Merge pull request #54350 from akien-mga/clang-format-dont-align-operands

135 files changed, 1052 insertions, 1184 deletions

diff --git a/.clang-format b/.clang-format
index 9ddb19e57c..e011f060b7 100644
--- a/.clang-format
+++ b/.clang-format
@@ -12,7 +12,7 @@ AlignAfterOpenBracket: DontAlign
 # AlignConsecutiveBitFields: None
 # AlignConsecutiveDeclarations: None
 # AlignEscapedNewlines: Right
-# AlignOperands:   Align
+AlignOperands:   DontAlign
 AlignTrailingComments: false
 # AllowAllArgumentsOnNextLine: true
 # AllowAllConstructorInitializersOnNextLine: true
@@ -56,7 +56,7 @@ AllowShortFunctionsOnASingleLine: Inline
 # BreakBeforeBraces: Attach
 # BreakBeforeInheritanceComma: false
 # BreakInheritanceList: BeforeColon
-BreakBeforeTernaryOperators: false
+# BreakBeforeTernaryOperators: true
 # BreakConstructorInitializersBeforeComma: false
 BreakConstructorInitializers: AfterColon
 # BreakStringLiterals: true
diff --git a/core/input/input.cpp b/core/input/input.cpp
index c3b43a4274..12028efc56 100644
--- a/core/input/input.cpp
+++ b/core/input/input.cpp
@@ -164,10 +164,11 @@ void Input::_bind_methods() {
 
 void Input::get_argument_options(const StringName &p_function, int p_idx, List<String> *r_options) const {
 	String pf = p_function;
-	if (p_idx == 0 && (pf == "is_action_pressed" || pf == "action_press" || pf == "action_release" ||
-							  pf == "is_action_just_pressed" || pf == "is_action_just_released" ||
-							  pf == "get_action_strength" || pf == "get_action_raw_strength" ||
-							  pf == "get_axis" || pf == "get_vector")) {
+	if (p_idx == 0 &&
+			(pf == "is_action_pressed" || pf == "action_press" || pf == "action_release" ||
+					pf == "is_action_just_pressed" || pf == "is_action_just_released" ||
+					pf == "get_action_strength" || pf == "get_action_raw_strength" ||
+					pf == "get_axis" || pf == "get_vector")) {
 		List<PropertyInfo> pinfo;
 		ProjectSettings::get_singleton()->get_property_list(&pinfo);
 
@@ -315,11 +316,11 @@ Vector2 Input::get_vector(const StringName &p_negative_x, const StringName &p_po
 
 	if (p_deadzone < 0.0f) {
 		// If the deadzone isn't specified, get it from the average of the actions.
-		p_deadzone = (InputMap::get_singleton()->action_get_deadzone(p_positive_x) +
-							 InputMap::get_singleton()->action_get_deadzone(p_negative_x) +
-							 InputMap::get_singleton()->action_get_deadzone(p_positive_y) +
-							 InputMap::get_singleton()->action_get_deadzone(p_negative_y)) /
-					 4;
+		p_deadzone = 0.25 *
+				(InputMap::get_singleton()->action_get_deadzone(p_positive_x) +
+						InputMap::get_singleton()->action_get_deadzone(p_negative_x) +
+						InputMap::get_singleton()->action_get_deadzone(p_positive_y) +
+						InputMap::get_singleton()->action_get_deadzone(p_negative_y));
 	}
 
 	// Circular length limiting and deadzone.
diff --git a/core/input/input_event.cpp b/core/input/input_event.cpp
index c6448b1e44..af3190bb17 100644
--- a/core/input/input_event.cpp
+++ b/core/input/input_event.cpp
@@ -454,10 +454,10 @@ bool InputEventKey::is_match(const Ref<InputEvent> &p_event, bool p_exact_match)
 
 	if (keycode == 0) {
 		return physical_keycode == key->physical_keycode &&
-			   (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
+				(!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
 	} else {
 		return keycode == key->keycode &&
-			   (!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
+				(!p_exact_match || get_modifiers_mask() == key->get_modifiers_mask());
 	}
 }
 
@@ -616,7 +616,7 @@ bool InputEventMouseButton::is_match(const Ref<InputEvent> &p_event, bool p_exac
 	}
 
 	return button_index == mb->button_index &&
-		   (!p_exact_match || get_modifiers_mask() == mb->get_modifiers_mask());
+			(!p_exact_match || get_modifiers_mask() == mb->get_modifiers_mask());
 }
 
 static const char *_mouse_button_descriptions[9] = {
@@ -935,7 +935,7 @@ bool InputEventJoypadMotion::is_match(const Ref<InputEvent> &p_event, bool p_exa
 	}
 
 	return axis == jm->axis &&
-		   (!p_exact_match || ((axis_value < 0) == (jm->axis_value < 0)));
+			(!p_exact_match || ((axis_value < 0) == (jm->axis_value < 0)));
 }
 
 static const char *_joy_axis_descriptions[JOY_AXIS_MAX] = {
diff --git a/core/input/input_map.h b/core/input/input_map.h
index 8bef722089..0bf572ddca 100644
--- a/core/input/input_map.h
+++ b/core/input/input_map.h
@@ -41,8 +41,8 @@ class InputMap : public Object {
 
 public:
 	/**
-	* A special value used to signify that a given Action can be triggered by any device
-	*/
+	 * A special value used to signify that a given Action can be triggered by any device
+	 */
 	static int ALL_DEVICES;
 
 	struct Action {
diff --git a/core/io/image.h b/core/io/image.h
index 8f1b251ac3..d31a065aa7 100644
--- a/core/io/image.h
+++ b/core/io/image.h
@@ -41,7 +41,7 @@
  * Image storage class. This is used to store an image in user memory, as well as
  * providing some basic methods for image manipulation.
  * Images can be loaded from a file, or registered into the Render object as textures.
-*/
+ */
 
 class Image;
 
diff --git a/core/io/marshalls.h b/core/io/marshalls.h
index 05804d5a46..9ea060e48c 100644
--- a/core/io/marshalls.h
+++ b/core/io/marshalls.h
@@ -44,9 +44,9 @@ typedef uint32_t uintr_t;
 #endif
 
 /**
-  * Miscellaneous helpers for marshalling data types, and encoding
-  * in an endian independent way
-  */
+ * Miscellaneous helpers for marshalling data types, and encoding
+ * in an endian independent way
+ */
 
 union MarshallFloat {
 	uint32_t i; ///< int
diff --git a/core/math/a_star.cpp b/core/math/a_star.cpp
index d59dbf1ba8..1079da75ef 100644
--- a/core/math/a_star.cpp
+++ b/core/math/a_star.cpp
@@ -239,7 +239,7 @@ bool AStar::are_points_connected(int p_id, int p_with_id, bool bidirectional) co
 	const Set<Segment>::Element *element = segments.find(s);
 
 	return element != nullptr &&
-		   (bidirectional || (element->get().direction & s.direction) == s.direction);
+			(bidirectional || (element->get().direction & s.direction) == s.direction);
 }
 
 void AStar::clear() {
diff --git a/core/math/aabb.h b/core/math/aabb.h
index 97d92fbe37..c458e61475 100644
--- a/core/math/aabb.h
+++ b/core/math/aabb.h
@@ -200,7 +200,7 @@ Vector3 AABB::get_support(const Vector3 &p_normal) const {
 				   (p_normal.x > 0) ? half_extents.x : -half_extents.x,
 				   (p_normal.y > 0) ? half_extents.y : -half_extents.y,
 				   (p_normal.z > 0) ? half_extents.z : -half_extents.z) +
-		   ofs;
+			ofs;
 }
 
 Vector3 AABB::get_endpoint(int p_point) const {
diff --git a/core/math/basis.cpp b/core/math/basis.cpp
index 0030cb1144..3d893afb4d 100644
--- a/core/math/basis.cpp
+++ b/core/math/basis.cpp
@@ -58,8 +58,8 @@ void Basis::invert() {
 		cofac(1, 1, 2, 2), cofac(1, 2, 2, 0), cofac(1, 0, 2, 1)
 	};
 	real_t det = elements[0][0] * co[0] +
-				 elements[0][1] * co[1] +
-				 elements[0][2] * co[2];
+			elements[0][1] * co[1] +
+			elements[0][2] * co[2];
 #ifdef MATH_CHECKS
 	ERR_FAIL_COND(det == 0);
 #endif
@@ -288,10 +288,7 @@ Vector3 Basis::get_scale() const {
 	//
 	// The rotation part of this decomposition is returned by get_rotation* functions.
 	real_t det_sign = SGN(determinant());
-	return det_sign * Vector3(
-							  Vector3(elements[0][0], elements[1][0], elements[2][0]).length(),
-							  Vector3(elements[0][1], elements[1][1], elements[2][1]).length(),
-							  Vector3(elements[0][2], elements[1][2], elements[2][2]).length());
+	return det_sign * get_scale_abs();
 }
 
 // Decomposes a Basis into a rotation-reflection matrix (an element of the group O(3)) and a positive scaling matrix as B = O.S.
@@ -682,8 +679,8 @@ bool Basis::operator!=(const Basis &p_matrix) const {
 
 Basis::operator String() const {
 	return "[X: " + get_axis(0).operator String() +
-		   ", Y: " + get_axis(1).operator String() +
-		   ", Z: " + get_axis(2).operator String() + "]";
+			", Y: " + get_axis(1).operator String() +
+			", Z: " + get_axis(2).operator String() + "]";
 }
 
 Quaternion Basis::get_quaternion() const {
@@ -704,9 +701,9 @@ Quaternion Basis::get_quaternion() const {
 		temp[1] = ((m.elements[0][2] - m.elements[2][0]) * s);
 		temp[2] = ((m.elements[1][0] - m.elements[0][1]) * s);
 	} else {
-		int i = m.elements[0][0] < m.elements[1][1] ?
-						  (m.elements[1][1] < m.elements[2][2] ? 2 : 1) :
-						  (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
+		int i = m.elements[0][0] < m.elements[1][1]
+				? (m.elements[1][1] < m.elements[2][2] ? 2 : 1)
+				: (m.elements[0][0] < m.elements[2][2] ? 2 : 0);
 		int j = (i + 1) % 3;
 		int k = (i + 2) % 3;
 
diff --git a/core/math/basis.h b/core/math/basis.h
index 617d005f19..e2fdb95685 100644
--- a/core/math/basis.h
+++ b/core/math/basis.h
@@ -324,7 +324,7 @@ Vector3 Basis::xform_inv(const Vector3 &p_vector) const {
 
 real_t Basis::determinant() const {
 	return elements[0][0] * (elements[1][1] * elements[2][2] - elements[2][1] * elements[1][2]) -
-		   elements[1][0] * (elements[0][1] * elements[2][2] - elements[2][1] * elements[0][2]) +
-		   elements[2][0] * (elements[0][1] * elements[1][2] - elements[1][1] * elements[0][2]);
+			elements[1][0] * (elements[0][1] * elements[2][2] - elements[2][1] * elements[0][2]) +
+			elements[2][0] * (elements[0][1] * elements[1][2] - elements[1][1] * elements[0][2]);
 }
 #endif // BASIS_H
diff --git a/core/math/bvh_logic.inc b/core/math/bvh_logic.inc
index afab08f151..c65002a9fd 100644
--- a/core/math/bvh_logic.inc
+++ b/core/math/bvh_logic.inc
@@ -42,24 +42,24 @@ BVHABB_CLASS _logic_abb_merge(const BVHABB_CLASS &a, const BVHABB_CLASS &b) {
 
 //--------------------------------------------------------------------------------------------------
 /**
-@file	q3DynamicAABBTree.h
-@author	Randy Gaul
-@date	10/10/2014
-	Copyright (c) 2014 Randy Gaul http://www.randygaul.net
-	This software is provided 'as-is', without any express or implied
-	warranty. In no event will the authors be held liable for any damages
-	arising from the use of this software.
-	Permission is granted to anyone to use this software for any purpose,
-	including commercial applications, and to alter it and redistribute it
-	freely, subject to the following restrictions:
-	  1. The origin of this software must not be misrepresented; you must not
-	     claim that you wrote the original software. If you use this software
-	     in a product, an acknowledgment in the product documentation would be
-	     appreciated but is not required.
-	  2. Altered source versions must be plainly marked as such, and must not
-	     be misrepresented as being the original software.
-	  3. This notice may not be removed or altered from any source distribution.
-*/
+ * @file	q3DynamicAABBTree.h
+ * @author	Randy Gaul
+ * @date	10/10/2014
+ *  Copyright (c) 2014 Randy Gaul http://www.randygaul.net
+ *  This software is provided 'as-is', without any express or implied
+ *  warranty. In no event will the authors be held liable for any damages
+ *  arising from the use of this software.
+ *  Permission is granted to anyone to use this software for any purpose,
+ *  including commercial applications, and to alter it and redistribute it
+ *  freely, subject to the following restrictions:
+ *    1. The origin of this software must not be misrepresented; you must not
+ *       claim that you wrote the original software. If you use this software
+ *       in a product, an acknowledgment in the product documentation would be
+ *       appreciated but is not required.
+ *    2. Altered source versions must be plainly marked as such, and must not
+ *       be misrepresented as being the original software.
+ *    3. This notice may not be removed or altered from any source distribution.
+ */
 //--------------------------------------------------------------------------------------------------
 
 // This function is based on the 'Balance' function from Randy Gaul's qu3e
@@ -67,7 +67,7 @@ BVHABB_CLASS _logic_abb_merge(const BVHABB_CLASS &a, const BVHABB_CLASS &b) {
 // It is MODIFIED from qu3e version.
 // This is the only function used (and _logic_abb_merge helper function).
 int32_t _logic_balance(int32_t iA, uint32_t p_tree_id) {
-	//	return iA; // uncomment this to bypass balance
+	//return iA; // uncomment this to bypass balance
 
 	TNode *A = &_nodes[iA];
 
@@ -75,12 +75,12 @@ int32_t _logic_balance(int32_t iA, uint32_t p_tree_id) {
 		return iA;
 	}
 
-	/*      A
-	      /   \
-	     B     C
-	    / \   / \
-	   D   E F   G
-	*/
+	/*       A
+	 *     /   \
+	 *    B     C
+	 *   / \   / \
+	 *  D   E F   G
+	 */
 
 	CRASH_COND(A->num_children != 2);
 	int32_t iB = A->children[0];
diff --git a/core/math/camera_matrix.cpp b/core/math/camera_matrix.cpp
index 8066a59281..48984c4d5b 100644
--- a/core/math/camera_matrix.cpp
+++ b/core/math/camera_matrix.cpp
@@ -35,17 +35,17 @@
 
 float CameraMatrix::determinant() const {
 	return matrix[0][3] * matrix[1][2] * matrix[2][1] * matrix[3][0] - matrix[0][2] * matrix[1][3] * matrix[2][1] * matrix[3][0] -
-		   matrix[0][3] * matrix[1][1] * matrix[2][2] * matrix[3][0] + matrix[0][1] * matrix[1][3] * matrix[2][2] * matrix[3][0] +
-		   matrix[0][2] * matrix[1][1] * matrix[2][3] * matrix[3][0] - matrix[0][1] * matrix[1][2] * matrix[2][3] * matrix[3][0] -
-		   matrix[0][3] * matrix[1][2] * matrix[2][0] * matrix[3][1] + matrix[0][2] * matrix[1][3] * matrix[2][0] * matrix[3][1] +
-		   matrix[0][3] * matrix[1][0] * matrix[2][2] * matrix[3][1] - matrix[0][0] * matrix[1][3] * matrix[2][2] * matrix[3][1] -
-		   matrix[0][2] * matrix[1][0] * matrix[2][3] * matrix[3][1] + matrix[0][0] * matrix[1][2] * matrix[2][3] * matrix[3][1] +
-		   matrix[0][3] * matrix[1][1] * matrix[2][0] * matrix[3][2] - matrix[0][1] * matrix[1][3] * matrix[2][0] * matrix[3][2] -
-		   matrix[0][3] * matrix[1][0] * matrix[2][1] * matrix[3][2] + matrix[0][0] * matrix[1][3] * matrix[2][1] * matrix[3][2] +
-		   matrix[0][1] * matrix[1][0] * matrix[2][3] * matrix[3][2] - matrix[0][0] * matrix[1][1] * matrix[2][3] * matrix[3][2] -
-		   matrix[0][2] * matrix[1][1] * matrix[2][0] * matrix[3][3] + matrix[0][1] * matrix[1][2] * matrix[2][0] * matrix[3][3] +
-		   matrix[0][2] * matrix[1][0] * matrix[2][1] * matrix[3][3] - matrix[0][0] * matrix[1][2] * matrix[2][1] * matrix[3][3] -
-		   matrix[0][1] * matrix[1][0] * matrix[2][2] * matrix[3][3] + matrix[0][0] * matrix[1][1] * matrix[2][2] * matrix[3][3];
+			matrix[0][3] * matrix[1][1] * matrix[2][2] * matrix[3][0] + matrix[0][1] * matrix[1][3] * matrix[2][2] * matrix[3][0] +
+			matrix[0][2] * matrix[1][1] * matrix[2][3] * matrix[3][0] - matrix[0][1] * matrix[1][2] * matrix[2][3] * matrix[3][0] -
+			matrix[0][3] * matrix[1][2] * matrix[2][0] * matrix[3][1] + matrix[0][2] * matrix[1][3] * matrix[2][0] * matrix[3][1] +
+			matrix[0][3] * matrix[1][0] * matrix[2][2] * matrix[3][1] - matrix[0][0] * matrix[1][3] * matrix[2][2] * matrix[3][1] -
+			matrix[0][2] * matrix[1][0] * matrix[2][3] * matrix[3][1] + matrix[0][0] * matrix[1][2] * matrix[2][3] * matrix[3][1] +
+			matrix[0][3] * matrix[1][1] * matrix[2][0] * matrix[3][2] - matrix[0][1] * matrix[1][3] * matrix[2][0] * matrix[3][2] -
+			matrix[0][3] * matrix[1][0] * matrix[2][1] * matrix[3][2] + matrix[0][0] * matrix[1][3] * matrix[2][1] * matrix[3][2] +
+			matrix[0][1] * matrix[1][0] * matrix[2][3] * matrix[3][2] - matrix[0][0] * matrix[1][1] * matrix[2][3] * matrix[3][2] -
+			matrix[0][2] * matrix[1][1] * matrix[2][0] * matrix[3][3] + matrix[0][1] * matrix[1][2] * matrix[2][0] * matrix[3][3] +
+			matrix[0][2] * matrix[1][0] * matrix[2][1] * matrix[3][3] - matrix[0][0] * matrix[1][2] * matrix[2][1] * matrix[3][3] -
+			matrix[0][1] * matrix[1][0] * matrix[2][2] * matrix[3][3] + matrix[0][0] * matrix[1][1] * matrix[2][2] * matrix[3][3];
 }
 
 void CameraMatrix::set_identity() {
diff --git a/core/math/convex_hull.cpp b/core/math/convex_hull.cpp
index 684814b1ae..f6560f1bea 100644
--- a/core/math/convex_hull.cpp
+++ b/core/math/convex_hull.cpp
@@ -265,8 +265,7 @@ public:
 		}
 
 		int32_t get_sign() const {
-			return ((int64_t)high < 0) ? -1 : (high || low) ? 1 :
-																0;
+			return ((int64_t)high < 0) ? -1 : ((high || low) ? 1 : 0);
 		}
 
 		bool operator<(const Int128 &b) const {
@@ -735,8 +734,6 @@ int32_t ConvexHullInternal::Rational64::compare(const Rational64 &b) const {
 		return 0;
 	}
 
-	//	return (numerator * b.denominator > b.numerator * denominator) ? sign : (numerator * b.denominator < b.numerator * denominator) ? -sign : 0;
-
 #ifdef USE_X86_64_ASM
 
 	int32_t result;
@@ -757,10 +754,9 @@ int32_t ConvexHullInternal::Rational64::compare(const Rational64 &b) const {
 			: "=&b"(result), [tmp] "=&r"(tmp), "=a"(dummy)
 			: "a"(denominator), [bn] "g"(b.numerator), [tn] "g"(numerator), [bd] "g"(b.denominator)
 			: "%rdx", "cc");
-	return result ? result ^ sign // if sign is +1, only bit 0 of result is inverted, which does not change the sign of result (and cannot result in zero)
-					// if sign is -1, all bits of result are inverted, which changes the sign of result (and again cannot result in zero)
-					:
-					  0;
+	// if sign is +1, only bit 0 of result is inverted, which does not change the sign of result (and cannot result in zero)
+	// if sign is -1, all bits of result are inverted, which changes the sign of result (and again cannot result in zero)
+	return result ? result ^ sign : 0;
 
 #else
 
@@ -793,8 +789,7 @@ int32_t ConvexHullInternal::Rational128::compare(const Rational128 &b) const {
 int32_t ConvexHullInternal::Rational128::compare(int64_t b) const {
 	if (is_int_64) {
 		int64_t a = sign * (int64_t)numerator.low;
-		return (a > b) ? 1 : (a < b) ? -1 :
-										 0;
+		return (a > b) ? 1 : ((a < b) ? -1 : 0);
 	}
 	if (b > 0) {
 		if (sign <= 0) {
@@ -1446,8 +1441,7 @@ void ConvexHullInternal::merge(IntermediateHull &p_h0, IntermediateHull &p_h1) {
 			c1->edges = e;
 			return;
 		} else {
-			int32_t cmp = !min0 ? 1 : !min1 ? -1 :
-												min_cot0.compare(min_cot1);
+			int32_t cmp = !min0 ? 1 : (!min1 ? -1 : min_cot0.compare(min_cot1));
 #ifdef DEBUG_CONVEX_HULL
 			printf("    -> Result %d\n", cmp);
 #endif
diff --git a/core/math/face3.h b/core/math/face3.h
index 9e9026e54e..0a8c1c6041 100644
--- a/core/math/face3.h
+++ b/core/math/face3.h
@@ -48,13 +48,13 @@ public:
 	Vector3 vertex[3];
 
 	/**
-         *
-         * @param p_plane plane used to split the face
-         * @param p_res array of at least 3 faces, amount used in function return
-         * @param p_is_point_over array of at least 3 booleans, determining which face is over the plane, amount used in function return
-         * @param _epsilon constant used for numerical error rounding, to add "thickness" to the plane (so coplanar points can happen)
-         * @return amount of faces generated by the split, either 0 (means no split possible), 2 or 3
-         */
+	 *
+	 * @param p_plane plane used to split the face
+	 * @param p_res array of at least 3 faces, amount used in function return
+	 * @param p_is_point_over array of at least 3 booleans, determining which face is over the plane, amount used in function return
+	 * @param _epsilon constant used for numerical error rounding, to add "thickness" to the plane (so coplanar points can happen)
+	 * @return amount of faces generated by the split, either 0 (means no split possible), 2 or 3
+	 */
 
 	int split_by_plane(const Plane &p_plane, Face3 *p_res, bool *p_is_point_over) const;
 
diff --git a/core/math/math_defs.h b/core/math/math_defs.h
index c3a8f910c0..900e90a598 100644
--- a/core/math/math_defs.h
+++ b/core/math/math_defs.h
@@ -116,10 +116,10 @@ enum Corner {
 };
 
 /**
-  * The "Real" type is an abstract type used for real numbers, such as 1.5,
-  * in contrast to integer numbers. Precision can be controlled with the
-  * presence or absence of the REAL_T_IS_DOUBLE define.
-  */
+ * The "Real" type is an abstract type used for real numbers, such as 1.5,
+ * in contrast to integer numbers. Precision can be controlled with the
+ * presence or absence of the REAL_T_IS_DOUBLE define.
+ */
 #ifdef REAL_T_IS_DOUBLE
 typedef double real_t;
 #else
diff --git a/core/math/math_funcs.h b/core/math/math_funcs.h
index 4e4f566517..baff10af98 100644
--- a/core/math/math_funcs.h
+++ b/core/math/math_funcs.h
@@ -159,7 +159,7 @@ public:
 		} ieee754;
 		ieee754.f = p_val;
 		return ((unsigned)(ieee754.u >> 32) & 0x7fffffff) == 0x7ff00000 &&
-			   ((unsigned)ieee754.u == 0);
+				((unsigned)ieee754.u == 0);
 #else
 		return isinf(p_val);
 #endif
@@ -461,7 +461,7 @@ public:
 				mantissa = 0;
 			}
 			hf = (((uint16_t)sign) << 15) | (uint16_t)((0x1F << 10)) |
-				 (uint16_t)(mantissa >> 13);
+					(uint16_t)(mantissa >> 13);
 		}
 		// check if exponent is <= -15
 		else if (exp <= 0x38000000) {
@@ -474,8 +474,8 @@ public:
 			hf = 0; //denormals do not work for 3D, convert to zero
 		} else {
 			hf = (((uint16_t)sign) << 15) |
-				 (uint16_t)((exp - 0x38000000) >> 13) |
-				 (uint16_t)(mantissa >> 13);
+					(uint16_t)((exp - 0x38000000) >> 13) |
+					(uint16_t)(mantissa >> 13);
 		}
 
 		return hf;
diff --git a/core/math/plane.cpp b/core/math/plane.cpp
index 3c78b55b90..59f7918258 100644
--- a/core/math/plane.cpp
+++ b/core/math/plane.cpp
@@ -88,7 +88,7 @@ bool Plane::intersect_3(const Plane &p_plane1, const Plane &p_plane2, Vector3 *r
 		*r_result = ((vec3_cross(normal1, normal2) * p_plane0.d) +
 							(vec3_cross(normal2, normal0) * p_plane1.d) +
 							(vec3_cross(normal0, normal1) * p_plane2.d)) /
-					denom;
+				denom;
 	}
 
 	return true;
diff --git a/core/math/rect2.h b/core/math/rect2.h
index 2557959fa2..26e202589d 100644
--- a/core/math/rect2.h
+++ b/core/math/rect2.h
@@ -118,8 +118,8 @@ struct Rect2 {
 
 	inline bool encloses(const Rect2 &p_rect) const {
 		return (p_rect.position.x >= position.x) && (p_rect.position.y >= position.y) &&
-			   ((p_rect.position.x + p_rect.size.x) <= (position.x + size.x)) &&
-			   ((p_rect.position.y + p_rect.size.y) <= (position.y + size.y));
+				((p_rect.position.x + p_rect.size.x) <= (position.x + size.x)) &&
+				((p_rect.position.y + p_rect.size.y) <= (position.y + size.y));
 	}
 
 	_FORCE_INLINE_ bool has_no_area() const {
@@ -257,7 +257,7 @@ struct Rect2 {
 		return Vector2(
 					   (p_normal.x > 0) ? -half_extents.x : half_extents.x,
 					   (p_normal.y > 0) ? -half_extents.y : half_extents.y) +
-			   ofs;
+				ofs;
 	}
 
 	_FORCE_INLINE_ bool intersects_filled_polygon(const Vector2 *p_points, int p_point_count) const {
@@ -367,8 +367,8 @@ struct Rect2i {
 
 	inline bool encloses(const Rect2i &p_rect) const {
 		return (p_rect.position.x >= position.x) && (p_rect.position.y >= position.y) &&
-			   ((p_rect.position.x + p_rect.size.x) < (position.x + size.x)) &&
-			   ((p_rect.position.y + p_rect.size.y) < (position.y + size.y));
+				((p_rect.position.x + p_rect.size.x) < (position.x + size.x)) &&
+				((p_rect.position.y + p_rect.size.y) < (position.y + size.y));
 	}
 
 	_FORCE_INLINE_ bool has_no_area() const {
diff --git a/core/math/transform_2d.cpp b/core/math/transform_2d.cpp
index 496a557844..df43c605f9 100644
--- a/core/math/transform_2d.cpp
+++ b/core/math/transform_2d.cpp
@@ -298,6 +298,6 @@ Transform2D Transform2D::operator*(const real_t p_val) const {
 
 Transform2D::operator String() const {
 	return "[X: " + elements[0].operator String() +
-		   ", Y: " + elements[1].operator String() +
-		   ", O: " + elements[2].operator String() + "]";
+			", Y: " + elements[1].operator String() +
+			", O: " + elements[2].operator String() + "]";
 }
diff --git a/core/math/transform_2d.h b/core/math/transform_2d.h
index 6ed3af2ba7..8a0e876d96 100644
--- a/core/math/transform_2d.h
+++ b/core/math/transform_2d.h
@@ -164,7 +164,7 @@ Vector2 Transform2D::xform(const Vector2 &p_vec) const {
 	return Vector2(
 				   tdotx(p_vec),
 				   tdoty(p_vec)) +
-		   elements[2];
+			elements[2];
 }
 
 Vector2 Transform2D::xform_inv(const Vector2 &p_vec) const {
diff --git a/core/math/transform_3d.cpp b/core/math/transform_3d.cpp
index 4f4943c8ef..78ef117443 100644
--- a/core/math/transform_3d.cpp
+++ b/core/math/transform_3d.cpp
@@ -175,9 +175,9 @@ Transform3D Transform3D::operator*(const real_t p_val) const {
 
 Transform3D::operator String() const {
 	return "[X: " + basis.get_axis(0).operator String() +
-		   ", Y: " + basis.get_axis(1).operator String() +
-		   ", Z: " + basis.get_axis(2).operator String() +
-		   ", O: " + origin.operator String() + "]";
+			", Y: " + basis.get_axis(1).operator String() +
+			", Z: " + basis.get_axis(2).operator String() +
+			", O: " + origin.operator String() + "]";
 }
 
 Transform3D::Transform3D(const Basis &p_basis, const Vector3 &p_origin) :
diff --git a/core/math/triangulate.cpp b/core/math/triangulate.cpp
index fa1588dbc5..28f1d96b14 100644
--- a/core/math/triangulate.cpp
+++ b/core/math/triangulate.cpp
@@ -42,18 +42,13 @@ real_t Triangulate::get_area(const Vector<Vector2> &contour) {
 	return A * 0.5;
 }
 
-/*
-     is_inside_triangle decides if a point P is Inside of the triangle
-     defined by A, B, C.
-   */
-
+/* `is_inside_triangle` decides if a point P is inside the triangle
+ * defined by A, B, C. */
 bool Triangulate::is_inside_triangle(real_t Ax, real_t Ay,
 		real_t Bx, real_t By,
 		real_t Cx, real_t Cy,
 		real_t Px, real_t Py,
-		bool include_edges)
-
-{
+		bool include_edges) {
 	real_t ax, ay, bx, by, cx, cy, apx, apy, bpx, bpy, cpx, cpy;
 	real_t cCROSSap, bCROSScp, aCROSSbp;
 
diff --git a/core/math/vector2.cpp b/core/math/vector2.cpp
index 16e43d7d06..6259bdead0 100644
--- a/core/math/vector2.cpp
+++ b/core/math/vector2.cpp
@@ -160,10 +160,11 @@ Vector2 Vector2::cubic_interpolate(const Vector2 &p_b, const Vector2 &p_pre_a, c
 	real_t t3 = t2 * t;
 
