_Mod_Err_CID -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* CIDERRS_H_ */ diff --git a/thirdparty/freetype/src/cid/cidgload.c b/thirdparty/freetype/src/cid/cidgload.c index daa0bddc2a..54aa62f810 100644 --- a/thirdparty/freetype/src/cid/cidgload.c +++ b/thirdparty/freetype/src/cid/cidgload.c @@ -16,17 +16,16 @@ */ -#include <ft2build.h> #include "cidload.h" #include "cidgload.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_OUTLINE_H -#include FT_INTERNAL_CALC_H - -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_CFF_TYPES_H -#include FT_DRIVER_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/ftoutln.h> +#include <freetype/internal/ftcalc.h> + +#include <freetype/internal/psaux.h> +#include <freetype/internal/cfftypes.h> +#include <freetype/ftdriver.h> #include "ciderrs.h" diff --git a/thirdparty/freetype/src/cid/cidgload.h b/thirdparty/freetype/src/cid/cidgload.h index 251c93c9f2..da36e37e06 100644 --- a/thirdparty/freetype/src/cid/cidgload.h +++ b/thirdparty/freetype/src/cid/cidgload.h @@ -20,7 +20,6 @@ #define CIDGLOAD_H_ -#include <ft2build.h> #include "cidobjs.h" diff --git a/thirdparty/freetype/src/cid/cidload.c b/thirdparty/freetype/src/cid/cidload.c index 4723966024..bb9136a3df 100644 --- a/thirdparty/freetype/src/cid/cidload.c +++ b/thirdparty/freetype/src/cid/cidload.c @@ -17,11 +17,11 @@ #include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include FT_CONFIG_CONFIG_H -#include FT_MULTIPLE_MASTERS_H -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/ftmm.h> +#include <freetype/internal/t1types.h> +#include <freetype/internal/psaux.h> #include "cidload.h" @@ -254,7 +254,7 @@ goto Exit; } - FT_TRACE4(( " %d\n", num_dicts )); + FT_TRACE4(( " %ld\n", num_dicts )); /* * A single entry in the FDArray must (at least) contain the following @@ -275,7 +275,7 @@ if ( (FT_ULong)num_dicts > stream->size / 100 ) { FT_TRACE0(( "parse_fd_array: adjusting FDArray size" - " (from %d to %d)\n", + " (from %ld to %ld)\n", num_dicts, stream->size / 100 )); num_dicts = (FT_Long)( stream->size / 100 ); @@ -329,7 +329,7 @@ dict->expansion_factor = cid_parser_to_fixed( parser, 0 ); dict->private_dict.expansion_factor = dict->expansion_factor; - FT_TRACE4(( "%d\n", dict->expansion_factor )); + FT_TRACE4(( "%ld\n", dict->expansion_factor )); } return; @@ -804,7 +804,7 @@ face->root.stream->size - parser->data_offset ) { FT_TRACE0(( "cid_face_open: adjusting length of binary data\n" - " (from %d to %d bytes)\n", + " (from %ld to %ld bytes)\n", parser->binary_length, face->root.stream->size - parser->data_offset )); parser->binary_length = face->root.stream->size - diff --git a/thirdparty/freetype/src/cid/cidload.h b/thirdparty/freetype/src/cid/cidload.h index e639f6ffef..06fb9ef476 100644 --- a/thirdparty/freetype/src/cid/cidload.h +++ b/thirdparty/freetype/src/cid/cidload.h @@ -20,8 +20,7 @@ #define CIDLOAD_H_ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftstream.h> #include "cidparse.h" diff --git a/thirdparty/freetype/src/cid/cidobjs.c b/thirdparty/freetype/src/cid/cidobjs.c index 34f72b588d..04b295eb8f 100644 --- a/thirdparty/freetype/src/cid/cidobjs.c +++ b/thirdparty/freetype/src/cid/cidobjs.c @@ -16,17 +16,16 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> #include "cidgload.h" #include "cidload.h" -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H -#include FT_DRIVER_H +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/psaux.h> +#include <freetype/internal/pshints.h> +#include <freetype/ftdriver.h> #include "ciderrs.h" @@ -50,7 +49,8 @@ FT_LOCAL_DEF( void ) cid_slot_done( FT_GlyphSlot slot ) { - slot->internal->glyph_hints = NULL; + if ( slot->internal ) + slot->internal->glyph_hints = NULL; } diff --git a/thirdparty/freetype/src/cid/cidobjs.h b/thirdparty/freetype/src/cid/cidobjs.h index efe812fd11..6ae3061379 100644 --- a/thirdparty/freetype/src/cid/cidobjs.h +++ b/thirdparty/freetype/src/cid/cidobjs.h @@ -21,9 +21,9 @@ #include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cid/cidparse.c b/thirdparty/freetype/src/cid/cidparse.c index 94a36e22f5..1fc098b448 100644 --- a/thirdparty/freetype/src/cid/cidparse.c +++ b/thirdparty/freetype/src/cid/cidparse.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftstream.h> #include "cidparse.h" diff --git a/thirdparty/freetype/src/cid/cidparse.h b/thirdparty/freetype/src/cid/cidparse.h index 6b2944ff57..0b49bebf48 100644 --- a/thirdparty/freetype/src/cid/cidparse.h +++ b/thirdparty/freetype/src/cid/cidparse.h @@ -20,10 +20,9 @@ #define CIDPARSE_H_ -#include <ft2build.h> -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/t1types.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cid/cidriver.c b/thirdparty/freetype/src/cid/cidriver.c index ad2f7b5cf5..d08cea1d7e 100644 --- a/thirdparty/freetype/src/cid/cidriver.c +++ b/thirdparty/freetype/src/cid/cidriver.c @@ -16,22 +16,21 @@ */ -#include <ft2build.h> #include "cidriver.h" #include "cidgload.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_POSTSCRIPT_PROPS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftpsprop.h> #include "ciderrs.h" -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_FONT_FORMAT_H -#include FT_SERVICE_POSTSCRIPT_INFO_H -#include FT_SERVICE_CID_H -#include FT_SERVICE_PROPERTIES_H -#include FT_DRIVER_H +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svfntfmt.h> +#include <freetype/internal/services/svpsinfo.h> +#include <freetype/internal/services/svcid.h> +#include <freetype/internal/services/svprop.h> +#include <freetype/ftdriver.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> /************************************************************************** diff --git a/thirdparty/freetype/src/cid/cidriver.h b/thirdparty/freetype/src/cid/cidriver.h index 400c2ae295..0fc8ed37bf 100644 --- a/thirdparty/freetype/src/cid/cidriver.h +++ b/thirdparty/freetype/src/cid/cidriver.h @@ -20,8 +20,7 @@ #define CIDRIVER_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/cid/type1cid.c b/thirdparty/freetype/src/cid/type1cid.c index ba9141075f..082e8bfe5b 100644 --- a/thirdparty/freetype/src/cid/type1cid.c +++ b/thirdparty/freetype/src/cid/type1cid.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "cidgload.c" #include "cidload.c" diff --git a/thirdparty/freetype/src/gxvalid/gxvalid.c b/thirdparty/freetype/src/gxvalid/gxvalid.c index cb655aeb9d..683b8a6972 100644 --- a/thirdparty/freetype/src/gxvalid/gxvalid.c +++ b/thirdparty/freetype/src/gxvalid/gxvalid.c @@ -18,7 +18,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "gxvbsln.c" #include "gxvcommn.c" diff --git a/thirdparty/freetype/src/gxvalid/gxvalid.h b/thirdparty/freetype/src/gxvalid/gxvalid.h index cdf1986324..ff2812da20 100644 --- a/thirdparty/freetype/src/gxvalid/gxvalid.h +++ b/thirdparty/freetype/src/gxvalid/gxvalid.h @@ -28,13 +28,12 @@ #ifndef GXVALID_H_ #define GXVALID_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> -#include "gxverror.h" /* must come before FT_INTERNAL_VALIDATE_H */ +#include "gxverror.h" /* must come before `ftvalid.h' */ -#include FT_INTERNAL_VALIDATE_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftvalid.h> +#include <freetype/internal/ftstream.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/gxvalid/gxvcommn.h b/thirdparty/freetype/src/gxvalid/gxvcommn.h index 2372fc86fa..59d149215c 100644 --- a/thirdparty/freetype/src/gxvalid/gxvcommn.h +++ b/thirdparty/freetype/src/gxvalid/gxvcommn.h @@ -43,10 +43,9 @@ #define GXVCOMMN_H_ -#include <ft2build.h> #include "gxvalid.h" -#include FT_INTERNAL_DEBUG_H -#include FT_SFNT_NAMES_H +#include <freetype/internal/ftdebug.h> +#include <freetype/ftsnames.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/gxvalid/gxverror.h b/thirdparty/freetype/src/gxvalid/gxverror.h index 475b9f7778..5d8f0b6806 100644 --- a/thirdparty/freetype/src/gxvalid/gxverror.h +++ b/thirdparty/freetype/src/gxvalid/gxverror.h @@ -35,7 +35,7 @@ #ifndef GXVERROR_H_ #define GXVERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -43,7 +43,7 @@ #define FT_ERR_PREFIX GXV_Err_ #define FT_ERR_BASE FT_Mod_Err_GXvalid -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* GXVERROR_H_ */ diff --git a/thirdparty/freetype/src/gxvalid/gxvjust.c b/thirdparty/freetype/src/gxvalid/gxvjust.c index d8875b4111..3c7f1f9534 100644 --- a/thirdparty/freetype/src/gxvalid/gxvjust.c +++ b/thirdparty/freetype/src/gxvalid/gxvjust.c @@ -28,7 +28,7 @@ #include "gxvalid.h" #include "gxvcommn.h" -#include FT_SFNT_NAMES_H +#include <freetype/ftsnames.h> /************************************************************************** diff --git a/thirdparty/freetype/src/gxvalid/gxvkern.c b/thirdparty/freetype/src/gxvalid/gxvkern.c index ab5643eb83..cc0b3dfcb4 100644 --- a/thirdparty/freetype/src/gxvalid/gxvkern.c +++ b/thirdparty/freetype/src/gxvalid/gxvkern.c @@ -28,8 +28,8 @@ #include "gxvalid.h" #include "gxvcommn.h" -#include FT_SFNT_NAMES_H -#include FT_SERVICE_GX_VALIDATE_H +#include <freetype/ftsnames.h> +#include <freetype/internal/services/svgxval.h> /************************************************************************** diff --git a/thirdparty/freetype/src/gxvalid/gxvmod.c b/thirdparty/freetype/src/gxvalid/gxvmod.c index 2b8f45d1c2..a467e87131 100644 --- a/thirdparty/freetype/src/gxvalid/gxvmod.c +++ b/thirdparty/freetype/src/gxvalid/gxvmod.c @@ -25,12 +25,11 @@ */ -#include <ft2build.h> -#include FT_TRUETYPE_TABLES_H -#include FT_TRUETYPE_TAGS_H -#include FT_GX_VALIDATE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_GX_VALIDATE_H +#include <freetype/tttables.h> +#include <freetype/tttags.h> +#include <freetype/ftgxval.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svgxval.h> #include "gxvmod.h" #include "gxvalid.h" diff --git a/thirdparty/freetype/src/gxvalid/gxvmod.h b/thirdparty/freetype/src/gxvalid/gxvmod.h index bdf465f4f0..f2982c96c2 100644 --- a/thirdparty/freetype/src/gxvalid/gxvmod.h +++ b/thirdparty/freetype/src/gxvalid/gxvmod.h @@ -29,8 +29,7 @@ #ifndef GXVMOD_H_ #define GXVMOD_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/gxvalid/gxvmort.h b/thirdparty/freetype/src/gxvalid/gxvmort.h index 35a18e76a6..7237c58254 100644 --- a/thirdparty/freetype/src/gxvalid/gxvmort.h +++ b/thirdparty/freetype/src/gxvalid/gxvmort.h @@ -31,7 +31,10 @@ #include "gxvalid.h" #include "gxvcommn.h" -#include FT_SFNT_NAMES_H +#include <freetype/ftsnames.h> + + +FT_BEGIN_HEADER typedef struct GXV_mort_featureRec_ @@ -88,6 +91,8 @@ GXV_Validator gxvalid ); +FT_END_HEADER + #endif /* GXVMORT_H_ */ diff --git a/thirdparty/freetype/src/gxvalid/gxvmorx.h b/thirdparty/freetype/src/gxvalid/gxvmorx.h index 99be181067..f747b1d636 100644 --- a/thirdparty/freetype/src/gxvalid/gxvmorx.h +++ b/thirdparty/freetype/src/gxvalid/gxvmorx.h @@ -33,7 +33,10 @@ #include "gxvcommn.h" #include "gxvmort.h" -#include FT_SFNT_NAMES_H +#include <freetype/ftsnames.h> + + +FT_BEGIN_HEADER FT_LOCAL( void ) @@ -62,6 +65,8 @@ GXV_Validator gxvalid ); +FT_END_HEADER + #endif /* GXVMORX_H_ */ diff --git a/thirdparty/freetype/src/gzip/ftgzip.c b/thirdparty/freetype/src/gzip/ftgzip.c index 6b1df3a4a7..de7d0fdd5b 100644 --- a/thirdparty/freetype/src/gzip/ftgzip.c +++ b/thirdparty/freetype/src/gzip/ftgzip.c @@ -20,15 +20,14 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H -#include FT_GZIP_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftgzip.h> #include FT_CONFIG_STANDARD_LIBRARY_H -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -36,7 +35,7 @@ #define FT_ERR_PREFIX Gzip_Err_ #define FT_ERR_BASE FT_Mod_Err_Gzip -#include FT_ERRORS_H +#include <freetype/fterrors.h> #ifdef FT_CONFIG_OPTION_USE_ZLIB diff --git a/thirdparty/freetype/src/lzw/ftlzw.c b/thirdparty/freetype/src/lzw/ftlzw.c index 7d3f3e3f55..ddb81e6e97 100644 --- a/thirdparty/freetype/src/lzw/ftlzw.c +++ b/thirdparty/freetype/src/lzw/ftlzw.c @@ -21,15 +21,14 @@ * */ -#include <ft2build.h> -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H -#include FT_LZW_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ftlzw.h> #include FT_CONFIG_STANDARD_LIBRARY_H -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -37,7 +36,7 @@ #define FT_ERR_PREFIX LZW_Err_ #define FT_ERR_BASE FT_Mod_Err_LZW -#include FT_ERRORS_H +#include <freetype/fterrors.h> #ifdef FT_CONFIG_OPTION_USE_LZW diff --git a/thirdparty/freetype/src/lzw/ftzopen.c b/thirdparty/freetype/src/lzw/ftzopen.c index cdc7f4e683..884d2ec74e 100644 --- a/thirdparty/freetype/src/lzw/ftzopen.c +++ b/thirdparty/freetype/src/lzw/ftzopen.c @@ -20,9 +20,9 @@ */ #include "ftzopen.h" -#include FT_INTERNAL_MEMORY_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftmemory.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftdebug.h> static int diff --git a/thirdparty/freetype/src/lzw/ftzopen.h b/thirdparty/freetype/src/lzw/ftzopen.h index 2866529bd4..d8768f7b47 100644 --- a/thirdparty/freetype/src/lzw/ftzopen.h +++ b/thirdparty/freetype/src/lzw/ftzopen.h @@ -22,9 +22,9 @@ #ifndef FTZOPEN_H_ #define FTZOPEN_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> +FT_BEGIN_HEADER /* * This is a complete re-implementation of the LZW file reader, @@ -166,6 +166,8 @@ /* */ +FT_END_HEADER + #endif /* FTZOPEN_H_ */ diff --git a/thirdparty/freetype/src/otvalid/otvalid.c b/thirdparty/freetype/src/otvalid/otvalid.c index 487d336a3b..d640209f68 100644 --- a/thirdparty/freetype/src/otvalid/otvalid.c +++ b/thirdparty/freetype/src/otvalid/otvalid.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "otvbase.c" #include "otvcommn.c" diff --git a/thirdparty/freetype/src/otvalid/otvalid.h b/thirdparty/freetype/src/otvalid/otvalid.h index 3c70268964..8208ff0112 100644 --- a/thirdparty/freetype/src/otvalid/otvalid.h +++ b/thirdparty/freetype/src/otvalid/otvalid.h @@ -20,13 +20,12 @@ #define OTVALID_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> -#include "otverror.h" /* must come before FT_INTERNAL_VALIDATE_H */ +#include "otverror.h" /* must come before `ftvalid.h' */ -#include FT_INTERNAL_VALIDATE_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftvalid.h> +#include <freetype/internal/ftstream.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/otvalid/otvcommn.h b/thirdparty/freetype/src/otvalid/otvcommn.h index 1daf7dca79..f9926034a9 100644 --- a/thirdparty/freetype/src/otvalid/otvcommn.h +++ b/thirdparty/freetype/src/otvalid/otvcommn.h @@ -20,9 +20,8 @@ #define OTVCOMMN_H_ -#include <ft2build.h> #include "otvalid.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/otvalid/otverror.h b/thirdparty/freetype/src/otvalid/otverror.h index 49c34d6cd8..979e9cbd9c 100644 --- a/thirdparty/freetype/src/otvalid/otverror.h +++ b/thirdparty/freetype/src/otvalid/otverror.h @@ -26,7 +26,7 @@ #ifndef OTVERROR_H_ #define OTVERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX OTV_Err_ #define FT_ERR_BASE FT_Mod_Err_OTvalid -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* OTVERROR_H_ */ diff --git a/thirdparty/freetype/src/otvalid/otvmod.c b/thirdparty/freetype/src/otvalid/otvmod.c index 5f3e7e8d49..0188b27018 100644 --- a/thirdparty/freetype/src/otvalid/otvmod.c +++ b/thirdparty/freetype/src/otvalid/otvmod.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_TRUETYPE_TABLES_H -#include FT_TRUETYPE_TAGS_H -#include FT_OPENTYPE_VALIDATE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_OPENTYPE_VALIDATE_H +#include <freetype/tttables.h> +#include <freetype/tttags.h> +#include <freetype/ftotval.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svotval.h> #include "otvmod.h" #include "otvalid.h" diff --git a/thirdparty/freetype/src/otvalid/otvmod.h b/thirdparty/freetype/src/otvalid/otvmod.h index f172c2c8fa..efd6da035f 100644 --- a/thirdparty/freetype/src/otvalid/otvmod.h +++ b/thirdparty/freetype/src/otvalid/otvmod.h @@ -21,8 +21,7 @@ #define OTVMOD_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pcf/pcf.c b/thirdparty/freetype/src/pcf/pcf.c index 8ffd6e280b..6b30fb249a 100644 --- a/thirdparty/freetype/src/pcf/pcf.c +++ b/thirdparty/freetype/src/pcf/pcf.c @@ -26,7 +26,6 @@ THE SOFTWARE. #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "pcfdrivr.c" #include "pcfread.c" diff --git a/thirdparty/freetype/src/pcf/pcf.h b/thirdparty/freetype/src/pcf/pcf.h index 33be4bcd85..3134cc355b 100644 --- a/thirdparty/freetype/src/pcf/pcf.h +++ b/thirdparty/freetype/src/pcf/pcf.h @@ -29,9 +29,8 @@ THE SOFTWARE. #define PCF_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftdrv.h> +#include <freetype/internal/ftstream.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pcf/pcfdrivr.c b/thirdparty/freetype/src/pcf/pcfdrivr.c index b39592c794..e9dd51752e 100644 --- a/thirdparty/freetype/src/pcf/pcfdrivr.c +++ b/thirdparty/freetype/src/pcf/pcfdrivr.c @@ -25,17 +25,16 @@ THE SOFTWARE. */ -#include <ft2build.h> - -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_OBJECTS_H -#include FT_GZIP_H -#include FT_LZW_H -#include FT_BZIP2_H -#include FT_ERRORS_H -#include FT_BDF_H -#include FT_TRUETYPE_IDS_H + +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftgzip.h> +#include <freetype/ftlzw.h> +#include <freetype/ftbzip2.h> +#include <freetype/fterrors.h> +#include <freetype/ftbdf.h> +#include <freetype/ttnameid.h> #include "pcf.h" #include "pcfdrivr.h" @@ -47,10 +46,10 @@ THE SOFTWARE. #undef FT_COMPONENT #define FT_COMPONENT pcfread -#include FT_SERVICE_BDF_H -#include FT_SERVICE_FONT_FORMAT_H -#include FT_SERVICE_PROPERTIES_H -#include FT_DRIVER_H +#include <freetype/internal/services/svbdf.h> +#include <freetype/internal/services/svfntfmt.h> +#include <freetype/internal/services/svprop.h> +#include <freetype/ftdriver.h> /************************************************************************** @@ -137,7 +136,7 @@ THE SOFTWARE. FT_UInt32 charcode = *acharcode; FT_UShort charcodeRow; FT_UShort charcodeCol; - FT_Int result = 0; + FT_UInt result = 0; while ( charcode < (FT_UInt32)( enc->lastRow * 256 + enc->lastCol ) ) @@ -607,8 +606,9 @@ THE SOFTWARE. if ( prop->value.l > 0x7FFFFFFFL || prop->value.l < ( -1 - 0x7FFFFFFFL ) ) { - FT_TRACE1(( "pcf_get_bdf_property:" )); - FT_TRACE1(( " too large integer 0x%x is truncated\n" )); + FT_TRACE1(( "pcf_get_bdf_property:" + " too large integer 0x%lx is truncated\n", + prop->value.l )); } /* diff --git a/thirdparty/freetype/src/pcf/pcfdrivr.h b/thirdparty/freetype/src/pcf/pcfdrivr.h index 73db0823d2..d465393743 100644 --- a/thirdparty/freetype/src/pcf/pcfdrivr.h +++ b/thirdparty/freetype/src/pcf/pcfdrivr.h @@ -28,8 +28,7 @@ THE SOFTWARE. #ifndef PCFDRIVR_H_ #define PCFDRIVR_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pcf/pcferror.h b/thirdparty/freetype/src/pcf/pcferror.h index 2e69d1d219..8b9e9902a3 100644 --- a/thirdparty/freetype/src/pcf/pcferror.h +++ b/thirdparty/freetype/src/pcf/pcferror.h @@ -25,7 +25,7 @@ #ifndef PCFERROR_H_ #define PCFERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX PCF_Err_ #define FT_ERR_BASE FT_Mod_Err_PCF -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* PCFERROR_H_ */ diff --git a/thirdparty/freetype/src/pcf/pcfread.c b/thirdparty/freetype/src/pcf/pcfread.c index 2ffe22d71c..8817682cdf 100644 --- a/thirdparty/freetype/src/pcf/pcfread.c +++ b/thirdparty/freetype/src/pcf/pcfread.c @@ -25,11 +25,10 @@ THE SOFTWARE. */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftobjs.h> #include "pcf.h" #include "pcfread.h" @@ -122,7 +121,7 @@ THE SOFTWARE. toc->count > 9 ) { FT_TRACE0(( "pcf_read_TOC: adjusting number of tables" - " (from %d to %d)\n", + " (from %ld to %ld)\n", toc->count, FT_MIN( stream->size >> 4, 9 ) )); toc->count = FT_MIN( stream->size >> 4, 9 ); @@ -242,7 +241,7 @@ THE SOFTWARE. if ( tables[i].type == (FT_UInt)( 1 << j ) ) name = tableNames[j]; - FT_TRACE4(( " %d: type=%s, format=0x%X," + FT_TRACE4(( " %d: type=%s, format=0x%lX," " size=%ld (0x%lX), offset=%ld (0x%lX)\n", i, name, tables[i].format, @@ -661,7 +660,7 @@ THE SOFTWARE. { properties[i].value.l = props[i].value; - FT_TRACE4(( " %d\n", properties[i].value.l )); + FT_TRACE4(( " %ld\n", properties[i].value.l )); } } @@ -798,7 +797,7 @@ THE SOFTWARE. metrics->descent = 0; FT_TRACE0(( "pcf_get_metrics:" - " invalid metrics for glyph %d\n", i )); + " invalid metrics for glyph %ld\n", i )); } } @@ -918,11 +917,11 @@ THE SOFTWARE. sizebitmaps = bitmapSizes[PCF_GLYPH_PAD_INDEX( format )]; - FT_TRACE4(( " %ld-bit padding implies a size of %lu\n", + FT_TRACE4(( " %d-bit padding implies a size of %lu\n", 8 << i, bitmapSizes[i] )); } - FT_TRACE4(( " %lu bitmaps, using %ld-bit padding\n", + FT_TRACE4(( " %lu bitmaps, using %d-bit padding\n", nbitmaps, 8 << PCF_GLYPH_PAD_INDEX( format ) )); FT_TRACE4(( " bitmap size: %lu\n", sizebitmaps )); @@ -1252,13 +1251,13 @@ THE SOFTWARE. if ( FT_ABS( accel->fontAscent ) > 0x7FFF ) { accel->fontAscent = accel->fontAscent < 0 ? -0x7FFF : 0x7FFF; - FT_TRACE0(( "pfc_get_accel: clamping font ascent to value %d\n", + FT_TRACE0(( "pfc_get_accel: clamping font ascent to value %ld\n", accel->fontAscent )); } if ( FT_ABS( accel->fontDescent ) > 0x7FFF ) { accel->fontDescent = accel->fontDescent < 0 ? -0x7FFF : 0x7FFF; - FT_TRACE0(( "pfc_get_accel: clamping font descent to value %d\n", + FT_TRACE0(( "pfc_get_accel: clamping font descent to value %ld\n", accel->fontDescent )); } @@ -1631,7 +1630,7 @@ THE SOFTWARE. if ( FT_ABS( prop->value.l ) > 0x504C2L ) /* 0x7FFF * 72270/7200 */ { bsize->size = 0x7FFF; - FT_TRACE0(( "pcf_load_font: clamping point size to value %d\n", + FT_TRACE0(( "pcf_load_font: clamping point size to value %ld\n", bsize->size )); } else @@ -1650,7 +1649,7 @@ THE SOFTWARE. if ( FT_ABS( prop->value.l ) > 0x7FFF ) { bsize->y_ppem = 0x7FFF << 6; - FT_TRACE0(( "pcf_load_font: clamping pixel size to value %d\n", + FT_TRACE0(( "pcf_load_font: clamping pixel size to value %ld\n", bsize->y_ppem )); } else diff --git a/thirdparty/freetype/src/pcf/pcfread.h b/thirdparty/freetype/src/pcf/pcfread.h index bed30e5030..a54648fbf9 100644 --- a/thirdparty/freetype/src/pcf/pcfread.h +++ b/thirdparty/freetype/src/pcf/pcfread.h @@ -29,7 +29,6 @@ THE SOFTWARE. #define PCFREAD_H_ -#include <ft2build.