summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--.github/workflows/android_builds.yml20
-rw-r--r--.github/workflows/ios_builds.yml12
-rw-r--r--.github/workflows/javascript_builds.disabled12
-rw-r--r--.github/workflows/linux_builds.yml34
-rw-r--r--.github/workflows/macos_builds.yml21
-rw-r--r--.github/workflows/windows_builds.yml37
-rw-r--r--CONTRIBUTING.md23
-rw-r--r--SConstruct23
-rw-r--r--core/SCsub22
-rw-r--r--core/array.cpp13
-rw-r--r--core/array.h6
-rw-r--r--core/bind/core_bind.cpp8
-rw-r--r--core/bind/core_bind.h1
-rw-r--r--core/binder_common.h657
-rw-r--r--core/callable.cpp29
-rw-r--r--core/callable.h6
-rw-r--r--core/callable_bind.cpp193
-rw-r--r--core/callable_bind.h85
-rw-r--r--core/callable_method_pointer.h173
-rw-r--r--core/class_db.cpp2
-rw-r--r--core/class_db.h2
-rw-r--r--core/command_queue_mt.cpp7
-rw-r--r--core/command_queue_mt.h36
-rw-r--r--core/core_string_names.cpp2
-rw-r--r--core/core_string_names.h2
-rw-r--r--core/debugger/remote_debugger.h2
-rw-r--r--core/global_constants.cpp2
-rw-r--r--core/input/input_map.h2
-rw-r--r--core/io/http_client.cpp4
-rw-r--r--core/io/packet_peer.h2
-rw-r--r--core/io/resource_format_binary.cpp7
-rw-r--r--core/make_binders.py390
-rw-r--r--core/math/aabb.cpp16
-rw-r--r--core/math/aabb.h4
-rw-r--r--core/math/geometry_3d.h48
-rw-r--r--core/math/plane.cpp26
-rw-r--r--core/math/plane.h7
-rw-r--r--core/math/rect2.h8
-rw-r--r--core/math/vector2.h8
-rw-r--r--core/message_queue.h2
-rw-r--r--core/method_bind.h532
-rw-r--r--core/object.cpp14
-rw-r--r--core/object.h4
-rw-r--r--core/project_settings.h2
-rw-r--r--core/reference.h1
-rw-r--r--core/resource.h1
-rw-r--r--core/script_language.cpp8
-rw-r--r--core/simple_type.h5
-rw-r--r--core/thread_work_pool.h27
-rw-r--r--core/type_info.h9
-rw-r--r--core/typedefs.h4
-rw-r--r--core/undo_redo.h2
-rw-r--r--core/ustring.cpp109
-rw-r--r--core/ustring.h5
-rw-r--r--core/variant.h28
-rw-r--r--core/variant_call.cpp2768
-rw-r--r--core/variant_internal.h534
-rw-r--r--core/variant_op.cpp2
-rw-r--r--doc/classes/AABB.xml2
-rw-r--r--doc/classes/AnimatedSprite2D.xml1
-rw-r--r--doc/classes/Animation.xml16
-rw-r--r--doc/classes/AnimationNodeAdd3.xml1
-rw-r--r--doc/classes/AnimationNodeAnimation.xml2
-rw-r--r--doc/classes/AnimationNodeBlend2.xml2
-rw-r--r--doc/classes/AnimationNodeBlendSpace2D.xml1
-rw-r--r--doc/classes/AnimationNodeOneShot.xml1
-rw-r--r--doc/classes/AnimationNodeOutput.xml2
-rw-r--r--doc/classes/AnimationNodeTimeScale.xml1
-rw-r--r--doc/classes/AnimationNodeTransition.xml2
-rw-r--r--doc/classes/AnimationPlayer.xml1
-rw-r--r--doc/classes/AnimationTree.xml2
-rw-r--r--doc/classes/Area2D.xml9
-rw-r--r--doc/classes/Area3D.xml8
-rw-r--r--doc/classes/ArrayMesh.xml1
-rw-r--r--doc/classes/AudioEffect.xml1
-rw-r--r--doc/classes/AudioEffectRecord.xml1
-rw-r--r--doc/classes/AudioEffectReverb.xml1
-rw-r--r--doc/classes/AudioServer.xml3
-rw-r--r--doc/classes/AudioStream.xml3
-rw-r--r--doc/classes/AudioStreamGenerator.xml2
-rw-r--r--doc/classes/AudioStreamPlayback.xml1
-rw-r--r--doc/classes/AudioStreamPlayer.xml5
-rw-r--r--doc/classes/BaseButton.xml3
-rw-r--r--doc/classes/Basis.xml7
-rw-r--r--doc/classes/BoxShape3D.xml3
-rw-r--r--doc/classes/Button.xml2
-rw-r--r--doc/classes/Callable.xml14
-rw-r--r--doc/classes/Camera2D.xml3
-rw-r--r--doc/classes/Camera3D.xml1
-rw-r--r--doc/classes/CanvasItem.xml7
-rw-r--r--doc/classes/CanvasLayer.xml1
-rw-r--r--doc/classes/CapsuleShape3D.xml1
-rw-r--r--doc/classes/CollisionShape2D.xml3
-rw-r--r--doc/classes/CollisionShape3D.xml3
-rw-r--r--doc/classes/Color.xml3
-rw-r--r--doc/classes/ColorPicker.xml1
-rw-r--r--doc/classes/ColorPickerButton.xml2
-rw-r--r--doc/classes/ColorRect.xml1
-rw-r--r--doc/classes/ConcavePolygonShape3D.xml1
-rw-r--r--doc/classes/Control.xml3
-rw-r--r--doc/classes/ConvexPolygonShape3D.xml1
-rw-r--r--doc/classes/CylinderShape3D.xml3
-rw-r--r--doc/classes/Dictionary.xml2
-rw-r--r--doc/classes/DisplayServer.xml12
-rw-r--r--doc/classes/DynamicFont.xml1
-rw-r--r--doc/classes/DynamicFontData.xml1
-rw-r--r--doc/classes/Environment.xml54
-rw-r--r--doc/classes/File.xml1
-rw-r--r--doc/classes/FuncRef.xml16
-rw-r--r--doc/classes/GIProbe.xml1
-rw-r--r--doc/classes/GIProbeData.xml1
-rw-r--r--doc/classes/GPUParticles2D.xml1
-rw-r--r--doc/classes/GPUParticles3D.xml3
-rw-r--r--doc/classes/GPUParticlesAttractor3D.xml23
-rw-r--r--doc/classes/GPUParticlesAttractorBox.xml17
-rw-r--r--doc/classes/GPUParticlesAttractorSphere.xml17
-rw-r--r--doc/classes/GPUParticlesAttractorVectorField.xml19
-rw-r--r--doc/classes/GPUParticlesCollision3D.xml17
-rw-r--r--doc/classes/GPUParticlesCollisionBox.xml17
-rw-r--r--doc/classes/GPUParticlesCollisionHeightField.xml43
-rw-r--r--doc/classes/GPUParticlesCollisionSDF.xml37
-rw-r--r--doc/classes/GPUParticlesCollisionSphere.xml17
-rw-r--r--doc/classes/Geometry3D.xml9
-rw-r--r--doc/classes/GridContainer.xml1
-rw-r--r--doc/classes/Input.xml2
-rw-r--r--doc/classes/InputEvent.xml2
-rw-r--r--doc/classes/InputEventAction.xml2
-rw-r--r--doc/classes/InputEventMouseMotion.xml1
-rw-r--r--doc/classes/Joint3D.xml1
-rw-r--r--doc/classes/KinematicBody2D.xml8
-rw-r--r--doc/classes/KinematicBody3D.xml10
-rw-r--r--doc/classes/Label.xml1
-rw-r--r--doc/classes/Light3D.xml1
-rw-r--r--doc/classes/Line2D.xml2
-rw-r--r--doc/classes/LinkButton.xml1
-rw-r--r--doc/classes/Material.xml2
-rw-r--r--doc/classes/MenuButton.xml1
-rw-r--r--doc/classes/Mesh.xml4
-rw-r--r--doc/classes/MeshInstance3D.xml4
-rw-r--r--doc/classes/MeshLibrary.xml2
-rw-r--r--doc/classes/MultiMesh.xml2
-rw-r--r--doc/classes/Navigation2D.xml1
-rw-r--r--doc/classes/Navigation3D.xml1
-rw-r--r--doc/classes/NavigationMesh.xml1
-rw-r--r--doc/classes/NavigationPolygon.xml1
-rw-r--r--doc/classes/NavigationServer2D.xml1
-rw-r--r--doc/classes/NavigationServer3D.xml1
-rw-r--r--doc/classes/NetworkedMultiplayerPeer.xml1
-rw-r--r--doc/classes/NinePatchRect.xml6
-rw-r--r--doc/classes/Node.xml2
-rw-r--r--doc/classes/Node2D.xml1
-rw-r--r--doc/classes/Node3D.xml3
-rw-r--r--doc/classes/NodePath.xml1
-rw-r--r--doc/classes/OS.xml1
-rw-r--r--doc/classes/PackedScene.xml1
-rw-r--r--doc/classes/PackedStringArray.xml1
-rw-r--r--doc/classes/PackedVector2Array.xml1
-rw-r--r--doc/classes/Panel.xml3
-rw-r--r--doc/classes/PanelContainer.xml1
-rw-r--r--doc/classes/ParticlesMaterial.xml10
-rw-r--r--doc/classes/PhysicsBody2D.xml3
-rw-r--r--doc/classes/PhysicsDirectSpaceState2D.xml3
-rw-r--r--doc/classes/ProjectSettings.xml13
-rw-r--r--doc/classes/QuadMesh.xml2
-rw-r--r--doc/classes/Quat.xml1
-rw-r--r--doc/classes/RandomNumberGenerator.xml1
-rw-r--r--doc/classes/RayCast3D.xml1
-rw-r--r--doc/classes/Rect2.xml2
-rw-r--r--doc/classes/Rect2i.xml1
-rw-r--r--doc/classes/RectangleShape2D.xml2
-rw-r--r--doc/classes/RenderingServer.xml23
-rw-r--r--doc/classes/ResourceLoader.xml5
-rw-r--r--doc/classes/RichTextLabel.xml2
-rw-r--r--doc/classes/RigidBody2D.xml6
-rw-r--r--doc/classes/RigidBody3D.xml4
-rw-r--r--doc/classes/Skeleton3D.xml2
-rw-r--r--doc/classes/SkeletonIK3D.xml1
-rw-r--r--doc/classes/SphereShape3D.xml1
-rw-r--r--doc/classes/SpotLight3D.xml1
-rw-r--r--doc/classes/Sprite2D.xml1
-rw-r--r--doc/classes/StaticBody3D.xml3
-rw-r--r--doc/classes/StreamPeerTCP.xml2
-rw-r--r--doc/classes/SubViewport.xml9
-rw-r--r--doc/classes/SurfaceTool.xml1
-rw-r--r--doc/classes/TextureButton.xml1
-rw-r--r--doc/classes/TextureRect.xml1
-rw-r--r--doc/classes/Thread.xml1
-rw-r--r--doc/classes/TileMap.xml6
-rw-r--r--doc/classes/TileSet.xml7
-rw-r--r--doc/classes/Timer.xml1
-rw-r--r--doc/classes/Transform.xml3
-rw-r--r--doc/classes/Transform2D.xml3
-rw-r--r--doc/classes/VBoxContainer.xml1
-rw-r--r--doc/classes/Vector2.xml5
-rw-r--r--doc/classes/Vector2i.xml2
-rw-r--r--doc/classes/Vector3.xml5
-rw-r--r--doc/classes/Vector3i.xml2
-rw-r--r--doc/classes/VehicleBody3D.xml1
-rw-r--r--doc/classes/VehicleWheel3D.xml1
-rw-r--r--doc/classes/Viewport.xml6
-rw-r--r--doc/classes/ViewportTexture.xml4
-rw-r--r--doc/classes/VisibilityNotifier2D.xml1
-rw-r--r--doc/classes/VisualShaderNode.xml6
-rw-r--r--doc/classes/WorldEnvironment.xml3
-rw-r--r--doc/translations/ar.po6
-rw-r--r--doc/translations/ca.po6
-rw-r--r--doc/translations/classes.pot6
-rw-r--r--doc/translations/cs.po6
-rw-r--r--doc/translations/de.po6
-rw-r--r--doc/translations/es.po10
-rw-r--r--doc/translations/fa.po6
-rw-r--r--doc/translations/fi.po6
-rw-r--r--doc/translations/fr.po6
-rw-r--r--doc/translations/id.po6
-rw-r--r--doc/translations/it.po6
-rw-r--r--doc/translations/ja.po6
-rw-r--r--doc/translations/ko.po6
-rw-r--r--doc/translations/nl.po6
-rw-r--r--doc/translations/pl.po6
-rw-r--r--doc/translations/pt_BR.po6
-rw-r--r--doc/translations/ro.po6
-rw-r--r--doc/translations/ru.po6
-rw-r--r--doc/translations/sr_Cyrl.po6
-rw-r--r--doc/translations/th.po6
-rw-r--r--doc/translations/tr.po6
-rw-r--r--doc/translations/uk.po6
-rw-r--r--doc/translations/zh_Hans.po6
-rw-r--r--doc/translations/zh_Hant.po6
-rw-r--r--drivers/dummy/rasterizer_dummy.h26
-rw-r--r--editor/animation_track_editor.cpp2
-rw-r--r--editor/editor_audio_buses.cpp2
-rw-r--r--editor/editor_data.cpp8
-rw-r--r--editor/editor_file_dialog.cpp15
-rw-r--r--editor/editor_inspector.cpp10
-rw-r--r--editor/editor_node.cpp6
-rw-r--r--editor/editor_plugin.cpp2
-rw-r--r--editor/editor_plugin.h2
-rw-r--r--editor/editor_properties.cpp2
-rw-r--r--editor/editor_resource_preview.cpp2
-rw-r--r--editor/editor_run_native.cpp6
-rw-r--r--editor/editor_settings.h3
-rw-r--r--editor/editor_spin_slider.cpp2
-rw-r--r--editor/editor_vcs_interface.h2
-rw-r--r--editor/fileserver/editor_file_server.h2
-rw-r--r--editor/import/editor_scene_importer_gltf.cpp151
-rw-r--r--editor/import/resource_importer_layered_texture.cpp2
-rw-r--r--editor/inspector_dock.cpp8
-rw-r--r--editor/inspector_dock.h8
-rw-r--r--editor/localization_editor.cpp2
-rw-r--r--editor/node_3d_editor_gizmos.cpp261
-rw-r--r--editor/node_3d_editor_gizmos.h17
-rw-r--r--editor/plugins/animation_state_machine_editor.cpp6
-rw-r--r--editor/plugins/canvas_item_editor_plugin.cpp10
-rw-r--r--editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp201
-rw-r--r--editor/plugins/gpu_particles_collision_sdf_editor_plugin.h74
-rw-r--r--editor/plugins/node_3d_editor_plugin.cpp13
-rw-r--r--editor/plugins/node_3d_editor_plugin.h8
-rw-r--r--editor/plugins/tile_map_editor_plugin.cpp25
-rw-r--r--editor/plugins/tile_map_editor_plugin.h1
-rw-r--r--editor/plugins/visual_shader_editor_plugin.cpp336
-rw-r--r--editor/plugins/visual_shader_editor_plugin.h9
-rw-r--r--editor/scene_tree_dock.cpp46
-rw-r--r--editor/shader_globals_editor.cpp4
-rw-r--r--main/performance.h2
-rw-r--r--misc/dist/html/editor.html475
-rw-r--r--misc/dist/ios_xcode/godot_ios.xcodeproj/project.pbxproj4
-rw-r--r--modules/arkit/arkit_interface.h13
-rw-r--r--modules/arkit/arkit_interface.mm12
-rw-r--r--modules/bullet/area_bullet.cpp27
-rw-r--r--modules/bullet/area_bullet.h24
-rw-r--r--modules/bullet/bullet_physics_server.h2
-rw-r--r--modules/bullet/bullet_types_converter.cpp14
-rw-r--r--modules/bullet/collision_object_bullet.cpp76
-rw-r--r--modules/bullet/collision_object_bullet.h52
-rw-r--r--modules/bullet/rigid_body_bullet.cpp116
-rw-r--r--modules/bullet/rigid_body_bullet.h52
-rw-r--r--modules/bullet/shape_bullet.cpp55
-rw-r--r--modules/bullet/shape_bullet.h28
-rw-r--r--modules/bullet/soft_body_bullet.cpp24
-rw-r--r--modules/bullet/soft_body_bullet.h20
-rw-r--r--modules/bullet/space_bullet.cpp111
-rw-r--r--modules/bullet/space_bullet.h20
-rw-r--r--modules/camera/camera_ios.mm24
-rw-r--r--modules/denoise/lightmap_denoiser.h2
-rw-r--r--modules/gdnavigation/rvo_agent.h3
-rw-r--r--modules/gdscript/doc_classes/@GDScript.xml4
-rw-r--r--modules/gdscript/editor/gdscript_highlighter.cpp7
-rw-r--r--modules/gdscript/gdscript_byte_codegen.cpp1
-rw-r--r--modules/gridmap/doc_classes/GridMap.xml2
-rw-r--r--modules/jsonrpc/jsonrpc.h2
-rw-r--r--modules/mono/csharp_script.cpp190
-rw-r--r--modules/mono/csharp_script.h1
-rw-r--r--modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec2
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs2
-rwxr-xr-xmodules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs6
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs4
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs6
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs2
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs6
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs6
-rw-r--r--modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs12
-rw-r--r--modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs29
-rw-r--r--modules/mono/glue/GodotSharp/GodotSharp/Core/Vector2.cs7
-rw-r--r--modules/mono/glue/base_object_glue.cpp1
-rw-r--r--modules/mono/glue/glue_header.h1
-rw-r--r--modules/mono/glue/rid_glue.cpp2
-rw-r--r--modules/mono/mono_gd/gd_mono_internals.h2
-rw-r--r--modules/mono/mono_gd/gd_mono_utils.h2
-rw-r--r--modules/mono/mono_gd/support/ios_support.mm3
-rw-r--r--modules/visual_script/visual_script_editor.cpp2
-rw-r--r--modules/visual_script/visual_script_func_nodes.cpp1
-rw-r--r--modules/visual_script/visual_script_nodes.cpp4
-rw-r--r--modules/webrtc/doc_classes/WebRTCPeerConnection.xml2
-rw-r--r--platform/iphone/SCsub2
-rw-r--r--platform/iphone/app_delegate.mm3
-rw-r--r--platform/iphone/detect.py4
-rw-r--r--platform/iphone/device_metrics.h37
-rw-r--r--platform/iphone/device_metrics.m152
-rw-r--r--platform/iphone/display_layer.mm3
-rw-r--r--platform/iphone/display_server_iphone.mm185
-rw-r--r--platform/iphone/game_center.h2
-rw-r--r--platform/iphone/game_center.mm17
-rw-r--r--platform/iphone/godot_iphone.mm4
-rw-r--r--platform/iphone/godot_view.mm18
-rw-r--r--platform/iphone/godot_view_gesture_recognizer.mm7
-rw-r--r--platform/iphone/icloud.h2
-rw-r--r--platform/iphone/icloud.mm14
-rw-r--r--platform/iphone/in_app_store.h2
-rw-r--r--platform/iphone/in_app_store.mm41
-rw-r--r--platform/iphone/ios.h2
-rw-r--r--platform/iphone/ios.mm19
-rw-r--r--platform/iphone/joypad_iphone.mm101
-rw-r--r--platform/iphone/native_video_view.h41
-rw-r--r--platform/iphone/native_video_view.m260
-rw-r--r--platform/iphone/os_iphone.mm5
-rw-r--r--platform/iphone/platform_config.h7
-rw-r--r--platform/iphone/view_controller.h8
-rw-r--r--platform/iphone/view_controller.mm209
-rw-r--r--platform/iphone/vulkan_context_iphone.mm6
-rw-r--r--platform/javascript/SCsub4
-rw-r--r--platform/javascript/api/api.cpp2
-rw-r--r--platform/javascript/api/javascript_eval.h2
-rw-r--r--platform/javascript/api/javascript_tools_editor_plugin.cpp153
-rw-r--r--platform/javascript/api/javascript_tools_editor_plugin.h62
-rw-r--r--platform/javascript/audio_driver_javascript.cpp248
-rw-r--r--platform/javascript/audio_driver_javascript.h19
-rw-r--r--platform/javascript/detect.py11
-rw-r--r--platform/javascript/emscripten_helpers.py23
-rw-r--r--platform/javascript/engine/engine.js8
-rw-r--r--platform/javascript/export/export.cpp3
-rw-r--r--platform/javascript/godot_audio.h58
-rw-r--r--platform/javascript/native/library_godot_audio.js173
-rw-r--r--platform/javascript/native/utils.js21
-rw-r--r--platform/linuxbsd/display_server_x11.cpp37
-rw-r--r--platform/osx/detect.py3
-rw-r--r--platform/osx/display_server_osx.mm13
-rw-r--r--platform/uwp/detect.py3
-rw-r--r--platform/uwp/export/export.cpp5
-rw-r--r--platform/windows/detect.py19
-rw-r--r--scene/2d/area_2d.cpp28
-rw-r--r--scene/2d/light_2d.cpp3
-rw-r--r--scene/2d/physics_body_2d.cpp16
-rw-r--r--scene/2d/physics_body_2d.h3
-rw-r--r--scene/2d/tile_map.cpp1
-rw-r--r--scene/3d/area_3d.cpp28
-rw-r--r--scene/3d/collision_shape_3d.cpp15
-rw-r--r--scene/3d/gi_probe.cpp1
-rw-r--r--scene/3d/gpu_particles_3d.cpp14
-rw-r--r--scene/3d/gpu_particles_3d.h3
-rw-r--r--scene/3d/gpu_particles_collision_3d.cpp901
-rw-r--r--scene/3d/gpu_particles_collision_3d.h342
-rw-r--r--scene/3d/navigation_region_3d.cpp4
-rw-r--r--scene/3d/node_3d.cpp38
-rw-r--r--scene/3d/node_3d.h8
-rw-r--r--scene/3d/physics_body_3d.cpp19
-rw-r--r--scene/3d/physics_body_3d.h3
-rw-r--r--scene/3d/soft_body_3d.cpp6
-rw-r--r--scene/animation/animation_player.cpp4
-rw-r--r--scene/animation/animation_tree.cpp1
-rw-r--r--scene/animation/tween.cpp2
-rw-r--r--scene/debugger/scene_debugger.h2
-rw-r--r--scene/gui/base_button.cpp15
-rw-r--r--scene/gui/base_button.h4
-rw-r--r--scene/gui/box_container.cpp8
-rw-r--r--scene/gui/center_container.cpp4
-rw-r--r--scene/gui/code_edit.cpp3
-rw-r--r--scene/gui/color_picker.cpp2
-rw-r--r--scene/gui/control.cpp30
-rw-r--r--scene/gui/control.h2
-rw-r--r--scene/gui/dialogs.cpp4
-rw-r--r--scene/gui/file_dialog.cpp2
-rw-r--r--scene/gui/graph_edit.cpp2
-rw-r--r--scene/gui/graph_node.cpp12
-rw-r--r--scene/gui/link_button.cpp1
-rw-r--r--scene/gui/margin_container.cpp4
-rw-r--r--scene/gui/menu_button.cpp1
-rw-r--r--scene/gui/panel_container.cpp4
-rw-r--r--scene/gui/popup.cpp4
-rw-r--r--scene/gui/scroll_container.cpp6
-rw-r--r--scene/gui/split_container.cpp2
-rw-r--r--scene/gui/tab_container.cpp6
-rw-r--r--scene/gui/tree.cpp5
-rw-r--r--scene/main/canvas_item.cpp47
-rw-r--r--scene/main/canvas_item.h10
-rw-r--r--scene/main/node.h1
-rw-r--r--scene/main/viewport.cpp22
-rw-r--r--scene/main/window.cpp4
-rw-r--r--scene/register_scene_types.cpp10
-rw-r--r--scene/resources/environment.cpp93
-rw-r--r--scene/resources/environment.h12
-rw-r--r--scene/resources/font.cpp1
-rw-r--r--scene/resources/mesh.cpp1
-rw-r--r--scene/resources/particles_material.cpp98
-rw-r--r--scene/resources/particles_material.h34
-rw-r--r--scene/resources/surface_tool.cpp2
-rw-r--r--scene/resources/syntax_highlighter.cpp7
-rw-r--r--scene/resources/texture.cpp1
-rw-r--r--scene/resources/visual_shader.cpp11
-rw-r--r--scene/resources/visual_shader.h3
-rw-r--r--scene/resources/visual_shader_nodes.cpp72
-rw-r--r--servers/audio/effects/audio_effect_spectrum_analyzer.cpp19
-rw-r--r--servers/audio_server.h2
-rw-r--r--servers/camera_server.h2
-rw-r--r--servers/display_server.cpp1
-rw-r--r--servers/navigation_server_2d.h2
-rw-r--r--servers/navigation_server_3d.h2
-rw-r--r--servers/physics_2d/collision_solver_2d_sw.cpp2
-rw-r--r--servers/physics_server_2d.cpp1
-rw-r--r--servers/physics_server_2d.h2
-rw-r--r--servers/physics_server_3d.cpp1
-rw-r--r--servers/physics_server_3d.h2
-rw-r--r--servers/rendering/rasterizer.h28
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp33
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_effects_rd.h10
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp41
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h15
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp49
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_scene_rd.h14
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp420
-rw-r--r--servers/rendering/rasterizer_rd/rasterizer_storage_rd.h100
-rw-r--r--servers/rendering/rasterizer_rd/shaders/copy.glsl123
-rw-r--r--servers/rendering/rasterizer_rd/shaders/particles.glsl333
-rw-r--r--servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl60
-rw-r--r--servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl13
-rw-r--r--servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl10
-rw-r--r--servers/rendering/rasterizer_rd/shaders/sky.glsl19
-rw-r--r--servers/rendering/rasterizer_rd/shaders/tonemap.glsl32
-rw-r--r--servers/rendering/rendering_device.cpp2
-rw-r--r--servers/rendering/rendering_device.h2
-rw-r--r--servers/rendering/rendering_server_raster.cpp3
-rw-r--r--servers/rendering/rendering_server_raster.h20
-rw-r--r--servers/rendering/rendering_server_scene.cpp50
-rw-r--r--servers/rendering/rendering_server_scene.h3
-rw-r--r--servers/rendering/rendering_server_wrap_mt.cpp1
-rw-r--r--servers/rendering/rendering_server_wrap_mt.h21
-rw-r--r--servers/rendering/shader_language.cpp59
-rw-r--r--servers/rendering/shader_language.h1
-rw-r--r--servers/rendering/shader_types.cpp10
-rw-r--r--servers/rendering_server.cpp10
-rw-r--r--servers/rendering_server.h45
-rw-r--r--tests/test_command_queue.h482
-rw-r--r--tests/test_main.cpp2
-rw-r--r--tests/test_method_bind.h165
463 files changed, 10922 insertions, 4872 deletions
diff --git a/.github/workflows/android_builds.yml b/.github/workflows/android_builds.yml
index 1c9a8f7f03..3c1e6a6b72 100644
--- a/.github/workflows/android_builds.yml
+++ b/.github/workflows/android_builds.yml
@@ -1,9 +1,10 @@
name: 🤖 Android Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=android verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_LIMIT: 4096
jobs:
@@ -26,14 +27,14 @@ jobs:
- name: Configure dependencies
run: |
sudo apt-get install openjdk-8-jdk
- echo "::set-env name=JAVA_HOME::usr/lib/jvm/java-8-openjdk-amd64"
+ echo 'JAVA_HOME=usr/lib/jvm/java-8-openjdk-amd64' >> $GITHUB_ENV
- name: Install Android SDK and NDK
run: |
- echo "::set-env name=PATH::/usr/lib/jvm/java-8-openjdk-amd64/jre/bin:${PATH}"
+ echo '/usr/lib/jvm/java-8-openjdk-amd64/jre/bin' >> $GITHUB_PATH
java -version
- echo "::set-env name=ANDROID_HOME::$(pwd)/godot-dev/build-tools/android-sdk"
- echo "::set-env name=ANDROID_NDK_ROOT::$(pwd)/godot-dev/build-tools/android-ndk"
+ echo "ANDROID_HOME=$(pwd)/godot-dev/build-tools/android-sdk" >> $GITHUB_ENV
+ echo "ANDROID_NDK_ROOT=$(pwd)/godot-dev/build-tools/android-ndk" >> $GITHUB_ENV
misc/ci/android-tools-linux.sh
source ~/.bashrc
@@ -70,4 +71,11 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=android target=release tools=no
+ scons target=release tools=no
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/.github/workflows/ios_builds.yml b/.github/workflows/ios_builds.yml
index e6770d384a..80db5d68ce 100644
--- a/.github/workflows/ios_builds.yml
+++ b/.github/workflows/ios_builds.yml
@@ -1,9 +1,10 @@
name: 🍏 iOS Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=iphone verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_LIMIT: 4096
jobs:
@@ -47,4 +48,11 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=iphone target=release tools=no
+ scons target=release tools=no
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/.github/workflows/javascript_builds.disabled b/.github/workflows/javascript_builds.disabled
index c3c51209bd..8ed77726cc 100644
--- a/.github/workflows/javascript_builds.disabled
+++ b/.github/workflows/javascript_builds.disabled
@@ -1,9 +1,10 @@
name: 🌐 JavaScript Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=javascript verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_LIMIT: 4096
EM_VERSION: 1.39.20
EM_CACHE_FOLDER: 'emsdk-cache'
@@ -74,4 +75,11 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=javascript target=release tools=no use_closure_compiler=yes
+ scons target=release tools=no use_closure_compiler=yes
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/.github/workflows/linux_builds.yml b/.github/workflows/linux_builds.yml
index 436671dd95..b170889cb3 100644
--- a/.github/workflows/linux_builds.yml
+++ b/.github/workflows/linux_builds.yml
@@ -1,13 +1,14 @@
name: 🐧 Linux Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=linuxbsd verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_LIMIT: 4096
jobs:
- linux-editor:
+ linux-editor-mono:
runs-on: "ubuntu-20.04"
name: Editor w/ Mono (target=release_debug, tools=yes, tests=yes)
@@ -61,13 +62,20 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd tools=yes tests=yes target=release_debug module_mono_enabled=yes mono_glue=no
+ scons tools=yes tests=yes target=release_debug module_mono_enabled=yes mono_glue=no
+ ls -l bin/
# Execute unit tests for the editor
- name: Unit Tests
run: |
./bin/godot.linuxbsd.opt.tools.64.mono --test
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
+
linux-editor-sanitizers:
runs-on: "ubuntu-20.04"
name: Editor with sanitizers (target=debug, tools=yes, tests=yes, use_asan=yes, use_ubsan=yes)
@@ -122,14 +130,21 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd tools=yes tests=yes target=debug use_asan=yes use_ubsan=yes
+ scons tools=yes tests=yes target=debug use_asan=yes use_ubsan=yes
+ ls -l bin/
# Execute unit tests for the editor
- name: Unit Tests
run: |
./bin/godot.linuxbsd.tools.64s --test
- linux-template:
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
+
+ linux-template-mono:
runs-on: "ubuntu-20.04"
name: Template w/ Mono (target=release, tools=no)
@@ -182,4 +197,11 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=linuxbsd target=release tools=no module_mono_enabled=yes mono_glue=no
+ scons target=release tools=no module_mono_enabled=yes mono_glue=no
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/.github/workflows/macos_builds.yml b/.github/workflows/macos_builds.yml
index 74b57adaeb..6a684872f2 100644
--- a/.github/workflows/macos_builds.yml
+++ b/.github/workflows/macos_builds.yml
@@ -1,9 +1,10 @@
name: 🍎 macOS Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=osx verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_LIMIT: 4096
jobs:
@@ -49,13 +50,20 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=osx tools=yes tests=yes target=release_debug
+ scons tools=yes tests=yes target=release_debug
+ ls -l bin/
# Execute unit tests for the editor
- name: Unit Tests
run: |
./bin/godot.osx.opt.tools.64 --test
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
+
macos-template:
runs-on: "macos-latest"
name: Template (target=release, tools=no)
@@ -96,4 +104,11 @@ jobs:
env:
SCONS_CACHE: ${{github.workspace}}/.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=osx target=release tools=no
+ scons target=release tools=no
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/.github/workflows/windows_builds.yml b/.github/workflows/windows_builds.yml
index a2fa4cc7c8..0af4d22b72 100644
--- a/.github/workflows/windows_builds.yml
+++ b/.github/workflows/windows_builds.yml
@@ -1,10 +1,11 @@
name: 🏁 Windows Builds
on: [push, pull_request]
-# Global Cache Settings
+# Global Settings
# SCONS_CACHE for windows must be set in the build environment
env:
GODOT_BASE_BRANCH: master
+ SCONSFLAGS: platform=windows verbose=yes warnings=all werror=yes --jobs=2
SCONS_CACHE_MSVC_CONFIG: true
SCONS_CACHE_LIMIT: 4096
@@ -54,21 +55,19 @@ jobs:
env:
SCONS_CACHE: /.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=windows tools=yes tests=yes target=release_debug
+ scons tools=yes tests=yes target=release_debug
+ ls -l bin/
# Execute unit tests for the editor
- name: Unit Tests
run: |
./bin/godot.windows.opt.tools.64.exe --test
-# Build Product Upload (tested and working)
-# sorry this is disabled until github can give us some more space as we would hit our limit very quickly
-# tested this code and it works fine so just enable it to get them back
-# - name: publishing godot windows-editor
-# uses: actions/upload-artifact@v1
-# with:
-# name: windows-editor (x64)
-# path: bin/godot.windows.opt.tools.64.exe
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
windows-template:
runs-on: "windows-latest"
@@ -111,13 +110,11 @@ jobs:
env:
SCONS_CACHE: /.scons_cache/
run: |
- scons -j2 verbose=yes warnings=all werror=yes platform=windows target=release tools=no
-
-# Build Product Upload (tested and working)
-# sorry this is disabled until github can give us some more space as we would hit our limit very quickly
-# tested this code and it works fine so just enable it to get them back
-# - name: publishing godot windows-template
-# uses: actions/upload-artifact@v1
-# with:
-# name: windows-template (x64)
-# path: bin/godot.windows.opt.64.exe
+ scons target=release tools=no
+ ls -l bin/
+
+ - uses: actions/upload-artifact@v2
+ with:
+ name: ${{ github.job }}
+ path: bin/*
+ retention-days: 14
diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md
index c28692c34f..1abd76b2ff 100644
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -135,6 +135,29 @@ If your pull request modifies parts of the code in a non-obvious way, make sure
to add comments in the code as well. This helps other people understand the
change without having to look at `git blame`.
+### Write unit tests
+
+When fixing a bug or contributing a new feature, we recommend including unit
+tests in the same commit as the rest of the pull request. Unit tests are pieces
+of code that compare the output to a predetermined *expected result* to detect
+regressions. Tests are compiled and run on GitHub Actions for every commit and
+pull request.
+
+Pull requests that include tests are more likely to be merged, since we can have
+greater confidence in them not being the target of regressions in the future.
+
+For bugs, the unit tests should cover the functionality that was previously
+broken. If done well, this ensures regressions won't appear in the future
+again. For new features, the unit tests should cover the newly added
+functionality, testing both the "success" and "expected failure" cases if
+applicable.
+
+Feel free to contribute standalone pull requests to add new tests or improve
+existing tests as well.
+
+See [Unit testing](https://docs.godotengine.org/en/latest/development/cpp/unit_testing.html)
+for information on writing tests in Godot's C++ codebase.
+
### Be nice to the Git history
Try to make simple PRs that handle one specific topic. Just like for reporting
diff --git a/SConstruct b/SConstruct
index e38e0dc231..f134dfddac 100644
--- a/SConstruct
+++ b/SConstruct
@@ -414,7 +414,7 @@ if selected_platform in platform_list:
Exit(255)
# Configure compiler warnings
- if env.msvc:
+ if env.msvc: # MSVC
# Truncations, narrowing conversions, signed/unsigned comparisons...
disable_nonessential_warnings = ["/wd4267", "/wd4244", "/wd4305", "/wd4018", "/wd4800"]
if env["warnings"] == "extra":
@@ -427,21 +427,17 @@ if selected_platform in platform_list:
env.Append(CCFLAGS=["/w"])
# Set exception handling model to avoid warnings caused by Windows system headers.
env.Append(CCFLAGS=["/EHsc"])
+
if env["werror"]:
env.Append(CCFLAGS=["/WX"])
- # Force to use Unicode encoding
- env.Append(MSVC_FLAGS=["/utf8"])
- else: # Rest of the world
- shadow_local_warning = []
- all_plus_warnings = ["-Wwrite-strings"]
+ else: # GCC, Clang
+ gcc_common_warnings = []
if methods.using_gcc(env):
- env.Append(CCFLAGS=["-Wno-misleading-indentation"])
- if cc_version_major >= 7:
- shadow_local_warning = ["-Wshadow-local"]
+ gcc_common_warnings += ["-Wshadow-local", "-Wno-misleading-indentation"]
if env["warnings"] == "extra":
- env.Append(CCFLAGS=["-Wall", "-Wextra", "-Wno-unused-parameter"] + all_plus_warnings + shadow_local_warning)
+ env.Append(CCFLAGS=["-Wall", "-Wextra", "-Wwrite-strings", "-Wno-unused-parameter"] + gcc_common_warnings)
env.Append(CXXFLAGS=["-Wctor-dtor-privacy", "-Wnon-virtual-dtor"])
if methods.using_gcc(env):
env.Append(
@@ -457,14 +453,15 @@ if selected_platform in platform_list:
env.Append(CXXFLAGS=["-Wplacement-new=1"])
if cc_version_major >= 9:
env.Append(CCFLAGS=["-Wattribute-alias=2"])
- if methods.using_clang(env):
+ elif methods.using_clang(env):
env.Append(CCFLAGS=["-Wimplicit-fallthrough"])
elif env["warnings"] == "all":
- env.Append(CCFLAGS=["-Wall"] + shadow_local_warning)
+ env.Append(CCFLAGS=["-Wall"] + gcc_common_warnings)
elif env["warnings"] == "moderate":
- env.Append(CCFLAGS=["-Wall", "-Wno-unused"] + shadow_local_warning)
+ env.Append(CCFLAGS=["-Wall", "-Wno-unused"] + gcc_common_warnings)
else: # 'no'
env.Append(CCFLAGS=["-w"])
+
if env["werror"]:
env.Append(CCFLAGS=["-Werror"])
# FIXME: Temporary workaround after the Vulkan merge, remove once warnings are fixed.
diff --git a/core/SCsub b/core/SCsub
index 59fe63b4b3..b9f06d12ae 100644
--- a/core/SCsub
+++ b/core/SCsub
@@ -3,7 +3,6 @@
Import("env")
import core_builders
-import make_binders
env.core_sources = []
@@ -87,11 +86,7 @@ if env["builtin_zlib"]:
# Minizip library, could be unbundled in theory
# However, our version has some custom modifications, so it won't compile with the system one
thirdparty_minizip_dir = "#thirdparty/minizip/"
-thirdparty_minizip_sources = [
- "ioapi.c",
- "unzip.c",
- "zip.c",
-]
+thirdparty_minizip_sources = ["ioapi.c", "unzip.c", "zip.c"]
thirdparty_minizip_sources = [thirdparty_minizip_dir + file for file in thirdparty_minizip_sources]
env_thirdparty.add_source_files(env.core_sources, thirdparty_minizip_sources)
@@ -152,27 +147,16 @@ env.CommandNoCache(
env.Run(core_builders.make_certs_header, "Building ca-certificates header."),
)
-# Make binders
-env.CommandNoCache(
- ["method_bind.gen.inc", "method_bind_ext.gen.inc", "method_bind_free_func.gen.inc"],
- "make_binders.py",
- env.Run(make_binders.run, "Generating method binders."),
-)
-
# Authors
env.Depends("#core/authors.gen.h", "../AUTHORS.md")
env.CommandNoCache(
- "#core/authors.gen.h",
- "../AUTHORS.md",
- env.Run(core_builders.make_authors_header, "Generating authors header."),
+ "#core/authors.gen.h", "../AUTHORS.md", env.Run(core_builders.make_authors_header, "Generating authors header.")
)
# Donors
env.Depends("#core/donors.gen.h", "../DONORS.md")
env.CommandNoCache(
- "#core/donors.gen.h",
- "../DONORS.md",
- env.Run(core_builders.make_donors_header, "Generating donors header."),
+ "#core/donors.gen.h", "../DONORS.md", env.Run(core_builders.make_donors_header, "Generating donors header.")
)
# License
diff --git a/core/array.cpp b/core/array.cpp
index d1c0688e63..c6e90d71ec 100644
--- a/core/array.cpp
+++ b/core/array.cpp
@@ -31,8 +31,8 @@
#include "array.h"
#include "container_type_validate.h"
+#include "core/class_db.h"
#include "core/hashfuncs.h"
-#include "core/object.h"
#include "core/script_language.h"
#include "core/variant.h"
#include "core/vector.h"
@@ -330,9 +330,8 @@ struct _ArrayVariantSort {
}
};
-Array &Array::sort() {
+void Array::sort() {
_p->array.sort_custom<_ArrayVariantSort>();
- return *this;
}
struct _ArrayVariantSortCustom {
@@ -349,14 +348,13 @@ struct _ArrayVariantSortCustom {
return res;
}
};
-Array &Array::sort_custom(Object *p_obj, const StringName &p_function) {
- ERR_FAIL_NULL_V(p_obj, *this);
+void Array::sort_custom(Object *p_obj, const StringName &p_function) {
+ ERR_FAIL_NULL(p_obj);
SortArray<Variant, _ArrayVariantSortCustom, true> avs;
avs.compare.obj = p_obj;
avs.compare.func = p_function;
avs.sort(_p->array.ptrw(), _p->array.size());
- return *this;
}
void Array::shuffle() {
@@ -415,9 +413,8 @@ int Array::bsearch_custom(const Variant &p_value, Object *p_obj, const StringNam
return bisect(_p->array, p_value, p_before, less);
}
-Array &Array::invert() {
+void Array::invert() {
_p->array.invert();
- return *this;
}
void Array::push_front(const Variant &p_value) {
diff --git a/core/array.h b/core/array.h
index d2e0537ad5..34367088e4 100644
--- a/core/array.h
+++ b/core/array.h
@@ -75,12 +75,12 @@ public:
Variant front() const;
Variant back() const;
- Array &sort();
- Array &sort_custom(Object *p_obj, const StringName &p_function);
+ void sort();
+ void sort_custom(Object *p_obj, const StringName &p_function);
void shuffle();
int bsearch(const Variant &p_value, bool p_before = true);
int bsearch_custom(const Variant &p_value, Object *p_obj, const StringName &p_function, bool p_before = true);
- Array &invert();
+ void invert();
int find(const Variant &p_value, int p_from = 0) const;
int rfind(const Variant &p_value, int p_from = -1) const;
diff --git a/core/bind/core_bind.cpp b/core/bind/core_bind.cpp
index c68222c767..baf5d4b928 100644
--- a/core/bind/core_bind.cpp
+++ b/core/bind/core_bind.cpp
@@ -1156,10 +1156,6 @@ Vector<Vector3> _Geometry3D::clip_polygon(const Vector<Vector3> &p_points, const
return Geometry3D::clip_polygon(p_points, p_plane);
}
-int _Geometry3D::get_uv84_normal_bit(const Vector3 &p_vector) {
- return Geometry3D::get_uv84_normal_bit(p_vector);
-}
-
void _Geometry3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("build_box_planes", "extents"), &_Geometry3D::build_box_planes);
ClassDB::bind_method(D_METHOD("build_cylinder_planes", "radius", "height", "sides", "axis"), &_Geometry3D::build_cylinder_planes, DEFVAL(Vector3::AXIS_Z));
@@ -1171,8 +1167,6 @@ void _Geometry3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("get_closest_point_to_segment_uncapped", "point", "s1", "s2"), &_Geometry3D::get_closest_point_to_segment_uncapped);
- ClassDB::bind_method(D_METHOD("get_uv84_normal_bit", "normal"), &_Geometry3D::get_uv84_normal_bit);
-
ClassDB::bind_method(D_METHOD("ray_intersects_triangle", "from", "dir", "a", "b", "c"), &_Geometry3D::ray_intersects_triangle);
ClassDB::bind_method(D_METHOD("segment_intersects_triangle", "from", "to", "a", "b", "c"), &_Geometry3D::segment_intersects_triangle);
ClassDB::bind_method(D_METHOD("segment_intersects_sphere", "from", "to", "sphere_position", "sphere_radius"), &_Geometry3D::segment_intersects_sphere);
@@ -1743,11 +1737,13 @@ Error _Directory::rename(String p_from, String p_to) {
ERR_FAIL_COND_V_MSG(!is_open(), ERR_UNCONFIGURED, "Directory must be opened before use.");
if (!p_from.is_rel_path()) {
DirAccess *d = DirAccess::create_for_path(p_from);
+ ERR_FAIL_COND_V_MSG(!d->file_exists(p_from), ERR_DOES_NOT_EXIST, "File does not exist.");
Error err = d->rename(p_from, p_to);
memdelete(d);
return err;
}
+ ERR_FAIL_COND_V_MSG(!d->file_exists(p_from), ERR_DOES_NOT_EXIST, "File does not exist.");
return d->rename(p_from, p_to);
}
diff --git a/core/bind/core_bind.h b/core/bind/core_bind.h
index 5c9520d7fe..e75e740cd5 100644
--- a/core/bind/core_bind.h
+++ b/core/bind/core_bind.h
@@ -344,7 +344,6 @@ public:
Vector<Vector3> segment_intersects_sphere(const Vector3 &p_from, const Vector3 &p_to, const Vector3 &p_sphere_pos, real_t p_sphere_radius);
Vector<Vector3> segment_intersects_cylinder(const Vector3 &p_from, const Vector3 &p_to, float p_height, float p_radius);
Vector<Vector3> segment_intersects_convex(const Vector3 &p_from, const Vector3 &p_to, const Vector<Plane> &p_planes);
- int get_uv84_normal_bit(const Vector3 &p_vector);
Vector<Vector3> clip_polygon(const Vector<Vector3> &p_points, const Plane &p_plane);
diff --git a/core/binder_common.h b/core/binder_common.h
new file mode 100644
index 0000000000..0fbfa56230
--- /dev/null
+++ b/core/binder_common.h
@@ -0,0 +1,657 @@
+/*************************************************************************/
+/* binder_common.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef BINDER_COMMON_H
+#define BINDER_COMMON_H
+
+#include "core/list.h"
+#include "core/method_ptrcall.h"
+#include "core/object.h"
+#include "core/simple_type.h"
+#include "core/type_info.h"
+#include "core/typedefs.h"
+#include "core/variant.h"
+#include "core/variant_internal.h"
+
+#include <stdio.h>
+
+template <class T>
+struct VariantCaster {
+ static _FORCE_INLINE_ T cast(const Variant &p_variant) {
+ return p_variant;
+ }
+};
+
+template <class T>
+struct VariantCaster<T &> {
+ static _FORCE_INLINE_ T cast(const Variant &p_variant) {
+ return p_variant;
+ }
+};
+
+template <class T>
+struct VariantCaster<const T &> {
+ static _FORCE_INLINE_ T cast(const Variant &p_variant) {
+ return p_variant;
+ }
+};
+
+#ifdef PTRCALL_ENABLED
+
+#define VARIANT_ENUM_CAST(m_enum) \
+ MAKE_ENUM_TYPE_INFO(m_enum) \
+ template <> \
+ struct VariantCaster<m_enum> { \
+ static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \
+ return (m_enum)p_variant.operator int(); \
+ } \
+ }; \
+ template <> \
+ struct PtrToArg<m_enum> { \
+ _FORCE_INLINE_ static m_enum convert(const void *p_ptr) { \
+ return m_enum(*reinterpret_cast<const int *>(p_ptr)); \
+ } \
+ _FORCE_INLINE_ static void encode(m_enum p_val, const void *p_ptr) { \
+ *(int *)p_ptr = p_val; \
+ } \
+ };
+
+#else
+
+#define VARIANT_ENUM_CAST(m_enum) \
+ MAKE_ENUM_TYPE_INFO(m_enum) \
+ template <> \
+ struct VariantCaster<m_enum> { \
+ static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \
+ return (m_enum)p_variant.operator int(); \
+ } \
+ };
+
+#endif
+
+// Object enum casts must go here
+VARIANT_ENUM_CAST(Object::ConnectFlags);
+
+VARIANT_ENUM_CAST(Vector3::Axis);
+
+VARIANT_ENUM_CAST(Error);
+VARIANT_ENUM_CAST(Margin);
+VARIANT_ENUM_CAST(Corner);
+VARIANT_ENUM_CAST(Orientation);
+VARIANT_ENUM_CAST(HAlign);
+VARIANT_ENUM_CAST(VAlign);
+VARIANT_ENUM_CAST(PropertyHint);
+VARIANT_ENUM_CAST(PropertyUsageFlags);
+VARIANT_ENUM_CAST(Variant::Type);
+VARIANT_ENUM_CAST(Variant::Operator);
+
+template <>
+struct VariantCaster<char32_t> {
+ static _FORCE_INLINE_ char32_t cast(const Variant &p_variant) {
+ return (char32_t)p_variant.operator int();
+ }
+};
+#ifdef PTRCALL_ENABLED
+template <>
+struct PtrToArg<char32_t> {
+ _FORCE_INLINE_ static char32_t convert(const void *p_ptr) {
+ return char32_t(*reinterpret_cast<const int *>(p_ptr));
+ }
+ _FORCE_INLINE_ static void encode(char32_t p_val, const void *p_ptr) {
+ *(int *)p_ptr = p_val;
+ }
+};
+#endif
+
+template <typename T>
+struct VariantObjectClassChecker {
+ static _FORCE_INLINE_ bool check(const Variant &p_variant) {
+ return true;
+ }
+};
+
+template <>
+struct VariantObjectClassChecker<Node *> {
+ static _FORCE_INLINE_ bool check(const Variant &p_variant) {
+ Object *obj = p_variant;
+ Node *node = p_variant;
+ return node || !obj;
+ }
+};
+
+template <>
+struct VariantObjectClassChecker<Control *> {
+ static _FORCE_INLINE_ bool check(const Variant &p_variant) {
+ Object *obj = p_variant;
+ Control *control = p_variant;
+ return control || !obj;
+ }
+};
+
+#ifdef DEBUG_METHODS_ENABLED
+
+template <class T>
+struct VariantCasterAndValidate {
+ static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
+ Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
+ if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) ||
+ !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) {
+ r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
+ r_error.argument = p_arg_idx;
+ r_error.expected = argtype;
+ }
+
+ return VariantCaster<T>::cast(*p_args[p_arg_idx]);
+ }
+};
+
+template <class T>
+struct VariantCasterAndValidate<T &> {
+ static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
+ Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
+ if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) ||
+ !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) {
+ r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
+ r_error.argument = p_arg_idx;
+ r_error.expected = argtype;
+ }
+
+ return VariantCaster<T>::cast(*p_args[p_arg_idx]);
+ }
+};
+
+template <class T>
+struct VariantCasterAndValidate<const T &> {
+ static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
+ Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
+ if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype) ||
+ !VariantObjectClassChecker<T>::check(p_args[p_arg_idx])) {
+ r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
+ r_error.argument = p_arg_idx;
+ r_error.expected = argtype;
+ }
+
+ return VariantCaster<T>::cast(*p_args[p_arg_idx]);
+ }
+};
+
+#endif // DEBUG_METHODS_ENABLED
+
+template <class T, class... P, size_t... Is>
+void call_with_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) {
+ r_error.error = Callable::CallError::CALL_OK;
+
+#ifdef DEBUG_METHODS_ENABLED
+ (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
+#else
+ (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
+#endif
+ (void)(p_args); //avoid warning
+}
+
+template <class T, class... P, size_t... Is>
+void call_with_variant_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) {
+ r_error.error = Callable::CallError::CALL_OK;
+
+#ifdef DEBUG_METHODS_ENABLED
+ (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
+#else
+ (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
+#endif
+ (void)(p_args); //avoid warning
+}
+
+#ifdef PTRCALL_ENABLED
+
+template <class T, class... P, size_t... Is>
+void call_with_ptr_args_helper(T *p_instance, void (T::*p_method)(P...), const void **p_args, IndexSequence<Is...>) {
+ (p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...);
+}
+
+template <class T, class... P, size_t... Is>
+void call_with_ptr_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const void **p_args, IndexSequence<Is...>) {
+ (p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...);
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_ptr_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const void **p_args, void *r_ret, IndexSequence<Is...>) {
+ PtrToArg<R>::encode((p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...), r_ret);
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_ptr_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const void **p_args, void *r_ret, IndexSequence<Is...>) {
+ PtrToArg<R>::encode((p_instance->*p_method)(PtrToArg<P>::convert(p_args[Is])...), r_ret);
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_ptr_args_static_retc_helper(T *p_instance, R (*p_method)(T *, P...), const void **p_args, void *r_ret, IndexSequence<Is...>) {
+ PtrToArg<R>::encode(p_method(p_instance, PtrToArg<P>::convert(p_args[Is])...), r_ret);
+}
+
+#endif // PTRCALL_ENABLED
+
+template <class T, class... P, size_t... Is>
+void call_with_validated_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, IndexSequence<Is...>) {
+ (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...);
+}
+
+template <class T, class... P, size_t... Is>
+void call_with_validated_variant_argsc_helper(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, IndexSequence<Is...>) {
+ (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...);
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_validated_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) {
+ VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...));
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_validated_variant_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) {
+ VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, (p_instance->*p_method)((VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...));
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_validated_variant_args_static_retc_helper(T *p_instance, R (*p_method)(T *, P...), const Variant **p_args, Variant *r_ret, IndexSequence<Is...>) {
+ VariantInternalAccessor<typename GetSimpleTypeT<R>::type_t>::set(r_ret, p_method(p_instance, (VariantInternalAccessor<typename GetSimpleTypeT<P>::type_t>::get(p_args[Is]))...));
+}
+
+template <class T, class... P>
+void call_with_variant_args(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error) {
+#ifdef DEBUG_METHODS_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+
+ if ((size_t)p_argcount < sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+ call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class... P>
+void call_with_variant_args_dv(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error, const Vector<Variant> &default_values) {
+#ifdef DEBUG_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount;
+
+ int32_t dvs = default_values.size();
+#ifdef DEBUG_ENABLED
+ if (missing > dvs) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array
+ for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) {
+ if (i < p_argcount) {
+ args[i] = p_args[i];
+ } else {
+ args[i] = &default_values[i - p_argcount + (dvs - missing)];
+ }
+ }
+
+ call_with_variant_args_helper(p_instance, p_method, args, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class... P>
+void call_with_variant_argsc(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Callable::CallError &r_error) {
+#ifdef DEBUG_METHODS_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+
+ if ((size_t)p_argcount < sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+ call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class... P>
+void call_with_variant_argsc_dv(T *p_instance, void (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Callable::CallError &r_error, const Vector<Variant> &default_values) {
+#ifdef DEBUG_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount;
+
+ int32_t dvs = default_values.size();
+#ifdef DEBUG_ENABLED
+ if (missing > dvs) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array
+ for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) {
+ if (i < p_argcount) {
+ args[i] = p_args[i];
+ } else {
+ args[i] = &default_values[i - p_argcount + (dvs - missing)];
+ }
+ }
+
+ call_with_variant_argsc_helper(p_instance, p_method, args, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_variant_args_ret_dv(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error, const Vector<Variant> &default_values) {
+#ifdef DEBUG_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount;
+
+ int32_t dvs = default_values.size();
+#ifdef DEBUG_ENABLED
+ if (missing > dvs) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array
+ for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) {
+ if (i < p_argcount) {
+ args[i] = p_args[i];
+ } else {
+ args[i] = &default_values[i - p_argcount + (dvs - missing)];
+ }
+ }
+
+ call_with_variant_args_ret_helper(p_instance, p_method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_variant_args_retc_dv(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error, const Vector<Variant> &default_values) {
+#ifdef DEBUG_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ int32_t missing = (int32_t)sizeof...(P) - (int32_t)p_argcount;
+
+ int32_t dvs = default_values.size();
+#ifdef DEBUG_ENABLED
+ if (missing > dvs) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+
+ const Variant *args[sizeof...(P) == 0 ? 1 : sizeof...(P)]; //avoid zero sized array
+ for (int32_t i = 0; i < (int32_t)sizeof...(P); i++) {
+ if (i < p_argcount) {
+ args[i] = p_args[i];
+ } else {
+ args[i] = &default_values[i - p_argcount + (dvs - missing)];
+ }
+ }
+
+ call_with_variant_args_retc_helper(p_instance, p_method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+#ifdef PTRCALL_ENABLED
+
+template <class T, class... P>
+void call_with_ptr_args(T *p_instance, void (T::*p_method)(P...), const void **p_args) {
+ call_with_ptr_args_helper<T, P...>(p_instance, p_method, p_args, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class... P>
+void call_with_ptr_argsc(T *p_instance, void (T::*p_method)(P...) const, const void **p_args) {
+ call_with_ptr_argsc_helper<T, P...>(p_instance, p_method, p_args, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_ptr_args_ret(T *p_instance, R (T::*p_method)(P...), const void **p_args, void *r_ret) {
+ call_with_ptr_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_ptr_args_retc(T *p_instance, R (T::*p_method)(P...) const, const void **p_args, void *r_ret) {
+ call_with_ptr_args_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_ptr_args_static_retc(T *p_instance, R (*p_method)(T *, P...), const void **p_args, void *r_ret) {
+ call_with_ptr_args_static_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+#endif // PTRCALL_ENABLED
+
+template <class T, class... P>
+void call_with_validated_variant_args(Variant *base, void (T::*p_method)(P...), const Variant **p_args) {
+ call_with_validated_variant_args_helper<T, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_validated_variant_args_ret(Variant *base, R (T::*p_method)(P...), const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_ret_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_validated_variant_args_retc(Variant *base, R (T::*p_method)(P...) const, const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_retc_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P>
+void call_with_validated_variant_args_static_retc(Variant *base, R (*p_method)(T *, P...), const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_static_retc_helper<T, R, P...>(VariantGetInternalPtr<T>::get_ptr(base), p_method, p_args, r_ret, BuildIndexSequence<sizeof...(P)>{});
+}
+
+// GCC raises "parameter 'p_args' set but not used" when P = {},
+// it's not clever enough to treat other P values as making this branch valid.
+#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wunused-but-set-parameter"
+#endif
+
+#ifdef DEBUG_METHODS_ENABLED
+
+template <class Q>
+void call_get_argument_type_helper(int p_arg, int &index, Variant::Type &type) {
+ if (p_arg == index) {
+ type = GetTypeInfo<Q>::VARIANT_TYPE;
+ }
+ index++;
+}
+
+template <class... P>
+Variant::Type call_get_argument_type(int p_arg) {
+ Variant::Type type = Variant::NIL;
+ int index = 0;
+ // I think rocket science is simpler than modern C++.
+ using expand_type = int[];
+ expand_type a{ 0, (call_get_argument_type_helper<P>(p_arg, index, type), 0)... };
+ (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning.
+ (void)index; // Suppress GCC warning.
+ return type;
+}
+
+template <class Q>
+void call_get_argument_type_info_helper(int p_arg, int &index, PropertyInfo &info) {
+ if (p_arg == index) {
+ info = GetTypeInfo<Q>::get_class_info();
+ }
+ index++;
+}
+
+template <class... P>
+void call_get_argument_type_info(int p_arg, PropertyInfo &info) {
+ int index = 0;
+ // I think rocket science is simpler than modern C++.
+ using expand_type = int[];
+ expand_type a{ 0, (call_get_argument_type_info_helper<P>(p_arg, index, info), 0)... };
+ (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning.
+ (void)index; // Suppress GCC warning.
+}
+
+template <class Q>
+void call_get_argument_metadata_helper(int p_arg, int &index, GodotTypeInfo::Metadata &md) {
+ if (p_arg == index) {
+ md = GetTypeInfo<Q>::METADATA;
+ }
+ index++;
+}
+
+template <class... P>
+GodotTypeInfo::Metadata call_get_argument_metadata(int p_arg) {
+ GodotTypeInfo::Metadata md = GodotTypeInfo::METADATA_NONE;
+
+ int index = 0;
+ // I think rocket science is simpler than modern C++.
+ using expand_type = int[];
+ expand_type a{ 0, (call_get_argument_metadata_helper<P>(p_arg, index, md), 0)... };
+ (void)a; // Suppress (valid, but unavoidable) -Wunused-variable warning.
+ (void)index;
+ return md;
+}
+
+#else
+
+template <class... P>
+Variant::Type call_get_argument_type(int p_arg) {
+ return Variant::NIL;
+}
+
+#endif // DEBUG_METHODS_ENABLED
+
+//////////////////////
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) {
+ r_error.error = Callable::CallError::CALL_OK;
+
+#ifdef DEBUG_METHODS_ENABLED
+ r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
+#else
+ r_ret = (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
+#endif
+}
+
+template <class T, class R, class... P>
+void call_with_variant_args_ret(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+#ifdef DEBUG_METHODS_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+
+ if ((size_t)p_argcount < sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+ call_with_variant_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_variant_args_retc_helper(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) {
+ r_error.error = Callable::CallError::CALL_OK;
+
+#ifdef DEBUG_METHODS_ENABLED
+ r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
+#else
+ r_ret = (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
+#endif
+ (void)p_args;
+}
+
+template <class T, class R, class... P>
+void call_with_variant_args_retc(T *p_instance, R (T::*p_method)(P...) const, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+#ifdef DEBUG_METHODS_ENABLED
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+
+ if ((size_t)p_argcount < sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
+#endif
+ call_with_variant_args_retc_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
+}
+
+template <class T, class R, class... P, size_t... Is>
+void call_with_variant_args_retc_static_helper(T *p_instance, R (*p_method)(T *, P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) {
+ r_error.error = Callable::CallError::CALL_OK;
+
+#ifdef DEBUG_METHODS_ENABLED
+ r_ret = (p_method)(p_instance, VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
+#else
+ r_ret = (p_method)(p_instance, VariantCaster<P>::cast(*p_args[Is])...);
+#endif
+
+ (void)p_args;
+}
+
+#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+
+#endif // BINDER_COMMON_H
diff --git a/core/callable.cpp b/core/callable.cpp
index b7bdc715f8..c368565687 100644
--- a/core/callable.cpp
+++ b/core/callable.cpp
@@ -30,6 +30,7 @@
#include "callable.h"
+#include "callable_bind.h"
#include "core/script_language.h"
#include "message_queue.h"
#include "object.h"
@@ -53,6 +54,18 @@ void Callable::call(const Variant **p_arguments, int p_argcount, Variant &r_retu
}
}
+Callable Callable::bind(const Variant **p_arguments, int p_argcount) const {
+ Vector<Variant> args;
+ args.resize(p_argcount);
+ for (int i = 0; i < p_argcount; i++) {
+ args.write[i] = *p_arguments[i];
+ }
+ return Callable(memnew(CallableCustomBind(*this, args)));
+}
+Callable Callable::unbind(int p_argcount) const {
+ return Callable(memnew(CallableCustomUnbind(*this, p_argcount)));
+}
+
Object *Callable::get_object() const {
if (is_null()) {
return nullptr;
@@ -85,6 +98,18 @@ CallableCustom *Callable::get_custom() const {
return custom;
}
+const Callable *Callable::get_base_comparator() const {
+ const Callable *comparator = nullptr;
+ if (is_custom()) {
+ comparator = custom->get_base_comparator();
+ }
+ if (comparator) {
+ return comparator;
+ } else {
+ return this;
+ }
+}
+
uint32_t Callable::hash() const {
if (is_custom()) {
return custom->hash();
@@ -258,6 +283,10 @@ Callable::~Callable() {
}
}
+const Callable *CallableCustom::get_base_comparator() const {
+ return nullptr;
+}
+
CallableCustom::CallableCustom() {
ref_count.init();
}
diff --git a/core/callable.h b/core/callable.h
index 7fd6b54cf7..936272a681 100644
--- a/core/callable.h
+++ b/core/callable.h
@@ -80,6 +80,9 @@ public:
return method != StringName();
}
+ Callable bind(const Variant **p_arguments, int p_argcount) const;
+ Callable unbind(int p_argcount) const;
+
Object *get_object() const;
ObjectID get_object_id() const;
StringName get_method() const;
@@ -87,6 +90,8 @@ public:
uint32_t hash() const;
+ const Callable *get_base_comparator() const; //used for bind/unbind to do less precise comparisons (ignoring binds) in signal connect/disconnect
+
bool operator==(const Callable &p_callable) const;
bool operator!=(const Callable &p_callable) const;
bool operator<(const Callable &p_callable) const;
@@ -119,6 +124,7 @@ public:
virtual CompareLessFunc get_compare_less_func() const = 0;
virtual ObjectID get_object() const = 0; //must always be able to provide an object
virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const = 0;
+ virtual const Callable *get_base_comparator() const;
CallableCustom();
virtual ~CallableCustom() {}
diff --git a/core/callable_bind.cpp b/core/callable_bind.cpp
new file mode 100644
index 0000000000..da08d3ccbd
--- /dev/null
+++ b/core/callable_bind.cpp
@@ -0,0 +1,193 @@
+/*************************************************************************/
+/* callable_bind.cpp */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#include "callable_bind.h"
+
+//////////////////////////////////
+
+uint32_t CallableCustomBind::hash() const {
+ return callable.hash();
+}
+String CallableCustomBind::get_as_text() const {
+ return callable.operator String();
+}
+
+bool CallableCustomBind::_equal_func(const CallableCustom *p_a, const CallableCustom *p_b) {
+ const CallableCustomBind *a = (const CallableCustomBind *)p_a;
+ const CallableCustomBind *b = (const CallableCustomBind *)p_b;
+
+ if (!(a->callable != b->callable)) {
+ return false;
+ }
+
+ if (a->binds.size() != b->binds.size()) {
+ return false;
+ }
+
+ return true;
+}
+
+bool CallableCustomBind::_less_func(const CallableCustom *p_a, const CallableCustom *p_b) {
+ const CallableCustomBind *a = (const CallableCustomBind *)p_a;
+ const CallableCustomBind *b = (const CallableCustomBind *)p_b;
+
+ if (a->callable < b->callable) {
+ return true;
+ } else if (b->callable < a->callable) {
+ return false;
+ }
+
+ return a->binds.size() < b->binds.size();
+}
+
+CallableCustom::CompareEqualFunc CallableCustomBind::get_compare_equal_func() const {
+ return _equal_func;
+}
+CallableCustom::CompareLessFunc CallableCustomBind::get_compare_less_func() const {
+ return _less_func;
+}
+ObjectID CallableCustomBind::get_object() const {
+ return callable.get_object_id();
+}
+const Callable *CallableCustomBind::get_base_comparator() const {
+ return &callable;
+}
+
+void CallableCustomBind::call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const {
+ const Variant **args = (const Variant **)alloca(sizeof(const Variant **) * (binds.size() + p_argcount));
+ for (int i = 0; i < p_argcount; i++) {
+ args[i] = (const Variant *)p_arguments[i];
+ }
+ for (int i = 0; i < binds.size(); i++) {
+ args[i + p_argcount] = (const Variant *)&binds[i];
+ }
+
+ callable.call(args, p_argcount + binds.size(), r_return_value, r_call_error);
+}
+
+CallableCustomBind::CallableCustomBind(const Callable &p_callable, const Vector<Variant> &p_binds) {
+ callable = p_callable;
+ binds = p_binds;
+}
+
+CallableCustomBind::~CallableCustomBind() {
+}
+
+//////////////////////////////////
+
+uint32_t CallableCustomUnbind::hash() const {
+ return callable.hash();
+}
+String CallableCustomUnbind::get_as_text() const {
+ return callable.operator String();
+}
+
+bool CallableCustomUnbind::_equal_func(const CallableCustom *p_a, const CallableCustom *p_b) {
+ const CallableCustomUnbind *a = (const CallableCustomUnbind *)p_a;
+ const CallableCustomUnbind *b = (const CallableCustomUnbind *)p_b;
+
+ if (!(a->callable != b->callable)) {
+ return false;
+ }
+
+ if (a->argcount != b->argcount) {
+ return false;
+ }
+
+ return true;
+}
+
+bool CallableCustomUnbind::_less_func(const CallableCustom *p_a, const CallableCustom *p_b) {
+ const CallableCustomUnbind *a = (const CallableCustomUnbind *)p_a;
+ const CallableCustomUnbind *b = (const CallableCustomUnbind *)p_b;
+
+ if (a->callable < b->callable) {
+ return true;
+ } else if (b->callable < a->callable) {
+ return false;
+ }
+
+ return a->argcount < b->argcount;
+}
+
+CallableCustom::CompareEqualFunc CallableCustomUnbind::get_compare_equal_func() const {
+ return _equal_func;
+}
+CallableCustom::CompareLessFunc CallableCustomUnbind::get_compare_less_func() const {
+ return _less_func;
+}
+ObjectID CallableCustomUnbind::get_object() const {
+ return callable.get_object_id();
+}
+const Callable *CallableCustomUnbind::get_base_comparator() const {
+ return &callable;
+}
+
+void CallableCustomUnbind::call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const {
+ if (argcount > p_argcount) {
+ r_call_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_call_error.argument = 0;
+ r_call_error.expected = argcount;
+ return;
+ }
+ callable.call(p_arguments, p_argcount - argcount, r_return_value, r_call_error);
+}
+
+CallableCustomUnbind::CallableCustomUnbind(const Callable &p_callable, int p_argcount) {
+ callable = p_callable;
+ argcount = p_argcount;
+}
+
+CallableCustomUnbind::~CallableCustomUnbind() {
+}
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1) {
+ return p_callable.bind((const Variant **)&p_arg1, 1);
+}
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2) {
+ const Variant *args[2] = { &p_arg1, &p_arg2 };
+ return p_callable.bind(args, 2);
+}
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3) {
+ const Variant *args[3] = { &p_arg1, &p_arg2, &p_arg3 };
+ return p_callable.bind(args, 3);
+}
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4) {
+ const Variant *args[4] = { &p_arg1, &p_arg2, &p_arg3, &p_arg4 };
+ return p_callable.bind(args, 4);
+}
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5) {
+ const Variant *args[5] = { &p_arg1, &p_arg2, &p_arg3, &p_arg4, &p_arg5 };
+ return p_callable.bind(args, 5);
+}
diff --git a/core/callable_bind.h b/core/callable_bind.h
new file mode 100644
index 0000000000..21b9228be3
--- /dev/null
+++ b/core/callable_bind.h
@@ -0,0 +1,85 @@
+/*************************************************************************/
+/* callable_bind.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef CALLABLE_BIND_H
+#define CALLABLE_BIND_H
+
+#include "core/callable.h"
+#include "core/variant.h"
+
+class CallableCustomBind : public CallableCustom {
+ Callable callable;
+ Vector<Variant> binds;
+
+ static bool _equal_func(const CallableCustom *p_a, const CallableCustom *p_b);
+ static bool _less_func(const CallableCustom *p_a, const CallableCustom *p_b);
+
+public:
+ //for every type that inherits, these must always be the same for this type
+ virtual uint32_t hash() const;
+ virtual String get_as_text() const;
+ virtual CompareEqualFunc get_compare_equal_func() const;
+ virtual CompareLessFunc get_compare_less_func() const;
+ virtual ObjectID get_object() const; //must always be able to provide an object
+ virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const;
+ virtual const Callable *get_base_comparator() const;
+
+ CallableCustomBind(const Callable &p_callable, const Vector<Variant> &p_binds);
+ virtual ~CallableCustomBind();
+};
+
+class CallableCustomUnbind : public CallableCustom {
+ Callable callable;
+ int argcount;
+
+ static bool _equal_func(const CallableCustom *p_a, const CallableCustom *p_b);
+ static bool _less_func(const CallableCustom *p_a, const CallableCustom *p_b);
+
+public:
+ //for every type that inherits, these must always be the same for this type
+ virtual uint32_t hash() const;
+ virtual String get_as_text() const;
+ virtual CompareEqualFunc get_compare_equal_func() const;
+ virtual CompareLessFunc get_compare_less_func() const;
+ virtual ObjectID get_object() const; //must always be able to provide an object
+ virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const;
+ virtual const Callable *get_base_comparator() const;
+
+ CallableCustomUnbind(const Callable &p_callable, int p_argcount);
+ virtual ~CallableCustomUnbind();
+};
+
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1);
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2);
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3);
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4);
+Callable callable_bind(const Callable &p_callable, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5);
+
+#endif // CALLABLE_BIND_H
diff --git a/core/callable_method_pointer.h b/core/callable_method_pointer.h
index 1bb89e53e1..2007b9f338 100644
--- a/core/callable_method_pointer.h
+++ b/core/callable_method_pointer.h
@@ -31,6 +31,7 @@
#ifndef CALLABLE_METHOD_POINTER_H
#define CALLABLE_METHOD_POINTER_H
+#include "core/binder_common.h"
#include "core/callable.h"
#include "core/hashfuncs.h"
#include "core/object.h"
@@ -69,94 +70,6 @@ public:
virtual uint32_t hash() const;
};
-#ifdef DEBUG_METHODS_ENABLED
-
-template <class T>
-struct VariantCasterAndValidate {
- static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
- Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
- if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) {
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
- r_error.argument = p_arg_idx;
- r_error.expected = argtype;
- }
-
- return VariantCaster<T>::cast(*p_args[p_arg_idx]);
- }
-};
-
-template <class T>
-struct VariantCasterAndValidate<T &> {
- static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
- Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
- if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) {
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
- r_error.argument = p_arg_idx;
- r_error.expected = argtype;
- }
-
- return VariantCaster<T>::cast(*p_args[p_arg_idx]);
- }
-};
-
-template <class T>
-struct VariantCasterAndValidate<const T &> {
- static _FORCE_INLINE_ T cast(const Variant **p_args, uint32_t p_arg_idx, Callable::CallError &r_error) {
- Variant::Type argtype = GetTypeInfo<T>::VARIANT_TYPE;
- if (!Variant::can_convert_strict(p_args[p_arg_idx]->get_type(), argtype)) {
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
- r_error.argument = p_arg_idx;
- r_error.expected = argtype;
- }
-
- return VariantCaster<T>::cast(*p_args[p_arg_idx]);
- }
-};
-
-#endif // DEBUG_METHODS_ENABLED
-
-// GCC 8 raises "parameter 'p_args' set but not used" here, probably using a
-// template version that does not have arguments and thus sees it unused, but
-// obviously the template can be used for functions with and without them, and
-// the optimizer will get rid of it anyway.
-#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
-#pragma GCC diagnostic push
-#pragma GCC diagnostic ignored "-Wunused-but-set-parameter"
-#endif
-
-template <class T, class... P, size_t... Is>
-void call_with_variant_args_helper(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, Callable::CallError &r_error, IndexSequence<Is...>) {
- r_error.error = Callable::CallError::CALL_OK;
-
-#ifdef DEBUG_METHODS_ENABLED
- (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
-#else
- (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
-#endif
-}
-
-#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
-#pragma GCC diagnostic pop
-#endif
-
-template <class T, class... P>
-void call_with_variant_args(T *p_instance, void (T::*p_method)(P...), const Variant **p_args, int p_argcount, Callable::CallError &r_error) {
-#ifdef DEBUG_METHODS_ENABLED
- if ((size_t)p_argcount > sizeof...(P)) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument = sizeof...(P);
- return;
- }
-
- if ((size_t)p_argcount < sizeof...(P)) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument = sizeof...(P);
- return;
- }
-#endif
- call_with_variant_args_helper<T, P...>(p_instance, p_method, p_args, r_error, BuildIndexSequence<sizeof...(P)>{});
-}
-
template <class T, class... P>
class CallableCustomMethodPointer : public CallableCustomMethodPointerBase {
struct Data {
@@ -212,57 +125,71 @@ Callable create_custom_callable_function_pointer(T *p_instance,
// VERSION WITH RETURN
-// GCC 8 raises "parameter 'p_args' set but not used" here, probably using a
-// template version that does not have arguments and thus sees it unused, but
-// obviously the template can be used for functions with and without them, and
-// the optimizer will get rid of it anyway.
-#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
-#pragma GCC diagnostic push
-#pragma GCC diagnostic ignored "-Wunused-but-set-parameter"
+template <class T, class R, class... P>
+class CallableCustomMethodPointerRet : public CallableCustomMethodPointerBase {
+ struct Data {
+ T *instance;
+#ifdef DEBUG_ENABLED
+ uint64_t object_id;
#endif
+ R(T::*method)
+ (P...);
+ } data;
-template <class T, class R, class... P, size_t... Is>
-void call_with_variant_args_ret_helper(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, Variant &r_ret, Callable::CallError &r_error, IndexSequence<Is...>) {
- r_error.error = Callable::CallError::CALL_OK;
+public:
+ virtual ObjectID get_object() const {
+#ifdef DEBUG_ENABLED
+ if (ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr) {
+ return ObjectID();
+ }
+#endif
+ return data.instance->get_instance_id();
+ }
-#ifdef DEBUG_METHODS_ENABLED
- r_ret = (p_instance->*p_method)(VariantCasterAndValidate<P>::cast(p_args, Is, r_error)...);
-#else
- (p_instance->*p_method)(VariantCaster<P>::cast(*p_args[Is])...);
+ virtual void call(const Variant **p_arguments, int p_argcount, Variant &r_return_value, Callable::CallError &r_call_error) const {
+#ifdef DEBUG_ENABLED
+ ERR_FAIL_COND_MSG(ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr, "Invalid Object id '" + uitos(data.object_id) + "', can't call method.");
#endif
-}
+ call_with_variant_args_ret(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error);
+ }
-#if defined(DEBUG_METHODS_ENABLED) && defined(__GNUC__) && !defined(__clang__)
-#pragma GCC diagnostic pop
+ CallableCustomMethodPointerRet(T *p_instance, R (T::*p_method)(P...)) {
+ zeromem(&data, sizeof(Data)); // Clear beforehand, may have padding bytes.
+ data.instance = p_instance;
+#ifdef DEBUG_ENABLED
+ data.object_id = p_instance->get_instance_id();
#endif
+ data.method = p_method;
+ _setup((uint32_t *)&data, sizeof(Data));
+ }
+};
template <class T, class R, class... P>
-void call_with_variant_args_ret(T *p_instance, R (T::*p_method)(P...), const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+Callable create_custom_callable_function_pointer(T *p_instance,
#ifdef DEBUG_METHODS_ENABLED
- if ((size_t)p_argcount > sizeof...(P)) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument = sizeof...(P);
- return;
- }
+ const char *p_func_text,
+#endif
+ R (T::*p_method)(P...)) {
- if ((size_t)p_argcount < sizeof...(P)) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument = sizeof...(P);
- return;
- }
+ typedef CallableCustomMethodPointerRet<T, R, P...> CCMP; // Messes with memnew otherwise.
+ CCMP *ccmp = memnew(CCMP(p_instance, p_method));
+#ifdef DEBUG_METHODS_ENABLED
+ ccmp->set_text(p_func_text + 1); // Try to get rid of the ampersand.
#endif
- call_with_variant_args_ret_helper<T, R, P...>(p_instance, p_method, p_args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
+ return Callable(ccmp);
}
+// CONST VERSION WITH RETURN
+
template <class T, class R, class... P>
-class CallableCustomMethodPointerRet : public CallableCustomMethodPointerBase {
+class CallableCustomMethodPointerRetC : public CallableCustomMethodPointerBase {
struct Data {
T *instance;
#ifdef DEBUG_ENABLED
uint64_t object_id;
#endif
R(T::*method)
- (P...);
+ (P...) const;
} data;
public:
@@ -279,10 +206,10 @@ public:
#ifdef DEBUG_ENABLED
ERR_FAIL_COND_MSG(ObjectDB::get_instance(ObjectID(data.object_id)) == nullptr, "Invalid Object id '" + uitos(data.object_id) + "', can't call method.");
#endif
- call_with_variant_args_ret(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error);
+ call_with_variant_args_retc(data.instance, data.method, p_arguments, p_argcount, r_return_value, r_call_error);
}
- CallableCustomMethodPointerRet(T *p_instance, R (T::*p_method)(P...)) {
+ CallableCustomMethodPointerRetC(T *p_instance, R (T::*p_method)(P...) const) {
zeromem(&data, sizeof(Data)); // Clear beforehand, may have padding bytes.
data.instance = p_instance;
#ifdef DEBUG_ENABLED
@@ -298,9 +225,9 @@ Callable create_custom_callable_function_pointer(T *p_instance,
#ifdef DEBUG_METHODS_ENABLED
const char *p_func_text,
#endif
- R (T::*p_method)(P...)) {
+ R (T::*p_method)(P...) const) {
- typedef CallableCustomMethodPointerRet<T, R, P...> CCMP; // Messes with memnew otherwise.
+ typedef CallableCustomMethodPointerRetC<T, R, P...> CCMP; // Messes with memnew otherwise.
CCMP *ccmp = memnew(CCMP(p_instance, p_method));
#ifdef DEBUG_METHODS_ENABLED
ccmp->set_text(p_func_text + 1); // Try to get rid of the ampersand.
diff --git a/core/class_db.cpp b/core/class_db.cpp
index 88f1df3457..ad85cd0d62 100644
--- a/core/class_db.cpp
+++ b/core/class_db.cpp
@@ -1343,7 +1343,7 @@ MethodBind *ClassDB::bind_methodfi(uint32_t p_flags, MethodBind *p_bind, const c
defvals.resize(p_defcount);
for (int i = 0; i < p_defcount; i++) {
- defvals.write[i] = *p_defs[p_defcount - i - 1];
+ defvals.write[i] = *p_defs[i];
}
p_bind->set_default_arguments(defvals);
diff --git a/core/class_db.h b/core/class_db.h
index 86ac2aa001..4734b06c7a 100644
--- a/core/class_db.h
+++ b/core/class_db.h
@@ -36,7 +36,7 @@
#include "core/print_string.h"
/** To bind more then 6 parameters include this:
- * #include "core/method_bind_ext.gen.inc"
+ *
*/
// Makes callable_mp readily available in all classes connecting signals.
diff --git a/core/command_queue_mt.cpp b/core/command_queue_mt.cpp
index ace210ca2c..a55eed5d3c 100644
--- a/core/command_queue_mt.cpp
+++ b/core/command_queue_mt.cpp
@@ -31,6 +31,7 @@
#include "command_queue_mt.h"
#include "core/os/os.h"
+#include "core/project_settings.h"
void CommandQueueMT::lock() {
mutex.lock();
@@ -71,7 +72,7 @@ CommandQueueMT::SyncSemaphore *CommandQueueMT::_alloc_sync_sem() {
bool CommandQueueMT::dealloc_one() {
tryagain:
- if (dealloc_ptr == write_ptr) {
+ if (dealloc_ptr == (write_ptr_and_epoch >> 1)) {
// The queue is empty
return false;
}
@@ -94,6 +95,10 @@ tryagain:
}
CommandQueueMT::CommandQueueMT(bool p_sync) {
+ command_mem_size = GLOBAL_DEF_RST("memory/limits/command_queue/multithreading_queue_size_kb", DEFAULT_COMMAND_MEM_SIZE_KB);
+ ProjectSettings::get_singleton()->set_custom_property_info("memory/limits/command_queue/multithreading_queue_size_kb", PropertyInfo(Variant::INT, "memory/limits/command_queue/multithreading_queue_size_kb", PROPERTY_HINT_RANGE, "1,4096,1,or_greater"));
+ command_mem_size *= 1024;
+ command_mem = (uint8_t *)memalloc(command_mem_size);
if (p_sync) {
sync = memnew(Semaphore);
}
diff --git a/core/command_queue_mt.h b/core/command_queue_mt.h
index d7a6a5bc43..0e5bc7f369 100644
--- a/core/command_queue_mt.h
+++ b/core/command_queue_mt.h
@@ -330,15 +330,15 @@ class CommandQueueMT {
/***** BASE *******/
enum {
- COMMAND_MEM_SIZE_KB = 256,
- COMMAND_MEM_SIZE = COMMAND_MEM_SIZE_KB * 1024,
+ DEFAULT_COMMAND_MEM_SIZE_KB = 256,
SYNC_SEMAPHORES = 8
};
- uint8_t *command_mem = (uint8_t *)memalloc(COMMAND_MEM_SIZE);
- uint32_t read_ptr = 0;
- uint32_t write_ptr = 0;
+ uint8_t *command_mem = nullptr;
+ uint32_t read_ptr_and_epoch = 0;
+ uint32_t write_ptr_and_epoch = 0;
uint32_t dealloc_ptr = 0;
+ uint32_t command_mem_size = 0;
SyncSemaphore sync_sems[SYNC_SEMAPHORES];
Mutex mutex;
Semaphore *sync = nullptr;
@@ -348,7 +348,11 @@ class CommandQueueMT {
// alloc size is size+T+safeguard
uint32_t alloc_size = ((sizeof(T) + 8 - 1) & ~(8 - 1)) + 8;
+ // Assert that the buffer is big enough to hold at least two messages.
+ ERR_FAIL_COND_V(alloc_size * 2 + sizeof(uint32_t) > command_mem_size, nullptr);
+
tryagain:
+ uint32_t write_ptr = write_ptr_and_epoch >> 1;
if (write_ptr < dealloc_ptr) {
// behind dealloc_ptr, check that there is room
@@ -362,7 +366,7 @@ class CommandQueueMT {
} else {
// ahead of dealloc_ptr, check that there is room
- if ((COMMAND_MEM_SIZE - write_ptr) < alloc_size + sizeof(uint32_t)) {
+ if ((command_mem_size - write_ptr) < alloc_size + sizeof(uint32_t)) {
// no room at the end, wrap down;
if (dealloc_ptr == 0) { // don't want write_ptr to become dealloc_ptr
@@ -375,12 +379,17 @@ class CommandQueueMT {
}
// if this happens, it's a bug
- ERR_FAIL_COND_V((COMMAND_MEM_SIZE - write_ptr) < 8, nullptr);
+ ERR_FAIL_COND_V((command_mem_size - write_ptr) < 8, nullptr);
// zero means, wrap to beginning
uint32_t *p = (uint32_t *)&command_mem[write_ptr];
- *p = 0;
- write_ptr = 0;
+ *p = 1;
+ write_ptr_and_epoch = 0 | (1 & ~write_ptr_and_epoch); // Invert epoch.
+ // See if we can get the thread to run and clear up some more space while we wait.
+ // This is required if alloc_size * 2 + 4 > COMMAND_MEM_SIZE
+ if (sync) {
+ sync->post();
+ }
goto tryagain;
}
}
@@ -394,6 +403,7 @@ class CommandQueueMT {
// allocate the command
T *cmd = memnew_placement(&command_mem[write_ptr], T);
write_ptr += size;
+ write_ptr_and_epoch = (write_ptr << 1) | (write_ptr_and_epoch & 1);
return cmd;
}
@@ -419,19 +429,21 @@ class CommandQueueMT {
tryagain:
// tried to read an empty queue
- if (read_ptr == write_ptr) {
+ if (read_ptr_and_epoch == write_ptr_and_epoch) {
if (p_lock) {
unlock();
}
return false;
}
+ uint32_t read_ptr = read_ptr_and_epoch >> 1;
uint32_t size_ptr = read_ptr;
uint32_t size = *(uint32_t *)&command_mem[read_ptr] >> 1;
if (size == 0) {
+ *(uint32_t *)&command_mem[read_ptr] = 0; // clear in-use bit.
//end of ringbuffer, wrap
- read_ptr = 0;
+ read_ptr_and_epoch = 0 | (1 & ~read_ptr_and_epoch); // Invert epoch.
goto tryagain;
}
@@ -441,6 +453,8 @@ class CommandQueueMT {
read_ptr += size;
+ read_ptr_and_epoch = (read_ptr << 1) | (read_ptr_and_epoch & 1);
+
if (p_lock) {
unlock();
}
diff --git a/core/core_string_names.cpp b/core/core_string_names.cpp
index 1d3b333efc..6f86f107e6 100644
--- a/core/core_string_names.cpp
+++ b/core/core_string_names.cpp
@@ -73,6 +73,8 @@ CoreStringNames::CoreStringNames() :
a8(StaticCString::create("a8")),
call(StaticCString::create("call")),
call_deferred(StaticCString::create("call_deferred")),
+ bind(StaticCString::create("bind")),
+ unbind(StaticCString::create("unbind")),
emit(StaticCString::create("emit")),
notification(StaticCString::create("notification")) {
}
diff --git a/core/core_string_names.h b/core/core_string_names.h
index 1a18c84572..43597ef301 100644
--- a/core/core_string_names.h
+++ b/core/core_string_names.h
@@ -92,6 +92,8 @@ public:
StringName call;
StringName call_deferred;
+ StringName bind;
+ StringName unbind;
StringName emit;
StringName notification;
};
diff --git a/core/debugger/remote_debugger.h b/core/debugger/remote_debugger.h
index dc7e4436e1..320ee15996 100644
--- a/core/debugger/remote_debugger.h
+++ b/core/debugger/remote_debugger.h
@@ -32,10 +32,10 @@
#define REMOTE_DEBUGGER_H
#include "core/array.h"
+#include "core/class_db.h"
#include "core/debugger/debugger_marshalls.h"
#include "core/debugger/engine_debugger.h"
#include "core/debugger/remote_debugger_peer.h"
-#include "core/object.h"
#include "core/string_name.h"
#include "core/ustring.h"
diff --git a/core/global_constants.cpp b/core/global_constants.cpp
index b30685539a..064c302341 100644
--- a/core/global_constants.cpp
+++ b/core/global_constants.cpp
@@ -30,8 +30,8 @@
#include "global_constants.h"
+#include "core/class_db.h"
#include "core/input/input_event.h"
-#include "core/object.h"
#include "core/os/keyboard.h"
#include "core/variant.h"
diff --git a/core/input/input_map.h b/core/input/input_map.h
index 548553ed31..755df26984 100644
--- a/core/input/input_map.h
+++ b/core/input/input_map.h
@@ -31,8 +31,8 @@
#ifndef INPUT_MAP_H
#define INPUT_MAP_H
+#include "core/class_db.h"
#include "core/input/input_event.h"
-#include "core/object.h"
class InputMap : public Object {
GDCLASS(InputMap, Object);
diff --git a/core/io/http_client.cpp b/core/io/http_client.cpp
index 46e45500bf..a25413b21b 100644
--- a/core/io/http_client.cpp
+++ b/core/io/http_client.cpp
@@ -96,6 +96,10 @@ Error HTTPClient::connect_to_host(const String &p_host, int p_port, bool p_ssl,
void HTTPClient::set_connection(const Ref<StreamPeer> &p_connection) {
ERR_FAIL_COND_MSG(p_connection.is_null(), "Connection is not a reference to a valid StreamPeer object.");
+ if (connection == p_connection) {
+ return;
+ }
+
close();
connection = p_connection;
status = STATUS_CONNECTED;
diff --git a/core/io/packet_peer.h b/core/io/packet_peer.h
index 92cdbc4151..fb4dc181db 100644
--- a/core/io/packet_peer.h
+++ b/core/io/packet_peer.h
@@ -31,8 +31,8 @@
#ifndef PACKET_PEER_H
#define PACKET_PEER_H
+#include "core/class_db.h"
#include "core/io/stream_peer.h"
-#include "core/object.h"
#include "core/ring_buffer.h"
class PacketPeer : public Reference {
diff --git a/core/io/resource_format_binary.cpp b/core/io/resource_format_binary.cpp
index 5097f6d98b..21de7835ce 100644
--- a/core/io/resource_format_binary.cpp
+++ b/core/io/resource_format_binary.cpp
@@ -863,7 +863,8 @@ void ResourceLoaderBinary::open(FileAccess *p_f) {
if (ver_format > FORMAT_VERSION || ver_major > VERSION_MAJOR) {
f->close();
- ERR_FAIL_MSG("File format '" + itos(FORMAT_VERSION) + "." + itos(ver_major) + "." + itos(ver_minor) + "' is too new! Please upgrade to a new engine version: " + local_path + ".");
+ ERR_FAIL_MSG(vformat("File '%s' can't be loaded, as it uses a format version (%d) or engine version (%d.%d) which are not supported by your engine version (%s).",
+ local_path, ver_format, ver_major, ver_minor, VERSION_BRANCH));
}
type = get_unicode_string();
@@ -1136,7 +1137,9 @@ Error ResourceFormatLoaderBinary::rename_dependencies(const String &p_path, cons
if (ver_format > FORMAT_VERSION || ver_major > VERSION_MAJOR) {
memdelete(f);
memdelete(fw);
- ERR_FAIL_V_MSG(ERR_FILE_UNRECOGNIZED, "File format '" + itos(FORMAT_VERSION) + "." + itos(ver_major) + "." + itos(ver_minor) + "' is too new! Please upgrade to a new engine version: " + local_path + ".");
+ ERR_FAIL_V_MSG(ERR_FILE_UNRECOGNIZED,
+ vformat("File '%s' can't be loaded, as it uses a format version (%d) or engine version (%d.%d) which are not supported by your engine version (%s).",
+ local_path, ver_format, ver_major, ver_minor, VERSION_BRANCH));
}
// Since we're not actually converting the file contents, leave the version
diff --git a/core/make_binders.py b/core/make_binders.py
deleted file mode 100644
index 7d0d08cde6..0000000000
--- a/core/make_binders.py
+++ /dev/null
@@ -1,390 +0,0 @@
-# -*- coding: ibm850 -*-
-
-template_typed = """
-#ifdef TYPED_METHOD_BIND
-template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$>
-class MethodBind$argc$$ifret R$$ifconst C$ : public MethodBind {
-public:
-
- $ifret R$ $ifnoret void$ (T::*method)($arg, P@$) $ifconst const$;
-#ifdef DEBUG_METHODS_ENABLED
- virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); }
- virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
- $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$
- $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA;
- $
- return GodotTypeInfo::METADATA_NONE;
- }
- Variant::Type _get_argument_type(int p_argument) const {
- $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$
- $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE;
- $
- return Variant::NIL;
- }
- virtual PropertyInfo _gen_argument_type_info(int p_argument) const {
- $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$
- $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info();
- $
- return PropertyInfo();
- }
-#endif
- virtual String get_instance_class() const {
- return T::get_class_static();
- }
-
- virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) {
-
- T *instance=Object::cast_to<T>(p_object);
- r_error.error=Callable::CallError::CALL_OK;
-#ifdef DEBUG_METHODS_ENABLED
-
- ERR_FAIL_COND_V(!instance,Variant());
- if (p_arg_count>get_argument_count()) {
- r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument=get_argument_count();
- return Variant();
-
- }
- if (p_arg_count<(get_argument_count()-get_default_argument_count())) {
-
- r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument=get_argument_count()-get_default_argument_count();
- return Variant();
- }
- $arg CHECK_ARG(@);
- $
-#endif
- $ifret Variant ret = $(instance->*method)($arg, _VC(@)$);
- $ifret return Variant(ret);$
- $ifnoret return Variant();$
- }
-
-#ifdef PTRCALL_ENABLED
- virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) {
-
- T *instance=Object::cast_to<T>(p_object);
- $ifret PtrToArg<R>::encode( $ (instance->*method)($arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret)$ ;
- }
-#endif
- MethodBind$argc$$ifret R$$ifconst C$ () {
-#ifdef DEBUG_METHODS_ENABLED
- _set_const($ifconst true$$ifnoconst false$);
- _generate_argument_types($argc$);
-#else
- set_argument_count($argc$);
-#endif
-
- $ifret _set_returns(true); $
- }
-};
-
-template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$>
-MethodBind* create_method_bind($ifret R$ $ifnoret void$ (T::*p_method)($arg, P@$) $ifconst const$ ) {
-
- MethodBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$> * a = memnew( (MethodBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$>) );
- a->method=p_method;
- return a;
-}
-#endif
-"""
-
-template = """
-#ifndef TYPED_METHOD_BIND
-$iftempl template<$ $ifret class R$ $ifretargs ,$ $arg, class P@$ $iftempl >$
-class MethodBind$argc$$ifret R$$ifconst C$ : public MethodBind {
-
-public:
-
- StringName type_name;
- $ifret R$ $ifnoret void$ (__UnexistingClass::*method)($arg, P@$) $ifconst const$;
-
-#ifdef DEBUG_METHODS_ENABLED
- virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); }
- virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
- $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$
- $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA;
- $
- return GodotTypeInfo::METADATA_NONE;
- }
-
- Variant::Type _get_argument_type(int p_argument) const {
- $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$
- $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE;
- $
- return Variant::NIL;
- }
-
- virtual PropertyInfo _gen_argument_type_info(int p_argument) const {
- $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$
- $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info();
- $
- return PropertyInfo();
- }
-
-#endif
- virtual String get_instance_class() const {
- return type_name;
- }
-
- virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) {
-
- __UnexistingClass *instance = (__UnexistingClass*)p_object;
-
- r_error.error=Callable::CallError::CALL_OK;
-#ifdef DEBUG_METHODS_ENABLED
-
- ERR_FAIL_COND_V(!instance,Variant());
- if (p_arg_count>get_argument_count()) {
- r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument=get_argument_count();
- return Variant();
- }
-
- if (p_arg_count<(get_argument_count()-get_default_argument_count())) {
-
- r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument=get_argument_count()-get_default_argument_count();
- return Variant();
- }
-
- $arg CHECK_ARG(@);
- $
-#endif
- $ifret Variant ret = $(instance->*method)($arg, _VC(@)$);
- $ifret return Variant(ret);$
- $ifnoret return Variant();$
- }
-#ifdef PTRCALL_ENABLED
- virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) {
- __UnexistingClass *instance = (__UnexistingClass*)p_object;
- $ifret PtrToArg<R>::encode( $ (instance->*method)($arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret) $ ;
- }
-#endif
- MethodBind$argc$$ifret R$$ifconst C$ () {
-#ifdef DEBUG_METHODS_ENABLED
- _set_const($ifconst true$$ifnoconst false$);
- _generate_argument_types($argc$);
-#else
- set_argument_count($argc$);
-#endif
- $ifret _set_returns(true); $
-
-
- }
-};
-
-template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$>
-MethodBind* create_method_bind($ifret R$ $ifnoret void$ (T::*p_method)($arg, P@$) $ifconst const$ ) {
-
- MethodBind$argc$$ifret R$$ifconst C$ $iftempl <$ $ifret R$ $ifretargs ,$ $arg, P@$ $iftempl >$ * a = memnew( (MethodBind$argc$$ifret R$$ifconst C$ $iftempl <$ $ifret R$ $ifretargs ,$ $arg, P@$ $iftempl >$) );
- union {
-
- $ifret R$ $ifnoret void$ (T::*sm)($arg, P@$) $ifconst const$;
- $ifret R$ $ifnoret void$ (__UnexistingClass::*dm)($arg, P@$) $ifconst const$;
- } u;
- u.sm=p_method;
- a->method=u.dm;
- a->type_name=T::get_class_static();
- return a;
-}
-#endif
-"""
-
-
-template_typed_free_func = """
-#ifdef TYPED_METHOD_BIND
-template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$>
-class FunctionBind$argc$$ifret R$$ifconst C$ : public MethodBind {
-public:
-
- $ifret R$ $ifnoret void$ (*method) ($ifconst const$ T *$ifargs , $$arg, P@$);
-#ifdef DEBUG_METHODS_ENABLED
- virtual Variant::Type _gen_argument_type(int p_arg) const { return _get_argument_type(p_arg); }
- virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
- $ifret if (p_arg==-1) return GetTypeInfo<R>::METADATA;$
- $arg if (p_arg==(@-1)) return GetTypeInfo<P@>::METADATA;
- $
- return GodotTypeInfo::METADATA_NONE;
- }
- Variant::Type _get_argument_type(int p_argument) const {
- $ifret if (p_argument==-1) return (Variant::Type)GetTypeInfo<R>::VARIANT_TYPE;$
- $arg if (p_argument==(@-1)) return (Variant::Type)GetTypeInfo<P@>::VARIANT_TYPE;
- $
- return Variant::NIL;
- }
- virtual PropertyInfo _gen_argument_type_info(int p_argument) const {
- $ifret if (p_argument==-1) return GetTypeInfo<R>::get_class_info();$
- $arg if (p_argument==(@-1)) return GetTypeInfo<P@>::get_class_info();
- $
- return PropertyInfo();
- }
-#endif
- virtual String get_instance_class() const {
- return T::get_class_static();
- }
-
- virtual Variant call(Object* p_object,const Variant** p_args,int p_arg_count, Callable::CallError& r_error) {
-
- T *instance=Object::cast_to<T>(p_object);
- r_error.error=Callable::CallError::CALL_OK;
-#ifdef DEBUG_METHODS_ENABLED
-
- ERR_FAIL_COND_V(!instance,Variant());
- if (p_arg_count>get_argument_count()) {
- r_error.error=Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument=get_argument_count();
- return Variant();
-
- }
- if (p_arg_count<(get_argument_count()-get_default_argument_count())) {
-
- r_error.error=Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument=get_argument_count()-get_default_argument_count();
- return Variant();
- }
- $arg CHECK_ARG(@);
- $
-#endif
- $ifret Variant ret = $(method)(instance$ifargs , $$arg, _VC(@)$);
- $ifret return Variant(ret);$
- $ifnoret return Variant();$
- }
-
-#ifdef PTRCALL_ENABLED
- virtual void ptrcall(Object*p_object,const void** p_args,void *r_ret) {
-
- T *instance=Object::cast_to<T>(p_object);
- $ifret PtrToArg<R>::encode( $ (method)(instance$ifargs , $$arg, PtrToArg<P@>::convert(p_args[@-1])$) $ifret ,r_ret)$ ;
- }
-#endif
- FunctionBind$argc$$ifret R$$ifconst C$ () {
-#ifdef DEBUG_METHODS_ENABLED
- _set_const($ifconst true$$ifnoconst false$);
- _generate_argument_types($argc$);
-#else
- set_argument_count($argc$);
-#endif
-
- $ifret _set_returns(true); $
- }
-};
-
-template<class T $ifret ,class R$ $ifargs ,$ $arg, class P@$>
-MethodBind* create_method_bind($ifret R$ $ifnoret void$ (*p_method)($ifconst const$ T *$ifargs , $$arg, P@$) ) {
-
- FunctionBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$> * a = memnew( (FunctionBind$argc$$ifret R$$ifconst C$<T $ifret ,R$ $ifargs ,$ $arg, P@$>) );
- a->method=p_method;
- return a;
-}
-#endif
-"""
-
-
-def make_version(template, nargs, argmax, const, ret):
-
- intext = template
- from_pos = 0
- outtext = ""
-
- while True:
- to_pos = intext.find("$", from_pos)
- if to_pos == -1:
- outtext += intext[from_pos:]
- break
- else:
- outtext += intext[from_pos:to_pos]
- end = intext.find("$", to_pos + 1)
- if end == -1:
- break # ignore
- macro = intext[to_pos + 1 : end]
- cmd = ""
- data = ""
-
- if macro.find(" ") != -1:
- cmd = macro[0 : macro.find(" ")]
- data = macro[macro.find(" ") + 1 :]
- else:
- cmd = macro
-
- if cmd == "argc":
- outtext += str(nargs)
- if cmd == "ifret" and ret:
- outtext += data
- if cmd == "ifargs" and nargs:
- outtext += data
- if cmd == "ifretargs" and nargs and ret:
- outtext += data
- if cmd == "ifconst" and const:
- outtext += data
- elif cmd == "ifnoconst" and not const:
- outtext += data
- elif cmd == "ifnoret" and not ret:
- outtext += data
- elif cmd == "iftempl" and (nargs > 0 or ret):
- outtext += data
- elif cmd == "arg,":
- for i in range(1, nargs + 1):
- if i > 1:
- outtext += ", "
- outtext += data.replace("@", str(i))
- elif cmd == "arg":
- for i in range(1, nargs + 1):
- outtext += data.replace("@", str(i))
- elif cmd == "noarg":
- for i in range(nargs + 1, argmax + 1):
- outtext += data.replace("@", str(i))
-
- from_pos = end + 1
-
- return outtext
-
-
-def run(target, source, env):
-
- versions = 15
- versions_ext = 6
- text = ""
- text_ext = ""
- text_free_func = "#ifndef METHOD_BIND_FREE_FUNC_H\n#define METHOD_BIND_FREE_FUNC_H\n"
- text_free_func += "\n//including this header file allows method binding to use free functions\n"
- text_free_func += (
- "//note that the free function must have a pointer to an instance of the class as its first parameter\n"
- )
-
- for i in range(0, versions + 1):
-
- t = ""
- t += make_version(template, i, versions, False, False)
- t += make_version(template_typed, i, versions, False, False)
- t += make_version(template, i, versions, False, True)
- t += make_version(template_typed, i, versions, False, True)
- t += make_version(template, i, versions, True, False)
- t += make_version(template_typed, i, versions, True, False)
- t += make_version(template, i, versions, True, True)
- t += make_version(template_typed, i, versions, True, True)
- if i >= versions_ext:
- text_ext += t
- else:
- text += t
-
- text_free_func += make_version(template_typed_free_func, i, versions, False, False)
- text_free_func += make_version(template_typed_free_func, i, versions, False, True)
- text_free_func += make_version(template_typed_free_func, i, versions, True, False)
- text_free_func += make_version(template_typed_free_func, i, versions, True, True)
-
- text_free_func += "#endif"
-
- with open(target[0], "w") as f:
- f.write(text)
-
- with open(target[1], "w") as f:
- f.write(text_ext)
-
- with open(target[2], "w") as f:
- f.write(text_free_func)
-
-
-if __name__ == "__main__":
- from platform_methods import subprocess_main
-
- subprocess_main(globals())
diff --git a/core/math/aabb.cpp b/core/math/aabb.cpp
index f5c667dab0..e868ebc7c8 100644
--- a/core/math/aabb.cpp
+++ b/core/math/aabb.cpp
@@ -31,6 +31,7 @@
#include "aabb.h"
#include "core/print_string.h"
+#include "core/variant.h"
real_t AABB::get_area() const {
return size.x * size.y * size.z;
@@ -375,6 +376,21 @@ void AABB::get_edge(int p_edge, Vector3 &r_from, Vector3 &r_to) const {
}
}
+Variant AABB::intersects_segment_bind(const Vector3 &p_from, const Vector3 &p_to) const {
+ Vector3 inters;
+ if (intersects_segment(p_from, p_to, &inters)) {
+ return inters;
+ }
+ return Variant();
+}
+Variant AABB::intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const {
+ Vector3 inters;
+ if (intersects_ray(p_from, p_dir, &inters)) {
+ return inters;
+ }
+ return Variant();
+}
+
AABB::operator String() const {
return String() + position + " - " + size;
}
diff --git a/core/math/aabb.h b/core/math/aabb.h
index bd1f3a1a36..8c08754e1c 100644
--- a/core/math/aabb.h
+++ b/core/math/aabb.h
@@ -39,6 +39,7 @@
* AABB / AABB (Axis Aligned Bounding Box)
* This is implemented by a point (position) and the box size
*/
+class Variant;
class AABB {
public:
@@ -103,6 +104,9 @@ public:
return AABB(Vector3(position.x + MIN(size.x, 0), position.y + MIN(size.y, 0), position.z + MIN(size.z, 0)), size.abs());
}
+ Variant intersects_segment_bind(const Vector3 &p_from, const Vector3 &p_to) const;
+ Variant intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const;
+
operator String() const;
_FORCE_INLINE_ AABB() {}
diff --git a/core/math/geometry_3d.h b/core/math/geometry_3d.h
index 6bbf518141..11cac8f108 100644
--- a/core/math/geometry_3d.h
+++ b/core/math/geometry_3d.h
@@ -636,54 +636,6 @@ public:
void optimize_vertices();
};
- _FORCE_INLINE_ static int get_uv84_normal_bit(const Vector3 &p_vector) {
- int lat = Math::fast_ftoi(Math::floor(Math::acos(p_vector.dot(Vector3(0, 1, 0))) * 4.0 / Math_PI + 0.5));
-
- if (lat == 0) {
- return 24;
- } else if (lat == 4) {
- return 25;
- }
-
- int lon = Math::fast_ftoi(Math::floor((Math_PI + Math::atan2(p_vector.x, p_vector.z)) * 8.0 / (Math_PI * 2.0) + 0.5)) % 8;
-
- return lon + (lat - 1) * 8;
- }
-
- _FORCE_INLINE_ static int get_uv84_normal_bit_neighbors(int p_idx) {
- if (p_idx == 24) {
- return 1 | 2 | 4 | 8;
- } else if (p_idx == 25) {
- return (1 << 23) | (1 << 22) | (1 << 21) | (1 << 20);
- } else {
- int ret = 0;
- if ((p_idx % 8) == 0) {
- ret |= (1 << (p_idx + 7));
- } else {
- ret |= (1 << (p_idx - 1));
- }
- if ((p_idx % 8) == 7) {
- ret |= (1 << (p_idx - 7));
- } else {
- ret |= (1 << (p_idx + 1));
- }
-
- int mask = ret | (1 << p_idx);
- if (p_idx < 8) {
- ret |= 24;
- } else {
- ret |= mask >> 8;
- }
-
- if (p_idx >= 16) {
- ret |= 25;
- } else {
- ret |= mask << 8;
- }
-
- return ret;
- }
- }
static MeshData build_convex_mesh(const Vector<Plane> &p_planes);
static Vector<Plane> build_sphere_planes(real_t p_radius, int p_lats, int p_lons, Vector3::Axis p_axis = Vector3::AXIS_Z);
static Vector<Plane> build_box_planes(const Vector3 &p_extents);
diff --git a/core/math/plane.cpp b/core/math/plane.cpp
index 4200484c59..ae2021d2f6 100644
--- a/core/math/plane.cpp
+++ b/core/math/plane.cpp
@@ -31,6 +31,7 @@
#include "plane.h"
#include "core/math/math_funcs.h"
+#include "core/variant.h"
void Plane::set_normal(const Vector3 &p_normal) {
normal = p_normal;
@@ -138,6 +139,31 @@ bool Plane::intersects_segment(const Vector3 &p_begin, const Vector3 &p_end, Vec
return true;
}
+Variant Plane::intersect_3_bind(const Plane &p_plane1, const Plane &p_plane2) const {
+ Vector3 inters;
+ if (intersect_3(p_plane1, p_plane2, &inters)) {
+ return inters;
+ } else {
+ return Variant();
+ }
+}
+Variant Plane::intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const {
+ Vector3 inters;
+ if (intersects_ray(p_from, p_dir, &inters)) {
+ return inters;
+ } else {
+ return Variant();
+ }
+}
+Variant Plane::intersects_segment_bind(const Vector3 &p_begin, const Vector3 &p_end) const {
+ Vector3 inters;
+ if (intersects_segment(p_begin, p_end, &inters)) {
+ return inters;
+ } else {
+ return Variant();
+ }
+}
+
/* misc */
bool Plane::is_equal_approx_any_side(const Plane &p_plane) const {
diff --git a/core/math/plane.h b/core/math/plane.h
index 70a6111edd..1386b0a2cb 100644
--- a/core/math/plane.h
+++ b/core/math/plane.h
@@ -33,6 +33,8 @@
#include "core/math/vector3.h"
+class Variant;
+
class Plane {
public:
Vector3 normal;
@@ -59,6 +61,11 @@ public:
bool intersects_ray(const Vector3 &p_from, const Vector3 &p_dir, Vector3 *p_intersection) const;
bool intersects_segment(const Vector3 &p_begin, const Vector3 &p_end, Vector3 *p_intersection) const;
+ // For Variant bindings.
+ Variant intersect_3_bind(const Plane &p_plane1, const Plane &p_plane2) const;
+ Variant intersects_ray_bind(const Vector3 &p_from, const Vector3 &p_dir) const;
+ Variant intersects_segment_bind(const Vector3 &p_begin, const Vector3 &p_end) const;
+
_FORCE_INLINE_ Vector3 project(const Vector3 &p_point) const {
return p_point - normal * distance_to(p_point);
}
diff --git a/core/math/rect2.h b/core/math/rect2.h
index 14393325ec..7660db71eb 100644
--- a/core/math/rect2.h
+++ b/core/math/rect2.h
@@ -197,6 +197,10 @@ struct Rect2 {
return g;
}
+ inline Rect2 grow_margin_bind(uint32_t p_margin, real_t p_amount) const {
+ return grow_margin(Margin(p_margin), p_amount);
+ }
+
inline Rect2 grow_individual(real_t p_left, real_t p_top, real_t p_right, real_t p_bottom) const {
Rect2 g = *this;
g.position.x -= p_left;
@@ -363,6 +367,10 @@ struct Rect2i {
return g;
}
+ inline Rect2i grow_margin_bind(uint32_t p_margin, int p_amount) const {
+ return grow_margin(Margin(p_margin), p_amount);
+ }
+
inline Rect2i grow_individual(int p_left, int p_top, int p_right, int p_bottom) const {
Rect2i g = *this;
g.position.x -= p_left;
diff --git a/core/math/vector2.h b/core/math/vector2.h
index f41bcc15bc..c2a2656e72 100644
--- a/core/math/vector2.h
+++ b/core/math/vector2.h
@@ -65,6 +65,14 @@ struct Vector2 {
real_t length() const;
real_t length_squared() const;
+ Vector2 min(const Vector2 &p_vector2) const {
+ return Vector2(MIN(x, p_vector2.x), MIN(y, p_vector2.y));
+ }
+
+ Vector2 max(const Vector2 &p_vector2) const {
+ return Vector2(MAX(x, p_vector2.x), MAX(y, p_vector2.y));
+ }
+
real_t distance_to(const Vector2 &p_vector2) const;
real_t distance_squared_to(const Vector2 &p_vector2) const;
real_t angle_to(const Vector2 &p_vector2) const;
diff --git a/core/message_queue.h b/core/message_queue.h
index 710a605371..5d39ceee03 100644
--- a/core/message_queue.h
+++ b/core/message_queue.h
@@ -31,7 +31,7 @@
#ifndef MESSAGE_QUEUE_H
#define MESSAGE_QUEUE_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/os/thread_safe.h"
class MessageQueue {
diff --git a/core/method_bind.h b/core/method_bind.h
index 942e2e0036..d43186257b 100644
--- a/core/method_bind.h
+++ b/core/method_bind.h
@@ -31,18 +31,7 @@
#ifndef METHOD_BIND_H
#define METHOD_BIND_H
-#ifdef DEBUG_ENABLED
-#define DEBUG_METHODS_ENABLED
-#endif
-
-#include "core/list.h"
-#include "core/method_ptrcall.h"
-#include "core/object.h"
-#include "core/type_info.h"
-#include "core/typedefs.h"
-#include "core/variant.h"
-
-#include <stdio.h>
+#include "core/binder_common.h"
enum MethodFlags {
@@ -57,151 +46,15 @@ enum MethodFlags {
METHOD_FLAGS_DEFAULT = METHOD_FLAG_NORMAL,
};
-template <class T>
-struct VariantCaster {
- static _FORCE_INLINE_ T cast(const Variant &p_variant) {
- return p_variant;
- }
-};
-
-template <class T>
-struct VariantCaster<T &> {
- static _FORCE_INLINE_ T cast(const Variant &p_variant) {
- return p_variant;
- }
-};
-
-template <class T>
-struct VariantCaster<const T &> {
- static _FORCE_INLINE_ T cast(const Variant &p_variant) {
- return p_variant;
- }
-};
-
-#define _VC(m_idx) \
- (VariantCaster<P##m_idx>::cast((m_idx - 1) >= p_arg_count ? get_default_argument(m_idx - 1) : *p_args[m_idx - 1]))
-
-#ifdef PTRCALL_ENABLED
-
-#define VARIANT_ENUM_CAST(m_enum) \
- MAKE_ENUM_TYPE_INFO(m_enum) \
- template <> \
- struct VariantCaster<m_enum> { \
- static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \
- return (m_enum)p_variant.operator int(); \
- } \
- }; \
- template <> \
- struct PtrToArg<m_enum> { \
- _FORCE_INLINE_ static m_enum convert(const void *p_ptr) { \
- return m_enum(*reinterpret_cast<const int *>(p_ptr)); \
- } \
- _FORCE_INLINE_ static void encode(m_enum p_val, const void *p_ptr) { \
- *(int *)p_ptr = p_val; \
- } \
- };
-
-#else
-
-#define VARIANT_ENUM_CAST(m_enum) \
- MAKE_ENUM_TYPE_INFO(m_enum) \
- template <> \
- struct VariantCaster<m_enum> { \
- static _FORCE_INLINE_ m_enum cast(const Variant &p_variant) { \
- return (m_enum)p_variant.operator int(); \
- } \
- };
-
-#endif
-
-// Object enum casts must go here
-VARIANT_ENUM_CAST(Object::ConnectFlags);
-
-template <typename T>
-struct VariantObjectClassChecker {
- static _FORCE_INLINE_ bool check(const Variant &p_variant) {
- return true;
- }
-};
-
-template <>
-struct VariantObjectClassChecker<Node *> {
- static _FORCE_INLINE_ bool check(const Variant &p_variant) {
- Object *obj = p_variant;
- Node *node = p_variant;
- return node || !obj;
- }
-};
-
-template <>
-struct VariantObjectClassChecker<Control *> {
- static _FORCE_INLINE_ bool check(const Variant &p_variant) {
- Object *obj = p_variant;
- Control *control = p_variant;
- return control || !obj;
- }
-};
-
-#define CHECK_ARG(m_arg) \
- if ((m_arg - 1) < p_arg_count) { \
- Variant::Type argtype = get_argument_type(m_arg - 1); \
- if (!Variant::can_convert_strict(p_args[m_arg - 1]->get_type(), argtype) || \
- !VariantObjectClassChecker<P##m_arg>::check(*p_args[m_arg - 1])) { \
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT; \
- r_error.argument = m_arg - 1; \
- r_error.expected = argtype; \
- return Variant(); \
- } \
- }
-
-#define CHECK_NOARG(m_arg) \
- { \
- if (p_arg##m_arg.get_type() != Variant::NIL) { \
- if (r_argerror) { \
- *r_argerror = (m_arg - 1); \
- } \
- return CALL_ERROR_EXTRA_ARGUMENT; \
- } \
- }
+VARIANT_ENUM_CAST(MethodFlags)
// some helpers
-VARIANT_ENUM_CAST(Vector3::Axis);
-
-VARIANT_ENUM_CAST(Error);
-VARIANT_ENUM_CAST(Margin);
-VARIANT_ENUM_CAST(Corner);
-VARIANT_ENUM_CAST(Orientation);
-VARIANT_ENUM_CAST(HAlign);
-VARIANT_ENUM_CAST(VAlign);
-VARIANT_ENUM_CAST(PropertyHint);
-VARIANT_ENUM_CAST(PropertyUsageFlags);
-VARIANT_ENUM_CAST(MethodFlags);
-VARIANT_ENUM_CAST(Variant::Type);
-VARIANT_ENUM_CAST(Variant::Operator);
-
-template <>
-struct VariantCaster<char32_t> {
- static _FORCE_INLINE_ char32_t cast(const Variant &p_variant) {
- return (char32_t)p_variant.operator int();
- }
-};
-#ifdef PTRCALL_ENABLED
-template <>
-struct PtrToArg<char32_t> {
- _FORCE_INLINE_ static char32_t convert(const void *p_ptr) {
- return char32_t(*reinterpret_cast<const int *>(p_ptr));
- }
- _FORCE_INLINE_ static void encode(char32_t p_val, const void *p_ptr) {
- *(int *)p_ptr = p_val;
- }
-};
-#endif
-
class MethodBind {
int method_id;
uint32_t hint_flags = METHOD_FLAGS_DEFAULT;
StringName name;
+ StringName instance_class;
Vector<Variant> default_arguments;
int default_argument_count = 0;
int argument_count = 0;
@@ -225,11 +78,11 @@ protected:
void set_argument_count(int p_count) { argument_count = p_count; }
public:
- Vector<Variant> get_default_arguments() const { return default_arguments; }
+ _FORCE_INLINE_ const Vector<Variant> &get_default_arguments() const { return default_arguments; }
_FORCE_INLINE_ int get_default_argument_count() const { return default_argument_count; }
_FORCE_INLINE_ Variant has_default_argument(int p_arg) const {
- int idx = argument_count - p_arg - 1;
+ int idx = p_arg - (argument_count - default_arguments.size());
if (idx < 0 || idx >= default_arguments.size()) {
return false;
@@ -239,7 +92,7 @@ public:
}
_FORCE_INLINE_ Variant get_default_argument(int p_arg) const {
- int idx = argument_count - p_arg - 1;
+ int idx = p_arg - (argument_count - default_arguments.size());
if (idx < 0 || idx >= default_arguments.size()) {
return Variant();
@@ -249,7 +102,6 @@ public:
}
#ifdef DEBUG_METHODS_ENABLED
-
_FORCE_INLINE_ Variant::Type get_argument_type(int p_argument) const {
ERR_FAIL_COND_V(p_argument < -1 || p_argument > argument_count, Variant::NIL);
return argument_types[p_argument + 1];
@@ -258,15 +110,16 @@ public:
PropertyInfo get_argument_info(int p_argument) const;
PropertyInfo get_return_info() const;
- void set_argument_names(const Vector<StringName> &p_names); //set by class, db, can't be inferred otherwise
+ void set_argument_names(const Vector<StringName> &p_names); // Set by ClassDB, can't be inferred otherwise.
Vector<StringName> get_argument_names() const;
virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const = 0;
-
#endif
+
void set_hint_flags(uint32_t p_hint) { hint_flags = p_hint; }
uint32_t get_hint_flags() const { return hint_flags | (is_const() ? METHOD_FLAG_CONST : 0) | (is_vararg() ? METHOD_FLAG_VARARG : 0); }
- virtual String get_instance_class() const = 0;
+ _FORCE_INLINE_ StringName get_instance_class() const { return instance_class; }
+ _FORCE_INLINE_ void set_instance_class(const StringName &p_class) { instance_class = p_class; }
_FORCE_INLINE_ int get_argument_count() const { return argument_count; };
@@ -302,7 +155,6 @@ protected:
public:
#ifdef DEBUG_METHODS_ENABLED
-
virtual PropertyInfo _gen_argument_type_info(int p_arg) const {
if (p_arg < 0) {
return arguments.return_val;
@@ -320,14 +172,12 @@ public:
virtual GodotTypeInfo::Metadata get_argument_meta(int) const {
return GodotTypeInfo::METADATA_NONE;
}
-
#else
-
virtual Variant::Type _gen_argument_type(int p_arg) const {
return Variant::NIL;
}
-
#endif
+
virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) {
T *instance = static_cast<T *>(p_object);
return (instance->*call_method)(p_args, p_arg_count, r_error);
@@ -364,7 +214,6 @@ public:
void set_method(NativeCall p_method) { call_method = p_method; }
virtual bool is_const() const { return false; }
- virtual String get_instance_class() const { return T::get_class_static(); }
virtual bool is_vararg() const { return true; }
@@ -378,16 +227,365 @@ MethodBind *create_vararg_method_bind(Variant (T::*p_method)(const Variant **, i
MethodBindVarArg<T> *a = memnew((MethodBindVarArg<T>));
a->set_method(p_method);
a->set_method_info(p_info, p_return_nil_is_variant);
+ a->set_instance_class(T::get_class_static());
return a;
}
-/** This amazing hack is based on the FastDelegates theory */
-
-// tale of an amazing hack.. //
+/**** VARIADIC TEMPLATES ****/
-// if you declare a nonexistent class..
+#ifndef TYPED_METHOD_BIND
class __UnexistingClass;
+#define MB_T __UnexistingClass
+#else
+#define MB_T T
+#endif
-#include "method_bind.gen.inc"
+// no return, not const
+#ifdef TYPED_METHOD_BIND
+template <class T, class... P>
+#else
+template <class... P>
+#endif
+class MethodBindT : public MethodBind {
+ void (MB_T::*method)(P...);
+
+protected:
+#ifdef DEBUG_METHODS_ENABLED
+// GCC raises warnings in the case P = {} as the comparison is always false...
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wlogical-op"
+#endif
+ virtual Variant::Type _gen_argument_type(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ return call_get_argument_type<P...>(p_arg);
+ } else {
+ return Variant::NIL;
+ }
+ }
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+
+ virtual PropertyInfo _gen_argument_type_info(int p_arg) const {
+ PropertyInfo pi;
+ call_get_argument_type_info<P...>(p_arg, pi);
+ return pi;
+ }
+#endif
+
+public:
+#ifdef DEBUG_METHODS_ENABLED
+ virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
+ return call_get_argument_metadata<P...>(p_arg);
+ }
+
+#endif
+ virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) {
+#ifdef TYPED_METHOD_BIND
+ call_with_variant_args_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, r_error, get_default_arguments());
+#else
+ call_with_variant_args_dv((MB_T *)(p_object), method, p_args, p_arg_count, r_error, get_default_arguments());
+#endif
+ return Variant();
+ }
+
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) {
+#ifdef TYPED_METHOD_BIND
+ call_with_ptr_args<T, P...>(static_cast<T *>(p_object), method, p_args);
+#else
+ call_with_ptr_args<MB_T, P...>((MB_T *)(p_object), method, p_args);
+#endif
+ }
+#endif
+
+ MethodBindT(void (MB_T::*p_method)(P...)) {
+ method = p_method;
+#ifdef DEBUG_METHODS_ENABLED
+ _generate_argument_types(sizeof...(P));
+#endif
+ set_argument_count(sizeof...(P));
+ }
+};
+
+template <class T, class... P>
+MethodBind *create_method_bind(void (T::*p_method)(P...)) {
+#ifdef TYPED_METHOD_BIND
+ MethodBind *a = memnew((MethodBindT<T, P...>)(p_method));
+#else
+ MethodBind *a = memnew((MethodBindT<P...>)(reinterpret_cast<void (MB_T::*)(P...)>(p_method)));
+#endif
+ a->set_instance_class(T::get_class_static());
+ return a;
+}
+
+// no return, not const
+
+#ifdef TYPED_METHOD_BIND
+template <class T, class... P>
+#else
+template <class... P>
+#endif
+class MethodBindTC : public MethodBind {
+ void (MB_T::*method)(P...) const;
+
+protected:
+#ifdef DEBUG_METHODS_ENABLED
+// GCC raises warnings in the case P = {} as the comparison is always false...
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wlogical-op"
+#endif
+ virtual Variant::Type _gen_argument_type(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ return call_get_argument_type<P...>(p_arg);
+ } else {
+ return Variant::NIL;
+ }
+ }
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+
+ virtual PropertyInfo _gen_argument_type_info(int p_arg) const {
+ PropertyInfo pi;
+ call_get_argument_type_info<P...>(p_arg, pi);
+ return pi;
+ }
+#endif
+
+public:
+#ifdef DEBUG_METHODS_ENABLED
+ virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
+ return call_get_argument_metadata<P...>(p_arg);
+ }
+
+#endif
+ virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) {
+#ifdef TYPED_METHOD_BIND
+ call_with_variant_argsc_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, r_error, get_default_arguments());
+#else
+ call_with_variant_argsc_dv((MB_T *)(p_object), method, p_args, p_arg_count, r_error, get_default_arguments());
+#endif
+ return Variant();
+ }
+
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) {
+#ifdef TYPED_METHOD_BIND
+ call_with_ptr_argsc<T, P...>(static_cast<T *>(p_object), method, p_args);
+#else
+ call_with_ptr_argsc<MB_T, P...>((MB_T *)(p_object), method, p_args);
+#endif
+ }
+#endif
+
+ MethodBindTC(void (MB_T::*p_method)(P...) const) {
+ method = p_method;
+ _set_const(true);
+#ifdef DEBUG_METHODS_ENABLED
+ _generate_argument_types(sizeof...(P));
+#endif
+ set_argument_count(sizeof...(P));
+ }
+};
+
+template <class T, class... P>
+MethodBind *create_method_bind(void (T::*p_method)(P...) const) {
+#ifdef TYPED_METHOD_BIND
+ MethodBind *a = memnew((MethodBindTC<T, P...>)(p_method));
+#else
+ MethodBind *a = memnew((MethodBindTC<P...>)(reinterpret_cast<void (MB_T::*)(P...) const>(p_method)));
+#endif
+ a->set_instance_class(T::get_class_static());
+ return a;
+}
+
+// return, not const
+
+#ifdef TYPED_METHOD_BIND
+template <class T, class R, class... P>
+#else
+template <class R, class... P>
+#endif
+class MethodBindTR : public MethodBind {
+ R(MB_T::*method)
+ (P...);
+
+protected:
+#ifdef DEBUG_METHODS_ENABLED
+// GCC raises warnings in the case P = {} as the comparison is always false...
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wlogical-op"
+#endif
+ virtual Variant::Type _gen_argument_type(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ return call_get_argument_type<P...>(p_arg);
+ } else {
+ return GetTypeInfo<R>::VARIANT_TYPE;
+ }
+ }
+
+ virtual PropertyInfo _gen_argument_type_info(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ PropertyInfo pi;
+ call_get_argument_type_info<P...>(p_arg, pi);
+ return pi;
+ } else {
+ return GetTypeInfo<R>::get_class_info();
+ }
+ }
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+#endif
+
+public:
+#ifdef DEBUG_METHODS_ENABLED
+ virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
+ if (p_arg >= 0) {
+ return call_get_argument_metadata<P...>(p_arg);
+ } else {
+ return GetTypeInfo<R>::METADATA;
+ }
+ }
+#endif
+
+ virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) {
+ Variant ret;
+#ifdef TYPED_METHOD_BIND
+ call_with_variant_args_ret_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments());
+#else
+ call_with_variant_args_ret_dv((MB_T *)p_object, method, p_args, p_arg_count, ret, r_error, get_default_arguments());
+#endif
+ return ret;
+ }
+
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) {
+#ifdef TYPED_METHOD_BIND
+ call_with_ptr_args_ret<T, R, P...>(static_cast<T *>(p_object), method, p_args, r_ret);
+#else
+ call_with_ptr_args_ret<MB_T, R, P...>((MB_T *)(p_object), method, p_args, r_ret);
+#endif
+ }
+#endif
+
+ MethodBindTR(R (MB_T::*p_method)(P...)) {
+ method = p_method;
+ _set_returns(true);
+#ifdef DEBUG_METHODS_ENABLED
+ _generate_argument_types(sizeof...(P));
+#endif
+ set_argument_count(sizeof...(P));
+ }
+};
+
+template <class T, class R, class... P>
+MethodBind *create_method_bind(R (T::*p_method)(P...)) {
+#ifdef TYPED_METHOD_BIND
+ MethodBind *a = memnew((MethodBindTR<T, R, P...>)(p_method));
+#else
+ MethodBind *a = memnew((MethodBindTR<R, P...>)(reinterpret_cast<R (MB_T::*)(P...)>(p_method)));
+#endif
+
+ a->set_instance_class(T::get_class_static());
+ return a;
+}
+
+// return, const
+
+#ifdef TYPED_METHOD_BIND
+template <class T, class R, class... P>
+#else
+template <class R, class... P>
+#endif
+class MethodBindTRC : public MethodBind {
+ R(MB_T::*method)
+ (P...) const;
+
+protected:
+#ifdef DEBUG_METHODS_ENABLED
+// GCC raises warnings in the case P = {} as the comparison is always false...