 	Vector2 out;
-	out = 0.5 * ((p1 * 2.0) +
-						(-p0 + p2) * t +
-						(2.0 * p0 - 5.0 * p1 + 4 * p2 - p3) * t2 +
-						(-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
+	out = 0.5 *
+			((p1 * 2.0) +
+					(-p0 + p2) * t +
+					(2.0 * p0 - 5.0 * p1 + 4 * p2 - p3) * t2 +
+					(-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
 	return out;
 }
 
diff --git a/core/math/vector3.cpp b/core/math/vector3.cpp
index fa212c178a..42e3da0b27 100644
--- a/core/math/vector3.cpp
+++ b/core/math/vector3.cpp
@@ -93,10 +93,11 @@ Vector3 Vector3::cubic_interpolate(const Vector3 &p_b, const Vector3 &p_pre_a, c
 	real_t t3 = t2 * t;
 
 	Vector3 out;
-	out = 0.5 * ((p1 * 2.0) +
-						(-p0 + p2) * t +
-						(2.0 * p0 - 5.0 * p1 + 4.0 * p2 - p3) * t2 +
-						(-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
+	out = 0.5 *
+			((p1 * 2.0) +
+					(-p0 + p2) * t +
+					(2.0 * p0 - 5.0 * p1 + 4.0 * p2 - p3) * t2 +
+					(-p0 + 3.0 * p1 - 3.0 * p2 + p3) * t3);
 	return out;
 }
 
diff --git a/core/object/object.cpp b/core/object/object.cpp
index b5797a4633..e7d8b0e543 100644
--- a/core/object/object.cpp
+++ b/core/object/object.cpp
@@ -1398,7 +1398,7 @@ void Object::_disconnect(const StringName &p_signal, const Callable &p_callable,
 	SignalData *s = signal_map.getptr(p_signal);
 	if (!s) {
 		bool signal_is_valid = ClassDB::has_signal(get_class_name(), p_signal) ||
-							   (!script.is_null() && Ref<Script>(script)->has_script_signal(p_signal));
+				(!script.is_null() && Ref<Script>(script)->has_script_signal(p_signal));
 		ERR_FAIL_COND_MSG(signal_is_valid, "Attempt to disconnect a nonexistent connection from '" + to_string() + "'. Signal: '" + p_signal + "', callable: '" + p_callable + "'.");
 	}
 	ERR_FAIL_COND_MSG(!s, vformat("Disconnecting nonexistent signal '%s' in %s.", p_signal, to_string()));
diff --git a/core/string/translation.cpp b/core/string/translation.cpp
index cf61467d08..6ff31a4a02 100644
--- a/core/string/translation.cpp
+++ b/core/string/translation.cpp
@@ -1563,8 +1563,8 @@ const char32_t *TranslationServer::get_accented_version(char32_t p_character) co
 
 bool TranslationServer::is_placeholder(String &p_message, int p_index) const {
 	return p_message[p_index] == '%' && p_index < p_message.size() - 1 &&
-		   (p_message[p_index + 1] == 's' || p_message[p_index + 1] == 'c' || p_message[p_index + 1] == 'd' ||
-				   p_message[p_index + 1] == 'o' || p_message[p_index + 1] == 'x' || p_message[p_index + 1] == 'X' || p_message[p_index + 1] == 'f');
+			(p_message[p_index + 1] == 's' || p_message[p_index + 1] == 'c' || p_message[p_index + 1] == 'd' ||
+					p_message[p_index + 1] == 'o' || p_message[p_index + 1] == 'x' || p_message[p_index + 1] == 'X' || p_message[p_index + 1] == 'f');
 }
 
 void TranslationServer::_bind_methods() {
diff --git a/core/string/ustring.cpp b/core/string/ustring.cpp
index 397743fb6e..8d6da31cf3 100644
--- a/core/string/ustring.cpp
+++ b/core/string/ustring.cpp
@@ -2317,28 +2317,33 @@ bool String::is_numeric() const {
 }
 
 template <class C>
-static double built_in_strtod(const C *string, /* A decimal ASCII floating-point number,
-				 * optionally preceded by white space. Must
-				 * have form "-I.FE-X", where I is the integer
-				 * part of the mantissa, F is the fractional
-				 * part of the mantissa, and X is the
-				 * exponent. Either of the signs may be "+",
-				 * "-", or omitted. Either I or F may be
-				 * omitted, or both. The decimal point isn't
-				 * necessary unless F is present. The "E" may
-				 * actually be an "e". E and X may both be
-				 * omitted (but not just one). */
-		C **endPtr = nullptr) /* If non-nullptr, store terminating Cacter's
-				 * address here. */
-{
-	static const int maxExponent = 511; /* Largest possible base 10 exponent.  Any
-					 * exponent larger than this will already
-					 * produce underflow or overflow, so there's
-					 * no need to worry about additional digits.
-					 */
-	static const double powersOf10[] = { /* Table giving binary powers of 10.  Entry */
-		10., /* is 10^2^i.  Used to convert decimal */
-		100., /* exponents into floating-point numbers. */
+static double built_in_strtod(
+		/* A decimal ASCII floating-point number,
+		 * optionally preceded by white space. Must
+		 * have form "-I.FE-X", where I is the integer
+		 * part of the mantissa, F is the fractional
+		 * part of the mantissa, and X is the
+		 * exponent. Either of the signs may be "+",
+		 * "-", or omitted. Either I or F may be
+		 * omitted, or both. The decimal point isn't
+		 * necessary unless F is present. The "E" may
+		 * actually be an "e". E and X may both be
+		 * omitted (but not just one). */
+		const C *string,
+		/* If non-nullptr, store terminating Cacter's
+		 * address here. */
+		C **endPtr = nullptr) {
+	/* Largest possible base 10 exponent. Any
+	 * exponent larger than this will already
+	 * produce underflow or overflow, so there's
+	 * no need to worry about additional digits. */
+	static const int maxExponent = 511;
+	/* Table giving binary powers of 10. Entry
+	 * is 10^2^i. Used to convert decimal
+	 * exponents into floating-point numbers. */
+	static const double powersOf10[] = {
+		10.,
+		100.,
 		1.0e4,
 		1.0e8,
 		1.0e16,
@@ -2353,25 +2358,28 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
 	const double *d;
 	const C *p;
 	int c;
-	int exp = 0; /* Exponent read from "EX" field. */
-	int fracExp = 0; /* Exponent that derives from the fractional
-				 * part. Under normal circumstances, it is
-				 * the negative of the number of digits in F.
-				 * However, if I is very long, the last digits
-				 * of I get dropped (otherwise a long I with a
-				 * large negative exponent could cause an
-				 * unnecessary overflow on I alone). In this
-				 * case, fracExp is incremented one for each
-				 * dropped digit. */
-	int mantSize; /* Number of digits in mantissa. */
-	int decPt; /* Number of mantissa digits BEFORE decimal
-				 * point. */
-	const C *pExp; /* Temporarily holds location of exponent in
-				 * string. */
+	/* Exponent read from "EX" field. */
+	int exp = 0;
+	/* Exponent that derives from the fractional
+	 * part. Under normal circumstances, it is
+	 * the negative of the number of digits in F.
+	 * However, if I is very long, the last digits
+	 * of I get dropped (otherwise a long I with a
+	 * large negative exponent could cause an
+	 * unnecessary overflow on I alone). In this
+	 * case, fracExp is incremented one for each
+	 * dropped digit. */
+	int fracExp = 0;
+	/* Number of digits in mantissa. */
+	int mantSize;
+	/* Number of mantissa digits BEFORE decimal point. */
+	int decPt;
+	/* Temporarily holds location of exponent in string. */
+	const C *pExp;
 
 	/*
-     * Strip off leading blanks and check for a sign.
-     */
+	 * Strip off leading blanks and check for a sign.
+	 */
 
 	p = string;
 	while (*p == ' ' || *p == '\t' || *p == '\n') {
@@ -2388,9 +2396,9 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
 	}
 
 	/*
-     * Count the number of digits in the mantissa (including the decimal
-     * point), and also locate the decimal point.
-     */
+	 * Count the number of digits in the mantissa (including the decimal
+	 * point), and also locate the decimal point.
+	 */
 
 	decPt = -1;
 	for (mantSize = 0;; mantSize += 1) {
@@ -2405,11 +2413,11 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
 	}
 
 	/*
-     * Now suck up the digits in the mantissa. Use two integers to collect 9
-     * digits each (this is faster than using floating-point). If the mantissa
-     * has more than 18 digits, ignore the extras, since they can't affect the
-     * value anyway.
-     */
+	 * Now suck up the digits in the mantissa. Use two integers to collect 9
+	 * digits each (this is faster than using floating-point). If the mantissa
+	 * has more than 18 digits, ignore the extras, since they can't affect the
+	 * value anyway.
+	 */
 
 	pExp = p;
 	p -= mantSize;
@@ -2455,8 +2463,8 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
 	}
 
 	/*
-     * Skim off the exponent.
-     */
+	 * Skim off the exponent.
+	 */
 
 	p = pExp;
 	if ((*p == 'E') || (*p == 'e')) {
@@ -2486,10 +2494,10 @@ static double built_in_strtod(const C *string, /* A decimal ASCII floating-point
 	}
 
 	/*
-     * Generate a floating-point number that represents the exponent. Do this
-     * by processing the exponent one bit at a time to combine many powers of
-     * 2 of 10. Then combine the exponent with the fraction.
-     */
+	 * Generate a floating-point number that represents the exponent. Do this
+	 * by processing the exponent one bit at a time to combine many powers of
+	 * 2 of 10. Then combine the exponent with the fraction.
+	 */
 
 	if (exp < 0) {
 		expSign = true;
diff --git a/core/templates/hash_map.h b/core/templates/hash_map.h
index 1634219c23..45e0cc2427 100644
--- a/core/templates/hash_map.h
+++ b/core/templates/hash_map.h
@@ -53,7 +53,7 @@
  * @param RELATIONSHIP Relationship at which the hash table is resized. if amount of elements is RELATIONSHIP
  * times bigger than the hash table, table is resized to solve this condition. if RELATIONSHIP is zero, table is always MIN_HASH_TABLE_POWER.
  *
-*/
+ */
 
 template <class TKey, class TData, class Hasher = HashMapHasherDefault, class Comparator = HashMapComparatorDefault<TKey>, uint8_t MIN_HASH_TABLE_POWER = 3, uint8_t RELATIONSHIP = 8>
 class HashMap {
@@ -458,8 +458,8 @@ public:
 	 *
 	 * 		print( *k );
 	 * 	}
-         *
-	*/
+	 *
+	 */
 	const TKey *next(const TKey *p_key) const {
 		if (unlikely(!hash_table)) {
 			return nullptr;
diff --git a/core/templates/list.h b/core/templates/list.h
index c2e17a2f6f..afbed998c2 100644
--- a/core/templates/list.h
+++ b/core/templates/list.h
@@ -249,29 +249,29 @@ private:
 
 public:
 	/**
-	* return a const iterator to the beginning of the list.
-	*/
+	 * return a const iterator to the beginning of the list.
+	 */
 	_FORCE_INLINE_ const Element *front() const {
 		return _data ? _data->first : nullptr;
 	}
 
 	/**
-	* return an iterator to the beginning of the list.
-	*/
+	 * return an iterator to the beginning of the list.
+	 */
 	_FORCE_INLINE_ Element *front() {
 		return _data ? _data->first : nullptr;
 	}
 
 	/**
- 	* return a const iterator to the last member of the list.
-	*/
+	 * return a const iterator to the last member of the list.
+	 */
 	_FORCE_INLINE_ const Element *back() const {
 		return _data ? _data->last : nullptr;
 	}
 
 	/**
- 	* return an iterator to the last member of the list.
-	*/
+	 * return an iterator to the last member of the list.
+	 */
 	_FORCE_INLINE_ Element *back() {
 		return _data ? _data->last : nullptr;
 	}
diff --git a/core/templates/vector.h b/core/templates/vector.h
index 4b008a45a4..98982c80d3 100644
--- a/core/templates/vector.h
+++ b/core/templates/vector.h
@@ -35,7 +35,7 @@
  * @class Vector
  * @author Juan Linietsky
  * Vector container. Regular Vector Container. Use with care and for smaller arrays when possible. Use Vector for large arrays.
-*/
+ */
 
 #include "core/error/error_macros.h"
 #include "core/os/memory.h"
diff --git a/core/variant/type_info.h b/core/variant/type_info.h
index b70d29bbac..2c6b82d25f 100644
--- a/core/variant/type_info.h
+++ b/core/variant/type_info.h
@@ -60,7 +60,7 @@ struct TypeInherits {
 	static char (&test(...))[2];
 
 	static bool const value = sizeof(test(get_d())) == sizeof(char) &&
-							  !TypesAreSame<B volatile const, void volatile const>::value;
+			!TypesAreSame<B volatile const, void volatile const>::value;
 };
 
 namespace GodotTypeInfo {
diff --git a/core/variant/variant.cpp b/core/variant/variant.cpp
index 81428caca1..1d70d4c506 100644
--- a/core/variant/variant.cpp
+++ b/core/variant/variant.cpp
@@ -3118,7 +3118,7 @@ bool Variant::hash_compare(const Variant &p_variant) const {
 			const Rect2 *r = reinterpret_cast<const Rect2 *>(p_variant._data._mem);
 
 			return (hash_compare_vector2(l->position, r->position)) &&
-				   (hash_compare_vector2(l->size, r->size));
+					(hash_compare_vector2(l->size, r->size));
 		} break;
 		case RECT2I: {
 			const Rect2i *l = reinterpret_cast<const Rect2i *>(_data._mem);
@@ -3158,7 +3158,7 @@ bool Variant::hash_compare(const Variant &p_variant) const {
 			const Plane *r = reinterpret_cast<const Plane *>(p_variant._data._mem);
 
 			return (hash_compare_vector3(l->normal, r->normal)) &&
-				   (hash_compare_scalar(l->d, r->d));
+					(hash_compare_scalar(l->d, r->d));
 		} break;
 
 		case AABB: {
diff --git a/drivers/vulkan/rendering_device_vulkan.cpp b/drivers/vulkan/rendering_device_vulkan.cpp
index e7ac447426..0d9dc7c5d1 100644
--- a/drivers/vulkan/rendering_device_vulkan.cpp
+++ b/drivers/vulkan/rendering_device_vulkan.cpp
@@ -3273,10 +3273,10 @@ bool RenderingDeviceVulkan::texture_is_format_supported_for_usage(DataFormat p_f
 VkRenderPass RenderingDeviceVulkan::_render_pass_create(const Vector<AttachmentFormat> &p_attachments, const Vector<FramebufferPass> &p_passes, InitialAction p_initial_action, FinalAction p_final_action, InitialAction p_initial_depth_action, FinalAction p_final_depth_action, uint32_t p_view_count, Vector<TextureSamples> *r_samples) {
 	// Set up dependencies from/to external equivalent to the default (implicit) one, and then amend them
 	const VkPipelineStageFlags default_access_mask = VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
-													 VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
-													 VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
-													 VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
-													 VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; // From Section 7.1 of Vulkan API Spec v1.1.148
+			VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+			VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+			VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+			VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT; // From Section 7.1 of Vulkan API Spec v1.1.148
 
 	VkPipelineStageFlags reading_stages = VK_PIPELINE_STAGE_COMPUTE_SHADER_BIT | VK_PIPELINE_STAGE_VERTEX_SHADER_BIT | VK_PIPELINE_STAGE_FRAGMENT_SHADER_BIT | VK_PIPELINE_STAGE_TRANSFER_BIT;
 	VkSubpassDependency dependencies[2] = { { VK_SUBPASS_EXTERNAL, 0, VK_PIPELINE_STAGE_TOP_OF_PIPE_BIT, VK_PIPELINE_STAGE_ALL_GRAPHICS_BIT, 0, default_access_mask, 0 },
@@ -8980,35 +8980,35 @@ void RenderingDeviceVulkan::capture_timestamp(const String &p_name) {
 		memoryBarrier.sType = VK_STRUCTURE_TYPE_MEMORY_BARRIER;
 		memoryBarrier.pNext = nullptr;
 		memoryBarrier.srcAccessMask = VK_ACCESS_INDIRECT_COMMAND_READ_BIT |
-									  VK_ACCESS_INDEX_READ_BIT |
-									  VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
-									  VK_ACCESS_UNIFORM_READ_BIT |
-									  VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_SHADER_READ_BIT |
-									  VK_ACCESS_SHADER_WRITE_BIT |
-									  VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
-									  VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
-									  VK_ACCESS_TRANSFER_READ_BIT |
-									  VK_ACCESS_TRANSFER_WRITE_BIT |
-									  VK_ACCESS_HOST_READ_BIT |
-									  VK_ACCESS_HOST_WRITE_BIT;
+				VK_ACCESS_INDEX_READ_BIT |
+				VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
+				VK_ACCESS_UNIFORM_READ_BIT |
+				VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
+				VK_ACCESS_SHADER_READ_BIT |
+				VK_ACCESS_SHADER_WRITE_BIT |
+				VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+				VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+				VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+				VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
+				VK_ACCESS_TRANSFER_READ_BIT |
+				VK_ACCESS_TRANSFER_WRITE_BIT |
+				VK_ACCESS_HOST_READ_BIT |
+				VK_ACCESS_HOST_WRITE_BIT;
 		memoryBarrier.dstAccessMask = VK_ACCESS_INDIRECT_COMMAND_READ_BIT |
-									  VK_ACCESS_INDEX_READ_BIT |
-									  VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
-									  VK_ACCESS_UNIFORM_READ_BIT |
-									  VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_SHADER_READ_BIT |
-									  VK_ACCESS_SHADER_WRITE_BIT |
-									  VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
-									  VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
-									  VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
-									  VK_ACCESS_TRANSFER_READ_BIT |
-									  VK_ACCESS_TRANSFER_WRITE_BIT |
-									  VK_ACCESS_HOST_READ_BIT |
-									  VK_ACCESS_HOST_WRITE_BIT;
+				VK_ACCESS_INDEX_READ_BIT |
+				VK_ACCESS_VERTEX_ATTRIBUTE_READ_BIT |
+				VK_ACCESS_UNIFORM_READ_BIT |
+				VK_ACCESS_INPUT_ATTACHMENT_READ_BIT |
+				VK_ACCESS_SHADER_READ_BIT |
+				VK_ACCESS_SHADER_WRITE_BIT |
+				VK_ACCESS_COLOR_ATTACHMENT_READ_BIT |
+				VK_ACCESS_COLOR_ATTACHMENT_WRITE_BIT |
+				VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_READ_BIT |
+				VK_ACCESS_DEPTH_STENCIL_ATTACHMENT_WRITE_BIT |
+				VK_ACCESS_TRANSFER_READ_BIT |
+				VK_ACCESS_TRANSFER_WRITE_BIT |
+				VK_ACCESS_HOST_READ_BIT |
+				VK_ACCESS_HOST_WRITE_BIT;
 
 		vkCmdPipelineBarrier(frames[frame].draw_command_buffer, VK_PIPELINE_STAGE_ALL_COMMANDS_BIT, VK_PIPELINE_STAGE_ALL_COMMANDS_BIT, 0, 1, &memoryBarrier, 0, nullptr, 0, nullptr);
 	}
diff --git a/drivers/vulkan/vulkan_context.cpp b/drivers/vulkan/vulkan_context.cpp
index 44fed02f41..c178a68236 100644
--- a/drivers/vulkan/vulkan_context.cpp
+++ b/drivers/vulkan/vulkan_context.cpp
@@ -137,10 +137,10 @@ VKAPI_ATTR VkBool32 VKAPI_CALL VulkanContext::_debug_messenger_callback(
 	}
 
 	String error_message(type_string +
-						 " - Message Id Number: " + String::num_int64(pCallbackData->messageIdNumber) +
-						 " | Message Id Name: " + pCallbackData->pMessageIdName +
-						 "\n\t" + pCallbackData->pMessage +
-						 objects_string + labels_string);
+			" - Message Id Number: " + String::num_int64(pCallbackData->messageIdNumber) +
+			" | Message Id Name: " + pCallbackData->pMessageIdName +
+			"\n\t" + pCallbackData->pMessage +
+			objects_string + labels_string);
 
 	// Convert VK severity to our own log macros.
 	switch (messageSeverity) {
@@ -175,7 +175,7 @@ VKAPI_ATTR VkBool32 VKAPI_CALL VulkanContext::_debug_report_callback(
 		const char *pMessage,
 		void *pUserData) {
 	String debugMessage = String("Vulkan Debug Report: object - ") +
-						  String::num_int64(object) + "\n" + pMessage;
+			String::num_int64(object) + "\n" + pMessage;
 
 	switch (flags) {
 		case VK_DEBUG_REPORT_DEBUG_BIT_EXT:
@@ -631,10 +631,10 @@ Error VulkanContext::_create_physical_device() {
 	}
 
 	/*
-	   * This is info for a temp callback to use during CreateInstance.
-	   * After the instance is created, we use the instance-based
-	   * function to register the final callback.
-	   */
+	 * This is info for a temp callback to use during CreateInstance.
+	 * After the instance is created, we use the instance-based
+	 * function to register the final callback.
+	 */
 	VkDebugUtilsMessengerCreateInfoEXT dbg_messenger_create_info;
 	VkDebugReportCallbackCreateInfoEXT dbg_report_callback_create_info{};
 	if (enabled_debug_utils) {
@@ -645,18 +645,18 @@ Error VulkanContext::_create_physical_device() {
 		dbg_messenger_create_info.messageSeverity =
 				VK_DEBUG_UTILS_MESSAGE_SEVERITY_WARNING_BIT_EXT | VK_DEBUG_UTILS_MESSAGE_SEVERITY_ERROR_BIT_EXT;
 		dbg_messenger_create_info.messageType = VK_DEBUG_UTILS_MESSAGE_TYPE_GENERAL_BIT_EXT |
-												VK_DEBUG_UTILS_MESSAGE_TYPE_VALIDATION_BIT_EXT |
-												VK_DEBUG_UTILS_MESSAGE_TYPE_PERFORMANCE_BIT_EXT;
+				VK_DEBUG_UTILS_MESSAGE_TYPE_VALIDATION_BIT_EXT |
+				VK_DEBUG_UTILS_MESSAGE_TYPE_PERFORMANCE_BIT_EXT;
 		dbg_messenger_create_info.pfnUserCallback = _debug_messenger_callback;
 		dbg_messenger_create_info.pUserData = this;
 		inst_info.pNext = &dbg_messenger_create_info;
 	} else if (enabled_debug_report) {
 		dbg_report_callback_create_info.sType = VK_STRUCTURE_TYPE_DEBUG_REPORT_CALLBACK_CREATE_INFO_EXT;
 		dbg_report_callback_create_info.flags = VK_DEBUG_REPORT_INFORMATION_BIT_EXT |
-												VK_DEBUG_REPORT_WARNING_BIT_EXT |
-												VK_DEBUG_REPORT_PERFORMANCE_WARNING_BIT_EXT |
-												VK_DEBUG_REPORT_ERROR_BIT_EXT |
-												VK_DEBUG_REPORT_DEBUG_BIT_EXT;
+				VK_DEBUG_REPORT_WARNING_BIT_EXT |
+				VK_DEBUG_REPORT_PERFORMANCE_WARNING_BIT_EXT |
+				VK_DEBUG_REPORT_ERROR_BIT_EXT |
+				VK_DEBUG_REPORT_DEBUG_BIT_EXT;
 		dbg_report_callback_create_info.pfnCallback = _debug_report_callback;
 		dbg_report_callback_create_info.pUserData = this;
 		inst_info.pNext = &dbg_report_callback_create_info;
diff --git a/editor/action_map_editor.cpp b/editor/action_map_editor.cpp
index fc7e7389d5..519dd654ef 100644
--- a/editor/action_map_editor.cpp
+++ b/editor/action_map_editor.cpp
@@ -238,10 +238,16 @@ void InputEventConfigurationDialog::_listen_window_input(const Ref<InputEvent> &
 	Ref<InputEventJoypadButton> joyb = p_event;
 	Ref<InputEventJoypadMotion> joym = p_event;
 
-	int type = k.is_valid() ? INPUT_KEY : joyb.is_valid() ? INPUT_JOY_BUTTON :
-								  joym.is_valid()		  ? INPUT_JOY_MOTION :
-								  mb.is_valid()			  ? INPUT_MOUSE_BUTTON :
-															  0;
+	int type = 0;
+	if (k.is_valid()) {
+		type = INPUT_KEY;
+	} else if (joyb.is_valid()) {
+		type = INPUT_JOY_BUTTON;
+	} else if (joym.is_valid()) {
+		type = INPUT_JOY_MOTION;
+	} else if (mb.is_valid()) {
+		type = INPUT_MOUSE_BUTTON;
+	}
 
 	if (!(allowed_input_types & type)) {
 		return;
diff --git a/editor/editor_about.cpp b/editor/editor_about.cpp
index c895e2c158..414264e697 100644
--- a/editor/editor_about.cpp
+++ b/editor/editor_about.cpp
@@ -155,7 +155,7 @@ EditorAbout::EditorAbout() {
 	Label *about_text = memnew(Label);
 	about_text->set_v_size_flags(Control::SIZE_SHRINK_CENTER);
 	about_text->set_text(String::utf8("\xc2\xa9 2007-2021 Juan Linietsky, Ariel Manzur.\n\xc2\xa9 2014-2021 ") +
-						 TTR("Godot Engine contributors") + "\n");
+			TTR("Godot Engine contributors") + "\n");
 	version_info_vbc->add_child(about_text);
 
 	hbc->add_child(version_info_vbc);
diff --git a/editor/editor_node.cpp b/editor/editor_node.cpp
index 1904ac58b0..372cf14dc1 100644
--- a/editor/editor_node.cpp
+++ b/editor/editor_node.cpp
@@ -4964,9 +4964,9 @@ void EditorNode::_scene_tab_closed(int p_tab, int option) {
 		return;
 	}
 
-	bool unsaved = (p_tab == editor_data.get_edited_scene()) ?
-							 saved_version != editor_data.get_undo_redo().get_version() :
-							 editor_data.get_scene_version(p_tab) != 0;
+	bool unsaved = (p_tab == editor_data.get_edited_scene())
+			? saved_version != editor_data.get_undo_redo().get_version()
+			: editor_data.get_scene_version(p_tab) != 0;
 	if (unsaved) {
 		save_confirmation->get_ok_button()->set_text(TTR("Save & Close"));
 		save_confirmation->set_text(vformat(TTR("Save changes to '%s' before closing?"), scene->get_scene_file_path() != "" ? scene->get_scene_file_path() : "unsaved scene"));
diff --git a/editor/editor_properties.cpp b/editor/editor_properties.cpp
index 6a36304ba4..e679222567 100644
--- a/editor/editor_properties.cpp
+++ b/editor/editor_properties.cpp
@@ -3237,11 +3237,11 @@ EditorProperty *EditorInspectorDefaultPlugin::get_editor_for_property(Object *p_
 				return editor;
 
 			} else if (p_hint == PROPERTY_HINT_LAYERS_2D_PHYSICS ||
-					   p_hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
-					   p_hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
-					   p_hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
-					   p_hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
-					   p_hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
+					p_hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
+					p_hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
+					p_hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
+					p_hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
+					p_hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
 				EditorPropertyLayers::LayerType lt = EditorPropertyLayers::LAYER_RENDER_2D;
 				switch (p_hint) {
 					case PROPERTY_HINT_LAYERS_2D_RENDER:
@@ -3336,13 +3336,13 @@ EditorProperty *EditorInspectorDefaultPlugin::get_editor_for_property(Object *p_
 				}
 				return editor;
 			} else if (p_hint == PROPERTY_HINT_METHOD_OF_VARIANT_TYPE ||
-					   p_hint == PROPERTY_HINT_METHOD_OF_BASE_TYPE ||
-					   p_hint == PROPERTY_HINT_METHOD_OF_INSTANCE ||
-					   p_hint == PROPERTY_HINT_METHOD_OF_SCRIPT ||
-					   p_hint == PROPERTY_HINT_PROPERTY_OF_VARIANT_TYPE ||
-					   p_hint == PROPERTY_HINT_PROPERTY_OF_BASE_TYPE ||
-					   p_hint == PROPERTY_HINT_PROPERTY_OF_INSTANCE ||
-					   p_hint == PROPERTY_HINT_PROPERTY_OF_SCRIPT) {
+					p_hint == PROPERTY_HINT_METHOD_OF_BASE_TYPE ||
+					p_hint == PROPERTY_HINT_METHOD_OF_INSTANCE ||
+					p_hint == PROPERTY_HINT_METHOD_OF_SCRIPT ||
+					p_hint == PROPERTY_HINT_PROPERTY_OF_VARIANT_TYPE ||
+					p_hint == PROPERTY_HINT_PROPERTY_OF_BASE_TYPE ||
+					p_hint == PROPERTY_HINT_PROPERTY_OF_INSTANCE ||
+					p_hint == PROPERTY_HINT_PROPERTY_OF_SCRIPT) {
 				EditorPropertyMember *editor = memnew(EditorPropertyMember);
 
 				EditorPropertyMember::Type type = EditorPropertyMember::MEMBER_METHOD_OF_BASE_TYPE;
diff --git a/editor/filesystem_dock.cpp b/editor/filesystem_dock.cpp
index cdf0f6e391..f2a3aa3b44 100644
--- a/editor/filesystem_dock.cpp
+++ b/editor/filesystem_dock.cpp
@@ -1371,7 +1371,7 @@ void FileSystemDock::_make_dir_confirm() {
 		EditorNode::get_singleton()->show_warning(TTR("No name provided."));
 		return;
 	} else if (dir_name.find("/") != -1 || dir_name.find("\\") != -1 || dir_name.find(":") != -1 || dir_name.find("*") != -1 ||
-			   dir_name.find("|") != -1 || dir_name.find(">") != -1 || dir_name.ends_with(".") || dir_name.ends_with(" ")) {
+			dir_name.find("|") != -1 || dir_name.find(">") != -1 || dir_name.ends_with(".") || dir_name.ends_with(" ")) {
 		EditorNode::get_singleton()->show_warning(TTR("Provided name contains invalid characters."));
 		return;
 	}
diff --git a/editor/import/collada.cpp b/editor/import/collada.cpp
index 4cd9066350..19b4943e6d 100644
--- a/editor/import/collada.cpp
+++ b/editor/import/collada.cpp
@@ -541,7 +541,10 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
 