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pcf/pcfutil.c b/thirdparty/freetype/src/pcf/pcfutil.c index 045c42d60f..5d3c00791f 100644 --- a/thirdparty/freetype/src/pcf/pcfutil.c +++ b/thirdparty/freetype/src/pcf/pcfutil.c @@ -32,7 +32,6 @@ in this Software without prior written authorization from The Open Group. /* Modified for use with FreeType */ -#include <ft2build.h> #include "pcfutil.h" diff --git a/thirdparty/freetype/src/pcf/pcfutil.h b/thirdparty/freetype/src/pcf/pcfutil.h index be986e756b..a197c15595 100644 --- a/thirdparty/freetype/src/pcf/pcfutil.h +++ b/thirdparty/freetype/src/pcf/pcfutil.h @@ -31,7 +31,7 @@ THE SOFTWARE. #include <ft2build.h> #include FT_CONFIG_CONFIG_H - +#include <freetype/internal/compiler-macros.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pfr/pfr.c b/thirdparty/freetype/src/pfr/pfr.c index 5dea6fa34a..9264c77df2 100644 --- a/thirdparty/freetype/src/pfr/pfr.c +++ b/thirdparty/freetype/src/pfr/pfr.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "pfrcmap.c" #include "pfrdrivr.c" diff --git a/thirdparty/freetype/src/pfr/pfrcmap.c b/thirdparty/freetype/src/pfr/pfrcmap.c index 3f64ba8b04..ebc7b84393 100644 --- a/thirdparty/freetype/src/pfr/pfrcmap.c +++ b/thirdparty/freetype/src/pfr/pfrcmap.c @@ -16,8 +16,7 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "pfrcmap.h" #include "pfrobjs.h" diff --git a/thirdparty/freetype/src/pfr/pfrcmap.h b/thirdparty/freetype/src/pfr/pfrcmap.h index b90e8a101f..a6d920c30b 100644 --- a/thirdparty/freetype/src/pfr/pfrcmap.h +++ b/thirdparty/freetype/src/pfr/pfrcmap.h @@ -19,8 +19,7 @@ #ifndef PFRCMAP_H_ #define PFRCMAP_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> #include "pfrtypes.h" diff --git a/thirdparty/freetype/src/pfr/pfrdrivr.c b/thirdparty/freetype/src/pfr/pfrdrivr.c index 2028c8e11b..b14320875a 100644 --- a/thirdparty/freetype/src/pfr/pfrdrivr.c +++ b/thirdparty/freetype/src/pfr/pfrdrivr.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_SERVICE_PFR_H -#include FT_SERVICE_FONT_FORMAT_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/services/svpfr.h> +#include <freetype/internal/services/svfntfmt.h> #include "pfrdrivr.h" #include "pfrobjs.h" diff --git a/thirdparty/freetype/src/pfr/pfrdrivr.h b/thirdparty/freetype/src/pfr/pfrdrivr.h index 865ec8188a..7646b4d1bd 100644 --- a/thirdparty/freetype/src/pfr/pfrdrivr.h +++ b/thirdparty/freetype/src/pfr/pfrdrivr.h @@ -20,8 +20,7 @@ #define PFRDRIVR_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pfr/pfrerror.h b/thirdparty/freetype/src/pfr/pfrerror.h index 2dbeedfe15..33460ef4fd 100644 --- a/thirdparty/freetype/src/pfr/pfrerror.h +++ b/thirdparty/freetype/src/pfr/pfrerror.h @@ -25,7 +25,7 @@ #ifndef PFRERROR_H_ #define PFRERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX PFR_Err_ #define FT_ERR_BASE FT_Mod_Err_PFR -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* PFRERROR_H_ */ diff --git a/thirdparty/freetype/src/pfr/pfrgload.c b/thirdparty/freetype/src/pfr/pfrgload.c index 7d57ae1530..aa640c3b07 100644 --- a/thirdparty/freetype/src/pfr/pfrgload.c +++ b/thirdparty/freetype/src/pfr/pfrgload.c @@ -19,7 +19,7 @@ #include "pfrgload.h" #include "pfrsbit.h" #include "pfrload.h" /* for macro definitions */ -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "pfrerror.h" @@ -451,7 +451,7 @@ case 1: /* 16-bit absolute value */ PFR_CHECK( 2 ); cur->x = PFR_NEXT_SHORT( p ); - FT_TRACE7(( " x.%d", cur->x )); + FT_TRACE7(( " x.%ld", cur->x )); break; case 2: /* 8-bit delta */ @@ -481,7 +481,7 @@ case 1: /* 16-bit absolute value */ PFR_CHECK( 2 ); cur->y = PFR_NEXT_SHORT( p ); - FT_TRACE7(( " y.%d", cur->y )); + FT_TRACE7(( " y.%ld", cur->y )); break; case 2: /* 8-bit delta */ diff --git a/thirdparty/freetype/src/pfr/pfrload.c b/thirdparty/freetype/src/pfr/pfrload.c index 6eeed28245..a2832e55c7 100644 --- a/thirdparty/freetype/src/pfr/pfrload.c +++ b/thirdparty/freetype/src/pfr/pfrload.c @@ -17,8 +17,8 @@ #include "pfrload.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> #include "pfrerror.h" diff --git a/thirdparty/freetype/src/pfr/pfrload.h b/thirdparty/freetype/src/pfr/pfrload.h index 7d113df270..7615b9ce14 100644 --- a/thirdparty/freetype/src/pfr/pfrload.h +++ b/thirdparty/freetype/src/pfr/pfrload.h @@ -20,7 +20,7 @@ #define PFRLOAD_H_ #include "pfrobjs.h" -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftstream.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pfr/pfrobjs.c b/thirdparty/freetype/src/pfr/pfrobjs.c index 9bc90a4b68..918e7fd496 100644 --- a/thirdparty/freetype/src/pfr/pfrobjs.c +++ b/thirdparty/freetype/src/pfr/pfrobjs.c @@ -21,10 +21,10 @@ #include "pfrgload.h" #include "pfrcmap.h" #include "pfrsbit.h" -#include FT_OUTLINE_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_TRUETYPE_IDS_H +#include <freetype/ftoutln.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/ttnameid.h> #include "pfrerror.h" diff --git a/thirdparty/freetype/src/pfr/pfrsbit.c b/thirdparty/freetype/src/pfr/pfrsbit.c index 00669e13ff..a6691e6d18 100644 --- a/thirdparty/freetype/src/pfr/pfrsbit.c +++ b/thirdparty/freetype/src/pfr/pfrsbit.c @@ -18,8 +18,8 @@ #include "pfrsbit.h" #include "pfrload.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> #include "pfrerror.h" @@ -745,7 +745,7 @@ ypos + (FT_Long)ysize < FT_INT_MIN ) { FT_TRACE1(( "pfr_slot_load_bitmap:" )); - FT_TRACE1(( "huge bitmap glyph %dx%d over FT_GlyphSlot\n", + FT_TRACE1(( "huge bitmap glyph %ldx%ld over FT_GlyphSlot\n", xpos, ypos )); error = FT_THROW( Invalid_Pixel_Size ); } diff --git a/thirdparty/freetype/src/pfr/pfrtypes.h b/thirdparty/freetype/src/pfr/pfrtypes.h index dfc47beff3..06fb82d51a 100644 --- a/thirdparty/freetype/src/pfr/pfrtypes.h +++ b/thirdparty/freetype/src/pfr/pfrtypes.h @@ -19,8 +19,7 @@ #ifndef PFRTYPES_H_ #define PFRTYPES_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/afmparse.c b/thirdparty/freetype/src/psaux/afmparse.c index b957158aec..2d6a0d9a12 100644 --- a/thirdparty/freetype/src/psaux/afmparse.c +++ b/thirdparty/freetype/src/psaux/afmparse.c @@ -15,10 +15,9 @@ * */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/freetype.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/psaux.h> #ifndef T1_CONFIG_OPTION_NO_AFM diff --git a/thirdparty/freetype/src/psaux/afmparse.h b/thirdparty/freetype/src/psaux/afmparse.h index 50f4834b3f..16a3a3e902 100644 --- a/thirdparty/freetype/src/psaux/afmparse.h +++ b/thirdparty/freetype/src/psaux/afmparse.h @@ -20,8 +20,7 @@ #define AFMPARSE_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/cffdecode.c b/thirdparty/freetype/src/psaux/cffdecode.c index 172e3b23a3..3d2da1e03c 100644 --- a/thirdparty/freetype/src/psaux/cffdecode.c +++ b/thirdparty/freetype/src/psaux/cffdecode.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_SERVICE_H -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/freetype.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftserv.h> +#include <freetype/internal/services/svcfftl.h> #include "cffdecode.h" #include "psobjs.h" diff --git a/thirdparty/freetype/src/psaux/cffdecode.h b/thirdparty/freetype/src/psaux/cffdecode.h index 5dc968b255..77a4962698 100644 --- a/thirdparty/freetype/src/psaux/cffdecode.h +++ b/thirdparty/freetype/src/psaux/cffdecode.h @@ -20,8 +20,7 @@ #define CFFDECODE_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/psarrst.c b/thirdparty/freetype/src/psaux/psarrst.c index 011803b416..8751d275fb 100644 --- a/thirdparty/freetype/src/psaux/psarrst.c +++ b/thirdparty/freetype/src/psaux/psarrst.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psglue.h" #include "psarrst.h" diff --git a/thirdparty/freetype/src/psaux/psaux.c b/thirdparty/freetype/src/psaux/psaux.c index 96d2484e9d..f4282222a6 100644 --- a/thirdparty/freetype/src/psaux/psaux.c +++ b/thirdparty/freetype/src/psaux/psaux.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "afmparse.c" #include "psauxmod.c" diff --git a/thirdparty/freetype/src/psaux/psauxerr.h b/thirdparty/freetype/src/psaux/psauxerr.h index df8b09ff78..8b9a958aec 100644 --- a/thirdparty/freetype/src/psaux/psauxerr.h +++ b/thirdparty/freetype/src/psaux/psauxerr.h @@ -26,7 +26,7 @@ #ifndef PSAUXERR_H_ #define PSAUXERR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX PSaux_Err_ #define FT_ERR_BASE FT_Mod_Err_PSaux -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* PSAUXERR_H_ */ diff --git a/thirdparty/freetype/src/psaux/psauxmod.c b/thirdparty/freetype/src/psaux/psauxmod.c index bb520792e0..e73ba22451 100644 --- a/thirdparty/freetype/src/psaux/psauxmod.c +++ b/thirdparty/freetype/src/psaux/psauxmod.c @@ -16,7 +16,6 @@ */ -#include <ft2build.h> #include "psauxmod.h" #include "psobjs.h" #include "t1decode.h" @@ -171,9 +170,9 @@ }; - FT_CALLBACK_TABLE_DEF - const FT_Module_Class psaux_module_class = - { + FT_DEFINE_MODULE( + psaux_module_class, + 0, sizeof ( FT_ModuleRec ), "psaux", @@ -185,7 +184,7 @@ (FT_Module_Constructor)NULL, /* module_init */ (FT_Module_Destructor) NULL, /* module_done */ (FT_Module_Requester) NULL /* get_interface */ - }; + ) /* END */ diff --git a/thirdparty/freetype/src/psaux/psauxmod.h b/thirdparty/freetype/src/psaux/psauxmod.h index 6e2eb67042..a6bebe4b94 100644 --- a/thirdparty/freetype/src/psaux/psauxmod.h +++ b/thirdparty/freetype/src/psaux/psauxmod.h @@ -20,10 +20,9 @@ #define PSAUXMOD_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER @@ -35,10 +34,24 @@ FT_BEGIN_HEADER FT_CALLBACK_TABLE const PS_Builder_FuncsRec ps_builder_funcs; +#ifndef T1_CONFIG_OPTION_NO_AFM + FT_CALLBACK_TABLE + const AFM_Parser_FuncsRec afm_parser_funcs; +#endif + + FT_CALLBACK_TABLE + const T1_CMap_ClassesRec t1_cmap_classes; + + FT_CALLBACK_TABLE + const CFF_Decoder_FuncsRec cff_decoder_funcs; + FT_EXPORT_VAR( const FT_Module_Class ) psaux_driver_class; + FT_DECLARE_MODULE( psaux_module_class ) + + FT_END_HEADER #endif /* PSAUXMOD_H_ */ diff --git a/thirdparty/freetype/src/psaux/psblues.c b/thirdparty/freetype/src/psaux/psblues.c index 89738ce474..3878e9bde0 100644 --- a/thirdparty/freetype/src/psaux/psblues.c +++ b/thirdparty/freetype/src/psaux/psblues.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psblues.h" #include "pshints.h" diff --git a/thirdparty/freetype/src/psaux/psconv.c b/thirdparty/freetype/src/psaux/psconv.c index c813a0596c..4cf5cd5d88 100644 --- a/thirdparty/freetype/src/psaux/psconv.c +++ b/thirdparty/freetype/src/psaux/psconv.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/psaux.h> +#include <freetype/internal/ftdebug.h> #include "psconv.h" #include "psauxerr.h" diff --git a/thirdparty/freetype/src/psaux/psconv.h b/thirdparty/freetype/src/psaux/psconv.h index 2cd5c60e4b..833e827364 100644 --- a/thirdparty/freetype/src/psaux/psconv.h +++ b/thirdparty/freetype/src/psaux/psconv.h @@ -20,8 +20,7 @@ #define PSCONV_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/pserror.h b/thirdparty/freetype/src/psaux/pserror.h index b2156b3318..5738853fac 100644 --- a/thirdparty/freetype/src/psaux/pserror.h +++ b/thirdparty/freetype/src/psaux/pserror.h @@ -40,7 +40,7 @@ #define PSERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -49,7 +49,8 @@ #define FT_ERR_BASE FT_Mod_Err_CF2 -#include FT_ERRORS_H +#include <freetype/fterrors.h> +#include <freetype/internal/compiler-macros.h> #include "psft.h" diff --git a/thirdparty/freetype/src/psaux/psfont.c b/thirdparty/freetype/src/psaux/psfont.c index 00e4210819..0db1f0c5bc 100644 --- a/thirdparty/freetype/src/psaux/psfont.c +++ b/thirdparty/freetype/src/psaux/psfont.c @@ -36,8 +36,7 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_CALC_H +#include <freetype/internal/ftcalc.h> #include "psft.h" diff --git a/thirdparty/freetype/src/psaux/psfont.h b/thirdparty/freetype/src/psaux/psfont.h index 8fbacbb6e3..836fce4e4d 100644 --- a/thirdparty/freetype/src/psaux/psfont.h +++ b/thirdparty/freetype/src/psaux/psfont.h @@ -40,7 +40,7 @@ #define PSFONT_H_ -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/internal/services/svcfftl.h> #include "psft.h" #include "psblues.h" diff --git a/thirdparty/freetype/src/psaux/psft.c b/thirdparty/freetype/src/psaux/psft.c index 50b40bf8fe..41c16542c1 100644 --- a/thirdparty/freetype/src/psaux/psft.c +++ b/thirdparty/freetype/src/psaux/psft.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psfont.h" #include "pserror.h" @@ -45,11 +45,11 @@ #include "cffdecode.h" #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H +#include <freetype/ftmm.h> +#include <freetype/internal/services/svmm.h> #endif -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/internal/services/svcfftl.h> #define CF2_MAX_SIZE cf2_intToFixed( 2000 ) /* max ppem */ diff --git a/thirdparty/freetype/src/psaux/psft.h b/thirdparty/freetype/src/psaux/psft.h index 4c930f0d73..3da454e601 100644 --- a/thirdparty/freetype/src/psaux/psft.h +++ b/thirdparty/freetype/src/psaux/psft.h @@ -40,17 +40,17 @@ #define PSFT_H_ +#include <freetype/internal/compiler-macros.h> #include "pstypes.h" - /* TODO: disable asserts for now */ #define CF2_NDEBUG -#include FT_SYSTEM_H +#include <freetype/ftsystem.h> #include "psglue.h" -#include FT_INTERNAL_POSTSCRIPT_AUX_H /* for PS_Decoder */ +#include <freetype/internal/psaux.h> /* for PS_Decoder */ FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/pshints.c b/thirdparty/freetype/src/psaux/pshints.c index 1cbecd2b19..ce8cfca715 100644 --- a/thirdparty/freetype/src/psaux/pshints.c +++ b/thirdparty/freetype/src/psaux/pshints.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psglue.h" #include "psfont.h" @@ -310,7 +310,7 @@ CF2_Hint hint = &hintmap->edge[i]; - FT_TRACE6(( " %3d %7.2f %7.2f %5d %s%s%s%s\n", + FT_TRACE6(( " %3ld %7.2f %7.2f %5d %s%s%s%s\n", hint->index, hint->csCoord / 65536.0, hint->dsCoord / ( hint->scale * 1.0 ), diff --git a/thirdparty/freetype/src/psaux/psintrp.c b/thirdparty/freetype/src/psaux/psintrp.c index 0a84145535..519c694447 100644 --- a/thirdparty/freetype/src/psaux/psintrp.c +++ b/thirdparty/freetype/src/psaux/psintrp.c @@ -37,8 +37,8 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H -#include FT_SERVICE_CFF_TABLE_LOAD_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/services/svcfftl.h> #include "psglue.h" #include "psfont.h" diff --git a/thirdparty/freetype/src/psaux/psobjs.c b/thirdparty/freetype/src/psaux/psobjs.c index b37a78832c..defc4d4fce 100644 --- a/thirdparty/freetype/src/psaux/psobjs.c +++ b/thirdparty/freetype/src/psaux/psobjs.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_DRIVER_H +#include <freetype/internal/psaux.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/ftdriver.h> #include "psobjs.h" #include "psconv.h" @@ -1233,7 +1232,7 @@ bbox->xMax = FT_RoundFix( temp[2] ); bbox->yMax = FT_RoundFix( temp[3] ); - FT_TRACE4(( " [%d %d %d %d]", + FT_TRACE4(( " [%ld %ld %ld %ld]", bbox->xMin / 65536, bbox->yMin / 65536, bbox->xMax / 65536, @@ -1287,7 +1286,7 @@ bbox->xMax = FT_RoundFix( temp[i + 2 * max_objects] ); bbox->yMax = FT_RoundFix( temp[i + 3 * max_objects] ); - FT_TRACE4(( " [%d %d %d %d]", + FT_TRACE4(( " [%ld %ld %ld %ld]", bbox->xMin / 65536, bbox->yMin / 65536, bbox->xMax / 65536, diff --git a/thirdparty/freetype/src/psaux/psobjs.h b/thirdparty/freetype/src/psaux/psobjs.h index d37638d0ca..fdad672b6d 100644 --- a/thirdparty/freetype/src/psaux/psobjs.h +++ b/thirdparty/freetype/src/psaux/psobjs.h @@ -20,9 +20,8 @@ #define PSOBJS_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_CFF_OBJECTS_TYPES_H +#include <freetype/internal/psaux.h> +#include <freetype/internal/cffotypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/psread.c b/thirdparty/freetype/src/psaux/psread.c index 86bfc03c6e..7f657f2cdc 100644 --- a/thirdparty/freetype/src/psaux/psread.c +++ b/thirdparty/freetype/src/psaux/psread.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psglue.h" diff --git a/thirdparty/freetype/src/psaux/psstack.c b/thirdparty/freetype/src/psaux/psstack.c index 6659068001..7ae5256ef1 100644 --- a/thirdparty/freetype/src/psaux/psstack.c +++ b/thirdparty/freetype/src/psaux/psstack.c @@ -37,7 +37,7 @@ #include "psft.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psglue.h" #include "psfont.h" @@ -59,12 +59,12 @@ CF2_Stack stack = NULL; - if ( !FT_NEW( stack ) ) - { - /* initialize the structure; FT_NEW zeroes it */ - stack->memory = memory; - stack->error = e; - } + if ( FT_NEW( stack ) ) + return NULL; + + /* initialize the structure; FT_NEW zeroes it */ + stack->memory = memory; + stack->error = e; /* allocate the stack buffer */ if ( FT_NEW_ARRAY( stack->buffer, stackSize ) ) diff --git a/thirdparty/freetype/src/psaux/psstack.h b/thirdparty/freetype/src/psaux/psstack.h index 18cd39bc6a..b9ef9edf1b 100644 --- a/thirdparty/freetype/src/psaux/psstack.h +++ b/thirdparty/freetype/src/psaux/psstack.h @@ -39,6 +39,7 @@ #ifndef PSSTACK_H_ #define PSSTACK_H_ +#include <freetype/internal/compiler-macros.