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wlogical-op"
+#endif
+ virtual Variant::Type _gen_argument_type(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ return call_get_argument_type<P...>(p_arg);
+ } else {
+ return GetTypeInfo<R>::VARIANT_TYPE;
+ }
+ }
+
+ virtual PropertyInfo _gen_argument_type_info(int p_arg) const {
+ if (p_arg >= 0 && p_arg < (int)sizeof...(P)) {
+ PropertyInfo pi;
+ call_get_argument_type_info<P...>(p_arg, pi);
+ return pi;
+ } else {
+ return GetTypeInfo<R>::get_class_info();
+ }
+ }
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+#endif
+
+public:
+#ifdef DEBUG_METHODS_ENABLED
+ virtual GodotTypeInfo::Metadata get_argument_meta(int p_arg) const {
+ if (p_arg >= 0) {
+ return call_get_argument_metadata<P...>(p_arg);
+ } else {
+ return GetTypeInfo<R>::METADATA;
+ }
+ }
+#endif
+
+ virtual Variant call(Object *p_object, const Variant **p_args, int p_arg_count, Callable::CallError &r_error) {
+ Variant ret;
+#ifdef TYPED_METHOD_BIND
+ call_with_variant_args_retc_dv(static_cast<T *>(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments());
+#else
+ call_with_variant_args_retc_dv((MB_T *)(p_object), method, p_args, p_arg_count, ret, r_error, get_default_arguments());
+#endif
+ return ret;
+ }
+
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(Object *p_object, const void **p_args, void *r_ret) {
+#ifdef TYPED_METHOD_BIND
+ call_with_ptr_args_retc<T, R, P...>(static_cast<T *>(p_object), method, p_args, r_ret);
+#else
+ call_with_ptr_args_retc<MB_T, R, P...>((MB_T *)(p_object), method, p_args, r_ret);
+#endif
+ }
+#endif
+
+ MethodBindTRC(R (MB_T::*p_method)(P...) const) {
+ method = p_method;
+ _set_returns(true);
+ _set_const(true);
+#ifdef DEBUG_METHODS_ENABLED
+ _generate_argument_types(sizeof...(P));
+#endif
+ set_argument_count(sizeof...(P));
+ }
+};
+
+template <class T, class R, class... P>
+MethodBind *create_method_bind(R (T::*p_method)(P...) const) {
+#ifdef TYPED_METHOD_BIND
+ MethodBind *a = memnew((MethodBindTRC<T, R, P...>)(p_method));
+#else
+ MethodBind *a = memnew((MethodBindTRC<R, P...>)(reinterpret_cast<R (MB_T::*)(P...) const>(p_method)));
+#endif
+ a->set_instance_class(T::get_class_static());
+ return a;
+}
#endif // METHOD_BIND_H
diff --git a/core/object.cpp b/core/object.cpp
index 67c605c39b..0d9e5c5116 100644
--- a/core/object.cpp
+++ b/core/object.cpp
@@ -1315,9 +1315,10 @@ Error Object::connect(const StringName &p_signal, const Callable &p_callable, co
Callable target = p_callable;
- if (s->slot_map.has(target)) {
+ //compare with the base callable, so binds can be ignored
+ if (s->slot_map.has(*target.get_base_comparator())) {
if (p_flags & CONNECT_REFERENCE_COUNTED) {
- s->slot_map[target].reference_count++;
+ s->slot_map[*target.get_base_comparator()].reference_count++;
return OK;
} else {
ERR_FAIL_V_MSG(ERR_INVALID_PARAMETER, "Signal '" + p_signal + "' is already connected to given callable '" + p_callable + "' in that object.");
@@ -1337,7 +1338,8 @@ Error Object::connect(const StringName &p_signal, const Callable &p_callable, co
slot.reference_count = 1;
}
- s->slot_map[target] = slot;
+ //use callable version as key, so binds can be ignored
+ s->slot_map[*target.get_base_comparator()] = slot;
return OK;
}
@@ -1364,7 +1366,7 @@ bool Object::is_connected(const StringName &p_signal, const Callable &p_callable
Callable target = p_callable;
- return s->slot_map.has(target);
+ return s->slot_map.has(*target.get_base_comparator());
//const Map<Signal::Target,Signal::Slot>::Element *E = s->slot_map.find(target);
//return (E!=nullptr );
}
@@ -1386,7 +1388,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable,
SignalData *s = signal_map.getptr(p_signal);
ERR_FAIL_COND_MSG(!s, vformat("Nonexistent signal '%s' in %s.", p_signal, to_string()));
- ERR_FAIL_COND_MSG(!s->slot_map.has(p_callable), "Disconnecting nonexistent signal '" + p_signal + "', callable: " + p_callable + ".");
+ ERR_FAIL_COND_MSG(!s->slot_map.has(*p_callable.get_base_comparator()), "Disconnecting nonexistent signal '" + p_signal + "', callable: " + p_callable + ".");
SignalData::Slot *slot = &s->slot_map[p_callable];
@@ -1398,7 +1400,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable,
}
target_object->connections.erase(slot->cE);
- s->slot_map.erase(p_callable);
+ s->slot_map.erase(*p_callable.get_base_comparator());
if (s->slot_map.empty() && ClassDB::has_signal(get_class_name(), p_signal)) {
//not user signal, delete
diff --git a/core/object.h b/core/object.h
index 12ef600dfc..765fb63c6e 100644
--- a/core/object.h
+++ b/core/object.h
@@ -31,6 +31,7 @@
#ifndef OBJECT_H
#define OBJECT_H
+#include "core/callable_bind.h"
#include "core/hash_map.h"
#include "core/list.h"
#include "core/map.h"
@@ -811,7 +812,4 @@ public:
static int get_object_count();
};
-//needed by macros
-#include "core/class_db.h"
-
#endif // OBJECT_H
diff --git a/core/project_settings.h b/core/project_settings.h
index 6cbb02d30e..9a1d9cee97 100644
--- a/core/project_settings.h
+++ b/core/project_settings.h
@@ -31,7 +31,7 @@
#ifndef PROJECT_SETTINGS_H
#define PROJECT_SETTINGS_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/os/thread_safe.h"
#include "core/set.h"
diff --git a/core/reference.h b/core/reference.h
index f5794b0b67..868894aad4 100644
--- a/core/reference.h
+++ b/core/reference.h
@@ -32,7 +32,6 @@
#define REFERENCE_H
#include "core/class_db.h"
-#include "core/object.h"
#include "core/safe_refcount.h"
class Reference : public Object {
diff --git a/core/resource.h b/core/resource.h
index 7699d48735..41707f216d 100644
--- a/core/resource.h
+++ b/core/resource.h
@@ -32,7 +32,6 @@
#define RESOURCE_H
#include "core/class_db.h"
-#include "core/object.h"
#include "core/reference.h"
#include "core/safe_refcount.h"
#include "core/self_list.h"
diff --git a/core/script_language.cpp b/core/script_language.cpp
index b63aeb952c..d535c54dea 100644
--- a/core/script_language.cpp
+++ b/core/script_language.cpp
@@ -275,7 +275,13 @@ void ScriptServer::save_global_classes() {
gcarr.push_back(d);
}
- ProjectSettings::get_singleton()->set("_global_script_classes", gcarr);
+ if (gcarr.empty()) {
+ if (ProjectSettings::get_singleton()->has_setting("_global_script_classes")) {
+ ProjectSettings::get_singleton()->clear("_global_script_classes");
+ }
+ } else {
+ ProjectSettings::get_singleton()->set("_global_script_classes", gcarr);
+ }
ProjectSettings::get_singleton()->save();
}
diff --git a/core/simple_type.h b/core/simple_type.h
index 10dc36cbd4..841ab9f384 100644
--- a/core/simple_type.h
+++ b/core/simple_type.h
@@ -48,4 +48,9 @@ struct GetSimpleTypeT<T const> {
typedef T type_t;
};
+template <class T>
+struct GetSimpleTypeT<T const &> {
+ typedef T type_t;
+};
+
#endif // SIMPLE_TYPE_H
diff --git a/core/thread_work_pool.h b/core/thread_work_pool.h
index e21d3974ee..661060aa3f 100644
--- a/core/thread_work_pool.h
+++ b/core/thread_work_pool.h
@@ -73,13 +73,15 @@ class ThreadWorkPool {
ThreadData *threads = nullptr;
uint32_t thread_count = 0;
+ BaseWork *current_work = nullptr;
static void _thread_function(ThreadData *p_thread);
public:
template <class C, class M, class U>
- void do_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) {
+ void begin_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) {
ERR_FAIL_COND(!threads); //never initialized
+ ERR_FAIL_COND(current_work != nullptr);
index.store(0);
@@ -90,16 +92,37 @@ public:
w->index = &index;
w->max_elements = p_elements;
+ current_work = w;
+
for (uint32_t i = 0; i < thread_count; i++) {
threads[i].work = w;
threads[i].start.post();
}
+ }
+
+ bool is_working() const {
+ return current_work != nullptr;
+ }
+
+ uint32_t get_work_index() const {
+ return index;
+ }
+
+ void end_work() {
+ ERR_FAIL_COND(current_work == nullptr);
for (uint32_t i = 0; i < thread_count; i++) {
threads[i].completed.wait();
threads[i].work = nullptr;
}
- memdelete(w);
+ memdelete(current_work);
+ current_work = nullptr;
+ }
+
+ template <class C, class M, class U>
+ void do_work(uint32_t p_elements, C *p_instance, M p_method, U p_userdata) {
+ begin_work(p_elements, p_instance, p_method, p_userdata);
+ end_work();
}
void init(int p_thread_count = -1);
diff --git a/core/type_info.h b/core/type_info.h
index 3c7f59bb84..b9ae88d97c 100644
--- a/core/type_info.h
+++ b/core/type_info.h
@@ -31,7 +31,7 @@
#ifndef TYPE_INFO_H
#define TYPE_INFO_H
-#ifdef DEBUG_METHODS_ENABLED
+#include "core/typedefs.h"
template <bool C, typename T = void>
struct EnableIf {
@@ -267,11 +267,4 @@ inline StringName __constant_get_enum_name(T param, const String &p_constant) {
#define CLASS_INFO(m_type) (GetTypeInfo<m_type *>::get_class_info())
-#else
-
-#define MAKE_ENUM_TYPE_INFO(m_enum)
-#define CLASS_INFO(m_type)
-
-#endif // DEBUG_METHODS_ENABLED
-
#endif // TYPE_INFO_H
diff --git a/core/typedefs.h b/core/typedefs.h
index 4bfa5debac..2472e5fcd9 100644
--- a/core/typedefs.h
+++ b/core/typedefs.h
@@ -263,4 +263,8 @@ struct BuildIndexSequence : BuildIndexSequence<N - 1, N - 1, Is...> {};
template <size_t... Is>
struct BuildIndexSequence<0, Is...> : IndexSequence<Is...> {};
+#ifdef DEBUG_ENABLED
+#define DEBUG_METHODS_ENABLED
+#endif
+
#endif // TYPEDEFS_H
diff --git a/core/undo_redo.h b/core/undo_redo.h
index b46f7ff867..68a553efd4 100644
--- a/core/undo_redo.h
+++ b/core/undo_redo.h
@@ -31,7 +31,7 @@
#ifndef UNDO_REDO_H
#define UNDO_REDO_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/resource.h"
class UndoRedo : public Object {
diff --git a/core/ustring.cpp b/core/ustring.cpp
index d5afbc2b47..27dab8db6e 100644
--- a/core/ustring.cpp
+++ b/core/ustring.cpp
@@ -787,29 +787,46 @@ signed char String::naturalnocasecmp_to(const String &p_str) const {
if (!*that_str) {
return 1;
} else if (IS_DIGIT(*this_str)) {
- int64_t this_int, that_int;
-
if (!IS_DIGIT(*that_str)) {
return -1;
}
- /* Compare the numbers */
- this_int = to_int(this_str, -1, true);
- that_int = to_int(that_str, -1, true);
-
- if (this_int < that_int) {
- return -1;
- } else if (this_int > that_int) {
- return 1;
- }
+ // Keep ptrs to start of numerical sequences
+ const char32_t *this_substr = this_str;
+ const char32_t *that_substr = that_str;
- /* Skip */
+ // Compare lengths of both numerical sequences, ignoring leading zeros
while (IS_DIGIT(*this_str)) {
this_str++;
}
while (IS_DIGIT(*that_str)) {
that_str++;
}
+ while (*this_substr == '0') {
+ this_substr++;
+ }
+ while (*that_substr == '0') {
+ that_substr++;
+ }
+ int this_len = this_str - this_substr;
+ int that_len = that_str - that_substr;
+
+ if (this_len < that_len) {
+ return -1;
+ } else if (this_len > that_len) {
+ return 1;
+ }
+
+ // If lengths equal, compare lexicographically
+ while (this_substr != this_str && that_substr != that_str) {
+ if (*this_substr < *that_substr) {
+ return -1;
+ } else if (*this_substr > *that_substr) {
+ return 1;
+ }
+ this_substr++;
+ that_substr++;
+ }
} else if (IS_DIGIT(*that_str)) {
return 1;
} else {
@@ -4484,11 +4501,12 @@ String String::sprintf(const Array &values, bool *error) const {
int number_len = str.length();
// Padding.
+ int pad_chars_count = (value < 0 || show_sign) ? min_chars - 1 : min_chars;
String pad_char = pad_with_zeroes ? String("0") : String(" ");
if (left_justified) {
- str = str.rpad(min_chars, pad_char);
+ str = str.rpad(pad_chars_count, pad_char);
} else {
- str = str.lpad(min_chars, pad_char);
+ str = str.lpad(pad_chars_count, pad_char);
}
// Sign.
@@ -4714,6 +4732,69 @@ String String::unquote() const {
return substr(1, length() - 2);
}
+Vector<uint8_t> String::to_ascii_buffer() const {
+ const String *s = this;
+ if (s->empty()) {
+ return Vector<uint8_t>();
+ }
+ CharString charstr = s->ascii();
+
+ Vector<uint8_t> retval;
+ size_t len = charstr.length();
+ retval.resize(len);
+ uint8_t *w = retval.ptrw();
+ copymem(w, charstr.ptr(), len);
+
+ return retval;
+}
+
+Vector<uint8_t> String::to_utf8_buffer() const {
+ const String *s = this;
+ if (s->empty()) {
+ return Vector<uint8_t>();
+ }
+ CharString charstr = s->utf8();
+
+ Vector<uint8_t> retval;
+ size_t len = charstr.length();
+ retval.resize(len);
+ uint8_t *w = retval.ptrw();
+ copymem(w, charstr.ptr(), len);
+
+ return retval;
+}
+
+Vector<uint8_t> String::to_utf16_buffer() const {
+ const String *s = this;
+ if (s->empty()) {
+ return Vector<uint8_t>();
+ }
+ Char16String charstr = s->utf16();
+
+ Vector<uint8_t> retval;
+ size_t len = charstr.length() * 2;
+ retval.resize(len);
+ uint8_t *w = retval.ptrw();
+ copymem(w, (const void *)charstr.ptr(), len);
+
+ return retval;
+}
+
+Vector<uint8_t> String::to_utf32_buffer() const {
+ const String *s = this;
+ if (s->empty()) {
+ return Vector<uint8_t>();
+ }
+
+ Vector<uint8_t> retval;
+ size_t len = s->length() * 4;
+ retval.resize(len);
+ uint8_t *w = retval.ptrw();
+ copymem(w, (const void *)s->ptr(), len);
+
+ return retval;
+}
+
#ifdef TOOLS_ENABLED
String TTR(const String &p_text, const String &p_context) {
if (TranslationServer::get_singleton()) {
diff --git a/core/ustring.h b/core/ustring.h
index 1f8a5d7e7d..bf9c06b9ca 100644
--- a/core/ustring.h
+++ b/core/ustring.h
@@ -440,6 +440,11 @@ public:
return *this;
}
+ Vector<uint8_t> to_ascii_buffer() const;
+ Vector<uint8_t> to_utf8_buffer() const;
+ Vector<uint8_t> to_utf16_buffer() const;
+ Vector<uint8_t> to_utf32_buffer() const;
+
String(const char *p_str);
String(const wchar_t *p_str);
String(const char32_t *p_str);
diff --git a/core/variant.h b/core/variant.h
index 112003a7ae..1f3ee8ec74 100644
--- a/core/variant.h
+++ b/core/variant.h
@@ -414,6 +414,34 @@ public:
static void blend(const Variant &a, const Variant &b, float c, Variant &r_dst);
static void interpolate(const Variant &a, const Variant &b, float c, Variant &r_dst);
+ class InternalMethod {
+ public:
+ enum Flags {
+ FLAG_IS_CONST = 1,
+ FLAG_RETURNS_VARIANT = 2,
+ FLAG_NO_PTRCALL = 4,
+ FLAG_VARARGS = 8
+ };
+
+ virtual int get_argument_count() const = 0;
+ virtual Type get_argument_type(int p_arg) const = 0;
+ virtual Type get_return_type() const = 0;
+ virtual uint32_t get_flags() const = 0;
+
+#ifdef DEBUG_ENABLED
+ virtual String get_argument_name(int p_arg) const = 0;
+#endif
+ virtual Vector<Variant> get_default_arguments() const = 0;
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) = 0;
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) = 0;
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) = 0;
+#endif
+ virtual ~InternalMethod() {}
+ };
+
+ static InternalMethod *get_internal_method(Type p_type, const StringName &p_method_name);
+
void call_ptr(const StringName &p_method, const Variant **p_args, int p_argcount, Variant *r_ret, Callable::CallError &r_error);
Variant call(const StringName &p_method, const Variant **p_args, int p_argcount, Callable::CallError &r_error);
Variant call(const StringName &p_method, const Variant &p_arg1 = Variant(), const Variant &p_arg2 = Variant(), const Variant &p_arg3 = Variant(), const Variant &p_arg4 = Variant(), const Variant &p_arg5 = Variant());
diff --git a/core/variant_call.cpp b/core/variant_call.cpp
index 5fd970c8e1..66c1987a58 100644
--- a/core/variant_call.cpp
+++ b/core/variant_call.cpp
@@ -30,1062 +30,635 @@
#include "variant.h"
+#include "core/class_db.h"
#include "core/color_names.inc"
#include "core/core_string_names.h"
#include "core/crypto/crypto_core.h"
#include "core/debugger/engine_debugger.h"
#include "core/io/compression.h"
-#include "core/object.h"
+#include "core/oa_hash_map.h"
#include "core/os/os.h"
+_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr) {
+}
+
+_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr, const String &p_str) {
+ arr.push_back(p_str);
+}
+
+template <class... P>
+_FORCE_INLINE_ void sarray_add_str(Vector<String> &arr, const String &p_str, P... p_args) {
+ arr.push_back(p_str);
+ sarray_add_str(arr, p_args...);
+}
+
+template <class... P>
+_FORCE_INLINE_ Vector<String> sarray(P... p_args) {
+ Vector<String> arr;
+ sarray_add_str(arr, p_args...);
+ return arr;
+}
+
typedef void (*VariantFunc)(Variant &r_ret, Variant &p_self, const Variant **p_args);
typedef void (*VariantConstructFunc)(Variant &r_ret, const Variant **p_args);
struct _VariantCall {
- static void Vector3_dot(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- r_ret = reinterpret_cast<Vector3 *>(p_self._data._mem)->dot(*reinterpret_cast<const Vector3 *>(p_args[0]->_data._mem));
- }
-
- struct FuncData {
- int arg_count;
- Vector<Variant> default_args;
- Vector<Variant::Type> arg_types;
- Vector<StringName> arg_names;
- Variant::Type return_type;
+ template <class T, class... P>
+ class InternalMethod : public Variant::InternalMethod {
+ public:
+ void (T::*method)(P...);
+ Vector<Variant> default_values;
+#ifdef DEBUG_ENABLED
+ Vector<String> argument_names;
+#endif
- bool _const;
- bool returns;
+ virtual int get_argument_count() const {
+ return sizeof...(P);
+ }
+ virtual Variant::Type get_argument_type(int p_arg) const {
+ return call_get_argument_type<P...>(p_arg);
+ }
+#ifdef DEBUG_ENABLED
+ virtual String get_argument_name(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String());
+ return argument_names[p_arg];
+ }
+#endif
+ virtual Vector<Variant> get_default_arguments() const {
+ return default_values;
+ }
- VariantFunc func;
+ virtual Variant::Type get_return_type() const {
+ return Variant::NIL;
+ }
+ virtual uint32_t get_flags() const {
+ return 0;
+ }
- _FORCE_INLINE_ bool verify_arguments(const Variant **p_args, Callable::CallError &r_error) {
- if (arg_count == 0) {
- return true;
- }
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ call_with_variant_args_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_error, default_values);
+ }
- const Variant::Type *tptr = &arg_types[0];
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args(base, method, p_args);
+ }
- for (int i = 0; i < arg_count; i++) {
- if (tptr[i] == Variant::NIL || tptr[i] == p_args[i]->type) {
- continue; // all good
- }
- if (!Variant::can_convert(p_args[i]->type, tptr[i])) {
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_ARGUMENT;
- r_error.argument = i;
- r_error.expected = tptr[i];
- return false;
- }
- }
- return true;
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) {
+ call_with_ptr_args<T, P...>(reinterpret_cast<T *>(p_base), method, p_args);
}
+#endif
+ InternalMethod(void (T::*p_method)(P...), const Vector<Variant> &p_default_args
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_arg_names
+#endif
+ ) {
+ method = p_method;
+ default_values = p_default_args;
+#ifdef DEBUG_ENABLED
+ argument_names = p_arg_names;
+#endif
+ }
+ };
- _FORCE_INLINE_ void call(Variant &r_ret, Variant &p_self, const Variant **p_args, int p_argcount, Callable::CallError &r_error) {
+ template <class T, class R, class... P>
+ class InternalMethodR : public Variant::InternalMethod {
+ public:
+ R(T::*method)
+ (P...);
+ Vector<Variant> default_values;
#ifdef DEBUG_ENABLED
- if (p_argcount > arg_count) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
- r_error.argument = arg_count;
- return;
- } else
+ Vector<String> argument_names;
#endif
- if (p_argcount < arg_count) {
- int def_argcount = default_args.size();
+
+ virtual int get_argument_count() const {
+ return sizeof...(P);
+ }
+ virtual Variant::Type get_argument_type(int p_arg) const {
+ return call_get_argument_type<P...>(p_arg);
+ return Variant::NIL;
+ }
#ifdef DEBUG_ENABLED
- if (p_argcount < (arg_count - def_argcount)) {
- r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
- r_error.argument = arg_count - def_argcount;
- return;
- }
+ virtual String get_argument_name(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String());
+ return argument_names[p_arg];
+ }
+#endif
+ virtual Vector<Variant> get_default_arguments() const {
+ return default_values;
+ }
+ virtual Variant::Type get_return_type() const {
+ return GetTypeInfo<R>::VARIANT_TYPE;
+ }
+ virtual uint32_t get_flags() const {
+ uint32_t f = 0;
+ if (get_return_type() == Variant::NIL) {
+ f |= FLAG_RETURNS_VARIANT;
+ }
+ return f;
+ }
+
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ call_with_variant_args_ret_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_ret, r_error, default_values);
+ }
+
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_ret(base, method, p_args, r_ret);
+ }
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) {
+ call_with_ptr_args_ret<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret);
+ }
#endif
- ERR_FAIL_COND(p_argcount > VARIANT_ARG_MAX);
- const Variant *newargs[VARIANT_ARG_MAX];
- for (int i = 0; i < p_argcount; i++) {
- newargs[i] = p_args[i];
- }
- // fill in any remaining parameters with defaults
- int first_default_arg = arg_count - def_argcount;
- for (int i = p_argcount; i < arg_count; i++) {
- newargs[i] = &default_args[i - first_default_arg];
- }
+ InternalMethodR(R (T::*p_method)(P...), const Vector<Variant> &p_default_args
#ifdef DEBUG_ENABLED
- if (!verify_arguments(newargs, r_error)) {
- return;
- }
+ ,
+ const Vector<String> &p_arg_names
#endif
- func(r_ret, p_self, newargs);
- } else {
+ ) {
+ method = p_method;
+ default_values = p_default_args;
#ifdef DEBUG_ENABLED
- if (!verify_arguments(p_args, r_error)) {
- return;
- }
+ argument_names = p_arg_names;
#endif
- func(r_ret, p_self, p_args);
- }
}
};
- struct TypeFunc {
- Map<StringName, FuncData> functions;
- };
+ template <class T, class R, class... P>
+ class InternalMethodRC : public Variant::InternalMethod {
+ public:
+ R(T::*method)
+ (P...) const;
+ Vector<Variant> default_values;
+#ifdef DEBUG_ENABLED
+ Vector<String> argument_names;
+#endif
- static TypeFunc *type_funcs;
+ virtual int get_argument_count() const {
+ return sizeof...(P);
+ }
+ virtual Variant::Type get_argument_type(int p_arg) const {
+ return call_get_argument_type<P...>(p_arg);
+ }
+#ifdef DEBUG_ENABLED
+ virtual String get_argument_name(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String());
+ return argument_names[p_arg];
+ }
+#endif
+ virtual Vector<Variant> get_default_arguments() const {
+ return default_values;
+ }
- struct Arg {
- StringName name;
- Variant::Type type;
- Arg() { type = Variant::NIL; }
- Arg(Variant::Type p_type, const StringName &p_name) :
- name(p_name),
- type(p_type) {
+ virtual Variant::Type get_return_type() const {
+ return GetTypeInfo<R>::VARIANT_TYPE;
+ }
+ virtual uint32_t get_flags() const {
+ uint32_t f = FLAG_IS_CONST;
+ if (get_return_type() == Variant::NIL) {
+ f |= FLAG_RETURNS_VARIANT;
+ }
+ return f;
}
- };
- //void addfunc(Variant::Type p_type, const StringName& p_name,VariantFunc p_func);
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ call_with_variant_args_retc_dv(VariantGetInternalPtr<T>::get_ptr(base), method, p_args, p_argcount, r_ret, r_error, default_values);
+ }
- static void make_func_return_variant(Variant::Type p_type, const StringName &p_name) {
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_retc(base, method, p_args, r_ret);
+ }
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) {
+ call_with_ptr_args_retc<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret);
+ }
+#endif
+ InternalMethodRC(R (T::*p_method)(P...) const, const Vector<Variant> &p_default_args
#ifdef DEBUG_ENABLED
- type_funcs[p_type].functions[p_name].returns = true;
+ ,
+ const Vector<String> &p_arg_names
#endif
- }
-
- static void addfunc(bool p_const, Variant::Type p_type, Variant::Type p_return, bool p_has_return, const StringName &p_name, VariantFunc p_func, const Vector<Variant> &p_defaultarg, const Arg &p_argtype1 = Arg(), const Arg &p_argtype2 = Arg(), const Arg &p_argtype3 = Arg(), const Arg &p_argtype4 = Arg(), const Arg &p_argtype5 = Arg()) {
- FuncData funcdata;
- funcdata.func = p_func;
- funcdata.default_args = p_defaultarg;
- funcdata._const = p_const;
- funcdata.returns = p_has_return;
- funcdata.return_type = p_return;
+ ) {
+ method = p_method;
+ default_values = p_default_args;
+#ifdef DEBUG_ENABLED
+ argument_names = p_arg_names;
+#endif
+ }
+ };
- if (p_argtype1.name) {
- funcdata.arg_types.push_back(p_argtype1.type);
+ template <class T, class R, class... P>
+ class InternalMethodRS : public Variant::InternalMethod {
+ public:
+ R(*method)
+ (T *, P...);
+ Vector<Variant> default_values;
#ifdef DEBUG_ENABLED
- funcdata.arg_names.push_back(p_argtype1.name);
+ Vector<String> argument_names;
#endif
- } else {
- goto end;
+ virtual int get_argument_count() const {
+ return sizeof...(P);
+ }
+ virtual Variant::Type get_argument_type(int p_arg) const {
+ return call_get_argument_type<P...>(p_arg);
}
-
- if (p_argtype2.name) {
- funcdata.arg_types.push_back(p_argtype2.type);
#ifdef DEBUG_ENABLED
- funcdata.arg_names.push_back(p_argtype2.name);
+ virtual String get_argument_name(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String());
+ return argument_names[p_arg];
+ }
#endif
+ virtual Vector<Variant> get_default_arguments() const {
+ return default_values;
+ }
- } else {
- goto end;
+ virtual Variant::Type get_return_type() const {
+ return GetTypeInfo<R>::VARIANT_TYPE;
+ }
+ virtual uint32_t get_flags() const {
+ uint32_t f = 0;
+ if (get_return_type() == Variant::NIL) {
+ f |= FLAG_RETURNS_VARIANT;
+ }
+ return f;
}
- if (p_argtype3.name) {
- funcdata.arg_types.push_back(p_argtype3.type);
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ const Variant **args = p_args;
#ifdef DEBUG_ENABLED
- funcdata.arg_names.push_back(p_argtype3.name);
+ if ((size_t)p_argcount > sizeof...(P)) {
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_MANY_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+ return;
+ }
#endif
-
- } else {
- goto end;
+ if ((size_t)p_argcount < sizeof...(P)) {
+ size_t missing = sizeof...(P) - (size_t)p_argcount;
+ if (missing <= (size_t)default_values.size()) {
+ args = (const Variant **)alloca(sizeof...(P) * sizeof(const Variant *));
+ // GCC fails to see that `sizeof...(P)` cannot be 0 here given the previous
+ // conditions, so it raises a warning on the potential use of `i < 0` as the
+ // execution condition.
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic push
+#pragma GCC diagnostic ignored "-Wtype-limits"
+#endif
+ for (size_t i = 0; i < sizeof...(P); i++) {
+ if (i < (size_t)p_argcount) {
+ args[i] = p_args[i];
+ } else {
+ args[i] = &default_values[i - p_argcount + (default_values.size() - missing)];
+ }
+ }
+#if defined(__GNUC__) && !defined(__clang__)
+#pragma GCC diagnostic pop
+#endif
+ } else {
+#ifdef DEBUG_ENABLED
+ r_error.error = Callable::CallError::CALL_ERROR_TOO_FEW_ARGUMENTS;
+ r_error.argument = sizeof...(P);
+#endif
+ return;
+ }
+ }
+ call_with_variant_args_retc_static_helper(VariantGetInternalPtr<T>::get_ptr(base), method, args, r_ret, r_error, BuildIndexSequence<sizeof...(P)>{});
}
- if (p_argtype4.name) {
- funcdata.arg_types.push_back(p_argtype4.type);
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) {
+ call_with_validated_variant_args_static_retc(base, method, p_args, r_ret);
+ }
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) {
+ call_with_ptr_args_static_retc<T, R, P...>(reinterpret_cast<T *>(p_base), method, p_args, r_ret);
+ }
+#endif
+ InternalMethodRS(R (*p_method)(T *, P...), const Vector<Variant> &p_default_args
#ifdef DEBUG_ENABLED
- funcdata.arg_names.push_back(p_argtype4.name);
+ ,
+ const Vector<String> &p_arg_names
+#endif
+ ) {
+ method = p_method;
+ default_values = p_default_args;
+#ifdef DEBUG_ENABLED
+ argument_names = p_arg_names;
#endif
- } else {
- goto end;
}
+ };
- if (p_argtype5.name) {
- funcdata.arg_types.push_back(p_argtype5.type);
+ class InternalMethodVC : public Variant::InternalMethod {
+ public:
+ typedef void (*MethodVC)(Variant *, const Variant **, int, Variant &r_ret, Callable::CallError &);
+ MethodVC methodvc = nullptr;
+ uint32_t base_flags = 0;
+ Vector<String> argument_names;
+ Vector<Variant::Type> argument_types;
+ Variant::Type return_type = Variant::NIL;
+
+ virtual int get_argument_count() const {
+ return argument_names.size();
+ }
+ virtual Variant::Type get_argument_type(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_types.size(), Variant::NIL);
+ return argument_types[p_arg];
+ }
#ifdef DEBUG_ENABLED
- funcdata.arg_names.push_back(p_argtype5.name);
+ virtual String get_argument_name(int p_arg) const {
+ ERR_FAIL_INDEX_V(p_arg, argument_names.size(), String());
+ return argument_names[p_arg];
+ }
#endif
- } else {
- goto end;
+ virtual Vector<Variant> get_default_arguments() const {
+ return Vector<Variant>();
}
- end:
+ virtual Variant::Type get_return_type() const {
+ return return_type;
+ }
+ virtual uint32_t get_flags() const {
+ return base_flags | FLAG_NO_PTRCALL;
+ }
- funcdata.arg_count = funcdata.arg_types.size();
- type_funcs[p_type].functions[p_name] = funcdata;
- }
-
-#define VCALL_LOCALMEM0(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(); }
-#define VCALL_LOCALMEM0R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(); }
-#define VCALL_LOCALMEM1(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0]); }
-#define VCALL_LOCALMEM1R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0]); }
-#define VCALL_LOCALMEM2(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_LOCALMEM2R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_LOCALMEM3(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_LOCALMEM3R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_LOCALMEM4(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_LOCALMEM4R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_LOCALMEM5(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-#define VCALL_LOCALMEM5R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._mem)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-
- // built-in functions of localmem based types
-
- VCALL_LOCALMEM1R(String, casecmp_to);
- VCALL_LOCALMEM1R(String, nocasecmp_to);
- VCALL_LOCALMEM1R(String, naturalnocasecmp_to);
- VCALL_LOCALMEM0R(String, length);
- VCALL_LOCALMEM3R(String, count);
- VCALL_LOCALMEM3R(String, countn);
- VCALL_LOCALMEM2R(String, substr);
- VCALL_LOCALMEM2R(String, find);
- VCALL_LOCALMEM2R(String, findn);
- VCALL_LOCALMEM2R(String, rfind);
- VCALL_LOCALMEM2R(String, rfindn);
- VCALL_LOCALMEM1R(String, match);
- VCALL_LOCALMEM1R(String, matchn);
- VCALL_LOCALMEM1R(String, begins_with);
- VCALL_LOCALMEM1R(String, ends_with);
- VCALL_LOCALMEM1R(String, is_subsequence_of);
- VCALL_LOCALMEM1R(String, is_subsequence_ofi);
- VCALL_LOCALMEM0R(String, bigrams);
- VCALL_LOCALMEM1R(String, similarity);
- VCALL_LOCALMEM2R(String, format);
- VCALL_LOCALMEM2R(String, replace);
- VCALL_LOCALMEM2R(String, replacen);
- VCALL_LOCALMEM1R(String, repeat);
- VCALL_LOCALMEM2R(String, insert);
- VCALL_LOCALMEM0R(String, capitalize);
- VCALL_LOCALMEM3R(String, split);
- VCALL_LOCALMEM3R(String, rsplit);
- VCALL_LOCALMEM2R(String, split_floats);
- VCALL_LOCALMEM1R(String, join);
- VCALL_LOCALMEM0R(String, to_upper);
- VCALL_LOCALMEM0R(String, to_lower);
- VCALL_LOCALMEM1R(String, left);
- VCALL_LOCALMEM1R(String, right);
- VCALL_LOCALMEM0R(String, dedent);
- VCALL_LOCALMEM2R(String, strip_edges);
- VCALL_LOCALMEM0R(String, strip_escapes);
- VCALL_LOCALMEM1R(String, lstrip);
- VCALL_LOCALMEM1R(String, rstrip);
- VCALL_LOCALMEM0R(String, get_extension);
- VCALL_LOCALMEM0R(String, get_basename);
- VCALL_LOCALMEM1R(String, plus_file);
- VCALL_LOCALMEM1R(String, ord_at);
- VCALL_LOCALMEM2(String, erase);
- VCALL_LOCALMEM0R(String, hash);
- VCALL_LOCALMEM0R(String, md5_text);
- VCALL_LOCALMEM0R(String, sha1_text);
- VCALL_LOCALMEM0R(String, sha256_text);
- VCALL_LOCALMEM0R(String, md5_buffer);
- VCALL_LOCALMEM0R(String, sha1_buffer);
- VCALL_LOCALMEM0R(String, sha256_buffer);
- VCALL_LOCALMEM0R(String, empty);
- VCALL_LOCALMEM1R(String, humanize_size);
- VCALL_LOCALMEM0R(String, is_abs_path);
- VCALL_LOCALMEM0R(String, is_rel_path);
- VCALL_LOCALMEM0R(String, get_base_dir);
- VCALL_LOCALMEM0R(String, get_file);
- VCALL_LOCALMEM0R(String, xml_escape);
- VCALL_LOCALMEM0R(String, xml_unescape);
- VCALL_LOCALMEM0R(String, http_escape);
- VCALL_LOCALMEM0R(String, http_unescape);
- VCALL_LOCALMEM0R(String, c_escape);
- VCALL_LOCALMEM0R(String, c_unescape);
- VCALL_LOCALMEM0R(String, json_escape);
- VCALL_LOCALMEM0R(String, percent_encode);
- VCALL_LOCALMEM0R(String, percent_decode);
- VCALL_LOCALMEM0R(String, is_valid_identifier);
- VCALL_LOCALMEM0R(String, is_valid_integer);
- VCALL_LOCALMEM0R(String, is_valid_float);
- VCALL_LOCALMEM1R(String, is_valid_hex_number);
- VCALL_LOCALMEM0R(String, is_valid_html_color);
- VCALL_LOCALMEM0R(String, is_valid_ip_address);
- VCALL_LOCALMEM0R(String, is_valid_filename);
- VCALL_LOCALMEM0R(String, to_int);
- VCALL_LOCALMEM0R(String, to_float);
- VCALL_LOCALMEM0R(String, hex_to_int);
- VCALL_LOCALMEM2R(String, lpad);
- VCALL_LOCALMEM2R(String, rpad);
- VCALL_LOCALMEM1R(String, pad_decimals);
- VCALL_LOCALMEM1R(String, pad_zeros);
- VCALL_LOCALMEM1R(String, trim_prefix);
- VCALL_LOCALMEM1R(String, trim_suffix);
-
- static void _call_String_to_ascii(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- String *s = reinterpret_cast<String *>(p_self._data._mem);
- if (s->empty()) {
- r_ret = PackedByteArray();
- return;
+ virtual void call(Variant *base, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ methodvc(base, p_args, p_argcount, r_ret, r_error);
}
- CharString charstr = s->ascii();
- PackedByteArray retval;
- size_t len = charstr.length();
- retval.resize(len);
- uint8_t *w = retval.ptrw();
- copymem(w, charstr.ptr(), len);
+ virtual void validated_call(Variant *base, const Variant **p_args, Variant *r_ret) {
+ ERR_FAIL_MSG("No support for validated call");
+ }
+#ifdef PTRCALL_ENABLED
+ virtual void ptrcall(void *p_base, const void **p_args, void *r_ret) {
+ ERR_FAIL_MSG("No support for ptrcall call");
+ }
+#endif
+ InternalMethodVC(MethodVC p_method, uint32_t p_flags, const Vector<Variant::Type> &p_argument_types, const Variant::Type &p_return_type
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_arg_names
+#endif
+ ) {
+ methodvc = p_method;
+ argument_types = p_argument_types;
+ return_type = p_return_type;
+ base_flags = p_flags;
+#ifdef DEBUG_ENABLED
+ argument_names = p_arg_names;
+#endif
+ }
+ };
- r_ret = retval;
- }
+ typedef OAHashMap<StringName, Variant::InternalMethod *> MethodMap;
+ static MethodMap *type_internal_methods;
+ static List<StringName> *type_internal_method_names;
- static void _call_String_to_utf8(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- String *s = reinterpret_cast<String *>(p_self._data._mem);
- if (s->empty()) {
- r_ret = PackedByteArray();
- return;
- }
- CharString charstr = s->utf8();
+ template <class T, class... P>
+ static void _bind_method(const StringName &p_name, void (T::*p_method)(P...), const Vector<Variant> &p_default_args = Vector<Variant>()
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_argument_names = Vector<String>()
+#endif
+ ) {
- PackedByteArray retval;
- size_t len = charstr.length();
- retval.resize(len);
- uint8_t *w = retval.ptrw();
- copymem(w, charstr.ptr(), len);
+#ifdef DEBUG_ENABLED
+ ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+ ERR_FAIL_COND(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name));
+#endif
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod *m = memnew((InternalMethod<T, P...>)(p_method, p_default_args, p_argument_names));
+#else
+ Variant::InternalMethod *m = memnew((InternalMethod<T, P...>)(p_method, p_default_args));
+#endif
- r_ret = retval;
+ type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m);
+ type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name);
}
- static void _call_String_to_utf16(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- String *s = reinterpret_cast<String *>(p_self._data._mem);
- if (s->empty()) {
- r_ret = PackedByteArray();
- return;
- }
- Char16String charstr = s->utf16();
+ template <class T, class R, class... P>
+ static void _bind_method(const StringName &p_name, R (T::*p_method)(P...) const, const Vector<Variant> &p_default_args = Vector<Variant>()
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_argument_names = Vector<String>()
+#endif
+ ) {
+#ifdef DEBUG_ENABLED
+ ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+ ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
- PackedByteArray retval;
- size_t len = charstr.length() * 2;
- retval.resize(len);
- uint8_t *w = retval.ptrw();
- copymem(w, (const void *)charstr.ptr(), len);
+#endif
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod *m = memnew((InternalMethodRC<T, R, P...>)(p_method, p_default_args, p_argument_names));
+#else
+ Variant::InternalMethod *m = memnew((InternalMethodRC<T, R, P...>)(p_method, p_default_args));
+#endif
- r_ret = retval;
+ type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m);
+ type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name);
}
- static void _call_String_to_utf32(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- String *s = reinterpret_cast<String *>(p_self._data._mem);
- if (s->empty()) {
- r_ret = PackedByteArray();
- return;
- }
+ template <class T, class R, class... P>
+ static void _bind_method(const StringName &p_name, R (T::*p_method)(P...), const Vector<Variant> &p_default_args = Vector<Variant>()
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_argument_names = Vector<String>()
+#endif
+ ) {
+#ifdef DEBUG_ENABLED
+ ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+ ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+#endif
- PackedByteArray retval;
- size_t len = s->length() * 4;
- retval.resize(len);
- uint8_t *w = retval.ptrw();
- copymem(w, (const void *)s->ptr(), len);
-
- r_ret = retval;
- }
-
- VCALL_LOCALMEM1R(Vector2, distance_to);
- VCALL_LOCALMEM1R(Vector2, distance_squared_to);
- VCALL_LOCALMEM0R(Vector2, length);
- VCALL_LOCALMEM0R(Vector2, length_squared);
- VCALL_LOCALMEM0R(Vector2, normalized);
- VCALL_LOCALMEM0R(Vector2, is_normalized);
- VCALL_LOCALMEM1R(Vector2, is_equal_approx);
- VCALL_LOCALMEM1R(Vector2, posmod);
- VCALL_LOCALMEM1R(Vector2, posmodv);
- VCALL_LOCALMEM1R(Vector2, project);
- VCALL_LOCALMEM1R(Vector2, angle_to);
- VCALL_LOCALMEM1R(Vector2, angle_to_point);
- VCALL_LOCALMEM1R(Vector2, direction_to);
- VCALL_LOCALMEM2R(Vector2, lerp);
- VCALL_LOCALMEM2R(Vector2, slerp);
- VCALL_LOCALMEM4R(Vector2, cubic_interpolate);
- VCALL_LOCALMEM2R(Vector2, move_toward);
- VCALL_LOCALMEM1R(Vector2, rotated);
- VCALL_LOCALMEM0R(Vector2, tangent);
- VCALL_LOCALMEM0R(Vector2, floor);
- VCALL_LOCALMEM0R(Vector2, ceil);
- VCALL_LOCALMEM0R(Vector2, round);
- VCALL_LOCALMEM1R(Vector2, snapped);
- VCALL_LOCALMEM0R(Vector2, aspect);
- VCALL_LOCALMEM1R(Vector2, dot);
- VCALL_LOCALMEM1R(Vector2, slide);
- VCALL_LOCALMEM1R(Vector2, bounce);
- VCALL_LOCALMEM1R(Vector2, reflect);
- VCALL_LOCALMEM0R(Vector2, angle);
- VCALL_LOCALMEM1R(Vector2, cross);
- VCALL_LOCALMEM0R(Vector2, abs);
- VCALL_LOCALMEM1R(Vector2, clamped);
- VCALL_LOCALMEM0R(Vector2, sign);
-
- VCALL_LOCALMEM0R(Vector2i, aspect);
- VCALL_LOCALMEM0R(Vector2i, sign);
- VCALL_LOCALMEM0R(Vector2i, abs);
-
- VCALL_LOCALMEM0R(Rect2, get_area);
- VCALL_LOCALMEM0R(Rect2, has_no_area);
- VCALL_LOCALMEM1R(Rect2, has_point);
- VCALL_LOCALMEM1R(Rect2, is_equal_approx);
- VCALL_LOCALMEM2R(Rect2, intersects);
- VCALL_LOCALMEM1R(Rect2, encloses);
- VCALL_LOCALMEM1R(Rect2, clip);
- VCALL_LOCALMEM1R(Rect2, merge);
- VCALL_LOCALMEM1R(Rect2, expand);
- VCALL_LOCALMEM1R(Rect2, grow);
- VCALL_LOCALMEM2R(Rect2, grow_margin);
- VCALL_LOCALMEM4R(Rect2, grow_individual);
- VCALL_LOCALMEM0R(Rect2, abs);
-
- VCALL_LOCALMEM0R(Rect2i, get_area);
- VCALL_LOCALMEM0R(Rect2i, has_no_area);
- VCALL_LOCALMEM1R(Rect2i, has_point);
- VCALL_LOCALMEM1R(Rect2i, intersects);
- VCALL_LOCALMEM1R(Rect2i, encloses);
- VCALL_LOCALMEM1R(Rect2i, clip);
- VCALL_LOCALMEM1R(Rect2i, merge);
- VCALL_LOCALMEM1R(Rect2i, expand);
- VCALL_LOCALMEM1R(Rect2i, grow);
- VCALL_LOCALMEM2R(Rect2i, grow_margin);
- VCALL_LOCALMEM4R(Rect2i, grow_individual);
- VCALL_LOCALMEM0R(Rect2i, abs);
-
- VCALL_LOCALMEM0R(Vector3, min_axis);
- VCALL_LOCALMEM0R(Vector3, max_axis);
- VCALL_LOCALMEM1R(Vector3, distance_to);
- VCALL_LOCALMEM1R(Vector3, distance_squared_to);
- VCALL_LOCALMEM0R(Vector3, length);
- VCALL_LOCALMEM0R(Vector3, length_squared);
- VCALL_LOCALMEM0R(Vector3, normalized);
- VCALL_LOCALMEM0R(Vector3, is_normalized);
- VCALL_LOCALMEM1R(Vector3, is_equal_approx);
- VCALL_LOCALMEM0R(Vector3, inverse);
- VCALL_LOCALMEM1R(Vector3, snapped);
- VCALL_LOCALMEM2R(Vector3, rotated);
- VCALL_LOCALMEM2R(Vector3, lerp);
- VCALL_LOCALMEM2R(Vector3, slerp);
- VCALL_LOCALMEM4R(Vector3, cubic_interpolate);
- VCALL_LOCALMEM2R(Vector3, move_toward);
- VCALL_LOCALMEM1R(Vector3, dot);
- VCALL_LOCALMEM1R(Vector3, cross);
- VCALL_LOCALMEM1R(Vector3, outer);
- VCALL_LOCALMEM0R(Vector3, to_diagonal_matrix);
- VCALL_LOCALMEM0R(Vector3, abs);
- VCALL_LOCALMEM0R(Vector3, floor);
- VCALL_LOCALMEM0R(Vector3, ceil);
- VCALL_LOCALMEM0R(Vector3, round);
- VCALL_LOCALMEM1R(Vector3, posmod);
- VCALL_LOCALMEM1R(Vector3, posmodv);
- VCALL_LOCALMEM1R(Vector3, project);
- VCALL_LOCALMEM1R(Vector3, angle_to);
- VCALL_LOCALMEM1R(Vector3, direction_to);
- VCALL_LOCALMEM1R(Vector3, slide);
- VCALL_LOCALMEM1R(Vector3, bounce);
- VCALL_LOCALMEM1R(Vector3, reflect);
- VCALL_LOCALMEM0R(Vector3, sign);
-
- VCALL_LOCALMEM0R(Vector3i, min_axis);
- VCALL_LOCALMEM0R(Vector3i, max_axis);
- VCALL_LOCALMEM0R(Vector3i, sign);
-
- VCALL_LOCALMEM0R(Plane, normalized);
- VCALL_LOCALMEM0R(Plane, center);
- VCALL_LOCALMEM1R(Plane, is_equal_approx);
- VCALL_LOCALMEM1R(Plane, is_point_over);
- VCALL_LOCALMEM1R(Plane, distance_to);
- VCALL_LOCALMEM2R(Plane, has_point);
- VCALL_LOCALMEM1R(Plane, project);
-
- //return vector3 if intersected, nil if not
- static void _call_Plane_intersect_3(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Vector3 result;
- if (reinterpret_cast<Plane *>(p_self._data._mem)->intersect_3(*p_args[0], *p_args[1], &result)) {
- r_ret = result;
- } else {
- r_ret = Variant();
- }
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod *m = memnew((InternalMethodR<T, R, P...>)(p_method, p_default_args, p_argument_names));
+#else
+ Variant::InternalMethod *m = memnew((InternalMethodR<T, R, P...>)(p_method, p_default_args));
+#endif
+ type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m);
+ type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name);
}
- static void _call_Plane_intersects_ray(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Vector3 result;
- if (reinterpret_cast<Plane *>(p_self._data._mem)->intersects_ray(*p_args[0], *p_args[1], &result)) {
- r_ret = result;
- } else {
- r_ret = Variant();
- }
+#ifdef DEBUG_ENABLED
+#define bind_method(m_type, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_method, &m_type ::m_method, m_default_args, m_arg_names)
+#else
+#define bind_method(m_type, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_method, &m_type ::m_method, m_default_args)
+#endif
+
+#ifdef DEBUG_ENABLED
+#define bind_methodv(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_name, m_method, m_default_args, m_arg_names)
+#else
+#define bind_methodv(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_method(#m_name, m_method, m_default_args)
+#endif
+
+ template <class T, class R, class... P>
+ static void _bind_function(const StringName &p_name, R (*p_method)(T *, P...), const Vector<Variant> &p_default_args = Vector<Variant>()
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_argument_names = Vector<String>()
+#endif
+ ) {
+#ifdef DEBUG_ENABLED
+ ERR_FAIL_COND_MSG(p_argument_names.size() != sizeof...(P), "Wrong argument name count supplied for method: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+ ERR_FAIL_COND_MSG(type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].has(p_name), " Method already registered: " + Variant::get_type_name(GetTypeInfo<T>::VARIANT_TYPE) + "::" + String(p_name));
+#endif
+
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod *m = memnew((InternalMethodRS<T, R, P...>)(p_method, p_default_args, p_argument_names));
+#else
+ Variant::InternalMethod *m = memnew((InternalMethodRS<T, R, P...>)(p_method, p_default_args));
+#endif
+
+ type_internal_methods[GetTypeInfo<T>::VARIANT_TYPE].insert(p_name, m);
+ type_internal_method_names[GetTypeInfo<T>::VARIANT_TYPE].push_back(p_name);
}
- static void _call_Plane_intersects_segment(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Vector3 result;
- if (reinterpret_cast<Plane *>(p_self._data._mem)->intersects_segment(*p_args[0], *p_args[1], &result)) {
- r_ret = result;
- } else {
- r_ret = Variant();
- }
- }
-
- VCALL_LOCALMEM0R(Quat, length);
- VCALL_LOCALMEM0R(Quat, length_squared);
- VCALL_LOCALMEM0R(Quat, normalized);
- VCALL_LOCALMEM0R(Quat, is_normalized);
- VCALL_LOCALMEM1R(Quat, is_equal_approx);
- VCALL_LOCALMEM0R(Quat, inverse);
- VCALL_LOCALMEM1R(Quat, dot);
- VCALL_LOCALMEM1R(Quat, xform);
- VCALL_LOCALMEM2R(Quat, slerp);
- VCALL_LOCALMEM2R(Quat, slerpni);
- VCALL_LOCALMEM4R(Quat, cubic_slerp);
- VCALL_LOCALMEM0R(Quat, get_euler);
- VCALL_LOCALMEM1(Quat, set_euler);
- VCALL_LOCALMEM2(Quat, set_axis_angle);
-
- VCALL_LOCALMEM0R(Color, to_argb32);
- VCALL_LOCALMEM0R(Color, to_abgr32);
- VCALL_LOCALMEM0R(Color, to_rgba32);
- VCALL_LOCALMEM0R(Color, to_argb64);
- VCALL_LOCALMEM0R(Color, to_abgr64);
- VCALL_LOCALMEM0R(Color, to_rgba64);
- VCALL_LOCALMEM0R(Color, inverted);
- VCALL_LOCALMEM0R(Color, contrasted);
- VCALL_LOCALMEM2R(Color, lerp);
- VCALL_LOCALMEM1R(Color, blend);
- VCALL_LOCALMEM1R(Color, lightened);
- VCALL_LOCALMEM1R(Color, darkened);
- VCALL_LOCALMEM1R(Color, to_html);
- VCALL_LOCALMEM4R(Color, from_hsv);
- VCALL_LOCALMEM1R(Color, is_equal_approx);
-
- VCALL_LOCALMEM0R(RID, get_id);
-
- VCALL_LOCALMEM0R(NodePath, is_absolute);
- VCALL_LOCALMEM0R(NodePath, get_name_count);
- VCALL_LOCALMEM1R(NodePath, get_name);
- VCALL_LOCALMEM0R(NodePath, get_subname_count);
- VCALL_LOCALMEM1R(NodePath, get_subname);
- VCALL_LOCALMEM0R(NodePath, get_concatenated_subnames);
- VCALL_LOCALMEM0R(NodePath, get_as_property_path);
- VCALL_LOCALMEM0R(NodePath, is_empty);
-
- VCALL_LOCALMEM0R(Dictionary, size);
- VCALL_LOCALMEM0R(Dictionary, empty);
- VCALL_LOCALMEM0(Dictionary, clear);
- VCALL_LOCALMEM1R(Dictionary, has);
- VCALL_LOCALMEM1R(Dictionary, has_all);
- VCALL_LOCALMEM1R(Dictionary, erase);
- VCALL_LOCALMEM0R(Dictionary, hash);
- VCALL_LOCALMEM0R(Dictionary, keys);
- VCALL_LOCALMEM0R(Dictionary, values);
- VCALL_LOCALMEM1R(Dictionary, duplicate);
- VCALL_LOCALMEM2R(Dictionary, get);
-
- VCALL_LOCALMEM0R(Callable, is_null);
- VCALL_LOCALMEM0R(Callable, is_custom);
- VCALL_LOCALMEM0(Callable, is_standard);
- VCALL_LOCALMEM0(Callable, get_object);
- VCALL_LOCALMEM0(Callable, get_object_id);
- VCALL_LOCALMEM0(Callable, get_method);
- VCALL_LOCALMEM0(Callable, hash);
-
- VCALL_LOCALMEM0R(Signal, is_null);
- VCALL_LOCALMEM0R(Signal, get_object);
- VCALL_LOCALMEM0R(Signal, get_object_id);
- VCALL_LOCALMEM0R(Signal, get_name);
- VCALL_LOCALMEM3R(Signal, connect);
- VCALL_LOCALMEM1(Signal, disconnect);
- VCALL_LOCALMEM1R(Signal, is_connected);
- VCALL_LOCALMEM0R(Signal, get_connections);
-
- VCALL_LOCALMEM2(Array, set);
- VCALL_LOCALMEM1R(Array, get);
- VCALL_LOCALMEM0R(Array, size);
- VCALL_LOCALMEM0R(Array, empty);
- VCALL_LOCALMEM0(Array, clear);
- VCALL_LOCALMEM0R(Array, hash);
- VCALL_LOCALMEM1(Array, push_back);
- VCALL_LOCALMEM1(Array, push_front);
- VCALL_LOCALMEM0R(Array, pop_back);
- VCALL_LOCALMEM0R(Array, pop_front);
- VCALL_LOCALMEM1(Array, append);
- VCALL_LOCALMEM1(Array, resize);
- VCALL_LOCALMEM2(Array, insert);
- VCALL_LOCALMEM1(Array, remove);
- VCALL_LOCALMEM0R(Array, front);
- VCALL_LOCALMEM0R(Array, back);
- VCALL_LOCALMEM2R(Array, find);
- VCALL_LOCALMEM2R(Array, rfind);
- VCALL_LOCALMEM1R(Array, find_last);
- VCALL_LOCALMEM1R(Array, count);
- VCALL_LOCALMEM1R(Array, has);
- VCALL_LOCALMEM1(Array, erase);
- VCALL_LOCALMEM0(Array, sort);
- VCALL_LOCALMEM2(Array, sort_custom);
- VCALL_LOCALMEM0(Array, shuffle);
- VCALL_LOCALMEM2R(Array, bsearch);
- VCALL_LOCALMEM4R(Array, bsearch_custom);
- VCALL_LOCALMEM1R(Array, duplicate);
- VCALL_LOCALMEM4R(Array, slice);
- VCALL_LOCALMEM0(Array, invert);
- VCALL_LOCALMEM0R(Array, max);
- VCALL_LOCALMEM0R(Array, min);
-
- static void _call_PackedByteArray_get_string_from_ascii(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
+#ifdef DEBUG_ENABLED
+#define bind_function(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_function(m_name, m_method, m_default_args, m_arg_names)
+#else
+#define bind_function(m_name, m_method, m_arg_names, m_default_args) _VariantCall::_bind_function(m_name, m_method, m_default_args)
+#endif
+
+ static void _bind_custom(Variant::Type p_type, const StringName &p_name, InternalMethodVC::MethodVC p_method, uint32_t p_flags, const Vector<Variant::Type> &p_argument_types, const Variant::Type &p_return_type
+#ifdef DEBUG_ENABLED
+ ,
+ const Vector<String> &p_argument_names = Vector<String>()
+#endif
+ ) {
+
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod *m = memnew(InternalMethodVC(p_method, p_flags, p_argument_types, p_return_type, p_argument_names));
+#else
+ Variant::InternalMethod *m = memnew(InternalMethodVC(p_method, p_flags, p_argument_types, p_return_type));
+#endif
+
+ type_internal_methods[p_type].insert(p_name, m);
+ type_internal_method_names[p_type].push_back(p_name);
+ }
+
+#ifdef DEBUG_ENABLED
+#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names)
+#else
+#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type)
+#endif
+
+ static String func_PackedByteArray_get_string_from_ascii(PackedByteArray *p_instance) {
String s;
- if (ba->array.size() > 0) {
- const uint8_t *r = ba->array.ptr();
+ if (p_instance->size() > 0) {
+ const uint8_t *r = p_instance->ptr();
CharString cs;
- cs.resize(ba->array.size() + 1);
- copymem(cs.ptrw(), r, ba->array.size());
- cs[ba->array.size()] = 0;
+ cs.resize(p_instance->size() + 1);
+ copymem(cs.ptrw(), r, p_instance->size());
+ cs[p_instance->size()] = 0;
s = cs.get_data();
}
- r_ret = s;
+ return s;
}
- static void _call_PackedByteArray_get_string_from_utf8(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
-
+ static String func_PackedByteArray_get_string_from_utf8(PackedByteArray *p_instance) {
String s;
- if (ba->array.size() > 0) {
- const uint8_t *r = ba->array.ptr();
- s.parse_utf8((const char *)r, ba->array.size());
+ if (p_instance->size() > 0) {
+ const uint8_t *r = p_instance->ptr();
+ s.parse_utf8((const char *)r, p_instance->size());
}
- r_ret = s;
+ return s;
}
- static void _call_PackedByteArray_get_string_from_utf16(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- PackedByteArray *ba = reinterpret_cast<PackedByteArray *>(p_self._data._mem);
+ static String func_PackedByteArray_get_string_from_utf16(PackedByteArray *p_instance) {
String s;
- if (ba->size() > 0) {
- const uint8_t *r = ba->ptr();
- s.parse_utf16((const char16_t *)r, ba->size() / 2);
+ if (p_instance->size() > 0) {
+ const uint8_t *r = p_instance->ptr();
+ s.parse_utf16((const char16_t *)r, p_instance->size() / 2);
}
- r_ret = s;
+ return s;
}
- static void _call_PackedByteArray_get_string_from_utf32(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- PackedByteArray *ba = reinterpret_cast<PackedByteArray *>(p_self._data._mem);
+ static String func_PackedByteArray_get_string_from_utf32(PackedByteArray *p_instance) {
String s;
- if (ba->size() > 0) {
- const uint8_t *r = ba->ptr();
- s = String((const char32_t *)r, ba->size() / 4);
+ if (p_instance->size() > 0) {
+ const uint8_t *r = p_instance->ptr();
+ s = String((const char32_t *)r, p_instance->size() / 4);
}
- r_ret = s;
+ return s;
}
- static void _call_PackedByteArray_compress(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
+ static PackedByteArray func_PackedByteArray_compress(PackedByteArray *p_instance, int p_mode) {
PackedByteArray compressed;
- if (ba->array.size() > 0) {
- Compression::Mode mode = (Compression::Mode)(int)(*p_args[0]);
- compressed.resize(Compression::get_max_compressed_buffer_size(ba->array.size(), mode));
- int result = Compression::compress(compressed.ptrw(), ba->array.ptr(), ba->array.size(), mode);
+ if (p_instance->size() > 0) {
+ Compression::Mode mode = (Compression::Mode)(p_mode);
+ compressed.resize(Compression::get_max_compressed_buffer_size(p_instance->size(), mode));
+ int result = Compression::compress(compressed.ptrw(), p_instance->ptr(), p_instance->size(), mode);
result = result >= 0 ? result : 0;
compressed.resize(result);
}
- r_ret = compressed;
+ return compressed;
}
- static void _call_PackedByteArray_decompress(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
+ static PackedByteArray func_PackedByteArray_decompress(PackedByteArray *p_instance, int64_t p_buffer_size, int p_mode) {
PackedByteArray decompressed;
- Compression::Mode mode = (Compression::Mode)(int)(*p_args[1]);
+ Compression::Mode mode = (Compression::Mode)(p_mode);
- int buffer_size = (int)(*p_args[0]);
+ int64_t buffer_size = p_buffer_size;
if (buffer_size <= 0) {
- r_ret = decompressed;
- ERR_FAIL_MSG("Decompression buffer size must be greater than zero.");
+ ERR_FAIL_V_MSG(decompressed, "Decompression buffer size must be greater than zero.");
}
decompressed.resize(buffer_size);
- int result = Compression::decompress(decompressed.ptrw(), buffer_size, ba->array.ptr(), ba->array.size(), mode);
+ int result = Compression::decompress(decompressed.ptrw(), buffer_size, p_instance->ptr(), p_instance->size(), mode);
result = result >= 0 ? result : 0;
decompressed.resize(result);
- r_ret = decompressed;
+ return decompressed;
}
- static void _call_PackedByteArray_decompress_dynamic(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
+ static PackedByteArray func_PackedByteArray_decompress_dynamic(PackedByteArray *p_instance, int64_t p_buffer_size, int p_mode) {
PackedByteArray decompressed;
- int max_output_size = (int)(*p_args[0]);
- Compression::Mode mode = (Compression::Mode)(int)(*p_args[1]);
+ int64_t max_output_size = p_buffer_size;
+ Compression::Mode mode = (Compression::Mode)(p_mode);
- int result = Compression::decompress_dynamic(&decompressed, max_output_size, ba->array.ptr(), ba->array.size(), mode);
+ int result = Compression::decompress_dynamic(&decompressed, max_output_size, p_instance->ptr(), p_instance->size(), mode);
if (result == OK) {
- r_ret = decompressed;
+ return decompressed;
} else {
decompressed.clear();
- r_ret = decompressed;
- ERR_FAIL_MSG("Decompression failed.");
+ ERR_FAIL_V_MSG(decompressed, "Decompression failed.");
}
}
- static void _call_PackedByteArray_hex_encode(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- Variant::PackedArrayRef<uint8_t> *ba = reinterpret_cast<Variant::PackedArrayRef<uint8_t> *>(p_self._data.packed_array);
- if (ba->array.size() == 0) {
- r_ret = String();
- return;
- }
- const uint8_t *r = ba->array.ptr();
- String s = String::hex_encode_buffer(&r[0], ba->array.size());
- r_ret = s;
- }
-
-#define VCALL_PARRMEM0(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(); }
-#define VCALL_PARRMEM0R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(); }
-#define VCALL_PARRMEM1(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0]); }
-#define VCALL_PARRMEM1R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0]); }
-#define VCALL_PARRMEM2(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_PARRMEM2R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_PARRMEM3(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_PARRMEM3R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_PARRMEM4(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_PARRMEM4R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_PARRMEM5(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-#define VCALL_PARRMEM5R(m_type, m_elemtype, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = Variant::PackedArrayRef<m_elemtype>::get_array_ptr(p_self._data.packed_array)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-
- VCALL_PARRMEM0R(PackedByteArray, uint8_t, size);
- VCALL_PARRMEM0R(PackedByteArray, uint8_t, empty);
- VCALL_PARRMEM2(PackedByteArray, uint8_t, set);
- VCALL_PARRMEM1R(PackedByteArray, uint8_t, get);
- VCALL_PARRMEM1(PackedByteArray, uint8_t, push_back);
- VCALL_PARRMEM1(PackedByteArray, uint8_t, resize);
- VCALL_PARRMEM2R(PackedByteArray, uint8_t, insert);
- VCALL_PARRMEM1(PackedByteArray, uint8_t, remove);
- VCALL_PARRMEM1(PackedByteArray, uint8_t, append);
- VCALL_PARRMEM1(PackedByteArray, uint8_t, append_array);
- VCALL_PARRMEM1R(PackedByteArray, uint8_t, has);
- VCALL_PARRMEM0(PackedByteArray, uint8_t, sort);
- VCALL_PARRMEM0(PackedByteArray, uint8_t, invert);
- VCALL_PARRMEM2R(PackedByteArray, uint8_t, subarray);
-
- VCALL_PARRMEM0R(PackedInt32Array, int32_t, size);
- VCALL_PARRMEM0R(PackedInt32Array, int32_t, empty);
- VCALL_PARRMEM2(PackedInt32Array, int32_t, set);
- VCALL_PARRMEM1R(PackedInt32Array, int32_t, get);
- VCALL_PARRMEM1(PackedInt32Array, int32_t, push_back);
- VCALL_PARRMEM1(PackedInt32Array, int32_t, resize);
- VCALL_PARRMEM2R(PackedInt32Array, int32_t, insert);
- VCALL_PARRMEM1(PackedInt32Array, int32_t, remove);
- VCALL_PARRMEM1(PackedInt32Array, int32_t, append);
- VCALL_PARRMEM1(PackedInt32Array, int32_t, append_array);
- VCALL_PARRMEM1R(PackedInt32Array, int32_t, has);
- VCALL_PARRMEM0(PackedInt32Array, int32_t, sort);
- VCALL_PARRMEM0(PackedInt32Array, int32_t, invert);
-
- VCALL_PARRMEM0R(PackedInt64Array, int64_t, size);
- VCALL_PARRMEM0R(PackedInt64Array, int64_t, empty);
- VCALL_PARRMEM2(PackedInt64Array, int64_t, set);
- VCALL_PARRMEM1R(PackedInt64Array, int64_t, get);
- VCALL_PARRMEM1(PackedInt64Array, int64_t, push_back);
- VCALL_PARRMEM1(PackedInt64Array, int64_t, resize);
- VCALL_PARRMEM2R(PackedInt64Array, int64_t, insert);
- VCALL_PARRMEM1(PackedInt64Array, int64_t, remove);
- VCALL_PARRMEM1(PackedInt64Array, int64_t, append);
- VCALL_PARRMEM1(PackedInt64Array, int64_t, append_array);
- VCALL_PARRMEM1R(PackedInt64Array, int64_t, has);
- VCALL_PARRMEM0(PackedInt64Array, int64_t, sort);
- VCALL_PARRMEM0(PackedInt64Array, int64_t, invert);
-
- VCALL_PARRMEM0R(PackedFloat32Array, float, size);
- VCALL_PARRMEM0R(PackedFloat32Array, float, empty);
- VCALL_PARRMEM2(PackedFloat32Array, float, set);
- VCALL_PARRMEM1R(PackedFloat32Array, float, get);
- VCALL_PARRMEM1(PackedFloat32Array, float, push_back);
- VCALL_PARRMEM1(PackedFloat32Array, float, resize);
- VCALL_PARRMEM2R(PackedFloat32Array, float, insert);
- VCALL_PARRMEM1(PackedFloat32Array, float, remove);
- VCALL_PARRMEM1(PackedFloat32Array, float, append);
- VCALL_PARRMEM1(PackedFloat32Array, float, append_array);
- VCALL_PARRMEM1R(PackedFloat32Array, float, has);
- VCALL_PARRMEM0(PackedFloat32Array, float, sort);
- VCALL_PARRMEM0(PackedFloat32Array, float, invert);
-
- VCALL_PARRMEM0R(PackedFloat64Array, double, size);
- VCALL_PARRMEM0R(PackedFloat64Array, double, empty);
- VCALL_PARRMEM2(PackedFloat64Array, double, set);
- VCALL_PARRMEM1R(PackedFloat64Array, double, get);
- VCALL_PARRMEM1(PackedFloat64Array, double, push_back);
- VCALL_PARRMEM1(PackedFloat64Array, double, resize);
- VCALL_PARRMEM2R(PackedFloat64Array, double, insert);
- VCALL_PARRMEM1(PackedFloat64Array, double, remove);
- VCALL_PARRMEM1(PackedFloat64Array, double, append);
- VCALL_PARRMEM1(PackedFloat64Array, double, append_array);
- VCALL_PARRMEM1R(PackedFloat64Array, double, has);
- VCALL_PARRMEM0(PackedFloat64Array, double, sort);
- VCALL_PARRMEM0(PackedFloat64Array, double, invert);
-
- VCALL_PARRMEM0R(PackedStringArray, String, size);
- VCALL_PARRMEM0R(PackedStringArray, String, empty);
- VCALL_PARRMEM2(PackedStringArray, String, set);
- VCALL_PARRMEM1R(PackedStringArray, String, get);
- VCALL_PARRMEM1(PackedStringArray, String, push_back);
- VCALL_PARRMEM1(PackedStringArray, String, resize);
- VCALL_PARRMEM2R(PackedStringArray, String, insert);
- VCALL_PARRMEM1(PackedStringArray, String, remove);
- VCALL_PARRMEM1(PackedStringArray, String, append);
- VCALL_PARRMEM1(PackedStringArray, String, append_array);
- VCALL_PARRMEM1R(PackedStringArray, String, has);
- VCALL_PARRMEM0(PackedStringArray, String, sort);
- VCALL_PARRMEM0(PackedStringArray, String, invert);
-
- VCALL_PARRMEM0R(PackedVector2Array, Vector2, size);
- VCALL_PARRMEM0R(PackedVector2Array, Vector2, empty);
- VCALL_PARRMEM2(PackedVector2Array, Vector2, set);
- VCALL_PARRMEM1R(PackedVector2Array, Vector2, get);
- VCALL_PARRMEM1(PackedVector2Array, Vector2, push_back);
- VCALL_PARRMEM1(PackedVector2Array, Vector2, resize);
- VCALL_PARRMEM2R(PackedVector2Array, Vector2, insert);
- VCALL_PARRMEM1(PackedVector2Array, Vector2, remove);
- VCALL_PARRMEM1(PackedVector2Array, Vector2, append);
- VCALL_PARRMEM1(PackedVector2Array, Vector2, append_array);
- VCALL_PARRMEM1R(PackedVector2Array, Vector2, has);
- VCALL_PARRMEM0(PackedVector2Array, Vector2, sort);
- VCALL_PARRMEM0(PackedVector2Array, Vector2, invert);
-
- VCALL_PARRMEM0R(PackedVector3Array, Vector3, size);
- VCALL_PARRMEM0R(PackedVector3Array, Vector3, empty);
- VCALL_PARRMEM2(PackedVector3Array, Vector3, set);
- VCALL_PARRMEM1R(PackedVector3Array, Vector3, get);
- VCALL_PARRMEM1(PackedVector3Array, Vector3, push_back);
- VCALL_PARRMEM1(PackedVector3Array, Vector3, resize);
- VCALL_PARRMEM2R(PackedVector3Array, Vector3, insert);
- VCALL_PARRMEM1(PackedVector3Array, Vector3, remove);
- VCALL_PARRMEM1(PackedVector3Array, Vector3, append);
- VCALL_PARRMEM1(PackedVector3Array, Vector3, append_array);
- VCALL_PARRMEM1R(PackedVector3Array, Vector3, has);
- VCALL_PARRMEM0(PackedVector3Array, Vector3, sort);
- VCALL_PARRMEM0(PackedVector3Array, Vector3, invert);
-
- VCALL_PARRMEM0R(PackedColorArray, Color, size);
- VCALL_PARRMEM0R(PackedColorArray, Color, empty);
- VCALL_PARRMEM2(PackedColorArray, Color, set);
- VCALL_PARRMEM1R(PackedColorArray, Color, get);
- VCALL_PARRMEM1(PackedColorArray, Color, push_back);
- VCALL_PARRMEM1(PackedColorArray, Color, resize);
- VCALL_PARRMEM2R(PackedColorArray, Color, insert);
- VCALL_PARRMEM1(PackedColorArray, Color, remove);
- VCALL_PARRMEM1(PackedColorArray, Color, append);
- VCALL_PARRMEM1(PackedColorArray, Color, append_array);
- VCALL_PARRMEM1R(PackedColorArray, Color, has);
- VCALL_PARRMEM0(PackedColorArray, Color, sort);
- VCALL_PARRMEM0(PackedColorArray, Color, invert);
-
-#define VCALL_PTR0(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(); }
-#define VCALL_PTR0R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(); }
-#define VCALL_PTR1(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0]); }
-#define VCALL_PTR1R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0]); }
-#define VCALL_PTR2(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_PTR2R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1]); }
-#define VCALL_PTR3(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_PTR3R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2]); }
-#define VCALL_PTR4(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_PTR4R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3]); }
-#define VCALL_PTR5(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-#define VCALL_PTR5R(m_type, m_method) \
- static void _call_##m_type##_##m_method(Variant &r_ret, Variant &p_self, const Variant **p_args) { r_ret = reinterpret_cast<m_type *>(p_self._data._ptr)->m_method(*p_args[0], *p_args[1], *p_args[2], *p_args[3], *p_args[4]); }
-
- VCALL_PTR0R(AABB, abs);
- VCALL_PTR0R(AABB, get_area);
- VCALL_PTR0R(AABB, has_no_area);
- VCALL_PTR0R(AABB, has_no_surface);
- VCALL_PTR1R(AABB, has_point);
- VCALL_PTR1R(AABB, is_equal_approx);
- VCALL_PTR1R(AABB, intersects);
- VCALL_PTR1R(AABB, encloses);
- VCALL_PTR1R(AABB, intersects_plane);
- VCALL_PTR2R(AABB, intersects_segment);
- VCALL_PTR1R(AABB, intersection);
- VCALL_PTR1R(AABB, merge);
- VCALL_PTR1R(AABB, expand);
- VCALL_PTR1R(AABB, grow);
- VCALL_PTR1R(AABB, get_support);
- VCALL_PTR0R(AABB, get_longest_axis);
- VCALL_PTR0R(AABB, get_longest_axis_index);
- VCALL_PTR0R(AABB, get_longest_axis_size);
- VCALL_PTR0R(AABB, get_shortest_axis);
- VCALL_PTR0R(AABB, get_shortest_axis_index);
- VCALL_PTR0R(AABB, get_shortest_axis_size);
- VCALL_PTR1R(AABB, get_endpoint);
-
- VCALL_PTR0R(Transform2D, inverse);
- VCALL_PTR0R(Transform2D, affine_inverse);
- VCALL_PTR0R(Transform2D, get_rotation);
- VCALL_PTR0R(Transform2D, get_origin);
- VCALL_PTR0R(Transform2D, get_scale);
- VCALL_PTR0R(Transform2D, orthonormalized);
- VCALL_PTR1R(Transform2D, rotated);
- VCALL_PTR1R(Transform2D, scaled);
- VCALL_PTR1R(Transform2D, translated);
- VCALL_PTR2R(Transform2D, interpolate_with);
- VCALL_PTR1R(Transform2D, is_equal_approx);
-
- static void _call_Transform2D_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator Vector2());
- return;
- case Variant::RECT2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator Rect2());
- return;
- case Variant::PACKED_VECTOR2_ARRAY:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform(p_args[0]->operator PackedVector2Array());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'xform' in base 'Transform2D'. Valid types are Vector2, Rect2, and PackedVector2Array.");
+ static String func_PackedByteArray_hex_encode(PackedByteArray *p_instance) {
+ if (p_instance->size() == 0) {
+ return String();
}
+ const uint8_t *r = p_instance->ptr();
+ String s = String::hex_encode_buffer(&r[0], p_instance->size());
+ return s;
}
- static void _call_Transform2D_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Vector2());
- return;
- case Variant::RECT2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Rect2());
- return;
- case Variant::PACKED_VECTOR2_ARRAY:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->xform_inv(p_args[0]->operator PackedVector2Array());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'xform_inv' in base 'Transform2D'. Valid types are Vector2, Rect2, and PackedVector2Array.");
- }
+ static void func_Callable_call(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v);
+ callable->call(p_args, p_argcount, r_ret, r_error);
}
- static void _call_Transform2D_basis_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->basis_xform(p_args[0]->operator Vector2());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'basis_xform' in base 'Transform2D'. Only Vector2 is valid.");
- }
+ static void func_Callable_call_deferred(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v);
+ callable->call_deferred(p_args, p_argcount);
}
- static void _call_Transform2D_basis_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR2:
- r_ret = reinterpret_cast<Transform2D *>(p_self._data._ptr)->basis_xform_inv(p_args[0]->operator Vector2());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'basis_xform_inv' in base 'Transform2D'. Only Vector2 is valid.");
- }
- }
-
- VCALL_PTR0R(Basis, inverse);
- VCALL_PTR0R(Basis, transposed);
- VCALL_PTR0R(Basis, determinant);
- VCALL_PTR2R(Basis, rotated);
- VCALL_PTR1R(Basis, scaled);
- VCALL_PTR0R(Basis, get_scale);
- VCALL_PTR0R(Basis, get_euler);
- VCALL_PTR0R(Basis, get_euler_xyz);
- VCALL_PTR1(Basis, set_euler_xyz);
- VCALL_PTR0R(Basis, get_euler_xzy);
- VCALL_PTR1(Basis, set_euler_xzy);
- VCALL_PTR0R(Basis, get_euler_yzx);
- VCALL_PTR1(Basis, set_euler_yzx);
- VCALL_PTR0R(Basis, get_euler_yxz);
- VCALL_PTR1(Basis, set_euler_yxz);
- VCALL_PTR0R(Basis, get_euler_zxy);
- VCALL_PTR1(Basis, set_euler_zxy);
- VCALL_PTR0R(Basis, get_euler_zyx);
- VCALL_PTR1(Basis, set_euler_zyx);
- VCALL_PTR1R(Basis, tdotx);
- VCALL_PTR1R(Basis, tdoty);
- VCALL_PTR1R(Basis, tdotz);
- VCALL_PTR1R(Basis, xform);
- VCALL_PTR1R(Basis, xform_inv);
- VCALL_PTR0R(Basis, get_orthogonal_index);
- VCALL_PTR0R(Basis, orthonormalized);
- VCALL_PTR2R(Basis, slerp);
- VCALL_PTR1R(Basis, is_equal_approx);
- VCALL_PTR0R(Basis, get_rotation_quat);
-
- VCALL_PTR0R(Transform, inverse);
- VCALL_PTR0R(Transform, affine_inverse);
- VCALL_PTR2R(Transform, rotated);
- VCALL_PTR1R(Transform, scaled);
- VCALL_PTR1R(Transform, translated);
- VCALL_PTR0R(Transform, orthonormalized);
- VCALL_PTR2R(Transform, looking_at);
- VCALL_PTR2R(Transform, interpolate_with);
- VCALL_PTR1R(Transform, is_equal_approx);
-
- static void _call_Transform_xform(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR3:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator Vector3());
- return;
- case Variant::PLANE:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator Plane());
- return;
- case Variant::AABB:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator ::AABB());
- return;
- case Variant::PACKED_VECTOR3_ARRAY:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform(p_args[0]->operator ::PackedVector3Array());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'xform' in base 'Transform'. Valid types are Vector3, Plane, AABB, and PackedVector3Array.");
- }
+ static void func_Callable_bind(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ Callable *callable = VariantGetInternalPtr<Callable>::get_ptr(v);
+ r_ret = callable->bind(p_args, p_argcount);
}
- static void _call_Transform_xform_inv(Variant &r_ret, Variant &p_self, const Variant **p_args) {
- switch (p_args[0]->type) {
- case Variant::VECTOR3:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Vector3());
- return;
- case Variant::PLANE:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator Plane());
- return;
- case Variant::AABB:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator ::AABB());
- return;
- case Variant::PACKED_VECTOR3_ARRAY:
- r_ret = reinterpret_cast<Transform *>(p_self._data._ptr)->xform_inv(p_args[0]->operator ::PackedVector3Array());
- return;
- default:
- r_ret = Variant();
- ERR_PRINT("Invalid type in function 'xform_inv' in base 'Transform'. Valid types are Vector3, Plane, AABB, and PackedVector3Array.");
- }
+ static void func_Signal_emit(Variant *v, const Variant **p_args, int p_argcount, Variant &r_ret, Callable::CallError &r_error) {
+ Signal *signal = VariantGetInternalPtr<Signal>::get_ptr(v);
+ signal->emit(p_args, p_argcount);
}
struct ConstructData {
@@ -1300,9 +873,10 @@ struct _VariantCall {
}
};
-_VariantCall::TypeFunc *_VariantCall::type_funcs = nullptr;
_VariantCall::ConstructFunc *_VariantCall::construct_funcs = nullptr;
_VariantCall::ConstantData *_VariantCall::constant_data = nullptr;
+_VariantCall::MethodMap *_VariantCall::type_internal_methods = nullptr;
+List<StringName> *_VariantCall::type_internal_method_names = nullptr;
Variant Variant::call(const StringName &p_method, const Variant **p_args, int p_argcount, Callable::CallError &r_error) {
Variant ret;
@@ -1334,38 +908,14 @@ void Variant::call_ptr(const StringName &p_method, const Variant **p_args, int p
} else {
r_error.error = Callable::CallError::CALL_OK;
- Map<StringName, _VariantCall::FuncData>::Element *E = _VariantCall::type_funcs[type].functions.find(p_method);
-
- if (E) {
- _VariantCall::FuncData &funcdata = E->get();
- funcdata.call(ret, *this, p_args, p_argcount, r_error);
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[type].lookup_ptr(p_method);
+ if (m) {
+ (*m)->call((Variant *)this, p_args, p_argcount, ret, r_error);
} else {
- //handle vararg functions manually
- bool valid = false;
- if (type == CALLABLE) {
- if (p_method == CoreStringNames::get_singleton()->call) {
- reinterpret_cast<const Callable *>(_data._mem)->call(p_args, p_argcount, ret, r_error);
- valid = true;
- }
- if (p_method == CoreStringNames::get_singleton()->call_deferred) {
- reinterpret_cast<const Callable *>(_data._mem)->call_deferred(p_args, p_argcount);
- valid = true;
- }
- } else if (type == SIGNAL) {
- if (p_method == CoreStringNames::get_singleton()->emit) {
- if (r_ret) {
- *r_ret = Variant();
- }
- reinterpret_cast<const Signal *>(_data._mem)->emit(p_args, p_argcount);
- valid = true;
- }
- }
- if (!valid) {
- //ok fail because not found
- r_error.error = Callable::CallError::CALL_ERROR_INVALID_METHOD;
- return;
- }
+ //ok fail because not found
+ r_error.error = Callable::CallError::CALL_ERROR_INVALID_METHOD;
+ return;
}
}
@@ -1593,126 +1143,96 @@ bool Variant::has_method(const StringName &p_method) const {
return obj->has_method(p_method);
}
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[type];
- return tf.functions.has(p_method);
+ return _VariantCall::type_internal_methods[type].has(p_method);
}
Vector<Variant::Type> Variant::get_method_argument_types(Variant::Type p_type, const StringName &p_method) {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type];
+ Vector<Variant::Type> types;
- const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method);
- if (!E) {
- return Vector<Variant::Type>();
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method);
+ if (*m) {
+ types.resize((*m)->get_argument_count());
+ for (int i = 0; i < (*m)->get_argument_count(); i++) {
+ types.write[i] = (*m)->get_argument_type(i);
+ }
}
- return E->get().arg_types;
+ return types;
}
bool Variant::is_method_const(Variant::Type p_type, const StringName &p_method) {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type];
-
- const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method);
- if (!E) {
- return false;
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method);
+ if (*m) {
+ return (*m)->get_flags() & Variant::InternalMethod::FLAG_IS_CONST;
}
-
- return E->get()._const;
+ return false;
}
Vector<StringName> Variant::get_method_argument_names(Variant::Type p_type, const StringName &p_method) {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type];
+ Vector<StringName> argnames;
- const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method);
- if (!E) {
- return Vector<StringName>();
+#ifdef DEBUG_ENABLED
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method);
+ if (*m) {
+ argnames.resize((*m)->get_argument_count());
+ for (int i = 0; i < (*m)->get_argument_count(); i++) {
+ argnames.write[i] = (*m)->get_argument_name(i);
+ }
}
-
- return E->get().arg_names;
+#endif
+ return argnames;
}
Variant::Type Variant::get_method_return_type(Variant::Type p_type, const StringName &p_method, bool *r_has_return) {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type];
-
- const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method);
- if (!E) {
- return Variant::NIL;
- }
-
- if (r_has_return) {
- *r_has_return = E->get().returns;
+ Variant::Type rt = Variant::NIL;
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method);
+ if (*m) {
+ rt = (*m)->get_return_type();
+ if (r_has_return) {
+ *r_has_return = ((*m)->get_flags() & Variant::InternalMethod::FLAG_RETURNS_VARIANT) || rt != Variant::NIL;
+ }
}
-
- return E->get().return_type;
+ return rt;
}
Vector<Variant> Variant::get_method_default_arguments(Variant::Type p_type, const StringName &p_method) {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[p_type];
-
- const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.find(p_method);
- if (!E) {
- return Vector<Variant>();
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method);
+ if (*m) {
+ return (*m)->get_default_arguments();
}
-
- return E->get().default_args;
+ return Vector<Variant>();
}
void Variant::get_method_list(List<MethodInfo> *p_list) const {
- const _VariantCall::TypeFunc &tf = _VariantCall::type_funcs[type];
-
- for (const Map<StringName, _VariantCall::FuncData>::Element *E = tf.functions.front(); E; E = E->next()) {
- const _VariantCall::FuncData &fd = E->get();
+ for (List<StringName>::Element *E = _VariantCall::type_internal_method_names[type].front(); E; E = E->next()) {
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[type].lookup_ptr(E->get());
+ ERR_CONTINUE(!*m);
MethodInfo mi;
- mi.name = E->key();
-
- if (fd._const) {
+ mi.name = E->get();
+ mi.return_val.type = (*m)->get_return_type();
+ if ((*m)->get_flags() & Variant::InternalMethod::FLAG_RETURNS_VARIANT) {
+ mi.return_val.usage |= PROPERTY_USAGE_NIL_IS_VARIANT;
+ }
+ if ((*m)->get_flags() & Variant::InternalMethod::FLAG_IS_CONST) {
mi.flags |= METHOD_FLAG_CONST;
}
-
- for (int i = 0; i < fd.arg_types.size(); i++) {
- PropertyInfo pi;
- pi.type = fd.arg_types[i];
-#ifdef DEBUG_ENABLED
- pi.name = fd.arg_names[i];
-#endif
- mi.arguments.push_back(pi);
+ if ((*m)->get_flags() & Variant::InternalMethod::FLAG_VARARGS) {
+ mi.flags |= METHOD_FLAG_VARARG;
}
- mi.default_arguments = fd.default_args;
- PropertyInfo ret;
+ for (int i = 0; i < (*m)->get_argument_count(); i++) {
+ PropertyInfo arg;
#ifdef DEBUG_ENABLED
- ret.type = fd.return_type;
- if (fd.returns) {
- ret.name = "ret";
- if (fd.return_type == Variant::NIL) {
- ret.usage = PROPERTY_USAGE_NIL_IS_VARIANT;
- }
- }
- mi.return_val = ret;
+ arg.name = (*m)->get_argument_name(i);
+#else
+ arg.name = "arg" + itos(i + 1);
#endif
+ arg.type = (*m)->get_argument_type(i);
+ mi.arguments.push_back(arg);
+ }
- p_list->push_back(mi);
- }
-
- if (type == CALLABLE) {
- MethodInfo mi;
- mi.name = "call";
- mi.return_val.usage = PROPERTY_USAGE_NIL_IS_VARIANT;
- mi.flags |= METHOD_FLAG_VARARG;
-
- p_list->push_back(mi);
-
- mi.name = "call_deferred";
- mi.return_val.usage = 0;
-
- p_list->push_back(mi);
- }
-
- if (type == SIGNAL) {
- MethodInfo mi;
- mi.name = "emit";
- mi.flags |= METHOD_FLAG_VARARG;
-
+ mi.default_arguments = (*m)->get_default_arguments();
p_list->push_back(mi);
}
}
@@ -1811,565 +1331,620 @@ Variant Variant::get_constant_value(Variant::Type p_type, const StringName &p_va
return E->get();
}
-void register_variant_methods() {
- _VariantCall::type_funcs = memnew_arr(_VariantCall::TypeFunc, Variant::VARIANT_MAX);
+Variant::InternalMethod *Variant::get_internal_method(Type p_type, const StringName &p_method_name) {
+ ERR_FAIL_INDEX_V(p_type, VARIANT_MAX, nullptr);
+
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[p_type].lookup_ptr(p_method_name);
+ if (*m) {
+ return *m;
+ }
+ return nullptr;
+}
+void register_variant_methods() {
+ _VariantCall::type_internal_methods = memnew_arr(_VariantCall::MethodMap, Variant::VARIANT_MAX);
+ _VariantCall::type_internal_method_names = memnew_arr(List<StringName>, Variant::VARIANT_MAX);
_VariantCall::construct_funcs = memnew_arr(_VariantCall::ConstructFunc, Variant::VARIANT_MAX);
_VariantCall::constant_data = memnew_arr(_VariantCall::ConstantData, Variant::VARIANT_MAX);
-#define ADDFUNC0R(m_vtype, m_ret, m_class, m_method, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg);
-#define ADDFUNC1R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)));
-#define ADDFUNC2R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)));
-#define ADDFUNC3R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)));
-#define ADDFUNC4R(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4)));
-
-#define ADDFUNC0RNC(m_vtype, m_ret, m_class, m_method, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg);
-#define ADDFUNC1RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)));
-#define ADDFUNC2RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)));
-#define ADDFUNC3RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)));
-#define ADDFUNC4RNC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, true, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4)));
-
-#define ADDFUNC0(m_vtype, m_ret, m_class, m_method, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg);
-#define ADDFUNC1(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)));
-#define ADDFUNC2(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)));
-#define ADDFUNC3(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)));
-#define ADDFUNC4(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \
- _VariantCall::addfunc(true, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4)));
-
-#define ADDFUNC0NC(m_vtype, m_ret, m_class, m_method, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg);
-#define ADDFUNC1NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)));
-#define ADDFUNC2NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)));
-#define ADDFUNC3NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)));
-#define ADDFUNC4NC(m_vtype, m_ret, m_class, m_method, m_arg1, m_argname1, m_arg2, m_argname2, m_arg3, m_argname3, m_arg4, m_argname4, m_defarg) \
- _VariantCall::addfunc(false, Variant::m_vtype, Variant::m_ret, false, _scs_create(#m_method), VCALL(m_class, m_method), m_defarg, _VariantCall::Arg(Variant::m_arg1, _scs_create(m_argname1)), _VariantCall::Arg(Variant::m_arg2, _scs_create(m_argname2)), _VariantCall::Arg(Variant::m_arg3, _scs_create(m_argname3)), _VariantCall::Arg(Variant::m_arg4, _scs_create(m_argname4)));
-
/* STRING */
- ADDFUNC1R(STRING, INT, String, casecmp_to, STRING, "to", varray());
- ADDFUNC1R(STRING, INT, String, nocasecmp_to, STRING, "to", varray());
- ADDFUNC1R(STRING, INT, String, naturalnocasecmp_to, STRING, "to", varray());
- ADDFUNC0R(STRING, INT, String, length, varray());
- ADDFUNC2R(STRING, STRING, String, substr, INT, "from", INT, "len", varray(-1));
-
- ADDFUNC2R(STRING, INT, String, find, STRING, "what", INT, "from", varray(0));
-
- ADDFUNC3R(STRING, INT, String, count, STRING, "what", INT, "from", INT, "to", varray(0, 0));
- ADDFUNC3R(STRING, INT, String, countn, STRING, "what", INT, "from", INT, "to", varray(0, 0));
-
- ADDFUNC2R(STRING, INT, String, findn, STRING, "what", INT, "from", varray(0));
- ADDFUNC2R(STRING, INT, String, rfind, STRING, "what", INT, "from", varray(-1));
- ADDFUNC2R(STRING, INT, String, rfindn, STRING, "what", INT, "from", varray(-1));
- ADDFUNC1R(STRING, BOOL, String, match, STRING, "expr", varray());
- ADDFUNC1R(STRING, BOOL, String, matchn, STRING, "expr", varray());
- ADDFUNC1R(STRING, BOOL, String, begins_with, STRING, "text", varray());
- ADDFUNC1R(STRING, BOOL, String, ends_with, STRING, "text", varray());
- ADDFUNC1R(STRING, BOOL, String, is_subsequence_of, STRING, "text", varray());
- ADDFUNC1R(STRING, BOOL, String, is_subsequence_ofi, STRING, "text", varray());
- ADDFUNC0R(STRING, PACKED_STRING_ARRAY, String, bigrams, varray());
- ADDFUNC1R(STRING, FLOAT, String, similarity, STRING, "text", varray());
-
- ADDFUNC2R(STRING, STRING, String, format, NIL, "values", STRING, "placeholder", varray("{_}"));
- ADDFUNC2R(STRING, STRING, String, replace, STRING, "what", STRING, "forwhat", varray());
- ADDFUNC2R(STRING, STRING, String, replacen, STRING, "what", STRING, "forwhat", varray());
- ADDFUNC1R(STRING, STRING, String, repeat, INT, "count", varray());
- ADDFUNC2R(STRING, STRING, String, insert, INT, "position", STRING, "what", varray());
- ADDFUNC0R(STRING, STRING, String, capitalize, varray());
- ADDFUNC3R(STRING, PACKED_STRING_ARRAY, String, split, STRING, "delimiter", BOOL, "allow_empty", INT, "maxsplit", varray(true, 0));
- ADDFUNC3R(STRING, PACKED_STRING_ARRAY, String, rsplit, STRING, "delimiter", BOOL, "allow_empty", INT, "maxsplit", varray(true, 0));
- ADDFUNC2R(STRING, PACKED_FLOAT32_ARRAY, String, split_floats, STRING, "delimiter", BOOL, "allow_empty", varray(true));
- ADDFUNC1R(STRING, STRING, String, join, PACKED_STRING_ARRAY, "parts", varray());
-
- ADDFUNC0R(STRING, STRING, String, to_upper, varray());
- ADDFUNC0R(STRING, STRING, String, to_lower, varray());
-
- ADDFUNC1R(STRING, STRING, String, left, INT, "position", varray());
- ADDFUNC1R(STRING, STRING, String, right, INT, "position", varray());
- ADDFUNC2R(STRING, STRING, String, strip_edges, BOOL, "left", BOOL, "right", varray(true, true));
- ADDFUNC0R(STRING, STRING, String, strip_escapes, varray());
- ADDFUNC1R(STRING, STRING, String, lstrip, STRING, "chars", varray());
- ADDFUNC1R(STRING, STRING, String, rstrip, STRING, "chars", varray());
- ADDFUNC0R(STRING, STRING, String, get_extension, varray());
- ADDFUNC0R(STRING, STRING, String, get_basename, varray());
- ADDFUNC1R(STRING, STRING, String, plus_file, STRING, "file", varray());
- ADDFUNC1R(STRING, INT, String, ord_at, INT, "at", varray());
- ADDFUNC0R(STRING, STRING, String, dedent, varray());
- ADDFUNC2(STRING, NIL, String, erase, INT, "position", INT, "chars", varray());
- ADDFUNC0R(STRING, INT, String, hash, varray());
- ADDFUNC0R(STRING, STRING, String, md5_text, varray());
- ADDFUNC0R(STRING, STRING, String, sha1_text, varray());
- ADDFUNC0R(STRING, STRING, String, sha256_text, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, md5_buffer, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, sha1_buffer, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, sha256_buffer, varray());
- ADDFUNC0R(STRING, BOOL, String, empty, varray());
- ADDFUNC1R(STRING, STRING, String, humanize_size, INT, "size", varray());
- ADDFUNC0R(STRING, BOOL, String, is_abs_path, varray());
- ADDFUNC0R(STRING, BOOL, String, is_rel_path, varray());
- ADDFUNC0R(STRING, STRING, String, get_base_dir, varray());
- ADDFUNC0R(STRING, STRING, String, get_file, varray());
- ADDFUNC0R(STRING, STRING, String, xml_escape, varray());
- ADDFUNC0R(STRING, STRING, String, xml_unescape, varray());
- ADDFUNC0R(STRING, STRING, String, http_escape, varray());
- ADDFUNC0R(STRING, STRING, String, http_unescape, varray());
- ADDFUNC0R(STRING, STRING, String, c_escape, varray());
- ADDFUNC0R(STRING, STRING, String, c_unescape, varray());
- ADDFUNC0R(STRING, STRING, String, json_escape, varray());
- ADDFUNC0R(STRING, STRING, String, percent_encode, varray());
- ADDFUNC0R(STRING, STRING, String, percent_decode, varray());
- ADDFUNC0R(STRING, BOOL, String, is_valid_identifier, varray());
- ADDFUNC0R(STRING, BOOL, String, is_valid_integer, varray());
- ADDFUNC0R(STRING, BOOL, String, is_valid_float, varray());
- ADDFUNC1R(STRING, BOOL, String, is_valid_hex_number, BOOL, "with_prefix", varray(false));
- ADDFUNC0R(STRING, BOOL, String, is_valid_html_color, varray());
- ADDFUNC0R(STRING, BOOL, String, is_valid_ip_address, varray());
- ADDFUNC0R(STRING, BOOL, String, is_valid_filename, varray());
- ADDFUNC0R(STRING, INT, String, to_int, varray());
- ADDFUNC0R(STRING, FLOAT, String, to_float, varray());
- ADDFUNC0R(STRING, INT, String, hex_to_int, varray());
- ADDFUNC2R(STRING, STRING, String, lpad, INT, "min_length", STRING, "character", varray(" "));
- ADDFUNC2R(STRING, STRING, String, rpad, INT, "min_length", STRING, "character", varray(" "));
- ADDFUNC1R(STRING, STRING, String, pad_decimals, INT, "digits", varray());
- ADDFUNC1R(STRING, STRING, String, pad_zeros, INT, "digits", varray());
- ADDFUNC1R(STRING, STRING, String, trim_prefix, STRING, "prefix", varray());
- ADDFUNC1R(STRING, STRING, String, trim_suffix, STRING, "suffix", varray());
-
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_ascii, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf8, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf16, varray());
- ADDFUNC0R(STRING, PACKED_BYTE_ARRAY, String, to_utf32, varray());
-
- ADDFUNC0R(VECTOR2, FLOAT, Vector2, angle, varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, angle_to, VECTOR2, "to", varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, angle_to_point, VECTOR2, "to", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, direction_to, VECTOR2, "b", varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, distance_to, VECTOR2, "to", varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, distance_squared_to, VECTOR2, "to", varray());
- ADDFUNC0R(VECTOR2, FLOAT, Vector2, length, varray());
- ADDFUNC0R(VECTOR2, FLOAT, Vector2, length_squared, varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, normalized, varray());
- ADDFUNC0R(VECTOR2, BOOL, Vector2, is_normalized, varray());
- ADDFUNC1R(VECTOR2, BOOL, Vector2, is_equal_approx, VECTOR2, "v", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, posmod, FLOAT, "mod", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, posmodv, VECTOR2, "modv", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, project, VECTOR2, "b", varray());
- ADDFUNC2R(VECTOR2, VECTOR2, Vector2, lerp, VECTOR2, "b", FLOAT, "t", varray());
- ADDFUNC2R(VECTOR2, VECTOR2, Vector2, slerp, VECTOR2, "b", FLOAT, "t", varray());
- ADDFUNC4R(VECTOR2, VECTOR2, Vector2, cubic_interpolate, VECTOR2, "b", VECTOR2, "pre_a", VECTOR2, "post_b", FLOAT, "t", varray());
- ADDFUNC2R(VECTOR2, VECTOR2, Vector2, move_toward, VECTOR2, "to", FLOAT, "delta", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, rotated, FLOAT, "phi", varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, tangent, varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, floor, varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, ceil, varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, round, varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, snapped, VECTOR2, "by", varray());
- ADDFUNC0R(VECTOR2, FLOAT, Vector2, aspect, varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, dot, VECTOR2, "with", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, slide, VECTOR2, "n", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, bounce, VECTOR2, "n", varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, reflect, VECTOR2, "n", varray());
- ADDFUNC1R(VECTOR2, FLOAT, Vector2, cross, VECTOR2, "with", varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, abs, varray());
- ADDFUNC1R(VECTOR2, VECTOR2, Vector2, clamped, FLOAT, "length", varray());
- ADDFUNC0R(VECTOR2, VECTOR2, Vector2, sign, varray());
-
- ADDFUNC0R(VECTOR2I, FLOAT, Vector2i, aspect, varray());
- ADDFUNC0R(VECTOR2I, VECTOR2I, Vector2i, sign, varray());
- ADDFUNC0R(VECTOR2I, VECTOR2I, Vector2i, abs, varray());
-
- ADDFUNC0R(RECT2, FLOAT, Rect2, get_area, varray());
- ADDFUNC0R(RECT2, BOOL, Rect2, has_no_area, varray());
- ADDFUNC1R(RECT2, BOOL, Rect2, has_point, VECTOR2, "point", varray());
- ADDFUNC1R(RECT2, BOOL, Rect2, is_equal_approx, RECT2, "rect", varray());
- ADDFUNC2R(RECT2, BOOL, Rect2, intersects, RECT2, "b", BOOL, "include_borders", varray(false));
- ADDFUNC1R(RECT2, BOOL, Rect2, encloses, RECT2, "b", varray());
- ADDFUNC1R(RECT2, RECT2, Rect2, clip, RECT2, "b", varray());
- ADDFUNC1R(RECT2, RECT2, Rect2, merge, RECT2, "b", varray());
- ADDFUNC1R(RECT2, RECT2, Rect2, expand, VECTOR2, "to", varray());
- ADDFUNC1R(RECT2, RECT2, Rect2, grow, FLOAT, "by", varray());
- ADDFUNC2R(RECT2, RECT2, Rect2, grow_margin, INT, "margin", FLOAT, "by", varray());
- ADDFUNC4R(RECT2, RECT2, Rect2, grow_individual, FLOAT, "left", FLOAT, "top", FLOAT, "right", FLOAT, " bottom", varray());
- ADDFUNC0R(RECT2, RECT2, Rect2, abs, varray());
-
- ADDFUNC0R(RECT2I, INT, Rect2i, get_area, varray());
- ADDFUNC0R(RECT2I, BOOL, Rect2i, has_no_area, varray());
- ADDFUNC1R(RECT2I, BOOL, Rect2i, has_point, VECTOR2I, "point", varray());
- ADDFUNC1R(RECT2I, BOOL, Rect2i, intersects, RECT2I, "b", varray());
- ADDFUNC1R(RECT2I, BOOL, Rect2i, encloses, RECT2I, "b", varray());
- ADDFUNC1R(RECT2I, RECT2I, Rect2i, clip, RECT2I, "b", varray());
- ADDFUNC1R(RECT2I, RECT2I, Rect2i, merge, RECT2I, "b", varray());
- ADDFUNC1R(RECT2I, RECT2I, Rect2i, expand, VECTOR2I, "to", varray());
- ADDFUNC1R(RECT2I, RECT2I, Rect2i, grow, INT, "by", varray());
- ADDFUNC2R(RECT2I, RECT2I, Rect2i, grow_margin, INT, "margin", INT, "by", varray());
- ADDFUNC4R(RECT2I, RECT2I, Rect2i, grow_individual, INT, "left", INT, "top", INT, "right", INT, " bottom", varray());
- ADDFUNC0R(RECT2I, RECT2I, Rect2i, abs, varray());
-
- ADDFUNC0R(VECTOR3, INT, Vector3, min_axis, varray());
- ADDFUNC0R(VECTOR3, INT, Vector3, max_axis, varray());
- ADDFUNC1R(VECTOR3, FLOAT, Vector3, angle_to, VECTOR3, "to", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, direction_to, VECTOR3, "b", varray());
- ADDFUNC1R(VECTOR3, FLOAT, Vector3, distance_to, VECTOR3, "b", varray());
- ADDFUNC1R(VECTOR3, FLOAT, Vector3, distance_squared_to, VECTOR3, "b", varray());
- ADDFUNC0R(VECTOR3, FLOAT, Vector3, length, varray());
- ADDFUNC0R(VECTOR3, FLOAT, Vector3, length_squared, varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, normalized, varray());
- ADDFUNC0R(VECTOR3, BOOL, Vector3, is_normalized, varray());
- ADDFUNC1R(VECTOR3, BOOL, Vector3, is_equal_approx, VECTOR3, "v", varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, inverse, varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, snapped, VECTOR3, "by", varray());
- ADDFUNC2R(VECTOR3, VECTOR3, Vector3, rotated, VECTOR3, "axis", FLOAT, "phi", varray());
- ADDFUNC2R(VECTOR3, VECTOR3, Vector3, lerp, VECTOR3, "b", FLOAT, "t", varray());
- ADDFUNC2R(VECTOR3, VECTOR3, Vector3, slerp, VECTOR3, "b", FLOAT, "t", varray());
- ADDFUNC4R(VECTOR3, VECTOR3, Vector3, cubic_interpolate, VECTOR3, "b", VECTOR3, "pre_a", VECTOR3, "post_b", FLOAT, "t", varray());
- ADDFUNC2R(VECTOR3, VECTOR3, Vector3, move_toward, VECTOR3, "to", FLOAT, "delta", varray());
- ADDFUNC1R(VECTOR3, FLOAT, Vector3, dot, VECTOR3, "b", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, cross, VECTOR3, "b", varray());
- ADDFUNC1R(VECTOR3, BASIS, Vector3, outer, VECTOR3, "b", varray());
- ADDFUNC0R(VECTOR3, BASIS, Vector3, to_diagonal_matrix, varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, abs, varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, floor, varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, ceil, varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, round, varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, posmod, FLOAT, "mod", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, posmodv, VECTOR3, "modv", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, project, VECTOR3, "b", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, slide, VECTOR3, "n", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, bounce, VECTOR3, "n", varray());
- ADDFUNC1R(VECTOR3, VECTOR3, Vector3, reflect, VECTOR3, "n", varray());
- ADDFUNC0R(VECTOR3, VECTOR3, Vector3, sign, varray());
-
- ADDFUNC0R(VECTOR3I, INT, Vector3i, min_axis, varray());
- ADDFUNC0R(VECTOR3I, INT, Vector3i, max_axis, varray());
- ADDFUNC0R(VECTOR3I, VECTOR3I, Vector3i, sign, varray());
-
- ADDFUNC0R(PLANE, PLANE, Plane, normalized, varray());
- ADDFUNC0R(PLANE, VECTOR3, Plane, center, varray());
- ADDFUNC1R(PLANE, BOOL, Plane, is_equal_approx, PLANE, "plane", varray());
- ADDFUNC1R(PLANE, BOOL, Plane, is_point_over, VECTOR3, "point", varray());
- ADDFUNC1R(PLANE, FLOAT, Plane, distance_to, VECTOR3, "point", varray());
- ADDFUNC2R(PLANE, BOOL, Plane, has_point, VECTOR3, "point", FLOAT, "epsilon", varray(CMP_EPSILON));
- ADDFUNC1R(PLANE, VECTOR3, Plane, project, VECTOR3, "point", varray());
- ADDFUNC2R(PLANE, VECTOR3, Plane, intersect_3, PLANE, "b", PLANE, "c", varray());
- ADDFUNC2R(PLANE, VECTOR3, Plane, intersects_ray, VECTOR3, "from", VECTOR3, "dir", varray());
- ADDFUNC2R(PLANE, VECTOR3, Plane, intersects_segment, VECTOR3, "begin", VECTOR3, "end", varray());
-
- ADDFUNC0R(QUAT, FLOAT, Quat, length, varray());
- ADDFUNC0R(QUAT, FLOAT, Quat, length_squared, varray());
- ADDFUNC0R(QUAT, QUAT, Quat, normalized, varray());
- ADDFUNC0R(QUAT, BOOL, Quat, is_normalized, varray());
- ADDFUNC1R(QUAT, BOOL, Quat, is_equal_approx, QUAT, "quat", varray());
- ADDFUNC0R(QUAT, QUAT, Quat, inverse, varray());
- ADDFUNC1R(QUAT, FLOAT, Quat, dot, QUAT, "b", varray());
- ADDFUNC1R(QUAT, VECTOR3, Quat, xform, VECTOR3, "v", varray());
- ADDFUNC2R(QUAT, QUAT, Quat, slerp, QUAT, "b", FLOAT, "t", varray());
- ADDFUNC2R(QUAT, QUAT, Quat, slerpni, QUAT, "b", FLOAT, "t", varray());
- ADDFUNC4R(QUAT, QUAT, Quat, cubic_slerp, QUAT, "b", QUAT, "pre_a", QUAT, "post_b", FLOAT, "t", varray());
- ADDFUNC0R(QUAT, VECTOR3, Quat, get_euler, varray());
- ADDFUNC1(QUAT, NIL, Quat, set_euler, VECTOR3, "euler", varray());
- ADDFUNC2(QUAT, NIL, Quat, set_axis_angle, VECTOR3, "axis", FLOAT, "angle", varray());
-
- ADDFUNC0R(COLOR, INT, Color, to_argb32, varray());
- ADDFUNC0R(COLOR, INT, Color, to_abgr32, varray());
- ADDFUNC0R(COLOR, INT, Color, to_rgba32, varray());
- ADDFUNC0R(COLOR, INT, Color, to_argb64, varray());
- ADDFUNC0R(COLOR, INT, Color, to_abgr64, varray());
- ADDFUNC0R(COLOR, INT, Color, to_rgba64, varray());
- ADDFUNC0R(COLOR, COLOR, Color, inverted, varray());
- ADDFUNC0R(COLOR, COLOR, Color, contrasted, varray());
- ADDFUNC2R(COLOR, COLOR, Color, lerp, COLOR, "b", FLOAT, "t", varray());
- ADDFUNC1R(COLOR, COLOR, Color, blend, COLOR, "over", varray());
- ADDFUNC1R(COLOR, COLOR, Color, lightened, FLOAT, "amount", varray());
- ADDFUNC1R(COLOR, COLOR, Color, darkened, FLOAT, "amount", varray());
- ADDFUNC1R(COLOR, STRING, Color, to_html, BOOL, "with_alpha", varray(true));
- ADDFUNC4R(COLOR, COLOR, Color, from_hsv, FLOAT, "h", FLOAT, "s", FLOAT, "v", FLOAT, "a", varray(1.0));
- ADDFUNC1R(COLOR, BOOL, Color, is_equal_approx, COLOR, "color", varray());
-
- ADDFUNC0R(_RID, INT, RID, get_id, varray());
-
- ADDFUNC0R(NODE_PATH, BOOL, NodePath, is_absolute, varray());
- ADDFUNC0R(NODE_PATH, INT, NodePath, get_name_count, varray());
- ADDFUNC1R(NODE_PATH, STRING, NodePath, get_name, INT, "idx", varray());
- ADDFUNC0R(NODE_PATH, INT, NodePath, get_subname_count, varray());
- ADDFUNC1R(NODE_PATH, STRING, NodePath, get_subname, INT, "idx", varray());
- ADDFUNC0R(NODE_PATH, STRING, NodePath, get_concatenated_subnames, varray());
- ADDFUNC0R(NODE_PATH, NODE_PATH, NodePath, get_as_property_path, varray());
- ADDFUNC0R(NODE_PATH, BOOL, NodePath, is_empty, varray());
-
- ADDFUNC0R(DICTIONARY, INT, Dictionary, size, varray());
- ADDFUNC0R(DICTIONARY, BOOL, Dictionary, empty, varray());
- ADDFUNC0NC(DICTIONARY, NIL, Dictionary, clear, varray());
- ADDFUNC1R(DICTIONARY, BOOL, Dictionary, has, NIL, "key", varray());
- ADDFUNC1R(DICTIONARY, BOOL, Dictionary, has_all, ARRAY, "keys", varray());
- ADDFUNC1RNC(DICTIONARY, BOOL, Dictionary, erase, NIL, "key", varray());
- ADDFUNC0R(DICTIONARY, INT, Dictionary, hash, varray());
- ADDFUNC0R(DICTIONARY, ARRAY, Dictionary, keys, varray());
- ADDFUNC0R(DICTIONARY, ARRAY, Dictionary, values, varray());
- ADDFUNC1R(DICTIONARY, DICTIONARY, Dictionary, duplicate, BOOL, "deep", varray(false));
- ADDFUNC2R(DICTIONARY, NIL, Dictionary, get, NIL, "key", NIL, "default", varray(Variant()));
-
- ADDFUNC0R(CALLABLE, BOOL, Callable, is_null, varray());
- ADDFUNC0R(CALLABLE, BOOL, Callable, is_custom, varray());
- ADDFUNC0R(CALLABLE, BOOL, Callable, is_standard, varray());
- ADDFUNC0R(CALLABLE, OBJECT, Callable, get_object, varray());
- ADDFUNC0R(CALLABLE, INT, Callable, get_object_id, varray());
- ADDFUNC0R(CALLABLE, STRING_NAME, Callable, get_method, varray());
- ADDFUNC0R(CALLABLE, INT, Callable, hash, varray());
-
- ADDFUNC0R(SIGNAL, BOOL, Signal, is_null, varray());
- ADDFUNC0R(SIGNAL, OBJECT, Signal, get_object, varray());
- ADDFUNC0R(SIGNAL, INT, Signal, get_object_id, varray());
- ADDFUNC0R(SIGNAL, STRING_NAME, Signal, get_name, varray());
-
- ADDFUNC3R(SIGNAL, INT, Signal, connect, CALLABLE, "callable", ARRAY, "binds", INT, "flags", varray(Array(), 0));
-
- ADDFUNC1R(SIGNAL, NIL, Signal, disconnect, CALLABLE, "callable", varray());
- ADDFUNC1R(SIGNAL, BOOL, Signal, is_connected, CALLABLE, "callable", varray());
- ADDFUNC0R(SIGNAL, ARRAY, Signal, get_connections, varray());
-
- ADDFUNC0R(ARRAY, INT, Array, size, varray());
- ADDFUNC0R(ARRAY, BOOL, Array, empty, varray());
- ADDFUNC0NC(ARRAY, NIL, Array, clear, varray());
- ADDFUNC0R(ARRAY, INT, Array, hash, varray());
- ADDFUNC1NC(ARRAY, NIL, Array, push_back, NIL, "value", varray());
- ADDFUNC1NC(ARRAY, NIL, Array, push_front, NIL, "value", varray());
- ADDFUNC1NC(ARRAY, NIL, Array, append, NIL, "value", varray());
- ADDFUNC1NC(ARRAY, NIL, Array, resize, INT, "size", varray());
- ADDFUNC2NC(ARRAY, NIL, Array, insert, INT, "position", NIL, "value", varray());
- ADDFUNC1NC(ARRAY, NIL, Array, remove, INT, "position", varray());
- ADDFUNC1NC(ARRAY, NIL, Array, erase, NIL, "value", varray());
- ADDFUNC0R(ARRAY, NIL, Array, front, varray());
- ADDFUNC0R(ARRAY, NIL, Array, back, varray());
- ADDFUNC2R(ARRAY, INT, Array, find, NIL, "what", INT, "from", varray(0));
- ADDFUNC2R(ARRAY, INT, Array, rfind, NIL, "what", INT, "from", varray(-1));
- ADDFUNC1R(ARRAY, INT, Array, find_last, NIL, "value", varray());
- ADDFUNC1R(ARRAY, INT, Array, count, NIL, "value", varray());
- ADDFUNC1R(ARRAY, BOOL, Array, has, NIL, "value", varray());
- ADDFUNC0RNC(ARRAY, NIL, Array, pop_back, varray());
- ADDFUNC0RNC(ARRAY, NIL, Array, pop_front, varray());
- ADDFUNC0NC(ARRAY, NIL, Array, sort, varray());
- ADDFUNC2NC(ARRAY, NIL, Array, sort_custom, OBJECT, "obj", STRING, "func", varray());
- ADDFUNC0NC(ARRAY, NIL, Array, shuffle, varray());
- ADDFUNC2R(ARRAY, INT, Array, bsearch, NIL, "value", BOOL, "before", varray(true));
- ADDFUNC4R(ARRAY, INT, Array, bsearch_custom, NIL, "value", OBJECT, "obj", STRING, "func", BOOL, "before", varray(true));
- ADDFUNC0NC(ARRAY, NIL, Array, invert, varray());
- ADDFUNC1R(ARRAY, ARRAY, Array, duplicate, BOOL, "deep", varray(false));
- ADDFUNC4R(ARRAY, ARRAY, Array, slice, INT, "begin", INT, "end", INT, "step", BOOL, "deep", varray(1, false));
- ADDFUNC0R(ARRAY, NIL, Array, max, varray());
- ADDFUNC0R(ARRAY, NIL, Array, min, varray());
-
- ADDFUNC0R(PACKED_BYTE_ARRAY, INT, PackedByteArray, size, varray());
- ADDFUNC0R(PACKED_BYTE_ARRAY, BOOL, PackedByteArray, empty, varray());
- ADDFUNC2(PACKED_BYTE_ARRAY, NIL, PackedByteArray, set, INT, "idx", INT, "byte", varray());
- ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, push_back, INT, "byte", varray());
- ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, append, INT, "byte", varray());
- ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, append_array, PACKED_BYTE_ARRAY, "array", varray());
- ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_BYTE_ARRAY, INT, PackedByteArray, insert, INT, "idx", INT, "byte", varray());
- ADDFUNC1(PACKED_BYTE_ARRAY, NIL, PackedByteArray, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_BYTE_ARRAY, BOOL, PackedByteArray, has, INT, "value", varray());
- ADDFUNC0(PACKED_BYTE_ARRAY, NIL, PackedByteArray, sort, varray());
- ADDFUNC0(PACKED_BYTE_ARRAY, NIL, PackedByteArray, invert, varray());
- ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, subarray, INT, "from", INT, "to", varray());
-
- ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_ascii, varray());
- ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf8, varray());
- ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf16, varray());
- ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, get_string_from_utf32, varray());
- ADDFUNC0R(PACKED_BYTE_ARRAY, STRING, PackedByteArray, hex_encode, varray());
- ADDFUNC1R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, compress, INT, "compression_mode", varray(0));
- ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, decompress, INT, "buffer_size", INT, "compression_mode", varray(0));
- ADDFUNC2R(PACKED_BYTE_ARRAY, PACKED_BYTE_ARRAY, PackedByteArray, decompress_dynamic, INT, "max_output_size", INT, "compression_mode", varray(0));
-
- ADDFUNC0R(PACKED_INT32_ARRAY, INT, PackedInt32Array, size, varray());
- ADDFUNC0R(PACKED_INT32_ARRAY, BOOL, PackedInt32Array, empty, varray());
- ADDFUNC2(PACKED_INT32_ARRAY, NIL, PackedInt32Array, set, INT, "idx", INT, "integer", varray());
- ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, push_back, INT, "integer", varray());
- ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, append, INT, "integer", varray());
- ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, append_array, PACKED_INT32_ARRAY, "array", varray());
- ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_INT32_ARRAY, INT, PackedInt32Array, insert, INT, "idx", INT, "integer", varray());
- ADDFUNC1(PACKED_INT32_ARRAY, NIL, PackedInt32Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_INT32_ARRAY, BOOL, PackedInt32Array, has, INT, "value", varray());
- ADDFUNC0(PACKED_INT32_ARRAY, NIL, PackedInt32Array, sort, varray());
- ADDFUNC0(PACKED_INT32_ARRAY, NIL, PackedInt32Array, invert, varray());
-
- ADDFUNC0R(PACKED_INT64_ARRAY, INT, PackedInt64Array, size, varray());
- ADDFUNC0R(PACKED_INT64_ARRAY, BOOL, PackedInt64Array, empty, varray());
- ADDFUNC2(PACKED_INT64_ARRAY, NIL, PackedInt64Array, set, INT, "idx", INT, "integer", varray());
- ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, push_back, INT, "integer", varray());
- ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, append, INT, "integer", varray());
- ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, append_array, PACKED_INT64_ARRAY, "array", varray());
- ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_INT64_ARRAY, INT, PackedInt64Array, insert, INT, "idx", INT, "integer", varray());
- ADDFUNC1(PACKED_INT64_ARRAY, NIL, PackedInt64Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_INT64_ARRAY, BOOL, PackedInt64Array, has, INT, "value", varray());
- ADDFUNC0(PACKED_INT64_ARRAY, NIL, PackedInt64Array, sort, varray());
- ADDFUNC0(PACKED_INT64_ARRAY, NIL, PackedInt64Array, invert, varray());
-
- ADDFUNC0R(PACKED_FLOAT32_ARRAY, INT, PackedFloat32Array, size, varray());
- ADDFUNC0R(PACKED_FLOAT32_ARRAY, BOOL, PackedFloat32Array, empty, varray());
- ADDFUNC2(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, set, INT, "idx", FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, push_back, FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, append, FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, append_array, PACKED_FLOAT32_ARRAY, "array", varray());
- ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_FLOAT32_ARRAY, INT, PackedFloat32Array, insert, INT, "idx", FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_FLOAT32_ARRAY, BOOL, PackedFloat32Array, has, FLOAT, "value", varray());
- ADDFUNC0(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, sort, varray());
- ADDFUNC0(PACKED_FLOAT32_ARRAY, NIL, PackedFloat32Array, invert, varray());
-
- ADDFUNC0R(PACKED_FLOAT64_ARRAY, INT, PackedFloat64Array, size, varray());
- ADDFUNC0R(PACKED_FLOAT64_ARRAY, BOOL, PackedFloat64Array, empty, varray());
- ADDFUNC2(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, set, INT, "idx", FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, push_back, FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, append, FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, append_array, PACKED_FLOAT64_ARRAY, "array", varray());
- ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_FLOAT64_ARRAY, INT, PackedFloat64Array, insert, INT, "idx", FLOAT, "value", varray());
- ADDFUNC1(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_FLOAT64_ARRAY, BOOL, PackedFloat64Array, has, FLOAT, "value", varray());
- ADDFUNC0(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, sort, varray());
- ADDFUNC0(PACKED_FLOAT64_ARRAY, NIL, PackedFloat64Array, invert, varray());
-
- ADDFUNC0R(PACKED_STRING_ARRAY, INT, PackedStringArray, size, varray());
- ADDFUNC0R(PACKED_STRING_ARRAY, BOOL, PackedStringArray, empty, varray());
- ADDFUNC2(PACKED_STRING_ARRAY, NIL, PackedStringArray, set, INT, "idx", STRING, "string", varray());
- ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, push_back, STRING, "string", varray());
- ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, append, STRING, "string", varray());
- ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, append_array, PACKED_STRING_ARRAY, "array", varray());
- ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_STRING_ARRAY, INT, PackedStringArray, insert, INT, "idx", STRING, "string", varray());
- ADDFUNC1(PACKED_STRING_ARRAY, NIL, PackedStringArray, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_STRING_ARRAY, BOOL, PackedStringArray, has, STRING, "value", varray());
- ADDFUNC0(PACKED_STRING_ARRAY, NIL, PackedStringArray, sort, varray());
- ADDFUNC0(PACKED_STRING_ARRAY, NIL, PackedStringArray, invert, varray());
-
- ADDFUNC0R(PACKED_VECTOR2_ARRAY, INT, PackedVector2Array, size, varray());
- ADDFUNC0R(PACKED_VECTOR2_ARRAY, BOOL, PackedVector2Array, empty, varray());
- ADDFUNC2(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, set, INT, "idx", VECTOR2, "vector2", varray());
- ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, push_back, VECTOR2, "vector2", varray());
- ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, append, VECTOR2, "vector2", varray());
- ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, append_array, PACKED_VECTOR2_ARRAY, "array", varray());
- ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_VECTOR2_ARRAY, INT, PackedVector2Array, insert, INT, "idx", VECTOR2, "vector2", varray());
- ADDFUNC1(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_VECTOR2_ARRAY, BOOL, PackedVector2Array, has, VECTOR2, "value", varray());
- ADDFUNC0(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, sort, varray());
- ADDFUNC0(PACKED_VECTOR2_ARRAY, NIL, PackedVector2Array, invert, varray());
-
- ADDFUNC0R(PACKED_VECTOR3_ARRAY, INT, PackedVector3Array, size, varray());
- ADDFUNC0R(PACKED_VECTOR3_ARRAY, BOOL, PackedVector3Array, empty, varray());
- ADDFUNC2(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, set, INT, "idx", VECTOR3, "vector3", varray());
- ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, push_back, VECTOR3, "vector3", varray());
- ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, append, VECTOR3, "vector3", varray());
- ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, append_array, PACKED_VECTOR3_ARRAY, "array", varray());
- ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_VECTOR3_ARRAY, INT, PackedVector3Array, insert, INT, "idx", VECTOR3, "vector3", varray());
- ADDFUNC1(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_VECTOR3_ARRAY, BOOL, PackedVector3Array, has, VECTOR3, "value", varray());
- ADDFUNC0(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, sort, varray());
- ADDFUNC0(PACKED_VECTOR3_ARRAY, NIL, PackedVector3Array, invert, varray());
-
- ADDFUNC0R(PACKED_COLOR_ARRAY, INT, PackedColorArray, size, varray());
- ADDFUNC0R(PACKED_COLOR_ARRAY, BOOL, PackedColorArray, empty, varray());
- ADDFUNC2(PACKED_COLOR_ARRAY, NIL, PackedColorArray, set, INT, "idx", COLOR, "color", varray());
- ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, push_back, COLOR, "color", varray());
- ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, append, COLOR, "color", varray());
- ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, append_array, PACKED_COLOR_ARRAY, "array", varray());
- ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, remove, INT, "idx", varray());
- ADDFUNC2R(PACKED_COLOR_ARRAY, INT, PackedColorArray, insert, INT, "idx", COLOR, "color", varray());
- ADDFUNC1(PACKED_COLOR_ARRAY, NIL, PackedColorArray, resize, INT, "idx", varray());
- ADDFUNC1R(PACKED_COLOR_ARRAY, BOOL, PackedColorArray, has, COLOR, "value", varray());
- ADDFUNC0(PACKED_COLOR_ARRAY, NIL, PackedColorArray, sort, varray());
- ADDFUNC0(PACKED_COLOR_ARRAY, NIL, PackedColorArray, invert, varray());
-
- //pointerbased
-
- ADDFUNC0R(AABB, AABB, AABB, abs, varray());
- ADDFUNC0R(AABB, FLOAT, AABB, get_area, varray());
- ADDFUNC0R(AABB, BOOL, AABB, has_no_area, varray());
- ADDFUNC0R(AABB, BOOL, AABB, has_no_surface, varray());
- ADDFUNC1R(AABB, BOOL, AABB, has_point, VECTOR3, "point", varray());
- ADDFUNC1R(AABB, BOOL, AABB, is_equal_approx, AABB, "aabb", varray());
- ADDFUNC1R(AABB, BOOL, AABB, intersects, AABB, "with", varray());
- ADDFUNC1R(AABB, BOOL, AABB, encloses, AABB, "with", varray());
- ADDFUNC1R(AABB, BOOL, AABB, intersects_plane, PLANE, "plane", varray());
- ADDFUNC2R(AABB, BOOL, AABB, intersects_segment, VECTOR3, "from", VECTOR3, "to", varray());
- ADDFUNC1R(AABB, AABB, AABB, intersection, AABB, "with", varray());
- ADDFUNC1R(AABB, AABB, AABB, merge, AABB, "with", varray());
- ADDFUNC1R(AABB, AABB, AABB, expand, VECTOR3, "to_point", varray());
- ADDFUNC1R(AABB, AABB, AABB, grow, FLOAT, "by", varray());
- ADDFUNC1R(AABB, VECTOR3, AABB, get_support, VECTOR3, "dir", varray());
- ADDFUNC0R(AABB, VECTOR3, AABB, get_longest_axis, varray());
- ADDFUNC0R(AABB, INT, AABB, get_longest_axis_index, varray());
- ADDFUNC0R(AABB, FLOAT, AABB, get_longest_axis_size, varray());
- ADDFUNC0R(AABB, VECTOR3, AABB, get_shortest_axis, varray());
- ADDFUNC0R(AABB, INT, AABB, get_shortest_axis_index, varray());
- ADDFUNC0R(AABB, FLOAT, AABB, get_shortest_axis_size, varray());
- ADDFUNC1R(AABB, VECTOR3, AABB, get_endpoint, INT, "idx", varray());
-
- ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, inverse, varray());
- ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, affine_inverse, varray());
- ADDFUNC0R(TRANSFORM2D, FLOAT, Transform2D, get_rotation, varray());
- ADDFUNC0R(TRANSFORM2D, VECTOR2, Transform2D, get_origin, varray());
- ADDFUNC0R(TRANSFORM2D, VECTOR2, Transform2D, get_scale, varray());
- ADDFUNC0R(TRANSFORM2D, TRANSFORM2D, Transform2D, orthonormalized, varray());
- ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, rotated, FLOAT, "phi", varray());
- ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, scaled, VECTOR2, "scale", varray());
- ADDFUNC1R(TRANSFORM2D, TRANSFORM2D, Transform2D, translated, VECTOR2, "offset", varray());
- ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform, NIL, "v", varray());
- ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform_inv, NIL, "v", varray());
- ADDFUNC1R(TRANSFORM2D, VECTOR2, Transform2D, basis_xform, VECTOR2, "v", varray());
- ADDFUNC1R(TRANSFORM2D, VECTOR2, Transform2D, basis_xform_inv, VECTOR2, "v", varray());
- ADDFUNC2R(TRANSFORM2D, TRANSFORM2D, Transform2D, interpolate_with, TRANSFORM2D, "transform", FLOAT, "weight", varray());
- ADDFUNC1R(TRANSFORM2D, BOOL, Transform2D, is_equal_approx, TRANSFORM2D, "transform", varray());
-
- ADDFUNC0R(BASIS, BASIS, Basis, inverse, varray());
- ADDFUNC0R(BASIS, BASIS, Basis, transposed, varray());
- ADDFUNC0R(BASIS, BASIS, Basis, orthonormalized, varray());
- ADDFUNC0R(BASIS, FLOAT, Basis, determinant, varray());
- ADDFUNC2R(BASIS, BASIS, Basis, rotated, VECTOR3, "axis", FLOAT, "phi", varray());
- ADDFUNC1R(BASIS, BASIS, Basis, scaled, VECTOR3, "scale", varray());
- ADDFUNC0R(BASIS, VECTOR3, Basis, get_scale, varray());
- ADDFUNC0R(BASIS, VECTOR3, Basis, get_euler, varray());
- ADDFUNC1R(BASIS, FLOAT, Basis, tdotx, VECTOR3, "with", varray());
- ADDFUNC1R(BASIS, FLOAT, Basis, tdoty, VECTOR3, "with", varray());
- ADDFUNC1R(BASIS, FLOAT, Basis, tdotz, VECTOR3, "with", varray());
- ADDFUNC1R(BASIS, VECTOR3, Basis, xform, VECTOR3, "v", varray());
- ADDFUNC1R(BASIS, VECTOR3, Basis, xform_inv, VECTOR3, "v", varray());
- ADDFUNC0R(BASIS, INT, Basis, get_orthogonal_index, varray());
- ADDFUNC2R(BASIS, BASIS, Basis, slerp, BASIS, "b", FLOAT, "t", varray());
- ADDFUNC1R(BASIS, BOOL, Basis, is_equal_approx, BASIS, "b", varray());
- ADDFUNC0R(BASIS, QUAT, Basis, get_rotation_quat, varray());
-
- ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, inverse, varray());
- ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, affine_inverse, varray());
- ADDFUNC0R(TRANSFORM, TRANSFORM, Transform, orthonormalized, varray());
- ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, rotated, VECTOR3, "axis", FLOAT, "phi", varray());
- ADDFUNC1R(TRANSFORM, TRANSFORM, Transform, scaled, VECTOR3, "scale", varray());
- ADDFUNC1R(TRANSFORM, TRANSFORM, Transform, translated, VECTOR3, "offset", varray());
- ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, looking_at, VECTOR3, "target", VECTOR3, "up", varray());
- ADDFUNC2R(TRANSFORM, TRANSFORM, Transform, interpolate_with, TRANSFORM, "transform", FLOAT, "weight", varray());
- ADDFUNC1R(TRANSFORM, BOOL, Transform, is_equal_approx, TRANSFORM, "transform", varray());
- ADDFUNC1R(TRANSFORM, NIL, Transform, xform, NIL, "v", varray());
- ADDFUNC1R(TRANSFORM, NIL, Transform, xform_inv, NIL, "v", varray());
+
+ bind_method(String, casecmp_to, sarray("to"), varray());
+ bind_method(String, nocasecmp_to, sarray("to"), varray());
+ bind_method(String, naturalnocasecmp_to, sarray("to"), varray());
+ bind_method(String, length, sarray(), varray());
+ bind_method(String, substr, sarray("from", "len"), varray(-1));
+ bind_methodv("find", static_cast<int (String::*)(const String &, int) const>(&String::find), sarray("what", "from"), varray(0));
+ bind_method(String, count, sarray("what", "from", "to"), varray(0, 0));
+ bind_method(String, countn, sarray("what", "from", "to"), varray(0, 0));
+ bind_method(String, findn, sarray("what", "from"), varray(0));
+ bind_method(String, rfind, sarray("what", "from"), varray(-1));
+ bind_method(String, rfindn, sarray("what", "from"), varray(-1));
+ bind_method(String, match, sarray("expr"), varray());
+ bind_method(String, matchn, sarray("expr"), varray());
+ bind_methodv("begins_with", static_cast<bool (String::*)(const String &) const>(&String::begins_with), sarray("text"), varray());
+ bind_method(String, ends_with, sarray("text"), varray());
+ bind_method(String, is_subsequence_of, sarray("text"), varray());
+ bind_method(String, is_subsequence_ofi, sarray("text"), varray());
+ bind_method(String, bigrams, sarray(), varray());
+ bind_method(String, similarity, sarray("text"), varray());
+
+ bind_method(String, format, sarray("values", "placeholder"), varray("{_}"));
+ bind_methodv("replace", static_cast<String (String::*)(const String &, const String &) const>(&String::replace), sarray("what", "forwhat"), varray());
+ bind_method(String, replacen, sarray("what", "forwhat"), varray());
+ bind_method(String, repeat, sarray("count"), varray());
+ bind_method(String, insert, sarray("position", "what"), varray());
+ bind_method(String, capitalize, sarray(), varray());
+ bind_method(String, split, sarray("delimiter", "allow_empty", "maxsplit"), varray(true, 0));
+ bind_method(String, rsplit, sarray("delimiter", "allow_empty", "maxsplit"), varray(true, 0));
+ bind_method(String, split_floats, sarray("delimiter", "allow_empty"), varray(true));
+ bind_method(String, join, sarray("parts"), varray());
+
+ bind_method(String, to_upper, sarray(), varray());
+ bind_method(String, to_lower, sarray(), varray());
+
+ bind_method(String, left, sarray("position"), varray());
+ bind_method(String, right, sarray("position"), varray());
+
+ bind_method(String, strip_edges, sarray("left", "right"), varray(true, true));
+ bind_method(String, strip_escapes, sarray(), varray());
+ bind_method(String, lstrip, sarray("chars"), varray());
+ bind_method(String, rstrip, sarray("chars"), varray());
+ bind_method(String, get_extension, sarray(), varray());
+ bind_method(String, get_basename, sarray(), varray());
+ bind_method(String, plus_file, sarray("file"), varray());
+ bind_method(String, ord_at, sarray("at"), varray());
+ bind_method(String, dedent, sarray(), varray());
+ //string needs to be immutable when binding
+ //bind_method(String, erase, sarray("position", "chars"), varray());
+ bind_method(String, hash, sarray(), varray());
+ bind_method(String, md5_text, sarray(), varray());
+ bind_method(String, sha1_text, sarray(), varray());
+ bind_method(String, sha256_text, sarray(), varray());
+ bind_method(String, md5_buffer, sarray(), varray());
+ bind_method(String, sha1_buffer, sarray(), varray());
+ bind_method(String, sha256_buffer, sarray(), varray());
+ bind_method(String, empty, sarray(), varray());
+ //static function, not sure how to bind
+ //bind_method(String, humanize_size, sarray("size"), varray());
+
+ bind_method(String, is_abs_path, sarray(), varray());
+ bind_method(String, is_rel_path, sarray(), varray());
+ bind_method(String, get_base_dir, sarray(), varray());
+ bind_method(String, get_file, sarray(), varray());
+ bind_method(String, xml_escape, sarray("escape_quotes"), varray(false));
+ bind_method(String, xml_unescape, sarray(), varray());
+ bind_method(String, http_escape, sarray(), varray());
+ bind_method(String, http_unescape, sarray(), varray());
+ bind_method(String, c_escape, sarray(), varray());
+ bind_method(String, c_unescape, sarray(), varray());
+ bind_method(String, json_escape, sarray(), varray());
+ bind_method(String, percent_encode, sarray(), varray());
+ bind_method(String, percent_decode, sarray(), varray());
+
+ bind_method(String, is_valid_identifier, sarray(), varray());
+ bind_method(String, is_valid_integer, sarray(), varray());
+ bind_method(String, is_valid_float, sarray(), varray());
+ bind_method(String, is_valid_hex_number, sarray("with_prefix"), varray(false));
+ bind_method(String, is_valid_html_color, sarray(), varray());
+ bind_method(String, is_valid_ip_address, sarray(), varray());
+ bind_method(String, is_valid_filename, sarray(), varray());
+
+ bind_method(String, to_int, sarray(), varray());
+ bind_method(String, to_float, sarray(), varray());
+ bind_method(String, hex_to_int, sarray("with_prefix"), varray(true));
+ bind_method(String, bin_to_int, sarray("with_prefix"), varray(true));
+
+ bind_method(String, lpad, sarray("min_length", "character"), varray(" "));
+ bind_method(String, rpad, sarray("min_length", "character"), varray(" "));
+ bind_method(String, pad_decimals, sarray("digits"), varray());
+ bind_method(String, pad_zeros, sarray("digits"), varray());
+ bind_method(String, trim_prefix, sarray("prefix"), varray());
+ bind_method(String, trim_suffix, sarray("suffix"), varray());
+
+ bind_method(String, to_ascii_buffer, sarray(), varray());
+ bind_method(String, to_utf8_buffer, sarray(), varray());
+ bind_method(String, to_utf16_buffer, sarray(), varray());
+ bind_method(String, to_utf32_buffer, sarray(), varray());
+
+ /* VECTOR2 */
+
+ bind_method(Vector2, angle, sarray(), varray());
+ bind_method(Vector2, angle_to, sarray("to"), varray());
+ bind_method(Vector2, angle_to_point, sarray("to"), varray());
+ bind_method(Vector2, direction_to, sarray("b"), varray());
+ bind_method(Vector2, distance_to, sarray("to"), varray());
+ bind_method(Vector2, distance_squared_to, sarray("to"), varray());
+ bind_method(Vector2, length, sarray(), varray());
+ bind_method(Vector2, length_squared, sarray(), varray());
+ bind_method(Vector2, normalized, sarray(), varray());
+ bind_method(Vector2, is_normalized, sarray(), varray());
+ bind_method(Vector2, is_equal_approx, sarray("to"), varray());
+ bind_method(Vector2, posmod, sarray("mod"), varray());
+ bind_method(Vector2, posmodv, sarray("modv"), varray());
+ bind_method(Vector2, project, sarray("b"), varray());
+ bind_method(Vector2, lerp, sarray("with", "t"), varray());
+ bind_method(Vector2, slerp, sarray("with", "t"), varray());
+ bind_method(Vector2, cubic_interpolate, sarray("b", "pre_a", "post_b", "t"), varray());
+ bind_method(Vector2, move_toward, sarray("to", "delta"), varray());
+ bind_method(Vector2, rotated, sarray("phi"), varray());
+ bind_method(Vector2, tangent, sarray(), varray());
+ bind_method(Vector2, floor, sarray(), varray());
+ bind_method(Vector2, ceil, sarray(), varray());
+ bind_method(Vector2, round, sarray(), varray());
+ bind_method(Vector2, aspect, sarray(), varray());
+ bind_method(Vector2, dot, sarray("with"), varray());
+ bind_method(Vector2, slide, sarray("n"), varray());
+ bind_method(Vector2, bounce, sarray("n"), varray());
+ bind_method(Vector2, reflect, sarray("n"), varray());
+ bind_method(Vector2, cross, sarray("with"), varray());
+ bind_method(Vector2, abs, sarray(), varray());
+ bind_method(Vector2, sign, sarray(), varray());
+ bind_method(Vector2, clamped, sarray("length"), varray());
+
+ /* VECTOR2I */
+
+ bind_method(Vector2i, aspect, sarray(), varray());
+ bind_method(Vector2i, sign, sarray(), varray());
+ bind_method(Vector2i, abs, sarray(), varray());
+
+ /* RECT2 */
+
+ bind_method(Rect2, get_area, sarray(), varray());
+ bind_method(Rect2, has_no_area, sarray(), varray());
+ bind_method(Rect2, has_point, sarray("point"), varray());