 			COLLADA_PRINT("node name: " + parser.get_node_name());
 
-			if (!parser.is_empty() && (parser.get_node_name() == "profile_COMMON" || parser.get_node_name() == "technique" || parser.get_node_name() == "extra")) {
+			if (!parser.is_empty() &&
+					(parser.get_node_name() == "profile_COMMON" ||
+							parser.get_node_name() == "technique" ||
+							parser.get_node_name() == "extra")) {
 				_parse_effect_material(parser, effect, id); // try again
 
 			} else if (parser.get_node_name() == "newparam") {
@@ -551,9 +554,9 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
 				COLLADA_PRINT("param: " + name + " value:" + String(value));
 
 			} else if (parser.get_node_name() == "constant" ||
-					   parser.get_node_name() == "lambert" ||
-					   parser.get_node_name() == "phong" ||
-					   parser.get_node_name() == "blinn") {
+					parser.get_node_name() == "lambert" ||
+					parser.get_node_name() == "phong" ||
+					parser.get_node_name() == "blinn") {
 				COLLADA_PRINT("shade model: " + parser.get_node_name());
 				while (parser.read() == OK) {
 					if (parser.get_node_type() == XMLParser::NODE_ELEMENT) {
@@ -627,10 +630,11 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
 						} else if (what == "shininess") {
 							effect.shininess = _parse_param(parser);
 						}
-					} else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END && (parser.get_node_name() == "constant" ||
-																								parser.get_node_name() == "lambert" ||
-																								parser.get_node_name() == "phong" ||
-																								parser.get_node_name() == "blinn")) {
+					} else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END &&
+							(parser.get_node_name() == "constant" ||
+									parser.get_node_name() == "lambert" ||
+									parser.get_node_name() == "phong" ||
+									parser.get_node_name() == "blinn")) {
 						break;
 					}
 				}
@@ -681,10 +685,10 @@ void Collada::_parse_effect_material(XMLParser &parser, Effect &effect, String &
 				parser.skip_section();
 			}
 		} else if (parser.get_node_type() == XMLParser::NODE_ELEMENT_END &&
-				   (parser.get_node_name() == "effect" ||
-						   parser.get_node_name() == "profile_COMMON" ||
-						   parser.get_node_name() == "technique" ||
-						   parser.get_node_name() == "extra")) {
+				(parser.get_node_name() == "effect" ||
+						parser.get_node_name() == "profile_COMMON" ||
+						parser.get_node_name() == "technique" ||
+						parser.get_node_name() == "extra")) {
 			break;
 		}
 	}
diff --git a/editor/import/editor_import_collada.cpp b/editor/import/editor_import_collada.cpp
index ac8adedf2f..f9aa550e7d 100644
--- a/editor/import/editor_import_collada.cpp
+++ b/editor/import/editor_import_collada.cpp
@@ -1650,8 +1650,7 @@ void ColladaImport::create_animation(int p_clip, bool p_import_value_tracks) {
 
 			Vector3 s = xform.basis.get_scale();
 			bool singular_matrix = Math::is_zero_approx(s.x) || Math::is_zero_approx(s.y) || Math::is_zero_approx(s.z);
-			Quaternion q = singular_matrix ? Quaternion() :
-											   xform.basis.get_rotation_quaternion();
+			Quaternion q = singular_matrix ? Quaternion() : xform.basis.get_rotation_quaternion();
 			Vector3 l = xform.origin;
 
 			if (position_idx >= 0) {
diff --git a/editor/import/resource_importer_scene.cpp b/editor/import/resource_importer_scene.cpp
index 9cb69357bd..7d3b945b04 100644
--- a/editor/import/resource_importer_scene.cpp
+++ b/editor/import/resource_importer_scene.cpp
@@ -1300,27 +1300,28 @@ bool ResourceImporterScene::get_internal_option_visibility(InternalImportCategor
 			if (p_option == "primitive/position" || p_option == "primitive/rotation") {
 				const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
 				return generate_physics &&
-					   physics_shape >= SHAPE_TYPE_BOX;
+						physics_shape >= SHAPE_TYPE_BOX;
 			}
 
 			if (p_option == "primitive/size") {
 				const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
 				return generate_physics &&
-					   physics_shape == SHAPE_TYPE_BOX;
+						physics_shape == SHAPE_TYPE_BOX;
 			}
 
 			if (p_option == "primitive/radius") {
 				const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
-				return generate_physics && (physics_shape == SHAPE_TYPE_SPHERE ||
-												   physics_shape == SHAPE_TYPE_CYLINDER ||
-												   physics_shape == SHAPE_TYPE_CAPSULE);
+				return generate_physics &&
+						(physics_shape == SHAPE_TYPE_SPHERE ||
+								physics_shape == SHAPE_TYPE_CYLINDER ||
+								physics_shape == SHAPE_TYPE_CAPSULE);
 			}
 
 			if (p_option == "primitive/height") {
 				const ShapeType physics_shape = (ShapeType)p_options["physics/shape_type"].operator int();
 				return generate_physics &&
-					   (physics_shape == SHAPE_TYPE_CYLINDER ||
-							   physics_shape == SHAPE_TYPE_CAPSULE);
+						(physics_shape == SHAPE_TYPE_CYLINDER ||
+								physics_shape == SHAPE_TYPE_CAPSULE);
 			}
 		} break;
 		case INTERNAL_IMPORT_CATEGORY_MESH: {
diff --git a/editor/import/resource_importer_wav.cpp b/editor/import/resource_importer_wav.cpp
index 2db1db9e51..89383d3dde 100644
--- a/editor/import/resource_importer_wav.cpp
+++ b/editor/import/resource_importer_wav.cpp
@@ -252,13 +252,13 @@ Error ResourceImporterWAV::import(const String &p_source_file, const String &p_s
 			//loop point info!
 
 			/**
-			*	Consider exploring next document:
-			*		http://www-mmsp.ece.mcgill.ca/Documents/AudioFormats/WAVE/Docs/RIFFNEW.pdf
-			*	Especially on page:
-			*		16 - 17
-			*	Timestamp:
-			*		22:38 06.07.2017 GMT
-			**/
+			 *	Consider exploring next document:
+			 *		http://www-mmsp.ece.mcgill.ca/Documents/AudioFormats/WAVE/Docs/RIFFNEW.pdf
+			 *	Especially on page:
+			 *		16 - 17
+			 *	Timestamp:
+			 *		22:38 06.07.2017 GMT
+			 **/
 
 			for (int i = 0; i < 10; i++) {
 				file->get_32(); // i wish to know why should i do this... no doc!
diff --git a/editor/plugins/canvas_item_editor_plugin.cpp b/editor/plugins/canvas_item_editor_plugin.cpp
index 5544d9261e..0e1bdf0155 100644
--- a/editor/plugins/canvas_item_editor_plugin.cpp
+++ b/editor/plugins/canvas_item_editor_plugin.cpp
@@ -2983,18 +2983,16 @@ void CanvasItemEditor::_draw_ruler_tool() {
 
 			const Vector2 end_to_begin = (end - begin);
 
-			real_t arc_1_start_angle =
-					end_to_begin.x < 0 ?
-							  (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0) :
-							  (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
+			real_t arc_1_start_angle = end_to_begin.x < 0
+					? (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 - vertical_angle_rad : Math_PI / 2.0)
+					: (end_to_begin.y < 0 ? 3.0 * Math_PI / 2.0 : Math_PI / 2.0 - vertical_angle_rad);
 			real_t arc_1_end_angle = arc_1_start_angle + vertical_angle_rad;
 			// Constrain arc to triangle height & max size
 			real_t arc_1_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.y)), arc_max_radius);
 
-			real_t arc_2_start_angle =
-					end_to_begin.x < 0 ?
-							  (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad) :
-							  (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
+			real_t arc_2_start_angle = end_to_begin.x < 0
+					? (end_to_begin.y < 0 ? 0.0 : -horizontal_angle_rad)
+					: (end_to_begin.y < 0 ? Math_PI - horizontal_angle_rad : Math_PI);
 			real_t arc_2_end_angle = arc_2_start_angle + horizontal_angle_rad;
 			// Constrain arc to triangle width & max size
 			real_t arc_2_radius = MIN(MIN(arc_radius_max_length_percent * ruler_length, ABS(end_to_begin.x)), arc_max_radius);
diff --git a/editor/plugins/curve_editor_plugin.cpp b/editor/plugins/curve_editor_plugin.cpp
index 4a22dc5b62..43eb6a7ce9 100644
--- a/editor/plugins/curve_editor_plugin.cpp
+++ b/editor/plugins/curve_editor_plugin.cpp
@@ -354,9 +354,9 @@ void CurveEditor::open_context_menu(Vector2 pos) {
 
 				_context_menu->add_check_item(TTR("Linear"), CONTEXT_LINEAR);
 
-				bool is_linear = _selected_tangent == TANGENT_LEFT ?
-										   _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR :
-										   _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
+				bool is_linear = _selected_tangent == TANGENT_LEFT
+						? _curve_ref->get_point_left_mode(_selected_point) == Curve::TANGENT_LINEAR
+						: _curve_ref->get_point_right_mode(_selected_point) == Curve::TANGENT_LINEAR;
 
 				_context_menu->set_item_checked(_context_menu->get_item_index(CONTEXT_LINEAR), is_linear);
 
diff --git a/editor/plugins/node_3d_editor_gizmos.cpp b/editor/plugins/node_3d_editor_gizmos.cpp
index b28f3e134c..cbbdfd412d 100644
--- a/editor/plugins/node_3d_editor_gizmos.cpp
+++ b/editor/plugins/node_3d_editor_gizmos.cpp
@@ -3641,15 +3641,15 @@ void LightmapGIGizmoPlugin::redraw(EditorNode3DGizmo *p_gizmo) {
 				const float c4 = 0.886227;
 				const float c5 = 0.247708;
 				Vector3 light = (c1 * sh_col[8] * (n.x * n.x - n.y * n.y) +
-								 c3 * sh_col[6] * n.z * n.z +
-								 c4 * sh_col[0] -
-								 c5 * sh_col[6] +
-								 2.0 * c1 * sh_col[4] * n.x * n.y +
-								 2.0 * c1 * sh_col[7] * n.x * n.z +
-								 2.0 * c1 * sh_col[5] * n.y * n.z +
-								 2.0 * c2 * sh_col[3] * n.x +
-								 2.0 * c2 * sh_col[1] * n.y +
-								 2.0 * c2 * sh_col[2] * n.z);
+						c3 * sh_col[6] * n.z * n.z +
+						c4 * sh_col[0] -
+						c5 * sh_col[6] +
+						2.0 * c1 * sh_col[4] * n.x * n.y +
+						2.0 * c1 * sh_col[7] * n.x * n.z +
+						2.0 * c1 * sh_col[5] * n.y * n.z +
+						2.0 * c2 * sh_col[3] * n.x +
+						2.0 * c2 * sh_col[1] * n.y +
+						2.0 * c2 * sh_col[2] * n.z);
 
 				colors.push_back(Color(light.x, light.y, light.z, 1));
 			}
diff --git a/editor/plugins/node_3d_editor_plugin.cpp b/editor/plugins/node_3d_editor_plugin.cpp
index 632207befc..fb41a8f497 100644
--- a/editor/plugins/node_3d_editor_plugin.cpp
+++ b/editor/plugins/node_3d_editor_plugin.cpp
@@ -1855,7 +1855,7 @@ void Node3DEditorViewport::_sinput(const Ref<InputEvent> &p_event) {
 						motion_snapped.snap(Vector3(snap, snap, snap));
 						// This might not be necessary anymore after issue #288 is solved (in 4.0?).
 						set_message(TTR("Scaling: ") + "(" + String::num(motion_snapped.x, snap_step_decimals) + ", " +
-									String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
+								String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
 
 						List<Node *> &selection = editor_selection->get_selected_node_list();
 						for (Node *E : selection) {
@@ -1954,7 +1954,7 @@ void Node3DEditorViewport::_sinput(const Ref<InputEvent> &p_event) {
 						Vector3 motion_snapped = motion;
 						motion_snapped.snap(Vector3(snap, snap, snap));
 						set_message(TTR("Translating: ") + "(" + String::num(motion_snapped.x, snap_step_decimals) + ", " +
-									String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
+								String::num(motion_snapped.y, snap_step_decimals) + ", " + String::num(motion_snapped.z, snap_step_decimals) + ")");
 
 						List<Node *> &selection = editor_selection->get_selected_node_list();
 						for (Node *E : selection) {
diff --git a/editor/plugins/path_3d_editor_plugin.cpp b/editor/plugins/path_3d_editor_plugin.cpp
index e2902feba1..f9a5f429d2 100644
--- a/editor/plugins/path_3d_editor_plugin.cpp
+++ b/editor/plugins/path_3d_editor_plugin.cpp
@@ -614,15 +614,6 @@ Path3DEditorPlugin::Path3DEditorPlugin(EditorNode *p_node) {
 	menu->connect("id_pressed", callable_mp(this, &Path3DEditorPlugin::_handle_option_pressed));
 
 	curve_edit->set_pressed(true);
-	/*
-    collision_polygon_editor = memnew( PathEditor(p_node) );
-    editor->get_main_control()->add_child(collision_polygon_editor);
-    collision_polygon_editor->set_margin(MARGIN_LEFT,200);
-    collision_polygon_editor->set_margin(MARGIN_RIGHT,230);
-    collision_polygon_editor->set_margin(MARGIN_TOP,0);
-    collision_polygon_editor->set_margin(MARGIN_BOTTOM,10);
-    collision_polygon_editor->hide();
-    */
 }
 
 Path3DEditorPlugin::~Path3DEditorPlugin() {
diff --git a/editor/plugins/script_editor_plugin.cpp b/editor/plugins/script_editor_plugin.cpp
index 677a5f1f2c..3f98560a2f 100644
--- a/editor/plugins/script_editor_plugin.cpp
+++ b/editor/plugins/script_editor_plugin.cpp
@@ -315,10 +315,7 @@ void ScriptEditorQuickOpen::_text_changed(const String &p_newtext) {
 void ScriptEditorQuickOpen::_sbox_input(const Ref<InputEvent> &p_ie) {
 	Ref<InputEventKey> k = p_ie;
 
-	if (k.is_valid() && (k->get_keycode() == KEY_UP ||
-								k->get_keycode() == KEY_DOWN ||
-								k->get_keycode() == KEY_PAGEUP ||
-								k->get_keycode() == KEY_PAGEDOWN)) {
+	if (k.is_valid() && (k->get_keycode() == KEY_UP || k->get_keycode() == KEY_DOWN || k->get_keycode() == KEY_PAGEUP || k->get_keycode() == KEY_PAGEDOWN)) {
 		search_options->gui_input(k);
 		search_box->accept_event();
 	}
diff --git a/editor/plugins/script_text_editor.cpp b/editor/plugins/script_text_editor.cpp
index 2c02389db2..219498b5e7 100644
--- a/editor/plugins/script_text_editor.cpp
+++ b/editor/plugins/script_text_editor.cpp
@@ -1396,11 +1396,12 @@ Variant ScriptTextEditor::get_drag_data_fw(const Point2 &p_point, Control *p_fro
 
 bool ScriptTextEditor::can_drop_data_fw(const Point2 &p_point, const Variant &p_data, Control *p_from) const {
 	Dictionary d = p_data;
-	if (d.has("type") && (String(d["type"]) == "resource" ||
-								 String(d["type"]) == "files" ||
-								 String(d["type"]) == "nodes" ||
-								 String(d["type"]) == "obj_property" ||
-								 String(d["type"]) == "files_and_dirs")) {
+	if (d.has("type") &&
+			(String(d["type"]) == "resource" ||
+					String(d["type"]) == "files" ||
+					String(d["type"]) == "nodes" ||
+					String(d["type"]) == "obj_property" ||
+					String(d["type"]) == "files_and_dirs")) {
 		return true;
 	}
 
diff --git a/editor/plugins/visual_shader_editor_plugin.cpp b/editor/plugins/visual_shader_editor_plugin.cpp
index 09ca1f7608..d0f3da8d81 100644
--- a/editor/plugins/visual_shader_editor_plugin.cpp
+++ b/editor/plugins/visual_shader_editor_plugin.cpp
@@ -3207,10 +3207,7 @@ void VisualShaderEditor::_show_members_dialog(bool at_mouse_pos, VisualShaderNod
 
 void VisualShaderEditor::_sbox_input(const Ref<InputEvent> &p_ie) {
 	Ref<InputEventKey> ie = p_ie;
-	if (ie.is_valid() && (ie->get_keycode() == KEY_UP ||
-								 ie->get_keycode() == KEY_DOWN ||
-								 ie->get_keycode() == KEY_ENTER ||
-								 ie->get_keycode() == KEY_KP_ENTER)) {
+	if (ie.is_valid() && (ie->get_keycode() == KEY_UP || ie->get_keycode() == KEY_DOWN || ie->get_keycode() == KEY_ENTER || ie->get_keycode() == KEY_KP_ENTER)) {
 		members->gui_input(ie);
 		node_filter->accept_event();
 	}
diff --git a/editor/property_editor.cpp b/editor/property_editor.cpp
index 6ea9b9dfae..db560af657 100644
--- a/editor/property_editor.cpp
+++ b/editor/property_editor.cpp
@@ -407,11 +407,11 @@ bool CustomPropertyEditor::edit(Object *p_owner, const String &p_name, Variant::
 				return false;
 
 			} else if (hint == PROPERTY_HINT_LAYERS_2D_PHYSICS ||
-					   hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
-					   hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
-					   hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
-					   hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
-					   hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
+					hint == PROPERTY_HINT_LAYERS_2D_RENDER ||
+					hint == PROPERTY_HINT_LAYERS_2D_NAVIGATION ||
+					hint == PROPERTY_HINT_LAYERS_3D_PHYSICS ||
+					hint == PROPERTY_HINT_LAYERS_3D_RENDER ||
+					hint == PROPERTY_HINT_LAYERS_3D_NAVIGATION) {
 				String basename;
 				switch (hint) {
 					case PROPERTY_HINT_LAYERS_2D_RENDER:
diff --git a/editor/rename_dialog.cpp b/editor/rename_dialog.cpp
index a5e1b0eab8..2792c193d9 100644
--- a/editor/rename_dialog.cpp
+++ b/editor/rename_dialog.cpp
@@ -626,7 +626,7 @@ void RenameDialog::reset() {
 
 bool RenameDialog::_is_main_field(LineEdit *line_edit) {
 	return line_edit &&
-		   (line_edit == lne_search || line_edit == lne_replace || line_edit == lne_prefix || line_edit == lne_suffix);
+			(line_edit == lne_search || line_edit == lne_replace || line_edit == lne_prefix || line_edit == lne_suffix);
 }
 
 void RenameDialog::_insert_text(String text) {
diff --git a/main/main.cpp b/main/main.cpp
index d4a6216e35..edd67971ea 100644
--- a/main/main.cpp
+++ b/main/main.cpp
@@ -923,7 +923,7 @@ Error Main::setup(const char *execpath, int argc, char *argv[], bool p_second_ph
 			// Needs full refactoring to fix properly.
 			main_args.push_back(I->get());
 		} else if (I->get() == "--export" || I->get() == "--export-debug" ||
-				   I->get() == "--export-pack") { // Export project
+				I->get() == "--export-pack") { // Export project
 			// Actually handling is done in start().
 			editor = true;
 			cmdline_tool = true;
@@ -1308,10 +1308,12 @@ Error Main::setup(const char *execpath, int argc, char *argv[], bool p_second_ph
 		OS::get_singleton()->_allow_hidpi = GLOBAL_DEF("display/window/dpi/allow_hidpi", false);
 	}
 
-	/* todo restore
-    OS::get_singleton()->_allow_layered = GLOBAL_DEF("display/window/per_pixel_transparency/allowed", false);
-    video_mode.layered = GLOBAL_DEF("display/window/per_pixel_transparency/enabled", false);
-*/
+	// FIXME: Restore support.
+#if 0
+	//OS::get_singleton()->_allow_layered = GLOBAL_DEF("display/window/per_pixel_transparency/allowed", false);
+	video_mode.layered = GLOBAL_DEF("display/window/per_pixel_transparency/enabled", false);
+#endif
+
 	if (editor || project_manager) {
 		// The editor and project manager always detect and use hiDPI if needed
 		OS::get_singleton()->_allow_hidpi = true;
diff --git a/modules/bmp/image_loader_bmp.cpp b/modules/bmp/image_loader_bmp.cpp
index bd8342e1aa..3d47055247 100644
--- a/modules/bmp/image_loader_bmp.cpp
+++ b/modules/bmp/image_loader_bmp.cpp
@@ -248,8 +248,7 @@ Error ImageLoaderBMP::load_image(Ref<Image> p_image, FileAccess *f,
 			}
 			// Don't rely on sizeof(bmp_file_header) as structure padding
 			// adds 2 bytes offset leading to misaligned color table reading
-			uint32_t ct_offset = BITMAP_FILE_HEADER_SIZE +
-								 bmp_header.bmp_info_header.bmp_header_size;
+			uint32_t ct_offset = BITMAP_FILE_HEADER_SIZE + bmp_header.bmp_info_header.bmp_header_size;
 			f->seek(ct_offset);
 
 			uint32_t color_table_size = 0;
@@ -271,8 +270,7 @@ Error ImageLoaderBMP::load_image(Ref<Image> p_image, FileAccess *f,
 
 			f->seek(bmp_header.bmp_file_header.bmp_file_offset);
 
-			uint32_t bmp_buffer_size = (bmp_header.bmp_file_header.bmp_file_size -
-										bmp_header.bmp_file_header.bmp_file_offset);
+			uint32_t bmp_buffer_size = (bmp_header.bmp_file_header.bmp_file_size - bmp_header.bmp_file_header.bmp_file_offset);
 
 			Vector<uint8_t> bmp_buffer;
 			err = bmp_buffer.resize(bmp_buffer_size);
diff --git a/modules/csg/csg.cpp b/modules/csg/csg.cpp
index 5ffe644495..a7742ef415 100644
--- a/modules/csg/csg.cpp
+++ b/modules/csg/csg.cpp
@@ -156,8 +156,8 @@ inline bool is_point_in_triangle(const Vector3 &p_point, const Vector3 p_vertice
 
 inline static bool is_triangle_degenerate(const Vector2 p_vertices[3], real_t p_vertex_snap2) {
 	real_t det = p_vertices[0].x * p_vertices[1].y - p_vertices[0].x * p_vertices[2].y +
-				 p_vertices[0].y * p_vertices[2].x - p_vertices[0].y * p_vertices[1].x +
-				 p_vertices[1].x * p_vertices[2].y - p_vertices[1].y * p_vertices[2].x;
+			p_vertices[0].y * p_vertices[2].x - p_vertices[0].y * p_vertices[1].x +
+			p_vertices[1].x * p_vertices[2].y - p_vertices[1].y * p_vertices[2].x;
 
 	return det < p_vertex_snap2;
 }
diff --git a/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp b/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
index 1eee10b251..d6abcbb00a 100644
--- a/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
+++ b/modules/fbx/fbx_parser/FBXBinaryTokenizer.cpp
@@ -82,46 +82,6 @@ OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
 #include <stdint.h>
 
 namespace FBXDocParser {
-//enum Flag
-//{
-//   e_unknown_0 = 1 << 0,
-//   e_unknown_1 = 1 << 1,
-//   e_unknown_2 = 1 << 2,
-//   e_unknown_3 = 1 << 3,
-//   e_unknown_4 = 1 << 4,
-//   e_unknown_5 = 1 << 5,
-//   e_unknown_6 = 1 << 6,
-//   e_unknown_7 = 1 << 7,
-//   e_unknown_8 = 1 << 8,
-//   e_unknown_9 = 1 << 9,
-//   e_unknown_10 = 1 << 10,
-//   e_unknown_11 = 1 << 11,
-//   e_unknown_12 = 1 << 12,
-//   e_unknown_13 = 1 << 13,
-//   e_unknown_14 = 1 << 14,
-//   e_unknown_15 = 1 << 15,
-//   e_unknown_16 = 1 << 16,
-//   e_unknown_17 = 1 << 17,
-//   e_unknown_18 = 1 << 18,
-//   e_unknown_19 = 1 << 19,
-//   e_unknown_20 = 1 << 20,
-//   e_unknown_21 = 1 << 21,
-//   e_unknown_22 = 1 << 22,
-//   e_unknown_23 = 1 << 23,
-//   e_flag_field_size_64_bit = 1 << 24, // Not sure what is
-//   e_unknown_25 = 1 << 25,
-//   e_unknown_26 = 1 << 26,
-//   e_unknown_27 = 1 << 27,
-//   e_unknown_28 = 1 << 28,
-//   e_unknown_29 = 1 << 29,
-//   e_unknown_30 = 1 << 30,
-//   e_unknown_31 = 1 << 31
-//};
-//
-//bool check_flag(uint32_t flags, Flag to_check)
-//{
-//	return (flags & to_check) != 0;
-//}
 // ------------------------------------------------------------------------------------------------
 Token::Token(const char *sbegin, const char *send, TokenType type, size_t offset) :
 		sbegin(sbegin),
@@ -458,12 +418,6 @@ void TokenizeBinary(TokenList &output_tokens, const char *input, size_t length,
 		//TokenizeError("file is too short",0);
 	}
 
-	//uint32_t offset = 0x15;
-	/*    const char* cursor = input + 0x15;
-    const uint32_t flags = ReadWord(input, cursor, input + length);
-    const uint8_t padding_0 = ReadByte(input, cursor, input + length); // unused
-    const uint8_t padding_1 = ReadByte(input, cursor, input + length); // unused*/
-
 	if (strncmp(input, "Kaydara FBX Binary", 18)) {
 		TokenizeError("magic bytes not found", 0);
 	}
diff --git a/modules/fbx/fbx_parser/FBXCommon.h b/modules/fbx/fbx_parser/FBXCommon.h
index 641d6d351e..611bf22d3b 100644
--- a/modules/fbx/fbx_parser/FBXCommon.h
+++ b/modules/fbx/fbx_parser/FBXCommon.h
@@ -70,8 +70,8 @@ OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
 */
 
 /** @file FBXCommon.h
-* Some useful constants and enums for dealing with FBX files.
-*/
+ * Some useful constants and enums for dealing with FBX files.
+ */
 #ifndef FBX_COMMON_H
 #define FBX_COMMON_H
 
diff --git a/modules/fbx/fbx_parser/FBXDocument.h b/modules/fbx/fbx_parser/FBXDocument.h
index 885ff8fca4..539d633331 100644
--- a/modules/fbx/fbx_parser/FBXDocument.h
+++ b/modules/fbx/fbx_parser/FBXDocument.h
@@ -706,13 +706,13 @@ public:
 	virtual ~AnimationCurve();
 
 	/** get list of keyframe positions (time).
-     *  Invariant: |GetKeys()| > 0 */
+	 *  Invariant: |GetKeys()| > 0 */
 	const KeyTimeList &GetKeys() const {
 		return keys;
 	}
 
 	/** get list of keyframe values.
-      * Invariant: |GetKeys()| == |GetValues()| && |GetKeys()| > 0*/
+	 * Invariant: |GetKeys()| == |GetValues()| && |GetKeys()| > 0*/
 	const KeyValueList &GetValues() const {
 		return values;
 	}
@@ -750,8 +750,8 @@ typedef std::weak_ptr<AnimationCurveNode> AnimationCurveNodeWeakPtr;
 class AnimationCurveNode : public Object {
 public:
 	/* the optional white list specifies a list of property names for which the caller
-    wants animations for. If the curve node does not match one of these, std::range_error
-    will be thrown. */
+	wants animations for. If the curve node does not match one of these, std::range_error
+	will be thrown. */
 	AnimationCurveNode(uint64_t id, const ElementPtr element, const std::string &name, const Document &doc,
 			const char *const *target_prop_whitelist = nullptr, size_t whitelist_size = 0);
 
@@ -760,8 +760,8 @@ public:
 	const AnimationMap &Curves() const;
 
 	/** Object the curve is assigned to, this can be nullptr if the
-     *  target object has no DOM representation or could not
-     *  be read for other reasons.*/
+	 *  target object has no DOM representation or could not
+	 *  be read for other reasons.*/
 	Object *Target() const {
 		return target;
 	}
@@ -799,8 +799,8 @@ public:
 	virtual ~AnimationLayer();
 
 	/* the optional white list specifies a list of property names for which the caller
-    wants animations for. Curves not matching this list will not be added to the
-    animation layer. */
+	wants animations for. Curves not matching this list will not be added to the
+	animation layer. */
 	const AnimationCurveNodeList Nodes(const char *const *target_prop_whitelist = nullptr, size_t whitelist_size = 0) const;
 
 private:
@@ -891,15 +891,15 @@ public:
 	virtual ~Cluster();
 
 	/** get the list of deformer weights associated with this cluster.
-     *  Use #GetIndices() to get the associated vertices. Both arrays
-     *  have the same size (and may also be empty). */
+	 *  Use #GetIndices() to get the associated vertices. Both arrays
+	 *  have the same size (and may also be empty). */
 	const std::vector<float> &GetWeights() const {
 		return weights;
 	}
 
 	/** get indices into the vertex data of the geometry associated
-     *  with this cluster. Use #GetWeights() to get the associated weights.
-     *  Both arrays have the same size (and may also be empty). */
+	 *  with this cluster. Use #GetWeights() to get the associated weights.
+	 *  Both arrays have the same size (and may also be empty). */
 	const std::vector<unsigned int> &GetIndices() const {
 		return indices;
 	}
@@ -998,7 +998,7 @@ public:
 	LazyObject *LazyDestinationObject() const;
 