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/pstypes.h b/thirdparty/freetype/src/psaux/pstypes.h index 041287e8d5..435ef7e1fe 100644 --- a/thirdparty/freetype/src/psaux/pstypes.h +++ b/thirdparty/freetype/src/psaux/pstypes.h @@ -39,8 +39,7 @@ #ifndef PSTYPES_H_ #define PSTYPES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H +#include <freetype/freetype.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/t1cmap.c b/thirdparty/freetype/src/psaux/t1cmap.c index 451b276537..e21e93ca26 100644 --- a/thirdparty/freetype/src/psaux/t1cmap.c +++ b/thirdparty/freetype/src/psaux/t1cmap.c @@ -18,7 +18,7 @@ #include "t1cmap.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include "psauxerr.h" diff --git a/thirdparty/freetype/src/psaux/t1cmap.h b/thirdparty/freetype/src/psaux/t1cmap.h index 5411913831..031796510f 100644 --- a/thirdparty/freetype/src/psaux/t1cmap.h +++ b/thirdparty/freetype/src/psaux/t1cmap.h @@ -19,9 +19,8 @@ #ifndef T1CMAP_H_ #define T1CMAP_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psaux/t1decode.c b/thirdparty/freetype/src/psaux/t1decode.c index fa1745d9e0..2ed27ca19e 100644 --- a/thirdparty/freetype/src/psaux/t1decode.c +++ b/thirdparty/freetype/src/psaux/t1decode.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H -#include FT_INTERNAL_HASH_H -#include FT_OUTLINE_H +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/pshints.h> +#include <freetype/internal/fthash.h> +#include <freetype/ftoutln.h> #include "t1decode.h" #include "psobjs.h" @@ -1238,8 +1237,8 @@ FT_UNUSED( orig_y ); - /* the `metrics_only' indicates that we only want to compute */ - /* the glyph's metrics (lsb + advance width), not load the */ + /* `metrics_only' indicates that we only want to compute the */ + /* glyph's metrics (lsb + advance width) without loading the */ /* rest of it; so exit immediately */ if ( builder->metrics_only ) { @@ -1273,8 +1272,8 @@ x = ADD_LONG( builder->pos_x, top[0] ); y = ADD_LONG( builder->pos_y, top[1] ); - /* the `metrics_only' indicates that we only want to compute */ - /* the glyph's metrics (lsb + advance width), not load the */ + /* `metrics_only' indicates that we only want to compute the */ + /* glyph's metrics (lsb + advance width) without loading the */ /* rest of it; so exit immediately */ if ( builder->metrics_only ) { @@ -1728,7 +1727,7 @@ #ifdef FT_DEBUG_LEVEL_TRACE if ( bol ) { - FT_TRACE5(( " (%d)", decoder->top - decoder->stack )); + FT_TRACE5(( " (%ld)", decoder->top - decoder->stack )); bol = FALSE; } #endif @@ -1750,8 +1749,6 @@ case 7: case 8: case 9: - case 10: - case 11: case 14: case 15: case 21: @@ -1760,6 +1757,13 @@ case 31: goto No_Width; + case 10: + op = op_callsubr; + break; + case 11: + op = op_return; + break; + case 13: op = op_hsbw; break; @@ -1899,13 +1903,20 @@ #ifdef FT_DEBUG_LEVEL_TRACE - if ( op != op_div ) + switch ( op ) { + case op_callsubr: + case op_div: + case op_return: + break; + + default: if ( top - decoder->stack != num_args ) FT_TRACE0(( "t1_decoder_parse_metrics:" " too much operands on the stack" - " (seen %d, expected %d)\n", + " (seen %ld, expected %d)\n", top - decoder->stack, num_args )); + break; } #endif /* FT_DEBUG_LEVEL_TRACE */ @@ -1926,8 +1937,8 @@ builder->advance.y = 0; /* we only want to compute the glyph's metrics */ - /* (lsb + advance width), not load the rest of */ - /* it; so exit immediately */ + /* (lsb + advance width) without loading the */ + /* rest of it; so exit immediately */ FT_TRACE4(( "\n" )); return FT_Err_Ok; @@ -1945,8 +1956,8 @@ builder->advance.y = top[3]; /* we only want to compute the glyph's metrics */ - /* (lsb + advance width), not load the rest of */ - /* it; so exit immediately */ + /* (lsb + advance width), without loading the */ + /* rest of it; so exit immediately */ FT_TRACE4(( "\n" )); return FT_Err_Ok; @@ -1962,6 +1973,91 @@ large_int = FALSE; break; + case op_callsubr: + { + FT_Int idx; + + + FT_TRACE4(( " callsubr" )); + + idx = Fix2Int( top[0] ); + + if ( decoder->subrs_hash ) + { + size_t* val = ft_hash_num_lookup( idx, + decoder->subrs_hash ); + + + if ( val ) + idx = *val; + else + idx = -1; + } + + if ( idx < 0 || idx >= decoder->num_subrs ) + { + FT_ERROR(( "t1_decoder_parse_metrics:" + " invalid subrs index\n" )); + goto Syntax_Error; + } + + if ( zone - decoder->zones >= T1_MAX_SUBRS_CALLS ) + { + FT_ERROR(( "t1_decoder_parse_metrics:" + " too many nested subrs\n" )); + goto Syntax_Error; + } + + zone->cursor = ip; /* save current instruction pointer */ + + zone++; + + /* The Type 1 driver stores subroutines without the seed bytes. */ + /* The CID driver stores subroutines with seed bytes. This */ + /* case is taken care of when decoder->subrs_len == 0. */ + zone->base = decoder->subrs[idx]; + + if ( decoder->subrs_len ) + zone->limit = zone->base + decoder->subrs_len[idx]; + else + { + /* We are using subroutines from a CID font. We must adjust */ + /* for the seed bytes. */ + zone->base += ( decoder->lenIV >= 0 ? decoder->lenIV : 0 ); + zone->limit = decoder->subrs[idx + 1]; + } + + zone->cursor = zone->base; + + if ( !zone->base ) + { + FT_ERROR(( "t1_decoder_parse_metrics:" + " invoking empty subrs\n" )); + goto Syntax_Error; + } + + decoder->zone = zone; + ip = zone->base; + limit = zone->limit; + break; + } + + case op_return: + FT_TRACE4(( " return" )); + + if ( zone <= decoder->zones ) + { + FT_ERROR(( "t1_decoder_parse_metrics:" + " unexpected return\n" )); + goto Syntax_Error; + } + + zone--; + ip = zone->cursor; + limit = zone->limit; + decoder->zone = zone; + break; + default: FT_ERROR(( "t1_decoder_parse_metrics:" " unhandled opcode %d\n", op )); diff --git a/thirdparty/freetype/src/psaux/t1decode.h b/thirdparty/freetype/src/psaux/t1decode.h index 231947e852..b793504ac6 100644 --- a/thirdparty/freetype/src/psaux/t1decode.h +++ b/thirdparty/freetype/src/psaux/t1decode.h @@ -20,9 +20,8 @@ #define T1DECODE_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/psaux.h> +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pshinter/pshalgo.c b/thirdparty/freetype/src/pshinter/pshalgo.c index 57dfa3da96..920b9a74b5 100644 --- a/thirdparty/freetype/src/pshinter/pshalgo.c +++ b/thirdparty/freetype/src/pshinter/pshalgo.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> #include "pshalgo.h" #include "pshnterr.h" diff --git a/thirdparty/freetype/src/pshinter/pshglob.c b/thirdparty/freetype/src/pshinter/pshglob.c index d9f835f99e..cdc1c3af0e 100644 --- a/thirdparty/freetype/src/pshinter/pshglob.c +++ b/thirdparty/freetype/src/pshinter/pshglob.c @@ -17,10 +17,9 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_CALC_H +#include <freetype/freetype.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftcalc.h> #include "pshglob.h" #ifdef DEBUG_HINTER diff --git a/thirdparty/freetype/src/pshinter/pshglob.h b/thirdparty/freetype/src/pshinter/pshglob.h index cd2f3122f7..8181324e5e 100644 --- a/thirdparty/freetype/src/pshinter/pshglob.h +++ b/thirdparty/freetype/src/pshinter/pshglob.h @@ -20,8 +20,8 @@ #define PSHGLOB_H_ -#include FT_FREETYPE_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H +#include <freetype/freetype.h> +#include <freetype/internal/pshints.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pshinter/pshinter.c b/thirdparty/freetype/src/pshinter/pshinter.c index 6009db5187..3cca0ad7c2 100644 --- a/thirdparty/freetype/src/pshinter/pshinter.c +++ b/thirdparty/freetype/src/pshinter/pshinter.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "pshalgo.c" #include "pshglob.c" diff --git a/thirdparty/freetype/src/pshinter/pshmod.c b/thirdparty/freetype/src/pshinter/pshmod.c index 686859b3ed..e0abd386f9 100644 --- a/thirdparty/freetype/src/pshinter/pshmod.c +++ b/thirdparty/freetype/src/pshinter/pshmod.c @@ -16,10 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> #include "pshrec.h" #include "pshalgo.h" +#include "pshmod.h" /* the Postscript Hinter module structure */ diff --git a/thirdparty/freetype/src/pshinter/pshmod.h b/thirdparty/freetype/src/pshinter/pshmod.h index c44112e9d4..2a6eb1c469 100644 --- a/thirdparty/freetype/src/pshinter/pshmod.h +++ b/thirdparty/freetype/src/pshinter/pshmod.h @@ -20,8 +20,7 @@ #define PSHMOD_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/pshinter/pshnterr.h b/thirdparty/freetype/src/pshinter/pshnterr.h index c4e9f42d2c..d67955c410 100644 --- a/thirdparty/freetype/src/pshinter/pshnterr.h +++ b/thirdparty/freetype/src/pshinter/pshnterr.h @@ -25,7 +25,7 @@ #ifndef PSHNTERR_H_ #define PSHNTERR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX PSH_Err_ #define FT_ERR_BASE FT_Mod_Err_PShinter -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* PSHNTERR_H_ */ diff --git a/thirdparty/freetype/src/pshinter/pshrec.c b/thirdparty/freetype/src/pshinter/pshrec.c index a81c6f7123..bddccf2a6e 100644 --- a/thirdparty/freetype/src/pshinter/pshrec.c +++ b/thirdparty/freetype/src/pshinter/pshrec.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H +#include <freetype/freetype.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> #include "pshrec.h" #include "pshalgo.h" @@ -875,7 +874,7 @@ if ( error ) { FT_ERROR(( "ps_hints_stem: could not add stem" - " (%d,%d) to hints table\n", stems[0], stems[1] )); + " (%ld,%ld) to hints table\n", stems[0], stems[1] )); hints->error = error; return; diff --git a/thirdparty/freetype/src/pshinter/pshrec.h b/thirdparty/freetype/src/pshinter/pshrec.h index a8bc5aeecb..b13c7be13c 100644 --- a/thirdparty/freetype/src/pshinter/pshrec.h +++ b/thirdparty/freetype/src/pshinter/pshrec.h @@ -32,8 +32,7 @@ #define PSHREC_H_ -#include <ft2build.h> -#include FT_INTERNAL_POSTSCRIPT_HINTS_H +#include <freetype/internal/pshints.h> #include "pshglob.h" diff --git a/thirdparty/freetype/src/psnames/psmodule.c b/thirdparty/freetype/src/psnames/psmodule.c index bb3ff07022..b38f9d3b1c 100644 --- a/thirdparty/freetype/src/psnames/psmodule.c +++ b/thirdparty/freetype/src/psnames/psmodule.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/services/svpscmap.h> #include "psmodule.h" diff --git a/thirdparty/freetype/src/psnames/psmodule.h b/thirdparty/freetype/src/psnames/psmodule.h index 955f699f3a..c85a9ecad7 100644 --- a/thirdparty/freetype/src/psnames/psmodule.h +++ b/thirdparty/freetype/src/psnames/psmodule.h @@ -20,8 +20,7 @@ #define PSMODULE_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/psnames/psnamerr.h b/thirdparty/freetype/src/psnames/psnamerr.h index fb9058e61a..154c701d04 100644 --- a/thirdparty/freetype/src/psnames/psnamerr.h +++ b/thirdparty/freetype/src/psnames/psnamerr.h @@ -26,7 +26,7 @@ #ifndef PSNAMERR_H_ #define PSNAMERR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX PSnames_Err_ #define FT_ERR_BASE FT_Mod_Err_PSnames -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* PSNAMERR_H_ */ diff --git a/thirdparty/freetype/src/psnames/psnames.c b/thirdparty/freetype/src/psnames/psnames.c index 5ac3897d25..cff36851ba 100644 --- a/thirdparty/freetype/src/psnames/psnames.c +++ b/thirdparty/freetype/src/psnames/psnames.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "psmodule.c" diff --git a/thirdparty/freetype/src/raster/ftraster.c b/thirdparty/freetype/src/raster/ftraster.c index 35655a6346..9f0a7976fa 100644 --- a/thirdparty/freetype/src/raster/ftraster.c +++ b/thirdparty/freetype/src/raster/ftraster.c @@ -62,10 +62,9 @@ #else /* !STANDALONE_ */ -#include <ft2build.h> #include "ftraster.h" -#include FT_INTERNAL_CALC_H /* for FT_MulDiv and FT_MulDiv_No_Round */ -#include FT_OUTLINE_H /* for FT_Outline_Get_CBox */ +#include <freetype/internal/ftcalc.h> /* for FT_MulDiv and FT_MulDiv_No_Round */ +#include <freetype/ftoutln.h> /* for FT_Outline_Get_CBox */ #endif /* !STANDALONE_ */ @@ -226,8 +225,8 @@ #else /* !STANDALONE_ */ -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H /* for FT_TRACE, FT_ERROR, and FT_THROW */ +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> /* for FT_TRACE, FT_ERROR, and FT_THROW */ #include "rasterrs.h" @@ -460,6 +459,11 @@ #define IS_TOP_OVERSHOOT( x ) \ (Bool)( x - FLOOR( x ) >= ras.precision_half ) + /* Smart dropout rounding to find which pixel is closer to span ends. */ + /* To mimick Windows, symmetric cases break down indepenently of the */ + /* precision. */ +#define SMART( p, q ) FLOOR( ( (p) + (q) + ras.precision * 63 / 64 ) >> 1 ) + #if FT_RENDER_POOL_SIZE > 2048 #define FT_MAX_BLACK_POOL ( FT_RENDER_POOL_SIZE / sizeof ( Long ) ) #else @@ -674,13 +678,13 @@ if ( overshoot ) ras.cProfile->flags |= Overshoot_Bottom; - FT_TRACE6(( " new ascending profile = %p\n", ras.cProfile )); + FT_TRACE6(( " new ascending profile = %p\n", (void *)ras.cProfile )); break; case Descending_State: if ( overshoot ) ras.cProfile->flags |= Overshoot_Top; - FT_TRACE6(( " new descending profile = %p\n", ras.cProfile )); + FT_TRACE6(( " new descending profile = %p\n", (void *)ras.cProfile )); break; default: @@ -737,7 +741,7 @@ FT_TRACE6(( " ending profile %p, start = %ld, height = %ld\n", - ras.cProfile, ras.cProfile->start, h )); + (void *)ras.cProfile, ras.cProfile->start, h )); ras.cProfile->height = h; if ( overshoot ) @@ -2242,11 +2246,10 @@ /* in high-precision mode, we need 12 digits after the comma to */ /* represent multiples of 1/(1<<12) = 1/4096 */ - FT_TRACE7(( " y=%d x=[%.12f;%.12f], drop-out=%d", + FT_TRACE7(( " y=%d x=[% .12f;% .12f]", y, x1 / (double)ras.precision, - x2 / (double)ras.precision, - dropOutControl )); + x2 / (double)ras.precision )); /* Drop-out control */ @@ -2274,7 +2277,7 @@ if ( e2 >= ras.bWidth ) e2 = ras.bWidth - 1; - FT_TRACE7(( " -> x=[%d;%d]", e1, e2 )); + FT_TRACE7(( " -> x=[%ld;%ld]", e1, e2 )); c1 = (Short)( e1 >> 3 ); c2 = (Short)( e2 >> 3 ); @@ -2316,7 +2319,7 @@ Short c1, f1; - FT_TRACE7(( " y=%d x=[%.12f;%.12f]", + FT_TRACE7(( " y=%d x=[% .12f;% .12f]", y, x1 / (double)ras.precision, x2 / (double)ras.precision )); @@ -2353,8 +2356,6 @@ Int dropOutControl = left->flags & 7; - FT_TRACE7(( ", drop-out=%d", dropOutControl )); - if ( e1 == e2 + ras.precision ) { switch ( dropOutControl ) @@ -2364,7 +2365,7 @@ break; case 4: /* smart drop-outs including stubs */ - pxl = FLOOR( ( x1 + x2 - 1 ) / 2 + ras.precision_half ); + pxl = SMART( x1, x2 ); break; case 1: /* simple drop-outs excluding stubs */ @@ -2413,7 +2414,7 @@ if ( dropOutControl == 1 ) pxl = e2; else - pxl = FLOOR( ( x1 + x2 - 1 ) / 2 + ras.precision_half ); + pxl = SMART( x1, x2 ); break; default: /* modes 2, 3, 6, 7 */ @@ -2448,7 +2449,7 @@ if ( e1 >= 0 && e1 < ras.bWidth ) { - FT_TRACE7(( " -> x=%d (drop-out)", e1 )); + FT_TRACE7(( " -> x=%ld", e1 )); c1 = (Short)( e1 >> 3 ); f1 = (Short)( e1 & 7 ); @@ -2457,7 +2458,7 @@ } Exit: - FT_TRACE7(( "\n" )); + FT_TRACE7(( " dropout=%d\n", left->flags & 7 )); } @@ -2495,44 +2496,68 @@ PProfile left, PProfile right ) { + Long e1, e2; + FT_UNUSED( left ); FT_UNUSED( right ); - if ( x2 - x1 < ras.precision ) - { - Long e1, e2; + FT_TRACE7(( " x=%d y=[% .12f;% .12f]", + y, + x1 / (double)ras.precision, + x2 / (double)ras.precision )); + /* We should not need this procedure but the vertical sweep */ + /* mishandles horizontal lines through pixel centers. So we */ + /* have to check perfectly aligned span edges here. */ + /* */ + /* XXX: Can we handle horizontal lines better and drop this? */ - FT_TRACE7(( " x=%d y=[%.12f;%.12f]", - y, - x1 / (double)ras.precision, - x2 / (double)ras.precision )); + e1 = CEILING( x1 ); - e1 = CEILING( x1 ); - e2 = FLOOR ( x2 ); + if ( x1 == e1 ) + { + e1 = TRUNC( e1 ); - if ( e1 == e2 ) + if ( e1 >= 0 && (ULong)e1 < ras.target.rows ) { - e1 = TRUNC( e1 ); - - if ( e1 >= 0 && (ULong)e1 < ras.target.rows ) - { - Byte f1; - PByte bits; + Byte f1; + PByte bits; - FT_TRACE7(( " -> y=%d (drop-out)", e1 )); + bits = ras.bOrigin + ( y >> 3 ) - e1 * ras.target.pitch; + f1 = (Byte)( 0x80 >> ( y & 7 ) ); - bits = ras.bOrigin + ( y >> 3 ) - e1 * ras.target.pitch; - f1 = (Byte)( 0x80 >> ( y & 7 ) ); + FT_TRACE7(( bits[0] & f1 ? " redundant" + : " -> y=%ld edge", e1 )); - bits[0] |= f1; - } + bits[0] |= f1; } + } + + e2 = FLOOR ( x2 ); + + if ( x2 == e2 ) + { + e2 = TRUNC( e2 ); + + if ( e2 >= 0 && (ULong)e2 < ras.target.rows ) + { + Byte f1; + PByte bits; + - FT_TRACE7(( "\n" )); + bits = ras.bOrigin + ( y >> 3 ) - e2 * ras.target.pitch; + f1 = (Byte)( 0x80 >> ( y & 7 ) ); + + FT_TRACE7(( bits[0] & f1 ? " redundant" + : " -> y=%ld edge", e2 )); + + bits[0] |= f1; + } } + + FT_TRACE7(( "\n" )); } @@ -2548,7 +2573,7 @@ Byte f1; - FT_TRACE7(( " x=%d y=[%.12f;%.12f]", + FT_TRACE7(( " x=%d y=[% .12f;% .12f]", y, x1 / (double)ras.precision, x2 / (double)ras.precision )); @@ -2574,8 +2599,6 @@ Int dropOutControl = left->flags & 7; - FT_TRACE7(( ", dropout=%d", dropOutControl )); - if ( e1 == e2 + ras.precision ) { switch ( dropOutControl ) @@ -2585,7 +2608,7 @@ break; case 4: /* smart drop-outs including stubs */ - pxl = FLOOR( ( x1 + x2 - 1 ) / 2 + ras.precision_half ); + pxl = SMART( x1, x2 ); break; case 1: /* simple drop-outs excluding stubs */ @@ -2609,7 +2632,7 @@ if ( dropOutControl == 1 ) pxl = e2; else - pxl = FLOOR( ( x1 + x2 - 1 ) / 2 + ras.precision_half ); + pxl = SMART( x1, x2 ); break; default: /* modes 2, 3, 6, 7 */ @@ -2645,7 +2668,7 @@ if ( e1 >= 0 && (ULong)e1 < ras.target.rows ) { - FT_TRACE7(( " -> y=%d (drop-out)", e1 )); + FT_TRACE7(( " -> y=%ld", e1 )); bits = ras.bOrigin + ( y >> 3 ) - e1 * ras.target.pitch; f1 = (Byte)( 0x80 >> ( y & 7 ) ); @@ -2654,7 +2677,7 @@ } Exit: - FT_TRACE7(( "\n" )); + FT_TRACE7(( " dropout=%d\n", left->flags & 7 )); } diff --git a/thirdparty/freetype/src/raster/ftraster.h b/thirdparty/freetype/src/raster/ftraster.h index 833d30f234..1b2ee3c016 100644 --- a/thirdparty/freetype/src/raster/ftraster.h +++ b/thirdparty/freetype/src/raster/ftraster.h @@ -22,8 +22,9 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_IMAGE_H +#include <freetype/ftimage.h> +#include <freetype/internal/compiler-macros.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/raster/ftrend1.c b/thirdparty/freetype/src/raster/ftrend1.c index 944279a8d1..57fed9bc14 100644 --- a/thirdparty/freetype/src/raster/ftrend1.c +++ b/thirdparty/freetype/src/raster/ftrend1.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_OUTLINE_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftoutln.h> #include "ftrend1.h" #include "ftraster.h" diff --git a/thirdparty/freetype/src/raster/ftrend1.h b/thirdparty/freetype/src/raster/ftrend1.h index dc972b1bc2..3f6be53675 100644 --- a/thirdparty/freetype/src/raster/ftrend1.h +++ b/thirdparty/freetype/src/raster/ftrend1.h @@ -20,8 +20,7 @@ #define FTREND1_H_ -#include <ft2build.h> -#include FT_RENDER_H +#include <freetype/ftrender.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/raster/raster.c b/thirdparty/freetype/src/raster/raster.c index 08431c8509..cd37943bf6 100644 --- a/thirdparty/freetype/src/raster/raster.c +++ b/thirdparty/freetype/src/raster/raster.