+ bind_method(Rect2, is_equal_approx, sarray("rect"), varray());
+ bind_method(Rect2, intersects, sarray("b", "include_borders"), varray(false));
+ bind_method(Rect2, encloses, sarray("b"), varray());
+ bind_method(Rect2, clip, sarray("b"), varray());
+ bind_method(Rect2, merge, sarray("b"), varray());
+ bind_method(Rect2, expand, sarray("to"), varray());
+ bind_method(Rect2, grow, sarray("by"), varray());
+ bind_methodv("grow_margin", &Rect2::grow_margin_bind, sarray("margin", "by"), varray());
+ bind_method(Rect2, grow_individual, sarray("left", "top", "right", "bottom"), varray());
+ bind_method(Rect2, abs, sarray(), varray());
+
+ /* Rect2i */
+
+ bind_method(Rect2i, get_area, sarray(), varray());
+ bind_method(Rect2i, has_no_area, sarray(), varray());
+ bind_method(Rect2i, has_point, sarray("point"), varray());
+ bind_method(Rect2i, intersects, sarray("b"), varray());
+ bind_method(Rect2i, encloses, sarray("b"), varray());
+ bind_method(Rect2i, clip, sarray("b"), varray());
+ bind_method(Rect2i, merge, sarray("b"), varray());
+ bind_method(Rect2i, expand, sarray("to"), varray());
+ bind_method(Rect2i, grow, sarray("by"), varray());
+ bind_methodv("grow_margin", &Rect2i::grow_margin_bind, sarray("margin", "by"), varray());
+ bind_method(Rect2i, grow_individual, sarray("left", "top", "right", "bottom"), varray());
+ bind_method(Rect2i, abs, sarray(), varray());
+
+ /* Vector3 */
+
+ bind_method(Vector3, min_axis, sarray(), varray());
+ bind_method(Vector3, max_axis, sarray(), varray());
+ bind_method(Vector3, angle_to, sarray("to"), varray());
+ bind_method(Vector3, direction_to, sarray("b"), varray());
+ bind_method(Vector3, distance_to, sarray("b"), varray());
+ bind_method(Vector3, distance_squared_to, sarray("b"), varray());
+ bind_method(Vector3, length, sarray(), varray());
+ bind_method(Vector3, length_squared, sarray(), varray());
+ bind_method(Vector3, normalized, sarray(), varray());
+ bind_method(Vector3, is_normalized, sarray(), varray());
+ bind_method(Vector3, is_equal_approx, sarray("to"), varray());
+ bind_method(Vector3, inverse, sarray(), varray());
+ bind_method(Vector3, snapped, sarray("by"), varray());
+ bind_method(Vector3, rotated, sarray("by_axis", "phi"), varray());
+ bind_method(Vector3, lerp, sarray("b", "t"), varray());
+ bind_method(Vector3, slerp, sarray("b", "t"), varray());
+ bind_method(Vector3, cubic_interpolate, sarray("b", "pre_a", "post_b", "t"), varray());
+ bind_method(Vector3, move_toward, sarray("to", "delta"), varray());
+ bind_method(Vector3, dot, sarray("with"), varray());
+ bind_method(Vector3, cross, sarray("with"), varray());
+ bind_method(Vector3, outer, sarray("with"), varray());
+ bind_method(Vector3, to_diagonal_matrix, sarray(), varray());
+ bind_method(Vector3, abs, sarray(), varray());
+ bind_method(Vector3, floor, sarray(), varray());
+ bind_method(Vector3, ceil, sarray(), varray());
+ bind_method(Vector3, round, sarray(), varray());
+ bind_method(Vector3, posmod, sarray("mod"), varray());
+ bind_method(Vector3, posmodv, sarray("modv"), varray());
+ bind_method(Vector3, project, sarray("b"), varray());
+ bind_method(Vector3, slide, sarray("n"), varray());
+ bind_method(Vector3, bounce, sarray("n"), varray());
+ bind_method(Vector3, reflect, sarray("n"), varray());
+ bind_method(Vector3, sign, sarray(), varray());
+
+ /* Vector3i */
+
+ bind_method(Vector3i, min_axis, sarray(), varray());
+ bind_method(Vector3i, max_axis, sarray(), varray());
+ bind_method(Vector3i, sign, sarray(), varray());
+ bind_method(Vector3i, abs, sarray(), varray());
+
+ /* Plane */
+
+ bind_method(Plane, normalized, sarray(), varray());
+ bind_method(Plane, center, sarray(), varray());
+ bind_method(Plane, is_equal_approx, sarray("to_plane"), varray());
+ bind_method(Plane, is_point_over, sarray("plane"), varray());
+ bind_method(Plane, distance_to, sarray("point"), varray());
+ bind_method(Plane, has_point, sarray("point", "epsilon"), varray(CMP_EPSILON));
+ bind_method(Plane, project, sarray("point"), varray());
+ bind_methodv("intersect_3", &Plane::intersect_3_bind, sarray("b", "c"), varray());
+ bind_methodv("intersects_ray", &Plane::intersects_ray_bind, sarray("from", "dir"), varray());
+ bind_methodv("intersects_segment", &Plane::intersects_segment_bind, sarray("from", "to"), varray());
+
+ /* Quaternion */
+
+ bind_method(Quat, length, sarray(), varray());
+ bind_method(Quat, length_squared, sarray(), varray());
+ bind_method(Quat, normalized, sarray(), varray());
+ bind_method(Quat, is_normalized, sarray(), varray());
+ bind_method(Quat, is_equal_approx, sarray("to"), varray());
+ bind_method(Quat, inverse, sarray(), varray());
+ bind_method(Quat, dot, sarray("with"), varray());
+ bind_method(Quat, xform, sarray("v3"), varray());
+ bind_method(Quat, slerp, sarray("b", "t"), varray());
+ bind_method(Quat, slerpni, sarray("b", "t"), varray());
+ bind_method(Quat, cubic_slerp, sarray("b", "pre_a", "post_b", "t"), varray());
+ bind_method(Quat, get_euler, sarray(), varray());
+
+ //Quat is atomic, this should be done via construcror
+ //ADDFUNC1(QUAT, NIL, Quat, set_euler, VECTOR3, "euler", varray());
+ //ADDFUNC2(QUAT, NIL, Quat, set_axis_angle, VECTOR3, "axis", FLOAT, "angle", varray());
+
+ /* Color */
+
+ bind_method(Color, to_argb32, sarray(), varray());
+ bind_method(Color, to_abgr32, sarray(), varray());
+ bind_method(Color, to_rgba32, sarray(), varray());
+ bind_method(Color, to_argb64, sarray(), varray());
+ bind_method(Color, to_abgr64, sarray(), varray());
+ bind_method(Color, to_rgba64, sarray(), varray());
+
+ bind_method(Color, inverted, sarray(), varray());
+ bind_method(Color, contrasted, sarray(), varray());
+ bind_method(Color, lerp, sarray("b", "t"), varray());
+ bind_method(Color, lightened, sarray("amount"), varray());
+ bind_method(Color, darkened, sarray("amount"), varray());
+ bind_method(Color, to_html, sarray("with_alpha"), varray(true));
+ bind_method(Color, blend, sarray("over"), varray());
+
+ //Color is immutable, need to probably find a way to do this via constructor
+ //ADDFUNC4R(COLOR, COLOR, Color, from_hsv, FLOAT, "h", FLOAT, "s", FLOAT, "v", FLOAT, "a", varray(1.0));
+ bind_method(Color, is_equal_approx, sarray("to"), varray());
+
+ /* RID */
+
+ bind_method(RID, get_id, sarray(), varray());
+
+ /* NodePath */
+
+ bind_method(NodePath, is_absolute, sarray(), varray());
+ bind_method(NodePath, get_name_count, sarray(), varray());
+ bind_method(NodePath, get_name, sarray("idx"), varray());
+ bind_method(NodePath, get_subname_count, sarray(), varray());
+ bind_method(NodePath, get_subname, sarray("idx"), varray());
+ bind_method(NodePath, get_concatenated_subnames, sarray(), varray());
+ bind_method(NodePath, get_as_property_path, sarray(), varray());
+ bind_method(NodePath, is_empty, sarray(), varray());
+
+ /* Callable */
+
+ bind_method(Callable, is_null, sarray(), varray());
+ bind_method(Callable, is_custom, sarray(), varray());
+ bind_method(Callable, is_standard, sarray(), varray());
+ bind_method(Callable, get_object, sarray(), varray());
+ bind_method(Callable, get_object_id, sarray(), varray());
+ bind_method(Callable, get_method, sarray(), varray());
+ bind_method(Callable, hash, sarray(), varray());
+ bind_method(Callable, unbind, sarray("argcount"), varray());
+
+ //#define bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type, m_arg_names) _VariantCall::_bind_custom(m_type, m_name, m_method, m_flags, m_arg_types, m_ret_type)
+
+ bind_custom(Variant::CALLABLE, "call", _VariantCall::func_Callable_call, Variant::InternalMethod::FLAG_VARARGS | Variant::InternalMethod::FLAG_RETURNS_VARIANT, Vector<Variant::Type>(), Variant::NIL, sarray());
+ bind_custom(Variant::CALLABLE, "call_deferred", _VariantCall::func_Callable_call_deferred, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::NIL, sarray());
+ bind_custom(Variant::CALLABLE, "bind", _VariantCall::func_Callable_bind, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::CALLABLE, sarray());
+
+ /* Signal */
+
+ bind_method(Signal, is_null, sarray(), varray());
+ bind_method(Signal, get_object, sarray(), varray());
+ bind_method(Signal, get_object_id, sarray(), varray());
+ bind_method(Signal, get_name, sarray(), varray());
+
+ bind_method(Signal, connect, sarray("callable", "binds", "flags"), varray(Array(), 0));
+ bind_method(Signal, disconnect, sarray("callable"), varray());
+ bind_method(Signal, is_connected, sarray("callable"), varray());
+ bind_method(Signal, get_connections, sarray(), varray());
+
+ bind_custom(Variant::SIGNAL, "emit", _VariantCall::func_Signal_emit, Variant::InternalMethod::FLAG_VARARGS, Vector<Variant::Type>(), Variant::NIL, sarray());
+
+ /* Transform2D */
+
+ bind_method(Transform2D, inverse, sarray(), varray());
+ bind_method(Transform2D, affine_inverse, sarray(), varray());
+ bind_method(Transform2D, get_rotation, sarray(), varray());
+ bind_method(Transform2D, get_origin, sarray(), varray());
+ bind_method(Transform2D, get_scale, sarray(), varray());
+ bind_method(Transform2D, orthonormalized, sarray(), varray());
+ bind_method(Transform2D, rotated, sarray("phi"), varray());
+ bind_method(Transform2D, scaled, sarray("scale"), varray());
+ bind_method(Transform2D, translated, sarray("offset"), varray());
+ //too complex to bind this, operator * should be used instead
+ //ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform, NIL, "v", varray());
+ //ADDFUNC1R(TRANSFORM2D, NIL, Transform2D, xform_inv, NIL, "v", varray());
+ bind_method(Transform2D, basis_xform, sarray("v"), varray());
+ bind_method(Transform2D, basis_xform_inv, sarray("v"), varray());
+ bind_method(Transform2D, interpolate_with, sarray("xform", "t"), varray());
+ bind_method(Transform2D, is_equal_approx, sarray("xform"), varray());
+
+ /* Basis */
+
+ bind_method(Basis, inverse, sarray(), varray());
+ bind_method(Basis, transposed, sarray(), varray());
+ bind_method(Basis, orthonormalized, sarray(), varray());
+ bind_method(Basis, determinant, sarray(), varray());
+ bind_methodv("rotated", static_cast<Basis (Basis::*)(const Vector3 &, float) const>(&Basis::rotated), sarray("axis", "phi"), varray());
+ bind_method(Basis, scaled, sarray("scale"), varray());
+ bind_method(Basis, get_scale, sarray(), varray());
+ bind_method(Basis, get_euler, sarray(), varray());
+ bind_method(Basis, tdotx, sarray("with"), varray());
+ bind_method(Basis, tdoty, sarray("with"), varray());
+ bind_method(Basis, tdotz, sarray("with"), varray());
+ //use the operators instead
+ //ADDFUNC1R(BASIS, VECTOR3, Basis, xform, VECTOR3, "v", varray());
+ //ADDFUNC1R(BASIS, VECTOR3, Basis, xform_inv, VECTOR3, "v", varray());
+ bind_method(Basis, get_orthogonal_index, sarray(), varray());
+ bind_method(Basis, slerp, sarray("b", "t"), varray());
+ bind_method(Basis, is_equal_approx, sarray("b"), varray());
+ bind_method(Basis, get_rotation_quat, sarray(), varray());
+
+ /* AABB */
+
+ bind_method(::AABB, abs, sarray(), varray());
+ bind_method(::AABB, get_area, sarray(), varray());
+ bind_method(::AABB, has_no_area, sarray(), varray());
+ bind_method(::AABB, has_no_surface, sarray(), varray());
+ bind_method(::AABB, has_point, sarray("point"), varray());
+ bind_method(::AABB, is_equal_approx, sarray("aabb"), varray());
+ bind_method(::AABB, intersects, sarray("with"), varray());
+ bind_method(::AABB, encloses, sarray("with"), varray());
+ bind_method(::AABB, intersects_plane, sarray("plane"), varray());
+ bind_method(::AABB, intersection, sarray("with"), varray());
+ bind_method(::AABB, merge, sarray("with"), varray());
+ bind_method(::AABB, expand, sarray("to_point"), varray());
+ bind_method(::AABB, grow, sarray("by"), varray());
+ bind_method(::AABB, get_support, sarray("dir"), varray());
+ bind_method(::AABB, get_longest_axis, sarray(), varray());
+ bind_method(::AABB, get_longest_axis_index, sarray(), varray());
+ bind_method(::AABB, get_longest_axis_size, sarray(), varray());
+ bind_method(::AABB, get_shortest_axis, sarray(), varray());
+ bind_method(::AABB, get_shortest_axis_index, sarray(), varray());
+ bind_method(::AABB, get_shortest_axis_size, sarray(), varray());
+ bind_method(::AABB, get_endpoint, sarray("idx"), varray());
+ bind_methodv("intersects_segment", &AABB::intersects_segment_bind, sarray("from", "to"), varray());
+ bind_methodv("intersects_ray", &AABB::intersects_ray_bind, sarray("from", "dir"), varray());
+
+ /* Transform */
+
+ bind_method(Transform, inverse, sarray(), varray());
+ bind_method(Transform, affine_inverse, sarray(), varray());
+ bind_method(Transform, orthonormalized, sarray(), varray());
+ bind_method(Transform, rotated, sarray("axis", "phi"), varray());
+ bind_method(Transform, scaled, sarray("scale"), varray());
+ bind_method(Transform, translated, sarray("offset"), varray());
+ bind_method(Transform, looking_at, sarray("target", "up"), varray());
+ bind_method(Transform, interpolate_with, sarray("xform", "weight"), varray());
+ bind_method(Transform, is_equal_approx, sarray("xform"), varray());
+ //use the operators instead
+ //ADDFUNC1R(TRANSFORM, NIL, Transform, xform, NIL, "v", varray());
+ //ADDFUNC1R(TRANSFORM, NIL, Transform, xform_inv, NIL, "v", varray());
+
+ /* Dictionary */
+
+ bind_method(Dictionary, size, sarray(), varray());
+ bind_method(Dictionary, empty, sarray(), varray());
+ bind_method(Dictionary, clear, sarray(), varray());
+ bind_method(Dictionary, has, sarray("key"), varray());
+ bind_method(Dictionary, has_all, sarray("keys"), varray());
+ bind_method(Dictionary, erase, sarray("key"), varray());
+ bind_method(Dictionary, hash, sarray(), varray());
+ bind_method(Dictionary, keys, sarray(), varray());
+ bind_method(Dictionary, values, sarray(), varray());
+ bind_method(Dictionary, duplicate, sarray("deep"), varray(false));
+ bind_method(Dictionary, get, sarray("key", "default"), varray(Variant()));
+
+ /* Array */
+
+ bind_method(Array, size, sarray(), varray());
+ bind_method(Array, empty, sarray(), varray());
+ bind_method(Array, clear, sarray(), varray());
+ bind_method(Array, hash, sarray(), varray());
+ bind_method(Array, push_back, sarray("value"), varray());
+ bind_method(Array, push_front, sarray("value"), varray());
+ bind_method(Array, append, sarray("value"), varray());
+ bind_method(Array, resize, sarray("size"), varray());
+ bind_method(Array, insert, sarray("position", "value"), varray());
+ bind_method(Array, remove, sarray("position"), varray());
+ bind_method(Array, erase, sarray("value"), varray());
+ bind_method(Array, front, sarray(), varray());
+ bind_method(Array, back, sarray(), varray());
+ bind_method(Array, find, sarray("what", "from"), varray(0));
+ bind_method(Array, rfind, sarray("what", "from"), varray(-1));
+ bind_method(Array, find_last, sarray("value"), varray());
+ bind_method(Array, count, sarray("value"), varray());
+ bind_method(Array, has, sarray("value"), varray());
+ bind_method(Array, pop_back, sarray(), varray());
+ bind_method(Array, pop_front, sarray(), varray());
+ bind_method(Array, sort, sarray(), varray());
+ bind_method(Array, sort_custom, sarray("obj", "func"), varray());
+ bind_method(Array, shuffle, sarray(), varray());
+ bind_method(Array, bsearch, sarray("value", "before"), varray(true));
+ bind_method(Array, bsearch_custom, sarray("value", "obj", "func", "before"), varray(true));
+ bind_method(Array, invert, sarray(), varray());
+ bind_method(Array, duplicate, sarray("deep"), varray(false));
+ bind_method(Array, slice, sarray("begin", "end", "step", "deep"), varray(1, false));
+ bind_method(Array, max, sarray(), varray());
+ bind_method(Array, min, sarray(), varray());
+
+ /* Byte Array */
+ bind_method(PackedByteArray, size, sarray(), varray());
+ bind_method(PackedByteArray, empty, sarray(), varray());
+ bind_method(PackedByteArray, set, sarray("index", "value"), varray());
+ bind_method(PackedByteArray, push_back, sarray("value"), varray());
+ bind_method(PackedByteArray, append, sarray("value"), varray());
+ bind_method(PackedByteArray, append_array, sarray("array"), varray());
+ bind_method(PackedByteArray, remove, sarray("index"), varray());
+ bind_method(PackedByteArray, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedByteArray, resize, sarray("new_size"), varray());
+ bind_method(PackedByteArray, has, sarray("value"), varray());
+ bind_method(PackedByteArray, invert, sarray(), varray());
+ bind_method(PackedByteArray, subarray, sarray("from", "to"), varray());
+ bind_method(PackedByteArray, sort, sarray(), varray());
+
+ bind_function("get_string_from_ascii", _VariantCall::func_PackedByteArray_get_string_from_ascii, sarray(), varray());
+ bind_function("get_string_from_utf8", _VariantCall::func_PackedByteArray_get_string_from_utf8, sarray(), varray());
+ bind_function("get_string_from_utf16", _VariantCall::func_PackedByteArray_get_string_from_utf16, sarray(), varray());
+ bind_function("get_string_from_utf32", _VariantCall::func_PackedByteArray_get_string_from_utf32, sarray(), varray());
+ bind_function("hex_encode", _VariantCall::func_PackedByteArray_hex_encode, sarray(), varray());
+ bind_function("compress", _VariantCall::func_PackedByteArray_compress, sarray("compression_mode"), varray(0));
+ bind_function("decompress", _VariantCall::func_PackedByteArray_decompress, sarray("buffer_size", "compression_mode"), varray(0));
+ bind_function("decompress_dynamic", _VariantCall::func_PackedByteArray_decompress_dynamic, sarray("max_output_size", "compression_mode"), varray(0));
+
+ /* Int32 Array */
+
+ bind_method(PackedInt32Array, size, sarray(), varray());
+ bind_method(PackedInt32Array, empty, sarray(), varray());
+ bind_method(PackedInt32Array, set, sarray("index", "value"), varray());
+ bind_method(PackedInt32Array, push_back, sarray("value"), varray());
+ bind_method(PackedInt32Array, append, sarray("value"), varray());
+ bind_method(PackedInt32Array, append_array, sarray("array"), varray());
+ bind_method(PackedInt32Array, remove, sarray("index"), varray());
+ bind_method(PackedInt32Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedInt32Array, resize, sarray("new_size"), varray());
+ bind_method(PackedInt32Array, has, sarray("value"), varray());
+ bind_method(PackedInt32Array, invert, sarray(), varray());
+ bind_method(PackedInt32Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedInt32Array, to_byte_array, sarray(), varray());
+ bind_method(PackedInt32Array, sort, sarray(), varray());
+
+ /* Int64 Array */
+
+ bind_method(PackedInt64Array, size, sarray(), varray());
+ bind_method(PackedInt64Array, empty, sarray(), varray());
+ bind_method(PackedInt64Array, set, sarray("index", "value"), varray());
+ bind_method(PackedInt64Array, push_back, sarray("value"), varray());
+ bind_method(PackedInt64Array, append, sarray("value"), varray());
+ bind_method(PackedInt64Array, append_array, sarray("array"), varray());
+ bind_method(PackedInt64Array, remove, sarray("index"), varray());
+ bind_method(PackedInt64Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedInt64Array, resize, sarray("new_size"), varray());
+ bind_method(PackedInt64Array, has, sarray("value"), varray());
+ bind_method(PackedInt64Array, invert, sarray(), varray());
+ bind_method(PackedInt64Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedInt64Array, to_byte_array, sarray(), varray());
+ bind_method(PackedInt64Array, sort, sarray(), varray());
+
+ /* Float32 Array */
+
+ bind_method(PackedFloat32Array, size, sarray(), varray());
+ bind_method(PackedFloat32Array, empty, sarray(), varray());
+ bind_method(PackedFloat32Array, set, sarray("index", "value"), varray());
+ bind_method(PackedFloat32Array, push_back, sarray("value"), varray());
+ bind_method(PackedFloat32Array, append, sarray("value"), varray());
+ bind_method(PackedFloat32Array, append_array, sarray("array"), varray());
+ bind_method(PackedFloat32Array, remove, sarray("index"), varray());
+ bind_method(PackedFloat32Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedFloat32Array, resize, sarray("new_size"), varray());
+ bind_method(PackedFloat32Array, has, sarray("value"), varray());
+ bind_method(PackedFloat32Array, invert, sarray(), varray());
+ bind_method(PackedFloat32Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedFloat32Array, to_byte_array, sarray(), varray());
+ bind_method(PackedFloat32Array, sort, sarray(), varray());
+
+ /* Float64 Array */
+
+ bind_method(PackedFloat64Array, size, sarray(), varray());
+ bind_method(PackedFloat64Array, empty, sarray(), varray());
+ bind_method(PackedFloat64Array, set, sarray("index", "value"), varray());
+ bind_method(PackedFloat64Array, push_back, sarray("value"), varray());
+ bind_method(PackedFloat64Array, append, sarray("value"), varray());
+ bind_method(PackedFloat64Array, append_array, sarray("array"), varray());
+ bind_method(PackedFloat64Array, remove, sarray("index"), varray());
+ bind_method(PackedFloat64Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedFloat64Array, resize, sarray("new_size"), varray());
+ bind_method(PackedFloat64Array, has, sarray("value"), varray());
+ bind_method(PackedFloat64Array, invert, sarray(), varray());
+ bind_method(PackedFloat64Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedFloat64Array, to_byte_array, sarray(), varray());
+ bind_method(PackedFloat64Array, sort, sarray(), varray());
+
+ /* String Array */
+
+ bind_method(PackedStringArray, size, sarray(), varray());
+ bind_method(PackedStringArray, empty, sarray(), varray());
+ bind_method(PackedStringArray, set, sarray("index", "value"), varray());
+ bind_method(PackedStringArray, push_back, sarray("value"), varray());
+ bind_method(PackedStringArray, append, sarray("value"), varray());
+ bind_method(PackedStringArray, append_array, sarray("array"), varray());
+ bind_method(PackedStringArray, remove, sarray("index"), varray());
+ bind_method(PackedStringArray, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedStringArray, resize, sarray("new_size"), varray());
+ bind_method(PackedStringArray, has, sarray("value"), varray());
+ bind_method(PackedStringArray, invert, sarray(), varray());
+ bind_method(PackedStringArray, subarray, sarray("from", "to"), varray());
+ bind_method(PackedStringArray, to_byte_array, sarray(), varray());
+ bind_method(PackedStringArray, sort, sarray(), varray());
+
+ /* Vector2 Array */
+
+ bind_method(PackedVector2Array, size, sarray(), varray());
+ bind_method(PackedVector2Array, empty, sarray(), varray());
+ bind_method(PackedVector2Array, set, sarray("index", "value"), varray());
+ bind_method(PackedVector2Array, push_back, sarray("value"), varray());
+ bind_method(PackedVector2Array, append, sarray("value"), varray());
+ bind_method(PackedVector2Array, append_array, sarray("array"), varray());
+ bind_method(PackedVector2Array, remove, sarray("index"), varray());
+ bind_method(PackedVector2Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedVector2Array, resize, sarray("new_size"), varray());
+ bind_method(PackedVector2Array, has, sarray("value"), varray());
+ bind_method(PackedVector2Array, invert, sarray(), varray());
+ bind_method(PackedVector2Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedVector2Array, to_byte_array, sarray(), varray());
+
+ /* Vector3 Array */
+
+ bind_method(PackedVector3Array, size, sarray(), varray());
+ bind_method(PackedVector3Array, empty, sarray(), varray());
+ bind_method(PackedVector3Array, set, sarray("index", "value"), varray());
+ bind_method(PackedVector3Array, push_back, sarray("value"), varray());
+ bind_method(PackedVector3Array, append, sarray("value"), varray());
+ bind_method(PackedVector3Array, append_array, sarray("array"), varray());
+ bind_method(PackedVector3Array, remove, sarray("index"), varray());
+ bind_method(PackedVector3Array, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedVector3Array, resize, sarray("new_size"), varray());
+ bind_method(PackedVector3Array, has, sarray("value"), varray());
+ bind_method(PackedVector3Array, invert, sarray(), varray());
+ bind_method(PackedVector3Array, subarray, sarray("from", "to"), varray());
+ bind_method(PackedVector3Array, to_byte_array, sarray(), varray());
+
+ /* Color Array */
+
+ bind_method(PackedColorArray, size, sarray(), varray());
+ bind_method(PackedColorArray, empty, sarray(), varray());
+ bind_method(PackedColorArray, set, sarray("index", "value"), varray());
+ bind_method(PackedColorArray, push_back, sarray("value"), varray());
+ bind_method(PackedColorArray, append, sarray("value"), varray());
+ bind_method(PackedColorArray, append_array, sarray("array"), varray());
+ bind_method(PackedColorArray, remove, sarray("index"), varray());
+ bind_method(PackedColorArray, insert, sarray("at_index", "value"), varray());
+ bind_method(PackedColorArray, resize, sarray("new_size"), varray());
+ bind_method(PackedColorArray, has, sarray("value"), varray());
+ bind_method(PackedColorArray, invert, sarray(), varray());
+ bind_method(PackedColorArray, subarray, sarray("from", "to"), varray());
+ bind_method(PackedColorArray, to_byte_array, sarray(), varray());
/* REGISTER CONSTRUCTORS */
@@ -2497,7 +2072,18 @@ void register_variant_methods() {
}
void unregister_variant_methods() {
- memdelete_arr(_VariantCall::type_funcs);
+ //clear methods
+ for (int i = 0; i < Variant::VARIANT_MAX; i++) {
+ for (List<StringName>::Element *E = _VariantCall::type_internal_method_names[i].front(); E; E = E->next()) {
+ Variant::InternalMethod **m = _VariantCall::type_internal_methods[i].lookup_ptr(E->get());
+ if (*m) {
+ memdelete(*m);
+ }
+ }
+ }
+
+ memdelete_arr(_VariantCall::type_internal_methods);
+ memdelete_arr(_VariantCall::type_internal_method_names);
memdelete_arr(_VariantCall::construct_funcs);
memdelete_arr(_VariantCall::constant_data);
}
diff --git a/core/variant_internal.h b/core/variant_internal.h
index 0e0a1e398f..7893c6d382 100644
--- a/core/variant_internal.h
+++ b/core/variant_internal.h
@@ -113,6 +113,540 @@ public:
_FORCE_INLINE_ static const PackedVector3Array *get_vector3_array(const Variant *v) { return &static_cast<const Variant::PackedArrayRef<Vector3> *>(v->_data.packed_array)->array; }
_FORCE_INLINE_ static PackedColorArray *get_color_array(Variant *v) { return &static_cast<Variant::PackedArrayRef<Color> *>(v->_data.packed_array)->array; }
_FORCE_INLINE_ static const PackedColorArray *get_color_array(const Variant *v) { return &static_cast<const Variant::PackedArrayRef<Color> *>(v->_data.packed_array)->array; }
+
+ _FORCE_INLINE_ static Object **get_object(Variant *v) { return (Object **)&v->_get_obj().obj; }
+ _FORCE_INLINE_ static const Object **get_object(const Variant *v) { return (const Object **)&v->_get_obj().obj; }
+};
+
+template <class T>
+struct VariantGetInternalPtr {
+};
+
+template <>
+struct VariantGetInternalPtr<bool> {
+ static bool *get_ptr(Variant *v) { return VariantInternal::get_bool(v); }
+ static const bool *get_ptr(const Variant *v) { return VariantInternal::get_bool(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<int8_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<uint8_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<int16_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<uint16_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<int32_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<uint32_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<int64_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<uint64_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<char32_t> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<ObjectID> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Error> {
+ static int64_t *get_ptr(Variant *v) { return VariantInternal::get_int(v); }
+ static const int64_t *get_ptr(const Variant *v) { return VariantInternal::get_int(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<float> {
+ static double *get_ptr(Variant *v) { return VariantInternal::get_float(v); }
+ static const double *get_ptr(const Variant *v) { return VariantInternal::get_float(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<double> {
+ static double *get_ptr(Variant *v) { return VariantInternal::get_float(v); }
+ static const double *get_ptr(const Variant *v) { return VariantInternal::get_float(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<String> {
+ static String *get_ptr(Variant *v) { return VariantInternal::get_string(v); }
+ static const String *get_ptr(const Variant *v) { return VariantInternal::get_string(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Vector2> {
+ static Vector2 *get_ptr(Variant *v) { return VariantInternal::get_vector2(v); }
+ static const Vector2 *get_ptr(const Variant *v) { return VariantInternal::get_vector2(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Vector2i> {
+ static Vector2i *get_ptr(Variant *v) { return VariantInternal::get_vector2i(v); }
+ static const Vector2i *get_ptr(const Variant *v) { return VariantInternal::get_vector2i(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Rect2> {
+ static Rect2 *get_ptr(Variant *v) { return VariantInternal::get_rect2(v); }
+ static const Rect2 *get_ptr(const Variant *v) { return VariantInternal::get_rect2(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Rect2i> {
+ static Rect2i *get_ptr(Variant *v) { return VariantInternal::get_rect2i(v); }
+ static const Rect2i *get_ptr(const Variant *v) { return VariantInternal::get_rect2i(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Vector3> {
+ static Vector3 *get_ptr(Variant *v) { return VariantInternal::get_vector3(v); }
+ static const Vector3 *get_ptr(const Variant *v) { return VariantInternal::get_vector3(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Vector3i> {
+ static Vector3i *get_ptr(Variant *v) { return VariantInternal::get_vector3i(v); }
+ static const Vector3i *get_ptr(const Variant *v) { return VariantInternal::get_vector3i(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Transform2D> {
+ static Transform2D *get_ptr(Variant *v) { return VariantInternal::get_transform2d(v); }
+ static const Transform2D *get_ptr(const Variant *v) { return VariantInternal::get_transform2d(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Transform> {
+ static Transform *get_ptr(Variant *v) { return VariantInternal::get_transform(v); }
+ static const Transform *get_ptr(const Variant *v) { return VariantInternal::get_transform(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Plane> {
+ static Plane *get_ptr(Variant *v) { return VariantInternal::get_plane(v); }
+ static const Plane *get_ptr(const Variant *v) { return VariantInternal::get_plane(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Quat> {
+ static Quat *get_ptr(Variant *v) { return VariantInternal::get_quat(v); }
+ static const Quat *get_ptr(const Variant *v) { return VariantInternal::get_quat(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<::AABB> {
+ static ::AABB *get_ptr(Variant *v) { return VariantInternal::get_aabb(v); }
+ static const ::AABB *get_ptr(const Variant *v) { return VariantInternal::get_aabb(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Basis> {
+ static Basis *get_ptr(Variant *v) { return VariantInternal::get_basis(v); }
+ static const Basis *get_ptr(const Variant *v) { return VariantInternal::get_basis(v); }
+};
+
+//
+
+template <>
+struct VariantGetInternalPtr<Color> {
+ static Color *get_ptr(Variant *v) { return VariantInternal::get_color(v); }
+ static const Color *get_ptr(const Variant *v) { return VariantInternal::get_color(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<StringName> {
+ static StringName *get_ptr(Variant *v) { return VariantInternal::get_string_name(v); }
+ static const StringName *get_ptr(const Variant *v) { return VariantInternal::get_string_name(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<NodePath> {
+ static NodePath *get_ptr(Variant *v) { return VariantInternal::get_node_path(v); }
+ static const NodePath *get_ptr(const Variant *v) { return VariantInternal::get_node_path(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<RID> {
+ static RID *get_ptr(Variant *v) { return VariantInternal::get_rid(v); }
+ static const RID *get_ptr(const Variant *v) { return VariantInternal::get_rid(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Callable> {
+ static Callable *get_ptr(Variant *v) { return VariantInternal::get_callable(v); }
+ static const Callable *get_ptr(const Variant *v) { return VariantInternal::get_callable(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Signal> {
+ static Signal *get_ptr(Variant *v) { return VariantInternal::get_signal(v); }
+ static const Signal *get_ptr(const Variant *v) { return VariantInternal::get_signal(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Dictionary> {
+ static Dictionary *get_ptr(Variant *v) { return VariantInternal::get_dictionary(v); }
+ static const Dictionary *get_ptr(const Variant *v) { return VariantInternal::get_dictionary(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<Array> {
+ static Array *get_ptr(Variant *v) { return VariantInternal::get_array(v); }
+ static const Array *get_ptr(const Variant *v) { return VariantInternal::get_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedByteArray> {
+ static PackedByteArray *get_ptr(Variant *v) { return VariantInternal::get_byte_array(v); }
+ static const PackedByteArray *get_ptr(const Variant *v) { return VariantInternal::get_byte_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedInt32Array> {
+ static PackedInt32Array *get_ptr(Variant *v) { return VariantInternal::get_int32_array(v); }
+ static const PackedInt32Array *get_ptr(const Variant *v) { return VariantInternal::get_int32_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedInt64Array> {
+ static PackedInt64Array *get_ptr(Variant *v) { return VariantInternal::get_int64_array(v); }
+ static const PackedInt64Array *get_ptr(const Variant *v) { return VariantInternal::get_int64_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedFloat32Array> {
+ static PackedFloat32Array *get_ptr(Variant *v) { return VariantInternal::get_float32_array(v); }
+ static const PackedFloat32Array *get_ptr(const Variant *v) { return VariantInternal::get_float32_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedFloat64Array> {
+ static PackedFloat64Array *get_ptr(Variant *v) { return VariantInternal::get_float64_array(v); }
+ static const PackedFloat64Array *get_ptr(const Variant *v) { return VariantInternal::get_float64_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedStringArray> {
+ static PackedStringArray *get_ptr(Variant *v) { return VariantInternal::get_string_array(v); }
+ static const PackedStringArray *get_ptr(const Variant *v) { return VariantInternal::get_string_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedVector2Array> {
+ static PackedVector2Array *get_ptr(Variant *v) { return VariantInternal::get_vector2_array(v); }
+ static const PackedVector2Array *get_ptr(const Variant *v) { return VariantInternal::get_vector2_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedVector3Array> {
+ static PackedVector3Array *get_ptr(Variant *v) { return VariantInternal::get_vector3_array(v); }
+ static const PackedVector3Array *get_ptr(const Variant *v) { return VariantInternal::get_vector3_array(v); }
+};
+
+template <>
+struct VariantGetInternalPtr<PackedColorArray> {
+ static PackedColorArray *get_ptr(Variant *v) { return VariantInternal::get_color_array(v); }
+ static const PackedColorArray *get_ptr(const Variant *v) { return VariantInternal::get_color_array(v); }
+};
+
+template <class T>
+struct VariantInternalAccessor {
+};
+
+template <>
+struct VariantInternalAccessor<bool> {
+ static _FORCE_INLINE_ bool get(const Variant *v) { return *VariantInternal::get_bool(v); }
+ static _FORCE_INLINE_ void set(Variant *v, bool p_value) { *VariantInternal::get_bool(v) = p_value; }
+};
+
+#define VARIANT_ACCESSOR_NUMBER(m_type) \
+ template <> \
+ struct VariantInternalAccessor<m_type> { \
+ static _FORCE_INLINE_ m_type get(const Variant *v) { return (m_type)*VariantInternal::get_int(v); } \
+ static _FORCE_INLINE_ void set(Variant *v, m_type p_value) { *VariantInternal::get_int(v) = p_value; } \
+ };
+
+VARIANT_ACCESSOR_NUMBER(int8_t)
+VARIANT_ACCESSOR_NUMBER(uint8_t)
+VARIANT_ACCESSOR_NUMBER(int16_t)
+VARIANT_ACCESSOR_NUMBER(uint16_t)
+VARIANT_ACCESSOR_NUMBER(int32_t)
+VARIANT_ACCESSOR_NUMBER(uint32_t)
+VARIANT_ACCESSOR_NUMBER(int64_t)
+VARIANT_ACCESSOR_NUMBER(uint64_t)
+VARIANT_ACCESSOR_NUMBER(char32_t)
+VARIANT_ACCESSOR_NUMBER(Error)
+VARIANT_ACCESSOR_NUMBER(Margin)
+
+template <>
+struct VariantInternalAccessor<ObjectID> {
+ static _FORCE_INLINE_ ObjectID get(const Variant *v) { return ObjectID(*VariantInternal::get_int(v)); }
+ static _FORCE_INLINE_ void set(Variant *v, ObjectID p_value) { *VariantInternal::get_int(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<float> {
+ static _FORCE_INLINE_ float get(const Variant *v) { return *VariantInternal::get_float(v); }
+ static _FORCE_INLINE_ void set(Variant *v, float p_value) { *VariantInternal::get_float(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<double> {
+ static _FORCE_INLINE_ double get(const Variant *v) { return *VariantInternal::get_float(v); }
+ static _FORCE_INLINE_ void set(Variant *v, double p_value) { *VariantInternal::get_float(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<String> {
+ static _FORCE_INLINE_ const String &get(const Variant *v) { return *VariantInternal::get_string(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const String &p_value) { *VariantInternal::get_string(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Vector2> {
+ static _FORCE_INLINE_ const Vector2 &get(const Variant *v) { return *VariantInternal::get_vector2(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Vector2 &p_value) { *VariantInternal::get_vector2(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Vector2i> {
+ static _FORCE_INLINE_ const Vector2i &get(const Variant *v) { return *VariantInternal::get_vector2i(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Vector2i &p_value) { *VariantInternal::get_vector2i(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Rect2> {
+ static _FORCE_INLINE_ const Rect2 &get(const Variant *v) { return *VariantInternal::get_rect2(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Rect2 &p_value) { *VariantInternal::get_rect2(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Rect2i> {
+ static _FORCE_INLINE_ const Rect2i &get(const Variant *v) { return *VariantInternal::get_rect2i(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Rect2i &p_value) { *VariantInternal::get_rect2i(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Vector3> {
+ static _FORCE_INLINE_ const Vector3 &get(const Variant *v) { return *VariantInternal::get_vector3(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Vector3 &p_value) { *VariantInternal::get_vector3(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Vector3i> {
+ static _FORCE_INLINE_ const Vector3i &get(const Variant *v) { return *VariantInternal::get_vector3i(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Vector3i &p_value) { *VariantInternal::get_vector3i(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Transform2D> {
+ static _FORCE_INLINE_ const Transform2D &get(const Variant *v) { return *VariantInternal::get_transform2d(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Transform2D &p_value) { *VariantInternal::get_transform2d(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Transform> {
+ static _FORCE_INLINE_ const Transform &get(const Variant *v) { return *VariantInternal::get_transform(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Transform &p_value) { *VariantInternal::get_transform(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Plane> {
+ static _FORCE_INLINE_ const Plane &get(const Variant *v) { return *VariantInternal::get_plane(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Plane &p_value) { *VariantInternal::get_plane(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Quat> {
+ static _FORCE_INLINE_ const Quat &get(const Variant *v) { return *VariantInternal::get_quat(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Quat &p_value) { *VariantInternal::get_quat(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<AABB> {
+ static _FORCE_INLINE_ const AABB &get(const Variant *v) { return *VariantInternal::get_aabb(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const AABB &p_value) { *VariantInternal::get_aabb(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Basis> {
+ static _FORCE_INLINE_ const Basis &get(const Variant *v) { return *VariantInternal::get_basis(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Basis &p_value) { *VariantInternal::get_basis(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Color> {
+ static _FORCE_INLINE_ const Color &get(const Variant *v) { return *VariantInternal::get_color(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Color &p_value) { *VariantInternal::get_color(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<StringName> {
+ static _FORCE_INLINE_ const StringName &get(const Variant *v) { return *VariantInternal::get_string_name(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const StringName &p_value) { *VariantInternal::get_string_name(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<NodePath> {
+ static _FORCE_INLINE_ const NodePath &get(const Variant *v) { return *VariantInternal::get_node_path(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const NodePath &p_value) { *VariantInternal::get_node_path(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<RID> {
+ static _FORCE_INLINE_ const RID &get(const Variant *v) { return *VariantInternal::get_rid(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const RID &p_value) { *VariantInternal::get_rid(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Callable> {
+ static _FORCE_INLINE_ const Callable &get(const Variant *v) { return *VariantInternal::get_callable(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Callable &p_value) { *VariantInternal::get_callable(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Signal> {
+ static _FORCE_INLINE_ const Signal &get(const Variant *v) { return *VariantInternal::get_signal(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Signal &p_value) { *VariantInternal::get_signal(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Dictionary> {
+ static _FORCE_INLINE_ const Dictionary &get(const Variant *v) { return *VariantInternal::get_dictionary(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Dictionary &p_value) { *VariantInternal::get_dictionary(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Array> {
+ static _FORCE_INLINE_ const Array &get(const Variant *v) { return *VariantInternal::get_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const Array &p_value) { *VariantInternal::get_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedByteArray> {
+ static _FORCE_INLINE_ const PackedByteArray &get(const Variant *v) { return *VariantInternal::get_byte_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedByteArray &p_value) { *VariantInternal::get_byte_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedInt32Array> {
+ static _FORCE_INLINE_ const PackedInt32Array &get(const Variant *v) { return *VariantInternal::get_int32_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedInt32Array &p_value) { *VariantInternal::get_int32_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedInt64Array> {
+ static _FORCE_INLINE_ const PackedInt64Array &get(const Variant *v) { return *VariantInternal::get_int64_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedInt64Array &p_value) { *VariantInternal::get_int64_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedFloat32Array> {
+ static _FORCE_INLINE_ const PackedFloat32Array &get(const Variant *v) { return *VariantInternal::get_float32_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedFloat32Array &p_value) { *VariantInternal::get_float32_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedFloat64Array> {
+ static _FORCE_INLINE_ const PackedFloat64Array &get(const Variant *v) { return *VariantInternal::get_float64_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedFloat64Array &p_value) { *VariantInternal::get_float64_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedStringArray> {
+ static _FORCE_INLINE_ const PackedStringArray &get(const Variant *v) { return *VariantInternal::get_string_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedStringArray &p_value) { *VariantInternal::get_string_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedVector2Array> {
+ static _FORCE_INLINE_ const PackedVector2Array &get(const Variant *v) { return *VariantInternal::get_vector2_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedVector2Array &p_value) { *VariantInternal::get_vector2_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedVector3Array> {
+ static _FORCE_INLINE_ const PackedVector3Array &get(const Variant *v) { return *VariantInternal::get_vector3_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedVector3Array &p_value) { *VariantInternal::get_vector3_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<PackedColorArray> {
+ static _FORCE_INLINE_ const PackedColorArray &get(const Variant *v) { return *VariantInternal::get_color_array(v); }
+ static _FORCE_INLINE_ void set(Variant *v, const PackedColorArray &p_value) { *VariantInternal::get_color_array(v) = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Object *> {
+ static _FORCE_INLINE_ Object *get(const Variant *v) { return const_cast<Object *>(*VariantInternal::get_object(v)); }
+ static _FORCE_INLINE_ void set(Variant *v, const Object *p_value) { *VariantInternal::get_object(v) = const_cast<Object *>(p_value); }
+};
+
+template <>
+struct VariantInternalAccessor<Variant> {
+ static _FORCE_INLINE_ Variant &get(Variant *v) { return *v; }
+ static _FORCE_INLINE_ const Variant &get(const Variant *v) { return *v; }
+ static _FORCE_INLINE_ void set(Variant *v, const Variant &p_value) { *v = p_value; }
+};
+
+template <>
+struct VariantInternalAccessor<Vector<Variant>> {
+ static _FORCE_INLINE_ Vector<Variant> get(const Variant *v) {
+ Vector<Variant> ret;
+ int s = VariantInternal::get_array(v)->size();
+ ret.resize(s);
+ for (int i = 0; i < s; i++) {
+ ret.write[i] = VariantInternal::get_array(v)->get(i);
+ }
+
+ return ret;
+ }
+ static _FORCE_INLINE_ void set(Variant *v, const Vector<Variant> &p_value) {
+ int s = p_value.size();
+ VariantInternal::get_array(v)->resize(s);
+ for (int i = 0; i < s; i++) {
+ VariantInternal::get_array(v)->set(i, p_value[i]);
+ }
+ }
};
#endif // VARIANT_INTERNAL_H
diff --git a/core/variant_op.cpp b/core/variant_op.cpp
index 533b056f91..47539df856 100644
--- a/core/variant_op.cpp
+++ b/core/variant_op.cpp
@@ -30,9 +30,9 @@
#include "variant.h"
+#include "core/class_db.h"
#include "core/core_string_names.h"
#include "core/debugger/engine_debugger.h"
-#include "core/object.h"
#define CASE_TYPE_ALL(PREFIX, OP) \
CASE_TYPE(PREFIX, OP, INT) \
diff --git a/doc/classes/AABB.xml b/doc/classes/AABB.xml
index faa380ff33..c547563a6e 100644
--- a/doc/classes/AABB.xml
+++ b/doc/classes/AABB.xml
@@ -10,6 +10,8 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="Advanced vector math">https://docs.godotengine.org/en/latest/tutorials/math/vectors_advanced.html</link>
</tutorials>
<methods>
<method name="AABB">
diff --git a/doc/classes/AnimatedSprite2D.xml b/doc/classes/AnimatedSprite2D.xml
index e23a4fe9f8..39228eab79 100644
--- a/doc/classes/AnimatedSprite2D.xml
+++ b/doc/classes/AnimatedSprite2D.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="2D Sprite animation">https://docs.godotengine.org/en/latest/tutorials/2d/2d_sprite_animation.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="is_playing" qualifiers="const">
diff --git a/doc/classes/Animation.xml b/doc/classes/Animation.xml
index ceef16f158..d34308501c 100644
--- a/doc/classes/Animation.xml
+++ b/doc/classes/Animation.xml
@@ -681,26 +681,26 @@
Returns the update mode of a value track.
</description>
</method>
- <method name="value_track_set_update_mode">
- <return type="void">
+ <method name="value_track_interpolate" qualifiers="const">
+ <return type="Variant">
</return>
<argument index="0" name="track_idx" type="int">
</argument>
- <argument index="1" name="mode" type="int" enum="Animation.UpdateMode">
+ <argument index="1" name="time_sec" type="float">
</argument>
<description>
- Sets the update mode (see [enum UpdateMode]) of a value track.
+ Returns the interpolated value at the given time (in seconds). The [code]track_idx[/code] must be the index of a value track.
</description>
</method>
- <method name="value_track_interpolate" qualifiers="const">
- <return type="float">
+ <method name="value_track_set_update_mode">
+ <return type="void">
</return>
<argument index="0" name="track_idx" type="int">
</argument>
- <argument index="1" name="time_sec" type="float">
+ <argument index="1" name="mode" type="int" enum="Animation.UpdateMode">
</argument>
<description>
- Returns the interpolated value at the given time (in seconds). The [code]track_idx[/code] must be the index of a value track.
+ Sets the update mode (see [enum UpdateMode]) of a value track.
</description>
</method>
</methods>
diff --git a/doc/classes/AnimationNodeAdd3.xml b/doc/classes/AnimationNodeAdd3.xml
index 94a6ae4221..0e49ac7bbf 100644
--- a/doc/classes/AnimationNodeAdd3.xml
+++ b/doc/classes/AnimationNodeAdd3.xml
@@ -12,6 +12,7 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AnimationNodeAnimation.xml b/doc/classes/AnimationNodeAnimation.xml
index d8ac5413fd..3f0843c112 100644
--- a/doc/classes/AnimationNodeAnimation.xml
+++ b/doc/classes/AnimationNodeAnimation.xml
@@ -8,6 +8,8 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AnimationNodeBlend2.xml b/doc/classes/AnimationNodeBlend2.xml
index e2cd12e685..e509a2df6c 100644
--- a/doc/classes/AnimationNodeBlend2.xml
+++ b/doc/classes/AnimationNodeBlend2.xml
@@ -8,6 +8,8 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AnimationNodeBlendSpace2D.xml b/doc/classes/AnimationNodeBlendSpace2D.xml
index 460c11cc5e..abbc8cb2e6 100644
--- a/doc/classes/AnimationNodeBlendSpace2D.xml
+++ b/doc/classes/AnimationNodeBlendSpace2D.xml
@@ -10,6 +10,7 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="add_blend_point">
diff --git a/doc/classes/AnimationNodeOneShot.xml b/doc/classes/AnimationNodeOneShot.xml
index d5793e5839..65ab363e1f 100644
--- a/doc/classes/AnimationNodeOneShot.xml
+++ b/doc/classes/AnimationNodeOneShot.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="get_mix_mode" qualifiers="const">
diff --git a/doc/classes/AnimationNodeOutput.xml b/doc/classes/AnimationNodeOutput.xml
index 7640f4dcfa..c4150d7e82 100644
--- a/doc/classes/AnimationNodeOutput.xml
+++ b/doc/classes/AnimationNodeOutput.xml
@@ -7,6 +7,8 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AnimationNodeTimeScale.xml b/doc/classes/AnimationNodeTimeScale.xml
index 334fdb0b95..2ce8309418 100644
--- a/doc/classes/AnimationNodeTimeScale.xml
+++ b/doc/classes/AnimationNodeTimeScale.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AnimationNodeTransition.xml b/doc/classes/AnimationNodeTransition.xml
index 8338f0d39a..73c7006768 100644
--- a/doc/classes/AnimationNodeTransition.xml
+++ b/doc/classes/AnimationNodeTransition.xml
@@ -8,6 +8,8 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="get_input_caption" qualifiers="const">
diff --git a/doc/classes/AnimationPlayer.xml b/doc/classes/AnimationPlayer.xml
index ac91272e00..de2087d930 100644
--- a/doc/classes/AnimationPlayer.xml
+++ b/doc/classes/AnimationPlayer.xml
@@ -11,6 +11,7 @@
<tutorials>
<link title="2D Sprite animation">https://docs.godotengine.org/en/latest/tutorials/2d/2d_sprite_animation.html</link>
<link title="Animation tutorial index">https://docs.godotengine.org/en/latest/tutorials/animation/index.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="add_animation">
diff --git a/doc/classes/AnimationTree.xml b/doc/classes/AnimationTree.xml
index cc8e83f509..262b5addb7 100644
--- a/doc/classes/AnimationTree.xml
+++ b/doc/classes/AnimationTree.xml
@@ -8,7 +8,7 @@
</description>
<tutorials>
<link title="AnimationTree">https://docs.godotengine.org/en/latest/tutorials/animation/animation_tree.html</link>
- <link title="Third-person shooter demo code repository">https://github.com/godotengine/tps-demo</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="advance">
diff --git a/doc/classes/Area2D.xml b/doc/classes/Area2D.xml
index e98c0af0d9..72c40478bb 100644
--- a/doc/classes/Area2D.xml
+++ b/doc/classes/Area2D.xml
@@ -8,6 +8,9 @@
</description>
<tutorials>
<link title="Using Area2D">https://docs.godotengine.org/en/latest/tutorials/physics/using_area_2d.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="2D Pong Demo">https://godotengine.org/asset-library/asset/121</link>
+ <link title="2D Platformer Demo">https://godotengine.org/asset-library/asset/120</link>
</tutorials>
<methods>
<method name="get_collision_layer_bit" qualifiers="const">
@@ -88,7 +91,8 @@
</methods>
<members>
<member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="1.0">
- The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping).
+ The rate at which objects stop spinning in this area. Represents the angular velocity lost per second.
+ See [member ProjectSettings.physics/2d/default_angular_damp] for more details about damping.
</member>
<member name="audio_bus_name" type="StringName" setter="set_audio_bus_name" getter="get_audio_bus_name" default="@&quot;Master&quot;">
The name of the area's audio bus.
@@ -115,7 +119,8 @@
The area's gravity vector (not normalized). If gravity is a point (see [member gravity_point]), this will be the point of attraction.
</member>
<member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="0.1">
- The rate at which objects stop moving in this area. Represents the linear velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping).
+ The rate at which objects stop moving in this area. Represents the linear velocity lost per second.
+ See [member ProjectSettings.physics/2d/default_linear_damp] for more details about damping.
</member>
<member name="monitorable" type="bool" setter="set_monitorable" getter="is_monitorable" default="true">
If [code]true[/code], other monitoring areas can detect this area.
diff --git a/doc/classes/Area3D.xml b/doc/classes/Area3D.xml
index ad9eff3a64..92a8465762 100644
--- a/doc/classes/Area3D.xml
+++ b/doc/classes/Area3D.xml
@@ -7,6 +7,8 @@
3D area that detects [CollisionObject3D] nodes overlapping, entering, or exiting. Can also alter or override local physics parameters (gravity, damping).
</description>
<tutorials>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="GUI in 3D Demo">https://godotengine.org/asset-library/asset/127</link>
</tutorials>
<methods>
<method name="get_collision_layer_bit" qualifiers="const">
@@ -87,7 +89,8 @@
</methods>
<members>
<member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="0.1">
- The rate at which objects stop spinning in this area. Represents the angular velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping).
+ The rate at which objects stop spinning in this area. Represents the angular velocity lost per second.
+ See [member ProjectSettings.physics/3d/default_angular_damp] for more details about damping.
</member>
<member name="audio_bus_name" type="StringName" setter="set_audio_bus" getter="get_audio_bus" default="@&quot;Master&quot;">
The name of the area's audio bus.
@@ -114,7 +117,8 @@
The area's gravity vector (not normalized). If gravity is a point (see [member gravity_point]), this will be the point of attraction.
</member>
<member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="0.1">
- The rate at which objects stop moving in this area. Represents the linear velocity lost per second. Values range from [code]0[/code] (no damping) to [code]1[/code] (full damping).
+ The rate at which objects stop moving in this area. Represents the linear velocity lost per second.
+ See [member ProjectSettings.physics/3d/default_linear_damp] for more details about damping.
</member>
<member name="monitorable" type="bool" setter="set_monitorable" getter="is_monitorable" default="true">
If [code]true[/code], other monitoring areas can detect this area.
diff --git a/doc/classes/ArrayMesh.xml b/doc/classes/ArrayMesh.xml
index 4edf69ccb2..dc834474ad 100644
--- a/doc/classes/ArrayMesh.xml
+++ b/doc/classes/ArrayMesh.xml
@@ -69,7 +69,6 @@
<argument index="2" name="blend_shapes" type="Array" default="[ ]">
</argument>
<argument index="3" name="lods" type="Dictionary" default="{
-
}">
</argument>
<argument index="4" name="compress_flags" type="int" default="31744">
diff --git a/doc/classes/AudioEffect.xml b/doc/classes/AudioEffect.xml
index 60bf15ce57..955285bd2e 100644
--- a/doc/classes/AudioEffect.xml
+++ b/doc/classes/AudioEffect.xml
@@ -7,6 +7,7 @@
Base resource for audio bus. Applies an audio effect on the bus that the resource is applied on.
</description>
<tutorials>
+ <link title="Audio Mic Record Demo">https://godotengine.org/asset-library/asset/527</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AudioEffectRecord.xml b/doc/classes/AudioEffectRecord.xml
index 6617d16290..872ddf3b0f 100644
--- a/doc/classes/AudioEffectRecord.xml
+++ b/doc/classes/AudioEffectRecord.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="Recording with microphone">https://docs.godotengine.org/en/latest/tutorials/audio/recording_with_microphone.html</link>
+ <link title="Audio Mic Record Demo">https://godotengine.org/asset-library/asset/527</link>
</tutorials>
<methods>
<method name="get_recording" qualifiers="const">
diff --git a/doc/classes/AudioEffectReverb.xml b/doc/classes/AudioEffectReverb.xml
index 26eb2be753..fbe68cde0e 100644
--- a/doc/classes/AudioEffectReverb.xml
+++ b/doc/classes/AudioEffectReverb.xml
@@ -8,6 +8,7 @@
Simulates rooms of different sizes. Its parameters can be adjusted to simulate the sound of a specific room.
</description>
<tutorials>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AudioServer.xml b/doc/classes/AudioServer.xml
index d5fd5d8f00..dafc0065f6 100644
--- a/doc/classes/AudioServer.xml
+++ b/doc/classes/AudioServer.xml
@@ -8,6 +8,9 @@
</description>
<tutorials>
<link title="Audio buses">https://docs.godotengine.org/en/latest/tutorials/audio/audio_buses.html</link>
+ <link title="Audio Device Changer Demo">https://godotengine.org/asset-library/asset/525</link>
+ <link title="Audio Mic Record Demo">https://godotengine.org/asset-library/asset/527</link>
+ <link title="Audio Spectrum Demo">https://godotengine.org/asset-library/asset/528</link>
</tutorials>
<methods>
<method name="add_bus">
diff --git a/doc/classes/AudioStream.xml b/doc/classes/AudioStream.xml
index 58768dc008..bbfec579bb 100644
--- a/doc/classes/AudioStream.xml
+++ b/doc/classes/AudioStream.xml
@@ -8,6 +8,9 @@
</description>
<tutorials>
<link title="Audio streams">https://docs.godotengine.org/en/latest/tutorials/audio/audio_streams.html</link>
+ <link title="Audio Generator Demo">https://godotengine.org/asset-library/asset/526</link>
+ <link title="Audio Mic Record Demo">https://godotengine.org/asset-library/asset/527</link>
+ <link title="Audio Spectrum Demo">https://godotengine.org/asset-library/asset/528</link>
</tutorials>
<methods>
<method name="get_length" qualifiers="const">
diff --git a/doc/classes/AudioStreamGenerator.xml b/doc/classes/AudioStreamGenerator.xml
index 51254f9305..a273beb5af 100644
--- a/doc/classes/AudioStreamGenerator.xml
+++ b/doc/classes/AudioStreamGenerator.xml
@@ -5,7 +5,7 @@
<description>
</description>
<tutorials>
- <link title="Audio generator demo project">https://github.com/godotengine/godot-demo-projects/tree/master/audio/generator</link>
+ <link title="Audio Generator Demo">https://godotengine.org/asset-library/asset/526</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AudioStreamPlayback.xml b/doc/classes/AudioStreamPlayback.xml
index f928d54526..da75ff206c 100644
--- a/doc/classes/AudioStreamPlayback.xml
+++ b/doc/classes/AudioStreamPlayback.xml
@@ -7,6 +7,7 @@
Can play, loop, pause a scroll through audio. See [AudioStream] and [AudioStreamOGGVorbis] for usage.
</description>
<tutorials>
+ <link title="Audio Generator Demo">https://godotengine.org/asset-library/asset/526</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/AudioStreamPlayer.xml b/doc/classes/AudioStreamPlayer.xml
index 86048ca8c1..55190c5f9f 100644
--- a/doc/classes/AudioStreamPlayer.xml
+++ b/doc/classes/AudioStreamPlayer.xml
@@ -8,6 +8,11 @@
</description>
<tutorials>
<link title="Audio streams">https://docs.godotengine.org/en/latest/tutorials/audio/audio_streams.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="Audio Device Changer Demo">https://godotengine.org/asset-library/asset/525</link>
+ <link title="Audio Generator Demo">https://godotengine.org/asset-library/asset/526</link>
+ <link title="Audio Mic Record Demo">https://godotengine.org/asset-library/asset/527</link>
+ <link title="Audio Spectrum Demo">https://godotengine.org/asset-library/asset/528</link>
</tutorials>
<methods>
<method name="get_playback_position">
diff --git a/doc/classes/BaseButton.xml b/doc/classes/BaseButton.xml
index bf4d9383ac..e3045f9611 100644
--- a/doc/classes/BaseButton.xml
+++ b/doc/classes/BaseButton.xml
@@ -51,9 +51,6 @@
<member name="disabled" type="bool" setter="set_disabled" getter="is_disabled" default="false">
If [code]true[/code], the button is in disabled state and can't be clicked or toggled.
</member>
- <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" enum="Control.FocusMode" default="2">
- Focus access mode to use when switching between enabled/disabled (see [member Control.focus_mode] and [member disabled]).
- </member>
<member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="2" />
<member name="group" type="ButtonGroup" setter="set_button_group" getter="get_button_group">
[ButtonGroup] associated to the button.
diff --git a/doc/classes/Basis.xml b/doc/classes/Basis.xml
index c614a281ae..42ca3ad24b 100644
--- a/doc/classes/Basis.xml
+++ b/doc/classes/Basis.xml
@@ -10,8 +10,13 @@
For more information, read the "Matrices and transforms" documentation article.
</description>
<tutorials>
+ <link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
<link title="Matrices and transforms">https://docs.godotengine.org/en/latest/tutorials/math/matrices_and_transforms.html</link>
<link title="Using 3D transforms">https://docs.godotengine.org/en/latest/tutorials/3d/using_transforms.html</link>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
+ <link title="2.5D Demo">https://godotengine.org/asset-library/asset/583</link>
</tutorials>
<methods>
<method name="Basis">
@@ -106,8 +111,6 @@
</return>
<argument index="0" name="b" type="Basis">
</argument>
- <argument index="1" name="epsilon" type="float" default="1e-05">
- </argument>
<description>
Returns [code]true[/code] if this basis and [code]b[/code] are approximately equal, by calling [code]is_equal_approx[/code] on each component.
</description>
diff --git a/doc/classes/BoxShape3D.xml b/doc/classes/BoxShape3D.xml
index fd08da148d..d8cbd8b980 100644
--- a/doc/classes/BoxShape3D.xml
+++ b/doc/classes/BoxShape3D.xml
@@ -7,6 +7,9 @@
3D box shape that can be a child of a [PhysicsBody3D] or [Area3D].
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Button.xml b/doc/classes/Button.xml
index e0ccda957f..df47fa8bec 100644
--- a/doc/classes/Button.xml
+++ b/doc/classes/Button.xml
@@ -36,6 +36,8 @@
See also [BaseButton] which contains common properties and methods associated with this node.
</description>
<tutorials>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Callable.xml b/doc/classes/Callable.xml
index 3bbee993ac..ad5c549fee 100644
--- a/doc/classes/Callable.xml
+++ b/doc/classes/Callable.xml
@@ -47,6 +47,12 @@
Creates a new [Callable] for the method called [code]method_name[/code] in the specified [code]object[/code].
</description>
</method>
+ <method name="bind" qualifiers="vararg">
+ <return type="void">
+ </return>
+ <description>
+ </description>
+ </method>
<method name="call" qualifiers="vararg">
<return type="Variant">
</return>
@@ -106,6 +112,14 @@
<description>
</description>
</method>
+ <method name="unbind">
+ <return type="Callable">
+ </return>
+ <argument index="0" name="argcount" type="int">
+ </argument>
+ <description>
+ </description>
+ </method>
</methods>
<constants>
</constants>
diff --git a/doc/classes/Camera2D.xml b/doc/classes/Camera2D.xml
index ad49216b34..c7ee915109 100644
--- a/doc/classes/Camera2D.xml
+++ b/doc/classes/Camera2D.xml
@@ -9,6 +9,9 @@
Note that the [Camera2D] node's [code]position[/code] doesn't represent the actual position of the screen, which may differ due to applied smoothing or limits. You can use [method get_camera_screen_center] to get the real position.
</description>
<tutorials>
+ <link title="2D Platformer Demo">https://godotengine.org/asset-library/asset/120</link>
+ <link title="2D Isometric Demo">https://godotengine.org/asset-library/asset/112</link>
+ <link title="2D HDR Demo">https://godotengine.org/asset-library/asset/110</link>
</tutorials>
<methods>
<method name="align">
diff --git a/doc/classes/Camera3D.xml b/doc/classes/Camera3D.xml
index 598b4bd685..b6a108fb25 100644
--- a/doc/classes/Camera3D.xml
+++ b/doc/classes/Camera3D.xml
@@ -7,6 +7,7 @@
[Camera3D] is a special node that displays what is visible from its current location. Cameras register themselves in the nearest [Viewport] node (when ascending the tree). Only one camera can be active per viewport. If no viewport is available ascending the tree, the camera will register in the global viewport. In other words, a camera just provides 3D display capabilities to a [Viewport], and, without one, a scene registered in that [Viewport] (or higher viewports) can't be displayed.
</description>
<tutorials>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="clear_current">
diff --git a/doc/classes/CanvasItem.xml b/doc/classes/CanvasItem.xml
index 3524a5d22b..11000ce8d5 100644
--- a/doc/classes/CanvasItem.xml
+++ b/doc/classes/CanvasItem.xml
@@ -14,6 +14,7 @@
<tutorials>
<link title="Viewport and canvas transforms">https://docs.godotengine.org/en/latest/tutorials/2d/2d_transforms.html</link>
<link title="Custom drawing in 2D">https://docs.godotengine.org/en/latest/tutorials/2d/custom_drawing_in_2d.html</link>
+ <link title="Audio Spectrum Demo">https://godotengine.org/asset-library/asset/528</link>
</tutorials>
<methods>
<method name="_draw" qualifiers="virtual">
@@ -606,9 +607,6 @@
<member name="show_behind_parent" type="bool" setter="set_draw_behind_parent" getter="is_draw_behind_parent_enabled" default="false">
If [code]true[/code], the object draws behind its parent.
</member>
- <member name="toplevel" type="bool" setter="set_as_toplevel" getter="is_set_as_toplevel">
- If [code]true[/code], the node will not inherit its transform from parent [CanvasItem]s.
- </member>
<member name="show_on_top" type="bool" setter="_set_on_top" getter="_is_on_top">
If [code]true[/code], the object draws on top of its parent.
</member>
@@ -618,6 +616,9 @@
<member name="texture_repeat" type="int" setter="set_texture_repeat" getter="get_texture_repeat" enum="CanvasItem.TextureRepeat" default="0">
The texture repeating mode to use on this [CanvasItem].
</member>
+ <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level" default="false">
+ If [code]true[/code], the node will not inherit its transform from parent [CanvasItem]s.
+ </member>
<member name="use_parent_material" type="bool" setter="set_use_parent_material" getter="get_use_parent_material" default="false">
If [code]true[/code], the parent [CanvasItem]'s [member material] property is used as this one's material.
</member>
diff --git a/doc/classes/CanvasLayer.xml b/doc/classes/CanvasLayer.xml
index 89cd28b617..9d952cdba3 100644
--- a/doc/classes/CanvasLayer.xml
+++ b/doc/classes/CanvasLayer.xml
@@ -9,6 +9,7 @@
<tutorials>
<link title="Viewport and canvas transforms">https://docs.godotengine.org/en/latest/tutorials/2d/2d_transforms.html</link>
<link title="Canvas layers">https://docs.godotengine.org/en/latest/tutorials/2d/canvas_layers.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="get_canvas" qualifiers="const">
diff --git a/doc/classes/CapsuleShape3D.xml b/doc/classes/CapsuleShape3D.xml
index f56d94dc63..27a6242bc9 100644
--- a/doc/classes/CapsuleShape3D.xml
+++ b/doc/classes/CapsuleShape3D.xml
@@ -7,6 +7,7 @@
Capsule shape for collisions.
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/CollisionShape2D.xml b/doc/classes/CollisionShape2D.xml
index b4fcf9cd88..c03eba82ff 100644
--- a/doc/classes/CollisionShape2D.xml
+++ b/doc/classes/CollisionShape2D.xml
@@ -8,6 +8,9 @@
</description>
<tutorials>
<link title="Physics introduction">https://docs.godotengine.org/en/latest/tutorials/physics/physics_introduction.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="2D Pong Demo">https://godotengine.org/asset-library/asset/121</link>
+ <link title="2D Kinematic Character Demo">https://godotengine.org/asset-library/asset/113</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/CollisionShape3D.xml b/doc/classes/CollisionShape3D.xml
index 177900dd4f..5590947a4f 100644
--- a/doc/classes/CollisionShape3D.xml
+++ b/doc/classes/CollisionShape3D.xml
@@ -8,6 +8,9 @@
</description>
<tutorials>
<link title="Physics introduction">https://docs.godotengine.org/en/latest/tutorials/physics/physics_introduction.html</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="make_convex_from_siblings">
diff --git a/doc/classes/Color.xml b/doc/classes/Color.xml
index 1d249a253c..ef438e422a 100644
--- a/doc/classes/Color.xml
+++ b/doc/classes/Color.xml
@@ -11,6 +11,9 @@
[url=https://raw.githubusercontent.com/godotengine/godot-docs/master/img/color_constants.png]Color constants cheatsheet[/url]
</description>
<tutorials>
+ <link title="2D GD Paint Demo">https://godotengine.org/asset-library/asset/517</link>
+ <link title="Tween Demo">https://godotengine.org/asset-library/asset/146</link>
+ <link title="GUI Drag And Drop Demo">https://godotengine.org/asset-library/asset/133</link>
</tutorials>
<methods>
<method name="Color">
diff --git a/doc/classes/ColorPicker.xml b/doc/classes/ColorPicker.xml
index d8b4a8f76c..aea3542867 100644
--- a/doc/classes/ColorPicker.xml
+++ b/doc/classes/ColorPicker.xml
@@ -7,6 +7,7 @@
Displays a color picker widget. Useful for selecting a color from an RGB/RGBA colorspace.
</description>
<tutorials>
+ <link title="Tween Demo">https://godotengine.org/asset-library/asset/146</link>
</tutorials>
<methods>
<method name="add_preset">
diff --git a/doc/classes/ColorPickerButton.xml b/doc/classes/ColorPickerButton.xml
index 36f7880060..76cc49a043 100644
--- a/doc/classes/ColorPickerButton.xml
+++ b/doc/classes/ColorPickerButton.xml
@@ -8,6 +8,8 @@
See also [BaseButton] which contains common properties and methods associated with this node.
</description>
<tutorials>
+ <link title="GUI Drag And Drop Demo">https://godotengine.org/asset-library/asset/133</link>
+ <link title="2D GD Paint Demo">https://godotengine.org/asset-library/asset/517</link>
</tutorials>
<methods>
<method name="get_picker">
diff --git a/doc/classes/ColorRect.xml b/doc/classes/ColorRect.xml
index 9bfcf5071d..072759e383 100644
--- a/doc/classes/ColorRect.xml
+++ b/doc/classes/ColorRect.xml
@@ -7,6 +7,7 @@
Displays a colored rectangle.
</description>
<tutorials>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/ConcavePolygonShape3D.xml b/doc/classes/ConcavePolygonShape3D.xml
index 20402d350a..3e83202472 100644
--- a/doc/classes/ConcavePolygonShape3D.xml
+++ b/doc/classes/ConcavePolygonShape3D.xml
@@ -8,6 +8,7 @@
Note: when used for collision, [ConcavePolygonShape3D] is intended to work with static [PhysicsBody3D] nodes like [StaticBody3D] and will not work with [KinematicBody3D] or [RigidBody3D] with a mode other than Static.
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
</tutorials>
<methods>
<method name="get_faces" qualifiers="const">
diff --git a/doc/classes/Control.xml b/doc/classes/Control.xml
index bb00ac33bf..f495bfe894 100644
--- a/doc/classes/Control.xml
+++ b/doc/classes/Control.xml
@@ -18,6 +18,7 @@
<tutorials>
<link title="GUI tutorial index">https://docs.godotengine.org/en/latest/tutorials/gui/index.html</link>
<link title="Custom drawing in 2D">https://docs.godotengine.org/en/latest/tutorials/2d/custom_drawing_in_2d.html</link>
+ <link title="All GUI Demos">https://github.com/godotengine/godot-demo-projects/tree/master/gui</link>
</tutorials>
<methods>
<method name="_clips_input" qualifiers="virtual">
@@ -668,7 +669,7 @@
<return type="void">
</return>
<description>
- Invalidates the size cache in this node and in parent nodes up to toplevel. Intended to be used with [method get_minimum_size] when the return value is changed. Setting [member rect_min_size] directly calls this method automatically.
+ Invalidates the size cache in this node and in parent nodes up to top_level. Intended to be used with [method get_minimum_size] when the return value is changed. Setting [member rect_min_size] directly calls this method automatically.
</description>
</method>
<method name="release_focus">
diff --git a/doc/classes/ConvexPolygonShape3D.xml b/doc/classes/ConvexPolygonShape3D.xml
index c036f80e2d..e18d716255 100644
--- a/doc/classes/ConvexPolygonShape3D.xml
+++ b/doc/classes/ConvexPolygonShape3D.xml
@@ -7,6 +7,7 @@
Convex polygon shape resource, which can be added to a [PhysicsBody3D] or area.
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/CylinderShape3D.xml b/doc/classes/CylinderShape3D.xml
index eb12568e71..99334ceae6 100644
--- a/doc/classes/CylinderShape3D.xml
+++ b/doc/classes/CylinderShape3D.xml
@@ -7,6 +7,9 @@
Cylinder shape for collisions.
</description>
<tutorials>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Dictionary.xml b/doc/classes/Dictionary.xml
index 7123deb206..cb60d6e621 100644
--- a/doc/classes/Dictionary.xml
+++ b/doc/classes/Dictionary.xml
@@ -74,6 +74,8 @@
</description>
<tutorials>
<link title="GDScript basics: Dictionary">https://docs.godotengine.org/en/latest/getting_started/scripting/gdscript/gdscript_basics.html#dictionary</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="clear">
diff --git a/doc/classes/DisplayServer.xml b/doc/classes/DisplayServer.xml
index 28194587ab..53776b7752 100644
--- a/doc/classes/DisplayServer.xml
+++ b/doc/classes/DisplayServer.xml
@@ -521,6 +521,18 @@
<argument index="0" name="screen" type="int" default="-1">
</argument>
<description>
+ Returns the dots per inch density of the specified screen. If [code]screen[/code] is [/code]SCREEN_OF_MAIN_WINDOW[/code] (the default value), a screen with the main window will be used.
+ [b]Note:[/b] On macOS, returned value is inaccurate if fractional display scaling mode is used.
+ [b]Note:[/b] On Android devices, the actual screen densities are grouped into six generalized densities:
+ [codeblock]
+ ldpi - 120 dpi
+ mdpi - 160 dpi
+ hdpi - 240 dpi
+ xhdpi - 320 dpi
+ xxhdpi - 480 dpi
+ xxxhdpi - 640 dpi
+ [/codeblock]
+ [b]Note:[/b] This method is implemented on Android, Linux, macOS and Windows. Returns [code]72[/code] on unsupported platforms.
</description>
</method>
<method name="screen_get_max_scale" qualifiers="const">
diff --git a/doc/classes/DynamicFont.xml b/doc/classes/DynamicFont.xml
index 0b9b97f54a..f687937e27 100644
--- a/doc/classes/DynamicFont.xml
+++ b/doc/classes/DynamicFont.xml
@@ -15,6 +15,7 @@
[b]Note:[/b] DynamicFont doesn't support features such as kerning, right-to-left typesetting, ligatures, text shaping, variable fonts and optional font features yet. If you wish to "bake" an optional font feature into a TTF font file, you can use [url=https://fontforge.org/]FontForge[/url] to do so. In FontForge, use [b]File &gt; Generate Fonts[/b], click [b]Options[/b], choose the desired features then generate the font.
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="add_fallback">
diff --git a/doc/classes/DynamicFontData.xml b/doc/classes/DynamicFontData.xml
index 483da96f3f..45585f17e0 100644
--- a/doc/classes/DynamicFontData.xml
+++ b/doc/classes/DynamicFontData.xml
@@ -7,6 +7,7 @@
Used with [DynamicFont] to describe the location of a vector font file for dynamic rendering at runtime.
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Environment.xml b/doc/classes/Environment.xml
index caee6a0c07..104c149784 100644
--- a/doc/classes/Environment.xml
+++ b/doc/classes/Environment.xml
@@ -13,26 +13,29 @@
<tutorials>
<link title="Environment and post-processing">https://docs.godotengine.org/en/latest/tutorials/3d/environment_and_post_processing.html</link>
<link title="Light transport in game engines">https://docs.godotengine.org/en/latest/tutorials/3d/high_dynamic_range.html</link>
+ <link title="3D Material Testers Demo">https://godotengine.org/asset-library/asset/123</link>
+ <link title="2D HDR Demo">https://godotengine.org/asset-library/asset/110</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
- <method name="is_glow_level_enabled" qualifiers="const">
- <return type="bool">
+ <method name="get_glow_level" qualifiers="const">
+ <return type="float">
</return>
<argument index="0" name="idx" type="int">
</argument>
<description>
- Returns [code]true[/code] if the glow level [code]idx[/code] is specified, [code]false[/code] otherwise.
+ Returns the intensity of the glow level [code]idx[/code].
</description>
</method>
- <method name="set_glow_level_enabled">
+ <method name="set_glow_level">
<return type="void">
</return>
<argument index="0" name="idx" type="int">
</argument>
- <argument index="1" name="enabled" type="bool">
+ <argument index="1" name="intensity" type="float">
</argument>
<description>
- Enables or disables the glow level at index [code]idx[/code]. Each level relies on the previous level. This means that enabling higher glow levels will slow down the glow effect rendering, even if previous levels aren't enabled.
+ Sets the intensity of the glow level [code]idx[/code]. A value above [code]0.0[/code] enables the level. Each level relies on the previous level. This means that enabling higher glow levels will slow down the glow effect rendering, even if previous levels aren't enabled.
</description>
</method>
</methods>
@@ -95,6 +98,10 @@
<member name="background_mode" type="int" setter="set_background" getter="get_background" enum="Environment.BGMode" default="0">
The background mode. See [enum BGMode] for possible values.
</member>
+ <member name="fog_aerial_perspective" type="float" setter="set_fog_aerial_perspective" getter="get_fog_aerial_perspective" default="0.0">
+ Blend factor between the fog's color and the color of the background [Sky]. Must have [member background_mode] set to [constant BG_SKY].
+ This is useful to simulate [url=https://en.wikipedia.org/wiki/Aerial_perspective]aerial perspective[/url] in large scenes with low density fog. However, it is not very useful for high-density fog, as the sky will shine through. When set to [code]1.0[/code], the fog color comes completely from the [Sky]. If set to [code]0.0[/code], aerial perspective is disabled.
+ </member>
<member name="fog_density" type="float" setter="set_fog_density" getter="get_fog_density" default="0.001">
</member>
<member name="fog_enabled" type="bool" setter="set_fog_enabled" getter="is_fog_enabled" default="false">
@@ -129,33 +136,36 @@
The lower threshold of the HDR glow. When using the GLES2 renderer (which doesn't support HDR), this needs to be below [code]1.0[/code] for glow to be visible. A value of [code]0.9[/code] works well in this case.
</member>
<member name="glow_intensity" type="float" setter="set_glow_intensity" getter="get_glow_intensity" default="0.8">
- The glow intensity. When using the GLES2 renderer, this should be increased to 1.5 to compensate for the lack of HDR rendering.
+ The overall brightness multiplier of the glow effect. When using the GLES2 renderer, this should be increased to 1.5 to compensate for the lack of HDR rendering.
</member>
- <member name="glow_levels/1" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false">
- If [code]true[/code], the 1st level of glow is enabled. This is the most "local" level (least blurry).
+ <member name="glow_levels/1" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0">
+ The intensity of the 1st level of glow. This is the most "local" level (least blurry).
</member>
- <member name="glow_levels/2" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false">
- If [code]true[/code], the 2th level of glow is enabled.
+ <member name="glow_levels/2" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0">
+ The intensity of the 2nd level of glow.
</member>
- <member name="glow_levels/3" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="true">
- If [code]true[/code], the 3th level of glow is enabled.
+ <member name="glow_levels/3" type="float" setter="set_glow_level" getter="get_glow_level" default="1.0">
+ The intensity of the 3rd level of glow.
</member>
- <member name="glow_levels/4" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false">
- If [code]true[/code], the 4th level of glow is enabled.
+ <member name="glow_levels/4" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0">
+ The intensity of the 4th level of glow.
</member>
- <member name="glow_levels/5" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="true">
- If [code]true[/code], the 5th level of glow is enabled.
+ <member name="glow_levels/5" type="float" setter="set_glow_level" getter="get_glow_level" default="1.0">
+ The intensity of the 5th level of glow.
</member>
- <member name="glow_levels/6" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false">
- If [code]true[/code], the 6th level of glow is enabled.
+ <member name="glow_levels/6" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0">
+ The intensity of the 6th level of glow.
</member>
- <member name="glow_levels/7" type="bool" setter="set_glow_level_enabled" getter="is_glow_level_enabled" default="false">
- If [code]true[/code], the 7th level of glow is enabled. This is the most "global" level (blurriest).
+ <member name="glow_levels/7" type="float" setter="set_glow_level" getter="get_glow_level" default="0.0">
+ The intensity of the 7th level of glow. This is the most "global" level (blurriest).
</member>
<member name="glow_mix" type="float" setter="set_glow_mix" getter="get_glow_mix" default="0.05">
</member>
+ <member name="glow_normalized" type="bool" setter="set_glow_normalized" getter="is_glow_normalized" default="false">
+ If [code]true[/code], glow levels will be normalized so that summed together their intensities equal [code]1.0[/code].
+ </member>
<member name="glow_strength" type="float" setter="set_glow_strength" getter="get_glow_strength" default="1.0">
- The glow strength. When using the GLES2 renderer, this should be increased to 1.3 to compensate for the lack of HDR rendering.
+ The strength of the glow effect. This applies as the glow is blurred across the screen and increases the distance and intensity of the blur. When using the GLES2 renderer, this should be increased to 1.3 to compensate for the lack of HDR rendering.
</member>
<member name="reflected_light_source" type="int" setter="set_reflection_source" getter="get_reflection_source" enum="Environment.ReflectionSource" default="0">
</member>
diff --git a/doc/classes/File.xml b/doc/classes/File.xml
index 9a94231cc1..ada57a8114 100644
--- a/doc/classes/File.xml
+++ b/doc/classes/File.xml
@@ -25,6 +25,7 @@
</description>
<tutorials>
<link title="File system">https://docs.godotengine.org/en/latest/getting_started/step_by_step/filesystem.html</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="close">
diff --git a/doc/classes/FuncRef.xml b/doc/classes/FuncRef.xml
index 7c01397c24..dc9246ad35 100644
--- a/doc/classes/FuncRef.xml
+++ b/doc/classes/FuncRef.xml
@@ -26,6 +26,13 @@
Calls the referenced function previously set in [member function] or [method @GDScript.funcref]. Contrarily to [method call_func], this method does not support a variable number of arguments but expects all parameters to be passed via a single [Array].
</description>
</method>
+ <method name="is_valid" qualifiers="const">
+ <return type="bool">
+ </return>
+ <description>
+ Returns whether the object still exists and has the function assigned.
+ </description>
+ </method>
<method name="set_instance">
<return type="void">
</return>
@@ -35,16 +42,9 @@
The object containing the referenced function. This object must be of a type actually inheriting from [Object], not a built-in type such as [int], [Vector2] or [Dictionary].
</description>
</method>
- <method name="is_valid" qualifiers="const">
- <return type="bool">
- </return>
- <description>
- Returns whether the object still exists and has the function assigned.
- </description>
- </method>
</methods>
<members>
- <member name="function" type="StringName" setter="set_function" getter="get_function">
+ <member name="function" type="StringName" setter="set_function" getter="get_function" default="@&quot;&quot;">
The name of the referenced function.
</member>
</members>
diff --git a/doc/classes/GIProbe.xml b/doc/classes/GIProbe.xml
index 9199468ab3..52d3698201 100644
--- a/doc/classes/GIProbe.xml
+++ b/doc/classes/GIProbe.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="GI probes">https://docs.godotengine.org/en/latest/tutorials/3d/gi_probes.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="bake">
diff --git a/doc/classes/GIProbeData.xml b/doc/classes/GIProbeData.xml
index 228e1afb4c..693df8f819 100644
--- a/doc/classes/GIProbeData.xml
+++ b/doc/classes/GIProbeData.xml
@@ -5,6 +5,7 @@
<description>
</description>
<tutorials>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="allocate">
diff --git a/doc/classes/GPUParticles2D.xml b/doc/classes/GPUParticles2D.xml
index 244bdcf2f3..ba201af5db 100644
--- a/doc/classes/GPUParticles2D.xml
+++ b/doc/classes/GPUParticles2D.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="Particle systems (2D)">https://docs.godotengine.org/en/latest/tutorials/2d/particle_systems_2d.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="capture_rect" qualifiers="const">
diff --git a/doc/classes/GPUParticles3D.xml b/doc/classes/GPUParticles3D.xml
index 8444610f49..d1296c3418 100644
--- a/doc/classes/GPUParticles3D.xml
+++ b/doc/classes/GPUParticles3D.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="Controlling thousands of fish with Particles">https://docs.godotengine.org/en/latest/tutorials/3d/vertex_animation/controlling_thousands_of_fish.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="capture_aabb" qualifiers="const">
@@ -66,6 +67,8 @@
<member name="amount" type="int" setter="set_amount" getter="get_amount" default="8">
Number of particles to emit.
</member>
+ <member name="collision_base_size" type="float" setter="set_collision_base_size" getter="get_collision_base_size" default="0.01">
+ </member>
<member name="draw_order" type="int" setter="set_draw_order" getter="get_draw_order" enum="GPUParticles3D.DrawOrder" default="0">
Particle draw order. Uses [enum DrawOrder] values.
</member>
diff --git a/doc/classes/GPUParticlesAttractor3D.xml b/doc/classes/GPUParticlesAttractor3D.xml
new file mode 100644
index 0000000000..111827d294
--- /dev/null
+++ b/doc/classes/GPUParticlesAttractor3D.xml
@@ -0,0 +1,23 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesAttractor3D" inherits="VisualInstance3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="attenuation" type="float" setter="set_attenuation" getter="get_attenuation" default="1.0">
+ </member>
+ <member name="cull_mask" type="int" setter="set_cull_mask" getter="get_cull_mask" default="4294967295">
+ </member>
+ <member name="directionality" type="float" setter="set_directionality" getter="get_directionality" default="0.0">
+ </member>
+ <member name="strength" type="float" setter="set_strength" getter="get_strength" default="1.0">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesAttractorBox.xml b/doc/classes/GPUParticlesAttractorBox.xml
new file mode 100644
index 0000000000..68616f9bbd
--- /dev/null
+++ b/doc/classes/GPUParticlesAttractorBox.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesAttractorBox" inherits="GPUParticlesAttractor3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesAttractorSphere.xml b/doc/classes/GPUParticlesAttractorSphere.xml
new file mode 100644
index 0000000000..6984427a96
--- /dev/null
+++ b/doc/classes/GPUParticlesAttractorSphere.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesAttractorSphere" inherits="GPUParticlesAttractor3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="radius" type="float" setter="set_radius" getter="get_radius" default="1.0">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesAttractorVectorField.xml b/doc/classes/GPUParticlesAttractorVectorField.xml
new file mode 100644
index 0000000000..cf5e375ea3
--- /dev/null
+++ b/doc/classes/GPUParticlesAttractorVectorField.xml
@@ -0,0 +1,19 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesAttractorVectorField" inherits="GPUParticlesAttractor3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )">
+ </member>
+ <member name="texture" type="Texture3D" setter="set_texture" getter="get_texture">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesCollision3D.xml b/doc/classes/GPUParticlesCollision3D.xml
new file mode 100644
index 0000000000..dce9a32fc4
--- /dev/null
+++ b/doc/classes/GPUParticlesCollision3D.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesCollision3D" inherits="VisualInstance3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="cull_mask" type="int" setter="set_cull_mask" getter="get_cull_mask" default="4294967295">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesCollisionBox.xml b/doc/classes/GPUParticlesCollisionBox.xml
new file mode 100644
index 0000000000..17fc124c41
--- /dev/null
+++ b/doc/classes/GPUParticlesCollisionBox.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesCollisionBox" inherits="GPUParticlesCollision3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesCollisionHeightField.xml b/doc/classes/GPUParticlesCollisionHeightField.xml
new file mode 100644
index 0000000000..c6987515a9
--- /dev/null
+++ b/doc/classes/GPUParticlesCollisionHeightField.xml
@@ -0,0 +1,43 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesCollisionHeightField" inherits="GPUParticlesCollision3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )">
+ </member>
+ <member name="follow_camera_enabled" type="bool" setter="set_follow_camera_mode" getter="is_follow_camera_mode_enabled" default="false">
+ </member>
+ <member name="follow_camera_push_ratio" type="float" setter="set_follow_camera_push_ratio" getter="get_follow_camera_push_ratio" default="0.1">
+ </member>
+ <member name="resolution" type="int" setter="set_resolution" getter="get_resolution" enum="GPUParticlesCollisionHeightField.Resolution" default="2">
+ </member>
+ <member name="update_mode" type="int" setter="set_update_mode" getter="get_update_mode" enum="GPUParticlesCollisionHeightField.UpdateMode" default="0">
+ </member>
+ </members>
+ <constants>
+ <constant name="RESOLUTION_256" value="0" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_512" value="1" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_1024" value="2" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_2048" value="3" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_4096" value="4" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_8192" value="5" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_MAX" value="6" enum="Resolution">
+ </constant>
+ <constant name="UPDATE_MODE_WHEN_MOVED" value="0" enum="UpdateMode">
+ </constant>
+ <constant name="UPDATE_MODE_ALWAYS" value="1" enum="UpdateMode">
+ </constant>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesCollisionSDF.xml b/doc/classes/GPUParticlesCollisionSDF.xml
new file mode 100644
index 0000000000..c3cbe4b1c6
--- /dev/null
+++ b/doc/classes/GPUParticlesCollisionSDF.xml
@@ -0,0 +1,37 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesCollisionSDF" inherits="GPUParticlesCollision3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="extents" type="Vector3" setter="set_extents" getter="get_extents" default="Vector3( 1, 1, 1 )">
+ </member>
+ <member name="resolution" type="int" setter="set_resolution" getter="get_resolution" enum="GPUParticlesCollisionSDF.Resolution" default="2">
+ </member>
+ <member name="texture" type="Texture3D" setter="set_texture" getter="get_texture">
+ </member>
+ <member name="thickness" type="float" setter="set_thickness" getter="get_thickness" default="1.0">
+ </member>
+ </members>
+ <constants>
+ <constant name="RESOLUTION_16" value="0" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_32" value="1" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_64" value="2" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_128" value="3" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_256" value="4" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_512" value="5" enum="Resolution">
+ </constant>
+ <constant name="RESOLUTION_MAX" value="6" enum="Resolution">
+ </constant>
+ </constants>
+</class>
diff --git a/doc/classes/GPUParticlesCollisionSphere.xml b/doc/classes/GPUParticlesCollisionSphere.xml
new file mode 100644
index 0000000000..41150960d2
--- /dev/null
+++ b/doc/classes/GPUParticlesCollisionSphere.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<class name="GPUParticlesCollisionSphere" inherits="GPUParticlesCollision3D" version="4.0">
+ <brief_description>
+ </brief_description>
+ <description>
+ </description>
+ <tutorials>
+ </tutorials>
+ <methods>
+ </methods>
+ <members>
+ <member name="radius" type="float" setter="set_radius" getter="get_radius" default="1.0">
+ </member>
+ </members>
+ <constants>
+ </constants>
+</class>
diff --git a/doc/classes/Geometry3D.xml b/doc/classes/Geometry3D.xml
index ec685a5ce7..d0b930defb 100644
--- a/doc/classes/Geometry3D.xml
+++ b/doc/classes/Geometry3D.xml
@@ -102,15 +102,6 @@
Given the two 3D segments ([code]p1[/code], [code]p2[/code]) and ([code]q1[/code], [code]q2[/code]), finds those two points on the two segments that are closest to each other. Returns a [PackedVector3Array] that contains this point on ([code]p1[/code], [code]p2[/code]) as well the accompanying point on ([code]q1[/code], [code]q2[/code]).
</description>
</method>
- <method name="get_uv84_normal_bit">
- <return type="int">
- </return>
- <argument index="0" name="normal" type="Vector3">
- </argument>
- <description>
- Used internally by the engine.
- </description>
- </method>
<method name="ray_intersects_triangle">
<return type="Variant">
</return>
diff --git a/doc/classes/GridContainer.xml b/doc/classes/GridContainer.xml
index 6ee794c5c4..ca6b4e69c3 100644
--- a/doc/classes/GridContainer.xml
+++ b/doc/classes/GridContainer.xml
@@ -9,6 +9,7 @@
[b]Note:[/b] GridContainer only works with child nodes inheriting from Control. It won't rearrange child nodes inheriting from Node2D.
</description>
<tutorials>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Input.xml b/doc/classes/Input.xml
index b05ab5b4d6..fb0ed8ff62 100644
--- a/doc/classes/Input.xml
+++ b/doc/classes/Input.xml
@@ -8,6 +8,8 @@
</description>
<tutorials>
<link title="Inputs tutorial index">https://docs.godotengine.org/en/latest/tutorials/inputs/index.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="action_press">
diff --git a/doc/classes/InputEvent.xml b/doc/classes/InputEvent.xml
index 3663ee98cc..8c6063bd67 100644
--- a/doc/classes/InputEvent.xml
+++ b/doc/classes/InputEvent.xml
@@ -9,6 +9,8 @@
<tutorials>
<link title="InputEvent">https://docs.godotengine.org/en/latest/tutorials/inputs/inputevent.html</link>
<link title="Viewport and canvas transforms">https://docs.godotengine.org/en/latest/tutorials/2d/2d_transforms.html</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="accumulate">
diff --git a/doc/classes/InputEventAction.xml b/doc/classes/InputEventAction.xml
index e0d3e47219..1fe85a5ae8 100644
--- a/doc/classes/InputEventAction.xml
+++ b/doc/classes/InputEventAction.xml
@@ -8,6 +8,8 @@
</description>
<tutorials>
<link title="InputEvent: Actions">https://docs.godotengine.org/en/latest/tutorials/inputs/inputevent.html#actions</link>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/InputEventMouseMotion.xml b/doc/classes/InputEventMouseMotion.xml
index 3e64fd63ab..0f9e71adb4 100644
--- a/doc/classes/InputEventMouseMotion.xml
+++ b/doc/classes/InputEventMouseMotion.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="Mouse and input coordinates">https://docs.godotengine.org/en/latest/tutorials/inputs/mouse_and_input_coordinates.html</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Joint3D.xml b/doc/classes/Joint3D.xml
index 15bef960f6..107c638b9e 100644
--- a/doc/classes/Joint3D.xml
+++ b/doc/classes/Joint3D.xml
@@ -7,6 +7,7 @@
Joints are used to bind together two physics bodies. They have a solver priority and can define if the bodies of the two attached nodes should be able to collide with each other.
</description>
<tutorials>
+ <link title="3D Truck Town Demo">https://godotengine.org/asset-library/asset/524</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/KinematicBody2D.xml b/doc/classes/KinematicBody2D.xml
index bc7a7c0d0d..425df00b6f 100644
--- a/doc/classes/KinematicBody2D.xml
+++ b/doc/classes/KinematicBody2D.xml
@@ -11,6 +11,8 @@
<tutorials>
<link title="Kinematic character (2D)">https://docs.godotengine.org/en/latest/tutorials/physics/kinematic_character_2d.html</link>
<link title="Using KinematicBody2D">https://docs.godotengine.org/en/latest/tutorials/physics/using_kinematic_body_2d.html</link>
+ <link title="2D Kinematic Character Demo">https://godotengine.org/asset-library/asset/113</link>
+ <link title="2D Platformer Demo">https://godotengine.org/asset-library/asset/120</link>
</tutorials>
<methods>
<method name="get_floor_normal" qualifiers="const">
@@ -53,21 +55,21 @@
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on the ceiling. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with the ceiling on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="is_on_floor" qualifiers="const">
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on the floor. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with the floor on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="is_on_wall" qualifiers="const">
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on a wall. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with a wall on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="move_and_collide">
diff --git a/doc/classes/KinematicBody3D.xml b/doc/classes/KinematicBody3D.xml
index 897b2c6280..a21496de54 100644
--- a/doc/classes/KinematicBody3D.xml
+++ b/doc/classes/KinematicBody3D.xml
@@ -10,6 +10,10 @@
</description>
<tutorials>
<link title="Kinematic character (2D)">https://docs.godotengine.org/en/latest/tutorials/physics/kinematic_character_2d.html</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="get_axis_lock" qualifiers="const">
@@ -55,21 +59,21 @@
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on the ceiling. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with the ceiling on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="is_on_floor" qualifiers="const">
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on the floor. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with the floor on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="is_on_wall" qualifiers="const">
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if the body is on a wall. Only updates when calling [method move_and_slide] or [method move_and_slide_with_snap].
+ Returns [code]true[/code] if the body collided with a wall on the last call of [method move_and_slide] or [method move_and_slide_with_snap]. Otherwise, returns [code]false[/code].
</description>
</method>
<method name="move_and_collide">
diff --git a/doc/classes/Label.xml b/doc/classes/Label.xml
index 3318f2757d..570d7f075b 100644
--- a/doc/classes/Label.xml
+++ b/doc/classes/Label.xml
@@ -8,6 +8,7 @@
[b]Note:[/b] Contrarily to most other [Control]s, Label's [member Control.mouse_filter] defaults to [constant Control.MOUSE_FILTER_IGNORE] (i.e. it doesn't react to mouse input events). This implies that a label won't display any configured [member Control.hint_tooltip], unless you change its mouse filter.
</description>
<tutorials>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="get_line_count" qualifiers="const">
diff --git a/doc/classes/Light3D.xml b/doc/classes/Light3D.xml
index c022e56a39..6c008e4f7e 100644
--- a/doc/classes/Light3D.xml
+++ b/doc/classes/Light3D.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="3D lights and shadows">https://docs.godotengine.org/en/latest/tutorials/3d/lights_and_shadows.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="get_param" qualifiers="const">
diff --git a/doc/classes/Line2D.xml b/doc/classes/Line2D.xml
index 22fe4f6194..dec5d60cbb 100644
--- a/doc/classes/Line2D.xml
+++ b/doc/classes/Line2D.xml
@@ -7,6 +7,8 @@
A line through several points in 2D space.
</description>
<tutorials>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="2.5D Demo">https://godotengine.org/asset-library/asset/583</link>
</tutorials>
<methods>
<method name="add_point">
diff --git a/doc/classes/LinkButton.xml b/doc/classes/LinkButton.xml
index fed936cc2f..2d475fc449 100644
--- a/doc/classes/LinkButton.xml
+++ b/doc/classes/LinkButton.xml
@@ -12,7 +12,6 @@
<methods>
</methods>
<members>
- <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" override="true" enum="Control.FocusMode" default="0" />
<member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="0" />
<member name="mouse_default_cursor_shape" type="int" setter="set_default_cursor_shape" getter="get_default_cursor_shape" override="true" enum="Control.CursorShape" default="2" />
<member name="text" type="String" setter="set_text" getter="get_text" default="&quot;&quot;">
diff --git a/doc/classes/Material.xml b/doc/classes/Material.xml
index f3686876ca..10a7061bef 100644
--- a/doc/classes/Material.xml
+++ b/doc/classes/Material.xml
@@ -7,6 +7,8 @@
Material is a base [Resource] used for coloring and shading geometry. All materials inherit from it and almost all [VisualInstance3D] derived nodes carry a Material. A few flags and parameters are shared between all material types and are configured here.
</description>
<tutorials>
+ <link title="3D Material Testers Demo">https://godotengine.org/asset-library/asset/123</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/MenuButton.xml b/doc/classes/MenuButton.xml
index cf1fdb5ba6..d97e0f0f21 100644
--- a/doc/classes/MenuButton.xml
+++ b/doc/classes/MenuButton.xml
@@ -30,7 +30,6 @@
</methods>
<members>
<member name="action_mode" type="int" setter="set_action_mode" getter="get_action_mode" override="true" enum="BaseButton.ActionMode" default="0" />
- <member name="enabled_focus_mode" type="int" setter="set_enabled_focus_mode" getter="get_enabled_focus_mode" override="true" enum="Control.FocusMode" default="0" />
<member name="flat" type="bool" setter="set_flat" getter="is_flat" override="true" default="true" />
<member name="focus_mode" type="int" setter="set_focus_mode" getter="get_focus_mode" override="true" enum="Control.FocusMode" default="0" />
<member name="switch_on_hover" type="bool" setter="set_switch_on_hover" getter="is_switch_on_hover" default="false">
diff --git a/doc/classes/Mesh.xml b/doc/classes/Mesh.xml
index 1efa72a2b2..78db09feee 100644
--- a/doc/classes/Mesh.xml
+++ b/doc/classes/Mesh.xml
@@ -7,6 +7,10 @@
Mesh is a type of [Resource] that contains vertex array-based geometry, divided in [i]surfaces[/i]. Each surface contains a completely separate array and a material used to draw it. Design wise, a mesh with multiple surfaces is preferred to a single surface, because objects created in 3D editing software commonly contain multiple materials.
</description>
<tutorials>
+ <link title="3D Material Testers Demo">https://godotengine.org/asset-library/asset/123</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="create_convex_shape" qualifiers="const">
diff --git a/doc/classes/MeshInstance3D.xml b/doc/classes/MeshInstance3D.xml
index c569da2df1..82cd392cd3 100644
--- a/doc/classes/MeshInstance3D.xml
+++ b/doc/classes/MeshInstance3D.xml
@@ -7,6 +7,10 @@
MeshInstance3D is a node that takes a [Mesh] resource and adds it to the current scenario by creating an instance of it. This is the class most often used render 3D geometry and can be used to instance a single [Mesh] in many places. This allows reuse of geometry which can save on resources. When a [Mesh] has to be instanced more than thousands of times at close proximity, consider using a [MultiMesh] in a [MultiMeshInstance3D] instead.
</description>
<tutorials>
+ <link title="3D Material Testers Demo">https://godotengine.org/asset-library/asset/123</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="create_convex_collision">
diff --git a/doc/classes/MeshLibrary.xml b/doc/classes/MeshLibrary.xml
index ccf6172017..ad8bd6991d 100644
--- a/doc/classes/MeshLibrary.xml
+++ b/doc/classes/MeshLibrary.xml
@@ -7,6 +7,8 @@
A library of meshes. Contains a list of [Mesh] resources, each with a name and ID. Each item can also include collision and navigation shapes. This resource is used in [GridMap].
</description>
<tutorials>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
</tutorials>
<methods>
<method name="clear">
diff --git a/doc/classes/MultiMesh.xml b/doc/classes/MultiMesh.xml
index e1b3ffa2e4..6ebfc946dc 100644
--- a/doc/classes/MultiMesh.xml
+++ b/doc/classes/MultiMesh.xml
@@ -65,7 +65,7 @@
<argument index="1" name="color" type="Color">
</argument>
<description>
- Sets the color of a specific instance.
+ Sets the color of a specific instance by [i]multiplying[/i] the mesh's existing vertex colors.
For the color to take effect, ensure that [member use_colors] is [code]true[/code] on the [MultiMesh] and [member BaseMaterial3D.vertex_color_use_as_albedo] is [code]true[/code] on the material.
</description>
</method>
diff --git a/doc/classes/Navigation2D.xml b/doc/classes/Navigation2D.xml
index dcbfbc2350..abac29bdb7 100644
--- a/doc/classes/Navigation2D.xml
+++ b/doc/classes/Navigation2D.xml
@@ -7,6 +7,7 @@
Navigation2D provides navigation and pathfinding within a 2D area, specified as a collection of [NavigationPolygon] resources. These are automatically collected from child [NavigationRegion2D] nodes.
</description>
<tutorials>
+ <link title="2D Navigation Demo">https://godotengine.org/asset-library/asset/117</link>
</tutorials>
<methods>
<method name="get_closest_point" qualifiers="const">
diff --git a/doc/classes/Navigation3D.xml b/doc/classes/Navigation3D.xml
index 807f0ad309..e7a4fe3c43 100644
--- a/doc/classes/Navigation3D.xml
+++ b/doc/classes/Navigation3D.xml
@@ -7,6 +7,7 @@
Provides navigation and pathfinding within a collection of [NavigationMesh]es. These will be automatically collected from child [NavigationRegion3D] nodes. In addition to basic pathfinding, this class also assists with aligning navigation agents with the meshes they are navigating on.
</description>
<tutorials>
+ <link title="3D Navmesh Demo">https://godotengine.org/asset-library/asset/124</link>
</tutorials>
<methods>
<method name="get_closest_point" qualifiers="const">
diff --git a/doc/classes/NavigationMesh.xml b/doc/classes/NavigationMesh.xml
index a2fa31bf65..dd7464ac0e 100644
--- a/doc/classes/NavigationMesh.xml
+++ b/doc/classes/NavigationMesh.xml
@@ -5,6 +5,7 @@
<description>
</description>
<tutorials>
+ <link title="3D Navmesh Demo">https://godotengine.org/asset-library/asset/124</link>
</tutorials>
<methods>
<method name="add_polygon">
diff --git a/doc/classes/NavigationPolygon.xml b/doc/classes/NavigationPolygon.xml
index b0f77dff83..e75efa3b27 100644
--- a/doc/classes/NavigationPolygon.xml
+++ b/doc/classes/NavigationPolygon.xml
@@ -24,6 +24,7 @@
[/codeblock]
</description>
<tutorials>
+ <link title="2D Navigation Demo">https://godotengine.org/asset-library/asset/117</link>
</tutorials>
<methods>
<method name="add_outline">
diff --git a/doc/classes/NavigationServer2D.xml b/doc/classes/NavigationServer2D.xml
index 1b9099336c..5f0b04487e 100644
--- a/doc/classes/NavigationServer2D.xml
+++ b/doc/classes/NavigationServer2D.xml
@@ -7,6 +7,7 @@
NavigationServer2D is the server responsible for all 2D navigation. It creates the agents, maps, and regions for navigation to work as expected. This keeps tracks of any call and executes them during the sync phase. This means that you can request any change to the map, using any thread, without worrying.
</description>
<tutorials>
+ <link title="2D Navigation Demo">https://godotengine.org/asset-library/asset/117</link>
</tutorials>
<methods>
<method name="agent_create" qualifiers="const">
diff --git a/doc/classes/NavigationServer3D.xml b/doc/classes/NavigationServer3D.xml
index 1f621c3c81..95890c4b4c 100644
--- a/doc/classes/NavigationServer3D.xml
+++ b/doc/classes/NavigationServer3D.xml
@@ -7,6 +7,7 @@
NavigationServer3D is the server responsible for all 3D navigation. It creates the agents, maps, and regions for navigation to work as expected. This keeps tracks of any call and executes them during the sync phase. This means that you can request any change to the map, using any thread, without worrying.
</description>
<tutorials>
+ <link title="3D Navmesh Demo">https://godotengine.org/asset-library/asset/124</link>
</tutorials>
<methods>
<method name="agent_create" qualifiers="const">
diff --git a/doc/classes/NetworkedMultiplayerPeer.xml b/doc/classes/NetworkedMultiplayerPeer.xml
index 7e2a9af59f..954d31794a 100644
--- a/doc/classes/NetworkedMultiplayerPeer.xml
+++ b/doc/classes/NetworkedMultiplayerPeer.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="High-level multiplayer">https://docs.godotengine.org/en/latest/tutorials/networking/high_level_multiplayer.html</link>
+ <link title="WebRTC Signaling Demo">https://godotengine.org/asset-library/asset/537</link>
</tutorials>
<methods>
<method name="get_connection_status" qualifiers="const">
diff --git a/doc/classes/NinePatchRect.xml b/doc/classes/NinePatchRect.xml
index 9c3acc9b0a..08ab01036c 100644
--- a/doc/classes/NinePatchRect.xml
+++ b/doc/classes/NinePatchRect.xml
@@ -45,13 +45,13 @@
The height of the 9-slice's bottom row. A margin of 16 means the 9-slice's bottom corners and side will have a height of 16 pixels. You can set all 4 margin values individually to create panels with non-uniform borders.
</member>
<member name="patch_margin_left" type="int" setter="set_patch_margin" getter="get_patch_margin" default="0">
- The height of the 9-slice's left column.
+ The width of the 9-slice's left column. A margin of 16 means the 9-slice's left corners and side will have a width of 16 pixels. You can set all 4 margin values individually to create panels with non-uniform borders.
</member>
<member name="patch_margin_right" type="int" setter="set_patch_margin" getter="get_patch_margin" default="0">
- The height of the 9-slice's right column.
+ The width of the 9-slice's right column. A margin of 16 means the 9-slice's right corners and side will have a width of 16 pixels. You can set all 4 margin values individually to create panels with non-uniform borders.
</member>
<member name="patch_margin_top" type="int" setter="set_patch_margin" getter="get_patch_margin" default="0">
- The height of the 9-slice's top row.
+ The height of the 9-slice's top row. A margin of 16 means the 9-slice's top corners and side will have a height of 16 pixels. You can set all 4 margin values individually to create panels with non-uniform borders.
</member>
<member name="region_rect" type="Rect2" setter="set_region_rect" getter="get_region_rect" default="Rect2( 0, 0, 0, 0 )">
Rectangular region of the texture to sample from. If you're working with an atlas, use this property to define the area the 9-slice should use. All other properties are relative to this one. If the rect is empty, NinePatchRect will use the whole texture.
diff --git a/doc/classes/Node.xml b/doc/classes/Node.xml
index 1548800901..2e8b76865d 100644
--- a/doc/classes/Node.xml
+++ b/doc/classes/Node.xml
@@ -18,6 +18,7 @@
</description>
<tutorials>
<link title="Scenes and nodes">https://docs.godotengine.org/en/latest/getting_started/step_by_step/scenes_and_nodes.html</link>
+ <link title="All Demos">https://github.com/godotengine/godot-demo-projects/</link>
</tutorials>
<methods>
<method name="_enter_tree" qualifiers="virtual">
@@ -833,6 +834,7 @@
</member>
<member name="name" type="StringName" setter="set_name" getter="get_name">
The name of the node. This name is unique among the siblings (other child nodes from the same parent). When set to an existing name, the node will be automatically renamed.
+ [b]Note:[/b] Auto-generated names might include the [code]@[/code] character, which is reserved for unique names when using [method add_child]. When setting the name manually, any [code]@[/code] will be removed.
</member>
<member name="owner" type="Node" setter="set_owner" getter="get_owner">
The node owner. A node can have any other node as owner (as long as it is a valid parent, grandparent, etc. ascending in the tree). When saving a node (using [PackedScene]), all the nodes it owns will be saved with it. This allows for the creation of complex [SceneTree]s, with instancing and subinstancing.
diff --git a/doc/classes/Node2D.xml b/doc/classes/Node2D.xml
index 987a18f367..eed0ec8d7e 100644
--- a/doc/classes/Node2D.xml
+++ b/doc/classes/Node2D.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="Custom drawing in 2D">https://docs.godotengine.org/en/latest/tutorials/2d/custom_drawing_in_2d.html</link>
+ <link title="All 2D Demos">https://github.com/godotengine/godot-demo-projects/tree/master/2d</link>
</tutorials>
<methods>
<method name="apply_scale">
diff --git a/doc/classes/Node3D.xml b/doc/classes/Node3D.xml
index daadde4fe4..f6ff514474 100644
--- a/doc/classes/Node3D.xml
+++ b/doc/classes/Node3D.xml
@@ -10,6 +10,7 @@
</description>
<tutorials>
<link title="Introduction to 3D">https://docs.godotengine.org/en/latest/tutorials/3d/introduction_to_3d.html</link>
+ <link title="All 3D Demos">https://github.com/godotengine/godot-demo-projects/tree/master/3d</link>
</tutorials>
<methods>
<method name="force_update_transform">
@@ -300,7 +301,7 @@
<member name="scale" type="Vector3" setter="set_scale" getter="get_scale" default="Vector3( 1, 1, 1 )">
Scale part of the local transformation.
</member>
- <member name="toplevel" type="bool" setter="set_as_toplevel" getter="is_set_as_toplevel">
+ <member name="top_level" type="bool" setter="set_as_top_level" getter="is_set_as_top_level" default="false">
If [code]true[/code], the node will not inherit its transformations from its parent. Node transformations are only in global space.
</member>
<member name="transform" type="Transform" setter="set_transform" getter="get_transform" default="Transform( 1, 0, 0, 0, 1, 0, 0, 0, 1, 0, 0, 0 )">
diff --git a/doc/classes/NodePath.xml b/doc/classes/NodePath.xml
index dc7fd1be3f..658f0e6c28 100644
--- a/doc/classes/NodePath.xml
+++ b/doc/classes/NodePath.xml
@@ -22,6 +22,7 @@
[/codeblock]
</description>
<tutorials>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
</tutorials>
<methods>
<method name="NodePath">
diff --git a/doc/classes/OS.xml b/doc/classes/OS.xml
index a1f12e1a31..1487c9e078 100644
--- a/doc/classes/OS.xml
+++ b/doc/classes/OS.xml
@@ -7,6 +7,7 @@
Operating System functions. OS wraps the most common functionality to communicate with the host operating system, such as the clipboard, video driver, date and time, timers, environment variables, execution of binaries, command line, etc.
</description>
<tutorials>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="can_use_threads" qualifiers="const">
diff --git a/doc/classes/PackedScene.xml b/doc/classes/PackedScene.xml
index bb56330248..be40ab05de 100644
--- a/doc/classes/PackedScene.xml
+++ b/doc/classes/PackedScene.xml
@@ -38,6 +38,7 @@
[/codeblock]
</description>
<tutorials>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
</tutorials>
<methods>
<method name="can_instance" qualifiers="const">
diff --git a/doc/classes/PackedStringArray.xml b/doc/classes/PackedStringArray.xml
index f36af66d6d..5f3a16ac73 100644
--- a/doc/classes/PackedStringArray.xml
+++ b/doc/classes/PackedStringArray.xml
@@ -8,6 +8,7 @@
[b]Note:[/b] This type is passed by value and not by reference.
</description>
<tutorials>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="PackedStringArray">
diff --git a/doc/classes/PackedVector2Array.xml b/doc/classes/PackedVector2Array.xml
index ecc535e488..cb62aea95c 100644
--- a/doc/classes/PackedVector2Array.xml
+++ b/doc/classes/PackedVector2Array.xml
@@ -8,6 +8,7 @@
[b]Note:[/b] This type is passed by value and not by reference.
</description>
<tutorials>
+ <link title="2D Navigation Astar Demo">https://godotengine.org/asset-library/asset/519</link>
</tutorials>
<methods>
<method name="PackedVector2Array">
diff --git a/doc/classes/Panel.xml b/doc/classes/Panel.xml
index 7285bc9e2e..b65c2c956d 100644
--- a/doc/classes/Panel.xml
+++ b/doc/classes/Panel.xml
@@ -7,6 +7,9 @@
Panel is a [Control] that displays an opaque background. It's commonly used as a parent and container for other types of [Control] nodes.
</description>
<tutorials>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
+ <link title="2D Finite State Machine Demo">https://godotengine.org/asset-library/asset/516</link>
+ <link title="3D Inverse Kinematics Demo">https://godotengine.org/asset-library/asset/523</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/PanelContainer.xml b/doc/classes/PanelContainer.xml
index d39122c395..ad6080c780 100644
--- a/doc/classes/PanelContainer.xml
+++ b/doc/classes/PanelContainer.xml
@@ -7,6 +7,7 @@
Panel container type. This container fits controls inside of the delimited area of a stylebox. It's useful for giving controls an outline.
</description>
<tutorials>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/ParticlesMaterial.xml b/doc/classes/ParticlesMaterial.xml
index f6fa3cf38b..77df6245e9 100644
--- a/doc/classes/ParticlesMaterial.xml
+++ b/doc/classes/ParticlesMaterial.xml
@@ -131,6 +131,16 @@
<member name="anim_speed_random" type="float" setter="set_param_randomness" getter="get_param_randomness" default="0.0">
Animation speed randomness ratio.
</member>
+ <member name="attractor_interaction_enabled" type="bool" setter="set_attractor_interaction_enabled" getter="is_attractor_interaction_enabled" default="true">
+ </member>
+ <member name="collision_bounce" type="float" setter="set_collision_bounce" getter="get_collision_bounce" default="0.0">
+ </member>
+ <member name="collision_enabled" type="bool" setter="set_collision_enabled" getter="is_collision_enabled" default="true">
+ </member>
+ <member name="collision_friction" type="float" setter="set_collision_friction" getter="get_collision_friction" default="0.0">
+ </member>
+ <member name="collision_use_scale" type="bool" setter="set_collision_use_scale" getter="is_collision_using_scale" default="false">
+ </member>
<member name="color" type="Color" setter="set_color" getter="get_color" default="Color( 1, 1, 1, 1 )">
Each particle's initial color. If the [GPUParticles2D]'s [code]texture[/code] is defined, it will be multiplied by this color. To have particle display color in a [BaseMaterial3D] make sure to set [member BaseMaterial3D.vertex_color_use_as_albedo] to [code]true[/code].
</member>
diff --git a/doc/classes/PhysicsBody2D.xml b/doc/classes/PhysicsBody2D.xml
index ca42f5801a..9c3c47afba 100644
--- a/doc/classes/PhysicsBody2D.xml
+++ b/doc/classes/PhysicsBody2D.xml
@@ -86,9 +86,6 @@
The physics layers this area scans for collisions. See [url=https://docs.godotengine.org/en/latest/tutorials/physics/physics_introduction.html#collision-layers-and-masks]Collision layers and masks[/url] in the documentation for more information.
</member>
<member name="input_pickable" type="bool" setter="set_pickable" getter="is_pickable" override="true" default="false" />
- <member name="layers" type="int" setter="_set_layers" getter="_get_layers">
- Both [member collision_layer] and [member collision_mask]. Returns [member collision_layer] when accessed. Updates [member collision_layer] and [member collision_mask] when modified.
- </member>
</members>
<constants>
</constants>
diff --git a/doc/classes/PhysicsDirectSpaceState2D.xml b/doc/classes/PhysicsDirectSpaceState2D.xml
index 676e33601a..c26cf0514c 100644
--- a/doc/classes/PhysicsDirectSpaceState2D.xml
+++ b/doc/classes/PhysicsDirectSpaceState2D.xml
@@ -64,13 +64,14 @@
<argument index="5" name="collide_with_areas" type="bool" default="false">
</argument>
<description>
- Checks whether a point is inside any shape. The shapes the point is inside of are returned in an array containing dictionaries with the following fields:
+ Checks whether a point is inside any solid shape. The shapes the point is inside of are returned in an array containing dictionaries with the following fields:
[code]collider[/code]: The colliding object.
[code]collider_id[/code]: The colliding object's ID.
[code]metadata[/code]: The intersecting shape's metadata. This metadata is different from [method Object.get_meta], and is set with [method PhysicsServer2D.shape_set_data].
[code]rid[/code]: The intersecting object's [RID].
[code]shape[/code]: The shape index of the colliding shape.
Additionally, the method can take an [code]exclude[/code] array of objects or [RID]s that are to be excluded from collisions, a [code]collision_mask[/code] bitmask representing the physics layers to check in, or booleans to determine if the ray should collide with [PhysicsBody2D]s or [Area2D]s, respectively.
+ [b]Note:[/b] [ConcavePolygonShape2D]s and [CollisionPolygon2D]s in [code]Segments[/code] build mode are not solid shapes. Therefore, they will not be detected.
</description>
</method>
<method name="intersect_point_on_canvas">
diff --git a/doc/classes/ProjectSettings.xml b/doc/classes/ProjectSettings.xml
index d040341100..91998ead34 100644
--- a/doc/classes/ProjectSettings.xml
+++ b/doc/classes/ProjectSettings.xml
@@ -9,6 +9,9 @@
[b]Overriding:[/b] Any project setting can be overridden by creating a file named [code]override.cfg[/code] in the project's root directory. This can also be used in exported projects by placing this file in the same directory as the project binary.
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="add_property_info">
@@ -466,7 +469,7 @@
[b]Note:[/b] This option is experimental and meant to alleviate stutter experienced by some users. However, some users have experienced a Vsync framerate halving (e.g. from 60 FPS to 30 FPS) when using it.