 	/** return the name of the property the connection is attached to.
-      * this is an empty string for object to object (OO) connections. */
+	 * this is an empty string for object to object (OO) connections. */
 	const std::string &PropertyName() const {
 		return prop;
 	}
diff --git a/modules/fbx/fbx_parser/FBXDocumentUtil.h b/modules/fbx/fbx_parser/FBXDocumentUtil.h
index ba86191c4a..0489ce10ce 100644
--- a/modules/fbx/fbx_parser/FBXDocumentUtil.h
+++ b/modules/fbx/fbx_parser/FBXDocumentUtil.h
@@ -107,12 +107,12 @@ const T *ProcessSimpleConnection(const Connection &con,
 		const char **propNameOut = nullptr) {
 	if (is_object_property_conn && !con.PropertyName().length()) {
 		DOMWarning("expected incoming " + std::string(name) +
-						   " link to be an object-object connection, ignoring",
+						" link to be an object-object connection, ignoring",
 				element);
 		return nullptr;
 	} else if (!is_object_property_conn && con.PropertyName().length()) {
 		DOMWarning("expected incoming " + std::string(name) +
-						   " link to be an object-property connection, ignoring",
+						" link to be an object-property connection, ignoring",
 				element);
 		return nullptr;
 	}
diff --git a/modules/fbx/fbx_parser/FBXImportSettings.h b/modules/fbx/fbx_parser/FBXImportSettings.h
index b016db174b..bc22386957 100644
--- a/modules/fbx/fbx_parser/FBXImportSettings.h
+++ b/modules/fbx/fbx_parser/FBXImportSettings.h
@@ -81,29 +81,29 @@ namespace FBXDocParser {
 /** FBX import settings, parts of which are publicly accessible via their corresponding AI_CONFIG constants */
 struct ImportSettings {
 	/** enable strict mode:
-     *   - only accept fbx 2012, 2013 files
-     *   - on the slightest error, give up.
-     *
-     *  Basically, strict mode means that the fbx file will actually
-     *  be validated.*/
+	 *   - only accept fbx 2012, 2013 files
+	 *   - on the slightest error, give up.
+	 *
+	 *  Basically, strict mode means that the fbx file will actually
+	 *  be validated.*/
 	bool strictMode = true;
 
 	/** specifies whether all geometry layers are read and scanned for
-      * usable data channels. The FBX spec indicates that many readers
-      * will only read the first channel and that this is in some way
-      * the recommended way- in reality, however, it happens a lot that
-      * vertex data is spread among multiple layers.*/
+	 * usable data channels. The FBX spec indicates that many readers
+	 * will only read the first channel and that this is in some way
+	 * the recommended way- in reality, however, it happens a lot that
+	 * vertex data is spread among multiple layers.*/
 	bool readAllLayers = true;
 
 	/** specifies whether all materials are read, or only those that
-     *  are referenced by at least one mesh. Reading all materials
-     *  may make FBX reading a lot slower since all objects
-     *  need to be processed.
-     *  This bit is ignored unless readMaterials=true.*/
+	 *  are referenced by at least one mesh. Reading all materials
+	 *  may make FBX reading a lot slower since all objects
+	 *  need to be processed.
+	 *  This bit is ignored unless readMaterials=true.*/
 	bool readAllMaterials = true;
 
 	/** import materials (true) or skip them and assign a default
-     *  material.*/
+	 *  material.*/
 	bool readMaterials = true;
 
 	/** import embedded textures?*/
@@ -116,35 +116,35 @@ struct ImportSettings {
 	bool readLights = true;
 
 	/** import animations (i.e. animation curves, the node
-     *  skeleton is always imported).*/
+	 *  skeleton is always imported).*/
 	bool readAnimations = true;
 
 	/** read bones (vertex weights and deform info).*/
 	bool readWeights = true;
 
 	/** preserve transformation pivots and offsets. Since these can
-     *  not directly be represented in assimp, additional dummy
-     *  nodes will be generated. Note that settings this to false
-     *  can make animation import a lot slower.
-     *
-     *  The naming scheme for the generated nodes is:
-     *    <OriginalName>_$AssimpFbx$_<TransformName>
-     *
-     *  where <TransformName> is one of
-     *    RotationPivot
-     *    RotationOffset
-     *    PreRotation
-     *    PostRotation
-     *    ScalingPivot
-     *    ScalingOffset
-     *    Translation
-     *    Scaling
-     *    Rotation
-     **/
+	 *  not directly be represented in assimp, additional dummy
+	 *  nodes will be generated. Note that settings this to false
+	 *  can make animation import a lot slower.
+	 *
+	 *  The naming scheme for the generated nodes is:
+	 *    <OriginalName>_$AssimpFbx$_<TransformName>
+	 *
+	 *  where <TransformName> is one of
+	 *    RotationPivot
+	 *    RotationOffset
+	 *    PreRotation
+	 *    PostRotation
+	 *    ScalingPivot
+	 *    ScalingOffset
+	 *    Translation
+	 *    Scaling
+	 *    Rotation
+	 **/
 	bool preservePivots = true;
 
 	/** do not import animation curves that specify a constant
-     *  values matching the corresponding node transformation.*/
+	 *  values matching the corresponding node transformation.*/
 	bool optimizeEmptyAnimationCurves = true;
 
 	/** use legacy naming for embedded textures eg: (*0, *1, *2).*/
diff --git a/modules/fbx/fbx_parser/FBXMeshGeometry.h b/modules/fbx/fbx_parser/FBXMeshGeometry.h
index c9b25f008d..26fc1914d1 100644
--- a/modules/fbx/fbx_parser/FBXMeshGeometry.h
+++ b/modules/fbx/fbx_parser/FBXMeshGeometry.h
@@ -226,7 +226,7 @@ public:
 	const std::vector<Vector3> &GetVertices() const;
 
 	/** Get a list of all vertex normals or an empty array if
-    *  no normals are specified. */
+	 *  no normals are specified. */
 	const std::vector<Vector3> &GetNormals() const;
 
 	/** Return list of vertex indices. */
@@ -238,8 +238,8 @@ private:
 	std::vector<unsigned int> m_indices;
 };
 /**
-*  DOM class for FBX geometry of type "Line"
-*/
+ *  DOM class for FBX geometry of type "Line"
+ */
 class LineGeometry : public Geometry {
 public:
 	/** The class constructor */
diff --git a/modules/fbx/fbx_parser/FBXParser.cpp b/modules/fbx/fbx_parser/FBXParser.cpp
index d9ef025a16..dbc9a0e46d 100644
--- a/modules/fbx/fbx_parser/FBXParser.cpp
+++ b/modules/fbx/fbx_parser/FBXParser.cpp
@@ -660,13 +660,6 @@ void ParseVectorDataArray(std::vector<Vector3> &out, const ElementPtr el) {
 						static_cast<real_t>(d[1]),
 						static_cast<real_t>(d[2])));
 			}
-			// for debugging
-			/*for ( size_t i = 0; i < out.size(); i++ ) {
-                aiVector3D vec3( out[ i ] );
-                std::stringstream stream;
-                stream << " vec3.x = " << vec3.x << " vec3.y = " << vec3.y << " vec3.z = " << vec3.z << std::endl;
-                DefaultLogger::get()->info( stream.str() );
-            }*/
 		} else if (type == 'f') {
 			const float *f = reinterpret_cast<const float *>(&buff[0]);
 			for (unsigned int i = 0; i < count3; ++i, f += 3) {
diff --git a/modules/fbx/fbx_parser/FBXParser.h b/modules/fbx/fbx_parser/FBXParser.h
index 93836c2205..27db18bf8a 100644
--- a/modules/fbx/fbx_parser/FBXParser.h
+++ b/modules/fbx/fbx_parser/FBXParser.h
@@ -187,7 +187,7 @@ private:
 class Parser {
 public:
 	/** Parse given a token list. Does not take ownership of the tokens -
-     *  the objects must persist during the entire parser lifetime */
+	 *  the objects must persist during the entire parser lifetime */
 	Parser(const TokenList &tokens, bool is_binary);
 	~Parser();
 
diff --git a/modules/fbx/fbx_parser/FBXProperties.cpp b/modules/fbx/fbx_parser/FBXProperties.cpp
index 37717e9109..b8c0f685ac 100644
--- a/modules/fbx/fbx_parser/FBXProperties.cpp
+++ b/modules/fbx/fbx_parser/FBXProperties.cpp
@@ -114,12 +114,12 @@ PropertyPtr ReadTypedProperty(const ElementPtr element) {
 	} else if (!strcmp(cs, "KTime")) {
 		return new TypedProperty<int64_t>(ParseTokenAsInt64(tok[4]));
 	} else if (!strcmp(cs, "Vector3D") ||
-			   !strcmp(cs, "ColorRGB") ||
-			   !strcmp(cs, "Vector") ||
-			   !strcmp(cs, "Color") ||
-			   !strcmp(cs, "Lcl Translation") ||
-			   !strcmp(cs, "Lcl Rotation") ||
-			   !strcmp(cs, "Lcl Scaling")) {
+			!strcmp(cs, "ColorRGB") ||
+			!strcmp(cs, "Vector") ||
+			!strcmp(cs, "Color") ||
+			!strcmp(cs, "Lcl Translation") ||
+			!strcmp(cs, "Lcl Rotation") ||
+			!strcmp(cs, "Lcl Scaling")) {
 		return new TypedProperty<Vector3>(Vector3(
 				ParseTokenAsFloat(tok[4]),
 				ParseTokenAsFloat(tok[5]),
diff --git a/modules/fbx/fbx_parser/FBXUtil.cpp b/modules/fbx/fbx_parser/FBXUtil.cpp
index 1f14a69099..df46bd85c7 100644
--- a/modules/fbx/fbx_parser/FBXUtil.cpp
+++ b/modules/fbx/fbx_parser/FBXUtil.cpp
@@ -169,10 +169,10 @@ char EncodeBase64(char byte) {
 }
 
 /** Encodes a block of 4 bytes to base64 encoding
-*  @param bytes Bytes to encode.
-*  @param out_string String to write encoded values to.
-*  @param string_pos Position in out_string.
-*/
+ *  @param bytes Bytes to encode.
+ *  @param out_string String to write encoded values to.
+ *  @param string_pos Position in out_string.
+ */
 void EncodeByteBlock(const char *bytes, std::string &out_string, size_t string_pos) {
 	char b0 = (bytes[0] & 0xFC) >> 2;
 	char b1 = (bytes[0] & 0x03) << 4 | ((bytes[1] & 0xF0) >> 4);
diff --git a/modules/fbx/fbx_parser/FBXUtil.h b/modules/fbx/fbx_parser/FBXUtil.h
index efc131831b..dab2a4201e 100644
--- a/modules/fbx/fbx_parser/FBXUtil.h
+++ b/modules/fbx/fbx_parser/FBXUtil.h
@@ -87,34 +87,34 @@ namespace Util {
 const char *TokenTypeString(TokenType t);
 
 /** Decode a single Base64-encoded character.
-*
-*  @param ch Character to decode (from base64 to binary).
-*  @return decoded byte value*/
+ *
+ *  @param ch Character to decode (from base64 to binary).
+ *  @return decoded byte value*/
 uint8_t DecodeBase64(char ch);
 
 /** Compute decoded size of a Base64-encoded string
-*
-*  @param in Characters to decode.
-*  @param inLength Number of characters to decode.
-*  @return size of the decoded data (number of bytes)*/
+ *
+ *  @param in Characters to decode.
+ *  @param inLength Number of characters to decode.
+ *  @return size of the decoded data (number of bytes)*/
 size_t ComputeDecodedSizeBase64(const char *in, size_t inLength);
 
 /** Decode a Base64-encoded string
-*
-*  @param in Characters to decode.
-*  @param inLength Number of characters to decode.
-*  @param out Pointer where we will store the decoded data.
-*  @param maxOutLength Size of output buffer.
-*  @return size of the decoded data (number of bytes)*/
+ *
+ *  @param in Characters to decode.
+ *  @param inLength Number of characters to decode.
+ *  @param out Pointer where we will store the decoded data.
+ *  @param maxOutLength Size of output buffer.
+ *  @return size of the decoded data (number of bytes)*/
 size_t DecodeBase64(const char *in, size_t inLength, uint8_t *out, size_t maxOutLength);
 
 char EncodeBase64(char byte);
 
 /** Encode bytes in base64-encoding
-*
-*  @param data Binary data to encode.
-*  @param inLength Number of bytes to encode.
-*  @return base64-encoded string*/
+ *
+ *  @param data Binary data to encode.
+ *  @param inLength Number of bytes to encode.
+ *  @return base64-encoded string*/
 std::string EncodeBase64(const char *data, size_t length);
 } // namespace Util
 } // namespace FBXDocParser
diff --git a/modules/fbx/tools/import_utils.h b/modules/fbx/tools/import_utils.h
index fbe7dbd82f..88c71fb87e 100644
--- a/modules/fbx/tools/import_utils.h
+++ b/modules/fbx/tools/import_utils.h
@@ -43,7 +43,7 @@
 /**
  * Import Utils
  * Conversion tools / glue code to convert from FBX to Godot
-*/
+ */
 class ImportUtils {
 public:
 	///	Convert a vector from degrees to radians.
@@ -201,7 +201,7 @@ public:
 	};
 
 	/** Get fbx fps for time mode meta data
-     */
+	 */
 	static float get_fbx_fps(int32_t time_mode) {
 		switch (time_mode) {
 			case AssetImportFbx::TIME_MODE_DEFAULT:
@@ -258,13 +258,13 @@ public:
 	}
 
 	/**
-	  * Find hardcoded textures from assimp which could be in many different directories
-	  */
+	 * Find hardcoded textures from assimp which could be in many different directories
+	 */
 
 	/**
-	  * set_texture_mapping_mode
-	  * Helper to check the mapping mode of the texture (repeat, clamp and mirror)
-	  */
+	 * set_texture_mapping_mode
+	 * Helper to check the mapping mode of the texture (repeat, clamp and mirror)
+	 */
 	// static void set_texture_mapping_mode(aiTextureMapMode *map_mode, Ref<ImageTexture> texture) {
 	// 	ERR_FAIL_COND(texture.is_null());
 	// 	ERR_FAIL_COND(map_mode == nullptr);
@@ -282,9 +282,9 @@ public:
 	// }
 
 	/**
-	  * Load or load from cache image :)
-	  * We need to upgrade this in the later version :) should not be hard
-	  */
+	 * Load or load from cache image :)
+	 * We need to upgrade this in the later version :) should not be hard
+	 */
 	//static Ref<Image> load_image(ImportState &state, const aiScene *p_scene, String p_path){
 	// Map<String, Ref<Image> >::Element *match = state.path_to_image_cache.find(p_path);
 
diff --git a/modules/gdnative/pluginscript/pluginscript_script.cpp b/modules/gdnative/pluginscript/pluginscript_script.cpp
index 2b4ceda49d..04a293ddbd 100644
--- a/modules/gdnative/pluginscript/pluginscript_script.cpp
+++ b/modules/gdnative/pluginscript/pluginscript_script.cpp
@@ -361,13 +361,6 @@ Error PluginScript::reload(bool p_keep_state) {
 		_properties_default_values[pi.name] = v["default_value"];
 	}
 
-#ifdef TOOLS_ENABLED
-/*for (Set<PlaceHolderScriptInstance*>::Element *E=placeholders.front();E;E=E->next()) {
-
-        _update_placeholder(E->get());
-    }*/
-#endif
-
 	FREE_SCRIPT_MANIFEST(manifest);
 	return OK;
 #undef FREE_SCRIPT_MANIFEST
diff --git a/modules/gdscript/gdscript.cpp b/modules/gdscript/gdscript.cpp
index 42865242d3..2e55506fd4 100644
--- a/modules/gdscript/gdscript.cpp
+++ b/modules/gdscript/gdscript.cpp
@@ -2040,15 +2040,15 @@ void GDScriptLanguage::get_reserved_words(List<String> *p_words) const {
 
 bool GDScriptLanguage::is_control_flow_keyword(String p_keyword) const {
 	return p_keyword == "break" ||
-		   p_keyword == "continue" ||
-		   p_keyword == "elif" ||
-		   p_keyword == "else" ||
-		   p_keyword == "if" ||
-		   p_keyword == "for" ||
-		   p_keyword == "match" ||
-		   p_keyword == "pass" ||
-		   p_keyword == "return" ||
-		   p_keyword == "while";
+			p_keyword == "continue" ||
+			p_keyword == "elif" ||
+			p_keyword == "else" ||
+			p_keyword == "if" ||
+			p_keyword == "for" ||
+			p_keyword == "match" ||
+			p_keyword == "pass" ||
+			p_keyword == "return" ||
+			p_keyword == "while";
 }
 
 bool GDScriptLanguage::handles_global_class_type(const String &p_type) const {
diff --git a/modules/gdscript/gdscript_parser.cpp b/modules/gdscript/gdscript_parser.cpp
index 8cb25e2c03..b96139ac51 100644
--- a/modules/gdscript/gdscript_parser.cpp
+++ b/modules/gdscript/gdscript_parser.cpp
@@ -3068,9 +3068,9 @@ void GDScriptParser::get_class_doc_comment(int p_line, String &p_brief, String &
 
 			} else {
 				/* Syntax:
-				   @tutorial ( The Title Here )         :         https://the.url/
-				             ^ open           ^ close   ^ colon   ^ url
-				*/
+				 *   @tutorial ( The Title Here )         :         https://the.url/
+				 *             ^ open           ^ close   ^ colon   ^ url
+				 */
 				int open_bracket_pos = begin_scan, close_bracket_pos = 0;
 				while (open_bracket_pos < striped_line.length() && (striped_line[open_bracket_pos] == ' ' || striped_line[open_bracket_pos] == '\t')) {
 					open_bracket_pos++;
diff --git a/modules/gdscript/gdscript_vm.cpp b/modules/gdscript/gdscript_vm.cpp
index 40f03979c6..a1cc2246d6 100644
--- a/modules/gdscript/gdscript_vm.cpp
+++ b/modules/gdscript/gdscript_vm.cpp
@@ -1110,7 +1110,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
 					} else {
 #ifdef DEBUG_ENABLED
 						err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
-								   "' to a variable of type '" + Variant::get_type_name(var_type) + "'.";
+								"' to a variable of type '" + Variant::get_type_name(var_type) + "'.";
 						OPCODE_BREAK;
 					}
 				} else {
@@ -1132,7 +1132,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
 				if (src->get_type() != Variant::ARRAY) {
 #ifdef DEBUG_ENABLED
 					err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
-							   "' to a variable of type '" + +"'.";
+							"' to a variable of type '" + +"'.";
 #endif
 					OPCODE_BREAK;
 				}
@@ -1158,14 +1158,14 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
 				GD_ERR_BREAK(!nc);
 				if (src->get_type() != Variant::OBJECT && src->get_type() != Variant::NIL) {
 					err_text = "Trying to assign value of type '" + Variant::get_type_name(src->get_type()) +
-							   "' to a variable of type '" + nc->get_name() + "'.";
+							"' to a variable of type '" + nc->get_name() + "'.";
 					OPCODE_BREAK;
 				}
 				Object *src_obj = src->operator Object *();
 
 				if (src_obj && !ClassDB::is_parent_class(src_obj->get_class_name(), nc->get_name())) {
 					err_text = "Trying to assign value of type '" + src_obj->get_class_name() +
-							   "' to a variable of type '" + nc->get_name() + "'.";
+							"' to a variable of type '" + nc->get_name() + "'.";
 					OPCODE_BREAK;
 				}
 #endif // DEBUG_ENABLED
@@ -1195,7 +1195,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
 					ScriptInstance *scr_inst = src->operator Object *()->get_script_instance();
 					if (!scr_inst) {
 						err_text = "Trying to assign value of type '" + src->operator Object *()->get_class_name() +
-								   "' to a variable of type '" + base_type->get_path().get_file() + "'.";
+								"' to a variable of type '" + base_type->get_path().get_file() + "'.";
 						OPCODE_BREAK;
 					}
 
@@ -1212,7 +1212,7 @@ Variant GDScriptFunction::call(GDScriptInstance *p_instance, const Variant **p_a
 
 					if (!valid) {
 						err_text = "Trying to assign value of type '" + src->operator Object *()->get_script_instance()->get_script()->get_path().get_file() +
-								   "' to a variable of type '" + base_type->get_path().get_file() + "'.";
+								"' to a variable of type '" + base_type->get_path().get_file() + "'.";
 						OPCODE_BREAK;
 					}
 				}
diff --git a/modules/gdscript/language_server/lsp.hpp b/modules/gdscript/language_server/lsp.hpp
index 3710a84a28..b12d1f5f3b 100644
--- a/modules/gdscript/language_server/lsp.hpp
+++ b/modules/gdscript/language_server/lsp.hpp
@@ -358,21 +358,21 @@ struct Command {
 
 namespace TextDocumentSyncKind {
 /**
-	 * Documents should not be synced at all.
-	 */
+ * Documents should not be synced at all.
+ */
 static const int None = 0;
 
 /**
-	 * Documents are synced by always sending the full content
-	 * of the document.
-	 */
+ * Documents are synced by always sending the full content
+ * of the document.
+ */
 static const int Full = 1;
 
 /**
-	 * Documents are synced by sending the full content on open.
-	 * After that only incremental updates to the document are
-	 * send.
-	 */
+ * Documents are synced by sending the full content on open.
+ * After that only incremental updates to the document are
+ * send.
+ */
 static const int Incremental = 2;
 }; // namespace TextDocumentSyncKind
 
@@ -667,20 +667,20 @@ struct TextDocumentContentChangeEvent {
 // Use namespace instead of enumeration to follow the LSP specifications
 namespace DiagnosticSeverity {
 /**
-	 * Reports an error.
-	 */
+ * Reports an error.
+ */
 static const int Error = 1;
 /**
-	 * Reports a warning.
-	 */
+ * Reports a warning.
+ */
 static const int Warning = 2;
 /**
-	 * Reports an information.
-	 */
+ * Reports an information.
+ */
 static const int Information = 3;
 /**
-	 * Reports a hint.
-	 */
+ * Reports a hint.
+ */
 static const int Hint = 4;
 }; // namespace DiagnosticSeverity
 
@@ -871,18 +871,18 @@ static const int TypeParameter = 25;
  */
 namespace InsertTextFormat {
 /**
-	 * The primary text to be inserted is treated as a plain string.
-	 */
+ * The primary text to be inserted is treated as a plain string.
+ */
 static const int PlainText = 1;
 
 /**
-	 * The primary text to be inserted is treated as a snippet.
-	 *
-	 * A snippet can define tab stops and placeholders with `$1`, `$2`
-	 * and `${3:foo}`. `$0` defines the final tab stop, it defaults to
-	 * the end of the snippet. Placeholders with equal identifiers are linked,
-	 * that is typing in one will update others too.
-	 */
+ * The primary text to be inserted is treated as a snippet.
+ *
+ * A snippet can define tab stops and placeholders with `$1`, `$2`
+ * and `${3:foo}`. `$0` defines the final tab stop, it defaults to
+ * the end of the snippet. Placeholders with equal identifiers are linked,
+ * that is typing in one will update others too.
+ */
 static const int Snippet = 2;
 }; // namespace InsertTextFormat
 
@@ -1359,16 +1359,16 @@ struct NativeSymbolInspectParams {
  */
 namespace FoldingRangeKind {
 /**
-	 * Folding range for a comment
-	 */
+ * Folding range for a comment
+ */
 static const String Comment = "comment";
 /**
-	 * Folding range for a imports or includes
-	 */
+ * Folding range for a imports or includes
+ */
 static const String Imports = "imports";
 /**
-	 * Folding range for a region (e.g. `#region`)
-	 */
+ * Folding range for a region (e.g. `#region`)
+ */
 static const String Region = "region";
 } // namespace FoldingRangeKind
 
@@ -1419,20 +1419,20 @@ struct FoldingRange {
  */
 namespace CompletionTriggerKind {
 /**
-	 * Completion was triggered by typing an identifier (24x7 code
-	 * complete), manual invocation (e.g Ctrl+Space) or via API.
-	 */
+ * Completion was triggered by typing an identifier (24x7 code
+ * complete), manual invocation (e.g Ctrl+Space) or via API.
+ */
 static const int Invoked = 1;
 
 /**
-	 * Completion was triggered by a trigger character specified by
-	 * the `triggerCharacters` properties of the `CompletionRegistrationOptions`.
-	 */
+ * Completion was triggered by a trigger character specified by
+ * the `triggerCharacters` properties of the `CompletionRegistrationOptions`.
+ */
 static const int TriggerCharacter = 2;
 
 /**
-	 * Completion was re-triggered as the current completion list is incomplete.
-	 */
+ * Completion was re-triggered as the current completion list is incomplete.
+ */
 static const int TriggerForIncompleteCompletions = 3;
 } // namespace CompletionTriggerKind
 
@@ -1441,8 +1441,8 @@ static const int TriggerForIncompleteCompletions = 3;
  */
 struct CompletionContext {
 	/**
-	* How the completion was triggered.
-	*/
+	 * How the completion was triggered.
+	 */
 	int triggerKind = CompletionTriggerKind::TriggerCharacter;
 
 	/**
@@ -1906,7 +1906,7 @@ struct GodotNativeClassInfo {
 struct GodotCapabilities {
 	/**
 	 * Native class list
-	*/
+	 */
 	List<GodotNativeClassInfo> native_classes;
 
 	Dictionary to_json() {
diff --git a/modules/gltf/gltf_document.cpp b/modules/gltf/gltf_document.cpp
index 3a8cab7e7e..333fc4637d 100644
--- a/modules/gltf/gltf_document.cpp
+++ b/modules/gltf/gltf_document.cpp
@@ -2498,8 +2498,7 @@ Error GLTFDocument::_parse_meshes(Ref<GLTFState> state) {
 		ERR_FAIL_COND_V(!d.has("primitives"), ERR_PARSE_ERROR);
 
 		Array primitives = d["primitives"];
-		const Dictionary &extras = d.has("extras") ? (Dictionary)d["extras"] :
-													   Dictionary();
+		const Dictionary &extras = d.has("extras") ? (Dictionary)d["extras"] : Dictionary();
 		Ref<ImporterMesh> import_mesh;
 		import_mesh.instantiate();
 		String mesh_name = "mesh";
@@ -5447,7 +5446,7 @@ void GLTFDocument::_convert_multi_mesh_instance_to_gltf(
 			transform = p_multi_mesh_instance->get_transform() * transform;
 		} else if (multi_mesh->get_transform_format() == MultiMesh::TRANSFORM_3D) {
 			transform = p_multi_mesh_instance->get_transform() *
-						multi_mesh->get_instance_transform(instance_i);
+					multi_mesh->get_instance_transform(instance_i);
 		}
 		Ref<GLTFNode> new_gltf_node;
 		new_gltf_node.instantiate();
diff --git a/modules/lightmapper_rd/lightmapper_rd.h b/modules/lightmapper_rd/lightmapper_rd.h
index e1657b2069..51ab60fc29 100644
--- a/modules/lightmapper_rd/lightmapper_rd.h
+++ b/modules/lightmapper_rd/lightmapper_rd.h
@@ -73,13 +73,13 @@ class LightmapperRD : public Lightmapper {
 
 		bool operator==(const Vertex &p_vtx) const {
 			return (position[0] == p_vtx.position[0]) &&
-				   (position[1] == p_vtx.position[1]) &&
-				   (position[2] == p_vtx.position[2]) &&
-				   (uv[0] == p_vtx.uv[0]) &&
-				   (uv[1] == p_vtx.uv[1]) &&
-				   (normal_xy[0] == p_vtx.normal_xy[0]) &&
-				   (normal_xy[1] == p_vtx.normal_xy[1]) &&
-				   (normal_z == p_vtx.normal_z);
+					(position[1] == p_vtx.position[1]) &&
+					(position[2] == p_vtx.position[2]) &&
+					(uv[0] == p_vtx.uv[0]) &&
+					(uv[1] == p_vtx.uv[1]) &&
+					(normal_xy[0] == p_vtx.normal_xy[0]) &&
+					(normal_xy[1] == p_vtx.normal_xy[1]) &&
+					(normal_z == p_vtx.normal_z);
 		}
 	};
 
diff --git a/modules/mono/csharp_script.cpp b/modules/mono/csharp_script.cpp
index 531f600c3f..b85b65e6d9 100644
--- a/modules/mono/csharp_script.cpp
+++ b/modules/mono/csharp_script.cpp
@@ -313,22 +313,22 @@ void CSharpLanguage::get_reserved_words(List<String> *p_words) const {
 
 bool CSharpLanguage::is_control_flow_keyword(String p_keyword) const {
 	return p_keyword == "break" ||
-		   p_keyword == "case" ||
-		   p_keyword == "catch" ||
-		   p_keyword == "continue" ||
-		   p_keyword == "default" ||
-		   p_keyword == "do" ||
-		   p_keyword == "else" ||
-		   p_keyword == "finally" ||
-		   p_keyword == "for" ||
-		   p_keyword == "foreach" ||
-		   p_keyword == "goto" ||
-		   p_keyword == "if" ||
-		   p_keyword == "return" ||
-		   p_keyword == "switch" ||
-		   p_keyword == "throw" ||
-		   p_keyword == "try" ||
-		   p_keyword == "while";
+			p_keyword == "case" ||
+			p_keyword == "catch" ||
+			p_keyword == "continue" ||
+			p_keyword == "default" ||
+			p_keyword == "do" ||
+			p_keyword == "else" ||
+			p_keyword == "finally" ||
+			p_keyword == "for" ||
+			p_keyword == "foreach" ||
+			p_keyword == "goto" ||
+			p_keyword == "if" ||
+			p_keyword == "return" ||
+			p_keyword == "switch" ||
+			p_keyword == "throw" ||
+			p_keyword == "try" ||
+			p_keyword == "while";
 }
 
 void CSharpLanguage::get_comment_delimiters(List<String> *p_delimiters) const {
@@ -3265,8 +3265,7 @@ ScriptInstance *CSharpScript::instance_create(Object *p_this) {
 						"Script inherits from native type '" + String(native_name) +
 								"', so it can't be instantiated in object of type: '" + p_this->get_class() + "'");
 			}
-			ERR_FAIL_V_MSG(nullptr, "Script inherits from native type '" + String(native_name) +
-											"', so it can't be instantiated in object of type: '" + p_this->get_class() + "'.");
+			ERR_FAIL_V_MSG(nullptr, "Script inherits from native type '" + String(native_name) + "', so it can't be instantiated in object of type: '" + p_this->get_class() + "'.");
 		}
 	}
 
@@ -3529,10 +3528,10 @@ Error CSharpScript::load_source_code(const String &p_path) {
 	Error ferr = read_all_file_utf8(p_path, source);
 
 	ERR_FAIL_COND_V_MSG(ferr != OK, ferr,
-			ferr == ERR_INVALID_DATA ?
-					  "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
-										  " Please ensure that scripts are saved in valid UTF-8 unicode." :
-					  "Failed to read file: '" + p_path + "'.");
+			ferr == ERR_INVALID_DATA
+					? "Script '" + p_path + "' contains invalid unicode (UTF-8), so it was not loaded."
+											" Please ensure that scripts are saved in valid UTF-8 unicode."
+					: "Failed to read file: '" + p_path + "'.");
 