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "ftraster.c" #include "ftrend1.c" diff --git a/thirdparty/freetype/src/raster/rasterrs.h b/thirdparty/freetype/src/raster/rasterrs.h index 379e1d3e89..a29651a6c5 100644 --- a/thirdparty/freetype/src/raster/rasterrs.h +++ b/thirdparty/freetype/src/raster/rasterrs.h @@ -26,7 +26,7 @@ #ifndef RASTERRS_H_ #define RASTERRS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX Raster_Err_ #define FT_ERR_BASE FT_Mod_Err_Raster -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* RASTERRS_H_ */ diff --git a/thirdparty/freetype/src/sfnt/pngshim.c b/thirdparty/freetype/src/sfnt/pngshim.c index 523b30a745..f55016122c 100644 --- a/thirdparty/freetype/src/sfnt/pngshim.c +++ b/thirdparty/freetype/src/sfnt/pngshim.c @@ -17,10 +17,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #include FT_CONFIG_STANDARD_LIBRARY_H @@ -61,7 +60,12 @@ /* predates clang; the `__BYTE_ORDER__' preprocessor symbol was */ /* introduced in gcc 4.6 and clang 3.2, respectively. */ /* `__builtin_shuffle' for gcc was introduced in gcc 4.7.0. */ -#if ( ( defined( __GNUC__ ) && \ + /* */ + /* Intel compilers do not currently support __builtin_shuffle; */ + + /* The Intel check must be first. */ +#if !defined( __INTEL_COMPILER ) && \ + ( ( defined( __GNUC__ ) && \ ( ( __GNUC__ >= 5 ) || \ ( ( __GNUC__ == 4 ) && ( __GNUC_MINOR__ >= 7 ) ) ) ) || \ ( defined( __clang__ ) && \ @@ -328,6 +332,13 @@ if ( populate_map_and_metrics ) { + /* reject too large bitmaps similarly to the rasterizer */ + if ( imgHeight > 0x7FFF || imgWidth > 0x7FFF ) + { + error = FT_THROW( Array_Too_Large ); + goto DestroyExit; + } + metrics->width = (FT_UShort)imgWidth; metrics->height = (FT_UShort)imgHeight; @@ -336,13 +347,6 @@ map->pixel_mode = FT_PIXEL_MODE_BGRA; map->pitch = (int)( map->width * 4 ); map->num_grays = 256; - - /* reject too large bitmaps similarly to the rasterizer */ - if ( map->rows > 0x7FFF || map->width > 0x7FFF ) - { - error = FT_THROW( Array_Too_Large ); - goto DestroyExit; - } } /* convert palette/gray image to rgb */ diff --git a/thirdparty/freetype/src/sfnt/pngshim.h b/thirdparty/freetype/src/sfnt/pngshim.h index d2c9e2b9b5..2d6e83d69b 100644 --- a/thirdparty/freetype/src/sfnt/pngshim.h +++ b/thirdparty/freetype/src/sfnt/pngshim.h @@ -21,7 +21,6 @@ #define PNGSHIM_H_ -#include <ft2build.h> #include "ttload.h" diff --git a/thirdparty/freetype/src/sfnt/sfdriver.c b/thirdparty/freetype/src/sfnt/sfdriver.c index 6ca4f3c268..0460339a74 100644 --- a/thirdparty/freetype/src/sfnt/sfdriver.c +++ b/thirdparty/freetype/src/sfnt/sfdriver.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_OBJECTS_H -#include FT_TRUETYPE_IDS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ttnameid.h> #include "sfdriver.h" #include "ttload.h" @@ -43,21 +42,21 @@ #ifdef TT_CONFIG_OPTION_BDF #include "ttbdf.h" -#include FT_SERVICE_BDF_H +#include <freetype/internal/services/svbdf.h> #endif #include "ttcmap.h" #include "ttkern.h" #include "ttmtx.h" -#include FT_SERVICE_GLYPH_DICT_H -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_SFNT_H -#include FT_SERVICE_TT_CMAP_H +#include <freetype/internal/services/svgldict.h> +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svsfnt.h> +#include <freetype/internal/services/svttcmap.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H +#include <freetype/ftmm.h> +#include <freetype/internal/services/svmm.h> #endif @@ -195,7 +194,7 @@ else if ( (FT_ULong)face->num_glyphs < FT_UINT_MAX ) max_gid = (FT_UInt)face->num_glyphs; else - FT_TRACE0(( "Ignore glyph names for invalid GID 0x%08x - 0x%08x\n", + FT_TRACE0(( "Ignore glyph names for invalid GID 0x%08x - 0x%08lx\n", FT_UINT_MAX, face->num_glyphs )); for ( i = 0; i < max_gid; i++ ) diff --git a/thirdparty/freetype/src/sfnt/sfdriver.h b/thirdparty/freetype/src/sfnt/sfdriver.h index d108ee2000..1ac2706325 100644 --- a/thirdparty/freetype/src/sfnt/sfdriver.h +++ b/thirdparty/freetype/src/sfnt/sfdriver.h @@ -20,8 +20,7 @@ #define SFDRIVER_H_ -#include <ft2build.h> -#include FT_MODULE_H +#include <freetype/ftmodapi.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/sferrors.h b/thirdparty/freetype/src/sfnt/sferrors.h index fbfca0e525..55c3e76b66 100644 --- a/thirdparty/freetype/src/sfnt/sferrors.h +++ b/thirdparty/freetype/src/sfnt/sferrors.h @@ -25,7 +25,7 @@ #ifndef SFERRORS_H_ #define SFERRORS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX SFNT_Err_ #define FT_ERR_BASE FT_Mod_Err_SFNT -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* SFERRORS_H_ */ diff --git a/thirdparty/freetype/src/sfnt/sfnt.c b/thirdparty/freetype/src/sfnt/sfnt.c index 9db7935ae4..471239ff0b 100644 --- a/thirdparty/freetype/src/sfnt/sfnt.c +++ b/thirdparty/freetype/src/sfnt/sfnt.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "pngshim.c" #include "sfdriver.c" diff --git a/thirdparty/freetype/src/sfnt/sfobjs.c b/thirdparty/freetype/src/sfnt/sfobjs.c index 2c66a9b648..39460be2e6 100644 --- a/thirdparty/freetype/src/sfnt/sfobjs.c +++ b/thirdparty/freetype/src/sfnt/sfobjs.c @@ -16,23 +16,22 @@ */ -#include <ft2build.h> #include "sfobjs.h" #include "ttload.h" #include "ttcmap.h" #include "ttkern.h" #include "sfwoff.h" #include "sfwoff2.h" -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_DEBUG_H -#include FT_TRUETYPE_IDS_H -#include FT_TRUETYPE_TAGS_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_SFNT_NAMES_H +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/ttnameid.h> +#include <freetype/tttags.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/ftsnames.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svmetric.h> #endif #include "sferrors.h" @@ -547,8 +546,8 @@ /* Stream may have changed in sfnt_open_font. */ stream = face->root.stream; - FT_TRACE2(( "sfnt_init_face: %08p (index %d)\n", - face, + FT_TRACE2(( "sfnt_init_face: %p (index %d)\n", + (void *)face, face_instance_index )); face_index = FT_ABS( face_instance_index ) & 0xFFFF; @@ -821,7 +820,7 @@ /* it doesn't contain outlines. */ /* */ - FT_TRACE2(( "sfnt_load_face: %08p\n\n", face )); + FT_TRACE2(( "sfnt_load_face: %p\n\n", (void *)face )); /* do we have outlines in there? */ #ifdef FT_CONFIG_OPTION_INCREMENTAL diff --git a/thirdparty/freetype/src/sfnt/sfobjs.h b/thirdparty/freetype/src/sfnt/sfobjs.h index d8438a4834..e8e3042083 100644 --- a/thirdparty/freetype/src/sfnt/sfobjs.h +++ b/thirdparty/freetype/src/sfnt/sfobjs.h @@ -20,9 +20,8 @@ #define SFOBJS_H_ -#include <ft2build.h> -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/sfwoff.c b/thirdparty/freetype/src/sfnt/sfwoff.c index d1e330f675..f0a32e1e06 100644 --- a/thirdparty/freetype/src/sfnt/sfwoff.c +++ b/thirdparty/freetype/src/sfnt/sfwoff.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> #include "sfwoff.h" -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_GZIP_H +#include <freetype/tttags.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/ftgzip.h> /************************************************************************** diff --git a/thirdparty/freetype/src/sfnt/sfwoff.h b/thirdparty/freetype/src/sfnt/sfwoff.h index c1789d33d5..d177ab1160 100644 --- a/thirdparty/freetype/src/sfnt/sfwoff.h +++ b/thirdparty/freetype/src/sfnt/sfwoff.h @@ -20,9 +20,8 @@ #define SFWOFF_H_ -#include <ft2build.h> -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/sfwoff2.c b/thirdparty/freetype/src/sfnt/sfwoff2.c index 1b99e7d28c..5c8202f823 100644 --- a/thirdparty/freetype/src/sfnt/sfwoff2.c +++ b/thirdparty/freetype/src/sfnt/sfwoff2.c @@ -15,12 +15,11 @@ * */ -#include <ft2build.h> #include "sfwoff2.h" #include "woff2tags.h" -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H +#include <freetype/tttags.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> #ifdef FT_CONFIG_OPTION_USE_BROTLI @@ -44,7 +43,8 @@ #define READ_BASE128( var ) FT_SET_ERROR( ReadBase128( stream, &var ) ) -#define ROUND4( var ) ( ( var + 3 ) & ~3 ) + /* `var' should be FT_ULong */ +#define ROUND4( var ) ( ( var + 3 ) & ~3UL ) #define WRITE_USHORT( p, v ) \ do \ @@ -64,12 +64,12 @@ \ } while ( 0 ) -#define WRITE_SHORT( p, v ) \ - do \ - { \ - *(p)++ = ( (v) >> 8 ); \ - *(p)++ = ( (v) >> 0 ); \ - \ +#define WRITE_SHORT( p, v ) \ + do \ + { \ + *(p)++ = (FT_Byte)( (v) >> 8 ); \ + *(p)++ = (FT_Byte)( (v) >> 0 ); \ + \ } while ( 0 ) #define WRITE_SFNT_BUF( buf, s ) \ @@ -125,10 +125,10 @@ Read255UShort( FT_Stream stream, FT_UShort* value ) { - static const FT_Int oneMoreByteCode1 = 255; - static const FT_Int oneMoreByteCode2 = 254; - static const FT_Int wordCode = 253; - static const FT_Int lowestUCode = 253; + const FT_Byte oneMoreByteCode1 = 255; + const FT_Byte oneMoreByteCode2 = 254; + const FT_Byte wordCode = 253; + const FT_UShort lowestUCode = 253; FT_Error error = FT_Err_Ok; FT_Byte code; @@ -281,12 +281,12 @@ /* Calculate table checksum of `buf'. */ - static FT_Long + static FT_ULong compute_ULong_sum( FT_Byte* buf, FT_ULong size ) { FT_ULong checksum = 0; - FT_ULong aligned_size = size & ~3; + FT_ULong aligned_size = size & ~3UL; FT_ULong i; FT_ULong v; @@ -318,7 +318,9 @@ { #ifdef FT_CONFIG_OPTION_USE_BROTLI - FT_ULong uncompressed_size = dst_size; + /* this cast is only of importance on 32bit systems; */ + /* we don't validate it */ + FT_Offset uncompressed_size = (FT_Offset)dst_size; BrotliDecoderResult result; @@ -537,12 +539,12 @@ FT_ULong* glyph_size ) { FT_UInt flag_offset = 10 + ( 2 * n_contours ) + 2 + instruction_len; - FT_Int last_flag = -1; - FT_Int repeat_count = 0; - FT_Int last_x = 0; - FT_Int last_y = 0; - FT_UInt x_bytes = 0; - FT_UInt y_bytes = 0; + FT_Byte last_flag = 0xFFU; + FT_Byte repeat_count = 0; + FT_Int last_x = 0; + FT_Int last_y = 0; + FT_UInt x_bytes = 0; + FT_UInt y_bytes = 0; FT_UInt xy_bytes; FT_UInt i; FT_UInt x_offset; @@ -554,9 +556,9 @@ { const WOFF2_PointRec point = points[i]; - FT_Int flag = point.on_curve ? GLYF_ON_CURVE : 0; - FT_Int dx = point.x - last_x; - FT_Int dy = point.y - last_y; + FT_Byte flag = point.on_curve ? GLYF_ON_CURVE : 0; + FT_Int dx = point.x - last_x; + FT_Int dy = point.y - last_y; if ( dx == 0 ) @@ -633,7 +635,7 @@ if ( dx == 0 ) ; else if ( dx > -256 && dx < 256 ) - dst[x_offset++] = FT_ABS( dx ); + dst[x_offset++] = (FT_Byte)FT_ABS( dx ); else { pointer = dst + x_offset; @@ -646,7 +648,7 @@ if ( dy == 0 ) ; else if ( dy > -256 && dy < 256 ) - dst[y_offset++] = FT_ABS( dy ); + dst[y_offset++] = (FT_Byte)FT_ABS( dy ); else { pointer = dst + y_offset; @@ -918,7 +920,7 @@ bbox_bitmap_offset = substreams[BBOX_STREAM].offset; /* Size of bboxBitmap = 4 * floor((numGlyphs + 31) / 32) */ - bitmap_length = ( ( num_glyphs + 31 ) >> 5 ) << 2; + bitmap_length = ( ( num_glyphs + 31U ) >> 5 ) << 2; substreams[BBOX_STREAM].offset += bitmap_length; glyph_buf_size = WOFF2_DEFAULT_GLYPH_BUF; @@ -1196,7 +1198,7 @@ /* Store x_mins, may be required to reconstruct `hmtx'. */ if ( n_contours > 0 ) - info->x_mins[i] = x_min; + info->x_mins[i] = (FT_Short)x_min; } info->glyf_table->dst_length = dest_offset - info->glyf_table->dst_offset; @@ -1220,7 +1222,7 @@ FT_TRACE4(( " loca table info:\n" )); FT_TRACE4(( " dst_offset = %lu\n", info->loca_table->dst_offset )); FT_TRACE4(( " dst_length = %lu\n", info->loca_table->dst_length )); - FT_TRACE4(( " checksum = %09x\n", *loca_checksum )); + FT_TRACE4(( " checksum = %09lx\n", *loca_checksum )); /* Set pointer `sfnt_bytes' to its correct value. */ *sfnt_bytes = sfnt; @@ -1287,6 +1289,12 @@ return FT_THROW( Invalid_Table ); } + if ( !info->loca_table ) + { + FT_ERROR(( "`loca' table is missing.\n" )); + return FT_THROW( Invalid_Table ); + } + /* Read `numGlyphs' field from `maxp' table. */ if ( FT_STREAM_SEEK( maxp_table->src_offset ) || FT_STREAM_SKIP( 8 ) ) return error; @@ -1338,7 +1346,7 @@ if ( FT_STREAM_SEEK( glyf_offset ) || FT_STREAM_SKIP( 2 ) ) return error; - if ( FT_READ_USHORT( info->x_mins[i] ) ) + if ( FT_READ_SHORT( info->x_mins[i] ) ) return error; } @@ -1565,7 +1573,7 @@ WOFF2_TableRec table = *( indices[nn] ); - FT_TRACE3(( "Seeking to %d with table size %d.\n", + FT_TRACE3(( "Seeking to %ld with table size %ld.\n", table.src_offset, table.src_length )); FT_TRACE3(( "Table tag: %c%c%c%c.\n", (FT_Char)( table.Tag >> 24 ), @@ -1606,7 +1614,7 @@ checksum = compute_ULong_sum( transformed_buf + table.src_offset, table.src_length ); - FT_TRACE4(( "Checksum = %09x.\n", checksum )); + FT_TRACE4(( "Checksum = %09lx.\n", checksum )); if ( WRITE_SFNT_BUF( transformed_buf + table.src_offset, table.src_length ) ) @@ -1631,7 +1639,7 @@ memory ) ) goto Fail; - FT_TRACE4(( "Checksum = %09x.\n", checksum )); + FT_TRACE4(( "Checksum = %09lx.\n", checksum )); } else if ( table.Tag == TTAG_loca ) @@ -1707,7 +1715,7 @@ WRITE_ULONG( buf_cursor, font_checksum ); - FT_TRACE2(( "Final checksum = %09x.\n", font_checksum )); + FT_TRACE2(( "Final checksum = %09lx.\n", font_checksum )); woff2->actual_sfnt_size = dest_offset; @@ -1804,15 +1812,15 @@ if ( FT_STREAM_READ_FIELDS( woff2_header_fields, &woff2 ) ) return error; - FT_TRACE4(( "signature -> 0x%X\n", woff2.signature )); + FT_TRACE4(( "signature -> 0x%lX\n", woff2.signature )); FT_TRACE2(( "flavor -> 0x%08lx\n", woff2.flavor )); FT_TRACE4(( "length -> %lu\n", woff2.length )); FT_TRACE2(( "num_tables -> %hu\n", woff2.num_tables )); FT_TRACE4(( "totalSfntSize -> %lu\n", woff2.totalSfntSize )); - FT_TRACE4(( "metaOffset -> %hu\n", woff2.metaOffset )); - FT_TRACE4(( "metaLength -> %hu\n", woff2.metaLength )); - FT_TRACE4(( "privOffset -> %hu\n", woff2.privOffset )); - FT_TRACE4(( "privLength -> %hu\n", woff2.privLength )); + FT_TRACE4(( "metaOffset -> %lu\n", woff2.metaOffset )); + FT_TRACE4(( "metaLength -> %lu\n", woff2.metaLength )); + FT_TRACE4(( "privOffset -> %lu\n", woff2.privOffset )); + FT_TRACE4(( "privLength -> %lu\n", woff2.privLength )); /* Make sure we don't recurse back here. */ if ( woff2.flavor == TTAG_wOF2 ) @@ -1844,9 +1852,11 @@ FT_NEW_ARRAY( indices, woff2.num_tables ) ) goto Exit; - FT_TRACE2(( "\n" - " tag flags transform origLen transformLen\n" - " --------------------------------------------------\n" )); + FT_TRACE2(( + "\n" + " tag flags transform origLen transformLen offset\n" + " -----------------------------------------------------------\n" )); + /* " XXXX XXXXXXXX XXXXXXXX XXXXXXXX XXXXXXXX XXXXXXXX" */ for ( nn = 0; nn < woff2.num_tables; nn++ ) { @@ -1916,7 +1926,7 @@ src_offset += table->TransformLength; table->flags = flags; - FT_TRACE2(( " %c%c%c%c %08d %08d %08ld %08ld\n", + FT_TRACE2(( " %c%c%c%c %08d %08d %08ld %08ld %08ld\n", (FT_Char)( table->Tag >> 24 ), (FT_Char)( table->Tag >> 16 ), (FT_Char)( table->Tag >> 8 ), @@ -1925,7 +1935,6 @@ ( table->FlagByte >> 6 ) & 0x03, table->dst_length, table->TransformLength, - table->src_length, table->src_offset )); indices[nn] = table; @@ -1971,7 +1980,7 @@ goto Exit; } - FT_TRACE4(( "Number of fonts in TTC: %ld\n", woff2.num_fonts )); + FT_TRACE4(( "Number of fonts in TTC: %d\n", woff2.num_fonts )); if ( FT_NEW_ARRAY( woff2.ttc_fonts, woff2.num_fonts ) ) goto Exit; @@ -1989,7 +1998,7 @@ if ( FT_NEW_ARRAY( ttc_font->table_indices, ttc_font->num_tables ) ) goto Exit; - FT_TRACE5(( "Number of tables in font %d: %ld\n", + FT_TRACE5(( "Number of tables in font %d: %d\n", nn, ttc_font->num_tables )); #ifdef FT_DEBUG_LEVEL_TRACE diff --git a/thirdparty/freetype/src/sfnt/sfwoff2.h b/thirdparty/freetype/src/sfnt/sfwoff2.h index 7ae6e2c06d..798f66bd0a 100644 --- a/thirdparty/freetype/src/sfnt/sfwoff2.h +++ b/thirdparty/freetype/src/sfnt/sfwoff2.h @@ -20,9 +20,8 @@ #define SFWOFF2_H_ -#include <ft2build.h> -#include FT_INTERNAL_SFNT_H -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/sfnt.h> +#include <freetype/internal/ftobjs.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttbdf.c b/thirdparty/freetype/src/sfnt/ttbdf.c index bc35284cc8..a287d3afc4 100644 --- a/thirdparty/freetype/src/sfnt/ttbdf.c +++ b/thirdparty/freetype/src/sfnt/ttbdf.c @@ -16,10 +16,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #include "ttbdf.h" #include "sferrors.h" diff --git a/thirdparty/freetype/src/sfnt/ttbdf.h b/thirdparty/freetype/src/sfnt/ttbdf.h index c340f6631d..e60c01cb8b 100644 --- a/thirdparty/freetype/src/sfnt/ttbdf.h +++ b/thirdparty/freetype/src/sfnt/ttbdf.h @@ -20,9 +20,8 @@ #define TTBDF_H_ -#include <ft2build.h> #include "ttload.h" -#include FT_BDF_H +#include <freetype/ftbdf.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttcmap.c b/thirdparty/freetype/src/sfnt/ttcmap.c index 2c34efb5ce..556a712199 100644 --- a/thirdparty/freetype/src/sfnt/ttcmap.c +++ b/thirdparty/freetype/src/sfnt/ttcmap.c @@ -16,14 +16,13 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include "sferrors.h" /* must come before FT_INTERNAL_VALIDATE_H */ +#include "sferrors.h" /* must come before `ftvalid.h' */ -#include FT_INTERNAL_VALIDATE_H -#include FT_INTERNAL_STREAM_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H +#include <freetype/internal/ftvalid.