</member>
<member name="editor/script_templates_search_path" type="String" setter="" getter="" default="&quot;res://script_templates&quot;">
- Search path for project-specific script templates. Script templates will be search both in the editor-specific path and in this project-specific path.
+ Search path for project-specific script templates. Godot will search for script templates both in the editor-specific path and in this project-specific path.
</member>
<member name="editor/search_in_file_extensions" type="PackedStringArray" setter="" getter="" default="PackedStringArray( &quot;gd&quot;, &quot;shader&quot; )">
Text-based file extensions to include in the script editor's "Find in Files" feature. You can add e.g. [code]tscn[/code] if you wish to also parse your scene files, especially if you use built-in scripts which are serialized in the scene files.
@@ -555,7 +558,7 @@
<member name="input_devices/pointing/emulate_touch_from_mouse" type="bool" setter="" getter="" default="false">
If [code]true[/code], sends touch input events when clicking or dragging the mouse.
</member>
- <member name="input_devices/pointing/ios/touch_delay" type="float" setter="" getter="" default="0.150">
+ <member name="input_devices/pointing/ios/touch_delay" type="float" setter="" getter="" default="0.15">
Default delay for touch events. This only affects iOS devices.
</member>
<member name="layer_names/2d_physics/layer_1" type="String" setter="" getter="" default="&quot;&quot;">
@@ -815,7 +818,7 @@
<member name="logging/file_logging/max_log_files" type="int" setter="" getter="" default="5">
Specifies the maximum amount of log files allowed (used for rotation).
</member>
- <member name="memory/limits/message_queue/max_size_kb" type="int" setter="" getter="" default="1024">
+ <member name="memory/limits/message_queue/max_size_kb" type="int" setter="" getter="" default="4096">
Godot uses a message queue to defer some function calls. If you run out of space on it (you will see an error), you can increase the size here.
</member>
<member name="memory/limits/multithreaded_server/rid_pool_prealloc" type="int" setter="" getter="" default="60">
@@ -880,6 +883,7 @@
</member>
<member name="physics/2d/default_angular_damp" type="float" setter="" getter="" default="1.0">
The default angular damp in 2D.
+ [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration.
</member>
<member name="physics/2d/default_gravity" type="int" setter="" getter="" default="98">
The default gravity strength in 2D.
@@ -899,6 +903,7 @@
</member>
<member name="physics/2d/default_linear_damp" type="float" setter="" getter="" default="0.1">
The default linear damp in 2D.
+ [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration.
</member>
<member name="physics/2d/large_object_surface_threshold_in_cells" type="int" setter="" getter="" default="512">
Threshold defining the surface size that constitutes a large object with regard to cells in the broad-phase 2D hash grid algorithm.
@@ -925,6 +930,7 @@
</member>
<member name="physics/3d/default_angular_damp" type="float" setter="" getter="" default="0.1">
The default angular damp in 3D.
+ [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration.
</member>
<member name="physics/3d/default_gravity" type="float" setter="" getter="" default="9.8">
The default gravity strength in 3D.
@@ -944,6 +950,7 @@
</member>
<member name="physics/3d/default_linear_damp" type="float" setter="" getter="" default="0.1">
The default linear damp in 3D.
+ [b]Note:[/b] Good values are in the range [code]0[/code] to [code]1[/code]. At value [code]0[/code] objects will keep moving with the same velocity. Values greater than [code]1[/code] will aim to reduce the velocity to [code]0[/code] in less than a second e.g. a value of [code]2[/code] will aim to reduce the velocity to [code]0[/code] in half a second. A value equal to or greater than the physics frame rate ([member ProjectSettings.physics/common/physics_fps], [code]60[/code] by default) will bring the object to a stop in one iteration.
</member>
<member name="physics/3d/physics_engine" type="String" setter="" getter="" default="&quot;DEFAULT&quot;">
Sets which physics engine to use for 3D physics.
diff --git a/doc/classes/QuadMesh.xml b/doc/classes/QuadMesh.xml
index 422add08d1..24a3d76ee2 100644
--- a/doc/classes/QuadMesh.xml
+++ b/doc/classes/QuadMesh.xml
@@ -7,6 +7,8 @@
Class representing a square [PrimitiveMesh]. This flat mesh does not have a thickness. By default, this mesh is aligned on the X and Y axes; this default rotation is more suited for use with billboarded materials. Unlike [PlaneMesh], this mesh doesn't provide subdivision options.
</description>
<tutorials>
+ <link title="GUI in 3D Demo">https://godotengine.org/asset-library/asset/127</link>
+ <link title="2D in 3D Demo">https://godotengine.org/asset-library/asset/129</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Quat.xml b/doc/classes/Quat.xml
index 2218852dae..6c95e303b8 100644
--- a/doc/classes/Quat.xml
+++ b/doc/classes/Quat.xml
@@ -10,6 +10,7 @@
</description>
<tutorials>
<link title="Using 3D transforms">https://docs.godotengine.org/en/latest/tutorials/3d/using_transforms.html#interpolating-with-quaternions</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="Quat">
diff --git a/doc/classes/RandomNumberGenerator.xml b/doc/classes/RandomNumberGenerator.xml
index ec0f1a96b2..d4f9517dd1 100644
--- a/doc/classes/RandomNumberGenerator.xml
+++ b/doc/classes/RandomNumberGenerator.xml
@@ -15,6 +15,7 @@
[/codeblock]
</description>
<tutorials>
+ <link title="Random number generation">https://docs.godotengine.org/en/latest/tutorials/math/random_number_generation.html</link>
</tutorials>
<methods>
<method name="randf">
diff --git a/doc/classes/RayCast3D.xml b/doc/classes/RayCast3D.xml
index 1d8edf0adb..d24e86a08b 100644
--- a/doc/classes/RayCast3D.xml
+++ b/doc/classes/RayCast3D.xml
@@ -12,6 +12,7 @@
</description>
<tutorials>
<link title="Ray-casting">https://docs.godotengine.org/en/latest/tutorials/physics/ray-casting.html</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="add_exception">
diff --git a/doc/classes/Rect2.xml b/doc/classes/Rect2.xml
index 2d1685871d..aaeaa7629d 100644
--- a/doc/classes/Rect2.xml
+++ b/doc/classes/Rect2.xml
@@ -10,6 +10,8 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="Advanced vector math">https://docs.godotengine.org/en/latest/tutorials/math/vectors_advanced.html</link>
</tutorials>
<methods>
<method name="Rect2">
diff --git a/doc/classes/Rect2i.xml b/doc/classes/Rect2i.xml
index 809f385f6e..8b29daa264 100644
--- a/doc/classes/Rect2i.xml
+++ b/doc/classes/Rect2i.xml
@@ -9,6 +9,7 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
</tutorials>
<methods>
<method name="Rect2i">
diff --git a/doc/classes/RectangleShape2D.xml b/doc/classes/RectangleShape2D.xml
index b42cc48d43..041416a24b 100644
--- a/doc/classes/RectangleShape2D.xml
+++ b/doc/classes/RectangleShape2D.xml
@@ -7,6 +7,8 @@
Rectangle shape for 2D collisions. This shape is useful for modeling box-like 2D objects.
</description>
<tutorials>
+ <link title="2D Pong Demo">https://godotengine.org/asset-library/asset/121</link>
+ <link title="2D Kinematic Character Demo">https://godotengine.org/asset-library/asset/113</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/RenderingServer.xml b/doc/classes/RenderingServer.xml
index 9c8c964967..857c13deb5 100644
--- a/doc/classes/RenderingServer.xml
+++ b/doc/classes/RenderingServer.xml
@@ -583,6 +583,12 @@
Modulates all colors in the given canvas.
</description>
</method>
+ <method name="create_local_rendering_device" qualifiers="const">
+ <return type="RenderingDevice">
+ </return>
+ <description>
+ </description>
+ </method>
<method name="directional_light_create">
<return type="RID">
</return>
@@ -712,7 +718,7 @@
</argument>
<argument index="1" name="enable" type="bool">
</argument>
- <argument index="2" name="level_flags" type="int">
+ <argument index="2" name="levels" type="PackedFloat32Array">
</argument>
<argument index="3" name="intensity" type="float">
</argument>
@@ -1627,7 +1633,6 @@
<argument index="3" name="blend_shapes" type="Array" default="[ ]">
</argument>
<argument index="4" name="lods" type="Dictionary" default="{
-
}">
</argument>
<argument index="5" name="compress_format" type="int" default="31744">
@@ -3574,22 +3579,24 @@
<constant name="INSTANCE_PARTICLES" value="4" enum="InstanceType">
The instance is a particle emitter.
</constant>
- <constant name="INSTANCE_LIGHT" value="5" enum="InstanceType">
+ <constant name="INSTANCE_PARTICLES_COLLISION" value="5" enum="InstanceType">
+ </constant>
+ <constant name="INSTANCE_LIGHT" value="6" enum="InstanceType">
The instance is a light.
</constant>
- <constant name="INSTANCE_REFLECTION_PROBE" value="6" enum="InstanceType">
+ <constant name="INSTANCE_REFLECTION_PROBE" value="7" enum="InstanceType">
The instance is a reflection probe.
</constant>
- <constant name="INSTANCE_DECAL" value="7" enum="InstanceType">
+ <constant name="INSTANCE_DECAL" value="8" enum="InstanceType">
The instance is a decal.
</constant>
- <constant name="INSTANCE_GI_PROBE" value="8" enum="InstanceType">
+ <constant name="INSTANCE_GI_PROBE" value="9" enum="InstanceType">
The instance is a GI probe.
</constant>
- <constant name="INSTANCE_LIGHTMAP" value="9" enum="InstanceType">
+ <constant name="INSTANCE_LIGHTMAP" value="10" enum="InstanceType">
The instance is a lightmap.
</constant>
- <constant name="INSTANCE_MAX" value="10" enum="InstanceType">
+ <constant name="INSTANCE_MAX" value="11" enum="InstanceType">
Represents the size of the [enum InstanceType] enum.
</constant>
<constant name="INSTANCE_GEOMETRY_MASK" value="30" enum="InstanceType">
diff --git a/doc/classes/ResourceLoader.xml b/doc/classes/ResourceLoader.xml
index 1cf775f389..049613fa5d 100644
--- a/doc/classes/ResourceLoader.xml
+++ b/doc/classes/ResourceLoader.xml
@@ -6,9 +6,9 @@
<description>
Singleton used to load resource files from the filesystem.
It uses the many [ResourceFormatLoader] classes registered in the engine (either built-in or from a plugin) to load files into memory and convert them to a format that can be used by the engine.
- GDScript has a simplified [method @GDScript.load] built-in method which can be used in most situations, leaving the use of [ResourceLoader] for more advanced scenarios.
</description>
<tutorials>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="exists">
@@ -65,7 +65,8 @@
The registered [ResourceFormatLoader]s are queried sequentially to find the first one which can handle the file's extension, and then attempt loading. If loading fails, the remaining ResourceFormatLoaders are also attempted.
An optional [code]type_hint[/code] can be used to further specify the [Resource] type that should be handled by the [ResourceFormatLoader].
If [code]no_cache[/code] is [code]true[/code], the resource cache will be bypassed and the resource will be loaded anew. Otherwise, the cached resource will be returned if it exists.
- Returns an empty resource if no ResourceFormatLoader could handle the file.
+ Returns an empty resource if no [ResourceFormatLoader] could handle the file.
+ GDScript has a simplified [method @GDScript.load] built-in method which can be used in most situations, leaving the use of [ResourceLoader] for more advanced scenarios.
</description>
</method>
<method name="load_threaded_get">
diff --git a/doc/classes/RichTextLabel.xml b/doc/classes/RichTextLabel.xml
index 050f1aab25..faf0d97766 100644
--- a/doc/classes/RichTextLabel.xml
+++ b/doc/classes/RichTextLabel.xml
@@ -10,6 +10,8 @@
</description>
<tutorials>
<link title="BBCode in RichTextLabel">https://docs.godotengine.org/en/latest/tutorials/gui/bbcode_in_richtextlabel.html</link>
+ <link title="GUI Rich Text/BBcode Demo">https://godotengine.org/asset-library/asset/132</link>
+ <link title="OS Test Demo">https://godotengine.org/asset-library/asset/677</link>
</tutorials>
<methods>
<method name="add_image">
diff --git a/doc/classes/RigidBody2D.xml b/doc/classes/RigidBody2D.xml
index f3d43b193e..6f41d5ba27 100644
--- a/doc/classes/RigidBody2D.xml
+++ b/doc/classes/RigidBody2D.xml
@@ -12,6 +12,8 @@
The center of mass is always located at the node's origin without taking into account the [CollisionShape2D] centroid offsets.
</description>
<tutorials>
+ <link title="2D Physics Platformer Demo">https://godotengine.org/asset-library/asset/119</link>
+ <link title="Instancing Demo">https://godotengine.org/asset-library/asset/148</link>
</tutorials>
<methods>
<method name="_integrate_forces" qualifiers="virtual">
@@ -117,6 +119,7 @@
<members>
<member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="-1.0">
Damps the body's [member angular_velocity]. If [code]-1[/code], the body will use the [b]Default Angular Damp[/b] defined in [b]Project &gt; Project Settings &gt; Physics &gt; 2d[/b].
+ See [member ProjectSettings.physics/2d/default_angular_damp] for more details about damping.
</member>
<member name="angular_velocity" type="float" setter="set_angular_velocity" getter="get_angular_velocity" default="0.0">
The body's rotational velocity.
@@ -136,7 +139,7 @@
</member>
<member name="contacts_reported" type="int" setter="set_max_contacts_reported" getter="get_max_contacts_reported" default="0">
The maximum number of contacts that will be recorded. Requires [member contact_monitor] to be set to [code]true[/code].
- [b]Note:[/b] The number of contacts is different from the number of collisions. Collisions between parallel edges will result in two contacts (one at each end), and collisions between parallel faces will result in four contacts (one at each corner).
+ [b]Note:[/b] The number of contacts is different from the number of collisions. Collisions between parallel edges will result in two contacts (one at each end).
</member>
<member name="continuous_cd" type="int" setter="set_continuous_collision_detection_mode" getter="get_continuous_collision_detection_mode" enum="RigidBody2D.CCDMode" default="0">
Continuous collision detection mode.
@@ -153,6 +156,7 @@
</member>
<member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="-1.0">
Damps the body's [member linear_velocity]. If [code]-1[/code], the body will use the [b]Default Linear Damp[/b] in [b]Project &gt; Project Settings &gt; Physics &gt; 2d[/b].
+ See [member ProjectSettings.physics/2d/default_linear_damp] for more details about damping.
</member>
<member name="linear_velocity" type="Vector2" setter="set_linear_velocity" getter="get_linear_velocity" default="Vector2( 0, 0 )">
The body's linear velocity.
diff --git a/doc/classes/RigidBody3D.xml b/doc/classes/RigidBody3D.xml
index e9ebf33aa7..f8dc9887a9 100644
--- a/doc/classes/RigidBody3D.xml
+++ b/doc/classes/RigidBody3D.xml
@@ -12,6 +12,8 @@
</description>
<tutorials>
<link title="Physics introduction">https://docs.godotengine.org/en/latest/tutorials/physics/physics_introduction.html</link>
+ <link title="3D Truck Town Demo">https://godotengine.org/asset-library/asset/524</link>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
</tutorials>
<methods>
<method name="_integrate_forces" qualifiers="virtual">
@@ -132,6 +134,7 @@
<members>
<member name="angular_damp" type="float" setter="set_angular_damp" getter="get_angular_damp" default="-1.0">
Damps RigidBody3D's rotational forces.
+ See [member ProjectSettings.physics/3d/default_angular_damp] for more details about damping.
</member>
<member name="angular_velocity" type="Vector3" setter="set_angular_velocity" getter="get_angular_velocity" default="Vector3( 0, 0, 0 )">
RigidBody3D's rotational velocity.
@@ -177,6 +180,7 @@
</member>
<member name="linear_damp" type="float" setter="set_linear_damp" getter="get_linear_damp" default="-1.0">
The body's linear damp. Cannot be less than -1.0. If this value is different from -1.0, any linear damp derived from the world or areas will be overridden.
+ See [member ProjectSettings.physics/3d/default_linear_damp] for more details about damping.
</member>
<member name="linear_velocity" type="Vector3" setter="set_linear_velocity" getter="get_linear_velocity" default="Vector3( 0, 0, 0 )">
The body's linear velocity. Can be used sporadically, but [b]don't set this every frame[/b], because physics may run in another thread and runs at a different granularity. Use [method _integrate_forces] as your process loop for precise control of the body state.
diff --git a/doc/classes/Skeleton3D.xml b/doc/classes/Skeleton3D.xml
index 7ec8fe12fb..fe2cc1f5ad 100644
--- a/doc/classes/Skeleton3D.xml
+++ b/doc/classes/Skeleton3D.xml
@@ -9,6 +9,8 @@
Note that "global pose" below refers to the overall transform of the bone with respect to skeleton, so it not the actual global/world transform of the bone.
</description>
<tutorials>
+ <link title="3D Inverse Kinematics Demo">https://godotengine.org/asset-library/asset/523</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
<method name="add_bone">
diff --git a/doc/classes/SkeletonIK3D.xml b/doc/classes/SkeletonIK3D.xml
index de83847403..5193109447 100644
--- a/doc/classes/SkeletonIK3D.xml
+++ b/doc/classes/SkeletonIK3D.xml
@@ -5,6 +5,7 @@
<description>
</description>
<tutorials>
+ <link title="3D Inverse Kinematics Demo">https://godotengine.org/asset-library/asset/523</link>
</tutorials>
<methods>
<method name="get_parent_skeleton" qualifiers="const">
diff --git a/doc/classes/SphereShape3D.xml b/doc/classes/SphereShape3D.xml
index 1eaf890639..e90493fca2 100644
--- a/doc/classes/SphereShape3D.xml
+++ b/doc/classes/SphereShape3D.xml
@@ -7,6 +7,7 @@
Sphere shape for 3D collisions, which can be set into a [PhysicsBody3D] or [Area3D]. This shape is useful for modeling sphere-like 3D objects.
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/SpotLight3D.xml b/doc/classes/SpotLight3D.xml
index fc849baa8d..f868503bbd 100644
--- a/doc/classes/SpotLight3D.xml
+++ b/doc/classes/SpotLight3D.xml
@@ -8,6 +8,7 @@
</description>
<tutorials>
<link title="3D lights and shadows">https://docs.godotengine.org/en/latest/tutorials/3d/lights_and_shadows.html</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Sprite2D.xml b/doc/classes/Sprite2D.xml
index f218631038..8205889ea7 100644
--- a/doc/classes/Sprite2D.xml
+++ b/doc/classes/Sprite2D.xml
@@ -7,6 +7,7 @@
A node that displays a 2D texture. The texture displayed can be a region from a larger atlas texture, or a frame from a sprite sheet animation.
</description>
<tutorials>
+ <link title="Instancing Demo">https://godotengine.org/asset-library/asset/148</link>
</tutorials>
<methods>
<method name="get_rect" qualifiers="const">
diff --git a/doc/classes/StaticBody3D.xml b/doc/classes/StaticBody3D.xml
index c896efc314..63a15cbe1d 100644
--- a/doc/classes/StaticBody3D.xml
+++ b/doc/classes/StaticBody3D.xml
@@ -8,6 +8,9 @@
Additionally, a constant linear or angular velocity can be set for the static body, so even if it doesn't move, it affects other bodies as if it was moving (this is useful for simulating conveyor belts or conveyor wheels).
</description>
<tutorials>
+ <link title="3D Physics Tests Demo">https://godotengine.org/asset-library/asset/675</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/StreamPeerTCP.xml b/doc/classes/StreamPeerTCP.xml
index dbd53f8ba0..bb85d94bf9 100644
--- a/doc/classes/StreamPeerTCP.xml
+++ b/doc/classes/StreamPeerTCP.xml
@@ -52,7 +52,7 @@
<return type="bool">
</return>
<description>
- Returns [code]true[/code] if this peer is currently connected to a host, [code]false[/code] otherwise.
+ Returns [code]true[/code] if this peer is currently connected or is connecting to a host, [code]false[/code] otherwise.
</description>
</method>
<method name="set_no_delay">
diff --git a/doc/classes/SubViewport.xml b/doc/classes/SubViewport.xml
index c9c7589631..4736401395 100644
--- a/doc/classes/SubViewport.xml
+++ b/doc/classes/SubViewport.xml
@@ -1,10 +1,19 @@
<?xml version="1.0" encoding="UTF-8" ?>
<class name="SubViewport" inherits="Viewport" version="4.0">
<brief_description>
+ Creates a sub-view into the screen.
</brief_description>
<description>
</description>
<tutorials>
+ <link title="Viewport and canvas transforms">https://docs.godotengine.org/en/latest/tutorials/2d/2d_transforms.html</link>
+ <link title="Viewports tutorial index">https://docs.godotengine.org/en/latest/tutorials/viewports/index.html</link>
+ <link title="GUI in 3D Demo">https://godotengine.org/asset-library/asset/127</link>
+ <link title="3D in 2D Demo">https://godotengine.org/asset-library/asset/128</link>
+ <link title="2D in 3D Demo">https://godotengine.org/asset-library/asset/129</link>
+ <link title="Screen Capture Demo">https://godotengine.org/asset-library/asset/130</link>
+ <link title="Dynamic Split Screen Demo">https://godotengine.org/asset-library/asset/541</link>
+ <link title="3D Viewport Scaling Demo">https://godotengine.org/asset-library/asset/586</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/SurfaceTool.xml b/doc/classes/SurfaceTool.xml
index eeb6b6cd9d..385e31ccc7 100644
--- a/doc/classes/SurfaceTool.xml
+++ b/doc/classes/SurfaceTool.xml
@@ -19,6 +19,7 @@
[b]Note:[/b] Godot uses clockwise [url=https://learnopengl.com/Advanced-OpenGL/Face-culling]winding order[/url] for front faces of triangle primitive modes.
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="add_bones">
diff --git a/doc/classes/TextureButton.xml b/doc/classes/TextureButton.xml
index 46b008c018..70bf138f27 100644
--- a/doc/classes/TextureButton.xml
+++ b/doc/classes/TextureButton.xml
@@ -9,6 +9,7 @@
See also [BaseButton] which contains common properties and methods associated with this node.
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/TextureRect.xml b/doc/classes/TextureRect.xml
index 709d87b858..743e7f6d1e 100644
--- a/doc/classes/TextureRect.xml
+++ b/doc/classes/TextureRect.xml
@@ -7,6 +7,7 @@
Used to draw icons and sprites in a user interface. The texture's placement can be controlled with the [member stretch_mode] property. It can scale, tile, or stay centered inside its bounding rectangle.
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Thread.xml b/doc/classes/Thread.xml
index 46377ecf20..88f46e3937 100644
--- a/doc/classes/Thread.xml
+++ b/doc/classes/Thread.xml
@@ -10,6 +10,7 @@
<tutorials>
<link title="Using multiple threads">https://docs.godotengine.org/en/latest/tutorials/threads/using_multiple_threads.html</link>
<link title="Thread-safe APIs">https://docs.godotengine.org/en/latest/tutorials/threads/thread_safe_apis.html</link>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
<method name="get_id" qualifiers="const">
diff --git a/doc/classes/TileMap.xml b/doc/classes/TileMap.xml
index 2780545f55..371ba80723 100644
--- a/doc/classes/TileMap.xml
+++ b/doc/classes/TileMap.xml
@@ -8,6 +8,12 @@
</description>
<tutorials>
<link title="Using Tilemaps">https://docs.godotengine.org/en/latest/tutorials/2d/using_tilemaps.html</link>
+ <link title="2D Platformer Demo">https://godotengine.org/asset-library/asset/120</link>
+ <link title="2D Isometric Demo">https://godotengine.org/asset-library/asset/112</link>
+ <link title="2D Hexagonal Demo">https://godotengine.org/asset-library/asset/111</link>
+ <link title="2D Navigation Astar Demo">https://godotengine.org/asset-library/asset/519</link>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
+ <link title="2D Kinematic Character Demo">https://godotengine.org/asset-library/asset/113</link>
</tutorials>
<methods>
<method name="clear">
diff --git a/doc/classes/TileSet.xml b/doc/classes/TileSet.xml
index 4991a1e58b..9ab9d9ca7a 100644
--- a/doc/classes/TileSet.xml
+++ b/doc/classes/TileSet.xml
@@ -8,6 +8,13 @@
Tiles are referenced by a unique integer ID.
</description>
<tutorials>
+ <link title="Using Tilemaps">https://docs.godotengine.org/en/latest/tutorials/2d/using_tilemaps.html</link>
+ <link title="2D Platformer Demo">https://godotengine.org/asset-library/asset/120</link>
+ <link title="2D Isometric Demo">https://godotengine.org/asset-library/asset/112</link>
+ <link title="2D Hexagonal Demo">https://godotengine.org/asset-library/asset/111</link>
+ <link title="2D Navigation Astar Demo">https://godotengine.org/asset-library/asset/519</link>
+ <link title="2D Role Playing Game Demo">https://godotengine.org/asset-library/asset/520</link>
+ <link title="2D Kinematic Character Demo">https://godotengine.org/asset-library/asset/113</link>
</tutorials>
<methods>
<method name="_forward_atlas_subtile_selection" qualifiers="virtual">
diff --git a/doc/classes/Timer.xml b/doc/classes/Timer.xml
index 5d684755fa..ab75e21ce8 100644
--- a/doc/classes/Timer.xml
+++ b/doc/classes/Timer.xml
@@ -8,6 +8,7 @@
[b]Note:[/b] To create an one-shot timer without instantiating a node, use [method SceneTree.create_timer].
</description>
<tutorials>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="is_stopped" qualifiers="const">
diff --git a/doc/classes/Transform.xml b/doc/classes/Transform.xml
index 09dfe56f8f..52dda75dff 100644
--- a/doc/classes/Transform.xml
+++ b/doc/classes/Transform.xml
@@ -11,6 +11,9 @@
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
<link title="Matrices and transforms">https://docs.godotengine.org/en/latest/tutorials/math/matrices_and_transforms.html</link>
<link title="Using 3D transforms">https://docs.godotengine.org/en/latest/tutorials/3d/using_transforms.html</link>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="2.5D Demo">https://godotengine.org/asset-library/asset/583</link>
</tutorials>
<methods>
<method name="Transform">
diff --git a/doc/classes/Transform2D.xml b/doc/classes/Transform2D.xml
index 5da88892fe..b23bb4d33b 100644
--- a/doc/classes/Transform2D.xml
+++ b/doc/classes/Transform2D.xml
@@ -8,7 +8,10 @@
For more information, read the "Matrices and transforms" documentation article.
</description>
<tutorials>
+ <link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
<link title="Matrices and transforms">https://docs.godotengine.org/en/latest/tutorials/math/matrices_and_transforms.html</link>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="2.5D Demo">https://godotengine.org/asset-library/asset/583</link>
</tutorials>
<methods>
<method name="Transform2D">
diff --git a/doc/classes/VBoxContainer.xml b/doc/classes/VBoxContainer.xml
index 6b32a08f93..213f8fd742 100644
--- a/doc/classes/VBoxContainer.xml
+++ b/doc/classes/VBoxContainer.xml
@@ -7,6 +7,7 @@
Vertical box container. See [BoxContainer].
</description>
<tutorials>
+ <link title="3D Voxel Demo">https://godotengine.org/asset-library/asset/676</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/Vector2.xml b/doc/classes/Vector2.xml
index 44398cabbf..025d6474ee 100644
--- a/doc/classes/Vector2.xml
+++ b/doc/classes/Vector2.xml
@@ -10,6 +10,11 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="Advanced vector math">https://docs.godotengine.org/en/latest/tutorials/math/vectors_advanced.html</link>
+ <link title="3Blue1Brown Essence of Linear Algebra">https://www.youtube.com/playlist?list=PLZHQObOWTQDPD3MizzM2xVFitgF8hE_ab</link>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="All 2D Demos">https://github.com/godotengine/godot-demo-projects/tree/master/2d</link>
</tutorials>
<methods>
<method name="Vector2">
diff --git a/doc/classes/Vector2i.xml b/doc/classes/Vector2i.xml
index 3ad926210b..75ddc46dab 100644
--- a/doc/classes/Vector2i.xml
+++ b/doc/classes/Vector2i.xml
@@ -10,6 +10,8 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="3Blue1Brown Essence of Linear Algebra">https://www.youtube.com/playlist?list=PLZHQObOWTQDPD3MizzM2xVFitgF8hE_ab</link>
</tutorials>
<methods>
<method name="Vector2i">
diff --git a/doc/classes/Vector3.xml b/doc/classes/Vector3.xml
index df5d4f150e..b26fe09e91 100644
--- a/doc/classes/Vector3.xml
+++ b/doc/classes/Vector3.xml
@@ -10,6 +10,11 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="Advanced vector math">https://docs.godotengine.org/en/latest/tutorials/math/vectors_advanced.html</link>
+ <link title="3Blue1Brown Essence of Linear Algebra">https://www.youtube.com/playlist?list=PLZHQObOWTQDPD3MizzM2xVFitgF8hE_ab</link>
+ <link title="Matrix Transform Demo">https://godotengine.org/asset-library/asset/584</link>
+ <link title="All 3D Demos">https://github.com/godotengine/godot-demo-projects/tree/master/3d</link>
</tutorials>
<methods>
<method name="Vector3">
diff --git a/doc/classes/Vector3i.xml b/doc/classes/Vector3i.xml
index bd7c354241..f977b81ce7 100644
--- a/doc/classes/Vector3i.xml
+++ b/doc/classes/Vector3i.xml
@@ -10,6 +10,8 @@
</description>
<tutorials>
<link title="Math tutorial index">https://docs.godotengine.org/en/latest/tutorials/math/index.html</link>
+ <link title="Vector math">https://docs.godotengine.org/en/latest/tutorials/math/vector_math.html</link>
+ <link title="3Blue1Brown Essence of Linear Algebra">https://www.youtube.com/playlist?list=PLZHQObOWTQDPD3MizzM2xVFitgF8hE_ab</link>
</tutorials>
<methods>
<method name="Vector3i">
diff --git a/doc/classes/VehicleBody3D.xml b/doc/classes/VehicleBody3D.xml
index 5a2cce376e..1125a1da94 100644
--- a/doc/classes/VehicleBody3D.xml
+++ b/doc/classes/VehicleBody3D.xml
@@ -9,6 +9,7 @@
[b]Note:[/b] This class has known issues and isn't designed to provide realistic 3D vehicle physics. If you want advanced vehicle physics, you will probably have to write your own physics integration using another [PhysicsBody3D] class.
</description>
<tutorials>
+ <link title="3D Truck Town Demo">https://godotengine.org/asset-library/asset/524</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/VehicleWheel3D.xml b/doc/classes/VehicleWheel3D.xml
index 97b2abfa92..fb0cb03d1c 100644
--- a/doc/classes/VehicleWheel3D.xml
+++ b/doc/classes/VehicleWheel3D.xml
@@ -8,6 +8,7 @@
[b]Note:[/b] This class has known issues and isn't designed to provide realistic 3D vehicle physics. If you want advanced vehicle physics, you will probably have to write your own physics integration using another [PhysicsBody3D] class.
</description>
<tutorials>
+ <link title="3D Truck Town Demo">https://godotengine.org/asset-library/asset/524</link>
</tutorials>
<methods>
<method name="get_rpm" qualifiers="const">
diff --git a/doc/classes/Viewport.xml b/doc/classes/Viewport.xml
index e42c4021ab..84974874de 100644
--- a/doc/classes/Viewport.xml
+++ b/doc/classes/Viewport.xml
@@ -14,6 +14,12 @@
<tutorials>
<link title="Viewport and canvas transforms">https://docs.godotengine.org/en/latest/tutorials/2d/2d_transforms.html</link>
<link title="Viewports tutorial index">https://docs.godotengine.org/en/latest/tutorials/viewports/index.html</link>
+ <link title="GUI in 3D Demo">https://godotengine.org/asset-library/asset/127</link>
+ <link title="3D in 2D Demo">https://godotengine.org/asset-library/asset/128</link>
+ <link title="2D in 3D Demo">https://godotengine.org/asset-library/asset/129</link>
+ <link title="Screen Capture Demo">https://godotengine.org/asset-library/asset/130</link>
+ <link title="Dynamic Split Screen Demo">https://godotengine.org/asset-library/asset/541</link>
+ <link title="3D Viewport Scaling Demo">https://godotengine.org/asset-library/asset/586</link>
</tutorials>
<methods>
<method name="find_world_2d" qualifiers="const">
diff --git a/doc/classes/ViewportTexture.xml b/doc/classes/ViewportTexture.xml
index 14b460a43b..393f1bb0b8 100644
--- a/doc/classes/ViewportTexture.xml
+++ b/doc/classes/ViewportTexture.xml
@@ -8,6 +8,10 @@
To create a ViewportTexture in code, use the [method Viewport.get_texture] method on the target viewport.
</description>
<tutorials>
+ <link title="GUI in 3D Demo">https://godotengine.org/asset-library/asset/127</link>
+ <link title="3D in 2D Demo">https://godotengine.org/asset-library/asset/128</link>
+ <link title="2D in 3D Demo">https://godotengine.org/asset-library/asset/129</link>
+ <link title="3D Viewport Scaling Demo">https://godotengine.org/asset-library/asset/586</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/classes/VisibilityNotifier2D.xml b/doc/classes/VisibilityNotifier2D.xml
index 314a100989..761438b77e 100644
--- a/doc/classes/VisibilityNotifier2D.xml
+++ b/doc/classes/VisibilityNotifier2D.xml
@@ -9,6 +9,7 @@
[b]Note:[/b] For performance reasons, VisibilityNotifier2D uses an approximate heuristic with precision determined by [member ProjectSettings.world/2d/cell_size]. If you need precise visibility checking, use another method such as adding an [Area2D] node as a child of a [Camera2D] node.
</description>
<tutorials>
+ <link title="2D Dodge The Creeps Demo">https://godotengine.org/asset-library/asset/515</link>
</tutorials>
<methods>
<method name="is_on_screen" qualifiers="const">
diff --git a/doc/classes/VisualShaderNode.xml b/doc/classes/VisualShaderNode.xml
index 3bb527f3d4..6327ab534f 100644
--- a/doc/classes/VisualShaderNode.xml
+++ b/doc/classes/VisualShaderNode.xml
@@ -57,12 +57,6 @@
Emitted when the node requests an editor refresh. Currently called only in setter of [member VisualShaderNodeTexture.source], [VisualShaderNodeTexture], and [VisualShaderNodeCubemap] (and their derivatives).
</description>
</signal>
- <signal name="show_port_preview">
- <argument index="0" name="port_id" type="int">
- </argument>
- <description>
- </description>
- </signal>
</signals>
<constants>
<constant name="PORT_TYPE_SCALAR" value="0" enum="PortType">
diff --git a/doc/classes/WorldEnvironment.xml b/doc/classes/WorldEnvironment.xml
index f9f0241365..c1cf639ec0 100644
--- a/doc/classes/WorldEnvironment.xml
+++ b/doc/classes/WorldEnvironment.xml
@@ -10,6 +10,9 @@
</description>
<tutorials>
<link title="Environment and post-processing">https://docs.godotengine.org/en/latest/tutorials/3d/environment_and_post_processing.html</link>
+ <link title="3D Material Testers Demo">https://godotengine.org/asset-library/asset/123</link>
+ <link title="2D HDR Demo">https://godotengine.org/asset-library/asset/110</link>
+ <link title="Third Person Shooter Demo">https://godotengine.org/asset-library/asset/678</link>
</tutorials>
<methods>
</methods>
diff --git a/doc/translations/ar.po b/doc/translations/ar.po
index eae5d09b38..1857e45627 100644
--- a/doc/translations/ar.po
+++ b/doc/translations/ar.po
@@ -11069,7 +11069,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14163,7 +14163,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32615,7 +32615,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/ca.po b/doc/translations/ca.po
index caa43cfa3a..2e5c7e2c84 100644
--- a/doc/translations/ca.po
+++ b/doc/translations/ca.po
@@ -11100,7 +11100,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14194,7 +14194,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32646,7 +32646,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/classes.pot b/doc/translations/classes.pot
index 7f352bce28..41c20b05ea 100644
--- a/doc/translations/classes.pot
+++ b/doc/translations/classes.pot
@@ -11070,7 +11070,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14164,7 +14164,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32616,7 +32616,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/cs.po b/doc/translations/cs.po
index 8f8cb7da91..8d94351710 100644
--- a/doc/translations/cs.po
+++ b/doc/translations/cs.po
@@ -11562,7 +11562,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14656,7 +14656,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -33115,7 +33115,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/de.po b/doc/translations/de.po
index 740d4eed12..95b73f8257 100644
--- a/doc/translations/de.po
+++ b/doc/translations/de.po
@@ -11385,7 +11385,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14492,7 +14492,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -33032,7 +33032,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/es.po b/doc/translations/es.po
index 4d71c12010..ef6012b240 100644
--- a/doc/translations/es.po
+++ b/doc/translations/es.po
@@ -14573,10 +14573,10 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
"Devuelve [code]true[/code] si el nodo está configurado como de nivel "
-"superior. Ver [method set_as_toplevel]."
+"superior. Ver [method set_as_top_level]."
#: doc/classes/CanvasItem.xml:530
msgid ""
@@ -18642,7 +18642,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -44207,10 +44207,10 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
-"Devuelve si este nodo se establece como Toplevel, es decir, si ignora las "
+"Devuelve si este nodo se establece como top_level, es decir, si ignora las "
"transformaciones de sus nodos padres."
#: doc/classes/Node3D.xml:97
diff --git a/doc/translations/fa.po b/doc/translations/fa.po
index 874d3273c3..06d6ee47d7 100644
--- a/doc/translations/fa.po
+++ b/doc/translations/fa.po
@@ -11075,7 +11075,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14169,7 +14169,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32621,7 +32621,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/fi.po b/doc/translations/fi.po
index 3163a6131f..02ac9fdd76 100644
--- a/doc/translations/fi.po
+++ b/doc/translations/fi.po
@@ -11088,7 +11088,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14182,7 +14182,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32634,7 +32634,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/fr.po b/doc/translations/fr.po
index 55434729e5..a8075d919d 100644
--- a/doc/translations/fr.po
+++ b/doc/translations/fr.po
@@ -11406,7 +11406,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14500,7 +14500,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32982,7 +32982,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/id.po b/doc/translations/id.po
index 246cf15495..b686ef8de6 100644
--- a/doc/translations/id.po
+++ b/doc/translations/id.po
@@ -11101,7 +11101,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14195,7 +14195,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32647,7 +32647,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/it.po b/doc/translations/it.po
index 8a8ec5d107..f664268ebe 100644
--- a/doc/translations/it.po
+++ b/doc/translations/it.po
@@ -11359,7 +11359,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14453,7 +14453,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32913,7 +32913,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/ja.po b/doc/translations/ja.po
index 02072678ef..9727ca0cd3 100644
--- a/doc/translations/ja.po
+++ b/doc/translations/ja.po
@@ -12289,7 +12289,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -15383,7 +15383,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -33885,7 +33885,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/ko.po b/doc/translations/ko.po
index ddc892b659..f69b5f00c0 100644
--- a/doc/translations/ko.po
+++ b/doc/translations/ko.po
@@ -11077,7 +11077,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14171,7 +14171,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32623,7 +32623,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/nl.po b/doc/translations/nl.po
index 4f840c229c..17bd3db383 100644
--- a/doc/translations/nl.po
+++ b/doc/translations/nl.po
@@ -11103,7 +11103,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14197,7 +14197,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32649,7 +32649,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/pl.po b/doc/translations/pl.po
index b3817aa5f6..fd494dc656 100644
--- a/doc/translations/pl.po
+++ b/doc/translations/pl.po
@@ -11121,7 +11121,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14215,7 +14215,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32668,7 +32668,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/pt_BR.po b/doc/translations/pt_BR.po
index 89460c5caf..2e8337989f 100644
--- a/doc/translations/pt_BR.po
+++ b/doc/translations/pt_BR.po
@@ -11116,7 +11116,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14210,7 +14210,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32662,7 +32662,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/ro.po b/doc/translations/ro.po
index fb47ddb0dc..f7e5e0f86f 100644
--- a/doc/translations/ro.po
+++ b/doc/translations/ro.po
@@ -11077,7 +11077,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14171,7 +14171,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32623,7 +32623,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/ru.po b/doc/translations/ru.po
index 83c3440a64..6a397ec35d 100644
--- a/doc/translations/ru.po
+++ b/doc/translations/ru.po
@@ -11582,7 +11582,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14676,7 +14676,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -33160,7 +33160,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/sr_Cyrl.po b/doc/translations/sr_Cyrl.po
index 6d0bd44ba7..156fbabfc0 100644
--- a/doc/translations/sr_Cyrl.po
+++ b/doc/translations/sr_Cyrl.po
@@ -11087,7 +11087,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14181,7 +14181,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32633,7 +32633,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/th.po b/doc/translations/th.po
index 5753295ef4..cbcbc51f63 100644
--- a/doc/translations/th.po
+++ b/doc/translations/th.po
@@ -11093,7 +11093,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14187,7 +14187,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32639,7 +32639,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/tr.po b/doc/translations/tr.po
index 0e5992ad0e..33208243f8 100644
--- a/doc/translations/tr.po
+++ b/doc/translations/tr.po
@@ -11069,7 +11069,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14163,7 +14163,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32615,7 +32615,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/uk.po b/doc/translations/uk.po
index e94a78591f..45da6d19aa 100644
--- a/doc/translations/uk.po
+++ b/doc/translations/uk.po
@@ -11155,7 +11155,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14249,7 +14249,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32701,7 +32701,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/zh_Hans.po b/doc/translations/zh_Hans.po
index 08e9667c29..2e9d14c0d8 100644
--- a/doc/translations/zh_Hans.po
+++ b/doc/translations/zh_Hans.po
@@ -11302,7 +11302,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14396,7 +14396,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32851,7 +32851,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/doc/translations/zh_Hant.po b/doc/translations/zh_Hant.po
index e09b693f6e..9483576d0e 100644
--- a/doc/translations/zh_Hant.po
+++ b/doc/translations/zh_Hant.po
@@ -11106,7 +11106,7 @@ msgstr ""
#: doc/classes/CanvasItem.xml:523
msgid ""
"Returns [code]true[/code] if the node is set as top-level. See [method "
-"set_as_toplevel]."
+"set_as_top_level]."
msgstr ""
#: doc/classes/CanvasItem.xml:530
@@ -14200,7 +14200,7 @@ msgstr ""
#: doc/classes/Control.xml:545
msgid ""
-"Invalidates the size cache in this node and in parent nodes up to toplevel. "
+"Invalidates the size cache in this node and in parent nodes up to top_level. "
"Intended to be used with [method get_minimum_size] when the return value is "
"changed. Setting [member rect_min_size] directly calls this method "
"automatically."
@@ -32652,7 +32652,7 @@ msgstr ""
#: doc/classes/Node3D.xml:90
msgid ""
-"Returns whether this node is set as Toplevel, that is whether it ignores its "
+"Returns whether this node is set as top_level, that is whether it ignores its "
"parent nodes transformations."
msgstr ""
diff --git a/drivers/dummy/rasterizer_dummy.h b/drivers/dummy/rasterizer_dummy.h
index bdb51b1573..bef4d999af 100644
--- a/drivers/dummy/rasterizer_dummy.h
+++ b/drivers/dummy/rasterizer_dummy.h
@@ -80,7 +80,7 @@ public:
void environment_set_canvas_max_layer(RID p_env, int p_max_layer) override {}
void environment_set_ambient_light(RID p_env, const Color &p_color, RS::EnvironmentAmbientSource p_ambient = RS::ENV_AMBIENT_SOURCE_BG, float p_energy = 1.0, float p_sky_contribution = 0.0, RS::EnvironmentReflectionSource p_reflection_source = RS::ENV_REFLECTION_SOURCE_BG, const Color &p_ao_color = Color()) override {}
- void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) override {}
+ void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) override {}
void environment_glow_set_use_bicubic_upscale(bool p_enable) override {}
void environment_glow_set_use_high_quality(bool p_enable) override {}
@@ -154,6 +154,7 @@ public:
void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) override {}
void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count) override {}
void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) override {}
+ void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) override {}
void set_scene_pass(uint64_t p_pass) override {}
void set_time(double p_time, double p_step) override {}
@@ -802,6 +803,7 @@ public:
void particles_set_fractional_delta(RID p_particles, bool p_enable) override {}
void particles_set_subemitter(RID p_particles, RID p_subemitter_particles) override {}
void particles_set_view_axis(RID p_particles, const Vector3 &p_axis) override {}
+ void particles_set_collision_base_size(RID p_particles, float p_size) override {}
void particles_restart(RID p_particles) override {}
void particles_set_draw_order(RID p_particles, RS::ParticlesDrawOrder p_order) override {}
@@ -819,6 +821,28 @@ public:
int particles_get_draw_passes(RID p_particles) const override { return 0; }
RID particles_get_draw_pass_mesh(RID p_particles, int p_pass) const override { return RID(); }
+ void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) override {}
+ void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) override {}
+
+ void update_particles() override {}
+
+ /* PARTICLES COLLISION */
+
+ RID particles_collision_create() override { return RID(); }
+ void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) override {}
+ void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) override {}
+ void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) override {}
+ void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) override {}
+ void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) override {}
+ void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) override {}
+ void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) override {}
+ void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) override {}
+ void particles_collision_height_field_update(RID p_particles_collision) override {}
+ void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) override {}
+ AABB particles_collision_get_aabb(RID p_particles_collision) const override { return AABB(); }
+ bool particles_collision_is_heightfield(RID p_particles_collision) const override { return false; }
+ RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const override { return RID(); }
+
/* GLOBAL VARIABLES */
void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value) override {}
diff --git a/editor/animation_track_editor.cpp b/editor/animation_track_editor.cpp
index 39e863ae0f..52c984cbc0 100644
--- a/editor/animation_track_editor.cpp
+++ b/editor/animation_track_editor.cpp
@@ -5758,7 +5758,7 @@ AnimationTrackEditor::AnimationTrackEditor() {
box_selection = memnew(Control);
add_child(box_selection);
- box_selection->set_as_toplevel(true);
+ box_selection->set_as_top_level(true);
box_selection->set_mouse_filter(MOUSE_FILTER_IGNORE);
box_selection->hide();
box_selection->connect("draw", callable_mp(this, &AnimationTrackEditor::_box_selection_draw));
diff --git a/editor/editor_audio_buses.cpp b/editor/editor_audio_buses.cpp
index adb09532eb..a3deb95130 100644
--- a/editor/editor_audio_buses.cpp
+++ b/editor/editor_audio_buses.cpp
@@ -846,7 +846,7 @@ EditorAudioBus::EditorAudioBus(EditorAudioBuses *p_buses, bool p_is_master) {
audioprev_hbc->add_child(audio_value_preview_label);
slider->add_child(audio_value_preview_box);
- audio_value_preview_box->set_as_toplevel(true);
+ audio_value_preview_box->set_as_top_level(true);
Ref<StyleBoxFlat> panel_style = memnew(StyleBoxFlat);
panel_style->set_bg_color(Color(0.0f, 0.0f, 0.0f, 0.8f));
audio_value_preview_box->add_theme_style_override("panel", panel_style);
diff --git a/editor/editor_data.cpp b/editor/editor_data.cpp
index 5118ccacad..1002c4917b 100644
--- a/editor/editor_data.cpp
+++ b/editor/editor_data.cpp
@@ -936,7 +936,13 @@ void EditorData::script_class_save_icon_paths() {
}
}
- ProjectSettings::get_singleton()->set("_global_script_class_icons", d);
+ if (d.empty()) {
+ if (ProjectSettings::get_singleton()->has_setting("_global_script_class_icons")) {
+ ProjectSettings::get_singleton()->clear("_global_script_class_icons");
+ }
+ } else {
+ ProjectSettings::get_singleton()->set("_global_script_class_icons", d);
+ }
ProjectSettings::get_singleton()->save();
}
diff --git a/editor/editor_file_dialog.cpp b/editor/editor_file_dialog.cpp
index ba9f27f65f..2140b6bd13 100644
--- a/editor/editor_file_dialog.cpp
+++ b/editor/editor_file_dialog.cpp
@@ -60,7 +60,7 @@ VBoxContainer *EditorFileDialog::get_vbox() {
void EditorFileDialog::_notification(int p_what) {
if (p_what == NOTIFICATION_READY || p_what == NOTIFICATION_THEME_CHANGED) {
- // update icons
+ // Update icons.
mode_thumbnails->set_icon(item_list->get_theme_icon("FileThumbnail", "EditorIcons"));
mode_list->set_icon(item_list->get_theme_icon("FileList", "EditorIcons"));
dir_prev->set_icon(item_list->get_theme_icon("Back", "EditorIcons"));
@@ -94,7 +94,7 @@ void EditorFileDialog::_notification(int p_what) {
}
set_display_mode((DisplayMode)EditorSettings::get_singleton()->get("filesystem/file_dialog/display_mode").operator int());
- // update icons
+ // Update icons.
mode_thumbnails->set_icon(item_list->get_theme_icon("FileThumbnail", "EditorIcons"));
mode_list->set_icon(item_list->get_theme_icon("FileList", "EditorIcons"));
dir_prev->set_icon(item_list->get_theme_icon("Back", "EditorIcons"));
@@ -138,9 +138,7 @@ void EditorFileDialog::_unhandled_input(const Ref<InputEvent> &p_event) {
handled = true;
}
if (ED_IS_SHORTCUT("file_dialog/toggle_hidden_files", p_event)) {
- bool show = !show_hidden_files;
- set_show_hidden_files(show);
- EditorSettings::get_singleton()->set("filesystem/file_dialog/show_hidden_files", show);
+ set_show_hidden_files(!show_hidden_files);
handled = true;
}
if (ED_IS_SHORTCUT("file_dialog/toggle_favorite", p_event)) {
@@ -1385,6 +1383,11 @@ void EditorFileDialog::_bind_methods() {
}
void EditorFileDialog::set_show_hidden_files(bool p_show) {
+ if (p_show == show_hidden_files) {
+ return;
+ }
+
+ EditorSettings::get_singleton()->set("filesystem/file_dialog/show_hidden_files", p_show);
show_hidden_files = p_show;
show_hidden->set_pressed(p_show);
invalidate();
@@ -1646,7 +1649,7 @@ EditorFileDialog::EditorFileDialog() {
filter->connect("item_selected", callable_mp(this, &EditorFileDialog::_filter_selected));
confirm_save = memnew(ConfirmationDialog);
- //confirm_save->set_as_toplevel(true);
+ //confirm_save->set_as_top_level(true);
add_child(confirm_save);
confirm_save->connect("confirmed", callable_mp(this, &EditorFileDialog::_save_confirm_pressed));
diff --git a/editor/editor_inspector.cpp b/editor/editor_inspector.cpp
index 2e716a636e..9900e8184d 100644
--- a/editor/editor_inspector.cpp
+++ b/editor/editor_inspector.cpp
@@ -48,7 +48,7 @@ Size2 EditorProperty::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (!c->is_visible()) {
@@ -117,7 +117,7 @@ void EditorProperty::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (c == bottom_editor) {
@@ -179,7 +179,7 @@ void EditorProperty::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (c == bottom_editor) {
@@ -1133,7 +1133,7 @@ void EditorInspectorSection::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (!c->is_visible_in_tree()) {
@@ -1225,7 +1225,7 @@ Size2 EditorInspectorSection::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (!c->is_visible()) {
diff --git a/editor/editor_node.cpp b/editor/editor_node.cpp
index 8edda3123b..a6321ce058 100644
--- a/editor/editor_node.cpp
+++ b/editor/editor_node.cpp
@@ -128,6 +128,7 @@
#include "editor/plugins/gi_probe_editor_plugin.h"
#include "editor/plugins/gpu_particles_2d_editor_plugin.h"
#include "editor/plugins/gpu_particles_3d_editor_plugin.h"
+#include "editor/plugins/gpu_particles_collision_sdf_editor_plugin.h"
#include "editor/plugins/gradient_editor_plugin.h"
#include "editor/plugins/item_list_editor_plugin.h"
#include "editor/plugins/light_occluder_2d_editor_plugin.h"
@@ -5121,7 +5122,6 @@ void EditorNode::_dropped_files(const Vector<String> &p_files, int p_screen) {
void EditorNode::_add_dropped_files_recursive(const Vector<String> &p_files, String to_path) {
DirAccessRef dir = DirAccess::create(DirAccess::ACCESS_FILESYSTEM);
- Vector<String> just_copy = String("ttf,otf").split(",");
for (int i = 0; i < p_files.size(); i++) {
String from = p_files[i];
@@ -5152,9 +5152,6 @@ void EditorNode::_add_dropped_files_recursive(const Vector<String> &p_files, Str
continue;
}
- if (!ResourceFormatImporter::get_singleton()->can_be_imported(from) && (just_copy.find(from.get_extension().to_lower()) == -1)) {
- continue;
- }
dir->copy(from, to);
}
}
@@ -6635,6 +6632,7 @@ EditorNode::EditorNode() {
add_editor_plugin(memnew(PhysicalBone3DEditorPlugin(this)));
add_editor_plugin(memnew(MeshEditorPlugin(this)));
add_editor_plugin(memnew(MaterialEditorPlugin(this)));
+ add_editor_plugin(memnew(GPUParticlesCollisionSDFEditorPlugin(this)));
for (int i = 0; i < EditorPlugins::get_plugin_count(); i++) {
add_editor_plugin(EditorPlugins::create(i, this));
diff --git a/editor/editor_plugin.cpp b/editor/editor_plugin.cpp
index 082c317655..e330713cfb 100644
--- a/editor/editor_plugin.cpp
+++ b/editor/editor_plugin.cpp
@@ -791,7 +791,7 @@ bool EditorPlugin::build() {
return true;
}
-void EditorPlugin::queue_save_layout() const {
+void EditorPlugin::queue_save_layout() {
EditorNode::get_singleton()->save_layout();
}
diff --git a/editor/editor_plugin.h b/editor/editor_plugin.h
index 40a91cbfb9..dd3bf08678 100644
--- a/editor/editor_plugin.h
+++ b/editor/editor_plugin.h
@@ -221,7 +221,7 @@ public:
int update_overlays() const;
- void queue_save_layout() const;
+ void queue_save_layout();
void make_bottom_panel_item_visible(Control *p_item);
void hide_bottom_panel();
diff --git a/editor/editor_properties.cpp b/editor/editor_properties.cpp
index 4c8af615b4..9e68ef2f35 100644
--- a/editor/editor_properties.cpp
+++ b/editor/editor_properties.cpp
@@ -614,7 +614,7 @@ public:
const Ref<InputEventMouseButton> mb = p_ev;
- if (mb.is_valid() && mb->get_button_index() == BUTTON_LEFT && mb->is_pressed()) {
+ if (mb.is_valid() && mb->get_button_index() == BUTTON_LEFT && mb->is_pressed() && hovered_index > 0) {
// Toggle the flag.
// We base our choice on the hovered flag, so that it always matches the hovered flag.
if (value & (1 << hovered_index)) {
diff --git a/editor/editor_resource_preview.cpp b/editor/editor_resource_preview.cpp
index 3170ea5ff8..9723ae188b 100644
--- a/editor/editor_resource_preview.cpp
+++ b/editor/editor_resource_preview.cpp
@@ -30,8 +30,6 @@
#include "editor_resource_preview.h"
-#include "core/method_bind_ext.gen.inc"
-
#include "core/io/resource_loader.h"
#include "core/io/resource_saver.h"
#include "core/message_queue.h"
diff --git a/editor/editor_run_native.cpp b/editor/editor_run_native.cpp
index 422534a2e1..639da371bd 100644
--- a/editor/editor_run_native.cpp
+++ b/editor/editor_run_native.cpp
@@ -76,8 +76,10 @@ void EditorRunNative::_notification(int p_what) {
} else {
mb->get_popup()->clear();
mb->show();
- mb->set_tooltip(eep->get_options_tooltip());
- if (dc > 1) {
+ if (dc == 1) {
+ mb->set_tooltip(eep->get_option_tooltip(0));
+ } else {
+ mb->set_tooltip(eep->get_options_tooltip());
for (int i = 0; i < dc; i++) {
mb->get_popup()->add_icon_item(eep->get_option_icon(i), eep->get_option_label(i));
mb->get_popup()->set_item_tooltip(mb->get_popup()->get_item_count() - 1, eep->get_option_tooltip(i));
diff --git a/editor/editor_settings.h b/editor/editor_settings.h
index 04bb49bb51..c1bb7951fa 100644
--- a/editor/editor_settings.h
+++ b/editor/editor_settings.h
@@ -31,8 +31,7 @@
#ifndef EDITOR_SETTINGS_H
#define EDITOR_SETTINGS_H
-#include "core/object.h"
-
+#include "core/class_db.h"
#include "core/io/config_file.h"
#include "core/os/thread_safe.h"
#include "core/resource.h"
diff --git a/editor/editor_spin_slider.cpp b/editor/editor_spin_slider.cpp
index ac61a75a6c..efc966c6c4 100644
--- a/editor/editor_spin_slider.cpp
+++ b/editor/editor_spin_slider.cpp
@@ -483,7 +483,7 @@ EditorSpinSlider::EditorSpinSlider() {
grabber = memnew(TextureRect);
add_child(grabber);
grabber->hide();
- grabber->set_as_toplevel(true);
+ grabber->set_as_top_level(true);
grabber->set_mouse_filter(MOUSE_FILTER_STOP);
grabber->connect("mouse_entered", callable_mp(this, &EditorSpinSlider::_grabber_mouse_entered));
grabber->connect("mouse_exited", callable_mp(this, &EditorSpinSlider::_grabber_mouse_exited));
diff --git a/editor/editor_vcs_interface.h b/editor/editor_vcs_interface.h
index ee9e51441d..6ef55f0a46 100644
--- a/editor/editor_vcs_interface.h
+++ b/editor/editor_vcs_interface.h
@@ -31,7 +31,7 @@
#ifndef EDITOR_VCS_INTERFACE_H
#define EDITOR_VCS_INTERFACE_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/ustring.h"
#include "scene/gui/panel_container.h"
diff --git a/editor/fileserver/editor_file_server.h b/editor/fileserver/editor_file_server.h
index 9645fbf39e..eefaa503c1 100644
--- a/editor/fileserver/editor_file_server.h
+++ b/editor/fileserver/editor_file_server.h
@@ -31,10 +31,10 @@
#ifndef EDITOR_FILE_SERVER_H
#define EDITOR_FILE_SERVER_H
+#include "core/class_db.h"
#include "core/io/file_access_network.h"
#include "core/io/packet_peer.h"
#include "core/io/tcp_server.h"
-#include "core/object.h"
#include "core/os/thread.h"
class EditorFileServer : public Object {
diff --git a/editor/import/editor_scene_importer_gltf.cpp b/editor/import/editor_scene_importer_gltf.cpp
index 8caa4aeeaf..266df78949 100644
--- a/editor/import/editor_scene_importer_gltf.cpp
+++ b/editor/import/editor_scene_importer_gltf.cpp
@@ -184,8 +184,11 @@ String EditorSceneImporterGLTF::_gen_unique_name(GLTFState &state, const String
String EditorSceneImporterGLTF::_sanitize_bone_name(const String &name) {
String p_name = name.camelcase_to_underscore(true);
- RegEx pattern_del("([^a-zA-Z0-9_ ])+");
- p_name = pattern_del.sub(p_name, "", true);
+ RegEx pattern_nocolon(":");
+ p_name = pattern_nocolon.sub(p_name, "_", true);
+
+ RegEx pattern_noslash("/");
+ p_name = pattern_noslash.sub(p_name, "_", true);
RegEx pattern_nospace(" +");
p_name = pattern_nospace.sub(p_name, "_", true);
@@ -200,8 +203,10 @@ String EditorSceneImporterGLTF::_sanitize_bone_name(const String &name) {
}
String EditorSceneImporterGLTF::_gen_unique_bone_name(GLTFState &state, const GLTFSkeletonIndex skel_i, const String &p_name) {
- const String s_name = _sanitize_bone_name(p_name);
-
+ String s_name = _sanitize_bone_name(p_name);
+ if (s_name.empty()) {
+ s_name = "bone";
+ }
String name;
int index = 1;
while (true) {
@@ -379,13 +384,17 @@ Error EditorSceneImporterGLTF::_parse_buffers(GLTFState &state, const String &p_
Vector<uint8_t> buffer_data;
String uri = buffer["uri"];
- if (uri.findn("data:application/octet-stream;base64") == 0) {
- //embedded data
+ if (uri.begins_with("data:")) { // Embedded data using base64.
+ // Validate data MIME types and throw an error if it's one we don't know/support.
+ if (!uri.begins_with("data:application/octet-stream;base64") &&
+ !uri.begins_with("data:application/gltf-buffer;base64")) {
+ ERR_PRINT("glTF: Got buffer with an unknown URI data type: " + uri);
+ }
buffer_data = _parse_base64_uri(uri);
- } else {
- uri = p_base_path.plus_file(uri).replace("\\", "/"); //fix for windows
+ } else { // Relative path to an external image file.
+ uri = p_base_path.plus_file(uri).replace("\\", "/"); // Fix for Windows.
buffer_data = FileAccess::get_file_as_array(uri);
- ERR_FAIL_COND_V(buffer.size() == 0, ERR_PARSE_ERROR);
+ ERR_FAIL_COND_V_MSG(buffer.size() == 0, ERR_PARSE_ERROR, "glTF: Couldn't load binary file as an array: " + uri);
}
ERR_FAIL_COND_V(!buffer.has("byteLength"), ERR_PARSE_ERROR);
@@ -1261,12 +1270,28 @@ Error EditorSceneImporterGLTF::_parse_images(GLTFState &state, const String &p_b
return OK;
}
+ // Ref: https://github.com/KhronosGroup/glTF/blob/master/specification/2.0/README.md#images
+
const Array &images = state.json["images"];
for (int i = 0; i < images.size(); i++) {
const Dictionary &d = images[i];
+ // glTF 2.0 supports PNG and JPEG types, which can be specified as (from spec):
+ // "- a URI to an external file in one of the supported images formats, or
+ // - a URI with embedded base64-encoded data, or
+ // - a reference to a bufferView; in that case mimeType must be defined."
+ // Since mimeType is optional for external files and base64 data, we'll have to
+ // fall back on letting Godot parse the data to figure out if it's PNG or JPEG.
+
+ // We'll assume that we use either URI or bufferView, so let's warn the user
+ // if their image somehow uses both. And fail if it has neither.
+ ERR_CONTINUE_MSG(!d.has("uri") && !d.has("bufferView"), "Invalid image definition in glTF file, it should specific an 'uri' or 'bufferView'.");
+ if (d.has("uri") && d.has("bufferView")) {
+ WARN_PRINT("Invalid image definition in glTF file using both 'uri' and 'bufferView'. 'bufferView' will take precedence.");
+ }
+
String mimetype;
- if (d.has("mimeType")) {
+ if (d.has("mimeType")) { // Should be "image/png" or "image/jpeg".
mimetype = d["mimeType"];
}
@@ -1275,23 +1300,52 @@ Error EditorSceneImporterGLTF::_parse_images(GLTFState &state, const String &p_b
int data_size = 0;
if (d.has("uri")) {
+ // Handles the first two bullet points from the spec (embedded data, or external file).
String uri = d["uri"];
- if (uri.findn("data:application/octet-stream;base64") == 0 ||
- uri.findn("data:" + mimetype + ";base64") == 0) {
- //embedded data
+ if (uri.begins_with("data:")) { // Embedded data using base64.
+ // Validate data MIME types and throw an error if it's one we don't know/support.
+ if (!uri.begins_with("data:application/octet-stream;base64") &&
+ !uri.begins_with("data:application/gltf-buffer;base64") &&
+ !uri.begins_with("data:image/png;base64") &&
+ !uri.begins_with("data:image/jpeg;base64")) {
+ ERR_PRINT("glTF: Got image data with an unknown URI data type: " + uri);
+ }
data = _parse_base64_uri(uri);
data_ptr = data.ptr();
data_size = data.size();
- } else {
- uri = p_base_path.plus_file(uri).replace("\\", "/"); //fix for windows
- Ref<Texture2D> texture = ResourceLoader::load(uri);
- state.images.push_back(texture);
- continue;
+ // mimeType is optional, but if we have it defined in the URI, let's use it.
+ if (mimetype.empty()) {
+ if (uri.begins_with("data:image/png;base64")) {
+ mimetype = "image/png";
+ } else if (uri.begins_with("data:image/jpeg;base64")) {
+ mimetype = "image/jpeg";
+ }
+ }
+ } else { // Relative path to an external image file.
+ uri = p_base_path.plus_file(uri).replace("\\", "/"); // Fix for Windows.
+ // The spec says that if mimeType is defined, we should enforce it.
+ // So we should only rely on ResourceLoader::load if mimeType is not defined,
+ // otherwise we should use the same logic as for buffers.
+ if (mimetype == "image/png" || mimetype == "image/jpeg") {
+ // Load data buffer and rely on PNG and JPEG-specific logic below to load the image.
+ // This makes it possible to load a file with a wrong extension but correct MIME type,
+ // e.g. "foo.jpg" containing PNG data and with MIME type "image/png". ResourceLoader would fail.
+ data = FileAccess::get_file_as_array(uri);
+ ERR_FAIL_COND_V_MSG(data.size() == 0, ERR_PARSE_ERROR, "glTF: Couldn't load image file as an array: " + uri);
+ data_ptr = data.ptr();
+ data_size = data.size();
+ } else {
+ // Good old ResourceLoader will rely on file extension.
+ Ref<Texture2D> texture = ResourceLoader::load(uri);
+ state.images.push_back(texture);
+ continue;
+ }
}
- }
+ } else if (d.has("bufferView")) {
+ // Handles the third bullet point from the spec (bufferView).
+ ERR_FAIL_COND_V_MSG(mimetype.empty(), ERR_FILE_CORRUPT, "glTF: Image specifies 'bufferView' but no 'mimeType', which is invalid.");
- if (d.has("bufferView")) {
const GLTFBufferViewIndex bvi = d["bufferView"];
ERR_FAIL_INDEX_V(bvi, state.buffer_views.size(), ERR_PARAMETER_RANGE_ERROR);
@@ -1307,45 +1361,36 @@ Error EditorSceneImporterGLTF::_parse_images(GLTFState &state, const String &p_b
data_size = bv.byte_length;
}
- ERR_FAIL_COND_V(mimetype == "", ERR_FILE_CORRUPT);
+ Ref<Image> img;
- if (mimetype.findn("png") != -1) {
- //is a png
+ if (mimetype == "image/png") { // Load buffer as PNG.
ERR_FAIL_COND_V(Image::_png_mem_loader_func == nullptr, ERR_UNAVAILABLE);
-
- const Ref<Image> img = Image::_png_mem_loader_func(data_ptr, data_size);
-
- ERR_FAIL_COND_V(img.is_null(), ERR_FILE_CORRUPT);
-
- Ref<ImageTexture> t;
- t.instance();
- t->create_from_image(img);
-
- state.images.push_back(t);
- continue;
- }
-
- if (mimetype.findn("jpeg") != -1) {
- //is a jpg
+ img = Image::_png_mem_loader_func(data_ptr, data_size);
+ } else if (mimetype == "image/jpeg") { // Loader buffer as JPEG.
ERR_FAIL_COND_V(Image::_jpg_mem_loader_func == nullptr, ERR_UNAVAILABLE);
+ img = Image::_jpg_mem_loader_func(data_ptr, data_size);
+ } else {
+ // We can land here if we got an URI with base64-encoded data with application/* MIME type,
+ // and the optional mimeType property was not defined to tell us how to handle this data (or was invalid).
+ // So let's try PNG first, then JPEG.
+ ERR_FAIL_COND_V(Image::_png_mem_loader_func == nullptr, ERR_UNAVAILABLE);
+ img = Image::_png_mem_loader_func(data_ptr, data_size);
+ if (img.is_null()) {
+ ERR_FAIL_COND_V(Image::_jpg_mem_loader_func == nullptr, ERR_UNAVAILABLE);
+ img = Image::_jpg_mem_loader_func(data_ptr, data_size);
+ }
+ }
- const Ref<Image> img = Image::_jpg_mem_loader_func(data_ptr, data_size);
-
- ERR_FAIL_COND_V(img.is_null(), ERR_FILE_CORRUPT);
-
- Ref<ImageTexture> t;
- t.instance();
- t->create_from_image(img);
-
- state.images.push_back(t);
+ ERR_FAIL_COND_V_MSG(img.is_null(), ERR_FILE_CORRUPT, "glTF: Couldn't load image with its given mimetype: " + mimetype);
- continue;
- }
+ Ref<ImageTexture> t;
+ t.instance();
+ t->create_from_image(img);
- ERR_FAIL_V(ERR_FILE_CORRUPT);
+ state.images.push_back(t);
}
- print_verbose("Total images: " + itos(state.images.size()));
+ print_verbose("glTF: Total images: " + itos(state.images.size()));
return OK;
}
@@ -1505,7 +1550,7 @@ Error EditorSceneImporterGLTF::_parse_materials(GLTFState &state) {
state.materials.push_back(material);
}
- print_verbose("Total materials: " + itos(state.materials.size()));
+ print_verbose("glTF: Total materials: " + itos(state.materials.size()));
return OK;
}
@@ -3056,6 +3101,8 @@ Node3D *EditorSceneImporterGLTF::_generate_scene(GLTFState &state, const int p_b
}
Node *EditorSceneImporterGLTF::import_scene(const String &p_path, uint32_t p_flags, int p_bake_fps, List<String> *r_missing_deps, Error *r_err) {
+ print_verbose(vformat("glTF: Importing file %s as scene.", p_path));
+
GLTFState state;
if (p_path.to_lower().ends_with("glb")) {
diff --git a/editor/import/resource_importer_layered_texture.cpp b/editor/import/resource_importer_layered_texture.cpp
index bbf62596d0..ac068c05cf 100644
--- a/editor/import/resource_importer_layered_texture.cpp
+++ b/editor/import/resource_importer_layered_texture.cpp
@@ -51,7 +51,7 @@ String ResourceImporterLayeredTexture::get_importer_name() const {
return "cubemap_array_texture";
} break;
case MODE_3D: {
- return "cubemap_3d_texture";
+ return "3d_texture";
} break;
}
diff --git a/editor/inspector_dock.cpp b/editor/inspector_dock.cpp
index 8f1b8838d8..c88cd8ea5f 100644
--- a/editor/inspector_dock.cpp
+++ b/editor/inspector_dock.cpp
@@ -164,7 +164,7 @@ void InspectorDock::_resource_file_selected(String p_file) {
editor->push_item(res.operator->());
}
-void InspectorDock::_save_resource(bool save_as) const {
+void InspectorDock::_save_resource(bool save_as) {
ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current();
Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr;
@@ -179,7 +179,7 @@ void InspectorDock::_save_resource(bool save_as) const {
}
}
-void InspectorDock::_unref_resource() const {
+void InspectorDock::_unref_resource() {
ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current();
Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr;
@@ -190,7 +190,7 @@ void InspectorDock::_unref_resource() const {
editor->edit_current();
}
-void InspectorDock::_copy_resource() const {
+void InspectorDock::_copy_resource() {
ObjectID current = EditorNode::get_singleton()->get_editor_history()->get_current();
Object *current_obj = current.is_valid() ? ObjectDB::get_instance(current) : nullptr;
@@ -201,7 +201,7 @@ void InspectorDock::_copy_resource() const {
EditorSettings::get_singleton()->set_resource_clipboard(current_res);
}
-void InspectorDock::_paste_resource() const {
+void InspectorDock::_paste_resource() {
RES r = EditorSettings::get_singleton()->get_resource_clipboard();
if (r.is_valid()) {
editor->push_item(EditorSettings::get_singleton()->get_resource_clipboard().ptr(), String());
diff --git a/editor/inspector_dock.h b/editor/inspector_dock.h
index 551d3d1643..b2dabf19c5 100644
--- a/editor/inspector_dock.h
+++ b/editor/inspector_dock.h
@@ -96,10 +96,10 @@ class InspectorDock : public VBoxContainer {
void _load_resource(const String &p_type = "");
void _open_resource_selector() { _load_resource(); }; // just used to call from arg-less signal
void _resource_file_selected(String p_file);
- void _save_resource(bool save_as) const;
- void _unref_resource() const;
- void _copy_resource() const;
- void _paste_resource() const;
+ void _save_resource(bool save_as);
+ void _unref_resource();
+ void _copy_resource();
+ void _paste_resource();
void _warning_pressed();
void _resource_created();
diff --git a/editor/localization_editor.cpp b/editor/localization_editor.cpp
index 6764f70d9b..e4562c57af 100644
--- a/editor/localization_editor.cpp
+++ b/editor/localization_editor.cpp
@@ -319,7 +319,7 @@ void LocalizationEditor::_translation_filter_option_changed() {
}
}
- f_locales = f_locales.sort();
+ f_locales.sort();
undo_redo->create_action(TTR("Changed Locale Filter"));
undo_redo->add_do_property(ProjectSettings::get_singleton(), "locale/locale_filter", f_locales_all);
diff --git a/editor/node_3d_editor_gizmos.cpp b/editor/node_3d_editor_gizmos.cpp
index 6e5fb6389d..397a958d8f 100644
--- a/editor/node_3d_editor_gizmos.cpp
+++ b/editor/node_3d_editor_gizmos.cpp
@@ -41,6 +41,7 @@
#include "scene/3d/decal.h"
#include "scene/3d/gi_probe.h"
#include "scene/3d/gpu_particles_3d.h"
+#include "scene/3d/gpu_particles_collision_3d.h"
#include "scene/3d/light_3d.h"
#include "scene/3d/lightmap_probe.h"
#include "scene/3d/listener_3d.h"
@@ -2455,6 +2456,266 @@ void GPUParticles3DGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) {
////
+////
+
+GPUParticlesCollision3DGizmoPlugin::GPUParticlesCollision3DGizmoPlugin() {
+ Color gizmo_color = EDITOR_DEF("editors/3d_gizmos/gizmo_colors/particle_collision", Color(0.5, 0.7, 1));
+ create_material("shape_material", gizmo_color);
+ gizmo_color.a = 0.15;
+ create_material("shape_material_internal", gizmo_color);
+
+ create_handle_material("handles");
+}
+
+bool GPUParticlesCollision3DGizmoPlugin::has_gizmo(Node3D *p_spatial) {
+ return (Object::cast_to<GPUParticlesCollision3D>(p_spatial) != nullptr) || (Object::cast_to<GPUParticlesAttractor3D>(p_spatial) != nullptr);
+}
+
+String GPUParticlesCollision3DGizmoPlugin::get_name() const {
+ return "GPUParticlesCollision3D";
+}
+
+int GPUParticlesCollision3DGizmoPlugin::get_priority() const {
+ return -1;
+}
+
+String GPUParticlesCollision3DGizmoPlugin::get_handle_name(const EditorNode3DGizmo *p_gizmo, int p_idx) const {
+ const Node3D *cs = p_gizmo->get_spatial_node();
+
+ if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) {
+ return "Radius";
+ }
+
+ if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) {
+ return "Extents";
+ }
+
+ return "";
+}
+
+Variant GPUParticlesCollision3DGizmoPlugin::get_handle_value(EditorNode3DGizmo *p_gizmo, int p_idx) const {
+ const Node3D *cs = p_gizmo->get_spatial_node();
+
+ if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) {
+ return p_gizmo->get_spatial_node()->call("get_radius");
+ }
+
+ if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) {
+ return Vector3(p_gizmo->get_spatial_node()->call("get_extents"));
+ }
+
+ return Variant();
+}
+
+void GPUParticlesCollision3DGizmoPlugin::set_handle(EditorNode3DGizmo *p_gizmo, int p_idx, Camera3D *p_camera, const Point2 &p_point) {
+ Node3D *sn = p_gizmo->get_spatial_node();
+
+ Transform gt = sn->get_global_transform();
+ Transform gi = gt.affine_inverse();
+
+ Vector3 ray_from = p_camera->project_ray_origin(p_point);
+ Vector3 ray_dir = p_camera->project_ray_normal(p_point);
+
+ Vector3 sg[2] = { gi.xform(ray_from), gi.xform(ray_from + ray_dir * 4096) };
+
+ if (Object::cast_to<GPUParticlesCollisionSphere>(sn) || Object::cast_to<GPUParticlesAttractorSphere>(sn)) {
+ Vector3 ra, rb;
+ Geometry3D::get_closest_points_between_segments(Vector3(), Vector3(4096, 0, 0), sg[0], sg[1], ra, rb);
+ float d = ra.x;
+ if (Node3DEditor::get_singleton()->is_snap_enabled()) {
+ d = Math::stepify(d, Node3DEditor::get_singleton()->get_translate_snap());
+ }
+
+ if (d < 0.001) {
+ d = 0.001;
+ }
+
+ sn->call("set_radius", d);
+ }
+
+ if (Object::cast_to<GPUParticlesCollisionBox>(sn) || Object::cast_to<GPUParticlesAttractorBox>(sn) || Object::cast_to<GPUParticlesAttractorVectorField>(sn) || Object::cast_to<GPUParticlesCollisionSDF>(sn) || Object::cast_to<GPUParticlesCollisionHeightField>(sn)) {
+ Vector3 axis;
+ axis[p_idx] = 1.0;
+ Vector3 ra, rb;
+ Geometry3D::get_closest_points_between_segments(Vector3(), axis * 4096, sg[0], sg[1], ra, rb);
+ float d = ra[p_idx];
+ if (Node3DEditor::get_singleton()->is_snap_enabled()) {
+ d = Math::stepify(d, Node3DEditor::get_singleton()->get_translate_snap());
+ }
+
+ if (d < 0.001) {
+ d = 0.001;
+ }
+
+ Vector3 he = sn->call("get_extents");
+ he[p_idx] = d;
+ sn->call("set_extents", he);
+ }
+}
+
+void GPUParticlesCollision3DGizmoPlugin::commit_handle(EditorNode3DGizmo *p_gizmo, int p_idx, const Variant &p_restore, bool p_cancel) {
+ Node3D *sn = p_gizmo->get_spatial_node();
+
+ if (Object::cast_to<GPUParticlesCollisionSphere>(sn) || Object::cast_to<GPUParticlesAttractorSphere>(sn)) {
+ if (p_cancel) {
+ sn->call("set_radius", p_restore);
+ return;
+ }
+
+ UndoRedo *ur = Node3DEditor::get_singleton()->get_undo_redo();
+ ur->create_action(TTR("Change Radius"));
+ ur->add_do_method(sn, "set_radius", sn->call("get_radius"));
+ ur->add_undo_method(sn, "set_radius", p_restore);
+ ur->commit_action();
+ }
+
+ if (Object::cast_to<GPUParticlesCollisionBox>(sn) || Object::cast_to<GPUParticlesAttractorBox>(sn) || Object::cast_to<GPUParticlesAttractorVectorField>(sn) || Object::cast_to<GPUParticlesCollisionSDF>(sn) || Object::cast_to<GPUParticlesCollisionHeightField>(sn)) {
+ if (p_cancel) {
+ sn->call("set_extents", p_restore);
+ return;
+ }
+
+ UndoRedo *ur = Node3DEditor::get_singleton()->get_undo_redo();
+ ur->create_action(TTR("Change Box Shape Extents"));
+ ur->add_do_method(sn, "set_extents", sn->call("get_extents"));
+ ur->add_undo_method(sn, "set_extents", p_restore);
+ ur->commit_action();
+ }
+}
+
+void GPUParticlesCollision3DGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) {
+ Node3D *cs = p_gizmo->get_spatial_node();
+
+ print_line("redraw request " + itos(cs != nullptr));
+ p_gizmo->clear();
+
+ const Ref<Material> material =
+ get_material("shape_material", p_gizmo);
+ const Ref<Material> material_internal =
+ get_material("shape_material_internal", p_gizmo);
+
+ Ref<Material> handles_material = get_material("handles");
+
+ if (Object::cast_to<GPUParticlesCollisionSphere>(cs) || Object::cast_to<GPUParticlesAttractorSphere>(cs)) {
+ float r = cs->call("get_radius");
+
+ Vector<Vector3> points;
+
+ for (int i = 0; i <= 360; i++) {
+ float ra = Math::deg2rad((float)i);
+ float rb = Math::deg2rad((float)i + 1);
+ Point2 a = Vector2(Math::sin(ra), Math::cos(ra)) * r;
+ Point2 b = Vector2(Math::sin(rb), Math::cos(rb)) * r;
+
+ points.push_back(Vector3(a.x, 0, a.y));
+ points.push_back(Vector3(b.x, 0, b.y));
+ points.push_back(Vector3(0, a.x, a.y));
+ points.push_back(Vector3(0, b.x, b.y));
+ points.push_back(Vector3(a.x, a.y, 0));
+ points.push_back(Vector3(b.x, b.y, 0));
+ }
+
+ Vector<Vector3> collision_segments;
+
+ for (int i = 0; i < 64; i++) {
+ float ra = i * Math_PI * 2.0 / 64.0;
+ float rb = (i + 1) * Math_PI * 2.0 / 64.0;
+ Point2 a = Vector2(Math::sin(ra), Math::cos(ra)) * r;
+ Point2 b = Vector2(Math::sin(rb), Math::cos(rb)) * r;
+
+ collision_segments.push_back(Vector3(a.x, 0, a.y));
+ collision_segments.push_back(Vector3(b.x, 0, b.y));
+ collision_segments.push_back(Vector3(0, a.x, a.y));
+ collision_segments.push_back(Vector3(0, b.x, b.y));
+ collision_segments.push_back(Vector3(a.x, a.y, 0));
+ collision_segments.push_back(Vector3(b.x, b.y, 0));
+ }
+
+ p_gizmo->add_lines(points, material);
+ p_gizmo->add_collision_segments(collision_segments);
+ Vector<Vector3> handles;
+ handles.push_back(Vector3(r, 0, 0));
+ p_gizmo->add_handles(handles, handles_material);
+ }
+
+ if (Object::cast_to<GPUParticlesCollisionBox>(cs) || Object::cast_to<GPUParticlesAttractorBox>(cs) || Object::cast_to<GPUParticlesAttractorVectorField>(cs) || Object::cast_to<GPUParticlesCollisionSDF>(cs) || Object::cast_to<GPUParticlesCollisionHeightField>(cs)) {
+ Vector<Vector3> lines;
+ AABB aabb;
+ aabb.position = -cs->call("get_extents").operator Vector3();
+ aabb.size = aabb.position * -2;
+
+ for (int i = 0; i < 12; i++) {
+ Vector3 a, b;
+ aabb.get_edge(i, a, b);
+ lines.push_back(a);
+ lines.push_back(b);
+ }
+
+ Vector<Vector3> handles;
+
+ for (int i = 0; i < 3; i++) {
+ Vector3 ax;
+ ax[i] = cs->call("get_extents").operator Vector3()[i];
+ handles.push_back(ax);
+ }
+
+ p_gizmo->add_lines(lines, material);
+ p_gizmo->add_collision_segments(lines);
+ p_gizmo->add_handles(handles, handles_material);
+
+ GPUParticlesCollisionSDF *col_sdf = Object::cast_to<GPUParticlesCollisionSDF>(cs);
+ if (col_sdf) {
+ static const int subdivs[GPUParticlesCollisionSDF::RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 };
+ int subdiv = subdivs[col_sdf->get_resolution()];
+ float cell_size = aabb.get_longest_axis_size() / subdiv;
+
+ lines.clear();
+
+ for (int i = 1; i < subdiv; i++) {
+ for (int j = 0; j < 3; j++) {
+ if (cell_size * i > aabb.size[j]) {
+ continue;
+ }
+
+ Vector2 dir;
+ dir[j] = 1.0;
+ Vector2 ta, tb;
+ int j_n1 = (j + 1) % 3;
+ int j_n2 = (j + 2) % 3;
+ ta[j_n1] = 1.0;
+ tb[j_n2] = 1.0;
+
+ for (int k = 0; k < 4; k++) {
+ Vector3 from = aabb.position, to = aabb.position;
+ from[j] += cell_size * i;
+ to[j] += cell_size * i;
+
+ if (k & 1) {
+ to[j_n1] += aabb.size[j_n1];
+ } else {
+ to[j_n2] += aabb.size[j_n2];
+ }
+
+ if (k & 2) {
+ from[j_n1] += aabb.size[j_n1];
+ from[j_n2] += aabb.size[j_n2];
+ }
+
+ lines.push_back(from);
+ lines.push_back(to);
+ }
+ }
+ }
+
+ p_gizmo->add_lines(lines, material_internal);
+ }
+ }
+}
+
+/////
+
+////
+
ReflectionProbeGizmoPlugin::ReflectionProbeGizmoPlugin() {
Color gizmo_color = EDITOR_DEF("editors/3d_gizmos/gizmo_colors/reflection_probe", Color(0.6, 1, 0.5));
diff --git a/editor/node_3d_editor_gizmos.h b/editor/node_3d_editor_gizmos.h
index c7aae39a45..4826054643 100644
--- a/editor/node_3d_editor_gizmos.h
+++ b/editor/node_3d_editor_gizmos.h
@@ -253,6 +253,23 @@ public:
GPUParticles3DGizmoPlugin();
};
+class GPUParticlesCollision3DGizmoPlugin : public EditorNode3DGizmoPlugin {
+ GDCLASS(GPUParticlesCollision3DGizmoPlugin, EditorNode3DGizmoPlugin);
+
+public:
+ bool has_gizmo(Node3D *p_spatial) override;
+ String get_name() const override;
+ int get_priority() const override;
+ void redraw(EditorNode3DGizmo *p_gizmo) override;
+
+ String get_handle_name(const EditorNode3DGizmo *p_gizmo, int p_idx) const override;
+ Variant get_handle_value(EditorNode3DGizmo *p_gizmo, int p_idx) const override;
+ void set_handle(EditorNode3DGizmo *p_gizmo, int p_idx, Camera3D *p_camera, const Point2 &p_point) override;
+ void commit_handle(EditorNode3DGizmo *p_gizmo, int p_idx, const Variant &p_restore, bool p_cancel = false) override;
+
+ GPUParticlesCollision3DGizmoPlugin();
+};
+
class ReflectionProbeGizmoPlugin : public EditorNode3DGizmoPlugin {
GDCLASS(ReflectionProbeGizmoPlugin, EditorNode3DGizmoPlugin);
diff --git a/editor/plugins/animation_state_machine_editor.cpp b/editor/plugins/animation_state_machine_editor.cpp
index 26006d85c9..885ec17cb3 100644
--- a/editor/plugins/animation_state_machine_editor.cpp
+++ b/editor/plugins/animation_state_machine_editor.cpp
@@ -386,6 +386,12 @@ void AnimationNodeStateMachineEditor::_state_machine_gui_input(const Ref<InputEv
over_text = over_text_now;
}
}
+
+ Ref<InputEventPanGesture> pan_gesture = p_event;
+ if (pan_gesture.is_valid()) {
+ h_scroll->set_value(h_scroll->get_value() + h_scroll->get_page() * pan_gesture->get_delta().x / 8);
+ v_scroll->set_value(v_scroll->get_value() + v_scroll->get_page() * pan_gesture->get_delta().y / 8);
+ }
}
void AnimationNodeStateMachineEditor::_file_opened(const String &p_file) {
diff --git a/editor/plugins/canvas_item_editor_plugin.cpp b/editor/plugins/canvas_item_editor_plugin.cpp
index 470d19e65a..c06580df26 100644
--- a/editor/plugins/canvas_item_editor_plugin.cpp
+++ b/editor/plugins/canvas_item_editor_plugin.cpp
@@ -548,7 +548,7 @@ void CanvasItemEditor::_expand_encompassing_rect_using_children(Rect2 &r_rect, c
const CanvasItem *canvas_item = Object::cast_to<CanvasItem>(p_node);
for (int i = p_node->get_child_count() - 1; i >= 0; i--) {
- if (canvas_item && !canvas_item->is_set_as_toplevel()) {
+ if (canvas_item && !canvas_item->is_set_as_top_level()) {
_expand_encompassing_rect_using_children(r_rect, p_node->get_child(i), r_first, p_parent_xform * canvas_item->get_transform(), p_canvas_xform);
} else {
const CanvasLayer *canvas_layer = Object::cast_to<CanvasLayer>(p_node);
@@ -591,7 +591,7 @@ void CanvasItemEditor::_find_canvas_items_at_pos(const Point2 &p_pos, Node *p_no
for (int i = p_node->get_child_count() - 1; i >= 0; i--) {
if (canvas_item) {
- if (!canvas_item->is_set_as_toplevel()) {
+ if (!canvas_item->is_set_as_top_level()) {
_find_canvas_items_at_pos(p_pos, p_node->get_child(i), r_items, p_parent_xform * canvas_item->get_transform(), p_canvas_xform);
} else {
_find_canvas_items_at_pos(p_pos, p_node->get_child(i), r_items, canvas_item->get_transform(), p_canvas_xform);
@@ -767,7 +767,7 @@ void CanvasItemEditor::_find_canvas_items_in_rect(const Rect2 &p_rect, Node *p_n
if (!lock_children || !editable) {
for (int i = p_node->get_child_count() - 1; i >= 0; i--) {
if (canvas_item) {
- if (!canvas_item->is_set_as_toplevel()) {
+ if (!canvas_item->is_set_as_top_level()) {
_find_canvas_items_in_rect(p_rect, p_node->get_child(i), r_items, p_parent_xform * canvas_item->get_transform(), p_canvas_xform);
} else {
_find_canvas_items_in_rect(p_rect, p_node->get_child(i), r_items, canvas_item->get_transform(), p_canvas_xform);
@@ -3626,7 +3626,7 @@ void CanvasItemEditor::_draw_invisible_nodes_positions(Node *p_node, const Trans
Transform2D parent_xform = p_parent_xform;
Transform2D canvas_xform = p_canvas_xform;
- if (canvas_item && !canvas_item->is_set_as_toplevel()) {
+ if (canvas_item && !canvas_item->is_set_as_top_level()) {
parent_xform = parent_xform * canvas_item->get_transform();
} else {
CanvasLayer *cl = Object::cast_to<CanvasLayer>(p_node);
@@ -3695,7 +3695,7 @@ void CanvasItemEditor::_draw_locks_and_groups(Node *p_node, const Transform2D &p
Transform2D parent_xform = p_parent_xform;
Transform2D canvas_xform = p_canvas_xform;
- if (canvas_item && !canvas_item->is_set_as_toplevel()) {
+ if (canvas_item && !canvas_item->is_set_as_top_level()) {
parent_xform = parent_xform * canvas_item->get_transform();
} else {
CanvasLayer *cl = Object::cast_to<CanvasLayer>(p_node);
diff --git a/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp
new file mode 100644
index 0000000000..0288645f91
--- /dev/null
+++ b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.cpp
@@ -0,0 +1,201 @@
+/*************************************************************************/
+/* gpu_particles_collision_sdf_editor_plugin.cpp */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#include "gpu_particles_collision_sdf_editor_plugin.h"
+
+void GPUParticlesCollisionSDFEditorPlugin::_bake() {
+ if (col_sdf) {
+ if (col_sdf->get_texture().is_null() || !col_sdf->get_texture()->get_path().is_resource_file()) {
+ String path = get_tree()->get_edited_scene_root()->get_filename();
+ if (path == String()) {
+ path = "res://" + col_sdf->get_name() + "_data.exr";
+ } else {
+ String ext = path.get_extension();
+ path = path.get_basename() + "." + col_sdf->get_name() + "_data.exr";
+ }
+ probe_file->set_current_path(path);
+ probe_file->popup_file_dialog();
+ return;
+ }
+
+ _sdf_save_path_and_bake(col_sdf->get_texture()->get_path());
+ }
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::edit(Object *p_object) {
+ GPUParticlesCollisionSDF *s = Object::cast_to<GPUParticlesCollisionSDF>(p_object);
+ if (!s) {
+ return;
+ }
+
+ col_sdf = s;
+}
+
+bool GPUParticlesCollisionSDFEditorPlugin::handles(Object *p_object) const {
+ return p_object->is_class("GPUParticlesCollisionSDF");
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::_notification(int p_what) {
+ if (p_what == NOTIFICATION_PROCESS) {
+ if (!col_sdf) {
+ return;
+ }
+
+ const Vector3i size = col_sdf->get_estimated_cell_size();
+ String text = vformat(String::utf8("%d × %d × %d"), size.x, size.y, size.z);
+ int data_size = 2;
+
+ const double size_mb = size.x * size.y * size.z * data_size / (1024.0 * 1024.0);
+ text += " - " + vformat(TTR("VRAM Size: %s MB"), String::num(size_mb, 2));
+
+ if (bake_info->get_text() == text) {
+ return;
+ }
+
+ // Color the label depending on the estimated performance level.
+ Color color;
+ if (size_mb <= 16.0 + CMP_EPSILON) {
+ // Fast.
+ color = bake_info->get_theme_color("success_color", "Editor");
+ } else if (size_mb <= 64.0 + CMP_EPSILON) {
+ // Medium.
+ color = bake_info->get_theme_color("warning_color", "Editor");
+ } else {
+ // Slow.
+ color = bake_info->get_theme_color("error_color", "Editor");
+ }
+ bake_info->add_theme_color_override("font_color", color);
+
+ bake_info->set_text(text);
+ }
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::make_visible(bool p_visible) {
+ if (p_visible) {
+ bake_hb->show();
+ set_process(true);
+ } else {
+ bake_hb->hide();
+ set_process(false);
+ }
+}
+
+EditorProgress *GPUParticlesCollisionSDFEditorPlugin::tmp_progress = nullptr;
+
+void GPUParticlesCollisionSDFEditorPlugin::bake_func_begin(int p_steps) {
+ ERR_FAIL_COND(tmp_progress != nullptr);
+
+ tmp_progress = memnew(EditorProgress("bake_sdf", TTR("Bake SDF"), p_steps));
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::bake_func_step(int p_step, const String &p_description) {
+ ERR_FAIL_COND(tmp_progress == nullptr);
+ tmp_progress->step(p_description, p_step, false);
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::bake_func_end() {
+ ERR_FAIL_COND(tmp_progress == nullptr);
+ memdelete(tmp_progress);
+ tmp_progress = nullptr;
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::_sdf_save_path_and_bake(const String &p_path) {
+ probe_file->hide();
+ if (col_sdf) {
+ Ref<Image> bake_img = col_sdf->bake();
+ if (bake_img.is_null()) {
+ EditorNode::get_singleton()->show_warning("Bake Error.");
+ return;
+ }
+
+ Ref<ConfigFile> config;
+
+ config.instance();
+ if (FileAccess::exists(p_path + ".import")) {
+ config->load(p_path + ".import");
+ }
+
+ config->set_value("remap", "importer", "3d_texture");
+ config->set_value("remap", "type", "StreamTexture3D");
+ if (!config->has_section_key("params", "compress/mode")) {
+ config->set_value("params", "compress/mode", 3); //user may want another compression, so leave it be
+ }
+ config->set_value("params", "compress/channel_pack", 1);
+ config->set_value("params", "mipmaps/generate", false);
+ config->set_value("params", "slices/horizontal", 1);
+ config->set_value("params", "slices/vertical", bake_img->get_meta("depth"));
+
+ config->save(p_path + ".import");
+
+ Error err = bake_img->save_exr(p_path, false);
+ ERR_FAIL_COND(err);
+ ResourceLoader::import(p_path);
+ Ref<Texture> t = ResourceLoader::load(p_path); //if already loaded, it will be updated on refocus?
+ ERR_FAIL_COND(t.is_null());
+
+ col_sdf->set_texture(t);
+ }
+}
+
+void GPUParticlesCollisionSDFEditorPlugin::_bind_methods() {
+}
+
+GPUParticlesCollisionSDFEditorPlugin::GPUParticlesCollisionSDFEditorPlugin(EditorNode *p_node) {
+ editor = p_node;
+ bake_hb = memnew(HBoxContainer);
+ bake_hb->set_h_size_flags(Control::SIZE_EXPAND_FILL);
+ bake_hb->hide();
+ bake = memnew(Button);
+ bake->set_flat(true);
+ bake->set_icon(editor->get_gui_base()->get_theme_icon("Bake", "EditorIcons"));
+ bake->set_text(TTR("Bake SDF"));
+ bake->connect("pressed", callable_mp(this, &GPUParticlesCollisionSDFEditorPlugin::_bake));
+ bake_hb->add_child(bake);
+ bake_info = memnew(Label);
+ bake_info->set_h_size_flags(Control::SIZE_EXPAND_FILL);
+ bake_info->set_clip_text(true);
+ bake_hb->add_child(bake_info);
+
+ add_control_to_container(CONTAINER_SPATIAL_EDITOR_MENU, bake_hb);
+ col_sdf = nullptr;
+ probe_file = memnew(EditorFileDialog);
+ probe_file->set_file_mode(EditorFileDialog::FILE_MODE_SAVE_FILE);
+ probe_file->add_filter("*.exr");
+ probe_file->connect("file_selected", callable_mp(this, &GPUParticlesCollisionSDFEditorPlugin::_sdf_save_path_and_bake));
+ get_editor_interface()->get_base_control()->add_child(probe_file);
+ probe_file->set_title(TTR("Select path for SDF Texture"));
+
+ GPUParticlesCollisionSDF::bake_begin_function = bake_func_begin;
+ GPUParticlesCollisionSDF::bake_step_function = bake_func_step;
+ GPUParticlesCollisionSDF::bake_end_function = bake_func_end;
+}
+
+GPUParticlesCollisionSDFEditorPlugin::~GPUParticlesCollisionSDFEditorPlugin() {
+}
diff --git a/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h
new file mode 100644
index 0000000000..0cdc70a62b
--- /dev/null
+++ b/editor/plugins/gpu_particles_collision_sdf_editor_plugin.h
@@ -0,0 +1,74 @@
+/*************************************************************************/
+/* gpu_particles_collision_sdf_editor_plugin.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H
+#define GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H
+
+#include "editor/editor_node.h"
+#include "editor/editor_plugin.h"
+#include "scene/3d/gpu_particles_collision_3d.h"
+#include "scene/resources/material.h"
+
+class GPUParticlesCollisionSDFEditorPlugin : public EditorPlugin {
+ GDCLASS(GPUParticlesCollisionSDFEditorPlugin, EditorPlugin);
+
+ GPUParticlesCollisionSDF *col_sdf;
+
+ HBoxContainer *bake_hb;
+ Label *bake_info;
+ Button *bake;
+ EditorNode *editor;
+
+ EditorFileDialog *probe_file;
+
+ static EditorProgress *tmp_progress;
+ static void bake_func_begin(int p_steps);
+ static void bake_func_step(int p_step, const String &p_description);
+ static void bake_func_end();
+
+ void _bake();
+ void _sdf_save_path_and_bake(const String &p_path);
+
+protected:
+ static void _bind_methods();
+ void _notification(int p_what);
+
+public:
+ virtual String get_name() const override { return "GPUParticlesCollisionSDF"; }
+ bool has_main_screen() const override { return false; }
+ virtual void edit(Object *p_object) override;
+ virtual bool handles(Object *p_object) const override;
+ virtual void make_visible(bool p_visible) override;
+
+ GPUParticlesCollisionSDFEditorPlugin(EditorNode *p_node);
+ ~GPUParticlesCollisionSDFEditorPlugin();
+};
+
+#endif // GPU_PARTICLES_COLLISION_SDF_EDITOR_PLUGIN_H
diff --git a/editor/plugins/node_3d_editor_plugin.cpp b/editor/plugins/node_3d_editor_plugin.cpp
index 8580bdf47e..aecbf817c4 100644
--- a/editor/plugins/node_3d_editor_plugin.cpp
+++ b/editor/plugins/node_3d_editor_plugin.cpp
@@ -2405,18 +2405,18 @@ void Node3DEditorViewport::_notification(int p_what) {
}
Transform t = sp->get_global_gizmo_transform();
+ VisualInstance3D *vi = Object::cast_to<VisualInstance3D>(sp);
+ AABB new_aabb = vi ? vi->get_aabb() : _calculate_spatial_bounds(sp);
exist = true;
- if (se->last_xform == t && !se->last_xform_dirty) {
+ if (se->last_xform == t && se->aabb == new_aabb && !se->last_xform_dirty) {
continue;
}
changed = true;
se->last_xform_dirty = false;
se->last_xform = t;
- VisualInstance3D *vi = Object::cast_to<VisualInstance3D>(sp);
-
- se->aabb = vi ? vi->get_aabb() : _calculate_spatial_bounds(sp);
+ se->aabb = new_aabb;
t.translate(se->aabb.position);
@@ -3566,7 +3566,7 @@ Vector3 Node3DEditorViewport::_get_instance_position(const Point2 &p_pos) const
return point + offset;
}
-AABB Node3DEditorViewport::_calculate_spatial_bounds(const Node3D *p_parent, bool p_exclude_toplevel_transform) {
+AABB Node3DEditorViewport::_calculate_spatial_bounds(const Node3D *p_parent, bool p_exclude_top_level_transform) {
AABB bounds;
const MeshInstance3D *mesh_instance = Object::cast_to<MeshInstance3D>(p_parent);
@@ -3591,7 +3591,7 @@ AABB Node3DEditorViewport::_calculate_spatial_bounds(const Node3D *p_parent, boo
bounds = AABB(Vector3(-0.2, -0.2, -0.2), Vector3(0.4, 0.4, 0.4));
}
- if (!p_exclude_toplevel_transform) {
+ if (!p_exclude_top_level_transform) {
bounds = p_parent->get_transform().xform(bounds);
}
@@ -6092,6 +6092,7 @@ void Node3DEditor::_register_all_gizmos() {
add_gizmo_plugin(Ref<VehicleWheel3DGizmoPlugin>(memnew(VehicleWheel3DGizmoPlugin)));
add_gizmo_plugin(Ref<VisibilityNotifier3DGizmoPlugin>(memnew(VisibilityNotifier3DGizmoPlugin)));
add_gizmo_plugin(Ref<GPUParticles3DGizmoPlugin>(memnew(GPUParticles3DGizmoPlugin)));
+ add_gizmo_plugin(Ref<GPUParticlesCollision3DGizmoPlugin>(memnew(GPUParticlesCollision3DGizmoPlugin)));
add_gizmo_plugin(Ref<CPUParticles3DGizmoPlugin>(memnew(CPUParticles3DGizmoPlugin)));
add_gizmo_plugin(Ref<ReflectionProbeGizmoPlugin>(memnew(ReflectionProbeGizmoPlugin)));
add_gizmo_plugin(Ref<DecalGizmoPlugin>(memnew(DecalGizmoPlugin)));
diff --git a/editor/plugins/node_3d_editor_plugin.h b/editor/plugins/node_3d_editor_plugin.h
index b3dc4ef5f2..e4a384449b 100644
--- a/editor/plugins/node_3d_editor_plugin.h
+++ b/editor/plugins/node_3d_editor_plugin.h
@@ -28,8 +28,8 @@
/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
/*************************************************************************/
-#ifndef SPATIAL_EDITOR_PLUGIN_H
-#define SPATIAL_EDITOR_PLUGIN_H
+#ifndef NODE_3D_EDITOR_PLUGIN_H
+#define NODE_3D_EDITOR_PLUGIN_H
#include "editor/editor_node.h"
#include "editor/editor_plugin.h"
@@ -450,7 +450,7 @@ private:
Point2i _get_warped_mouse_motion(const Ref<InputEventMouseMotion> &p_ev_mouse_motion) const;
Vector3 _get_instance_position(const Point2 &p_pos) const;
- static AABB _calculate_spatial_bounds(const Node3D *p_parent, bool p_exclude_toplevel_transform = true);
+ static AABB _calculate_spatial_bounds(const Node3D *p_parent, bool p_exclude_top_level_transform = true);
void _create_preview(const Vector<String> &files) const;
void _remove_preview();
bool _cyclical_dependency_exists(const String &p_target_scene_path, Node *p_desired_node);
@@ -890,4 +890,4 @@ public:
virtual ~EditorNode3DGizmoPlugin();
};
-#endif
+#endif // NODE_3D_EDITOR_PLUGIN_H
diff --git a/editor/plugins/tile_map_editor_plugin.cpp b/editor/plugins/tile_map_editor_plugin.cpp
index 8cd8aaf277..9261113706 100644
--- a/editor/plugins/tile_map_editor_plugin.cpp
+++ b/editor/plugins/tile_map_editor_plugin.cpp
@@ -89,6 +89,25 @@ void TileMapEditor::_notification(int p_what) {
case NOTIFICATION_EXIT_TREE: {
get_tree()->disconnect("node_removed", callable_mp(this, &TileMapEditor::_node_removed));
} break;
+
+ case NOTIFICATION_APPLICATION_FOCUS_OUT: {
+ if (tool == TOOL_PAINTING) {
+ Vector<int> ids = get_selected_tiles();
+
+ if (ids.size() > 0 && ids[0] != TileMap::INVALID_CELL) {
+ _set_cell(over_tile, ids, flip_h, flip_v, transpose);
+ _finish_undo();
+
+ paint_undo.clear();
+ }
+
+ tool = TOOL_NONE;
+ _update_button_tool();
+ }
+
+ // set flag to ignore over_tile on refocus
+ refocus_over_tile = true;
+ } break;
}
}
@@ -1299,6 +1318,12 @@ bool TileMapEditor::forward_gui_input(const Ref<InputEvent> &p_event) {
CanvasItemEditor::get_singleton()->update_viewport();
}
+ if (refocus_over_tile) {
+ // editor lost focus; forget last tile position
+ old_over_tile = new_over_tile;
+ refocus_over_tile = false;
+ }
+
int tile_under = node->get_cell(over_tile.x, over_tile.y);
String tile_name = "none";
diff --git a/editor/plugins/tile_map_editor_plugin.h b/editor/plugins/tile_map_editor_plugin.h
index 996e904853..f57616db1f 100644
--- a/editor/plugins/tile_map_editor_plugin.h
+++ b/editor/plugins/tile_map_editor_plugin.h
@@ -119,6 +119,7 @@ class TileMapEditor : public VBoxContainer {
Rect2i rectangle;
Point2i over_tile;
+ bool refocus_over_tile = false;
bool *bucket_cache_visited;
Rect2i bucket_cache_rect;
diff --git a/editor/plugins/visual_shader_editor_plugin.cpp b/editor/plugins/visual_shader_editor_plugin.cpp
index 35e8f560b0..61fb0f4700 100644
--- a/editor/plugins/visual_shader_editor_plugin.cpp
+++ b/editor/plugins/visual_shader_editor_plugin.cpp
@@ -107,6 +107,7 @@ void VisualShaderGraphPlugin::_bind_methods() {
ClassDB::bind_method("update_node_deferred", &VisualShaderGraphPlugin::update_node_deferred);
ClassDB::bind_method("set_input_port_default_value", &VisualShaderGraphPlugin::set_input_port_default_value);
ClassDB::bind_method("set_uniform_name", &VisualShaderGraphPlugin::set_uniform_name);
+ ClassDB::bind_method("set_expression", &VisualShaderGraphPlugin::set_expression);
ClassDB::bind_method("update_constant", &VisualShaderGraphPlugin::update_constant);
}
@@ -226,6 +227,20 @@ void VisualShaderGraphPlugin::update_constant(VisualShader::Type p_type, int p_n
links[p_node_id].graph_node->set_size(Size2(-1, -1));
}
+void VisualShaderGraphPlugin::set_expression(VisualShader::Type p_type, int p_node_id, const String &p_expression) {
+ if (p_type != visual_shader->get_shader_type() || !links.has(p_node_id) || !links[p_node_id].expression_edit) {
+ return;
+ }
+ links[p_node_id].expression_edit->set_text(p_expression);
+}
+
+void VisualShaderGraphPlugin::update_node_size(int p_node_id) {
+ if (!links.has(p_node_id)) {
+ return;
+ }
+ links[p_node_id].graph_node->set_size(Size2(-1, -1));
+}
+
void VisualShaderGraphPlugin::register_default_input_button(int p_node_id, int p_port_id, Button *p_button) {
links[p_node_id].input_ports.insert(p_port_id, { p_button });
}
@@ -234,6 +249,10 @@ void VisualShaderGraphPlugin::register_constant_option_btn(int p_node_id, Option
links[p_node_id].const_op = p_button;
}
+void VisualShaderGraphPlugin::register_expression_edit(int p_node_id, CodeEdit *p_expression_edit) {
+ links[p_node_id].expression_edit = p_expression_edit;
+}
+
void VisualShaderGraphPlugin::update_uniform_refs() {
for (Map<int, Link>::Element *E = links.front(); E; E = E->next()) {
VisualShaderNodeUniformRef *ref = Object::cast_to<VisualShaderNodeUniformRef>(E->get().visual_node);
@@ -277,7 +296,7 @@ void VisualShaderGraphPlugin::make_dirty(bool p_enabled) {
}
void VisualShaderGraphPlugin::register_link(VisualShader::Type p_type, int p_id, VisualShaderNode *p_visual_node, GraphNode *p_graph_node) {
- links.insert(p_id, { p_type, p_visual_node, p_graph_node, p_visual_node->get_output_port_for_preview() != -1, -1, Map<int, InputPort>(), Map<int, Port>(), nullptr, nullptr, nullptr });
+ links.insert(p_id, { p_type, p_visual_node, p_graph_node, p_visual_node->get_output_port_for_preview() != -1, -1, Map<int, InputPort>(), Map<int, Port>(), nullptr, nullptr, nullptr, nullptr });
}
void VisualShaderGraphPlugin::register_output_port(int p_node_id, int p_port, TextureButton *p_button) {
@@ -335,7 +354,7 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) {
if (p_id >= 2) {
node->set_show_close_button(true);
- node->connect("close_request", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_delete_request), varray(p_id), CONNECT_DEFERRED);
+ node->connect("close_request", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_delete_node_request), varray(p_type, p_id), CONNECT_DEFERRED);
}
node->connect("dragged", callable_mp(VisualShaderEditor::get_singleton(), &VisualShaderEditor::_node_dragged), varray(p_id));
@@ -616,6 +635,7 @@ void VisualShaderGraphPlugin::add_node(VisualShader::Type p_type, int p_id) {
expression_syntax_highlighter.instance();
expression_node->set_control(expression_box, 0);
node->add_child(expression_box);
+ register_expression_edit(p_id, expression_box);
Color background_color = EDITOR_GET("text_editor/highlighting/background_color");
Color text_color = EDITOR_GET("text_editor/highlighting/text_color");
@@ -1203,7 +1223,7 @@ void VisualShaderEditor::_add_input_port(int p_node, int p_port, int p_port_type
return;
}
- undo_redo->create_action(TTR("Add input port"));
+ undo_redo->create_action(TTR("Add Input Port"));
undo_redo->add_do_method(node.ptr(), "add_input_port", p_port, p_port_type, p_name);
undo_redo->add_undo_method(node.ptr(), "remove_input_port", p_port);
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node);
@@ -1218,7 +1238,7 @@ void VisualShaderEditor::_add_output_port(int p_node, int p_port, int p_port_typ
return;
}
- undo_redo->create_action(TTR("Add output port"));
+ undo_redo->create_action(TTR("Add Output Port"));
undo_redo->add_do_method(node.ptr(), "add_output_port", p_port, p_port_type, p_name);
undo_redo->add_undo_method(node.ptr(), "remove_output_port", p_port);
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node);
@@ -1233,7 +1253,7 @@ void VisualShaderEditor::_change_input_port_type(int p_type, int p_node, int p_p
return;
}
- undo_redo->create_action(TTR("Change input port type"));
+ undo_redo->create_action(TTR("Change Input Port Type"));
undo_redo->add_do_method(node.ptr(), "set_input_port_type", p_port, p_type);
undo_redo->add_undo_method(node.ptr(), "set_input_port_type", p_port, node->get_input_port_type(p_port));
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node);
@@ -1248,7 +1268,7 @@ void VisualShaderEditor::_change_output_port_type(int p_type, int p_node, int p_
return;
}
- undo_redo->create_action(TTR("Change output port type"));
+ undo_redo->create_action(TTR("Change Output Port Type"));
undo_redo->add_do_method(node.ptr(), "set_output_port_type", p_port, p_type);
undo_redo->add_undo_method(node.ptr(), "set_output_port_type", p_port, node->get_output_port_type(p_port));
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node);
@@ -1262,7 +1282,7 @@ void VisualShaderEditor::_change_input_port_name(const String &p_text, Object *l
Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node_id);
ERR_FAIL_COND(!node.is_valid());
- undo_redo->create_action(TTR("Change input port name"));
+ undo_redo->create_action(TTR("Change Input Port Name"));
undo_redo->add_do_method(node.ptr(), "set_input_port_name", p_port_id, p_text);
undo_redo->add_undo_method(node.ptr(), "set_input_port_name", p_port_id, node->get_input_port_name(p_port_id));
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node_id);
@@ -1276,7 +1296,7 @@ void VisualShaderEditor::_change_output_port_name(const String &p_text, Object *
Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node_id);
ERR_FAIL_COND(!node.is_valid());
- undo_redo->create_action(TTR("Change output port name"));
+ undo_redo->create_action(TTR("Change Output Port Name"));
undo_redo->add_do_method(node.ptr(), "set_output_port_name", p_port_id, p_text);
undo_redo->add_undo_method(node.ptr(), "set_output_port_name", p_port_id, node->get_output_port_name(p_port_id));
undo_redo->add_do_method(graph_plugin.ptr(), "update_node", type, p_node_id);
@@ -1291,7 +1311,7 @@ void VisualShaderEditor::_remove_input_port(int p_node, int p_port) {
return;
}
- undo_redo->create_action(TTR("Remove input port"));
+ undo_redo->create_action(TTR("Remove Input Port"));
List<VisualShader::Connection> conns;
visual_shader->get_node_connections(type, &conns);
@@ -1340,7 +1360,7 @@ void VisualShaderEditor::_remove_output_port(int p_node, int p_port) {
return;
}
- undo_redo->create_action(TTR("Remove output port"));
+ undo_redo->create_action(TTR("Remove Output Port"));
List<VisualShader::Connection> conns;
visual_shader->get_node_connections(type, &conns);
@@ -1395,67 +1415,72 @@ void VisualShaderEditor::_expression_focus_out(Object *code_edit, int p_node) {
return;
}
- undo_redo->create_action(TTR("Set expression"));
+ undo_redo->create_action(TTR("Set VisualShader Expression"));
undo_redo->add_do_method(node.ptr(), "set_expression", expression_box->get_text());
undo_redo->add_undo_method(node.ptr(), "set_expression", node->get_expression());
+ undo_redo->add_do_method(graph_plugin.ptr(), "set_expression", type, p_node, expression_box->get_text());
+ undo_redo->add_undo_method(graph_plugin.ptr(), "set_expression", type, p_node, node->get_expression());
undo_redo->commit_action();
}
void VisualShaderEditor::_set_node_size(int p_type, int p_node, const Vector2 &p_size) {
- VisualShader::Type type = get_current_shader_type();
+ VisualShader::Type type = VisualShader::Type(p_type);
Ref<VisualShaderNode> node = visual_shader->get_node(type, p_node);
if (node.is_null()) {
return;
}
Ref<VisualShaderNodeGroupBase> group_node = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr());
-
if (group_node.is_null()) {
return;
}
- Vector2 size = p_size;
+ group_node->set_size(p_size);
- group_node->set_size(size);
+ if (get_current_shader_type() == type) {
+ Ref<VisualShaderNodeExpression> expression_node = Object::cast_to<VisualShaderNodeExpression>(node.ptr());
+ Control *text_box = nullptr;
+ if (!expression_node.is_null()) {
+ text_box = expression_node->get_control(0);
+ if (text_box) {
+ text_box->set_custom_minimum_size(Size2(0, 0));
+ }
+ }
- GraphNode *gn = nullptr;
- if (edit_type->get_selected() == p_type) { // check - otherwise the error will be emitted
+ GraphNode *gn = nullptr;
Node *node2 = graph->get_node(itos(p_node));
gn = Object::cast_to<GraphNode>(node2);
if (!gn) {
return;
}
- gn->set_custom_minimum_size(size);
+ gn->set_custom_minimum_size(p_size);
gn->set_size(Size2(1, 1));
- }
- Ref<VisualShaderNodeExpression> expression_node = Object::cast_to<VisualShaderNodeExpression>(node.ptr());
- if (!expression_node.is_null()) {
- Control *text_box = expression_node->get_control(0);
- Size2 box_size = size;
- if (gn != nullptr) {
- if (box_size.x < 150 * EDSCALE || box_size.y < 0) {
- box_size.x = gn->get_size().x;
+ if (!expression_node.is_null() && text_box) {
+ Size2 box_size = p_size;
+ if (gn != nullptr) {
+ if (box_size.x < 150 * EDSCALE || box_size.y < 0) {
+ box_size.x = gn->get_size().x;
+ }
}
+ box_size.x -= text_box->get_margin(MARGIN_LEFT);
+ box_size.x -= 28 * EDSCALE;
+ box_size.y -= text_box->get_margin(MARGIN_TOP);
+ box_size.y -= 28 * EDSCALE;
+ text_box->set_custom_minimum_size(Size2(box_size.x, box_size.y));
+ text_box->set_size(Size2(1, 1));
}
- box_size.x -= text_box->get_margin(MARGIN_LEFT);
- box_size.x -= 28 * EDSCALE;
- box_size.y -= text_box->get_margin(MARGIN_TOP);
- box_size.y -= 28 * EDSCALE;
- text_box->set_custom_minimum_size(Size2(box_size.x, box_size.y));
- text_box->set_size(Size2(1, 1));
}
}
void VisualShaderEditor::_node_resized(const Vector2 &p_new_size, int p_type, int p_node) {
- VisualShader::Type type = get_current_shader_type();
- Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(type, p_node);
+ Ref<VisualShaderNodeGroupBase> node = visual_shader->get_node(VisualShader::Type(p_type), p_node);
if (node.is_null()) {
return;
}
- undo_redo->create_action(TTR("Resize VisualShader node"), UndoRedo::MERGE_ENDS);
+ undo_redo->create_action(TTR("Resize VisualShader Node"), UndoRedo::MERGE_ENDS);
undo_redo->add_do_method(this, "_set_node_size", p_type, p_node, p_new_size);
undo_redo->add_undo_method(this, "_set_node_size", p_type, p_node, node->get_size());
undo_redo->commit_action();
@@ -1896,61 +1921,112 @@ void VisualShaderEditor::_connection_from_empty(const String &p_to, int p_to_slo
_show_members_dialog(true);
}
-void VisualShaderEditor::_delete_request(int which) {
- VisualShader::Type type = get_current_shader_type();
- Ref<VisualShaderNode> node = Ref<VisualShaderNode>(visual_shader->get_node(type, which));
-
- undo_redo->create_action(TTR("Delete Node"));
-
+void VisualShaderEditor::_delete_nodes(int p_type, const List<int> &p_nodes) {
+ VisualShader::Type type = VisualShader::Type(p_type);
List<VisualShader::Connection> conns;
visual_shader->get_node_connections(type, &conns);
- for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
- if (E->get().from_node == which || E->get().to_node == which) {
- undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
+
+ for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) {
+ for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
+ if (E->get().from_node == F->get() || E->get().to_node == F->get()) {
+ undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
+ }
}
}
- undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, which);
- undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, which), which);
- undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, which);
+ Set<String> uniform_names;
- undo_redo->add_do_method(this, "_clear_buffer");
- undo_redo->add_undo_method(this, "_clear_buffer");
+ for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) {
+ Ref<VisualShaderNode> node = visual_shader->get_node(type, F->get());
- // restore size, inputs and outputs if node is group
- VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr());
- if (group) {
- undo_redo->add_undo_method(group, "set_size", group->get_size());
- undo_redo->add_undo_method(group, "set_inputs", group->get_inputs());
- undo_redo->add_undo_method(group, "set_outputs", group->get_outputs());
- }
+ undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, F->get());
+ undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, F->get()), F->get());
+ undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, F->get());
+
+ undo_redo->add_do_method(this, "_clear_buffer");
+ undo_redo->add_undo_method(this, "_clear_buffer");
- // restore expression text if node is expression
- VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr());
- if (expression) {
- undo_redo->add_undo_method(expression, "set_expression", expression->get_expression());
+ // restore size, inputs and outputs if node is group
+ VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr());
+ if (group) {
+ undo_redo->add_undo_method(group, "set_size", group->get_size());
+ undo_redo->add_undo_method(group, "set_inputs", group->get_inputs());
+ undo_redo->add_undo_method(group, "set_outputs", group->get_outputs());
+ }
+
+ // restore expression text if node is expression
+ VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr());
+ if (expression) {
+ undo_redo->add_undo_method(expression, "set_expression", expression->get_expression());
+ }
+
+ VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr());
+ if (uniform) {
+ uniform_names.insert(uniform->get_uniform_name());
+ }
}
- for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
- if (E->get().from_node == which || E->get().to_node == which) {
- undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
- undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
+ List<VisualShader::Connection> used_conns;
+ for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) {
+ for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
+ if (E->get().from_node == F->get() || E->get().to_node == F->get()) {
+ bool cancel = false;
+ for (List<VisualShader::Connection>::Element *R = used_conns.front(); R; R = R->next()) {
+ if (R->get().from_node == E->get().from_node && R->get().from_port == E->get().from_port && R->get().to_node == E->get().to_node && R->get().to_port == E->get().to_port) {
+ cancel = true; // to avoid ERR_ALREADY_EXISTS warning
+ break;
+ }
+ }
+ if (!cancel) {
+ undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
+ undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
+ used_conns.push_back(E->get());
+ }
+ }
}
}
- // delete a node from the graph
- undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, which);
- VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr());
- if (uniform) {
+ // delete nodes from the graph
+ for (const List<int>::Element *F = p_nodes.front(); F; F = F->next()) {
+ undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, F->get());
+ }
+
+ // update uniform refs if any uniform has been deleted
+ if (uniform_names.size() > 0) {
undo_redo->add_do_method(this, "_update_uniforms", true);
undo_redo->add_undo_method(this, "_update_uniforms", true);
- Set<String> uniform_names;
- uniform_names.insert(uniform->get_uniform_name());
-
_update_uniform_refs(uniform_names);
}
+}
+
+void VisualShaderEditor::_delete_node_request(int p_type, int p_node) {
+ List<int> to_erase;
+ to_erase.push_back(p_node);
+
+ undo_redo->create_action(TTR("Delete VisualShader Node"));
+ _delete_nodes(p_type, to_erase);
+ undo_redo->commit_action();
+}
+
+void VisualShaderEditor::_delete_nodes_request() {
+ List<int> to_erase;
+
+ for (int i = 0; i < graph->get_child_count(); i++) {
+ GraphNode *gn = Object::cast_to<GraphNode>(graph->get_child(i));
+ if (gn) {
+ if (gn->is_selected() && gn->is_close_button_visible()) {
+ to_erase.push_back(gn->get_name().operator String().to_int());
+ }
+ }
+ }
+ if (to_erase.empty()) {
+ return;
+ }
+
+ undo_redo->create_action(TTR("Delete VisualShader Node(s)"));
+ _delete_nodes(get_current_shader_type(), to_erase);
undo_redo->commit_action();
}
@@ -2273,7 +2349,7 @@ void VisualShaderEditor::_clear_buffer() {
}
void VisualShaderEditor::_duplicate_nodes() {
- int type = edit_type->get_selected();
+ int type = get_current_shader_type();
List<int> nodes;
Set<int> excluded;
@@ -2284,13 +2360,13 @@ void VisualShaderEditor::_duplicate_nodes() {
return;
}
- undo_redo->create_action(TTR("Duplicate Nodes"));
+ undo_redo->create_action(TTR("Duplicate VisualShader Node(s)"));
_dup_paste_nodes(type, type, nodes, excluded, Vector2(10, 10) * EDSCALE, true);
}
void VisualShaderEditor::_copy_nodes() {
- copy_type = edit_type->get_selected();
+ copy_type = get_current_shader_type();
_clear_buffer();
@@ -2302,9 +2378,7 @@ void VisualShaderEditor::_paste_nodes(bool p_use_custom_position, const Vector2
return;
}
- int type = edit_type->get_selected();
-
- undo_redo->create_action(TTR("Paste Nodes"));
+ int type = get_current_shader_type();
float scale = graph->get_zoom();
@@ -2315,109 +2389,13 @@ void VisualShaderEditor::_paste_nodes(bool p_use_custom_position, const Vector2
mpos = graph->get_local_mouse_position();
}
+ undo_redo->create_action(TTR("Paste VisualShader Node(s)"));
+
_dup_paste_nodes(type, copy_type, copy_nodes_buffer, copy_nodes_excluded_buffer, (graph->get_scroll_ofs() / scale + mpos / scale - selection_center), false);
_dup_update_excluded(type, copy_nodes_excluded_buffer); // to prevent selection of previous copies at new paste
}
-void VisualShaderEditor::_delete_nodes() {
- VisualShader::Type type = get_current_shader_type();
- List<int> to_erase;
-
- for (int i = 0; i < graph->get_child_count(); i++) {
- GraphNode *gn = Object::cast_to<GraphNode>(graph->get_child(i));
- if (gn) {
- if (gn->is_selected() && gn->is_close_button_visible()) {
- to_erase.push_back(gn->get_name().operator String().to_int());
- }
- }
- }
-
- if (to_erase.empty()) {
- return;
- }
-
- undo_redo->create_action(TTR("Delete Nodes"));
-
- List<VisualShader::Connection> conns;
- visual_shader->get_node_connections(type, &conns);
-
- for (List<int>::Element *F = to_erase.front(); F; F = F->next()) {
- for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
- if (E->get().from_node == F->get() || E->get().to_node == F->get()) {
- undo_redo->add_do_method(graph_plugin.ptr(), "disconnect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
- }
- }
- }
-
- Set<String> uniform_names;
-
- for (List<int>::Element *F = to_erase.front(); F; F = F->next()) {
- Ref<VisualShaderNode> node = visual_shader->get_node(type, F->get());
-
- undo_redo->add_do_method(visual_shader.ptr(), "remove_node", type, F->get());
- undo_redo->add_undo_method(visual_shader.ptr(), "add_node", type, node, visual_shader->get_node_position(type, F->get()), F->get());
- undo_redo->add_undo_method(graph_plugin.ptr(), "add_node", type, F->get());
-
- undo_redo->add_do_method(this, "_clear_buffer");
- undo_redo->add_undo_method(this, "_clear_buffer");
-
- // restore size, inputs and outputs if node is group
- VisualShaderNodeGroupBase *group = Object::cast_to<VisualShaderNodeGroupBase>(node.ptr());
- if (group) {
- undo_redo->add_undo_method(group, "set_size", group->get_size());
- undo_redo->add_undo_method(group, "set_inputs", group->get_inputs());
- undo_redo->add_undo_method(group, "set_outputs", group->get_outputs());
- }
-
- // restore expression text if node is expression
- VisualShaderNodeExpression *expression = Object::cast_to<VisualShaderNodeExpression>(node.ptr());
- if (expression) {
- undo_redo->add_undo_method(expression, "set_expression", expression->get_expression());
- }
-
- VisualShaderNodeUniform *uniform = Object::cast_to<VisualShaderNodeUniform>(node.ptr());
- if (uniform) {
- uniform_names.insert(uniform->get_uniform_name());
- }
- }
-
- List<VisualShader::Connection> used_conns;
- for (List<int>::Element *F = to_erase.front(); F; F = F->next()) {
- for (List<VisualShader::Connection>::Element *E = conns.front(); E; E = E->next()) {
- if (E->get().from_node == F->get() || E->get().to_node == F->get()) {
- bool cancel = false;
- for (List<VisualShader::Connection>::Element *R = used_conns.front(); R; R = R->next()) {
- if (R->get().from_node == E->get().from_node && R->get().from_port == E->get().from_port && R->get().to_node == E->get().to_node && R->get().to_port == E->get().to_port) {
- cancel = true; // to avoid ERR_ALREADY_EXISTS warning
- break;
- }
- }
- if (!cancel) {
- undo_redo->add_undo_method(visual_shader.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
- undo_redo->add_undo_method(graph_plugin.ptr(), "connect_nodes", type, E->get().from_node, E->get().from_port, E->get().to_node, E->get().to_port);
- used_conns.push_back(E->get());
- }
- }
- }
- }
-
- // delete nodes from the graph
- for (List<int>::Element *F = to_erase.front(); F; F = F->next()) {
- undo_redo->add_do_method(graph_plugin.ptr(), "remove_node", type, F->get());
- }
-
- // update uniform refs if any uniform has been deleted
- if (uniform_names.size() > 0) {
- undo_redo->add_do_method(this, "_update_uniforms", true);
- undo_redo->add_undo_method(this, "_update_uniforms", true);
-
- _update_uniform_refs(uniform_names);
- }
-
- undo_redo->commit_action();
-}
-
void VisualShaderEditor::_mode_selected(int p_id) {
visual_shader->set_shader_type(particles_mode ? VisualShader::Type(p_id + 3) : VisualShader::Type(p_id));
_update_options_menu();
@@ -2516,6 +2494,7 @@ void VisualShaderEditor::_uniform_select_item(Ref<VisualShaderNodeUniformRef> p_
void VisualShaderEditor::_float_constant_selected(int p_index, int p_node) {
if (p_index == 0) {
+ graph_plugin->update_node_size(p_node);
return;
}
@@ -2622,7 +2601,7 @@ void VisualShaderEditor::_node_menu_id_pressed(int p_idx) {
_paste_nodes(true, menu_point);
break;
case NodeMenuOptions::DELETE:
- _delete_nodes();
+ _delete_nodes_request();
break;
case NodeMenuOptions::DUPLICATE:
_duplicate_nodes();
@@ -2834,8 +2813,8 @@ VisualShaderEditor::VisualShaderEditor() {
graph->connect("scroll_offset_changed", callable_mp(this, &VisualShaderEditor::_scroll_changed));
graph->connect("duplicate_nodes_request", callable_mp(this, &VisualShaderEditor::_duplicate_nodes));
graph->connect("copy_nodes_request", callable_mp(this, &VisualShaderEditor::_copy_nodes));
- graph->connect("paste_nodes_request", callable_mp(this, &VisualShaderEditor::_paste_nodes));
- graph->connect("delete_nodes_request", callable_mp(this, &VisualShaderEditor::_delete_nodes));
+ graph->connect("paste_nodes_request", callable_mp(this, &VisualShaderEditor::_paste_nodes), varray(false, Point2()));
+ graph->connect("delete_nodes_request", callable_mp(this, &VisualShaderEditor::_delete_nodes_request));
graph->connect("gui_input", callable_mp(this, &VisualShaderEditor::_graph_gui_input));
graph->connect("connection_to_empty", callable_mp(this, &VisualShaderEditor::_connection_to_empty));
graph->connect("connection_from_empty", callable_mp(this, &VisualShaderEditor::_connection_from_empty));
@@ -3119,6 +3098,7 @@ VisualShaderEditor::VisualShaderEditor() {
add_options.push_back(AddOption("FragCoord", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_fragment_and_light_shader_modes, "fragcoord"), "fragcoord", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
add_options.push_back(AddOption("Light", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "light"), "light", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
add_options.push_back(AddOption("LightColor", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "light_color"), "light_color", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
+ add_options.push_back(AddOption("Metallic", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "metallic"), "metallic", VisualShaderNode::PORT_TYPE_SCALAR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
add_options.push_back(AddOption("Roughness", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "roughness"), "roughness", VisualShaderNode::PORT_TYPE_SCALAR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
add_options.push_back(AddOption("Specular", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "specular"), "specular", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
add_options.push_back(AddOption("Transmission", "Input", "Light", "VisualShaderNodeInput", vformat(input_param_for_light_shader_mode, "transmission"), "transmission", VisualShaderNode::PORT_TYPE_VECTOR, TYPE_FLAGS_LIGHT, Shader::MODE_SPATIAL));
diff --git a/editor/plugins/visual_shader_editor_plugin.h b/editor/plugins/visual_shader_editor_plugin.h
index 60a354d1fd..cecee70ca9 100644
--- a/editor/plugins/visual_shader_editor_plugin.h
+++ b/editor/plugins/visual_shader_editor_plugin.h
@@ -73,6 +73,7 @@ private:
VBoxContainer *preview_box;
LineEdit *uniform_name;
OptionButton *const_op;
+ CodeEdit *expression_edit;
};
Ref<VisualShader> visual_shader;
@@ -91,6 +92,7 @@ public:
void register_uniform_name(int p_id, LineEdit *p_uniform_name);
void register_default_input_button(int p_node_id, int p_port_id, Button *p_button);
void register_constant_option_btn(int p_node_id, OptionButton *p_button);
+ void register_expression_edit(int p_node_id, CodeEdit *p_expression_edit);
void clear_links();
void set_shader_type(VisualShader::Type p_type);
bool is_preview_visible(int p_id) const;
@@ -110,7 +112,9 @@ public:
void update_uniform_refs();
void set_uniform_name(VisualShader::Type p_type, int p_node_id, const String &p_name);
void update_constant(VisualShader::Type p_type, int p_node_id);
+ void set_expression(VisualShader::Type p_type, int p_node_id, const String &p_expression);
int get_constant_index(float p_constant) const;
+ void update_node_size(int p_node_id);
VisualShader::Type get_shader_type() const;
VisualShaderGraphPlugin();
@@ -289,8 +293,9 @@ class VisualShaderEditor : public VBoxContainer {
void _scroll_changed(const Vector2 &p_scroll);
void _node_selected(Object *p_node);
- void _delete_request(int);
- void _delete_nodes();
+ void _delete_nodes(int p_type, const List<int> &p_nodes);
+ void _delete_node_request(int p_type, int p_node);
+ void _delete_nodes_request();
void _removed_from_graph();
diff --git a/editor/scene_tree_dock.cpp b/editor/scene_tree_dock.cpp
index d9c95b1944..c4e90ca3ff 100644
--- a/editor/scene_tree_dock.cpp
+++ b/editor/scene_tree_dock.cpp
@@ -1141,7 +1141,7 @@ void SceneTreeDock::_notification(int p_what) {
node_shortcuts->add_child(button_custom);
button_custom->set_text(TTR("Other Node"));
button_custom->set_icon(get_theme_icon("Add", "EditorIcons"));
- button_custom->connect("pressed", callable_mp(this, &SceneTreeDock::_tool_selected), make_binds(TOOL_NEW, false));
+ button_custom->connect("pressed", callable_bind(callable_mp(this, &SceneTreeDock::_tool_selected), TOOL_NEW, false));
node_shortcuts->add_spacer();
create_root_dialog->add_child(node_shortcuts);
@@ -1318,32 +1318,50 @@ void SceneTreeDock::perform_node_renames(Node *p_base, List<Pair<NodePath, NodeP
if (si) {
List<PropertyInfo> properties;
si->get_property_list(&properties);
+ NodePath root_path = p_base->get_path();
for (List<PropertyInfo>::Element *E = properties.front(); E; E = E->next()) {
String propertyname = E->get().name;
Variant p = p_base->get(propertyname);
if (p.get_type() == Variant::NODE_PATH) {
- // Goes through all paths to check if its matching
+ NodePath root_path_new = root_path;
for (List<Pair<NodePath, NodePath>>::Element *F = p_renames->front(); F; F = F->next()) {
- NodePath root_path = p_base->get_path();
+ if (root_path == F->get().first) {
+ root_path_new = F->get().second;
+ break;
+ }
+ }
+ // Goes through all paths to check if its matching
+ for (List<Pair<NodePath, NodePath>>::Element *F = p_renames->front(); F; F = F->next()) {
NodePath rel_path_old = root_path.rel_path_to(F->get().first);
- NodePath rel_path_new = F->get().second;
-
- // if not empty, get new relative path
- if (F->get().second != NodePath()) {
- rel_path_new = root_path.rel_path_to(F->get().second);
- }
-
// if old path detected, then it needs to be replaced with the new one
if (p == rel_path_old) {
+ NodePath rel_path_new = F->get().second;
+
+ // if not empty, get new relative path
+ if (!rel_path_new.is_empty()) {
+ rel_path_new = root_path_new.rel_path_to(F->get().second);
+ }
+
editor_data->get_undo_redo().add_do_property(p_base, propertyname, rel_path_new);
editor_data->get_undo_redo().add_undo_property(p_base, propertyname, rel_path_old);
p_base->set(propertyname, rel_path_new);
break;
}
+
+ // update if the node itself moved up/down the tree hirarchy
+ if (root_path == F->get().first) {
+ NodePath abs_path = NodePath(String(root_path).plus_file(p)).simplified();
+ NodePath rel_path_new = F->get().second.rel_path_to(abs_path);
+
+ editor_data->get_undo_redo().add_do_property(p_base, propertyname, rel_path_new);
+ editor_data->get_undo_redo().add_undo_property(p_base, propertyname, p);
+
+ p_base->set(propertyname, rel_path_new);
+ }
}
}
}
@@ -2089,8 +2107,12 @@ void SceneTreeDock::replace_node(Node *p_node, Node *p_by_node, bool p_keep_prop
}
if (E->get().name == "__meta__") {
- if (Object::cast_to<CanvasItem>(newnode)) {
- Dictionary metadata = n->get(E->get().name);
+ Dictionary metadata = n->get(E->get().name);
+ if (metadata.has("_editor_description_")) {
+ newnode->set_meta("_editor_description_", metadata["_editor_description_"]);
+ }
+
+ if (Object::cast_to<CanvasItem>(newnode) || Object::cast_to<Node3D>(newnode)) {
if (metadata.has("_edit_group_") && metadata["_edit_group_"]) {
newnode->set_meta("_edit_group_", true);
}
diff --git a/editor/shader_globals_editor.cpp b/editor/shader_globals_editor.cpp
index aa88b0ef39..04fbac3463 100644
--- a/editor/shader_globals_editor.cpp
+++ b/editor/shader_globals_editor.cpp
@@ -437,6 +437,9 @@ void ShaderGlobalsEditor::_notification(int p_what) {
inspector->edit(interface);
}
}
+ if (p_what == NOTIFICATION_PREDELETE) {
+ inspector->edit(nullptr);
+ }
}
ShaderGlobalsEditor::ShaderGlobalsEditor() {
@@ -474,6 +477,5 @@ ShaderGlobalsEditor::ShaderGlobalsEditor() {
}
ShaderGlobalsEditor::~ShaderGlobalsEditor() {
- inspector->edit(nullptr);
memdelete(interface);
}
diff --git a/main/performance.h b/main/performance.h
index 5f88a24c0f..f406433cf2 100644
--- a/main/performance.h
+++ b/main/performance.h
@@ -31,7 +31,7 @@
#ifndef PERFORMANCE_H
#define PERFORMANCE_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/ordered_hash_map.h"
#define PERF_WARN_OFFLINE_FUNCTION
diff --git a/misc/dist/html/editor.html b/misc/dist/html/editor.html
new file mode 100644
index 0000000000..5b6ad2df65
--- /dev/null
+++ b/misc/dist/html/editor.html
@@ -0,0 +1,475 @@
+<!DOCTYPE html>
+<html xmlns='http://www.w3.org/1999/xhtml' lang='' xml:lang=''>
+<head>
+ <meta charset='utf-8' />
+ <meta name='viewport' content='width=device-width, user-scalable=no' />
+ <link id='-gd-engine-icon' rel='icon' type='image/png' href='favicon.png' />
+ <title></title>
+ <style type='text/css'>
+
+ body {
+ touch-action: none;
+ margin: 0;
+ border: 0 none;
+ padding: 0;
+ text-align: center;
+ background-color: black;
+ overflow: hidden;
+ }
+
+ #canvas, #gameCanvas {
+ display: block;
+ margin: 0;
+ color: white;
+ }
+
+ #canvas:focus, #gameCanvas:focus {
+ outline: none;
+ }
+
+ .godot {
+ font-family: 'Noto Sans', 'Droid Sans', Arial, sans-serif;
+ color: #e0e0e0;
+ background-color: #3b3943;
+ background-image: linear-gradient(to bottom, #403e48, #35333c);
+ border: 1px solid #45434e;
+ box-shadow: 0 0 1px 1px #2f2d35;
+ }
+
+
+ /* Status display
+ * ============== */
+
+ #status {
+ position: absolute;
+ left: 0;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ /* don't consume click events - make children visible explicitly */
+ visibility: hidden;
+ }
+
+ #status-progress {
+ width: 366px;
+ height: 7px;
+ background-color: #38363A;
+ border: 1px solid #444246;
+ padding: 1px;
+ box-shadow: 0 0 2px 1px #1B1C22;
+ border-radius: 2px;
+ visibility: visible;
+ }
+
+ @media only screen and (orientation:portrait) {
+ #status-progress {
+ width: 61.8%;
+ }
+ }
+
+ #status-progress-inner {
+ height: 100%;
+ width: 0;
+ box-sizing: border-box;
+ transition: width 0.5s linear;
+ background-color: #202020;
+ border: 1px solid #222223;
+ box-shadow: 0 0 1px 1px #27282E;
+ border-radius: 3px;
+ }
+
+ #status-indeterminate {
+ visibility: visible;
+ position: relative;
+ }
+
+ #status-indeterminate > div {
+ width: 4.5px;
+ height: 0;
+ border-style: solid;
+ border-width: 9px 3px 0 3px;
+ border-color: #2b2b2b transparent transparent transparent;
+ transform-origin: center 21px;
+ position: absolute;
+ }
+
+ #status-indeterminate > div:nth-child(1) { transform: rotate( 22.5deg); }
+ #status-indeterminate > div:nth-child(2) { transform: rotate( 67.5deg); }
+ #status-indeterminate > div:nth-child(3) { transform: rotate(112.5deg); }
+ #status-indeterminate > div:nth-child(4) { transform: rotate(157.5deg); }
+ #status-indeterminate > div:nth-child(5) { transform: rotate(202.5deg); }
+ #status-indeterminate > div:nth-child(6) { transform: rotate(247.5deg); }
+ #status-indeterminate > div:nth-child(7) { transform: rotate(292.5deg); }
+ #status-indeterminate > div:nth-child(8) { transform: rotate(337.5deg); }
+
+ #status-notice {
+ margin: 0 100px;
+ line-height: 1.3;
+ visibility: visible;
+ padding: 4px 6px;
+ visibility: visible;
+ }
+ </style>
+</head>
+<body>
+ <div id="tabs-buttons">
+ <button id="btn-tab-loader" class="tab-btn" onclick="showTab('loader')">Loader</button>
+ <button id="btn-tab-editor" class="tab-btn" disabled="disabled" onclick="showTab('editor')">Editor</button>
+ <button id="btn-close-editor" class="close-btn" disabled="disabled" onclick="closeEditor()">X</button>
+ <button id="btn-tab-game" class="tab-btn" disabled="disabled" onclick="showTab('game')">Game</button>
+ <button id="btn-close-game" class="close-btn" disabled="disabled" onclick="closeGame()">X</button>
+ </div>
+ <div id='tabs'>
+ <div id='tab-loader'>
+ <div style="color: white;" id="persistence">
+ <label for="videoMode" style="display: none;">Select video driver:</label><br />
+ <select id="videoMode" style="display: none;">
+ <option value="GLES2" selected="selected">WebGL</option>
+ <option value="GLES3">WebGL 2</option>
+ </select>
+ <br />
+ <label for="zip-file">Preload project zip: </label><input id="zip-file" type="file" id="files" name="files"/>
+ <br />
+ <button id="startButton">Start Godot Editor</button>
+ <br />
+ <br />
+ <button onclick="clearPersistence()">Clear persistent data</button>
+ </div>
+ </div>
+ <div id='tab-editor' style="display: none;">
+ <canvas id='editor-canvas' tabindex="1">
+ HTML5 canvas appears to be unsupported in the current browser.<br />
+ Please try updating or use a different browser.