 #ifdef TOOLS_ENABLED
 	source_changed_cache = true;
diff --git a/modules/mono/editor/bindings_generator.cpp b/modules/mono/editor/bindings_generator.cpp
index e03c5fd248..148a6796d2 100644
--- a/modules/mono/editor/bindings_generator.cpp
+++ b/modules/mono/editor/bindings_generator.cpp
@@ -365,8 +365,7 @@ String BindingsGenerator::bbcode_to_xml(const String &p_bbcode, const TypeInterf
 				xml_output.append(link_target);
 				xml_output.append("</c>");
 			} else if (link_tag == "enum") {
-				StringName search_cname = !target_itype ? target_cname :
-															StringName(target_itype->name + "." + (String)target_cname);
+				StringName search_cname = !target_itype ? target_cname : StringName(target_itype->name + "." + (String)target_cname);
 
 				const Map<StringName, TypeInterface>::Element *enum_match = enum_types.find(search_cname);
 
@@ -1524,7 +1523,7 @@ Error BindingsGenerator::_generate_cs_property(const BindingsGenerator::TypeInte
 		if (getter->return_type.cname != setter_first_arg.type.cname) {
 			// Special case for Node::set_name
 			bool whitelisted = getter->return_type.cname == name_cache.type_StringName &&
-							   setter_first_arg.type.cname == name_cache.type_String;
+					setter_first_arg.type.cname == name_cache.type_String;
 
 			ERR_FAIL_COND_V_MSG(!whitelisted, ERR_BUG,
 					"Return type from getter doesn't match first argument of setter for property: '" +
@@ -2481,29 +2480,29 @@ bool BindingsGenerator::_arg_default_value_is_assignable_to_type(const Variant &
 	switch (p_val.get_type()) {
 		case Variant::NIL:
 			return p_arg_type.is_object_type ||
-				   name_cache.is_nullable_type(p_arg_type.name);
+					name_cache.is_nullable_type(p_arg_type.name);
 		case Variant::BOOL:
 			return p_arg_type.name == name_cache.type_bool;
 		case Variant::INT:
 			return p_arg_type.name == name_cache.type_sbyte ||
-				   p_arg_type.name == name_cache.type_short ||
-				   p_arg_type.name == name_cache.type_int ||
-				   p_arg_type.name == name_cache.type_byte ||
-				   p_arg_type.name == name_cache.type_ushort ||
-				   p_arg_type.name == name_cache.type_uint ||
-				   p_arg_type.name == name_cache.type_long ||
-				   p_arg_type.name == name_cache.type_ulong ||
-				   p_arg_type.name == name_cache.type_float ||
-				   p_arg_type.name == name_cache.type_double ||
-				   p_arg_type.is_enum;
+					p_arg_type.name == name_cache.type_short ||
+					p_arg_type.name == name_cache.type_int ||
+					p_arg_type.name == name_cache.type_byte ||
+					p_arg_type.name == name_cache.type_ushort ||
+					p_arg_type.name == name_cache.type_uint ||
+					p_arg_type.name == name_cache.type_long ||
+					p_arg_type.name == name_cache.type_ulong ||
+					p_arg_type.name == name_cache.type_float ||
+					p_arg_type.name == name_cache.type_double ||
+					p_arg_type.is_enum;
 		case Variant::FLOAT:
 			return p_arg_type.name == name_cache.type_float ||
-				   p_arg_type.name == name_cache.type_double;
+					p_arg_type.name == name_cache.type_double;
 		case Variant::STRING:
 		case Variant::STRING_NAME:
 			return p_arg_type.name == name_cache.type_String ||
-				   p_arg_type.name == name_cache.type_StringName ||
-				   p_arg_type.name == name_cache.type_NodePath;
+					p_arg_type.name == name_cache.type_StringName ||
+					p_arg_type.name == name_cache.type_NodePath;
 		case Variant::NODE_PATH:
 			return p_arg_type.name == name_cache.type_NodePath;
 		case Variant::TRANSFORM2D:
@@ -2535,13 +2534,13 @@ bool BindingsGenerator::_arg_default_value_is_assignable_to_type(const Variant &
 			return p_arg_type.is_object_type;
 		case Variant::VECTOR2I:
 			return p_arg_type.name == name_cache.type_Vector2 ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		case Variant::RECT2I:
 			return p_arg_type.name == name_cache.type_Rect2 ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		case Variant::VECTOR3I:
 			return p_arg_type.name == name_cache.type_Vector3 ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		default:
 			CRASH_NOW_MSG("Unexpected Variant type: " + itos(p_val.get_type()));
 			break;
@@ -2714,7 +2713,7 @@ bool BindingsGenerator::_populate_object_type_interfaces() {
 				if (itype.cname != name_cache.type_Object || imethod.name != "free") {
 					WARN_PRINT("Notification: New unexpected virtual non-overridable method found."
 							   " We only expected Object.free, but found '" +
-							   itype.name + "." + imethod.name + "'.");
+							itype.name + "." + imethod.name + "'.");
 				}
 			} else if (return_info.type == Variant::INT && return_info.usage & PROPERTY_USAGE_CLASS_IS_ENUM) {
 				imethod.return_type.cname = return_info.class_name;
@@ -2723,7 +2722,7 @@ bool BindingsGenerator::_populate_object_type_interfaces() {
 				imethod.return_type.cname = return_info.class_name;
 
 				bool bad_reference_hint = !imethod.is_virtual && return_info.hint != PROPERTY_HINT_RESOURCE_TYPE &&
-										  ClassDB::is_parent_class(return_info.class_name, name_cache.type_RefCounted);
+						ClassDB::is_parent_class(return_info.class_name, name_cache.type_RefCounted);
 				ERR_FAIL_COND_V_MSG(bad_reference_hint, false,
 						String() + "Return type is reference but hint is not '" _STR(PROPERTY_HINT_RESOURCE_TYPE) "'." +
 								" Are you returning a reference type by pointer? Method: '" + itype.name + "." + imethod.name + "'.");
diff --git a/modules/mono/mono_gd/gd_mono.cpp b/modules/mono/mono_gd/gd_mono.cpp
index 1b1349a3a3..f3e83b26b9 100644
--- a/modules/mono/mono_gd/gd_mono.cpp
+++ b/modules/mono/mono_gd/gd_mono.cpp
@@ -151,7 +151,7 @@ void gd_mono_debug_init() {
 
 	if (da_args.length() == 0) {
 		da_args = String("--debugger-agent=transport=dt_socket,address=127.0.0.1:" + itos(da_port) +
-						 ",embedding=1,server=y,suspend=" + (da_suspend ? "y,timeout=" + itos(da_timeout) : "n"))
+				",embedding=1,server=y,suspend=" + (da_suspend ? "y,timeout=" + itos(da_timeout) : "n"))
 						  .utf8();
 	}
 #else
@@ -592,9 +592,9 @@ bool GDMono::load_assembly_from(const String &p_name, const String &p_path, GDMo
 ApiAssemblyInfo::Version ApiAssemblyInfo::Version::get_from_loaded_assembly(GDMonoAssembly *p_api_assembly, ApiAssemblyInfo::Type p_api_type) {
 	ApiAssemblyInfo::Version api_assembly_version;
 
-	const char *nativecalls_name = p_api_type == ApiAssemblyInfo::API_CORE ?
-											 BINDINGS_CLASS_NATIVECALLS :
-											 BINDINGS_CLASS_NATIVECALLS_EDITOR;
+	const char *nativecalls_name = p_api_type == ApiAssemblyInfo::API_CORE
+			? BINDINGS_CLASS_NATIVECALLS
+			: BINDINGS_CLASS_NATIVECALLS_EDITOR;
 
 	GDMonoClass *nativecalls_klass = p_api_assembly->get_class(BINDINGS_NAMESPACE, nativecalls_name);
 
@@ -702,11 +702,11 @@ static bool try_get_cached_api_hash_for(const String &p_api_assemblies_dir, bool
 	}
 
 	r_out_of_sync = GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("core", "bindings_version") ||
-					GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("core", "cs_glue_version") ||
-					GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("editor", "bindings_version") ||
-					GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("editor", "cs_glue_version") ||
-					GodotSharpBindings::get_core_api_hash() != (uint64_t)cfg->get_value("core", "api_hash") ||
-					GodotSharpBindings::get_editor_api_hash() != (uint64_t)cfg->get_value("editor", "api_hash");
+			GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("core", "cs_glue_version") ||
+			GodotSharpBindings::get_bindings_version() != (uint32_t)cfg->get_value("editor", "bindings_version") ||
+			GodotSharpBindings::get_cs_glue_version() != (uint32_t)cfg->get_value("editor", "cs_glue_version") ||
+			GodotSharpBindings::get_core_api_hash() != (uint64_t)cfg->get_value("core", "api_hash") ||
+			GodotSharpBindings::get_editor_api_hash() != (uint64_t)cfg->get_value("editor", "api_hash");
 
 	return true;
 }
@@ -754,14 +754,10 @@ bool GDMono::_temp_domain_load_are_assemblies_out_of_sync(const String &p_config
 }
 
 String GDMono::update_api_assemblies_from_prebuilt(const String &p_config, const bool *p_core_api_out_of_sync, const bool *p_editor_api_out_of_sync) {
-#define FAIL_REASON(m_out_of_sync, m_prebuilt_exists)                            \
-	(                                                                            \
-			(m_out_of_sync ?                                                     \
-							  String("The assembly is invalidated ") :             \
-							  String("The assembly was not found ")) +             \
-			(m_prebuilt_exists ?                                                 \
-							  String("and the prebuilt assemblies are missing.") : \
-							  String("and we failed to copy the prebuilt assemblies.")))
+#define FAIL_REASON(m_out_of_sync, m_prebuilt_exists)                                                          \
+	(                                                                                                          \
+			(m_out_of_sync ? String("The assembly is invalidated ") : String("The assembly was not found ")) + \
+			(m_prebuilt_exists ? String("and the prebuilt assemblies are missing.") : String("and we failed to copy the prebuilt assemblies.")))
 
 	String dst_assemblies_dir = GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config);
 
@@ -819,14 +815,14 @@ bool GDMono::_load_core_api_assembly(LoadedApiAssembly &r_loaded_api_assembly, c
 	// For the editor and the editor player we want to load it from a specific path to make sure we can keep it up to date
 
 	// If running the project manager, load it from the prebuilt API directory
-	String assembly_dir = !Main::is_project_manager() ?
-									GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
-									GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+	String assembly_dir = !Main::is_project_manager()
+			? GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config)
+			: GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
 
 	String assembly_path = assembly_dir.plus_file(CORE_API_ASSEMBLY_NAME ".dll");
 
 	bool success = FileAccess::exists(assembly_path) &&
-				   load_assembly_from(CORE_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
+			load_assembly_from(CORE_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
 #else
 	bool success = load_assembly(CORE_API_ASSEMBLY_NAME, &r_loaded_api_assembly.assembly, p_refonly);
 #endif
@@ -834,8 +830,8 @@ bool GDMono::_load_core_api_assembly(LoadedApiAssembly &r_loaded_api_assembly, c
 	if (success) {
 		ApiAssemblyInfo::Version api_assembly_ver = ApiAssemblyInfo::Version::get_from_loaded_assembly(r_loaded_api_assembly.assembly, ApiAssemblyInfo::API_CORE);
 		r_loaded_api_assembly.out_of_sync = GodotSharpBindings::get_core_api_hash() != api_assembly_ver.godot_api_hash ||
-											GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
-											GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
+				GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
+				GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
 	} else {
 		r_loaded_api_assembly.out_of_sync = false;
 	}
@@ -852,20 +848,20 @@ bool GDMono::_load_editor_api_assembly(LoadedApiAssembly &r_loaded_api_assembly,
 	// For the editor and the editor player we want to load it from a specific path to make sure we can keep it up to date
 
 	// If running the project manager, load it from the prebuilt API directory
-	String assembly_dir = !Main::is_project_manager() ?
-									GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config) :
-									GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
+	String assembly_dir = !Main::is_project_manager()
+			? GodotSharpDirs::get_res_assemblies_base_dir().plus_file(p_config)
+			: GodotSharpDirs::get_data_editor_prebuilt_api_dir().plus_file(p_config);
 
 	String assembly_path = assembly_dir.plus_file(EDITOR_API_ASSEMBLY_NAME ".dll");
 
 	bool success = FileAccess::exists(assembly_path) &&
-				   load_assembly_from(EDITOR_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
+			load_assembly_from(EDITOR_API_ASSEMBLY_NAME, assembly_path, &r_loaded_api_assembly.assembly, p_refonly);
 
 	if (success) {
 		ApiAssemblyInfo::Version api_assembly_ver = ApiAssemblyInfo::Version::get_from_loaded_assembly(r_loaded_api_assembly.assembly, ApiAssemblyInfo::API_EDITOR);
 		r_loaded_api_assembly.out_of_sync = GodotSharpBindings::get_editor_api_hash() != api_assembly_ver.godot_api_hash ||
-											GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
-											GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
+				GodotSharpBindings::get_bindings_version() != api_assembly_ver.bindings_version ||
+				GodotSharpBindings::get_cs_glue_version() != api_assembly_ver.cs_glue_version;
 	} else {
 		r_loaded_api_assembly.out_of_sync = false;
 	}
@@ -985,7 +981,7 @@ bool GDMono::_load_tools_assemblies() {
 	}
 
 	bool success = load_assembly(TOOLS_ASM_NAME, &tools_assembly) &&
-				   load_assembly(TOOLS_PROJECT_EDITOR_ASM_NAME, &tools_project_editor_assembly);
+			load_assembly(TOOLS_PROJECT_EDITOR_ASM_NAME, &tools_project_editor_assembly);
 
 	return success;
 }
@@ -1363,8 +1359,8 @@ int32_t GodotSharp::get_scripts_domain_id() {
 
 bool GodotSharp::is_scripts_domain_loaded() {
 	return GDMono::get_singleton() != nullptr &&
-		   GDMono::get_singleton()->is_runtime_initialized() &&
-		   GDMono::get_singleton()->get_scripts_domain() != nullptr;
+			GDMono::get_singleton()->is_runtime_initialized() &&
+			GDMono::get_singleton()->get_scripts_domain() != nullptr;
 }
 
 bool GodotSharp::_is_domain_finalizing_for_unload(int32_t p_domain_id) {
diff --git a/modules/mono/mono_gd/gd_mono.h b/modules/mono/mono_gd/gd_mono.h
index 4170e5053f..a18fa6c6b4 100644
--- a/modules/mono/mono_gd/gd_mono.h
+++ b/modules/mono/mono_gd/gd_mono.h
@@ -54,8 +54,8 @@ struct Version {
 
 	bool operator==(const Version &p_other) const {
 		return godot_api_hash == p_other.godot_api_hash &&
-			   bindings_version == p_other.bindings_version &&
-			   cs_glue_version == p_other.cs_glue_version;
+				bindings_version == p_other.bindings_version &&
+				cs_glue_version == p_other.cs_glue_version;
 	}
 
 	Version() {}
diff --git a/modules/mono/mono_gd/gd_mono_class.cpp b/modules/mono/mono_gd/gd_mono_class.cpp
index 27b4ac7fa7..4f4480fa49 100644
--- a/modules/mono/mono_gd/gd_mono_class.cpp
+++ b/modules/mono/mono_gd/gd_mono_class.cpp
@@ -187,7 +187,7 @@ void GDMonoClass::fetch_methods_with_godot_api_checks(GDMonoClass *p_native_base
 #ifdef DEBUG_ENABLED
 			String fullname = method->get_ret_type_full_name() + " " + name + "(" + method->get_signature_desc(true) + ")";
 			WARN_PRINT("Method '" + fullname + "' is hidden by Godot API method. Should be '" +
-					   method->get_full_name_no_class() + "'. In class '" + namespace_name + "." + class_name + "'.");
+					method->get_full_name_no_class() + "'. In class '" + namespace_name + "." + class_name + "'.");
 #endif
 			continue;
 		}
@@ -205,7 +205,7 @@ void GDMonoClass::fetch_methods_with_godot_api_checks(GDMonoClass *p_native_base
 					// found
 					String fullname = m->get_ret_type_full_name() + " " + name + "(" + m->get_signature_desc(true) + ")";
 					WARN_PRINT("Method '" + fullname + "' should be '" + m->get_full_name_no_class() +
-							   "'. In class '" + namespace_name + "." + class_name + "'.");
+							"'. In class '" + namespace_name + "." + class_name + "'.");
 					break;
 				}
 
diff --git a/modules/mono/mono_gd/gd_mono_marshal.cpp b/modules/mono/mono_gd/gd_mono_marshal.cpp
index 1904634132..6b395303dd 100644
--- a/modules/mono/mono_gd/gd_mono_marshal.cpp
+++ b/modules/mono/mono_gd/gd_mono_marshal.cpp
@@ -398,8 +398,7 @@ MonoArray *variant_to_mono_array(const Variant &p_var, GDMonoClass *p_type_class
 		return Array_to_mono_array(p_var.operator ::Array(), array_type->eklass);
 	}
 
-	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to array of unsupported element type:" +
-									GDMonoClass::get_full_name(array_type->eklass) + "'.");
+	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to array of unsupported element type:" + GDMonoClass::get_full_name(array_type->eklass) + "'.");
 }
 
 MonoObject *variant_to_mono_object_of_class(const Variant &p_var, GDMonoClass *p_type_class) {
@@ -432,8 +431,7 @@ MonoObject *variant_to_mono_object_of_class(const Variant &p_var, GDMonoClass *p
 		return GDMonoUtils::create_managed_from(p_var.operator Array(), CACHED_CLASS(Array));
 	}
 
-	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type: '" +
-									p_type_class->get_full_name() + "'.");
+	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type: '" + p_type_class->get_full_name() + "'.");
 }
 
 MonoObject *variant_to_mono_object_of_genericinst(const Variant &p_var, GDMonoClass *p_type_class) {
@@ -488,8 +486,7 @@ MonoObject *variant_to_mono_object_of_genericinst(const Variant &p_var, GDMonoCl
 		return GDMonoUtils::unmanaged_get_managed(p_var.operator Object *());
 	}
 
-	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported generic type: '" +
-									p_type_class->get_full_name() + "'.");
+	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported generic type: '" + p_type_class->get_full_name() + "'.");
 }
 
 MonoObject *variant_to_mono_object(const Variant &p_var) {
@@ -824,14 +821,12 @@ void *variant_to_managed_unboxed(const Variant &p_var, const ManagedType &p_type
 						RETURN_TYPE_VAL(uint64_t, val);
 					}
 					default: {
-						ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" +
-														GDMonoClass::get_full_name(mono_class_from_mono_type(enum_basetype)) + "'.");
+						ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" + GDMonoClass::get_full_name(mono_class_from_mono_type(enum_basetype)) + "'.");
 					}
 				}
 			}
 
-			ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" +
-											p_type.type_class->get_full_name() + "'.");
+			ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" + p_type.type_class->get_full_name() + "'.");
 		} break;
 #undef RETURN_TYPE_VAL
 		case MONO_TYPE_STRING:
@@ -847,8 +842,7 @@ void *variant_to_managed_unboxed(const Variant &p_var, const ManagedType &p_type
 			return variant_to_mono_object(p_var);
 	}
 
-	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " +
-									itos(p_type.type_encoding) + ".");
+	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " + itos(p_type.type_encoding) + ".");
 }
 
 MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_type) {
@@ -981,14 +975,12 @@ MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_ty
 						return BOX_ENUM(enum_baseclass, val);
 					}
 					default: {
-						ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" +
-														GDMonoClass::get_full_name(enum_baseclass) + "'.");
+						ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to enum value of unsupported base type: '" + GDMonoClass::get_full_name(enum_baseclass) + "'.");
 					}
 				}
 			}
 
-			ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" +
-											p_type.type_class->get_full_name() + "'.");
+			ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported value type: '" + p_type.type_class->get_full_name() + "'.");
 		} break;
 		case MONO_TYPE_STRING:
 			return (MonoObject *)variant_to_mono_string(p_var);
@@ -1003,8 +995,7 @@ MonoObject *variant_to_mono_object(const Variant &p_var, const ManagedType &p_ty
 			return variant_to_mono_object(p_var);
 	}
 
-	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " +
-									itos(p_type.type_encoding) + ".");
+	ERR_FAIL_V_MSG(nullptr, "Attempted to convert Variant to unsupported type with encoding: " + itos(p_type.type_encoding) + ".");
 }
 
 Variant mono_object_to_variant_impl(MonoObject *p_obj, const ManagedType &p_type, bool p_fail_with_err = true) {
@@ -1271,8 +1262,7 @@ Variant mono_object_to_variant_impl(MonoObject *p_obj, const ManagedType &p_type
 	}
 
 	if (p_fail_with_err) {
-		ERR_FAIL_V_MSG(Variant(), "Attempted to convert an unmarshallable managed type to Variant. Name: '" +
-										  p_type.type_class->get_name() + "' Encoding: " + itos(p_type.type_encoding) + ".");
+		ERR_FAIL_V_MSG(Variant(), "Attempted to convert an unmarshallable managed type to Variant. Name: '" + p_type.type_class->get_name() + "' Encoding: " + itos(p_type.type_encoding) + ".");
 	} else {
 		return Variant();
 	}
@@ -1332,7 +1322,7 @@ String mono_object_to_variant_string(MonoObject *p_obj, MonoException **r_exc) {
 
 MonoObject *Dictionary_to_system_generic_dict(const Dictionary &p_dict, GDMonoClass *p_class, MonoReflectionType *p_key_reftype, MonoReflectionType *p_value_reftype) {
 	String ctor_desc = ":.ctor(System.Collections.Generic.IDictionary`2<" + GDMonoUtils::get_type_desc(p_key_reftype) +
-					   ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
+			", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
 	GDMonoMethod *ctor = p_class->get_method_with_desc(ctor_desc, true);
 	CRASH_COND(ctor == nullptr);
 
@@ -1354,7 +1344,7 @@ MonoObject *Dictionary_to_system_generic_dict(const Dictionary &p_dict, GDMonoCl
 Dictionary system_generic_dict_to_Dictionary(MonoObject *p_obj, [[maybe_unused]] GDMonoClass *p_class, MonoReflectionType *p_key_reftype, MonoReflectionType *p_value_reftype) {
 	GDMonoClass *godot_dict_class = GDMonoUtils::Marshal::make_generic_dictionary_type(p_key_reftype, p_value_reftype);
 	String ctor_desc = ":.ctor(System.Collections.Generic.IDictionary`2<" + GDMonoUtils::get_type_desc(p_key_reftype) +
-					   ", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
+			", " + GDMonoUtils::get_type_desc(p_value_reftype) + ">)";
 	GDMonoMethod *godot_dict_ctor = godot_dict_class->get_method_with_desc(ctor_desc, true);
 	CRASH_COND(godot_dict_ctor == nullptr);
 
@@ -1746,12 +1736,12 @@ Callable managed_to_callable(const M_Callable &p_managed_callable) {
 		CallableCustom *managed_callable = memnew(ManagedCallable(p_managed_callable.delegate));
 		return Callable(managed_callable);
 	} else {
-		Object *target = p_managed_callable.target ?
-								   unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target)) :
-								   nullptr;
-		StringName *method_ptr = p_managed_callable.method_string_name ?
-										   unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_callable.method_string_name)) :
-										   nullptr;
+		Object *target = p_managed_callable.target
+				? unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_callable.target))
+				: nullptr;
+		StringName *method_ptr = p_managed_callable.method_string_name
+				? unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_callable.method_string_name))
+				: nullptr;
 		StringName method = method_ptr ? *method_ptr : StringName();
 		return Callable(target, method);
 	}
@@ -1794,12 +1784,12 @@ M_Callable callable_to_managed(const Callable &p_callable) {
 }
 
 Signal managed_to_signal_info(const M_SignalInfo &p_managed_signal) {
-	Object *owner = p_managed_signal.owner ?
-							  unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner)) :
-							  nullptr;
-	StringName *name_ptr = p_managed_signal.name_string_name ?
-									 unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_signal.name_string_name)) :
-									 nullptr;
+	Object *owner = p_managed_signal.owner
+			? unbox<Object *>(CACHED_FIELD(GodotObject, ptr)->get_value(p_managed_signal.owner))
+			: nullptr;
+	StringName *name_ptr = p_managed_signal.name_string_name
+			? unbox<StringName *>(CACHED_FIELD(StringName, ptr)->get_value(p_managed_signal.name_string_name))
+			: nullptr;
 	StringName name = name_ptr ? *name_ptr : StringName();
 	return Signal(owner, name);
 }
diff --git a/modules/mono/mono_gd/gd_mono_marshal.h b/modules/mono/mono_gd/gd_mono_marshal.h
index 88afc7ebc5..2f4b619b61 100644
--- a/modules/mono/mono_gd/gd_mono_marshal.h
+++ b/modules/mono/mono_gd/gd_mono_marshal.h
@@ -234,58 +234,58 @@ enum {
 #endif
 
 	MATCHES_Vector2 = (MATCHES_real_t && (sizeof(Vector2) == (sizeof(real_t) * 2)) &&
-					   offsetof(Vector2, x) == (sizeof(real_t) * 0) &&
-					   offsetof(Vector2, y) == (sizeof(real_t) * 1)),
+			offsetof(Vector2, x) == (sizeof(real_t) * 0) &&
+			offsetof(Vector2, y) == (sizeof(real_t) * 1)),
 
 	MATCHES_Vector2i = (MATCHES_int && (sizeof(Vector2i) == (sizeof(int32_t) * 2)) &&
-						offsetof(Vector2i, x) == (sizeof(int32_t) * 0) &&
-						offsetof(Vector2i, y) == (sizeof(int32_t) * 1)),
+			offsetof(Vector2i, x) == (sizeof(int32_t) * 0) &&
+			offsetof(Vector2i, y) == (sizeof(int32_t) * 1)),
 
 	MATCHES_Rect2 = (MATCHES_Vector2 && (sizeof(Rect2) == (sizeof(Vector2) * 2)) &&
-					 offsetof(Rect2, position) == (sizeof(Vector2) * 0) &&
-					 offsetof(Rect2, size) == (sizeof(Vector2) * 1)),
+			offsetof(Rect2, position) == (sizeof(Vector2) * 0) &&
+			offsetof(Rect2, size) == (sizeof(Vector2) * 1)),
 
 	MATCHES_Rect2i = (MATCHES_Vector2i && (sizeof(Rect2i) == (sizeof(Vector2i) * 2)) &&
-					  offsetof(Rect2i, position) == (sizeof(Vector2i) * 0) &&
-					  offsetof(Rect2i, size) == (sizeof(Vector2i) * 1)),
+			offsetof(Rect2i, position) == (sizeof(Vector2i) * 0) &&
+			offsetof(Rect2i, size) == (sizeof(Vector2i) * 1)),
 
 	MATCHES_Transform2D = (MATCHES_Vector2 && (sizeof(Transform2D) == (sizeof(Vector2) * 3))), // No field offset required, it stores an array
 
 	MATCHES_Vector3 = (MATCHES_real_t && (sizeof(Vector3) == (sizeof(real_t) * 3)) &&
-					   offsetof(Vector3, x) == (sizeof(real_t) * 0) &&
-					   offsetof(Vector3, y) == (sizeof(real_t) * 1) &&
-					   offsetof(Vector3, z) == (sizeof(real_t) * 2)),
+			offsetof(Vector3, x) == (sizeof(real_t) * 0) &&
+			offsetof(Vector3, y) == (sizeof(real_t) * 1) &&
+			offsetof(Vector3, z) == (sizeof(real_t) * 2)),
 
 	MATCHES_Vector3i = (MATCHES_int && (sizeof(Vector3i) == (sizeof(int32_t) * 3)) &&
-						offsetof(Vector3i, x) == (sizeof(int32_t) * 0) &&
-						offsetof(Vector3i, y) == (sizeof(int32_t) * 1) &&
-						offsetof(Vector3i, z) == (sizeof(int32_t) * 2)),
+			offsetof(Vector3i, x) == (sizeof(int32_t) * 0) &&
+			offsetof(Vector3i, y) == (sizeof(int32_t) * 1) &&
+			offsetof(Vector3i, z) == (sizeof(int32_t) * 2)),
 
 	MATCHES_Basis = (MATCHES_Vector3 && (sizeof(Basis) == (sizeof(Vector3) * 3))), // No field offset required, it stores an array
 
 	MATCHES_Quaternion = (MATCHES_real_t && (sizeof(Quaternion) == (sizeof(real_t) * 4)) &&
-						  offsetof(Quaternion, x) == (sizeof(real_t) * 0) &&
-						  offsetof(Quaternion, y) == (sizeof(real_t) * 1) &&
-						  offsetof(Quaternion, z) == (sizeof(real_t) * 2) &&
-						  offsetof(Quaternion, w) == (sizeof(real_t) * 3)),
+			offsetof(Quaternion, x) == (sizeof(real_t) * 0) &&
+			offsetof(Quaternion, y) == (sizeof(real_t) * 1) &&
+			offsetof(Quaternion, z) == (sizeof(real_t) * 2) &&
+			offsetof(Quaternion, w) == (sizeof(real_t) * 3)),
 
 	MATCHES_Transform3D = (MATCHES_Basis && MATCHES_Vector3 && (sizeof(Transform3D) == (sizeof(Basis) + sizeof(Vector3))) &&
-						   offsetof(Transform3D, basis) == 0 &&
-						   offsetof(Transform3D, origin) == sizeof(Basis)),
+			offsetof(Transform3D, basis) == 0 &&
+			offsetof(Transform3D, origin) == sizeof(Basis)),
 
 	MATCHES_AABB = (MATCHES_Vector3 && (sizeof(AABB) == (sizeof(Vector3) * 2)) &&
-					offsetof(AABB, position) == (sizeof(Vector3) * 0) &&
-					offsetof(AABB, size) == (sizeof(Vector3) * 1)),
+			offsetof(AABB, position) == (sizeof(Vector3) * 0) &&
+			offsetof(AABB, size) == (sizeof(Vector3) * 1)),
 