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/services/svpscmap.h> #include "ttload.h" #include "ttcmap.h" #include "ttpost.h" @@ -3752,6 +3751,7 @@ static const TT_CMap_Class tt_cmap_classes[] = { +#undef TTCMAPCITEM #define TTCMAPCITEM( a ) &a, #include "ttcmapc.h" NULL, @@ -3788,8 +3788,9 @@ p += 2; num_cmaps = TT_NEXT_USHORT( p ); - limit = table + face->cmap_size; + FT_TRACE4(( "tt_face_build_cmaps: %d cmaps\n", num_cmaps )); + limit = table + face->cmap_size; for ( ; num_cmaps > 0 && p + 8 <= limit; num_cmaps-- ) { FT_CharMapRec charmap; diff --git a/thirdparty/freetype/src/sfnt/ttcmap.h b/thirdparty/freetype/src/sfnt/ttcmap.h index 4bf49e2d49..c7d7c21d2c 100644 --- a/thirdparty/freetype/src/sfnt/ttcmap.h +++ b/thirdparty/freetype/src/sfnt/ttcmap.h @@ -20,10 +20,9 @@ #define TTCMAP_H_ -#include <ft2build.h> -#include FT_INTERNAL_TRUETYPE_TYPES_H -#include FT_INTERNAL_VALIDATE_H -#include FT_SERVICE_TT_CMAP_H +#include <freetype/internal/tttypes.h> +#include <freetype/internal/ftvalid.h> +#include <freetype/internal/services/svttcmap.h> FT_BEGIN_HEADER @@ -91,6 +90,11 @@ FT_BEGIN_HEADER }; +#undef TTCMAPCITEM +#define TTCMAPCITEM( a ) FT_CALLBACK_TABLE const TT_CMap_ClassRec a; +#include "ttcmapc.h" + + typedef struct TT_ValidatorRec_ { FT_ValidatorRec validator; diff --git a/thirdparty/freetype/src/sfnt/ttcolr.c b/thirdparty/freetype/src/sfnt/ttcolr.c index b37fa7b09a..9025e356ce 100644 --- a/thirdparty/freetype/src/sfnt/ttcolr.c +++ b/thirdparty/freetype/src/sfnt/ttcolr.c @@ -27,11 +27,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H -#include FT_COLOR_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> +#include <freetype/ftcolor.h> #ifdef TT_CONFIG_OPTION_COLOR_LAYERS @@ -40,9 +39,9 @@ /* NOTE: These are the table sizes calculated through the specs. */ -#define BASE_GLYPH_SIZE 6 -#define LAYER_SIZE 4 -#define COLR_HEADER_SIZE 14 +#define BASE_GLYPH_SIZE 6U +#define LAYER_SIZE 4U +#define COLR_HEADER_SIZE 14U typedef struct BaseGlyphRecord_ diff --git a/thirdparty/freetype/src/sfnt/ttcolr.h b/thirdparty/freetype/src/sfnt/ttcolr.h index 8da6b3aa14..6412162669 100644 --- a/thirdparty/freetype/src/sfnt/ttcolr.h +++ b/thirdparty/freetype/src/sfnt/ttcolr.h @@ -22,7 +22,6 @@ #define __TTCOLR_H__ -#include <ft2build.h> #include "ttload.h" diff --git a/thirdparty/freetype/src/sfnt/ttcpal.c b/thirdparty/freetype/src/sfnt/ttcpal.c index 165423e305..9c514bafe5 100644 --- a/thirdparty/freetype/src/sfnt/ttcpal.c +++ b/thirdparty/freetype/src/sfnt/ttcpal.c @@ -27,11 +27,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H -#include FT_COLOR_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> +#include <freetype/ftcolor.h> #ifdef TT_CONFIG_OPTION_COLOR_LAYERS @@ -40,8 +39,8 @@ /* NOTE: These are the table sizes calculated through the specs. */ -#define CPAL_V0_HEADER_BASE_SIZE 12 -#define COLOR_SIZE 4 +#define CPAL_V0_HEADER_BASE_SIZE 12U +#define COLOR_SIZE 4U /* all data from `CPAL' not covered in FT_Palette_Data */ @@ -140,7 +139,7 @@ 3U * 4 > table_size ) goto InvalidTable; - p += face->palette_data.num_palettes * 2; + p += face->palette_data.num_palettes * 2U; type_offset = FT_NEXT_ULONG( p ); label_offset = FT_NEXT_ULONG( p ); @@ -150,7 +149,7 @@ { if ( type_offset >= table_size ) goto InvalidTable; - if ( face->palette_data.num_palettes * 2 > + if ( face->palette_data.num_palettes * 2U > table_size - type_offset ) goto InvalidTable; @@ -171,7 +170,7 @@ { if ( label_offset >= table_size ) goto InvalidTable; - if ( face->palette_data.num_palettes * 2 > + if ( face->palette_data.num_palettes * 2U > table_size - label_offset ) goto InvalidTable; @@ -192,7 +191,7 @@ { if ( entry_label_offset >= table_size ) goto InvalidTable; - if ( face->palette_data.num_palette_entries * 2 > + if ( face->palette_data.num_palette_entries * 2U > table_size - entry_label_offset ) goto InvalidTable; diff --git a/thirdparty/freetype/src/sfnt/ttcpal.h b/thirdparty/freetype/src/sfnt/ttcpal.h index f2e116ba2c..b544be696a 100644 --- a/thirdparty/freetype/src/sfnt/ttcpal.h +++ b/thirdparty/freetype/src/sfnt/ttcpal.h @@ -22,7 +22,6 @@ #define __TTCPAL_H__ -#include <ft2build.h> #include "ttload.h" diff --git a/thirdparty/freetype/src/sfnt/ttkern.c b/thirdparty/freetype/src/sfnt/ttkern.c index 1d34acbd13..d4a70c7855 100644 --- a/thirdparty/freetype/src/sfnt/ttkern.c +++ b/thirdparty/freetype/src/sfnt/ttkern.c @@ -17,10 +17,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #include "ttkern.h" #include "sferrors.h" diff --git a/thirdparty/freetype/src/sfnt/ttkern.h b/thirdparty/freetype/src/sfnt/ttkern.h index 6560a283a6..f44b5bdeb0 100644 --- a/thirdparty/freetype/src/sfnt/ttkern.h +++ b/thirdparty/freetype/src/sfnt/ttkern.h @@ -21,9 +21,8 @@ #define TTKERN_H_ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttload.c b/thirdparty/freetype/src/sfnt/ttload.c index d4e4ee4f10..4b46f41357 100644 --- a/thirdparty/freetype/src/sfnt/ttload.c +++ b/thirdparty/freetype/src/sfnt/ttload.c @@ -17,10 +17,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #include "ttload.h" #include "sferrors.h" @@ -65,8 +64,8 @@ #endif - FT_TRACE4(( "tt_face_lookup_table: %08p, `%c%c%c%c' -- ", - face, + FT_TRACE4(( "tt_face_lookup_table: %p, `%c%c%c%c' -- ", + (void *)face, (FT_Char)( tag >> 24 ), (FT_Char)( tag >> 16 ), (FT_Char)( tag >> 8 ), @@ -363,7 +362,7 @@ }; - FT_TRACE2(( "tt_face_load_font_dir: %08p\n", face )); + FT_TRACE2(( "tt_face_load_font_dir: %p\n", (void *)face )); /* read the offset table */ @@ -1315,7 +1314,7 @@ /* we don't load the glyph names, we do that in another */ /* module (ttpost). */ - FT_TRACE3(( "FormatType: 0x%x\n", post->FormatType )); + FT_TRACE3(( "FormatType: 0x%lx\n", post->FormatType )); FT_TRACE3(( "isFixedPitch: %s\n", post->isFixedPitch ? " yes" : " no" )); diff --git a/thirdparty/freetype/src/sfnt/ttload.h b/thirdparty/freetype/src/sfnt/ttload.h index 49d40655f8..4e53d8b782 100644 --- a/thirdparty/freetype/src/sfnt/ttload.h +++ b/thirdparty/freetype/src/sfnt/ttload.h @@ -21,9 +21,8 @@ #define TTLOAD_H_ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttmtx.c b/thirdparty/freetype/src/sfnt/ttmtx.c index e18ff877ef..021123336e 100644 --- a/thirdparty/freetype/src/sfnt/ttmtx.c +++ b/thirdparty/freetype/src/sfnt/ttmtx.c @@ -16,13 +16,12 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/internal/services/svmetric.h> #endif #include "ttmtx.h" diff --git a/thirdparty/freetype/src/sfnt/ttmtx.h b/thirdparty/freetype/src/sfnt/ttmtx.h index c98c79ec51..dba65ca9ba 100644 --- a/thirdparty/freetype/src/sfnt/ttmtx.h +++ b/thirdparty/freetype/src/sfnt/ttmtx.h @@ -20,9 +20,8 @@ #define TTMTX_H_ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttpost.c b/thirdparty/freetype/src/sfnt/ttpost.c index f7be716219..e93a4bf1b1 100644 --- a/thirdparty/freetype/src/sfnt/ttpost.c +++ b/thirdparty/freetype/src/sfnt/ttpost.c @@ -25,10 +25,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #ifdef TT_CONFIG_OPTION_POSTSCRIPT_NAMES @@ -54,7 +53,7 @@ #ifdef FT_CONFIG_OPTION_POSTSCRIPT_NAMES -#include FT_SERVICE_POSTSCRIPT_CMAPS_H +#include <freetype/internal/services/svpscmap.h> #define MAC_NAME( x ) (FT_String*)psnames->macintosh_name( (FT_UInt)(x) ) @@ -240,7 +239,7 @@ break; else { - FT_TRACE6(( "load_format_20: %d byte left in post table\n", + FT_TRACE6(( "load_format_20: %ld byte left in post table\n", post_limit - FT_STREAM_POS() )); if ( FT_READ_BYTE( len ) ) diff --git a/thirdparty/freetype/src/sfnt/ttpost.h b/thirdparty/freetype/src/sfnt/ttpost.h index 547f2ff843..94c7d16800 100644 --- a/thirdparty/freetype/src/sfnt/ttpost.h +++ b/thirdparty/freetype/src/sfnt/ttpost.h @@ -23,7 +23,7 @@ #include <ft2build.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/sfnt/ttsbit.c b/thirdparty/freetype/src/sfnt/ttsbit.c index 3f8730f7fb..9dd4419710 100644 --- a/thirdparty/freetype/src/sfnt/ttsbit.c +++ b/thirdparty/freetype/src/sfnt/ttsbit.c @@ -19,11 +19,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H -#include FT_BITMAP_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> +#include <freetype/ftbitmap.h> #ifdef TT_CONFIG_OPTION_EMBEDDED_BITMAPS @@ -348,7 +347,7 @@ FT_TRACE2(( "tt_face_load_strike_metrics:" " sanitizing invalid ascender and descender\n" " " - " values for strike %d (%dppem, %dppem)\n", + " values for strike %ld (%dppem, %dppem)\n", strike_index, metrics->x_ppem, metrics->y_ppem )); diff --git a/thirdparty/freetype/src/sfnt/ttsbit.h b/thirdparty/freetype/src/sfnt/ttsbit.h index dfeb886838..b867e43a61 100644 --- a/thirdparty/freetype/src/sfnt/ttsbit.h +++ b/thirdparty/freetype/src/sfnt/ttsbit.h @@ -20,7 +20,6 @@ #define TTSBIT_H_ -#include <ft2build.h> #include "ttload.h" diff --git a/thirdparty/freetype/src/sfnt/woff2tags.c b/thirdparty/freetype/src/sfnt/woff2tags.c index 246f7fa062..fd9f2e6c5d 100644 --- a/thirdparty/freetype/src/sfnt/woff2tags.c +++ b/thirdparty/freetype/src/sfnt/woff2tags.c @@ -16,9 +16,8 @@ */ -#include <ft2build.h> -#include FT_TRUETYPE_TAGS_H - +#include <freetype/tttags.h> +#include "woff2tags.h" /* * Return tag from index in the order given in WOFF2 specification. diff --git a/thirdparty/freetype/src/sfnt/woff2tags.h b/thirdparty/freetype/src/sfnt/woff2tags.h index 13d242e11d..c437c77aa1 100644 --- a/thirdparty/freetype/src/sfnt/woff2tags.h +++ b/thirdparty/freetype/src/sfnt/woff2tags.h @@ -4,7 +4,7 @@ * * WOFFF2 Font table tags (specification). * - * Copyright (C) 1996-2020 by + * Copyright (C) 2019-2020 by * Nikhil Ramakrishnan, David Turner, Robert Wilhelm, and Werner Lemberg. * * This file is part of the FreeType project, and may only be used, @@ -20,8 +20,8 @@ #define WOFF2TAGS_H -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/compiler-macros.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/smooth/ftgrays.c b/thirdparty/freetype/src/smooth/ftgrays.c index 93538331af..681900fd40 100644 --- a/thirdparty/freetype/src/smooth/ftgrays.c +++ b/thirdparty/freetype/src/smooth/ftgrays.c @@ -278,12 +278,11 @@ typedef ptrdiff_t FT_PtrDist; #else /* !STANDALONE_ */ -#include <ft2build.h> #include "ftgrays.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_OUTLINE_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/ftoutln.h> #include "ftsmerrs.h" @@ -1649,7 +1648,7 @@ typedef ptrdiff_t FT_PtrDist; if ( !ras.invalid ) gray_record_cell( RAS_VAR ); - FT_TRACE7(( "band [%d..%d]: %d cell%s\n", + FT_TRACE7(( "band [%d..%d]: %ld cell%s\n", ras.min_ey, ras.max_ey, ras.num_cells, diff --git a/thirdparty/freetype/src/smooth/ftgrays.h b/thirdparty/freetype/src/smooth/ftgrays.h index e10fd039ac..caba632833 100644 --- a/thirdparty/freetype/src/smooth/ftgrays.h +++ b/thirdparty/freetype/src/smooth/ftgrays.h @@ -28,7 +28,7 @@ #include "ftimage.h" #else #include <ft2build.h> -#include FT_IMAGE_H +#include <freetype/ftimage.h> #endif diff --git a/thirdparty/freetype/src/smooth/ftsmerrs.h b/thirdparty/freetype/src/smooth/ftsmerrs.h index 3f8567b0fa..e93f3df9b3 100644 --- a/thirdparty/freetype/src/smooth/ftsmerrs.h +++ b/thirdparty/freetype/src/smooth/ftsmerrs.h @@ -26,7 +26,7 @@ #ifndef FTSMERRS_H_ #define FTSMERRS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX Smooth_Err_ #define FT_ERR_BASE FT_Mod_Err_Smooth -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* FTSMERRS_H_ */ diff --git a/thirdparty/freetype/src/smooth/ftsmooth.c b/thirdparty/freetype/src/smooth/ftsmooth.c index 072045cbc2..5d66bd6fc4 100644 --- a/thirdparty/freetype/src/smooth/ftsmooth.c +++ b/thirdparty/freetype/src/smooth/ftsmooth.c @@ -16,46 +16,15 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_OUTLINE_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ftoutln.h> #include "ftsmooth.h" #include "ftgrays.h" #include "ftsmerrs.h" - /* initialize renderer -- init its raster */ - static FT_Error - ft_smooth_init( FT_Renderer render ) - { - -#ifndef FT_CONFIG_OPTION_SUBPIXEL_RENDERING - - FT_Vector* sub = render->root.library->lcd_geometry; - - - /* set up default subpixel geometry for striped RGB panels. */ - sub[0].x = -21; - sub[0].y = 0; - sub[1].x = 0; - sub[1].y = 0; - sub[2].x = 21; - sub[2].y = 0; - -#elif 0 /* or else, once ClearType patents expire */ - - FT_Library_SetLcdFilter( render->root.library, FT_LCD_FILTER_DEFAULT ); - -#endif - - render->clazz->raster_class->raster_reset( render->raster, NULL, 0 ); - - return 0; - } - - /* sets render-specific mode */ static FT_Error ft_smooth_set_mode( FT_Renderer render, @@ -107,14 +76,359 @@ FT_Outline_Get_CBox( &slot->outline, cbox ); } + typedef struct TOrigin_ + { + unsigned char* origin; /* pixmap origin at the bottom-left */ + int pitch; /* pitch to go down one row */ + + } TOrigin; - /* convert a slot's glyph image into a bitmap */ +#ifndef FT_CONFIG_OPTION_SUBPIXEL_RENDERING + + /* initialize renderer -- init its raster */ static FT_Error - ft_smooth_render_generic( FT_Renderer render, - FT_GlyphSlot slot, - FT_Render_Mode mode, - const FT_Vector* origin, - FT_Render_Mode required_mode ) + ft_smooth_init( FT_Renderer render ) + { + FT_Vector* sub = render->root.library->lcd_geometry; + + + /* set up default subpixel geometry for striped RGB panels. */ + sub[0].x = -21; + sub[0].y = 0; + sub[1].x = 0; + sub[1].y = 0; + sub[2].x = 21; + sub[2].y = 0; + + render->clazz->raster_class->raster_reset( render->raster, NULL, 0 ); + + return 0; + } + + + /* This function writes every third byte in direct rendering mode */ + static void + ft_smooth_lcd_spans( int y, + int count, + const FT_Span* spans, + TOrigin* target ) + { + unsigned char* dst_line = target->origin - y * target->pitch; + unsigned char* dst; + unsigned short w; + + + for ( ; count--; spans++ ) + for ( dst = dst_line + spans->x * 3, w = spans->len; w--; dst += 3 ) + *dst = spans->coverage; + } + + + static FT_Error + ft_smooth_raster_lcd( FT_Renderer render, + FT_Outline* outline, + FT_Bitmap* bitmap ) + { + FT_Error error = FT_Err_Ok; + FT_Vector* sub = render->root.library->lcd_geometry; + FT_Pos x, y; + + FT_Raster_Params params; + TOrigin target; + + + /* Render 3 separate coverage bitmaps, shifting the outline. */ + /* Set up direct rendering to record them on each third byte. */ + params.source = outline; + params.flags = FT_RASTER_FLAG_AA | FT_RASTER_FLAG_DIRECT; + params.gray_spans = (FT_SpanFunc)ft_smooth_lcd_spans; + params.user = ⌖ + + params.clip_box.xMin = 0; + params.clip_box.yMin = 0; + params.clip_box.xMax = bitmap->width; + params.clip_box.yMax = bitmap->rows; + + if ( bitmap->pitch < 0 ) + target.origin = bitmap->buffer; + else + target.origin = bitmap->buffer + + ( bitmap->rows - 1 ) * (unsigned int)bitmap->pitch; + + target.pitch = bitmap->pitch; + + FT_Outline_Translate( outline, + -sub[0].x, + -sub[0].y ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[0].x; + y = sub[0].y; + if ( error ) + goto Exit; + + target.origin++; + FT_Outline_Translate( outline, + sub[0].x - sub[1].x, + sub[0].y - sub[1].y ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[1].x; + y = sub[1].y; + if ( error ) + goto Exit; + + target.origin++; + FT_Outline_Translate( outline, + sub[1].x - sub[2].x, + sub[1].y - sub[2].y ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[2].x; + y = sub[2].y; + + Exit: + FT_Outline_Translate( outline, x, y ); + + return error; + } + + + static FT_Error + ft_smooth_raster_lcdv( FT_Renderer render, + FT_Outline* outline, + FT_Bitmap* bitmap ) + { + FT_Error error = FT_Err_Ok; + int pitch = bitmap->pitch; + FT_Vector* sub = render->root.library->lcd_geometry; + FT_Pos x, y; + + FT_Raster_Params params; + + + params.target = bitmap; + params.source = outline; + params.flags = FT_RASTER_FLAG_AA; + + /* Render 3 separate coverage bitmaps, shifting the outline. */ + /* Notice that the subpixel geometry vectors are rotated. */ + /* Triple the pitch to render on each third row. */ + bitmap->pitch *= 3; + bitmap->rows /= 3; + + FT_Outline_Translate( outline, + -sub[0].y, + sub[0].x ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[0].y; + y = -sub[0].x; + if ( error ) + goto Exit; + + bitmap->buffer += pitch; + FT_Outline_Translate( outline, + sub[0].y - sub[1].y, + sub[1].x - sub[0].x ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[1].y; + y = -sub[1].x; + bitmap->buffer -= pitch; + if ( error ) + goto Exit; + + bitmap->buffer += 2 * pitch; + FT_Outline_Translate( outline, + sub[1].y - sub[2].y, + sub[2].x - sub[1].x ); + error = render->raster_render( render->raster, ¶ms ); + x = sub[2].y; + y = -sub[2].x; + bitmap->buffer -= 2 * pitch; + + Exit: + FT_Outline_Translate( outline, x, y ); + + bitmap->pitch /= 3; + bitmap->rows *= 3; + + return error; + } + +#else /* FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ + + /* initialize renderer -- init its raster */ + static FT_Error + ft_smooth_init( FT_Renderer render ) + { + /* set up default LCD filtering */ + FT_Library_SetLcdFilter( render->root.library, FT_LCD_FILTER_DEFAULT ); + + render->clazz->raster_class->raster_reset( render->raster, NULL, 0 ); + + return 0; + } + + + static FT_Error + ft_smooth_raster_lcd( FT_Renderer render, + FT_Outline* outline, + FT_Bitmap* bitmap ) + { + FT_Error error = FT_Err_Ok; + FT_Vector* points = outline->points; + FT_Vector* points_end = FT_OFFSET( points, outline->n_points ); + FT_Vector* vec; + + FT_Raster_Params params; + + + params.target = bitmap; + params.source = outline; + params.flags = FT_RASTER_FLAG_AA; + + /* implode outline */ + for ( vec = points; vec < points_end; vec++ ) + vec->x *= 3; + + /* render outline into the bitmap */ + error = render->raster_render( render->raster, ¶ms ); + + /* deflate outline */ + for ( vec = points; vec < points_end; vec++ ) + vec->x /= 3; + + return error; + } + + + static FT_Error + ft_smooth_raster_lcdv( FT_Renderer render, + FT_Outline* outline, + FT_Bitmap* bitmap ) + { + FT_Error error = FT_Err_Ok; + FT_Vector* points = outline->points; + FT_Vector* points_end = FT_OFFSET( points, outline->n_points ); + FT_Vector* vec; + + FT_Raster_Params params; + + + params.target = bitmap; + params.source = outline; + params.flags = FT_RASTER_FLAG_AA; + + /* implode outline */ + for ( vec = points; vec < points_end; vec++ ) + vec->y *= 3; + + /* render outline into the bitmap */ + error = render->raster_render( render->raster, ¶ms ); + + /* deflate outline */ + for ( vec = points; vec < points_end; vec++ ) + vec->y /= 3; + + return error; + } + +#endif /* FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ + +/* Oversampling scale to be used in rendering overlaps */ +#define SCALE ( 1 << 2 ) + + /* This function averages inflated spans in direct rendering mode */ + static void + ft_smooth_overlap_spans( int y, + int count, + const FT_Span* spans, + TOrigin* target ) + { + unsigned char* dst = target->origin - ( y / SCALE ) * target->pitch; + unsigned short x; + unsigned int cover, sum; + + + /* When accumulating the oversampled spans we need to assure that */ + /* fully covered pixels are equal to 255 and do not overflow. */ + /* It is important that the SCALE is a power of 2, each subpixel */ + /* cover can also reach a power of 2 after rounding, and the total */ + /* is clamped to 255 when it adds up to 256. */ + for ( ; count--; spans++ ) + { + cover = ( spans->coverage + SCALE * SCALE / 2 ) / ( SCALE * SCALE ); + for ( x = 0; x < spans->len; x++ ) + { + sum = dst[( spans->x + x ) / SCALE] + cover; + dst[( spans->x + x ) / SCALE] = (unsigned char)( sum - ( sum >> 8 ) ); + } + } + } + + + static FT_Error + ft_smooth_raster_overlap( FT_Renderer render, + FT_Outline* outline, + FT_Bitmap* bitmap ) + { + FT_Error error = FT_Err_Ok; + FT_Vector* points = outline->points; + FT_Vector* points_end = FT_OFFSET( points, outline->n_points ); + FT_Vector* vec; + + FT_Raster_Params params; + TOrigin target; + + + /* Reject outlines that are too wide for 16-bit FT_Span. */ + /* Other limits are applied upstream with the same error code. */ + if ( bitmap->width * SCALE > 0x7FFF ) + return FT_THROW( Raster_Overflow ); + + /* Set up direct rendering to average oversampled spans. */ + params.source = outline; + params.flags = FT_RASTER_FLAG_AA | FT_RASTER_FLAG_DIRECT; + params.gray_spans = (FT_SpanFunc)ft_smooth_overlap_spans; + params.user = ⌖ + + params.clip_box.xMin = 0; + params.clip_box.yMin = 0; + params.clip_box.xMax = bitmap->width * SCALE; + params.clip_box.yMax = bitmap->rows * SCALE; + + if ( bitmap->pitch < 0 ) + target.origin = bitmap->buffer; + else + target.origin = bitmap->buffer + + ( bitmap->rows - 1 ) * (unsigned int)bitmap->pitch; + + target.pitch = bitmap->pitch; + + /* inflate outline */ + for ( vec = points; vec < points_end; vec++ ) + { + vec->x *= SCALE; + vec->y *= SCALE; + } + + /* render outline into the bitmap */ + error = render->raster_render( render->raster, ¶ms ); + + /* deflate outline */ + for ( vec = points; vec < points_end; vec++ ) + { + vec->x /= SCALE; + vec->y /= SCALE; + } + + return error; + } + +#undef SCALE + + static FT_Error + ft_smooth_render( FT_Renderer render, + FT_GlyphSlot slot, + FT_Render_Mode mode, + const FT_Vector* origin ) { FT_Error error = FT_Err_Ok; FT_Outline* outline = &slot->outline; @@ -122,10 +436,6 @@ FT_Memory memory = render->root.memory; FT_Pos x_shift = 0; FT_Pos y_shift = 0; - FT_Int hmul = ( mode == FT_RENDER_MODE_LCD ); - FT_Int vmul = ( mode == FT_RENDER_MODE_LCD_V ); - - FT_Raster_Params params; /* check glyph image format */ @@ -136,7 +446,10 @@ } /* check mode */ - if ( mode != required_mode ) + if ( mode != FT_RENDER_MODE_NORMAL && + mode != FT_RENDER_MODE_LIGHT && + mode != FT_RENDER_MODE_LCD && + mode != FT_RENDER_MODE_LCD_V ) { error = FT_THROW( Cannot_Render_Glyph ); goto Exit; @@ -181,188 +494,57 @@ if ( x_shift || y_shift ) FT_Outline_Translate( outline, x_shift, y_shift ); - /* set up parameters */ - params.target = bitmap; - params.source = outline; - params.flags = FT_RASTER_FLAG_AA; - -#ifdef FT_CONFIG_OPTION_SUBPIXEL_RENDERING - - /* implode outline if needed */ + if ( mode == FT_RENDER_MODE_NORMAL || + mode == FT_RENDER_MODE_LIGHT ) { - FT_Vector* points = outline->points; - FT_Vector* points_end = FT_OFFSET( points, outline->n_points ); - FT_Vector* vec; - - - if ( hmul ) - for ( vec = points; vec < points_end; vec++ ) - vec->x *= 3; - - if ( vmul ) - for ( vec = points; vec < points_end; vec++ ) - vec->y *= 3; - } - - /* render outline into the bitmap */ - error = render->raster_render( render->raster, ¶ms ); - - /* deflate outline if needed */ - { - FT_Vector* points = outline->points; - FT_Vector* points_end = FT_OFFSET( points, outline->n_points ); - FT_Vector* vec; + if ( outline->flags & FT_OUTLINE_OVERLAP ) + error = ft_smooth_raster_overlap( render, outline, bitmap ); + else + { + FT_Raster_Params params; - if ( hmul ) - for ( vec = points; vec < points_end; vec++ ) - vec->x /= 3; + params.target = bitmap; + params.source = outline; + params.flags = FT_RASTER_FLAG_AA; - if ( vmul ) - for ( vec = points; vec < points_end; vec++ ) - vec->y /= 3; + error = render->raster_render( render->raster, ¶ms ); + } } - - if ( error ) - goto Exit; - - /* finally apply filtering */ - if ( hmul || vmul ) + else { - FT_Byte* lcd_weights; - FT_Bitmap_LcdFilterFunc lcd_filter_func; + if ( mode == FT_RENDER_MODE_LCD ) + error = ft_smooth_raster_lcd ( render, outline, bitmap ); + else if ( mode == FT_RENDER_MODE_LCD_V ) + error = ft_smooth_raster_lcdv( render, outline, bitmap ); +#ifdef FT_CONFIG_OPTION_SUBPIXEL_RENDERING - /* Per-face LCD filtering takes priority if set up. */ - if ( slot->face && slot->face->internal->lcd_filter_func ) + /* finally apply filtering */ { - lcd_weights = slot->face->internal->lcd_weights; - lcd_filter_func = slot->face->internal->lcd_filter_func; - } - else - { - lcd_weights = slot->library->lcd_weights; - lcd_filter_func = slot->library->lcd_filter_func; - } + FT_Byte* lcd_weights; + FT_Bitmap_LcdFilterFunc lcd_filter_func; - if ( lcd_filter_func ) - lcd_filter_func( bitmap, lcd_weights ); - } - -#else /* !FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ - if ( hmul ) /* lcd */ - { - FT_Byte* line; - FT_Byte* temp = NULL; - FT_UInt i, j; - - unsigned int height = bitmap->rows; - unsigned int width = bitmap->width; - int pitch = bitmap->pitch; - - FT_Vector* sub = slot->library->lcd_geometry; - - - /* Render 3 separate monochrome bitmaps, shifting the outline. */ - width /= 3; - - FT_Outline_Translate( outline, - -sub[0].x, - -sub[0].y ); - error = render->raster_render( render->raster, ¶ms ); - if ( error ) - goto Exit; - - bitmap->buffer += width; - FT_Outline_Translate( outline, - sub[0].x - sub[1].x, - sub[0].y - sub[1].y ); - error = render->raster_render( render->raster, ¶ms ); - bitmap->buffer -= width; - if ( error ) - goto Exit; - - bitmap->buffer += 2 * width; - FT_Outline_Translate( outline, - sub[1].x - sub[2].x, - sub[1].y - sub[2].y ); - error = render->raster_render( render->raster, ¶ms ); - bitmap->buffer -= 2 * width; - if ( error ) - goto Exit; - - x_shift -= sub[2].x; - y_shift -= sub[2].y; - - /* XXX: Rearrange the bytes according to FT_PIXEL_MODE_LCD. */ - /* XXX: It is more efficient to render every third byte above. */ - - if ( FT_ALLOC( temp, (FT_ULong)pitch ) ) - goto Exit; - - for ( i = 0; i < height; i++ ) - { - line = bitmap->buffer + i * (FT_ULong)pitch; - for ( j = 0; j < width; j++ ) + /* Per-face LCD filtering takes priority if set up. */ + if ( slot->face && slot->face->internal->lcd_filter_func ) { - temp[3 * j ] = line[j]; - temp[3 * j + 1] = line[j + width]; - temp[3 * j + 2] = line[j + width + width]; + lcd_weights = slot->face->internal->lcd_weights; + lcd_filter_func = slot->face->internal->lcd_filter_func; } - FT_MEM_COPY( line, temp, pitch ); + else + { + lcd_weights = slot->library->lcd_weights; + lcd_filter_func = slot->library->lcd_filter_func; + } + + if ( lcd_filter_func ) + lcd_filter_func( bitmap, lcd_weights ); } - FT_FREE( temp ); - } - else if ( vmul ) /* lcd_v */ - { - int pitch = bitmap->pitch; - - FT_Vector* sub = slot->library->lcd_geometry; - - - /* Render 3 separate monochrome bitmaps, shifting the outline. */ - /* Notice that the subpixel geometry vectors are rotated. */ - /* Triple the pitch to render on each third row. */ - bitmap->pitch *= 3; - bitmap->rows /= 3; - - FT_Outline_Translate( outline, - -sub[0].y, - sub[0].x ); - error = render->raster_render( render->raster, ¶ms ); - if ( error ) - goto Exit; - - bitmap->buffer += pitch; - FT_Outline_Translate( outline, - sub[0].y - sub[1].y, - sub[1].x - sub[0].x ); - error = render->raster_render( render->raster, ¶ms ); - bitmap->buffer -= pitch; - if ( error ) - goto Exit; - - bitmap->buffer += 2 * pitch; - FT_Outline_Translate( outline, - sub[1].y - sub[2].y, - sub[2].x - sub[1].x ); - error = render->raster_render( render->raster, ¶ms ); - bitmap->buffer -= 2 * pitch; - if ( error ) - goto Exit; - - x_shift -= sub[2].y; - y_shift += sub[2].x; - - bitmap->pitch /= 3; - bitmap->rows *= 3; - } - else /* grayscale */ - error = render->raster_render( render->raster, ¶ms ); +#endif /* FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ -#endif /* !FT_CONFIG_OPTION_SUBPIXEL_RENDERING */ + } Exit: if ( !error ) @@ -383,45 +565,6 @@ } - /* convert a slot's glyph image into a bitmap */ - static FT_Error - ft_smooth_render( FT_Renderer render, - FT_GlyphSlot slot, - FT_Render_Mode mode, - const FT_Vector* origin ) - { - if ( mode == FT_RENDER_MODE_LIGHT ) - mode = FT_RENDER_MODE_NORMAL; - - return ft_smooth_render_generic( render, slot, mode, origin, - FT_RENDER_MODE_NORMAL ); - } - - - /* convert a slot's glyph image into a horizontal LCD bitmap */ - static FT_Error - ft_smooth_render_lcd( FT_Renderer render, - FT_GlyphSlot slot, - FT_Render_Mode mode, - const FT_Vector* origin ) - { - return ft_smooth_render_generic( render, slot, mode, origin, - FT_RENDER_MODE_LCD ); - } - - - /* convert a slot's glyph image into a vertical LCD bitmap */ - static FT_Error - ft_smooth_render_lcd_v( FT_Renderer render, - FT_GlyphSlot slot, - FT_Render_Mode mode, - const FT_Vector* origin ) - { - return ft_smooth_render_generic( render, slot, mode, origin, - FT_RENDER_MODE_LCD_V ); - } - - FT_DEFINE_RENDERER( ft_smooth_renderer_class, @@ -449,58 +592,4 @@ ) - FT_DEFINE_RENDERER( - ft_smooth_lcd_renderer_class, - - FT_MODULE_RENDERER, - sizeof ( FT_RendererRec ), - - "smooth-lcd", - 0x10000L, - 0x20000L, - - NULL, /* module specific interface */ - - (FT_Module_Constructor)ft_smooth_init, /* module_init */ - (FT_Module_Destructor) NULL, /* module_done */ - (FT_Module_Requester) NULL, /* get_interface */ - - FT_GLYPH_FORMAT_OUTLINE, - - (FT_Renderer_RenderFunc) ft_smooth_render_lcd, /* render_glyph */ - (FT_Renderer_TransformFunc)ft_smooth_transform, /* transform_glyph */ - (FT_Renderer_GetCBoxFunc) ft_smooth_get_cbox, /* get_glyph_cbox */ - (FT_Renderer_SetModeFunc) ft_smooth_set_mode, /* set_mode */ - - (FT_Raster_Funcs*)&ft_grays_raster /* raster_class */ - ) - - - FT_DEFINE_RENDERER( - ft_smooth_lcdv_renderer_class, - - FT_MODULE_RENDERER, - sizeof ( FT_RendererRec ), - - "smooth-lcdv", - 0x10000L, - 0x20000L, - - NULL, /* module specific interface */ - - (FT_Module_Constructor)ft_smooth_init, /* module_init */ - (FT_Module_Destructor) NULL, /* module_done */ - (FT_Module_Requester) NULL, /* get_interface */ - - FT_GLYPH_FORMAT_OUTLINE, - - (FT_Renderer_RenderFunc) ft_smooth_render_lcd_v, /* render_glyph */ - (FT_Renderer_TransformFunc)ft_smooth_transform, /* transform_glyph */ - (FT_Renderer_GetCBoxFunc) ft_smooth_get_cbox, /* get_glyph_cbox */ - (FT_Renderer_SetModeFunc) ft_smooth_set_mode, /* set_mode */ - - (FT_Raster_Funcs*)&ft_grays_raster /* raster_class */ - ) - - /* END */ diff --git a/thirdparty/freetype/src/smooth/ftsmooth.h b/thirdparty/freetype/src/smooth/ftsmooth.h index ee5d2ff61d..22a88d54ec 100644 --- a/thirdparty/freetype/src/smooth/ftsmooth.h +++ b/thirdparty/freetype/src/smooth/ftsmooth.h @@ -20,8 +20,7 @@ #define FTSMOOTH_H_ -#include <ft2build.h> -#include FT_RENDER_H +#include <freetype/ftrender.h> FT_BEGIN_HEADER @@ -29,10 +28,6 @@ FT_BEGIN_HEADER FT_DECLARE_RENDERER( ft_smooth_renderer_class ) - FT_DECLARE_RENDERER( ft_smooth_lcd_renderer_class ) - - FT_DECLARE_RENDERER( ft_smooth_lcdv_renderer_class ) - FT_END_HEADER diff --git a/thirdparty/freetype/src/smooth/module.mk b/thirdparty/freetype/src/smooth/module.mk index ad8b47dab6..9b1507f1e0 100644 --- a/thirdparty/freetype/src/smooth/module.mk +++ b/thirdparty/freetype/src/smooth/module.mk @@ -18,10 +18,6 @@ FTMODULE_H_COMMANDS += SMOOTH_RENDERER define SMOOTH_RENDERER $(OPEN_DRIVER) FT_Renderer_Class, ft_smooth_renderer_class $(CLOSE_DRIVER) $(ECHO_DRIVER)smooth $(ECHO_DRIVER_DESC)anti-aliased bitmap renderer$(ECHO_DRIVER_DONE) -$(OPEN_DRIVER) FT_Renderer_Class, ft_smooth_lcd_renderer_class $(CLOSE_DRIVER) -$(ECHO_DRIVER)smooth $(ECHO_DRIVER_DESC)anti-aliased bitmap renderer for LCDs$(ECHO_DRIVER_DONE) -$(OPEN_DRIVER) FT_Renderer_Class, ft_smooth_lcdv_renderer_class $(CLOSE_DRIVER) -$(ECHO_DRIVER)smooth $(ECHO_DRIVER_DESC)anti-aliased bitmap renderer for vertical LCDs$(ECHO_DRIVER_DONE) endef # EOF diff --git a/thirdparty/freetype/src/smooth/smooth.c b/thirdparty/freetype/src/smooth/smooth.c index 6ad9424f01..04b531c087 100644 --- a/thirdparty/freetype/src/smooth/smooth.c +++ b/thirdparty/freetype/src/smooth/smooth.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "ftgrays.c" #include "ftsmooth.c" diff --git a/thirdparty/freetype/src/truetype/truetype.c b/thirdparty/freetype/src/truetype/truetype.c index 1f15b29bb2..41b6808a84 100644 --- a/thirdparty/freetype/src/truetype/truetype.c +++ b/thirdparty/freetype/src/truetype/truetype.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "ttdriver.c" /* driver interface */ #include "ttgload.c" /* glyph loader */ diff --git a/thirdparty/freetype/src/truetype/ttdriver.c b/thirdparty/freetype/src/truetype/ttdriver.c index 90fab46e28..bf830b1418 100644 --- a/thirdparty/freetype/src/truetype/ttdriver.c +++ b/thirdparty/freetype/src/truetype/ttdriver.c @@ -16,22 +16,21 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_SERVICE_FONT_FORMAT_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/internal/services/svfntfmt.h> #ifdef TT_CONFIG_OPTION_GX_VAR_SUPPORT -#include FT_MULTIPLE_MASTERS_H -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_METRICS_VARIATIONS_H +#include <freetype/ftmm.h> +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svmetric.h> #endif -#include FT_SERVICE_TRUETYPE_ENGINE_H -#include FT_SERVICE_TRUETYPE_GLYF_H -#include FT_SERVICE_PROPERTIES_H -#include FT_DRIVER_H +#include <freetype/internal/services/svtteng.h> +#include <freetype/internal/services/svttglyf.h> +#include <freetype/internal/services/svprop.h> +#include <freetype/ftdriver.h> #include "ttdriver.h" #include "ttgload.h" diff --git a/thirdparty/freetype/src/truetype/ttdriver.h b/thirdparty/freetype/src/truetype/ttdriver.h index d1cfa47c8b..ee1438eb6e 100644 --- a/thirdparty/freetype/src/truetype/ttdriver.h +++ b/thirdparty/freetype/src/truetype/ttdriver.h @@ -20,8 +20,7 @@ #define TTDRIVER_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/truetype/tterrors.h b/thirdparty/freetype/src/truetype/tterrors.h index 71d66023cd..efeafd3a1b 100644 --- a/thirdparty/freetype/src/truetype/tterrors.h +++ b/thirdparty/freetype/src/truetype/tterrors.h @@ -26,7 +26,7 @@ #ifndef TTERRORS_H_ #define TTERRORS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX TT_Err_ #define FT_ERR_BASE FT_Mod_Err_TrueType -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* TTERRORS_H_ */ diff --git a/thirdparty/freetype/src/truetype/ttgload.c b/thirdparty/freetype/src/truetype/ttgload.c index 2a1742839a..1dd319dcbf 100644 --- a/thirdparty/freetype/src/truetype/ttgload.c +++ b/thirdparty/freetype/src/truetype/ttgload.c @@ -17,15 +17,15 @@ #include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_TRUETYPE_TAGS_H -#include FT_OUTLINE_H -#include FT_DRIVER_H -#include FT_LIST_H +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/tttags.h> +#include <freetype/ftoutln.h> +#include <freetype/ftdriver.h> +#include <freetype/ftlist.h> #include "ttgload.h" #include "ttpload.h" @@ -60,7 +60,7 @@ #define SAME_X 0x10 #define Y_POSITIVE 0x20 /* two meanings depending on Y_SHORT_VECTOR */ #define SAME_Y 0x20 -#define OVERLAP_SIMPLE 0x40 /* we ignore this value */ +#define OVERLAP_SIMPLE 0x40 /* retained as FT_OUTLINE_OVERLAP */ /************************************************************************** @@ -77,7 +77,7 @@ #define WE_HAVE_A_2X2 0x0080 #define WE_HAVE_INSTR 0x0100 #define USE_MY_METRICS 0x0200 -#define OVERLAP_COMPOUND 0x0400 /* we ignore this value */ +#define OVERLAP_COMPOUND 0x0400 /* retained as FT_OUTLINE_OVERLAP */ #define SCALED_COMPONENT_OFFSET 0x0800 #define UNSCALED_COMPONENT_OFFSET 0x1000 @@ -137,6 +137,11 @@ face->horizontal.Descender ); } +#ifdef FT_DEBUG_LEVEL_TRACE + if ( !face->vertical_info ) + FT_TRACE5(( " [vertical metrics missing, computing values]\n" )); +#endif + FT_TRACE5(( " advance height (font units): %d\n", *ah )); FT_TRACE5(( " top side bearing (font units): %d\n", *tsb )); } @@ -333,9 +338,9 @@ loader->bbox.yMax = FT_NEXT_SHORT( p ); FT_TRACE5(( " # of contours: %d\n", loader->n_contours )); - FT_TRACE5(( " xMin: %4d xMax: %4d\n", loader->bbox.xMin, + FT_TRACE5(( " xMin: %4ld xMax: %4ld\n", loader->bbox.xMin, loader->bbox.xMax )); - FT_TRACE5(( " yMin: %4d yMax: %4d\n", loader->bbox.yMin, + FT_TRACE5(( " yMin: %4ld yMax: %4ld\n", loader->bbox.yMin, loader->bbox.yMax )); loader->cursor = p; @@ -489,6 +494,10 @@ } } + /* retain the overlap flag */ + if ( n_points && outline->tags[0] & OVERLAP_SIMPLE ) + gloader->base.outline.flags |= FT_OUTLINE_OVERLAP; + /* reading the X coordinates */ vec = outline->points; @@ -2183,6 +2192,11 @@ goto Exit; } } + + /* retain the overlap flag */ + if ( gloader->base.num_subglyphs && + gloader->base.subglyphs[0].flags & OVERLAP_COMPOUND ) + gloader->base.outline.flags |= FT_OUTLINE_OVERLAP; } /***********************************************************************/ @@ -2981,8 +2995,6 @@ error = compute_glyph_metrics( &loader, glyph_index ); } - tt_loader_done( &loader ); - /* Set the `high precision' bit flag. */ /* This is _critical_ to get correct output for monochrome */ /* TrueType glyphs at all sizes using the bytecode interpreter. */ @@ -2991,6 +3003,15 @@ size->metrics->y_ppem < 24 ) glyph->outline.flags |= FT_OUTLINE_HIGH_PRECISION; + FT_TRACE1(( " subglyphs = %u, contours = %hd, points = %hd," + " flags = 0x%.3x\n", + loader.gloader->base.num_subglyphs, + glyph->outline.n_contours, + glyph->outline.n_points, + glyph->outline.flags )); + + tt_loader_done( &loader ); + Exit: #ifdef FT_DEBUG_LEVEL_TRACE if ( error ) diff --git a/thirdparty/freetype/src/truetype/ttgload.h b/thirdparty/freetype/src/truetype/ttgload.h index 9a8c3e71dd..8f72cd558c 100644 --- a/thirdparty/freetype/src/truetype/ttgload.h +++ b/thirdparty/freetype/src/truetype/ttgload.h @@ -20,7 +20,6 @@ #define TTGLOAD_H_ -#include <ft2build.h> #include "ttobjs.h" #ifdef TT_USE_BYTECODE_INTERPRETER diff --git a/thirdparty/freetype/src/truetype/ttgxvar.c b/thirdparty/freetype/src/truetype/ttgxvar.c index 110f24a116..b462263de1 100644 --- a/thirdparty/freetype/src/truetype/ttgxvar.c +++ b/thirdparty/freetype/src/truetype/ttgxvar.c @@ -40,14 +40,14 @@ #include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_TRUETYPE_TAGS_H -#include FT_TRUETYPE_IDS_H -#include FT_MULTIPLE_MASTERS_H -#include FT_LIST_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/tttags.h> +#include <freetype/ttnameid.h> +#include <freetype/ftmm.h> +#include <freetype/ftlist.h> #include "ttpload.h" #include "ttgxvar.h" @@ -1729,7 +1729,7 @@ if ( tuple_coords[i] == 0 ) { - FT_TRACE6(( " tuple coordinate is zero, ignore\n", i )); + FT_TRACE6(( " tuple coordinate is zero, ignore\n" )); continue; } diff --git a/thirdparty/freetype/src/truetype/ttgxvar.h b/thirdparty/freetype/src/truetype/ttgxvar.h index 11664e997a..26e89bcf74 100644 --- a/thirdparty/freetype/src/truetype/ttgxvar.h +++ b/thirdparty/freetype/src/truetype/ttgxvar.h @@ -20,7 +20,6 @@ #define TTGXVAR_H_ -#include <ft2build.h> #include "ttobjs.h" diff --git a/thirdparty/freetype/src/truetype/ttinterp.c b/thirdparty/freetype/src/truetype/ttinterp.c index 3215040970..0c3cb10ae8 100644 --- a/thirdparty/freetype/src/truetype/ttinterp.c +++ b/thirdparty/freetype/src/truetype/ttinterp.c @@ -20,13 +20,12 @@ /* issues; many thanks! */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_TRIGONOMETRY_H -#include FT_SYSTEM_H -#include FT_DRIVER_H -#include FT_MULTIPLE_MASTERS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/fttrigon.h> +#include <freetype/ftsystem.h> +#include <freetype/ftdriver.h> +#include <freetype/ftmm.h> #include "ttinterp.h" #include "tterrors.h" @@ -294,7 +293,7 @@ FT_Error error; - FT_TRACE1(( "Init_Context: new object at 0x%08p\n", exec )); + FT_TRACE1(( "Init_Context: new object at %p\n", (void *)exec )); exec->memory = memory; exec->callSize = 32; @@ -319,7 +318,7 @@ return FT_Err_Ok; Fail_Memory: - FT_ERROR(( "Init_Context: not enough memory for %p\n", exec )); + FT_ERROR(( "Init_Context: not enough memory for %p\n", (void *)exec )); TT_Done_Context( exec ); return error; @@ -1956,8 +1955,8 @@ * distance :: * The distance (not) to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * The compensated distance. @@ -1965,12 +1964,11 @@ static FT_F26Dot6 Round_None( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2000,8 +1998,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2009,12 +2007,11 @@ static FT_F26Dot6 Round_To_Grid( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2046,8 +2043,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2055,12 +2052,11 @@ static FT_F26Dot6 Round_To_Half_Grid( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2094,8 +2090,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2103,12 +2099,11 @@ static FT_F26Dot6 Round_Down_To_Grid( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2139,8 +2134,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2148,12 +2143,11 @@ static FT_F26Dot6 Round_Up_To_Grid( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2185,8 +2179,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2194,12 +2188,11 @@ static FT_F26Dot6 Round_To_Double_Grid( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; - FT_UNUSED( exc ); - if ( distance >= 0 ) { @@ -2231,8 +2224,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2246,8 +2239,9 @@ static FT_F26Dot6 Round_Super( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; @@ -2286,8 +2280,8 @@ * distance :: * The distance to round. * - * compensation :: - * The engine compensation. + * color :: + * The engine compensation color. * * @Return: * Rounded distance. @@ -2299,8 +2293,9 @@ static FT_F26Dot6 Round_Super_45( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ) + FT_Int color ) { + FT_F26Dot6 compensation = exc->tt_metrics.compensations[color]; FT_F26Dot6 val; @@ -2899,7 +2894,7 @@ Ins_ODD( TT_ExecContext exc, FT_Long* args ) { - args[0] = ( ( exc->func_round( exc, args[0], 0 ) & 127 ) == 64 ); + args[0] = ( ( exc->func_round( exc, args[0], 3 ) & 127 ) == 64 ); } @@ -2913,7 +2908,7 @@ Ins_EVEN( TT_ExecContext exc, FT_Long* args ) { - args[0] = ( ( exc->func_round( exc, args[0], 0 ) & 127 ) == 0 ); + args[0] = ( ( exc->func_round( exc, args[0], 3 ) & 127 ) == 0 ); } @@ -3243,10 +3238,7 @@ Ins_ROUND( TT_ExecContext exc, FT_Long* args ) { - args[0] = exc->func_round( - exc, - args[0], - exc->tt_metrics.compensations[exc->opcode - 0x68] ); + args[0] = exc->func_round( exc, args[0], exc->opcode & 3 ); } @@ -3260,10 +3252,7 @@ Ins_NROUND( TT_ExecContext exc, FT_Long* args ) { - args[0] = Round_None( - exc, - args[0], - exc->tt_metrics.compensations[exc->opcode - 0x6C] ); + args[0] = Round_None( exc, args[0], exc->opcode & 3 ); } @@ -5733,9 +5722,6 @@ { FT_F26Dot6 dx, dy; FT_UShort point; -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - FT_Int B1, B2; -#endif #ifdef TT_SUPPORT_SUBPIXEL_HINTING_MINIMAL FT_Bool in_twilight = FT_BOOL( exc->GS.gep0 == 0 || exc->GS.gep1 == 0 || @@ -5770,8 +5756,12 @@ } else #ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY ) + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode ) { + FT_Int B1, B2; + + /* If not using ignore_x_mode rendering, allow ZP2 move. */ /* If inline deltas aren't allowed, skip ZP2 move. */ /* If using ignore_x_mode rendering, allow ZP2 point move if: */ @@ -5780,72 +5770,57 @@ /* - the glyph is specifically set to allow SHPIX moves */ /* - the move is on a previously Y-touched point */ - if ( exc->ignore_x_mode ) + /* save point for later comparison */ + B1 = exc->zp2.cur[point].y; + + if ( exc->face->sph_compatibility_mode ) { - /* save point for later comparison */ + if ( exc->sph_tweak_flags & SPH_TWEAK_ROUND_NONPIXEL_Y_MOVES ) + dy = FT_PIX_ROUND( B1 + dy ) - B1; + + /* skip post-iup deltas */ + if ( exc->iup_called && + ( ( exc->sph_in_func_flags & SPH_FDEF_INLINE_DELTA_1 ) || + ( exc->sph_in_func_flags & SPH_FDEF_INLINE_DELTA_2 ) ) ) + goto Skip; + + if ( !