+ </canvas>
+ </div>
+ <div id='tab-game' style="display: none;">
+ <canvas id='game-canvas' tabindex="2">
+ HTML5 canvas appears to be unsupported in the current browser.<br />
+ Please try updating or use a different browser.
+ </canvas>
+ </div>
+ <div id='tab-status' style="display: none;">
+ <div id='status-progress' style='display: none;' oncontextmenu='event.preventDefault();'><div id ='status-progress-inner'></div></div>
+ <div id='status-indeterminate' style='display: none;' oncontextmenu='event.preventDefault();'>
+ <div></div>
+ <div></div>
+ <div></div>
+ <div></div>
+ <div></div>
+ <div></div>
+ <div></div>
+ <div></div>
+ </div>
+ <div id='status-notice' class='godot' style='display: none;'></div>
+ </div>
+ </div>
+
+ <script type='text/javascript' src='godot.tools.js'></script>
+ <script type='text/javascript'>//<![CDATA[
+
+ var engine = new Engine;
+ var game = null;
+ var setStatusMode;
+ var setStatusNotice;
+ var video_driver = "GLES2";
+
+ function clearPersistence() {
+ function deleteDB(path) {
+ return new Promise(function(resolve, reject) {
+ var req = indexedDB.deleteDatabase(path);
+ req.onsuccess = function() {
+ resolve();
+ };
+ req.onerror = function(err) {
+ reject(err);
+ };
+ req.onblocked = function(err) {
+ reject(err);
+ }
+
+ });
+ }
+ if (!window.confirm("Are you sure you want to delete all the locally stored files?")) {
+ return;
+ }
+ Promise.all([
+ deleteDB("/home/web_user/projects"),
+ deleteDB("/home/web_user/.config")
+ ]).then(function(results) {
+ alert("Done.");
+ }).catch(function (err) {
+ alert("Error deleting local files. Please retry after reloading the page.");
+ });
+ }
+
+ function selectVideoMode() {
+ var select = document.getElementById('videoMode');
+ video_driver = select.selectedOptions[0].value;
+ }
+
+ var tabs = [
+ document.getElementById('tab-loader'),
+ document.getElementById('tab-editor'),
+ document.getElementById('tab-game')
+ ]
+ function showTab(name) {
+ tabs.forEach(function (elem) {
+ if (elem.id == 'tab-' + name) {
+ elem.style.display = 'block';
+ } else {
+ elem.style.display = 'none';
+ }
+ });
+ }
+
+ function setButtonEnabled(id, enabled) {
+ if (enabled) {
+ document.getElementById(id).disabled = "";
+ } else {
+ document.getElementById(id).disabled = "disabled";
+ }
+ }
+
+ function setLoaderEnabled(enabled) {
+ setButtonEnabled('btn-tab-loader', enabled);
+ setButtonEnabled('btn-tab-editor', !enabled);
+ setButtonEnabled('btn-close-editor', !enabled);
+ }
+
+ function setGameTabEnabled(enabled) {
+ setButtonEnabled('btn-tab-game', enabled);
+ setButtonEnabled('btn-close-game', enabled);
+ }
+
+ function closeGame() {
+ if (game) {
+ game.requestQuit();
+ }
+ }
+
+ function closeEditor() {
+ closeGame();
+ if (engine) {
+ engine.requestQuit();
+ }
+ }
+
+ function startEditor(zip) {
+
+ const INDETERMINATE_STATUS_STEP_MS = 100;
+ const persistentPaths = ['/home/web_user/.config', '/home/web_user/projects'];
+
+ var editorCanvas = document.getElementById('editor-canvas');
+ var gameCanvas = document.getElementById('game-canvas');
+ var statusProgress = document.getElementById('status-progress');
+ var statusProgressInner = document.getElementById('status-progress-inner');
+ var statusIndeterminate = document.getElementById('status-indeterminate');
+ var statusNotice = document.getElementById('status-notice');
+
+ var initializing = true;
+ var statusMode = 'hidden';
+
+ showTab('status');
+
+ var animationCallbacks = [];
+ function animate(time) {
+ animationCallbacks.forEach(callback => callback(time));
+ requestAnimationFrame(animate);
+ }
+ requestAnimationFrame(animate);
+
+ function adjustCanvasDimensions() {
+ var scale = window.devicePixelRatio || 1;
+ var header = document.getElementById('tabs-buttons');
+ var headerHeight = header.offsetHeight + 1;
+ var width = window.innerWidth;
+ var height = window.innerHeight - headerHeight;
+ editorCanvas.width = width * scale;
+ editorCanvas.height = height * scale;
+ editorCanvas.style.width = width + "px";
+ editorCanvas.style.height = height + "px";
+ }
+ animationCallbacks.push(adjustCanvasDimensions);
+ adjustCanvasDimensions();
+
+ setStatusMode = function setStatusMode(mode) {
+
+ if (statusMode === mode || !initializing)
+ return;
+ [statusProgress, statusIndeterminate, statusNotice].forEach(elem => {
+ elem.style.display = 'none';
+ });
+ animationCallbacks = animationCallbacks.filter(function(value) {
+ return (value != animateStatusIndeterminate);
+ });
+ switch (mode) {
+ case 'progress':
+ statusProgress.style.display = 'block';
+ break;
+ case 'indeterminate':
+ statusIndeterminate.style.display = 'block';
+ animationCallbacks.push(animateStatusIndeterminate);
+ break;
+ case 'notice':
+ statusNotice.style.display = 'block';
+ break;
+ case 'hidden':
+ break;
+ default:
+ throw new Error('Invalid status mode');
+ }
+ statusMode = mode;
+ }
+
+ function animateStatusIndeterminate(ms) {
+
+ var i = Math.floor(ms / INDETERMINATE_STATUS_STEP_MS % 8);
+ if (statusIndeterminate.children[i].style.borderTopColor == '') {
+ Array.prototype.slice.call(statusIndeterminate.children).forEach(child => {
+ child.style.borderTopColor = '';
+ });
+ statusIndeterminate.children[i].style.borderTopColor = '#dfdfdf';
+ }
+ }
+
+ setStatusNotice = function setStatusNotice(text) {
+
+ while (statusNotice.lastChild) {
+ statusNotice.removeChild(statusNotice.lastChild);
+ }
+ var lines = text.split('\n');
+ lines.forEach((line) => {
+ statusNotice.appendChild(document.createTextNode(line));
+ statusNotice.appendChild(document.createElement('br'));
+ });
+ };
+
+ engine.setProgressFunc((current, total) => {
+
+ if (total > 0) {
+ statusProgressInner.style.width = current/total * 100 + '%';
+ setStatusMode('progress');
+ if (current === total) {
+ // wait for progress bar animation
+ setTimeout(() => {
+ setStatusMode('indeterminate');
+ }, 100);
+ }
+ } else {
+ setStatusMode('indeterminate');
+ }
+ });
+
+ engine.setPersistentPaths(persistentPaths);
+
+ engine.setOnExecute(function(args) {
+ const is_editor = args.filter(function(v) { return v == '--editor' || v == '-e' }).length != 0;
+ const is_project_manager = args.filter(function(v) { return v == '--project-manager' }).length != 0;
+ const is_game = !is_editor && !is_project_manager;
+ if (is_project_manager) {
+ args.push('--video-driver', video_driver);
+ }
+ if (is_game) {
+ if (game) {
+ console.error("A game is already running. Close it first");
+ return;
+ }
+ setGameTabEnabled(true);
+ game = new Engine();
+ game.setPersistentPaths(persistentPaths);
+ game.setUnloadAfterInit(false);
+ game.setOnExecute(engine.onExecute);
+ game.setCanvas(gameCanvas);
+ game.setCanvasResizedOnStart(true);
+ game.setOnExit(function() {
+ setGameTabEnabled(false);
+ showTab('editor');
+ game = null;
+ });
+ showTab('game');
+ game.init().then(function() {
+ requestAnimationFrame(function() {
+ game.start.apply(game, args).then(function() {
+ gameCanvas.focus();
+ });
+ });
+ });
+ } else { // New editor instances will be run in the same canvas. We want to wait for it to exit.
+ engine.setOnExit(function(code) {
+ setLoaderEnabled(true);
+ setTimeout(function() {
+ engine.init().then(function() {
+ setLoaderEnabled(false);
+ engine.setOnExit(function() {
+ showTab('loader');
+ setLoaderEnabled(true);
+ });
+ engine.start.apply(engine, args);
+ });
+ }, 0);
+ engine.setOnExit(null);
+ });
+ }
+ });
+
+ function displayFailureNotice(err) {
+ var msg = err.message || err;
+ console.error(msg);
+ setStatusNotice(msg);
+ setStatusMode('notice');
+ initializing = false;
+ };
+
+ if (!Engine.isWebGLAvailable()) {
+ displayFailureNotice('WebGL not available');
+ } else {
+ setStatusMode('indeterminate');
+ engine.setCanvas(editorCanvas);
+ engine.setUnloadAfterInit(false); // Don't want to reload when starting game.
+ engine.init('godot.tools').then(function() {
+ if (zip) {
+ engine.copyToFS("/home/web_user/preload.zip", zip);
+ }
+ try {
+ // Avoid user creating project in the persistent root folder.
+ engine.copyToFS("/home/web_user/projects/keep", new Uint8Array());
+ } catch(e) {
+ // File exists
+ }
+ //selectVideoMode();
+ showTab('editor');
+ setLoaderEnabled(false);
+ engine.setOnExit(function() {
+ showTab('loader');
+ setLoaderEnabled(true);
+ });
+ engine.start('--video-driver', video_driver).then(function() {
+ setStatusMode('hidden');
+ initializing = false;
+ });
+ }).catch(displayFailureNotice);
+ }
+ };
+ document.getElementById("startButton").onclick = function() {
+ preloadZip(document.getElementById('zip-file')).then(function(zip) {
+ startEditor(zip);
+ });
+ }
+
+ function preloadZip(target) {
+ return new Promise(function(resolve, reject) {
+ if (target.files.length > 0) {
+ target.files[0].arrayBuffer().then(function(data) {
+ resolve(data);
+ });
+ } else {
+ resolve();
+ }
+ });
+ }
+ //]]></script>
+</body>
+</html>
diff --git a/misc/dist/ios_xcode/godot_ios.xcodeproj/project.pbxproj b/misc/dist/ios_xcode/godot_ios.xcodeproj/project.pbxproj
index 9a1143a21a..d8da520ed7 100644
--- a/misc/dist/ios_xcode/godot_ios.xcodeproj/project.pbxproj
+++ b/misc/dist/ios_xcode/godot_ios.xcodeproj/project.pbxproj
@@ -386,7 +386,7 @@
CONFIGURATION_BUILD_DIR = "$(BUILD_DIR)/$(CONFIGURATION)$(EFFECTIVE_PLATFORM_NAME)";
DEVELOPMENT_TEAM = $team_id;
INFOPLIST_FILE = "$binary/$binary-Info.plist";
- IPHONEOS_DEPLOYMENT_TARGET = 9.0;
+ IPHONEOS_DEPLOYMENT_TARGET = 11.0;
LD_RUNPATH_SEARCH_PATHS = (
"$(inherited)",
"@executable_path/Frameworks",
@@ -416,7 +416,7 @@
CONFIGURATION_BUILD_DIR = "$(BUILD_DIR)/$(CONFIGURATION)$(EFFECTIVE_PLATFORM_NAME)";
DEVELOPMENT_TEAM = $team_id;
INFOPLIST_FILE = "$binary/$binary-Info.plist";
- IPHONEOS_DEPLOYMENT_TARGET = 9.0;
+ IPHONEOS_DEPLOYMENT_TARGET = 11.0;
LD_RUNPATH_SEARCH_PATHS = (
"$(inherited)",
"@executable_path/Frameworks",
diff --git a/modules/arkit/arkit_interface.h b/modules/arkit/arkit_interface.h
index 5a2c50e213..29e09411ff 100644
--- a/modules/arkit/arkit_interface.h
+++ b/modules/arkit/arkit_interface.h
@@ -44,6 +44,15 @@
// forward declaration for some needed objects
class ARKitShader;
+#ifdef __OBJC__
+
+typedef ARAnchor GodotARAnchor;
+
+#else
+
+typedef void GodotARAnchor;
+#endif
+
class ARKitInterface : public XRInterface {
GDCLASS(ARKitInterface, XRInterface);
@@ -115,8 +124,8 @@ public:
virtual void process() override;
// called by delegate (void * because C++ and Obj-C don't always mix, should really change all platform/iphone/*.cpp files to .mm)
- void _add_or_update_anchor(void *p_anchor);
- void _remove_anchor(void *p_anchor);
+ void _add_or_update_anchor(GodotARAnchor *p_anchor);
+ void _remove_anchor(GodotARAnchor *p_anchor);
ARKitInterface();
~ARKitInterface();
diff --git a/modules/arkit/arkit_interface.mm b/modules/arkit/arkit_interface.mm
index 3fb2cc933d..e8fa023ac7 100644
--- a/modules/arkit/arkit_interface.mm
+++ b/modules/arkit/arkit_interface.mm
@@ -306,12 +306,10 @@ void ARKitInterface::uninitialize() {
remove_all_anchors();
if (@available(iOS 11.0, *)) {
- [ar_session release];
- ar_session = NULL;
+ ar_session = nil;
}
- [ar_delegate release];
- ar_delegate = NULL;
+ ar_delegate = nil;
initialized = false;
session_was_started = false;
}
@@ -687,7 +685,7 @@ void ARKitInterface::process() {
}
}
-void ARKitInterface::_add_or_update_anchor(void *p_anchor) {
+void ARKitInterface::_add_or_update_anchor(GodotARAnchor *p_anchor) {
// _THREAD_SAFE_METHOD_
if (@available(iOS 11.0, *)) {
@@ -749,7 +747,7 @@ void ARKitInterface::_add_or_update_anchor(void *p_anchor) {
}
}
-void ARKitInterface::_remove_anchor(void *p_anchor) {
+void ARKitInterface::_remove_anchor(GodotARAnchor *p_anchor) {
// _THREAD_SAFE_METHOD_
if (@available(iOS 11.0, *)) {
@@ -768,7 +766,7 @@ ARKitInterface::ARKitInterface() {
plane_detection_is_enabled = false;
light_estimation_is_enabled = false;
if (@available(iOS 11.0, *)) {
- ar_session = NULL;
+ ar_session = nil;
}
z_near = 0.01;
z_far = 1000.0;
diff --git a/modules/bullet/area_bullet.cpp b/modules/bullet/area_bullet.cpp
index b35019bea3..f8f7d79a11 100644
--- a/modules/bullet/area_bullet.cpp
+++ b/modules/bullet/area_bullet.cpp
@@ -65,11 +65,14 @@ AreaBullet::~AreaBullet() {
}
void AreaBullet::dispatch_callbacks() {
- RigidCollisionObjectBullet::dispatch_callbacks();
+ if (!isScratched) {
+ return;
+ }
+ isScratched = false;
// Reverse order because I've to remove EXIT objects
for (int i = overlappingObjects.size() - 1; 0 <= i; --i) {
- OverlappingObjectData &otherObj = overlappingObjects[i];
+ OverlappingObjectData &otherObj = overlappingObjects.write[i];
switch (otherObj.state) {
case OVERLAP_STATE_ENTER:
@@ -109,9 +112,10 @@ void AreaBullet::call_event(CollisionObjectBullet *p_otherObject, PhysicsServer3
}
void AreaBullet::scratch() {
- if (space != nullptr) {
- space->add_to_pre_flush_queue(this);
+ if (isScratched) {
+ return;
}
+ isScratched = true;
}
void AreaBullet::clear_overlaps(bool p_notify) {
@@ -160,7 +164,7 @@ void AreaBullet::main_shape_changed() {
btGhost->setCollisionShape(get_main_shape());
}
-void AreaBullet::do_reload_body() {
+void AreaBullet::reload_body() {
if (space) {
space->remove_area(this);
space->add_area(this);
@@ -169,25 +173,22 @@ void AreaBullet::do_reload_body() {
void AreaBullet::set_space(SpaceBullet *p_space) {
// Clear the old space if there is one
-
if (space) {
clear_overlaps(false);
+ isScratched = false;
// Remove this object form the physics world
- space->unregister_collision_object(this);
space->remove_area(this);
}
space = p_space;
if (space) {
- space->register_collision_object(this);
- reload_body();
- scratch();
+ space->add_area(this);
}
}
-void AreaBullet::do_reload_collision_filters() {
+void AreaBullet::on_collision_filters_change() {
if (space) {
space->reload_collision_filters(this);
}
@@ -201,13 +202,13 @@ void AreaBullet::add_overlap(CollisionObjectBullet *p_otherObject) {
void AreaBullet::put_overlap_as_exit(int p_index) {
scratch();
- overlappingObjects[p_index].state = OVERLAP_STATE_EXIT;
+ overlappingObjects.write[p_index].state = OVERLAP_STATE_EXIT;
}
void AreaBullet::put_overlap_as_inside(int p_index) {
// This check is required to be sure this body was inside
if (OVERLAP_STATE_DIRTY == overlappingObjects[p_index].state) {
- overlappingObjects[p_index].state = OVERLAP_STATE_INSIDE;
+ overlappingObjects.write[p_index].state = OVERLAP_STATE_INSIDE;
}
}
diff --git a/modules/bullet/area_bullet.h b/modules/bullet/area_bullet.h
index 51fbc1f71d..c0bcc858fe 100644
--- a/modules/bullet/area_bullet.h
+++ b/modules/bullet/area_bullet.h
@@ -32,7 +32,7 @@
#define AREABULLET_H
#include "collision_object_bullet.h"
-#include "core/local_vector.h"
+#include "core/vector.h"
#include "servers/physics_server_3d.h"
#include "space_bullet.h"
@@ -83,7 +83,7 @@ private:
Variant *call_event_res_ptr[5];
btGhostObject *btGhost;
- LocalVector<OverlappingObjectData> overlappingObjects;
+ Vector<OverlappingObjectData> overlappingObjects;
bool monitorable = true;
PhysicsServer3D::AreaSpaceOverrideMode spOv_mode = PhysicsServer3D::AREA_SPACE_OVERRIDE_DISABLED;
@@ -96,6 +96,8 @@ private:
real_t spOv_angularDump = 0.1;
int spOv_priority = 0;
+ bool isScratched = false;
+
InOutEventCallback eventsCallbacks[2];
public:
@@ -137,11 +139,11 @@ public:
_FORCE_INLINE_ void set_spOv_priority(int p_priority) { spOv_priority = p_priority; }
_FORCE_INLINE_ int get_spOv_priority() { return spOv_priority; }
- virtual void main_shape_changed() override;
- virtual void do_reload_body() override;
- virtual void set_space(SpaceBullet *p_space) override;
+ virtual void main_shape_changed();
+ virtual void reload_body();
+ virtual void set_space(SpaceBullet *p_space);
- virtual void dispatch_callbacks() override;
+ virtual void dispatch_callbacks();
void call_event(CollisionObjectBullet *p_otherObject, PhysicsServer3D::AreaBodyStatus p_status);
void set_on_state_change(ObjectID p_id, const StringName &p_method, const Variant &p_udata = Variant());
void scratch();
@@ -150,9 +152,9 @@ public:
// Dispatch the callbacks and removes from overlapping list
void remove_overlap(CollisionObjectBullet *p_object, bool p_notify);
- virtual void do_reload_collision_filters() override;
- virtual void on_collision_checker_start() override {}
- virtual void on_collision_checker_end() override { isTransformChanged = false; }
+ virtual void on_collision_filters_change();
+ virtual void on_collision_checker_start() {}
+ virtual void on_collision_checker_end() { isTransformChanged = false; }
void add_overlap(CollisionObjectBullet *p_otherObject);
void put_overlap_as_exit(int p_index);
@@ -164,8 +166,8 @@ public:
void set_event_callback(Type p_callbackObjectType, ObjectID p_id, const StringName &p_method);
bool has_event_callback(Type p_callbackObjectType);
- virtual void on_enter_area(AreaBullet *p_area) override;
- virtual void on_exit_area(AreaBullet *p_area) override;
+ virtual void on_enter_area(AreaBullet *p_area);
+ virtual void on_exit_area(AreaBullet *p_area);
};
#endif
diff --git a/modules/bullet/bullet_physics_server.h b/modules/bullet/bullet_physics_server.h
index eb95120f74..6078babaf8 100644
--- a/modules/bullet/bullet_physics_server.h
+++ b/modules/bullet/bullet_physics_server.h
@@ -52,7 +52,7 @@ class BulletPhysicsServer3D : public PhysicsServer3D {
bool active = true;
char active_spaces_count = 0;
- LocalVector<SpaceBullet *> active_spaces;
+ Vector<SpaceBullet *> active_spaces;
mutable RID_PtrOwner<SpaceBullet> space_owner;
mutable RID_PtrOwner<ShapeBullet> shape_owner;
diff --git a/modules/bullet/bullet_types_converter.cpp b/modules/bullet/bullet_types_converter.cpp
index 7ecad9b78a..09b90fe09e 100644
--- a/modules/bullet/bullet_types_converter.cpp
+++ b/modules/bullet/bullet_types_converter.cpp
@@ -101,9 +101,9 @@ void UNSCALE_BT_BASIS(btTransform &scaledBasis) {
btVector3 column2 = basis.getColumn(2);
// Check for zero scaling.
- if (btFuzzyZero(column0[0])) {
- if (btFuzzyZero(column1[1])) {
- if (btFuzzyZero(column2[2])) {
+ if (column0.fuzzyZero()) {
+ if (column1.fuzzyZero()) {
+ if (column2.fuzzyZero()) {
// All dimensions are fuzzy zero. Create a default basis.
column0 = btVector3(1, 0, 0);
column1 = btVector3(0, 1, 0);
@@ -115,7 +115,7 @@ void UNSCALE_BT_BASIS(btTransform &scaledBasis) {
column0 = column1.cross(column2);
}
} else { // Column 1 scale not fuzzy zero.
- if (btFuzzyZero(column2[2])) {
+ if (column2.fuzzyZero()) {
// Create two vectors othogonal to column 1.
// Ensure that a default basis is created if column 1 = <0, 1, 0>
column0 = btVector3(column1[1], -column1[0], 0);
@@ -126,8 +126,8 @@ void UNSCALE_BT_BASIS(btTransform &scaledBasis) {
}
}
} else { // Column 0 scale not fuzzy zero.
- if (btFuzzyZero(column1[1])) {
- if (btFuzzyZero(column2[2])) {
+ if (column1.fuzzyZero()) {
+ if (column2.fuzzyZero()) {
// Create two vectors orthogonal to column 0.
// Ensure that a default basis is created if column 0 = <1, 0, 0>
column2 = btVector3(-column0[2], 0, column0[0]);
@@ -137,7 +137,7 @@ void UNSCALE_BT_BASIS(btTransform &scaledBasis) {
column1 = column2.cross(column0);
}
} else { // Column 0 and column 1 scales not fuzzy zero.
- if (btFuzzyZero(column2[2])) {
+ if (column2.fuzzyZero()) {
// Create column 2 orthogonal to column 0 and column 1.
column2 = column0.cross(column1);
}
diff --git a/modules/bullet/collision_object_bullet.cpp b/modules/bullet/collision_object_bullet.cpp
index 660e9afc5e..a3158a15e5 100644
--- a/modules/bullet/collision_object_bullet.cpp
+++ b/modules/bullet/collision_object_bullet.cpp
@@ -79,7 +79,7 @@ btTransform CollisionObjectBullet::ShapeWrapper::get_adjusted_transform() const
}
void CollisionObjectBullet::ShapeWrapper::claim_bt_shape(const btVector3 &body_scale) {
- if (bt_shape == nullptr) {
+ if (!bt_shape) {
if (active) {
bt_shape = shape->create_bt_shape(scale * body_scale);
} else {
@@ -88,13 +88,6 @@ void CollisionObjectBullet::ShapeWrapper::claim_bt_shape(const btVector3 &body_s
}
}
-void CollisionObjectBullet::ShapeWrapper::release_bt_shape() {
- if (bt_shape != nullptr) {
- shape->destroy_bt_shape(bt_shape);
- bt_shape = nullptr;
- }
-}
-
CollisionObjectBullet::CollisionObjectBullet(Type p_type) :
RIDBullet(),
type(p_type) {}
@@ -165,22 +158,6 @@ bool CollisionObjectBullet::has_collision_exception(const CollisionObjectBullet
return !bt_collision_object->checkCollideWith(p_otherCollisionObject->bt_collision_object);
}
-void CollisionObjectBullet::reload_body() {
- needs_body_reload = true;
-}
-
-void CollisionObjectBullet::dispatch_callbacks() {}
-
-void CollisionObjectBullet::pre_process() {
- if (needs_body_reload) {
- do_reload_body();
- } else if (needs_collision_filters_reload) {
- do_reload_collision_filters();
- }
- needs_body_reload = false;
- needs_collision_filters_reload = false;
-}
-
void CollisionObjectBullet::set_collision_enabled(bool p_enabled) {
collisionsEnabled = p_enabled;
if (collisionsEnabled) {
@@ -254,7 +231,7 @@ void RigidCollisionObjectBullet::add_shape(ShapeBullet *p_shape, const Transform
}
void RigidCollisionObjectBullet::set_shape(int p_index, ShapeBullet *p_shape) {
- ShapeWrapper &shp = shapes[p_index];
+ ShapeWrapper &shp = shapes.write[p_index];
shp.shape->remove_owner(this);
p_shape->add_owner(this);
shp.shape = p_shape;
@@ -316,7 +293,7 @@ void RigidCollisionObjectBullet::remove_all_shapes(bool p_permanentlyFromThisBod
void RigidCollisionObjectBullet::set_shape_transform(int p_index, const Transform &p_transform) {
ERR_FAIL_INDEX(p_index, get_shape_count());
- shapes[p_index].set_transform(p_transform);
+ shapes.write[p_index].set_transform(p_transform);
shape_changed(p_index);
}
@@ -334,7 +311,7 @@ void RigidCollisionObjectBullet::set_shape_disabled(int p_index, bool p_disabled
if (shapes[p_index].active != p_disabled) {
return;
}
- shapes[p_index].active = !p_disabled;
+ shapes.write[p_index].active = !p_disabled;
shape_changed(p_index);
}
@@ -342,28 +319,16 @@ bool RigidCollisionObjectBullet::is_shape_disabled(int p_index) {
return !shapes[p_index].active;
}
-void RigidCollisionObjectBullet::pre_process() {
- if (need_shape_reload) {
- do_reload_shapes();
- need_shape_reload = false;
- }
- CollisionObjectBullet::pre_process();
-}
-
void RigidCollisionObjectBullet::shape_changed(int p_shape_index) {
- ShapeWrapper &shp = shapes[p_shape_index];
+ ShapeWrapper &shp = shapes.write[p_shape_index];
if (shp.bt_shape == mainShape) {
mainShape = nullptr;
}
- shp.release_bt_shape();
+ bulletdelete(shp.bt_shape);
reload_shapes();
}
void RigidCollisionObjectBullet::reload_shapes() {
- need_shape_reload = true;
-}
-
-void RigidCollisionObjectBullet::do_reload_shapes() {
if (mainShape && mainShape->isCompound()) {
// Destroy compound
bulletdelete(mainShape);
@@ -371,38 +336,41 @@ void RigidCollisionObjectBullet::do_reload_shapes() {
mainShape = nullptr;
+ ShapeWrapper *shpWrapper;
const int shape_count = shapes.size();
- // Reset all shapes if required
+ // Reset shape if required
if (force_shape_reset) {
for (int i(0); i < shape_count; ++i) {
- shapes[i].release_bt_shape();
+ shpWrapper = &shapes.write[i];
+ bulletdelete(shpWrapper->bt_shape);
}
force_shape_reset = false;
}
const btVector3 body_scale(get_bt_body_scale());
+ // Try to optimize by not using compound
if (1 == shape_count) {
- // Is it possible to optimize by not using compound?
- btTransform transform = shapes[0].get_adjusted_transform();
+ shpWrapper = &shapes.write[0];
+ btTransform transform = shpWrapper->get_adjusted_transform();
if (transform.getOrigin().isZero() && transform.getBasis() == transform.getBasis().getIdentity()) {
- shapes[0].claim_bt_shape(body_scale);
- mainShape = shapes[0].bt_shape;
+ shpWrapper->claim_bt_shape(body_scale);
+ mainShape = shpWrapper->bt_shape;
main_shape_changed();
- // Nothing more to do
return;
}
}
- // Optimization not possible use a compound shape.
+ // Optimization not possible use a compound shape
btCompoundShape *compoundShape = bulletnew(btCompoundShape(enableDynamicAabbTree, shape_count));
for (int i(0); i < shape_count; ++i) {
- shapes[i].claim_bt_shape(body_scale);
- btTransform scaled_shape_transform(shapes[i].get_adjusted_transform());
+ shpWrapper = &shapes.write[i];
+ shpWrapper->claim_bt_shape(body_scale);
+ btTransform scaled_shape_transform(shpWrapper->get_adjusted_transform());
scaled_shape_transform.getOrigin() *= body_scale;
- compoundShape->addChildShape(scaled_shape_transform, shapes[i].bt_shape);
+ compoundShape->addChildShape(scaled_shape_transform, shpWrapper->bt_shape);
}
compoundShape->recalculateLocalAabb();
@@ -416,10 +384,10 @@ void RigidCollisionObjectBullet::body_scale_changed() {
}
void RigidCollisionObjectBullet::internal_shape_destroy(int p_index, bool p_permanentlyFromThisBody) {
- ShapeWrapper &shp = shapes[p_index];
+ ShapeWrapper &shp = shapes.write[p_index];
shp.shape->remove_owner(this, p_permanentlyFromThisBody);
if (shp.bt_shape == mainShape) {
mainShape = nullptr;
}
- shp.release_bt_shape();
+ bulletdelete(shp.bt_shape);
}
diff --git a/modules/bullet/collision_object_bullet.h b/modules/bullet/collision_object_bullet.h
index 920d80af23..36b3a9550c 100644
--- a/modules/bullet/collision_object_bullet.h
+++ b/modules/bullet/collision_object_bullet.h
@@ -31,10 +31,9 @@
#ifndef COLLISION_OBJECT_BULLET_H
#define COLLISION_OBJECT_BULLET_H
-#include "core/local_vector.h"
+#include "core/class_db.h"
#include "core/math/transform.h"
#include "core/math/vector3.h"
-#include "core/object.h"
#include "core/vset.h"
#include "shape_owner_bullet.h"
@@ -71,12 +70,11 @@ public:
struct ShapeWrapper {
ShapeBullet *shape = nullptr;
+ btCollisionShape *bt_shape = nullptr;
btTransform transform;
btVector3 scale;
bool active = true;
- btCollisionShape *bt_shape = nullptr;
- public:
ShapeWrapper() {}
ShapeWrapper(ShapeBullet *p_shape, const btTransform &p_transform, bool p_active) :
@@ -109,7 +107,6 @@ public:
btTransform get_adjusted_transform() const;
void claim_bt_shape(const btVector3 &body_scale);
- void release_bt_shape();
};
protected:
@@ -127,20 +124,13 @@ protected:
VSet<RID> exceptions;
- bool needs_body_reload = true;
- bool needs_collision_filters_reload = true;
-
/// This array is used to know all areas where this Object is overlapped in
/// New area is added when overlap with new area (AreaBullet::addOverlap), then is removed when it exit (CollisionObjectBullet::onExitArea)
/// This array is used mainly to know which area hold the pointer of this object
- LocalVector<AreaBullet *> areasOverlapped;
+ Vector<AreaBullet *> areasOverlapped;
bool isTransformChanged = false;
public:
- bool is_in_world = false;
- bool is_in_flush_queue = false;
-
-public:
CollisionObjectBullet(Type p_type);
virtual ~CollisionObjectBullet();
@@ -174,7 +164,7 @@ public:
_FORCE_INLINE_ void set_collision_layer(uint32_t p_layer) {
if (collisionLayer != p_layer) {
collisionLayer = p_layer;
- needs_collision_filters_reload = true;
+ on_collision_filters_change();
}
}
_FORCE_INLINE_ uint32_t get_collision_layer() const { return collisionLayer; }
@@ -182,32 +172,25 @@ public:
_FORCE_INLINE_ void set_collision_mask(uint32_t p_mask) {
if (collisionMask != p_mask) {
collisionMask = p_mask;
- needs_collision_filters_reload = true;
+ on_collision_filters_change();
}
}
_FORCE_INLINE_ uint32_t get_collision_mask() const { return collisionMask; }
- virtual void do_reload_collision_filters() = 0;
+ virtual void on_collision_filters_change() = 0;
_FORCE_INLINE_ bool test_collision_mask(CollisionObjectBullet *p_other) const {
return collisionLayer & p_other->collisionMask || p_other->collisionLayer & collisionMask;
}
- bool need_reload_body() const {
- return needs_body_reload;
- }
-
- void reload_body();
-
- virtual void do_reload_body() = 0;
+ virtual void reload_body() = 0;
virtual void set_space(SpaceBullet *p_space) = 0;
_FORCE_INLINE_ SpaceBullet *get_space() const { return space; }
virtual void on_collision_checker_start() = 0;
virtual void on_collision_checker_end() = 0;
- virtual void dispatch_callbacks();
- virtual void pre_process();
+ virtual void dispatch_callbacks() = 0;
void set_collision_enabled(bool p_enabled);
bool is_collisions_response_enabled();
@@ -231,15 +214,14 @@ public:
class RigidCollisionObjectBullet : public CollisionObjectBullet, public ShapeOwnerBullet {
protected:
btCollisionShape *mainShape = nullptr;
- LocalVector<ShapeWrapper> shapes;
- bool need_shape_reload = true;
+ Vector<ShapeWrapper> shapes;
public:
RigidCollisionObjectBullet(Type p_type) :
CollisionObjectBullet(p_type) {}
~RigidCollisionObjectBullet();
- _FORCE_INLINE_ const LocalVector<ShapeWrapper> &get_shapes_wrappers() const { return shapes; }
+ _FORCE_INLINE_ const Vector<ShapeWrapper> &get_shapes_wrappers() const { return shapes; }
_FORCE_INLINE_ btCollisionShape *get_main_shape() const { return mainShape; }
@@ -250,9 +232,9 @@ public:
ShapeBullet *get_shape(int p_index) const;
btCollisionShape *get_bt_shape(int p_index) const;
- virtual int find_shape(ShapeBullet *p_shape) const override;
+ int find_shape(ShapeBullet *p_shape) const;
- virtual void remove_shape_full(ShapeBullet *p_shape) override;
+ virtual void remove_shape_full(ShapeBullet *p_shape);
void remove_shape_full(int p_index);
void remove_all_shapes(bool p_permanentlyFromThisBody = false, bool p_force_not_reload = false);
@@ -264,15 +246,11 @@ public:
void set_shape_disabled(int p_index, bool p_disabled);
bool is_shape_disabled(int p_index);
- virtual void pre_process() override;
-
- virtual void shape_changed(int p_shape_index) override;
- virtual void reload_shapes() override;
- bool need_reload_shapes() const { return need_shape_reload; }
- virtual void do_reload_shapes();
+ virtual void shape_changed(int p_shape_index);
+ virtual void reload_shapes();
virtual void main_shape_changed() = 0;
- virtual void body_scale_changed() override;
+ virtual void body_scale_changed();
private:
void internal_shape_destroy(int p_index, bool p_permanentlyFromThisBody = false);
diff --git a/modules/bullet/rigid_body_bullet.cpp b/modules/bullet/rigid_body_bullet.cpp
index f517eecf64..eb599df74c 100644
--- a/modules/bullet/rigid_body_bullet.cpp
+++ b/modules/bullet/rigid_body_bullet.cpp
@@ -51,7 +51,9 @@
BulletPhysicsDirectBodyState3D *BulletPhysicsDirectBodyState3D::singleton = nullptr;
Vector3 BulletPhysicsDirectBodyState3D::get_total_gravity() const {
- return body->total_gravity;
+ Vector3 gVec;
+ B_TO_G(body->btBody->getGravity(), gVec);
+ return gVec;
}
float BulletPhysicsDirectBodyState3D::get_total_angular_damp() const {
@@ -181,7 +183,7 @@ int BulletPhysicsDirectBodyState3D::get_contact_collider_shape(int p_contact_idx
}
Vector3 BulletPhysicsDirectBodyState3D::get_contact_collider_velocity_at_position(int p_contact_idx) const {
- RigidBodyBullet::CollisionData &colDat = body->collisions[p_contact_idx];
+ RigidBodyBullet::CollisionData &colDat = body->collisions.write[p_contact_idx];
btVector3 hitLocation;
G_TO_B(colDat.hitLocalLocation, hitLocation);
@@ -211,7 +213,7 @@ void RigidBodyBullet::KinematicUtilities::setSafeMargin(btScalar p_margin) {
}
void RigidBodyBullet::KinematicUtilities::copyAllOwnerShapes() {
- const LocalVector<CollisionObjectBullet::ShapeWrapper> &shapes_wrappers(owner->get_shapes_wrappers());
+ const Vector<CollisionObjectBullet::ShapeWrapper> &shapes_wrappers(owner->get_shapes_wrappers());
const int shapes_count = shapes_wrappers.size();
just_delete_shapes(shapes_count);
@@ -226,8 +228,8 @@ void RigidBodyBullet::KinematicUtilities::copyAllOwnerShapes() {
continue;
}
- shapes[i].transform = shape_wrapper->transform;
- shapes[i].transform.getOrigin() *= owner_scale;
+ shapes.write[i].transform = shape_wrapper->transform;
+ shapes.write[i].transform.getOrigin() *= owner_scale;
switch (shape_wrapper->shape->get_type()) {
case PhysicsServer3D::SHAPE_SPHERE:
case PhysicsServer3D::SHAPE_BOX:
@@ -235,11 +237,11 @@ void RigidBodyBullet::KinematicUtilities::copyAllOwnerShapes() {
case PhysicsServer3D::SHAPE_CYLINDER:
case PhysicsServer3D::SHAPE_CONVEX_POLYGON:
case PhysicsServer3D::SHAPE_RAY: {
- shapes[i].shape = static_cast<btConvexShape *>(shape_wrapper->shape->internal_create_bt_shape(owner_scale * shape_wrapper->scale, safe_margin));
+ shapes.write[i].shape = static_cast<btConvexShape *>(shape_wrapper->shape->create_bt_shape(owner_scale * shape_wrapper->scale, safe_margin));
} break;
default:
WARN_PRINT("This shape is not supported for kinematic collision.");
- shapes[i].shape = nullptr;
+ shapes.write[i].shape = nullptr;
}
}
}
@@ -247,7 +249,7 @@ void RigidBodyBullet::KinematicUtilities::copyAllOwnerShapes() {
void RigidBodyBullet::KinematicUtilities::just_delete_shapes(int new_size) {
for (int i = shapes.size() - 1; 0 <= i; --i) {
if (shapes[i].shape) {
- bulletdelete(shapes[i].shape);
+ bulletdelete(shapes.write[i].shape);
}
}
shapes.resize(new_size);
@@ -262,6 +264,7 @@ RigidBodyBullet::RigidBodyBullet() :
btRigidBody::btRigidBodyConstructionInfo cInfo(mass, godotMotionState, nullptr, localInertia);
btBody = bulletnew(btRigidBody(cInfo));
+ btBody->setFriction(1.0);
reload_shapes();
setupBulletCollisionObject(btBody);
@@ -269,8 +272,8 @@ RigidBodyBullet::RigidBodyBullet() :
reload_axis_lock();
areasWhereIam.resize(maxAreasWhereIam);
- for (uint32_t i = 0; i < areasWhereIam.size(); i += 1) {
- areasWhereIam[i] = nullptr;
+ for (int i = areasWhereIam.size() - 1; 0 <= i; --i) {
+ areasWhereIam.write[i] = nullptr;
}
btBody->setSleepingThresholds(0.2, 0.2);
@@ -305,7 +308,7 @@ void RigidBodyBullet::main_shape_changed() {
set_continuous_collision_detection(is_continuous_collision_detection_enabled()); // Reset
}
-void RigidBodyBullet::do_reload_body() {
+void RigidBodyBullet::reload_body() {
if (space) {
space->remove_rigid_body(this);
if (get_main_shape()) {
@@ -324,24 +327,23 @@ void RigidBodyBullet::set_space(SpaceBullet *p_space) {
assert_no_constraints();
// Remove this object form the physics world
- space->unregister_collision_object(this);
space->remove_rigid_body(this);
}
space = p_space;
if (space) {
- space->register_collision_object(this);
- reload_body();
- space->add_to_flush_queue(this);
+ space->add_rigid_body(this);
}
}
void RigidBodyBullet::dispatch_callbacks() {
- RigidCollisionObjectBullet::dispatch_callbacks();
-
/// The check isFirstTransformChanged is necessary in order to call integrated forces only when the first transform is sent
if ((btBody->isKinematicObject() || btBody->isActive() || previousActiveState != btBody->isActive()) && force_integration_callback && can_integrate_forces) {
+ if (omit_forces_integration) {
+ btBody->clearForces();
+ }
+
BulletPhysicsDirectBodyState3D *bodyDirect = BulletPhysicsDirectBodyState3D::get_singleton(this);
Variant variantBodyDirect = bodyDirect;
@@ -359,22 +361,16 @@ void RigidBodyBullet::dispatch_callbacks() {
}
}
- previousActiveState = btBody->isActive();
-}
-
-void RigidBodyBullet::pre_process() {
- RigidCollisionObjectBullet::pre_process();
-
if (isScratchedSpaceOverrideModificator || 0 < countGravityPointSpaces) {
isScratchedSpaceOverrideModificator = false;
reload_space_override_modificator();
}
- if (is_active()) {
- /// Lock axis
- btBody->setLinearVelocity(btBody->getLinearVelocity() * btBody->getLinearFactor());
- btBody->setAngularVelocity(btBody->getAngularVelocity() * btBody->getAngularFactor());
- }
+ /// Lock axis
+ btBody->setLinearVelocity(btBody->getLinearVelocity() * btBody->getLinearFactor());
+ btBody->setAngularVelocity(btBody->getAngularVelocity() * btBody->getAngularFactor());
+
+ previousActiveState = btBody->isActive();
}
void RigidBodyBullet::set_force_integration_callback(ObjectID p_id, const StringName &p_method, const Variant &p_udata) {
@@ -395,7 +391,7 @@ void RigidBodyBullet::scratch_space_override_modificator() {
isScratchedSpaceOverrideModificator = true;
}
-void RigidBodyBullet::do_reload_collision_filters() {
+void RigidBodyBullet::on_collision_filters_change() {
if (space) {
space->reload_collision_filters(this);
}
@@ -408,15 +404,14 @@ void RigidBodyBullet::on_collision_checker_start() {
collisionsCount = 0;
// Swap array
- SWAP(prev_collision_traces, curr_collision_traces);
+ Vector<RigidBodyBullet *> *s = prev_collision_traces;
+ prev_collision_traces = curr_collision_traces;
+ curr_collision_traces = s;
}
void RigidBodyBullet::on_collision_checker_end() {
// Always true if active and not a static or kinematic body
isTransformChanged = btBody->isActive() && !btBody->isStaticOrKinematicObject();
- if (isTransformChanged && space != nullptr) {
- space->add_to_flush_queue(this);
- }
}
bool RigidBodyBullet::add_collision_object(RigidBodyBullet *p_otherObject, const Vector3 &p_hitWorldLocation, const Vector3 &p_hitLocalLocation, const Vector3 &p_hitNormal, const float &p_appliedImpulse, int p_other_shape_index, int p_local_shape_index) {
@@ -424,7 +419,7 @@ bool RigidBodyBullet::add_collision_object(RigidBodyBullet *p_otherObject, const
return false;
}
- CollisionData &cd = collisions[collisionsCount];
+ CollisionData &cd = collisions.write[collisionsCount];
cd.hitLocalLocation = p_hitLocalLocation;
cd.otherObject = p_otherObject;
cd.hitWorldLocation = p_hitWorldLocation;
@@ -433,7 +428,7 @@ bool RigidBodyBullet::add_collision_object(RigidBodyBullet *p_otherObject, const
cd.other_object_shape = p_other_shape_index;
cd.local_shape = p_local_shape_index;
- (*curr_collision_traces)[collisionsCount] = p_otherObject;
+ curr_collision_traces->write[collisionsCount] = p_otherObject;
++collisionsCount;
return true;
@@ -468,7 +463,6 @@ bool RigidBodyBullet::is_active() const {
void RigidBodyBullet::set_omit_forces_integration(bool p_omit) {
omit_forces_integration = p_omit;
- scratch_space_override_modificator();
}
void RigidBodyBullet::set_param(PhysicsServer3D::BodyParameter p_param, real_t p_value) {
@@ -811,8 +805,8 @@ const btTransform &RigidBodyBullet::get_transform__bullet() const {
}
}
-void RigidBodyBullet::do_reload_shapes() {
- RigidCollisionObjectBullet::do_reload_shapes();
+void RigidBodyBullet::reload_shapes() {
+ RigidCollisionObjectBullet::reload_shapes();
const btScalar invMass = btBody->getInvMass();
const btScalar mass = invMass == 0 ? 0 : 1 / invMass;
@@ -844,15 +838,15 @@ void RigidBodyBullet::on_enter_area(AreaBullet *p_area) {
for (int i = 0; i < areaWhereIamCount; ++i) {
if (nullptr == areasWhereIam[i]) {
// This area has the highest priority
- areasWhereIam[i] = p_area;
+ areasWhereIam.write[i] = p_area;
break;
} else {
if (areasWhereIam[i]->get_spOv_priority() > p_area->get_spOv_priority()) {
// The position was found, just shift all elements
for (int j = areaWhereIamCount; j > i; j--) {
- areasWhereIam[j] = areasWhereIam[j - 1];
+ areasWhereIam.write[j] = areasWhereIam[j - 1];
}
- areasWhereIam[i] = p_area;
+ areasWhereIam.write[i] = p_area;
break;
}
}
@@ -876,7 +870,7 @@ void RigidBodyBullet::on_exit_area(AreaBullet *p_area) {
if (p_area == areasWhereIam[i]) {
// The area was found, just shift down all elements
for (int j = i; j < areaWhereIamCount; ++j) {
- areasWhereIam[j] = areasWhereIam[j + 1];
+ areasWhereIam.write[j] = areasWhereIam[j + 1];
}
wasTheAreaFound = true;
break;
@@ -889,7 +883,7 @@ void RigidBodyBullet::on_exit_area(AreaBullet *p_area) {
}
--areaWhereIamCount;
- areasWhereIam[areaWhereIamCount] = nullptr; // Even if this is not required, I clear the last element to be safe
+ areasWhereIam.write[areaWhereIamCount] = nullptr; // Even if this is not required, I clear the last element to be safe
if (PhysicsServer3D::AREA_SPACE_OVERRIDE_DISABLED != p_area->get_spOv_mode()) {
scratch_space_override_modificator();
}
@@ -901,31 +895,36 @@ void RigidBodyBullet::reload_space_override_modificator() {
return;
}
- Vector3 newGravity;
+ Vector3 newGravity(0.0, 0.0, 0.0);
real_t newLinearDamp = MAX(0.0, linearDamp);
real_t newAngularDamp = MAX(0.0, angularDamp);
+ AreaBullet *currentArea;
+ // Variable used to calculate new gravity for gravity point areas, it is pointed by currentGravity pointer
+ Vector3 support_gravity(0, 0, 0);
+
bool stopped = false;
- for (int i = 0; i < areaWhereIamCount && !stopped; i += 1) {
- AreaBullet *currentArea = areasWhereIam[i];
+ for (int i = areaWhereIamCount - 1; (0 <= i) && !stopped; --i) {
+ currentArea = areasWhereIam[i];
if (!currentArea || PhysicsServer3D::AREA_SPACE_OVERRIDE_DISABLED == currentArea->get_spOv_mode()) {
continue;
}
- Vector3 support_gravity;
-
/// Here is calculated the gravity
if (currentArea->is_spOv_gravityPoint()) {
/// It calculates the direction of new gravity
support_gravity = currentArea->get_transform().xform(currentArea->get_spOv_gravityVec()) - get_transform().get_origin();
-
- const real_t distanceMag = support_gravity.length();
+ real_t distanceMag = support_gravity.length();
// Normalized in this way to avoid the double call of function "length()"
if (distanceMag == 0) {
- support_gravity = Vector3();
+ support_gravity.x = 0;
+ support_gravity.y = 0;
+ support_gravity.z = 0;
} else {
- support_gravity /= distanceMag;
+ support_gravity.x /= distanceMag;
+ support_gravity.y /= distanceMag;
+ support_gravity.z /= distanceMag;
}
/// Here is calculated the final gravity
@@ -987,17 +986,10 @@ void RigidBodyBullet::reload_space_override_modificator() {
newAngularDamp += space->get_angular_damp();
}
- total_gravity = newGravity;
-
- if (omit_forces_integration) {
- // Custom behaviour.
- btBody->setGravity(btVector3(0, 0, 0));
- } else {
- btVector3 newBtGravity;
- G_TO_B(newGravity * gravity_scale, newBtGravity);
- btBody->setGravity(newBtGravity);
- }
+ btVector3 newBtGravity;
+ G_TO_B(newGravity * gravity_scale, newBtGravity);
+ btBody->setGravity(newBtGravity);
btBody->setDamping(newLinearDamp, newAngularDamp);
}
diff --git a/modules/bullet/rigid_body_bullet.h b/modules/bullet/rigid_body_bullet.h
index 047645677b..c643611397 100644
--- a/modules/bullet/rigid_body_bullet.h
+++ b/modules/bullet/rigid_body_bullet.h
@@ -171,7 +171,7 @@ public:
struct KinematicUtilities {
RigidBodyBullet *owner;
btScalar safe_margin;
- LocalVector<KinematicShape> shapes;
+ Vector<KinematicShape> shapes;
KinematicUtilities(RigidBodyBullet *p_owner);
~KinematicUtilities();
@@ -193,7 +193,6 @@ private:
PhysicsServer3D::BodyMode mode;
GodotMotionState *godotMotionState;
btRigidBody *btBody;
- Vector3 total_gravity;
uint16_t locked_axis = 0;
real_t mass = 1;
real_t gravity_scale = 1;
@@ -203,18 +202,18 @@ private:
bool omit_forces_integration = false;
bool can_integrate_forces = false;
- LocalVector<CollisionData> collisions;
- LocalVector<RigidBodyBullet *> collision_traces_1;
- LocalVector<RigidBodyBullet *> collision_traces_2;
- LocalVector<RigidBodyBullet *> *prev_collision_traces;
- LocalVector<RigidBodyBullet *> *curr_collision_traces;
+ Vector<CollisionData> collisions;
+ Vector<RigidBodyBullet *> collision_traces_1;
+ Vector<RigidBodyBullet *> collision_traces_2;
+ Vector<RigidBodyBullet *> *prev_collision_traces;
+ Vector<RigidBodyBullet *> *curr_collision_traces;
// these parameters are used to avoid vector resize
- uint32_t maxCollisionsDetection = 0;
- uint32_t collisionsCount = 0;
- uint32_t prev_collision_count = 0;
+ int maxCollisionsDetection = 0;
+ int collisionsCount = 0;
+ int prev_collision_count = 0;
- LocalVector<AreaBullet *> areasWhereIam;
+ Vector<AreaBullet *> areasWhereIam;
// these parameters are used to avoid vector resize
int maxAreasWhereIam = 10;
int areaWhereIamCount = 0;
@@ -236,20 +235,21 @@ public:
_FORCE_INLINE_ btRigidBody *get_bt_rigid_body() { return btBody; }
- virtual void main_shape_changed() override;
- virtual void do_reload_body() override;
- virtual void set_space(SpaceBullet *p_space) override;
+ virtual void main_shape_changed();
+ virtual void reload_body();
+ virtual void set_space(SpaceBullet *p_space);
- virtual void dispatch_callbacks() override;
- virtual void pre_process() override;
+ virtual void dispatch_callbacks();
void set_force_integration_callback(ObjectID p_id, const StringName &p_method, const Variant &p_udata = Variant());
void scratch_space_override_modificator();
- virtual void do_reload_collision_filters() override;
- virtual void on_collision_checker_start() override;
- virtual void on_collision_checker_end() override;
+ virtual void on_collision_filters_change();
+ virtual void on_collision_checker_start();
+ virtual void on_collision_checker_end();
+
+ void set_max_collisions_detection(int p_maxCollisionsDetection) {
+ ERR_FAIL_COND(0 > p_maxCollisionsDetection);
- void set_max_collisions_detection(uint32_t p_maxCollisionsDetection) {
maxCollisionsDetection = p_maxCollisionsDetection;
collisions.resize(p_maxCollisionsDetection);
@@ -312,19 +312,19 @@ public:
void set_angular_velocity(const Vector3 &p_velocity);
Vector3 get_angular_velocity() const;
- virtual void set_transform__bullet(const btTransform &p_global_transform) override;
- virtual const btTransform &get_transform__bullet() const override;
+ virtual void set_transform__bullet(const btTransform &p_global_transform);
+ virtual const btTransform &get_transform__bullet() const;
- virtual void do_reload_shapes() override;
+ virtual void reload_shapes();
- virtual void on_enter_area(AreaBullet *p_area) override;
- virtual void on_exit_area(AreaBullet *p_area) override;
+ virtual void on_enter_area(AreaBullet *p_area);
+ virtual void on_exit_area(AreaBullet *p_area);
void reload_space_override_modificator();
/// Kinematic
void reload_kinematic_shapes();
- virtual void notify_transform_changed() override;
+ virtual void notify_transform_changed();
private:
void _internal_set_mass(real_t p_mass);
diff --git a/modules/bullet/shape_bullet.cpp b/modules/bullet/shape_bullet.cpp
index 74d6e073b3..fdc2944dad 100644
--- a/modules/bullet/shape_bullet.cpp
+++ b/modules/bullet/shape_bullet.cpp
@@ -46,15 +46,9 @@
@author AndreaCatania
*/
-ShapeBullet::ShapeBullet() {
-}
+ShapeBullet::ShapeBullet() {}
-ShapeBullet::~ShapeBullet() {
- if (default_shape != nullptr) {
- bulletdelete(default_shape);
- default_shape = nullptr;
- }
-}
+ShapeBullet::~ShapeBullet() {}
btCollisionShape *ShapeBullet::create_bt_shape(const Vector3 &p_implicit_scale, real_t p_extra_edge) {
btVector3 s;
@@ -62,22 +56,6 @@ btCollisionShape *ShapeBullet::create_bt_shape(const Vector3 &p_implicit_scale,
return create_bt_shape(s, p_extra_edge);
}
-btCollisionShape *ShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
- if (p_extra_edge == 0.0 && (p_implicit_scale - btVector3(1, 1, 1)).length2() <= CMP_EPSILON) {
- return default_shape;
- }
-
- return internal_create_bt_shape(p_implicit_scale, p_extra_edge);
-}
-
-void ShapeBullet::destroy_bt_shape(btCollisionShape *p_shape) const {
- if (p_shape != default_shape && p_shape != old_default_shape) {
- if (likely(p_shape != nullptr)) {
- bulletdelete(p_shape);
- }
- }
-}
-
btCollisionShape *ShapeBullet::prepare(btCollisionShape *p_btShape) const {
p_btShape->setUserPointer(const_cast<ShapeBullet *>(this));
p_btShape->setMargin(margin);
@@ -85,21 +63,10 @@ btCollisionShape *ShapeBullet::prepare(btCollisionShape *p_btShape) const {
}
void ShapeBullet::notifyShapeChanged() {
- // Store the old shape ptr so to not lose the reference pointer.
- old_default_shape = default_shape;
- // Create the new default shape with the new data.
- default_shape = internal_create_bt_shape(btVector3(1, 1, 1));
-
for (Map<ShapeOwnerBullet *, int>::Element *E = owners.front(); E; E = E->next()) {
ShapeOwnerBullet *owner = static_cast<ShapeOwnerBullet *>(E->key());
owner->shape_changed(owner->find_shape(this));
}
-
- if (old_default_shape) {
- // At this point now one has the old default shape; just delete it.
- bulletdelete(old_default_shape);
- old_default_shape = nullptr;
- }
}
void ShapeBullet::add_owner(ShapeOwnerBullet *p_owner) {
@@ -219,7 +186,7 @@ void PlaneShapeBullet::setup(const Plane &p_plane) {
notifyShapeChanged();
}
-btCollisionShape *PlaneShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *PlaneShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
btVector3 btPlaneNormal;
G_TO_B(plane.normal, btPlaneNormal);
return prepare(PlaneShapeBullet::create_shape_plane(btPlaneNormal, plane.d));
@@ -247,7 +214,7 @@ void SphereShapeBullet::setup(real_t p_radius) {
notifyShapeChanged();
}
-btCollisionShape *SphereShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *SphereShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
return prepare(ShapeBullet::create_shape_sphere(radius * p_implicit_scale[0] + p_extra_edge));
}
@@ -274,7 +241,7 @@ void BoxShapeBullet::setup(const Vector3 &p_half_extents) {
notifyShapeChanged();
}
-btCollisionShape *BoxShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *BoxShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
return prepare(ShapeBullet::create_shape_box((half_extents * p_implicit_scale) + btVector3(p_extra_edge, p_extra_edge, p_extra_edge)));
}
@@ -307,7 +274,7 @@ void CapsuleShapeBullet::setup(real_t p_height, real_t p_radius) {
notifyShapeChanged();
}
-btCollisionShape *CapsuleShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *CapsuleShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
return prepare(ShapeBullet::create_shape_capsule(radius * p_implicit_scale[0] + p_extra_edge, height * p_implicit_scale[1]));
}
@@ -340,7 +307,7 @@ void CylinderShapeBullet::setup(real_t p_height, real_t p_radius) {
notifyShapeChanged();
}
-btCollisionShape *CylinderShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_margin) {
+btCollisionShape *CylinderShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_margin) {
return prepare(ShapeBullet::create_shape_cylinder(radius * p_implicit_scale[0] + p_margin, height * p_implicit_scale[1] + p_margin));
}
@@ -382,7 +349,7 @@ void ConvexPolygonShapeBullet::setup(const Vector<Vector3> &p_vertices) {
notifyShapeChanged();
}
-btCollisionShape *ConvexPolygonShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *ConvexPolygonShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
if (!vertices.size()) {
// This is necessary since 0 vertices
return prepare(ShapeBullet::create_shape_empty());
@@ -464,7 +431,7 @@ void ConcavePolygonShapeBullet::setup(Vector<Vector3> p_faces) {
notifyShapeChanged();
}
-btCollisionShape *ConcavePolygonShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *ConcavePolygonShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
btCollisionShape *cs = ShapeBullet::create_shape_concave(meshShape);
if (!cs) {
// This is necessary since if 0 faces the creation of concave return null
@@ -591,7 +558,7 @@ void HeightMapShapeBullet::setup(Vector<real_t> &p_heights, int p_width, int p_d
notifyShapeChanged();
}
-btCollisionShape *HeightMapShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *HeightMapShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
btCollisionShape *cs(ShapeBullet::create_shape_height_field(heights, width, depth, min_height, max_height));
cs->setLocalScaling(p_implicit_scale);
prepare(cs);
@@ -624,6 +591,6 @@ void RayShapeBullet::setup(real_t p_length, bool p_slips_on_slope) {
notifyShapeChanged();
}
-btCollisionShape *RayShapeBullet::internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
+btCollisionShape *RayShapeBullet::create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge) {
return prepare(ShapeBullet::create_shape_ray(length * p_implicit_scale[1] + p_extra_edge, slips_on_slope));
}
diff --git a/modules/bullet/shape_bullet.h b/modules/bullet/shape_bullet.h
index 6ca4d36a23..a35a1d8a18 100644
--- a/modules/bullet/shape_bullet.h
+++ b/modules/bullet/shape_bullet.h
@@ -53,10 +53,6 @@ class ShapeBullet : public RIDBullet {
Map<ShapeOwnerBullet *, int> owners;
real_t margin = 0.04;
- // Contains the default shape.
- btCollisionShape *default_shape = nullptr;
- btCollisionShape *old_default_shape = nullptr;
-
protected:
/// return self
btCollisionShape *prepare(btCollisionShape *p_btShape) const;
@@ -67,11 +63,7 @@ public:
virtual ~ShapeBullet();
btCollisionShape *create_bt_shape(const Vector3 &p_implicit_scale, real_t p_extra_edge = 0);
- btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
-
- void destroy_bt_shape(btCollisionShape *p_shape) const;
-
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0) = 0;
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0) = 0;
void add_owner(ShapeOwnerBullet *p_owner);
void remove_owner(ShapeOwnerBullet *p_owner, bool p_permanentlyFromThisBody = false);
@@ -110,7 +102,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(const Plane &p_plane);
@@ -126,7 +118,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(real_t p_radius);
@@ -142,7 +134,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(const Vector3 &p_half_extents);
@@ -160,7 +152,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(real_t p_height, real_t p_radius);
@@ -178,7 +170,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_margin = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_margin = 0);
private:
void setup(real_t p_height, real_t p_radius);
@@ -194,7 +186,7 @@ public:
void get_vertices(Vector<Vector3> &out_vertices);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(const Vector<Vector3> &p_vertices);
@@ -212,7 +204,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(Vector<Vector3> p_faces);
@@ -231,7 +223,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(Vector<real_t> &p_heights, int p_width, int p_depth, real_t p_min_height, real_t p_max_height);
@@ -247,7 +239,7 @@ public:
virtual void set_data(const Variant &p_data);
virtual Variant get_data() const;
virtual PhysicsServer3D::ShapeType get_type() const;
- virtual btCollisionShape *internal_create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
+ virtual btCollisionShape *create_bt_shape(const btVector3 &p_implicit_scale, real_t p_extra_edge = 0);
private:
void setup(real_t p_length, bool p_slips_on_slope);
diff --git a/modules/bullet/soft_body_bullet.cpp b/modules/bullet/soft_body_bullet.cpp
index ee48b3c5f0..6794d6c313 100644
--- a/modules/bullet/soft_body_bullet.cpp
+++ b/modules/bullet/soft_body_bullet.cpp
@@ -41,7 +41,7 @@ SoftBodyBullet::SoftBodyBullet() :
SoftBodyBullet::~SoftBodyBullet() {
}
-void SoftBodyBullet::do_reload_body() {
+void SoftBodyBullet::reload_body() {
if (space) {
space->remove_soft_body(this);
space->add_soft_body(this);
@@ -51,15 +51,13 @@ void SoftBodyBullet::do_reload_body() {
void SoftBodyBullet::set_space(SpaceBullet *p_space) {
if (space) {
isScratched = false;
- space->unregister_collision_object(this);
space->remove_soft_body(this);
}
space = p_space;
if (space) {
- space->register_collision_object(this);
- reload_body();
+ space->add_soft_body(this);
}
}
@@ -346,14 +344,14 @@ void SoftBodyBullet::set_trimesh_body_shape(Vector<int> p_indices, Vector<Vector
indices_table.push_back(Vector<int>());
}
- indices_table[vertex_id].push_back(vs_vertex_index);
+ indices_table.write[vertex_id].push_back(vs_vertex_index);
vs_indices_to_physics_table.push_back(vertex_id);
}
}
const int indices_map_size(indices_table.size());
- LocalVector<btScalar> bt_vertices;
+ Vector<btScalar> bt_vertices;
{ // Parse vertices to bullet
@@ -361,13 +359,13 @@ void SoftBodyBullet::set_trimesh_body_shape(Vector<int> p_indices, Vector<Vector
const Vector3 *p_vertices_read = p_vertices.ptr();
for (int i = 0; i < indices_map_size; ++i) {
- bt_vertices[3 * i + 0] = p_vertices_read[indices_table[i][0]].x;
- bt_vertices[3 * i + 1] = p_vertices_read[indices_table[i][0]].y;
- bt_vertices[3 * i + 2] = p_vertices_read[indices_table[i][0]].z;
+ bt_vertices.write[3 * i + 0] = p_vertices_read[indices_table[i][0]].x;
+ bt_vertices.write[3 * i + 1] = p_vertices_read[indices_table[i][0]].y;
+ bt_vertices.write[3 * i + 2] = p_vertices_read[indices_table[i][0]].z;
}
}
- LocalVector<int> bt_triangles;
+ Vector<int> bt_triangles;
const int triangles_size(p_indices.size() / 3);
{ // Parse indices
@@ -377,9 +375,9 @@ void SoftBodyBullet::set_trimesh_body_shape(Vector<int> p_indices, Vector<Vector
const int *p_indices_read = p_indices.ptr();
for (int i = 0; i < triangles_size; ++i) {
- bt_triangles[3 * i + 0] = vs_indices_to_physics_table[p_indices_read[3 * i + 2]];
- bt_triangles[3 * i + 1] = vs_indices_to_physics_table[p_indices_read[3 * i + 1]];
- bt_triangles[3 * i + 2] = vs_indices_to_physics_table[p_indices_read[3 * i + 0]];
+ bt_triangles.write[3 * i + 0] = vs_indices_to_physics_table[p_indices_read[3 * i + 2]];
+ bt_triangles.write[3 * i + 1] = vs_indices_to_physics_table[p_indices_read[3 * i + 1]];
+ bt_triangles.write[3 * i + 2] = vs_indices_to_physics_table[p_indices_read[3 * i + 0]];
}
}
diff --git a/modules/bullet/soft_body_bullet.h b/modules/bullet/soft_body_bullet.h
index 229204b539..da8a2412ed 100644
--- a/modules/bullet/soft_body_bullet.h
+++ b/modules/bullet/soft_body_bullet.h
@@ -32,6 +32,7 @@
#define SOFT_BODY_BULLET_H
#include "collision_object_bullet.h"
+#include "scene/resources/material.h" // TODO remove this please
#ifdef None
/// This is required to remove the macro None defined by x11 compiler because this word "None" is used internally by Bullet
@@ -57,7 +58,7 @@
class SoftBodyBullet : public CollisionObjectBullet {
private:
btSoftBody *bt_soft_body = nullptr;
- LocalVector<Vector<int>> indices_table;
+ Vector<Vector<int>> indices_table;
btSoftBody::Material *mat0; // This is just a copy of pointer managed by btSoftBody
bool isScratched = false;
@@ -72,7 +73,7 @@ private:
real_t pose_matching_coefficient = 0.; // [0,1]
real_t damping_coefficient = 0.01; // [0,1]
real_t drag_coefficient = 0.; // [0,1]
- LocalVector<int> pinned_nodes;
+ Vector<int> pinned_nodes;
// Other property to add
//btScalar kVC; // Volume conversation coefficient [0,+inf]
@@ -86,14 +87,15 @@ public:
SoftBodyBullet();
~SoftBodyBullet();
- virtual void do_reload_body() override;
- virtual void set_space(SpaceBullet *p_space) override;
+ virtual void reload_body();
+ virtual void set_space(SpaceBullet *p_space);
- virtual void do_reload_collision_filters() override {}
- virtual void on_collision_checker_start() override {}
- virtual void on_collision_checker_end() override {}
- virtual void on_enter_area(AreaBullet *p_area) override;
- virtual void on_exit_area(AreaBullet *p_area) override;
+ virtual void dispatch_callbacks() {}
+ virtual void on_collision_filters_change() {}
+ virtual void on_collision_checker_start() {}
+ virtual void on_collision_checker_end() {}
+ virtual void on_enter_area(AreaBullet *p_area);
+ virtual void on_exit_area(AreaBullet *p_area);
_FORCE_INLINE_ btSoftBody *get_bt_soft_body() const { return bt_soft_body; }
diff --git a/modules/bullet/space_bullet.cpp b/modules/bullet/space_bullet.cpp
index d0515e7c97..c581d1804e 100644
--- a/modules/bullet/space_bullet.cpp
+++ b/modules/bullet/space_bullet.cpp
@@ -127,7 +127,7 @@ int BulletPhysicsDirectSpaceState::intersect_shape(const RID &p_shape, const Tra
btCollisionShape *btShape = shape->create_bt_shape(p_xform.basis.get_scale_abs(), p_margin);
if (!btShape->isConvex()) {
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btShape);
ERR_PRINT("The shape is not a convex shape, then is not supported: shape type: " + itos(shape->get_type()));
return 0;
}
@@ -147,7 +147,7 @@ int BulletPhysicsDirectSpaceState::intersect_shape(const RID &p_shape, const Tra
btQuery.m_closestDistanceThreshold = 0;
space->dynamicsWorld->contactTest(&collision_object, btQuery);
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btConvex);
return btQuery.m_count;
}
@@ -163,7 +163,7 @@ bool BulletPhysicsDirectSpaceState::cast_motion(const RID &p_shape, const Transf
btCollisionShape *btShape = shape->create_bt_shape(p_xform.basis.get_scale(), p_margin);
if (!btShape->isConvex()) {
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btShape);
ERR_PRINT("The shape is not a convex shape, then is not supported: shape type: " + itos(shape->get_type()));
return false;
}
@@ -177,7 +177,7 @@ bool BulletPhysicsDirectSpaceState::cast_motion(const RID &p_shape, const Transf
bt_xform_to.getOrigin() += bt_motion;
if ((bt_xform_to.getOrigin() - bt_xform_from.getOrigin()).fuzzyZero()) {
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btShape);
return false;
}
@@ -207,7 +207,7 @@ bool BulletPhysicsDirectSpaceState::cast_motion(const RID &p_shape, const Transf
r_closest_unsafe = 1.0f;
}
- shape->destroy_bt_shape(btShape);
+ bulletdelete(bt_convex_shape);
return true; // Mean success
}
@@ -222,7 +222,7 @@ bool BulletPhysicsDirectSpaceState::collide_shape(RID p_shape, const Transform &
btCollisionShape *btShape = shape->create_bt_shape(p_shape_xform.basis.get_scale_abs(), p_margin);
if (!btShape->isConvex()) {
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btShape);
ERR_PRINT("The shape is not a convex shape, then is not supported: shape type: " + itos(shape->get_type()));
return false;
}
@@ -243,7 +243,7 @@ bool BulletPhysicsDirectSpaceState::collide_shape(RID p_shape, const Transform &
space->dynamicsWorld->contactTest(&collision_object, btQuery);
r_result_count = btQuery.m_count;
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btConvex);
return btQuery.m_count;
}
@@ -254,7 +254,7 @@ bool BulletPhysicsDirectSpaceState::rest_info(RID p_shape, const Transform &p_sh
btCollisionShape *btShape = shape->create_bt_shape(p_shape_xform.basis.get_scale_abs(), p_margin);
if (!btShape->isConvex()) {
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btShape);
ERR_PRINT("The shape is not a convex shape, then is not supported: shape type: " + itos(shape->get_type()));
return false;
}
@@ -274,7 +274,7 @@ bool BulletPhysicsDirectSpaceState::rest_info(RID p_shape, const Transform &p_sh
btQuery.m_closestDistanceThreshold = 0;
space->dynamicsWorld->contactTest(&collision_object, btQuery);
- shape->destroy_bt_shape(btShape);
+ bulletdelete(btConvex);
if (btQuery.m_collided) {
if (btCollisionObject::CO_RIGID_BODY == btQuery.m_rest_info_collision_object->getInternalType()) {
@@ -349,46 +349,14 @@ SpaceBullet::~SpaceBullet() {
destroy_world();
}
-void SpaceBullet::add_to_pre_flush_queue(CollisionObjectBullet *p_co) {
- if (p_co->is_in_flush_queue == false) {
- p_co->is_in_flush_queue = true;
- queue_pre_flush.push_back(p_co);
- }
-}
-
-void SpaceBullet::add_to_flush_queue(CollisionObjectBullet *p_co) {
- if (p_co->is_in_flush_queue == false) {
- p_co->is_in_flush_queue = true;
- queue_flush.push_back(p_co);
- }
-}
-
-void SpaceBullet::remove_from_any_queue(CollisionObjectBullet *p_co) {
- if (p_co->is_in_flush_queue) {
- p_co->is_in_flush_queue = false;
- queue_pre_flush.erase(p_co);
- queue_flush.erase(p_co);
- }
-}
-
void SpaceBullet::flush_queries() {
- for (uint32_t i = 0; i < queue_pre_flush.size(); i += 1) {
- queue_pre_flush[i]->dispatch_callbacks();
- queue_pre_flush[i]->is_in_flush_queue = false;
- }
- for (uint32_t i = 0; i < queue_flush.size(); i += 1) {
- queue_flush[i]->dispatch_callbacks();
- queue_flush[i]->is_in_flush_queue = false;
+ const btCollisionObjectArray &colObjArray = dynamicsWorld->getCollisionObjectArray();
+ for (int i = colObjArray.size() - 1; 0 <= i; --i) {
+ static_cast<CollisionObjectBullet *>(colObjArray[i]->getUserPointer())->dispatch_callbacks();
}
- queue_pre_flush.clear();
- queue_flush.clear();
}
void SpaceBullet::step(real_t p_delta_time) {
- for (uint32_t i = 0; i < collision_objects.size(); i += 1) {
- collision_objects[i]->pre_process();
- }
-
delta_time = p_delta_time;
dynamicsWorld->stepSimulation(p_delta_time, 0, 0);
}
@@ -481,30 +449,16 @@ real_t SpaceBullet::get_param(PhysicsServer3D::SpaceParameter p_param) {
}
void SpaceBullet::add_area(AreaBullet *p_area) {
-#ifdef TOOLS_ENABLED
- // This never happen, and there is no way for the user to trigger it.
- // If in future a bug is introduced into this bullet integration and this
- // function is called twice, the crash will notify the developer that will
- // fix it even before do the eventual PR.
- CRASH_COND(p_area->is_in_world);
-#endif
areas.push_back(p_area);
dynamicsWorld->addCollisionObject(p_area->get_bt_ghost(), p_area->get_collision_layer(), p_area->get_collision_mask());
- p_area->is_in_world = true;
}
void SpaceBullet::remove_area(AreaBullet *p_area) {
- if (p_area->is_in_world) {
- areas.erase(p_area);
- dynamicsWorld->removeCollisionObject(p_area->get_bt_ghost());
- p_area->is_in_world = false;
- }
+ areas.erase(p_area);
+ dynamicsWorld->removeCollisionObject(p_area->get_bt_ghost());
}
void SpaceBullet::reload_collision_filters(AreaBullet *p_area) {
- if (p_area->is_in_world == false) {
- return;
- }
btGhostObject *ghost_object = p_area->get_bt_ghost();
btBroadphaseProxy *ghost_proxy = ghost_object->getBroadphaseHandle();
@@ -514,47 +468,24 @@ void SpaceBullet::reload_collision_filters(AreaBullet *p_area) {
dynamicsWorld->refreshBroadphaseProxy(ghost_object);
}
-void SpaceBullet::register_collision_object(CollisionObjectBullet *p_object) {
- collision_objects.push_back(p_object);
-}
-
-void SpaceBullet::unregister_collision_object(CollisionObjectBullet *p_object) {
- remove_from_any_queue(p_object);
- collision_objects.erase(p_object);
-}
-
void SpaceBullet::add_rigid_body(RigidBodyBullet *p_body) {
-#ifdef TOOLS_ENABLED
- // This never happen, and there is no way for the user to trigger it.
- // If in future a bug is introduced into this bullet integration and this
- // function is called twice, the crash will notify the developer that will
- // fix it even before do the eventual PR.
- CRASH_COND(p_body->is_in_world);
-#endif
if (p_body->is_static()) {
dynamicsWorld->addCollisionObject(p_body->get_bt_rigid_body(), p_body->get_collision_layer(), p_body->get_collision_mask());
} else {
dynamicsWorld->addRigidBody(p_body->get_bt_rigid_body(), p_body->get_collision_layer(), p_body->get_collision_mask());
p_body->scratch_space_override_modificator();
}
- p_body->is_in_world = true;
}
void SpaceBullet::remove_rigid_body(RigidBodyBullet *p_body) {
- if (p_body->is_in_world) {
- if (p_body->is_static()) {
- dynamicsWorld->removeCollisionObject(p_body->get_bt_rigid_body());
- } else {
- dynamicsWorld->removeRigidBody(p_body->get_bt_rigid_body());
- }
- p_body->is_in_world = false;
+ if (p_body->is_static()) {
+ dynamicsWorld->removeCollisionObject(p_body->get_bt_rigid_body());
+ } else {
+ dynamicsWorld->removeRigidBody(p_body->get_bt_rigid_body());
}
}
void SpaceBullet::reload_collision_filters(RigidBodyBullet *p_body) {
- if (p_body->is_in_world == false) {
- return;
- }
btRigidBody *rigid_body = p_body->get_bt_rigid_body();
btBroadphaseProxy *body_proxy = rigid_body->getBroadphaseProxy();
@@ -734,7 +665,7 @@ void SpaceBullet::check_ghost_overlaps() {
/// 1. Reset all states
for (i = area->overlappingObjects.size() - 1; 0 <= i; --i) {
- AreaBullet::OverlappingObjectData &otherObj = area->overlappingObjects[i];
+ AreaBullet::OverlappingObjectData &otherObj = area->overlappingObjects.write[i];
// This check prevent the overwrite of ENTER state
// if this function is called more times before dispatchCallbacks
if (otherObj.state != AreaBullet::OVERLAP_STATE_ENTER) {
@@ -959,8 +890,8 @@ bool SpaceBullet::test_body_motion(RigidBodyBullet *p_body, const Transform &p_f
SceneTree::get_singleton()->get_current_scene()->add_child(motionVec);
SceneTree::get_singleton()->get_current_scene()->add_child(normalLine);
- motionVec->set_as_toplevel(true);
- normalLine->set_as_toplevel(true);
+ motionVec->set_as_top_level(true);
+ normalLine->set_as_top_level(true);
red_mat = Ref<StandardMaterial3D>(memnew(StandardMaterial3D));
red_mat->set_shading_mode(StandardMaterial3D::SHADING_MODE_UNSHADED);
diff --git a/modules/bullet/space_bullet.h b/modules/bullet/space_bullet.h
index 897f902fe1..de281064af 100644
--- a/modules/bullet/space_bullet.h
+++ b/modules/bullet/space_bullet.h
@@ -31,8 +31,8 @@
#ifndef SPACE_BULLET_H
#define SPACE_BULLET_H
-#include "core/local_vector.h"
#include "core/variant.h"
+#include "core/vector.h"
#include "godot_result_callbacks.h"
#include "rid_bullet.h"
#include "servers/physics_server_3d.h"
@@ -110,23 +110,16 @@ class SpaceBullet : public RIDBullet {
real_t linear_damp = 0.0;
real_t angular_damp = 0.0;
- LocalVector<CollisionObjectBullet *> queue_pre_flush;
- LocalVector<CollisionObjectBullet *> queue_flush;
- LocalVector<CollisionObjectBullet *> collision_objects;
- LocalVector<AreaBullet *> areas;
+ Vector<AreaBullet *> areas;
- LocalVector<Vector3> contactDebug;
- uint32_t contactDebugCount = 0;
+ Vector<Vector3> contactDebug;
+ int contactDebugCount = 0;
real_t delta_time = 0.;
public:
SpaceBullet();
virtual ~SpaceBullet();
- void add_to_flush_queue(CollisionObjectBullet *p_co);
- void add_to_pre_flush_queue(CollisionObjectBullet *p_co);
- void remove_from_any_queue(CollisionObjectBullet *p_co);
-
void flush_queries();
real_t get_delta_time() { return delta_time; }
void step(real_t p_delta_time);
@@ -157,9 +150,6 @@ public:
void remove_area(AreaBullet *p_area);
void reload_collision_filters(AreaBullet *p_area);
- void register_collision_object(CollisionObjectBullet *p_object);
- void unregister_collision_object(CollisionObjectBullet *p_object);
-
void add_rigid_body(RigidBodyBullet *p_body);
void remove_rigid_body(RigidBodyBullet *p_body);
void reload_collision_filters(RigidBodyBullet *p_body);
@@ -183,7 +173,7 @@ public:
}
_FORCE_INLINE_ void add_debug_contact(const Vector3 &p_contact) {
if (contactDebugCount < contactDebug.size()) {
- contactDebug[contactDebugCount++] = p_contact;
+ contactDebug.write[contactDebugCount++] = p_contact;
}
}
_FORCE_INLINE_ Vector<Vector3> get_debug_contacts() { return contactDebug; }
diff --git a/modules/camera/camera_ios.mm b/modules/camera/camera_ios.mm
index c10b13b2af..e4cb928805 100644
--- a/modules/camera/camera_ios.mm
+++ b/modules/camera/camera_ios.mm
@@ -124,18 +124,12 @@
if (output) {
[self removeOutput:output];
[output setSampleBufferDelegate:nil queue:NULL];
- [output release];
output = nil;
}
[self commitConfiguration];
}
-- (void)dealloc {
- // bye bye
- [super dealloc];
-}
-
- (void)captureOutput:(AVCaptureOutput *)captureOutput didOutputSampleBuffer:(CMSampleBufferRef)sampleBuffer fromConnection:(AVCaptureConnection *)connection {
// This gets called every time our camera has a new image for us to process.
// May need to investigate in a way to throttle this if we get more images then we're rendering frames..
@@ -272,7 +266,6 @@ CameraFeedIOS::CameraFeedIOS() {
void CameraFeedIOS::set_device(AVCaptureDevice *p_device) {
device = p_device;
- [device retain];
// get some info
NSString *device_name = p_device.localizedName;
@@ -286,14 +279,12 @@ void CameraFeedIOS::set_device(AVCaptureDevice *p_device) {
};
CameraFeedIOS::~CameraFeedIOS() {
- if (capture_session != NULL) {
- [capture_session release];
- capture_session = NULL;
+ if (capture_session) {
+ capture_session = nil;
};
- if (device != NULL) {
- [device release];
- device = NULL;
+ if (device) {
+ device = nil;
};
};
@@ -312,8 +303,7 @@ void CameraFeedIOS::deactivate_feed() {
// end camera capture if we have one
if (capture_session) {
[capture_session cleanup];
- [capture_session release];
- capture_session = NULL;
+ capture_session = nil;
};
};
@@ -347,8 +337,6 @@ void CameraFeedIOS::deactivate_feed() {
// remove notifications
[[NSNotificationCenter defaultCenter] removeObserver:self name:AVCaptureDeviceWasConnectedNotification object:nil];
[[NSNotificationCenter defaultCenter] removeObserver:self name:AVCaptureDeviceWasDisconnectedNotification object:nil];
-
- [super dealloc];
}
@end
@@ -453,5 +441,5 @@ CameraIOS::CameraIOS() {
};
CameraIOS::~CameraIOS() {
- [device_notifications release];
+ device_notifications = nil;
};
diff --git a/modules/denoise/lightmap_denoiser.h b/modules/denoise/lightmap_denoiser.h
index d01bbd10a5..74a9d8af86 100644
--- a/modules/denoise/lightmap_denoiser.h
+++ b/modules/denoise/lightmap_denoiser.h
@@ -31,7 +31,7 @@
#ifndef LIGHTMAP_DENOISER_H
#define LIGHTMAP_DENOISER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "scene/3d/lightmapper.h"
struct OIDNDeviceImpl;
diff --git a/modules/gdnavigation/rvo_agent.h b/modules/gdnavigation/rvo_agent.h
index f5c579ba84..1ad9d3ed76 100644
--- a/modules/gdnavigation/rvo_agent.h
+++ b/modules/gdnavigation/rvo_agent.h
@@ -31,8 +31,9 @@
#ifndef RVO_AGENT_H
#define RVO_AGENT_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "nav_rid.h"
+
#include <Agent.h>
/**
diff --git a/modules/gdscript/doc_classes/@GDScript.xml b/modules/gdscript/doc_classes/@GDScript.xml
index 613039754f..e170667a30 100644
--- a/modules/gdscript/doc_classes/@GDScript.xml
+++ b/modules/gdscript/doc_classes/@GDScript.xml
@@ -7,6 +7,7 @@
List of core built-in GDScript functions. Math functions and other utilities. Everything else is provided by objects. (Keywords: builtin, built in, global functions.)
</description>
<tutorials>
+ <link title="Random number generation">https://docs.godotengine.org/en/latest/tutorials/math/random_number_generation.html</link>
</tutorials>
<methods>
<method name="Color8">
@@ -627,6 +628,7 @@
var main = load("res://main.tscn") # main will contain a PackedScene resource.
[/codeblock]
[b]Important:[/b] The path must be absolute, a local path will just return [code]null[/code].
+ This method is a simplified version of [method ResourceLoader.load], which can be used for more advanced scenarios.
</description>
</method>
<method name="log">
@@ -767,7 +769,7 @@
Returns the integer modulus of [code]a/b[/code] that wraps equally in positive and negative.
[codeblock]
for i in range(-3, 4):
- print("%2.0f %2.0f %2.0f" % [i, i % 3, posmod(i, 3)])
+ print("%2d %2d %2d" % [i, i % 3, posmod(i, 3)])
[/codeblock]
Produces:
[codeblock]
diff --git a/modules/gdscript/editor/gdscript_highlighter.cpp b/modules/gdscript/editor/gdscript_highlighter.cpp
index 9a3273d201..7f7410a92c 100644
--- a/modules/gdscript/editor/gdscript_highlighter.cpp
+++ b/modules/gdscript/editor/gdscript_highlighter.cpp
@@ -73,6 +73,13 @@ Dictionary GDScriptSyntaxHighlighter::_get_line_syntax_highlighting(int p_line)
color_region_cache[p_line] = -1;
int in_region = -1;
if (p_line != 0) {
+ int prev_region_line = p_line - 1;
+ while (prev_region_line > 0 && !color_region_cache.has(prev_region_line)) {
+ prev_region_line--;
+ }
+ for (int i = prev_region_line; i < p_line - 1; i++) {
+ get_line_syntax_highlighting(i);
+ }
if (!color_region_cache.has(p_line - 1)) {
get_line_syntax_highlighting(p_line - 1);
}
diff --git a/modules/gdscript/gdscript_byte_codegen.cpp b/modules/gdscript/gdscript_byte_codegen.cpp
index 8f0ce99de6..eabf53581d 100644
--- a/modules/gdscript/gdscript_byte_codegen.cpp
+++ b/modules/gdscript/gdscript_byte_codegen.cpp
@@ -529,6 +529,7 @@ void GDScriptByteCodeGenerator::write_construct(const Address &p_target, Variant
append(p_arguments[i]);
}
append(p_target);
+ alloc_call(p_arguments.size());
}
void GDScriptByteCodeGenerator::write_construct_array(const Address &p_target, const Vector<Address> &p_arguments) {
diff --git a/modules/gridmap/doc_classes/GridMap.xml b/modules/gridmap/doc_classes/GridMap.xml
index 57fbc5bfc0..4dccb03369 100644
--- a/modules/gridmap/doc_classes/GridMap.xml
+++ b/modules/gridmap/doc_classes/GridMap.xml
@@ -11,6 +11,8 @@
</description>
<tutorials>
<link title="Using gridmaps">https://docs.godotengine.org/en/latest/tutorials/3d/using_gridmaps.html</link>
+ <link title="3D Platformer Demo">https://godotengine.org/asset-library/asset/125</link>
+ <link title="3D Kinematic Character Demo">https://godotengine.org/asset-library/asset/126</link>
</tutorials>
<methods>
<method name="clear">
diff --git a/modules/jsonrpc/jsonrpc.h b/modules/jsonrpc/jsonrpc.h
index e2b7ab0975..6f3f8003e0 100644
--- a/modules/jsonrpc/jsonrpc.h
+++ b/modules/jsonrpc/jsonrpc.h
@@ -31,7 +31,7 @@
#ifndef GODOT_JSON_RPC_H
#define GODOT_JSON_RPC_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/variant.h"
class JSONRPC : public Object {
diff --git a/modules/mono/csharp_script.cpp b/modules/mono/csharp_script.cpp
index a05b38b8bf..70b731d611 100644
--- a/modules/mono/csharp_script.cpp
+++ b/modules/mono/csharp_script.cpp
@@ -975,7 +975,6 @@ void CSharpLanguage::reload_assemblies(bool p_soft_reload) {
script->signals_invalidated = true;
script->reload(p_soft_reload);
- script->update_exports();
if (!script->valid) {
script->pending_reload_instances.clear();
@@ -2955,13 +2954,24 @@ void CSharpScript::initialize_for_managed_type(Ref<CSharpScript> p_script, GDMon
CRASH_COND(p_script->native == nullptr);
+ p_script->valid = true;
+
+ update_script_class_info(p_script);
+
+#ifdef TOOLS_ENABLED
+ p_script->_update_member_info_no_exports();
+#endif
+}
+
+// Extract information about the script using the mono class.
+void CSharpScript::update_script_class_info(Ref<CSharpScript> p_script) {
GDMonoClass *base = p_script->script_class->get_parent_class();
+ // `base` should only be set if the script is a user defined type.
if (base != p_script->native) {
p_script->base = base;
}
- p_script->valid = true;
p_script->tool = p_script->script_class->has_attribute(CACHED_CLASS(ToolAttribute));
if (!p_script->tool) {
@@ -2996,17 +3006,74 @@ void CSharpScript::initialize_for_managed_type(Ref<CSharpScript> p_script, GDMon
p_script->script_class->fetch_methods_with_godot_api_checks(p_script->native);
- // Need to fetch method from base classes as well
+ p_script->rpc_functions.clear();
+ p_script->rpc_variables.clear();
+
GDMonoClass *top = p_script->script_class;
while (top && top != p_script->native) {
+ // Fetch methods from base classes as well
top->fetch_methods_with_godot_api_checks(p_script->native);
+
+ // Update RPC info
+ {
+ Vector<GDMonoMethod *> methods = top->get_all_methods();
+ for (int i = 0; i < methods.size(); i++) {
+ if (!methods[i]->is_static()) {
+ MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(methods[i]);
+ if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
+ ScriptNetData nd;
+ nd.name = methods[i]->get_name();
+ nd.mode = mode;
+ if (-1 == p_script->rpc_functions.find(nd)) {
+ p_script->rpc_functions.push_back(nd);
+ }
+ }
+ }
+ }
+ }
+
+ {
+ Vector<GDMonoField *> fields = top->get_all_fields();
+ for (int i = 0; i < fields.size(); i++) {
+ if (!fields[i]->is_static()) {
+ MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(fields[i]);
+ if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
+ ScriptNetData nd;
+ nd.name = fields[i]->get_name();
+ nd.mode = mode;
+ if (-1 == p_script->rpc_variables.find(nd)) {
+ p_script->rpc_variables.push_back(nd);
+ }
+ }
+ }
+ }
+ }
+
+ {
+ Vector<GDMonoProperty *> properties = top->get_all_properties();
+ for (int i = 0; i < properties.size(); i++) {
+ if (!properties[i]->is_static()) {
+ MultiplayerAPI::RPCMode mode = p_script->_member_get_rpc_mode(properties[i]);
+ if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
+ ScriptNetData nd;
+ nd.name = properties[i]->get_name();
+ nd.mode = mode;
+ if (-1 == p_script->rpc_variables.find(nd)) {
+ p_script->rpc_variables.push_back(nd);
+ }
+ }
+ }
+ }
+ }
+
top = top->get_parent_class();
}
+ // Sort so we are 100% that they are always the same.
+ p_script->rpc_functions.sort_custom<SortNetData>();
+ p_script->rpc_variables.sort_custom<SortNetData>();
+
p_script->load_script_signals(p_script->script_class, p_script->native);
-#ifdef TOOLS_ENABLED
- p_script->_update_member_info_no_exports();
-#endif
}
bool CSharpScript::can_instance() const {
@@ -3305,124 +3372,15 @@ Error CSharpScript::reload(bool p_keep_state) {
print_verbose("Found class " + script_class->get_full_name() + " for script " + get_path());
#endif
- tool = script_class->has_attribute(CACHED_CLASS(ToolAttribute));
-
- if (!tool) {
- GDMonoClass *nesting_class = script_class->get_nesting_class();
- tool = nesting_class && nesting_class->has_attribute(CACHED_CLASS(ToolAttribute));
- }
-
-#if TOOLS_ENABLED
- if (!tool) {
- tool = script_class->get_assembly() == GDMono::get_singleton()->get_tools_assembly();
- }
-#endif
-
native = GDMonoUtils::get_class_native_base(script_class);
CRASH_COND(native == nullptr);
- GDMonoClass *base_class = script_class->get_parent_class();
-
- if (base_class != native) {
- base = base_class;
- }
-
-#ifdef DEBUG_ENABLED
- // For debug builds, we must fetch from all native base methods as well.
- // Native base methods must be fetched before the current class.
- // Not needed if the script class itself is a native class.
+ update_script_class_info(this);
- if (script_class != native) {
- GDMonoClass *native_top = native;
- while (native_top) {
- native_top->fetch_methods_with_godot_api_checks(native);
-
- if (native_top == CACHED_CLASS(GodotObject)) {
- break;
- }
-
- native_top = native_top->get_parent_class();
- }
- }
-#endif
-
- script_class->fetch_methods_with_godot_api_checks(native);
-
- // Need to fetch method from base classes as well
- GDMonoClass *top = script_class;
- while (top && top != native) {
- top->fetch_methods_with_godot_api_checks(native);
- top = top->get_parent_class();
- }
-
- load_script_signals(script_class, native);
_update_exports();
}
- rpc_functions.clear();
- rpc_variables.clear();
-
- GDMonoClass *top = script_class;
- while (top && top != native) {
- {
- Vector<GDMonoMethod *> methods = top->get_all_methods();
- for (int i = 0; i < methods.size(); i++) {
- if (!methods[i]->is_static()) {
- MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(methods[i]);
- if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
- ScriptNetData nd;
- nd.name = methods[i]->get_name();
- nd.mode = mode;
- if (-1 == rpc_functions.find(nd)) {
- rpc_functions.push_back(nd);
- }
- }
- }
- }
- }
-
- {
- Vector<GDMonoField *> fields = top->get_all_fields();
- for (int i = 0; i < fields.size(); i++) {
- if (!fields[i]->is_static()) {
- MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(fields[i]);
- if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
- ScriptNetData nd;
- nd.name = fields[i]->get_name();
- nd.mode = mode;
- if (-1 == rpc_variables.find(nd)) {
- rpc_variables.push_back(nd);
- }
- }
- }
- }
- }
-
- {
- Vector<GDMonoProperty *> properties = top->get_all_properties();
- for (int i = 0; i < properties.size(); i++) {
- if (!properties[i]->is_static()) {
- MultiplayerAPI::RPCMode mode = _member_get_rpc_mode(properties[i]);
- if (MultiplayerAPI::RPC_MODE_DISABLED != mode) {
- ScriptNetData nd;
- nd.name = properties[i]->get_name();
- nd.mode = mode;
- if (-1 == rpc_variables.find(nd)) {
- rpc_variables.push_back(nd);
- }
- }
- }
- }
- }
-
- top = top->get_parent_class();
- }
-
- // Sort so we are 100% that they are always the same.
- rpc_functions.sort_custom<SortNetData>();
- rpc_variables.sort_custom<SortNetData>();
-
return OK;
}
diff --git a/modules/mono/csharp_script.h b/modules/mono/csharp_script.h
index f0b43a40f9..cfe070a371 100644
--- a/modules/mono/csharp_script.h
+++ b/modules/mono/csharp_script.h
@@ -164,6 +164,7 @@ private:
// Do not use unless you know what you are doing
friend void GDMonoInternals::tie_managed_to_unmanaged(MonoObject *, Object *);
static Ref<CSharpScript> create_for_managed_type(GDMonoClass *p_class, GDMonoClass *p_native);
+ static void update_script_class_info(Ref<CSharpScript> p_script);
static void initialize_for_managed_type(Ref<CSharpScript> p_script, GDMonoClass *p_class, GDMonoClass *p_native);
MultiplayerAPI::RPCMode _member_get_rpc_mode(IMonoClassMember *p_member) const;
diff --git a/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec b/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec
index 5b5cefe80e..ba68a4da43 100644
--- a/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec
+++ b/modules/mono/editor/Godot.NET.Sdk/Godot.NET.Sdk/Godot.NET.Sdk.nuspec
@@ -17,6 +17,6 @@
<repository url="$projecturl$" />
</metadata>
<files>
- <file src="Sdk\**" target="Sdk" />\
+ <file src="Sdk\**" target="Sdk" />
</files>
</package>
diff --git a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
index 7bfba779fb..93aae2e03e 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Build/MsBuildFinder.cs
@@ -119,7 +119,7 @@ namespace GodotTools.Build
{
var result = new List<string>();
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
result.Add("/Library/Frameworks/Mono.framework/Versions/Current/bin/");
result.Add("/usr/local/var/homebrew/linked/mono/bin/");
diff --git a/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs b/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs
index 42ede3f3f3..5bb8d444c2 100755
--- a/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Export/AotBuilder.cs
@@ -120,7 +120,7 @@ namespace GodotTools.Export
string assemblyPath = assembly.Value;
string outputFileExtension = platform == OS.Platforms.Windows ? ".dll" :
- platform == OS.Platforms.OSX ? ".dylib" :
+ platform == OS.Platforms.MacOS ? ".dylib" :
".so";
string outputFileName = assemblyName + ".dll" + outputFileExtension;
@@ -132,7 +132,7 @@ namespace GodotTools.Export
ExecuteCompiler(FindCrossCompiler(compilerDirPath), compilerArgs, bclDir);
- if (platform == OS.Platforms.OSX)
+ if (platform == OS.Platforms.MacOS)
{
exporter.AddSharedObject(tempOutputFilePath, tags: null);
}
@@ -581,7 +581,7 @@ MONO_AOT_MODE_LAST = 1000,
string arch = bits == "64" ? "x86_64" : "i686";
return $"windows-{arch}";
}
- case OS.Platforms.OSX:
+ case OS.Platforms.MacOS:
{
Debug.Assert(bits == null || bits == "64");
string arch = "x86_64";
diff --git a/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs b/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs
index 599ca94699..cd188509b4 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Export/ExportPlugin.cs
@@ -340,7 +340,7 @@ namespace GodotTools.Export
private static bool PlatformHasTemplateDir(string platform)
{
// OSX export templates are contained in a zip, so we place our custom template inside it and let Godot do the rest.
- return !new[] {OS.Platforms.OSX, OS.Platforms.Android, OS.Platforms.iOS, OS.Platforms.HTML5}.Contains(platform);
+ return !new[] {OS.Platforms.MacOS, OS.Platforms.Android, OS.Platforms.iOS, OS.Platforms.HTML5}.Contains(platform);
}
private static bool DeterminePlatformFromFeatures(IEnumerable<string> features, out string platform)
@@ -411,7 +411,7 @@ namespace GodotTools.Export
case OS.Platforms.Windows:
case OS.Platforms.UWP:
return "net_4_x_win";
- case OS.Platforms.OSX:
+ case OS.Platforms.MacOS:
case OS.Platforms.LinuxBSD:
case OS.Platforms.Server:
case OS.Platforms.Haiku:
diff --git a/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs b/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs
index 2a450c5b87..57d334b93e 100644
--- a/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/GodotSharpEditor.cs
@@ -272,7 +272,7 @@ namespace GodotTools
bool osxAppBundleInstalled = false;
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
// The package path is '/Applications/Visual Studio Code.app'
const string vscodeBundleId = "com.microsoft.VSCode";
@@ -312,7 +312,7 @@ namespace GodotTools
string command;
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
if (!osxAppBundleInstalled && string.IsNullOrEmpty(_vsCodePath))
{
@@ -504,7 +504,7 @@ namespace GodotTools
$",Visual Studio Code:{(int)ExternalEditorId.VsCode}" +
$",JetBrains Rider:{(int)ExternalEditorId.Rider}";
}
- else if (OS.IsOSX)
+ else if (OS.IsMacOS)
{
settingsHintStr += $",Visual Studio:{(int)ExternalEditorId.VisualStudioForMac}" +
$",MonoDevelop:{(int)ExternalEditorId.MonoDevelop}" +
diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs
index e4932ca217..451ce39f5c 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Ides/GodotIdeManager.cs
@@ -111,7 +111,7 @@ namespace GodotTools.Ides
{
MonoDevelop.Instance GetMonoDevelopInstance(string solutionPath)
{
- if (Utils.OS.IsOSX && editorId == ExternalEditorId.VisualStudioForMac)
+ if (Utils.OS.IsMacOS && editorId == ExternalEditorId.VisualStudioForMac)
{
vsForMacInstance = (vsForMacInstance?.IsDisposed ?? true ? null : vsForMacInstance) ??
new MonoDevelop.Instance(solutionPath, MonoDevelop.EditorId.VisualStudioForMac);
diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs
index d6fa2eeba7..fd7bbd5578 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Ides/MonoDevelop/Instance.cs
@@ -26,7 +26,7 @@ namespace GodotTools.Ides.MonoDevelop
string command;
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
string bundleId = BundleIds[editorId];
@@ -85,7 +85,7 @@ namespace GodotTools.Ides.MonoDevelop
public Instance(string solutionFile, EditorId editorId)
{
- if (editorId == EditorId.VisualStudioForMac && !OS.IsOSX)
+ if (editorId == EditorId.VisualStudioForMac && !OS.IsMacOS)
throw new InvalidOperationException($"{nameof(EditorId.VisualStudioForMac)} not supported on this platform");
this.solutionFile = solutionFile;
@@ -103,7 +103,7 @@ namespace GodotTools.Ides.MonoDevelop
static Instance()
{
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
ExecutableNames = new Dictionary<EditorId, string>
{
diff --git a/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs b/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs
index e22e9af919..94fc5da425 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Ides/Rider/RiderPathLocator.cs
@@ -32,7 +32,7 @@ namespace GodotTools.Ides.Rider
{
return CollectRiderInfosWindows();
}
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
return CollectRiderInfosMac();
}
@@ -138,7 +138,7 @@ namespace GodotTools.Ides.Rider
return GetToolboxRiderRootPath(localAppData);
}
- if (OS.IsOSX)
+ if (OS.IsMacOS)
{
var home = Environment.GetEnvironmentVariable("HOME");
if (string.IsNullOrEmpty(home))
@@ -211,7 +211,7 @@ namespace GodotTools.Ides.Rider
{
if (OS.IsWindows || OS.IsUnixLike)
return "../../build.txt";
- if (OS.IsOSX)
+ if (OS.IsMacOS)
return "Contents/Resources/build.txt";
throw new Exception("Unknown OS.");
}
diff --git a/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs b/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs
index 6c05891f2c..e745966435 100644
--- a/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs
+++ b/modules/mono/editor/GodotTools/GodotTools/Utils/OS.cs
@@ -21,7 +21,7 @@ namespace GodotTools.Utils
public static class Names
{
public const string Windows = "Windows";
- public const string OSX = "OSX";
+ public const string MacOS = "macOS";
public const string Linux = "Linux";
public const string FreeBSD = "FreeBSD";
public const string NetBSD = "NetBSD";
@@ -37,7 +37,7 @@ namespace GodotTools.Utils
public static class Platforms
{
public const string Windows = "windows";
- public const string OSX = "osx";
+ public const string MacOS = "osx";
public const string LinuxBSD = "linuxbsd";
public const string Server = "server";
public const string UWP = "uwp";
@@ -50,7 +50,7 @@ namespace GodotTools.Utils
public static readonly Dictionary<string, string> PlatformNameMap = new Dictionary<string, string>
{
[Names.Windows] = Platforms.Windows,
- [Names.OSX] = Platforms.OSX,
+ [Names.MacOS] = Platforms.MacOS,
[Names.Linux] = Platforms.LinuxBSD,
[Names.FreeBSD] = Platforms.LinuxBSD,
[Names.NetBSD] = Platforms.LinuxBSD,
@@ -77,11 +77,11 @@ namespace GodotTools.Utils
new[] {Names.Linux, Names.FreeBSD, Names.NetBSD, Names.BSD};
private static readonly IEnumerable<string> UnixLikePlatforms =
- new[] {Names.OSX, Names.Server, Names.Haiku, Names.Android, Names.iOS}
+ new[] {Names.MacOS, Names.Server, Names.Haiku, Names.Android, Names.iOS}
.Concat(LinuxBSDPlatforms).ToArray();
private static readonly Lazy<bool> _isWindows = new Lazy<bool>(() => IsOS(Names.Windows));
- private static readonly Lazy<bool> _isOSX = new Lazy<bool>(() => IsOS(Names.OSX));
+ private static readonly Lazy<bool> _isMacOS = new Lazy<bool>(() => IsOS(Names.MacOS));
private static readonly Lazy<bool> _isLinuxBSD = new Lazy<bool>(() => IsAnyOS(LinuxBSDPlatforms));
private static readonly Lazy<bool> _isServer = new Lazy<bool>(() => IsOS(Names.Server));
private static readonly Lazy<bool> _isUWP = new Lazy<bool>(() => IsOS(Names.UWP));
@@ -92,7 +92,7 @@ namespace GodotTools.Utils
private static readonly Lazy<bool> _isUnixLike = new Lazy<bool>(() => IsAnyOS(UnixLikePlatforms));
public static bool IsWindows => _isWindows.Value || IsUWP;
- public static bool IsOSX => _isOSX.Value;
+ public static bool IsMacOS => _isMacOS.Value;
public static bool IsLinuxBSD => _isLinuxBSD.Value;
public static bool IsServer => _isServer.Value;
public static bool IsUWP => _isUWP.Value;
diff --git a/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs b/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs
index bd1dbc1229..d63db0f905 100644
--- a/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs
+++ b/modules/mono/glue/GodotSharp/GodotSharp/Core/StringExtensions.cs
@@ -393,6 +393,35 @@ namespace Godot
return instance.Substring(sep + 1);
}
+ /// <summary>
+ /// Converts the given byte array of ASCII encoded text to a string.
+ /// Faster alternative to <see cref="GetStringFromUTF8"/> if the
+ /// content is ASCII-only. Unlike the UTF-8 function this function
+ /// maps every byte to a character in the array. Multibyte sequences
+ /// will not be interpreted correctly. For parsing user input always
+ /// use <see cref="GetStringFromUTF8"/>.
+ /// </summary>
+ /// <param name="bytes">A byte array of ASCII characters (on the range of 0-127).</param>
+ /// <returns>A string created from the bytes.</returns>
+ public static string GetStringFromASCII(this byte[] bytes)
+ {
+ return Encoding.ASCII.GetString(bytes);
+ }
+
+ /// <summary>
+ /// Converts the given byte array of UTF-8 encoded text to a string.
+ /// Slower than <see cref="GetStringFromASCII"/> but supports UTF-8
+ /// encoded data. Use this function if you are unsure about the
+ /// source of the data. For user input this function
+ /// should always be preferred.
+ /// </summary>
+ /// <param name="bytes">A byte array of UTF-8 characters (a character may take up multiple bytes).</param>
+ /// <returns>A string created from the bytes.</returns>
+ public static string GetStringFromUTF8(this byte[] bytes)
+ {
+ return Encoding.UTF8.GetString(bytes);
+ }
+
// <summary>
// Hash the string and return a 32 bits integer.
// </summary>
diff --git a/modules/mono/glue/GodotSharp/GodotSharp/Core/Vector2.cs b/modules/mono/glue/GodotSharp/GodotSharp/Core/Vector2.cs
index 3dff37279b..d536b14eac 100644
--- a/modules/mono/glue/GodotSharp/GodotSharp/Core/Vector2.cs
+++ b/modules/mono/glue/GodotSharp/GodotSharp/Core/Vector2.cs
@@ -437,8 +437,11 @@ namespace Godot
/// <returns>The rotated vector.</returns>
public Vector2 Rotated(real_t phi)
{
- real_t rads = Angle() + phi;
- return new Vector2(Mathf.Cos(rads), Mathf.Sin(rads)) * Length();
+ real_t sine = Mathf.Sin(phi);
+ real_t cosi = Mathf.Cos(phi);
+ return new Vector2(
+ x * cosi - y * sine,
+ x * sine + y * cosi);
}
/// <summary>
diff --git a/modules/mono/glue/base_object_glue.cpp b/modules/mono/glue/base_object_glue.cpp
index ebcd6d5e9c..439fb1ab0a 100644
--- a/modules/mono/glue/base_object_glue.cpp
+++ b/modules/mono/glue/base_object_glue.cpp
@@ -31,7 +31,6 @@
#ifdef MONO_GLUE_ENABLED
#include "core/class_db.h"
-#include "core/object.h"
#include "core/reference.h"
#include "core/string_name.h"
diff --git a/modules/mono/glue/glue_header.h b/modules/mono/glue/glue_header.h
index c1f1936711..dc3bf47838 100644
--- a/modules/mono/glue/glue_header.h
+++ b/modules/mono/glue/glue_header.h
@@ -64,7 +64,6 @@ void godot_register_glue_header_icalls() {
#include "core/engine.h"
#include "core/method_bind.h"
#include "core/node_path.h"
-#include "core/object.h"
#include "core/reference.h"
#include "core/typedefs.h"
#include "core/ustring.h"
diff --git a/modules/mono/glue/rid_glue.cpp b/modules/mono/glue/rid_glue.cpp
index 6d2e6b559f..a7b18c36dd 100644
--- a/modules/mono/glue/rid_glue.cpp
+++ b/modules/mono/glue/rid_glue.cpp
@@ -30,7 +30,7 @@
#ifdef MONO_GLUE_ENABLED
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/resource.h"
#include "core/rid.h"
diff --git a/modules/mono/mono_gd/gd_mono_internals.h b/modules/mono/mono_gd/gd_mono_internals.h
index 038d17f782..cf7efdecd6 100644
--- a/modules/mono/mono_gd/gd_mono_internals.h
+++ b/modules/mono/mono_gd/gd_mono_internals.h
@@ -35,7 +35,7 @@
#include "../utils/macros.h"
-#include "core/object.h"
+#include "core/class_db.h"
namespace GDMonoInternals {
diff --git a/modules/mono/mono_gd/gd_mono_utils.h b/modules/mono/mono_gd/gd_mono_utils.h
index 5958bf3cc1..80569cb1c7 100644
--- a/modules/mono/mono_gd/gd_mono_utils.h
+++ b/modules/mono/mono_gd/gd_mono_utils.h
@@ -37,7 +37,7 @@
#include "../utils/macros.h"
#include "gd_mono_header.h"
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/reference.h"
#define UNHANDLED_EXCEPTION(m_exc) \
diff --git a/modules/mono/mono_gd/support/ios_support.mm b/modules/mono/mono_gd/support/ios_support.mm
index e3d1a647fd..dc23c06eba 100644
--- a/modules/mono/mono_gd/support/ios_support.mm
+++ b/modules/mono/mono_gd/support/ios_support.mm
@@ -131,8 +131,7 @@ GD_PINVOKE_EXPORT void *xamarin_timezone_get_data(const char *p_name, uint32_t *
NSTimeZone *tz = nil;
if (p_name) {
NSString *n = [[NSString alloc] initWithUTF8String:p_name];
- tz = [[[NSTimeZone alloc] initWithName:n] autorelease];
- [n release];
+ tz = [[NSTimeZone alloc] initWithName:n];
} else {
tz = [NSTimeZone localTimeZone];
}
diff --git a/modules/visual_script/visual_script_editor.cpp b/modules/visual_script/visual_script_editor.cpp
index b1d8c05d87..d962d91287 100644
--- a/modules/visual_script/visual_script_editor.cpp
+++ b/modules/visual_script/visual_script_editor.cpp
@@ -30,8 +30,8 @@
#include "visual_script_editor.h"
+#include "core/class_db.h"
#include "core/input/input.h"
-#include "core/object.h"
#include "core/os/keyboard.h"
#include "core/script_language.h"
#include "core/variant.h"
diff --git a/modules/visual_script/visual_script_func_nodes.cpp b/modules/visual_script/visual_script_func_nodes.cpp
index f13377f3c8..68de686272 100644
--- a/modules/visual_script/visual_script_func_nodes.cpp
+++ b/modules/visual_script/visual_script_func_nodes.cpp
@@ -2088,6 +2088,7 @@ void VisualScriptPropertyGet::_bind_methods() {
BIND_ENUM_CONSTANT(CALL_MODE_SELF);
BIND_ENUM_CONSTANT(CALL_MODE_NODE_PATH);
BIND_ENUM_CONSTANT(CALL_MODE_INSTANCE);
+ BIND_ENUM_CONSTANT(CALL_MODE_BASIC_TYPE);
}
class VisualScriptNodeInstancePropertyGet : public VisualScriptNodeInstance {
diff --git a/modules/visual_script/visual_script_nodes.cpp b/modules/visual_script/visual_script_nodes.cpp
index 1b77ed3168..28122ade99 100644
--- a/modules/visual_script/visual_script_nodes.cpp
+++ b/modules/visual_script/visual_script_nodes.cpp
@@ -1706,8 +1706,10 @@ public:
virtual int step(const Variant **p_inputs, Variant **p_outputs, StartMode p_start_mode, Variant *p_working_mem, Callable::CallError &r_error, String &r_error_str) {
bool valid;
+ // *p_output[0] points to the same place as *p_inputs[2] so we need a temp to store the value before the change in the next line
+ Variant temp = *p_inputs[2];
*p_outputs[0] = *p_inputs[0];
- p_outputs[0]->set(*p_inputs[1], *p_inputs[2], &valid);
+ p_outputs[0]->set(*p_inputs[1], temp, &valid);
if (!valid) {
r_error.error = Callable::CallError::CALL_ERROR_INVALID_METHOD;
diff --git a/modules/webrtc/doc_classes/WebRTCPeerConnection.xml b/modules/webrtc/doc_classes/WebRTCPeerConnection.xml
index c80b903e39..e21dee8eff 100644
--- a/modules/webrtc/doc_classes/WebRTCPeerConnection.xml
+++ b/modules/webrtc/doc_classes/WebRTCPeerConnection.xml
@@ -40,7 +40,6 @@
<argument index="0" name="label" type="String">
</argument>
<argument index="1" name="options" type="Dictionary" default="{
-
}">
</argument>
<description>
@@ -82,7 +81,6 @@
<return type="int" enum="Error">
</return>
<argument index="0" name="configuration" type="Dictionary" default="{
-
}">
</argument>
<description>
diff --git a/platform/iphone/SCsub b/platform/iphone/SCsub
index 848fd9713a..1dd37dabe5 100644
--- a/platform/iphone/SCsub
+++ b/platform/iphone/SCsub
@@ -19,6 +19,8 @@ iphone_lib = [
"display_layer.mm",
"godot_view_renderer.mm",
"godot_view_gesture_recognizer.mm",
+ "device_metrics.m",
+ "native_video_view.m",
]
env_ios = env.Clone()
diff --git a/platform/iphone/app_delegate.mm b/platform/iphone/app_delegate.mm
index 7edbcc4667..40a63d7ad2 100644
--- a/platform/iphone/app_delegate.mm
+++ b/platform/iphone/app_delegate.mm
@@ -62,7 +62,7 @@ static ViewController *mainViewController = nil;
CGRect windowBounds = [[UIScreen mainScreen] bounds];
// Create a full-screen window
- self.window = [[[UIWindow alloc] initWithFrame:windowBounds] autorelease];
+ self.window = [[UIWindow alloc] initWithFrame:windowBounds];
NSArray *paths = NSSearchPathForDirectoriesInDomains(NSDocumentDirectory, NSUserDomainMask, YES);
NSString *documentsDirectory = [paths objectAtIndex:0];
@@ -140,7 +140,6 @@ static ViewController *mainViewController = nil;
- (void)dealloc {
self.window = nil;
- [super dealloc];
}
@end
diff --git a/platform/iphone/detect.py b/platform/iphone/detect.py
index 66579c1ad7..5ebabdd3dc 100644
--- a/platform/iphone/detect.py
+++ b/platform/iphone/detect.py
@@ -129,7 +129,7 @@ def configure(env):
detect_darwin_sdk_path("iphone", env)
env.Append(
CCFLAGS=(
- "-fno-objc-arc -arch armv7 -fmessage-length=0 -fno-strict-aliasing"
+ "-fobjc-arc -arch armv7 -fmessage-length=0 -fno-strict-aliasing"
" -fdiagnostics-print-source-range-info -fdiagnostics-show-category=id -fdiagnostics-parseable-fixits"
" -fpascal-strings -fblocks -isysroot $IPHONESDK -fvisibility=hidden -mthumb"
' "-DIBOutlet=__attribute__((iboutlet))"'
@@ -141,7 +141,7 @@ def configure(env):
detect_darwin_sdk_path("iphone", env)
env.Append(
CCFLAGS=(
- "-fno-objc-arc -arch arm64 -fmessage-length=0 -fno-strict-aliasing"
+ "-fobjc-arc -arch arm64 -fmessage-length=0 -fno-strict-aliasing"
" -fdiagnostics-print-source-range-info -fdiagnostics-show-category=id -fdiagnostics-parseable-fixits"
" -fpascal-strings -fblocks -fvisibility=hidden -MMD -MT dependencies -miphoneos-version-min=11.0"
" -isysroot $IPHONESDK".split()
diff --git a/platform/iphone/device_metrics.h b/platform/iphone/device_metrics.h
new file mode 100644
index 0000000000..6d0ff49077
--- /dev/null
+++ b/platform/iphone/device_metrics.h
@@ -0,0 +1,37 @@
+/*************************************************************************/
+/* device_metrics.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#import <Foundation/Foundation.h>
+
+@interface GodotDeviceMetrics : NSObject
+
+@property(nonatomic, class, readonly, strong) NSDictionary<NSArray *, NSNumber *> *dpiList;
+
+@end
diff --git a/platform/iphone/device_metrics.m b/platform/iphone/device_metrics.m
new file mode 100644
index 0000000000..747872bc49
--- /dev/null
+++ b/platform/iphone/device_metrics.m
@@ -0,0 +1,152 @@
+/*************************************************************************/
+/* device_metrics.m */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#import "device_metrics.h"
+
+@implementation GodotDeviceMetrics
+
++ (NSDictionary *)dpiList {
+ return @{
+ @[
+ @"iPad1,1",
+ @"iPad2,1",
+ @"iPad2,2",
+ @"iPad2,3",
+ @"iPad2,4",
+ ] : @132,
+ @[
+ @"iPhone1,1",
+ @"iPhone1,2",
+ @"iPhone2,1",
+ @"iPad2,5",
+ @"iPad2,6",
+ @"iPad2,7",
+ @"iPod1,1",
+ @"iPod2,1",
+ @"iPod3,1",
+ ] : @163,
+ @[
+ @"iPad3,1",
+ @"iPad3,2",
+ @"iPad3,3",
+ @"iPad3,4",
+ @"iPad3,5",
+ @"iPad3,6",
+ @"iPad4,1",
+ @"iPad4,2",
+ @"iPad4,3",
+ @"iPad5,3",
+ @"iPad5,4",
+ @"iPad6,3",
+ @"iPad6,4",
+ @"iPad6,7",
+ @"iPad6,8",
+ @"iPad6,11",
+ @"iPad6,12",
+ @"iPad7,1",
+ @"iPad7,2",
+ @"iPad7,3",
+ @"iPad7,4",
+ @"iPad7,5",
+ @"iPad7,6",
+ @"iPad7,11",
+ @"iPad7,12",
+ @"iPad8,1",
+ @"iPad8,2",
+ @"iPad8,3",
+ @"iPad8,4",
+ @"iPad8,5",
+ @"iPad8,6",
+ @"iPad8,7",
+ @"iPad8,8",
+ @"iPad8,9",
+ @"iPad8,10",
+ @"iPad8,11",
+ @"iPad8,12",
+ @"iPad11,3",
+ @"iPad11,4",
+ ] : @264,
+ @[
+ @"iPhone3,1",
+ @"iPhone3,2",
+ @"iPhone3,3",
+ @"iPhone4,1",
+ @"iPhone5,1",
+ @"iPhone5,2",
+ @"iPhone5,3",
+ @"iPhone5,4",
+ @"iPhone6,1",
+ @"iPhone6,2",
+ @"iPhone7,2",
+ @"iPhone8,1",
+ @"iPhone8,4",
+ @"iPhone9,1",
+ @"iPhone9,3",
+ @"iPhone10,1",
+ @"iPhone10,4",
+ @"iPhone11,8",
+ @"iPhone12,1",
+ @"iPhone12,8",
+ @"iPad4,4",
+ @"iPad4,5",
+ @"iPad4,6",
+ @"iPad4,7",
+ @"iPad4,8",
+ @"iPad4,9",
+ @"iPad5,1",
+ @"iPad5,2",
+ @"iPad11,1",
+ @"iPad11,2",
+ @"iPod4,1",
+ @"iPod5,1",
+ @"iPod7,1",
+ @"iPod9,1",
+ ] : @326,
+ @[
+ @"iPhone7,1",
+ @"iPhone8,2",
+ @"iPhone9,2",
+ @"iPhone9,4",
+ @"iPhone10,2",
+ @"iPhone10,5",
+ ] : @401,
+ @[
+ @"iPhone10,3",
+ @"iPhone10,6",
+ @"iPhone11,2",
+ @"iPhone11,4",
+ @"iPhone11,6",
+ @"iPhone12,3",
+ @"iPhone12,5",
+ ] : @458,
+ };
+}
+
+@end
diff --git a/platform/iphone/display_layer.mm b/platform/iphone/display_layer.mm
index 5ec94fb471..2716538b89 100644
--- a/platform/iphone/display_layer.mm
+++ b/platform/iphone/display_layer.mm
@@ -124,11 +124,8 @@
}
if (context) {
- [context release];
context = nil;
}
-
- [super dealloc];
}
- (BOOL)createFramebuffer {
diff --git a/platform/iphone/display_server_iphone.mm b/platform/iphone/display_server_iphone.mm
index eea87cecc9..d456f9cbf6 100644
--- a/platform/iphone/display_server_iphone.mm
+++ b/platform/iphone/display_server_iphone.mm
@@ -32,8 +32,10 @@
#import "app_delegate.h"
#include "core/io/file_access_pack.h"
#include "core/project_settings.h"
+#import "device_metrics.h"
#import "godot_view.h"
#include "ios.h"
+#import "native_video_view.h"
#include "os_iphone.h"
#import "view_controller.h"
@@ -41,120 +43,6 @@
#import <sys/utsname.h>
static const float kDisplayServerIPhoneAcceleration = 1;
-static NSDictionary *iOSModelToDPI = @{
- @[
- @"iPad1,1",
- @"iPad2,1",
- @"iPad2,2",
- @"iPad2,3",
- @"iPad2,4",
- ] : @132,
- @[
- @"iPhone1,1",
- @"iPhone1,2",
- @"iPhone2,1",
- @"iPad2,5",
- @"iPad2,6",
- @"iPad2,7",
- @"iPod1,1",
- @"iPod2,1",
- @"iPod3,1",
- ] : @163,
- @[
- @"iPad3,1",
- @"iPad3,2",
- @"iPad3,3",
- @"iPad3,4",
- @"iPad3,5",
- @"iPad3,6",
- @"iPad4,1",
- @"iPad4,2",
- @"iPad4,3",
- @"iPad5,3",
- @"iPad5,4",
- @"iPad6,3",
- @"iPad6,4",
- @"iPad6,7",
- @"iPad6,8",
- @"iPad6,11",
- @"iPad6,12",
- @"iPad7,1",
- @"iPad7,2",
- @"iPad7,3",
- @"iPad7,4",
- @"iPad7,5",
- @"iPad7,6",
- @"iPad7,11",
- @"iPad7,12",
- @"iPad8,1",
- @"iPad8,2",
- @"iPad8,3",
- @"iPad8,4",
- @"iPad8,5",
- @"iPad8,6",
- @"iPad8,7",
- @"iPad8,8",
- @"iPad8,9",
- @"iPad8,10",
- @"iPad8,11",
- @"iPad8,12",
- @"iPad11,3",
- @"iPad11,4",
- ] : @264,
- @[
- @"iPhone3,1",
- @"iPhone3,2",
- @"iPhone3,3",
- @"iPhone4,1",
- @"iPhone5,1",
- @"iPhone5,2",
- @"iPhone5,3",
- @"iPhone5,4",
- @"iPhone6,1",
- @"iPhone6,2",
- @"iPhone7,2",
- @"iPhone8,1",
- @"iPhone8,4",
- @"iPhone9,1",
- @"iPhone9,3",
- @"iPhone10,1",
- @"iPhone10,4",
- @"iPhone11,8",
- @"iPhone12,1",
- @"iPhone12,8",
- @"iPad4,4",
- @"iPad4,5",
- @"iPad4,6",
- @"iPad4,7",
- @"iPad4,8",
- @"iPad4,9",
- @"iPad5,1",
- @"iPad5,2",
- @"iPad11,1",
- @"iPad11,2",
- @"iPod4,1",
- @"iPod5,1",
- @"iPod7,1",
- @"iPod9,1",
- ] : @326,
- @[
- @"iPhone7,1",
- @"iPhone8,2",
- @"iPhone9,2",
- @"iPhone9,4",
- @"iPhone10,2",
- @"iPhone10,5",
- ] : @401,
- @[
- @"iPhone10,3",
- @"iPhone10,6",
- @"iPhone11,2",
- @"iPhone11,4",
- @"iPhone11,6",
- @"iPhone12,3",
- @"iPhone12,5",
- ] : @458,
-};
DisplayServerIPhone *DisplayServerIPhone::get_singleton() {
return (DisplayServerIPhone *)DisplayServer::get_singleton();
@@ -383,8 +271,7 @@ void DisplayServerIPhone::update_gravity(float p_x, float p_y, float p_z) {
Input::get_singleton()->set_gravity(Vector3(p_x, p_y, p_z));
};
-void DisplayServerIPhone::update_accelerometer(float p_x, float p_y,
- float p_z) {
+void DisplayServerIPhone::update_accelerometer(float p_x, float p_y, float p_z) {
// Found out the Z should not be negated! Pass as is!