 	MATCHES_Color = (MATCHES_float && (sizeof(Color) == (sizeof(float) * 4)) &&
-					 offsetof(Color, r) == (sizeof(float) * 0) &&
-					 offsetof(Color, g) == (sizeof(float) * 1) &&
-					 offsetof(Color, b) == (sizeof(float) * 2) &&
-					 offsetof(Color, a) == (sizeof(float) * 3)),
+			offsetof(Color, r) == (sizeof(float) * 0) &&
+			offsetof(Color, g) == (sizeof(float) * 1) &&
+			offsetof(Color, b) == (sizeof(float) * 2) &&
+			offsetof(Color, a) == (sizeof(float) * 3)),
 
 	MATCHES_Plane = (MATCHES_Vector3 && MATCHES_real_t && (sizeof(Plane) == (sizeof(Vector3) + sizeof(real_t))) &&
-					 offsetof(Plane, normal) == 0 &&
-					 offsetof(Plane, d) == sizeof(Vector3))
+			offsetof(Plane, normal) == 0 &&
+			offsetof(Plane, d) == sizeof(Vector3))
 };
 
 // In the future we may force this if we want to ref return these structs
diff --git a/modules/mono/mono_gd/gd_mono_wasm_m2n.h b/modules/mono/mono_gd/gd_mono_wasm_m2n.h
index 366662ff81..c49a62a632 100644
--- a/modules/mono/mono_gd/gd_mono_wasm_m2n.h
+++ b/modules/mono/mono_gd/gd_mono_wasm_m2n.h
@@ -158,7 +158,7 @@ T m2n_arg_cast(Mono_InterpMethodArguments *p_margs, size_t p_idx) {
 		return (T)(size_t)p_margs->iargs[p_idx];
 	} else if constexpr (cookie == 'L') {
 		static_assert(std::is_same_v<T, int64_t> || std::is_same_v<T, uint64_t> ||
-							  (sizeof(void *) == 8 && std::is_pointer_v<T>),
+						(sizeof(void *) == 8 && std::is_pointer_v<T>),
 				"Invalid type for cookie 'L'.");
 
 		union {
diff --git a/modules/mono/utils/string_utils.cpp b/modules/mono/utils/string_utils.cpp
index 2fb5e446da..6fdb5079ce 100644
--- a/modules/mono/utils/string_utils.cpp
+++ b/modules/mono/utils/string_utils.cpp
@@ -139,24 +139,24 @@ bool is_csharp_keyword(const String &p_name) {
 	// Reserved keywords
 
 	return p_name == "abstract" || p_name == "as" || p_name == "base" || p_name == "bool" ||
-		   p_name == "break" || p_name == "byte" || p_name == "case" || p_name == "catch" ||
-		   p_name == "char" || p_name == "checked" || p_name == "class" || p_name == "const" ||
-		   p_name == "continue" || p_name == "decimal" || p_name == "default" || p_name == "delegate" ||
-		   p_name == "do" || p_name == "double" || p_name == "else" || p_name == "enum" ||
-		   p_name == "event" || p_name == "explicit" || p_name == "extern" || p_name == "false" ||
-		   p_name == "finally" || p_name == "fixed" || p_name == "float" || p_name == "for" ||
-		   p_name == "forech" || p_name == "goto" || p_name == "if" || p_name == "implicit" ||
-		   p_name == "in" || p_name == "int" || p_name == "interface" || p_name == "internal" ||
-		   p_name == "is" || p_name == "lock" || p_name == "long" || p_name == "namespace" ||
-		   p_name == "new" || p_name == "null" || p_name == "object" || p_name == "operator" ||
-		   p_name == "out" || p_name == "override" || p_name == "params" || p_name == "private" ||
-		   p_name == "protected" || p_name == "public" || p_name == "readonly" || p_name == "ref" ||
-		   p_name == "return" || p_name == "sbyte" || p_name == "sealed" || p_name == "short" ||
-		   p_name == "sizeof" || p_name == "stackalloc" || p_name == "static" || p_name == "string" ||
-		   p_name == "struct" || p_name == "switch" || p_name == "this" || p_name == "throw" ||
-		   p_name == "true" || p_name == "try" || p_name == "typeof" || p_name == "uint" || p_name == "ulong" ||
-		   p_name == "unchecked" || p_name == "unsafe" || p_name == "ushort" || p_name == "using" ||
-		   p_name == "virtual" || p_name == "volatile" || p_name == "void" || p_name == "while";
+			p_name == "break" || p_name == "byte" || p_name == "case" || p_name == "catch" ||
+			p_name == "char" || p_name == "checked" || p_name == "class" || p_name == "const" ||
+			p_name == "continue" || p_name == "decimal" || p_name == "default" || p_name == "delegate" ||
+			p_name == "do" || p_name == "double" || p_name == "else" || p_name == "enum" ||
+			p_name == "event" || p_name == "explicit" || p_name == "extern" || p_name == "false" ||
+			p_name == "finally" || p_name == "fixed" || p_name == "float" || p_name == "for" ||
+			p_name == "forech" || p_name == "goto" || p_name == "if" || p_name == "implicit" ||
+			p_name == "in" || p_name == "int" || p_name == "interface" || p_name == "internal" ||
+			p_name == "is" || p_name == "lock" || p_name == "long" || p_name == "namespace" ||
+			p_name == "new" || p_name == "null" || p_name == "object" || p_name == "operator" ||
+			p_name == "out" || p_name == "override" || p_name == "params" || p_name == "private" ||
+			p_name == "protected" || p_name == "public" || p_name == "readonly" || p_name == "ref" ||
+			p_name == "return" || p_name == "sbyte" || p_name == "sealed" || p_name == "short" ||
+			p_name == "sizeof" || p_name == "stackalloc" || p_name == "static" || p_name == "string" ||
+			p_name == "struct" || p_name == "switch" || p_name == "this" || p_name == "throw" ||
+			p_name == "true" || p_name == "try" || p_name == "typeof" || p_name == "uint" || p_name == "ulong" ||
+			p_name == "unchecked" || p_name == "unsafe" || p_name == "ushort" || p_name == "using" ||
+			p_name == "virtual" || p_name == "volatile" || p_name == "void" || p_name == "while";
 }
 
 String escape_csharp_keyword(const String &p_name) {
diff --git a/modules/pvr/texture_loader_pvr.cpp b/modules/pvr/texture_loader_pvr.cpp
index cb12976090..ffa900ef99 100644
--- a/modules/pvr/texture_loader_pvr.cpp
+++ b/modules/pvr/texture_loader_pvr.cpp
@@ -390,15 +390,15 @@ static void get_modulation_value(int x, int y, const int p_2bit, const int p_mod
 							  rep_vals0[p_modulation[y + 1][x]] +
 							  rep_vals0[p_modulation[y][x - 1]] +
 							  rep_vals0[p_modulation[y][x + 1]] + 2) /
-					  4;
+					4;
 		} else if (p_modulation_modes[y][x] == 2) {
 			mod_val = (rep_vals0[p_modulation[y][x - 1]] +
 							  rep_vals0[p_modulation[y][x + 1]] + 1) /
-					  2;
+					2;
 		} else {
 			mod_val = (rep_vals0[p_modulation[y - 1][x]] +
 							  rep_vals0[p_modulation[y + 1][x]] + 1) /
-					  2;
+					2;
 		}
 	} else {
 		mod_val = rep_vals1[p_modulation[y][x]];
diff --git a/modules/upnp/upnp.cpp b/modules/upnp/upnp.cpp
index efe618012a..0e51822b01 100644
--- a/modules/upnp/upnp.cpp
+++ b/modules/upnp/upnp.cpp
@@ -37,10 +37,10 @@
 
 bool UPNP::is_common_device(const String &dev) const {
 	return dev.is_empty() ||
-		   dev.find("InternetGatewayDevice") >= 0 ||
-		   dev.find("WANIPConnection") >= 0 ||
-		   dev.find("WANPPPConnection") >= 0 ||
-		   dev.find("rootdevice") >= 0;
+			dev.find("InternetGatewayDevice") >= 0 ||
+			dev.find("WANIPConnection") >= 0 ||
+			dev.find("WANPPPConnection") >= 0 ||
+			dev.find("rootdevice") >= 0;
 }
 
 int UPNP::discover(int timeout, int ttl, const String &device_filter) {
diff --git a/modules/visual_script/visual_script.cpp b/modules/visual_script/visual_script.cpp
index 8f4e807295..01fc7cfca0 100644
--- a/modules/visual_script/visual_script.cpp
+++ b/modules/visual_script/visual_script.cpp
@@ -2370,7 +2370,6 @@ void VisualScriptLanguage::debug_get_stack_level_locals(int p_level, List<String
 	const StringName *f = _call_stack[l].function;
 
 	ERR_FAIL_COND(!_call_stack[l].instance->functions.has(*f));
-	//VisualScriptInstance::Function *func = &_call_stack[l].instance->functions[*f];
 
 	VisualScriptNodeInstance *node = _call_stack[l].instance->instances[*_call_stack[l].current_id];
 	ERR_FAIL_COND(!node);
@@ -2416,21 +2415,6 @@ void VisualScriptLanguage::debug_get_stack_level_locals(int p_level, List<String
 		p_locals->push_back("working_mem/mem_" + itos(i));
 		p_values->push_back((*_call_stack[l].work_mem)[i]);
 	}
-
-	/*
-    ERR_FAIL_INDEX(p_level,_debug_call_stack_pos);
-
-
-    VisualFunction *f = _call_stack[l].function;
-
-    List<Pair<StringName,int> > locals;
-
-    f->debug_get_stack_member_state(*_call_stack[l].line,&locals);
-    for( List<Pair<StringName,int> >::Element *E = locals.front();E;E=E->next() ) {
-	p_locals->push_back(E->get().first);
-	p_values->push_back(_call_stack[l].stack[E->get().second]);
-    }
-*/
 }
 
 void VisualScriptLanguage::debug_get_stack_level_members(int p_level, List<String> *p_members, List<Variant> *p_values, int p_max_subitems, int p_max_depth) {
diff --git a/modules/visual_script/visual_script_editor.cpp b/modules/visual_script/visual_script_editor.cpp
index d73b8d3ca0..b23374bfb1 100644
--- a/modules/visual_script/visual_script_editor.cpp
+++ b/modules/visual_script/visual_script_editor.cpp
@@ -3417,7 +3417,7 @@ void VisualScriptEditor::connect_seq(Ref<VisualScriptNode> vnode_old, Ref<Visual
 		undo_redo->add_do_method(script.ptr(), "sequence_connect", port_action_node, pass_port, new_id);
 		undo_redo->add_undo_method(script.ptr(), "sequence_disconnect", port_action_node, pass_port, new_id);
 	} else if (vnode_old->get_output_value_port_info(port_action_output).name == String("return") &&
-			   !script->get_output_sequence_ports_connected(port_action_node).has(return_port)) {
+			!script->get_output_sequence_ports_connected(port_action_node).has(return_port)) {
 		undo_redo->add_do_method(script.ptr(), "sequence_connect", port_action_node, return_port, new_id);
 		undo_redo->add_undo_method(script.ptr(), "sequence_disconnect", port_action_node, return_port, new_id);
 	} else {
diff --git a/platform/android/android_keys_utils.h b/platform/android/android_keys_utils.h
index 6d25a366a4..de6f48d33a 100644
--- a/platform/android/android_keys_utils.h
+++ b/platform/android/android_keys_utils.h
@@ -133,28 +133,28 @@ static _WinTranslatePair _ak_to_keycode[] = {
 };
 /*
 TODO: map these android key:
-    AKEYCODE_SOFT_LEFT       = 1,
-    AKEYCODE_SOFT_RIGHT      = 2,
-    AKEYCODE_CALL            = 5,
-    AKEYCODE_ENDCALL         = 6,
-    AKEYCODE_STAR            = 17,
-    AKEYCODE_POUND           = 18,
-    AKEYCODE_POWER           = 26,
-    AKEYCODE_CAMERA          = 27,
-    AKEYCODE_CLEAR           = 28,
-    AKEYCODE_SYM             = 63,
-    AKEYCODE_ENVELOPE        = 65,
-    AKEYCODE_GRAVE           = 68,
-    AKEYCODE_SEMICOLON       = 74,
-    AKEYCODE_APOSTROPHE      = 75,
-    AKEYCODE_AT              = 77,
-    AKEYCODE_NUM             = 78,
-    AKEYCODE_HEADSETHOOK     = 79,
-    AKEYCODE_FOCUS           = 80,   // *Camera* focus
-    AKEYCODE_NOTIFICATION    = 83,
-    AKEYCODE_SEARCH          = 84,
-    AKEYCODE_PICTSYMBOLS     = 94,
-    AKEYCODE_SWITCH_CHARSET  = 95,
+	AKEYCODE_SOFT_LEFT       = 1,
+	AKEYCODE_SOFT_RIGHT      = 2,
+	AKEYCODE_CALL            = 5,
+	AKEYCODE_ENDCALL         = 6,
+	AKEYCODE_STAR            = 17,
+	AKEYCODE_POUND           = 18,
+	AKEYCODE_POWER           = 26,
+	AKEYCODE_CAMERA          = 27,
+	AKEYCODE_CLEAR           = 28,
+	AKEYCODE_SYM             = 63,
+	AKEYCODE_ENVELOPE        = 65,
+	AKEYCODE_GRAVE           = 68,
+	AKEYCODE_SEMICOLON       = 74,
+	AKEYCODE_APOSTROPHE      = 75,
+	AKEYCODE_AT              = 77,
+	AKEYCODE_NUM             = 78,
+	AKEYCODE_HEADSETHOOK     = 79,
+	AKEYCODE_FOCUS           = 80,   // *Camera* focus
+	AKEYCODE_NOTIFICATION    = 83,
+	AKEYCODE_SEARCH          = 84,
+	AKEYCODE_PICTSYMBOLS     = 94,
+	AKEYCODE_SWITCH_CHARSET  = 95,
 */
 
 unsigned int android_get_keysym(unsigned int p_code);
diff --git a/platform/android/export/export_plugin.cpp b/platform/android/export/export_plugin.cpp
index 6ef17faf06..aa1aa4d264 100644
--- a/platform/android/export/export_plugin.cpp
+++ b/platform/android/export/export_plugin.cpp
@@ -498,11 +498,11 @@ bool EditorExportPlatformAndroid::is_package_name_valid(const String &p_package,
 
 bool EditorExportPlatformAndroid::_should_compress_asset(const String &p_path, const Vector<uint8_t> &p_data) {
 	/*
-     *  By not compressing files with little or not benefit in doing so,
-     *  a performance gain is expected attime. Moreover, if the APK is
-     *  zip-aligned, assets stored as they are can be efficiently read by
-     *  Android by memory-mapping them.
-     */
+	 *  By not compressing files with little or not benefit in doing so,
+	 *  a performance gain is expected attime. Moreover, if the APK is
+	 *  zip-aligned, assets stored as they are can be efficiently read by
+	 *  Android by memory-mapping them.
+	 */
 
 	// -- Unconditional uncompress to mimic AAPT plus some other
 
@@ -851,16 +851,11 @@ void EditorExportPlatformAndroid::_fix_manifest(const Ref<EditorExportPreset> &p
 				int iofs = ofs + 8;
 
 				string_count = decode_uint32(&p_manifest[iofs]);
-				//styles_count = decode_uint32(&p_manifest[iofs + 4]);
+				// iofs + 4 is `styles_count`.
 				string_flags = decode_uint32(&p_manifest[iofs + 8]);
 				string_data_offset = decode_uint32(&p_manifest[iofs + 12]);
-				//styles_offset = decode_uint32(&p_manifest[iofs + 16]);
-				/*
-                printf("string count: %i\n",string_count);
-                printf("flags: %i\n",string_flags);
-                printf("sdata ofs: %i\n",string_data_offset);
-                printf("styles ofs: %i\n",styles_offset);
-                */
+				// iofs + 16 is `styles_offset`.
+
 				uint32_t st_offset = iofs + 20;
 				string_table.resize(string_count);
 				uint32_t string_end = 0;
diff --git a/platform/android/export/godot_plugin_config.cpp b/platform/android/export/godot_plugin_config.cpp
index ba7b8ce6c7..205cba3350 100644
--- a/platform/android/export/godot_plugin_config.cpp
+++ b/platform/android/export/godot_plugin_config.cpp
@@ -78,14 +78,13 @@ Vector<PluginConfigAndroid> PluginConfigAndroid::get_prebuilt_plugins(String plu
 bool PluginConfigAndroid::is_plugin_config_valid(PluginConfigAndroid plugin_config) {
 	bool valid_name = !plugin_config.name.is_empty();
 	bool valid_binary_type = plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_LOCAL ||
-							 plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE;
+			plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE;
 
 	bool valid_binary = false;
 	if (valid_binary_type) {
 		valid_binary = !plugin_config.binary.is_empty() &&
-					   (plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE ||
-
-							   FileAccess::exists(plugin_config.binary));
+				(plugin_config.binary_type == PluginConfigAndroid::BINARY_TYPE_REMOTE ||
+						FileAccess::exists(plugin_config.binary));
 	}
 
 	bool valid_local_dependencies = true;
diff --git a/platform/android/export/gradle_export_util.cpp b/platform/android/export/gradle_export_util.cpp
index 311614234a..b0d623827e 100644
--- a/platform/android/export/gradle_export_util.cpp
+++ b/platform/android/export/gradle_export_util.cpp
@@ -191,7 +191,7 @@ String bool_to_string(bool v) {
 
 String _get_gles_tag() {
 	bool min_gles3 = ProjectSettings::get_singleton()->get("rendering/driver/driver_name") == "GLES3" &&
-					 !ProjectSettings::get_singleton()->get("rendering/driver/fallback_to_gles2");
+			!ProjectSettings::get_singleton()->get("rendering/driver/fallback_to_gles2");
 	return min_gles3 ? "    <uses-feature android:glEsVersion=\"0x00030000\" android:required=\"true\" />\n" : "";
 }
 
diff --git a/platform/android/java/lib/src/org/godotengine/godot/Godot.java b/platform/android/java/lib/src/org/godotengine/godot/Godot.java
index 70bc73b9ad..5de092ee7e 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/Godot.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/Godot.java
@@ -578,8 +578,7 @@ public class Godot extends Fragment implements SensorEventListener, IDownloaderC
 
 			if (!pack_valid) {
 				Intent notifierIntent = new Intent(activity, activity.getClass());
-				notifierIntent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK |
-										Intent.FLAG_ACTIVITY_CLEAR_TOP);
+				notifierIntent.setFlags(Intent.FLAG_ACTIVITY_NEW_TASK | Intent.FLAG_ACTIVITY_CLEAR_TOP);
 
 				PendingIntent pendingIntent = PendingIntent.getActivity(activity, 0,
 						notifierIntent, PendingIntent.FLAG_UPDATE_CURRENT);
diff --git a/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java b/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
index d33faab641..09337ef989 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/GodotDownloaderService.java
@@ -50,9 +50,9 @@ public class GodotDownloaderService extends DownloaderService {
 	};
 
 	/**
-     * This public key comes from your Android Market publisher account, and it
-     * used by the LVL to validate responses from Market on your behalf.
-     */
+	 * This public key comes from your Android Market publisher account, and it
+	 * used by the LVL to validate responses from Market on your behalf.
+	 */
 	@Override
 	public String getPublicKey() {
 		SharedPreferences prefs = getApplicationContext().getSharedPreferences("app_data_keys", Context.MODE_PRIVATE);
@@ -63,20 +63,20 @@ public class GodotDownloaderService extends DownloaderService {
 	}
 
 	/**
-     * This is used by the preference obfuscater to make sure that your
-     * obfuscated preferences are different than the ones used by other
-     * applications.
-     */
+	 * This is used by the preference obfuscater to make sure that your
+	 * obfuscated preferences are different than the ones used by other
+	 * applications.
+	 */
 	@Override
 	public byte[] getSALT() {
 		return SALT;
 	}
 
 	/**
-     * Fill this in with the class name for your alarm receiver. We do this
-     * because receivers must be unique across all of Android (it's a good idea
-     * to make sure that your receiver is in your unique package)
-     */
+	 * Fill this in with the class name for your alarm receiver. We do this
+	 * because receivers must be unique across all of Android (it's a good idea
+	 * to make sure that your receiver is in your unique package)
+	 */
 	@Override
 	public String getAlarmReceiverClassName() {
 		Log.d("GODOT", "getAlarmReceiverClassName()");
diff --git a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
index a9d45c943b..32aad8dc4f 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/GodotGLRenderView.java
@@ -210,16 +210,16 @@ public class GodotGLRenderView extends GLSurfaceView implements GodotRenderView
 				 */
 
 				if (GLUtils.use_32) {
-					setEGLConfigChooser(translucent ?
-												  new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
-														new RegularConfigChooser(8, 8, 8, 8, 16, stencil)) :
-												  new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
-														new RegularConfigChooser(5, 6, 5, 0, 16, stencil)));
+					setEGLConfigChooser(translucent
+									? new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+											  new RegularConfigChooser(8, 8, 8, 8, 16, stencil))
+									: new RegularFallbackConfigChooser(8, 8, 8, 8, 24, stencil,
+											  new RegularConfigChooser(5, 6, 5, 0, 16, stencil)));
 
 				} else {
-					setEGLConfigChooser(translucent ?
-												  new RegularConfigChooser(8, 8, 8, 8, 16, stencil) :
-												  new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
+					setEGLConfigChooser(translucent
+									? new RegularConfigChooser(8, 8, 8, 8, 16, stencil)
+									: new RegularConfigChooser(5, 6, 5, 0, 16, stencil));
 				}
 				break;
 		}
diff --git a/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java b/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
index d1e8ae5ca9..a98ecad594 100644
--- a/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
+++ b/platform/android/java/lib/src/org/godotengine/godot/input/GodotEditText.java
@@ -191,9 +191,9 @@ public class GodotEditText extends EditText {
 
 	private boolean needHandlingInGodot(int keyCode, KeyEvent keyEvent) {
 		boolean isArrowKey = keyCode == KeyEvent.KEYCODE_DPAD_UP || keyCode == KeyEvent.KEYCODE_DPAD_DOWN ||
-							 keyCode == KeyEvent.KEYCODE_DPAD_LEFT || keyCode == KeyEvent.KEYCODE_DPAD_RIGHT;
+				keyCode == KeyEvent.KEYCODE_DPAD_LEFT || keyCode == KeyEvent.KEYCODE_DPAD_RIGHT;
 		boolean isModifiedKey = keyEvent.isAltPressed() || keyEvent.isCtrlPressed() || keyEvent.isSymPressed() ||
-								keyEvent.isFunctionPressed() || keyEvent.isMetaPressed();
+				keyEvent.isFunctionPressed() || keyEvent.isMetaPressed();
 		return isArrowKey || keyCode == KeyEvent.KEYCODE_TAB || KeyEvent.isModifierKey(keyCode) ||
 				isModifiedKey;
 	}
diff --git a/platform/iphone/export/export_plugin.cpp b/platform/iphone/export/export_plugin.cpp
index 60fcbb68d3..54fb597c62 100644
--- a/platform/iphone/export/export_plugin.cpp
+++ b/platform/iphone/export/export_plugin.cpp
@@ -841,7 +841,7 @@ void EditorExportPlatformIOS::_add_assets_to_project(const Ref<EditorExportPrese
 	String pbx_embeded_frameworks;
 
 	const String file_info_format = String("$build_id = {isa = PBXBuildFile; fileRef = $ref_id; };\n") +
-									"$ref_id = {isa = PBXFileReference; lastKnownFileType = $file_type; name = \"$name\"; path = \"$file_path\"; sourceTree = \"<group>\"; };\n";
+			"$ref_id = {isa = PBXFileReference; lastKnownFileType = $file_type; name = \"$name\"; path = \"$file_path\"; sourceTree = \"<group>\"; };\n";
 
 	for (int i = 0; i < p_additional_assets.size(); ++i) {
 		String additional_asset_info_format = file_info_format;
@@ -1261,8 +1261,8 @@ Error EditorExportPlatformIOS::_export_ios_plugins(const Ref<EditorExportPreset>
 		String deinitialization_method = plugin.deinitialization_method + "();\n";
 
 		plugin_definition_cpp_code += definition_comment +
-									  "extern void " + initialization_method +
-									  "extern void " + deinitialization_method + "\n";
+				"extern void " + initialization_method +
+				"extern void " + deinitialization_method + "\n";
 
 		plugin_initialization_cpp_code += "\t" + initialization_method;
 		plugin_deinitialization_cpp_code += "\t" + deinitialization_method;
diff --git a/platform/javascript/export/export_plugin.cpp b/platform/javascript/export/export_plugin.cpp
index c7bd172751..1084a0adf7 100644
--- a/platform/javascript/export/export_plugin.cpp
+++ b/platform/javascript/export/export_plugin.cpp
@@ -140,7 +140,7 @@ void EditorExportPlatformJavaScript::_fix_html(Vector<uint8_t> &p_html, const Re
 	if (p_preset->get("progressive_web_app/enabled")) {
 		head_include += "<link rel='manifest' href='" + p_name + ".manifest.json'>\n";
 		head_include += "<script type='application/javascript'>window.addEventListener('load', () => {if ('serviceWorker' in navigator) {navigator.serviceWorker.register('" +
-						p_name + ".service.worker.js');}});</script>\n";
+				p_name + ".service.worker.js');}});</script>\n";
 	}
 
 	// Replaces HTML string
diff --git a/platform/linuxbsd/display_server_x11.cpp b/platform/linuxbsd/display_server_x11.cpp
index 5fe28935b9..a4dabab33b 100644
--- a/platform/linuxbsd/display_server_x11.cpp
+++ b/platform/linuxbsd/display_server_x11.cpp
@@ -616,7 +616,7 @@ String DisplayServerX11::clipboard_get_primary() const {
 Bool DisplayServerX11::_predicate_clipboard_save_targets(Display *display, XEvent *event, XPointer arg) {
 	if (event->xany.window == *(Window *)arg) {
 		return (event->type == SelectionRequest) ||
-			   (event->type == SelectionNotify);
+				(event->type == SelectionNotify);
 	} else {
 		return False;
 	}
@@ -2485,11 +2485,11 @@ Atom DisplayServerX11::_process_selection_request_target(Atom p_target, Window p
 				0);
 		return p_property;
 	} else if (p_target == XInternAtom(x11_display, "UTF8_STRING", 0) ||
-			   p_target == XInternAtom(x11_display, "COMPOUND_TEXT", 0) ||
-			   p_target == XInternAtom(x11_display, "TEXT", 0) ||
-			   p_target == XA_STRING ||
-			   p_target == XInternAtom(x11_display, "text/plain;charset=utf-8", 0) ||
-			   p_target == XInternAtom(x11_display, "text/plain", 0)) {
+			p_target == XInternAtom(x11_display, "COMPOUND_TEXT", 0) ||
+			p_target == XInternAtom(x11_display, "TEXT", 0) ||
+			p_target == XA_STRING ||
+			p_target == XInternAtom(x11_display, "text/plain;charset=utf-8", 0) ||
+			p_target == XInternAtom(x11_display, "text/plain", 0)) {
 		// Directly using internal clipboard because we know our window
 		// is the owner during a selection request.
 		CharString clip;
@@ -2867,7 +2867,7 @@ void DisplayServerX11::process_events() {
 								if (pen_pressure_range != Vector2()) {
 									xi.pressure_supported = true;
 									xi.pressure = (*values - pen_pressure_range[0]) /
-												  (pen_pressure_range[1] - pen_pressure_range[0]);
+											(pen_pressure_range[1] - pen_pressure_range[0]);
 								}
 							}
 
@@ -2926,10 +2926,7 @@ void DisplayServerX11::process_events() {
 						xi.last_relative_time = raw_event->time;
 					} break;
 #ifdef TOUCH_ENABLED
-					case XI_TouchBegin: // Fall-through
-							// Disabled hand-in-hand with the grabbing
-							//XIAllowTouchEvents(x11_display, event_data->deviceid, event_data->detail, x11_window, XIAcceptTouch);
-
+					case XI_TouchBegin:
 					case XI_TouchEnd: {
 						bool is_begin = event_data->evtype == XI_TouchBegin;
 
@@ -3756,18 +3753,18 @@ DisplayServerX11::WindowID DisplayServerX11::_create_window(WindowMode p_mode, V
 			XSetWindowAttributes new_attr;
 
 			new_attr.event_mask = KeyPressMask | KeyReleaseMask | ButtonPressMask |
-								  ButtonReleaseMask | EnterWindowMask |
-								  LeaveWindowMask | PointerMotionMask |
-								  Button1MotionMask |
-								  Button2MotionMask | Button3MotionMask |
-								  Button4MotionMask | Button5MotionMask |
-								  ButtonMotionMask | KeymapStateMask |
-								  ExposureMask | VisibilityChangeMask |
-								  StructureNotifyMask |
-								  SubstructureNotifyMask | SubstructureRedirectMask |
-								  FocusChangeMask | PropertyChangeMask |
-								  ColormapChangeMask | OwnerGrabButtonMask |
-								  im_event_mask;
+					ButtonReleaseMask | EnterWindowMask |
+					LeaveWindowMask | PointerMotionMask |
+					Button1MotionMask |
+					Button2MotionMask | Button3MotionMask |
+					Button4MotionMask | Button5MotionMask |
+					ButtonMotionMask | KeymapStateMask |
+					ExposureMask | VisibilityChangeMask |
+					StructureNotifyMask |
+					SubstructureNotifyMask | SubstructureRedirectMask |
+					FocusChangeMask | PropertyChangeMask |
+					ColormapChangeMask | OwnerGrabButtonMask |
+					im_event_mask;
 
 			XChangeWindowAttributes(x11_display, wd.x11_window, CWEventMask, &new_attr);
 
@@ -4137,7 +4134,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
 	}
 	show_window(main_window);
 
-//create RenderingDevice if used
 #if defined(VULKAN_ENABLED)
 	if (rendering_driver == "vulkan") {
 		//temporary
@@ -4148,13 +4144,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
 	}
 #endif
 
-	/*
-	rendering_server = memnew(RenderingServerDefault);
-	if (get_render_thread_mode() != RENDER_THREAD_UNSAFE) {
-		rendering_server = memnew(RenderingServerWrapMT(rendering_server, get_render_thread_mode() == RENDER_SEPARATE_THREAD));
-	}
-	*/
-
 	{
 		//set all event master mask
 		XIEventMask all_master_event_mask;
@@ -4167,15 +4156,6 @@ DisplayServerX11::DisplayServerX11(const String &p_rendering_driver, WindowMode
 		XISelectEvents(x11_display, DefaultRootWindow(x11_display), &all_master_event_mask, 1);
 	}
 