( exc->sph_tweak_flags & SPH_TWEAK_ALWAYS_SKIP_DELTAP ) && + ( ( exc->is_composite && exc->GS.freeVector.y != 0 ) || + ( exc->zp2.tags[point] & FT_CURVE_TAG_TOUCH_Y ) || + ( exc->sph_tweak_flags & SPH_TWEAK_DO_SHPIX ) ) ) + Move_Zp2_Point( exc, point, 0, dy, TRUE ); + + /* save new point */ if ( exc->GS.freeVector.y != 0 ) - B1 = exc->zp2.cur[point].y; - else - B1 = exc->zp2.cur[point].x; - - if ( !exc->face->sph_compatibility_mode && - exc->GS.freeVector.y != 0 ) { - Move_Zp2_Point( exc, point, dx, dy, TRUE ); + B2 = exc->zp2.cur[point].y; - /* save new point */ - if ( exc->GS.freeVector.y != 0 ) - { - B2 = exc->zp2.cur[point].y; - - /* reverse any disallowed moves */ - if ( ( exc->sph_tweak_flags & SPH_TWEAK_SKIP_NONPIXEL_Y_MOVES ) && - ( B1 & 63 ) != 0 && - ( B2 & 63 ) != 0 && - B1 != B2 ) - Move_Zp2_Point( exc, - point, - NEG_LONG( dx ), - NEG_LONG( dy ), - TRUE ); - } + /* reverse any disallowed moves */ + if ( ( B1 & 63 ) == 0 && + ( B2 & 63 ) != 0 && + B1 != B2 ) + Move_Zp2_Point( exc, point, 0, NEG_LONG( dy ), TRUE ); } - else if ( exc->face->sph_compatibility_mode ) - { - if ( exc->sph_tweak_flags & SPH_TWEAK_ROUND_NONPIXEL_Y_MOVES ) - { - dx = FT_PIX_ROUND( B1 + dx ) - B1; - dy = FT_PIX_ROUND( B1 + dy ) - B1; - } - - /* skip post-iup deltas */ - if ( exc->iup_called && - ( ( exc->sph_in_func_flags & SPH_FDEF_INLINE_DELTA_1 ) || - ( exc->sph_in_func_flags & SPH_FDEF_INLINE_DELTA_2 ) ) ) - goto Skip; - - if ( !( exc->sph_tweak_flags & SPH_TWEAK_ALWAYS_SKIP_DELTAP ) && - ( ( exc->is_composite && exc->GS.freeVector.y != 0 ) || - ( exc->zp2.tags[point] & FT_CURVE_TAG_TOUCH_Y ) || - ( exc->sph_tweak_flags & SPH_TWEAK_DO_SHPIX ) ) ) - Move_Zp2_Point( exc, point, 0, dy, TRUE ); - - /* save new point */ - if ( exc->GS.freeVector.y != 0 ) - { - B2 = exc->zp2.cur[point].y; + } + else if ( exc->GS.freeVector.y != 0 ) + { + Move_Zp2_Point( exc, point, dx, dy, TRUE ); - /* reverse any disallowed moves */ - if ( ( B1 & 63 ) == 0 && - ( B2 & 63 ) != 0 && - B1 != B2 ) - Move_Zp2_Point( exc, point, 0, NEG_LONG( dy ), TRUE ); - } - } - else if ( exc->sph_in_func_flags & SPH_FDEF_TYPEMAN_DIAGENDCTRL ) - Move_Zp2_Point( exc, point, dx, dy, TRUE ); + /* save new point */ + B2 = exc->zp2.cur[point].y; + + /* reverse any disallowed moves */ + if ( ( exc->sph_tweak_flags & SPH_TWEAK_SKIP_NONPIXEL_Y_MOVES ) && + ( B1 & 63 ) != 0 && + ( B2 & 63 ) != 0 && + B1 != B2 ) + Move_Zp2_Point( exc, + point, + NEG_LONG( dx ), + NEG_LONG( dy ), + TRUE ); } - else + else if ( exc->sph_in_func_flags & SPH_FDEF_TYPEMAN_DIAGENDCTRL ) Move_Zp2_Point( exc, point, dx, dy, TRUE ); } else @@ -5893,22 +5868,8 @@ { FT_UShort point = 0; FT_F26Dot6 distance; -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - FT_F26Dot6 control_value_cutin = 0; - FT_F26Dot6 delta; - if ( SUBPIXEL_HINTING_INFINALITY ) - { - control_value_cutin = exc->GS.control_value_cutin; - - if ( exc->ignore_x_mode && - exc->GS.freeVector.x != 0 && - !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) - control_value_cutin = 0; - } -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ - point = (FT_UShort)args[0]; if ( BOUNDS( point, exc->zp1.n_points ) || @@ -5931,16 +5892,25 @@ distance = PROJECT( exc->zp1.cur + point, exc->zp0.cur + exc->GS.rp0 ); #ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - delta = SUB_LONG( distance, args[1] ); - if ( delta < 0 ) - delta = NEG_LONG( delta ); - /* subpixel hinting - make MSIRP respect CVT cut-in; */ - if ( SUBPIXEL_HINTING_INFINALITY && - exc->ignore_x_mode && - exc->GS.freeVector.x != 0 && - delta >= control_value_cutin ) - distance = args[1]; + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode && + exc->GS.freeVector.x != 0 ) + { + FT_F26Dot6 control_value_cutin = exc->GS.control_value_cutin; + FT_F26Dot6 delta; + + + if ( !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) + control_value_cutin = 0; + + delta = SUB_LONG( distance, args[1] ); + if ( delta < 0 ) + delta = NEG_LONG( delta ); + + if ( delta >= control_value_cutin ) + distance = args[1]; + } #endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ exc->func_move( exc, @@ -5987,18 +5957,10 @@ if ( SUBPIXEL_HINTING_INFINALITY && exc->ignore_x_mode && exc->GS.freeVector.x != 0 ) - distance = SUB_LONG( - Round_None( exc, - cur_dist, - exc->tt_metrics.compensations[0] ), - cur_dist ); + distance = SUB_LONG( Round_None( exc, cur_dist, 3 ), cur_dist ); else #endif - distance = SUB_LONG( - exc->func_round( exc, - cur_dist, - exc->tt_metrics.compensations[0] ), - cur_dist ); + distance = SUB_LONG( exc->func_round( exc, cur_dist, 3 ), cur_dist ); } else distance = 0; @@ -6024,21 +5986,10 @@ FT_UShort point; FT_F26Dot6 distance; FT_F26Dot6 org_dist; - FT_F26Dot6 control_value_cutin; - - control_value_cutin = exc->GS.control_value_cutin; - cvtEntry = (FT_ULong)args[1]; - point = (FT_UShort)args[0]; -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY && - exc->ignore_x_mode && - exc->GS.freeVector.x != 0 && - exc->GS.freeVector.y == 0 && - !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) - control_value_cutin = 0; -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + cvtEntry = (FT_ULong)args[1]; + point = (FT_UShort)args[0]; if ( BOUNDS( point, exc->zp0.n_points ) || BOUNDSL( cvtEntry, exc->cvtSize ) ) @@ -6082,7 +6033,7 @@ exc->zp0.org[point].x = TT_MulFix14( distance, exc->GS.freeVector.x ); exc->zp0.org[point].y = TT_MulFix14( distance, - exc->GS.freeVector.y ), + exc->GS.freeVector.y ); exc->zp0.cur[point] = exc->zp0.org[point]; } #ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY @@ -6098,9 +6049,19 @@ if ( ( exc->opcode & 1 ) != 0 ) /* rounding and control cut-in flag */ { + FT_F26Dot6 control_value_cutin = exc->GS.control_value_cutin; FT_F26Dot6 delta; +#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode && + exc->GS.freeVector.x != 0 && + exc->GS.freeVector.y == 0 && + !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) + control_value_cutin = 0; +#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + delta = SUB_LONG( distance, org_dist ); if ( delta < 0 ) delta = NEG_LONG( delta ); @@ -6112,14 +6073,10 @@ if ( SUBPIXEL_HINTING_INFINALITY && exc->ignore_x_mode && exc->GS.freeVector.x != 0 ) - distance = Round_None( exc, - distance, - exc->tt_metrics.compensations[0] ); + distance = Round_None( exc, distance, 3 ); else #endif - distance = exc->func_round( exc, - distance, - exc->tt_metrics.compensations[0] ); + distance = exc->func_round( exc, distance, 3 ); } exc->func_move( exc, &exc->zp0, point, SUB_LONG( distance, org_dist ) ); @@ -6141,18 +6098,8 @@ FT_Long* args ) { FT_UShort point = 0; - FT_F26Dot6 org_dist, distance, minimum_distance; - + FT_F26Dot6 org_dist, distance; - minimum_distance = exc->GS.minimum_distance; - -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY && - exc->ignore_x_mode && - exc->GS.freeVector.x != 0 && - !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) - minimum_distance = 0; -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ point = (FT_UShort)args[0]; @@ -6226,27 +6173,29 @@ if ( SUBPIXEL_HINTING_INFINALITY && exc->ignore_x_mode && exc->GS.freeVector.x != 0 ) - distance = Round_None( - exc, - org_dist, - exc->tt_metrics.compensations[exc->opcode & 3] ); + distance = Round_None( exc, org_dist, exc->opcode & 3 ); else #endif - distance = exc->func_round( - exc, - org_dist, - exc->tt_metrics.compensations[exc->opcode & 3] ); + distance = exc->func_round( exc, org_dist, exc->opcode & 3 ); } else - distance = Round_None( - exc, - org_dist, - exc->tt_metrics.compensations[exc->opcode & 3] ); + distance = Round_None( exc, org_dist, exc->opcode & 3 ); /* minimum distance flag */ if ( ( exc->opcode & 8 ) != 0 ) { + FT_F26Dot6 minimum_distance = exc->GS.minimum_distance; + + +#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode && + exc->GS.freeVector.x != 0 && + !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) + minimum_distance = 0; +#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + if ( org_dist >= 0 ) { if ( distance < minimum_distance ) @@ -6290,30 +6239,13 @@ FT_F26Dot6 cvt_dist, distance, cur_dist, - org_dist, - control_value_cutin, - minimum_distance; -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - FT_Int B1 = 0; /* pacify compiler */ - FT_Int B2 = 0; - FT_Bool reverse_move = FALSE; -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + org_dist; FT_F26Dot6 delta; - minimum_distance = exc->GS.minimum_distance; - control_value_cutin = exc->GS.control_value_cutin; - point = (FT_UShort)args[0]; - cvtEntry = (FT_ULong)( ADD_LONG( args[1], 1 ) ); - -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY && - exc->ignore_x_mode && - exc->GS.freeVector.x != 0 && - !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) - control_value_cutin = minimum_distance = 0; -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + point = (FT_UShort)args[0]; + cvtEntry = (FT_ULong)( ADD_LONG( args[1], 1 ) ); /* XXX: UNDOCUMENTED! cvt[-1] = 0 always */ @@ -6371,19 +6303,6 @@ cvt_dist = NEG_LONG( cvt_dist ); } -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY && - exc->ignore_x_mode && - exc->GS.freeVector.y != 0 && - ( exc->sph_tweak_flags & SPH_TWEAK_TIMES_NEW_ROMAN_HACK ) ) - { - if ( cur_dist < -64 ) - cvt_dist -= 16; - else if ( cur_dist > 64 && cur_dist < 84 ) - cvt_dist += 32; - } -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ - /* control value cut-in and round */ if ( ( exc->opcode & 4 ) != 0 ) @@ -6393,6 +6312,9 @@ if ( exc->GS.gep0 == exc->GS.gep1 ) { + FT_F26Dot6 control_value_cutin = exc->GS.control_value_cutin; + + /* XXX: According to Greg Hitchcock, the following wording is */ /* the right one: */ /* */ @@ -6413,10 +6335,7 @@ cvt_dist = org_dist; } - distance = exc->func_round( - exc, - cvt_dist, - exc->tt_metrics.compensations[exc->opcode & 3] ); + distance = exc->func_round( exc, cvt_dist, exc->opcode & 3 ); } else { @@ -6427,6 +6346,22 @@ exc->ignore_x_mode && exc->GS.gep0 == exc->GS.gep1 ) { + FT_F26Dot6 control_value_cutin = exc->GS.control_value_cutin; + + + if ( exc->GS.freeVector.x != 0 && + !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) + control_value_cutin = 0; + + if ( exc->GS.freeVector.y != 0 && + ( exc->sph_tweak_flags & SPH_TWEAK_TIMES_NEW_ROMAN_HACK ) ) + { + if ( cur_dist < -64 ) + cvt_dist -= 16; + else if ( cur_dist > 64 && cur_dist < 84 ) + cvt_dist += 32; + } + delta = SUB_LONG( cvt_dist, org_dist ); if ( delta < 0 ) delta = NEG_LONG( delta ); @@ -6436,16 +6371,24 @@ } #endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ - distance = Round_None( - exc, - cvt_dist, - exc->tt_metrics.compensations[exc->opcode & 3] ); + distance = Round_None( exc, cvt_dist, exc->opcode & 3 ); } /* minimum distance test */ if ( ( exc->opcode & 8 ) != 0 ) { + FT_F26Dot6 minimum_distance = exc->GS.minimum_distance; + + +#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode && + exc->GS.freeVector.x != 0 && + !( exc->sph_tweak_flags & SPH_TWEAK_NORMAL_ROUND ) ) + minimum_distance = 0; +#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + if ( org_dist >= 0 ) { if ( distance < minimum_distance ) @@ -6459,60 +6402,51 @@ } #ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY ) + if ( SUBPIXEL_HINTING_INFINALITY && + exc->ignore_x_mode && + exc->GS.freeVector.y != 0 ) { + FT_Int B1, B2; + + B1 = exc->zp1.cur[point].y; /* Round moves if necessary */ - if ( exc->ignore_x_mode && - exc->GS.freeVector.y != 0 && - ( exc->sph_tweak_flags & SPH_TWEAK_ROUND_NONPIXEL_Y_MOVES ) ) + if ( exc->sph_tweak_flags & SPH_TWEAK_ROUND_NONPIXEL_Y_MOVES ) distance = FT_PIX_ROUND( B1 + distance - cur_dist ) - B1 + cur_dist; - if ( exc->ignore_x_mode && - exc->GS.freeVector.y != 0 && - ( exc->opcode & 16 ) == 0 && + if ( ( exc->opcode & 16 ) == 0 && ( exc->opcode & 8 ) == 0 && ( exc->sph_tweak_flags & SPH_TWEAK_COURIER_NEW_2_HACK ) ) distance += 64; - } -#endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ - exc->func_move( exc, - &exc->zp1, - point, - SUB_LONG( distance, cur_dist ) ); + exc->func_move( exc, + &exc->zp1, + point, + SUB_LONG( distance, cur_dist ) ); -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - if ( SUBPIXEL_HINTING_INFINALITY ) - { B2 = exc->zp1.cur[point].y; /* Reverse move if necessary */ - if ( exc->ignore_x_mode ) - { - if ( exc->face->sph_compatibility_mode && - exc->GS.freeVector.y != 0 && + if ( ( exc->face->sph_compatibility_mode && ( B1 & 63 ) == 0 && - ( B2 & 63 ) != 0 ) - reverse_move = TRUE; - - if ( ( exc->sph_tweak_flags & SPH_TWEAK_SKIP_NONPIXEL_Y_MOVES ) && - exc->GS.freeVector.y != 0 && - ( B2 & 63 ) != 0 && - ( B1 & 63 ) != 0 ) - reverse_move = TRUE; - } - - if ( reverse_move ) + ( B2 & 63 ) != 0 ) || + ( ( exc->sph_tweak_flags & SPH_TWEAK_SKIP_NONPIXEL_Y_MOVES ) && + ( B1 & 63 ) != 0 && + ( B2 & 63 ) != 0 ) ) exc->func_move( exc, &exc->zp1, point, SUB_LONG( cur_dist, distance ) ); } - + else #endif /* TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY */ + exc->func_move( exc, + &exc->zp1, + point, + SUB_LONG( distance, cur_dist ) ); + Fail: exc->GS.rp1 = exc->GS.rp0; @@ -7185,10 +7119,9 @@ FT_UShort A; FT_ULong C, P; FT_Long B; -#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY - FT_UShort B1, B2; +#ifdef TT_SUPPORT_SUBPIXEL_HINTING_INFINALITY if ( SUBPIXEL_HINTING_INFINALITY && exc->ignore_x_mode && exc->iup_called && @@ -7269,6 +7202,9 @@ /* rules, always skipping deltas in subpixel direction. */ else if ( exc->ignore_x_mode && exc->GS.freeVector.y != 0 ) { + FT_UShort B1, B2; + + /* save the y value of the point now; compare after move */ B1 = (FT_UShort)exc->zp0.cur[A].y; @@ -7846,7 +7782,7 @@ num_twilight_points = 0xFFFFU; FT_TRACE5(( "TT_RunIns: Resetting number of twilight points\n" - " from %d to the more reasonable value %d\n", + " from %d to the more reasonable value %ld\n", exc->twilight.n_points, num_twilight_points )); exc->twilight.n_points = (FT_UShort)num_twilight_points; @@ -7881,11 +7817,11 @@ exc->loopcall_counter_max = 100 * (FT_ULong)exc->face->root.num_glyphs; FT_TRACE5(( "TT_RunIns: Limiting total number of loops in LOOPCALL" - " to %d\n", exc->loopcall_counter_max )); + " to %ld\n", exc->loopcall_counter_max )); exc->neg_jump_counter_max = exc->loopcall_counter_max; FT_TRACE5(( "TT_RunIns: Limiting total number of backward jumps" - " to %d\n", exc->neg_jump_counter_max )); + " to %ld\n", exc->neg_jump_counter_max )); /* set PPEM and CVT functions */ exc->tt_metrics.ratio = 0; @@ -7922,14 +7858,14 @@ /* if tracing level is 7, show current code position */ /* and the first few stack elements also */ FT_TRACE6(( " " )); - FT_TRACE7(( "%06d ", exc->IP )); + FT_TRACE7(( "%06ld ", exc->IP )); FT_TRACE6(( "%s", opcode_name[exc->opcode] + 2 )); FT_TRACE7(( "%*s", *opcode_name[exc->opcode] == 'A' ? 2 : 12 - ( *opcode_name[exc->opcode] - '0' ), "#" )); for ( n = 1; n <= cnt; n++ ) - FT_TRACE7(( " %d", exc->stack[exc->top - n] )); + FT_TRACE7(( " %ld", exc->stack[exc->top - n] )); FT_TRACE6(( "\n" )); } #endif /* FT_DEBUG_LEVEL_TRACE */ @@ -8647,7 +8583,7 @@ } while ( !exc->instruction_trap ); LNo_Error_: - FT_TRACE4(( " %d instruction%s executed\n", + FT_TRACE4(( " %ld instruction%s executed\n", ins_counter, ins_counter == 1 ? "" : "s" )); return FT_Err_Ok; diff --git a/thirdparty/freetype/src/truetype/ttinterp.h b/thirdparty/freetype/src/truetype/ttinterp.h index 07e4ad6891..6a83705a6c 100644 --- a/thirdparty/freetype/src/truetype/ttinterp.h +++ b/thirdparty/freetype/src/truetype/ttinterp.h @@ -19,7 +19,6 @@ #ifndef TTINTERP_H_ #define TTINTERP_H_ -#include <ft2build.h> #include "ttobjs.h" @@ -52,7 +51,7 @@ FT_BEGIN_HEADER typedef FT_F26Dot6 (*TT_Round_Func)( TT_ExecContext exc, FT_F26Dot6 distance, - FT_F26Dot6 compensation ); + FT_Int color ); /* Point displacement along the freedom vector routine */ typedef void diff --git a/thirdparty/freetype/src/truetype/ttobjs.c b/thirdparty/freetype/src/truetype/ttobjs.c index 730a5b8cdf..06d4569559 100644 --- a/thirdparty/freetype/src/truetype/ttobjs.c +++ b/thirdparty/freetype/src/truetype/ttobjs.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H -#include FT_INTERNAL_SFNT_H -#include FT_DRIVER_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> +#include <freetype/internal/sfnt.h> +#include <freetype/ftdriver.h> #include "ttgload.h" #include "ttpload.h" @@ -1116,10 +1115,10 @@ /* The Apple specification says that the compensation for */ /* `gray' is always zero. FreeType doesn't do any */ /* compensation at all. */ - tt_metrics->compensations[0] = 0; /* gray */ - tt_metrics->compensations[1] = 0; /* black */ - tt_metrics->compensations[2] = 0; /* white */ - tt_metrics->compensations[3] = 0; /* the same as gray */ + tt_metrics->compensations[0] = 0; /* gray */ + tt_metrics->compensations[1] = 0; /* black */ + tt_metrics->compensations[2] = 0; /* white */ + tt_metrics->compensations[3] = 0; /* zero */ } /* allocate function defs, instruction defs, cvt, and storage area */ diff --git a/thirdparty/freetype/src/truetype/ttobjs.h b/thirdparty/freetype/src/truetype/ttobjs.h index 7c3fc7ef8a..d986deabc4 100644 --- a/thirdparty/freetype/src/truetype/ttobjs.h +++ b/thirdparty/freetype/src/truetype/ttobjs.h @@ -20,9 +20,8 @@ #define TTOBJS_H_ -#include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/truetype/ttpload.c b/thirdparty/freetype/src/truetype/ttpload.c index d35393a8b0..b1255b88cd 100644 --- a/thirdparty/freetype/src/truetype/ttpload.c +++ b/thirdparty/freetype/src/truetype/ttpload.