Vector3 v_accelerometer = Vector3(
p_x / kDisplayServerIPhoneAcceleration,
@@ -392,39 +279,6 @@ void DisplayServerIPhone::update_accelerometer(float p_x, float p_y,
p_z / kDisplayServerIPhoneAcceleration);
Input::get_singleton()->set_accelerometer(v_accelerometer);
-
- /*
- if (p_x != last_accel.x) {
- //printf("updating accel x %f\n", p_x);
- InputEvent ev;
- ev.type = InputEvent::JOYPAD_MOTION;
- ev.device = 0;
- ev.joy_motion.axis = JOY_ANALOG_0;
- ev.joy_motion.axis_value = (p_x / (float)ACCEL_RANGE);
- last_accel.x = p_x;
- queue_event(ev);
- };
- if (p_y != last_accel.y) {
- //printf("updating accel y %f\n", p_y);
- InputEvent ev;
- ev.type = InputEvent::JOYPAD_MOTION;
- ev.device = 0;
- ev.joy_motion.axis = JOY_ANALOG_1;
- ev.joy_motion.axis_value = (p_y / (float)ACCEL_RANGE);
- last_accel.y = p_y;
- queue_event(ev);
- };
- if (p_z != last_accel.z) {
- //printf("updating accel z %f\n", p_z);
- InputEvent ev;
- ev.type = InputEvent::JOYPAD_MOTION;
- ev.device = 0;
- ev.joy_motion.axis = JOY_ANALOG_2;
- ev.joy_motion.axis_value = ( (1.0 - p_z) / (float)ACCEL_RANGE);
- last_accel.z = p_z;
- queue_event(ev);
- };
- */
};
void DisplayServerIPhone::update_magnetometer(float p_x, float p_y, float p_z) {
@@ -516,6 +370,8 @@ int DisplayServerIPhone::screen_get_dpi(int p_screen) const {
NSString *string = [NSString stringWithCString:systemInfo.machine encoding:NSUTF8StringEncoding];
+ NSDictionary *iOSModelToDPI = [GodotDeviceMetrics dpiList];
+
for (NSArray *keyArray in iOSModelToDPI) {
if ([keyArray containsObject:string]) {
NSNumber *value = iOSModelToDPI[keyArray];
@@ -523,7 +379,26 @@ int DisplayServerIPhone::screen_get_dpi(int p_screen) const {
}
}
- return 163;
+ // If device wasn't found in dictionary
+ // make a best guess from device metrics.
+ CGFloat scale = [UIScreen mainScreen].scale;
+
+ UIUserInterfaceIdiom idiom = [UIDevice currentDevice].userInterfaceIdiom;
+
+ switch (idiom) {
+ case UIUserInterfaceIdiomPad:
+ return scale == 2 ? 264 : 132;
+ case UIUserInterfaceIdiomPhone: {
+ if (scale == 3) {
+ CGFloat nativeScale = [UIScreen mainScreen].nativeScale;
+ return nativeScale == 3 ? 458 : 401;
+ }
+
+ return 326;
+ }
+ default:
+ return 72;
+ }
}
float DisplayServerIPhone::screen_get_scale(int p_screen) const {
@@ -716,7 +591,7 @@ Error DisplayServerIPhone::native_video_play(String p_path, float p_volume, Stri
String file_path = ProjectSettings::get_singleton()->globalize_path(p_path);
- NSString *filePath = [[[NSString alloc] initWithUTF8String:file_path.utf8().get_data()] autorelease];
+ NSString *filePath = [[NSString alloc] initWithUTF8String:file_path.utf8().get_data()];
NSString *audioTrack = [NSString stringWithUTF8String:p_audio_track.utf8()];
NSString *subtitleTrack = [NSString stringWithUTF8String:p_subtitle_track.utf8()];
@@ -731,22 +606,22 @@ Error DisplayServerIPhone::native_video_play(String p_path, float p_volume, Stri
}
bool DisplayServerIPhone::native_video_is_playing() const {
- return [AppDelegate.viewController isVideoPlaying];
+ return [AppDelegate.viewController.videoView isVideoPlaying];
}
void DisplayServerIPhone::native_video_pause() {
if (native_video_is_playing()) {
- [AppDelegate.viewController pauseVideo];
+ [AppDelegate.viewController.videoView pauseVideo];
}
}
void DisplayServerIPhone::native_video_unpause() {
- [AppDelegate.viewController unpauseVideo];
+ [AppDelegate.viewController.videoView unpauseVideo];
};
void DisplayServerIPhone::native_video_stop() {
if (native_video_is_playing()) {
- [AppDelegate.viewController stopVideo];
+ [AppDelegate.viewController.videoView stopVideo];
}
}
diff --git a/platform/iphone/game_center.h b/platform/iphone/game_center.h
index 6705674ac6..10c8ef52fb 100644
--- a/platform/iphone/game_center.h
+++ b/platform/iphone/game_center.h
@@ -33,7 +33,7 @@
#ifndef GAME_CENTER_H
#define GAME_CENTER_H
-#include "core/object.h"
+#include "core/class_db.h"
class GameCenter : public Object {
GDCLASS(GameCenter, Object);
diff --git a/platform/iphone/game_center.mm b/platform/iphone/game_center.mm
index b237ba6bb6..0f8c0100c3 100644
--- a/platform/iphone/game_center.mm
+++ b/platform/iphone/game_center.mm
@@ -83,7 +83,12 @@ Error GameCenter::authenticate() {
// after the view is cancelled or the user logs in. Or if the user's already logged in, it's
// called just once to confirm they're authenticated. This is why no result needs to be specified
// in the presentViewController phase. In this case, more calls to this function will follow.
+ _weakify(root_controller);
+ _weakify(player);
player.authenticateHandler = (^(UIViewController *controller, NSError *error) {
+ _strongify(root_controller);
+ _strongify(player);
+
if (controller) {
[root_controller presentViewController:controller animated:YES completion:nil];
} else {
@@ -123,8 +128,8 @@ Error GameCenter::post_score(Dictionary p_score) {
float score = p_score["score"];
String category = p_score["category"];
- NSString *cat_str = [[[NSString alloc] initWithUTF8String:category.utf8().get_data()] autorelease];
- GKScore *reporter = [[[GKScore alloc] initWithLeaderboardIdentifier:cat_str] autorelease];
+ NSString *cat_str = [[NSString alloc] initWithUTF8String:category.utf8().get_data()];
+ GKScore *reporter = [[GKScore alloc] initWithLeaderboardIdentifier:cat_str];
reporter.value = score;
ERR_FAIL_COND_V([GKScore respondsToSelector:@selector(reportScores)], ERR_UNAVAILABLE);
@@ -152,8 +157,8 @@ Error GameCenter::award_achievement(Dictionary p_params) {
String name = p_params["name"];
float progress = p_params["progress"];
- NSString *name_str = [[[NSString alloc] initWithUTF8String:name.utf8().get_data()] autorelease];
- GKAchievement *achievement = [[[GKAchievement alloc] initWithIdentifier:name_str] autorelease];
+ NSString *name_str = [[NSString alloc] initWithUTF8String:name.utf8().get_data()];
+ GKAchievement *achievement = [[GKAchievement alloc] initWithIdentifier:name_str];
ERR_FAIL_COND_V(!achievement, FAILED);
ERR_FAIL_COND_V([GKAchievement respondsToSelector:@selector(reportAchievements)], ERR_UNAVAILABLE);
@@ -297,7 +302,7 @@ Error GameCenter::show_game_center(Dictionary p_params) {
}
}
- GKGameCenterViewController *controller = [[[GKGameCenterViewController alloc] init] autorelease];
+ GKGameCenterViewController *controller = [[GKGameCenterViewController alloc] init];
ERR_FAIL_COND_V(!controller, FAILED);
ViewController *root_controller = (ViewController *)((AppDelegate *)[[UIApplication sharedApplication] delegate]).window.rootViewController;
@@ -309,7 +314,7 @@ Error GameCenter::show_game_center(Dictionary p_params) {
controller.leaderboardIdentifier = nil;
if (p_params.has("leaderboard_name")) {
String name = p_params["leaderboard_name"];
- NSString *name_str = [[[NSString alloc] initWithUTF8String:name.utf8().get_data()] autorelease];
+ NSString *name_str = [[NSString alloc] initWithUTF8String:name.utf8().get_data()];
controller.leaderboardIdentifier = name_str;
}
}
diff --git a/platform/iphone/godot_iphone.mm b/platform/iphone/godot_iphone.mm
index 090b772947..6d95276f37 100644
--- a/platform/iphone/godot_iphone.mm
+++ b/platform/iphone/godot_iphone.mm
@@ -49,10 +49,8 @@ int add_path(int p_argc, char **p_args) {
}
p_args[p_argc++] = (char *)"--path";
- [str retain]; // memory leak lol (maybe make it static here and delete it in ViewController destructor? @todo
p_args[p_argc++] = (char *)[str cStringUsingEncoding:NSUTF8StringEncoding];
p_args[p_argc] = NULL;
- [str release];
return p_argc;
};
@@ -68,9 +66,7 @@ int add_cmdline(int p_argc, char **p_args) {
if (!str) {
continue;
}
- [str retain]; // @todo delete these at some point
p_args[p_argc++] = (char *)[str cStringUsingEncoding:NSUTF8StringEncoding];
- [str release];
};
p_args[p_argc] = NULL;
diff --git a/platform/iphone/godot_view.mm b/platform/iphone/godot_view.mm
index c0a31549c4..3b4344c46d 100644
--- a/platform/iphone/godot_view.mm
+++ b/platform/iphone/godot_view.mm
@@ -145,8 +145,6 @@ static const int max_touches = 8;
if (self.delayGestureRecognizer) {
self.delayGestureRecognizer = nil;
}
-
- [super dealloc];
}
- (void)godot_commonInit {
@@ -156,7 +154,7 @@ static const int max_touches = 8;
// Configure and start accelerometer
if (!self.motionManager) {
- self.motionManager = [[[CMMotionManager alloc] init] autorelease];
+ self.motionManager = [[CMMotionManager alloc] init];
if (self.motionManager.deviceMotionAvailable) {
self.motionManager.deviceMotionUpdateInterval = 1.0 / 70.0;
[self.motionManager startDeviceMotionUpdatesUsingReferenceFrame:CMAttitudeReferenceFrameXMagneticNorthZVertical];
@@ -169,7 +167,6 @@ static const int max_touches = 8;
GodotViewGestureRecognizer *gestureRecognizer = [[GodotViewGestureRecognizer alloc] init];
self.delayGestureRecognizer = gestureRecognizer;
[self addGestureRecognizer:self.delayGestureRecognizer];
- [gestureRecognizer release];
}
- (void)stopRendering {
@@ -204,14 +201,11 @@ static const int max_touches = 8;
if (self.useCADisplayLink) {
self.displayLink = [CADisplayLink displayLinkWithTarget:self selector:@selector(drawView)];
- // if (@available(iOS 10, *)) {
- self.displayLink.preferredFramesPerSecond = (NSInteger)(1.0 / self.renderingInterval);
- // } else {
- // // Approximate frame rate
- // // assumes device refreshes at 60 fps
- // int frameInterval = (int)floor(self.renderingInterval * 60.0f);
- // [self.displayLink setFrameInterval:frameInterval];
- // }
+ // Approximate frame rate
+ // assumes device refreshes at 60 fps
+ int displayFPS = (NSInteger)(1.0 / self.renderingInterval);
+
+ self.displayLink.preferredFramesPerSecond = displayFPS;
// Setup DisplayLink in main thread
[self.displayLink addToRunLoop:[NSRunLoop currentRunLoop] forMode:NSRunLoopCommonModes];
diff --git a/platform/iphone/godot_view_gesture_recognizer.mm b/platform/iphone/godot_view_gesture_recognizer.mm
index 99ee42ecb3..71367a629c 100644
--- a/platform/iphone/godot_view_gesture_recognizer.mm
+++ b/platform/iphone/godot_view_gesture_recognizer.mm
@@ -83,8 +83,6 @@ const CGFloat kGLGestureMovementDistance = 0.5;
if (self.delayedEvent) {
self.delayedEvent = nil;
}
-
- [super dealloc];
}
- (void)delayTouches:(NSSet *)touches andEvent:(UIEvent *)event {
@@ -116,7 +114,6 @@ const CGFloat kGLGestureMovementDistance = 0.5;
- (void)touchesBegan:(NSSet *)touches withEvent:(UIEvent *)event {
NSSet *cleared = [self copyClearedTouches:touches phase:UITouchPhaseBegan];
[self delayTouches:cleared andEvent:event];
- [cleared release];
}
- (void)touchesMoved:(NSSet *)touches withEvent:(UIEvent *)event {
@@ -137,17 +134,14 @@ const CGFloat kGLGestureMovementDistance = 0.5;
if (distance > kGLGestureMovementDistance) {
[self.delayTimer fire];
[self.view touchesMoved:cleared withEvent:event];
- [cleared release];
return;
}
}
- [cleared release];
return;
}
[self.view touchesMoved:cleared withEvent:event];
- [cleared release];
}
- (void)touchesEnded:(NSSet *)touches withEvent:(UIEvent *)event {
@@ -155,7 +149,6 @@ const CGFloat kGLGestureMovementDistance = 0.5;
NSSet *cleared = [self copyClearedTouches:touches phase:UITouchPhaseEnded];
[self.view touchesEnded:cleared withEvent:event];
- [cleared release];
}
- (void)touchesCancelled:(NSSet *)touches withEvent:(UIEvent *)event {
diff --git a/platform/iphone/icloud.h b/platform/iphone/icloud.h
index 381edfa718..6ca1e6594a 100644
--- a/platform/iphone/icloud.h
+++ b/platform/iphone/icloud.h
@@ -33,7 +33,7 @@
#ifndef ICLOUD_H
#define ICLOUD_H
-#include "core/object.h"
+#include "core/class_db.h"
class ICloud : public Object {
GDCLASS(ICloud, Object);
diff --git a/platform/iphone/icloud.mm b/platform/iphone/icloud.mm
index d3086e6cea..3d81349883 100644
--- a/platform/iphone/icloud.mm
+++ b/platform/iphone/icloud.mm
@@ -150,7 +150,7 @@ Variant nsobject_to_variant(NSObject *object) {
NSObject *variant_to_nsobject(Variant v) {
if (v.get_type() == Variant::STRING) {
- return [[[NSString alloc] initWithUTF8String:((String)v).utf8().get_data()] autorelease];
+ return [[NSString alloc] initWithUTF8String:((String)v).utf8().get_data()];
} else if (v.get_type() == Variant::FLOAT) {
return [NSNumber numberWithDouble:(double)v];
} else if (v.get_type() == Variant::INT) {
@@ -158,11 +158,11 @@ NSObject *variant_to_nsobject(Variant v) {
} else if (v.get_type() == Variant::BOOL) {
return [NSNumber numberWithBool:BOOL((bool)v)];
} else if (v.get_type() == Variant::DICTIONARY) {
- NSMutableDictionary *result = [[[NSMutableDictionary alloc] init] autorelease];
+ NSMutableDictionary *result = [[NSMutableDictionary alloc] init];
Dictionary dic = v;
Array keys = dic.keys();
for (int i = 0; i < keys.size(); ++i) {
- NSString *key = [[[NSString alloc] initWithUTF8String:((String)(keys[i])).utf8().get_data()] autorelease];
+ NSString *key = [[NSString alloc] initWithUTF8String:((String)(keys[i])).utf8().get_data()];
NSObject *value = variant_to_nsobject(dic[keys[i]]);
if (key == NULL || value == NULL) {
@@ -173,7 +173,7 @@ NSObject *variant_to_nsobject(Variant v) {
}
return result;
} else if (v.get_type() == Variant::ARRAY) {
- NSMutableArray *result = [[[NSMutableArray alloc] init] autorelease];
+ NSMutableArray *result = [[NSMutableArray alloc] init];
Array arr = v;
for (int i = 0; i < arr.size(); ++i) {
NSObject *value = variant_to_nsobject(arr[i]);
@@ -195,7 +195,7 @@ NSObject *variant_to_nsobject(Variant v) {
}
Error ICloud::remove_key(String p_param) {
- NSString *key = [[[NSString alloc] initWithUTF8String:p_param.utf8().get_data()] autorelease];
+ NSString *key = [[NSString alloc] initWithUTF8String:p_param.utf8().get_data()];
NSUbiquitousKeyValueStore *store = [NSUbiquitousKeyValueStore defaultStore];
@@ -217,7 +217,7 @@ Array ICloud::set_key_values(Dictionary p_params) {
String variant_key = keys[i];
Variant variant_value = p_params[variant_key];
- NSString *key = [[[NSString alloc] initWithUTF8String:variant_key.utf8().get_data()] autorelease];
+ NSString *key = [[NSString alloc] initWithUTF8String:variant_key.utf8().get_data()];
if (key == NULL) {
error_keys.push_back(variant_key);
continue;
@@ -238,7 +238,7 @@ Array ICloud::set_key_values(Dictionary p_params) {
}
Variant ICloud::get_key_value(String p_param) {
- NSString *key = [[[NSString alloc] initWithUTF8String:p_param.utf8().get_data()] autorelease];
+ NSString *key = [[NSString alloc] initWithUTF8String:p_param.utf8().get_data()];
NSUbiquitousKeyValueStore *store = [NSUbiquitousKeyValueStore defaultStore];
if (![[store dictionaryRepresentation] objectForKey:key]) {
diff --git a/platform/iphone/in_app_store.h b/platform/iphone/in_app_store.h
index beb58af2c7..ccf31876a9 100644
--- a/platform/iphone/in_app_store.h
+++ b/platform/iphone/in_app_store.h
@@ -33,7 +33,7 @@
#ifndef IN_APP_STORE_H
#define IN_APP_STORE_H
-#include "core/object.h"
+#include "core/class_db.h"
class InAppStore : public Object {
GDCLASS(InAppStore, Object);
diff --git a/platform/iphone/in_app_store.mm b/platform/iphone/in_app_store.mm
index 1477f92200..2b973dfbcf 100644
--- a/platform/iphone/in_app_store.mm
+++ b/platform/iphone/in_app_store.mm
@@ -56,7 +56,6 @@ static NSArray *latestProducts;
[numberFormatter setNumberStyle:NSNumberFormatterCurrencyStyle];
[numberFormatter setLocale:self.priceLocale];
NSString *formattedString = [numberFormatter stringFromNumber:self.price];
- [numberFormatter release];
return formattedString;
}
@@ -124,8 +123,6 @@ void InAppStore::_bind_methods() {
ret["invalid_ids"] = invalid_ids;
InAppStore::get_singleton()->_post_event(ret);
-
- [request release];
};
@end
@@ -136,14 +133,14 @@ Error InAppStore::request_product_info(Dictionary p_params) {
PackedStringArray pids = p_params["product_ids"];
printf("************ request product info! %i\n", pids.size());
- NSMutableArray *array = [[[NSMutableArray alloc] initWithCapacity:pids.size()] autorelease];
+ NSMutableArray *array = [[NSMutableArray alloc] initWithCapacity:pids.size()];
for (int i = 0; i < pids.size(); i++) {
printf("******** adding %s to product list\n", pids[i].utf8().get_data());
- NSString *pid = [[[NSString alloc] initWithUTF8String:pids[i].utf8().get_data()] autorelease];
+ NSString *pid = [[NSString alloc] initWithUTF8String:pids[i].utf8().get_data()];
[array addObject:pid];
};
- NSSet *products = [[[NSSet alloc] initWithArray:array] autorelease];
+ NSSet *products = [[NSSet alloc] initWithArray:array];
SKProductsRequest *request = [[SKProductsRequest alloc] initWithProductIdentifiers:products];
ProductsDelegate *delegate = [[ProductsDelegate alloc] init];
@@ -183,30 +180,14 @@ Error InAppStore::restore_purchases() {
ret["transaction_id"] = transactionId;
NSData *receipt = nil;
- int sdk_version = 6;
-
- if ([[[UIDevice currentDevice] systemVersion] floatValue] >= 7.0) {
- NSURL *receiptFileURL = nil;
- NSBundle *bundle = [NSBundle mainBundle];
- if ([bundle respondsToSelector:@selector(appStoreReceiptURL)]) {
- // Get the transaction receipt file path location in the app bundle.
- receiptFileURL = [bundle appStoreReceiptURL];
-
- // Read in the contents of the transaction file.
- receipt = [NSData dataWithContentsOfURL:receiptFileURL];
- sdk_version = 7;
+ int sdk_version = [[[UIDevice currentDevice] systemVersion] intValue];
- } else {
- // Fall back to deprecated transaction receipt,
- // which is still available in iOS 7.
+ NSBundle *bundle = [NSBundle mainBundle];
+ // Get the transaction receipt file path location in the app bundle.
+ NSURL *receiptFileURL = [bundle appStoreReceiptURL];
- // Use SKPaymentTransaction's transactionReceipt.
- receipt = [NSData dataWithContentsOfURL:[[NSBundle mainBundle] appStoreReceiptURL]];
- }
-
- } else {
- receipt = [NSData dataWithContentsOfURL:[[NSBundle mainBundle] appStoreReceiptURL]];
- }
+ // Read in the contents of the transaction file.
+ receipt = [NSData dataWithContentsOfURL:receiptFileURL];
NSString *receipt_to_send = nil;
if (receipt != nil) {
@@ -265,7 +246,7 @@ Error InAppStore::purchase(Dictionary p_params) {
printf("purchasing!\n");
ERR_FAIL_COND_V(!p_params.has("product_id"), ERR_INVALID_PARAMETER);
- NSString *pid = [[[NSString alloc] initWithUTF8String:String(p_params["product_id"]).utf8().get_data()] autorelease];
+ NSString *pid = [[NSString alloc] initWithUTF8String:String(p_params["product_id"]).utf8().get_data()];
SKProduct *product = nil;
@@ -307,7 +288,7 @@ void InAppStore::_post_event(Variant p_event) {
void InAppStore::_record_purchase(String product_id) {
String skey = "purchased/" + product_id;
- NSString *key = [[[NSString alloc] initWithUTF8String:skey.utf8().get_data()] autorelease];
+ NSString *key = [[NSString alloc] initWithUTF8String:skey.utf8().get_data()];
[[NSUserDefaults standardUserDefaults] setBool:YES forKey:key];
[[NSUserDefaults standardUserDefaults] synchronize];
};
diff --git a/platform/iphone/ios.h b/platform/iphone/ios.h
index 2b29e6f268..6a89cd38cb 100644
--- a/platform/iphone/ios.h
+++ b/platform/iphone/ios.h
@@ -31,7 +31,7 @@
#ifndef IOS_H
#define IOS_H
-#include "core/object.h"
+#include "core/class_db.h"
class iOS : public Object {
GDCLASS(iOS, Object);
diff --git a/platform/iphone/ios.mm b/platform/iphone/ios.mm
index 6d7699c0c9..d4e099063f 100644
--- a/platform/iphone/ios.mm
+++ b/platform/iphone/ios.mm
@@ -30,6 +30,7 @@
#include "ios.h"
#import "app_delegate.h"
+#import "view_controller.h"
#import <UIKit/UIKit.h>
#include <sys/sysctl.h>
@@ -68,23 +69,9 @@ String iOS::get_model() const {
}
String iOS::get_rate_url(int p_app_id) const {
- String templ = "itms-apps://ax.itunes.apple.com/WebObjects/MZStore.woa/wa/viewContentsUserReviews?type=Purple+Software&id=APP_ID";
- String templ_iOS7 = "itms-apps://itunes.apple.com/app/idAPP_ID";
- String templ_iOS8 = "itms-apps://itunes.apple.com/WebObjects/MZStore.woa/wa/viewContentsUserReviews?id=APP_ID&onlyLatestVersion=true&pageNumber=0&sortOrdering=1&type=Purple+Software";
+ String app_url_path = "itms-apps://itunes.apple.com/app/idAPP_ID";
- //ios7 before
- String ret = templ;
-
- if ([[[UIDevice currentDevice] systemVersion] floatValue] >= 7.0 && [[[UIDevice currentDevice] systemVersion] floatValue] < 7.1) {
- // iOS 7 needs a different templateReviewURL @see https://github.com/arashpayan/appirater/issues/131
- ret = templ_iOS7;
- } else if ([[[UIDevice currentDevice] systemVersion] floatValue] >= 8.0) {
- // iOS 8 needs a different templateReviewURL also @see https://github.com/arashpayan/appirater/issues/182
- ret = templ_iOS8;
- }
-
- // ios7 for everything?
- ret = templ_iOS7.replace("APP_ID", String::num(p_app_id));
+ String ret = app_url_path.replace("APP_ID", String::num(p_app_id));
printf("returning rate url %s\n", ret.utf8().get_data());
return ret;
diff --git a/platform/iphone/joypad_iphone.mm b/platform/iphone/joypad_iphone.mm
index 6088f1c25c..b0a8076b56 100644
--- a/platform/iphone/joypad_iphone.mm
+++ b/platform/iphone/joypad_iphone.mm
@@ -131,8 +131,6 @@ void JoypadIPhone::start_processing() {
- (void)dealloc {
[self finishObserving];
-
- [super dealloc];
}
- (int)getJoyIdForController:(GCController *)controller {
@@ -251,8 +249,13 @@ void JoypadIPhone::start_processing() {
// The extended gamepad profile has all the input you could possibly find on
// a gamepad but will only be active if your gamepad actually has all of
// these...
- controller.extendedGamepad.valueChangedHandler = ^(
- GCExtendedGamepad *gamepad, GCControllerElement *element) {
+ _weakify(self);
+ _weakify(controller);
+
+ controller.extendedGamepad.valueChangedHandler = ^(GCExtendedGamepad *gamepad, GCControllerElement *element) {
+ _strongify(self);
+ _strongify(controller);
+
int joy_id = [self getJoyIdForController:controller];
if (element == gamepad.buttonA) {
@@ -304,71 +307,33 @@ void JoypadIPhone::start_processing() {
Input::get_singleton()->joy_axis(joy_id, JOY_AXIS_TRIGGER_RIGHT, jx);
};
};
+ } else if (controller.microGamepad != nil) {
+ // micro gamepads were added in OS 9 and feature just 2 buttons and a d-pad
+ _weakify(self);
+ _weakify(controller);
+
+ controller.microGamepad.valueChangedHandler = ^(GCMicroGamepad *gamepad, GCControllerElement *element) {
+ _strongify(self);
+ _strongify(controller);
+
+ int joy_id = [self getJoyIdForController:controller];
+
+ if (element == gamepad.buttonA) {
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_A,
+ gamepad.buttonA.isPressed);
+ } else if (element == gamepad.buttonX) {
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_X,
+ gamepad.buttonX.isPressed);
+ } else if (element == gamepad.dpad) {
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_UP,
+ gamepad.dpad.up.isPressed);
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_DOWN,
+ gamepad.dpad.down.isPressed);
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_LEFT, gamepad.dpad.left.isPressed);
+ Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_RIGHT, gamepad.dpad.right.isPressed);
+ };
+ };
}
- // else if (controller.gamepad != nil) {
- // // gamepad is the standard profile with 4 buttons, shoulder buttons and a
- // // D-pad
- // controller.gamepad.valueChangedHandler = ^(GCGamepad *gamepad,
- // GCControllerElement *element) {
- // int joy_id = [self getJoyIdForController:controller];
- //
- // if (element == gamepad.buttonA) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_A,
- // gamepad.buttonA.isPressed);
- // } else if (element == gamepad.buttonB) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_B,
- // gamepad.buttonB.isPressed);
- // } else if (element == gamepad.buttonX) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_X,
- // gamepad.buttonX.isPressed);
- // } else if (element == gamepad.buttonY) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_Y,
- // gamepad.buttonY.isPressed);
- // } else if (element == gamepad.leftShoulder) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_LEFT_SHOULDER,
- // gamepad.leftShoulder.isPressed);
- // } else if (element == gamepad.rightShoulder) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_RIGHT_SHOULDER,
- // gamepad.rightShoulder.isPressed);
- // } else if (element == gamepad.dpad) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_UP,
- // gamepad.dpad.up.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_DOWN,
- // gamepad.dpad.down.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_LEFT,
- // gamepad.dpad.left.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_RIGHT,
- // gamepad.dpad.right.isPressed);
- // };
- // };
- //#ifdef ADD_MICRO_GAMEPAD // disabling this for now, only available on iOS 9+,
- // // while we are setting that as the minimum, seems our
- // // build environment doesn't like it
- // } else if (controller.microGamepad != nil) {
- // // micro gamepads were added in OS 9 and feature just 2 buttons and a d-pad
- // controller.microGamepad.valueChangedHandler =
- // ^(GCMicroGamepad *gamepad, GCControllerElement *element) {
- // int joy_id = [self getJoyIdForController:controller];
- //
- // if (element == gamepad.buttonA) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_A,
- // gamepad.buttonA.isPressed);
- // } else if (element == gamepad.buttonX) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_X,
- // gamepad.buttonX.isPressed);
- // } else if (element == gamepad.dpad) {
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_UP,
- // gamepad.dpad.up.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_DOWN,
- // gamepad.dpad.down.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_LEFT,
- // gamepad.dpad.left.isPressed);
- // Input::get_singleton()->joy_button(joy_id, JOY_BUTTON_DPAD_RIGHT,
- // gamepad.dpad.right.isPressed);
- // };
- // };
- //#endif
- // };
///@TODO need to add support for controller.motion which gives us access to
/// the orientation of the device (if supported)
diff --git a/platform/iphone/native_video_view.h b/platform/iphone/native_video_view.h
new file mode 100644
index 0000000000..d8687b3538
--- /dev/null
+++ b/platform/iphone/native_video_view.h
@@ -0,0 +1,41 @@
+/*************************************************************************/
+/* native_video_view.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#import <UIKit/UIKit.h>
+
+@interface GodotNativeVideoView : UIView
+
+- (BOOL)playVideoAtPath:(NSString *)filePath volume:(float)videoVolume audio:(NSString *)audioTrack subtitle:(NSString *)subtitleTrack;
+- (BOOL)isVideoPlaying;
+- (void)pauseVideo;
+- (void)unpauseVideo;
+- (void)stopVideo;
+
+@end
diff --git a/platform/iphone/native_video_view.m b/platform/iphone/native_video_view.m
new file mode 100644
index 0000000000..a4e9f209f0
--- /dev/null
+++ b/platform/iphone/native_video_view.m
@@ -0,0 +1,260 @@
+/*************************************************************************/
+/* native_video_view.m */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#import "native_video_view.h"
+#import <AVFoundation/AVFoundation.h>
+
+@interface GodotNativeVideoView ()
+
+@property(strong, nonatomic) AVAsset *avAsset;
+@property(strong, nonatomic) AVPlayerItem *avPlayerItem;
+@property(strong, nonatomic) AVPlayer *avPlayer;
+@property(strong, nonatomic) AVPlayerLayer *avPlayerLayer;
+@property(assign, nonatomic) CMTime videoCurrentTime;
+@property(assign, nonatomic) BOOL isVideoCurrentlyPlaying;
+
+@end
+
+@implementation GodotNativeVideoView
+
+- (instancetype)initWithFrame:(CGRect)frame {
+ self = [super initWithFrame:frame];
+
+ if (self) {
+ [self godot_commonInit];
+ }
+
+ return self;
+}
+
+- (instancetype)initWithCoder:(NSCoder *)coder {
+ self = [super initWithCoder:coder];
+
+ if (self) {
+ [self godot_commonInit];
+ }
+
+ return self;
+}
+
+- (void)godot_commonInit {
+ self.isVideoCurrentlyPlaying = NO;
+ self.videoCurrentTime = kCMTimeZero;
+
+ [self observeVideoAudio];
+}
+
+- (void)observeVideoAudio {
+ printf("******** adding observer for sound routing changes\n");
+ [[NSNotificationCenter defaultCenter]
+ addObserver:self
+ selector:@selector(audioRouteChangeListenerCallback:)
+ name:AVAudioSessionRouteChangeNotification
+ object:nil];
+}
+
+- (void)observeValueForKeyPath:(NSString *)keyPath ofObject:(id)object change:(NSDictionary *)change context:(void *)context {
+ if (object == self.avPlayerItem && [keyPath isEqualToString:@"status"]) {
+ [self handleVideoOrPlayerStatus];
+ }
+
+ if (object == self.avPlayer && [keyPath isEqualToString:@"rate"]) {
+ [self handleVideoPlayRate];
+ }
+}
+
+// MARK: Video Audio
+
+- (void)audioRouteChangeListenerCallback:(NSNotification *)notification {
+ printf("*********** route changed!\n");
+ NSDictionary *interuptionDict = notification.userInfo;
+
+ NSInteger routeChangeReason = [[interuptionDict valueForKey:AVAudioSessionRouteChangeReasonKey] integerValue];
+
+ switch (routeChangeReason) {
+ case AVAudioSessionRouteChangeReasonNewDeviceAvailable: {
+ NSLog(@"AVAudioSessionRouteChangeReasonNewDeviceAvailable");
+ NSLog(@"Headphone/Line plugged in");
+ } break;
+ case AVAudioSessionRouteChangeReasonOldDeviceUnavailable: {
+ NSLog(@"AVAudioSessionRouteChangeReasonOldDeviceUnavailable");
+ NSLog(@"Headphone/Line was pulled. Resuming video play....");
+ if ([self isVideoPlaying]) {
+ dispatch_after(dispatch_time(DISPATCH_TIME_NOW, 0.5f * NSEC_PER_SEC), dispatch_get_main_queue(), ^{
+ [self.avPlayer play]; // NOTE: change this line according your current player implementation
+ NSLog(@"resumed play");
+ });
+ }
+ } break;
+ case AVAudioSessionRouteChangeReasonCategoryChange: {
+ // called at start - also when other audio wants to play
+ NSLog(@"AVAudioSessionRouteChangeReasonCategoryChange");
+ } break;
+ }
+}
+
+// MARK: Native Video Player
+
+- (void)handleVideoOrPlayerStatus {
+ if (self.avPlayerItem.status == AVPlayerItemStatusFailed || self.avPlayer.status == AVPlayerStatusFailed) {
+ [self stopVideo];
+ }
+
+ if (self.avPlayer.status == AVPlayerStatusReadyToPlay && self.avPlayerItem.status == AVPlayerItemStatusReadyToPlay && CMTimeCompare(self.videoCurrentTime, kCMTimeZero) == 0) {
+ // NSLog(@"time: %@", self.video_current_time);
+ [self.avPlayer seekToTime:self.videoCurrentTime];
+ self.videoCurrentTime = kCMTimeZero;
+ }
+}
+
+- (void)handleVideoPlayRate {
+ NSLog(@"Player playback rate changed: %.5f", self.avPlayer.rate);
+ if ([self isVideoPlaying] && self.avPlayer.rate == 0.0 && !self.avPlayer.error) {
+ dispatch_after(dispatch_time(DISPATCH_TIME_NOW, 0.5f * NSEC_PER_SEC), dispatch_get_main_queue(), ^{
+ [self.avPlayer play]; // NOTE: change this line according your current player implementation
+ NSLog(@"resumed play");
+ });
+
+ NSLog(@" . . . PAUSED (or just started)");
+ }
+}
+
+- (BOOL)playVideoAtPath:(NSString *)filePath volume:(float)videoVolume audio:(NSString *)audioTrack subtitle:(NSString *)subtitleTrack {
+ self.avAsset = [AVAsset assetWithURL:[NSURL fileURLWithPath:filePath]];
+
+ self.avPlayerItem = [AVPlayerItem playerItemWithAsset:self.avAsset];
+ [self.avPlayerItem addObserver:self forKeyPath:@"status" options:0 context:nil];
+
+ self.avPlayer = [AVPlayer playerWithPlayerItem:self.avPlayerItem];
+ self.avPlayerLayer = [AVPlayerLayer playerLayerWithPlayer:self.avPlayer];
+
+ [self.avPlayer addObserver:self forKeyPath:@"status" options:0 context:nil];
+ [[NSNotificationCenter defaultCenter]
+ addObserver:self
+ selector:@selector(playerItemDidReachEnd:)
+ name:AVPlayerItemDidPlayToEndTimeNotification
+ object:[self.avPlayer currentItem]];
+
+ [self.avPlayer addObserver:self forKeyPath:@"rate" options:NSKeyValueObservingOptionNew context:0];
+
+ [self.avPlayerLayer setFrame:self.bounds];
+ [self.layer addSublayer:self.avPlayerLayer];
+ [self.avPlayer play];
+
+ AVMediaSelectionGroup *audioGroup = [self.avAsset mediaSelectionGroupForMediaCharacteristic:AVMediaCharacteristicAudible];
+
+ NSMutableArray *allAudioParams = [NSMutableArray array];
+ for (id track in audioGroup.options) {
+ NSString *language = [[track locale] localeIdentifier];
+ NSLog(@"subtitle lang: %@", language);
+
+ if ([language isEqualToString:audioTrack]) {
+ AVMutableAudioMixInputParameters *audioInputParams = [AVMutableAudioMixInputParameters audioMixInputParameters];
+ [audioInputParams setVolume:videoVolume atTime:kCMTimeZero];
+ [audioInputParams setTrackID:[track trackID]];
+ [allAudioParams addObject:audioInputParams];
+
+ AVMutableAudioMix *audioMix = [AVMutableAudioMix audioMix];
+ [audioMix setInputParameters:allAudioParams];
+
+ [self.avPlayer.currentItem selectMediaOption:track inMediaSelectionGroup:audioGroup];
+ [self.avPlayer.currentItem setAudioMix:audioMix];
+
+ break;
+ }
+ }
+
+ AVMediaSelectionGroup *subtitlesGroup = [self.avAsset mediaSelectionGroupForMediaCharacteristic:AVMediaCharacteristicLegible];
+ NSArray *useableTracks = [AVMediaSelectionGroup mediaSelectionOptionsFromArray:subtitlesGroup.options withoutMediaCharacteristics:[NSArray arrayWithObject:AVMediaCharacteristicContainsOnlyForcedSubtitles]];
+
+ for (id track in useableTracks) {
+ NSString *language = [[track locale] localeIdentifier];
+ NSLog(@"subtitle lang: %@", language);
+
+ if ([language isEqualToString:subtitleTrack]) {
+ [self.avPlayer.currentItem selectMediaOption:track inMediaSelectionGroup:subtitlesGroup];
+ break;
+ }
+ }
+
+ self.isVideoCurrentlyPlaying = YES;
+
+ return true;
+}
+
+- (BOOL)isVideoPlaying {
+ if (self.avPlayer.error) {
+ printf("Error during playback\n");
+ }
+ return (self.avPlayer.rate > 0 && !self.avPlayer.error);
+}
+
+- (void)pauseVideo {
+ self.videoCurrentTime = self.avPlayer.currentTime;
+ [self.avPlayer pause];
+ self.isVideoCurrentlyPlaying = NO;
+}
+
+- (void)unpauseVideo {
+ [self.avPlayer play];
+ self.isVideoCurrentlyPlaying = YES;
+}
+
+- (void)playerItemDidReachEnd:(NSNotification *)notification {
+ [self stopVideo];
+}
+
+- (void)finishPlayingVideo {
+ [self.avPlayer pause];
+ [self.avPlayerLayer removeFromSuperlayer];
+ self.avPlayerLayer = nil;
+
+ if (self.avPlayerItem) {
+ [self.avPlayerItem removeObserver:self forKeyPath:@"status"];
+ self.avPlayerItem = nil;
+ }
+
+ if (self.avPlayer) {
+ [self.avPlayer removeObserver:self forKeyPath:@"status"];
+ self.avPlayer = nil;
+ }
+
+ self.avAsset = nil;
+
+ self.isVideoCurrentlyPlaying = NO;
+}
+
+- (void)stopVideo {
+ [self finishPlayingVideo];
+
+ [self removeFromSuperview];
+}
+
+@end
diff --git a/platform/iphone/os_iphone.mm b/platform/iphone/os_iphone.mm
index 5baa5b66fc..e007276b4b 100644
--- a/platform/iphone/os_iphone.mm
+++ b/platform/iphone/os_iphone.mm
@@ -271,7 +271,6 @@ String OSIPhone::get_model_name() const {
Error OSIPhone::shell_open(String p_uri) {
NSString *urlPath = [[NSString alloc] initWithUTF8String:p_uri.utf8().get_data()];
NSURL *url = [NSURL URLWithString:urlPath];
- [urlPath release];
if (![[UIApplication sharedApplication] canOpenURL:url]) {
return ERR_CANT_OPEN;
@@ -279,11 +278,7 @@ Error OSIPhone::shell_open(String p_uri) {
printf("opening url %s\n", p_uri.utf8().get_data());
- // if (@available(iOS 10, *)) {
[[UIApplication sharedApplication] openURL:url options:@{} completionHandler:nil];
- // } else {
- // [[UIApplication sharedApplication] openURL:url];
- // }
return OK;
};
diff --git a/platform/iphone/platform_config.h b/platform/iphone/platform_config.h
index 2bbbe47c0d..ec39ad0ba4 100644
--- a/platform/iphone/platform_config.h
+++ b/platform/iphone/platform_config.h
@@ -33,3 +33,10 @@
#define PLATFORM_REFCOUNT
#define PTHREAD_RENAME_SELF
+
+#define _weakify(var) __weak typeof(var) GDWeak_##var = var;
+#define _strongify(var) \
+ _Pragma("clang diagnostic push") \
+ _Pragma("clang diagnostic ignored \"-Wshadow\"") \
+ __strong typeof(var) var = GDWeak_##var; \
+ _Pragma("clang diagnostic pop")
diff --git a/platform/iphone/view_controller.h b/platform/iphone/view_controller.h
index dffdc01d4a..b0b31ae377 100644
--- a/platform/iphone/view_controller.h
+++ b/platform/iphone/view_controller.h
@@ -32,17 +32,15 @@
#import <UIKit/UIKit.h>
@class GodotView;
+@class GodotNativeVideoView;
@interface ViewController : UIViewController <GKGameCenterControllerDelegate>
-- (GodotView *)godotView;
+@property(nonatomic, readonly, strong) GodotView *godotView;
+@property(nonatomic, readonly, strong) GodotNativeVideoView *videoView;
// MARK: Native Video Player
- (BOOL)playVideoAtPath:(NSString *)filePath volume:(float)videoVolume audio:(NSString *)audioTrack subtitle:(NSString *)subtitleTrack;
-- (BOOL)isVideoPlaying;
-- (void)pauseVideo;
-- (void)unpauseVideo;
-- (void)stopVideo;
@end
diff --git a/platform/iphone/view_controller.mm b/platform/iphone/view_controller.mm
index 31597f7856..fb25041779 100644
--- a/platform/iphone/view_controller.mm
+++ b/platform/iphone/view_controller.mm
@@ -33,6 +33,7 @@
#include "display_server_iphone.h"
#import "godot_view.h"
#import "godot_view_renderer.h"
+#import "native_video_view.h"
#include "os_iphone.h"
#import <GameController/GameController.h>
@@ -40,16 +41,7 @@
@interface ViewController ()
@property(strong, nonatomic) GodotViewRenderer *renderer;
-
-// TODO: separate view to handle video
-// AVPlayer-related properties
-@property(strong, nonatomic) AVAsset *avAsset;
-@property(strong, nonatomic) AVPlayerItem *avPlayerItem;
-@property(strong, nonatomic) AVPlayer *avPlayer;
-@property(strong, nonatomic) AVPlayerLayer *avPlayerLayer;
-@property(assign, nonatomic) CMTime videoCurrentTime;
-@property(assign, nonatomic) BOOL isVideoCurrentlyPlaying;
-@property(assign, nonatomic) BOOL videoHasFoundError;
+@property(strong, nonatomic) GodotNativeVideoView *videoView;
@end
@@ -67,9 +59,6 @@
self.view = view;
view.renderer = self.renderer;
-
- [renderer release];
- [view release];
}
- (instancetype)initWithNibName:(NSString *)nibNameOrNil bundle:(NSBundle *)nibBundleOrNil {
@@ -93,9 +82,7 @@
}
- (void)godot_commonInit {
- self.isVideoCurrentlyPlaying = NO;
- self.videoCurrentTime = kCMTimeZero;
- self.videoHasFoundError = false;
+ // Initialize view controller values.
}
- (void)didReceiveMemoryWarning {
@@ -107,7 +94,6 @@
[super viewDidLoad];
[self observeKeyboard];
- [self observeAudio];
if (@available(iOS 11.0, *)) {
[self setNeedsUpdateOfScreenEdgesDeferringSystemGestures];
@@ -128,33 +114,13 @@
object:nil];
}
-- (void)observeAudio {
- printf("******** adding observer for sound routing changes\n");
- [[NSNotificationCenter defaultCenter]
- addObserver:self
- selector:@selector(audioRouteChangeListenerCallback:)
- name:AVAudioSessionRouteChangeNotification
- object:nil];
-}
-
-- (void)observeValueForKeyPath:(NSString *)keyPath ofObject:(id)object change:(NSDictionary *)change context:(void *)context {
- if (object == self.avPlayerItem && [keyPath isEqualToString:@"status"]) {
- [self handleVideoOrPlayerStatus];
- }
-
- if (object == self.avPlayer && [keyPath isEqualToString:@"rate"]) {
- [self handleVideoPlayRate];
- }
-}
-
- (void)dealloc {
- [self stopVideo];
+ [self.videoView stopVideo];
+ self.videoView = nil;
self.renderer = nil;
[[NSNotificationCenter defaultCenter] removeObserver:self];
-
- [super dealloc];
}
// MARK: Orientation
@@ -233,166 +199,19 @@
}
}
-// MARK: Audio
-
-- (void)audioRouteChangeListenerCallback:(NSNotification *)notification {
- printf("*********** route changed!\n");
- NSDictionary *interuptionDict = notification.userInfo;
-
- NSInteger routeChangeReason = [[interuptionDict valueForKey:AVAudioSessionRouteChangeReasonKey] integerValue];
-
- switch (routeChangeReason) {
- case AVAudioSessionRouteChangeReasonNewDeviceAvailable: {
- NSLog(@"AVAudioSessionRouteChangeReasonNewDeviceAvailable");
- NSLog(@"Headphone/Line plugged in");
- } break;
- case AVAudioSessionRouteChangeReasonOldDeviceUnavailable: {
- NSLog(@"AVAudioSessionRouteChangeReasonOldDeviceUnavailable");
- NSLog(@"Headphone/Line was pulled. Resuming video play....");
- if ([self isVideoPlaying]) {
- dispatch_after(dispatch_time(DISPATCH_TIME_NOW, 0.5f * NSEC_PER_SEC), dispatch_get_main_queue(), ^{
- [self.avPlayer play]; // NOTE: change this line according your current player implementation
- NSLog(@"resumed play");
- });
- }
- } break;
- case AVAudioSessionRouteChangeReasonCategoryChange: {
- // called at start - also when other audio wants to play
- NSLog(@"AVAudioSessionRouteChangeReasonCategoryChange");
- } break;
- }
-}
-
// MARK: Native Video Player
-- (void)handleVideoOrPlayerStatus {
- if (self.avPlayerItem.status == AVPlayerItemStatusFailed || self.avPlayer.status == AVPlayerStatusFailed) {
- [self stopVideo];
- self.videoHasFoundError = true;
- }
-
- if (self.avPlayer.status == AVPlayerStatusReadyToPlay && self.avPlayerItem.status == AVPlayerItemStatusReadyToPlay && CMTimeCompare(self.videoCurrentTime, kCMTimeZero) == 0) {
- // NSLog(@"time: %@", self.video_current_time);
- [self.avPlayer seekToTime:self.videoCurrentTime];
- self.videoCurrentTime = kCMTimeZero;
- }
-}
-
-- (void)handleVideoPlayRate {
- NSLog(@"Player playback rate changed: %.5f", self.avPlayer.rate);
- if ([self isVideoPlaying] && self.avPlayer.rate == 0.0 && !self.avPlayer.error) {
- dispatch_after(dispatch_time(DISPATCH_TIME_NOW, 0.5f * NSEC_PER_SEC), dispatch_get_main_queue(), ^{
- [self.avPlayer play]; // NOTE: change this line according your current player implementation
- NSLog(@"resumed play");
- });
-
- NSLog(@" . . . PAUSED (or just started)");
- }
-}
-
- (BOOL)playVideoAtPath:(NSString *)filePath volume:(float)videoVolume audio:(NSString *)audioTrack subtitle:(NSString *)subtitleTrack {
- self.avAsset = [AVAsset assetWithURL:[NSURL fileURLWithPath:filePath]];
-
- self.avPlayerItem = [AVPlayerItem playerItemWithAsset:self.avAsset];
- [self.avPlayerItem addObserver:self forKeyPath:@"status" options:0 context:nil];
-
- self.avPlayer = [AVPlayer playerWithPlayerItem:self.avPlayerItem];
- self.avPlayerLayer = [AVPlayerLayer playerLayerWithPlayer:self.avPlayer];
-
- [self.avPlayer addObserver:self forKeyPath:@"status" options:0 context:nil];
- [[NSNotificationCenter defaultCenter]
- addObserver:self
- selector:@selector(playerItemDidReachEnd:)
- name:AVPlayerItemDidPlayToEndTimeNotification
- object:[self.avPlayer currentItem]];
-
- [self.avPlayer addObserver:self forKeyPath:@"rate" options:NSKeyValueObservingOptionNew context:0];
-
- [self.avPlayerLayer setFrame:self.view.bounds];
- [self.view.layer addSublayer:self.avPlayerLayer];
- [self.avPlayer play];
-
- AVMediaSelectionGroup *audioGroup = [self.avAsset mediaSelectionGroupForMediaCharacteristic:AVMediaCharacteristicAudible];
-
- NSMutableArray *allAudioParams = [NSMutableArray array];
- for (id track in audioGroup.options) {
- NSString *language = [[track locale] localeIdentifier];
- NSLog(@"subtitle lang: %@", language);
-
- if ([language isEqualToString:audioTrack]) {
- AVMutableAudioMixInputParameters *audioInputParams = [AVMutableAudioMixInputParameters audioMixInputParameters];
- [audioInputParams setVolume:videoVolume atTime:kCMTimeZero];
- [audioInputParams setTrackID:[track trackID]];
- [allAudioParams addObject:audioInputParams];
-
- AVMutableAudioMix *audioMix = [AVMutableAudioMix audioMix];
- [audioMix setInputParameters:allAudioParams];
-
- [self.avPlayer.currentItem selectMediaOption:track inMediaSelectionGroup:audioGroup];
- [self.avPlayer.currentItem setAudioMix:audioMix];
-
- break;
- }
- }
-
- AVMediaSelectionGroup *subtitlesGroup = [self.avAsset mediaSelectionGroupForMediaCharacteristic:AVMediaCharacteristicLegible];
- NSArray *useableTracks = [AVMediaSelectionGroup mediaSelectionOptionsFromArray:subtitlesGroup.options withoutMediaCharacteristics:[NSArray arrayWithObject:AVMediaCharacteristicContainsOnlyForcedSubtitles]];
-
- for (id track in useableTracks) {
- NSString *language = [[track locale] localeIdentifier];
- NSLog(@"subtitle lang: %@", language);
-
- if ([language isEqualToString:subtitleTrack]) {
- [self.avPlayer.currentItem selectMediaOption:track inMediaSelectionGroup:subtitlesGroup];
- break;
- }
- }
-
- self.isVideoCurrentlyPlaying = YES;
-
- return true;
-}
-
-- (BOOL)isVideoPlaying {
- if (self.avPlayer.error) {
- printf("Error during playback\n");
- }
- return (self.avPlayer.rate > 0 && !self.avPlayer.error);
-}
-
-- (void)pauseVideo {
- self.videoCurrentTime = self.avPlayer.currentTime;
- [self.avPlayer pause];
- self.isVideoCurrentlyPlaying = NO;
-}
-
-- (void)unpauseVideo {
- [self.avPlayer play];
- self.isVideoCurrentlyPlaying = YES;
-}
-
-- (void)playerItemDidReachEnd:(NSNotification *)notification {
- [self stopVideo];
-}
-
-- (void)stopVideo {
- [self.avPlayer pause];
- [self.avPlayerLayer removeFromSuperlayer];
- self.avPlayerLayer = nil;
-
- if (self.avPlayerItem) {
- [self.avPlayerItem removeObserver:self forKeyPath:@"status"];
- self.avPlayerItem = nil;
- }
-
- if (self.avPlayer) {
- [self.avPlayer removeObserver:self forKeyPath:@"status"];
- self.avPlayer = nil;
+ // If we are showing some video already, reuse existing view for new video.
+ if (self.videoView) {
+ return [self.videoView playVideoAtPath:filePath volume:videoVolume audio:audioTrack subtitle:subtitleTrack];
+ } else {
+ // Create autoresizing view for video playback.
+ GodotNativeVideoView *videoView = [[GodotNativeVideoView alloc] initWithFrame:self.view.bounds];
+ videoView.autoresizingMask = UIViewAutoresizingFlexibleWidth & UIViewAutoresizingFlexibleHeight;
+ [self.view addSubview:videoView];
+ return [self.videoView playVideoAtPath:filePath volume:videoVolume audio:audioTrack subtitle:subtitleTrack];
}
-
- self.avAsset = nil;
-
- self.isVideoCurrentlyPlaying = NO;
}
// MARK: Delegates
diff --git a/platform/iphone/vulkan_context_iphone.mm b/platform/iphone/vulkan_context_iphone.mm
index cb4dbe7f85..d62e826957 100644
--- a/platform/iphone/vulkan_context_iphone.mm
+++ b/platform/iphone/vulkan_context_iphone.mm
@@ -35,14 +35,12 @@ const char *VulkanContextIPhone::_get_platform_surface_extension() const {
return VK_MVK_IOS_SURFACE_EXTENSION_NAME;
}
-Error VulkanContextIPhone::window_create(DisplayServer::WindowID p_window_id,
- CALayer *p_metal_layer, int p_width,
- int p_height) {
+Error VulkanContextIPhone::window_create(DisplayServer::WindowID p_window_id, CALayer *p_metal_layer, int p_width, int p_height) {
VkIOSSurfaceCreateInfoMVK createInfo;
createInfo.sType = VK_STRUCTURE_TYPE_IOS_SURFACE_CREATE_INFO_MVK;
createInfo.pNext = NULL;
createInfo.flags = 0;
- createInfo.pView = p_metal_layer;
+ createInfo.pView = (__bridge const void *)p_metal_layer;
VkSurfaceKHR surface;
VkResult err =
diff --git a/platform/javascript/SCsub b/platform/javascript/SCsub
index 21456efde5..7381ea13b7 100644
--- a/platform/javascript/SCsub
+++ b/platform/javascript/SCsub
@@ -9,6 +9,7 @@ javascript_files = [
"javascript_eval.cpp",
"javascript_main.cpp",
"os_javascript.cpp",
+ "api/javascript_tools_editor_plugin.cpp",
]
build_targets = ["#bin/godot${PROGSUFFIX}.js", "#bin/godot${PROGSUFFIX}.wasm"]
@@ -19,6 +20,7 @@ build = env.add_program(build_targets, javascript_files)
js_libraries = [
"native/http_request.js",
+ "native/library_godot_audio.js",
]
for lib in js_libraries:
env.Append(LINKFLAGS=["--js-library", env.File(lib).path])
@@ -54,7 +56,7 @@ out_files = [
zip_dir.File(binary_name + ".wasm"),
zip_dir.File(binary_name + ".html"),
]
-html_file = "#misc/dist/html/full-size.html"
+html_file = "#misc/dist/html/editor.html" if env["tools"] else "#misc/dist/html/full-size.html"
in_files = [js_wrapped, build[1], html_file]
if env["threads_enabled"]:
in_files.append(build[2])
diff --git a/platform/javascript/api/api.cpp b/platform/javascript/api/api.cpp
index 9c73e5c4c4..aa0206d144 100644
--- a/platform/javascript/api/api.cpp
+++ b/platform/javascript/api/api.cpp
@@ -31,10 +31,12 @@
#include "api.h"
#include "core/engine.h"
#include "javascript_eval.h"
+#include "javascript_tools_editor_plugin.h"
static JavaScript *javascript_eval;
void register_javascript_api() {
+ JavaScriptToolsEditorPlugin::initialize();
ClassDB::register_virtual_class<JavaScript>();
javascript_eval = memnew(JavaScript);
Engine::get_singleton()->add_singleton(Engine::Singleton("JavaScript", javascript_eval));
diff --git a/platform/javascript/api/javascript_eval.h b/platform/javascript/api/javascript_eval.h
index 29229de8e3..26b5b9e484 100644
--- a/platform/javascript/api/javascript_eval.h
+++ b/platform/javascript/api/javascript_eval.h
@@ -31,7 +31,7 @@
#ifndef JAVASCRIPT_EVAL_H
#define JAVASCRIPT_EVAL_H
-#include "core/object.h"
+#include "core/class_db.h"
class JavaScript : public Object {
private:
diff --git a/platform/javascript/api/javascript_tools_editor_plugin.cpp b/platform/javascript/api/javascript_tools_editor_plugin.cpp
new file mode 100644
index 0000000000..e487bf23b7
--- /dev/null
+++ b/platform/javascript/api/javascript_tools_editor_plugin.cpp
@@ -0,0 +1,153 @@
+/*************************************************************************/
+/* javascript_tools_editor_plugin.cpp */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#if defined(TOOLS_ENABLED) && defined(JAVASCRIPT_ENABLED)
+#include "javascript_tools_editor_plugin.h"
+
+#include "core/engine.h"
+#include "core/os/dir_access.h"
+#include "core/os/file_access.h"
+#include "core/project_settings.h"
+#include "editor/editor_node.h"
+
+#include <emscripten/emscripten.h>
+
+static void _javascript_editor_init_callback() {
+ EditorNode::get_singleton()->add_editor_plugin(memnew(JavaScriptToolsEditorPlugin(EditorNode::get_singleton())));
+}
+
+void JavaScriptToolsEditorPlugin::initialize() {
+ EditorNode::add_init_callback(_javascript_editor_init_callback);
+}
+
+JavaScriptToolsEditorPlugin::JavaScriptToolsEditorPlugin(EditorNode *p_editor) {
+ Variant v;
+ add_tool_menu_item("Download Project Source", this, "_download_zip", v);
+}
+
+void JavaScriptToolsEditorPlugin::_download_zip(Variant p_v) {
+ if (!Engine::get_singleton() || !Engine::get_singleton()->is_editor_hint()) {
+ WARN_PRINT("Project download is only available in Editor mode");
+ return;
+ }
+ String resource_path = ProjectSettings::get_singleton()->get_resource_path();
+
+ FileAccess *src_f;
+ zlib_filefunc_def io = zipio_create_io_from_file(&src_f);
+ zipFile zip = zipOpen2("/tmp/project.zip", APPEND_STATUS_CREATE, NULL, &io);
+ String base_path = resource_path.substr(0, resource_path.rfind("/")) + "/";
+ _zip_recursive(resource_path, base_path, zip);
+ zipClose(zip, NULL);
+ EM_ASM({
+ const path = "/tmp/project.zip";
+ const size = FS.stat(path)["size"];
+ const buf = new Uint8Array(size);
+ const fd = FS.open(path, "r");
+ FS.read(fd, buf, 0, size);
+ FS.close(fd);
+ FS.unlink(path);
+ const blob = new Blob([buf], { type: "application/zip" });
+ const url = window.URL.createObjectURL(blob);
+ const a = document.createElement("a");
+ a.href = url;
+ a.download = "project.zip";
+ a.style.display = "none";
+ document.body.appendChild(a);
+ a.click();
+ a.remove();
+ window.URL.revokeObjectURL(url);
+ });
+}
+
+void JavaScriptToolsEditorPlugin::_bind_methods() {
+ ClassDB::bind_method("_download_zip", &JavaScriptToolsEditorPlugin::_download_zip);
+}
+
+void JavaScriptToolsEditorPlugin::_zip_file(String p_path, String p_base_path, zipFile p_zip) {
+ FileAccess *f = FileAccess::open(p_path, FileAccess::READ);
+ if (!f) {
+ WARN_PRINT("Unable to open file for zipping: " + p_path);
+ return;
+ }
+ Vector<uint8_t> data;
+ int len = f->get_len();
+ data.resize(len);
+ f->get_buffer(data.ptrw(), len);
+ f->close();
+ memdelete(f);
+
+ String path = p_path.replace_first(p_base_path, "");
+ zipOpenNewFileInZip(p_zip,
+ path.utf8().get_data(),
+ NULL,
+ NULL,
+ 0,
+ NULL,
+ 0,
+ NULL,
+ Z_DEFLATED,
+ Z_DEFAULT_COMPRESSION);
+ zipWriteInFileInZip(p_zip, data.ptr(), data.size());
+ zipCloseFileInZip(p_zip);
+}
+
+void JavaScriptToolsEditorPlugin::_zip_recursive(String p_path, String p_base_path, zipFile p_zip) {
+ DirAccess *dir = DirAccess::open(p_path);
+ if (!dir) {
+ WARN_PRINT("Unable to open dir for zipping: " + p_path);
+ return;
+ }
+ dir->list_dir_begin();
+ String cur = dir->get_next();
+ while (!cur.empty()) {
+ String cs = p_path.plus_file(cur);
+ if (cur == "." || cur == ".." || cur == ".import") {
+ // Skip
+ } else if (dir->current_is_dir()) {
+ String path = cs.replace_first(p_base_path, "") + "/";
+ zipOpenNewFileInZip(p_zip,
+ path.utf8().get_data(),
+ NULL,
+ NULL,
+ 0,
+ NULL,
+ 0,
+ NULL,
+ Z_DEFLATED,
+ Z_DEFAULT_COMPRESSION);
+ zipCloseFileInZip(p_zip);
+ _zip_recursive(cs, p_base_path, p_zip);
+ } else {
+ _zip_file(cs, p_base_path, p_zip);
+ }
+ cur = dir->get_next();
+ }
+}
+#endif
diff --git a/platform/javascript/api/javascript_tools_editor_plugin.h b/platform/javascript/api/javascript_tools_editor_plugin.h
new file mode 100644
index 0000000000..cc09fa4cd3
--- /dev/null
+++ b/platform/javascript/api/javascript_tools_editor_plugin.h
@@ -0,0 +1,62 @@
+/*************************************************************************/
+/* javascript_tools_editor_plugin.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H
+#define JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H
+
+#if defined(TOOLS_ENABLED) && defined(JAVASCRIPT_ENABLED)
+#include "core/io/zip_io.h"
+#include "editor/editor_plugin.h"
+
+class JavaScriptToolsEditorPlugin : public EditorPlugin {
+ GDCLASS(JavaScriptToolsEditorPlugin, EditorPlugin);
+
+private:
+ void _zip_file(String p_path, String p_base_path, zipFile p_zip);
+ void _zip_recursive(String p_path, String p_base_path, zipFile p_zip);
+
+protected:
+ static void _bind_methods();
+
+ void _download_zip(Variant p_v);
+
+public:
+ static void initialize();
+
+ JavaScriptToolsEditorPlugin(EditorNode *p_editor);
+};
+#else
+class JavaScriptToolsEditorPlugin {
+public:
+ static void initialize() {}
+};
+#endif
+
+#endif // JAVASCRIPT_TOOLS_EDITOR_PLUGIN_H
diff --git a/platform/javascript/audio_driver_javascript.cpp b/platform/javascript/audio_driver_javascript.cpp
index 9604914b2c..6ea948004e 100644
--- a/platform/javascript/audio_driver_javascript.cpp
+++ b/platform/javascript/audio_driver_javascript.cpp
@@ -31,34 +31,57 @@
#include "audio_driver_javascript.h"
#include "core/project_settings.h"
+#include "godot_audio.h"
#include <emscripten.h>
AudioDriverJavaScript *AudioDriverJavaScript::singleton = nullptr;
bool AudioDriverJavaScript::is_available() {
- return EM_ASM_INT({
- if (!(window.AudioContext || window.webkitAudioContext)) {
- return 0;
- }
- return 1;
- }) != 0;
+ return godot_audio_is_available() != 0;
}
const char *AudioDriverJavaScript::get_name() const {
return "JavaScript";
}
-extern "C" EMSCRIPTEN_KEEPALIVE void audio_driver_js_mix() {
- AudioDriverJavaScript::singleton->mix_to_js();
+#ifndef NO_THREADS
+void AudioDriverJavaScript::_audio_thread_func(void *p_data) {
+ AudioDriverJavaScript *obj = static_cast<AudioDriverJavaScript *>(p_data);
+ while (!obj->quit) {
+ obj->lock();
+ if (!obj->needs_process) {
+ obj->unlock();
+ OS::get_singleton()->delay_usec(1000); // Give the browser some slack.
+ continue;
+ }
+ obj->_js_driver_process();
+ obj->needs_process = false;
+ obj->unlock();
+ }
+}
+#endif
+
+extern "C" EMSCRIPTEN_KEEPALIVE void audio_driver_process_start() {
+#ifndef NO_THREADS
+ AudioDriverJavaScript::singleton->lock();
+#else
+ AudioDriverJavaScript::singleton->_js_driver_process();
+#endif
+}
+
+extern "C" EMSCRIPTEN_KEEPALIVE void audio_driver_process_end() {
+#ifndef NO_THREADS
+ AudioDriverJavaScript::singleton->needs_process = true;
+ AudioDriverJavaScript::singleton->unlock();
+#endif
}
extern "C" EMSCRIPTEN_KEEPALIVE void audio_driver_process_capture(float sample) {
AudioDriverJavaScript::singleton->process_capture(sample);
}
-void AudioDriverJavaScript::mix_to_js() {
- int channel_count = get_total_channels_by_speaker_mode(get_speaker_mode());
+void AudioDriverJavaScript::_js_driver_process() {
int sample_count = memarr_len(internal_buffer) / channel_count;
int32_t *stream_buffer = reinterpret_cast<int32_t *>(internal_buffer);
audio_server_process(sample_count, stream_buffer);
@@ -73,37 +96,12 @@ void AudioDriverJavaScript::process_capture(float sample) {
}
Error AudioDriverJavaScript::init() {
- int mix_rate = GLOBAL_GET("audio/mix_rate");
+ mix_rate = GLOBAL_GET("audio/mix_rate");
int latency = GLOBAL_GET("audio/output_latency");
- /* clang-format off */
- _driver_id = EM_ASM_INT({
- const MIX_RATE = $0;
- const LATENCY = $1 / 1000;
- return Module.IDHandler.add({
- 'context': new (window.AudioContext || window.webkitAudioContext)({ sampleRate: MIX_RATE, latencyHint: LATENCY}),
- 'input': null,
- 'stream': null,
- 'script': null
- });
- }, mix_rate, latency);
- /* clang-format on */
-
- int channel_count = get_total_channels_by_speaker_mode(get_speaker_mode());
+ channel_count = godot_audio_init(mix_rate, latency);
buffer_length = closest_power_of_2((latency * mix_rate / 1000) * channel_count);
- /* clang-format off */
- buffer_length = EM_ASM_INT({
- var ref = Module.IDHandler.get($0);
- const ctx = ref['context'];
- const BUFFER_LENGTH = $1;
- const CHANNEL_COUNT = $2;
-
- var script = ctx.createScriptProcessor(BUFFER_LENGTH, 2, CHANNEL_COUNT);
- script.connect(ctx.destination);
- ref['script'] = script;
- return script.bufferSize;
- }, _driver_id, buffer_length, channel_count);
- /* clang-format on */
+ buffer_length = godot_audio_create_processor(buffer_length, channel_count);
if (!buffer_length) {
return FAILED;
}
@@ -114,134 +112,60 @@ Error AudioDriverJavaScript::init() {
internal_buffer = memnew_arr(float, buffer_length *channel_count);
}
- return internal_buffer ? OK : ERR_OUT_OF_MEMORY;
+ if (!internal_buffer) {
+ return ERR_OUT_OF_MEMORY;
+ }
+ return OK;
}
void AudioDriverJavaScript::start() {
- /* clang-format off */
- EM_ASM({
- const ref = Module.IDHandler.get($0);
- var INTERNAL_BUFFER_PTR = $1;
-
- var audioDriverMixFunction = cwrap('audio_driver_js_mix');
- var audioDriverProcessCapture = cwrap('audio_driver_process_capture', null, ['number']);
- ref['script'].onaudioprocess = function(audioProcessingEvent) {
- audioDriverMixFunction();
-
- var input = audioProcessingEvent.inputBuffer;
- var output = audioProcessingEvent.outputBuffer;
- var internalBuffer = HEAPF32.subarray(
- INTERNAL_BUFFER_PTR / HEAPF32.BYTES_PER_ELEMENT,
- INTERNAL_BUFFER_PTR / HEAPF32.BYTES_PER_ELEMENT + output.length * output.numberOfChannels);
-
- for (var channel = 0; channel < output.numberOfChannels; channel++) {
- var outputData = output.getChannelData(channel);
- // Loop through samples.
- for (var sample = 0; sample < outputData.length; sample++) {
- outputData[sample] = internalBuffer[sample * output.numberOfChannels + channel];
- }
- }
-
- if (ref['input']) {
- var inputDataL = input.getChannelData(0);
- var inputDataR = input.getChannelData(1);
- for (var i = 0; i < inputDataL.length; i++) {
- audioDriverProcessCapture(inputDataL[i]);
- audioDriverProcessCapture(inputDataR[i]);
- }
- }
- };
- }, _driver_id, internal_buffer);
- /* clang-format on */
+#ifndef NO_THREADS
+ thread = Thread::create(_audio_thread_func, this);
+#endif
+ godot_audio_start(internal_buffer);
}
void AudioDriverJavaScript::resume() {
- /* clang-format off */
- EM_ASM({
- const ref = Module.IDHandler.get($0);
- if (ref && ref['context'] && ref['context'].resume)
- ref['context'].resume();
- }, _driver_id);
- /* clang-format on */
+ godot_audio_resume();
}
float AudioDriverJavaScript::get_latency() {
- /* clang-format off */
- return EM_ASM_DOUBLE({
- const ref = Module.IDHandler.get($0);
- var latency = 0;
- if (ref && ref['context']) {
- const ctx = ref['context'];
- if (ctx.baseLatency) {
- latency += ctx.baseLatency;
- }
- if (ctx.outputLatency) {
- latency += ctx.outputLatency;
- }
- }
- return latency;
- }, _driver_id);
- /* clang-format on */
+ return godot_audio_get_latency();
}
int AudioDriverJavaScript::get_mix_rate() const {
- /* clang-format off */
- return EM_ASM_INT({
- const ref = Module.IDHandler.get($0);
- return ref && ref['context'] ? ref['context'].sampleRate : 0;
- }, _driver_id);
- /* clang-format on */
+ return mix_rate;
}
AudioDriver::SpeakerMode AudioDriverJavaScript::get_speaker_mode() const {
- /* clang-format off */
- return get_speaker_mode_by_total_channels(EM_ASM_INT({
- const ref = Module.IDHandler.get($0);
- return ref && ref['context'] ? ref['context'].destination.channelCount : 0;
- }, _driver_id));
- /* clang-format on */
+ return get_speaker_mode_by_total_channels(channel_count);
}
-// No locking, as threads are not supported.
void AudioDriverJavaScript::lock() {
+#ifndef NO_THREADS
+ mutex.lock();
+#endif
}
void AudioDriverJavaScript::unlock() {
+#ifndef NO_THREADS
+ mutex.unlock();
+#endif
}
void AudioDriverJavaScript::finish_async() {
- // Close the context, add the operation to the async_finish list in module.
- int id = _driver_id;
- _driver_id = 0;
-
- /* clang-format off */
- EM_ASM({
- const id = $0;
- var ref = Module.IDHandler.get(id);
- Module.async_finish.push(new Promise(function(accept, reject) {
- if (!ref) {
- console.log("Ref not found!", id, Module.IDHandler);
- setTimeout(accept, 0);
- } else {
- Module.IDHandler.remove(id);
- const context = ref['context'];
- // Disconnect script and input.
- ref['script'].disconnect();
- if (ref['input'])
- ref['input'].disconnect();
- ref = null;
- context.close().then(function() {
- accept();
- }).catch(function(e) {
- accept();
- });
- }
- }));
- }, id);
- /* clang-format on */
+#ifndef NO_THREADS
+ quit = true; // Ask thread to quit.
+#endif
+ godot_audio_finish_async();
}
void AudioDriverJavaScript::finish() {
+#ifndef NO_THREADS
+ Thread::wait_to_finish(thread);
+ memdelete(thread);
+ thread = NULL;
+#endif
if (internal_buffer) {
memdelete_arr(internal_buffer);
internal_buffer = nullptr;
@@ -249,56 +173,14 @@ void AudioDriverJavaScript::finish() {
}
Error AudioDriverJavaScript::capture_start() {
+ godot_audio_capture_stop();
input_buffer_init(buffer_length);
-
- /* clang-format off */
- EM_ASM({
- function gotMediaInput(stream) {
- var ref = Module.IDHandler.get($0);
- ref['stream'] = stream;
- ref['input'] = ref['context'].createMediaStreamSource(stream);
- ref['input'].connect(ref['script']);
- }
-
- function gotMediaInputError(e) {
- out(e);
- }
-
- if (navigator.mediaDevices.getUserMedia) {
- navigator.mediaDevices.getUserMedia({"audio": true}).then(gotMediaInput, gotMediaInputError);
- } else {
- if (!navigator.getUserMedia)
- navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia;
- navigator.getUserMedia({"audio": true}, gotMediaInput, gotMediaInputError);
- }
- }, _driver_id);
- /* clang-format on */
-
+ godot_audio_capture_start();
return OK;
}
Error AudioDriverJavaScript::capture_stop() {
- /* clang-format off */
- EM_ASM({
- var ref = Module.IDHandler.get($0);
- if (ref['stream']) {
- const tracks = ref['stream'].getTracks();
- for (var i = 0; i < tracks.length; i++) {
- tracks[i].stop();
- }
- ref['stream'] = null;
- }
-
- if (ref['input']) {
- ref['input'].disconnect();
- ref['input'] = null;
- }
-
- }, _driver_id);
- /* clang-format on */
-
input_buffer.clear();
-
return OK;
}
diff --git a/platform/javascript/audio_driver_javascript.h b/platform/javascript/audio_driver_javascript.h
index c1607301d7..56a7da0307 100644
--- a/platform/javascript/audio_driver_javascript.h
+++ b/platform/javascript/audio_driver_javascript.h
@@ -33,15 +33,30 @@
#include "servers/audio_server.h"
+#include "core/os/mutex.h"
+#include "core/os/thread.h"
+
class AudioDriverJavaScript : public AudioDriver {
+private:
float *internal_buffer = nullptr;
- int _driver_id = 0;
int buffer_length = 0;
+ int mix_rate = 0;
+ int channel_count = 0;
public:
+#ifndef NO_THREADS
+ Mutex mutex;
+ Thread *thread = nullptr;
+ bool quit = false;
+ bool needs_process = true;
+
+ static void _audio_thread_func(void *p_data);
+#endif
+
+ void _js_driver_process();
+
static bool is_available();
- void mix_to_js();
void process_capture(float sample);
static AudioDriverJavaScript *singleton;
diff --git a/platform/javascript/detect.py b/platform/javascript/detect.py
index 81287cead8..8f2961b33d 100644
--- a/platform/javascript/detect.py
+++ b/platform/javascript/detect.py
@@ -1,6 +1,7 @@
import os
-from emscripten_helpers import parse_config, run_closure_compiler, create_engine_file
+from emscripten_helpers import run_closure_compiler, create_engine_file
+from SCons.Util import WhereIs
def is_active():
@@ -12,7 +13,7 @@ def get_name():
def can_build():
- return "EM_CONFIG" in os.environ or os.path.exists(os.path.expanduser("~/.emscripten"))
+ return WhereIs("emcc") is not None
def get_opts():
@@ -100,9 +101,6 @@ def configure(env):
# Closure compiler extern and support for ecmascript specs (const, let, etc).
env["ENV"]["EMCC_CLOSURE_ARGS"] = "--language_in ECMASCRIPT6"
- em_config = parse_config()
- env.PrependENVPath("PATH", em_config["EMCC_ROOT"])
-
env["CC"] = "emcc"
env["CXX"] = "em++"
env["LINK"] = "emcc"
@@ -137,8 +135,9 @@ def configure(env):
env.Append(CPPDEFINES=["PTHREAD_NO_RENAME"])
env.Append(CCFLAGS=["-s", "USE_PTHREADS=1"])
env.Append(LINKFLAGS=["-s", "USE_PTHREADS=1"])
- env.Append(LINKFLAGS=["-s", "PTHREAD_POOL_SIZE=4"])
+ env.Append(LINKFLAGS=["-s", "PTHREAD_POOL_SIZE=8"])
env.Append(LINKFLAGS=["-s", "WASM_MEM_MAX=2048MB"])
+ env.extra_suffix = ".threads" + env.extra_suffix
else:
env.Append(CPPDEFINES=["NO_THREADS"])
diff --git a/platform/javascript/emscripten_helpers.py b/platform/javascript/emscripten_helpers.py
index a55c9d3f48..f6db10fbbd 100644
--- a/platform/javascript/emscripten_helpers.py
+++ b/platform/javascript/emscripten_helpers.py
@@ -1,28 +1,11 @@
import os
-
-def parse_config():
- em_config_file = os.getenv("EM_CONFIG") or os.path.expanduser("~/.emscripten")
- if not os.path.exists(em_config_file):
- raise RuntimeError("Emscripten configuration file '%s' does not exist" % em_config_file)
-
- normalized = {}
- em_config = {}
- with open(em_config_file) as f:
- try:
- # Emscripten configuration file is a Python file with simple assignments.
- exec(f.read(), em_config)
- except StandardError as e:
- raise RuntimeError("Emscripten configuration file '%s' is invalid:\n%s" % (em_config_file, e))
- normalized["EMCC_ROOT"] = em_config.get("EMSCRIPTEN_ROOT")
- normalized["NODE_JS"] = em_config.get("NODE_JS")
- normalized["CLOSURE_BIN"] = os.path.join(normalized["EMCC_ROOT"], "node_modules", ".bin", "google-closure-compiler")
- return normalized
+from SCons.Util import WhereIs
def run_closure_compiler(target, source, env, for_signature):
- cfg = parse_config()
- cmd = [cfg["NODE_JS"], cfg["CLOSURE_BIN"]]
+ closure_bin = os.path.join(os.path.dirname(WhereIs("emcc")), "node_modules", ".bin", "google-closure-compiler")
+ cmd = [WhereIs("node"), closure_bin]
cmd.extend(["--compilation_level", "ADVANCED_OPTIMIZATIONS"])
for f in env["JSEXTERNS"]:
cmd.extend(["--externs", f.get_abspath()])
diff --git a/platform/javascript/engine/engine.js b/platform/javascript/engine/engine.js
index adcd919a6b..05a11701c0 100644
--- a/platform/javascript/engine/engine.js
+++ b/platform/javascript/engine/engine.js
@@ -121,6 +121,7 @@ Function('return this')()['Engine'] = (function() {
me.rtenv['noExitRuntime'] = true;
me.rtenv['onExecute'] = me.onExecute;
me.rtenv['onExit'] = function(code) {
+ me.rtenv['deinitFS']();
if (me.onExit)
me.onExit(code);
me.rtenv = null;
@@ -227,6 +228,12 @@ Function('return this')()['Engine'] = (function() {
this.persistentPaths = persistentPaths;
};
+ Engine.prototype.requestQuit = function() {
+ if (this.rtenv) {
+ this.rtenv['request_quit']();
+ }
+ };
+
// Closure compiler exported engine methods.
/** @export */
Engine['isWebGLAvailable'] = Utils.isWebGLAvailable;
@@ -249,5 +256,6 @@ Function('return this')()['Engine'] = (function() {
Engine.prototype['setOnExit'] = Engine.prototype.setOnExit;
Engine.prototype['copyToFS'] = Engine.prototype.copyToFS;
Engine.prototype['setPersistentPaths'] = Engine.prototype.setPersistentPaths;
+ Engine.prototype['requestQuit'] = Engine.prototype.requestQuit;
return Engine;
})();
diff --git a/platform/javascript/export/export.cpp b/platform/javascript/export/export.cpp
index 230575abce..a83ff44d20 100644
--- a/platform/javascript/export/export.cpp
+++ b/platform/javascript/export/export.cpp
@@ -124,6 +124,9 @@ public:
String s = "HTTP/1.1 200 OK\r\n";
s += "Connection: Close\r\n";
s += "Content-Type: " + ctype + "\r\n";
+ s += "Access-Control-Allow-Origin: *\r\n";
+ s += "Cross-Origin-Opener-Policy: same-origin\r\n";
+ s += "Cross-Origin-Embedder-Policy: require-corp\r\n";
s += "\r\n";
CharString cs = s.utf8();
Error err = connection->put_data((const uint8_t *)cs.get_data(), cs.size() - 1);
diff --git a/platform/javascript/godot_audio.h b/platform/javascript/godot_audio.h
new file mode 100644
index 0000000000..f7f26e5262
--- /dev/null
+++ b/platform/javascript/godot_audio.h
@@ -0,0 +1,58 @@
+/*************************************************************************/
+/* godot_audio.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef GODOT_AUDIO_H
+#define GODOT_AUDIO_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "stddef.h"
+
+extern int godot_audio_is_available();
+
+extern int godot_audio_init(int p_mix_rate, int p_latency);
+extern int godot_audio_create_processor(int p_buffer_length, int p_channel_count);
+
+extern void godot_audio_start(float *r_buffer_ptr);
+extern void godot_audio_resume();
+extern void godot_audio_finish_async();
+
+extern float godot_audio_get_latency();
+
+extern void godot_audio_capture_start();
+extern void godot_audio_capture_stop();
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* GODOT_AUDIO_H */
diff --git a/platform/javascript/native/library_godot_audio.js b/platform/javascript/native/library_godot_audio.js
new file mode 100644
index 0000000000..d300280ccd
--- /dev/null
+++ b/platform/javascript/native/library_godot_audio.js
@@ -0,0 +1,173 @@
+/*************************************************************************/
+/* library_godot_audio.js */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+var GodotAudio = {
+
+ $GodotAudio: {
+
+ ctx: null,
+ input: null,
+ script: null,
+ },
+
+ godot_audio_is_available__proxy: 'sync',
+ godot_audio_is_available: function () {
+ if (!(window.AudioContext || window.webkitAudioContext)) {
+ return 0;
+ }
+ return 1;
+ },
+
+ godot_audio_init: function(mix_rate, latency) {
+ GodotAudio.ctx = new (window.AudioContext || window.webkitAudioContext)({
+ sampleRate: mix_rate,
+ latencyHint: latency
+ });
+ return GodotAudio.ctx.destination.channelCount;
+ },
+
+ godot_audio_create_processor: function(buffer_length, channel_count) {
+ GodotAudio.script = GodotAudio.ctx.createScriptProcessor(buffer_length, 2, channel_count);
+ GodotAudio.script.connect(GodotAudio.ctx.destination);
+ return GodotAudio.script.bufferSize;
+ },
+
+ godot_audio_start: function(buffer_ptr) {
+ var audioDriverProcessStart = cwrap('audio_driver_process_start');
+ var audioDriverProcessEnd = cwrap('audio_driver_process_end');
+ var audioDriverProcessCapture = cwrap('audio_driver_process_capture', null, ['number']);
+ GodotAudio.script.onaudioprocess = function(audioProcessingEvent) {
+ audioDriverProcessStart();
+
+ var input = audioProcessingEvent.inputBuffer;
+ var output = audioProcessingEvent.outputBuffer;
+ var internalBuffer = HEAPF32.subarray(
+ buffer_ptr / HEAPF32.BYTES_PER_ELEMENT,
+ buffer_ptr / HEAPF32.BYTES_PER_ELEMENT + output.length * output.numberOfChannels);
+ for (var channel = 0; channel < output.numberOfChannels; channel++) {
+ var outputData = output.getChannelData(channel);
+ // Loop through samples.
+ for (var sample = 0; sample < outputData.length; sample++) {
+ outputData[sample] = internalBuffer[sample * output.numberOfChannels + channel];
+ }
+ }
+
+ if (GodotAudio.input) {
+ var inputDataL = input.getChannelData(0);
+ var inputDataR = input.getChannelData(1);
+ for (var i = 0; i < inputDataL.length; i++) {
+ audioDriverProcessCapture(inputDataL[i]);
+ audioDriverProcessCapture(inputDataR[i]);
+ }
+ }
+ audioDriverProcessEnd();
+ };
+ },
+
+ godot_audio_resume: function() {
+ if (GodotAudio.ctx && GodotAudio.ctx.state != 'running') {
+ GodotAudio.ctx.resume();
+ }
+ },
+
+ godot_audio_finish_async: function() {
+ Module.async_finish.push(new Promise(function(accept, reject) {
+ if (!GodotAudio.ctx) {
+ setTimeout(accept, 0);
+ } else {
+ if (GodotAudio.script) {
+ GodotAudio.script.disconnect();
+ GodotAudio.script = null;
+ }
+ if (GodotAudio.input) {
+ GodotAudio.input.disconnect();
+ GodotAudio.input = null;
+ }
+ GodotAudio.ctx.close().then(function() {
+ accept();
+ }).catch(function(e) {
+ accept();
+ });
+ GodotAudio.ctx = null;
+ }
+ }));
+ },
+
+ godot_audio_get_latency__proxy: 'sync',
+ godot_audio_get_latency: function() {
+ var latency = 0;
+ if (GodotAudio.ctx) {
+ if (GodotAudio.ctx.baseLatency) {
+ latency += GodotAudio.ctx.baseLatency;
+ }
+ if (GodotAudio.ctx.outputLatency) {
+ latency += GodotAudio.ctx.outputLatency;
+ }
+ }
+ return latency;
+ },
+
+ godot_audio_capture_start__proxy: 'sync',
+ godot_audio_capture_start: function() {
+ if (GodotAudio.input) {
+ return; // Already started.
+ }
+ function gotMediaInput(stream) {
+ GodotAudio.input = GodotAudio.ctx.createMediaStreamSource(stream);
+ GodotAudio.input.connect(GodotAudio.script);
+ }
+
+ function gotMediaInputError(e) {
+ out(e);
+ }
+
+ if (navigator.mediaDevices.getUserMedia) {
+ navigator.mediaDevices.getUserMedia({"audio": true}).then(gotMediaInput, gotMediaInputError);
+ } else {
+ if (!navigator.getUserMedia)
+ navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia;
+ navigator.getUserMedia({"audio": true}, gotMediaInput, gotMediaInputError);
+ }
+ },
+
+ godot_audio_capture_stop__proxy: 'sync',
+ godot_audio_capture_stop: function() {
+ if (GodotAudio.input) {
+ const tracks = GodotAudio.input.mediaStream.getTracks();
+ for (var i = 0; i < tracks.length; i++) {
+ tracks[i].stop();
+ }
+ GodotAudio.input.disconnect();
+ GodotAudio.input = null;
+ }
+ },
+};
+
+autoAddDeps(GodotAudio, "$GodotAudio");
+mergeInto(LibraryManager.library, GodotAudio);
diff --git a/platform/javascript/native/utils.js b/platform/javascript/native/utils.js
index 0b3698fd86..8d0beba454 100644
--- a/platform/javascript/native/utils.js
+++ b/platform/javascript/native/utils.js
@@ -29,8 +29,7 @@
/*************************************************************************/
Module['initFS'] = function(persistentPaths) {
- FS.mkdir('/userfs');
- FS.mount(IDBFS, {}, '/userfs');
+ Module.mount_points = ['/userfs'].concat(persistentPaths);
function createRecursive(dir) {
try {
@@ -43,13 +42,14 @@ Module['initFS'] = function(persistentPaths) {
}
}
- persistentPaths.forEach(function(path) {
+ Module.mount_points.forEach(function(path) {
createRecursive(path);
FS.mount(IDBFS, {}, path);
});
return new Promise(function(resolve, reject) {
FS.syncfs(true, function(err) {
if (err) {
+ Module.mount_points = [];
Module.idbfs = false;
console.log("IndexedDB not available: " + err.message);
} else {
@@ -60,6 +60,21 @@ Module['initFS'] = function(persistentPaths) {
});
};
+Module['deinitFS'] = function() {
+ Module.mount_points.forEach(function(path) {
+ try {
+ FS.unmount(path);
+ } catch (e) {
+ console.log("Already unmounted", e);
+ }
+ if (Module.idbfs && IDBFS.dbs[path]) {
+ IDBFS.dbs[path].close();
+ delete IDBFS.dbs[path];
+ }
+ });
+ Module.mount_points = [];
+};
+
Module['copyToFS'] = function(path, buffer) {
var p = path.lastIndexOf("/");
var dir = "/";
diff --git a/platform/linuxbsd/display_server_x11.cpp b/platform/linuxbsd/display_server_x11.cpp
index 8b0d08d1cb..176878bc12 100644
--- a/platform/linuxbsd/display_server_x11.cpp
+++ b/platform/linuxbsd/display_server_x11.cpp
@@ -737,6 +737,7 @@ void DisplayServerX11::delete_sub_window(WindowID p_id) {
XDestroyWindow(x11_display, wd.x11_window);
if (wd.xic) {
XDestroyIC(wd.xic);
+ wd.xic = nullptr;
}
windows.erase(p_id);
@@ -2784,6 +2785,13 @@ void DisplayServerX11::process_events() {
wd.focused = true;
+ if (wd.xic) {
+ // Block events polling while changing input focus
+ // because it triggers some event polling internally.
+ MutexLock mutex_lock(events_mutex);
+ XSetICFocus(wd.xic);
+ }
+
// Keep track of focus order for overlapping windows.
static unsigned int focus_order = 0;
wd.focus_order = ++focus_order;
@@ -2812,12 +2820,6 @@ void DisplayServerX11::process_events() {
XIGrabDevice(x11_display, xi.touch_devices[i], x11_window, CurrentTime, None, XIGrabModeAsync, XIGrabModeAsync, False, &xi.touch_event_mask);
}*/
#endif
- if (wd.xic) {
- // Block events polling while changing input focus
- // because it triggers some event polling internally.
- MutexLock mutex_lock(events_mutex);
- XSetICFocus(wd.xic);
- }
if (!app_focused) {
if (OS::get_singleton()->get_main_loop()) {
@@ -2834,6 +2836,13 @@ void DisplayServerX11::process_events() {
wd.focused = false;
+ if (wd.xic) {
+ // Block events polling while changing input focus
+ // because it triggers some event polling internally.
+ MutexLock mutex_lock(events_mutex);
+ XUnsetICFocus(wd.xic);
+ }
+
Input::get_singleton()->release_pressed_events();
_send_window_event(wd, WINDOW_EVENT_FOCUS_OUT);
@@ -2864,12 +2873,6 @@ void DisplayServerX11::process_events() {
}
xi.state.clear();
#endif
- if (wd.xic) {
- // Block events polling while changing input focus
- // because it triggers some event polling internally.
- MutexLock mutex_lock(events_mutex);
- XUnsetICFocus(wd.xic);
- }
} break;
case ConfigureNotify: {
@@ -4044,11 +4047,13 @@ DisplayServerX11::~DisplayServerX11() {
}
#endif
- if (E->get().xic) {
- XDestroyIC(E->get().xic);
+ WindowData &wd = E->get();
+ if (wd.xic) {
+ XDestroyIC(wd.xic);
+ wd.xic = nullptr;
}
- XUnmapWindow(x11_display, E->get().x11_window);
- XDestroyWindow(x11_display, E->get().x11_window);
+ XUnmapWindow(x11_display, wd.x11_window);
+ XDestroyWindow(x11_display, wd.x11_window);
}
//destroy drivers
diff --git a/platform/osx/detect.py b/platform/osx/detect.py
index 6fc1dc65af..50e9bd2653 100644
--- a/platform/osx/detect.py
+++ b/platform/osx/detect.py
@@ -139,7 +139,8 @@ def configure(env):
env.Append(CPPDEFINES=["__MACPORTS__"]) # hack to fix libvpx MM256_BROADCASTSI128_SI256 define
if env["CXX"] == "clang++":
- env.Append(CPPDEFINES=["TYPED_METHOD_BIND"])
+ # This should now work with clang++, re-enable if there are issues
+ # env.Append(CPPDEFINES=["TYPED_METHOD_BIND"])
env["CC"] = "clang"
env["LINK"] = "clang++"
diff --git a/platform/osx/display_server_osx.mm b/platform/osx/display_server_osx.mm
index 49f0e7bfa3..cd5b71890c 100644
--- a/platform/osx/display_server_osx.mm
+++ b/platform/osx/display_server_osx.mm
@@ -2246,11 +2246,18 @@ int DisplayServerOSX::screen_get_dpi(int p_screen) const {
NSArray *screenArray = [NSScreen screens];
if ((NSUInteger)p_screen < [screenArray count]) {
NSDictionary *description = [[screenArray objectAtIndex:p_screen] deviceDescription];
- NSSize displayDPI = [[description objectForKey:NSDeviceResolution] sizeValue];
- return (displayDPI.width + displayDPI.height) / 2;
+
+ const NSSize displayPixelSize = [[description objectForKey:NSDeviceSize] sizeValue];
+ const CGSize displayPhysicalSize = CGDisplayScreenSize([[description objectForKey:@"NSScreenNumber"] unsignedIntValue]);
+ float scale = [[screenArray objectAtIndex:p_screen] backingScaleFactor];
+
+ float den2 = (displayPhysicalSize.width / 25.4f) * (displayPhysicalSize.width / 25.4f) + (displayPhysicalSize.height / 25.4f) * (displayPhysicalSize.height / 25.4f);
+ if (den2 > 0.0f) {
+ return ceil(sqrt(displayPixelSize.width * displayPixelSize.width + displayPixelSize.height * displayPixelSize.height) / sqrt(den2) * scale);
+ }
}
- return 96;
+ return 72;
}
float DisplayServerOSX::screen_get_scale(int p_screen) const {
diff --git a/platform/uwp/detect.py b/platform/uwp/detect.py
index a7ca26c16c..2af7803749 100644
--- a/platform/uwp/detect.py
+++ b/platform/uwp/detect.py
@@ -80,6 +80,9 @@ def configure(env):
env["ENV"] = os.environ
vc_base_path = os.environ["VCTOOLSINSTALLDIR"] if "VCTOOLSINSTALLDIR" in os.environ else os.environ["VCINSTALLDIR"]
+ # Force to use Unicode encoding
+ env.AppendUnique(CCFLAGS=["/utf-8"])
+
# ANGLE
angle_root = os.getenv("ANGLE_SRC_PATH")
env.Prepend(CPPPATH=[angle_root + "/include"])
diff --git a/platform/uwp/export/export.cpp b/platform/uwp/export/export.cpp
index 5679ec3eac..e9e536837f 100644
--- a/platform/uwp/export/export.cpp
+++ b/platform/uwp/export/export.cpp
@@ -29,11 +29,12 @@
/*************************************************************************/
#include "export.h"
+
#include "core/bind/core_bind.h"
+#include "core/class_db.h"
#include "core/crypto/crypto_core.h"
#include "core/io/marshalls.h"
#include "core/io/zip_io.h"
-#include "core/object.h"
#include "core/os/dir_access.h"
#include "core/os/file_access.h"
#include "core/project_settings.h"
@@ -249,7 +250,7 @@ void AppxPackager::make_content_types(const String &p_path) {
Map<String, String> types;
for (int i = 0; i < file_metadata.size(); i++) {
- String ext = file_metadata[i].name.get_extension();
+ String ext = file_metadata[i].name.get_extension().to_lower();
if (types.has(ext)) {
continue;
diff --git a/platform/windows/detect.py b/platform/windows/detect.py
index 6b503c1561..489e45404f 100644
--- a/platform/windows/detect.py
+++ b/platform/windows/detect.py
@@ -65,7 +65,7 @@ def get_opts():
# Vista support dropped after EOL due to GH-10243
("target_win_version", "Targeted Windows version, >= 0x0601 (Windows 7)", "0x0601"),
EnumVariable("debug_symbols", "Add debugging symbols to release builds", "yes", ("yes", "no", "full")),
- EnumVariable("windows_subsystem", "Windows subsystem", "gui", ("console", "gui")),
+ EnumVariable("windows_subsystem", "Windows subsystem", "default", ("default", "console", "gui")),
BoolVariable("separate_debug_symbols", "Create a separate file containing debugging symbols", False),
("msvc_version", "MSVC version to use. Ignored if VCINSTALLDIR is set in shell env.", None),
BoolVariable("use_mingw", "Use the Mingw compiler, even if MSVC is installed. Only used on Windows.", False),
@@ -178,8 +178,15 @@ def configure_msvc(env, manual_msvc_config):
"""Configure env to work with MSVC"""
# Build type
+
if env["tests"]:
env["windows_subsystem"] = "console"
+ elif env["windows_subsystem"] == "default":
+ # Default means we use console for debug, gui for release.
+ if "debug" in env["target"]:
+ env["windows_subsystem"] = "console"
+ else:
+ env["windows_subsystem"] = "gui"
if env["target"] == "release":
if env["optimize"] == "speed": # optimize for speed (default)
@@ -215,8 +222,8 @@ def configure_msvc(env, manual_msvc_config):
## Compile/link flags
env.AppendUnique(CCFLAGS=["/MT", "/Gd", "/GR", "/nologo"])
- if int(env["MSVC_VERSION"].split(".")[0]) >= 14: # vs2015 and later
- env.AppendUnique(CCFLAGS=["/utf-8"])
+ # Force to use Unicode encoding
+ env.AppendUnique(CCFLAGS=["/utf-8"])
env.AppendUnique(CXXFLAGS=["/TP"]) # assume all sources are C++
if manual_msvc_config: # should be automatic if SCons found it
if os.getenv("WindowsSdkDir") is not None:
@@ -311,6 +318,12 @@ def configure_mingw(env):
if env["tests"]:
env["windows_subsystem"] = "console"
+ elif env["windows_subsystem"] == "default":
+ # Default means we use console for debug, gui for release.
+ if "debug" in env["target"]:
+ env["windows_subsystem"] = "console"
+ else:
+ env["windows_subsystem"] = "gui"
if env["target"] == "release":
env.Append(CCFLAGS=["-msse2"])
diff --git a/scene/2d/area_2d.cpp b/scene/2d/area_2d.cpp
index ebfcb9cad6..d51ee3f9a8 100644
--- a/scene/2d/area_2d.cpp
+++ b/scene/2d/area_2d.cpp
@@ -180,26 +180,20 @@ void Area2D::_body_inout(int p_status, const RID &p_body, ObjectID p_instance, i
E->get().shapes.erase(ShapePair(p_body_shape, p_area_shape));
}
- bool eraseit = false;
-
+ bool in_tree = E->get().in_tree;
if (E->get().rc == 0) {
+ body_map.erase(E);
if (node) {
node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area2D::_body_enter_tree));
node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area2D::_body_exit_tree));
- if (E->get().in_tree) {
+ if (in_tree) {
emit_signal(SceneStringNames::get_singleton()->body_exited, obj);
}
}
-
- eraseit = true;
}
- if (!node || E->get().in_tree) {
+ if (!node || in_tree) {
emit_signal(SceneStringNames::get_singleton()->body_shape_exited, objid, obj, p_body_shape, p_area_shape);
}
-
- if (eraseit) {
- body_map.erase(E);
- }
}
locked = false;
@@ -278,26 +272,20 @@ void Area2D::_area_inout(int p_status, const RID &p_area, ObjectID p_instance, i
E->get().shapes.erase(AreaShapePair(p_area_shape, p_self_shape));
}
- bool eraseit = false;
-
+ bool in_tree = E->get().in_tree;
if (E->get().rc == 0) {
+ area_map.erase(E);
if (node) {
node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area2D::_area_enter_tree));
node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area2D::_area_exit_tree));
- if (E->get().in_tree) {
+ if (in_tree) {
emit_signal(SceneStringNames::get_singleton()->area_exited, obj);
}
}
-
- eraseit = true;
}
- if (!node || E->get().in_tree) {
+ if (!node || in_tree) {
emit_signal(SceneStringNames::get_singleton()->area_shape_exited, objid, obj, p_area_shape, p_self_shape);
}
-
- if (eraseit) {
- area_map.erase(E);
- }
}
locked = false;
diff --git a/scene/2d/light_2d.cpp b/scene/2d/light_2d.cpp
index 52bf122789..217a210342 100644
--- a/scene/2d/light_2d.cpp
+++ b/scene/2d/light_2d.cpp
@@ -313,8 +313,9 @@ String Light2D::get_configuration_warning() const {
String warning = Node2D::get_configuration_warning();
if (!texture.is_valid()) {
- if (!warning.empty())
+ if (!warning.empty()) {
warning += "\n\n";
+ }
warning += TTR("A texture with the shape of the light must be supplied to the \"Texture\" property.");
}
diff --git a/scene/2d/physics_body_2d.cpp b/scene/2d/physics_body_2d.cpp
index 22d426bdb4..402eac644f 100644
--- a/scene/2d/physics_body_2d.cpp
+++ b/scene/2d/physics_body_2d.cpp
@@ -30,27 +30,17 @@
#include "physics_body_2d.h"
+#include "core/class_db.h"
#include "core/core_string_names.h"
#include "core/engine.h"
#include "core/list.h"
#include "core/math/math_funcs.h"
-#include "core/method_bind_ext.gen.inc"
-#include "core/object.h"
#include "core/rid.h"
#include "scene/scene_string_names.h"
void PhysicsBody2D::_notification(int p_what) {
}
-void PhysicsBody2D::_set_layers(uint32_t p_mask) {
- set_collision_layer(p_mask);
- set_collision_mask(p_mask);
-}
-
-uint32_t PhysicsBody2D::_get_layers() const {
- return get_collision_layer();
-}
-
void PhysicsBody2D::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody2D::set_collision_layer);
ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody2D::get_collision_layer);
@@ -63,13 +53,9 @@ void PhysicsBody2D::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody2D::set_collision_layer_bit);
ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody2D::get_collision_layer_bit);
- ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody2D::_set_layers);
- ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody2D::_get_layers);
-
ClassDB::bind_method(D_METHOD("get_collision_exceptions"), &PhysicsBody2D::get_collision_exceptions);
ClassDB::bind_method(D_METHOD("add_collision_exception_with", "body"), &PhysicsBody2D::add_collision_exception_with);
ClassDB::bind_method(D_METHOD("remove_collision_exception_with", "body"), &PhysicsBody2D::remove_collision_exception_with);
- ADD_PROPERTY(PropertyInfo(Variant::INT, "layers", PROPERTY_HINT_LAYERS_2D_PHYSICS, "", 0), "_set_layers", "_get_layers"); //for backwards compat
ADD_GROUP("Collision", "collision_");
ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_2D_PHYSICS), "set_collision_layer", "get_collision_layer");
diff --git a/scene/2d/physics_body_2d.h b/scene/2d/physics_body_2d.h
index e83ab6557d..aefea56fa3 100644
--- a/scene/2d/physics_body_2d.h
+++ b/scene/2d/physics_body_2d.h
@@ -44,9 +44,6 @@ class PhysicsBody2D : public CollisionObject2D {
uint32_t collision_layer;
uint32_t collision_mask;
- void _set_layers(uint32_t p_mask);
- uint32_t _get_layers() const;
-
protected:
void _notification(int p_what);
PhysicsBody2D(PhysicsServer2D::BodyMode p_mode);
diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp
index c2951559a4..94ec0998fa 100644
--- a/scene/2d/tile_map.cpp
+++ b/scene/2d/tile_map.cpp
@@ -32,7 +32,6 @@
#include "collision_object_2d.h"
#include "core/io/marshalls.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/os/os.h"
#include "scene/2d/area_2d.h"
#include "servers/navigation_server_2d.h"
diff --git a/scene/3d/area_3d.cpp b/scene/3d/area_3d.cpp
index dc35f069c0..b1ffe76662 100644
--- a/scene/3d/area_3d.cpp
+++ b/scene/3d/area_3d.cpp
@@ -180,26 +180,20 @@ void Area3D::_body_inout(int p_status, const RID &p_body, ObjectID p_instance, i
E->get().shapes.erase(ShapePair(p_body_shape, p_area_shape));
}
- bool eraseit = false;
-
+ bool in_tree = E->get().in_tree;
if (E->get().rc == 0) {
+ body_map.erase(E);
if (node) {
node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area3D::_body_enter_tree));
node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area3D::_body_exit_tree));
- if (E->get().in_tree) {
+ if (in_tree) {
emit_signal(SceneStringNames::get_singleton()->body_exited, obj);
}
}
-
- eraseit = true;
}
- if (node && E->get().in_tree) {
+ if (node && in_tree) {
emit_signal(SceneStringNames::get_singleton()->body_shape_exited, objid, obj, p_body_shape, p_area_shape);
}
-
- if (eraseit) {
- body_map.erase(E);
- }
}
locked = false;
@@ -366,26 +360,20 @@ void Area3D::_area_inout(int p_status, const RID &p_area, ObjectID p_instance, i
E->get().shapes.erase(AreaShapePair(p_area_shape, p_self_shape));
}
- bool eraseit = false;
-
+ bool in_tree = E->get().in_tree;
if (E->get().rc == 0) {
+ area_map.erase(E);
if (node) {
node->disconnect(SceneStringNames::get_singleton()->tree_entered, callable_mp(this, &Area3D::_area_enter_tree));
node->disconnect(SceneStringNames::get_singleton()->tree_exiting, callable_mp(this, &Area3D::_area_exit_tree));
- if (E->get().in_tree) {
+ if (in_tree) {
emit_signal(SceneStringNames::get_singleton()->area_exited, obj);
}
}
-
- eraseit = true;
}
- if (!node || E->get().in_tree) {
+ if (!node || in_tree) {
emit_signal(SceneStringNames::get_singleton()->area_shape_exited, objid, obj, p_area_shape, p_self_shape);
}
-
- if (eraseit) {
- area_map.erase(E);
- }
}
locked = false;
diff --git a/scene/3d/collision_shape_3d.cpp b/scene/3d/collision_shape_3d.cpp
index 6ff0ce6032..e1c691b89a 100644
--- a/scene/3d/collision_shape_3d.cpp
+++ b/scene/3d/collision_shape_3d.cpp
@@ -140,15 +140,14 @@ String CollisionShape3D::get_configuration_warning() const {
warning += TTR("A shape must be provided for CollisionShape3D to function. Please create a shape resource for it.");
}
- if (Object::cast_to<RigidBody3D>(get_parent())) {
- if (Object::cast_to<ConcavePolygonShape3D>(*shape)) {
- if (Object::cast_to<RigidBody3D>(get_parent())->get_mode() != RigidBody3D::MODE_STATIC) {
- if (!warning.empty()) {
- warning += "\n\n";
- }
- warning += TTR("ConcavePolygonShape3D doesn't support RigidBody3D in another mode than static.");
- }
+ if (shape.is_valid() &&
+ Object::cast_to<RigidBody3D>(get_parent()) &&
+ Object::cast_to<ConcavePolygonShape3D>(*shape) &&
+ Object::cast_to<RigidBody3D>(get_parent())->get_mode() != RigidBody3D::MODE_STATIC) {
+ if (!warning.empty()) {
+ warning += "\n\n";
}
+ warning += TTR("ConcavePolygonShape3D doesn't support RigidBody3D in another mode than static.");
}
return warning;
diff --git a/scene/3d/gi_probe.cpp b/scene/3d/gi_probe.cpp
index ab30d2fec5..fd592012f8 100644
--- a/scene/3d/gi_probe.cpp
+++ b/scene/3d/gi_probe.cpp
@@ -32,7 +32,6 @@
#include "core/os/os.h"
-#include "core/method_bind_ext.gen.inc"
#include "mesh_instance_3d.h"
#include "voxelizer.h"
diff --git a/scene/3d/gpu_particles_3d.cpp b/scene/3d/gpu_particles_3d.cpp
index da5c99a873..ec33d7bcab 100644
--- a/scene/3d/gpu_particles_3d.cpp
+++ b/scene/3d/gpu_particles_3d.cpp
@@ -124,6 +124,11 @@ void GPUParticles3D::set_speed_scale(float p_scale) {
RS::get_singleton()->particles_set_speed_scale(particles, p_scale);
}
+void GPUParticles3D::set_collision_base_size(float p_size) {
+ collision_base_size = p_size;
+ RS::get_singleton()->particles_set_collision_base_size(particles, p_size);
+}
+
bool GPUParticles3D::is_emitting() const {
return RS::get_singleton()->particles_get_emitting(particles);
}
@@ -168,6 +173,10 @@ float GPUParticles3D::get_speed_scale() const {
return speed_scale;
}
+float GPUParticles3D::get_collision_base_size() const {
+ return collision_base_size;
+}
+
void GPUParticles3D::set_draw_order(DrawOrder p_order) {
draw_order = p_order;
RS::get_singleton()->particles_set_draw_order(particles, RS::ParticlesDrawOrder(p_order));
@@ -381,6 +390,7 @@ void GPUParticles3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_fractional_delta", "enable"), &GPUParticles3D::set_fractional_delta);
ClassDB::bind_method(D_METHOD("set_process_material", "material"), &GPUParticles3D::set_process_material);
ClassDB::bind_method(D_METHOD("set_speed_scale", "scale"), &GPUParticles3D::set_speed_scale);
+ ClassDB::bind_method(D_METHOD("set_collision_base_size", "size"), &GPUParticles3D::set_collision_base_size);
ClassDB::bind_method(D_METHOD("is_emitting"), &GPUParticles3D::is_emitting);
ClassDB::bind_method(D_METHOD("get_amount"), &GPUParticles3D::get_amount);
@@ -395,6 +405,7 @@ void GPUParticles3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("get_fractional_delta"), &GPUParticles3D::get_fractional_delta);
ClassDB::bind_method(D_METHOD("get_process_material"), &GPUParticles3D::get_process_material);
ClassDB::bind_method(D_METHOD("get_speed_scale"), &GPUParticles3D::get_speed_scale);
+ ClassDB::bind_method(D_METHOD("get_collision_base_size"), &GPUParticles3D::get_collision_base_size);
ClassDB::bind_method(D_METHOD("set_draw_order", "order"), &GPUParticles3D::set_draw_order);
@@ -426,6 +437,8 @@ void GPUParticles3D::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_randomness_ratio", "get_randomness_ratio");
ADD_PROPERTY(PropertyInfo(Variant::INT, "fixed_fps", PROPERTY_HINT_RANGE, "0,1000,1"), "set_fixed_fps", "get_fixed_fps");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fract_delta"), "set_fractional_delta", "get_fractional_delta");
+ ADD_GROUP("Collision", "collision_");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_base_size", PROPERTY_HINT_RANGE, "0,128,0.01,or_greater"), "set_collision_base_size", "get_collision_base_size");
ADD_GROUP("Drawing", "");
ADD_PROPERTY(PropertyInfo(Variant::AABB, "visibility_aabb"), "set_visibility_aabb", "get_visibility_aabb");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "local_coords"), "set_use_local_coordinates", "get_use_local_coordinates");
@@ -469,6 +482,7 @@ GPUParticles3D::GPUParticles3D() {
set_draw_passes(1);
set_draw_order(DRAW_ORDER_INDEX);
set_speed_scale(1);
+ set_collision_base_size(0.01);
}
GPUParticles3D::~GPUParticles3D() {
diff --git a/scene/3d/gpu_particles_3d.h b/scene/3d/gpu_particles_3d.h
index 0d8dadd31d..b68acef21c 100644
--- a/scene/3d/gpu_particles_3d.h
+++ b/scene/3d/gpu_particles_3d.h
@@ -65,6 +65,7 @@ private:
int fixed_fps;
bool fractional_delta;
NodePath sub_emitter;
+ float collision_base_size;
Ref<Material> process_material;
@@ -94,6 +95,7 @@ public:
void set_use_local_coordinates(bool p_enable);
void set_process_material(const Ref<Material> &p_material);
void set_speed_scale(float p_scale);
+ void set_collision_base_size(float p_ratio);
bool is_emitting() const;
int get_amount() const;
@@ -106,6 +108,7 @@ public:
bool get_use_local_coordinates() const;
Ref<Material> get_process_material() const;
float get_speed_scale() const;
+ float get_collision_base_size() const;
void set_fixed_fps(int p_count);
int get_fixed_fps() const;
diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp
new file mode 100644
index 0000000000..baaaa23185
--- /dev/null
+++ b/scene/3d/gpu_particles_collision_3d.cpp
@@ -0,0 +1,901 @@
+/*************************************************************************/
+/* gpu_particles_collision_3d.cpp */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#include "gpu_particles_collision_3d.h"
+
+#include "core/thread_work_pool.h"
+#include "mesh_instance_3d.h"
+#include "scene/3d/camera_3d.h"
+#include "scene/main/viewport.h"
+
+void GPUParticlesCollision3D::set_cull_mask(uint32_t p_cull_mask) {
+ cull_mask = p_cull_mask;
+ RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask);
+}
+
+uint32_t GPUParticlesCollision3D::get_cull_mask() const {
+ return cull_mask;
+}
+
+void GPUParticlesCollision3D::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesCollision3D::set_cull_mask);
+ ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesCollision3D::get_cull_mask);
+
+ ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask");
+}
+
+GPUParticlesCollision3D::GPUParticlesCollision3D(RS::ParticlesCollisionType p_type) {
+ collision = RS::get_singleton()->particles_collision_create();
+ RS::get_singleton()->particles_collision_set_collision_type(collision, p_type);
+ set_base(collision);
+}
+
+GPUParticlesCollision3D::~GPUParticlesCollision3D() {
+ RS::get_singleton()->free(collision);
+}
+
+/////////////////////////////////
+
+void GPUParticlesCollisionSphere::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesCollisionSphere::set_radius);
+ ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesCollisionSphere::get_radius);
+
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius");
+}
+
+void GPUParticlesCollisionSphere::set_radius(float p_radius) {
+ radius = p_radius;
+ RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius);
+ update_gizmo();
+}
+
+float GPUParticlesCollisionSphere::get_radius() const {
+ return radius;
+}
+
+AABB GPUParticlesCollisionSphere::get_aabb() const {
+ return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2));
+}
+
+GPUParticlesCollisionSphere::GPUParticlesCollisionSphere() :
+ GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE) {
+}
+
+GPUParticlesCollisionSphere::~GPUParticlesCollisionSphere() {
+}
+
+///////////////////////////
+
+void GPUParticlesCollisionBox::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionBox::set_extents);
+ ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionBox::get_extents);
+
+ ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents");
+}
+
+void GPUParticlesCollisionBox::set_extents(const Vector3 &p_extents) {
+ extents = p_extents;
+ RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents);
+ update_gizmo();
+}
+
+Vector3 GPUParticlesCollisionBox::get_extents() const {
+ return extents;
+}
+
+AABB GPUParticlesCollisionBox::get_aabb() const {
+ return AABB(-extents, extents * 2);
+}
+
+GPUParticlesCollisionBox::GPUParticlesCollisionBox() :
+ GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE) {
+}
+
+GPUParticlesCollisionBox::~GPUParticlesCollisionBox() {
+}
+
+///////////////////////////////
+///////////////////////////
+
+void GPUParticlesCollisionSDF::_find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes) {
+ MeshInstance3D *mi = Object::cast_to<MeshInstance3D>(p_at_node);
+ if (mi && mi->is_visible_in_tree()) {
+ Ref<Mesh> mesh = mi->get_mesh();
+ if (mesh.is_valid()) {
+ AABB aabb = mesh->get_aabb();
+
+ Transform xf = get_global_transform().affine_inverse() * mi->get_global_transform();
+
+ if (p_aabb.intersects(xf.xform(aabb))) {
+ PlotMesh pm;
+ pm.local_xform = xf;
+ pm.mesh = mesh;
+ plot_meshes.push_back(pm);
+ }
+ }
+ }
+
+ Node3D *s = Object::cast_to<Node3D>(p_at_node);
+ if (s) {
+ if (s->is_visible_in_tree()) {
+ Array meshes = p_at_node->call("get_meshes");
+ for (int i = 0; i < meshes.size(); i += 2) {
+ Transform mxf = meshes[i];
+ Ref<Mesh> mesh = meshes[i + 1];
+ if (!mesh.is_valid()) {
+ continue;
+ }
+
+ AABB aabb = mesh->get_aabb();
+
+ Transform xf = get_global_transform().affine_inverse() * (s->get_global_transform() * mxf);
+
+ if (p_aabb.intersects(xf.xform(aabb))) {
+ PlotMesh pm;
+ pm.local_xform = xf;
+ pm.mesh = mesh;
+ plot_meshes.push_back(pm);
+ }
+ }
+ }
+ }
+
+ for (int i = 0; i < p_at_node->get_child_count(); i++) {
+ Node *child = p_at_node->get_child(i);
+ _find_meshes(p_aabb, child, plot_meshes);
+ }
+}
+
+uint32_t GPUParticlesCollisionSDF::_create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness) {
+ if (p_face_count == 1) {
+ return BVH::LEAF_BIT | p_faces[0].index;
+ }
+
+ uint32_t index = bvh_tree.size();
+ {
+ BVH bvh;
+
+ for (uint32_t i = 0; i < p_face_count; i++) {
+ const Face3 &f = p_triangles[p_faces[i].index];
+ AABB aabb(f.vertex[0], Vector3());
+ aabb.expand_to(f.vertex[1]);
+ aabb.expand_to(f.vertex[2]);
+ if (p_thickness > 0.0) {
+ Vector3 normal = p_triangles[p_faces[i].index].get_plane().normal;
+ aabb.expand_to(f.vertex[0] - normal * p_thickness);
+ aabb.expand_to(f.vertex[1] - normal * p_thickness);
+ aabb.expand_to(f.vertex[2] - normal * p_thickness);
+ }
+ if (i == 0) {
+ bvh.bounds = aabb;
+ } else {
+ bvh.bounds.merge_with(aabb);
+ }
+ }
+ bvh_tree.push_back(bvh);
+ }
+
+ uint32_t middle = p_face_count / 2;
+
+ SortArray<FacePos, FaceSort> s;
+ s.compare.axis = bvh_tree[index].bounds.get_longest_axis_index();
+ s.sort(p_faces, p_face_count);
+
+ uint32_t left = _create_bvh(bvh_tree, p_faces, middle, p_triangles, p_thickness);
+ uint32_t right = _create_bvh(bvh_tree, p_faces + middle, p_face_count - middle, p_triangles, p_thickness);
+
+ bvh_tree[index].children[0] = left;
+ bvh_tree[index].children[1] = right;
+
+ return index;
+}
+
+static _FORCE_INLINE_ float Vector3_dot2(const Vector3 &p_vec3) {
+ return p_vec3.dot(p_vec3);
+}
+
+void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance) {
+ if (p_bvh_cell & BVH::LEAF_BIT) {
+ p_bvh_cell &= BVH::LEAF_MASK; //remove bit
+
+ Vector3 point = p_pos;
+ Plane p = triangles[p_bvh_cell].get_plane();
+ float d = p.distance_to(point);
+ float inside_d = 1e20;
+ if (d < 0 && d > -thickness) {
+ //inside planes, do this in 2D
+
+ Vector3 x_axis = (triangles[p_bvh_cell].vertex[0] - triangles[p_bvh_cell].vertex[1]).normalized();
+ Vector3 y_axis = p.normal.cross(x_axis).normalized();
+
+ Vector2 points[3];
+ for (int i = 0; i < 3; i++) {
+ points[i] = Vector2(x_axis.dot(triangles[p_bvh_cell].vertex[i]), y_axis.dot(triangles[p_bvh_cell].vertex[i]));
+ }
+
+ Vector2 p2d = Vector2(x_axis.dot(point), y_axis.dot(point));
+
+ {
+ // https://www.shadertoy.com/view/XsXSz4
+
+ Vector2 e0 = points[1] - points[0];
+ Vector2 e1 = points[2] - points[1];
+ Vector2 e2 = points[0] - points[2];
+
+ Vector2 v0 = p2d - points[0];
+ Vector2 v1 = p2d - points[1];
+ Vector2 v2 = p2d - points[2];
+
+ Vector2 pq0 = v0 - e0 * CLAMP(v0.dot(e0) / e0.dot(e0), 0.0, 1.0);
+ Vector2 pq1 = v1 - e1 * CLAMP(v1.dot(e1) / e1.dot(e1), 0.0, 1.0);
+ Vector2 pq2 = v2 - e2 * CLAMP(v2.dot(e2) / e2.dot(e2), 0.0, 1.0);
+
+ float s = SGN(e0.x * e2.y - e0.y * e2.x);
+ Vector2 d2 = Vector2(pq0.dot(pq0), s * (v0.x * e0.y - v0.y * e0.x)).min(Vector2(pq1.dot(pq1), s * (v1.x * e1.y - v1.y * e1.x))).min(Vector2(pq2.dot(pq2), s * (v2.x * e2.y - v2.y * e2.x)));
+
+ inside_d = -Math::sqrt(d2.x) * SGN(d2.y);
+ }
+
+ //make sure distance to planes is not shorter if inside
+ if (inside_d < 0) {
+ inside_d = MAX(inside_d, d);
+ inside_d = MAX(inside_d, -(thickness + d));
+ }
+
+ closest_distance = MIN(closest_distance, inside_d);
+ } else {
+ if (d < 0) {
+ point -= p.normal * thickness; //flatten
+ }
+
+ // https://iquilezles.org/www/articles/distfunctions/distfunctions.htm
+ Vector3 a = triangles[p_bvh_cell].vertex[0];
+ Vector3 b = triangles[p_bvh_cell].vertex[1];
+ Vector3 c = triangles[p_bvh_cell].vertex[2];
+
+ Vector3 ba = b - a;
+ Vector3 pa = point - a;
+ Vector3 cb = c - b;
+ Vector3 pb = point - b;
+ Vector3 ac = a - c;
+ Vector3 pc = point - c;
+ Vector3 nor = ba.cross(ac);
+
+ inside_d = Math::sqrt(
+ (SGN(ba.cross(nor).dot(pa)) +
+ SGN(cb.cross(nor).dot(pb)) +
+ SGN(ac.cross(nor).dot(pc)) <
+ 2.0) ?