-	// Disabled by now since grabbing also blocks mouse events
-	// (they are received as extended events instead of standard events)
-	/*XIClearMask(xi.touch_event_mask.mask, XI_TouchOwnership);
-
-	// Grab touch devices to avoid OS gesture interference
-	for (int i = 0; i < xi.touch_devices.size(); ++i) {
-		XIGrabDevice(x11_display, xi.touch_devices[i], x11_window, CurrentTime, None, XIGrabModeAsync, XIGrabModeAsync, False, &xi.touch_event_mask);
-	}*/
-
 	cursor_size = XcursorGetDefaultSize(x11_display);
 	cursor_theme = XcursorGetTheme(x11_display);
 
diff --git a/platform/osx/export/export_plugin.cpp b/platform/osx/export/export_plugin.cpp
index 60a878d644..1e80dcd97b 100644
--- a/platform/osx/export/export_plugin.cpp
+++ b/platform/osx/export/export_plugin.cpp
@@ -325,11 +325,11 @@ void EditorExportPlatformOSX::_fix_plist(const Ref<EditorExportPreset> &p_preset
 }
 
 /**
-    If we're running the OSX version of the Godot editor we'll:
-    - export our application bundle to a temporary folder
-    - attempt to code sign it
-    - and then wrap it up in a DMG
-**/
+ * If we're running the OSX version of the Godot editor we'll:
+ * - export our application bundle to a temporary folder
+ * - attempt to code sign it
+ * - and then wrap it up in a DMG
+ */
 
 Error EditorExportPlatformOSX::_notarize(const Ref<EditorExportPreset> &p_preset, const String &p_path) {
 #ifdef OSX_ENABLED
diff --git a/platform/osx/joypad_osx.cpp b/platform/osx/joypad_osx.cpp
index e67d2b0e91..46ed651384 100644
--- a/platform/osx/joypad_osx.cpp
+++ b/platform/osx/joypad_osx.cpp
@@ -336,10 +336,10 @@ bool JoypadOSX::configure_joypad(IOHIDDeviceRef p_device_ref, joypad *p_joy) {
 	}
 	// Xbox controller hat values start at 1 rather than 0.
 	p_joy->offset_hat = vendor == 0x45e &&
-						(product_id == 0x0b05 ||
-								product_id == 0x02e0 ||
-								product_id == 0x02fd ||
-								product_id == 0x0b13);
+			(product_id == 0x0b05 ||
+					product_id == 0x02e0 ||
+					product_id == 0x02fd ||
+					product_id == 0x0b13);
 
 	return true;
 }
diff --git a/platform/uwp/app_uwp.cpp b/platform/uwp/app_uwp.cpp
index 50e33e6c49..9e6ad7a63e 100644
--- a/platform/uwp/app_uwp.cpp
+++ b/platform/uwp/app_uwp.cpp
@@ -121,8 +121,7 @@ void App::SetWindow(CoreWindow ^ p_window) {
 	window->PointerWheelChanged +=
 			ref new TypedEventHandler<CoreWindow ^, PointerEventArgs ^>(this, &App::OnPointerWheelChanged);
 
-	mouseChangedNotifier = SignalNotifier::AttachToEvent(L"os_mouse_mode_changed", ref new SignalHandler(
-																						   this, &App::OnMouseModeChanged));
+	mouseChangedNotifier = SignalNotifier::AttachToEvent(L"os_mouse_mode_changed", ref new SignalHandler(this, &App::OnMouseModeChanged));
 
 	mouseChangedNotifier->Enable();
 
diff --git a/platform/uwp/export/export_plugin.h b/platform/uwp/export/export_plugin.h
index f295789254..acdd85e888 100644
--- a/platform/uwp/export/export_plugin.h
+++ b/platform/uwp/export/export_plugin.h
@@ -367,15 +367,15 @@ class EditorExportPlatformUWP : public EditorExportPlatform {
 
 	static bool _should_compress_asset(const String &p_path, const Vector<uint8_t> &p_data) {
 		/* TODO: This was copied verbatim from Android export. It should be
-    * refactored to the parent class and also be used for .zip export.
-    */
+		 * refactored to the parent class and also be used for .zip export.
+		 */
 
 		/*
-    *  By not compressing files with little or not benefit in doing so,
-    *  a performance gain is expected at runtime. Moreover, if the APK is
-    *  zip-aligned, assets stored as they are can be efficiently read by
-    *  Android by memory-mapping them.
-    */
+		 *  By not compressing files with little or not benefit in doing so,
+		 *  a performance gain is expected at runtime. Moreover, if the APK is
+		 *  zip-aligned, assets stored as they are can be efficiently read by
+		 *  Android by memory-mapping them.
+		 */
 
 		// -- Unconditional uncompress to mimic AAPT plus some other
 
diff --git a/platform/windows/key_mapping_windows.cpp b/platform/windows/key_mapping_windows.cpp
index 8016d20470..b9cf8151fc 100644
--- a/platform/windows/key_mapping_windows.cpp
+++ b/platform/windows/key_mapping_windows.cpp
@@ -426,13 +426,13 @@ unsigned int KeyMappingWindows::get_scansym(unsigned int p_code, bool p_extended
 
 bool KeyMappingWindows::is_extended_key(unsigned int p_code) {
 	return p_code == VK_INSERT ||
-		   p_code == VK_DELETE ||
-		   p_code == VK_HOME ||
-		   p_code == VK_END ||
-		   p_code == VK_PRIOR ||
-		   p_code == VK_NEXT ||
-		   p_code == VK_LEFT ||
-		   p_code == VK_UP ||
-		   p_code == VK_RIGHT ||
-		   p_code == VK_DOWN;
+			p_code == VK_DELETE ||
+			p_code == VK_HOME ||
+			p_code == VK_END ||
+			p_code == VK_PRIOR ||
+			p_code == VK_NEXT ||
+			p_code == VK_LEFT ||
+			p_code == VK_UP ||
+			p_code == VK_RIGHT ||
+			p_code == VK_DOWN;
 }
diff --git a/scene/2d/line_builder.cpp b/scene/2d/line_builder.cpp
index a8a2639ccf..05d77f8224 100644
--- a/scene/2d/line_builder.cpp
+++ b/scene/2d/line_builder.cpp
@@ -128,9 +128,9 @@ void LineBuilder::build() {
 	_interpolate_color = gradient != nullptr;
 	bool retrieve_curve = curve != nullptr;
 	bool distance_required = _interpolate_color ||
-							 retrieve_curve ||
-							 texture_mode == Line2D::LINE_TEXTURE_TILE ||
-							 texture_mode == Line2D::LINE_TEXTURE_STRETCH;
+			retrieve_curve ||
+			texture_mode == Line2D::LINE_TEXTURE_TILE ||
+			texture_mode == Line2D::LINE_TEXTURE_STRETCH;
 	if (distance_required) {
 		total_distance = calculate_total_distance(points);
 		//Adjust totalDistance.
diff --git a/scene/2d/tile_map.cpp b/scene/2d/tile_map.cpp
index e54d1cd597..c11262e0c9 100644
--- a/scene/2d/tile_map.cpp
+++ b/scene/2d/tile_map.cpp
@@ -2974,38 +2974,38 @@ bool TileMap::is_existing_neighbor(TileSet::CellNeighbor p_cell_neighbor) const
 	TileSet::TileShape shape = tile_set->get_tile_shape();
 	if (shape == TileSet::TILE_SHAPE_SQUARE) {
 		return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER;
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_CORNER;
 
 	} else if (shape == TileSet::TILE_SHAPE_ISOMETRIC) {
 		return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER ||
-			   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER ||
+				p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
 	} else {
 		if (tile_set->get_tile_offset_axis() == TileSet::TILE_OFFSET_AXIS_HORIZONTAL) {
 			return p_cell_neighbor == TileSet::CELL_NEIGHBOR_RIGHT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
 		} else {
 			return p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_RIGHT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
-				   p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE ||
+					p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE;
 		}
 	}
 }
@@ -3050,7 +3050,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 						return p_coords + Vector2i(is_offset ? 0 : -1, 1);
 					} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-							   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+							(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 						return p_coords + Vector2i(-1, 0);
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 						return p_coords + Vector2i(is_offset ? 0 : -1, -1);
@@ -3074,7 +3074,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 						return p_coords + Vector2i(1, is_offset ? 0 : -1);
 					} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-							   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+							(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 						return p_coords + Vector2i(0, -1);
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 						return p_coords + Vector2i(-1, is_offset ? 0 : -1);
@@ -3101,7 +3101,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 						return p_coords + Vector2i(is_offset ? -1 : 0, 1);
 					} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-							   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+							(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 						return p_coords + Vector2i(-1, 0);
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 						return p_coords + Vector2i(is_offset ? -1 : 0, -1);
@@ -3125,7 +3125,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 						return p_coords + Vector2i(1, is_offset ? -1 : 0);
 					} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-							   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+							(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 						return p_coords + Vector2i(0, -1);
 					} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 						return p_coords + Vector2i(-1, is_offset ? -1 : 0);
@@ -3152,7 +3152,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 							return p_coords + Vector2i(-1, 0);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(0, -1);
@@ -3175,7 +3175,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 							return p_coords + Vector2i(1, -1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 							return p_coords + Vector2i(0, -1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 0);
@@ -3200,7 +3200,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 							return p_coords + Vector2i(-2, 1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 0);
@@ -3223,7 +3223,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 							return p_coords + Vector2i(1, -1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 							return p_coords + Vector2i(1, -2);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(0, -1);
@@ -3252,7 +3252,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 0);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 							return p_coords + Vector2i(-1, -1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(0, -1);
@@ -3275,7 +3275,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 							return p_coords + Vector2i(0, -1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 							return p_coords + Vector2i(-1, -1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 0);
@@ -3300,7 +3300,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_BOTTOM_LEFT_SIDE) {
 							return p_coords + Vector2i(0, 1);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_LEFT_SIDE)) {
 							return p_coords + Vector2i(-1, 1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(-1, 0);
@@ -3323,7 +3323,7 @@ Vector2i TileMap::get_neighbor_cell(const Vector2i &p_coords, TileSet::CellNeigh
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_RIGHT_SIDE) {
 							return p_coords + Vector2i(1, 0);
 						} else if ((shape == TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_CORNER) ||
-								   (shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
+								(shape != TileSet::TILE_SHAPE_ISOMETRIC && p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_SIDE)) {
 							return p_coords + Vector2i(1, -1);
 						} else if (p_cell_neighbor == TileSet::CELL_NEIGHBOR_TOP_LEFT_SIDE) {
 							return p_coords + Vector2i(0, -1);
diff --git a/scene/3d/cpu_particles_3d.cpp b/scene/3d/cpu_particles_3d.cpp
index f1e800988d..5f13ed3c66 100644
--- a/scene/3d/cpu_particles_3d.cpp
+++ b/scene/3d/cpu_particles_3d.cpp
@@ -213,8 +213,7 @@ TypedArray<String> CPUParticles3D::get_configuration_warnings() const {
 		warnings.push_back(TTR("Nothing is visible because no mesh has been assigned."));
 	}
 
-	if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 ||
-										get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) {
+	if (!anim_material_found && (get_param_max(PARAM_ANIM_SPEED) != 0.0 || get_param_max(PARAM_ANIM_OFFSET) != 0.0 || get_param_curve(PARAM_ANIM_SPEED).is_valid() || get_param_curve(PARAM_ANIM_OFFSET).is_valid())) {
 		warnings.push_back(TTR("CPUParticles3D animation requires the usage of a StandardMaterial3D whose Billboard Mode is set to \"Particle Billboard\"."));
 	}
 
diff --git a/scene/3d/gpu_particles_collision_3d.cpp b/scene/3d/gpu_particles_collision_3d.cpp
index 9127168c58..6ac9364b1a 100644
--- a/scene/3d/gpu_particles_collision_3d.cpp
+++ b/scene/3d/gpu_particles_collision_3d.cpp
@@ -288,15 +288,12 @@ void GPUParticlesCollisionSDF::_find_closest_distance(const Vector3 &p_pos, cons
 			Vector3 nor = ba.cross(ac);
 
 			inside_d = Math::sqrt(
-					(SGN(ba.cross(nor).dot(pa)) +
-									SGN(cb.cross(nor).dot(pb)) +
-									SGN(ac.cross(nor).dot(pc)) <
-							2.0) ?
-							  MIN(MIN(
-										Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
-										Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
-									Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc)) :
-							  nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
+					(SGN(ba.cross(nor).dot(pa)) + SGN(cb.cross(nor).dot(pb)) + SGN(ac.cross(nor).dot(pc)) < 2.0)
+							? MIN(MIN(
+										  Vector3_dot2(ba * CLAMP(ba.dot(pa) / Vector3_dot2(ba), 0.0, 1.0) - pa),
+										  Vector3_dot2(cb * CLAMP(cb.dot(pb) / Vector3_dot2(cb), 0.0, 1.0) - pb)),
+									  Vector3_dot2(ac * CLAMP(ac.dot(pc) / Vector3_dot2(ac), 0.0, 1.0) - pc))
+							: nor.dot(pa) * nor.dot(pa) / Vector3_dot2(nor));
 
 			closest_distance = MIN(closest_distance, inside_d);
 		}
diff --git a/scene/3d/node_3d.cpp b/scene/3d/node_3d.cpp
index 8a39d4d30f..1265679b36 100644
--- a/scene/3d/node_3d.cpp
+++ b/scene/3d/node_3d.cpp
@@ -44,7 +44,7 @@
  definition of invalidation: global is invalid
 
  1) If a node sets a LOCAL, it produces an invalidation of everything above
-    a) If above is invalid, don't keep invalidating upwards
+ .  a) If above is invalid, don't keep invalidating upwards
  2) If a node sets a GLOBAL, it is converted to LOCAL (and forces validation of everything pending below)
 
  drawback: setting/reading globals is useful and used very often, and using affine inverses is slow
@@ -56,7 +56,7 @@
  definition of invalidation: NONE dirty, LOCAL dirty, GLOBAL dirty
 
  1) If a node sets a LOCAL, it must climb the tree and set it as GLOBAL dirty
-    a) marking GLOBALs as dirty up all the tree must be done always
+ .  a) marking GLOBALs as dirty up all the tree must be done always
  2) If a node sets a GLOBAL, it marks local as dirty, and that's all?
 
  //is clearing the dirty state correct in this case?
@@ -94,11 +94,6 @@ void Node3D::_propagate_transform_changed(Node3D *p_origin) {
 		return;
 	}
 
-	/*
-	if (data.dirty&DIRTY_GLOBAL)
-		return; //already dirty
-	*/
-
 	data.children_lock++;
 
 	for (Node3D *&E : data.children) {
@@ -244,10 +239,9 @@ Quaternion Node3D::get_quaternion() const {
 }
 
 void Node3D::set_global_transform(const Transform3D &p_transform) {
-	Transform3D xform =
-			(data.parent && !data.top_level_active) ?
-					  data.parent->get_global_transform().affine_inverse() * p_transform :
-					  p_transform;
+	Transform3D xform = (data.parent && !data.top_level_active)
+			? data.parent->get_global_transform().affine_inverse() * p_transform
+			: p_transform;
 
 	set_transform(xform);
 }
diff --git a/scene/3d/vehicle_body_3d.cpp b/scene/3d/vehicle_body_3d.cpp
index 6761fdd944..61cba17cde 100644
--- a/scene/3d/vehicle_body_3d.cpp
+++ b/scene/3d/vehicle_body_3d.cpp
@@ -124,7 +124,7 @@ void VehicleWheel3D::_update(PhysicsDirectBodyState3D *s) {
 		Vector3 relpos = m_raycastInfo.m_contactPointWS - s->get_transform().origin;
 
 		chassis_velocity_at_contactPoint = s->get_linear_velocity() +
-										   (s->get_angular_velocity()).cross(relpos); // * mPos);
+				(s->get_angular_velocity()).cross(relpos); // * mPos);
 
 		real_t projVel = m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint);
 		if (project >= real_t(-0.1)) {
@@ -444,7 +444,7 @@ real_t VehicleBody3D::_ray_cast(int p_idx, PhysicsDirectBodyState3D *s) {
 		//chassis_velocity_at_contactPoint = getRigidBody()->getVelocityInLocalPoint(relpos);
 
 		chassis_velocity_at_contactPoint = s->get_linear_velocity() +
-										   (s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos);
+				(s->get_angular_velocity()).cross(wheel.m_raycastInfo.m_contactPointWS - s->get_transform().origin); // * mPos);
 
 		real_t projVel = wheel.m_raycastInfo.m_contactNormalWS.dot(chassis_velocity_at_contactPoint);
 
@@ -771,7 +771,7 @@ void VehicleBody3D::_update_friction(PhysicsDirectBodyState3D *s) {
 			VehicleWheel3D &wheelInfo = *wheels[wheel];
 
 			Vector3 rel_pos = wheelInfo.m_raycastInfo.m_contactPointWS -
-							  s->get_transform().origin;
+					s->get_transform().origin;
 
 			if (m_forwardImpulse[wheel] != real_t(0.)) {
 				s->apply_impulse(m_forwardWS[wheel] * (m_forwardImpulse[wheel]), rel_pos);
diff --git a/scene/gui/control.cpp b/scene/gui/control.cpp
index 77a1efd021..582c8e5860 100644
--- a/scene/gui/control.cpp
+++ b/scene/gui/control.cpp
@@ -73,8 +73,8 @@ Dictionary Control::_edit_get_state() const {
 
 void Control::_edit_set_state(const Dictionary &p_state) {
 	ERR_FAIL_COND((p_state.size() <= 0) ||
-				  !p_state.has("rotation") || !p_state.has("scale") ||
-				  !p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets"));
+			!p_state.has("rotation") || !p_state.has("scale") ||
+			!p_state.has("pivot") || !p_state.has("anchors") || !p_state.has("offsets"));
 	Dictionary state = p_state;
 
 	set_rotation(state["rotation"]);
diff --git a/scene/gui/file_dialog.cpp b/scene/gui/file_dialog.cpp
index bb77da9548..5f9f09fc50 100644
--- a/scene/gui/file_dialog.cpp
+++ b/scene/gui/file_dialog.cpp
@@ -348,7 +348,7 @@ bool FileDialog::_is_open_should_be_disabled() {
 
 	// Opening a file, but selected a folder? Forbidden.
 	return ((mode == FILE_MODE_OPEN_FILE || mode == FILE_MODE_OPEN_FILES) && d["dir"]) || // Flipped case, also forbidden.
-		   (mode == FILE_MODE_OPEN_DIR && !d["dir"]);
+			(mode == FILE_MODE_OPEN_DIR && !d["dir"]);
 }
 
 void FileDialog::_go_up() {
diff --git a/scene/gui/rich_text_label.h b/scene/gui/rich_text_label.h
index 6d772876ad..f3c4c11cc8 100644
--- a/scene/gui/rich_text_label.h
+++ b/scene/gui/rich_text_label.h
@@ -278,12 +278,12 @@ private:
 
 		uint64_t offset_random(int index) {
 			return (_current_rng >> (index % 64)) |
-				   (_current_rng << (64 - (index % 64)));
+					(_current_rng << (64 - (index % 64)));
 		}
 
 		uint64_t offset_previous_random(int index) {
 			return (_previous_rng >> (index % 64)) |
-				   (_previous_rng << (64 - (index % 64)));
+					(_previous_rng << (64 - (index % 64)));
 		}
 	};
 
diff --git a/scene/main/viewport.cpp b/scene/main/viewport.cpp
index 3280190250..5f8e66e337 100644
--- a/scene/main/viewport.cpp
+++ b/scene/main/viewport.cpp
@@ -1246,10 +1246,10 @@ void Viewport::_gui_call_input(Control *p_control, const Ref<InputEvent> &p_inpu
 	Ref<InputEventMouseButton> mb = p_input;
 
 	bool cant_stop_me_now = (mb.is_valid() &&
-							 (mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN ||
-									 mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP ||
-									 mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT ||
-									 mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT));
+			(mb->get_button_index() == MOUSE_BUTTON_WHEEL_DOWN ||
+					mb->get_button_index() == MOUSE_BUTTON_WHEEL_UP ||
+					mb->get_button_index() == MOUSE_BUTTON_WHEEL_LEFT ||
+					mb->get_button_index() == MOUSE_BUTTON_WHEEL_RIGHT));
 	Ref<InputEventPanGesture> pn = p_input;
 	cant_stop_me_now = pn.is_valid() || cant_stop_me_now;
 
diff --git a/scene/resources/animation.cpp b/scene/resources/animation.cpp
index f8e4845ae6..06ce993cc7 100644
--- a/scene/resources/animation.cpp
+++ b/scene/resources/animation.cpp
@@ -2319,10 +2319,11 @@ Variant Animation::_cubic_interpolate(const Variant &p_pre_a, const Variant &p_a
 		real_t t2 = t * t;
 		real_t t3 = t2 * t;
 
-		return 0.5f * ((p1 * 2.0f) +
-							  (-p0 + p2) * t +
-							  (2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 +
-							  (-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3);
+		return 0.5f *
+				((p1 * 2.0f) +
+						(-p0 + p2) * t +
+						(2.0f * p0 - 5.0f * p1 + 4 * p2 - p3) * t2 +
+						(-p0 + 3.0f * p1 - 3.0f * p2 + p3) * t3);
 
 	} else if ((vformat & (vformat - 1))) {
 		return p_a; //can't interpolate, mix of types
diff --git a/servers/audio/audio_filter_sw.cpp b/servers/audio/audio_filter_sw.cpp
index bcfa4c4c37..b31014bd21 100644
--- a/servers/audio/audio_filter_sw.cpp
+++ b/servers/audio/audio_filter_sw.cpp
@@ -173,28 +173,20 @@ void AudioFilterSW::prepare_coefficients(Coeffs *p_coeffs) {
 			p_coeffs->a2 = ((tmpgain + 1.0) - (tmpgain - 1.0) * cos_v - beta * sin_v);
 
 		} break;
-	};
+	}
 
 	p_coeffs->b0 /= a0;
 	p_coeffs->b1 /= a0;
 	p_coeffs->b2 /= a0;
 	p_coeffs->a1 /= 0.0 - a0;
 	p_coeffs->a2 /= 0.0 - a0;
-
-	//undenormalise
-	/*    p_coeffs->b0=undenormalise(p_coeffs->b0);
-    p_coeffs->b1=undenormalise(p_coeffs->b1);
-    p_coeffs->b2=undenormalise(p_coeffs->b2);
-    p_coeffs->a1=undenormalise(p_coeffs->a1);
-    p_coeffs->a2=undenormalise(p_coeffs->a2);*/
 }
 
-void AudioFilterSW::set_stages(int p_stages) { //adjust for multiple stages
-
+void AudioFilterSW::set_stages(int p_stages) {
 	stages = p_stages;
 }
 
-/* Fouriertransform kernel to obtain response */
+/* Fourier transform kernel to obtain response */
 
 float AudioFilterSW::get_response(float p_freq, Coeffs *p_coeffs) {
 	float freq = p_freq / sampling_rate * Math_TAU;
diff --git a/servers/physics_3d/godot_body_pair_3d.cpp b/servers/physics_3d/godot_body_pair_3d.cpp
index 457abfb71a..f7d9ed9ee9 100644
--- a/servers/physics_3d/godot_body_pair_3d.cpp
+++ b/servers/physics_3d/godot_body_pair_3d.cpp
@@ -495,8 +495,7 @@ void GodotBodyPair3D::solve(real_t p_step) {
 			Vector3 temp1 = inv_inertia_tensor_A.xform(c.rA.cross(tv));
 			Vector3 temp2 = inv_inertia_tensor_B.xform(c.rB.cross(tv));
 
-			real_t t = -tvl /
-					   (inv_mass_A + inv_mass_B + tv.dot(temp1.cross(c.rA) + temp2.cross(c.rB)));
+			real_t t = -tvl / (inv_mass_A + inv_mass_B + tv.dot(temp1.cross(c.rA) + temp2.cross(c.rB)));
 
 			Vector3 jt = t * tv;
 
@@ -863,8 +862,7 @@ void GodotBodySoftBodyPair3D::solve(real_t p_step) {
 
 			Vector3 temp1 = body_inv_inertia_tensor.xform(c.rA.cross(tv));
 
-			real_t t = -tvl /
-					   (body_inv_mass + node_inv_mass + tv.dot(temp1.cross(c.rA)));
+			real_t t = -tvl / (body_inv_mass + node_inv_mass + tv.dot(temp1.cross(c.rA)));
 
 			Vector3 jt = t * tv;
 
diff --git a/servers/physics_3d/godot_soft_body_3d.cpp b/servers/physics_3d/godot_soft_body_3d.cpp
index f214e3603a..4b3e8cc0d9 100644
--- a/servers/physics_3d/godot_soft_body_3d.cpp
+++ b/servers/physics_3d/godot_soft_body_3d.cpp
@@ -710,9 +710,11 @@ void GodotSoftBody3D::generate_bending_constraints(int p_distance) {
 // A small structure to track lists of dependent link calculations.
 class LinkDeps {
 public:
-	int value; // A link calculation that is dependent on this one
-			// Positive values = "input A" while negative values = "input B"
-	LinkDeps *next; // Next dependence in the list
+	// A link calculation that is dependent on this one.
+	// Positive values = "input A" while negative values = "input B".
+	int value;
+	// Next dependence in the list.
+	LinkDeps *next;
 };
 typedef LinkDeps *LinkDepsPtr;
 
diff --git a/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp b/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
index 31a87fc595..864086c956 100644
--- a/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_cone_twist_joint_3d.cpp
@@ -129,16 +129,18 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
 		plane_space(normal[0], normal[1], normal[2]);
 
 		for (int i = 0; i < 3; i++) {
-			memnew_placement(&m_jac[i], GodotJacobianEntry3D(
-												A->get_principal_inertia_axes().transposed(),
-												B->get_principal_inertia_axes().transposed(),
-												pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
-												pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
-												normal[i],
-												A->get_inv_inertia(),
-												A->get_inv_mass(),
-												B->get_inv_inertia(),
-												B->get_inv_mass()));
+			memnew_placement(
+					&m_jac[i],
+					GodotJacobianEntry3D(
+							A->get_principal_inertia_axes().transposed(),
+							B->get_principal_inertia_axes().transposed(),
+							pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+							pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+							normal[i],
+							A->get_inv_inertia(),
+							A->get_inv_mass(),
+							B->get_inv_inertia(),
+							B->get_inv_mass()));
 		}
 	}
 
@@ -192,8 +194,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
 		real_t swingAxisSign = (b2Axis1.dot(b1Axis1) >= 0.0f) ? 1.0f : -1.0f;
 		m_swingAxis *= swingAxisSign;
 
-		m_kSwing = real_t(1.) / (A->compute_angular_impulse_denominator(m_swingAxis) +
-										B->compute_angular_impulse_denominator(m_swingAxis));
+		m_kSwing = real_t(1.) / (A->compute_angular_impulse_denominator(m_swingAxis) + B->compute_angular_impulse_denominator(m_swingAxis));
 	}
 
 	// Twist limits
@@ -212,8 +213,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
 			m_twistAxis.normalize();
 			m_twistAxis *= -1.0f;
 
-			m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) +
-											B->compute_angular_impulse_denominator(m_twistAxis));
+			m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) + B->compute_angular_impulse_denominator(m_twistAxis));
 
 		} else if (twist > m_twistSpan * lockedFreeFactor) {
 			m_twistCorrection = (twist - m_twistSpan);
@@ -222,8 +222,7 @@ bool GodotConeTwistJoint3D::setup(real_t p_timestep) {
 			m_twistAxis = (b2Axis1 + b1Axis1) * 0.5f;
 			m_twistAxis.normalize();
 
-			m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) +
-											B->compute_angular_impulse_denominator(m_twistAxis));
+			m_kTwist = real_t(1.) / (A->compute_angular_impulse_denominator(m_twistAxis) + B->compute_angular_impulse_denominator(m_twistAxis));
 		}
 	}
 
diff --git a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
index b88e2d1190..915bb528e9 100644
--- a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.cpp
@@ -279,25 +279,30 @@ void GodotGeneric6DOFJoint3D::calculateTransforms() {
 void GodotGeneric6DOFJoint3D::buildLinearJacobian(
 		GodotJacobianEntry3D &jacLinear, const Vector3 &normalWorld,
 		const Vector3 &pivotAInW, const Vector3 &pivotBInW) {
-	memnew_placement(&jacLinear, GodotJacobianEntry3D(
-										 A->get_principal_inertia_axes().transposed(),
-										 B->get_principal_inertia_axes().transposed(),
-										 pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
-										 pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
-										 normalWorld,
-										 A->get_inv_inertia(),
-										 A->get_inv_mass(),
-										 B->get_inv_inertia(),
-										 B->get_inv_mass()));
+	memnew_placement(
+			&jacLinear,
+			GodotJacobianEntry3D(
+					A->get_principal_inertia_axes().transposed(),
+					B->get_principal_inertia_axes().transposed(),
+					pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+					pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+					normalWorld,
+					A->get_inv_inertia(),
+					A->get_inv_mass(),
+					B->get_inv_inertia(),
+					B->get_inv_mass()));
 }
 
 void GodotGeneric6DOFJoint3D::buildAngularJacobian(
 		GodotJacobianEntry3D &jacAngular, const Vector3 &jointAxisW) {
-	memnew_placement(&jacAngular, GodotJacobianEntry3D(jointAxisW,
-										  A->get_principal_inertia_axes().transposed(),
-										  B->get_principal_inertia_axes().transposed(),
-										  A->get_inv_inertia(),
-										  B->get_inv_inertia()));
+	memnew_placement(
+			&jacAngular,
+			GodotJacobianEntry3D(
+					jointAxisW,
+					A->get_principal_inertia_axes().transposed(),
+					B->get_principal_inertia_axes().transposed(),
+					A->get_inv_inertia(),
+					B->get_inv_inertia()));
 }
 
 bool GodotGeneric6DOFJoint3D::testAngularLimitMotor(int axis_index) {
diff --git a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
index 729b3fa1f9..f37b5b981b 100644
--- a/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
+++ b/servers/physics_3d/joints/godot_generic_6dof_joint_3d.h
@@ -119,11 +119,11 @@ public:
 
 	//! Test limit
 	/*!
-    - free means upper < lower,
-    - locked means upper == lower
-    - limited means upper > lower
-    - limitIndex: first 3 are linear, next 3 are angular
-    */
+	 * - free means upper < lower,
+	 * - locked means upper == lower
+	 * - limited means upper > lower
+	 * - limitIndex: first 3 are linear, next 3 are angular
+	 */
 	inline bool isLimited(int limitIndex) {
 		return (m_upperLimit[limitIndex] >= m_lowerLimit[limitIndex]);
 	}
@@ -291,11 +291,11 @@ public:
 