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_TAGS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftstream.h> +#include <freetype/tttags.h> #include "ttpload.h" @@ -124,7 +123,7 @@ if ( face->num_locations != (FT_ULong)face->root.num_glyphs + 1 ) { - FT_TRACE2(( "glyph count mismatch! loca: %d, maxp: %d\n", + FT_TRACE2(( "glyph count mismatch! loca: %ld, maxp: %ld\n", face->num_locations - 1, face->root.num_glyphs )); /* we only handle the case where `maxp' gives a larger value */ @@ -165,7 +164,7 @@ face->num_locations = (FT_ULong)face->root.num_glyphs + 1; table_len = new_loca_len; - FT_TRACE2(( "adjusting num_locations to %d\n", + FT_TRACE2(( "adjusting num_locations to %ld\n", face->num_locations )); } else @@ -173,7 +172,7 @@ face->root.num_glyphs = face->num_locations ? (FT_Long)face->num_locations - 1 : 0; - FT_TRACE2(( "adjusting num_glyphs to %d\n", + FT_TRACE2(( "adjusting num_glyphs to %ld\n", face->root.num_glyphs )); } } @@ -238,7 +237,7 @@ if ( pos1 > face->glyf_len ) { FT_TRACE1(( "tt_face_get_location:" - " too large offset (0x%08lx) found for glyph index %ld,\n" + " too large offset (0x%08lx) found for glyph index %d,\n" " " " exceeding the end of `glyf' table (0x%08lx)\n", pos1, gindex, face->glyf_len )); @@ -252,7 +251,7 @@ if ( gindex == face->num_locations - 2 ) { FT_TRACE1(( "tt_face_get_location:" - " too large size (%ld bytes) found for glyph index %ld,\n" + " too large size (%ld bytes) found for glyph index %d,\n" " " " truncating at the end of `glyf' table to %ld bytes\n", pos2 - pos1, gindex, face->glyf_len - pos1 )); @@ -261,7 +260,7 @@ else { FT_TRACE1(( "tt_face_get_location:" - " too large offset (0x%08lx) found for glyph index %ld,\n" + " too large offset (0x%08lx) found for glyph index %d,\n" " " " exceeding the end of `glyf' table (0x%08lx)\n", pos2, gindex + 1, face->glyf_len )); @@ -429,7 +428,7 @@ if ( FT_FRAME_EXTRACT( table_len, face->font_program ) ) goto Exit; - FT_TRACE2(( "loaded, %12d bytes\n", face->font_program_size )); + FT_TRACE2(( "loaded, %12ld bytes\n", face->font_program_size )); } Exit: @@ -492,7 +491,7 @@ if ( FT_FRAME_EXTRACT( table_len, face->cvt_program ) ) goto Exit; - FT_TRACE2(( "loaded, %12d bytes\n", face->cvt_program_size )); + FT_TRACE2(( "loaded, %12ld bytes\n", face->cvt_program_size )); } Exit: diff --git a/thirdparty/freetype/src/truetype/ttpload.h b/thirdparty/freetype/src/truetype/ttpload.h index 3bbd4add19..bb669e0278 100644 --- a/thirdparty/freetype/src/truetype/ttpload.h +++ b/thirdparty/freetype/src/truetype/ttpload.h @@ -20,8 +20,7 @@ #define TTPLOAD_H_ -#include <ft2build.h> -#include FT_INTERNAL_TRUETYPE_TYPES_H +#include <freetype/internal/tttypes.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/truetype/ttsubpix.c b/thirdparty/freetype/src/truetype/ttsubpix.c index 8289818863..56667deaf7 100644 --- a/thirdparty/freetype/src/truetype/ttsubpix.c +++ b/thirdparty/freetype/src/truetype/ttsubpix.c @@ -15,14 +15,13 @@ * */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_SFNT_H -#include FT_TRUETYPE_TAGS_H -#include FT_OUTLINE_H -#include FT_DRIVER_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/sfnt.h> +#include <freetype/tttags.h> +#include <freetype/ftoutln.h> +#include <freetype/ftdriver.h> #include "ttsubpix.h" diff --git a/thirdparty/freetype/src/truetype/ttsubpix.h b/thirdparty/freetype/src/truetype/ttsubpix.h index 23adf7e8d8..229a6cf055 100644 --- a/thirdparty/freetype/src/truetype/ttsubpix.h +++ b/thirdparty/freetype/src/truetype/ttsubpix.h @@ -19,7 +19,6 @@ #ifndef TTSUBPIX_H_ #define TTSUBPIX_H_ -#include <ft2build.h> #include "ttobjs.h" #include "ttinterp.h" diff --git a/thirdparty/freetype/src/type1/t1afm.c b/thirdparty/freetype/src/type1/t1afm.c index 0866e7bf97..b9cd66b045 100644 --- a/thirdparty/freetype/src/type1/t1afm.c +++ b/thirdparty/freetype/src/type1/t1afm.c @@ -16,11 +16,10 @@ */ -#include <ft2build.h> #include "t1afm.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/psaux.h> #include "t1errors.h" diff --git a/thirdparty/freetype/src/type1/t1afm.h b/thirdparty/freetype/src/type1/t1afm.h index 40ce8f9754..edf919c791 100644 --- a/thirdparty/freetype/src/type1/t1afm.h +++ b/thirdparty/freetype/src/type1/t1afm.h @@ -19,9 +19,8 @@ #ifndef T1AFM_H_ #define T1AFM_H_ -#include <ft2build.h> #include "t1objs.h" -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type1/t1driver.c b/thirdparty/freetype/src/type1/t1driver.c index 75a5698e8d..b786a87817 100644 --- a/thirdparty/freetype/src/type1/t1driver.c +++ b/thirdparty/freetype/src/type1/t1driver.c @@ -16,7 +16,6 @@ */ -#include <ft2build.h> #include "t1driver.h" #include "t1gload.h" #include "t1load.h" @@ -27,20 +26,20 @@ #include "t1afm.h" #endif -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_HASH_H -#include FT_INTERNAL_POSTSCRIPT_PROPS_H -#include FT_DRIVER_H - -#include FT_SERVICE_MULTIPLE_MASTERS_H -#include FT_SERVICE_GLYPH_DICT_H -#include FT_SERVICE_FONT_FORMAT_H -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_SERVICE_POSTSCRIPT_INFO_H -#include FT_SERVICE_PROPERTIES_H -#include FT_SERVICE_KERNING_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/fthash.h> +#include <freetype/internal/ftpsprop.h> +#include <freetype/ftdriver.h> + +#include <freetype/internal/services/svmm.h> +#include <freetype/internal/services/svgldict.h> +#include <freetype/internal/services/svfntfmt.h> +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/services/svpsinfo.h> +#include <freetype/internal/services/svprop.h> +#include <freetype/internal/services/svkern.h> /************************************************************************** diff --git a/thirdparty/freetype/src/type1/t1driver.h b/thirdparty/freetype/src/type1/t1driver.h index 84b3e041c4..e7eae0b88c 100644 --- a/thirdparty/freetype/src/type1/t1driver.h +++ b/thirdparty/freetype/src/type1/t1driver.h @@ -20,8 +20,7 @@ #define T1DRIVER_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type1/t1errors.h b/thirdparty/freetype/src/type1/t1errors.h index 1b119b843a..ad03a3d32a 100644 --- a/thirdparty/freetype/src/type1/t1errors.h +++ b/thirdparty/freetype/src/type1/t1errors.h @@ -25,7 +25,7 @@ #ifndef T1ERRORS_H_ #define T1ERRORS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX T1_Err_ #define FT_ERR_BASE FT_Mod_Err_Type1 -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* T1ERRORS_H_ */ diff --git a/thirdparty/freetype/src/type1/t1gload.c b/thirdparty/freetype/src/type1/t1gload.c index fcaf66c401..d16b81f246 100644 --- a/thirdparty/freetype/src/type1/t1gload.c +++ b/thirdparty/freetype/src/type1/t1gload.c @@ -16,15 +16,14 @@ */ -#include <ft2build.h> #include "t1gload.h" -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_OUTLINE_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_INTERNAL_CFF_TYPES_H -#include FT_DRIVER_H +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/ftoutln.h> +#include <freetype/internal/psaux.h> +#include <freetype/internal/cfftypes.h> +#include <freetype/ftdriver.h> #include "t1errors.h" @@ -334,7 +333,7 @@ else advances[nn] = 0; - FT_TRACE5(( " idx %d: advance width %d font unit%s\n", + FT_TRACE5(( " idx %d: advance width %ld font unit%s\n", first + nn, advances[nn], advances[nn] == 1 ? "" : "s" )); diff --git a/thirdparty/freetype/src/type1/t1gload.h b/thirdparty/freetype/src/type1/t1gload.h index 59fae82b6d..9947507c84 100644 --- a/thirdparty/freetype/src/type1/t1gload.h +++ b/thirdparty/freetype/src/type1/t1gload.h @@ -20,7 +20,6 @@ #define T1GLOAD_H_ -#include <ft2build.h> #include "t1objs.h" diff --git a/thirdparty/freetype/src/type1/t1load.c b/thirdparty/freetype/src/type1/t1load.c index d0ea36badb..84986007b0 100644 --- a/thirdparty/freetype/src/type1/t1load.c +++ b/thirdparty/freetype/src/type1/t1load.c @@ -61,12 +61,12 @@ #include <ft2build.h> -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> #include FT_CONFIG_CONFIG_H -#include FT_MULTIPLE_MASTERS_H -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_HASH_H +#include <freetype/ftmm.h> +#include <freetype/internal/t1types.h> +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/fthash.h> #include "t1load.h" #include "t1errors.h" @@ -1063,7 +1063,7 @@ map->design_points[p] = T1_ToInt( parser ); map->blend_points [p] = T1_ToFixed( parser, 0 ); - FT_TRACE4(( " [%d %f]", + FT_TRACE4(( " [%ld %f]", map->design_points[p], (double)map->blend_points[p] / 65536 )); } @@ -1755,7 +1755,7 @@ */ FT_TRACE0(( "parse_subrs: adjusting number of subroutines" - " (from %d to %d)\n", + " (from %d to %ld)\n", num_subrs, ( parser->root.limit - parser->root.cursor ) >> 3 )); num_subrs = ( parser->root.limit - parser->root.cursor ) >> 3; @@ -1926,7 +1926,7 @@ if ( num_glyphs > ( limit - cur ) >> 3 ) { FT_TRACE0(( "parse_charstrings: adjusting number of glyphs" - " (from %d to %d)\n", + " (from %d to %ld)\n", num_glyphs, ( limit - cur ) >> 3 )); num_glyphs = ( limit - cur ) >> 3; } diff --git a/thirdparty/freetype/src/type1/t1load.h b/thirdparty/freetype/src/type1/t1load.h index 9cac0f6fb6..4396415c20 100644 --- a/thirdparty/freetype/src/type1/t1load.h +++ b/thirdparty/freetype/src/type1/t1load.h @@ -20,10 +20,9 @@ #define T1LOAD_H_ -#include <ft2build.h> -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H -#include FT_MULTIPLE_MASTERS_H +#include <freetype/internal/ftstream.h> +#include <freetype/internal/psaux.h> +#include <freetype/ftmm.h> #include "t1parse.h" diff --git a/thirdparty/freetype/src/type1/t1objs.c b/thirdparty/freetype/src/type1/t1objs.c index 80ee0e265e..3b918b7338 100644 --- a/thirdparty/freetype/src/type1/t1objs.c +++ b/thirdparty/freetype/src/type1/t1objs.c @@ -16,12 +16,11 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_CALC_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_TRUETYPE_IDS_H -#include FT_DRIVER_H +#include <freetype/internal/ftcalc.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/ttnameid.h> +#include <freetype/ftdriver.h> #include "t1gload.h" #include "t1load.h" @@ -32,8 +31,8 @@ #include "t1afm.h" #endif -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/psaux.h> /************************************************************************** @@ -347,8 +346,8 @@ if ( error ) goto Exit; - FT_TRACE2(( "T1_Face_Init: %08p (index %d)\n", - face, + FT_TRACE2(( "T1_Face_Init: %p (index %d)\n", + (void *)face, face_index )); /* if we just wanted to check the format, leave successfully now */ diff --git a/thirdparty/freetype/src/type1/t1objs.h b/thirdparty/freetype/src/type1/t1objs.h index 6bc902cc89..536be8ba1e 100644 --- a/thirdparty/freetype/src/type1/t1objs.h +++ b/thirdparty/freetype/src/type1/t1objs.h @@ -21,9 +21,9 @@ #include <ft2build.h> -#include FT_INTERNAL_OBJECTS_H +#include <freetype/internal/ftobjs.h> #include FT_CONFIG_CONFIG_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/internal/t1types.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type1/t1parse.c b/thirdparty/freetype/src/type1/t1parse.c index ec30355bf8..74cf38bde7 100644 --- a/thirdparty/freetype/src/type1/t1parse.c +++ b/thirdparty/freetype/src/type1/t1parse.c @@ -33,10 +33,9 @@ */ -#include <ft2build.h> -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/psaux.h> #include "t1parse.h" diff --git a/thirdparty/freetype/src/type1/t1parse.h b/thirdparty/freetype/src/type1/t1parse.h index edf79b0a8b..1ea0110b50 100644 --- a/thirdparty/freetype/src/type1/t1parse.h +++ b/thirdparty/freetype/src/type1/t1parse.h @@ -20,9 +20,8 @@ #define T1PARSE_H_ -#include <ft2build.h> -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_STREAM_H +#include <freetype/internal/t1types.h> +#include <freetype/internal/ftstream.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type1/type1.c b/thirdparty/freetype/src/type1/type1.c index 95dbaeb501..cadee78994 100644 --- a/thirdparty/freetype/src/type1/type1.c +++ b/thirdparty/freetype/src/type1/type1.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "t1afm.c" #include "t1driver.c" diff --git a/thirdparty/freetype/src/type42/t42drivr.c b/thirdparty/freetype/src/type42/t42drivr.c index 4b2cab3474..90898b4329 100644 --- a/thirdparty/freetype/src/type42/t42drivr.c +++ b/thirdparty/freetype/src/type42/t42drivr.c @@ -39,12 +39,12 @@ #include "t42drivr.h" #include "t42objs.h" #include "t42error.h" -#include FT_INTERNAL_DEBUG_H +#include <freetype/internal/ftdebug.h> -#include FT_SERVICE_FONT_FORMAT_H -#include FT_SERVICE_GLYPH_DICT_H -#include FT_SERVICE_POSTSCRIPT_NAME_H -#include FT_SERVICE_POSTSCRIPT_INFO_H +#include <freetype/internal/services/svfntfmt.h> +#include <freetype/internal/services/svgldict.h> +#include <freetype/internal/services/svpostnm.h> +#include <freetype/internal/services/svpsinfo.h> #undef FT_COMPONENT #define FT_COMPONENT t42 diff --git a/thirdparty/freetype/src/type42/t42drivr.h b/thirdparty/freetype/src/type42/t42drivr.h index 7e7ec70f9d..8bf2afc755 100644 --- a/thirdparty/freetype/src/type42/t42drivr.h +++ b/thirdparty/freetype/src/type42/t42drivr.h @@ -20,8 +20,7 @@ #define T42DRIVR_H_ -#include <ft2build.h> -#include FT_INTERNAL_DRIVER_H +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type42/t42error.h b/thirdparty/freetype/src/type42/t42error.h index 6d3617e927..e48132ec09 100644 --- a/thirdparty/freetype/src/type42/t42error.h +++ b/thirdparty/freetype/src/type42/t42error.h @@ -25,7 +25,7 @@ #ifndef T42ERROR_H_ #define T42ERROR_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -33,7 +33,7 @@ #define FT_ERR_PREFIX T42_Err_ #define FT_ERR_BASE FT_Mod_Err_Type42 -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* T42ERROR_H_ */ diff --git a/thirdparty/freetype/src/type42/t42objs.c b/thirdparty/freetype/src/type42/t42objs.c index 8d1e63ffc7..6acfcdf401 100644 --- a/thirdparty/freetype/src/type42/t42objs.c +++ b/thirdparty/freetype/src/type42/t42objs.c @@ -19,9 +19,9 @@ #include "t42objs.h" #include "t42parse.h" #include "t42error.h" -#include FT_INTERNAL_DEBUG_H -#include FT_LIST_H -#include FT_TRUETYPE_IDS_H +#include <freetype/internal/ftdebug.h> +#include <freetype/ftlist.h> +#include <freetype/ttnameid.h> #undef FT_COMPONENT diff --git a/thirdparty/freetype/src/type42/t42objs.h b/thirdparty/freetype/src/type42/t42objs.h index ecb495e8f0..69f5cffd44 100644 --- a/thirdparty/freetype/src/type42/t42objs.h +++ b/thirdparty/freetype/src/type42/t42objs.h @@ -19,15 +19,14 @@ #ifndef T42OBJS_H_ #define T42OBJS_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TYPE1_TABLES_H -#include FT_INTERNAL_TYPE1_TYPES_H +#include <freetype/freetype.h> +#include <freetype/t1tables.h> +#include <freetype/internal/t1types.h> #include "t42types.h" -#include FT_INTERNAL_OBJECTS_H -#include FT_INTERNAL_DRIVER_H -#include FT_SERVICE_POSTSCRIPT_CMAPS_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H +#include <freetype/internal/ftobjs.h> +#include <freetype/internal/ftdrv.h> +#include <freetype/internal/services/svpscmap.h> +#include <freetype/internal/pshints.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type42/t42parse.c b/thirdparty/freetype/src/type42/t42parse.c index 7f26d04170..98507699fa 100644 --- a/thirdparty/freetype/src/type42/t42parse.c +++ b/thirdparty/freetype/src/type42/t42parse.c @@ -18,9 +18,9 @@ #include "t42parse.h" #include "t42error.h" -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/psaux.h> /************************************************************************** @@ -826,7 +826,7 @@ if ( loader->num_glyphs > ( limit - parser->root.cursor ) >> 2 ) { FT_TRACE0(( "t42_parse_charstrings: adjusting number of glyphs" - " (from %d to %d)\n", + " (from %d to %ld)\n", loader->num_glyphs, ( limit - parser->root.cursor ) >> 2 )); loader->num_glyphs = ( limit - parser->root.cursor ) >> 2; diff --git a/thirdparty/freetype/src/type42/t42parse.h b/thirdparty/freetype/src/type42/t42parse.h index de54a46cf1..2ccf052d78 100644 --- a/thirdparty/freetype/src/type42/t42parse.h +++ b/thirdparty/freetype/src/type42/t42parse.h @@ -21,7 +21,7 @@ #include "t42objs.h" -#include FT_INTERNAL_POSTSCRIPT_AUX_H +#include <freetype/internal/psaux.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type42/t42types.h b/thirdparty/freetype/src/type42/t42types.h index f66f09db87..ba0cc21429 100644 --- a/thirdparty/freetype/src/type42/t42types.h +++ b/thirdparty/freetype/src/type42/t42types.h @@ -20,11 +20,10 @@ #define T42TYPES_H_ -#include <ft2build.h> -#include FT_FREETYPE_H -#include FT_TYPE1_TABLES_H -#include FT_INTERNAL_TYPE1_TYPES_H -#include FT_INTERNAL_POSTSCRIPT_HINTS_H +#include <freetype/freetype.h> +#include <freetype/t1tables.h> +#include <freetype/internal/t1types.h> +#include <freetype/internal/pshints.h> FT_BEGIN_HEADER diff --git a/thirdparty/freetype/src/type42/type42.c b/thirdparty/freetype/src/type42/type42.c index 4739b3c333..012559e2fd 100644 --- a/thirdparty/freetype/src/type42/type42.c +++ b/thirdparty/freetype/src/type42/type42.c @@ -17,7 +17,6 @@ #define FT_MAKE_OPTION_SINGLE_OBJECT -#include <ft2build.h> #include "t42drivr.c" #include "t42objs.c" diff --git a/thirdparty/freetype/src/winfonts/fnterrs.h b/thirdparty/freetype/src/winfonts/fnterrs.h index f98e68435b..550de386fc 100644 --- a/thirdparty/freetype/src/winfonts/fnterrs.h +++ b/thirdparty/freetype/src/winfonts/fnterrs.h @@ -26,7 +26,7 @@ #ifndef FNTERRS_H_ #define FNTERRS_H_ -#include FT_MODULE_ERRORS_H +#include <freetype/ftmoderr.h> #undef FTERRORS_H_ @@ -34,7 +34,7 @@ #define FT_ERR_PREFIX FNT_Err_ #define FT_ERR_BASE FT_Mod_Err_Winfonts -#include FT_ERRORS_H +#include <freetype/fterrors.h> #endif /* FNTERRS_H_ */ diff --git a/thirdparty/freetype/src/winfonts/winfnt.c b/thirdparty/freetype/src/winfonts/winfnt.c index 9b466e8f28..e83312d166 100644 --- a/thirdparty/freetype/src/winfonts/winfnt.c +++ b/thirdparty/freetype/src/winfonts/winfnt.c @@ -18,17 +18,16 @@ */ -#include <ft2build.h> -#include FT_WINFONTS_H -#include FT_INTERNAL_DEBUG_H -#include FT_INTERNAL_STREAM_H -#include FT_INTERNAL_OBJECTS_H -#include FT_TRUETYPE_IDS_H +#include <freetype/ftwinfnt.h> +#include <freetype/internal/ftdebug.h> +#include <freetype/internal/ftstream.h> +#include <freetype/internal/ftobjs.h> +#include <freetype/ttnameid.h> #include "winfnt.h" #include "fnterrs.h" -#include FT_SERVICE_WINFNT_H -#include FT_SERVICE_FONT_FORMAT_H +#include <freetype/internal/services/svwinfnt.h> +#include <freetype/internal/services/svfntfmt.h> /************************************************************************** * diff --git a/thirdparty/freetype/src/winfonts/winfnt.h b/thirdparty/freetype/src/winfonts/winfnt.h index 391f4448a7..3367c7715e 100644 --- a/thirdparty/freetype/src/winfonts/winfnt.h +++ b/thirdparty/freetype/src/winfonts/winfnt.h @@ -21,9 +21,8 @@ #define WINFNT_H_ -#include <ft2build.h> -#include FT_WINFONTS_H -#include FT_INTERNAL_DRIVER_H +#include <freetype/ftwinfnt.h> +#include <freetype/internal/ftdrv.h> FT_BEGIN_HEADER |