+ MIN(MIN(
+ Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
+ Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
+ Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) :
+ nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
+
+ closest_distance = MIN(closest_distance, inside_d);
+ }
+
+ } else {
+ bool pass = true;
+ if (!bvh[p_bvh_cell].bounds.has_point(p_pos)) {
+ //outside, find closest point
+ Vector3 he = bvh[p_bvh_cell].bounds.size * 0.5;
+ Vector3 center = bvh[p_bvh_cell].bounds.position + he;
+
+ Vector3 rel = (p_pos - center).abs();
+ Vector3 closest(MIN(rel.x, he.x), MIN(rel.y, he.y), MIN(rel.z, he.z));
+ float d = rel.distance_to(closest);
+
+ if (d >= closest_distance) {
+ pass = false; //already closer than this aabb, discard
+ }
+ }
+
+ if (pass) {
+ _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[0], triangles, thickness, closest_distance);
+ _find_closest_distance(p_pos, bvh, bvh[p_bvh_cell].children[1], triangles, thickness, closest_distance);
+ }
+ }
+}
+
+void GPUParticlesCollisionSDF::_compute_sdf_z(uint32_t p_z, ComputeSDFParams *params) {
+ int32_t z_ofs = p_z * params->size.y * params->size.x;
+ for (int32_t y = 0; y < params->size.y; y++) {
+ int32_t y_ofs = z_ofs + y * params->size.x;
+ for (int32_t x = 0; x < params->size.x; x++) {
+ int32_t x_ofs = y_ofs + x;
+ float &cell = params->cells[x_ofs];
+
+ Vector3 pos = params->cell_offset + Vector3(x, y, p_z) * params->cell_size;
+
+ cell = 1e20;
+
+ _find_closest_distance(pos, params->bvh, 0, params->triangles, params->thickness, cell);
+ }
+ }
+}
+
+void GPUParticlesCollisionSDF::_compute_sdf(ComputeSDFParams *params) {
+ ThreadWorkPool work_pool;
+ work_pool.init();
+ work_pool.begin_work(params->size.z, this, &GPUParticlesCollisionSDF::_compute_sdf_z, params);
+ while (work_pool.get_work_index() < (uint32_t)params->size.z) {
+ OS::get_singleton()->delay_usec(10000);
+ bake_step_function(work_pool.get_work_index() * 100 / params->size.z, "Baking SDF");
+ }
+ work_pool.end_work();
+ work_pool.finish();
+}
+
+Vector3i GPUParticlesCollisionSDF::get_estimated_cell_size() const {
+ static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 };
+ int subdiv = subdivs[get_resolution()];
+
+ AABB aabb(-extents, extents * 2);
+
+ float cell_size = aabb.get_longest_axis_size() / float(subdiv);
+
+ Vector3i sdf_size = Vector3i(aabb.size / cell_size);
+ sdf_size.x = MAX(1, sdf_size.x);
+ sdf_size.y = MAX(1, sdf_size.y);
+ sdf_size.z = MAX(1, sdf_size.z);
+ return sdf_size;
+}
+
+Ref<Image> GPUParticlesCollisionSDF::bake() {
+ static const int subdivs[RESOLUTION_MAX] = { 16, 32, 64, 128, 256, 512 };
+ int subdiv = subdivs[get_resolution()];
+
+ AABB aabb(-extents, extents * 2);
+
+ float cell_size = aabb.get_longest_axis_size() / float(subdiv);
+
+ Vector3i sdf_size = Vector3i(aabb.size / cell_size);
+ sdf_size.x = MAX(1, sdf_size.x);
+ sdf_size.y = MAX(1, sdf_size.y);
+ sdf_size.z = MAX(1, sdf_size.z);
+
+ if (bake_begin_function) {
+ bake_begin_function(100);
+ }
+
+ aabb.size = Vector3(sdf_size) * cell_size;
+
+ List<PlotMesh> plot_meshes;
+ _find_meshes(aabb, get_parent(), plot_meshes);
+
+ LocalVector<Face3> faces;
+
+ if (bake_step_function) {
+ bake_step_function(0, "Finding Meshes");
+ }
+
+ for (List<PlotMesh>::Element *E = plot_meshes.front(); E; E = E->next()) {
+ const PlotMesh &pm = E->get();
+
+ for (int i = 0; i < pm.mesh->get_surface_count(); i++) {
+ if (pm.mesh->surface_get_primitive_type(i) != Mesh::PRIMITIVE_TRIANGLES) {
+ continue; //only triangles
+ }
+
+ Array a = pm.mesh->surface_get_arrays(i);
+
+ Vector<Vector3> vertices = a[Mesh::ARRAY_VERTEX];
+ const Vector3 *vr = vertices.ptr();
+ Vector<int> index = a[Mesh::ARRAY_INDEX];
+
+ if (index.size()) {
+ int facecount = index.size() / 3;
+ const int *ir = index.ptr();
+
+ for (int j = 0; j < facecount; j++) {
+ Face3 face;
+
+ for (int k = 0; k < 3; k++) {
+ face.vertex[k] = pm.local_xform.xform(vr[ir[j * 3 + k]]);
+ }
+
+ //test against original bounds
+ if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) {
+ continue;
+ }
+
+ faces.push_back(face);
+ }
+
+ } else {
+ int facecount = vertices.size() / 3;
+
+ for (int j = 0; j < facecount; j++) {
+ Face3 face;
+
+ for (int k = 0; k < 3; k++) {
+ face.vertex[k] = pm.local_xform.xform(vr[j * 3 + k]);
+ }
+
+ //test against original bounds
+ if (!Geometry3D::triangle_box_overlap(aabb.position + aabb.size * 0.5, aabb.size * 0.5, face.vertex)) {
+ continue;
+ }
+
+ faces.push_back(face);
+ }
+ }
+ }
+ }
+
+ //compute bvh
+
+ ERR_FAIL_COND_V(faces.size() <= 1, Ref<Image>());
+
+ LocalVector<FacePos> face_pos;
+
+ face_pos.resize(faces.size());
+
+ float th = cell_size * thickness;
+
+ for (uint32_t i = 0; i < faces.size(); i++) {
+ face_pos[i].index = i;
+ face_pos[i].center = (faces[i].vertex[0] + faces[i].vertex[1] + faces[i].vertex[2]) / 2;
+ if (th > 0.0) {
+ face_pos[i].center -= faces[i].get_plane().normal * th * 0.5;
+ }
+ }
+
+ if (bake_step_function) {
+ bake_step_function(0, "Creating BVH");
+ }
+
+ LocalVector<BVH> bvh;
+
+ _create_bvh(bvh, face_pos.ptr(), face_pos.size(), faces.ptr(), th);
+
+ Vector<uint8_t> data;
+ data.resize(sdf_size.z * sdf_size.y * sdf_size.x * sizeof(float));
+
+ if (bake_step_function) {
+ bake_step_function(0, "Baking SDF");
+ }
+
+ ComputeSDFParams params;
+ params.cells = (float *)data.ptrw();
+ params.size = sdf_size;
+ params.cell_size = cell_size;
+ params.cell_offset = aabb.position + Vector3(cell_size * 0.5, cell_size * 0.5, cell_size * 0.5);
+ params.bvh = bvh.ptr();
+ params.triangles = faces.ptr();
+ params.thickness = th;
+ _compute_sdf(&params);
+
+ Ref<Image> ret;
+ ret.instance();
+ ret->create(sdf_size.x, sdf_size.y * sdf_size.z, false, Image::FORMAT_RF, data);
+ ret->convert(Image::FORMAT_RH); //convert to half, save space
+ ret->set_meta("depth", sdf_size.z); //hack, make sure to add to the docs of this function
+
+ if (bake_end_function) {
+ bake_end_function();
+ }
+
+ return ret;
+}
+
+void GPUParticlesCollisionSDF::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionSDF::set_extents);
+ ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionSDF::get_extents);
+
+ ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionSDF::set_resolution);
+ ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionSDF::get_resolution);
+
+ ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesCollisionSDF::set_texture);
+ ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesCollisionSDF::get_texture);
+
+ ClassDB::bind_method(D_METHOD("set_thickness", "thickness"), &GPUParticlesCollisionSDF::set_thickness);
+ ClassDB::bind_method(D_METHOD("get_thickness"), &GPUParticlesCollisionSDF::get_thickness);
+
+ ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents");
+ ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "16,32,64,128,256,512"), "set_resolution", "get_resolution");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "thickness", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_thickness", "get_thickness");
+ ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture");
+
+ BIND_ENUM_CONSTANT(RESOLUTION_16);
+ BIND_ENUM_CONSTANT(RESOLUTION_32);
+ BIND_ENUM_CONSTANT(RESOLUTION_64);
+ BIND_ENUM_CONSTANT(RESOLUTION_128);
+ BIND_ENUM_CONSTANT(RESOLUTION_256);
+ BIND_ENUM_CONSTANT(RESOLUTION_512);
+ BIND_ENUM_CONSTANT(RESOLUTION_MAX);
+}
+
+void GPUParticlesCollisionSDF::set_thickness(float p_thickness) {
+ thickness = p_thickness;
+}
+
+float GPUParticlesCollisionSDF::get_thickness() const {
+ return thickness;
+}
+
+void GPUParticlesCollisionSDF::set_extents(const Vector3 &p_extents) {
+ extents = p_extents;
+ RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents);
+ update_gizmo();
+}
+
+Vector3 GPUParticlesCollisionSDF::get_extents() const {
+ return extents;
+}
+
+void GPUParticlesCollisionSDF::set_resolution(Resolution p_resolution) {
+ resolution = p_resolution;
+ update_gizmo();
+}
+
+GPUParticlesCollisionSDF::Resolution GPUParticlesCollisionSDF::get_resolution() const {
+ return resolution;
+}
+
+void GPUParticlesCollisionSDF::set_texture(const Ref<Texture3D> &p_texture) {
+ texture = p_texture;
+ RID tex = texture.is_valid() ? texture->get_rid() : RID();
+ RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex);
+}
+
+Ref<Texture3D> GPUParticlesCollisionSDF::get_texture() const {
+ return texture;
+}
+
+AABB GPUParticlesCollisionSDF::get_aabb() const {
+ return AABB(-extents, extents * 2);
+}
+
+GPUParticlesCollisionSDF::BakeBeginFunc GPUParticlesCollisionSDF::bake_begin_function = nullptr;
+GPUParticlesCollisionSDF::BakeStepFunc GPUParticlesCollisionSDF::bake_step_function = nullptr;
+GPUParticlesCollisionSDF::BakeEndFunc GPUParticlesCollisionSDF::bake_end_function = nullptr;
+
+GPUParticlesCollisionSDF::GPUParticlesCollisionSDF() :
+ GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE) {
+}
+
+GPUParticlesCollisionSDF::~GPUParticlesCollisionSDF() {
+}
+
+////////////////////////////
+////////////////////////////
+
+void GPUParticlesCollisionHeightField::_notification(int p_what) {
+ if (p_what == NOTIFICATION_INTERNAL_PROCESS) {
+ if (update_mode == UPDATE_MODE_ALWAYS) {
+ RS::get_singleton()->particles_collision_height_field_update(_get_collision());
+ }
+
+ if (follow_camera_mode && get_viewport()) {
+ Camera3D *cam = get_viewport()->get_camera();
+ if (cam) {
+ Transform xform = get_global_transform();
+ Vector3 x_axis = xform.basis.get_axis(Vector3::AXIS_X).normalized();
+ Vector3 z_axis = xform.basis.get_axis(Vector3::AXIS_Z).normalized();
+ float x_len = xform.basis.get_scale().x;
+ float z_len = xform.basis.get_scale().z;
+
+ Vector3 cam_pos = cam->get_global_transform().origin;
+ Transform new_xform = xform;
+
+ while (x_axis.dot(cam_pos - new_xform.origin) > x_len) {
+ new_xform.origin += x_axis * x_len;
+ }
+ while (x_axis.dot(cam_pos - new_xform.origin) < -x_len) {
+ new_xform.origin -= x_axis * x_len;
+ }
+
+ while (z_axis.dot(cam_pos - new_xform.origin) > z_len) {
+ new_xform.origin += z_axis * z_len;
+ }
+ while (z_axis.dot(cam_pos - new_xform.origin) < -z_len) {
+ new_xform.origin -= z_axis * z_len;
+ }
+
+ if (new_xform != xform) {
+ set_global_transform(new_xform);
+ RS::get_singleton()->particles_collision_height_field_update(_get_collision());
+ }
+ }
+ }
+ }
+
+ if (p_what == NOTIFICATION_TRANSFORM_CHANGED) {
+ RS::get_singleton()->particles_collision_height_field_update(_get_collision());
+ }
+}
+
+void GPUParticlesCollisionHeightField::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesCollisionHeightField::set_extents);
+ ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesCollisionHeightField::get_extents);
+
+ ClassDB::bind_method(D_METHOD("set_resolution", "resolution"), &GPUParticlesCollisionHeightField::set_resolution);
+ ClassDB::bind_method(D_METHOD("get_resolution"), &GPUParticlesCollisionHeightField::get_resolution);
+
+ ClassDB::bind_method(D_METHOD("set_update_mode", "update_mode"), &GPUParticlesCollisionHeightField::set_update_mode);
+ ClassDB::bind_method(D_METHOD("get_update_mode"), &GPUParticlesCollisionHeightField::get_update_mode);
+
+ ClassDB::bind_method(D_METHOD("set_follow_camera_mode", "enabled"), &GPUParticlesCollisionHeightField::set_follow_camera_mode);
+ ClassDB::bind_method(D_METHOD("is_follow_camera_mode_enabled"), &GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled);
+
+ ClassDB::bind_method(D_METHOD("set_follow_camera_push_ratio", "ratio"), &GPUParticlesCollisionHeightField::set_follow_camera_push_ratio);
+ ClassDB::bind_method(D_METHOD("get_follow_camera_push_ratio"), &GPUParticlesCollisionHeightField::get_follow_camera_push_ratio);
+
+ ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents");
+ ADD_PROPERTY(PropertyInfo(Variant::INT, "resolution", PROPERTY_HINT_ENUM, "256,512,1024,2048,4096,8192"), "set_resolution", "get_resolution");
+ ADD_PROPERTY(PropertyInfo(Variant::INT, "update_mode", PROPERTY_HINT_ENUM, "WhenMoved,Always"), "set_update_mode", "get_update_mode");
+ ADD_GROUP("Folow Camera", "follow_camera_");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "follow_camera_enabled"), "set_follow_camera_mode", "is_follow_camera_mode_enabled");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "follow_camera_push_ratio", PROPERTY_HINT_RANGE, "0.01,1,0.01"), "set_follow_camera_push_ratio", "get_follow_camera_push_ratio");
+
+ BIND_ENUM_CONSTANT(RESOLUTION_256);
+ BIND_ENUM_CONSTANT(RESOLUTION_512);
+ BIND_ENUM_CONSTANT(RESOLUTION_1024);
+ BIND_ENUM_CONSTANT(RESOLUTION_2048);
+ BIND_ENUM_CONSTANT(RESOLUTION_4096);
+ BIND_ENUM_CONSTANT(RESOLUTION_8192);
+ BIND_ENUM_CONSTANT(RESOLUTION_MAX);
+
+ BIND_ENUM_CONSTANT(UPDATE_MODE_WHEN_MOVED);
+ BIND_ENUM_CONSTANT(UPDATE_MODE_ALWAYS);
+}
+
+void GPUParticlesCollisionHeightField::set_follow_camera_push_ratio(float p_follow_camera_push_ratio) {
+ follow_camera_push_ratio = p_follow_camera_push_ratio;
+}
+
+float GPUParticlesCollisionHeightField::get_follow_camera_push_ratio() const {
+ return follow_camera_push_ratio;
+}
+
+void GPUParticlesCollisionHeightField::set_extents(const Vector3 &p_extents) {
+ extents = p_extents;
+ RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents);
+ update_gizmo();
+ RS::get_singleton()->particles_collision_height_field_update(_get_collision());
+}
+
+Vector3 GPUParticlesCollisionHeightField::get_extents() const {
+ return extents;
+}
+
+void GPUParticlesCollisionHeightField::set_resolution(Resolution p_resolution) {
+ resolution = p_resolution;
+ RS::get_singleton()->particles_collision_set_height_field_resolution(_get_collision(), RS::ParticlesCollisionHeightfieldResolution(resolution));
+ update_gizmo();
+ RS::get_singleton()->particles_collision_height_field_update(_get_collision());
+}
+
+GPUParticlesCollisionHeightField::Resolution GPUParticlesCollisionHeightField::get_resolution() const {
+ return resolution;
+}
+
+void GPUParticlesCollisionHeightField::set_update_mode(UpdateMode p_update_mode) {
+ update_mode = p_update_mode;
+ set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS);
+}
+
+GPUParticlesCollisionHeightField::UpdateMode GPUParticlesCollisionHeightField::get_update_mode() const {
+ return update_mode;
+}
+
+void GPUParticlesCollisionHeightField::set_follow_camera_mode(bool p_enabled) {
+ follow_camera_mode = p_enabled;
+ set_process_internal(follow_camera_mode || update_mode == UPDATE_MODE_ALWAYS);
+}
+
+bool GPUParticlesCollisionHeightField::is_follow_camera_mode_enabled() const {
+ return follow_camera_mode;
+}
+
+AABB GPUParticlesCollisionHeightField::get_aabb() const {
+ return AABB(-extents, extents * 2);
+}
+
+GPUParticlesCollisionHeightField::GPUParticlesCollisionHeightField() :
+ GPUParticlesCollision3D(RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE) {
+}
+
+GPUParticlesCollisionHeightField::~GPUParticlesCollisionHeightField() {
+}
+
+////////////////////////////
+////////////////////////////
+
+void GPUParticlesAttractor3D::set_cull_mask(uint32_t p_cull_mask) {
+ cull_mask = p_cull_mask;
+ RS::get_singleton()->particles_collision_set_cull_mask(collision, p_cull_mask);
+}
+
+uint32_t GPUParticlesAttractor3D::get_cull_mask() const {
+ return cull_mask;
+}
+
+void GPUParticlesAttractor3D::set_strength(float p_strength) {
+ strength = p_strength;
+ RS::get_singleton()->particles_collision_set_attractor_strength(collision, p_strength);
+}
+
+float GPUParticlesAttractor3D::get_strength() const {
+ return strength;
+}
+
+void GPUParticlesAttractor3D::set_attenuation(float p_attenuation) {
+ attenuation = p_attenuation;
+ RS::get_singleton()->particles_collision_set_attractor_attenuation(collision, p_attenuation);
+}
+
+float GPUParticlesAttractor3D::get_attenuation() const {
+ return attenuation;
+}
+
+void GPUParticlesAttractor3D::set_directionality(float p_directionality) {
+ directionality = p_directionality;
+ RS::get_singleton()->particles_collision_set_attractor_directionality(collision, p_directionality);
+ update_gizmo();
+}
+
+float GPUParticlesAttractor3D::get_directionality() const {
+ return directionality;
+}
+
+void GPUParticlesAttractor3D::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_cull_mask", "mask"), &GPUParticlesAttractor3D::set_cull_mask);
+ ClassDB::bind_method(D_METHOD("get_cull_mask"), &GPUParticlesAttractor3D::get_cull_mask);
+
+ ClassDB::bind_method(D_METHOD("set_strength", "strength"), &GPUParticlesAttractor3D::set_strength);
+ ClassDB::bind_method(D_METHOD("get_strength"), &GPUParticlesAttractor3D::get_strength);
+
+ ClassDB::bind_method(D_METHOD("set_attenuation", "attenuation"), &GPUParticlesAttractor3D::set_attenuation);
+ ClassDB::bind_method(D_METHOD("get_attenuation"), &GPUParticlesAttractor3D::get_attenuation);
+
+ ClassDB::bind_method(D_METHOD("set_directionality", "amount"), &GPUParticlesAttractor3D::set_directionality);
+ ClassDB::bind_method(D_METHOD("get_directionality"), &GPUParticlesAttractor3D::get_directionality);
+
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "strength", PROPERTY_HINT_RANGE, "-128,128,0.01,or_greater,or_lesser"), "set_strength", "get_strength");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "attenuation", PROPERTY_HINT_EXP_EASING, "0,8,0.01"), "set_attenuation", "get_attenuation");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "directionality", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_directionality", "get_directionality");
+ ADD_PROPERTY(PropertyInfo(Variant::INT, "cull_mask", PROPERTY_HINT_LAYERS_3D_RENDER), "set_cull_mask", "get_cull_mask");
+}
+
+GPUParticlesAttractor3D::GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type) {
+ collision = RS::get_singleton()->particles_collision_create();
+ RS::get_singleton()->particles_collision_set_collision_type(collision, p_type);
+ set_base(collision);
+}
+GPUParticlesAttractor3D::~GPUParticlesAttractor3D() {
+ RS::get_singleton()->free(collision);
+}
+
+/////////////////////////////////
+
+void GPUParticlesAttractorSphere::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_radius", "radius"), &GPUParticlesAttractorSphere::set_radius);
+ ClassDB::bind_method(D_METHOD("get_radius"), &GPUParticlesAttractorSphere::get_radius);
+
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "radius", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_radius", "get_radius");
+}
+
+void GPUParticlesAttractorSphere::set_radius(float p_radius) {
+ radius = p_radius;
+ RS::get_singleton()->particles_collision_set_sphere_radius(_get_collision(), radius);
+ update_gizmo();
+}
+
+float GPUParticlesAttractorSphere::get_radius() const {
+ return radius;
+}
+
+AABB GPUParticlesAttractorSphere::get_aabb() const {
+ return AABB(Vector3(-radius, -radius, -radius), Vector3(radius * 2, radius * 2, radius * 2));
+}
+
+GPUParticlesAttractorSphere::GPUParticlesAttractorSphere() :
+ GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT) {
+}
+
+GPUParticlesAttractorSphere::~GPUParticlesAttractorSphere() {
+}
+
+///////////////////////////
+
+void GPUParticlesAttractorBox::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorBox::set_extents);
+ ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorBox::get_extents);
+
+ ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents");
+}
+
+void GPUParticlesAttractorBox::set_extents(const Vector3 &p_extents) {
+ extents = p_extents;
+ RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents);
+ update_gizmo();
+}
+
+Vector3 GPUParticlesAttractorBox::get_extents() const {
+ return extents;
+}
+
+AABB GPUParticlesAttractorBox::get_aabb() const {
+ return AABB(-extents, extents * 2);
+}
+
+GPUParticlesAttractorBox::GPUParticlesAttractorBox() :
+ GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT) {
+}
+
+GPUParticlesAttractorBox::~GPUParticlesAttractorBox() {
+}
+
+///////////////////////////
+
+void GPUParticlesAttractorVectorField::_bind_methods() {
+ ClassDB::bind_method(D_METHOD("set_extents", "extents"), &GPUParticlesAttractorVectorField::set_extents);
+ ClassDB::bind_method(D_METHOD("get_extents"), &GPUParticlesAttractorVectorField::get_extents);
+
+ ClassDB::bind_method(D_METHOD("set_texture", "texture"), &GPUParticlesAttractorVectorField::set_texture);
+ ClassDB::bind_method(D_METHOD("get_texture"), &GPUParticlesAttractorVectorField::get_texture);
+
+ ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "extents", PROPERTY_HINT_RANGE, "0.01,1024,0.01,or_greater"), "set_extents", "get_extents");
+ ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "texture", PROPERTY_HINT_RESOURCE_TYPE, "Texture3D"), "set_texture", "get_texture");
+}
+
+void GPUParticlesAttractorVectorField::set_extents(const Vector3 &p_extents) {
+ extents = p_extents;
+ RS::get_singleton()->particles_collision_set_box_extents(_get_collision(), extents);
+ update_gizmo();
+}
+
+Vector3 GPUParticlesAttractorVectorField::get_extents() const {
+ return extents;
+}
+
+void GPUParticlesAttractorVectorField::set_texture(const Ref<Texture3D> &p_texture) {
+ texture = p_texture;
+ RID tex = texture.is_valid() ? texture->get_rid() : RID();
+ RS::get_singleton()->particles_collision_set_field_texture(_get_collision(), tex);
+}
+
+Ref<Texture3D> GPUParticlesAttractorVectorField::get_texture() const {
+ return texture;
+}
+
+AABB GPUParticlesAttractorVectorField::get_aabb() const {
+ return AABB(-extents, extents * 2);
+}
+
+GPUParticlesAttractorVectorField::GPUParticlesAttractorVectorField() :
+ GPUParticlesAttractor3D(RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) {
+}
+
+GPUParticlesAttractorVectorField::~GPUParticlesAttractorVectorField() {
+}
diff --git a/scene/3d/gpu_particles_collision_3d.h b/scene/3d/gpu_particles_collision_3d.h
new file mode 100644
index 0000000000..4c73c7bcb2
--- /dev/null
+++ b/scene/3d/gpu_particles_collision_3d.h
@@ -0,0 +1,342 @@
+/*************************************************************************/
+/* gpu_particles_collision_3d.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef GPU_PARTICLES_COLLISION_3D_H
+#define GPU_PARTICLES_COLLISION_3D_H
+
+#include "core/local_vector.h"
+#include "core/rid.h"
+#include "scene/3d/visual_instance_3d.h"
+#include "scene/resources/material.h"
+
+class GPUParticlesCollision3D : public VisualInstance3D {
+ GDCLASS(GPUParticlesCollision3D, VisualInstance3D);
+
+ uint32_t cull_mask = 0xFFFFFFFF;
+ RID collision;
+
+protected:
+ _FORCE_INLINE_ RID _get_collision() { return collision; }
+ static void _bind_methods();
+
+ GPUParticlesCollision3D(RS::ParticlesCollisionType p_type);
+
+public:
+ void set_cull_mask(uint32_t p_cull_mask);
+ uint32_t get_cull_mask() const;
+
+ virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); }
+
+ ~GPUParticlesCollision3D();
+};
+
+class GPUParticlesCollisionSphere : public GPUParticlesCollision3D {
+ GDCLASS(GPUParticlesCollisionSphere, GPUParticlesCollision3D);
+
+ float radius = 1.0;
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_radius(float p_radius);
+ float get_radius() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesCollisionSphere();
+ ~GPUParticlesCollisionSphere();
+};
+
+class GPUParticlesCollisionBox : public GPUParticlesCollision3D {
+ GDCLASS(GPUParticlesCollisionBox, GPUParticlesCollision3D);
+
+ Vector3 extents = Vector3(1, 1, 1);
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_extents(const Vector3 &p_extents);
+ Vector3 get_extents() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesCollisionBox();
+ ~GPUParticlesCollisionBox();
+};
+
+class GPUParticlesCollisionSDF : public GPUParticlesCollision3D {
+ GDCLASS(GPUParticlesCollisionSDF, GPUParticlesCollision3D);
+
+public:
+ enum Resolution {
+ RESOLUTION_16,
+ RESOLUTION_32,
+ RESOLUTION_64,
+ RESOLUTION_128,
+ RESOLUTION_256,
+ RESOLUTION_512,
+ RESOLUTION_MAX,
+ };
+
+ typedef void (*BakeBeginFunc)(int);
+ typedef void (*BakeStepFunc)(int, const String &);
+ typedef void (*BakeEndFunc)();
+
+private:
+ Vector3 extents = Vector3(1, 1, 1);
+ Resolution resolution = RESOLUTION_64;
+ Ref<Texture3D> texture;
+ float thickness = 1.0;
+
+ struct PlotMesh {
+ Ref<Mesh> mesh;
+ Transform local_xform;
+ };
+
+ void _find_meshes(const AABB &p_aabb, Node *p_at_node, List<PlotMesh> &plot_meshes);
+
+ struct BVH {
+ enum {
+ LEAF_BIT = 1 << 30,
+ LEAF_MASK = LEAF_BIT - 1
+ };
+ AABB bounds;
+ uint32_t children[2];
+ };
+
+ struct FacePos {
+ Vector3 center;
+ uint32_t index;
+ };
+
+ struct FaceSort {
+ uint32_t axis;
+ bool operator()(const FacePos &p_left, const FacePos &p_right) const {
+ return p_left.center[axis] < p_right.center[axis];
+ }
+ };
+
+ uint32_t _create_bvh(LocalVector<BVH> &bvh_tree, FacePos *p_faces, uint32_t p_face_count, const Face3 *p_triangles, float p_thickness);
+
+ struct ComputeSDFParams {
+ float *cells;
+ Vector3i size;
+ float cell_size;
+ Vector3 cell_offset;
+ const BVH *bvh;
+ const Face3 *triangles;
+ float thickness;
+ };
+
+ void _find_closest_distance(const Vector3 &p_pos, const BVH *bvh, uint32_t p_bvh_cell, const Face3 *triangles, float thickness, float &closest_distance);
+ void _compute_sdf_z(uint32_t p_z, ComputeSDFParams *params);
+ void _compute_sdf(ComputeSDFParams *params);
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_thickness(float p_thickness);
+ float get_thickness() const;
+
+ void set_extents(const Vector3 &p_extents);
+ Vector3 get_extents() const;
+
+ void set_resolution(Resolution p_resolution);
+ Resolution get_resolution() const;
+
+ void set_texture(const Ref<Texture3D> &p_texture);
+ Ref<Texture3D> get_texture() const;
+
+ Vector3i get_estimated_cell_size() const;
+ Ref<Image> bake();
+
+ virtual AABB get_aabb() const override;
+
+ static BakeBeginFunc bake_begin_function;
+ static BakeStepFunc bake_step_function;
+ static BakeEndFunc bake_end_function;
+
+ GPUParticlesCollisionSDF();
+ ~GPUParticlesCollisionSDF();
+};
+
+VARIANT_ENUM_CAST(GPUParticlesCollisionSDF::Resolution)
+
+class GPUParticlesCollisionHeightField : public GPUParticlesCollision3D {
+ GDCLASS(GPUParticlesCollisionHeightField, GPUParticlesCollision3D);
+
+public:
+ enum Resolution {
+ RESOLUTION_256,
+ RESOLUTION_512,
+ RESOLUTION_1024,
+ RESOLUTION_2048,
+ RESOLUTION_4096,
+ RESOLUTION_8192,
+ RESOLUTION_MAX,
+ };
+
+ enum UpdateMode {
+ UPDATE_MODE_WHEN_MOVED,
+ UPDATE_MODE_ALWAYS,
+ };
+
+private:
+ Vector3 extents = Vector3(1, 1, 1);
+ Resolution resolution = RESOLUTION_1024;
+ bool follow_camera_mode = false;
+ float follow_camera_push_ratio = 0.1;
+
+ UpdateMode update_mode = UPDATE_MODE_WHEN_MOVED;
+
+protected:
+ void _notification(int p_what);
+ static void _bind_methods();
+
+public:
+ void set_extents(const Vector3 &p_extents);
+ Vector3 get_extents() const;
+
+ void set_resolution(Resolution p_resolution);
+ Resolution get_resolution() const;
+
+ void set_update_mode(UpdateMode p_update_mode);
+ UpdateMode get_update_mode() const;
+
+ void set_follow_camera_mode(bool p_enabled);
+ bool is_follow_camera_mode_enabled() const;
+
+ void set_follow_camera_push_ratio(float p_ratio);
+ float get_follow_camera_push_ratio() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesCollisionHeightField();
+ ~GPUParticlesCollisionHeightField();
+};
+
+VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::Resolution)
+VARIANT_ENUM_CAST(GPUParticlesCollisionHeightField::UpdateMode)
+
+class GPUParticlesAttractor3D : public VisualInstance3D {
+ GDCLASS(GPUParticlesAttractor3D, VisualInstance3D);
+
+ uint32_t cull_mask = 0xFFFFFFFF;
+ RID collision;
+ float strength = 1.0;
+ float attenuation = 1.0;
+ float directionality = 0.0;
+
+protected:
+ _FORCE_INLINE_ RID _get_collision() { return collision; }
+ static void _bind_methods();
+
+ GPUParticlesAttractor3D(RS::ParticlesCollisionType p_type);
+
+public:
+ void set_cull_mask(uint32_t p_cull_mask);
+ uint32_t get_cull_mask() const;
+
+ void set_strength(float p_strength);
+ float get_strength() const;
+
+ void set_attenuation(float p_attenuation);
+ float get_attenuation() const;
+
+ void set_directionality(float p_directionality);
+ float get_directionality() const;
+
+ virtual Vector<Face3> get_faces(uint32_t p_usage_flags) const override { return Vector<Face3>(); }
+
+ ~GPUParticlesAttractor3D();
+};
+
+class GPUParticlesAttractorSphere : public GPUParticlesAttractor3D {
+ GDCLASS(GPUParticlesAttractorSphere, GPUParticlesAttractor3D);
+
+ float radius = 1.0;
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_radius(float p_radius);
+ float get_radius() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesAttractorSphere();
+ ~GPUParticlesAttractorSphere();
+};
+
+class GPUParticlesAttractorBox : public GPUParticlesAttractor3D {
+ GDCLASS(GPUParticlesAttractorBox, GPUParticlesAttractor3D);
+
+ Vector3 extents = Vector3(1, 1, 1);
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_extents(const Vector3 &p_extents);
+ Vector3 get_extents() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesAttractorBox();
+ ~GPUParticlesAttractorBox();
+};
+
+class GPUParticlesAttractorVectorField : public GPUParticlesAttractor3D {
+ GDCLASS(GPUParticlesAttractorVectorField, GPUParticlesAttractor3D);
+
+ Vector3 extents = Vector3(1, 1, 1);
+ Ref<Texture3D> texture;
+
+protected:
+ static void _bind_methods();
+
+public:
+ void set_extents(const Vector3 &p_extents);
+ Vector3 get_extents() const;
+
+ void set_texture(const Ref<Texture3D> &p_texture);
+ Ref<Texture3D> get_texture() const;
+
+ virtual AABB get_aabb() const override;
+
+ GPUParticlesAttractorVectorField();
+ ~GPUParticlesAttractorVectorField();
+};
+
+#endif // GPU_PARTICLES_COLLISION_3D_H
diff --git a/scene/3d/navigation_region_3d.cpp b/scene/3d/navigation_region_3d.cpp
index 71bc74f433..3d3467583d 100644
--- a/scene/3d/navigation_region_3d.cpp
+++ b/scene/3d/navigation_region_3d.cpp
@@ -197,10 +197,12 @@ String NavigationRegion3D::get_configuration_warning() const {
}
warning += TTR("A NavigationMesh resource must be set or created for this node to work.");
}
+
const Node3D *c = this;
while (c) {
- if (Object::cast_to<Navigation3D>(c))
+ if (Object::cast_to<Navigation3D>(c)) {
return warning;
+ }
c = Object::cast_to<Node3D>(c->get_parent());
}
diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp
index bf1445edf2..138788cf2d 100644
--- a/scene/3d/node_3d.cpp
+++ b/scene/3d/node_3d.cpp
@@ -103,8 +103,8 @@ void Node3D::_propagate_transform_changed(Node3D *p_origin) {
data.children_lock++;
for (List<Node3D *>::Element *E = data.children.front(); E; E = E->next()) {
- if (E->get()->data.toplevel_active) {
- continue; //don't propagate to a toplevel
+ if (E->get()->data.top_level_active) {
+ continue; //don't propagate to a top_level
}
E->get()->_propagate_transform_changed(p_origin);
}
@@ -136,12 +136,12 @@ void Node3D::_notification(int p_what) {
data.C = nullptr;
}
- if (data.toplevel && !Engine::get_singleton()->is_editor_hint()) {
+ if (data.top_level && !Engine::get_singleton()->is_editor_hint()) {
if (data.parent) {
data.local_transform = data.parent->get_global_transform() * get_transform();
data.dirty = DIRTY_VECTORS; //global is always dirty upon entering a scene
}
- data.toplevel_active = true;
+ data.top_level_active = true;
}
data.dirty |= DIRTY_GLOBAL; //global is always dirty upon entering a scene
@@ -160,7 +160,7 @@ void Node3D::_notification(int p_what) {
}
data.parent = nullptr;
data.C = nullptr;
- data.toplevel_active = false;
+ data.top_level_active = false;
} break;
case NOTIFICATION_ENTER_WORLD: {
data.inside_world = true;
@@ -238,7 +238,7 @@ void Node3D::set_transform(const Transform &p_transform) {
void Node3D::set_global_transform(const Transform &p_transform) {
Transform xform =
- (data.parent && !data.toplevel_active) ?
+ (data.parent && !data.top_level_active) ?
data.parent->get_global_transform().affine_inverse() * p_transform :
p_transform;
@@ -261,7 +261,7 @@ Transform Node3D::get_global_transform() const {
_update_local_transform();
}
- if (data.parent && !data.toplevel_active) {
+ if (data.parent && !data.top_level_active) {
data.global_transform = data.parent->get_global_transform() * data.local_transform;
} else {
data.global_transform = data.local_transform;
@@ -462,8 +462,8 @@ bool Node3D::is_scale_disabled() const {
return data.disable_scale;
}
-void Node3D::set_as_toplevel(bool p_enabled) {
- if (data.toplevel == p_enabled) {
+void Node3D::set_as_top_level(bool p_enabled) {
+ if (data.top_level == p_enabled) {
return;
}
if (is_inside_tree() && !Engine::get_singleton()->is_editor_hint()) {
@@ -473,16 +473,16 @@ void Node3D::set_as_toplevel(bool p_enabled) {
set_transform(data.parent->get_global_transform().affine_inverse() * get_global_transform());
}
- data.toplevel = p_enabled;
- data.toplevel_active = p_enabled;
+ data.top_level = p_enabled;
+ data.top_level_active = p_enabled;
} else {
- data.toplevel = p_enabled;
+ data.top_level = p_enabled;
}
}
-bool Node3D::is_set_as_toplevel() const {
- return data.toplevel;
+bool Node3D::is_set_as_top_level() const {
+ return data.top_level;
}
Ref<World3D> Node3D::get_world_3d() const {
@@ -715,8 +715,8 @@ void Node3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("get_global_transform"), &Node3D::get_global_transform);
ClassDB::bind_method(D_METHOD("get_parent_spatial"), &Node3D::get_parent_spatial);
ClassDB::bind_method(D_METHOD("set_ignore_transform_notification", "enabled"), &Node3D::set_ignore_transform_notification);
- ClassDB::bind_method(D_METHOD("set_as_toplevel", "enable"), &Node3D::set_as_toplevel);
- ClassDB::bind_method(D_METHOD("is_set_as_toplevel"), &Node3D::is_set_as_toplevel);
+ ClassDB::bind_method(D_METHOD("set_as_top_level", "enable"), &Node3D::set_as_top_level);
+ ClassDB::bind_method(D_METHOD("is_set_as_top_level"), &Node3D::is_set_as_top_level);
ClassDB::bind_method(D_METHOD("set_disable_scale", "disable"), &Node3D::set_disable_scale);
ClassDB::bind_method(D_METHOD("is_scale_disabled"), &Node3D::is_scale_disabled);
ClassDB::bind_method(D_METHOD("get_world_3d"), &Node3D::get_world_3d);
@@ -773,7 +773,7 @@ void Node3D::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "rotation_degrees", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_rotation_degrees", "get_rotation_degrees");
ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "rotation", PROPERTY_HINT_NONE, "", 0), "set_rotation", "get_rotation");
ADD_PROPERTY(PropertyInfo(Variant::VECTOR3, "scale", PROPERTY_HINT_NONE, "", PROPERTY_USAGE_EDITOR), "set_scale", "get_scale");
- ADD_PROPERTY(PropertyInfo(Variant::BOOL, "toplevel"), "set_as_toplevel", "is_set_as_toplevel");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "top_level"), "set_as_top_level", "is_set_as_top_level");
ADD_GROUP("Matrix", "");
ADD_PROPERTY(PropertyInfo(Variant::TRANSFORM, "transform", PROPERTY_HINT_NONE, ""), "set_transform", "get_transform");
ADD_GROUP("Visibility", "");
@@ -789,8 +789,8 @@ Node3D::Node3D() :
data.children_lock = 0;
data.ignore_notification = false;
- data.toplevel = false;
- data.toplevel_active = false;
+ data.top_level = false;
+ data.top_level_active = false;
data.scale = Vector3(1, 1, 1);
data.viewport = nullptr;
data.inside_world = false;
diff --git a/scene/3d/node_3d.h b/scene/3d/node_3d.h
index 327d4671e9..229e0f2c8c 100644
--- a/scene/3d/node_3d.h
+++ b/scene/3d/node_3d.h
@@ -71,8 +71,8 @@ class Node3D : public Node {
Viewport *viewport;
- bool toplevel_active;
- bool toplevel;
+ bool top_level_active;
+ bool top_level;
bool inside_world;
int children_lock;
@@ -144,8 +144,8 @@ public:
virtual Transform get_local_gizmo_transform() const;
#endif
- void set_as_toplevel(bool p_enabled);
- bool is_set_as_toplevel() const;
+ void set_as_top_level(bool p_enabled);
+ bool is_set_as_top_level() const;
void set_disable_scale(bool p_enabled);
bool is_scale_disabled() const;
diff --git a/scene/3d/physics_body_3d.cpp b/scene/3d/physics_body_3d.cpp
index 9a127c5425..579088b835 100644
--- a/scene/3d/physics_body_3d.cpp
+++ b/scene/3d/physics_body_3d.cpp
@@ -30,11 +30,10 @@
#include "physics_body_3d.h"
+#include "core/class_db.h"
#include "core/core_string_names.h"
#include "core/engine.h"
#include "core/list.h"
-#include "core/method_bind_ext.gen.inc"
-#include "core/object.h"
#include "core/rid.h"
#include "scene/3d/collision_shape_3d.h"
#include "scene/scene_string_names.h"
@@ -130,15 +129,6 @@ void PhysicsBody3D::remove_collision_exception_with(Node *p_node) {
PhysicsServer3D::get_singleton()->body_remove_collision_exception(get_rid(), collision_object->get_rid());
}
-void PhysicsBody3D::_set_layers(uint32_t p_mask) {
- set_collision_layer(p_mask);
- set_collision_mask(p_mask);
-}
-
-uint32_t PhysicsBody3D::_get_layers() const {
- return get_collision_layer();
-}
-
void PhysicsBody3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_collision_layer", "layer"), &PhysicsBody3D::set_collision_layer);
ClassDB::bind_method(D_METHOD("get_collision_layer"), &PhysicsBody3D::get_collision_layer);
@@ -152,9 +142,6 @@ void PhysicsBody3D::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_collision_layer_bit", "bit", "value"), &PhysicsBody3D::set_collision_layer_bit);
ClassDB::bind_method(D_METHOD("get_collision_layer_bit", "bit"), &PhysicsBody3D::get_collision_layer_bit);
- ClassDB::bind_method(D_METHOD("_set_layers", "mask"), &PhysicsBody3D::_set_layers);
- ClassDB::bind_method(D_METHOD("_get_layers"), &PhysicsBody3D::_get_layers);
-
ADD_GROUP("Collision", "collision_");
ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_layer", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_layer", "get_collision_layer");
ADD_PROPERTY(PropertyInfo(Variant::INT, "collision_mask", PROPERTY_HINT_LAYERS_3D_PHYSICS), "set_collision_mask", "get_collision_mask");
@@ -2606,7 +2593,7 @@ void PhysicalBone3D::_start_physics_simulation() {
PhysicsServer3D::get_singleton()->body_set_collision_layer(get_rid(), get_collision_layer());
PhysicsServer3D::get_singleton()->body_set_collision_mask(get_rid(), get_collision_mask());
PhysicsServer3D::get_singleton()->body_set_force_integration_callback(get_rid(), this, "_direct_state_changed");
- set_as_toplevel(true);
+ set_as_top_level(true);
_internal_simulate_physics = true;
}
@@ -2626,7 +2613,7 @@ void PhysicalBone3D::_stop_physics_simulation() {
if (_internal_simulate_physics) {
PhysicsServer3D::get_singleton()->body_set_force_integration_callback(get_rid(), nullptr, "");
parent_skeleton->set_bone_global_pose_override(bone_id, Transform(), 0.0, false);
- set_as_toplevel(false);
+ set_as_top_level(false);
_internal_simulate_physics = false;
}
}
diff --git a/scene/3d/physics_body_3d.h b/scene/3d/physics_body_3d.h
index 9830a55183..d3dddeae55 100644
--- a/scene/3d/physics_body_3d.h
+++ b/scene/3d/physics_body_3d.h
@@ -43,9 +43,6 @@ class PhysicsBody3D : public CollisionObject3D {
uint32_t collision_layer;
uint32_t collision_mask;
- void _set_layers(uint32_t p_mask);
- uint32_t _get_layers() const;
-
protected:
static void _bind_methods();
PhysicsBody3D(PhysicsServer3D::BodyMode p_mode);
diff --git a/scene/3d/soft_body_3d.cpp b/scene/3d/soft_body_3d.cpp
index d3d7cdc1ce..3b5c328e43 100644
--- a/scene/3d/soft_body_3d.cpp
+++ b/scene/3d/soft_body_3d.cpp
@@ -30,8 +30,8 @@
#include "soft_body_3d.h"
+#include "core/class_db.h"
#include "core/list.h"
-#include "core/object.h"
#include "core/os/os.h"
#include "core/rid.h"
#include "scene/3d/collision_object_3d.h"
@@ -282,7 +282,7 @@ void SoftBody3D::_notification(int p_what) {
set_notify_transform(false);
// Required to be top level with Transform at center of world in order to modify RenderingServer only to support custom Transform
- set_as_toplevel(true);
+ set_as_top_level(true);
set_transform(Transform());
set_notify_transform(true);
@@ -425,7 +425,7 @@ void SoftBody3D::_draw_soft_mesh() {
/// Necessary in order to render the mesh correctly (Soft body nodes are in global space)
simulation_started = true;
- call_deferred("set_as_toplevel", true);
+ call_deferred("set_as_top_level", true);
call_deferred("set_transform", Transform());
}
diff --git a/scene/animation/animation_player.cpp b/scene/animation/animation_player.cpp
index 66c587e2d4..30757d2d80 100644
--- a/scene/animation/animation_player.cpp
+++ b/scene/animation/animation_player.cpp
@@ -1294,12 +1294,12 @@ bool AnimationPlayer::is_valid() const {
}
float AnimationPlayer::get_current_animation_position() const {
- ERR_FAIL_COND_V(!playback.current.from, 0);
+ ERR_FAIL_COND_V_MSG(!playback.current.from, 0, "AnimationPlayer has no current animation");
return playback.current.pos;
}
float AnimationPlayer::get_current_animation_length() const {
- ERR_FAIL_COND_V(!playback.current.from, 0);
+ ERR_FAIL_COND_V_MSG(!playback.current.from, 0, "AnimationPlayer has no current animation");
return playback.current.from->animation->get_length();
}
diff --git a/scene/animation/animation_tree.cpp b/scene/animation/animation_tree.cpp
index d7d55b468e..bb5d536600 100644
--- a/scene/animation/animation_tree.cpp
+++ b/scene/animation/animation_tree.cpp
@@ -32,7 +32,6 @@
#include "animation_blend_tree.h"
#include "core/engine.h"
-#include "core/method_bind_ext.gen.inc"
#include "scene/scene_string_names.h"
#include "servers/audio/audio_stream.h"
diff --git a/scene/animation/tween.cpp b/scene/animation/tween.cpp
index bd4396d680..1a2a97ada8 100644
--- a/scene/animation/tween.cpp
+++ b/scene/animation/tween.cpp
@@ -30,8 +30,6 @@
#include "tween.h"
-#include "core/method_bind_ext.gen.inc"
-
void Tween::_add_pending_command(StringName p_key, const Variant &p_arg1, const Variant &p_arg2, const Variant &p_arg3, const Variant &p_arg4, const Variant &p_arg5, const Variant &p_arg6, const Variant &p_arg7, const Variant &p_arg8, const Variant &p_arg9, const Variant &p_arg10) {
// Add a new pending command and reference it
pending_commands.push_back(PendingCommand());
diff --git a/scene/debugger/scene_debugger.h b/scene/debugger/scene_debugger.h
index a2bafde039..80e329f1f2 100644
--- a/scene/debugger/scene_debugger.h
+++ b/scene/debugger/scene_debugger.h
@@ -32,7 +32,7 @@
#define SCENE_DEBUGGER_H
#include "core/array.h"
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/pair.h"
#include "core/ustring.h"
diff --git a/scene/gui/base_button.cpp b/scene/gui/base_button.cpp
index 2e77d20d4e..a759e329da 100644
--- a/scene/gui/base_button.cpp
+++ b/scene/gui/base_button.cpp
@@ -307,17 +307,6 @@ int BaseButton::get_button_mask() const {
return button_mask;
}
-void BaseButton::set_enabled_focus_mode(FocusMode p_mode) {
- enabled_focus_mode = p_mode;
- if (!status.disabled) {
- set_focus_mode(p_mode);
- }
-}
-
-Control::FocusMode BaseButton::get_enabled_focus_mode() const {
- return enabled_focus_mode;
-}
-
void BaseButton::set_keep_pressed_outside(bool p_on) {
keep_pressed_outside = p_on;
}
@@ -388,8 +377,6 @@ void BaseButton::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_button_mask", "mask"), &BaseButton::set_button_mask);
ClassDB::bind_method(D_METHOD("get_button_mask"), &BaseButton::get_button_mask);
ClassDB::bind_method(D_METHOD("get_draw_mode"), &BaseButton::get_draw_mode);
- ClassDB::bind_method(D_METHOD("set_enabled_focus_mode", "mode"), &BaseButton::set_enabled_focus_mode);
- ClassDB::bind_method(D_METHOD("get_enabled_focus_mode"), &BaseButton::get_enabled_focus_mode);
ClassDB::bind_method(D_METHOD("set_keep_pressed_outside", "enabled"), &BaseButton::set_keep_pressed_outside);
ClassDB::bind_method(D_METHOD("is_keep_pressed_outside"), &BaseButton::is_keep_pressed_outside);
@@ -412,7 +399,6 @@ void BaseButton::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "pressed"), "set_pressed", "is_pressed");
ADD_PROPERTY(PropertyInfo(Variant::INT, "action_mode", PROPERTY_HINT_ENUM, "Button Press,Button Release"), "set_action_mode", "get_action_mode");
ADD_PROPERTY(PropertyInfo(Variant::INT, "button_mask", PROPERTY_HINT_FLAGS, "Mouse Left, Mouse Right, Mouse Middle"), "set_button_mask", "get_button_mask");
- ADD_PROPERTY(PropertyInfo(Variant::INT, "enabled_focus_mode", PROPERTY_HINT_ENUM, "None,Click,All"), "set_enabled_focus_mode", "get_enabled_focus_mode");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "keep_pressed_outside"), "set_keep_pressed_outside", "is_keep_pressed_outside");
ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "shortcut", PROPERTY_HINT_RESOURCE_TYPE, "Shortcut"), "set_shortcut", "get_shortcut");
ADD_PROPERTY(PropertyInfo(Variant::OBJECT, "group", PROPERTY_HINT_RESOURCE_TYPE, "ButtonGroup"), "set_button_group", "get_button_group");
@@ -437,7 +423,6 @@ BaseButton::BaseButton() {
status.pressing_inside = false;
status.disabled = false;
set_focus_mode(FOCUS_ALL);
- enabled_focus_mode = FOCUS_ALL;
action_mode = ACTION_MODE_BUTTON_RELEASE;
button_mask = BUTTON_MASK_LEFT;
}
diff --git a/scene/gui/base_button.h b/scene/gui/base_button.h
index 8e71931f8b..33f19949cd 100644
--- a/scene/gui/base_button.h
+++ b/scene/gui/base_button.h
@@ -49,7 +49,6 @@ private:
bool toggle_mode;
bool shortcut_in_tooltip;
bool keep_pressed_outside;
- FocusMode enabled_focus_mode;
Ref<Shortcut> shortcut;
ActionMode action_mode;
@@ -115,9 +114,6 @@ public:
void set_button_mask(int p_mask);
int get_button_mask() const;
- void set_enabled_focus_mode(FocusMode p_mode);
- FocusMode get_enabled_focus_mode() const;
-
void set_shortcut(const Ref<Shortcut> &p_shortcut);
Ref<Shortcut> get_shortcut() const;
diff --git a/scene/gui/box_container.cpp b/scene/gui/box_container.cpp
index f130726837..33e030a573 100644
--- a/scene/gui/box_container.cpp
+++ b/scene/gui/box_container.cpp
@@ -57,7 +57,7 @@ void BoxContainer::_resort() {
if (!c || !c->is_visible_in_tree()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -111,7 +111,7 @@ void BoxContainer::_resort() {
if (!c || !c->is_visible_in_tree()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -172,7 +172,7 @@ void BoxContainer::_resort() {
if (!c || !c->is_visible_in_tree()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -224,7 +224,7 @@ Size2 BoxContainer::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/center_container.cpp b/scene/gui/center_container.cpp
index f8f9bec3d7..1a72f3ca4d 100644
--- a/scene/gui/center_container.cpp
+++ b/scene/gui/center_container.cpp
@@ -40,7 +40,7 @@ Size2 CenterContainer::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (!c->is_visible()) {
@@ -77,7 +77,7 @@ void CenterContainer::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/code_edit.cpp b/scene/gui/code_edit.cpp
index 56cf432b38..1eb45d7fc6 100644
--- a/scene/gui/code_edit.cpp
+++ b/scene/gui/code_edit.cpp
@@ -132,6 +132,7 @@ void CodeEdit::set_line_as_breakpoint(int p_line, bool p_breakpointed) {
breakpointed_lines.erase(p_line);
}
emit_signal("breakpoint_toggled", p_line);
+ update();
}
bool CodeEdit::is_line_breakpointed(int p_line) const {
@@ -160,6 +161,7 @@ Array CodeEdit::get_breakpointed_lines() const {
void CodeEdit::set_line_as_bookmarked(int p_line, bool p_bookmarked) {
int mask = get_line_gutter_metadata(p_line, main_gutter);
set_line_gutter_metadata(p_line, main_gutter, p_bookmarked ? mask | MAIN_GUTTER_BOOKMARK : mask & ~MAIN_GUTTER_BOOKMARK);
+ update();
}
bool CodeEdit::is_line_bookmarked(int p_line) const {
@@ -188,6 +190,7 @@ Array CodeEdit::get_bookmarked_lines() const {
void CodeEdit::set_line_as_executing(int p_line, bool p_executing) {
int mask = get_line_gutter_metadata(p_line, main_gutter);
set_line_gutter_metadata(p_line, main_gutter, p_executing ? mask | MAIN_GUTTER_EXECUTING : mask & ~MAIN_GUTTER_EXECUTING);
+ update();
}
bool CodeEdit::is_line_executing(int p_line) const {
diff --git a/scene/gui/color_picker.cpp b/scene/gui/color_picker.cpp
index cbe0367c7b..f8a67d154b 100644
--- a/scene/gui/color_picker.cpp
+++ b/scene/gui/color_picker.cpp
@@ -610,7 +610,7 @@ void ColorPicker::_screen_pick_pressed() {
if (!screen) {
screen = memnew(Control);
r->add_child(screen);
- screen->set_as_toplevel(true);
+ screen->set_as_top_level(true);
screen->set_anchors_and_margins_preset(Control::PRESET_WIDE);
screen->set_default_cursor_shape(CURSOR_POINTING_HAND);
screen->connect("gui_input", callable_mp(this, &ColorPicker::_screen_input));
diff --git a/scene/gui/control.cpp b/scene/gui/control.cpp
index 8d1dd5afeb..476dccab7e 100644
--- a/scene/gui/control.cpp
+++ b/scene/gui/control.cpp
@@ -493,7 +493,7 @@ void Control::_notification(int p_notification) {
}
CanvasItem *ci = Object::cast_to<CanvasItem>(parent);
- if (ci && ci->is_set_as_toplevel()) {
+ if (ci && ci->is_set_as_top_level()) {
subwindow = true;
break;
}
@@ -509,13 +509,13 @@ void Control::_notification(int p_notification) {
}
if (parent_control && !subwindow) {
- //do nothing, has a parent control and not toplevel
+ //do nothing, has a parent control and not top_level
if (data.theme.is_null() && parent_control->data.theme_owner) {
data.theme_owner = parent_control->data.theme_owner;
notification(NOTIFICATION_THEME_CHANGED);
}
} else {
- //is a regular root control or toplevel
+ //is a regular root control or top_level
data.RI = get_viewport()->_gui_add_root_control(this);
}
@@ -532,7 +532,7 @@ void Control::_notification(int p_notification) {
if (data.parent_canvas_item) {
data.parent_canvas_item->disconnect("item_rect_changed", callable_mp(this, &Control::_size_changed));
data.parent_canvas_item = nullptr;
- } else if (!is_set_as_toplevel()) {
+ } else if (!is_set_as_top_level()) {
//disconnect viewport
get_viewport()->disconnect("size_changed", callable_mp(this, &Control::_size_changed));
}
@@ -1816,7 +1816,7 @@ void Control::set_focus_mode(FocusMode p_focus_mode) {
}
static Control *_next_control(Control *p_from) {
- if (p_from->is_set_as_toplevel()) {
+ if (p_from->is_set_as_top_level()) {
return nullptr; // can't go above
}
@@ -1830,7 +1830,7 @@ static Control *_next_control(Control *p_from) {
ERR_FAIL_INDEX_V(next, parent->get_child_count(), nullptr);
for (int i = (next + 1); i < parent->get_child_count(); i++) {
Control *c = Object::cast_to<Control>(parent->get_child(i));
- if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) {
+ if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) {
continue;
}
@@ -1867,7 +1867,7 @@ Control *Control::find_next_valid_focus() const {
for (int i = 0; i < from->get_child_count(); i++) {
Control *c = Object::cast_to<Control>(from->get_child(i));
- if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) {
+ if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) {
continue;
}
@@ -1879,7 +1879,7 @@ Control *Control::find_next_valid_focus() const {
next_child = _next_control(from);
if (!next_child) { //nothing else.. go up and find either window or subwindow
next_child = const_cast<Control *>(this);
- while (next_child && !next_child->is_set_as_toplevel()) {
+ while (next_child && !next_child->is_set_as_top_level()) {
next_child = cast_to<Control>(next_child->get_parent());
}
@@ -1915,7 +1915,7 @@ static Control *_prev_control(Control *p_from) {
Control *child = nullptr;
for (int i = p_from->get_child_count() - 1; i >= 0; i--) {
Control *c = Object::cast_to<Control>(p_from->get_child(i));
- if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) {
+ if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) {
continue;
}
@@ -1955,7 +1955,7 @@ Control *Control::find_prev_valid_focus() const {
Control *prev_child = nullptr;
- if (from->is_set_as_toplevel() || !Object::cast_to<Control>(from->get_parent())) {
+ if (from->is_set_as_top_level() || !Object::cast_to<Control>(from->get_parent())) {
//find last of the children
prev_child = _prev_control(from);
@@ -1964,7 +1964,7 @@ Control *Control::find_prev_valid_focus() const {
for (int i = (from->get_index() - 1); i >= 0; i--) {
Control *c = Object::cast_to<Control>(from->get_parent()->get_child(i));
- if (!c || !c->is_visible_in_tree() || c->is_set_as_toplevel()) {
+ if (!c || !c->is_visible_in_tree() || c->is_set_as_top_level()) {
continue;
}
@@ -2023,8 +2023,8 @@ void Control::release_focus() {
update();
}
-bool Control::is_toplevel_control() const {
- return is_inside_tree() && (!data.parent_canvas_item && !data.RI && is_set_as_toplevel());
+bool Control::is_top_level_control() const {
+ return is_inside_tree() && (!data.parent_canvas_item && !data.RI && is_set_as_top_level());
}
void Control::_propagate_theme_changed(Node *p_at, Control *p_owner, Window *p_owner_window, bool p_assign) {
@@ -2374,7 +2374,7 @@ void Control::minimum_size_changed() {
//invalidate cache upwards
while (invalidate && invalidate->data.minimum_size_valid) {
invalidate->data.minimum_size_valid = false;
- if (invalidate->is_set_as_toplevel()) {
+ if (invalidate->is_set_as_top_level()) {
break; // do not go further up
}
if (!invalidate->data.parent && get_parent()) {
@@ -2499,7 +2499,7 @@ Control *Control::get_root_parent_control() const {
if (c) {
root = c;
- if (c->data.RI || c->is_toplevel_control()) {
+ if (c->data.RI || c->is_top_level_control()) {
break;
}
}
diff --git a/scene/gui/control.h b/scene/gui/control.h
index 15e10df0c6..83e79f908f 100644
--- a/scene/gui/control.h
+++ b/scene/gui/control.h
@@ -464,7 +464,7 @@ public:
virtual Transform2D get_transform() const override;
- bool is_toplevel_control() const;
+ bool is_top_level_control() const;
Size2 get_parent_area_size() const;
Rect2 get_parent_anchorable_rect() const;
diff --git a/scene/gui/dialogs.cpp b/scene/gui/dialogs.cpp
index 9077bfa4ba..430e98d50e 100644
--- a/scene/gui/dialogs.cpp
+++ b/scene/gui/dialogs.cpp
@@ -181,7 +181,7 @@ void AcceptDialog::_update_child_rects() {
continue;
}
- if (c == hbc || c == label || c == bg || c->is_set_as_toplevel()) {
+ if (c == hbc || c == label || c == bg || c->is_set_as_top_level()) {
continue;
}
@@ -209,7 +209,7 @@ Size2 AcceptDialog::_get_contents_minimum_size() const {
continue;
}
- if (c == hbc || c == label || c->is_set_as_toplevel()) {
+ if (c == hbc || c == label || c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/file_dialog.cpp b/scene/gui/file_dialog.cpp
index 4aea2928f4..2da61bdde7 100644
--- a/scene/gui/file_dialog.cpp
+++ b/scene/gui/file_dialog.cpp
@@ -936,7 +936,7 @@ FileDialog::FileDialog() {
filter->connect("item_selected", callable_mp(this, &FileDialog::_filter_selected));
confirm_save = memnew(ConfirmationDialog);
- // confirm_save->set_as_toplevel(true);
+ // confirm_save->set_as_top_level(true);
add_child(confirm_save);
confirm_save->connect("confirmed", callable_mp(this, &FileDialog::_save_confirm_pressed));
diff --git a/scene/gui/graph_edit.cpp b/scene/gui/graph_edit.cpp
index 467d252c81..a7c15e7027 100644
--- a/scene/gui/graph_edit.cpp
+++ b/scene/gui/graph_edit.cpp
@@ -547,7 +547,7 @@ void GraphEdit::_top_layer_input(const Ref<InputEvent> &p_ev) {
}
bool GraphEdit::_check_clickable_control(Control *p_control, const Vector2 &pos) {
- if (p_control->is_set_as_toplevel() || !p_control->is_visible()) {
+ if (p_control->is_set_as_top_level() || !p_control->is_visible()) {
return false;
}
diff --git a/scene/gui/graph_node.cpp b/scene/gui/graph_node.cpp
index 01b54ddaa8..4454e87017 100644
--- a/scene/gui/graph_node.cpp
+++ b/scene/gui/graph_node.cpp
@@ -30,8 +30,6 @@
#include "graph_node.h"
-#include "core/method_bind_ext.gen.inc"
-
bool GraphNode::_set(const StringName &p_name, const Variant &p_value) {
if (!p_name.operator String().begins_with("slot/")) {
return false;
@@ -102,7 +100,7 @@ void GraphNode::_get_property_list(List<PropertyInfo> *p_list) const {
int idx = 0;
for (int i = 0; i < get_child_count(); i++) {
Control *c = Object::cast_to<Control>(get_child(i));
- if (!c || c->is_set_as_toplevel()) {
+ if (!c || c->is_set_as_top_level()) {
continue;
}
@@ -131,7 +129,7 @@ void GraphNode::_resort() {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -156,7 +154,7 @@ void GraphNode::_resort() {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -388,7 +386,7 @@ Size2 GraphNode::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -477,7 +475,7 @@ void GraphNode::_connpos_update() {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/link_button.cpp b/scene/gui/link_button.cpp
index f8c8bd4caf..27a60945c8 100644
--- a/scene/gui/link_button.cpp
+++ b/scene/gui/link_button.cpp
@@ -127,6 +127,5 @@ void LinkButton::_bind_methods() {
LinkButton::LinkButton() {
underline_mode = UNDERLINE_MODE_ALWAYS;
- set_enabled_focus_mode(FOCUS_NONE);
set_default_cursor_shape(CURSOR_POINTING_HAND);
}
diff --git a/scene/gui/margin_container.cpp b/scene/gui/margin_container.cpp
index 0299065f77..b674b492d8 100644
--- a/scene/gui/margin_container.cpp
+++ b/scene/gui/margin_container.cpp
@@ -43,7 +43,7 @@ Size2 MarginContainer::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (!c->is_visible()) {
@@ -80,7 +80,7 @@ void MarginContainer::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/menu_button.cpp b/scene/gui/menu_button.cpp
index aa69fb39e7..9b1738ec79 100644
--- a/scene/gui/menu_button.cpp
+++ b/scene/gui/menu_button.cpp
@@ -130,7 +130,6 @@ MenuButton::MenuButton() {
set_flat(true);
set_toggle_mode(true);
set_disable_shortcuts(false);
- set_enabled_focus_mode(FOCUS_NONE);
set_process_unhandled_key_input(true);
set_action_mode(ACTION_MODE_BUTTON_PRESS);
diff --git a/scene/gui/panel_container.cpp b/scene/gui/panel_container.cpp
index 9abdfac009..051b4de825 100644
--- a/scene/gui/panel_container.cpp
+++ b/scene/gui/panel_container.cpp
@@ -45,7 +45,7 @@ Size2 PanelContainer::get_minimum_size() const {
if (!c || !c->is_visible()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -95,7 +95,7 @@ void PanelContainer::_notification(int p_what) {
if (!c || !c->is_visible_in_tree()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/popup.cpp b/scene/gui/popup.cpp
index 8a65aa5032..de866fa956 100644
--- a/scene/gui/popup.cpp
+++ b/scene/gui/popup.cpp
@@ -191,7 +191,7 @@ Size2 PopupPanel::_get_contents_minimum_size() const {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
@@ -215,7 +215,7 @@ void PopupPanel::_update_child_rects() {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/scroll_container.cpp b/scene/gui/scroll_container.cpp
index 5a3b94b198..f4e31c45d2 100644
--- a/scene/gui/scroll_container.cpp
+++ b/scene/gui/scroll_container.cpp
@@ -45,7 +45,7 @@ Size2 ScrollContainer::get_minimum_size() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (c == h_scroll || c == v_scroll) {
@@ -285,7 +285,7 @@ void ScrollContainer::_notification(int p_what) {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (c == h_scroll || c == v_scroll) {
@@ -529,7 +529,7 @@ String ScrollContainer::get_configuration_warning() const {
if (!c) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
if (c == h_scroll || c == v_scroll) {
diff --git a/scene/gui/split_container.cpp b/scene/gui/split_container.cpp
index 5c60153d91..6508be1e43 100644
--- a/scene/gui/split_container.cpp
+++ b/scene/gui/split_container.cpp
@@ -41,7 +41,7 @@ Control *SplitContainer::_getch(int p_idx) const {
if (!c || !c->is_visible_in_tree()) {
continue;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
continue;
}
diff --git a/scene/gui/tab_container.cpp b/scene/gui/tab_container.cpp
index 41b8fad49d..a1f93094c4 100644
--- a/scene/gui/tab_container.cpp
+++ b/scene/gui/tab_container.cpp
@@ -478,7 +478,7 @@ void TabContainer::_on_mouse_exited() {
int TabContainer::_get_tab_width(int p_index) const {
ERR_FAIL_INDEX_V(p_index, get_tab_count(), 0);
Control *control = Object::cast_to<Control>(_get_tabs()[p_index]);
- if (!control || control->is_set_as_toplevel() || get_tab_hidden(p_index)) {
+ if (!control || control->is_set_as_top_level() || get_tab_hidden(p_index)) {
return 0;
}
@@ -517,7 +517,7 @@ Vector<Control *> TabContainer::_get_tabs() const {
Vector<Control *> controls;
for (int i = 0; i < get_child_count(); i++) {
Control *control = Object::cast_to<Control>(get_child(i));
- if (!control || control->is_toplevel_control()) {
+ if (!control || control->is_top_level_control()) {
continue;
}
@@ -537,7 +537,7 @@ void TabContainer::add_child_notify(Node *p_child) {
if (!c) {
return;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
return;
}
diff --git a/scene/gui/tree.cpp b/scene/gui/tree.cpp
index 070948237a..318496df70 100644
--- a/scene/gui/tree.cpp
+++ b/scene/gui/tree.cpp
@@ -1173,6 +1173,9 @@ int Tree::draw_item(const Point2i &p_pos, const Point2 &p_draw_ofs, const Size2
if (p_item->cells[i].text.size() > 0) {
float icon_width = p_item->cells[i].get_icon_size().width;
+ if (p_item->get_icon_max_width(i) > 0) {
+ icon_width = p_item->get_icon_max_width(i);
+ }
r.position.x += icon_width;
r.size.x -= icon_width;
}
@@ -3892,7 +3895,7 @@ Tree::Tree() {
popup_menu = memnew(PopupMenu);
popup_menu->hide();
add_child(popup_menu);
- // popup_menu->set_as_toplevel(true);
+ // popup_menu->set_as_top_level(true);
popup_editor = memnew(Popup);
popup_editor->set_wrap_controls(true);
diff --git a/scene/main/canvas_item.cpp b/scene/main/canvas_item.cpp
index 564de31dca..718d805bdd 100644
--- a/scene/main/canvas_item.cpp
+++ b/scene/main/canvas_item.cpp
@@ -32,7 +32,6 @@
#include "core/input/input.h"
#include "core/message_queue.h"
-#include "core/method_bind_ext.gen.inc"
#include "scene/main/canvas_layer.h"
#include "scene/main/viewport.h"
#include "scene/main/window.h"
@@ -371,7 +370,7 @@ void CanvasItem::_propagate_visibility_changed(bool p_visible) {
for (int i = 0; i < get_child_count(); i++) {
CanvasItem *c = Object::cast_to<CanvasItem>(get_child(i));
- if (c && c->visible) { //should the toplevels stop propagation? i think so but..
+ if (c && c->visible) { //should the top_levels stop propagation? i think so but..
c->_propagate_visibility_changed(p_visible);
}
}
@@ -486,7 +485,7 @@ Transform2D CanvasItem::get_global_transform() const {
return global_transform;
}
-void CanvasItem::_toplevel_raise_self() {
+void CanvasItem::_top_level_raise_self() {
if (!is_inside_tree()) {
return;
}
@@ -499,7 +498,7 @@ void CanvasItem::_toplevel_raise_self() {
}
void CanvasItem::_enter_canvas() {
- if ((!Object::cast_to<CanvasItem>(get_parent())) || toplevel) {
+ if ((!Object::cast_to<CanvasItem>(get_parent())) || top_level) {
Node *n = this;
canvas_layer = nullptr;
@@ -533,7 +532,7 @@ void CanvasItem::_enter_canvas() {
get_viewport()->gui_reset_canvas_sort_index();
}
- get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_toplevel_raise_self");
+ get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_top_level_raise_self");
} else {
CanvasItem *parent = get_parent_item();
@@ -599,7 +598,7 @@ void CanvasItem::_notification(int p_what) {
}
if (group != "") {
- get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_toplevel_raise_self");
+ get_tree()->call_group_flags(SceneTree::GROUP_CALL_UNIQUE, group, "_top_level_raise_self");
} else {
CanvasItem *p = get_parent_item();
ERR_FAIL_COND(!p);
@@ -674,27 +673,27 @@ Color CanvasItem::get_modulate() const {
return modulate;
}
-void CanvasItem::set_as_toplevel(bool p_toplevel) {
- if (toplevel == p_toplevel) {
+void CanvasItem::set_as_top_level(bool p_top_level) {
+ if (top_level == p_top_level) {
return;
}
if (!is_inside_tree()) {
- toplevel = p_toplevel;
+ top_level = p_top_level;
return;
}
_exit_canvas();
- toplevel = p_toplevel;
+ top_level = p_top_level;
_enter_canvas();
}
-bool CanvasItem::is_set_as_toplevel() const {
- return toplevel;
+bool CanvasItem::is_set_as_top_level() const {
+ return top_level;
}
CanvasItem *CanvasItem::get_parent_item() const {
- if (toplevel) {
+ if (top_level) {
return nullptr;
}
@@ -967,7 +966,7 @@ void CanvasItem::_notify_transform(CanvasItem *p_node) {
for (List<CanvasItem *>::Element *E = p_node->children_items.front(); E; E = E->next()) {
CanvasItem *ci = E->get();
- if (ci->toplevel) {
+ if (ci->top_level) {
continue;
}
_notify_transform(ci);
@@ -997,9 +996,9 @@ ObjectID CanvasItem::get_canvas_layer_instance_id() const {
}
}
-CanvasItem *CanvasItem::get_toplevel() const {
+CanvasItem *CanvasItem::get_top_level() const {
CanvasItem *ci = const_cast<CanvasItem *>(this);
- while (!ci->toplevel && Object::cast_to<CanvasItem>(ci->get_parent())) {
+ while (!ci->top_level && Object::cast_to<CanvasItem>(ci->get_parent())) {
ci = Object::cast_to<CanvasItem>(ci->get_parent());
}
@@ -1009,7 +1008,7 @@ CanvasItem *CanvasItem::get_toplevel() const {
Ref<World2D> CanvasItem::get_world_2d() const {
ERR_FAIL_COND_V(!is_inside_tree(), Ref<World2D>());
- CanvasItem *tl = get_toplevel();
+ CanvasItem *tl = get_top_level();
if (tl->get_viewport()) {
return tl->get_viewport()->find_world_2d();
@@ -1104,7 +1103,7 @@ void CanvasItem::force_update_transform() {
}
void CanvasItem::_bind_methods() {
- ClassDB::bind_method(D_METHOD("_toplevel_raise_self"), &CanvasItem::_toplevel_raise_self);
+ ClassDB::bind_method(D_METHOD("_top_level_raise_self"), &CanvasItem::_top_level_raise_self);
ClassDB::bind_method(D_METHOD("_update_callback"), &CanvasItem::_update_callback);
#ifdef TOOLS_ENABLED
@@ -1136,8 +1135,8 @@ void CanvasItem::_bind_methods() {
ClassDB::bind_method(D_METHOD("update"), &CanvasItem::update);
- ClassDB::bind_method(D_METHOD("set_as_toplevel", "enable"), &CanvasItem::set_as_toplevel);
- ClassDB::bind_method(D_METHOD("is_set_as_toplevel"), &CanvasItem::is_set_as_toplevel);
+ ClassDB::bind_method(D_METHOD("set_as_top_level", "enable"), &CanvasItem::set_as_top_level);
+ ClassDB::bind_method(D_METHOD("is_set_as_top_level"), &CanvasItem::is_set_as_top_level);
ClassDB::bind_method(D_METHOD("set_light_mask", "light_mask"), &CanvasItem::set_light_mask);
ClassDB::bind_method(D_METHOD("get_light_mask"), &CanvasItem::get_light_mask);
@@ -1218,7 +1217,7 @@ void CanvasItem::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::COLOR, "modulate"), "set_modulate", "get_modulate");
ADD_PROPERTY(PropertyInfo(Variant::COLOR, "self_modulate"), "set_self_modulate", "get_self_modulate");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "show_behind_parent"), "set_draw_behind_parent", "is_draw_behind_parent_enabled");
- ADD_PROPERTY(PropertyInfo(Variant::BOOL, "toplevel"), "set_as_toplevel", "is_set_as_toplevel");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "top_level"), "set_as_top_level", "is_set_as_top_level");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "show_on_top", PROPERTY_HINT_NONE, "", 0), "_set_on_top", "_is_on_top"); //compatibility
ADD_PROPERTY(PropertyInfo(Variant::INT, "light_mask", PROPERTY_HINT_LAYERS_2D_RENDER), "set_light_mask", "get_light_mask");
@@ -1354,7 +1353,7 @@ void CanvasItem::_update_texture_filter_changed(bool p_propagate) {
if (p_propagate) {
for (List<CanvasItem *>::Element *E = children_items.front(); E; E = E->next()) {
- if (!E->get()->toplevel && E->get()->texture_filter == TEXTURE_FILTER_PARENT_NODE) {
+ if (!E->get()->top_level && E->get()->texture_filter == TEXTURE_FILTER_PARENT_NODE) {
E->get()->_update_texture_filter_changed(true);
}
}
@@ -1407,7 +1406,7 @@ void CanvasItem::_update_texture_repeat_changed(bool p_propagate) {
update();
if (p_propagate) {
for (List<CanvasItem *>::Element *E = children_items.front(); E; E = E->next()) {
- if (!E->get()->toplevel && E->get()->texture_repeat == TEXTURE_REPEAT_PARENT_NODE) {
+ if (!E->get()->top_level && E->get()->texture_repeat == TEXTURE_REPEAT_PARENT_NODE) {
E->get()->_update_texture_repeat_changed(true);
}
}
@@ -1436,7 +1435,7 @@ CanvasItem::CanvasItem() :
pending_update = false;
modulate = Color(1, 1, 1, 1);
self_modulate = Color(1, 1, 1, 1);
- toplevel = false;
+ top_level = false;
first_draw = false;
drawing = false;
behind = false;
diff --git a/scene/main/canvas_item.h b/scene/main/canvas_item.h
index 3f32df87a7..a331cb96a9 100644
--- a/scene/main/canvas_item.h
+++ b/scene/main/canvas_item.h
@@ -201,7 +201,7 @@ private:
bool first_draw;
bool visible;
bool pending_update;
- bool toplevel;
+ bool top_level;
bool drawing;
bool block_transform_notify;
bool behind;
@@ -220,7 +220,7 @@ private:
mutable Transform2D global_transform;
mutable bool global_invalid;
- void _toplevel_raise_self();
+ void _top_level_raise_self();
void _propagate_visibility_changed(bool p_visible);
@@ -355,8 +355,8 @@ public:
/* RECT / TRANSFORM */
- void set_as_toplevel(bool p_toplevel);
- bool is_set_as_toplevel() const;
+ void set_as_top_level(bool p_top_level);
+ bool is_set_as_top_level() const;
void set_draw_behind_parent(bool p_enable);
bool is_draw_behind_parent_enabled() const;
@@ -369,7 +369,7 @@ public:
virtual Transform2D get_global_transform_with_canvas() const;
virtual Transform2D get_screen_transform() const;
- CanvasItem *get_toplevel() const;
+ CanvasItem *get_top_level() const;
_FORCE_INLINE_ RID get_canvas_item() const {
return canvas_item;
}
diff --git a/scene/main/node.h b/scene/main/node.h
index 2928466cd0..09943d0626 100644
--- a/scene/main/node.h
+++ b/scene/main/node.h
@@ -34,7 +34,6 @@
#include "core/class_db.h"
#include "core/map.h"
#include "core/node_path.h"
-#include "core/object.h"
#include "core/project_settings.h"
#include "core/script_language.h"
#include "core/typed_array.h"
diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp
index 5e91e4fe42..3c7475a150 100644
--- a/scene/main/viewport.cpp
+++ b/scene/main/viewport.cpp
@@ -1493,7 +1493,7 @@ String Viewport::_gui_get_tooltip(Control *p_control, const Vector2 &p_pos, Cont
if (p_control->data.mouse_filter == Control::MOUSE_FILTER_STOP) {
break;
}
- if (p_control->is_set_as_toplevel()) {
+ if (p_control->is_set_as_top_level()) {
break;
}
@@ -1620,7 +1620,7 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu
}
}
- if (!control->is_inside_tree() || control->is_set_as_toplevel()) {
+ if (!control->is_inside_tree() || control->is_set_as_top_level()) {
break;
}
if (gui.key_event_accepted) {
@@ -1631,7 +1631,7 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu
}
}
- if (ci->is_set_as_toplevel()) {
+ if (ci->is_set_as_top_level()) {
break;
}
@@ -1655,7 +1655,7 @@ void Viewport::_gui_call_notification(Control *p_control, int p_what) {
break;
}
- if (!control->is_inside_tree() || control->is_set_as_toplevel()) {
+ if (!control->is_inside_tree() || control->is_set_as_top_level()) {
break;
}
if (control->data.mouse_filter == Control::MOUSE_FILTER_STOP) {
@@ -1663,7 +1663,7 @@ void Viewport::_gui_call_notification(Control *p_control, int p_what) {
}
}
- if (ci->is_set_as_toplevel()) {
+ if (ci->is_set_as_top_level()) {
break;
}
@@ -1721,7 +1721,7 @@ Control *Viewport::_gui_find_control_at_pos(CanvasItem *p_node, const Point2 &p_
if (!c || !c->clips_input() || c->has_point(matrix.affine_inverse().xform(p_global))) {
for (int i = p_node->get_child_count() - 1; i >= 0; i--) {
CanvasItem *ci = Object::cast_to<CanvasItem>(p_node->get_child(i));
- if (!ci || ci->is_set_as_toplevel()) {
+ if (!ci || ci->is_set_as_top_level()) {
continue;
}
@@ -1768,7 +1768,7 @@ bool Viewport::_gui_drop(Control *p_at_control, Point2 p_at_pos, bool p_just_che
p_at_pos = ci->get_transform().xform(p_at_pos);
- if (ci->is_set_as_toplevel()) {
+ if (ci->is_set_as_top_level()) {
break;
}
@@ -1865,7 +1865,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) {
}
}
- if (ci->is_set_as_toplevel()) {
+ if (ci->is_set_as_top_level()) {
break;
}
@@ -1993,7 +1993,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) {
}
}
- if (ci->is_set_as_toplevel()) {
+ if (ci->is_set_as_top_level()) {
break;
}
@@ -2105,7 +2105,7 @@ void Viewport::_gui_input_event(Ref<InputEvent> p_event) {
if (c->data.mouse_filter == Control::MOUSE_FILTER_STOP) {
break;
}
- if (c->is_set_as_toplevel()) {
+ if (c->is_set_as_top_level()) {
break;
}
c = c->get_parent_control();
@@ -2404,7 +2404,7 @@ void Viewport::_gui_set_drag_preview(Control *p_base, Control *p_control) {
if (gui.drag_preview) {
memdelete(gui.drag_preview);
}
- p_control->set_as_toplevel(true);
+ p_control->set_as_top_level(true);
p_control->set_position(gui.last_mouse_pos);
p_base->get_root_parent_control()->add_child(p_control); //add as child of viewport
p_control->raise();
diff --git a/scene/main/window.cpp b/scene/main/window.cpp
index 7c2350d1c0..9f014e8175 100644
--- a/scene/main/window.cpp
+++ b/scene/main/window.cpp
@@ -895,11 +895,11 @@ void Window::_window_input(const Ref<InputEvent> &p_ev) {
if (exclusive_child != nullptr) {
Window *focus_target = exclusive_child;
+ focus_target->grab_focus();
while (focus_target->exclusive_child != nullptr) {
- focus_target->grab_focus();
focus_target = focus_target->exclusive_child;
+ focus_target->grab_focus();
}
- focus_target->grab_focus();
if (!is_embedding_subwindows()) { //not embedding, no need for event
return;
diff --git a/scene/register_scene_types.cpp b/scene/register_scene_types.cpp
index 820513c53d..6b602ae6e5 100644
--- a/scene/register_scene_types.cpp
+++ b/scene/register_scene_types.cpp
@@ -194,6 +194,7 @@
#include "scene/3d/decal.h"
#include "scene/3d/gi_probe.h"
#include "scene/3d/gpu_particles_3d.h"
+#include "scene/3d/gpu_particles_collision_3d.h"
#include "scene/3d/immediate_geometry_3d.h"
#include "scene/3d/light_3d.h"
#include "scene/3d/lightmap_probe.h"
@@ -450,6 +451,15 @@ void register_scene_types() {
ClassDB::register_class<LightmapProbe>();
ClassDB::register_virtual_class<Lightmapper>();
ClassDB::register_class<GPUParticles3D>();
+ ClassDB::register_virtual_class<GPUParticlesCollision3D>();
+ ClassDB::register_class<GPUParticlesCollisionBox>();
+ ClassDB::register_class<GPUParticlesCollisionSphere>();
+ ClassDB::register_class<GPUParticlesCollisionSDF>();
+ ClassDB::register_class<GPUParticlesCollisionHeightField>();
+ ClassDB::register_virtual_class<GPUParticlesAttractor3D>();
+ ClassDB::register_class<GPUParticlesAttractorBox>();
+ ClassDB::register_class<GPUParticlesAttractorSphere>();
+ ClassDB::register_class<GPUParticlesAttractorVectorField>();
ClassDB::register_class<CPUParticles3D>();
ClassDB::register_class<Position3D>();
diff --git a/scene/resources/environment.cpp b/scene/resources/environment.cpp
index ee8e63266d..f4edab07b5 100644
--- a/scene/resources/environment.cpp
+++ b/scene/resources/environment.cpp
@@ -44,6 +44,9 @@ void Environment::set_background(BGMode p_bg) {
bg_mode = p_bg;
RS::get_singleton()->environment_set_background(environment, RS::EnvironmentBG(p_bg));
_change_notify();
+ if (bg_mode != BG_SKY) {
+ set_fog_aerial_perspective(0.0);
+ }
}
Environment::BGMode Environment::get_background() const {
@@ -578,22 +581,28 @@ bool Environment::is_glow_enabled() const {
return glow_enabled;
}
-void Environment::set_glow_level_enabled(int p_level, bool p_enabled) {
+void Environment::set_glow_level(int p_level, float p_intensity) {
ERR_FAIL_INDEX(p_level, RS::MAX_GLOW_LEVELS);
- if (p_enabled) {
- glow_levels |= (1 << p_level);
- } else {
- glow_levels &= ~(1 << p_level);
- }
+ glow_levels.write[p_level] = p_intensity;
_update_glow();
}
-bool Environment::is_glow_level_enabled(int p_level) const {
+float Environment::get_glow_level(int p_level) const {
ERR_FAIL_INDEX_V(p_level, RS::MAX_GLOW_LEVELS, false);
- return glow_levels & (1 << p_level);
+ return glow_levels[p_level];
+}
+
+void Environment::set_glow_normalized(bool p_normalized) {
+ glow_normalize_levels = p_normalized;
+
+ _update_glow();
+}
+
+bool Environment::is_glow_normalized() const {
+ return glow_normalize_levels;
}
void Environment::set_glow_intensity(float p_intensity) {
@@ -670,10 +679,24 @@ float Environment::get_glow_hdr_luminance_cap() const {
}
void Environment::_update_glow() {
+ Vector<float> normalized_levels;
+ if (glow_normalize_levels) {
+ normalized_levels.resize(7);
+ float size = 0.0;
+ for (int i = 0; i < glow_levels.size(); i++) {
+ size += glow_levels[i];
+ }
+ for (int i = 0; i < glow_levels.size(); i++) {
+ normalized_levels.write[i] = glow_levels[i] / size;
+ }
+ } else {
+ normalized_levels = glow_levels;
+ }
+
RS::get_singleton()->environment_set_glow(
environment,
glow_enabled,
- glow_levels,
+ normalized_levels,
glow_intensity,
glow_strength,
glow_mix,
@@ -739,6 +762,14 @@ float Environment::get_fog_height_density() const {
return fog_height_density;
}
+void Environment::set_fog_aerial_perspective(float p_aerial_perspective) {
+ fog_aerial_perspective = p_aerial_perspective;
+ _update_fog();
+}
+float Environment::get_fog_aerial_perspective() const {
+ return fog_aerial_perspective;
+}
+
void Environment::_update_fog() {
RS::get_singleton()->environment_set_fog(
environment,
@@ -748,7 +779,8 @@ void Environment::_update_fog() {
fog_sun_scatter,
fog_density,
fog_height,
- fog_height_density);
+ fog_height_density,
+ fog_aerial_perspective);
}
// Volumetric Fog
@@ -887,6 +919,12 @@ void Environment::_validate_property(PropertyInfo &property) const {
}
}
+ if (property.name == "fog_aerial_perspective") {
+ if (bg_mode != BG_SKY) {
+ property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL;
+ }
+ }
+
if (property.name == "glow_intensity" && glow_blend_mode == GLOW_BLEND_MODE_MIX) {
property.usage = PROPERTY_USAGE_NOEDITOR | PROPERTY_USAGE_INTERNAL;
}
@@ -1162,8 +1200,10 @@ void Environment::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_glow_enabled", "enabled"), &Environment::set_glow_enabled);
ClassDB::bind_method(D_METHOD("is_glow_enabled"), &Environment::is_glow_enabled);
- ClassDB::bind_method(D_METHOD("set_glow_level_enabled", "idx", "enabled"), &Environment::set_glow_level_enabled);
- ClassDB::bind_method(D_METHOD("is_glow_level_enabled", "idx"), &Environment::is_glow_level_enabled);
+ ClassDB::bind_method(D_METHOD("set_glow_level", "idx", "intensity"), &Environment::set_glow_level);
+ ClassDB::bind_method(D_METHOD("get_glow_level", "idx"), &Environment::get_glow_level);
+ ClassDB::bind_method(D_METHOD("set_glow_normalized", "normalize"), &Environment::set_glow_normalized);
+ ClassDB::bind_method(D_METHOD("is_glow_normalized"), &Environment::is_glow_normalized);
ClassDB::bind_method(D_METHOD("set_glow_intensity", "intensity"), &Environment::set_glow_intensity);
ClassDB::bind_method(D_METHOD("get_glow_intensity"), &Environment::get_glow_intensity);
ClassDB::bind_method(D_METHOD("set_glow_strength", "strength"), &Environment::set_glow_strength);
@@ -1183,13 +1223,14 @@ void Environment::_bind_methods() {
ADD_GROUP("Glow", "glow_");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_enabled"), "set_glow_enabled", "is_glow_enabled");
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/1"), "set_glow_level_enabled", "is_glow_level_enabled", 0);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/2"), "set_glow_level_enabled", "is_glow_level_enabled", 1);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/3"), "set_glow_level_enabled", "is_glow_level_enabled", 2);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/4"), "set_glow_level_enabled", "is_glow_level_enabled", 3);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/5"), "set_glow_level_enabled", "is_glow_level_enabled", 4);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/6"), "set_glow_level_enabled", "is_glow_level_enabled", 5);
- ADD_PROPERTYI(PropertyInfo(Variant::BOOL, "glow_levels/7"), "set_glow_level_enabled", "is_glow_level_enabled", 6);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/1", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 0);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/2", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 1);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/3", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 2);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/4", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 3);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/5", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 4);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/6", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 5);
+ ADD_PROPERTYI(PropertyInfo(Variant::FLOAT, "glow_levels/7", PROPERTY_HINT_RANGE, "0,16,0.01,or_greater"), "set_glow_level", "get_glow_level", 6);
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "glow_normalized"), "set_glow_normalized", "is_glow_normalized");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_intensity", PROPERTY_HINT_RANGE, "0.0,8.0,0.01"), "set_glow_intensity", "get_glow_intensity");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_strength", PROPERTY_HINT_RANGE, "0.0,2.0,0.01"), "set_glow_strength", "get_glow_strength");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "glow_mix", PROPERTY_HINT_RANGE, "0.0,1.0,0.001"), "set_glow_mix", "get_glow_mix");
@@ -1219,6 +1260,9 @@ void Environment::_bind_methods() {
ClassDB::bind_method(D_METHOD("set_fog_height_density", "height_density"), &Environment::set_fog_height_density);
ClassDB::bind_method(D_METHOD("get_fog_height_density"), &Environment::get_fog_height_density);
+ ClassDB::bind_method(D_METHOD("set_fog_aerial_perspective", "aerial_perspective"), &Environment::set_fog_aerial_perspective);
+ ClassDB::bind_method(D_METHOD("get_fog_aerial_perspective"), &Environment::get_fog_aerial_perspective);
+
ADD_GROUP("Fog", "fog_");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "fog_enabled"), "set_fog_enabled", "is_fog_enabled");
ADD_PROPERTY(PropertyInfo(Variant::COLOR, "fog_light_color", PROPERTY_HINT_COLOR_NO_ALPHA), "set_fog_light_color", "get_fog_light_color");
@@ -1226,6 +1270,7 @@ void Environment::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_sun_scatter", PROPERTY_HINT_RANGE, "0,1,0.01,or_greater"), "set_fog_sun_scatter", "get_fog_sun_scatter");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_density", PROPERTY_HINT_RANGE, "0,16,0.0001"), "set_fog_density", "get_fog_density");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_aerial_perspective", PROPERTY_HINT_RANGE, "0,1,0.001"), "set_fog_aerial_perspective", "get_fog_aerial_perspective");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height", PROPERTY_HINT_RANGE, "-1024,1024,0.01,or_lesser,or_greater"), "set_fog_height", "get_fog_height");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "fog_height_density", PROPERTY_HINT_RANGE, "0,128,0.001,or_greater"), "set_fog_height_density", "get_fog_height_density");
@@ -1329,6 +1374,16 @@ Environment::Environment() {
environment = RS::get_singleton()->environment_create();
set_camera_feed_id(bg_camera_feed_id);
+
+ glow_levels.resize(7);
+ glow_levels.write[0] = 0.0;
+ glow_levels.write[1] = 0.0;
+ glow_levels.write[2] = 1.0;
+ glow_levels.write[3] = 0.0;
+ glow_levels.write[4] = 1.0;
+ glow_levels.write[5] = 0.0;
+ glow_levels.write[6] = 0.0;
+
_update_ambient_light();
_update_tonemap();
_update_ssr();
diff --git a/scene/resources/environment.h b/scene/resources/environment.h
index d4d84f31aa..9b7247b58d 100644
--- a/scene/resources/environment.h
+++ b/scene/resources/environment.h
@@ -171,7 +171,8 @@ private:
// Glow
bool glow_enabled = false;
- int glow_levels = (1 << 2) | (1 << 4);
+ Vector<float> glow_levels;
+ bool glow_normalize_levels = false;
float glow_intensity = 0.8;
float glow_strength = 1.0;
float glow_mix = 0.05;
@@ -190,6 +191,7 @@ private:
float fog_density = 0.001;
float fog_height = 0.0;
float fog_height_density = 0.0; //can be negative to invert effect
+ float fog_aerial_perspective = 0.0;
void _update_fog();
@@ -332,8 +334,10 @@ public:
// Glow
void set_glow_enabled(bool p_enabled);
bool is_glow_enabled() const;
- void set_glow_level_enabled(int p_level, bool p_enabled);
- bool is_glow_level_enabled(int p_level) const;
+ void set_glow_level(int p_level, float p_intensity);
+ float get_glow_level(int p_level) const;
+ void set_glow_normalized(bool p_normalized);
+ bool is_glow_normalized() const;
void set_glow_intensity(float p_intensity);
float get_glow_intensity() const;
void set_glow_strength(float p_strength);
@@ -368,6 +372,8 @@ public:
float get_fog_height() const;
void set_fog_height_density(float p_amount);
float get_fog_height_density() const;
+ void set_fog_aerial_perspective(float p_aerial_perspective);
+ float get_fog_aerial_perspective() const;
// Volumetric Fog
void set_volumetric_fog_enabled(bool p_enable);
diff --git a/scene/resources/font.cpp b/scene/resources/font.cpp
index 7cc39f661d..b75657c2c2 100644
--- a/scene/resources/font.cpp
+++ b/scene/resources/font.cpp
@@ -31,7 +31,6 @@
#include "font.h"
#include "core/io/resource_loader.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/os/file_access.h"
void Font::draw_halign(RID p_canvas_item, const Point2 &p_pos, HAlign p_align, float p_width, const String &p_text, const Color &p_modulate, const Color &p_outline_modulate) const {
diff --git a/scene/resources/mesh.cpp b/scene/resources/mesh.cpp
index 10f0a040d0..e9606e03e6 100644
--- a/scene/resources/mesh.cpp
+++ b/scene/resources/mesh.cpp
@@ -872,7 +872,6 @@ Array ArrayMesh::_get_surfaces() const {
ret.push_back(data);
}
- print_line("Saving surfaces: " + itos(ret.size()));
return ret;
}
diff --git a/scene/resources/particles_material.cpp b/scene/resources/particles_material.cpp
index 4bbfa8965a..a286184aee 100644
--- a/scene/resources/particles_material.cpp
+++ b/scene/resources/particles_material.cpp
@@ -98,6 +98,9 @@ void ParticlesMaterial::init_shaders() {
shader_names->sub_emitter_frequency = "sub_emitter_frequency";
shader_names->sub_emitter_amount_at_end = "sub_emitter_amount_at_end";
shader_names->sub_emitter_keep_velocity = "sub_emitter_keep_velocity";
+
+ shader_names->collision_friction = "collision_friction";
+ shader_names->collision_bounce = "collision_bounce";
}
void ParticlesMaterial::finish_shaders() {
@@ -136,6 +139,10 @@ void ParticlesMaterial::_update_shader() {
String code = "shader_type particles;\n";
+ if (collision_scale) {
+ code += "render_mode collision_use_scale;\n";
+ }
+
code += "uniform vec3 direction;\n";
code += "uniform float spread;\n";
code += "uniform float flatness;\n";
@@ -247,6 +254,11 @@ void ParticlesMaterial::_update_shader() {
code += "uniform sampler2D anim_offset_texture;\n";
}
+ if (collision_enabled) {
+ code += "uniform float collision_friction;\n";
+ code += "uniform float collision_bounce;\n";
+ }
+
//need a random function
code += "\n\n";
code += "float rand_from_seed(inout uint seed) {\n";
@@ -476,6 +488,10 @@ void ParticlesMaterial::_update_shader() {
code += " vec3 crossDiff = cross(normalize(diff), normalize(gravity));\n";
code += " force += length(crossDiff) > 0.0 ? normalize(crossDiff) * ((tangent_accel + tex_tangent_accel) * mix(1.0, rand_from_seed(alt_seed), tangent_accel_random)) : vec3(0.0);\n";
}
+ if (attractor_interaction_enabled) {
+ code += " force += ATTRACTOR_FORCE;\n\n";
+ }
+
code += " // apply attractor forces\n";
code += " VELOCITY += force * DELTA;\n";
code += " // orbit velocity\n";
@@ -599,6 +615,13 @@ void ParticlesMaterial::_update_shader() {
code += " VELOCITY.z = 0.0;\n";
code += " TRANSFORM[3].z = 0.0;\n";
}
+ if (collision_enabled) {
+ code += " if (COLLIDED) {\n";
+ code += " TRANSFORM[3].xyz+=COLLISION_NORMAL * COLLISION_DEPTH;\n";
+ code += " VELOCITY -= COLLISION_NORMAL * dot(COLLISION_NORMAL, VELOCITY) * (1.0 + collision_bounce);\n";
+ code += " VELOCITY = mix(VELOCITY,vec3(0.0),collision_friction * DELTA * 100.0);\n";
+ code += " }\n";
+ }
if (sub_emitter_mode != SUB_EMITTER_DISABLED) {
code += " int emit_count = 0;\n";
switch (sub_emitter_mode) {
@@ -609,6 +632,7 @@ void ParticlesMaterial::_update_shader() {
} break;
case SUB_EMITTER_AT_COLLISION: {
//not implemented yet
+ code += " if (COLLIDED) emit_count = 1;\n";
} break;
case SUB_EMITTER_AT_END: {
//not implemented yet
@@ -1072,6 +1096,51 @@ bool ParticlesMaterial::get_sub_emitter_keep_velocity() const {
return sub_emitter_keep_velocity;
}
+void ParticlesMaterial::set_attractor_interaction_enabled(bool p_enable) {
+ attractor_interaction_enabled = p_enable;
+ _queue_shader_change();
+}
+
+bool ParticlesMaterial::is_attractor_interaction_enabled() const {
+ return attractor_interaction_enabled;
+}
+
+void ParticlesMaterial::set_collision_enabled(bool p_enabled) {
+ collision_enabled = p_enabled;
+ _queue_shader_change();
+}
+
+bool ParticlesMaterial::is_collision_enabled() const {
+ return collision_enabled;
+}
+
+void ParticlesMaterial::set_collision_use_scale(bool p_scale) {
+ collision_scale = p_scale;
+ _queue_shader_change();
+}
+
+bool ParticlesMaterial::is_collision_using_scale() const {
+ return collision_scale;
+}
+
+void ParticlesMaterial::set_collision_friction(float p_friction) {
+ collision_friction = p_friction;
+ RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_friction, p_friction);
+}
+
+float ParticlesMaterial::get_collision_friction() const {
+ return collision_friction;
+}
+
+void ParticlesMaterial::set_collision_bounce(float p_bounce) {
+ collision_bounce = p_bounce;
+ RenderingServer::get_singleton()->material_set_param(_get_material(), shader_names->collision_bounce, p_bounce);
+}
+
+float ParticlesMaterial::get_collision_bounce() const {
+ return collision_bounce;
+}
+
Shader::Mode ParticlesMaterial::get_shader_mode() const {
return Shader::MODE_PARTICLES;
}
@@ -1143,6 +1212,21 @@ void ParticlesMaterial::_bind_methods() {
ClassDB::bind_method(D_METHOD("get_sub_emitter_keep_velocity"), &ParticlesMaterial::get_sub_emitter_keep_velocity);
ClassDB::bind_method(D_METHOD("set_sub_emitter_keep_velocity", "enable"), &ParticlesMaterial::set_sub_emitter_keep_velocity);
+ ClassDB::bind_method(D_METHOD("set_attractor_interaction_enabled", "enabled"), &ParticlesMaterial::set_attractor_interaction_enabled);
+ ClassDB::bind_method(D_METHOD("is_attractor_interaction_enabled"), &ParticlesMaterial::is_attractor_interaction_enabled);
+
+ ClassDB::bind_method(D_METHOD("set_collision_enabled", "enabled"), &ParticlesMaterial::set_collision_enabled);
+ ClassDB::bind_method(D_METHOD("is_collision_enabled"), &ParticlesMaterial::is_collision_enabled);
+
+ ClassDB::bind_method(D_METHOD("set_collision_use_scale", "radius"), &ParticlesMaterial::set_collision_use_scale);
+ ClassDB::bind_method(D_METHOD("is_collision_using_scale"), &ParticlesMaterial::is_collision_using_scale);
+
+ ClassDB::bind_method(D_METHOD("set_collision_friction", "friction"), &ParticlesMaterial::set_collision_friction);
+ ClassDB::bind_method(D_METHOD("get_collision_friction"), &ParticlesMaterial::get_collision_friction);
+
+ ClassDB::bind_method(D_METHOD("set_collision_bounce", "bounce"), &ParticlesMaterial::set_collision_bounce);
+ ClassDB::bind_method(D_METHOD("get_collision_bounce"), &ParticlesMaterial::get_collision_bounce);
+
ADD_GROUP("Time", "");
ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "lifetime_randomness", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_lifetime_randomness", "get_lifetime_randomness");
@@ -1221,6 +1305,14 @@ void ParticlesMaterial::_bind_methods() {
ADD_PROPERTY(PropertyInfo(Variant::INT, "sub_emitter_amount_at_end", PROPERTY_HINT_RANGE, "1,32,1"), "set_sub_emitter_amount_at_end", "get_sub_emitter_amount_at_end");
ADD_PROPERTY(PropertyInfo(Variant::BOOL, "sub_emitter_keep_velocity"), "set_sub_emitter_keep_velocity", "get_sub_emitter_keep_velocity");
+ ADD_GROUP("Attractor Interaction", "attractor_interaction_");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "attractor_interaction_enabled"), "set_attractor_interaction_enabled", "is_attractor_interaction_enabled");
+ ADD_GROUP("Collision", "collision_");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_enabled"), "set_collision_enabled", "is_collision_enabled");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_friction", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_friction", "get_collision_friction");
+ ADD_PROPERTY(PropertyInfo(Variant::FLOAT, "collision_bounce", PROPERTY_HINT_RANGE, "0,1,0.01"), "set_collision_bounce", "get_collision_bounce");
+ ADD_PROPERTY(PropertyInfo(Variant::BOOL, "collision_use_scale"), "set_collision_use_scale", "is_collision_using_scale");
+
BIND_ENUM_CONSTANT(PARAM_INITIAL_LINEAR_VELOCITY);
BIND_ENUM_CONSTANT(PARAM_ANGULAR_VELOCITY);
BIND_ENUM_CONSTANT(PARAM_ORBIT_VELOCITY);
@@ -1283,6 +1375,12 @@ ParticlesMaterial::ParticlesMaterial() :
set_sub_emitter_amount_at_end(1);
set_sub_emitter_keep_velocity(false);
+ set_attractor_interaction_enabled(true);
+ set_collision_enabled(true);
+ set_collision_bounce(0.0);
+ set_collision_friction(0.0);
+ set_collision_use_scale(false);
+
for (int i = 0; i < PARAM_MAX; i++) {
set_param_randomness(Parameter(i), 0);
}
diff --git a/scene/resources/particles_material.h b/scene/resources/particles_material.h
index fa8858f67f..7aca708889 100644
--- a/scene/resources/particles_material.h
+++ b/scene/resources/particles_material.h
@@ -37,11 +37,7 @@
/*
TODO:
-Path following
-*Manual emission
--Sub Emitters
--Attractors
-Emitter positions deformable by bones
--Collision
-Proper trails
*/
@@ -99,6 +95,9 @@ private:
uint32_t invalid_key : 1;
uint32_t has_emission_color : 1;
uint32_t sub_emitter : 2;
+ uint32_t attractor_enabled : 1;
+ uint32_t collision_enabled : 1;
+ uint32_t collision_scale : 1;
};
uint32_t key;
@@ -135,6 +134,9 @@ private:
mk.emission_shape = emission_shape;
mk.has_emission_color = emission_shape >= EMISSION_SHAPE_POINTS && emission_color_texture.is_valid();
mk.sub_emitter = sub_emitter_mode;
+ mk.collision_enabled = collision_enabled;
+ mk.attractor_enabled = attractor_interaction_enabled;
+ mk.collision_scale = collision_scale;
return mk;
}
@@ -201,6 +203,9 @@ private:
StringName sub_emitter_frequency;
StringName sub_emitter_amount_at_end;
StringName sub_emitter_keep_velocity;
+
+ StringName collision_friction;
+ StringName collision_bounce;
};
static ShaderNames *shader_names;
@@ -244,6 +249,12 @@ private:
bool sub_emitter_keep_velocity;
//do not save emission points here
+ bool attractor_interaction_enabled;
+ bool collision_enabled;
+ bool collision_scale;
+ float collision_friction;
+ float collision_bounce;
+
protected:
static void _bind_methods();
virtual void _validate_property(PropertyInfo &property) const override;
@@ -298,6 +309,21 @@ public:
void set_lifetime_randomness(float p_lifetime);
float get_lifetime_randomness() const;
+ void set_attractor_interaction_enabled(bool p_enable);
+ bool is_attractor_interaction_enabled() const;
+
+ void set_collision_enabled(bool p_enabled);
+ bool is_collision_enabled() const;
+
+ void set_collision_use_scale(bool p_scale);
+ bool is_collision_using_scale() const;
+
+ void set_collision_friction(float p_friction);
+ float get_collision_friction() const;
+
+ void set_collision_bounce(float p_bounce);
+ float get_collision_bounce() const;
+
static void init_shaders();
static void finish_shaders();
static void flush_changes();
diff --git a/scene/resources/surface_tool.cpp b/scene/resources/surface_tool.cpp
index 1a2dcc84bb..ff14a5a292 100644
--- a/scene/resources/surface_tool.cpp
+++ b/scene/resources/surface_tool.cpp
@@ -30,8 +30,6 @@
#include "surface_tool.h"
-#include "core/method_bind_ext.gen.inc"
-
#define _VERTEX_SNAP 0.0001
#define EQ_VERTEX_DIST 0.00001
diff --git a/scene/resources/syntax_highlighter.cpp b/scene/resources/syntax_highlighter.cpp
index 5d58e71fc5..e7b49892d8 100644
--- a/scene/resources/syntax_highlighter.cpp
+++ b/scene/resources/syntax_highlighter.cpp
@@ -149,6 +149,13 @@ Dictionary CodeHighlighter::_get_line_syntax_highlighting(int p_line) {
color_region_cache[p_line] = -1;
int in_region = -1;
if (p_line != 0) {
+ int prev_region_line = p_line - 1;
+ while (prev_region_line > 0 && !color_region_cache.has(prev_region_line)) {
+ prev_region_line--;
+ }
+ for (int i = prev_region_line; i < p_line - 1; i++) {
+ get_line_syntax_highlighting(i);
+ }
if (!color_region_cache.has(p_line - 1)) {
get_line_syntax_highlighting(p_line - 1);
}
diff --git a/scene/resources/texture.cpp b/scene/resources/texture.cpp
index 39237e1a33..6291d2dddb 100644
--- a/scene/resources/texture.cpp
+++ b/scene/resources/texture.cpp
@@ -32,7 +32,6 @@
#include "core/core_string_names.h"
#include "core/io/image_loader.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/os/os.h"
#include "mesh.h"
#include "scene/resources/bit_map.h"
diff --git a/scene/resources/visual_shader.cpp b/scene/resources/visual_shader.cpp
index b8d2003e68..1afc4e114e 100644
--- a/scene/resources/visual_shader.cpp
+++ b/scene/resources/visual_shader.cpp
@@ -65,20 +65,16 @@ bool VisualShaderNode::is_port_separator(int p_index) const {
bool VisualShaderNode::is_output_port_connected(int p_port) const {
if (connected_output_ports.has(p_port)) {
- return connected_output_ports[p_port];
+ return connected_output_ports[p_port] > 0;
}
return false;
}
void VisualShaderNode::set_output_port_connected(int p_port, bool p_connected) {
if (p_connected) {
- connected_output_ports[p_port] = true;
- ++connected_output_count;
+ connected_output_ports[p_port]++;
} else {
- --connected_output_count;
- if (connected_output_count == 0) {
- connected_output_ports[p_port] = false;
- }
+ connected_output_ports[p_port]--;
}
}
@@ -1716,6 +1712,7 @@ const VisualShaderNodeInput::Port VisualShaderNodeInput::ports[] = {
{ Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "diffuse", "DIFFUSE_LIGHT" },
{ Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_VECTOR, "specular", "SPECULAR_LIGHT" },
{ Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "roughness", "ROUGHNESS" },
+ { Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_SCALAR, "metallic", "METALLIC" },
{ Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "world", "WORLD_MATRIX" },
{ Shader::MODE_SPATIAL, VisualShader::TYPE_LIGHT, VisualShaderNode::PORT_TYPE_TRANSFORM, "inv_camera", "INV_CAMERA_MATRIX" },
diff --git a/scene/resources/visual_shader.h b/scene/resources/visual_shader.h
index e7d74b6c17..e3d5200e6b 100644
--- a/scene/resources/visual_shader.h
+++ b/scene/resources/visual_shader.h
@@ -193,8 +193,7 @@ class VisualShaderNode : public Resource {
Map<int, Variant> default_input_values;
Map<int, bool> connected_input_ports;
- Map<int, bool> connected_output_ports;
- int connected_output_count = 0;
+ Map<int, int> connected_output_ports;
protected:
bool simple_decl = true;
diff --git a/scene/resources/visual_shader_nodes.cpp b/scene/resources/visual_shader_nodes.cpp
index 7c4500468b..085c0d0112 100644
--- a/scene/resources/visual_shader_nodes.cpp
+++ b/scene/resources/visual_shader_nodes.cpp
@@ -452,7 +452,7 @@ String VisualShaderNodeTexture::get_output_port_name(int p_port) const {
String VisualShaderNodeTexture::get_input_port_default_hint(int p_port) const {
if (p_port == 0) {
- return "UV.xy";
+ return "default";
}
return "";
}
@@ -491,15 +491,22 @@ String VisualShaderNodeTexture::generate_global(Shader::Mode p_mode, VisualShade
}
String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const {
+ String default_uv;
+ if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) {
+ default_uv = "UV.xy";
+ } else {
+ default_uv = "vec2(0.0)";
+ }
+
if (source == SOURCE_TEXTURE) {
String id = make_unique_id(p_type, p_id, "tex");
String code;
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\tvec4 " + id + "_read = texture(" + id + ", UV.xy);\n";
+ code += "\tvec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n";
} else {
- code += "\tvec4 " + id + "_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\tvec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
@@ -525,9 +532,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", UV.xy);\n";
+ code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n";
} else {
- code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
@@ -549,9 +556,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String() || p_for_preview) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, UV.xy, 0.0 );\n";
+ code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", 0.0 );\n";
} else {
- code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 _tex_read = textureLod(SCREEN_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
@@ -572,9 +579,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 _tex_read = texture(TEXTURE , UV.xy);\n";
+ code += "\t\tvec4 _tex_read = texture(TEXTURE, " + default_uv + ");\n";
} else {
- code += "\t\tvec4 _tex_read = textureLod(TEXTURE, UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 _tex_read = textureLod(TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
@@ -595,9 +602,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 _tex_read = texture(NORMAL_TEXTURE, UV.xy);\n";
+ code += "\t\tvec4 _tex_read = texture(NORMAL_TEXTURE, " + default_uv + ");\n";
} else {
- code += "\t\tvec4 _tex_read = textureLod(NORMAL_TEXTURE, UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 _tex_read = textureLod(NORMAL_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
@@ -628,9 +635,9 @@ String VisualShaderNodeTexture::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tfloat _depth = texture(DEPTH_TEXTURE, UV.xy).r;\n";
+ code += "\t\tfloat _depth = texture(DEPTH_TEXTURE, " + default_uv + ").r;\n";
} else {
- code += "\t\tfloat _depth = textureLod(DEPTH_TEXTURE, UV.xy, " + p_input_vars[1] + ").r;\n";
+ code += "\t\tfloat _depth = textureLod(DEPTH_TEXTURE, " + default_uv + ", " + p_input_vars[1] + ").r;\n";
}
} else if (p_input_vars[1] == String()) {
@@ -819,12 +826,19 @@ String VisualShaderNodeSample3D::get_output_port_name(int p_port) const {
String VisualShaderNodeSample3D::get_input_port_default_hint(int p_port) const {
if (p_port == 0) {
- return "vec3(UV.xy, 0.0)";
+ return "default";
}
return "";
}
String VisualShaderNodeSample3D::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const {
+ String default_uv;
+ if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) {
+ default_uv = "vec3(UV, 0.0)";
+ } else {
+ default_uv = "vec3(0.0)";
+ }
+
String code;
if (source == SOURCE_TEXTURE || source == SOURCE_PORT) {
String id;
@@ -837,9 +851,9 @@ String VisualShaderNodeSample3D::generate_code(Shader::Mode p_mode, VisualShader
if (id != String()) {
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", vec3(UV.xy, 0.0));\n";
+ code += "\t\tvec4 " + id + "_tex_read = texture(" + id + ", " + default_uv + ");\n";
} else {
- code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", vec3(UV.xy, 0.0), " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 " + id + "_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
//no lod
@@ -1085,6 +1099,13 @@ String VisualShaderNodeCubemap::generate_global(Shader::Mode p_mode, VisualShade
}
String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const {
+ String default_uv;
+ if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) {
+ default_uv = "vec3(UV, 0.0)";
+ } else {
+ default_uv = "vec3(0.0)";
+ }
+
String code;
String id;
if (source == SOURCE_TEXTURE) {
@@ -1108,9 +1129,9 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader:
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 " + id + "_read = texture(" + id + " , vec3(UV, 0.0));\n";
+ code += "\t\tvec4 " + id + "_read = texture(" + id + ", " + default_uv + ");\n";
} else {
- code += "\t\tvec4 " + id + "_read = textureLod(" + id + " , vec3(UV, 0.0)" + " , " + p_input_vars[1] + " );\n";
+ code += "\t\tvec4 " + id + "_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + " );\n";
}
} else if (p_input_vars[1] == String()) {
@@ -1128,7 +1149,7 @@ String VisualShaderNodeCubemap::generate_code(Shader::Mode p_mode, VisualShader:
String VisualShaderNodeCubemap::get_input_port_default_hint(int p_port) const {
if (p_port == 0) {
- return "vec3(UV, 0.0)";
+ return "default";
}
return "";
}
@@ -4246,13 +4267,20 @@ bool VisualShaderNodeTextureUniform::is_code_generated() const {
}
String VisualShaderNodeTextureUniform::generate_code(Shader::Mode p_mode, VisualShader::Type p_type, int p_id, const String *p_input_vars, const String *p_output_vars, bool p_for_preview) const {
+ String default_uv;
+ if (p_mode != Shader::MODE_PARTICLES && p_mode != Shader::MODE_SKY) {
+ default_uv = "UV.xy";
+ } else {
+ default_uv = "vec2(0.0)";
+ }
+
String id = get_uniform_name();
String code = "\t{\n";
if (p_input_vars[0] == String()) { // Use UV by default.