 	//! Test limit
 	/*!
-    - free means upper < lower,
-    - locked means upper == lower
-    - limited means upper > lower
-    - limitIndex: first 3 are linear, next 3 are angular
-    */
+	 * - free means upper < lower,
+	 * - locked means upper == lower
+	 * - limited means upper > lower
+	 * - limitIndex: first 3 are linear, next 3 are angular
+	 */
 	bool isLimited(int limitIndex) {
 		if (limitIndex < 3) {
 			return m_linearLimits.isLimited(limitIndex);
diff --git a/servers/physics_3d/joints/godot_hinge_joint_3d.cpp b/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
index 7b7ca1b3ac..cf77129a30 100644
--- a/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_hinge_joint_3d.cpp
@@ -149,16 +149,18 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
 		plane_space(normal[0], normal[1], normal[2]);
 
 		for (int i = 0; i < 3; i++) {
-			memnew_placement(&m_jac[i], GodotJacobianEntry3D(
-												A->get_principal_inertia_axes().transposed(),
-												B->get_principal_inertia_axes().transposed(),
-												pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
-												pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
-												normal[i],
-												A->get_inv_inertia(),
-												A->get_inv_mass(),
-												B->get_inv_inertia(),
-												B->get_inv_mass()));
+			memnew_placement(
+					&m_jac[i],
+					GodotJacobianEntry3D(
+							A->get_principal_inertia_axes().transposed(),
+							B->get_principal_inertia_axes().transposed(),
+							pivotAInW - A->get_transform().origin - A->get_center_of_mass(),
+							pivotBInW - B->get_transform().origin - B->get_center_of_mass(),
+							normal[i],
+							A->get_inv_inertia(),
+							A->get_inv_mass(),
+							B->get_inv_inertia(),
+							B->get_inv_mass()));
 		}
 	}
 
@@ -175,23 +177,32 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
 	Vector3 jointAxis1 = A->get_transform().basis.xform(jointAxis1local);
 	Vector3 hingeAxisWorld = A->get_transform().basis.xform(m_rbAFrame.basis.get_axis(2));
 
-	memnew_placement(&m_jacAng[0], GodotJacobianEntry3D(jointAxis0,
-										   A->get_principal_inertia_axes().transposed(),
-										   B->get_principal_inertia_axes().transposed(),
-										   A->get_inv_inertia(),
-										   B->get_inv_inertia()));
-
-	memnew_placement(&m_jacAng[1], GodotJacobianEntry3D(jointAxis1,
-										   A->get_principal_inertia_axes().transposed(),
-										   B->get_principal_inertia_axes().transposed(),
-										   A->get_inv_inertia(),
-										   B->get_inv_inertia()));
-
-	memnew_placement(&m_jacAng[2], GodotJacobianEntry3D(hingeAxisWorld,
-										   A->get_principal_inertia_axes().transposed(),
-										   B->get_principal_inertia_axes().transposed(),
-										   A->get_inv_inertia(),
-										   B->get_inv_inertia()));
+	memnew_placement(
+			&m_jacAng[0],
+			GodotJacobianEntry3D(
+					jointAxis0,
+					A->get_principal_inertia_axes().transposed(),
+					B->get_principal_inertia_axes().transposed(),
+					A->get_inv_inertia(),
+					B->get_inv_inertia()));
+
+	memnew_placement(
+			&m_jacAng[1],
+			GodotJacobianEntry3D(
+					jointAxis1,
+					A->get_principal_inertia_axes().transposed(),
+					B->get_principal_inertia_axes().transposed(),
+					A->get_inv_inertia(),
+					B->get_inv_inertia()));
+
+	memnew_placement(
+			&m_jacAng[2],
+			GodotJacobianEntry3D(
+					hingeAxisWorld,
+					A->get_principal_inertia_axes().transposed(),
+					B->get_principal_inertia_axes().transposed(),
+					A->get_inv_inertia(),
+					B->get_inv_inertia()));
 
 	// Compute limit information
 	real_t hingeAngle = get_hinge_angle();
@@ -220,8 +231,7 @@ bool GodotHingeJoint3D::setup(real_t p_step) {
 
 	//Compute K = J*W*J' for hinge axis
 	Vector3 axisA = A->get_transform().basis.xform(m_rbAFrame.basis.get_axis(2));
-	m_kHinge = 1.0f / (A->compute_angular_impulse_denominator(axisA) +
-							  B->compute_angular_impulse_denominator(axisA));
+	m_kHinge = 1.0f / (A->compute_angular_impulse_denominator(axisA) + B->compute_angular_impulse_denominator(axisA));
 
 	return true;
 }
@@ -284,7 +294,7 @@ void GodotHingeJoint3D::solve(real_t p_step) {
 			if (len > real_t(0.00001)) {
 				Vector3 normal = velrelOrthog.normalized();
 				real_t denom = A->compute_angular_impulse_denominator(normal) +
-							   B->compute_angular_impulse_denominator(normal);
+						B->compute_angular_impulse_denominator(normal);
 				// scale for mass and relaxation
 				velrelOrthog *= (real_t(1.) / denom) * m_relaxationFactor;
 			}
@@ -295,7 +305,7 @@ void GodotHingeJoint3D::solve(real_t p_step) {
 			if (len2 > real_t(0.00001)) {
 				Vector3 normal2 = angularError.normalized();
 				real_t denom2 = A->compute_angular_impulse_denominator(normal2) +
-								B->compute_angular_impulse_denominator(normal2);
+						B->compute_angular_impulse_denominator(normal2);
 				angularError *= (real_t(1.) / denom2) * relaxation;
 			}
 
diff --git a/servers/physics_3d/joints/godot_pin_joint_3d.cpp b/servers/physics_3d/joints/godot_pin_joint_3d.cpp
index 10d52ad5e9..e9e81b61a7 100644
--- a/servers/physics_3d/joints/godot_pin_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_pin_joint_3d.cpp
@@ -63,16 +63,18 @@ bool GodotPinJoint3D::setup(real_t p_step) {
 
 	for (int i = 0; i < 3; i++) {
 		normal[i] = 1;
-		memnew_placement(&m_jac[i], GodotJacobianEntry3D(
-											A->get_principal_inertia_axes().transposed(),
-											B->get_principal_inertia_axes().transposed(),
-											A->get_transform().xform(m_pivotInA) - A->get_transform().origin - A->get_center_of_mass(),
-											B->get_transform().xform(m_pivotInB) - B->get_transform().origin - B->get_center_of_mass(),
-											normal,
-											A->get_inv_inertia(),
-											A->get_inv_mass(),
-											B->get_inv_inertia(),
-											B->get_inv_mass()));
+		memnew_placement(
+				&m_jac[i],
+				GodotJacobianEntry3D(
+						A->get_principal_inertia_axes().transposed(),
+						B->get_principal_inertia_axes().transposed(),
+						A->get_transform().xform(m_pivotInA) - A->get_transform().origin - A->get_center_of_mass(),
+						B->get_transform().xform(m_pivotInB) - B->get_transform().origin - B->get_center_of_mass(),
+						normal,
+						A->get_inv_inertia(),
+						A->get_inv_mass(),
+						B->get_inv_inertia(),
+						B->get_inv_mass()));
 		normal[i] = 0;
 	}
 
diff --git a/servers/physics_3d/joints/godot_slider_joint_3d.cpp b/servers/physics_3d/joints/godot_slider_joint_3d.cpp
index 3be111ac92..1f463ad24c 100644
--- a/servers/physics_3d/joints/godot_slider_joint_3d.cpp
+++ b/servers/physics_3d/joints/godot_slider_joint_3d.cpp
@@ -112,16 +112,18 @@ bool GodotSliderJoint3D::setup(real_t p_step) {
 	//linear part
 	for (i = 0; i < 3; i++) {
 		normalWorld = m_calculatedTransformA.basis.get_axis(i);
-		memnew_placement(&m_jacLin[i], GodotJacobianEntry3D(
-											   A->get_principal_inertia_axes().transposed(),
-											   B->get_principal_inertia_axes().transposed(),
-											   m_relPosA - A->get_center_of_mass(),
-											   m_relPosB - B->get_center_of_mass(),
-											   normalWorld,
-											   A->get_inv_inertia(),
-											   A->get_inv_mass(),
-											   B->get_inv_inertia(),
-											   B->get_inv_mass()));
+		memnew_placement(
+				&m_jacLin[i],
+				GodotJacobianEntry3D(
+						A->get_principal_inertia_axes().transposed(),
+						B->get_principal_inertia_axes().transposed(),
+						m_relPosA - A->get_center_of_mass(),
+						m_relPosB - B->get_center_of_mass(),
+						normalWorld,
+						A->get_inv_inertia(),
+						A->get_inv_mass(),
+						B->get_inv_inertia(),
+						B->get_inv_mass()));
 		m_jacLinDiagABInv[i] = real_t(1.) / m_jacLin[i].getDiagonal();
 		m_depth[i] = m_delta.dot(normalWorld);
 	}
@@ -129,12 +131,14 @@ bool GodotSliderJoint3D::setup(real_t p_step) {
 	// angular part
 	for (i = 0; i < 3; i++) {
 		normalWorld = m_calculatedTransformA.basis.get_axis(i);
-		memnew_placement(&m_jacAng[i], GodotJacobianEntry3D(
-											   normalWorld,
-											   A->get_principal_inertia_axes().transposed(),
-											   B->get_principal_inertia_axes().transposed(),
-											   A->get_inv_inertia(),
-											   B->get_inv_inertia()));
+		memnew_placement(
+				&m_jacAng[i],
+				GodotJacobianEntry3D(
+						normalWorld,
+						A->get_principal_inertia_axes().transposed(),
+						B->get_principal_inertia_axes().transposed(),
+						A->get_inv_inertia(),
+						B->get_inv_inertia()));
 	}
 	testAngLimits();
 	Vector3 axisA = m_calculatedTransformA.basis.get_axis(0);
diff --git a/servers/rendering/renderer_canvas_cull.cpp b/servers/rendering/renderer_canvas_cull.cpp
index 46683e8e68..7b70483571 100644
--- a/servers/rendering/renderer_canvas_cull.cpp
+++ b/servers/rendering/renderer_canvas_cull.cpp
@@ -137,8 +137,7 @@ void RendererCanvasCull::_attach_canvas_item_for_draw(RendererCanvasCull::Item *
 
 			// We have two choices now, if user has drawn something, we must assume users wants to draw the "mask", so compute the size based on this.
 			// If nothing has been drawn, we just take it over and draw it ourselves.
-			if (ci->canvas_group->fit_empty && (ci->commands == nullptr ||
-													   (ci->commands->next == nullptr && ci->commands->type == RendererCanvasCull::Item::Command::TYPE_RECT && (static_cast<RendererCanvasCull::Item::CommandRect *>(ci->commands)->flags & RendererCanvasRender::CANVAS_RECT_IS_GROUP)))) {
+			if (ci->canvas_group->fit_empty && (ci->commands == nullptr || (ci->commands->next == nullptr && ci->commands->type == RendererCanvasCull::Item::Command::TYPE_RECT && (static_cast<RendererCanvasCull::Item::CommandRect *>(ci->commands)->flags & RendererCanvasRender::CANVAS_RECT_IS_GROUP)))) {
 				// No commands, or sole command is the one used to draw, so we (re)create the draw command.
 				ci->clear();
 
diff --git a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
index c69c9eeadf..13a3e814f6 100644
--- a/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
+++ b/servers/rendering/renderer_rd/renderer_canvas_render_rd.cpp
@@ -29,6 +29,7 @@
 /*************************************************************************/
 
 #include "renderer_canvas_render_rd.h"
+
 #include "core/config/project_settings.h"
 #include "core/math/geometry_2d.h"
 #include "core/math/math_defs.h"
@@ -1585,9 +1586,6 @@ void RendererCanvasRenderRD::light_update_shadow(RID p_rid, int p_shadow_index,
 		push_constant.z_far = p_far;
 		push_constant.pad = 0;
 
-		/*if (i == 0)
-			*p_xform_cache = projection;*/
-
 		LightOccluderInstance *instance = p_occluders;
 
 		while (instance) {
diff --git a/servers/rendering/renderer_rd/shaders/canvas.glsl b/servers/rendering/renderer_rd/shaders/canvas.glsl
index 2911e8b731..65a621b203 100644
--- a/servers/rendering/renderer_rd/shaders/canvas.glsl
+++ b/servers/rendering/renderer_rd/shaders/canvas.glsl
@@ -91,7 +91,6 @@ void main() {
 	uint instancing = draw_data.flags & FLAGS_INSTANCING_MASK;
 
 #ifdef USE_ATTRIBUTES
-
 	if (instancing > 1) {
 		// trails
 
@@ -128,37 +127,37 @@ void main() {
 
 		vertex = new_vertex;
 		color *= pcolor;
-
 	} else
 #endif // USE_ATTRIBUTES
+	{
+		if (instancing == 1) {
+			uint stride = 2;
+			{
+				if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
+					stride += 1;
+				}
+				if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
+					stride += 1;
+				}
+			}
+
+			uint offset = stride * gl_InstanceIndex;
+
+			mat4 matrix = mat4(transforms.data[offset + 0], transforms.data[offset + 1], vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0));
+			offset += 2;
 
-			if (instancing == 1) {
-		uint stride = 2;
-		{
 			if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
-				stride += 1;
+				color *= transforms.data[offset];
+				offset += 1;
 			}
+
 			if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
-				stride += 1;
+				instance_custom = transforms.data[offset];
 			}
-		}
-
-		uint offset = stride * gl_InstanceIndex;
 
-		mat4 matrix = mat4(transforms.data[offset + 0], transforms.data[offset + 1], vec4(0.0, 0.0, 1.0, 0.0), vec4(0.0, 0.0, 0.0, 1.0));
-		offset += 2;
-
-		if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_COLORS)) {
-			color *= transforms.data[offset];
-			offset += 1;
-		}
-
-		if (bool(draw_data.flags & FLAGS_INSTANCING_HAS_CUSTOM_DATA)) {
-			instance_custom = transforms.data[offset];
+			matrix = transpose(matrix);
+			world_matrix = world_matrix * matrix;
 		}
-
-		matrix = transpose(matrix);
-		world_matrix = world_matrix * matrix;
 	}
 
 #if !defined(USE_ATTRIBUTES) && !defined(USE_PRIMITIVE)
diff --git a/servers/rendering/renderer_rd/shaders/particles.glsl b/servers/rendering/renderer_rd/shaders/particles.glsl
index 9f8410fd8a..328becbc20 100644
--- a/servers/rendering/renderer_rd/shaders/particles.glsl
+++ b/servers/rendering/renderer_rd/shaders/particles.glsl
@@ -567,11 +567,11 @@ void main() {
 							depth = particle_size - s;
 							const float EPSILON = 0.001;
 							normal = mat3(FRAME.colliders[i].transform) *
-									 normalize(
-											 vec3(
-													 texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r,
-													 texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r,
-													 texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r));
+									normalize(
+											vec3(
+													texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(EPSILON, 0.0, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(EPSILON, 0.0, 0.0)).r,
+													texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, EPSILON, 0.0)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, EPSILON, 0.0)).r,
+													texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos + vec3(0.0, 0.0, EPSILON)).r - texture(sampler3D(sdf_vec_textures[FRAME.colliders[i].texture_index], material_samplers[SAMPLER_LINEAR_CLAMP]), uvw_pos - vec3(0.0, 0.0, EPSILON)).r));
 						}
 
 					} break;
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
index 99714b4504..97c913d489 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_aa_inc.glsl
@@ -2,7 +2,7 @@
 
 float hash_2d(vec2 p) {
 	return fract(1.0e4 * sin(17.0 * p.x + 0.1 * p.y) *
-				 (0.1 + abs(sin(13.0 * p.y + p.x))));
+			(0.1 + abs(sin(13.0 * p.y + p.x))));
 }
 
 float hash_3d(vec3 p) {
@@ -29,8 +29,7 @@ float compute_alpha_hash_threshold(vec3 pos, float hash_scale) {
 
 	vec3 cases = vec3(a_interp * a_interp / (2.0 * min_lerp * (1.0 - min_lerp)),
 			(a_interp - 0.5 * min_lerp) / (1.0 - min_lerp),
-			1.0 - ((1.0 - a_interp) * (1.0 - a_interp) /
-						  (2.0 * min_lerp * (1.0 - min_lerp))));
+			1.0 - ((1.0 - a_interp) * (1.0 - a_interp) / (2.0 * min_lerp * (1.0 - min_lerp))));
 
 	float alpha_hash_threshold =
 			(lerp_factor < (1.0 - min_lerp)) ? ((lerp_factor < min_lerp) ? cases.x : cases.y) : cases.z;
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
index 2aeb10c932..a83f87d23a 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_clustered.glsl
@@ -971,15 +971,15 @@ void main() {
 		const float c4 = 0.886227;
 		const float c5 = 0.247708;
 		ambient_light += (c1 * lightmap_captures.data[index].sh[8].rgb * (wnormal.x * wnormal.x - wnormal.y * wnormal.y) +
-						  c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
-						  c4 * lightmap_captures.data[index].sh[0].rgb -
-						  c5 * lightmap_captures.data[index].sh[6].rgb +
-						  2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
-						  2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
-						  2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
-						  2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
-						  2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
-						  2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
+				c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
+				c4 * lightmap_captures.data[index].sh[0].rgb -
+				c5 * lightmap_captures.data[index].sh[6].rgb +
+				2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
+				2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
+				2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
+				2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
+				2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
+				2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
 
 	} else if (bool(instances.data[instance_index].flags & INSTANCE_FLAGS_USE_LIGHTMAP)) { // has actual lightmap
 		bool uses_sh = bool(instances.data[instance_index].flags & INSTANCE_FLAGS_USE_SH_LIGHTMAP);
@@ -1256,10 +1256,10 @@ void main() {
 // LIGHTING
 #if !defined(MODE_RENDER_DEPTH) && !defined(MODE_UNSHADED)
 
-	{ //directional light
+	{ // Directional light.
 
+		// Do shadow and lighting in two passes to reduce register pressure.
 #ifndef SHADOWS_DISABLED
-		// Do shadow and lighting in two passes to reduce register pressure
 		uint shadow0 = 0;
 		uint shadow1 = 0;
 
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
index 61559fe809..b26489ddf1 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_lights_inc.glsl
@@ -182,11 +182,11 @@ void light_compute(vec3 N, vec3 L, vec3 V, float A, vec3 light_color, float atte
 			float d = scale * abs(transmittance_z);
 			float dd = -d * d;
 			vec3 profile = vec3(0.233, 0.455, 0.649) * exp(dd / 0.0064) +
-						   vec3(0.1, 0.336, 0.344) * exp(dd / 0.0484) +
-						   vec3(0.118, 0.198, 0.0) * exp(dd / 0.187) +
-						   vec3(0.113, 0.007, 0.007) * exp(dd / 0.567) +
-						   vec3(0.358, 0.004, 0.0) * exp(dd / 1.99) +
-						   vec3(0.078, 0.0, 0.0) * exp(dd / 7.41);
+					vec3(0.1, 0.336, 0.344) * exp(dd / 0.0484) +
+					vec3(0.118, 0.198, 0.0) * exp(dd / 0.187) +
+					vec3(0.113, 0.007, 0.007) * exp(dd / 0.567) +
+					vec3(0.358, 0.004, 0.0) * exp(dd / 1.99) +
+					vec3(0.078, 0.0, 0.0) * exp(dd / 7.41);
 
 			diffuse_light += profile * transmittance_color.a * light_color * clamp(transmittance_boost - NdotL, 0.0, 1.0) * (1.0 / M_PI);
 #else
diff --git a/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl b/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
index 2b59e85e4f..2f5cc58619 100644
--- a/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
+++ b/servers/rendering/renderer_rd/shaders/scene_forward_mobile.glsl
@@ -930,15 +930,15 @@ void main() {
 		const float c4 = 0.886227;
 		const float c5 = 0.247708;
 		ambient_light += (c1 * lightmap_captures.data[index].sh[8].rgb * (wnormal.x * wnormal.x - wnormal.y * wnormal.y) +
-						  c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
-						  c4 * lightmap_captures.data[index].sh[0].rgb -
-						  c5 * lightmap_captures.data[index].sh[6].rgb +
-						  2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
-						  2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
-						  2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
-						  2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
-						  2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
-						  2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
+				c3 * lightmap_captures.data[index].sh[6].rgb * wnormal.z * wnormal.z +
+				c4 * lightmap_captures.data[index].sh[0].rgb -
+				c5 * lightmap_captures.data[index].sh[6].rgb +
+				2.0 * c1 * lightmap_captures.data[index].sh[4].rgb * wnormal.x * wnormal.y +
+				2.0 * c1 * lightmap_captures.data[index].sh[7].rgb * wnormal.x * wnormal.z +
+				2.0 * c1 * lightmap_captures.data[index].sh[5].rgb * wnormal.y * wnormal.z +
+				2.0 * c2 * lightmap_captures.data[index].sh[3].rgb * wnormal.x +
+				2.0 * c2 * lightmap_captures.data[index].sh[1].rgb * wnormal.y +
+				2.0 * c2 * lightmap_captures.data[index].sh[2].rgb * wnormal.z);
 
 	} else if (bool(draw_call.flags & INSTANCE_FLAGS_USE_LIGHTMAP)) { // has actual lightmap
 		bool uses_sh = bool(draw_call.flags & INSTANCE_FLAGS_USE_SH_LIGHTMAP);
diff --git a/servers/rendering/renderer_rd/shaders/tonemap.glsl b/servers/rendering/renderer_rd/shaders/tonemap.glsl
index 1ce3e04421..948c6e1e39 100644
--- a/servers/rendering/renderer_rd/shaders/tonemap.glsl
+++ b/servers/rendering/renderer_rd/shaders/tonemap.glsl
@@ -140,7 +140,7 @@ vec4 texture2D_bicubic(sampler2D tex, vec2 uv, int p_lod) {
 	vec2 p3 = (vec2(iuv.x + h1x, iuv.y + h1y) - vec2(0.5f)) * pixel_size;
 
 	return (g0(fuv.y) * (g0x * textureLod(tex, p0, lod) + g1x * textureLod(tex, p1, lod))) +
-		   (g1(fuv.y) * (g0x * textureLod(tex, p2, lod) + g1x * textureLod(tex, p3, lod)));
+			(g1(fuv.y) * (g0x * textureLod(tex, p2, lod) + g1x * textureLod(tex, p3, lod)));
 }
 
 #define GLOW_TEXTURE_SAMPLE(m_tex, m_uv, m_lod) texture2D_bicubic(m_tex, m_uv, m_lod)
@@ -341,14 +341,14 @@ vec3 do_fxaa(vec3 color, float exposure, vec2 uv_interp) {
 	dir.y = ((lumaNW + lumaSW) - (lumaNE + lumaSE));
 
 	float dirReduce = max((lumaNW + lumaNE + lumaSW + lumaSE) *
-								  (0.25 * FXAA_REDUCE_MUL),
+					(0.25 * FXAA_REDUCE_MUL),
 			FXAA_REDUCE_MIN);
 
 	float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);
 	dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),
 				  max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),
 						  dir * rcpDirMin)) *
-		  params.pixel_size;
+			params.pixel_size;
 
 #ifdef MULTIVIEW
 	vec3 rgbA = 0.5 * exposure * (textureLod(source_color, vec3(uv_interp + dir * (1.0 / 3.0 - 0.5), ViewIndex), 0.0).xyz + textureLod(source_color, vec3(uv_interp + dir * (2.0 / 3.0 - 0.5), ViewIndex), 0.0).xyz) * params.luminance_multiplier;
diff --git a/servers/rendering/shader_language.cpp b/servers/rendering/shader_language.cpp
index 53f2d96f52..4c4fbfb2ed 100644
--- a/servers/rendering/shader_language.cpp
+++ b/servers/rendering/shader_language.cpp
@@ -3296,16 +3296,16 @@ bool ShaderLanguage::is_float_type(DataType p_type) {
 }
 bool ShaderLanguage::is_sampler_type(DataType p_type) {
 	return p_type == TYPE_SAMPLER2D ||
-		   p_type == TYPE_ISAMPLER2D ||
-		   p_type == TYPE_USAMPLER2D ||
-		   p_type == TYPE_SAMPLER2DARRAY ||
-		   p_type == TYPE_ISAMPLER2DARRAY ||
-		   p_type == TYPE_USAMPLER2DARRAY ||
-		   p_type == TYPE_SAMPLER3D ||
-		   p_type == TYPE_ISAMPLER3D ||
-		   p_type == TYPE_USAMPLER3D ||
-		   p_type == TYPE_SAMPLERCUBE ||
-		   p_type == TYPE_SAMPLERCUBEARRAY;
+			p_type == TYPE_ISAMPLER2D ||
+			p_type == TYPE_USAMPLER2D ||
+			p_type == TYPE_SAMPLER2DARRAY ||
+			p_type == TYPE_ISAMPLER2DARRAY ||
+			p_type == TYPE_USAMPLER2DARRAY ||
+			p_type == TYPE_SAMPLER3D ||
+			p_type == TYPE_ISAMPLER3D ||
+			p_type == TYPE_USAMPLER3D ||
+			p_type == TYPE_SAMPLERCUBE ||
+			p_type == TYPE_SAMPLERCUBEARRAY;
 }
 
 Variant ShaderLanguage::constant_value_to_variant(const Vector<ShaderLanguage::ConstantNode::Value> &p_value, DataType p_type, int p_array_size, ShaderLanguage::ShaderNode::Uniform::Hint p_hint) {
@@ -3873,16 +3873,16 @@ void ShaderLanguage::get_keyword_list(List<String> *r_keywords) {
 
 bool ShaderLanguage::is_control_flow_keyword(String p_keyword) {
 	return p_keyword == "break" ||
-		   p_keyword == "case" ||
-		   p_keyword == "continue" ||
-		   p_keyword == "default" ||
-		   p_keyword == "do" ||
-		   p_keyword == "else" ||
-		   p_keyword == "for" ||
-		   p_keyword == "if" ||
-		   p_keyword == "return" ||
-		   p_keyword == "switch" ||
-		   p_keyword == "while";
+			p_keyword == "case" ||
+			p_keyword == "continue" ||
+			p_keyword == "default" ||
+			p_keyword == "do" ||
+			p_keyword == "else" ||
+			p_keyword == "for" ||
+			p_keyword == "if" ||
+			p_keyword == "return" ||
+			p_keyword == "switch" ||
+			p_keyword == "while";
 }
 
 void ShaderLanguage::get_builtin_funcs(List<String> *r_keywords) {
diff --git a/tests/test_class_db.h b/tests/test_class_db.h
index 20397bb144..4b058a4c67 100644
--- a/tests/test_class_db.h
+++ b/tests/test_class_db.h
@@ -224,20 +224,20 @@ bool arg_default_value_is_assignable_to_type(const Context &p_context, const Var
 	switch (p_val.get_type()) {
 		case Variant::NIL:
 			return p_context.find_exposed_class(p_arg_type) ||
-				   p_context.names_cache.is_nullable_type(p_arg_type.name);
+					p_context.names_cache.is_nullable_type(p_arg_type.name);
 		case Variant::BOOL:
 			return p_arg_type.name == p_context.names_cache.bool_type;
 		case Variant::INT:
 			return p_arg_type.name == p_context.names_cache.int_type ||
-				   p_arg_type.name == p_context.names_cache.float_type ||
-				   p_arg_type.is_enum;
+					p_arg_type.name == p_context.names_cache.float_type ||
+					p_arg_type.is_enum;
 		case Variant::FLOAT:
 			return p_arg_type.name == p_context.names_cache.float_type;
 		case Variant::STRING:
 		case Variant::STRING_NAME:
 			return p_arg_type.name == p_context.names_cache.string_type ||
-				   p_arg_type.name == p_context.names_cache.string_name_type ||
-				   p_arg_type.name == p_context.names_cache.node_path_type;
+					p_arg_type.name == p_context.names_cache.string_name_type ||
+					p_arg_type.name == p_context.names_cache.node_path_type;
 		case Variant::NODE_PATH:
 			return p_arg_type.name == p_context.names_cache.node_path_type;
 		case Variant::TRANSFORM3D:
@@ -269,13 +269,13 @@ bool arg_default_value_is_assignable_to_type(const Context &p_context, const Var
 			return p_context.find_exposed_class(p_arg_type);
 		case Variant::VECTOR2I:
 			return p_arg_type.name == p_context.names_cache.vector2_type ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		case Variant::RECT2I:
 			return p_arg_type.name == p_context.names_cache.rect2_type ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		case Variant::VECTOR3I:
 			return p_arg_type.name == p_context.names_cache.vector3_type ||
-				   p_arg_type.name == Variant::get_type_name(p_val.get_type());
+					p_arg_type.name == Variant::get_type_name(p_val.get_type());
 		default:
 			if (r_err_msg) {
 				*r_err_msg = "Unexpected Variant type: " + itos(p_val.get_type());
@@ -327,7 +327,7 @@ void validate_property(const Context &p_context, const ExposedClass &p_class, co
 		if (getter->return_type.name != setter_first_arg.type.name) {
 			// Special case for Node::set_name
 			bool whitelisted = getter->return_type.name == p_context.names_cache.string_name_type &&
-							   setter_first_arg.type.name == p_context.names_cache.string_type;
+					setter_first_arg.type.name == p_context.names_cache.string_type;
 
 			TEST_FAIL_COND(!whitelisted,
 					"Return type from getter doesn't match first argument of setter, for property: '", p_class.name, ".", String(p_prop.name), "'.");
@@ -609,7 +609,7 @@ void add_exposed_classes(Context &r_context) {
 				method.return_type.name = return_info.class_name;
 
 				bool bad_reference_hint = !method.is_virtual && return_info.hint != PROPERTY_HINT_RESOURCE_TYPE &&
-										  ClassDB::is_parent_class(return_info.class_name, r_context.names_cache.ref_counted_class);
+						ClassDB::is_parent_class(return_info.class_name, r_context.names_cache.ref_counted_class);
 				TEST_COND(bad_reference_hint, "Return type is reference but hint is not '" _STR(PROPERTY_HINT_RESOURCE_TYPE) "'.", " Are you returning a reference type by pointer? Method: '",
 						exposed_class.name, ".", method.name, "'.");
 			} else if (return_info.hint == PROPERTY_HINT_RESOURCE_TYPE) {