if (p_input_vars[1] == String()) {
- code += "\t\tvec4 n_tex_read = texture(" + id + ", UV.xy);\n";
+ code += "\t\tvec4 n_tex_read = texture(" + id + ", " + default_uv + ");\n";
} else {
- code += "\t\tvec4 n_tex_read = textureLod(" + id + ", UV.xy, " + p_input_vars[1] + ");\n";
+ code += "\t\tvec4 n_tex_read = textureLod(" + id + ", " + default_uv + ", " + p_input_vars[1] + ");\n";
}
} else if (p_input_vars[1] == String()) {
//no lod
@@ -4313,7 +4341,7 @@ void VisualShaderNodeTextureUniform::_bind_methods() {
String VisualShaderNodeTextureUniform::get_input_port_default_hint(int p_port) const {
if (p_port == 0) {
- return "UV.xy";
+ return "default";
}
return "";
}
diff --git a/servers/audio/effects/audio_effect_spectrum_analyzer.cpp b/servers/audio/effects/audio_effect_spectrum_analyzer.cpp
index e744dbf9b0..3f4f11ee8d 100644
--- a/servers/audio/effects/audio_effect_spectrum_analyzer.cpp
+++ b/servers/audio/effects/audio_effect_spectrum_analyzer.cpp
@@ -113,15 +113,15 @@ void AudioEffectSpectrumAnalyzerInstance::process(const AudioFrame *p_src_frames
float *fftw = temporal_fft.ptrw();
for (int i = 0; i < to_fill; i++) { //left and right buffers
- float window = -0.5 * Math::cos(2.0 * Math_PI * (double)i / (double)to_fill) + 0.5;
- fftw[(i + temporal_fft_pos) * 2] = window * p_src_frames[i].l;
- fftw[(i + temporal_fft_pos) * 2 + 1] = 0;
- fftw[(i + temporal_fft_pos + fft_size * 2) * 2] = window * p_src_frames[i].r;
- fftw[(i + temporal_fft_pos + fft_size * 2) * 2 + 1] = 0;
+ float window = -0.5 * Math::cos(2.0 * Math_PI * (double)temporal_fft_pos / (double)fft_size) + 0.5;
+ fftw[temporal_fft_pos * 2] = window * p_src_frames->l;
+ fftw[temporal_fft_pos * 2 + 1] = 0;
+ fftw[(temporal_fft_pos + fft_size * 2) * 2] = window * p_src_frames->r;
+ fftw[(temporal_fft_pos + fft_size * 2) * 2 + 1] = 0;
+ ++p_src_frames;
+ ++temporal_fft_pos;
}
- p_src_frames += to_fill;
- temporal_fft_pos += to_fill;
p_frame_count -= to_fill;
if (temporal_fft_pos == fft_size * 2) {
@@ -134,9 +134,8 @@ void AudioEffectSpectrumAnalyzerInstance::process(const AudioFrame *p_src_frames
for (int i = 0; i < fft_size; i++) {
//abs(vec)/fft_size normalizes each frequency
- float window = 1.0; //-.5 * Math::cos(2. * Math_PI * (double)i / (double)fft_size) + .5;
- hw[i].l = window * Vector2(fftw[i * 2], fftw[i * 2 + 1]).length() / float(fft_size);
- hw[i].r = window * Vector2(fftw[fft_size * 4 + i * 2], fftw[fft_size * 4 + i * 2 + 1]).length() / float(fft_size);
+ hw[i].l = Vector2(fftw[i * 2], fftw[i * 2 + 1]).length() / float(fft_size);
+ hw[i].r = Vector2(fftw[fft_size * 4 + i * 2], fftw[fft_size * 4 + i * 2 + 1]).length() / float(fft_size);
}
fft_pos = next; //swap
diff --git a/servers/audio_server.h b/servers/audio_server.h
index 80e244aacd..31537e8326 100644
--- a/servers/audio_server.h
+++ b/servers/audio_server.h
@@ -31,8 +31,8 @@
#ifndef AUDIO_SERVER_H
#define AUDIO_SERVER_H
+#include "core/class_db.h"
#include "core/math/audio_frame.h"
-#include "core/object.h"
#include "core/os/os.h"
#include "core/variant.h"
#include "servers/audio/audio_effect.h"
diff --git a/servers/camera_server.h b/servers/camera_server.h
index b268553fe5..7723e30974 100644
--- a/servers/camera_server.h
+++ b/servers/camera_server.h
@@ -31,7 +31,7 @@
#ifndef CAMERA_SERVER_H
#define CAMERA_SERVER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/os/thread_safe.h"
#include "core/reference.h"
#include "core/rid.h"
diff --git a/servers/display_server.cpp b/servers/display_server.cpp
index 356f4b884a..e678c6919b 100644
--- a/servers/display_server.cpp
+++ b/servers/display_server.cpp
@@ -31,7 +31,6 @@
#include "display_server.h"
#include "core/input/input.h"
-#include "core/method_bind_ext.gen.inc"
#include "scene/resources/texture.h"
DisplayServer *DisplayServer::singleton = nullptr;
diff --git a/servers/navigation_server_2d.h b/servers/navigation_server_2d.h
index d7384bae74..6575426e73 100644
--- a/servers/navigation_server_2d.h
+++ b/servers/navigation_server_2d.h
@@ -35,7 +35,7 @@
#ifndef NAVIGATION_2D_SERVER_H
#define NAVIGATION_2D_SERVER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/rid.h"
#include "scene/2d/navigation_region_2d.h"
diff --git a/servers/navigation_server_3d.h b/servers/navigation_server_3d.h
index c34bd2391b..7a3e4f5f8f 100644
--- a/servers/navigation_server_3d.h
+++ b/servers/navigation_server_3d.h
@@ -35,7 +35,7 @@
#ifndef NAVIGATION_SERVER_H
#define NAVIGATION_SERVER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/rid.h"
#include "scene/3d/navigation_region_3d.h"
diff --git a/servers/physics_2d/collision_solver_2d_sw.cpp b/servers/physics_2d/collision_solver_2d_sw.cpp
index beba709807..0e056691c7 100644
--- a/servers/physics_2d/collision_solver_2d_sw.cpp
+++ b/servers/physics_2d/collision_solver_2d_sw.cpp
@@ -47,7 +47,7 @@ bool CollisionSolver2DSW::solve_static_line(const Shape2DSW *p_shape_A, const Tr
Vector2 supports[2];
int support_count;
- p_shape_B->get_supports(p_transform_A.affine_inverse().basis_xform(-n).normalized(), supports, support_count);
+ p_shape_B->get_supports(p_transform_B.affine_inverse().basis_xform(-n).normalized(), supports, support_count);
bool found = false;
diff --git a/servers/physics_server_2d.cpp b/servers/physics_server_2d.cpp
index 0dac08015f..4338a6938a 100644
--- a/servers/physics_server_2d.cpp
+++ b/servers/physics_server_2d.cpp
@@ -30,7 +30,6 @@
#include "physics_server_2d.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/print_string.h"
#include "core/project_settings.h"
diff --git a/servers/physics_server_2d.h b/servers/physics_server_2d.h
index f609adccf9..40773e4ced 100644
--- a/servers/physics_server_2d.h
+++ b/servers/physics_server_2d.h
@@ -31,7 +31,7 @@
#ifndef PHYSICS_2D_SERVER_H
#define PHYSICS_2D_SERVER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/reference.h"
#include "core/resource.h"
diff --git a/servers/physics_server_3d.cpp b/servers/physics_server_3d.cpp
index 33a2b91902..d0266f95b5 100644
--- a/servers/physics_server_3d.cpp
+++ b/servers/physics_server_3d.cpp
@@ -30,7 +30,6 @@
#include "physics_server_3d.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/print_string.h"
#include "core/project_settings.h"
diff --git a/servers/physics_server_3d.h b/servers/physics_server_3d.h
index b779942460..d79dc6fec0 100644
--- a/servers/physics_server_3d.h
+++ b/servers/physics_server_3d.h
@@ -31,7 +31,7 @@
#ifndef PHYSICS_SERVER_H
#define PHYSICS_SERVER_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/resource.h"
class PhysicsDirectSpaceState3D;
diff --git a/servers/rendering/rasterizer.h b/servers/rendering/rasterizer.h
index a24189bdd7..e64c517a0b 100644
--- a/servers/rendering/rasterizer.h
+++ b/servers/rendering/rasterizer.h
@@ -84,7 +84,7 @@ public:
virtual void environment_set_camera_feed_id(RID p_env, int p_camera_feed_id) = 0;
#endif
- virtual void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0;
+ virtual void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0;
virtual void environment_glow_set_use_bicubic_upscale(bool p_enable) = 0;
virtual void environment_glow_set_use_high_quality(bool p_enable) = 0;
@@ -111,7 +111,7 @@ public:
virtual void environment_set_adjustment(RID p_env, bool p_enable, float p_brightness, float p_contrast, float p_saturation, RID p_ramp) = 0;
- virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) = 0;
+ virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective) = 0;
virtual Ref<Image> environment_bake_panorama(RID p_env, bool p_bake_irradiance, const Size2i &p_size) = 0;
@@ -299,6 +299,7 @@ public:
virtual void render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0;
virtual void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count) = 0;
virtual void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) = 0;
+ virtual void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) = 0;
virtual void set_scene_pass(uint64_t p_pass) = 0;
virtual void set_time(double p_time, double p_step) = 0;
@@ -660,6 +661,7 @@ public:
virtual void particles_set_process_material(RID p_particles, RID p_material) = 0;
virtual void particles_set_fixed_fps(RID p_particles, int p_fps) = 0;
virtual void particles_set_fractional_delta(RID p_particles, bool p_enable) = 0;
+ virtual void particles_set_collision_base_size(RID p_particles, float p_size) = 0;
virtual void particles_restart(RID p_particles) = 0;
virtual void particles_emit(RID p_particles, const Transform &p_transform, const Vector3 &p_velocity, const Color &p_color, const Color &p_custom, uint32_t p_emit_flags) = 0;
virtual void particles_set_subemitter(RID p_particles, RID p_subemitter_particles) = 0;
@@ -682,6 +684,28 @@ public:
virtual void particles_set_view_axis(RID p_particles, const Vector3 &p_axis) = 0;
+ virtual void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) = 0;
+ virtual void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) = 0;
+
+ virtual void update_particles() = 0;
+
+ /* PARTICLES COLLISION */
+
+ virtual RID particles_collision_create() = 0;
+ virtual void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) = 0;
+ virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) = 0;
+ virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) = 0; //for spheres
+ virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) = 0; //for non-spheres
+ virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) = 0;
+ virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) = 0;
+ virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) = 0;
+ virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) = 0; //for SDF and vector field, heightfield is dynamic
+ virtual void particles_collision_height_field_update(RID p_particles_collision) = 0; //for SDF and vector field
+ virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) = 0; //for SDF and vector field
+ virtual AABB particles_collision_get_aabb(RID p_particles_collision) const = 0;
+ virtual bool particles_collision_is_heightfield(RID p_particles_collision) const = 0;
+ virtual RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const = 0;
+
/* GLOBAL VARIABLES */
virtual void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value) = 0;
diff --git a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp
index 527ed09584..0a3a863ee7 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp
+++ b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.cpp
@@ -389,14 +389,14 @@ void RasterizerEffectsRD::gaussian_blur(RID p_source_rd_texture, RID p_texture,
RD::get_singleton()->compute_list_end();
}
-void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Size2i &p_size, float p_strength, bool p_high_quality, bool p_first_pass, float p_luminance_cap, float p_exposure, float p_bloom, float p_hdr_bleed_treshold, float p_hdr_bleed_scale, RID p_auto_exposure, float p_auto_exposure_grey) {
+void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_back_texture, const Size2i &p_size, float p_strength, bool p_high_quality, bool p_first_pass, float p_luminance_cap, float p_exposure, float p_bloom, float p_hdr_bleed_treshold, float p_hdr_bleed_scale, RID p_auto_exposure, float p_auto_exposure_grey) {
zeromem(&copy.push_constant, sizeof(CopyPushConstant));
CopyMode copy_mode = p_first_pass && p_auto_exposure.is_valid() ? COPY_MODE_GAUSSIAN_GLOW_AUTO_EXPOSURE : COPY_MODE_GAUSSIAN_GLOW;
uint32_t base_flags = 0;
- int32_t x_groups = (p_size.width - 1) / 8 + 1;
- int32_t y_groups = (p_size.height - 1) / 8 + 1;
+ int32_t x_groups = (p_size.width + 7) / 8;
+ int32_t y_groups = (p_size.height + 7) / 8;
copy.push_constant.section[2] = p_size.x;
copy.push_constant.section[3] = p_size.y;
@@ -411,29 +411,15 @@ void RasterizerEffectsRD::gaussian_glow(RID p_source_rd_texture, RID p_texture,
copy.push_constant.glow_auto_exposure_grey = p_auto_exposure_grey; //unused also
- //HORIZONTAL
RD::ComputeListID compute_list = RD::get_singleton()->compute_list_begin();
RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, copy.pipelines[copy_mode]);
RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_source_rd_texture), 0);
- RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_texture), 3);
+ RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_back_texture), 3);
if (p_auto_exposure.is_valid() && p_first_pass) {
RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_auto_exposure), 1);
}
- copy.push_constant.flags = base_flags | COPY_FLAG_HORIZONTAL | (p_first_pass ? COPY_FLAG_GLOW_FIRST_PASS : 0) | (p_high_quality ? COPY_FLAG_HIGH_QUALITY_GLOW : 0);
- RD::get_singleton()->compute_list_set_push_constant(compute_list, &copy.push_constant, sizeof(CopyPushConstant));
-
- RD::get_singleton()->compute_list_dispatch(compute_list, x_groups, y_groups, 1);
- RD::get_singleton()->compute_list_add_barrier(compute_list);
-
- copy_mode = COPY_MODE_GAUSSIAN_GLOW;
-
- //VERTICAL
- RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, copy.pipelines[copy_mode]);
- RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_compute_uniform_set_from_texture(p_texture), 0);
- RD::get_singleton()->compute_list_bind_uniform_set(compute_list, _get_uniform_set_from_image(p_back_texture), 3);
-
- copy.push_constant.flags = base_flags;
+ copy.push_constant.flags = base_flags | (p_first_pass ? COPY_FLAG_GLOW_FIRST_PASS : 0) | (p_high_quality ? COPY_FLAG_HIGH_QUALITY_GLOW : 0);
RD::get_singleton()->compute_list_set_push_constant(compute_list, &copy.push_constant, sizeof(CopyPushConstant));
RD::get_singleton()->compute_list_dispatch(compute_list, x_groups, y_groups, 1);
@@ -692,7 +678,13 @@ void RasterizerEffectsRD::tonemapper(RID p_source_color, RID p_dst_framebuffer,
tonemap.push_constant.use_glow = p_settings.use_glow;
tonemap.push_constant.glow_intensity = p_settings.glow_intensity;
- tonemap.push_constant.glow_level_flags = p_settings.glow_level_flags;
+ tonemap.push_constant.glow_levels[0] = p_settings.glow_levels[0]; // clean this up to just pass by pointer or something
+ tonemap.push_constant.glow_levels[1] = p_settings.glow_levels[1];
+ tonemap.push_constant.glow_levels[2] = p_settings.glow_levels[2];
+ tonemap.push_constant.glow_levels[3] = p_settings.glow_levels[3];
+ tonemap.push_constant.glow_levels[4] = p_settings.glow_levels[4];
+ tonemap.push_constant.glow_levels[5] = p_settings.glow_levels[5];
+ tonemap.push_constant.glow_levels[6] = p_settings.glow_levels[6];
tonemap.push_constant.glow_texture_size[0] = p_settings.glow_texture_size.x;
tonemap.push_constant.glow_texture_size[1] = p_settings.glow_texture_size.y;
tonemap.push_constant.glow_mode = p_settings.glow_mode;
@@ -1758,6 +1750,7 @@ RasterizerEffectsRD::~RasterizerEffectsRD() {
resolve.shader.version_free(resolve.shader_version);
roughness.shader.version_free(roughness.shader_version);
roughness_limiter.shader.version_free(roughness_limiter.shader_version);
+ sort.shader.version_free(sort.shader_version);
specular_merge.shader.version_free(specular_merge.shader_version);
ssao.blur_shader.version_free(ssao.blur_shader_version);
ssao.gather_shader.version_free(ssao.gather_shader_version);
diff --git a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h
index e434bbc372..8607a6ee67 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h
+++ b/servers/rendering/rasterizer_rd/rasterizer_effects_rd.h
@@ -175,14 +175,16 @@ class RasterizerEffectsRD {
uint32_t tonemapper;
uint32_t glow_texture_size[2];
-
float glow_intensity;
- uint32_t glow_level_flags;
+ uint32_t pad3;
+
uint32_t glow_mode;
+ float glow_levels[7];
float exposure;
float white;
float auto_exposure_grey;
+ uint32_t pad2;
float pixel_size[2];
uint32_t use_fxaa;
@@ -607,7 +609,7 @@ public:
void copy_depth_to_rect_and_linearize(RID p_source_rd_texture, RID p_dest_texture, const Rect2i &p_rect, bool p_flip_y, float p_z_near, float p_z_far);
void copy_to_atlas_fb(RID p_source_rd_texture, RID p_dest_framebuffer, const Rect2 &p_uv_rect, RD::DrawListID p_draw_list, bool p_flip_y = false, bool p_panorama = false);
void gaussian_blur(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Rect2i &p_region, bool p_8bit_dst = false);
- void gaussian_glow(RID p_source_rd_texture, RID p_texture, RID p_back_texture, const Size2i &p_size, float p_strength = 1.0, bool p_high_quality = false, bool p_first_pass = false, float p_luminance_cap = 16.0, float p_exposure = 1.0, float p_bloom = 0.0, float p_hdr_bleed_treshold = 1.0, float p_hdr_bleed_scale = 1.0, RID p_auto_exposure = RID(), float p_auto_exposure_grey = 1.0);
+ void gaussian_glow(RID p_source_rd_texture, RID p_back_texture, const Size2i &p_size, float p_strength = 1.0, bool p_high_quality = false, bool p_first_pass = false, float p_luminance_cap = 16.0, float p_exposure = 1.0, float p_bloom = 0.0, float p_hdr_bleed_treshold = 1.0, float p_hdr_bleed_scale = 1.0, RID p_auto_exposure = RID(), float p_auto_exposure_grey = 1.0);
void cubemap_roughness(RID p_source_rd_texture, RID p_dest_framebuffer, uint32_t p_face_id, uint32_t p_sample_count, float p_roughness, float p_size);
void make_mipmap(RID p_source_rd_texture, RID p_dest_texture, const Size2i &p_size);
@@ -627,7 +629,7 @@ public:
GlowMode glow_mode = GLOW_MODE_ADD;
float glow_intensity = 1.0;
- uint32_t glow_level_flags = 0;
+ float glow_levels[7] = { 0.0, 0.0, 1.0, 0.0, 1.0, 0.0, 0.0 };
Vector2i glow_texture_size;
bool glow_use_bicubic_upscale = false;
RID glow_texture;
diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp
index c56c208098..35b0591289 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp
+++ b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.cpp
@@ -1335,6 +1335,7 @@ void RasterizerSceneHighEndRD::_setup_environment(RID p_environment, RID p_rende
if (scene_state.ubo.fog_height_density >= 0.0001) {
scene_state.ubo.fog_height_density = 1.0 / scene_state.ubo.fog_height_density;
}
+ scene_state.ubo.fog_aerial_perspective = environment_get_fog_aerial_perspective(p_environment);
Color fog_color = environment_get_fog_light_color(p_environment).to_linear();
float fog_energy = environment_get_fog_light_energy(p_environment);
@@ -2018,6 +2019,39 @@ void RasterizerSceneHighEndRD::_render_shadow(RID p_framebuffer, InstanceBase **
}
}
+void RasterizerSceneHighEndRD::_render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count) {
+ RENDER_TIMESTAMP("Setup Render Collider Heightfield");
+
+ _update_render_base_uniform_set();
+
+ render_pass++;
+
+ scene_state.ubo.dual_paraboloid_side = 0;
+
+ _setup_environment(RID(), RID(), p_cam_projection, p_cam_transform, RID(), true, Vector2(1, 1), RID(), true, Color(), 0, p_cam_projection.get_z_far(), false, false);
+
+ render_list.clear();
+
+ PassMode pass_mode = PASS_MODE_SHADOW;
+
+ _fill_render_list(p_cull_result, p_cull_count, pass_mode);
+
+ _setup_view_dependant_uniform_set(RID(), RID(), nullptr, 0);
+
+ RENDER_TIMESTAMP("Render Collider Heightield");
+
+ render_list.sort_by_key(false);
+
+ _fill_instances(render_list.elements, render_list.element_count, true);
+
+ {
+ //regular forward for now
+ RD::DrawListID draw_list = RD::get_singleton()->draw_list_begin(p_fb, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ, RD::INITIAL_ACTION_CLEAR, RD::FINAL_ACTION_READ);
+ _render_list(draw_list, RD::get_singleton()->framebuffer_get_format(p_fb), render_list.elements, render_list.element_count, false, pass_mode, true, RID(), RID());
+ RD::get_singleton()->draw_list_end();
+ }
+}
+
void RasterizerSceneHighEndRD::_render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) {
RENDER_TIMESTAMP("Setup Rendering Material");
@@ -2728,6 +2762,9 @@ RasterizerSceneHighEndRD::RasterizerSceneHighEndRD(RasterizerStorageRD *p_storag
actions.renames["NORMAL_ROUGHNESS_TEXTURE"] = "normal_roughness_buffer";
actions.renames["DEPTH"] = "gl_FragDepth";
actions.renames["OUTPUT_IS_SRGB"] = "true";
+ actions.renames["FOG"] = "custom_fog";
+ actions.renames["RADIANCE"] = "custom_radiance";
+ actions.renames["IRRADIANCE"] = "custom_irradiance";
//for light
actions.renames["VIEW"] = "view";
@@ -2765,6 +2802,10 @@ RasterizerSceneHighEndRD::RasterizerSceneHighEndRD(RasterizerStorageRD *p_storag
actions.usage_defines["DIFFUSE_LIGHT"] = "#define USE_LIGHT_SHADER_CODE\n";
actions.usage_defines["SPECULAR_LIGHT"] = "#define USE_LIGHT_SHADER_CODE\n";
+ actions.usage_defines["FOG"] = "#define CUSTOM_FOG_USED\n";
+ actions.usage_defines["RADIANCE"] = "#define CUSTOM_RADIANCE_USED\n";
+ actions.usage_defines["IRRADIANCE"] = "#define CUSTOM_IRRADIANCE_USED\n";
+
actions.render_mode_defines["skip_vertex_transform"] = "#define SKIP_TRANSFORM_USED\n";
actions.render_mode_defines["world_vertex_coords"] = "#define VERTEX_WORLD_COORDS_USED\n";
actions.render_mode_defines["ensure_correct_normals"] = "#define ENSURE_CORRECT_NORMALS\n";
diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h
index 1aad9039ff..566022ae5b 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h
+++ b/servers/rendering/rasterizer_rd/rasterizer_scene_high_end_rd.h
@@ -308,12 +308,6 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD {
float viewport_size[2];
float screen_pixel_size[2];
- float time;
- float reflection_multiplier;
-
- uint32_t pancake_shadows;
- uint32_t pad;
-
float directional_penumbra_shadow_kernel[128]; //32 vec4s
float directional_soft_shadow_kernel[128];
float penumbra_shadow_kernel[128];
@@ -366,7 +360,6 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD {
uint32_t volumetric_fog_pad;
// Fog
-
uint32_t fog_enabled;
float fog_density;
float fog_height;
@@ -374,6 +367,13 @@ class RasterizerSceneHighEndRD : public RasterizerSceneRD {
float fog_light_color[3];
float fog_sun_scatter;
+
+ float fog_aerial_perspective;
+
+ float time;
+ float reflection_multiplier;
+
+ uint32_t pancake_shadows;
};
UBO ubo;
@@ -581,6 +581,7 @@ protected:
virtual void _render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region);
virtual void _render_uv2(InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region);
virtual void _render_sdfgi(RID p_render_buffers, const Vector3i &p_from, const Vector3i &p_size, const AABB &p_bounds, InstanceBase **p_cull_result, int p_cull_count, const RID &p_albedo_texture, const RID &p_emission_texture, const RID &p_emission_aniso_texture, const RID &p_geom_facing_texture);
+ virtual void _render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count);
public:
virtual void set_time(double p_time, double p_step);
diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp
index 958d8eac1f..9e6225a97a 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp
+++ b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.cpp
@@ -2322,6 +2322,7 @@ void RasterizerSceneRD::_setup_sky(RID p_environment, RID p_render_buffers, cons
sky_scene_state.ubo.z_far = p_projection.get_z_far();
sky_scene_state.ubo.fog_enabled = environment_is_fog_enabled(p_environment);
sky_scene_state.ubo.fog_density = environment_get_fog_density(p_environment);
+ sky_scene_state.ubo.fog_aerial_perspective = environment_get_fog_aerial_perspective(p_environment);
Color fog_color = environment_get_fog_light_color(p_environment).to_linear();
float fog_energy = environment_get_fog_light_energy(p_environment);
sky_scene_state.ubo.fog_light_color[0] = fog_color.r * fog_energy;
@@ -2932,11 +2933,12 @@ void RasterizerSceneRD::environment_set_tonemap(RID p_env, RS::EnvironmentToneMa
env->auto_exp_scale = p_auto_exp_scale;
}
-void RasterizerSceneRD::environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) {
+void RasterizerSceneRD::environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) {
Environment *env = environment_owner.getornull(p_env);
ERR_FAIL_COND(!env);
+ ERR_FAIL_COND_MSG(p_levels.size() != 7, "Size of array of glow levels must be 7");
env->glow_enabled = p_enable;
- env->glow_levels = p_level_flags;
+ env->glow_levels = p_levels;
env->glow_intensity = p_intensity;
env->glow_strength = p_strength;
env->glow_mix = p_mix;
@@ -2971,7 +2973,7 @@ void RasterizerSceneRD::environment_set_sdfgi(RID p_env, bool p_enable, RS::Envi
env->sdfgi_y_scale = p_y_scale;
}
-void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) {
+void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_fog_aerial_perspective) {
Environment *env = environment_owner.getornull(p_env);
ERR_FAIL_COND(!env);
@@ -2982,6 +2984,7 @@ void RasterizerSceneRD::environment_set_fog(RID p_env, bool p_enable, const Colo
env->fog_density = p_density;
env->fog_height = p_height;
env->fog_height_density = p_height_density;
+ env->fog_aerial_perspective = p_fog_aerial_perspective;
}
bool RasterizerSceneRD::environment_is_fog_enabled(RID p_env) const {
@@ -3022,6 +3025,12 @@ float RasterizerSceneRD::environment_get_fog_height_density(RID p_env) const {
return env->fog_height_density;
}
+float RasterizerSceneRD::environment_get_fog_aerial_perspective(RID p_env) const {
+ const Environment *env = environment_owner.getornull(p_env);
+ ERR_FAIL_COND_V(!env, 0);
+ return env->fog_aerial_perspective;
+}
+
void RasterizerSceneRD::environment_set_volumetric_fog(RID p_env, bool p_enable, float p_density, const Color &p_light, float p_light_energy, float p_length, float p_detail_spread, float p_gi_inject, RenderingServer::EnvVolumetricFogShadowFilter p_shadow_filter) {
Environment *env = environment_owner.getornull(p_env);
ERR_FAIL_COND(!env);
@@ -5237,25 +5246,21 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu
}
int max_glow_level = -1;
- int glow_mask = 0;
if (can_use_effects && env && env->glow_enabled) {
/* see that blur textures are allocated */
- if (rb->blur[0].texture.is_null()) {
+ if (rb->blur[1].texture.is_null()) {
_allocate_blur_textures(rb);
_render_buffers_uniform_set_changed(p_render_buffers);
}
for (int i = 0; i < RS::MAX_GLOW_LEVELS; i++) {
- if (env->glow_levels & (1 << i)) {
+ if (env->glow_levels[i] > 0.0) {
if (i >= rb->blur[1].mipmaps.size()) {
max_glow_level = rb->blur[1].mipmaps.size() - 1;
- glow_mask |= 1 << max_glow_level;
-
} else {
max_glow_level = i;
- glow_mask |= (1 << i);
}
}
}
@@ -5269,9 +5274,9 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu
if (env->auto_exposure && rb->luminance.current.is_valid()) {
luminance_texture = rb->luminance.current;
}
- storage->get_effects()->gaussian_glow(rb->texture, rb->blur[0].mipmaps[i + 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality, true, env->glow_hdr_luminance_cap, env->exposure, env->glow_bloom, env->glow_hdr_bleed_threshold, env->glow_hdr_bleed_scale, luminance_texture, env->auto_exp_scale);
+ storage->get_effects()->gaussian_glow(rb->texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality, true, env->glow_hdr_luminance_cap, env->exposure, env->glow_bloom, env->glow_hdr_bleed_threshold, env->glow_hdr_bleed_scale, luminance_texture, env->auto_exp_scale);
} else {
- storage->get_effects()->gaussian_glow(rb->blur[1].mipmaps[i - 1].texture, rb->blur[0].mipmaps[i + 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality);
+ storage->get_effects()->gaussian_glow(rb->blur[1].mipmaps[i - 1].texture, rb->blur[1].mipmaps[i].texture, Size2i(vp_w, vp_h), env->glow_strength, glow_high_quality);
}
}
}
@@ -5294,7 +5299,9 @@ void RasterizerSceneRD::_render_buffers_post_process_and_tonemap(RID p_render_bu
tonemap.use_glow = true;
tonemap.glow_mode = RasterizerEffectsRD::TonemapSettings::GlowMode(env->glow_blend_mode);
tonemap.glow_intensity = env->glow_blend_mode == RS::ENV_GLOW_BLEND_MODE_MIX ? env->glow_mix : env->glow_intensity;
- tonemap.glow_level_flags = glow_mask;
+ for (int i = 0; i < RS::MAX_GLOW_LEVELS; i++) {
+ tonemap.glow_levels[i] = env->glow_levels[i];
+ }
tonemap.glow_texture_size.x = rb->blur[1].mipmaps[0].width;
tonemap.glow_texture_size.y = rb->blur[1].mipmaps[0].height;
tonemap.glow_use_bicubic_upscale = glow_bicubic_upscale;
@@ -7511,6 +7518,23 @@ void RasterizerSceneRD::render_sdfgi(RID p_render_buffers, int p_region, Instanc
}
}
+void RasterizerSceneRD::render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count) {
+ ERR_FAIL_COND(!storage->particles_collision_is_heightfield(p_collider));
+ Vector3 extents = storage->particles_collision_get_extents(p_collider) * p_transform.basis.get_scale();
+ CameraMatrix cm;
+ cm.set_orthogonal(-extents.x, extents.x, -extents.z, extents.z, 0, extents.y * 2.0);
+
+ Vector3 cam_pos = p_transform.origin;
+ cam_pos.y += extents.y;
+
+ Transform cam_xform;
+ cam_xform.set_look_at(cam_pos, cam_pos - p_transform.basis.get_axis(Vector3::AXIS_Y), -p_transform.basis.get_axis(Vector3::AXIS_Z).normalized());
+
+ RID fb = storage->particles_collision_get_heightfield_framebuffer(p_collider);
+
+ _render_particle_collider_heightfield(fb, cam_xform, cm, p_cull_result, p_cull_count);
+}
+
void RasterizerSceneRD::render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count) {
RenderBuffers *rb = render_buffers_owner.getornull(p_render_buffers);
ERR_FAIL_COND(!rb);
@@ -7975,6 +7999,7 @@ RasterizerSceneRD::RasterizerSceneRD(RasterizerStorageRD *p_storage) {
actions.renames["HALF_RES_COLOR"] = "half_res_color";
actions.renames["QUARTER_RES_COLOR"] = "quarter_res_color";
actions.renames["RADIANCE"] = "radiance";
+ actions.renames["FOG"] = "custom_fog";
actions.renames["LIGHT0_ENABLED"] = "directional_lights.data[0].enabled";
actions.renames["LIGHT0_DIRECTION"] = "directional_lights.data[0].direction_energy.xyz";
actions.renames["LIGHT0_ENERGY"] = "directional_lights.data[0].direction_energy.w";
diff --git a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h
index fe31d2f76b..8a14598250 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h
+++ b/servers/rendering/rasterizer_rd/rasterizer_scene_rd.h
@@ -67,7 +67,8 @@ protected:
uint32_t volumetric_fog_enabled;
float volumetric_fog_inv_length;
float volumetric_fog_detail_spread;
- uint32_t volumetric_fog_pad;
+
+ float fog_aerial_perspective;
float fog_light_color[3];
float fog_sun_scatter;
@@ -112,6 +113,7 @@ protected:
virtual void _render_material(const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, bool p_cam_ortogonal, InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0;
virtual void _render_uv2(InstanceBase **p_cull_result, int p_cull_count, RID p_framebuffer, const Rect2i &p_region) = 0;
virtual void _render_sdfgi(RID p_render_buffers, const Vector3i &p_from, const Vector3i &p_size, const AABB &p_bounds, InstanceBase **p_cull_result, int p_cull_count, const RID &p_albedo_texture, const RID &p_emission_texture, const RID &p_emission_aniso_texture, const RID &p_geom_facing_texture) = 0;
+ virtual void _render_particle_collider_heightfield(RID p_fb, const Transform &p_cam_transform, const CameraMatrix &p_cam_projection, InstanceBase **p_cull_result, int p_cull_count) = 0;
virtual void _debug_giprobe(RID p_gi_probe, RenderingDevice::DrawListID p_draw_list, RID p_framebuffer, const CameraMatrix &p_camera_with_transform, bool p_lighting, bool p_emission, float p_alpha);
void _debug_sdfgi_probes(RID p_render_buffers, RD::DrawListID p_draw_list, RID p_framebuffer, const CameraMatrix &p_camera_with_transform);
@@ -705,6 +707,7 @@ private:
float fog_density = 0.001;
float fog_height = 0.0;
float fog_height_density = 0.0; //can be negative to invert effect
+ float fog_aerial_perspective = 0.0;
/// Volumetric Fog
///
@@ -720,7 +723,7 @@ private:
/// Glow
bool glow_enabled = false;
- int glow_levels = (1 << 2) | (1 << 4);
+ Vector<float> glow_levels;
float glow_intensity = 0.8;
float glow_strength = 1.0;
float glow_bloom = 0.0;
@@ -1529,11 +1532,11 @@ public:
bool is_environment(RID p_env) const;
- void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap);
+ void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, RS::EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap);
void environment_glow_set_use_bicubic_upscale(bool p_enable);
void environment_glow_set_use_high_quality(bool p_enable);
- void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density);
+ void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective);
bool environment_is_fog_enabled(RID p_env) const;
Color environment_get_fog_light_color(RID p_env) const;
float environment_get_fog_light_energy(RID p_env) const;
@@ -1541,6 +1544,7 @@ public:
float environment_get_fog_density(RID p_env) const;
float environment_get_fog_height(RID p_env) const;
float environment_get_fog_height_density(RID p_env) const;
+ float environment_get_fog_aerial_perspective(RID p_env) const;
void environment_set_volumetric_fog(RID p_env, bool p_enable, float p_density, const Color &p_light, float p_light_energy, float p_length, float p_detail_spread, float p_gi_inject, RS::EnvVolumetricFogShadowFilter p_shadow_filter);
@@ -1876,6 +1880,8 @@ public:
void render_sdfgi(RID p_render_buffers, int p_region, InstanceBase **p_cull_result, int p_cull_count);
void render_sdfgi_static_lights(RID p_render_buffers, uint32_t p_cascade_count, const uint32_t *p_cascade_indices, const RID **p_positional_light_cull_result, const uint32_t *p_positional_light_cull_count);
+ void render_particle_collider_heightfield(RID p_collider, const Transform &p_transform, InstanceBase **p_cull_result, int p_cull_count);
+
virtual void set_scene_pass(uint64_t p_pass) {
scene_pass = p_pass;
}
diff --git a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp
index a13e7d786b..90dd6af319 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp
+++ b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.cpp
@@ -3333,6 +3333,10 @@ void RasterizerStorageRD::_particles_free_data(Particles *particles) {
particles->particles_transforms_buffer_uniform_set = RID();
particles->particle_buffer = RID();
+ if (RD::get_singleton()->uniform_set_is_valid(particles->collision_textures_uniform_set)) {
+ RD::get_singleton()->free(particles->collision_textures_uniform_set);
+ }
+
if (particles->particles_sort_buffer.is_valid()) {
RD::get_singleton()->free(particles->particles_sort_buffer);
particles->particles_sort_buffer = RID();
@@ -3454,6 +3458,13 @@ void RasterizerStorageRD::particles_set_fractional_delta(RID p_particles, bool p
particles->fractional_delta = p_enable;
}
+void RasterizerStorageRD::particles_set_collision_base_size(RID p_particles, float p_size) {
+ Particles *particles = particles_owner.getornull(p_particles);
+ ERR_FAIL_COND(!particles);
+
+ particles->collision_base_size = p_size;
+}
+
void RasterizerStorageRD::particles_set_process_material(RID p_particles, RID p_material) {
Particles *particles = particles_owner.getornull(p_particles);
ERR_FAIL_COND(!particles);
@@ -3646,6 +3657,22 @@ RID RasterizerStorageRD::particles_get_draw_pass_mesh(RID p_particles, int p_pas
return particles->draw_passes[p_pass];
}
+void RasterizerStorageRD::particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) {
+ Particles *particles = particles_owner.getornull(p_particles);
+ ERR_FAIL_COND(!particles);
+
+ ERR_FAIL_COND(p_instance->base_type != RS::INSTANCE_PARTICLES_COLLISION);
+
+ particles->collisions.insert(p_instance);
+}
+
+void RasterizerStorageRD::particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance) {
+ Particles *particles = particles_owner.getornull(p_particles);
+ ERR_FAIL_COND(!particles);
+
+ particles->collisions.erase(p_instance);
+}
+
void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_delta) {
if (p_particles->particles_material_uniform_set.is_null() || !RD::get_singleton()->uniform_set_is_valid(p_particles->particles_material_uniform_set)) {
Vector<RD::Uniform> uniforms;
@@ -3729,6 +3756,195 @@ void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_del
frame_params.cycle = p_particles->cycle_number;
+ { //collision and attractors
+
+ frame_params.collider_count = 0;
+ frame_params.attractor_count = 0;
+ frame_params.particle_size = p_particles->collision_base_size;
+
+ RID collision_3d_textures[ParticlesFrameParams::MAX_3D_TEXTURES];
+ RID collision_heightmap_texture;
+
+ Transform to_particles;
+ if (p_particles->use_local_coords) {
+ to_particles = p_particles->emission_transform.affine_inverse();
+ }
+ uint32_t collision_3d_textures_used = 0;
+ for (const Set<RasterizerScene::InstanceBase *>::Element *E = p_particles->collisions.front(); E; E = E->next()) {
+ ParticlesCollision *pc = particles_collision_owner.getornull(E->get()->base);
+ Transform to_collider = E->get()->transform;
+ if (p_particles->use_local_coords) {
+ to_collider = to_particles * to_collider;
+ }
+ Vector3 scale = to_collider.basis.get_scale();
+ to_collider.basis.orthonormalize();
+
+ if (pc->type <= RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT) {
+ //attractor
+ if (frame_params.attractor_count >= ParticlesFrameParams::MAX_ATTRACTORS) {
+ continue;
+ }
+
+ ParticlesFrameParams::Attractor &attr = frame_params.attractors[frame_params.attractor_count];
+
+ store_transform(to_collider, attr.transform);
+ attr.strength = pc->attractor_strength;
+ attr.attenuation = pc->attractor_attenuation;
+ attr.directionality = pc->attractor_directionality;
+
+ switch (pc->type) {
+ case RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT: {
+ attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_SPHERE;
+ float radius = pc->radius;
+ radius *= (scale.x + scale.y + scale.z) / 3.0;
+ attr.extents[0] = radius;
+ attr.extents[1] = radius;
+ attr.extents[2] = radius;
+ } break;
+ case RS::PARTICLES_COLLISION_TYPE_BOX_ATTRACT: {
+ attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_BOX;
+ Vector3 extents = pc->extents * scale;
+ attr.extents[0] = extents.x;
+ attr.extents[1] = extents.y;
+ attr.extents[2] = extents.z;
+ } break;
+ case RS::PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT: {
+ if (collision_3d_textures_used >= ParticlesFrameParams::MAX_3D_TEXTURES) {
+ continue;
+ }
+ attr.type = ParticlesFrameParams::ATTRACTOR_TYPE_VECTOR_FIELD;
+ Vector3 extents = pc->extents * scale;
+ attr.extents[0] = extents.x;
+ attr.extents[1] = extents.y;
+ attr.extents[2] = extents.z;
+ attr.texture_index = collision_3d_textures_used;
+
+ collision_3d_textures[collision_3d_textures_used] = pc->field_texture;
+ collision_3d_textures_used++;
+ } break;
+ default: {
+ }
+ }
+
+ frame_params.attractor_count++;
+ } else {
+ //collider
+ if (frame_params.collider_count >= ParticlesFrameParams::MAX_COLLIDERS) {
+ continue;
+ }
+
+ ParticlesFrameParams::Collider &col = frame_params.colliders[frame_params.collider_count];
+
+ store_transform(to_collider, col.transform);
+ switch (pc->type) {
+ case RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE: {
+ col.type = ParticlesFrameParams::COLLISION_TYPE_SPHERE;
+ float radius = pc->radius;
+ radius *= (scale.x + scale.y + scale.z) / 3.0;
+ col.extents[0] = radius;
+ col.extents[1] = radius;
+ col.extents[2] = radius;
+ } break;
+ case RS::PARTICLES_COLLISION_TYPE_BOX_COLLIDE: {
+ col.type = ParticlesFrameParams::COLLISION_TYPE_BOX;
+ Vector3 extents = pc->extents * scale;
+ col.extents[0] = extents.x;
+ col.extents[1] = extents.y;
+ col.extents[2] = extents.z;
+ } break;
+ case RS::PARTICLES_COLLISION_TYPE_SDF_COLLIDE: {
+ if (collision_3d_textures_used >= ParticlesFrameParams::MAX_3D_TEXTURES) {
+ continue;
+ }
+ col.type = ParticlesFrameParams::COLLISION_TYPE_SDF;
+ Vector3 extents = pc->extents * scale;
+ col.extents[0] = extents.x;
+ col.extents[1] = extents.y;
+ col.extents[2] = extents.z;
+ col.texture_index = collision_3d_textures_used;
+ col.scale = (scale.x + scale.y + scale.z) * 0.333333333333; //non uniform scale non supported
+
+ collision_3d_textures[collision_3d_textures_used] = pc->field_texture;
+ collision_3d_textures_used++;
+ } break;
+ case RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE: {
+ if (collision_heightmap_texture != RID()) { //already taken
+ continue;
+ }
+
+ col.type = ParticlesFrameParams::COLLISION_TYPE_HEIGHT_FIELD;
+ Vector3 extents = pc->extents * scale;
+ col.extents[0] = extents.x;
+ col.extents[1] = extents.y;
+ col.extents[2] = extents.z;
+ collision_heightmap_texture = pc->heightfield_texture;
+ } break;
+ default: {
+ }
+ }
+
+ frame_params.collider_count++;
+ }
+ }
+
+ bool different = false;
+ if (collision_3d_textures_used == p_particles->collision_3d_textures_used) {
+ for (int i = 0; i < ParticlesFrameParams::MAX_3D_TEXTURES; i++) {
+ if (p_particles->collision_3d_textures[i] != collision_3d_textures[i]) {
+ different = true;
+ break;
+ }
+ }
+ }
+
+ if (collision_heightmap_texture != p_particles->collision_heightmap_texture) {
+ different = true;
+ }
+
+ bool uniform_set_valid = RD::get_singleton()->uniform_set_is_valid(p_particles->collision_textures_uniform_set);
+
+ if (different || !uniform_set_valid) {
+ if (uniform_set_valid) {
+ RD::get_singleton()->free(p_particles->collision_textures_uniform_set);
+ }
+
+ Vector<RD::Uniform> uniforms;
+
+ {
+ RD::Uniform u;
+ u.type = RD::UNIFORM_TYPE_TEXTURE;
+ u.binding = 0;
+ for (uint32_t i = 0; i < ParticlesFrameParams::MAX_3D_TEXTURES; i++) {
+ RID rd_tex;
+ if (i < collision_3d_textures_used) {
+ Texture *t = texture_owner.getornull(collision_3d_textures[i]);
+ if (t && t->type == Texture::TYPE_3D) {
+ rd_tex = t->rd_texture;
+ }
+ }
+
+ if (rd_tex == RID()) {
+ rd_tex = default_rd_textures[DEFAULT_RD_TEXTURE_3D_WHITE];
+ }
+ u.ids.push_back(rd_tex);
+ }
+ uniforms.push_back(u);
+ }
+ {
+ RD::Uniform u;
+ u.type = RD::UNIFORM_TYPE_TEXTURE;
+ u.binding = 1;
+ if (collision_heightmap_texture.is_valid()) {
+ u.ids.push_back(collision_heightmap_texture);
+ } else {
+ u.ids.push_back(default_rd_textures[DEFAULT_RD_TEXTURE_BLACK]);
+ }
+ uniforms.push_back(u);
+ }
+ p_particles->collision_textures_uniform_set = RD::get_singleton()->uniform_set_create(uniforms, particles_shader.default_shader_rd, 2);
+ }
+ }
+
ParticlesShader::PushConstant push_constant;
push_constant.clear = p_particles->clear;
@@ -3783,8 +3999,10 @@ void RasterizerStorageRD::_particles_process(Particles *p_particles, float p_del
RD::get_singleton()->compute_list_bind_compute_pipeline(compute_list, m->shader_data->pipeline);
RD::get_singleton()->compute_list_bind_uniform_set(compute_list, particles_shader.base_uniform_set, 0);
RD::get_singleton()->compute_list_bind_uniform_set(compute_list, p_particles->particles_material_uniform_set, 1);
+ RD::get_singleton()->compute_list_bind_uniform_set(compute_list, p_particles->collision_textures_uniform_set, 2);
+
if (m->uniform_set.is_valid()) {
- RD::get_singleton()->compute_list_bind_uniform_set(compute_list, m->uniform_set, 2);
+ RD::get_singleton()->compute_list_bind_uniform_set(compute_list, m->uniform_set, 3);
}
RD::get_singleton()->compute_list_set_push_constant(compute_list, &push_constant, sizeof(ParticlesShader::PushConstant));
@@ -4190,7 +4408,7 @@ void RasterizerStorageRD::ParticlesMaterialData::update_parameters(const Map<Str
}
}
- uniform_set = RD::get_singleton()->uniform_set_create(uniforms, base_singleton->particles_shader.shader.version_get_shader(shader_data->version, 0), 2);
+ uniform_set = RD::get_singleton()->uniform_set_create(uniforms, base_singleton->particles_shader.shader.version_get_shader(shader_data->version, 0), 3);
}
RasterizerStorageRD::ParticlesMaterialData::~ParticlesMaterialData() {
@@ -4211,6 +4429,171 @@ RasterizerStorageRD::MaterialData *RasterizerStorageRD::_create_particles_materi
return material_data;
}
////////
+
+/* PARTICLES COLLISION API */
+
+RID RasterizerStorageRD::particles_collision_create() {
+ return particles_collision_owner.make_rid(ParticlesCollision());
+}
+
+RID RasterizerStorageRD::particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND_V(!particles_collision, RID());
+ ERR_FAIL_COND_V(particles_collision->type != RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE, RID());
+
+ if (particles_collision->heightfield_texture == RID()) {
+ //create
+ int resolutions[RS::PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_MAX] = { 256, 512, 1024, 2048, 4096, 8192 };
+ Size2i size;
+ if (particles_collision->extents.x > particles_collision->extents.z) {
+ size.x = resolutions[particles_collision->heightfield_resolution];
+ size.y = int32_t(particles_collision->extents.z / particles_collision->extents.x * size.x);
+ } else {
+ size.y = resolutions[particles_collision->heightfield_resolution];
+ size.x = int32_t(particles_collision->extents.x / particles_collision->extents.z * size.y);
+ }
+
+ RD::TextureFormat tf;
+ tf.format = RD::DATA_FORMAT_D32_SFLOAT;
+ tf.width = size.x;
+ tf.height = size.y;
+ tf.type = RD::TEXTURE_TYPE_2D;
+ tf.usage_bits = RD::TEXTURE_USAGE_SAMPLING_BIT | RD::TEXTURE_USAGE_DEPTH_STENCIL_ATTACHMENT_BIT;
+
+ particles_collision->heightfield_texture = RD::get_singleton()->texture_create(tf, RD::TextureView());
+
+ Vector<RID> fb_tex;
+ fb_tex.push_back(particles_collision->heightfield_texture);
+ particles_collision->heightfield_fb = RD::get_singleton()->framebuffer_create(fb_tex);
+ particles_collision->heightfield_fb_size = size;
+ }
+
+ return particles_collision->heightfield_fb;
+}
+
+void RasterizerStorageRD::particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ if (p_type == particles_collision->type) {
+ return;
+ }
+
+ if (particles_collision->heightfield_texture.is_valid()) {
+ RD::get_singleton()->free(particles_collision->heightfield_texture);
+ particles_collision->heightfield_texture = RID();
+ }
+ particles_collision->type = p_type;
+ particles_collision->instance_dependency.instance_notify_changed(true, false);
+}
+
+void RasterizerStorageRD::particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+ particles_collision->cull_mask = p_cull_mask;
+}
+
+void RasterizerStorageRD::particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->radius = p_radius;
+ particles_collision->instance_dependency.instance_notify_changed(true, false);
+}
+
+void RasterizerStorageRD::particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->extents = p_extents;
+ particles_collision->instance_dependency.instance_notify_changed(true, false);
+}
+
+void RasterizerStorageRD::particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->attractor_strength = p_strength;
+}
+
+void RasterizerStorageRD::particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->attractor_directionality = p_directionality;
+}
+
+void RasterizerStorageRD::particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->attractor_attenuation = p_curve;
+}
+
+void RasterizerStorageRD::particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ particles_collision->field_texture = p_texture;
+}
+
+void RasterizerStorageRD::particles_collision_height_field_update(RID p_particles_collision) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+ particles_collision->instance_dependency.instance_notify_changed(true, false);
+}
+
+void RasterizerStorageRD::particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND(!particles_collision);
+
+ if (particles_collision->heightfield_resolution == p_resolution) {
+ return;
+ }
+
+ particles_collision->heightfield_resolution = p_resolution;
+
+ if (particles_collision->heightfield_texture.is_valid()) {
+ RD::get_singleton()->free(particles_collision->heightfield_texture);
+ particles_collision->heightfield_texture = RID();
+ }
+}
+
+AABB RasterizerStorageRD::particles_collision_get_aabb(RID p_particles_collision) const {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND_V(!particles_collision, AABB());
+
+ switch (particles_collision->type) {
+ case RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT:
+ case RS::PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE: {
+ AABB aabb;
+ aabb.position = -Vector3(1, 1, 1) * particles_collision->radius;
+ aabb.size = Vector3(2, 2, 2) * particles_collision->radius;
+ return aabb;
+ }
+ default: {
+ AABB aabb;
+ aabb.position = -particles_collision->extents;
+ aabb.size = particles_collision->extents * 2;
+ return aabb;
+ }
+ }
+
+ return AABB();
+}
+
+Vector3 RasterizerStorageRD::particles_collision_get_extents(RID p_particles_collision) const {
+ const ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND_V(!particles_collision, Vector3());
+ return particles_collision->extents;
+}
+
+bool RasterizerStorageRD::particles_collision_is_heightfield(RID p_particles_collision) const {
+ const ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_particles_collision);
+ ERR_FAIL_COND_V(!particles_collision, false);
+ return particles_collision->type == RS::PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE;
+}
+
/* SKELETON API */
RID RasterizerStorageRD::skeleton_create() {
@@ -4680,6 +5063,9 @@ void RasterizerStorageRD::reflection_probe_set_extents(RID p_probe, const Vector
ReflectionProbe *reflection_probe = reflection_probe_owner.getornull(p_probe);
ERR_FAIL_COND(!reflection_probe);
+ if (reflection_probe->extents == p_extents) {
+ return;
+ }
reflection_probe->extents = p_extents;
reflection_probe->instance_dependency.instance_notify_changed(true, false);
}
@@ -5797,6 +6183,9 @@ void RasterizerStorageRD::base_update_dependency(RID p_base, RasterizerScene::In
} else if (particles_owner.owns(p_base)) {
Particles *p = particles_owner.getornull(p_base);
p_instance->update_dependency(&p->instance_dependency);
+ } else if (particles_collision_owner.owns(p_base)) {
+ ParticlesCollision *pc = particles_collision_owner.getornull(p_base);
+ p_instance->update_dependency(&pc->instance_dependency);
}
}
@@ -5832,6 +6221,9 @@ RS::InstanceType RasterizerStorageRD::get_base_type(RID p_rid) const {
if (particles_owner.owns(p_rid)) {
return RS::INSTANCE_PARTICLES;
}
+ if (particles_collision_owner.owns(p_rid)) {
+ return RS::INSTANCE_PARTICLES_COLLISION;
+ }
return RS::INSTANCE_NONE;
}
@@ -5871,7 +6263,7 @@ RID RasterizerStorageRD::decal_atlas_get_texture() const {
}
RID RasterizerStorageRD::decal_atlas_get_texture_srgb() const {
- return decal_atlas.texture;
+ return decal_atlas.texture_srgb;
}
void RasterizerStorageRD::_update_decal_atlas() {
@@ -6735,8 +7127,6 @@ void RasterizerStorageRD::update_dirty_resources() {
_update_dirty_multimeshes();
_update_dirty_skeletons();
_update_decal_atlas();
-
- update_particles();
}
bool RasterizerStorageRD::has_os_feature(const String &p_feature) const {
@@ -6871,6 +7261,14 @@ bool RasterizerStorageRD::free(RID p_rid) {
_particles_free_data(particles);
particles->instance_dependency.instance_notify_deleted(p_rid);
particles_owner.free(p_rid);
+ } else if (particles_collision_owner.owns(p_rid)) {
+ ParticlesCollision *particles_collision = particles_collision_owner.getornull(p_rid);
+
+ if (particles_collision->heightfield_texture.is_valid()) {
+ RD::get_singleton()->free(particles_collision->heightfield_texture);
+ }
+ particles_collision->instance_dependency.instance_notify_deleted(p_rid);
+ particles_collision_owner.free(p_rid);
} else if (render_target_owner.owns(p_rid)) {
RenderTarget *rt = render_target_owner.getornull(p_rid);
@@ -7379,14 +7777,19 @@ RasterizerStorageRD::RasterizerStorageRD() {
actions.renames["RESTART_COLOR"] = "restart_color";
actions.renames["RESTART_CUSTOM"] = "restart_custom";
actions.renames["emit_particle"] = "emit_particle";
+ actions.renames["COLLIDED"] = "collided";
+ actions.renames["COLLISION_NORMAL"] = "collision_normal";
+ actions.renames["COLLISION_DEPTH"] = "collision_depth";
+ actions.renames["ATTRACTOR_FORCE"] = "attractor_force";
actions.render_mode_defines["disable_force"] = "#define DISABLE_FORCE\n";
actions.render_mode_defines["disable_velocity"] = "#define DISABLE_VELOCITY\n";
actions.render_mode_defines["keep_data"] = "#define ENABLE_KEEP_DATA\n";
+ actions.render_mode_defines["collision_use_scale"] = "#define USE_COLLISON_SCALE\n";
actions.sampler_array_name = "material_samplers";
actions.base_texture_binding_index = 1;
- actions.texture_layout_set = 2;
+ actions.texture_layout_set = 3;
actions.base_uniform_string = "material.";
actions.base_varying_index = 10;
@@ -7481,7 +7884,12 @@ RasterizerStorageRD::~RasterizerStorageRD() {
for (int i = 0; i < DEFAULT_RD_BUFFER_MAX; i++) {
RD::get_singleton()->free(mesh_default_rd_buffers[i]);
}
+
giprobe_sdf_shader.version_free(giprobe_sdf_shader_version);
+ particles_shader.copy_shader.version_free(particles_shader.copy_shader_version);
+
+ RenderingServer::get_singleton()->free(particles_shader.default_material);
+ RenderingServer::get_singleton()->free(particles_shader.default_shader);
RD::get_singleton()->free(default_rd_storage_buffer);
diff --git a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h
index e14b9528cf..b03a26e200 100644
--- a/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h
+++ b/servers/rendering/rasterizer_rd/rasterizer_storage_rd.h
@@ -475,6 +475,46 @@ private:
};
struct ParticlesFrameParams {
+ enum {
+ MAX_ATTRACTORS = 32,
+ MAX_COLLIDERS = 32,
+ MAX_3D_TEXTURES = 7
+ };
+
+ enum AttractorType {
+ ATTRACTOR_TYPE_SPHERE,
+ ATTRACTOR_TYPE_BOX,
+ ATTRACTOR_TYPE_VECTOR_FIELD,
+ };
+
+ struct Attractor {
+ float transform[16];
+ float extents[3]; //exents or radius
+ uint32_t type;
+
+ uint32_t texture_index; //texture index for vector field
+ float strength;
+ float attenuation;
+ float directionality;
+ };
+
+ enum CollisionType {
+ COLLISION_TYPE_SPHERE,
+ COLLISION_TYPE_BOX,
+ COLLISION_TYPE_SDF,
+ COLLISION_TYPE_HEIGHT_FIELD
+ };
+
+ struct Collider {
+ float transform[16];
+ float extents[3]; //exents or radius
+ uint32_t type;
+
+ uint32_t texture_index; //texture index for vector field
+ float scale;
+ uint32_t pad[2];
+ };
+
uint32_t emitting;
float system_phase;
float prev_system_phase;
@@ -486,9 +526,14 @@ private:
float delta;
uint32_t random_seed;
- uint32_t pad[3];
+ uint32_t attractor_count;
+ uint32_t collider_count;
+ float particle_size;
float emission_transform[16];
+
+ Attractor attractors[MAX_ATTRACTORS];
+ Collider colliders[MAX_COLLIDERS];
};
struct ParticleEmissionBufferData {
@@ -536,6 +581,11 @@ private:
RID particles_material_uniform_set;
RID particles_copy_uniform_set;
RID particles_transforms_buffer_uniform_set;
+ RID collision_textures_uniform_set;
+
+ RID collision_3d_textures[ParticlesFrameParams::MAX_3D_TEXTURES];
+ uint32_t collision_3d_textures_used = 0;
+ RID collision_heightmap_texture;
RID particles_sort_buffer;
RID particles_sort_uniform_set;
@@ -557,6 +607,7 @@ private:
int fixed_fps;
bool fractional_delta;
float frame_remainder;
+ float collision_base_size;
bool clear;
@@ -569,6 +620,8 @@ private:
ParticleEmissionBuffer *emission_buffer = nullptr;
RID emission_storage_buffer;
+ Set<RasterizerScene::InstanceBase *> collisions;
+
Particles() :
inactive(true),
inactive_time(0.0),
@@ -590,6 +643,7 @@ private:
fixed_fps(0),
fractional_delta(false),
frame_remainder(0),
+ collision_base_size(0.01),
clear(true) {
}
@@ -704,6 +758,28 @@ private:
mutable RID_Owner<Particles> particles_owner;
+ /* Particles Collision */
+
+ struct ParticlesCollision {
+ RS::ParticlesCollisionType type = RS::PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT;
+ uint32_t cull_mask = 0xFFFFFFFF;
+ float radius = 1.0;
+ Vector3 extents = Vector3(1, 1, 1);
+ float attractor_strength = 1.0;
+ float attractor_attenuation = 1.0;
+ float attractor_directionality = 0.0;
+ RID field_texture;
+ RID heightfield_texture;
+ RID heightfield_fb;
+ Size2i heightfield_fb_size;
+
+ RS::ParticlesCollisionHeightfieldResolution heightfield_resolution = RS::PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_1024;
+
+ RasterizerScene::InstanceDependency instance_dependency;
+ };
+
+ mutable RID_Owner<ParticlesCollision> particles_collision_owner;
+
/* Skeleton */
struct Skeleton {
@@ -1691,6 +1767,7 @@ public:
void particles_set_process_material(RID p_particles, RID p_material);
void particles_set_fixed_fps(RID p_particles, int p_fps);
void particles_set_fractional_delta(RID p_particles, bool p_enable);
+ void particles_set_collision_base_size(RID p_particles, float p_size);
void particles_restart(RID p_particles);
void particles_emit(RID p_particles, const Transform &p_transform, const Vector3 &p_velocity, const Color &p_color, const Color &p_custom, uint32_t p_emit_flags);
void particles_set_subemitter(RID p_particles, RID p_subemitter_particles);
@@ -1748,6 +1825,27 @@ public:
return particles->particles_transforms_buffer_uniform_set;
}
+ virtual void particles_add_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance);
+ virtual void particles_remove_collision(RID p_particles, RasterizerScene::InstanceBase *p_instance);
+
+ /* PARTICLES COLLISION */
+
+ virtual RID particles_collision_create();
+ virtual void particles_collision_set_collision_type(RID p_particles_collision, RS::ParticlesCollisionType p_type);
+ virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask);
+ virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius); //for spheres
+ virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents); //for non-spheres
+ virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength);
+ virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality);
+ virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve);
+ virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture); //for SDF and vector field, heightfield is dynamic
+ virtual void particles_collision_height_field_update(RID p_particles_collision); //for SDF and vector field
+ virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, RS::ParticlesCollisionHeightfieldResolution p_resolution); //for SDF and vector field
+ virtual AABB particles_collision_get_aabb(RID p_particles_collision) const;
+ virtual Vector3 particles_collision_get_extents(RID p_particles_collision) const;
+ virtual bool particles_collision_is_heightfield(RID p_particles_collision) const;
+ RID particles_collision_get_heightfield_framebuffer(RID p_particles_collision) const;
+
/* GLOBAL VARIABLES API */
virtual void global_variable_add(const StringName &p_name, RS::GlobalVariableType p_type, const Variant &p_value);
diff --git a/servers/rendering/rasterizer_rd/shaders/copy.glsl b/servers/rendering/rasterizer_rd/shaders/copy.glsl
index e565bd8e3d..355a2b9d75 100644
--- a/servers/rendering/rasterizer_rd/shaders/copy.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/copy.glsl
@@ -58,12 +58,20 @@ layout(rgba8, set = 3, binding = 0) uniform restrict writeonly image2D dest_buff
layout(rgba32f, set = 3, binding = 0) uniform restrict writeonly image2D dest_buffer;
#endif
+#ifdef MODE_GAUSSIAN_GLOW
+shared vec4 local_cache[256];
+shared vec4 temp_cache[128];
+#endif
+
void main() {
// Pixel being shaded
ivec2 pos = ivec2(gl_GlobalInvocationID.xy);
+
+#ifndef MODE_GAUSSIAN_GLOW // Glow needs the extra threads
if (any(greaterThanEqual(pos, params.section.zw))) { //too large, do nothing
return;
}
+#endif
#ifdef MODE_MIPMAP
@@ -104,70 +112,69 @@ void main() {
#ifdef MODE_GAUSSIAN_GLOW
- //Glow uses larger sigma 1 for a more rounded blur effect
+ // First pass copy texture into 16x16 local memory for every 8x8 thread block
+ vec2 quad_center_uv = clamp(vec2(gl_GlobalInvocationID.xy + gl_LocalInvocationID.xy - 3.5) / params.section.zw, vec2(0.5 / params.section.zw), vec2(1.0 - 1.5 / params.section.zw));
+ uint dest_index = gl_LocalInvocationID.x * 2 + gl_LocalInvocationID.y * 2 * 16;
+
+ if (bool(params.flags & FLAG_HIGH_QUALITY_GLOW)) {
+ vec2 quad_offset_uv = clamp((vec2(gl_GlobalInvocationID.xy + gl_LocalInvocationID.xy - 3.0)) / params.section.zw, vec2(0.5 / params.section.zw), vec2(1.0 - 1.5 / params.section.zw));
-#define GLOW_ADD(m_ofs, m_mult) \
- { \
- ivec2 ofs = base_pos + m_ofs; \
- if (all(greaterThanEqual(ofs, section_begin)) && all(lessThan(ofs, section_end))) { \
- color += texelFetch(source_color, ofs, 0) * m_mult; \
- } \
+ local_cache[dest_index] = (textureLod(source_color, quad_center_uv, 0) + textureLod(source_color, quad_offset_uv, 0)) * 0.5;
+ local_cache[dest_index + 1] = (textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.z, 0.0), 0) + textureLod(source_color, quad_offset_uv + vec2(1.0 / params.section.z, 0.0), 0)) * 0.5;
+ local_cache[dest_index + 16] = (textureLod(source_color, quad_center_uv + vec2(0.0, 1.0 / params.section.w), 0) + textureLod(source_color, quad_offset_uv + vec2(0.0, 1.0 / params.section.w), 0)) * 0.5;
+ local_cache[dest_index + 16 + 1] = (textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.zw), 0) + textureLod(source_color, quad_offset_uv + vec2(1.0 / params.section.zw), 0)) * 0.5;
+ } else {
+ local_cache[dest_index] = textureLod(source_color, quad_center_uv, 0);
+ local_cache[dest_index + 1] = textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.z, 0.0), 0);
+ local_cache[dest_index + 16] = textureLod(source_color, quad_center_uv + vec2(0.0, 1.0 / params.section.w), 0);
+ local_cache[dest_index + 16 + 1] = textureLod(source_color, quad_center_uv + vec2(1.0 / params.section.zw), 0);
}
+ memoryBarrierShared();
+ barrier();
+
+ // Horizontal pass. Needs to copy into 8x16 chunk of local memory so vertical pass has full resolution
+ uint read_index = gl_LocalInvocationID.x + gl_LocalInvocationID.y * 32 + 4;
+ vec4 color_top = vec4(0.0);
+ color_top += local_cache[read_index] * 0.174938;
+ color_top += local_cache[read_index + 1] * 0.165569;
+ color_top += local_cache[read_index + 2] * 0.140367;
+ color_top += local_cache[read_index + 3] * 0.106595;
+ color_top += local_cache[read_index - 1] * 0.165569;
+ color_top += local_cache[read_index - 2] * 0.140367;
+ color_top += local_cache[read_index - 3] * 0.106595;
+
+ vec4 color_bottom = vec4(0.0);
+ color_bottom += local_cache[read_index + 16] * 0.174938;
+ color_bottom += local_cache[read_index + 1 + 16] * 0.165569;
+ color_bottom += local_cache[read_index + 2 + 16] * 0.140367;
+ color_bottom += local_cache[read_index + 3 + 16] * 0.106595;
+ color_bottom += local_cache[read_index - 1 + 16] * 0.165569;
+ color_bottom += local_cache[read_index - 2 + 16] * 0.140367;
+ color_bottom += local_cache[read_index - 3 + 16] * 0.106595;
+
+ // rotate samples to take advantage of cache coherency
+ uint write_index = gl_LocalInvocationID.y * 2 + gl_LocalInvocationID.x * 16;
+
+ temp_cache[write_index] = color_top;
+ temp_cache[write_index + 1] = color_bottom;
+
+ memoryBarrierShared();
+ barrier();
+
+ // Vertical pass
+ uint index = gl_LocalInvocationID.y + gl_LocalInvocationID.x * 16 + 4;
vec4 color = vec4(0.0);
- if (bool(params.flags & FLAG_HORIZONTAL)) {
- ivec2 base_pos = ((pos + params.section.xy) << 1) + ivec2(1);
- ivec2 section_begin = params.section.xy << 1;
- ivec2 section_end = section_begin + (params.section.zw << 1);
-
- if (bool(params.flags & FLAG_HIGH_QUALITY_GLOW)) {
- //Sample from two lines to capture single pixel features
- GLOW_ADD(ivec2(0, 0), 0.152781);
- GLOW_ADD(ivec2(1, 0), 0.144599);
- GLOW_ADD(ivec2(2, 0), 0.122589);
- GLOW_ADD(ivec2(3, 0), 0.093095);
- GLOW_ADD(ivec2(4, 0), 0.063327);
- GLOW_ADD(ivec2(-1, 0), 0.144599);
- GLOW_ADD(ivec2(-2, 0), 0.122589);
- GLOW_ADD(ivec2(-3, 0), 0.093095);
- GLOW_ADD(ivec2(-4, 0), 0.063327);
-
- GLOW_ADD(ivec2(0, 1), 0.152781);
- GLOW_ADD(ivec2(1, 1), 0.144599);
- GLOW_ADD(ivec2(2, 1), 0.122589);
- GLOW_ADD(ivec2(3, 1), 0.093095);
- GLOW_ADD(ivec2(4, 1), 0.063327);
- GLOW_ADD(ivec2(-1, 1), 0.144599);
- GLOW_ADD(ivec2(-2, 1), 0.122589);
- GLOW_ADD(ivec2(-3, 1), 0.093095);
- GLOW_ADD(ivec2(-4, 1), 0.063327);
- color *= 0.5;
- } else {
- GLOW_ADD(ivec2(0, 0), 0.174938);
- GLOW_ADD(ivec2(1, 0), 0.165569);
- GLOW_ADD(ivec2(2, 0), 0.140367);
- GLOW_ADD(ivec2(3, 0), 0.106595);
- GLOW_ADD(ivec2(-1, 0), 0.165569);
- GLOW_ADD(ivec2(-2, 0), 0.140367);
- GLOW_ADD(ivec2(-3, 0), 0.106595);
- }
-
- color *= params.glow_strength;
- } else {
- ivec2 base_pos = pos + params.section.xy;
- ivec2 section_begin = params.section.xy;
- ivec2 section_end = section_begin + params.section.zw;
-
- GLOW_ADD(ivec2(0, 0), 0.288713);
- GLOW_ADD(ivec2(0, 1), 0.233062);
- GLOW_ADD(ivec2(0, 2), 0.122581);
- GLOW_ADD(ivec2(0, -1), 0.233062);
- GLOW_ADD(ivec2(0, -2), 0.122581);
- color *= params.glow_strength;
- }
+ color += temp_cache[index] * 0.174938;
+ color += temp_cache[index + 1] * 0.165569;
+ color += temp_cache[index + 2] * 0.140367;
+ color += temp_cache[index + 3] * 0.106595;
+ color += temp_cache[index - 1] * 0.165569;
+ color += temp_cache[index - 2] * 0.140367;
+ color += temp_cache[index - 3] * 0.106595;
-#undef GLOW_ADD
+ color *= params.glow_strength;
if (bool(params.flags & FLAG_GLOW_FIRST_PASS)) {
#ifdef GLOW_USE_AUTO_EXPOSURE
diff --git a/servers/rendering/rasterizer_rd/shaders/particles.glsl b/servers/rendering/rasterizer_rd/shaders/particles.glsl
index a924509771..926c7ef9fc 100644
--- a/servers/rendering/rasterizer_rd/shaders/particles.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/particles.glsl
@@ -31,6 +31,40 @@ global_variables;
/* Set 1: FRAME AND PARTICLE DATA */
// a frame history is kept for trail deterministic behavior
+
+#define MAX_ATTRACTORS 32
+
+#define ATTRACTOR_TYPE_SPHERE 0
+#define ATTRACTOR_TYPE_BOX 1
+#define ATTRACTOR_TYPE_VECTOR_FIELD 2
+
+struct Attractor {
+ mat4 transform;
+ vec3 extents; //exents or radius
+ uint type;
+ uint texture_index; //texture index for vector field
+ float strength;
+ float attenuation;
+ float directionality;
+};
+
+#define MAX_COLLIDERS 32
+
+#define COLLIDER_TYPE_SPHERE 0
+#define COLLIDER_TYPE_BOX 1
+#define COLLIDER_TYPE_SDF 2
+#define COLLIDER_TYPE_HEIGHT_FIELD 3
+
+struct Collider {
+ mat4 transform;
+ vec3 extents; //exents or radius
+ uint type;
+
+ uint texture_index; //texture index for vector field
+ float scale;
+ uint pad[2];
+};
+
struct FrameParams {
bool emitting;
float system_phase;
@@ -43,9 +77,14 @@ struct FrameParams {
float delta;
uint random_seed;
- uint pad[3];
+ uint attractor_count;
+ uint collider_count;
+ float particle_size;
mat4 emission_transform;
+
+ Attractor attractors[MAX_ATTRACTORS];
+ Collider colliders[MAX_COLLIDERS];
};
layout(set = 1, binding = 0, std430) restrict buffer FrameHistory {
@@ -80,7 +119,7 @@ struct ParticleEmission {
vec4 custom;
};
-layout(set = 1, binding = 2, std430) restrict volatile coherent buffer SourceEmission {
+layout(set = 1, binding = 2, std430) restrict buffer SourceEmission {
int particle_count;
uint pad0;
uint pad1;
@@ -89,7 +128,7 @@ layout(set = 1, binding = 2, std430) restrict volatile coherent buffer SourceEmi
}
src_particles;
-layout(set = 1, binding = 3, std430) restrict volatile coherent buffer DestEmission {
+layout(set = 1, binding = 3, std430) restrict buffer DestEmission {
int particle_count;
int particle_max;
uint pad1;
@@ -98,10 +137,17 @@ layout(set = 1, binding = 3, std430) restrict volatile coherent buffer DestEmiss
}
dst_particles;
-/* SET 2: MATERIAL */
+/* SET 2: COLLIDER/ATTRACTOR TEXTURES */
+
+#define MAX_3D_TEXTURES 7
+
+layout(set = 2, binding = 0) uniform texture3D sdf_vec_textures[MAX_3D_TEXTURES];
+layout(set = 2, binding = 1) uniform texture2D height_field_texture;
+
+/* SET 3: MATERIAL */
#ifdef USE_MATERIAL_UNIFORMS
-layout(set = 2, binding = 0, std140) uniform MaterialUniforms{
+layout(set = 3, binding = 0, std140) uniform MaterialUniforms{
/* clang-format off */
MATERIAL_UNIFORMS
/* clang-format on */
@@ -140,29 +186,7 @@ bool emit_particle(mat4 p_xform, vec3 p_velocity, vec4 p_color, vec4 p_custom, u
atomicAdd(dst_particles.particle_count, -1);
return false;
}
- /*
- valid = true;
-
- int attempts = 256; // never trust compute
- while(attempts-- > 0) {
- dst_index = dst_particles.particle_count;
- if (dst_index == dst_particles.particle_max) {
- return false; //can't emit anymore
- }
-
- if (atomicCompSwap(dst_particles.particle_count, dst_index, dst_index +1 ) != dst_index) {
- continue;
- }
- valid=true;
- break;
- }
- barrier();
-
- if (!valid) {
- return false; //gave up (attempts exhausted)
- }
-*/
dst_particles.data[dst_index].xform = p_xform;
dst_particles.data[dst_index].velocity = p_velocity;
dst_particles.data[dst_index].color = p_color;
@@ -217,6 +241,199 @@ void main() {
vec4(0.0, 0.0, 0.0, 1.0));
}
+ bool collided = false;
+ vec3 collision_normal = vec3(0.0);
+ float collision_depth = 0.0;
+
+ vec3 attractor_force = vec3(0.0);
+
+#if !defined(DISABLE_VELOCITY)
+
+ if (PARTICLE.is_active) {
+ PARTICLE.xform[3].xyz += PARTICLE.velocity * local_delta;
+ }
+#endif
+
+ /* Process physics if active */
+
+ if (PARTICLE.is_active) {
+ for (uint i = 0; i < FRAME.attractor_count; i++) {
+ vec3 dir;
+ float amount;
+ vec3 rel_vec = PARTICLE.xform[3].xyz - FRAME.attractors[i].transform[3].xyz;
+ vec3 local_pos = rel_vec * mat3(FRAME.attractors[i].transform);
+
+ switch (FRAME.attractors[i].type) {
+ case ATTRACTOR_TYPE_SPHERE: {
+ dir = normalize(rel_vec);
+ float d = length(local_pos) / FRAME.attractors[i].extents.x;
+ if (d > 1.0) {
+ continue;
+ }
+ amount = max(0.0, 1.0 - d);
+ } break;
+ case ATTRACTOR_TYPE_BOX: {
+ dir = normalize(rel_vec);
+
+ vec3 abs_pos = abs(local_pos / FRAME.attractors[i].extents);
+ float d = max(abs_pos.x, max(abs_pos.y, abs_pos.z));
+ if (d > 1.0) {
+ continue;
+ }
+ amount = max(0.0, 1.0 - d);
+
+ } break;
+ case ATTRACTOR_TYPE_VECTOR_FIELD: {
+ vec3 uvw_pos = (local_pos / FRAME.attractors[i].extents) * 2.0 - 1.0;
+ if (any(lessThan(uvw_pos, vec3(0.0))) || any(greaterThan(uvw_pos, vec3(1.0)))) {
+ continue;
+ }
+ vec3 s = texture(sampler3D(sdf_vec_textures[FRAME.attractors[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos).xyz;
+ dir = mat3(FRAME.attractors[i].transform) * normalize(s); //revert direction
+ amount = length(s);
+
+ } break;
+ }
+ amount = pow(amount, FRAME.attractors[i].attenuation);
+ dir = normalize(mix(dir, FRAME.attractors[i].transform[2].xyz, FRAME.attractors[i].directionality));
+ attractor_force -= amount * dir * FRAME.attractors[i].strength;
+ }
+
+ float particle_size = FRAME.particle_size;
+
+#ifdef USE_COLLISON_SCALE
+
+ particle_size *= dot(vec3(length(PARTICLE.xform[0].xyz), length(PARTICLE.xform[1].xyz), length(PARTICLE.xform[2].xyz)), vec3(0.33333333333));
+
+#endif
+
+ for (uint i = 0; i < FRAME.collider_count; i++) {
+ vec3 normal;
+ float depth;
+ bool col = false;
+
+ vec3 rel_vec = PARTICLE.xform[3].xyz - FRAME.colliders[i].transform[3].xyz;
+ vec3 local_pos = rel_vec * mat3(FRAME.colliders[i].transform);
+
+ switch (FRAME.colliders[i].type) {
+ case COLLIDER_TYPE_SPHERE: {
+ float d = length(rel_vec) - (particle_size + FRAME.colliders[i].extents.x);
+
+ if (d < 0.0) {
+ col = true;
+ depth = -d;
+ normal = normalize(rel_vec);
+ }
+
+ } break;
+ case COLLIDER_TYPE_BOX: {
+ vec3 abs_pos = abs(local_pos);
+ vec3 sgn_pos = sign(local_pos);
+
+ if (any(greaterThan(abs_pos, FRAME.colliders[i].extents))) {
+ //point outside box
+
+ vec3 closest = min(abs_pos, FRAME.colliders[i].extents);
+ vec3 rel = abs_pos - closest;
+ depth = length(rel) - particle_size;
+ if (depth < 0.0) {
+ col = true;
+ normal = mat3(FRAME.colliders[i].transform) * (normalize(rel) * sgn_pos);
+ depth = -depth;
+ }
+ } else {
+ //point inside box
+ vec3 axis_len = FRAME.colliders[i].extents - abs_pos;
+ // there has to be a faster way to do this?
+ if (all(lessThan(axis_len.xx, axis_len.yz))) {
+ normal = vec3(1, 0, 0);
+ } else if (all(lessThan(axis_len.yy, axis_len.xz))) {
+ normal = vec3(0, 1, 0);
+ } else {
+ normal = vec3(0, 0, 1);
+ }
+
+ col = true;
+ depth = dot(normal * axis_len, vec3(1)) + particle_size;
+ normal = mat3(FRAME.colliders[i].transform) * (normal * sgn_pos);
+ }
+
+ } break;
+ case COLLIDER_TYPE_SDF: {
+ vec3 apos = abs(local_pos);
+ float extra_dist = 0.0;
+ if (any(greaterThan(apos, FRAME.colliders[i].extents))) { //outside
+ vec3 mpos = min(apos, FRAME.colliders[i].extents);
+ extra_dist = distance(mpos, apos);
+ }
+
+ if (extra_dist > particle_size) {
+ continue;
+ }
+
+ vec3 uvw_pos = (local_pos / FRAME.colliders[i].extents) * 0.5 + 0.5;
+ float s = texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos).r;
+ s *= FRAME.colliders[i].scale;
+ s += extra_dist;
+ if (s < particle_size) {
+ col = true;
+ depth = particle_size - s;
+ const float EPSILON = 0.001;
+ normal = mat3(FRAME.colliders[i].transform) *
+ normalize(
+ vec3(
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r,
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r,
+ texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r));
+ }
+
+ } break;
+ case COLLIDER_TYPE_HEIGHT_FIELD: {
+ vec3 local_pos_bottom = local_pos;
+ local_pos_bottom.y -= particle_size;
+
+ if (any(greaterThan(abs(local_pos_bottom), FRAME.colliders[i].extents))) {
+ continue;
+ }
+
+ const float DELTA = 1.0 / 8192.0;
+
+ vec3 uvw_pos = vec3(local_pos_bottom / FRAME.colliders[i].extents) * 0.5 + 0.5;
+
+ float y = 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz).r;
+
+ if (y > uvw_pos.y) {
+ //inside heightfield
+
+ vec3 pos1 = (vec3(uvw_pos.x, y, uvw_pos.z) * 2.0 - 1.0) * FRAME.colliders[i].extents;
+ vec3 pos2 = (vec3(uvw_pos.x + DELTA, 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz + vec2(DELTA, 0)).r, uvw_pos.z) * 2.0 - 1.0) * FRAME.colliders[i].extents;
+ vec3 pos3 = (vec3(uvw_pos.x, 1.0 - texture(sampler2D(height_field_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos.xz + vec2(0, DELTA)).r, uvw_pos.z + DELTA) * 2.0 - 1.0) * FRAME.colliders[i].extents;
+
+ normal = normalize(cross(pos1 - pos2, pos1 - pos3));
+ float local_y = (vec3(local_pos / FRAME.colliders[i].extents) * 0.5 + 0.5).y;
+
+ col = true;
+ depth = dot(normal, pos1) - dot(normal, local_pos_bottom);
+ }
+
+ } break;
+ }
+
+ if (col) {
+ if (!collided) {
+ collided = true;
+ collision_normal = normal;
+ collision_depth = depth;
+ } else {
+ vec3 c = collision_normal * collision_depth;
+ c += normal * max(0.0, depth - dot(normal, c));
+ collision_normal = normalize(c);
+ collision_depth = length(c);
+ }
+ }
+ }
+ }
+
if (params.sub_emitter_mode) {
if (!PARTICLE.is_active) {
int src_index = atomicAdd(src_particles.particle_count, -1) - 1;
@@ -329,66 +546,4 @@ COMPUTE_SHADER_CODE
/* clang-format on */
}
-
-#if !defined(DISABLE_VELOCITY)
-
- if (PARTICLE.is_active) {
- PARTICLE.xform[3].xyz += PARTICLE.velocity * local_delta;
- }
-#endif
-
-#if 0
- if (PARTICLE.is_active) {
- //execute shader
-
-
-
-
- //!defined(DISABLE_FORCE)
-
- if (false) {
- vec3 force = vec3(0.0);
- for (int i = 0; i < attractor_count; i++) {
- vec3 rel_vec = xform[3].xyz - attractors[i].pos;
- float dist = length(rel_vec);
- if (attractors[i].radius < dist)
- continue;
- if (attractors[i].eat_radius > 0.0 && attractors[i].eat_radius > dist) {
- out_velocity_active.a = 0.0;
- }
-
- rel_vec = normalize(rel_vec);
-
- float attenuation = pow(dist / attractors[i].radius, attractors[i].attenuation);
-
- if (attractors[i].dir == vec3(0.0)) {
- //towards center
- force += attractors[i].strength * rel_vec * attenuation * mass;
- } else {
- force += attractors[i].strength * attractors[i].dir * attenuation * mass;
- }
- }
-
- out_velocity_active.xyz += force * local_delta;
- }
-
-#if !defined(DISABLE_VELOCITY)
-
- if (true) {
- xform[3].xyz += out_velocity_active.xyz * local_delta;
- }
-#endif
- } else {
- xform = mat4(0.0);
- }
-
-
- xform = transpose(xform);
-
- out_velocity_active.a = mix(0.0, 1.0, shader_active);
-
- out_xform_1 = xform[0];
- out_xform_2 = xform[1];
- out_xform_3 = xform[2];
-#endif
}
diff --git a/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl b/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl
index e11f3983c5..455a3d4a3a 100644
--- a/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/scene_high_end.glsl
@@ -1621,6 +1621,22 @@ vec4 volumetric_fog_process(vec2 screen_uv, float z) {
vec4 fog_process(vec3 vertex) {
vec3 fog_color = scene_data.fog_light_color;
+ if (scene_data.fog_aerial_perspective > 0.0) {
+ vec3 sky_fog_color = vec3(0.0);
+ vec3 cube_view = scene_data.radiance_inverse_xform * vertex;
+ // mip_level always reads from the second mipmap and higher so the fog is always slightly blurred
+ float mip_level = mix(1.0 / MAX_ROUGHNESS_LOD, 1.0, 1.0 - (abs(vertex.z) - scene_data.z_near) / (scene_data.z_far - scene_data.z_near));
+#ifdef USE_RADIANCE_CUBEMAP_ARRAY
+ float lod, blend;
+ blend = modf(mip_level * MAX_ROUGHNESS_LOD, lod);
+ sky_fog_color = texture(samplerCubeArray(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), vec4(cube_view, lod)).rgb;
+ sky_fog_color = mix(sky_fog_color, texture(samplerCubeArray(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), vec4(cube_view, lod + 1)).rgb, blend);
+#else
+ sky_fog_color = textureLod(samplerCube(radiance_cubemap, material_samplers[SAMPLER_LINEAR_WITH_MIPMAPS_CLAMP]), cube_view, mip_level * MAX_ROUGHNESS_LOD).rgb;
+#endif //USE_RADIANCE_CUBEMAP_ARRAY
+ fog_color = mix(fog_color, sky_fog_color, scene_data.fog_aerial_perspective);
+ }
+
if (scene_data.fog_sun_scatter > 0.001) {
vec4 sun_scatter = vec4(0.0);
float sun_total = 0.0;
@@ -1676,6 +1692,15 @@ void main() {
float clearcoat_gloss = 0.0;
float anisotropy = 0.0;
vec2 anisotropy_flow = vec2(1.0, 0.0);
+#if defined(CUSTOM_FOG_USED)
+ vec4 custom_fog = vec4(0.0);
+#endif
+#if defined(CUSTOM_RADIANCE_USED)
+ vec4 custom_radiance = vec4(0.0);
+#endif
+#if defined(CUSTOM_IRRADIANCE_USED)
+ vec4 custom_irradiance = vec4(0.0);
+#endif
#if defined(AO_USED)
float ao = 1.0;
@@ -1893,6 +1918,10 @@ FRAGMENT_SHADER_CODE
specular_light *= scene_data.ambient_light_color_energy.a;
}
+#if defined(CUSTOM_RADIANCE_USED)
+ specular_light = mix(specular_light, custom_radiance.rgb, custom_radiance.a);
+#endif
+
#ifndef USE_LIGHTMAP
//lightmap overrides everything
if (scene_data.use_ambient_light) {
@@ -1910,7 +1939,9 @@ FRAGMENT_SHADER_CODE
}
}
#endif // USE_LIGHTMAP
-
+#if defined(CUSTOM_IRRADIANCE_USED)
+ ambient_light = mix(specular_light, custom_irradiance.rgb, custom_irradiance.a);
+#endif
#endif //!defined(MODE_RENDER_DEPTH) && !defined(MODE_UNSHADED)
//radiance
@@ -2726,18 +2757,24 @@ FRAGMENT_SHADER_CODE
specular_buffer = vec4(specular_light, metallic);
#endif
- if (scene_data.volumetric_fog_enabled) {
- vec4 fog = volumetric_fog_process(screen_uv, -vertex.z);
+ // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky.
+ if (scene_data.fog_enabled) {
+ vec4 fog = fog_process(vertex);
diffuse_buffer.rgb = mix(diffuse_buffer.rgb, fog.rgb, fog.a);
specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), fog.a);
}
- if (scene_data.fog_enabled) {
- vec4 fog = fog_process(vertex);
+ if (scene_data.volumetric_fog_enabled) {
+ vec4 fog = volumetric_fog_process(screen_uv, -vertex.z);
diffuse_buffer.rgb = mix(diffuse_buffer.rgb, fog.rgb, fog.a);
specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), fog.a);
}
+#if defined(CUSTOM_FOG_USED)
+ diffuse_buffer.rgb = mix(diffuse_buffer.rgb, custom_fog.rgb, custom_fog.a);
+ specular_buffer.rgb = mix(specular_buffer.rgb, vec3(0.0), custom_fog.a);
+#endif //CUSTOM_FOG_USED
+
#else //MODE_MULTIPLE_RENDER_TARGETS
#ifdef MODE_UNSHADED
@@ -2747,16 +2784,21 @@ FRAGMENT_SHADER_CODE
//frag_color = vec4(1.0);
#endif //USE_NO_SHADING
- if (scene_data.volumetric_fog_enabled) {
- vec4 fog = volumetric_fog_process(screen_uv, -vertex.z);
+ // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky.
+ if (scene_data.fog_enabled) {
+ vec4 fog = fog_process(vertex);
frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a);
}
- if (scene_data.fog_enabled) {
- vec4 fog = fog_process(vertex);
+ if (scene_data.volumetric_fog_enabled) {
+ vec4 fog = volumetric_fog_process(screen_uv, -vertex.z);
frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a);
}
+#if defined(CUSTOM_FOG_USED)
+ frag_color.rgb = mix(frag_color.rgb, custom_fog.rgb, custom_fog.a);
+#endif //CUSTOM_FOG_USED
+
#endif //MODE_MULTIPLE_RENDER_TARGETS
#endif //MODE_RENDER_DEPTH
diff --git a/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl b/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl
index 0cc2b90c53..e29a490ca1 100644
--- a/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/scene_high_end_inc.glsl
@@ -43,12 +43,6 @@ layout(set = 0, binding = 3, std140) uniform SceneData {
vec2 viewport_size;
vec2 screen_pixel_size;
- float time;
- float reflection_multiplier; // one normally, zero when rendering reflections
-
- bool pancake_shadows;
- uint pad;
-
//use vec4s because std140 doesnt play nice with vec2s, z and w are wasted
vec4 directional_penumbra_shadow_kernel[32];
vec4 directional_soft_shadow_kernel[32];
@@ -108,6 +102,13 @@ layout(set = 0, binding = 3, std140) uniform SceneData {
vec3 fog_light_color;
float fog_sun_scatter;
+
+ float fog_aerial_perspective;
+
+ float time;
+ float reflection_multiplier; // one normally, zero when rendering reflections
+
+ bool pancake_shadows;
}
scene_data;
diff --git a/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl b/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl
index a8ee33a664..06dc4b13de 100644
--- a/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/screen_space_reflection.glsl
@@ -155,18 +155,14 @@ void main() {
depth = imageLoad(source_depth, ivec2(pos - 0.5)).r;
- if (-depth >= params.camera_z_far) { //went beyond camera
- break;
- }
-
z_from = z_to;
z_to = z / w;
if (depth > z_to) {
// if depth was surpassed
- if (depth <= max(z_to, z_from) + params.depth_tolerance) {
- // check the depth tolerance
- //check that normal is valid
+ if (depth <= max(z_to, z_from) + params.depth_tolerance && -depth < params.camera_z_far) {
+ // check the depth tolerance and far clip
+ // check that normal is valid
found = true;
}
break;
diff --git a/servers/rendering/rasterizer_rd/shaders/sky.glsl b/servers/rendering/rasterizer_rd/shaders/sky.glsl
index 7b6de6a555..6c985e1f5c 100644
--- a/servers/rendering/rasterizer_rd/shaders/sky.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/sky.glsl
@@ -62,7 +62,8 @@ layout(set = 0, binding = 2, std140) uniform SceneData {
bool volumetric_fog_enabled;
float volumetric_fog_inv_length;
float volumetric_fog_detail_spread;
- uint volumetric_fog_pad;
+
+ float fog_aerial_perspective;
vec3 fog_light_color;
float fog_sun_scatter;
@@ -140,8 +141,8 @@ vec4 volumetric_fog_process(vec2 screen_uv) {
return texture(sampler3D(volumetric_fog_texture, material_samplers[SAMPLER_LINEAR_CLAMP]), fog_pos);
}
-vec4 fog_process(vec3 view) {
- vec3 fog_color = scene_data.fog_light_color;
+vec4 fog_process(vec3 view, vec3 sky_color) {
+ vec3 fog_color = mix(scene_data.fog_light_color, sky_color, scene_data.fog_aerial_perspective);
if (scene_data.fog_sun_scatter > 0.001) {
vec4 sun_scatter = vec4(0.0);
@@ -181,6 +182,7 @@ void main() {
float alpha = 1.0; // Only available to subpasses
vec4 half_res_color = vec4(1.0);
vec4 quarter_res_color = vec4(1.0);
+ vec4 custom_fog = vec4(0.0);
#ifdef USE_CUBEMAP_PASS
vec3 inverted_cube_normal = cube_normal;
@@ -223,14 +225,19 @@ FRAGMENT_SHADER_CODE
#if !defined(DISABLE_FOG) && !defined(USE_CUBEMAP_PASS)
+ // Draw "fixed" fog before volumetric fog to ensure volumetric fog can appear in front of the sky.
+ if (scene_data.fog_enabled) {
+ vec4 fog = fog_process(cube_normal, frag_color.rgb);
+ frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a);
+ }
+
if (scene_data.volumetric_fog_enabled) {
vec4 fog = volumetric_fog_process(uv);
frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a);
}
- if (scene_data.fog_enabled) {
- vec4 fog = fog_process(cube_normal);
- frag_color.rgb = mix(frag_color.rgb, fog.rgb, fog.a);
+ if (custom_fog.a > 0.0) {
+ frag_color.rgb = mix(frag_color.rgb, custom_fog.rgb, custom_fog.a);
}
#endif // DISABLE_FOG
diff --git a/servers/rendering/rasterizer_rd/shaders/tonemap.glsl b/servers/rendering/rasterizer_rd/shaders/tonemap.glsl
index b7c46a7d0e..74449496f6 100644
--- a/servers/rendering/rasterizer_rd/shaders/tonemap.glsl
+++ b/servers/rendering/rasterizer_rd/shaders/tonemap.glsl
@@ -37,12 +37,14 @@ layout(push_constant, binding = 1, std430) uniform Params {
uvec2 glow_texture_size;
float glow_intensity;
- uint glow_level_flags;
+ uint pad3;
uint glow_mode;
+ float glow_levels[7];
float exposure;
float white;
float auto_exposure_grey;
+ uint pad2;
vec2 pixel_size;
bool use_fxaa;
@@ -186,32 +188,32 @@ vec3 apply_tonemapping(vec3 color, float white) { // inputs are LINEAR, always o
vec3 gather_glow(sampler2D tex, vec2 uv) { // sample all selected glow levels
vec3 glow = vec3(0.0f);
- if (bool(params.glow_level_flags & (1 << 0))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 0).rgb;
+ if (params.glow_levels[0] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 0).rgb * params.glow_levels[0];
}
- if (bool(params.glow_level_flags & (1 << 1))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 1).rgb;
+ if (params.glow_levels[1] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 1).rgb * params.glow_levels[1];
}
- if (bool(params.glow_level_flags & (1 << 2))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 2).rgb;
+ if (params.glow_levels[2] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 2).rgb * params.glow_levels[2];
}
- if (bool(params.glow_level_flags & (1 << 3))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 3).rgb;
+ if (params.glow_levels[3] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 3).rgb * params.glow_levels[3];
}
- if (bool(params.glow_level_flags & (1 << 4))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 4).rgb;
+ if (params.glow_levels[4] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 4).rgb * params.glow_levels[4];
}
- if (bool(params.glow_level_flags & (1 << 5))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 5).rgb;
+ if (params.glow_levels[5] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 5).rgb * params.glow_levels[5];
}
- if (bool(params.glow_level_flags & (1 << 6))) {
- glow += GLOW_TEXTURE_SAMPLE(tex, uv, 6).rgb;
+ if (params.glow_levels[6] > 0.0001) {
+ glow += GLOW_TEXTURE_SAMPLE(tex, uv, 6).rgb * params.glow_levels[6];
}
return glow;
diff --git a/servers/rendering/rendering_device.cpp b/servers/rendering/rendering_device.cpp
index 83cbfb85bd..1259b161bd 100644
--- a/servers/rendering/rendering_device.cpp
+++ b/servers/rendering/rendering_device.cpp
@@ -29,7 +29,7 @@
/*************************************************************************/
#include "rendering_device.h"
-#include "core/method_bind_ext.gen.inc"
+
#include "rendering_device_binds.h"
RenderingDevice *RenderingDevice::singleton = nullptr;
diff --git a/servers/rendering/rendering_device.h b/servers/rendering/rendering_device.h
index 72afc7c621..6df66e7b20 100644
--- a/servers/rendering/rendering_device.h
+++ b/servers/rendering/rendering_device.h
@@ -31,7 +31,7 @@
#ifndef RENDERING_DEVICE_H
#define RENDERING_DEVICE_H
-#include "core/object.h"
+#include "core/class_db.h"
#include "core/typed_array.h"
#include "servers/display_server.h"
diff --git a/servers/rendering/rendering_server_raster.cpp b/servers/rendering/rendering_server_raster.cpp
index b12e2ff3c1..cbc91497ba 100644
--- a/servers/rendering/rendering_server_raster.cpp
+++ b/servers/rendering/rendering_server_raster.cpp
@@ -108,6 +108,9 @@ void RenderingServerRaster::draw(bool p_swap_buffers, double frame_step) {
RSG::scene->update_dirty_instances(); //update scene stuff
+ RSG::scene->render_particle_colliders();
+ RSG::storage->update_particles(); //need to be done after instances are updated (colliders and particle transforms), and colliders are rendered
+
RSG::scene->render_probes();
RSG::viewport->draw_viewports();
RSG::canvas_render->update();
diff --git a/servers/rendering/rendering_server_raster.h b/servers/rendering/rendering_server_raster.h
index b554425bef..fb3baeca95 100644
--- a/servers/rendering/rendering_server_raster.h
+++ b/servers/rendering/rendering_server_raster.h
@@ -452,6 +452,7 @@ public:
BIND1(particles_restart, RID)
BIND6(particles_emit, RID, const Transform &, const Vector3 &, const Color &, const Color &, uint32_t)
BIND2(particles_set_subemitter, RID, RID)
+ BIND2(particles_set_collision_base_size, RID, float)
BIND2(particles_set_draw_order, RID, RS::ParticlesDrawOrder)
@@ -461,6 +462,21 @@ public:
BIND1R(AABB, particles_get_current_aabb, RID)
BIND2(particles_set_emission_transform, RID, const Transform &)
+ /* PARTICLES COLLISION */
+
+ BIND0R(RID, particles_collision_create)
+
+ BIND2(particles_collision_set_collision_type, RID, ParticlesCollisionType)
+ BIND2(particles_collision_set_cull_mask, RID, uint32_t)
+ BIND2(particles_collision_set_sphere_radius, RID, float)
+ BIND2(particles_collision_set_box_extents, RID, const Vector3 &)
+ BIND2(particles_collision_set_attractor_strength, RID, float)
+ BIND2(particles_collision_set_attractor_directionality, RID, float)
+ BIND2(particles_collision_set_attractor_attenuation, RID, float)
+ BIND2(particles_collision_set_field_texture, RID, RID)
+ BIND1(particles_collision_height_field_update, RID)
+ BIND2(particles_collision_set_height_field_resolution, RID, ParticlesCollisionHeightfieldResolution)
+
#undef BINDBASE
//from now on, calls forwarded to this singleton
#define BINDBASE RSG::scene
@@ -565,7 +581,7 @@ public:
BIND9(environment_set_ssao, RID, bool, float, float, float, float, float, EnvironmentSSAOBlur, float)
BIND2(environment_set_ssao_quality, EnvironmentSSAOQuality, bool)
- BIND11(environment_set_glow, RID, bool, int, float, float, float, float, EnvironmentGlowBlendMode, float, float, float)
+ BIND11(environment_set_glow, RID, bool, Vector<float>, float, float, float, float, EnvironmentGlowBlendMode, float, float, float)
BIND1(environment_glow_set_use_bicubic_upscale, bool)
BIND1(environment_glow_set_use_high_quality, bool)
@@ -573,7 +589,7 @@ public:
BIND6(environment_set_adjustment, RID, bool, float, float, float, RID)
- BIND8(environment_set_fog, RID, bool, const Color &, float, float, float, float, float)
+ BIND9(environment_set_fog, RID, bool, const Color &, float, float, float, float, float, float)
BIND9(environment_set_volumetric_fog, RID, bool, float, const Color &, float, float, float, float, EnvVolumetricFogShadowFilter)
BIND2(environment_set_volumetric_fog_volume_size, int, int)
diff --git a/servers/rendering/rendering_server_scene.cpp b/servers/rendering/rendering_server_scene.cpp
index d8e52a5aae..ae6786090a 100644
--- a/servers/rendering/rendering_server_scene.cpp
+++ b/servers/rendering/rendering_server_scene.cpp
@@ -193,6 +193,8 @@ void *RenderingServerScene::_instance_pair(void *p_self, OctreeElementID, Instan
} else if (B->base_type == RS::INSTANCE_GI_PROBE && A->base_type == RS::INSTANCE_LIGHT) {
InstanceGIProbeData *gi_probe = static_cast<InstanceGIProbeData *>(B->base_data);
return gi_probe->lights.insert(A);
+ } else if (B->base_type == RS::INSTANCE_PARTICLES_COLLISION && A->base_type == RS::INSTANCE_PARTICLES) {
+ RSG::storage->particles_add_collision(A->base, B);
}
return nullptr;
@@ -274,6 +276,8 @@ void RenderingServerScene::_instance_unpair(void *p_self, OctreeElementID, Insta
Set<Instance *>::Element *E = reinterpret_cast<Set<Instance *>::Element *>(udata);
gi_probe->lights.erase(E);
+ } else if (B->base_type == RS::INSTANCE_PARTICLES_COLLISION && A->base_type == RS::INSTANCE_PARTICLES) {
+ RSG::storage->particles_remove_collision(A->base, B);
}
}
@@ -539,6 +543,9 @@ void RenderingServerScene::instance_set_scenario(RID p_instance, RID p_scenario)
RSG::scene_render->reflection_probe_release_atlas_index(reflection_probe->instance);
} break;
+ case RS::INSTANCE_PARTICLES_COLLISION: {
+ heightfield_particle_colliders_update_list.erase(instance);
+ } break;
case RS::INSTANCE_GI_PROBE: {
InstanceGIProbeData *gi_probe = static_cast<InstanceGIProbeData *>(instance->base_data);
@@ -702,6 +709,12 @@ void RenderingServerScene::instance_set_visible(RID p_instance, bool p_visible)
}
} break;
+ case RS::INSTANCE_PARTICLES_COLLISION: {
+ if (instance->octree_id && instance->scenario) {
+ instance->scenario->octree.set_pairable(instance->octree_id, p_visible, 1 << RS::INSTANCE_PARTICLES_COLLISION, p_visible ? (1 << RS::INSTANCE_PARTICLES) : 0);
+ }
+
+ } break;
default: {
}
}
@@ -1026,6 +1039,13 @@ void RenderingServerScene::_update_instance(Instance *p_instance) {
RSG::storage->particles_set_emission_transform(p_instance->base, p_instance->transform);
}
+ if (p_instance->base_type == RS::INSTANCE_PARTICLES_COLLISION) {
+ //remove materials no longer used and un-own them
+ if (RSG::storage->particles_collision_is_heightfield(p_instance->base)) {
+ heightfield_particle_colliders_update_list.insert(p_instance);
+ }
+ }
+
if (p_instance->aabb.has_no_surface()) {
return;
}
@@ -1085,6 +1105,11 @@ void RenderingServerScene::_update_instance(Instance *p_instance) {
pairable = true;
}
+ if (p_instance->base_type == RS::INSTANCE_PARTICLES_COLLISION) {
+ pairable_mask = p_instance->visible ? (1 << RS::INSTANCE_PARTICLES) : 0;
+ pairable = true;
+ }
+
if (p_instance->base_type == RS::INSTANCE_GI_PROBE) {
//lights and geometries
pairable_mask = p_instance->visible ? RS::INSTANCE_GEOMETRY_MASK | (1 << RS::INSTANCE_LIGHT) : 0;
@@ -1146,6 +1171,10 @@ void RenderingServerScene::_update_instance_aabb(Instance *p_instance) {
}
} break;
+ case RenderingServer::INSTANCE_PARTICLES_COLLISION: {
+ new_aabb = RSG::storage->particles_collision_get_aabb(p_instance->base);
+
+ } break;
case RenderingServer::INSTANCE_LIGHT: {
new_aabb = RSG::storage->light_get_aabb(p_instance->base);
@@ -2679,6 +2708,27 @@ void RenderingServerScene::render_probes() {
}
}
+void RenderingServerScene::render_particle_colliders() {
+ while (heightfield_particle_colliders_update_list.front()) {
+ Instance *hfpc = heightfield_particle_colliders_update_list.front()->get();
+
+ if (hfpc->scenario && hfpc->base_type == RS::INSTANCE_PARTICLES_COLLISION && RSG::storage->particles_collision_is_heightfield(hfpc->base)) {
+ //update heightfield
+ int cull_count = hfpc->scenario->octree.cull_aabb(hfpc->transformed_aabb, instance_cull_result, MAX_INSTANCE_CULL); //@TODO: cull mask missing
+ for (int i = 0; i < cull_count; i++) {
+ Instance *instance = instance_cull_result[i];
+ if (!instance->visible || !((1 << instance->base_type) & (RS::INSTANCE_GEOMETRY_MASK & (~(1 << RS::INSTANCE_PARTICLES))))) { //all but particles to avoid self collision
+ cull_count--;
+ SWAP(instance_cull_result[i], instance_cull_result[cull_count]);
+ }
+ }
+
+ RSG::scene_render->render_particle_collider_heightfield(hfpc->base, hfpc->transform, (RasterizerScene::InstanceBase **)instance_cull_result, cull_count);
+ }
+ heightfield_particle_colliders_update_list.erase(heightfield_particle_colliders_update_list.front());
+ }
+}
+
void RenderingServerScene::_update_instance_shader_parameters_from_material(Map<StringName, RasterizerScene::InstanceBase::InstanceShaderParameter> &isparams, const Map<StringName, RasterizerScene::InstanceBase::InstanceShaderParameter> &existing_isparams, RID p_material) {
List<RasterizerStorage::InstanceShaderParam> plist;
RSG::storage->material_get_instance_shader_parameters(p_material, &plist);
diff --git a/servers/rendering/rendering_server_scene.h b/servers/rendering/rendering_server_scene.h
index 165c3784c1..1b0a617627 100644
--- a/servers/rendering/rendering_server_scene.h
+++ b/servers/rendering/rendering_server_scene.h
@@ -385,6 +385,8 @@ public:
}
};
+ Set<Instance *> heightfield_particle_colliders_update_list;
+
int instance_cull_count;
Instance *instance_cull_result[MAX_INSTANCE_CULL];
Instance *instance_shadow_cull_result[MAX_INSTANCE_CULL]; //used for generating shadowmaps
@@ -461,6 +463,7 @@ public:
void render_camera(RID p_render_buffers, Ref<XRInterface> &p_interface, XRInterface::Eyes p_eye, RID p_camera, RID p_scenario, Size2 p_viewport_size, RID p_shadow_atlas);
void update_dirty_instances();
+ void render_particle_colliders();
void render_probes();
TypedArray<Image> bake_render_uv2(RID p_base, const Vector<RID> &p_material_overrides, const Size2i &p_image_size);
diff --git a/servers/rendering/rendering_server_wrap_mt.cpp b/servers/rendering/rendering_server_wrap_mt.cpp
index 9aa6593cbe..ab9856e06e 100644
--- a/servers/rendering/rendering_server_wrap_mt.cpp
+++ b/servers/rendering/rendering_server_wrap_mt.cpp
@@ -124,6 +124,7 @@ void RenderingServerWrapMT::finish() {
gi_probe_free_cached_ids();
lightmap_free_cached_ids();
particles_free_cached_ids();
+ particles_collision_free_cached_ids();
camera_free_cached_ids();
viewport_free_cached_ids();
environment_free_cached_ids();
diff --git a/servers/rendering/rendering_server_wrap_mt.h b/servers/rendering/rendering_server_wrap_mt.h
index 372a7269dc..305a3aaee7 100644
--- a/servers/rendering/rendering_server_wrap_mt.h
+++ b/servers/rendering/rendering_server_wrap_mt.h
@@ -356,6 +356,8 @@ public:
FUNC2(particles_set_process_material, RID, RID)
FUNC2(particles_set_fixed_fps, RID, int)
FUNC2(particles_set_fractional_delta, RID, bool)
+ FUNC2(particles_set_collision_base_size, RID, float)
+
FUNC1R(bool, particles_is_inactive, RID)
FUNC1(particles_request_process, RID)
FUNC1(particles_restart, RID)
@@ -371,6 +373,21 @@ public:
FUNC1R(AABB, particles_get_current_aabb, RID)
+ /* PARTICLES COLLISION */
+
+ FUNCRID(particles_collision)
+
+ FUNC2(particles_collision_set_collision_type, RID, ParticlesCollisionType)
+ FUNC2(particles_collision_set_cull_mask, RID, uint32_t)
+ FUNC2(particles_collision_set_sphere_radius, RID, float)
+ FUNC2(particles_collision_set_box_extents, RID, const Vector3 &)
+ FUNC2(particles_collision_set_attractor_strength, RID, float)
+ FUNC2(particles_collision_set_attractor_directionality, RID, float)
+ FUNC2(particles_collision_set_attractor_attenuation, RID, float)
+ FUNC2(particles_collision_set_field_texture, RID, RID)
+ FUNC1(particles_collision_height_field_update, RID)
+ FUNC2(particles_collision_set_height_field_resolution, RID, ParticlesCollisionHeightfieldResolution)
+
/* CAMERA API */
FUNCRID(camera)
@@ -475,7 +492,7 @@ public:
FUNC1(environment_set_sdfgi_ray_count, EnvironmentSDFGIRayCount)
FUNC1(environment_set_sdfgi_frames_to_converge, EnvironmentSDFGIFramesToConverge)
- FUNC11(environment_set_glow, RID, bool, int, float, float, float, float, EnvironmentGlowBlendMode, float, float, float)
+ FUNC11(environment_set_glow, RID, bool, Vector<float>, float, float, float, float, EnvironmentGlowBlendMode, float, float, float)
FUNC1(environment_glow_set_use_bicubic_upscale, bool)
FUNC1(environment_glow_set_use_high_quality, bool)
@@ -483,7 +500,7 @@ public:
FUNC6(environment_set_adjustment, RID, bool, float, float, float, RID)
- FUNC8(environment_set_fog, RID, bool, const Color &, float, float, float, float, float)
+ FUNC9(environment_set_fog, RID, bool, const Color &, float, float, float, float, float, float)
FUNC9(environment_set_volumetric_fog, RID, bool, float, const Color &, float, float, float, float, EnvVolumetricFogShadowFilter)
diff --git a/servers/rendering/shader_language.cpp b/servers/rendering/shader_language.cpp
index 6c835fcadf..1883b6b338 100644
--- a/servers/rendering/shader_language.cpp
+++ b/servers/rendering/shader_language.cpp
@@ -5912,6 +5912,8 @@ Error ShaderLanguage::_parse_shader(const Map<StringName, FunctionInfo> &p_funct
int instance_index = 0;
ShaderNode::Uniform::Scope uniform_scope = ShaderNode::Uniform::SCOPE_LOCAL;
+ stages = &p_functions;
+
while (tk.type != TK_EOF) {
switch (tk.type) {
case TK_RENDER_MODE: {
@@ -7326,6 +7328,12 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct
int idx = 0;
bool low_end = RenderingServer::get_singleton()->is_low_end();
+ if (stages && stages->has(skip_function)) {
+ for (const Map<StringName, StageFunctionInfo>::Element *E = (*stages)[skip_function].stage_functions.front(); E; E = E->next()) {
+ matches.insert(String(E->key()), ScriptCodeCompletionOption::KIND_FUNCTION);
+ }
+ }
+
while (builtin_func_defs[idx].name) {
if (low_end && builtin_func_defs[idx].high_end) {
idx++;
@@ -7362,6 +7370,16 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct
return OK;
} break;
case COMPLETION_CALL_ARGUMENTS: {
+ StringName block_function;
+ BlockNode *block = completion_block;
+
+ while (block) {
+ if (block->parent_function) {
+ block_function = block->parent_function->name;
+ }
+ block = block->parent_block;
+ }
+
for (int i = 0; i < shader->functions.size(); i++) {
if (!shader->functions[i].callable) {
continue;
@@ -7421,6 +7439,45 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct
String calltip;
bool low_end = RenderingServer::get_singleton()->is_low_end();
+ if (stages && stages->has(block_function)) {
+ for (const Map<StringName, StageFunctionInfo>::Element *E = (*stages)[block_function].stage_functions.front(); E; E = E->next()) {
+ if (completion_function == E->key()) {
+ calltip += get_datatype_name(E->get().return_type);
+ calltip += " ";
+ calltip += E->key();
+ calltip += "(";
+
+ for (int i = 0; i < E->get().arguments.size(); i++) {
+ if (i > 0) {
+ calltip += ", ";
+ } else {
+ calltip += " ";
+ }
+
+ if (i == completion_argument) {
+ calltip += char32_t(0xFFFF);
+ }
+
+ calltip += get_datatype_name(E->get().arguments[i].type);
+ calltip += " ";
+ calltip += E->get().arguments[i].name;
+
+ if (i == completion_argument) {
+ calltip += char32_t(0xFFFF);
+ }
+ }
+
+ if (E->get().arguments.size()) {
+ calltip += " ";
+ }
+ calltip += ")";
+
+ r_call_hint = calltip;
+ return OK;
+ }
+ }
+ }
+
while (builtin_func_defs[idx].name) {
if (low_end && builtin_func_defs[idx].high_end) {
idx++;
@@ -7453,7 +7510,7 @@ Error ShaderLanguage::complete(const String &p_code, const Map<StringName, Funct
calltip += "(";
bool found_arg = false;
- for (int i = 0; i < 4; i++) {
+ for (int i = 0; i < BuiltinFuncDef::MAX_ARGS - 1; i++) {
if (builtin_func_defs[idx].args[i] == TYPE_VOID) {
break;
}
diff --git a/servers/rendering/shader_language.h b/servers/rendering/shader_language.h
index 0d044a21c7..3c0a10809b 100644
--- a/servers/rendering/shader_language.h
+++ b/servers/rendering/shader_language.h
@@ -846,6 +846,7 @@ private:
StringName completion_function;
StringName completion_struct;
int completion_argument;
+ const Map<StringName, FunctionInfo> *stages = nullptr;
bool _get_completable_identifier(BlockNode *p_block, CompletionType p_type, StringName &identifier);
static const BuiltinFuncDef builtin_func_defs[];
diff --git a/servers/rendering/shader_types.cpp b/servers/rendering/shader_types.cpp
index ad5cbc9e51..48eaf1dd13 100644
--- a/servers/rendering/shader_types.cpp
+++ b/servers/rendering/shader_types.cpp
@@ -129,6 +129,9 @@ ShaderTypes::ShaderTypes() {
shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["PROJECTION_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4);
shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["INV_PROJECTION_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4);
shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["VIEWPORT_SIZE"] = constt(ShaderLanguage::TYPE_VEC2);
+ shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["FOG"] = ShaderLanguage::TYPE_VEC4; // TODO consider adding to light shader
+ shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["RADIANCE"] = ShaderLanguage::TYPE_VEC4;
+ shader_modes[RS::SHADER_SPATIAL].functions["fragment"].built_ins["IRRADIANCE"] = ShaderLanguage::TYPE_VEC4;
shader_modes[RS::SHADER_SPATIAL].functions["fragment"].can_discard = true;
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["WORLD_MATRIX"] = constt(ShaderLanguage::TYPE_MAT4);
@@ -149,6 +152,7 @@ ShaderTypes::ShaderTypes() {
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["SHADOW_ATTENUATION"] = constt(ShaderLanguage::TYPE_VEC3);
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["ALBEDO"] = constt(ShaderLanguage::TYPE_VEC3);
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["BACKLIGHT"] = constt(ShaderLanguage::TYPE_VEC3);
+ shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["METALLIC"] = constt(ShaderLanguage::TYPE_FLOAT);
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["ROUGHNESS"] = constt(ShaderLanguage::TYPE_FLOAT);
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["DIFFUSE_LIGHT"] = ShaderLanguage::TYPE_VEC3;
shader_modes[RS::SHADER_SPATIAL].functions["light"].built_ins["SPECULAR_LIGHT"] = ShaderLanguage::TYPE_VEC3;
@@ -294,6 +298,10 @@ ShaderTypes::ShaderTypes() {
shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_VELOCITY"] = constt(ShaderLanguage::TYPE_BOOL);
shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_COLOR"] = constt(ShaderLanguage::TYPE_BOOL);
shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["RESTART_CUSTOM"] = constt(ShaderLanguage::TYPE_BOOL);
+ shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLIDED"] = constt(ShaderLanguage::TYPE_BOOL);
+ shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLISION_NORMAL"] = constt(ShaderLanguage::TYPE_VEC3);
+ shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["COLLISION_DEPTH"] = constt(ShaderLanguage::TYPE_FLOAT);
+ shader_modes[RS::SHADER_PARTICLES].functions["compute"].built_ins["ATTRACTOR_FORCE"] = constt(ShaderLanguage::TYPE_VEC3);
shader_modes[RS::SHADER_PARTICLES].functions["compute"].can_discard = false;
{
@@ -307,6 +315,7 @@ ShaderTypes::ShaderTypes() {
shader_modes[RS::SHADER_PARTICLES].functions["compute"].stage_functions["emit_particle"] = emit_vertex_func;
}
+ shader_modes[RS::SHADER_PARTICLES].modes.push_back("collision_use_scale");
shader_modes[RS::SHADER_PARTICLES].modes.push_back("disable_force");
shader_modes[RS::SHADER_PARTICLES].modes.push_back("disable_velocity");
shader_modes[RS::SHADER_PARTICLES].modes.push_back("keep_data");
@@ -347,6 +356,7 @@ ShaderTypes::ShaderTypes() {
shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["SKY_COORDS"] = constt(ShaderLanguage::TYPE_VEC2);
shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["HALF_RES_COLOR"] = constt(ShaderLanguage::TYPE_VEC4);
shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["QUARTER_RES_COLOR"] = constt(ShaderLanguage::TYPE_VEC4);
+ shader_modes[RS::SHADER_SKY].functions["fragment"].built_ins["FOG"] = ShaderLanguage::TYPE_VEC4;
shader_modes[RS::SHADER_SKY].modes.push_back("use_half_res_pass");
shader_modes[RS::SHADER_SKY].modes.push_back("use_quarter_res_pass");
diff --git a/servers/rendering_server.cpp b/servers/rendering_server.cpp
index 9ad19e4b38..d747f31318 100644
--- a/servers/rendering_server.cpp
+++ b/servers/rendering_server.cpp
@@ -30,7 +30,6 @@
#include "rendering_server.h"
-#include "core/method_bind_ext.gen.inc"
#include "core/project_settings.h"
RenderingServer *RenderingServer::singleton = nullptr;
@@ -1747,12 +1746,12 @@ void RenderingServer::_bind_methods() {
ClassDB::bind_method(D_METHOD("environment_set_bg_energy", "env", "energy"), &RenderingServer::environment_set_bg_energy);
ClassDB::bind_method(D_METHOD("environment_set_canvas_max_layer", "env", "max_layer"), &RenderingServer::environment_set_canvas_max_layer);
ClassDB::bind_method(D_METHOD("environment_set_ambient_light", "env", "color", "ambient", "energy", "sky_contibution", "reflection_source", "ao_color"), &RenderingServer::environment_set_ambient_light, DEFVAL(RS::ENV_AMBIENT_SOURCE_BG), DEFVAL(1.0), DEFVAL(0.0), DEFVAL(RS::ENV_REFLECTION_SOURCE_BG), DEFVAL(Color()));
- ClassDB::bind_method(D_METHOD("environment_set_glow", "env", "enable", "level_flags", "intensity", "strength", "mix", "bloom_threshold", "blend_mode", "hdr_bleed_threshold", "hdr_bleed_scale", "hdr_luminance_cap"), &RenderingServer::environment_set_glow);
+ ClassDB::bind_method(D_METHOD("environment_set_glow", "env", "enable", "levels", "intensity", "strength", "mix", "bloom_threshold", "blend_mode", "hdr_bleed_threshold", "hdr_bleed_scale", "hdr_luminance_cap"), &RenderingServer::environment_set_glow);
ClassDB::bind_method(D_METHOD("environment_set_tonemap", "env", "tone_mapper", "exposure", "white", "auto_exposure", "min_luminance", "max_luminance", "auto_exp_speed", "auto_exp_grey"), &RenderingServer::environment_set_tonemap);
ClassDB::bind_method(D_METHOD("environment_set_adjustment", "env", "enable", "brightness", "contrast", "saturation", "ramp"), &RenderingServer::environment_set_adjustment);
ClassDB::bind_method(D_METHOD("environment_set_ssr", "env", "enable", "max_steps", "fade_in", "fade_out", "depth_tolerance"), &RenderingServer::environment_set_ssr);
ClassDB::bind_method(D_METHOD("environment_set_ssao", "env", "enable", "radius", "intensity", "bias", "light_affect", "ao_channel_affect", "blur", "bilateral_sharpness"), &RenderingServer::environment_set_ssao);
- ClassDB::bind_method(D_METHOD("environment_set_fog", "env", "enable", "light_color", "light_energy", "sun_scatter", "density", "height", "height_density"), &RenderingServer::environment_set_fog);
+ ClassDB::bind_method(D_METHOD("environment_set_fog", "env", "enable", "light_color", "light_energy", "sun_scatter", "density", "height", "height_density", "aerial_perspective"), &RenderingServer::environment_set_fog);
ClassDB::bind_method(D_METHOD("scenario_create"), &RenderingServer::scenario_create);
ClassDB::bind_method(D_METHOD("scenario_set_debug", "scenario", "debug_mode"), &RenderingServer::scenario_set_debug);
@@ -2152,6 +2151,7 @@ void RenderingServer::_bind_methods() {
BIND_ENUM_CONSTANT(INSTANCE_MULTIMESH);
BIND_ENUM_CONSTANT(INSTANCE_IMMEDIATE);
BIND_ENUM_CONSTANT(INSTANCE_PARTICLES);
+ BIND_ENUM_CONSTANT(INSTANCE_PARTICLES_COLLISION);
BIND_ENUM_CONSTANT(INSTANCE_LIGHT);
BIND_ENUM_CONSTANT(INSTANCE_REFLECTION_PROBE);
BIND_ENUM_CONSTANT(INSTANCE_DECAL);
@@ -2327,11 +2327,11 @@ RenderingServer::RenderingServer() {
ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/size", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/size", PROPERTY_HINT_RANGE, "256,16384"));
GLOBAL_DEF("rendering/quality/directional_shadow/soft_shadow_quality", 2);
GLOBAL_DEF("rendering/quality/directional_shadow/soft_shadow_quality.mobile", 0);
- ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard(Fastest), Soft Low (Fast), Soft Medium (Average), Soft High (Slow), Soft Ultra (Slowest)"));
+ ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/directional_shadow/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/directional_shadow/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard (Fastest),Soft Low (Fast),Soft Medium (Average),Soft High (Slow),Soft Ultra (Slowest)"));
GLOBAL_DEF("rendering/quality/shadows/soft_shadow_quality", 2);
GLOBAL_DEF("rendering/quality/shadows/soft_shadow_quality.mobile", 0);
- ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/shadows/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/shadows/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard(Fastest), Soft Low (Fast), Soft Medium (Average), Soft High (Slow), Soft Ultra (Slowest)"));
+ ProjectSettings::get_singleton()->set_custom_property_info("rendering/quality/shadows/soft_shadow_quality", PropertyInfo(Variant::INT, "rendering/quality/shadows/soft_shadow_quality", PROPERTY_HINT_ENUM, "Hard (Fastest),Soft Low (Fast),Soft Medium (Average),Soft High (Slow),Soft Ultra (Slowest)"));
GLOBAL_DEF("rendering/quality/shadow_atlas/size", 4096);
GLOBAL_DEF("rendering/quality/shadow_atlas/size.mobile", 2048);
diff --git a/servers/rendering_server.h b/servers/rendering_server.h
index 7dae45f126..11c73c63d0 100644
--- a/servers/rendering_server.h
+++ b/servers/rendering_server.h
@@ -31,10 +31,10 @@
#ifndef RENDERING_SERVER_H
#define RENDERING_SERVER_H
+#include "core/class_db.h"
#include "core/image.h"
#include "core/math/geometry_3d.h"
#include "core/math/transform_2d.h"
-#include "core/object.h"
#include "core/rid.h"
#include "core/typed_array.h"
#include "core/variant.h"
@@ -578,6 +578,7 @@ public:
virtual void particles_set_process_material(RID p_particles, RID p_material) = 0;
virtual void particles_set_fixed_fps(RID p_particles, int p_fps) = 0;
virtual void particles_set_fractional_delta(RID p_particles, bool p_enable) = 0;
+ virtual void particles_set_collision_base_size(RID p_particles, float p_size) = 0;
virtual bool particles_is_inactive(RID p_particles) = 0;
virtual void particles_request_process(RID p_particles) = 0;
virtual void particles_restart(RID p_particles) = 0;
@@ -609,6 +610,43 @@ public:
virtual void particles_set_emission_transform(RID p_particles, const Transform &p_transform) = 0; //this is only used for 2D, in 3D it's automatic
+ /* PARTICLES COLLISION API */
+
+ virtual RID particles_collision_create() = 0;
+
+ enum ParticlesCollisionType {
+ PARTICLES_COLLISION_TYPE_SPHERE_ATTRACT,
+ PARTICLES_COLLISION_TYPE_BOX_ATTRACT,
+ PARTICLES_COLLISION_TYPE_VECTOR_FIELD_ATTRACT,
+ PARTICLES_COLLISION_TYPE_SPHERE_COLLIDE,
+ PARTICLES_COLLISION_TYPE_BOX_COLLIDE,
+ PARTICLES_COLLISION_TYPE_SDF_COLLIDE,
+ PARTICLES_COLLISION_TYPE_HEIGHTFIELD_COLLIDE,
+ };
+
+ virtual void particles_collision_set_collision_type(RID p_particles_collision, ParticlesCollisionType p_type) = 0;
+ virtual void particles_collision_set_cull_mask(RID p_particles_collision, uint32_t p_cull_mask) = 0;
+ virtual void particles_collision_set_sphere_radius(RID p_particles_collision, float p_radius) = 0; //for spheres
+ virtual void particles_collision_set_box_extents(RID p_particles_collision, const Vector3 &p_extents) = 0; //for non-spheres
+ virtual void particles_collision_set_attractor_strength(RID p_particles_collision, float p_strength) = 0;
+ virtual void particles_collision_set_attractor_directionality(RID p_particles_collision, float p_directionality) = 0;
+ virtual void particles_collision_set_attractor_attenuation(RID p_particles_collision, float p_curve) = 0;
+ virtual void particles_collision_set_field_texture(RID p_particles_collision, RID p_texture) = 0; //for SDF and vector field, heightfield is dynamic
+
+ virtual void particles_collision_height_field_update(RID p_particles_collision) = 0; //for SDF and vector field
+
+ enum ParticlesCollisionHeightfieldResolution { //longest axis resolution
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_256,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_512,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_1024,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_2048,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_4096,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_8192,
+ PARTICLES_COLLISION_HEIGHTFIELD_RESOLUTION_MAX,
+ };
+
+ virtual void particles_collision_set_height_field_resolution(RID p_particles_collision, ParticlesCollisionHeightfieldResolution p_resolution) = 0; //for SDF and vector field
+
/* CAMERA API */
virtual RID camera_create() = 0;
@@ -794,7 +832,7 @@ public:
ENV_GLOW_BLEND_MODE_MIX,
};
- virtual void environment_set_glow(RID p_env, bool p_enable, int p_level_flags, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0;
+ virtual void environment_set_glow(RID p_env, bool p_enable, Vector<float> p_levels, float p_intensity, float p_strength, float p_mix, float p_bloom_threshold, EnvironmentGlowBlendMode p_blend_mode, float p_hdr_bleed_threshold, float p_hdr_bleed_scale, float p_hdr_luminance_cap) = 0;
virtual void environment_glow_set_use_bicubic_upscale(bool p_enable) = 0;
virtual void environment_glow_set_use_high_quality(bool p_enable) = 0;
@@ -876,7 +914,7 @@ public:
virtual void environment_set_sdfgi_frames_to_converge(EnvironmentSDFGIFramesToConverge p_frames) = 0;
- virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density) = 0;
+ virtual void environment_set_fog(RID p_env, bool p_enable, const Color &p_light_color, float p_light_energy, float p_sun_scatter, float p_density, float p_height, float p_height_density, float p_aerial_perspective) = 0;
enum EnvVolumetricFogShadowFilter {
ENV_VOLUMETRIC_FOG_SHADOW_FILTER_DISABLED,
@@ -965,6 +1003,7 @@ public:
INSTANCE_MULTIMESH,
INSTANCE_IMMEDIATE,
INSTANCE_PARTICLES,
+ INSTANCE_PARTICLES_COLLISION,
INSTANCE_LIGHT,
INSTANCE_REFLECTION_PROBE,
INSTANCE_DECAL,
diff --git a/tests/test_command_queue.h b/tests/test_command_queue.h
new file mode 100644
index 0000000000..a66fd3c86e
--- /dev/null
+++ b/tests/test_command_queue.h
@@ -0,0 +1,482 @@
+/*************************************************************************/
+/* test_command_queue.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef TEST_COMMAND_QUEUE_H
+#define TEST_COMMAND_QUEUE_H
+
+#include "test_command_queue.h"
+
+#include "core/command_queue_mt.h"
+#include "core/os/mutex.h"
+#include "core/os/os.h"
+#include "core/os/semaphore.h"
+#include "core/os/thread.h"
+#include "core/project_settings.h"
+
+#if !defined(NO_THREADS)
+
+namespace TestCommandQueue {
+
+class ThreadWork {
+ Semaphore thread_sem;
+ Semaphore main_sem;
+ Mutex mut;
+ int threading_errors = 0;
+ enum State {
+ MAIN_START,
+ MAIN_DONE,
+ THREAD_START,
+ THREAD_DONE,
+ } state;
+
+public:
+ ThreadWork() {
+ mut.lock();
+ state = MAIN_START;
+ }
+ ~ThreadWork() {
+ CHECK_MESSAGE(threading_errors == 0, "threads did not lock/unlock correctly");
+ }
+ void thread_wait_for_work() {
+ thread_sem.wait();
+ mut.lock();
+ if (state != MAIN_DONE) {
+ threading_errors++;
+ }
+ state = THREAD_START;
+ }
+ void thread_done_work() {
+ if (state != THREAD_START) {
+ threading_errors++;
+ }
+ state = THREAD_DONE;
+ mut.unlock();
+ main_sem.post();
+ }
+
+ void main_wait_for_done() {
+ main_sem.wait();
+ mut.lock();
+ if (state != THREAD_DONE) {
+ threading_errors++;
+ }
+ state = MAIN_START;
+ }
+ void main_start_work() {
+ if (state != MAIN_START) {
+ threading_errors++;
+ }
+ state = MAIN_DONE;
+ mut.unlock();
+ thread_sem.post();
+ }
+};
+
+class SharedThreadState {
+public:
+ ThreadWork reader_threadwork;
+ ThreadWork writer_threadwork;
+
+ CommandQueueMT command_queue = CommandQueueMT(true);
+
+ enum TestMsgType {
+ TEST_MSG_FUNC1_TRANSFORM,
+ TEST_MSG_FUNC2_TRANSFORM_FLOAT,
+ TEST_MSG_FUNC3_TRANSFORMx6,
+ TEST_MSGSYNC_FUNC1_TRANSFORM,
+ TEST_MSGSYNC_FUNC2_TRANSFORM_FLOAT,
+ TEST_MSGRET_FUNC1_TRANSFORM,
+ TEST_MSGRET_FUNC2_TRANSFORM_FLOAT,
+ TEST_MSG_MAX
+ };
+
+ Vector<TestMsgType> message_types_to_write;
+ bool during_writing = false;
+ int message_count_to_read = 0;
+ bool exit_threads = false;
+
+ Thread *reader_thread = nullptr;
+ Thread *writer_thread = nullptr;
+
+ int func1_count = 0;
+
+ void func1(Transform t) {
+ func1_count++;
+ }
+ void func2(Transform t, float f) {
+ func1_count++;
+ }
+ void func3(Transform t1, Transform t2, Transform t3, Transform t4, Transform t5, Transform t6) {
+ func1_count++;
+ }
+ Transform func1r(Transform t) {
+ func1_count++;
+ return t;
+ }
+ Transform func2r(Transform t, float f) {
+ func1_count++;
+ return t;
+ }
+
+ void add_msg_to_write(TestMsgType type) {
+ message_types_to_write.push_back(type);
+ }
+
+ void reader_thread_loop() {
+ reader_threadwork.thread_wait_for_work();
+ while (!exit_threads) {
+ if (message_count_to_read < 0) {
+ command_queue.flush_all();
+ }
+ for (int i = 0; i < message_count_to_read; i++) {
+ command_queue.wait_and_flush_one();
+ }
+ message_count_to_read = 0;
+
+ reader_threadwork.thread_done_work();
+ reader_threadwork.thread_wait_for_work();
+ }
+ command_queue.flush_all();
+ reader_threadwork.thread_done_work();
+ }
+ static void static_reader_thread_loop(void *stsvoid) {
+ SharedThreadState *sts = static_cast<SharedThreadState *>(stsvoid);
+ sts->reader_thread_loop();
+ }
+
+ void writer_thread_loop() {
+ during_writing = false;
+ writer_threadwork.thread_wait_for_work();
+ while (!exit_threads) {
+ Transform tr;
+ Transform otr;
+ float f = 1;
+ during_writing = true;
+ for (int i = 0; i < message_types_to_write.size(); i++) {
+ TestMsgType msg_type = message_types_to_write[i];
+ switch (msg_type) {
+ case TEST_MSG_FUNC1_TRANSFORM:
+ command_queue.push(this, &SharedThreadState::func1, tr);
+ break;
+ case TEST_MSG_FUNC2_TRANSFORM_FLOAT:
+ command_queue.push(this, &SharedThreadState::func2, tr, f);
+ break;
+ case TEST_MSG_FUNC3_TRANSFORMx6:
+ command_queue.push(this, &SharedThreadState::func3, tr, tr, tr, tr, tr, tr);
+ break;
+ case TEST_MSGSYNC_FUNC1_TRANSFORM:
+ command_queue.push_and_sync(this, &SharedThreadState::func1, tr);
+ break;
+ case TEST_MSGSYNC_FUNC2_TRANSFORM_FLOAT:
+ command_queue.push_and_sync(this, &SharedThreadState::func2, tr, f);
+ break;
+ case TEST_MSGRET_FUNC1_TRANSFORM:
+ command_queue.push_and_ret(this, &SharedThreadState::func1r, tr, &otr);
+ break;
+ case TEST_MSGRET_FUNC2_TRANSFORM_FLOAT:
+ command_queue.push_and_ret(this, &SharedThreadState::func2r, tr, f, &otr);
+ break;
+ default:
+ break;
+ }
+ }
+ message_types_to_write.clear();
+ during_writing = false;
+
+ writer_threadwork.thread_done_work();
+ writer_threadwork.thread_wait_for_work();
+ }
+ writer_threadwork.thread_done_work();
+ }
+ static void static_writer_thread_loop(void *stsvoid) {
+ SharedThreadState *sts = static_cast<SharedThreadState *>(stsvoid);
+ sts->writer_thread_loop();
+ }
+
+ void init_threads() {
+ reader_thread = Thread::create(&SharedThreadState::static_reader_thread_loop, this);
+ writer_thread = Thread::create(&SharedThreadState::static_writer_thread_loop, this);
+ }
+ void destroy_threads() {
+ exit_threads = true;
+ reader_threadwork.main_start_work();
+ writer_threadwork.main_start_work();
+
+ Thread::wait_to_finish(reader_thread);
+ memdelete(reader_thread);
+ reader_thread = nullptr;
+ Thread::wait_to_finish(writer_thread);
+ memdelete(writer_thread);
+ writer_thread = nullptr;
+ }
+};
+
+TEST_CASE("[CommandQueue] Test Queue Basics") {
+ const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb";
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1);
+ SharedThreadState sts;
+ sts.init_threads();
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ sts.writer_threadwork.main_start_work();
+ sts.writer_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 0,
+ "Control: no messages read before reader has run.");
+
+ sts.message_count_to_read = 1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 1,
+ "Reader should have read one message");
+
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 1,
+ "Reader should have read no additional messages from flush_all");
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ sts.writer_threadwork.main_start_work();
+ sts.writer_threadwork.main_wait_for_done();
+
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 2,
+ "Reader should have read one additional message from flush_all");
+
+ sts.destroy_threads();
+
+ CHECK_MESSAGE(sts.func1_count == 2,
+ "Reader should have read no additional messages after join");
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING,
+ ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING));
+}
+
+TEST_CASE("[CommandQueue] Test Waiting at Queue Full") {
+ const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb";
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1);
+ SharedThreadState sts;
+ sts.init_threads();
+
+ int msgs_to_add = 24; // a queue of size 1kB fundamentally cannot fit 24 matrices.
+ for (int i = 0; i < msgs_to_add; i++) {
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ }
+ sts.writer_threadwork.main_start_work();
+ // If we call main_wait_for_done, we will deadlock. So instead...
+ sts.message_count_to_read = 1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 1,
+ "Reader should have read one message");
+ CHECK_MESSAGE(sts.during_writing,
+ "Writer thread should still be blocked on writing.");
+ sts.message_count_to_read = msgs_to_add - 3;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count >= msgs_to_add - 3,
+ "Reader should have read most messages");
+ sts.writer_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.during_writing == false,
+ "Writer thread should no longer be blocked on writing.");
+ sts.message_count_to_read = 2;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == msgs_to_add,
+ "Reader should have read all messages");
+
+ sts.destroy_threads();
+
+ CHECK_MESSAGE(sts.func1_count == msgs_to_add,
+ "Reader should have read no additional messages after join");
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING,
+ ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING));
+}
+
+TEST_CASE("[CommandQueue] Test Queue Wrapping to same spot.") {
+ const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb";
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1);
+ SharedThreadState sts;
+ sts.init_threads();
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ sts.writer_threadwork.main_start_work();
+ sts.writer_threadwork.main_wait_for_done();
+
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 3,
+ "Reader should have read at least three messages");
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.writer_threadwork.main_start_work();
+ sts.writer_threadwork.main_wait_for_done();
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.writer_threadwork.main_start_work();
+ OS::get_singleton()->delay_usec(1000);
+
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ OS::get_singleton()->delay_usec(1000);
+
+ sts.writer_threadwork.main_wait_for_done();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count >= 3,
+ "Reader should have read at least three messages");
+
+ sts.message_count_to_read = 6 - sts.func1_count;
+ sts.reader_threadwork.main_start_work();
+
+ // The following will fail immediately.
+ // The reason it hangs indefinitely in engine, is all subsequent calls to
+ // CommandQueue.wait_and_flush_one will also fail.
+ sts.reader_threadwork.main_wait_for_done();
+
+ // Because looping around uses an extra message, easiest to consume all.
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 6,
+ "Reader should have read both message sets");
+
+ sts.destroy_threads();
+
+ CHECK_MESSAGE(sts.func1_count == 6,
+ "Reader should have read no additional messages after join");
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING,
+ ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING));
+}
+
+TEST_CASE("[CommandQueue] Test Queue Lapping") {
+ const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb";
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1);
+ SharedThreadState sts;
+ sts.init_threads();
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC1_TRANSFORM);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.writer_threadwork.main_start_work();
+ sts.writer_threadwork.main_wait_for_done();
+
+ // We need to read an extra message so that it triggers the dealloc logic once.
+ // Otherwise, the queue will be considered full.
+ sts.message_count_to_read = 3;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ CHECK_MESSAGE(sts.func1_count == 3,
+ "Reader should have read first set of messages");
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC3_TRANSFORMx6);
+ sts.writer_threadwork.main_start_work();
+ // Don't wait for these, because the queue isn't big enough.
+ sts.writer_threadwork.main_wait_for_done();
+
+ sts.add_msg_to_write(SharedThreadState::TEST_MSG_FUNC2_TRANSFORM_FLOAT);
+ sts.writer_threadwork.main_start_work();
+ OS::get_singleton()->delay_usec(1000);
+
+ sts.message_count_to_read = 3;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+
+ sts.writer_threadwork.main_wait_for_done();
+
+ sts.message_count_to_read = -1;
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+
+ CHECK_MESSAGE(sts.func1_count == 6,
+ "Reader should have read rest of the messages after lapping writers.");
+
+ sts.destroy_threads();
+
+ CHECK_MESSAGE(sts.func1_count == 6,
+ "Reader should have read no additional messages after join");
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING,
+ ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING));
+}
+
+TEST_CASE("[Stress][CommandQueue] Stress test command queue") {
+ const char *COMMAND_QUEUE_SETTING = "memory/limits/command_queue/multithreading_queue_size_kb";
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING, 1);
+ SharedThreadState sts;
+ sts.init_threads();
+
+ RandomNumberGenerator rng;
+
+ rng.set_seed(1837267);
+
+ int msgs_to_add = 2048;
+
+ for (int i = 0; i < msgs_to_add; i++) {
+ // randi_range is inclusive, so allow any enum value except MAX.
+ sts.add_msg_to_write((SharedThreadState::TestMsgType)rng.randi_range(0, SharedThreadState::TEST_MSG_MAX - 1));
+ }
+ sts.writer_threadwork.main_start_work();
+
+ int max_loop_iters = msgs_to_add * 2;
+ int loop_iters = 0;
+ while (sts.func1_count < msgs_to_add && loop_iters < max_loop_iters) {
+ int remaining = (msgs_to_add - sts.func1_count);
+ sts.message_count_to_read = rng.randi_range(1, remaining < 128 ? remaining : 128);
+ if (loop_iters % 3 == 0) {
+ sts.message_count_to_read = -1;
+ }
+ sts.reader_threadwork.main_start_work();
+ sts.reader_threadwork.main_wait_for_done();
+ loop_iters++;
+ }
+ CHECK_MESSAGE(loop_iters < max_loop_iters,
+ "Reader needed too many iterations to read messages!");
+ sts.writer_threadwork.main_wait_for_done();
+
+ sts.destroy_threads();
+
+ CHECK_MESSAGE(sts.func1_count == msgs_to_add,
+ "Reader should have read no additional messages after join");
+ ProjectSettings::get_singleton()->set_setting(COMMAND_QUEUE_SETTING,
+ ProjectSettings::get_singleton()->property_get_revert(COMMAND_QUEUE_SETTING));
+}
+
+} // namespace TestCommandQueue
+
+#endif // !defined(NO_THREADS)
+
+#endif // TEST_COMMAND_QUEUE_H
diff --git a/tests/test_main.cpp b/tests/test_main.cpp
index f0dec22738..871c796513 100644
--- a/tests/test_main.cpp
+++ b/tests/test_main.cpp
@@ -36,11 +36,13 @@
#include "test_basis.h"
#include "test_class_db.h"
#include "test_color.h"
+#include "test_command_queue.h"
#include "test_expression.h"
#include "test_gradient.h"
#include "test_gui.h"
#include "test_list.h"
#include "test_math.h"
+#include "test_method_bind.h"
#include "test_oa_hash_map.h"
#include "test_ordered_hash_map.h"
#include "test_physics_2d.h"
diff --git a/tests/test_method_bind.h b/tests/test_method_bind.h
new file mode 100644
index 0000000000..f4004c2090
--- /dev/null
+++ b/tests/test_method_bind.h
@@ -0,0 +1,165 @@
+/*************************************************************************/
+/* test_method_bind.h */
+/*************************************************************************/
+/* This file is part of: */
+/* GODOT ENGINE */
+/* https://godotengine.org */
+/*************************************************************************/
+/* Copyright (c) 2007-2020 Juan Linietsky, Ariel Manzur. */
+/* Copyright (c) 2014-2020 Godot Engine contributors (cf. AUTHORS.md). */
+/* */
+/* Permission is hereby granted, free of charge, to any person obtaining */
+/* a copy of this software and associated documentation files (the */
+/* "Software"), to deal in the Software without restriction, including */
+/* without limitation the rights to use, copy, modify, merge, publish, */
+/* distribute, sublicense, and/or sell copies of the Software, and to */
+/* permit persons to whom the Software is furnished to do so, subject to */
+/* the following conditions: */
+/* */
+/* The above copyright notice and this permission notice shall be */
+/* included in all copies or substantial portions of the Software. */
+/* */
+/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */
+/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */
+/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.*/
+/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */
+/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */
+/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */
+/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */
+/*************************************************************************/
+
+#ifndef TEST_METHOD_BIND_H
+#define TEST_METHOD_BIND_H
+
+#include "core/class_db.h"
+
+#include "tests/test_macros.h"
+
+#include <inttypes.h>
+#include <stdio.h>
+#include <wchar.h>
+
+namespace TestMethodBind {
+
+class MethodBindTester : public Object {
+ GDCLASS(MethodBindTester, Object);
+
+public:
+ enum Test {
+ TEST_METHOD,
+ TEST_METHOD_ARGS,
+ TEST_METHODC,
+ TEST_METHODC_ARGS,
+ TEST_METHODR,
+ TEST_METHODR_ARGS,
+ TEST_METHODRC,
+ TEST_METHODRC_ARGS,
+ TEST_METHOD_DEFARGS,
+ TEST_MAX
+ };
+
+ int test_num = 0;
+
+ bool test_valid[TEST_MAX];
+
+ void test_method() {
+ test_valid[TEST_METHOD] = true;
+ }
+
+ void test_method_args(int p_arg) {
+ test_valid[TEST_METHOD_ARGS] = p_arg == test_num;
+ }
+
+ void test_methodc() {
+ test_valid[TEST_METHODC] = true;
+ }
+
+ void test_methodc_args(int p_arg) {
+ test_valid[TEST_METHODC_ARGS] = p_arg == test_num;
+ }
+
+ int test_methodr() {
+ test_valid[TEST_METHODR] = true; //temporary
+ return test_num;
+ }
+
+ int test_methodr_args(int p_arg) {
+ test_valid[TEST_METHODR_ARGS] = true; //temporary
+ return p_arg;
+ }
+
+ int test_methodrc() {
+ test_valid[TEST_METHODRC] = true; //temporary
+ return test_num;
+ }
+
+ int test_methodrc_args(int p_arg) {
+ test_valid[TEST_METHODRC_ARGS] = true; //temporary
+ return p_arg;
+ }
+
+ void test_method_default_args(int p_arg1, int p_arg2, int p_arg3, int p_arg4, int p_arg5) {
+ test_valid[TEST_METHOD_DEFARGS] = p_arg1 == 1 && p_arg2 == 2 && p_arg3 == 3 && p_arg4 == 4 && p_arg5 == 5; //temporary
+ }
+
+ static void _bind_methods() {
+ ClassDB::bind_method(D_METHOD("test_method"), &MethodBindTester::test_method);
+ ClassDB::bind_method(D_METHOD("test_method_args"), &MethodBindTester::test_method_args);
+ ClassDB::bind_method(D_METHOD("test_methodc"), &MethodBindTester::test_methodc);
+ ClassDB::bind_method(D_METHOD("test_methodc_args"), &MethodBindTester::test_methodc_args);
+ ClassDB::bind_method(D_METHOD("test_methodr"), &MethodBindTester::test_methodr);
+ ClassDB::bind_method(D_METHOD("test_methodr_args"), &MethodBindTester::test_methodr_args);
+ ClassDB::bind_method(D_METHOD("test_methodrc"), &MethodBindTester::test_methodrc);
+ ClassDB::bind_method(D_METHOD("test_methodrc_args"), &MethodBindTester::test_methodrc_args);
+ ClassDB::bind_method(D_METHOD("test_method_default_args"), &MethodBindTester::test_method_default_args, DEFVAL(9) /* wrong on purpose */, DEFVAL(4), DEFVAL(5));
+ }
+
+ virtual void run_tests() {
+ for (int i = 0; i < TEST_MAX; i++) {
+ test_valid[i] = false;
+ }
+ //regular
+ test_num = Math::rand();
+ call("test_method");
+ test_num = Math::rand();
+ call("test_method_args", test_num);
+ test_num = Math::rand();
+ call("test_methodc");
+ test_num = Math::rand();
+ call("test_methodc_args", test_num);
+ //return
+ test_num = Math::rand();
+ test_valid[TEST_METHODR] = int(call("test_methodr")) == test_num && test_valid[TEST_METHODR];
+ test_num = Math::rand();
+ test_valid[TEST_METHODR_ARGS] = int(call("test_methodr_args", test_num)) == test_num && test_valid[TEST_METHODR_ARGS];
+ test_num = Math::rand();
+ test_valid[TEST_METHODRC] = int(call("test_methodrc")) == test_num && test_valid[TEST_METHODRC];
+ test_num = Math::rand();
+ test_valid[TEST_METHODRC_ARGS] = int(call("test_methodrc_args", test_num)) == test_num && test_valid[TEST_METHODRC_ARGS];
+
+ call("test_method_default_args", 1, 2, 3, 4);
+ }
+};
+
+TEST_CASE("[MethodBind] check all method binds") {
+ MethodBindTester *mbt = memnew(MethodBindTester);
+
+ print_line("testing method bind");
+ mbt->run_tests();
+
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD_ARGS]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODC]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODC_ARGS]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODR]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODR_ARGS]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODRC]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHODRC_ARGS]);
+ CHECK(mbt->test_valid[MethodBindTester::TEST_METHOD_DEFARGS]);
+
+ memdelete(mbt);
+}
+
+} // namespace TestMethodBind
+
+#endif // TEST_METHOD_BIND_H